CMSCOPE changed

author: Shashank 2017-05-29 12:40:26 +0530
committer: Shashank 2017-05-29 12:40:26 +0530
commit: 0345245e860375a32c9a437c4a9d9cae807134e9 (patch)
tree: ad51ecbfa7bcd3cc5f09834f1bb8c08feaa526a4 /modules/scicos/macros
download: scilab_for_xcos_on_cloud-0345245e860375a32c9a437c4a9d9cae807134e9.tar.gz
scilab_for_xcos_on_cloud-0345245e860375a32c9a437c4a9d9cae807134e9.tar.bz2
scilab_for_xcos_on_cloud-0345245e860375a32c9a437c4a9d9cae807134e9.zip
290 files changed, 26058 insertions, 0 deletions
diff --git a/modules/scicos/macros/buildmacros.sce b/modules/scicos/macros/buildmacros.sce
new file mode 100755
index 000000000..1fc8c45d3
--- /dev/null
+++ b/modules/scicos/macros/buildmacros.sce
@@ -0,0 +1,20 @@
+
+// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab
+// Copyright (C) 2007-2008 - INRIA - Allan CORNET <allan.cornet@inria.fr>
+// Copyright (C) 2008      - INRIA - Pierre MARECHAL <pierre.marechal@inria.fr>
+//
+// This file must be used under the terms of the CeCILL.
+// This source file is licensed as described in the file COPYING, which
+// you should have received as part of this distribution.  The terms
+// are also available at
+// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt
+
+lines(0);
+CurrentDirScicos = get_absolute_file_path("buildmacros.sce");
+macrosdirs       = ["scicos_auto","scicos_utils","scicos_scicos"];
+
+for i=1:size(macrosdirs,"*") do
+    exec(CurrentDirScicos+"/"+macrosdirs(i)+"/buildmacros.sce");
+end
+
+clear my_script_path CurrentDirScicos macrosdirs
diff --git a/modules/scicos/macros/scicos_auto/buildmacros.sce b/modules/scicos/macros/scicos_auto/buildmacros.sce
new file mode 100755
index 000000000..5ce4f79d8
--- /dev/null
+++ b/modules/scicos/macros/scicos_auto/buildmacros.sce
@@ -0,0 +1,16 @@
+
+// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab
+// Copyright (C) 2007-2008 - INRIA - Allan CORNET <allan.cornet@inria.fr>
+//
+// This file must be used under the terms of the CeCILL.
+// This source file is licensed as described in the file COPYING, which
+// you should have received as part of this distribution.  The terms
+// are also available at
+// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt
+
+if (isdef("genlib") == %f) then
+    exec(SCI+"/modules/functions/scripts/buildmacros/loadgenlib.sce");
+end
+//------------------------------------
+genlib("scicos_autolib","SCI/modules/scicos/macros/scicos_auto",%f,%t);
+//------------------------------------
diff --git a/modules/scicos/macros/scicos_auto/lib b/modules/scicos/macros/scicos_auto/lib
new file mode 100755
index 000000000..9be083f6e
--- /dev/null
+++ b/modules/scicos/macros/scicos_auto/lib
diff --git a/modules/scicos/macros/scicos_auto/lincos.bin b/modules/scicos/macros/scicos_auto/lincos.bin
new file mode 100755
index 000000000..de2bed985
--- /dev/null
+++ b/modules/scicos/macros/scicos_auto/lincos.bin
diff --git a/modules/scicos/macros/scicos_auto/lincos.sci b/modules/scicos/macros/scicos_auto/lincos.sci
new file mode 100755
index 000000000..06632dd1f
--- /dev/null
+++ b/modules/scicos/macros/scicos_auto/lincos.sci
@@ -0,0 +1,290 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) DIGITEO - Clément DAVID <clement.david@scilab.org>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ./license.txt
+//
+
+function sys = lincos(scs_m,x0,u0,param)
+    // NAME
+    // lincos - Constructs by linearization a linear state-space
+    // model from a general dynamical system described by a
+    // scicos diagram
+
+    // CALLING SEQUENCE
+    //
+    // sys = lincos(scs_m [,x0,u0 [,param] ])
+    //
+    //
+    // PARAMETERS
+    //
+    // scs_m: a Scicos data structure
+    // x0: column vector. Continuous state around which linearization to be done (default 0)
+    // u0: column vector. Input around which linearization to be done (default 0)
+    // param: list with two elements (default list(1.d-6,0))
+    //   param(1): scalar. Perturbation level for linearization; the following variation is used
+    //             del([x;u])_i = param(1)+param(1)*1d-4*abs([x;u])_i
+    //   param(2): scalar. Time t.
+    //
+    // sys: state-space system
+    //
+    // DESCRIPTION
+    // Constructs by linearization a linear state-space
+    // model from a general dynamical system described by a
+    // scicos diagram scs_m. Input and output ports, normally
+    // used inside superblocks, should be used to specify
+    // inputs and outputs in the scicos diagram. Suppose the
+    // scicos diagram to be linearized is called mysystem and
+    // it is saved in mysystem.cos in the current directory. The scicos
+    // diagram scs_m can be obtained either by
+    //             scs_m = scicos('mysystem.cos');
+    // followed by a quit in the scicos menu, or by
+    //             load('mysystem.cos')
+    // which creates by default a variable called scs_m.
+
+
+    //** This function can be (ab)used from the Scilab command line and
+    //** inside a Scicos "context". In order to handle the different situations,
+    //** the required library are loaded if not already present in the
+    //** "semiglobal-local-environment".
+
+    if ~exists("scicos_diagram") then
+        loadXcosLibs();
+    end
+
+    if exists("scicos_scicoslib")==0 then
+        load("SCI/modules/scicos/macros/scicos_scicos/lib") ;
+    end
+
+    if exists("scicos_autolib")==0 then
+        load("SCI/modules/scicos/macros/scicos_auto/lib") ;
+    end
+
+    if exists("scicos_utilslib")==0 then
+        load("SCI/modules/scicos/macros/scicos_utils/lib") ;
+    end
+
+    // Define Scicos data tables ===========================================
+    if ( ~isdef("modelica_libs") | ..
+        ~isdef("scicos_pal_libs") ) then
+        [modelica_libs, scicos_pal_libs, %scicos_with_grid, %scs_wgrid] = initial_scicos_tables();
+    end
+    // =====================================================================
+    [lhs, rhs] = argn(0);
+
+    if rhs < 1 then
+        error(msprintf(gettext("%s: Wrong number of input argument(s): At least %d expected.\n"), "lincos", 1));
+    end
+    if typeof(scs_m)<>"diagram" & typeof(scs_m)<>"cpr" then
+        error(msprintf(gettext("%s: Wrong type for input argument #%d: A diagram expected.\n"), "lincos", 1));
+    end
+
+    // compile and post-process the diagram
+    if typeof(scs_m)=="diagram" then
+
+        // Propagate context through all blocks
+        %state0     = list();
+        needcompile = 4;
+        %cpr        = struct();
+        %cpr.state  = %state0;
+        %scicos_context = struct();
+        context = scs_m.props.context;
+
+        [%scicos_context, ierr] = script2var(context, %scicos_context);
+        [scs_m,%cpr,needcompile,ok] = do_eval(scs_m, %cpr, %scicos_context);
+        if ~ok then
+            error(msprintf(gettext("%s: Error during block parameters evaluation.\n"), "lincos"));
+        end
+
+        IN  = [];
+        OUT = [];
+
+        // check version
+        current_version = get_scicos_version()
+        scicos_ver      = find_scicos_version(scs_m)
+        if scicos_ver<>current_version then
+            scs_m=do_version(scs_m, scicos_ver);
+        end
+
+        // looking for I/O
+        for i=1:size(scs_m.objs)
+            if typeof(scs_m.objs(i))=="Block" then
+                if or(scs_m.objs(i).gui==["IN_f", "INPUTPORT"]) then
+                    scs_m.objs(i).gui="INPUTPORT";
+                    IN=[IN scs_m.objs(i).model.ipar]
+                elseif or(scs_m.objs(i).gui==["OUT_f", "OUTPUTPORT"]) then
+                    scs_m.objs(i).gui="OUTPUTPORT";
+                    OUT=[OUT  scs_m.objs(i).model.ipar]
+                elseif or(scs_m.objs(i).gui==["CLKIN_f","CLKINV_f", "INPUTPORTEVTS"]) then
+                    scs_m.objs(i).gui="INPUTPORTEVTS";
+                    scs_m.objs(i).model.sim(1)="bidon"
+                elseif  or(scs_m.objs(i).gui==["CLKOUT_f","CLKOUTV_f", "OUTPUTPORTEVTS"]) then
+                    scs_m.objs(i).gui="OUTPUTPORTEVTS";
+                    scs_m.objs(i).model.sim(1)="bidon"
+                end
+            end
+        end
+
+        if IN == [] then
+            error(msprintf(gettext("%s: Unable to find diagram inputs\n"), "lincos"));
+        end
+        if OUT == [] then
+            error(msprintf(gettext("%s: Unable to find diagram outputs\n"), "lincos"));
+        end
+
+        IN=-gsort(-IN);
+        if or(IN<>[1:size(IN,"*")]) then
+            error(msprintf(gettext("%s: Input ports are not numbered properly.\n"),"lincos"))
+        end
+
+        OUT=-gsort(-OUT);
+        if or(OUT<>[1:size(OUT,"*")]) then
+            error(msprintf(gettext("%s: Output ports are not numbered properly.\n"),"lincos"))
+        end
+
+        //compile scs_m
+        [bllst, connectmat, clkconnect,cor,corinv,ok] = c_pass1(scs_m);
+        if ~ok then
+            error(msprintf(gettext("%s: Diagram does not compile in pass %d.\n"),"lincos",1));
+        end
+
+        %cpr = c_pass2(bllst,connectmat,clkconnect,cor,corinv);
+
+        if %cpr==list() then
+            ok = %f ;
+        end
+
+        if ~ok then
+            error(msprintf(gettext("%s: Diagram does not compile in pass %d.\n"),"lincos",2))
+        end
+
+        // compile and post-process the diagram end
+    end
+
+    sim   = %cpr.sim;
+    state = %cpr.state;
+    //
+    inplnk = sim.inplnk;
+    inpptr = sim.inpptr;
+    outlnk = sim.outlnk;
+    outptr = sim.outptr;
+    ipptr  = sim.ipptr;
+
+    ki=[];ko=[];nyptr=1;
+    for kfun=1:length(sim.funs)
+        if sim.funs(kfun)=="output" then
+            sim.funs(kfun)="bidon"
+            ko=[ko;[kfun,sim.ipar(ipptr(kfun))]];
+        elseif sim.funs(kfun)=="input" then
+            sim.funs(kfun)="bidon"
+            ki=[ki;[kfun,sim.ipar(ipptr(kfun))]];
+        end
+    end
+
+    [junk,ind]=gsort(-ko(:,2));ko=ko(ind,1);
+    [junk,ind]=gsort(-ki(:,2));ki=ki(ind,1);
+
+    pointo=[];
+    for k=ko'
+        pointo=[pointo;inplnk(inpptr(k))]
+    end
+    pointi=[];
+
+    for k=ki'
+        pointi=[pointi;outlnk(outptr(k))]
+    end
+
+    nx=size(state.x,"*");
+    nu=0; for k=pointi', nu=nu+size(state.outtb(k),"*"), end
+    ny=0; for k=pointo', ny=ny+size(state.outtb(k),"*"), end
+
+    if rhs<3 then
+        x0=zeros(nx,1);u0=zeros(nu,1);
+    else
+        if size(x0,"*")<>nx then
+            if nx == 0 then
+                error(msprintf(gettext("%s: Wrong size for input argument #%d: Empty matrix expected.\n"), "lincos", 2));
+            else
+                error(msprintf(gettext("%s: Wrong size for input argument #%d: %d-by-%d matrix expected.\n"),"lincos", 2, nx, 1))
+            end
+        elseif size(u0,"*")<>nu then
+            if nx == 0 then
+                error(msprintf(gettext("%s: Wrong size for input argument #%d: Empty matrix expected.\n"), "lincos", 3));
+            else
+                error(msprintf(gettext("%s: Wrong size for input argument #%d: %d-by-%d matrix expected.\n"),"lincos", 3, nx, 1))
+            end
+        end
+    end
+
+    if rhs==4 then
+        del = param(1)+param(1)*1d-4*abs([x0;u0])
+        t   = param(2)
+    else
+        del = 1.d-6*(1+1d-4*abs([x0;u0]) )
+        t   = 0;
+    end
+
+    x0 = x0(:);
+    u0 = u0(:);
+
+    state.x=x0;
+
+    Uind = 1
+    for k=pointi'
+        state.outtb(k) = matrix(u0(Uind:Uind+size(state.outtb(k),"*")-1),size(state.outtb(k)));
+        Uind = size(state.outtb(k),"*")+1;
+    end
+
+    [state,t]=scicosim(state,t,t,sim,"start",[.1,.1,.1,.1]);
+    [state,t]=scicosim(state,t,t,sim,"linear",[.1,.1,.1,.1]);
+    Yind=1
+    for k=pointo'
+        y0(Yind:Yind+size(state.outtb(k),"*")-1)=state.outtb(k)(:);
+        Yind=size(state.outtb(k),"*")+1
+    end
+    xp0=state.x;
+    zo0=[xp0;y0];
+
+    F=zeros(nx+ny,nx+nu);
+    z0=[x0;u0];
+    zer=zeros(nx+nu,1);
+
+    for i=1:nx+nu
+        dz=zer;dz(i)=del(i);
+        z=z0+dz;
+        state.x=z(1:nx);
+        Uind=nx+1
+        for k=pointi'
+            state.outtb(k)=matrix(z(Uind:Uind+size(state.outtb(k),"*")-1),size(state.outtb(k)));
+            Uind=size(state.outtb(k),"*")+1;
+        end
+        [state,t]=scicosim(state,t,t,sim,"linear",[.1,.1,.1,.1]);
+        zo=[]
+        Yind=1
+        for k=pointo'
+            zo(Yind:Yind+size(state.outtb(k),"*")-1)=state.outtb(k)(:);
+            Yind=size(state.outtb(k),"*")+1
+        end
+        zo=[state.x;zo];
+        F(:,i)=(zo-zo0)/del(i);
+    end
+    [state,t]=scicosim(state,t,t,sim,"finish",[.1,.1,.1,.1]);
+
+    sys = syslin("c",F(1:nx,1:nx),F(1:nx,nx+1:nx+nu),F(nx+1:nx+ny,1:nx),F(nx+1:nx+ny,nx+1:nx+nu));
+
+endfunction
diff --git a/modules/scicos/macros/scicos_auto/names b/modules/scicos/macros/scicos_auto/names
new file mode 100755
index 000000000..10baea247
--- /dev/null
+++ b/modules/scicos/macros/scicos_auto/names
@@ -0,0 +1,3 @@
+lincos
+scicos_simulate
+steadycos
diff --git a/modules/scicos/macros/scicos_auto/scicos_simulate.bin b/modules/scicos/macros/scicos_auto/scicos_simulate.bin
new file mode 100755
index 000000000..8405cc1b2
--- /dev/null
+++ b/modules/scicos/macros/scicos_auto/scicos_simulate.bin
diff --git a/modules/scicos/macros/scicos_auto/scicos_simulate.sci b/modules/scicos/macros/scicos_auto/scicos_simulate.sci
new file mode 100755
index 000000000..2235c8661
--- /dev/null
+++ b/modules/scicos/macros/scicos_auto/scicos_simulate.sci
@@ -0,0 +1,427 @@
+//  Scicos
+//
+//  Copyright (C) Scilab Enterprises - 2013 - Bruno JOFRET
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) 2011 - INRIA - Serge Steer
+
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ./license.txt
+//
+
+function Info = scicos_simulate(scs_m, Info, updated_vars, flag, Ignb)
+    // Function for running scicos simulation in batch mode
+    // Info = scicos_simulate(scs_m[,Info][,updated_vars][,flag][,Ignb])
+    //
+    // scs_m: scicos diagram (obtained by "load file.cos"). Note that
+    // the version of file.cos must be the current version. If not, load
+    // into scicos and save.
+    //
+    // updated_vars: a scilab struct containing values of
+    // symbolic variables used in the context and Scicos blocks. This
+    // is often used to change a parameter in the diagram context. In that
+    // case, make sure that in the diagram context the variable is defined such
+    // that it can be modified. Say a variable "a" is to be defined in the
+    // context having value 1, and later in batch mode, we want to change
+    // the value of "a". In that case, in the context of the diagram place:
+    //  if ~exists('a') then a=1,end
+    // If you want then to run the simulation in batch mode using the value
+    // a=2, set:
+    // updated_vars.a=2
+    //
+    // Info: a list. It must be list() at the first call, then use output
+    // Info as input Info for the next calls. Info contains compilation and
+    // simulation information and is used to avoid recompilation when not
+    // needed.
+    //
+    // flag: string. If it equals 'nw' (no window), then blocks using
+    // graphical windows are not executed. Note that the list of such
+    // blocks must be updated as new blocks are added.
+    //
+    // Ignb : matrix of string : The name of blocks to ignore.
+    // If flag is set and equal to 'nw' then Ignb contains
+    // name of blocks that are added to the list
+    // of blocks to ignore.
+    //
+
+
+    //** check/set rhs parameters
+    //---------------------------
+    if argn(2) == 1 then
+        //scicos_simulate(scs_m)
+        Info            = list()
+        updated_vars = struct()
+        flag            = ""
+        Ignb            = ""
+    elseif argn(2) == 2 then
+        //scicos_simulate(scs_m, Info)
+        //or scicos_simulate(scs_m,updated_vars)
+        //or scicos_simulate(scs_m,flag)
+        select typeof(Info)
+        case "st" then //scicos_simulate(scs_m,updated_vars)
+            updated_vars = Info
+            Info=list()
+            ku=2
+            flag = ""
+        case "string" then //scicos_simulate(scs_m,flag)
+            flag=Info
+            Info=list()
+            kf=2
+            updated_vars = struct()
+        else  //scicos_simulate(scs_m,Info)
+            flag = ""
+            updated_vars = struct()
+            ki=2
+        end
+        Ignb = ""
+    elseif argn(2) == 3 then
+        //scicos_simulate(scs_m, Info,updated_vars) or scicos_simulate(scs_m, Info,"nw")
+        if type(updated_vars) == 10 then
+            flag = updated_vars
+            updated_vars = struct()
+        else
+            ku=3
+            flag = ""
+        end
+        Ignb = ""
+    elseif argn(2) >= 4 then
+        //scicos_simulate(scs_m, Info,updated_vars,"nw") or
+        //scicos_simulate(scs_m, Info,"nw",updated_vars)
+        ku=3;kf=4
+        if type(updated_vars) == 10 then
+            [updated_vars,flag]=(flag,updated_vars)
+            kf=3;ku=4
+        end
+        if argn(2) == 4 then Ignb = "",end
+    else
+        error(msprintf(_("%s: Wrong number of input arguments. Must be between %d and %d.\n"),...
+        "scicos_simulate", 1, 5))
+    end
+
+    //Check variable types
+    if typeof(scs_m)<>"diagram" then
+        error(msprintf(_("%s: Wrong type for input argument #%d: %s data structure expected.\n"),...
+        "scicos_simulate",1,"scs_m"))
+    end
+    if type(Info)<>15 then
+        error(msprintf(_("%s: Wrong type for input argument #%d: A list expected.\n"),..
+        "scicos_simulate",2))
+    end
+    if typeof(updated_vars)<>"st" then
+        error(msprintf(_("%s: Wrong type for input argument #%d: A list expected.\n"),...
+        "scicos_simulate",ku))
+    end
+    if and(stripblanks(flag)<>["nw" ""]) then
+        error(msprintf(_("%s: Wrong value for input argument #%d: ''%s'' expected.\n"),...
+        "scicos_simulate",kf,"nw"))
+    end
+    if type(Ignb) <> 10 then
+        error(msprintf(_("%s: Wrong type for input argument #%d: String array expected.\n"),...
+        "scicos_simulate",5))
+    end
+
+    if or(sciargs() == "-nogui")|or(sciargs() == "-nwni")  then
+        flag = "nw"
+    end
+    //**blocks to ignore requested by user
+    Ignb = matrix(Ignb,1,-1)//make it row vector
+
+    //**blocks to ignore in any cases
+    Ignore=["affich",...
+    "affich2"]
+    //**blocks to ignore with flag=="nw"
+    Ignoreb = ["bouncexy", ...
+    "cscope", ...
+    "cmscope", ...
+    "canimxy", ...
+    "canimxy3d", ...
+    "cevscpe", ...
+    "cfscope", ...
+    "cscopxy", ...
+    "cscopxy3d", ...
+    "cmatview", ...
+    "cmat3d", ...
+    "bplatform2"]
+
+    //** load the scicos function libraries
+    //------------------------------------
+
+    if exists("scicos_scicoslib")==0 then
+        load("SCI/modules/scicos/macros/scicos_scicos/lib") ;
+    end
+
+    if exists("scicos_autolib")==0 then
+        load("SCI/modules/scicos/macros/scicos_auto/lib") ;
+    end
+
+    if exists("scicos_utilslib")==0 then
+        load("SCI/modules/scicos/macros/scicos_utils/lib") ;
+    end
+
+    // Define Scicos data tables ===========================================
+    [modelica_libs, scicos_pal_libs, %scicos_with_grid, %scs_wgrid] = initial_scicos_tables();
+    // =====================================================================
+
+    //** initialize a "scicos_debug_gr" variable
+    %scicos_debug_gr = %f;
+
+
+    //** redefine some functions
+    prot = funcprot();funcprot(0);
+    do_terminate = do_terminate1
+    funcprot(prot)
+
+
+    //check version
+    current_version = get_scicos_version()
+    scicos_ver = find_scicos_version(scs_m)
+
+    //do version
+    if scicos_ver <> current_version then
+        ierr = execstr("scs_m = do_version(scs_m, scicos_ver)","errcatch")
+        if ierr <> 0 then
+            messagebox(_("Can''t convert old diagram (problem in version)"),"modal")
+            return
+        end
+    end
+
+    //** prepare from and to workspace stuff
+    //-------------------------------------
+    scicos_workspace_init()
+
+    if flag == "nw" then
+        Ignore = [Ignore,Ignoreb]
+    end
+    //add user ignored blocks if any
+    Ignore = [Ignore, Ignb]
+
+    //** retrieve Info list
+    if Info <> list() then
+        [%tcur, %cpr, alreadyran, needstart, needcompile, %state0] = Info(:)
+    else
+        %tcur = 0;
+        %cpr = list();
+        alreadyran = %f;
+        needstart = %t;
+        needcompile = 4;
+        %state0 = list();
+    end
+
+    //** set solver
+    tolerances     = scs_m.props.tol
+    solver         = tolerances(6)
+    %scicos_solver = solver
+    //** set variables of context
+    [%scicos_context, ierr] = script2var(scs_m.props.context,struct())
+    //overload %scicos_context variables with those defined by updated_vars
+    contextvars=fieldnames(%scicos_context)
+    updatedvars=fieldnames(updated_vars)
+    for k=1:size(updatedvars,"*")
+        u=updatedvars(k)
+        if or(u==contextvars) then
+            %scicos_context(u)=updated_vars(u)
+        else
+            mprintf(_("Warning the variable %s does not match any context variable name\nignored"),u)
+        end
+    end
+    if ierr == 0 then //++ no error
+        [scs_m, %cpr, needcompile, ok] = do_eval(scs_m, %cpr,%scicos_context)
+        if ~ok then
+            error(msprintf(gettext("%s: Error during block parameters evaluation.\n"), "scicos_simulate"));
+        end
+        if needcompile <> 4 & size(%cpr) > 0 then
+            %state0 = %cpr.state
+        end
+        alreadyran = %f
+    else
+        error(["Incorrect context definition, " + lasterror()])
+    end
+
+    // perform block suppression only on partial compilation and full compilation
+    if needcompile > 1 then
+        need_suppress  =%t
+    else
+        need_suppress = %f
+    end
+
+    [%cpr, %state0_n, needcompile, alreadyran, ok] = do_update(%cpr, ...
+    %state0, needcompile)
+
+    if ~ok then
+        error(msprintf(gettext("%s: Error during block parameters update.\n"), "scicos_simulate"));
+    end
+
+    if or(%state0_n <> %state0) then //initial state has been changed
+        %state0 = %state0_n
+        [alreadyran, %cpr, Resume_line, TOWS_vals, Names] = do_terminate1(scs_m, %cpr)
+        choix = []
+    end
+    if (%cpr.sim.xptr($) - 1) < size(%cpr.state.x,"*") & solver < 100 then
+        warning(msprintf(_("Diagram has been compiled for implicit solver\nswitching to implicit solver.\n")))
+        solver = 100
+        tolerances(6) = solver
+    elseif (%cpr.sim.xptr($) - 1) == size(%cpr.state.x,"*") & ...
+        (or (solver == [100 101 102])) & size(%cpr.state.x,"*") <> 0 then
+        warning(msprintf(_("Diagram has been compiled for explicit solver\nswitching to explicit solver.\n")))
+        solver = 0
+        tolerances(6) = solver
+    end
+
+    if need_suppress then //this is done only once
+        for i = 1:length(%cpr.sim.funs)
+            if type(%cpr.sim.funs(i)) <> 13 then
+                if find(%cpr.sim.funs(i)(1) == Ignore) <> [] then
+                    if (%cpr.sim.funs(i)(1) == "bplatform2") then
+                        %cpr.sim.funtyp(i) = 4; // BPLATFORM block has function type 5, so need to set it to 4, like the trash block.
+                    end
+                    %cpr.sim.funs(i)(1) = "trash";
+                end
+            end
+        end
+    end
+
+    if needstart then //scicos initialization
+        if alreadyran then
+            [alreadyran, %cpr, Resume_line, TOWS_vals, Names] = do_terminate1(scs_m, %cpr)
+            alreadyran = %f
+        end
+        %tcur = 0
+        %cpr.state = %state0
+        tf = scs_m.props.tf;
+        if tf*tolerances == [] then
+            error(_("Simulation parameters not set:"));
+        end
+        ierr = execstr("[state, t] = scicosim(%cpr.state, %tcur, tf, %cpr.sim," + ..
+        "''start'', tolerances)","errcatch")
+        if ierr <> 0 then
+            error(_("Initialization problem:"))
+        end
+        %cpr.state = state
+    end
+
+    ierr = execstr("[state, t] = scicosim(%cpr.state, %tcur, tf, %cpr.sim," + ..
+    "''run'', tolerances)","errcatch")
+    if ierr == 0 then
+        %cpr.state = state
+        alreadyran = %t
+        if (tf - t) < tolerances(3) then
+            needstart = %t
+            [alreadyran, %cpr, Resume_line, TOWS_vals, Names] = do_terminate1(scs_m, %cpr)
+            for i=1:size(Names, "c")
+                ierr = execstr(Names(i)+" = TOWS_vals("+string(i)+");", "errcatch");
+                if ierr <> 0 then
+                    str_err = split_lasterror(lasterror());
+                    message(["Simulation problem" ; "Unable to find To Workspace Variable {"+Names(i)+"}:" ; str_err]);
+                    break;
+                end
+            end
+        else
+            %tcur = t
+        end
+    else
+        error([_("Simulation problem: ");lasterror()])
+    end
+
+    Info = list(%tcur, %cpr, alreadyran, needstart, needcompile, %state0)
+
+    // Executing the resume() function at the end, because it does not return control
+    if ~isempty(Names) then
+        execstr(Resume_line);
+    end
+endfunction
+
+function [alreadyran, %cpr, Resume_line, TOWS_vals, Names] = do_terminate1(scs_m, %cpr)
+    // Copyright INRIA
+
+    // Default return values
+    Resume_line = "";
+    TOWS_vals = struct("values",[],"time",[]);
+    Names = [];
+
+    if prod(size(%cpr)) < 2 then
+        alreadyran = %f
+        return
+    end
+
+    par = scs_m.props;
+
+    if alreadyran then
+        alreadyran = %f
+        // terminate current simulation
+        ierr = execstr("[state, t] = scicosim(%cpr.state, par.tf, par.tf, %cpr.sim, ''finish'', par.tol)", "errcatch")
+
+        %cpr.state = state
+        if ierr <> 0 then
+            error([_("End problem: ");lasterror()])
+        end
+
+        // Restore saved variables in Scilab environment ("To workspace" block)
+
+        // First step: Search the %cpr tree for TOWS_c blocks, and extract the variable names.
+        path = %cpr.sim;
+        buff_sizes = [];
+        increment = 1;
+        for i=1:size(path.funs)
+            increment2 = path.ipptr(i+1);
+            if (increment2 - increment <> 0) then   // ipar has at least a few elements
+                space = increment2 - increment;      // The number of elements that the current block pushed into ipar
+                if (path.funs(i) == "tows_c") then  // Found a Tow_workspace block
+                    varNameLen = space - 2;         // Space minus 'buffer_size' and 'var length' ipar elements
+                    varNameCode = path.ipar(increment+2:increment+2+varNameLen-1);  // varName is stored in Scilab code
+                    varName = ascii(varNameCode);
+                    Names = [Names varName];        // Append varName in Names
+                    buff_size  = path.ipar(increment);  // Retrieve buffer size
+                    buff_sizes = [buff_sizes buff_size];
+                end
+                increment = increment2;
+            end
+        end
+        // At the end, Names contains the string names of the variables and buff_sizes the respective buffer sizes
+
+        // Second step: Link the variable names to their values vectors,
+        //and call '[names(1), names(2), ...] = resume(names(1), names(2), ...)' to save the variable into Scilab
+        if ~isempty(Names) then
+            for i=1:size(Names, "c")
+                execstr("NamesIval = "+Names(i)+"_val;");
+                execstr("NamesIvalt = "+Names(i)+"_valt;");
+                // If input is a matrix, use function matrix() to reshape the saved values
+                // Check condition using time vector, if we have more values than time stamps, split it
+                if (size(NamesIval, "r") > size(NamesIvalt, "r")) then  // In this case, size(Names(i), 'r') = buff_sizes(i) * nCols2
+                    nRows  = size(NamesIvalt, "r");
+                    nCols  = size(NamesIval, "c");
+                    nCols2 = size(NamesIval, "r") / nRows;
+                    NamesIval = matrix(NamesIval, nCols, nCols2, nRows);
+                end
+                if i == 1 then
+                    // Replace default struct with value vector of first element of 'Names'
+                    TOWS_vals.values = NamesIval;
+                    TOWS_vals.time   = NamesIvalt;
+                    Resume_line_args = Names(1);
+                else
+                    ierr = execstr("TOWS_vals = [TOWS_vals struct(''values'', NamesIval, ''time'', NamesIvalt)];", "errcatch");
+                    if ierr <> 0 then
+                        str_err = split_lasterror(lasterror());
+                        message(["Simulation problem" ; "Unable to find To Workspace Variable {"+Names(i)+"}:" ; str_err]);
+                        break;
+                    end
+                    Resume_line_args   = Resume_line_args + ", " + Names(i);  // Concatenate the variable names up to the last one
+                end
+            end
+            Resume_line = "[" + Resume_line_args + "] = resume(" + Resume_line_args + ");";  // Build the message
+            // Will execute Resume_line at the end of the main function, because it does not return control
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_auto/steadycos.bin b/modules/scicos/macros/scicos_auto/steadycos.bin
new file mode 100755
index 000000000..74619b0ff
--- /dev/null
+++ b/modules/scicos/macros/scicos_auto/steadycos.bin
diff --git a/modules/scicos/macros/scicos_auto/steadycos.sci b/modules/scicos/macros/scicos_auto/steadycos.sci
new file mode 100755
index 000000000..38eb06495
--- /dev/null
+++ b/modules/scicos/macros/scicos_auto/steadycos.sci
@@ -0,0 +1,269 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) DIGITEO - Clément DAVID <clement.david@scilab.org>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ./license.txt
+//
+
+function [X,U,Y,XP] = steadycos(scs_m,X,U,Y,Indx,Indu,Indy,Indxp,param)
+    // NAME
+    // steadycos - Finds an equilibrium state of a general
+    // dynamical system described by a scicos diagram
+
+    // CALLING SEQUENCE
+    //
+    // [X,U,Y,XP] = steadycos(scs_m,X,U,Y,Indx,Indu,Indy [,Indxp [,param ] ])
+    //
+    // scs_m: a Scicos data structure
+    // X: column vector. Continuous state. Can be set to [] if zero.
+    // U: column vector. Input. Can be set to [] if zero.
+    // Y: column vector. Output. Can be set to [] if zero.
+    // Indx: index of entries of X that are not fixed. If all can vary, set to 1:$
+    // Indu: index of entries of U that are not fixed. If all can vary, set to 1:$
+    // Indy: index of entries of Y that are not fixed. If all can vary, set to 1:$
+    // Indxp: index of entries of XP (derivative of x) that need not be zero.
+    //        If all can vary, set to 1:$. Default [].
+    // param: list with two elements (default list(1.d-6,0))
+    //   param(1): scalar. Perturbation level for linearization; the following variation is used
+    //             del([x;u])_i = param(1)+param(1)*1d-4*abs([x;u])_i
+    //   param(2): scalar. Time t.
+    //
+
+    //** This function can be (ab)used from the Scilab command line and
+    //** inside a Scicos "context". In order to handle the different situations,
+    //** the required library are loaded if not already present in the
+    //** "semiglobal-local-environment".
+
+    if ~exists("scicos_diagram") then
+        loadXcosLibs();
+    end
+
+    if exists("scicos_scicoslib")==0 then
+        load("SCI/modules/scicos/macros/scicos_scicos/lib") ;
+    end
+
+    if exists("scicos_autolib")==0 then
+        load("SCI/modules/scicos/macros/scicos_auto/lib") ;
+    end
+
+    if exists("scicos_utilslib")==0 then
+        load("SCI/modules/scicos/macros/scicos_utils/lib") ;
+    end
+
+    // Define Scicos data tables ===========================================
+    if ( ~isdef("modelica_libs") | ..
+        ~isdef("scicos_pal_libs") ) then
+        [modelica_libs, scicos_pal_libs, %scicos_with_grid, %scs_wgrid] = initial_scicos_tables();
+    end
+    // =====================================================================
+
+    [lhs,rhs] = argn(0) ;
+
+    if rhs < 1 then
+        error(msprintf(gettext("%s: Wrong number of input argument(s): At least %d expected.\n"), "steadycos", 1));
+    end
+    if typeof(scs_m)<>"diagram" & typeof(scs_m)<>"cpr" then
+        error(msprintf(gettext("%s: Wrong type for input argument #%d: A diagram expected.\n"), "steadycos", 1));
+    end
+
+    // compile and post-process the diagram
+    if typeof(scs_m)=="diagram" then
+
+        // Propagate context through all blocks
+        %state0     = list();
+        needcompile = 4;
+        %cpr        = struct();
+        %cpr.state  = %state0;
+        %scicos_context = struct();
+        context = scs_m.props.context;
+
+        [%scicos_context, ierr] = script2var(context, %scicos_context);
+        [scs_m,%cpr,needcompile,ok] = do_eval(scs_m, %cpr, %scicos_context);
+        if ~ok then
+            error(msprintf(gettext("%s: Error during block parameters evaluation.\n"), "lincos"));
+        end
+
+        IN  = [];
+        OUT = [];
+
+        // check and do version
+        current_version = get_scicos_version()
+        scicos_ver = find_scicos_version(scs_m)
+        if scicos_ver<>current_version then
+            scs_m=do_version(scs_m,scicos_ver);
+        end
+
+        if rhs==7 then
+            Indxp=[ ];param=list(1.d-6,0)
+        elseif rhs==8 then
+            param=list(1.d-6,0)
+        elseif rhs==9 then
+        else
+            error(msprintf(gettext("%s: Wrong number of input arguments: %d to %d expected.\n"), "steadycos", 7, 9));
+        end
+
+        for i=1:length(scs_m.objs)
+            if typeof(scs_m.objs(i))=="Block" then
+                if or(scs_m.objs(i).gui==["IN_f", "INPUTPORT"]) then
+                    scs_m.objs(i).gui="INPUTPORT";
+                    IN=[IN scs_m.objs(i).model.ipar]
+                elseif or(scs_m.objs(i).gui==["OUT_f", "OUTPUTPORT"]) then
+                    scs_m.objs(i).gui="OUTPUTPORT";
+                    OUT=[OUT  scs_m.objs(i).model.ipar]
+                end
+            end
+        end
+
+        if IN == [] then
+            error(msprintf(gettext("%s: Unable to find diagram inputs\n"), "steadycos"));
+        end
+        if OUT == [] then
+            error(msprintf(gettext("%s: Unable to find diagram outputs\n"), "steadycos"));
+        end
+
+        IN=-gsort(-IN);
+        if or(IN<>[1:size(IN,"*")]) then
+            error(msprintf(gettext("%s: Input ports are not numbered properly.\n"), "steadycos"))
+        end
+
+        OUT=-gsort(-OUT);
+        if or(OUT<>[1:size(OUT,"*")]) then
+            error(msprintf(gettext("%s: Output ports are not numbered properly.\n"), "steadycos"))
+        end
+
+        // compile scs_m
+        [bllst,connectmat,clkconnect,cor,corinv,ok] = c_pass1(scs_m);
+        if ~ok then
+            error(msprintf(gettext("%s: Diagram does not compile in pass %d.\n"),"steadycos",1));
+        end
+        %cpr = c_pass2(bllst,connectmat,clkconnect,cor,corinv);
+        if %cpr==list() then
+            ok=%f,
+        end
+        if ~ok then
+            error(msprintf(gettext("%s: Diagram does not compile in pass %d.\n"),"steadycos",2));
+        end
+
+        // compile and post-process the diagram end
+    end
+
+    sim=%cpr.sim;state=%cpr.state;
+    //
+    inplnk=sim.inplnk;inpptr=sim.inpptr;
+    outlnk=sim.outlnk;outptr=sim.outptr;ipptr=sim.ipptr;
+
+    ki=[];ko=[];nyptr=1;
+    for kfun=1:length(sim.funs)
+        if sim.funs(kfun)=="output" then
+            sim.funs(kfun)="bidon"
+            ko=[ko;[kfun,sim.ipar(ipptr(kfun))]];
+
+        elseif sim.funs(kfun)=="input" then
+            sim.funs(kfun)="bidon"
+            ki=[ki;[kfun,sim.ipar(ipptr(kfun))]];
+
+        end
+    end
+    [junk,ind]=gsort(-ko(:,2));ko=ko(ind,1);
+    [junk,ind]=gsort(-ki(:,2));ki=ki(ind,1);
+
+    pointo=[];
+    for k=ko'
+        pointo=[pointo;inplnk(inpptr(k))]
+    end
+    pointi=[];
+    for k=ki'
+        pointi=[pointi;outlnk(outptr(k))]
+    end
+    nx=size(state.x,"*");
+    nu=0; for k=pointi', nu=nu+size(state.outtb(k),"*"), end
+    ny=0; for k=pointo', ny=ny+size(state.outtb(k),"*"), end
+
+    if X==[] then X=zeros(nx,1);end
+    if Y==[] then Y=zeros(ny,1);end
+    if U==[] then U=zeros(nu,1);end
+    if param(1)==0 then param(1)=1.d-6;end
+
+    t = param(2)
+
+    ux0 = [U(Indu);X(Indx)];
+    sindu = size(U(Indu),"*");
+    sindx = size(X(Indx),"*");
+    [err,uxopt,gopt] = optim(cost,ux0)
+    U(Indu) = uxopt(1:sindu);
+    X(Indx) = uxopt(sindu+1:sindx+sindu);
+    state.x = X;
+    Uind=1
+
+    for k=pointi'
+        state.outtb(k) = matrix(U(Uind:Uind+size(state.outtb(k),"*")-1),size(state.outtb(k)));
+        Uind = size(state.outtb(k),"*")+1;
+    end
+
+    [state,t] = scicosim(state,t,t,sim,"start",[.1,.1,.1,.1]);
+    [state,t] = scicosim(state,t,t,sim,"linear",[.1,.1,.1,.1]);
+    [state,t] = scicosim(state,t,t,sim,"finish",[.1,.1,.1,.1]);
+
+    XP=state.x;
+    Yind=1
+
+    for k=pointo'
+        Y(Yind:Yind+size(state.outtb(k),"*")-1) = state.outtb(k)(:);
+        Yind = size(state.outtb(k),"*")+1
+    end
+
+endfunction
+//**-------------------------------------------------------------------------------------------
+
+function [f,g,ind]=cost(ux,ind)
+    state;
+    X;
+    U;
+    X(Indx)=ux(sindu+1:sindx+sindu);
+    U(Indu)=ux(1:sindu);
+    state.x=X;
+    Uind=1
+    for k=pointi'
+        state.outtb(k) = matrix(U(Uind:Uind+size(state.outtb(k),"*")-1),size(state.outtb(k)));
+        Uind = size(state.outtb(k),"*")+1;
+    end
+    // state.outtb(pointi)=U;
+
+    [state,t] = scicosim(state,t,t,sim,"start",[.1,.1,.1,.1]);
+    [state,t] = scicosim(state,t,t,sim,"linear",[.1,.1,.1,.1]);
+    [state,t] = scicosim(state,t,t,sim,"finish",[.1,.1,.1,.1]);
+
+    zer=ones(X);zer(Indxp)=0;xp=zer.*state.x;
+
+    Yind=1
+    for k=pointo'
+        y(Yind:Yind+size(state.outtb(k),"*")-1)=state.outtb(k)(:);
+        Yind = size(state.outtb(k),"*")+1
+    end
+    // y=state.outtb(pointo);
+    zer = ones(y);
+    zer(Indy) = 0;
+    err       = zer.*(Y-y);
+    f=.5*(norm(xp,2)+norm(err,2));
+
+    sys = lincos(%cpr,X,U,param); //** lincos is used here
+
+    g  = xp'*[sys.B(:,Indu) sys.A(:,Indx)] - err'*[sys.D(:,Indu) sys.C(:,Indx)];
+
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/%Block_e.bin b/modules/scicos/macros/scicos_scicos/%Block_e.bin
new file mode 100755
index 000000000..e391c73ef
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%Block_e.bin
diff --git a/modules/scicos/macros/scicos_scicos/%Block_e.sci b/modules/scicos/macros/scicos_scicos/%Block_e.sci
new file mode 100755
index 000000000..07ea438aa
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%Block_e.sci
@@ -0,0 +1,34 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function varargout=%Block_e(i,o)
+    //function used only for backward compatibility of scicos blocks gui
+    warning("Obsolete use of o(i) in this scicos block")
+    varargout=list()
+    for k=1:size(i,"*")
+        ik=i(k)
+        if ik==1 then
+            varargout($+1)="Block"
+        else
+            varargout($+1)=getfield(ik,o)
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%Block_p.bin b/modules/scicos/macros/scicos_scicos/%Block_p.bin
new file mode 100755
index 000000000..417197671
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%Block_p.bin
diff --git a/modules/scicos/macros/scicos_scicos/%Block_p.sci b/modules/scicos/macros/scicos_scicos/%Block_p.sci
new file mode 100755
index 000000000..6287851a2
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%Block_p.sci
@@ -0,0 +1,56 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function %Block_p(block)
+    txt=["GUI     : "+block.gui
+    "Graphics: "
+    "          "+graphics2txt(block.graphics)
+    "Model   : "
+    "          "+model2txt(block.model)]
+    write(%io(2),txt,"(a)")
+endfunction
+
+function txt=graphics2txt(graphics)
+    fn=getfield(1,graphics)
+    txt=[]
+    for k=2:size(fn,"*")
+        txt=[txt
+        sci2exp(graphics(fn(k)),fn(k))]
+    end
+endfunction
+
+function txt=model2txt(model)
+    sim=model.sim
+    if type(sim)==15 then
+        txt=sim(1)+" type: "+string(sim(2))
+    else
+        txt=sim+" type: 0"
+    end
+    fn=getfield(1,model)
+    for k=3:size(fn,"*")
+        if fn(k)=="rpar" & type(model(fn(k)))==15 then
+            txt=[txt;fn(k)+" : SuperBlock"];
+        else
+            txt=[txt
+            sci2exp(model(fn(k)),fn(k))];
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%b_i_graphics.bin b/modules/scicos/macros/scicos_scicos/%b_i_graphics.bin
new file mode 100755
index 000000000..94e38c125
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%b_i_graphics.bin
diff --git a/modules/scicos/macros/scicos_scicos/%b_i_graphics.sci b/modules/scicos/macros/scicos_scicos/%b_i_graphics.sci
new file mode 100755
index 000000000..20cb6ff98
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%b_i_graphics.sci
@@ -0,0 +1,25 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function g=%b_i_graphics(i,b,g)
+    //function used only for backward compatibility of scicos blocks gui
+    setfield(i+1,b,g)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%b_i_model.bin b/modules/scicos/macros/scicos_scicos/%b_i_model.bin
new file mode 100755
index 000000000..99f28c0c1
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%b_i_model.bin
diff --git a/modules/scicos/macros/scicos_scicos/%b_i_model.sci b/modules/scicos/macros/scicos_scicos/%b_i_model.sci
new file mode 100755
index 000000000..da9a2fbb8
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%b_i_model.sci
@@ -0,0 +1,26 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function m=%b_i_model(i,b,m)
+    //function used only for backward compatibility of scicos blocks gui
+    if i>13 then warning("Field "+string(i)+" no longer in model, check"),end
+    setfield(i+1,b,m)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%c_i_block.bin b/modules/scicos/macros/scicos_scicos/%c_i_block.bin
new file mode 100755
index 000000000..99da9215d
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%c_i_block.bin
diff --git a/modules/scicos/macros/scicos_scicos/%c_i_block.sci b/modules/scicos/macros/scicos_scicos/%c_i_block.sci
new file mode 100755
index 000000000..91f89238f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%c_i_block.sci
@@ -0,0 +1,25 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function o=%c_i_block(i,b,o)
+    //function used only for backward compatibility of scicos blocks gui
+    if i<>1 then setfield(i,b,o),end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%c_i_graphics.bin b/modules/scicos/macros/scicos_scicos/%c_i_graphics.bin
new file mode 100755
index 000000000..dcfe2d467
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%c_i_graphics.bin
diff --git a/modules/scicos/macros/scicos_scicos/%c_i_graphics.sci b/modules/scicos/macros/scicos_scicos/%c_i_graphics.sci
new file mode 100755
index 000000000..cdba9d78c
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%c_i_graphics.sci
@@ -0,0 +1,25 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function g=%c_i_graphics(i,b,g)
+    //function used only for backward compatibility of scicos blocks gui
+    setfield(i+1,b,g)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%c_i_model.bin b/modules/scicos/macros/scicos_scicos/%c_i_model.bin
new file mode 100755
index 000000000..49dc36880
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%c_i_model.bin
diff --git a/modules/scicos/macros/scicos_scicos/%c_i_model.sci b/modules/scicos/macros/scicos_scicos/%c_i_model.sci
new file mode 100755
index 000000000..ea3641795
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%c_i_model.sci
@@ -0,0 +1,26 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function m=%c_i_model(i,b,m)
+    //function used only for backward compatibility of scicos blocks gui
+    if i>13 then warning("Field "+string(i)+" no longer in model, check"),end
+    setfield(i+1,b,m)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%debug_scicos.bin b/modules/scicos/macros/scicos_scicos/%debug_scicos.bin
new file mode 100755
index 000000000..f99f48325
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%debug_scicos.bin
diff --git a/modules/scicos/macros/scicos_scicos/%debug_scicos.sci b/modules/scicos/macros/scicos_scicos/%debug_scicos.sci
new file mode 100755
index 000000000..50dc73ff6
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%debug_scicos.sci
@@ -0,0 +1,29 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [block] = %debug_scicos(block,flag)
+    if execstr("load(TMPDIR+''/debug_scicos'')","errcatch")<>0 then
+        disp("Instantiate the Debug block")
+    else
+        [block] = debug_scicos(block,flag)
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%diagram_p.bin b/modules/scicos/macros/scicos_scicos/%diagram_p.bin
new file mode 100755
index 000000000..48803c642
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%diagram_p.bin
diff --git a/modules/scicos/macros/scicos_scicos/%diagram_p.sci b/modules/scicos/macros/scicos_scicos/%diagram_p.sci
new file mode 100755
index 000000000..fa9320fe8
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%diagram_p.sci
@@ -0,0 +1,34 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function %diagram_p(scs_m)
+    %params_p(scs_m.props)
+    nams=[]
+    for o=scs_m.objs
+        if typeof(o)=="Block" then
+            nams=[nams;o.gui]
+        end
+    end
+    if nams <> [] then
+        nums=part(string(1:size(nams,"*"))',1:6)
+        write(%io(2),nums+nams,"(a)")
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%graphics_e.bin b/modules/scicos/macros/scicos_scicos/%graphics_e.bin
new file mode 100755
index 000000000..061280b82
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%graphics_e.bin
diff --git a/modules/scicos/macros/scicos_scicos/%graphics_e.sci b/modules/scicos/macros/scicos_scicos/%graphics_e.sci
new file mode 100755
index 000000000..18e19e1f9
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%graphics_e.sci
@@ -0,0 +1,29 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function varargout=%graphics_e(i,o)
+    //function used only for backward compatibility of scicos blocks gui
+    warning("Obsolete use of graphics(i) in this scicos block")
+    varargout=list()
+    for k=1:size(i,"*")
+        varargout($+1)=getfield(i(k)+1,o)
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%graphics_i_Block.bin b/modules/scicos/macros/scicos_scicos/%graphics_i_Block.bin
new file mode 100755
index 000000000..ee03e4050
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%graphics_i_Block.bin
diff --git a/modules/scicos/macros/scicos_scicos/%graphics_i_Block.sci b/modules/scicos/macros/scicos_scicos/%graphics_i_Block.sci
new file mode 100755
index 000000000..0edce5f45
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%graphics_i_Block.sci
@@ -0,0 +1,24 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function g=%graphics_i_Block(i,b,g)
+    setfield(i,b,g)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%graphics_p.bin b/modules/scicos/macros/scicos_scicos/%graphics_p.bin
new file mode 100755
index 000000000..31ded4dcc
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%graphics_p.bin
diff --git a/modules/scicos/macros/scicos_scicos/%graphics_p.sci b/modules/scicos/macros/scicos_scicos/%graphics_p.sci
new file mode 100755
index 000000000..ce052bcce
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%graphics_p.sci
@@ -0,0 +1,30 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function %graphics_p(graphics)
+    fn=getfield(1,graphics)
+    txt=[]
+    for k=2:size(fn,"*")
+        txt=[txt
+        sci2exp(graphics(fn(k)),fn(k))]
+    end
+    write(%io(2),txt,"(a)")
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%l_i_block.bin b/modules/scicos/macros/scicos_scicos/%l_i_block.bin
new file mode 100755
index 000000000..81b71c550
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%l_i_block.bin
diff --git a/modules/scicos/macros/scicos_scicos/%l_i_block.sci b/modules/scicos/macros/scicos_scicos/%l_i_block.sci
new file mode 100755
index 000000000..19b2e04b3
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%l_i_block.sci
@@ -0,0 +1,25 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function o=%l_i_block(i,b,o)
+    //function used only for backward compatibility of scicos blocks gui
+    setfield(i,b,o)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%l_i_graphics.bin b/modules/scicos/macros/scicos_scicos/%l_i_graphics.bin
new file mode 100755
index 000000000..fb663e044
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%l_i_graphics.bin
diff --git a/modules/scicos/macros/scicos_scicos/%l_i_graphics.sci b/modules/scicos/macros/scicos_scicos/%l_i_graphics.sci
new file mode 100755
index 000000000..e7ace032d
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%l_i_graphics.sci
@@ -0,0 +1,25 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function g=%l_i_graphics(i,b,g)
+    //function used only for backward compatibility of scicos blocks gui
+    setfield(i+1,b,g)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%l_i_model.bin b/modules/scicos/macros/scicos_scicos/%l_i_model.bin
new file mode 100755
index 000000000..20057f5b3
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%l_i_model.bin
diff --git a/modules/scicos/macros/scicos_scicos/%l_i_model.sci b/modules/scicos/macros/scicos_scicos/%l_i_model.sci
new file mode 100755
index 000000000..fe1f35ef5
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%l_i_model.sci
@@ -0,0 +1,26 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function m=%l_i_model(i,b,m)
+    //function used only for backward compatibility of scicos blocks gui
+    if i>13 then warning("Field "+string(i)+" no longer in model, check"),end
+    setfield(i+1,b,m)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%model_e.bin b/modules/scicos/macros/scicos_scicos/%model_e.bin
new file mode 100755
index 000000000..25e41d107
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%model_e.bin
diff --git a/modules/scicos/macros/scicos_scicos/%model_e.sci b/modules/scicos/macros/scicos_scicos/%model_e.sci
new file mode 100755
index 000000000..00ced7b14
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%model_e.sci
@@ -0,0 +1,29 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function varargout=%model_e(i,o)
+    //function used only for backward compatibility of scicos blocks gui
+    warning("Obsolete use of model(i) in this scicos block")
+    varargout=list()
+    for k=1:size(i,"*")
+        varargout($+1)=getfield(i(k)+1,o)
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%model_i_Block.bin b/modules/scicos/macros/scicos_scicos/%model_i_Block.bin
new file mode 100755
index 000000000..a956bf297
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%model_i_Block.bin
diff --git a/modules/scicos/macros/scicos_scicos/%model_i_Block.sci b/modules/scicos/macros/scicos_scicos/%model_i_Block.sci
new file mode 100755
index 000000000..14fd59dd8
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%model_i_Block.sci
@@ -0,0 +1,24 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function g=%model_i_Block(i,b,g)
+    setfield(i,b,g)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%model_p.bin b/modules/scicos/macros/scicos_scicos/%model_p.bin
new file mode 100755
index 000000000..672557c4d
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%model_p.bin
diff --git a/modules/scicos/macros/scicos_scicos/%model_p.sci b/modules/scicos/macros/scicos_scicos/%model_p.sci
new file mode 100755
index 000000000..11ac4b812
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%model_p.sci
@@ -0,0 +1,40 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function %model_p(model)
+
+    sim=model.sim
+    if type(sim)==15 then
+        if type(sim(1))==13 then
+            txt="scifunc"
+        else
+            txt=sim(1)+" type: "+string(sim(2))
+        end
+    else
+        txt=sim+" type: 0"
+    end
+    fn=getfield(1,model)
+    for k=3:size(fn,"*")
+        txt=[txt
+        sci2exp(model(fn(k)),fn(k))]
+    end
+    write(%io(2),txt,"(a)")
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%params_p.bin b/modules/scicos/macros/scicos_scicos/%params_p.bin
new file mode 100755
index 000000000..849fd5e3c
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%params_p.bin
diff --git a/modules/scicos/macros/scicos_scicos/%params_p.sci b/modules/scicos/macros/scicos_scicos/%params_p.sci
new file mode 100755
index 000000000..02bd86d6e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%params_p.sci
@@ -0,0 +1,34 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function %params_p(par)
+    write(%io(2),params2txt(par),"(a)")
+endfunction
+
+function txt=params2txt(par)
+    fn=getfield(1,par)
+    txt=[]
+    for k=2:size(fn,"*")
+        txt=[txt
+        sci2exp(par(fn(k)),fn(k))]
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/%s_i_block.bin b/modules/scicos/macros/scicos_scicos/%s_i_block.bin
new file mode 100755
index 000000000..d5a94ab14
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%s_i_block.bin
diff --git a/modules/scicos/macros/scicos_scicos/%s_i_block.sci b/modules/scicos/macros/scicos_scicos/%s_i_block.sci
new file mode 100755
index 000000000..066de9578
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%s_i_block.sci
@@ -0,0 +1,25 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function o=%s_i_block(i,b,o)
+    //function used only for backward compatibility of scicos blocks gui
+    setfield(i,b,o)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%s_i_graphics.bin b/modules/scicos/macros/scicos_scicos/%s_i_graphics.bin
new file mode 100755
index 000000000..71c0486cb
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%s_i_graphics.bin
diff --git a/modules/scicos/macros/scicos_scicos/%s_i_graphics.sci b/modules/scicos/macros/scicos_scicos/%s_i_graphics.sci
new file mode 100755
index 000000000..db813d681
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%s_i_graphics.sci
@@ -0,0 +1,25 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function g=%s_i_graphics(i,b,g)
+    //function used only for backward compatibility of scicos blocks gui
+    setfield(i+1,b,g)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/%s_i_model.bin b/modules/scicos/macros/scicos_scicos/%s_i_model.bin
new file mode 100755
index 000000000..3abf96781
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%s_i_model.bin
diff --git a/modules/scicos/macros/scicos_scicos/%s_i_model.sci b/modules/scicos/macros/scicos_scicos/%s_i_model.sci
new file mode 100755
index 000000000..abd18d912
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/%s_i_model.sci
@@ -0,0 +1,26 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function m=%s_i_model(i,b,m)
+    //function used only for backward compatibility of scicos blocks gui
+    if i>13 then warning("Field "+string(i)+" no longer in model, check"),end
+    setfield(i+1,b,m)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/CC4.bin b/modules/scicos/macros/scicos_scicos/CC4.bin
new file mode 100755
index 000000000..8ca51d641
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/CC4.bin
diff --git a/modules/scicos/macros/scicos_scicos/CC4.sci b/modules/scicos/macros/scicos_scicos/CC4.sci
new file mode 100755
index 000000000..f7fb15579
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/CC4.sci
@@ -0,0 +1,121 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function [ok,tt,cancel]=CC4(funam,tt)
+    // Copyright INRIA
+    //
+    cancel=%f
+
+    if tt==[] then
+
+        textmp=["#include ""scicos_block4.h""";
+        ""
+        "void "+funam+"(scicos_block *block,int flag)";
+        ];
+        ttext=[];
+        textmp($+1)="{"
+        textmp=[textmp]
+
+        textmp($+1)="  /* init */"
+        textmp($+1)="  if (flag == 4) {"
+        textmp($+1)="   ";
+        if out<>0 then
+            textmp($+1)="  /* output computation */ ";
+            textmp($+1)="  } else if(flag == 1) {"
+            textmp($+1)="   ";
+        end
+
+        if nx<>0 then
+            textmp($+1)="  /* derivative or residual computation */"
+            textmp($+1)="  } else if(flag == 0) {"
+            textmp($+1)="   ";
+        end
+
+        if nzcr<>0 then
+            textmp($+1)="  /* zero crossing surface and mode computation */"
+            textmp($+1)="  } else if(flag == 9) {"
+            textmp($+1)="   ";
+        end
+
+        if nz<>0 then
+            textmp($+1)="  /* computation of next discrete state*/ "
+            textmp($+1)="  } else if(flag == 2) { "
+            textmp($+1)="   ";
+
+        elseif min(nx,nzcr+nevin)>0 then
+            textmp($+1)="  /* computation of jumped state*/ "
+            textmp($+1)="  } else if(flag == 2) {"
+            textmp($+1)="   ";
+        end
+
+        if nevout<>0 then
+            textmp($+1)="  /* computation of output event times*/"
+            textmp($+1)="  } else if(flag == 3) {"
+            textmp($+1)="   "
+        end
+        textmp($+1)="  /* ending */"
+        textmp($+1)="  } else  if (flag == 5) {"
+        textmp($+1)="   ";
+        textmp($+1)="  }"
+        textmp($+1)="}"
+        textmp=[textmp;" "; ttext];
+    else
+        textmp=tt;
+    end
+
+    tt = textmp
+    ok   = %t
+    //## set param of scstxtedit
+    ptxtedit=scicos_txtedit(clos = 0,...
+    typ  = "Cfunc",...
+    head = ["Function definition in C";
+    "Here is a skeleton of the functions which";
+    " you should edit."]);
+
+    while 1==1
+
+        [txt,Quit] = scstxtedit(textmp,ptxtedit);
+
+        if ptxtedit.clos==1 then
+            break;
+        end
+
+        if txt<>[] then
+            [libss,ok,cancel]=get_dynamic_lib_dir(txt,funam,"c")
+
+            if ~cancel & ok then
+                [ok]=scicos_block_link(funam,txt,"c",libss)
+                if ok then
+                    ptxtedit.clos=1
+                    tt=txt
+                    ok = %t;
+                end
+                textmp=txt;
+            end
+        end
+
+        if Quit==1 then
+            ok = %f;
+            cancel =%t;
+            break;
+        end
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/CFORTR.bin b/modules/scicos/macros/scicos_scicos/CFORTR.bin
new file mode 100755
index 000000000..f91f85108
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/CFORTR.bin
diff --git a/modules/scicos/macros/scicos_scicos/CFORTR.sci b/modules/scicos/macros/scicos_scicos/CFORTR.sci
new file mode 100755
index 000000000..367887afc
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/CFORTR.sci
@@ -0,0 +1,84 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [ok,tt]=CFORTR(funam,tt,inp,out)
+    //
+    ni=size(inp,"*")
+    no=size(out,"*")
+    if tt==[] then
+
+        tete1=["#include <machine.h>";"#include <math.h>";...
+        "void "+funam+"(flag,nevprt,t,xd,x,nx,z,nz,tvec,";..
+        "             ntvec,rpar,nrpar,ipar,nipar"]
+
+        tete2= "      "
+        decl=""
+        for i=1:ni
+            tete2=tete2+",u"+string(i)+",nu"+string(i)
+            decl=decl+",*nu"+string(i)
+        end
+        for i=1:no
+            tete2=tete2+",y"+string(i)+",ny"+string(i)
+            decl=decl+",*ny"+string(i)
+        end
+        tete2=tete2+")"
+
+        tete3=["      double *t,xd[],x[],z[],tvec[];";..
+        "      int *flag,*nevprt,*nx,*nz,*ntvec,*nrpar,ipar[],*nipar"+decl+";"]
+
+
+        tete4= "      double rpar[]"
+        for i=1:ni
+            tete4=tete4+",u"+string(i)+"[]"
+        end
+        for i=1:no
+            tete4=tete4+",y"+string(i)+"[]"
+        end
+        tetev=[" ";" "]
+
+        textmp=[tete1;tete2;tetev;tete3;tete4+";";
+        "/* modify below this line */";
+        "{"
+        "}"
+        tetev];
+    else
+        textmp=tt;
+    end
+
+    while 1==1
+        [txt]=x_dialog(["Function definition in C";
+        "Here is a skeleton of the functions which you should edit"],..
+        textmp);
+
+        if txt<>[] then
+            tt=txt
+            [ok]=scicos_block_link(funam,tt,"c")
+            if ok then
+                textmp=txt;
+            end
+            break;
+        else
+            ok=%f;break;
+        end
+    end
+
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/CFORTR2.bin b/modules/scicos/macros/scicos_scicos/CFORTR2.bin
new file mode 100755
index 000000000..63027bdb2
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/CFORTR2.bin
diff --git a/modules/scicos/macros/scicos_scicos/CFORTR2.sci b/modules/scicos/macros/scicos_scicos/CFORTR2.sci
new file mode 100755
index 000000000..59cf905c5
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/CFORTR2.sci
@@ -0,0 +1,164 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [ok,tt,cancel]=CFORTR2(funam,tt)
+
+    //
+    cancel=%f
+
+    if tt==[] then
+
+        textmp=[
+        "#include <math.h>";
+        "#include <stdlib.h>";
+        "#include <scicos_block.h>";
+        "void "+funam+"(scicos_block *block,int flag)";
+        ];
+        ttext=[];
+        textmp($+1)="{"
+        textmp=[textmp;
+        "  /* ";
+        "  int block->nevprt;"
+        "  int block->nz;"
+        "  double* block->z;"
+        "  int block->nx;"
+        "  double* block->x;"
+        "  double* block->xd;"
+        "  double* block->res;"
+        "  int block->nin;"
+        "  int *block->insz;"
+        "  double **block->inptr;"
+        "  int block->nout;"
+        "  int *block->outsz;"
+        "  double **block->outptr;"
+        "  int block->nevout;"
+        "  int block->nrpar;"
+        "  double *block->rpar;"
+        "  int block->nipar;"
+        "  int *block->ipar;"
+        "  int block->ng;"
+        "  double *block->g;"
+        "  int *block->jroot;"
+        "  char block->label[41];"
+        "  */"]
+
+        textmp($+1)="  if (flag == 4) { /* initialization */"
+        textmp($+1)="   "+funam+"_bloc_init(block,flag);"
+        ttext=[ttext;"int "+funam+"_bloc_init(scicos_block *block,int flag)";
+        "{";
+        "return 0;}"];
+        textmp($+1)=" "
+        if nout<>0 then
+            textmp($+1)="  } else if(flag == 1) { /* output computation*/"
+            textmp($+1)="   set_block_error("+funam+"_bloc_outputs(block,flag));"
+            ttext=[ttext;"int "+funam+"_bloc_outputs(scicos_block *block,int flag)";
+            "{";
+            "return 0;}"];
+        end
+
+        if nx<>0 then
+            textmp($+1)="  } else if(flag == 0) { /* derivative or residual computation*/",
+            textmp($+1)="   set_block_error("+funam+"_bloc_deriv(block,flag));"
+            ttext=[ttext;"int "+funam+"_bloc_deriv(scicos_block *block,int flag)";
+            "{";
+            "return 0;}"];
+        end
+
+        if ng <>0 then
+            textmp($+1)="  } else if(flag == 9) {/* zero crossing surface and mode computation*/",
+            textmp($+1)="     set_block_error("+funam+"_bloc_zcross(block,flag));";
+            ttext=[ttext;"int "+funam+"_bloc_zcross(scicos_block *block,int flag)";
+            "{";
+            "return 0;}"];
+        end
+
+        if nz<>0 then
+            textmp($+1)="  } else if(flag == 2) { /* computation of next discrte state*/ ",
+            textmp($+1)="     set_block_error("+funam+"_bloc_states(block,flag));";
+            ttext=[ttext;"int "+funam+"_bloc_states(scicos_block *block,int flag)";
+            "{";
+            "return 0;}"];
+        elseif min(nx,ng+nevin)>0 then
+            textmp($+1)="  } else if(flag == 2) { /* computation of jumped state*/ ",
+            textmp($+1)="     set_block_error("+funam+"_bloc_states(block,flag));";
+            ttext=[ttext;"int "+funam+"_bloc_states(scicos_block *block,int flag)";
+            "{";
+            "return 0;}"];
+        end
+
+        if nevout<>0 then
+            textmp($+1)="  } else if(flag == 3) { /* computation of output event times*/",
+            textmp($+1)="     set_block_error("+funam+"_bloc_evtout(block,flag));";
+            ttext=[ttext;"int "+funam+"_bloc_evtout(scicos_block *block,int flag)";
+            "{";
+            "return 0;}"];
+        end
+        textmp($+1)="  } else  if (flag == 5) { /* ending */"
+        textmp($+1)="     set_block_error("+funam+"_bloc_ending(block,flag));";
+        ttext=[ttext;"int "+funam+"_bloc_ending(scicos_block *block,int flag)";
+        "{";
+        "return 0;}"];
+        textmp($+1)="  }"
+        textmp($+1)="}"
+        textmp=[textmp;" "; ttext];
+    else
+        textmp=tt;
+    end
+
+    tt = textmp
+    ok   = %t
+    //## set param of scstxtedit
+    ptxtedit=scicos_txtedit(clos = 0,...
+    typ  = "Cfunc",...
+    head = ["Function definition in C";
+    "Here is a skeleton of the functions which";
+    " you should edit."]);
+
+    while 1==1
+
+        [txt,Quit] = scstxtedit(textmp,ptxtedit);
+
+        if ptxtedit.clos==1 then
+            break;
+        end
+
+        if txt<>[] then
+            [libss,ok,cancel]=get_dynamic_lib_dir(txt,funam,"c")
+
+            if ~cancel & ok then
+                [ok]=scicos_block_link(funam,txt,"c",libss)
+                if ok then
+                    ptxtedit.clos=1
+                    tt=txt
+                    ok = %t;
+                end
+                textmp=txt;
+            end
+        end
+
+        if Quit==1 then
+            ok = %f;
+            cancel =%t;
+            break;
+        end
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/Compute_cic.bin b/modules/scicos/macros/scicos_scicos/Compute_cic.bin
new file mode 100755
index 000000000..a4275fc29
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/Compute_cic.bin
diff --git a/modules/scicos/macros/scicos_scicos/Compute_cic.sci b/modules/scicos/macros/scicos_scicos/Compute_cic.sci
new file mode 100755
index 000000000..7ff47fd02
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/Compute_cic.sci
@@ -0,0 +1,257 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function ok=Compute_cic(method,Nunknowns)
+    global icpr
+    ok=%f
+
+    if icpr==list() then
+        return
+    end
+
+    tolerances=scs_m.props.tol
+    solver=tolerances(6)
+    if (and (solver <> [100 101 102])) then solver=100; end
+    tolerances(6)=solver
+    Atol=tolerances(1)
+    Rtol=tolerances(2)
+    %tcur=0;
+    tf=tolerances(3)
+    state=icpr.state;
+    nx=size(state.x,"r");
+    nx2=round(nx/2);
+    nxModelica=evstr(Nunknowns);
+
+    if nxModelica~=nx2 then
+        messagebox(msprintf(_("Your model contains states defined in standard Scicos blocks.\n"+..
+        "Current initialization interface does not support mixed models.")),"error","modal");
+        return
+    end
+
+    //------------------------------
+    ierr=0;
+    try
+        ierr=execstr("[state,t]=scicosim(state,%tcur,tf,icpr.sim,''start'',tolerances)","errcatch")
+        if ierr<>0 then
+            messagebox(msprintf(_("Initialisation problem in %s "),"Scicosim-start"),"error","modal");
+            return
+        end
+    catch
+        messagebox(msprintf(_("Initialisation problem in %s "),"Scicosim-start"),"error","modal");
+        return
+    end
+    //--------------------------------------------------------------
+    Ida_ierr=0;
+    if method=="Ida (init)" then
+        try
+            // scicos menu, not any more in xcos
+            // setmenu(curwin,'stop')
+            Ida_ierr=execstr("[state,t]=scicosim(state,%tcur,tf,icpr.sim,''run'',tolerances)","errcatch")
+            // unsetmenu(curwin,'stop')
+            if Ida_ierr<>0 then,
+                messagebox(msprintf(_("Initialisation problem in %s "),"Sundials"),"error","modal");
+            end
+        catch
+            messagebox(msprintf(_("Initialisation problem in %s "),"Sundials"),"error","modal");
+        end
+    end
+    //--------------------------------------------------------------
+    if method=="Kinsol" then
+        try
+            // scicos menu, not any more in xcos
+            // setmenu(curwin,'stop')
+            ierr=execstr("[state2,t]=scicosim(state,%tcur,tf,icpr.sim,''Kinsol'',tolerances)","errcatch")
+            if ierr==0 & (or(isnan(state2.x)) | or(isinf(state2.x))) then
+                ierr=-1;
+            end
+            if ierr==0 then
+                state=state2;
+            end
+            // unsetmenu(curwin,'stop')
+            if ierr<>0 then,
+                messagebox(msprintf(_("Initialisation problem in %s "),"Kinsol"),"error","modal");
+            end
+        catch
+            messagebox(msprintf(_("Initialisation problem in %s "),"Kinsol"),"error","modal");
+        end
+    end
+    //--------------------------------------------------------------
+    if method=="Fsolve" then
+        try
+            x0=state.x(1:nx2);
+            [xres]=fsolve(x0,fsim);
+            ierr=0
+            if or(isnan(xres)) | or(isinf(xres)) then
+                ierr=-1;
+            end
+            if ierr==0 then
+                for i=1:nx2, state.x(i)=xres(i);end
+                fsim(xres);// just to perform an idoit to update outputs in mixed_models
+            end
+        catch
+            messagebox(msprintf(_("Initialisation problem in %s "),"Fsolve"), "error","modal");
+        end
+    end
+    //--------------------------------------------------------------
+    if method=="Optim" then
+        try
+            x0=state.x(1:nx2);
+            [f,xres]=optim(fsumsquare,x0);
+            ierr=0
+            if or(isnan(xres)) | or(isinf(xres)) then
+                ierr=-1;
+            end
+            if ierr==0 then
+                for i=1:nx2, state.x(i)=xres(i);end
+                fsim(xres);// just to perform an idoit to update outputs in mixed_models
+            end
+        catch
+            messagebox(msprintf(_("Initialisation problem in the %s method"),"Optim"), "error","modal");
+        end
+    end
+    //--------------------------------------------------------------
+    if method=="Nelder_Mead" then
+        try
+            x0=state.x(1:nx2);
+            [xmin,fmin,epsilo,ls,fs] = neldermead(rand(nx2,nx2+1),Atol,1,0.5,1.5)
+
+            for i=1:nx2, state.x(i)=xmin(i);end
+        catch
+            messagebox(msprintf(_("Initialisation problem in the %s method")," Nelder_Mead"), "error","modal");
+        end
+    end
+    //--------------------------------------------------------------
+    if method=="Hompack77" then
+        try
+            ierr=execstr("[state,t]=scicosim(state,%tcur,tf,icpr.sim,''hompack77'',tolerances)","errcatch")
+            if ierr<>0 then,
+                messagebox(msprintf(_("Initialisation problem in the %s method"),"hompack77"), "error","modal");
+            end
+        catch
+            messagebox(msprintf(_("Initialisation problem in the %s method"),"hompack77"), "error","modal");
+        end
+
+    end
+    //--------------------------------------------------------------
+    if method=="Fsolve_Stepping" then
+        x0=state.x(1:nx2);
+        Res0=fsim(x0);
+        Lambda=0;
+        Steps=1000;
+        xres=x0;
+        for i=1:Steps
+            Lambda=i/Steps;
+            [xres]=fsolve(xres,fsim_step);
+            if modulo(i,10)==0 then,
+                disp("Source-stepping: progress="+string(i/Steps*100)+"%, Error="+string(norm(fsim_step(xres))));
+            end
+        end
+        for i=1:nx2, state.x(i)=xres(i);end
+    end
+    //--------------------------------------------------------------
+    if method=="Sundials_Stepping" then
+    end
+    //--------------------------------------------------------------
+    Err="?"
+    if Ida_ierr==0 & ierr==0 then
+        ss=fsim(state.x(1:nx2));if ss~=[] then Err=string(max(abs(ss)));else Err="0";end//using inf norm
+    end
+
+    try
+        if  Ida_ierr==0 then //cossimdaskr is followed by a cosend in case of error
+            ierr=execstr("[state,t]=scicosim(state,%tcur,tf,icpr.sim,''finish'',tolerances)","errcatch")
+            if ierr<>0 then
+                messagebox(_("Initialisation problem in the finish phase"), "error","modal");
+                return
+            end
+        end
+    catch
+        messagebox(_("Initialisation problem in the finish phase"), "error","modal");
+        return
+    end
+    ok=%t;
+endfunction
+
+//------------------------------------------------------------
+function  res=fsim(xin)
+    nx=size(xin,"r");
+    if nx==0 then res=[];return ;end
+    state1=state
+    for i=1:nx, state1.x(i)=xin(i);end
+    ierr=execstr("[state2,t]=scicosim(state1,%tcur,tf,icpr.sim,''linear'',tolerances)","errcatch")
+    res=state2.x(1:nx);
+endfunction
+
+function  res=fsim_step(xin)
+    res=fsim(xin)-(1-Lambda)*Res0;
+endfunction
+
+
+function  [sumsq,grad,ind]=fsumsquare(xin,ind)
+    nx=size(xin,"r");
+    tolerances=scs_m.props.tol;
+    atol=tolerances(1);
+    rtol=tolerances(2);
+
+    grad=[]
+    if ind==2 | ind==4 | ind==3 then
+        res=fsim(xin);
+        sumsq=0;  for i=1:nx,sumsq=sumsq+res(i)*res(i);end
+    end
+
+    if ind==3 | ind==4 then
+        for j=1:nx
+            xin_p=xin;
+            ewt_j=1/(abs(xin_p(j)*rtol+atol+%eps));
+            delta_j=max(abs(xin_p(j))*%eps,1/ewt_j);
+            xin_p(j)=xin_p(j)+delta_j;
+            res_p=fsim(xin_p);
+            sumsq_p=0;  for i=1:nx,sumsq_p=sumsq_p+(res_p(i)^2-res(i)^2)/delta_j;end
+            grad(j)=sumsq_p;
+        end
+    end
+
+endfunction
+
+
+function [xmin,fmin,epsilo,ls,fs] = neldermead(s,epsil,alpha,beta,gama)
+    // saved in the last versions
+endfunction
+
+
+function y=fsim2(x)
+    x0=x(1);x1=x(2);x2=x(3);x3=x(4);
+    x4=x(5);x5=x(6);x6=x(7);x7=x(8);
+
+    v0 = -x3;
+    v1 = -x2;
+
+    y(1) = x4+v0;
+    y(2) = x6+v1;
+    y(3) = x7-x6;
+    y(4) = x5-x4;
+    y(5) = 1e-14-x3*x2;
+    y(6) = v0+x2;
+    y(7) = v0+abs(x1);
+    y(8) = v1+abs(x0);
+
+    disp(y');
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/FORTR.bin b/modules/scicos/macros/scicos_scicos/FORTR.bin
new file mode 100755
index 000000000..39ad31053
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/FORTR.bin
diff --git a/modules/scicos/macros/scicos_scicos/FORTR.sci b/modules/scicos/macros/scicos_scicos/FORTR.sci
new file mode 100755
index 000000000..7303b695d
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/FORTR.sci
@@ -0,0 +1,75 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [ok,tt]=FORTR(funam,tt,inp,out)
+    //
+    ni=size(inp,"*")
+    no=size(out,"*")
+    if tt==[] then
+
+        tete1=["      subroutine "+funam+"(flag,nevprt,t,xd,x,nx,z,nz,tvec,";..
+        "     $        ntvec,rpar,nrpar,ipar,nipar"]
+
+        tete2= "     $        "
+        for i=1:ni
+            tete2=tete2+",u"+string(i)+",nu"+string(i)
+        end
+        for i=1:no
+            tete2=tete2+",y"+string(i)+",ny"+string(i)
+        end
+        tete2=tete2+")"
+
+        tete3=["      double precision t,xd(*),x(*),z(*),tvec(*)";..
+        "      integer flag,nevprt,nx,nz,ntvec,nrpar,ipar(*)"]
+
+        tete4= "      double precision rpar(*)"
+        for i=1:ni
+            tete4=tete4+",u"+string(i)+"(*)"
+        end
+        for i=1:no
+            tete4=tete4+",y"+string(i)+"(*)"
+        end
+        tetec=["c";"c"];tetev=[" ";" "];
+        tetend="      end"
+
+        textmp=[tete1;tete2;tetec;tete3;tete4;tetec;tetev;tetec;tetend];
+    else
+        textmp=tt;
+    end
+
+    while 1==1
+        [txt]=x_dialog(["Function definition in fortran";
+        "Here is a skeleton of the functions which you should edit"],..
+        textmp);
+
+        if txt<>[] then
+            tt=txt
+            [ok]=scicos_block_link(funam,tt,"f")
+            if ok then
+                textmp=txt;
+            end
+            break;
+        else
+            ok=%f;break;
+        end
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/Link_modelica_C.bin b/modules/scicos/macros/scicos_scicos/Link_modelica_C.bin
new file mode 100755
index 000000000..cc50d1845
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/Link_modelica_C.bin
diff --git a/modules/scicos/macros/scicos_scicos/Link_modelica_C.sci b/modules/scicos/macros/scicos_scicos/Link_modelica_C.sci
new file mode 100755
index 000000000..64deb6152
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/Link_modelica_C.sci
@@ -0,0 +1,75 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) DIGITEO - 2010 - Allan CORNET
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+// -----------------------------------------------------------------------------
+function ok = Link_modelica_C(Cfile)
+    mlibs = pathconvert(modelica_libs, %t, %t);
+    Cfile = pathconvert(Cfile, %f, %t)
+    name = basename(Cfile);
+    path = fileparts(Cfile, "path");
+
+    //  build the list of external functions libraries
+    // remove repreated directories from mlibs
+    rep = [];
+    for k = 1:size(mlibs, "*")
+        for j = k + 1:size(mlibs, "*")
+            if stripblanks(mlibs(k)) == stripblanks(mlibs(j)) then
+                rep = [rep, j];
+            end
+        end
+    end
+    mlibs(rep) = [];
+
+    // add dynamic libraries in same directory that .mo
+    // compatibility feature with 4.x.x
+    libs = [];
+    ext = getdynlibext();
+    for k = 1:size(mlibs, "*")
+        fileSearched = findfiles(mlibs(k), "*" + ext);
+        for j = 1:size(fileSearched, "*")
+            [pathx, fnamex, extensionx] = fileparts(fileSearched(j));
+            libsname = fullfile(pathx, fnamex);
+            if getos() == "Windows" then
+                libsname = strsubst(libsname, "\", "/");
+            end
+            libs = [libs; libsname];
+        end
+    end
+
+    // add modelica_libs to the list of directories to be searched for *.h
+    IncludePaths = "";
+    extToSearch = ".h";
+
+    for k = 1:size(mlibs, "*")
+        pathSearch = mlibs(k);
+        pathSearch = strsubst(pathSearch, "\", "/");
+        filesFounded = findfiles(pathSearch, "*" + ext);
+        if filesFounded <> [] then
+            IncludePaths = IncludePaths + "  -I""" + pathSearch + """";
+        end
+    end
+
+    //** build shared library with the C code
+    files = name;
+    ok = buildnewblock(name, files, "", "", libs, TMPDIR, "", IncludePaths);
+
+endfunction
+// -----------------------------------------------------------------------------
diff --git a/modules/scicos/macros/scicos_scicos/MODCOM.bin b/modules/scicos/macros/scicos_scicos/MODCOM.bin
new file mode 100755
index 000000000..0a779970f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/MODCOM.bin
diff --git a/modules/scicos/macros/scicos_scicos/MODCOM.sci b/modules/scicos/macros/scicos_scicos/MODCOM.sci
new file mode 100755
index 000000000..3263dd10d
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/MODCOM.sci
@@ -0,0 +1,211 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [ok,tt]=MODCOM(funam,tt,vinp,vout,vparam,vparamv,vpprop)
+    //
+    [dirF,nameF,extF]=fileparts(funam);
+
+    //the new head
+    class_txt_new=build_classhead(funam,vinp,vout,vparam,vparamv,vpprop)
+
+    if (tt==[]) then
+        tete4= ["";" //     Real x(start=1), y(start=2);"]
+        tete5="equation";
+
+        tete6=["      // exemple"];
+        tete7="      //der(x)=x-x*y;";
+        tete8="      //der(y)+2*y=x*y;";
+        tete9="end "+nameF+";";
+        textmp=[class_txt_new;tete4;tete5;tete6;tete7;tete8;tete9];
+    else
+        modif=%f;
+        for i=1:size(tt,"*")
+            if strindex(stripblanks(tt(i)),...
+                "////do not modif above this line ////")<>[] then
+                //Alan, 07/10/07
+                //tt(1:i-1) : the current head
+                textmp=[class_txt_new;tt(i+1:$)]
+                modif=%t
+                break
+            end
+        end
+        if ~modif then textmp=tt, end;
+    end
+
+    editblk=%f
+    //## set param of scstxtedit
+    ptxtedit = scicos_txtedit(clos = 0,...
+    typ  = "ModelicaClass",...
+    head = ["Function definition in Modelica";
+    "Here is a skeleton of the functions"+...
+    " which you should edit"])
+
+    while %t
+
+        if (extF=="" | (extF==".mo" & fileinfo(funam)==[])) then
+            editblk=%t;
+            [txt,Quit] = scstxtedit(textmp,ptxtedit);
+        elseif (extF==".mo" & fileinfo(funam)<>[]) then
+            txt=tt;
+        end
+
+
+        if ptxtedit.clos==1 then
+            break;
+        end
+
+        if txt<>[] then
+            //## TODO : compilation
+            //## printf("Compil !!");
+            ok=%t;
+
+            //** saving in the filename
+            if ok then
+                tarpath=pathconvert(TMPDIR+"/Modelica/",%f,%t);
+
+                if (extF=="")  then
+                    funam=tarpath+nameF+".mo";
+                    mputl(txt,funam);
+                elseif fileinfo(funam)==[] then
+                    mputl(txt,funam);
+                end
+                ptxtedit.clos = 1;
+                tt   = txt;
+            end
+            textmp    = txt;
+        end
+
+        if editblk then
+            if Quit==1 then
+                ok=%f;
+                break;
+            end
+        elseif txt==[] then
+            ok=%f; // cancel bouton
+            break
+        end
+    end
+endfunction
+
+//build_classhead : build the head of the modelica function
+function class_txt=build_classhead(funam,vinp,vout,vparam,vparamv,vpprop)
+
+    [dirF,nameF,extF]=fileparts(funam);
+
+    ni=size(vinp,"r");   //** number of inputs
+    no=size(vout,"r");   //** number of outputs
+    np=size(vparam,"r"); //** number of params
+
+    tete1=["class "+nameF]
+
+    //** parameters head
+    if np<>0 then
+        tete1b= "      //parameters";
+        for i=1:np
+            //** param
+            if vpprop(i)==0 then
+                head="      parameter Real "
+                if size(vparamv(i),"*")==1 then
+                    head=head+msprintf("%s = %e;", vparam(i), vparamv(i));
+                else
+                    head=head+vparam(i)+"["+string(size(vparamv(i),"*"))+"]={";
+                    for j=1:size(vparamv(i),"*")
+                        head=head+msprintf("%e", vparamv(i)(j));
+                        if j<>size(vparamv(i),"*") then
+                            head=head+","
+                        end
+                    end
+                    head=head+"};"
+                end
+                //** state
+            elseif vpprop(i)==1 then
+                head="      Real           "
+                if size(vparamv(i),"*")==1 then
+                    head=head+msprintf("%s (start=%e);", vparam(i), vparamv(i));
+                else
+                    head=head+vparam(i)+"["+string(size(vparamv(i),"*"))+"](start={";
+                    for j=1:size(vparamv(i),"*")
+                        head=head+msprintf("%e", vparamv(i)(j));
+                        if j<>size(vparamv(i),"*") then
+                            head=head+","
+                        end
+                    end
+                    head=head+"});"
+                end
+                //** fixed state
+            elseif vpprop(i)==2 then
+                head="      Real           "
+                if size(vparamv(i),"*")==1 then
+                    head=head+msprintf("%s (fixed=true,start=%e);", vparam(i), vparamv(i));
+                else
+                    head=head+vparam(i)+"["+string(size(vparamv(i),"*"))+"](start={";
+                    P_fix="fixed={"
+                    for j=1:size(vparamv(i),"*")
+                        head=head+msprintf("%e", vparamv(i)(j));
+                        P_fix=P_fix+"true"
+                        if j<>size(vparamv(i),"*") then
+                            head=head+","
+                            P_fix=P_fix+","
+                        end
+                    end
+                    head=head+"},"+P_fix+"});"
+                end
+            end
+            tete1b=[tete1b
+            head]
+        end
+    else
+        tete1b=[];
+    end
+
+    //** inputs head
+    if ni<>0 then
+        tete2= "      Real ";
+        for i=1:ni
+            tete2=tete2+vinp(i);
+            if (i==ni) then  tete2=tete2+";";else  tete2=tete2+",";end
+        end
+        tete2=["      //input variables";
+        tete2];
+    else
+        tete2=[];
+    end
+
+    //** outputs head
+    if no<>0 then
+        tete3= "      Real "
+        for i=1:no
+            tete3=tete3+vout(i);
+            if (i==no) then  tete3=tete3+";";else  tete3=tete3+",";end
+        end
+        tete3=["      //output variables";
+        tete3];
+    else
+        tete3=[];
+    end
+
+    tete4="  ////do not modif above this line ////"
+    //-----------------------------------------
+
+    class_txt=[tete1;
+    "  ////automatically generated ////";
+    tete1b;tete2;tete3;tete4]
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/Sinks.cosf b/modules/scicos/macros/scicos_scicos/Sinks.cosf
new file mode 100755
index 000000000..0b96104ab
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/Sinks.cosf
@@ -0,0 +1,837 @@
+scs_m=scicos_diagram(..
+      version="scicos4.2",..
+      props=scicos_params(..
+            wpar=[600,450,0,0,600,450],..
+            Title=["Sinks","SCI/modules/scicos/macros/scicos_scicos/"],..
+            tol=[0.0001,0.000001,1.000E-10,100001,0,0],..
+            tf=100000,..
+            context=[],..
+            void1=[],..
+            options=tlist(["scsopt","3D","Background","Link","ID","Cmap"],list(%t,33),[8,1],[1,5],..
+            list([5,1],[4,1]),[0.8,0.8,0.8]),..
+            void2=[],..
+            void3=[],..
+            doc=list()))
+scs_m.objs(1)=scicos_block(..
+              gui="AFFICH_m",..
+              graphics=scicos_graphics(..
+                       orig=[0,0],..
+                       sz=[60,40],..
+                       flip=%t,..
+                       theta=0,..
+                       exprs=["[1,1]";"1";"1";"1";"5";"1";"0"],..
+                       pin=0,..
+                       pout=[],..
+                       pein=0,..
+                       peout=[],..
+                       gr_i=list(..
+                       ["fnt=xget(''font'')";
+                       "xset(''font'',ipar(1),ipar(2))";
+                       "str='' ''+part(''0'',ones(1,ipar(5)-ipar(6)-2))+''.''+part(''0'',ones(1,ipar(6)))";
+                       "str(1:model.in*model.in2)=str";
+                       "str=matrix(str,model.in,model.in2)";
+                       "rr=xstringl(orig(1),orig(2),str)";
+                       "xstring(orig(1)+max(0,(sz(1)-rr(3))/2),orig(2)+max(0,(sz(2)-rr(4))/2),str)";
+                       "xset(''font'',fnt(1),fnt(2))"],8),..
+                       id="",..
+                       in_implicit="E",..
+                       out_implicit=[]),..
+              model=scicos_model(..
+                       sim=list("affich2",4),..
+                       in=1,..
+                       in2=1,..
+                       intyp=1,..
+                       out=[],..
+                       out2=[],..
+                       outtyp=1,..
+                       evtin=1,..
+                       evtout=[],..
+                       state=[],..
+                       dstate=[-1;0;0;1;1;0;0],..
+                       odstate=list(),..
+                       rpar=[],..
+                       ipar=[1;1;1;1000;5;1;1],..
+                       opar=list(),..
+                       blocktype="c",..
+                       firing=[],..
+                       dep_ut=[%t,%f],..
+                       label="",..
+                       nzcross=0,..
+                       nmode=0,..
+                       equations=list()),..
+              doc=list())
+scs_m.objs(2)=scicos_block(..
+              gui="CMSCOPE",..
+              graphics=scicos_graphics(..
+                       orig=[90,0],..
+                       sz=[40,40],..
+                       flip=%t,..
+                       theta=0,..
+                       exprs=["1 1";"1 3 5 7 9 11 13 15";"-1";"[]";"[]";"-1 -5";"1 5";"30 30";"20";"0";""],..
+                       pin=[0;0],..
+                       pout=[],..
+                       pein=0,..
+                       peout=[],..
+                       gr_i=list("xstringb(orig(1),orig(2),''MScope'',sz(1),sz(2),''fill'')",8),..
+                       id="",..
+                       in_implicit=["E";"E"],..
+                       out_implicit=[]),..
+              model=scicos_model(..
+                       sim=list("cmscope",4),..
+                       in=[1;1],..
+                       in2=[1;1],..
+                       intyp=[1;1],..
+                       out=[],..
+                       out2=[],..
+                       outtyp=1,..
+                       evtin=1,..
+                       evtout=[],..
+                       state=[],..
+                       dstate=[],..
+                       odstate=list(),..
+                       rpar=[0;30;30;-1;1;-5;5],..
+                       ipar=[-1;2;20;-1;-1;-1;-1;1;1;1;3],..
+                       opar=list(),..
+                       blocktype="c",..
+                       firing=[],..
+                       dep_ut=[%t,%f],..
+                       label="",..
+                       nzcross=0,..
+                       nmode=0,..
+                       equations=list()),..
+              doc=list())
+scs_m.objs(3)=scicos_block(..
+              gui="CSCOPXY",..
+              graphics=scicos_graphics(..
+                       orig=[160,0],..
+                       sz=[40,40],..
+                       flip=%t,..
+                       theta=0,..
+                       exprs=["1";"4";"1";"-1";"[]";"[600;400]";"-15";"15";"-15";"15";"2"],..
+                       pin=[0;0],..
+                       pout=[],..
+                       pein=0,..
+                       peout=[],..
+                       gr_i=list(..
+                       ["thick=xget(''thickness'');xset(''thickness'',2);";
+                       "t=(0:0.2:2*%pi)'';";
+                       "xx=orig(1)+(1/5+(cos(3*t)+1)*3/10)*sz(1);";
+                       "yy=orig(2)+(1/4.3+(sin(t+1)+1)*3/10)*sz(2);";
+                       "xpoly(xx,yy,''lines'');";
+                       "xset(''thickness'',thick)"],8),..
+                       id="",..
+                       in_implicit=["E";"E"],..
+                       out_implicit=[]),..
+              model=scicos_model(..
+                       sim=list("cscopxy",4),..
+                       in=[1;1],..
+                       in2=[1;1],..
+                       intyp=[1;1],..
+                       out=[],..
+                       out2=[],..
+                       outtyp=1,..
+                       evtin=1,..
+                       evtout=[],..
+                       state=[],..
+                       dstate=[],..
+                       odstate=list(),..
+                       rpar=[-15;15;-15;15],..
+                       ipar=[-1;1;2;4;1;1;-1;-1;600;400;1],..
+                       opar=list(),..
+                       blocktype="d",..
+                       firing=[],..
+                       dep_ut=[%f,%f],..
+                       label="",..
+                       nzcross=0,..
+                       nmode=0,..
+                       equations=list()),..
+              doc=list())
+scs_m.objs(4)=scicos_block(..
+              gui="WRITEC_f",..
+              graphics=scicos_graphics(..
+                       orig=[230,0],..
+                       sz=[60,40],..
+                       flip=%t,..
+                       theta=0,..
+                       exprs=["1";"foo";"c  ";"2";"0"],..
+                       pin=0,..
+                       pout=[],..
+                       pein=0,..
+                       peout=[],..
+                       gr_i=list(..
+                       ["txt=[''write to'';''C binary file''];";
+                       "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"],8),..
+                       id="",..
+                       in_implicit="E",..
+                       out_implicit=[]),..
+              model=scicos_model(..
+                       sim=list("writec",2),..
+                       in=1,..
+                       in2=[],..
+                       intyp=1,..
+                       out=[],..
+                       out2=[],..
+                       outtyp=1,..
+                       evtin=1,..
+                       evtout=[],..
+                       state=[],..
+                       dstate=[-1;0;0;0;0;0],..
+                       odstate=list(),..
+                       rpar=[],..
+                       ipar=[3;12;40;40;2;0;15;24;24],..
+                       opar=list(),..
+                       blocktype="d",..
+                       firing=[],..
+                       dep_ut=[%t,%f],..
+                       label="",..
+                       nzcross=0,..
+                       nmode=0,..
+                       equations=list()),..
+              doc=list())
+scs_m.objs(5)=scicos_block(..
+              gui="CANIMXY",..
+              graphics=scicos_graphics(..
+                       orig=[320,0],..
+                       sz=[40,40],..
+                       flip=%t,..
+                       theta=0,..
+                       exprs=["1";"-4";"1";"-1";"[]";"[]";"-15";"15";"-15";"15";"2"],..
+                       pin=[0;0],..
+                       pout=[],..
+                       pein=0,..
+                       peout=[],..
+                       gr_i=list(..
+                       ["thick=xget(''thickness'');xset(''thickness'',2);";
+                       "t=(0:0.3:2*%pi)'';";
+                       "xx=orig(1)+(1/5+(cos(2.2*t)+1)*3/10)*sz(1);";
+                       "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);";
+                       "xpoly(xx,yy,''lines'');";
+                       "xset(''thickness'',thick);"],8),..
+                       id="",..
+                       in_implicit=["E";"E"],..
+                       out_implicit=[]),..
+              model=scicos_model(..
+                       sim=list("canimxy",4),..
+                       in=[1;1],..
+                       in2=[1;1],..
+                       intyp=[1;1],..
+                       out=[],..
+                       out2=[],..
+                       outtyp=1,..
+                       evtin=1,..
+                       evtout=[],..
+                       state=[],..
+                       dstate=[],..
+                       odstate=list(),..
+                       rpar=[-15;15;-15;15],..
+                       ipar=[-1;1;2;-4;1;0;-1;-1;-1;-1;1],..
+                       opar=list(),..
+                       blocktype="d",..
+                       firing=[],..
+                       dep_ut=[%f,%f],..
+                       label="",..
+                       nzcross=0,..
+                       nmode=0,..
+                       equations=list()),..
+              doc=list())
+scs_m.objs(6)=scicos_block(..
+              gui="CSCOPE",..
+              graphics=scicos_graphics(..
+                       orig=[390,0],..
+                       sz=[40,40],..
+                       flip=%t,..
+                       theta=0,..
+                       exprs=["1 3 5 7 9 11 13 15";"-1";"[]";"[600;400]";"-15";"15";"30";"20";"0";""],..
+                       pin=0,..
+                       pout=[],..
+                       pein=0,..
+                       peout=[],..
+                       gr_i=list(..
+                       ["thick=xget(''thickness'');xset(''thickness'',2);";
+                       "xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);";
+                       "xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;";
+                       "orig(1)+(1-1/4)*sz(1),orig(1)+sz(1)/5];";
+                       "yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;";
+                       "orig(2)+sz(2)/5,orig(2)+(1-1/3)*sz(2)];";
+                       "xarrows(xx,yy);";
+                       "t=(0:0.3:2*%pi)'';";
+                       "xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);";
+                       "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);";
+                       "xpoly(xx,yy,''lines'');";
+                       "xset(''thickness'',thick)"],8),..
+                       id="",..
+                       in_implicit="E",..
+                       out_implicit=[]),..
+              model=scicos_model(..
+                       sim=list("cscope",4),..
+                       in=-1,..
+                       in2=1,..
+                       intyp=1,..
+                       out=[],..
+                       out2=[],..
+                       outtyp=1,..
+                       evtin=1,..
+                       evtout=[],..
+                       state=[],..
+                       dstate=[],..
+                       odstate=list(),..
+                       rpar=[0;-15;15;30],..
+                       ipar=[-1;1;20;1;3;5;7;9;11;13;15;-1;-1;600;400],..
+                       opar=list(),..
+                       blocktype="c",..
+                       firing=[],..
+                       dep_ut=[%t,%f],..
+                       label="",..
+                       nzcross=0,..
+                       nmode=0,..
+                       equations=list()),..
+              doc=list())
+scs_m.objs(7)=scicos_block(..
+              gui="OUTIMPL_f",..
+              graphics=scicos_graphics(..
+                       orig=[0,70],..
+                       sz=[20,20],..
+                       flip=%t,..
+                       theta=0,..
+                       exprs="1",..
+                       pin=0,..
+                       pout=[],..
+                       pein=[],..
+                       peout=[],..
+                       gr_i=list("prt=string(model.ipar);xstringb(orig(1),orig(2),prt,sz(1),sz(2))",8),..
+                       id="",..
+                       in_implicit="I",..
+                       out_implicit=[]),..
+              model=scicos_model(..
+                       sim="outimpl",..
+                       in=-1,..
+                       in2=1,..
+                       intyp=1,..
+                       out=[],..
+                       out2=[],..
+                       outtyp=1,..
+                       evtin=[],..
+                       evtout=[],..
+                       state=[],..
+                       dstate=[],..
+                       odstate=list(),..
+                       rpar=[],..
+                       ipar=1,..
+                       opar=list(),..
+                       blocktype="c",..
+                       firing=[],..
+                       dep_ut=[%f,%f],..
+                       label="",..
+                       nzcross=0,..
+                       nmode=0,..
+                       equations=tlist(["modelica","model","inputs","outputs","parameters"],"PORT","n",[],..
+                       list([],list()))),..
+              doc=list())
+scs_m.objs(8)=scicos_block(..
+              gui="CLKOUTV_f",..
+              graphics=scicos_graphics(..
+                       orig=[50,70],..
+                       sz=[20,30],..
+                       flip=%t,..
+                       theta=0,..
+                       exprs="1",..
+                       pin=[],..
+                       pout=[],..
+                       pein=0,..
+                       peout=[],..
+                       gr_i=list(" ",8),..
+                       id="",..
+                       in_implicit=[],..
+                       out_implicit=[]),..
+              model=scicos_model(..
+                       sim="output",..
+                       in=[],..
+                       in2=[],..
+                       intyp=1,..
+                       out=[],..
+                       out2=[],..
+                       outtyp=1,..
+                       evtin=1,..
+                       evtout=[],..
+                       state=[],..
+                       dstate=[],..
+                       odstate=list(),..
+                       rpar=[],..
+                       ipar=1,..
+                       opar=list(),..
+                       blocktype="d",..
+                       firing=[],..
+                       dep_ut=[%f,%f],..
+                       label="",..
+                       nzcross=0,..
+                       nmode=0,..
+                       equations=list()),..
+              doc=list())
+scs_m.objs(9)=scicos_block(..
+              gui="CEVENTSCOPE",..
+              graphics=scicos_graphics(..
+                       orig=[100,70],..
+                       sz=[40,40],..
+                       flip=%t,..
+                       theta=0,..
+                       exprs=["1";"1";"-1";"[]";"[600;400]";"30"],..
+                       pin=[],..
+                       pout=[],..
+                       pein=0,..
+                       peout=[],..
+                       gr_i=list(..
+                       ["thick=xget(''thickness'');xset(''thickness'',2);";
+                       "xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);";
+                       "xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;";
+                       "orig(1)+(1-1/5)*sz(1),orig(1)+sz(1)/5];";
+                       "yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;";
+                       "orig(2)+sz(2)/5,orig(2)+(1-1/5)*sz(2)];";
+                       "xarrows(xx,yy);";
+                       "t=(0:0.3:2*%pi)'';";
+                       "xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);";
+                       "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);";
+                       "xpoly(xx,yy,''lines'');";
+                       "xset(''thickness'',thick);"],8),..
+                       id="",..
+                       in_implicit=[],..
+                       out_implicit=[]),..
+              model=scicos_model(..
+                       sim=list("cevscpe",4),..
+                       in=[],..
+                       in2=[],..
+                       intyp=1,..
+                       out=[],..
+                       out2=[],..
+                       outtyp=1,..
+                       evtin=1,..
+                       evtout=[],..
+                       state=[],..
+                       dstate=[],..
+                       odstate=list(),..
+                       rpar=30,..
+                       ipar=[-1;1;1;-1;-1;600;400],..
+                       opar=list(),..
+                       blocktype="d",..
+                       firing=[],..
+                       dep_ut=[%f,%f],..
+                       label="",..
+                       nzcross=0,..
+                       nmode=0,..
+                       equations=list()),..
+              doc=list())
+scs_m.objs(10)=scicos_block(..
+               gui="OUT_f",..
+               graphics=scicos_graphics(..
+                        orig=[170,70],..
+                        sz=[20,20],..
+                        flip=%t,..
+                        theta=0,..
+                        exprs="1",..
+                        pin=0,..
+                        pout=[],..
+                        pein=[],..
+                        peout=[],..
+                        gr_i=list(" ",8),..
+                        id="",..
+                        in_implicit="E",..
+                        out_implicit=[]),..
+               model=scicos_model(..
+                        sim="output",..
+                        in=-1,..
+                        in2=-2,..
+                        intyp=-1,..
+                        out=[],..
+                        out2=[],..
+                        outtyp=1,..
+                        evtin=[],..
+                        evtout=[],..
+                        state=[],..
+                        dstate=[],..
+                        odstate=list(),..
+                        rpar=[],..
+                        ipar=1,..
+                        opar=list(),..
+                        blocktype="c",..
+                        firing=[],..
+                        dep_ut=[%f,%f],..
+                        label="",..
+                        nzcross=0,..
+                        nmode=0,..
+                        equations=list()),..
+               doc=list())
+scs_m.objs(11)=scicos_block(..
+               gui="WFILE_f",..
+               graphics=scicos_graphics(..
+                        orig=[220,70],..
+                        sz=[60,40],..
+                        flip=%t,..
+                        theta=0,..
+                        exprs=["1";"foo";"(7(e10.3,1x))";"2"],..
+                        pin=0,..
+                        pout=[],..
+                        pein=0,..
+                        peout=[],..
+                        gr_i=list(..
+                        ["txt=[''write to'';''output file''];";
+                        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"],8),..
+                        id="",..
+                        in_implicit="E",..
+                        out_implicit=[]),..
+               model=scicos_model(..
+                        sim="writef",..
+                        in=1,..
+                        in2=[],..
+                        intyp=1,..
+                        out=[],..
+                        out2=[],..
+                        outtyp=1,..
+                        evtin=1,..
+                        evtout=[],..
+                        state=[],..
+                        dstate=[-1;0;0;0;0;0],..
+                        odstate=list(),..
+                        rpar=[],..
+                        ipar=[3;13;0;2;15;24;24;41;7;41;14;1;0;51;3;52;1;33;42;42],..
+                        opar=list(),..
+                        blocktype="d",..
+                        firing=[],..
+                        dep_ut=[%t,%f],..
+                        label="",..
+                        nzcross=0,..
+                        nmode=0,..
+                        equations=list()),..
+               doc=list())
+scs_m.objs(12)=scicos_block(..
+               gui="CFSCOPE",..
+               graphics=scicos_graphics(..
+                        orig=[310,70],..
+                        sz=[40,40],..
+                        flip=%t,..
+                        theta=0,..
+                        exprs=["1 3 5 7 9 11 13 15";"-1";"[]";"[600;400]";"-15";"15";"30";"2";"1"],..
+                        pin=[],..
+                        pout=[],..
+                        pein=0,..
+                        peout=[],..
+                        gr_i=list(..
+                        ["thick=xget(''thickness'');xset(''thickness'',2);";
+                        "xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);";
+                        "xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;";
+                        "orig(1)+(1-1/4)*sz(1),orig(1)+sz(1)/5];";
+                        "yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;";
+                        "orig(2)+sz(2)/5,orig(2)+(1-1/3)*sz(2)];";
+                        "xarrows(xx,yy);";
+                        "t=(0:0.3:2*%pi)'';";
+                        "xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);";
+                        "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);";
+                        "xpoly(xx,yy,''lines'');";
+                        "xset(''thickness'',thick)"],8),..
+                        id="",..
+                        in_implicit=[],..
+                        out_implicit=[]),..
+               model=scicos_model(..
+                        sim=list("cfscope",4),..
+                        in=[],..
+                        in2=[],..
+                        intyp=1,..
+                        out=[],..
+                        out2=[],..
+                        outtyp=1,..
+                        evtin=1,..
+                        evtout=[],..
+                        state=[],..
+                        dstate=[],..
+                        odstate=list(),..
+                        rpar=[0;-15;15;30],..
+                        ipar=[-1;1;2;1;3;5;7;9;11;13;15;-1;-1;600;400;1;1],..
+                        opar=list(),..
+                        blocktype="c",..
+                        firing=[],..
+                        dep_ut=[%t,%f],..
+                        label="",..
+                        nzcross=0,..
+                        nmode=0,..
+                        equations=list()),..
+               doc=list())
+scs_m.objs(13)=scicos_block(..
+               gui="WRITEAU_f",..
+               graphics=scicos_graphics(..
+                        orig=[380,70],..
+                        sz=[60,40],..
+                        flip=%t,..
+                        theta=0,..
+                        exprs=["2";"0"],..
+                        pin=0,..
+                        pout=[],..
+                        pein=0,..
+                        peout=[],..
+                        gr_i=list(..
+                        ["txt=[''write AU to'';''/dev/audio''];";
+                        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"],8),..
+                        id="",..
+                        in_implicit="E",..
+                        out_implicit=[]),..
+               model=scicos_model(..
+                        sim=list("writeau",2),..
+                        in=1,..
+                        in2=[],..
+                        intyp=1,..
+                        out=[],..
+                        out2=[],..
+                        outtyp=1,..
+                        evtin=1,..
+                        evtout=[],..
+                        state=[],..
+                        dstate=[-1;0;0;0;0;0],..
+                        odstate=list(),..
+                        rpar=[],..
+                        ipar=[10;30;12;40;2;0;48;13;14;31;48;10;30;13;18;24],..
+                        opar=list(),..
+                        blocktype="d",..
+                        firing=[],..
+                        dep_ut=[%t,%f],..
+                        label="",..
+                        nzcross=0,..
+                        nmode=0,..
+                        equations=list()),..
+               doc=list())
+scs_m.objs(14)=scicos_block(..
+               gui="CSCOPXY3D",..
+               graphics=scicos_graphics(..
+                        orig=[0,140],..
+                        sz=[40,40],..
+                        flip=%t,..
+                        theta=0,..
+                        exprs=["1";
+                        "1 2 3 4 5 6 7 13";
+                        "1 1 1 1 1 1 1 1";
+                        "-1";
+                        "[]";
+                        "[600;400]";
+                        "-15 15";
+                        "-15 15";
+                        "-15 15";
+                        "50 280";
+                        "2"],..
+                        pin=[0;0;0],..
+                        pout=[],..
+                        pein=0,..
+                        peout=[],..
+                        gr_i=list(..
+                        ["thick=xget(''thickness'');xset(''thickness'',2);";
+                        "t=(0:0.2:2*%pi)'';";
+                        "xx=orig(1)+(1/5+(cos(3*t)+1)*3/10)*sz(1);";
+                        "yy=orig(2)+(1/4.3+(sin(t+1)+1)*3/10)*sz(2);";
+                        "xpoly(xx,yy,''lines'');";
+                        "xset(''thickness'',thick)"],8),..
+                        id="",..
+                        in_implicit=["E";"E";"E"],..
+                        out_implicit=[]),..
+               model=scicos_model(..
+                        sim=list("cscopxy3d",4),..
+                        in=[1;1;1],..
+                        in2=[1;1;1],..
+                        intyp=[1;1;1],..
+                        out=[],..
+                        out2=[],..
+                        outtyp=1,..
+                        evtin=1,..
+                        evtout=[],..
+                        state=[],..
+                        dstate=[],..
+                        odstate=list(),..
+                        rpar=[-15;15;-15;15;-15;15;50;280],..
+                        ipar=[-1;8;2;1;2;3;4;5;6;7;13;1;1;1;1;1;1;1;1;8;-1;-1;600;400;1],..
+                        opar=list(),..
+                        blocktype="d",..
+                        firing=[],..
+                        dep_ut=[%f,%f],..
+                        label="",..
+                        nzcross=0,..
+                        nmode=0,..
+                        equations=list()),..
+               doc=list())
+scs_m.objs(15)=scicos_block(..
+               gui="CANIMXY3D",..
+               graphics=scicos_graphics(..
+                        orig=[70,140],..
+                        sz=[40,40],..
+                        flip=%t,..
+                        theta=0,..
+                        exprs=["1";
+                        "1 2 3 4 5 6 7 13";
+                        "1 1 1 1 1 1 1 1";
+                        "-1";
+                        "[]";
+                        "[]";
+                        "-15 15";
+                        "-15 15";
+                        "-15 15";
+                        "50 280";
+                        "2"],..
+                        pin=[0;0;0],..
+                        pout=[],..
+                        pein=0,..
+                        peout=[],..
+                        gr_i=list(..
+                        ["thick=xget(''thickness'');xset(''thickness'',2);";
+                        "t=(0:0.3:2*%pi)'';";
+                        "xx=orig(1)+(1/5+(cos(2.2*t)+1)*3/10)*sz(1);";
+                        "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);";
+                        "xpoly(xx,yy,''lines'');";
+                        "xset(''thickness'',thick);"],8),..
+                        id="",..
+                        in_implicit=["E";"E";"E"],..
+                        out_implicit=[]),..
+               model=scicos_model(..
+                        sim=list("canimxy3d",4),..
+                        in=[1;1;1],..
+                        in2=[1;1;1],..
+                        intyp=[1;1;1],..
+                        out=[],..
+                        out2=[],..
+                        outtyp=1,..
+                        evtin=1,..
+                        evtout=[],..
+                        state=[],..
+                        dstate=[],..
+                        odstate=list(),..
+                        rpar=[-15;15;-15;15;-15;15;50;280],..
+                        ipar=[-1;8;2;1;2;3;4;5;6;7;13;1;1;1;1;1;1;1;1;8;-1;-1;-1;-1;1],..
+                        opar=list(),..
+                        blocktype="d",..
+                        firing=[],..
+                        dep_ut=[%f,%f],..
+                        label="",..
+                        nzcross=0,..
+                        nmode=0,..
+                        equations=list()),..
+               doc=list())
+scs_m.objs(16)=scicos_block(..
+               gui="CMATVIEW",..
+               graphics=scicos_graphics(..
+                        orig=[140,140],..
+                        sz=[40,40],..
+                        flip=%t,..
+                        theta=0,..
+                        exprs=["jetcolormap(25)";"0";"100"],..
+                        pin=0,..
+                        pout=[],..
+                        pein=0,..
+                        peout=[],..
+                        gr_i=list("xstringb(orig(1),orig(2),''Mat. View'',sz(1),sz(2),''fill'')",8),..
+                        id="",..
+                        in_implicit="E",..
+                        out_implicit=[]),..
+               model=scicos_model(..
+                        sim=list("cmatview",4),..
+                        in=-1,..
+                        in2=-2,..
+                        intyp=1,..
+                        out=[],..
+                        out2=[],..
+                        outtyp=1,..
+                        evtin=1,..
+                        evtout=[],..
+                        state=[],..
+                        dstate=[],..
+                        odstate=list(),..
+                        rpar=[0.24;1;0;0;0;0;0;0;0;0;0;0.02;0.18;0.34;0.5;0.66;0.82;0.98;1;1;1;1;1;1;0.9;
+                        0.74;0.58;0;0;0;0.06;0.22;0.38;0.54;0.7;0.86;1;1;1;1;1;1;1;0.86;0.7;0.54;0.38;
+                        0.22;0.06;0;0;0;0.58;0.74;0.9;1;1;1;1;1;1;0.98;0.82;0.66;0.5;0.34;0.18;0.02;0;
+                        0;0;0;0;0;0;0;0],..
+                        ipar=[0;100;25],..
+                        opar=list(),..
+                        blocktype="c",..
+                        firing=[],..
+                        dep_ut=[%t,%f],..
+                        label="",..
+                        nzcross=0,..
+                        nmode=0,..
+                        equations=list()),..
+               doc=list())
+scs_m.objs(17)=scicos_block(..
+               gui="CMAT3D",..
+               graphics=scicos_graphics(..
+                        orig=[210,140],..
+                        sz=[40,40],..
+                        flip=%t,..
+                        theta=0,..
+                        exprs=["-1";"-1";"jetcolormap(25)";"0";"100"],..
+                        pin=0,..
+                        pout=[],..
+                        pein=0,..
+                        peout=[],..
+                        gr_i=list("xstringb(orig(1),orig(2),''Mat. 3D'',sz(1),sz(2),''fill'')",8),..
+                        id="",..
+                        in_implicit="E",..
+                        out_implicit=[]),..
+               model=scicos_model(..
+                        sim=list("cmat3d",4),..
+                        in=-1,..
+                        in2=-2,..
+                        intyp=1,..
+                        out=[],..
+                        out2=[],..
+                        outtyp=1,..
+                        evtin=1,..
+                        evtout=[],..
+                        state=[],..
+                        dstate=[],..
+                        odstate=list(),..
+                        rpar=[0;0;0;0;0;0;0;0;0;0.02;0.18;0.34;0.5;0.66;0.82;0.98;1;1;1;1;1;1;0.9;0.74;0.58;
+                        0;0;0;0.06;0.22;0.38;0.54;0.7;0.86;1;1;1;1;1;1;1;0.86;0.7;0.54;0.38;0.22;0.06;
+                        0;0;0;0.58;0.74;0.9;1;1;1;1;1;1;0.98;0.82;0.66;0.5;0.34;0.18;0.02;0;0;0;0;0;0;
+                        0;0;0;-1;-1],..
+                        ipar=[0;100;25;1;1],..
+                        opar=list(),..
+                        blocktype="c",..
+                        firing=[],..
+                        dep_ut=[%t,%f],..
+                        label="",..
+                        nzcross=0,..
+                        nmode=0,..
+                        equations=list()),..
+               doc=list())
+scs_m.objs(18)=scicos_block(..
+               gui="TOWS_c",..
+               graphics=scicos_graphics(..
+                        orig=[280,140],..
+                        sz=[70,40],..
+                        flip=%t,..
+                        theta=0,..
+                        exprs=["128","A","0"],..
+                        pin=0,..
+                        pout=[],..
+                        pein=0,..
+                        peout=[],..
+                        gr_i=list(..
+                        ["txt=[''To workspace''];";"xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"],..
+                        8),..
+                        id="A",..
+                        in_implicit="E",..
+                        out_implicit=[]),..
+               model=scicos_model(..
+                        sim=list("tows_c",4),..
+                        in=-1,..
+                        in2=-2,..
+                        intyp=-1,..
+                        out=[],..
+                        out2=[],..
+                        outtyp=1,..
+                        evtin=1,..
+                        evtout=[],..
+                        state=[],..
+                        dstate=[],..
+                        odstate=list(),..
+                        rpar=[],..
+                        ipar=[128;1;-10],..
+                        opar=list(),..
+                        blocktype="d",..
+                        firing=[],..
+                        dep_ut=[%f,%f],..
+                        label="",..
+                        nzcross=0,..
+                        nmode=0,..
+                        equations=list()),..
+               doc=list())
diff --git a/modules/scicos/macros/scicos_scicos/adjust.bin b/modules/scicos/macros/scicos_scicos/adjust.bin
new file mode 100755
index 000000000..c8b998a2c
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/adjust.bin
diff --git a/modules/scicos/macros/scicos_scicos/adjust.sci b/modules/scicos/macros/scicos_scicos/adjust.sci
new file mode 100755
index 000000000..588ac5b9f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/adjust.sci
@@ -0,0 +1,465 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Alan Layec <alan.layec@inria.fr>
+//                      - Fady Nassif <fady.nassif@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [ok,bllst]=adjust(bllst,inpptr,outptr,inplnk,outlnk)
+    //
+    //adjust : a piece of the adjust_inout function.
+    //         Only one pass -see c_pass2.sci-
+    //
+    //
+    //in parameters  : bllst  : list of blocks
+    //                 inpptr : vector of regular input port number
+    //                          (of size nblk+1)
+    //                 outptr : vector of regular output port number
+    //                          (of size nblk+1)
+    //                 inplnk : vector of link number connected to regular input port
+    //                          (of size max(inpptr)-1)
+    //                 outlnk : vector of link number connected to regular output port
+    //                          (of size max(outptr)-1)
+    //
+    //out parameters : ok : a boolean flag to known if adjust_inout have
+    //                     succeeded to resolve the in/out port size
+    //                     - ok = %t : all size have been resolved in bllst
+    //                     - ok = %f : problem in size adjustement
+    //                 bllst : modified list of blocks
+    //
+    //18/05/06, Alan  : improvement in order to take into
+    //account two dimensional ports size.
+    //
+    //28/12/06, Alan : type for source port and target port must
+    //                 be the same.
+    //
+    //04/01/07, Fady :Can test the case of negatives equals target's dimensions.
+    //
+    //10/05/07, Alan : - if-then-else event-select case
+
+
+
+    //Adjust in2/out2, inttyp/outtyp
+    //in accordance to in/out in bllst
+    [ko,bllst]=adjust_in2out2(bllst);
+    if ~ko then ok=%f,return, end //if adjust_in2out2 failed then exit
+    //adjust_inout with flag ok=%f
+    //
+    [outoin,outoinptr]=connmat(inpptr,outptr,inplnk,outlnk)
+    for i=1:length(bllst)
+        if size(bllst(i).in,1)<>size(bllst(i).intyp,2) then
+            bllst(i).intyp=bllst(i).intyp(1)*ones(size(bllst(i).in,1),1);
+        end
+        if size(bllst(i).out,1)<>size(bllst(i).outtyp,2) then
+            bllst(i).outtyp=bllst(i).outtyp(1)*ones(size(bllst(i).out,1),1);
+        end
+    end
+    //loop on number of block
+    for hh=1:length(bllst)
+        ok=%t
+        for blkout=1:length(bllst) //second loop on number of block
+            for portout=1:outptr(blkout+1)-outptr(blkout) //loop on number of regular
+                //output port
+                jj=outptr(blkout)+portout-1 //get current number of output port
+
+                if [outoinptr(jj):outoinptr(jj+1)-1]<>[] then
+                    for kk=outoinptr(jj):outoinptr(jj+1)-1 //loop on
+                        blkin=outoin(kk,1)  //
+                        portin=outoin(kk,2) //
+
+                        //nnin/nnout are the size (two dimensions) of the
+                        //target port and the source port of the observed link
+                        //before adjust
+                        nnout(1,1)=bllst(blkout).out(portout)
+                        nnout(1,2)=bllst(blkout).out2(portout)
+                        nnin(1,1)=bllst(blkin).in(portin)
+                        nnin(1,2)=bllst(blkin).in2(portin)
+                        //intyp/outtyp are the type of the
+                        //target port and the source port of the observed link
+                        intyp=bllst(blkin).intyp(portin)
+                        outtyp=bllst(blkout).outtyp(portout)
+
+                        //check intyp outtyp
+                        if(intyp>0 & outtyp>0) then
+                            if intyp<>outtyp then
+                                if (intyp==1 & outtyp==2) then
+                                    bllst(blkin).intyp(portin)=2;
+                                elseif (intyp==2 & outtyp==1) then
+                                    bllst(blkout).outtyp(portout)=2;
+                                else
+                                    bad_connection(corinv(blkout),portout,..
+                                    nnout,outtyp,..
+                                    corinv(blkin),portin,..
+                                    nnin,intyp,1)
+                                    ok=%f;
+                                    return
+                                end
+                            end
+                        elseif(outtyp>0&intyp<0) then
+                            ww=find(bllst(blkin).intyp==intyp)
+                            bllst(blkin).intyp(ww)=outtyp
+                            ww=find(bllst(blkin).outtyp==intyp)
+                            bllst(blkin).outtyp(ww)=outtyp
+                        elseif(outtyp<0&intyp>0) then
+                            ww=find(bllst(blkout).outtyp==outtyp)
+                            bllst(blkout).outtyp(ww)=intyp
+                            ww=find(bllst(blkout).intyp==outtyp)
+                            bllst(blkout).intyp(ww)=intyp
+                        else
+                            ok=%f
+                        end
+
+                        //loop on the two dimensions of source/target port
+                        for ndim=1:2
+                            //nin/nout are the size (two dimensions) of the
+                            //target port and the source port of the observed link
+                            nout(1,1)=bllst(blkout).out(portout)
+                            nout(1,2)=bllst(blkout).out2(portout)
+                            nin(1,1)=bllst(blkin).in(portin)
+                            nin(1,2)=bllst(blkin).in2(portin)
+
+                            //first case : dimension of source and
+                            //             target ports are explicitly informed
+                            //             informed with positive size
+                            if (nout(1,ndim)>0&nin(1,ndim)>0) then
+                                //if dimension of source and target port doesn't match
+                                //then call bad_connection, set flag ok to false and exit
+                                if nin(1,ndim)<>nout(1,ndim) then
+                                    bad_connection(corinv(blkout),portout,..
+                                    nnout,outtyp,..
+                                    corinv(blkin),portin,nnin,intyp)
+                                    ok=%f;return
+                                end
+
+                                //second case : dimension of source port is
+                                //              positive and dimension of
+                                //              target port is negative
+                            elseif (nout(1,ndim)>0&nin(1,ndim)<0) then
+                                //find vector of input ports of target block with
+                                //first/second dimension equal to size nin(1,ndim)
+                                //and assign it to nout(1,ndim)
+                                ww=find(bllst(blkin).in==nin(1,ndim))
+                                if ww<>[] then
+                                    bllst(blkin).in(ww)=nout(1,ndim)
+                                end
+                                ww=find(bllst(blkin).in2==nin(1,ndim))
+                                if ww<>[] then
+                                    bllst(blkin).in2(ww)=nout(1,ndim)
+                                end
+                                //find vector of output ports of target block with
+                                //first/second dimension equal to size nin(1,ndim)
+                                //and assign it to nout(1,ndim)
+                                ww=find(bllst(blkin).out==nin(1,ndim))
+                                if ww<>[] then
+                                    bllst(blkin).out(ww)=nout(1,ndim)
+                                end
+                                ww=find(bllst(blkin).out2==nin(1,ndim))
+                                if ww<>[] then
+                                    bllst(blkin).out2(ww)=nout(1,ndim)
+                                end
+
+
+                                //third case : dimension of source port is
+                                //             negative and dimension of
+                                //             target port is positive
+                            elseif (nout(1,ndim)<0&nin(1,ndim)>0) then
+                                //find vector of output ports of source block with
+                                //first/second dimension equal to size nout(1,ndim)
+                                //and assign it to nin(1,ndim)
+                                ww=find(bllst(blkout).out==nout(1,ndim))
+                                if ww<>[] then
+                                    bllst(blkout).out(ww)=nin(1,ndim)
+                                end
+                                ww=find(bllst(blkout).out2==nout(1,ndim))
+                                if ww<>[] then
+                                    bllst(blkout).out2(ww)=nin(1,ndim)
+                                end
+                                //find vector of input ports of source block with
+                                //first/second dimension equal to size nout(1,ndim)
+                                //and assign it to nin(1,ndim)
+                                ww=find(bllst(blkout).in==nout(1,ndim))
+                                if ww<>[] then
+                                    bllst(blkout).in(ww)=nin(1,ndim)
+                                end
+                                ww=find(bllst(blkout).in2==nout(1,ndim))
+                                if ww<>[] then
+                                    bllst(blkout).in2(ww)=nin(1,ndim)
+                                end
+
+
+                                //fourth case : a dimension of source port is
+                                //              null
+                            elseif (nout(1,ndim)==0) then
+                                //set ww to be the vector of size of the ndim
+                                //dimension of input port of the source block
+                                if ndim==1 then
+                                    ww=bllst(blkout).in(:)
+                                elseif ndim==2 then
+                                    ww=bllst(blkout).in2(:)
+                                end
+
+                                //test if all size of the ndim dimension of input
+                                //port of the source block is positive
+                                if min(ww)>0 then
+
+                                    //test if the dimension of the target port
+                                    //is positive
+                                    if nin(1,ndim)>0 then
+
+                                        //if the sum of the size of the ndim dimension of the input
+                                        //port of the source block is equal to the size of the ndim dimension
+                                        //of the target port, then the size of the ndim dimension of the source
+                                        //port is equal to the size of ndim dimension of the target port
+                                        if sum(ww)==nin(1,ndim) then
+                                            if ndim==1 then
+                                                bllst(blkout).out(portout)=nin(1,ndim)
+                                            elseif ndim==2 then
+                                                bllst(blkout).out2(portout)=nin(1,ndim)
+                                            end
+                                            //else call bad_connection, set flag ok to false and exit
+                                        else
+                                            bad_connection(corinv(blkout),0,0,1,-1,0,0,1)
+                                            ok=%f;return
+                                        end
+
+                                        //if the ndim dimension of the target port is negative
+                                        //then the size of the ndim dimension of the source port
+                                        //is equal to the sum of the size of the ndim dimension
+                                        //of input ports of source block, and flag ok is set to false
+                                    else
+                                        if ndim==1 then
+                                            bllst(blkout).out(portout)=sum(ww)
+                                        elseif ndim==2 then
+                                            bllst(blkout).out2(portout)=sum(ww)
+                                        end
+                                        ok=%f
+                                    end
+
+                                else
+                                    //set nww to be the vector of all negative size of input ports
+                                    //of the source block
+                                    nww=ww(find(ww<0))
+
+                                    //if all negative size have same size and if size of the
+                                    //ndim dimension of target port is positive then assign
+                                    //size of the ndim dimension of the source port to nin(1,ndim)
+                                    if norm(nww-nww(1),1)==0 & nin(1,ndim)>0 then
+                                        if ndim==1 then
+                                            bllst(blkout).out(portout)=nin(1,ndim)
+                                        elseif ndim==2 then
+                                            bllst(blkout).out2(portout)=nin(1,ndim)
+                                        end
+
+                                        //compute a size to be the difference between the size
+                                        //of the ndim dimension of target block and sum of positive
+                                        //size of input ports of source block divided by the number
+                                        //of input ports of source block with same negative size
+                                        k=(nin(1,ndim)-sum(ww(find(ww>0))))/size(nww,"*")
+
+                                        //if this size is a positive integer then assign it
+                                        //to the size of the ndim dimension of input ports of the
+                                        //source block which have negative size
+                                        if k==int(k)&k>0 then
+                                            if ndim==1 then
+                                                bllst(blkout).in(find(ww<0))=k
+                                            elseif ndim==2 then
+                                                bllst(blkout).in2(find(ww<0))=k
+                                            end
+
+                                            //else call bad_connection, set flag ok to false and exit
+                                        else
+                                            bad_connection(corinv(blkout),0,0,1,-1,0,0,1)
+                                            ok=%f;return
+                                        end
+
+                                        //set flag ok to false
+                                    else
+                                        ok=%f
+                                    end
+
+                                end
+
+                                //fifth case : a dimension of target port is
+                                //             null
+                            elseif (nin(1,ndim)==0) then
+                                //set ww to be the vector of size of the ndim
+                                //dimension of output port of the target block
+                                if ndim==1 then
+                                    ww=bllst(blkin).out(:)
+                                elseif ndim==2 then
+                                    ww=bllst(blkin).out2(:)
+                                end
+
+                                //test if all size of the ndim dimension of output
+                                //port of the target block is positive
+                                if min(ww)>0 then
+                                    //test if the dimension of the source port
+                                    //is positive
+                                    if nout(1,ndim)>0 then
+
+                                        //if the sum of the size of the ndim dimension of the output
+                                        //port of the target block is equal to the size of the ndim dimension
+                                        //of the source port, then the size of the ndim dimension of the target
+                                        //port is equal to nout(1,ndim)
+                                        if sum(ww)==nout(1,ndim) then
+                                            if ndim==1 then
+                                                bllst(blkin).in(portin)=nout(1,ndim)
+                                            elseif ndim==1 then
+                                                bllst(blkin).in2(portin)=nout(1,ndim)
+                                            end
+                                            //else call bad_connection, set flag ok to false and exit
+                                        else
+                                            bad_connection(corinv(blkin),0,0,1,-1,0,0,1)
+                                            ok=%f;return
+                                        end
+                                    else
+                                        //if the ndim dimension of the source port is negative
+                                        //then the size of the ndim dimension of the target port
+                                        //is equal to the sum of the size of the ndim dimension
+                                        //of output ports of target block, and flag ok is set to false
+                                        if ndim==1 then
+                                            bllst(blkin).in(portin)=sum(ww)
+                                        elseif ndim==2 then
+                                            bllst(blkin).in2(portin)=sum(ww)
+                                        end
+                                        ok=%f
+                                    end
+
+                                else
+                                    //set nww to be the vector of all negative size of output ports
+                                    //of the target block
+                                    nww=ww(find(ww<0))
+
+                                    //if all negative size have same size and if size of the
+                                    //ndim dimension of the source port is positive then assign
+                                    //size of the ndim dimension of the target port to nout(1,ndim)
+                                    if norm(nww-nww(1),1)==0 & nout(1,ndim)>0 then
+                                        if ndim==1 then
+                                            bllst(blkin).in(portin)=nout(1,ndim)
+                                        elseif ndim==2 then
+                                            bllst(blkin).in2(portin)=nout(1,ndim)
+                                        end
+
+                                        //compute a size to be the difference between the size
+                                        //of the ndim dimension of the source block and sum of positive
+                                        //size of output ports of the target block divided by the number
+                                        //of output ports of target block with same negative size
+                                        k=(nout(1,ndim)-sum(ww(find(ww>0))))/size(nww,"*")
+
+                                        //if this size is a positive integer then assign it
+                                        //to the size of the ndim dimension of output ports of the
+                                        //target block which have negative size
+                                        if k==int(k)&k>0 then
+                                            if ndim==1 then
+                                                bllst(blkin).out(find(ww<0))=k
+                                            elseif ndim==2 then
+                                                bllst(blkin).out2(find(ww<0))=k
+                                            end
+
+                                            //else call bad_connection, set flag ok to false and exit
+                                        else
+                                            bad_connection(corinv(blkin),0,0,1,-1,0,0,1)
+                                            ok=%f;return
+                                        end
+
+                                        //set flag ok to false
+                                    else
+                                        ok=%f
+                                    end
+                                end
+
+                                //sixth (& last) case : dimension of both source
+                                //                      and target port are negatives
+                            else
+                                ok=%f  //set flag ok to false
+                            end
+
+                        end
+                    end
+                else
+                    //there is no target port
+                    nout(1,1)=bllst(blkout).out(portout)
+                    nout(1,2)=bllst(blkout).out2(portout)
+                    //loop on the two dimensions of source port
+                    for ndim=1:2
+                        //a dimension of the source port is
+                        //             null
+                        if (nout(1,ndim)==0) then
+                            if ndim==1 then
+                                ww=bllst(blkout).in(:)
+                                if min(ww)>0 then
+                                    bllst(blkout).out(portout)=sum(ww)
+                                    ok=%f
+                                end
+                            elseif ndim==2 then
+                                ww=bllst(blkout).in2(:)
+                                if min(ww)>0 then
+                                    bllst(blkout).out2(portout)=sum(ww)
+                                    ok=%f
+                                end
+                            end
+                        end
+                    end
+                end
+            end
+        end
+
+        if ok then return, end //if ok then exit adjust
+    end
+    //if failed then display message and set flag ok to false
+    messagebox(["Not enough information to determine port sizes";
+    "Compile the diagram before running."],"modal");
+    ok=%f
+
+endfunction
+
+//connmat :
+//
+//in parameters  : inpptr : vector of regular input port number
+//                          (of size nblk+1)
+//                 outptr : vector of regular output port number
+//                          (of size nblk+1)
+//                 inplnk : vector of link number connected to regular input port
+//                          (of size max(inpptr)-1)
+//                 outlnk : vector of link number connected to regular output port
+//                          (of size max(outptr)-1)
+//
+//out parameters : outoin :
+//
+//                 outoinptr :
+//
+function [outoin,outoinptr]=connmat(inpptr,outptr,inplnk,outlnk)
+    outoin=[];outoinptr=1
+    for k=1:outptr($)-1
+        ii=[]
+        for j=outlnk(k)
+            ii=[ii;find(inplnk==j)]
+        end
+        outoini=[];jj=0
+        for j=ii
+            //         m=int32(max(find(inpptr<=int32(j))))
+            m=max(find(inpptr<=j))
+            n=j-inpptr(m)+1
+            outoini=[outoini;[m,n]]
+            jj=jj+1
+        end
+        outoinptr=[outoinptr;outoinptr($)+jj]
+        outoin=[outoin;outoini]
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/adjust_in2out2.bin b/modules/scicos/macros/scicos_scicos/adjust_in2out2.bin
new file mode 100755
index 000000000..91d9b5dd9
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/adjust_in2out2.bin
diff --git a/modules/scicos/macros/scicos_scicos/adjust_in2out2.sci b/modules/scicos/macros/scicos_scicos/adjust_in2out2.sci
new file mode 100755
index 000000000..46ba92b8c
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/adjust_in2out2.sci
@@ -0,0 +1,58 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [ok,bllst]=adjust_in2out2(bllst)
+    //adjust_in2out2
+    //Alan
+    //adjust in2,intyp,out2, outtyp in accordance to
+    //in out (for compatibility)
+    ok=%t
+    nblk=size(bllst);
+    //Check dimension of vectors in/in2,out/out2
+    //and intyp/outyp for each block
+    for i=1:nblk
+        //input port
+        sz_in=size(bllst(i).in,"*");
+        sz_in2=size(bllst(i).in2,"*");
+        sz_intyp=size(bllst(i).intyp,"*");
+        //adjust dimension of in2
+        if sz_in2<sz_in then
+            bllst(i).in2=[bllst(i).in2;ones(sz_in-sz_in2,1)]
+        end
+        //adjust dimension of intyp
+        if sz_intyp<sz_in then
+            bllst(i).intyp=[bllst(i).intyp;ones(sz_in-sz_intyp,1)]
+        end
+
+        //output port
+        sz_out=size(bllst(i).out,"*");
+        sz_out2=size(bllst(i).out2,"*");
+        sz_outtyp=size(bllst(i).outtyp,"*");
+        //adjust dimension of out2
+        if sz_out2<sz_out then
+            bllst(i).out2=[bllst(i).out2;ones(sz_out-sz_out2,1)]
+        end
+        //adjust dimension of outtyp
+        if sz_outtyp<sz_out then
+            bllst(i).outtyp=[bllst(i).outtyp;ones(sz_out-sz_outtyp,1)]
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/bad_connection.bin b/modules/scicos/macros/scicos_scicos/bad_connection.bin
new file mode 100755
index 000000000..2e0f608a5
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/bad_connection.bin
diff --git a/modules/scicos/macros/scicos_scicos/bad_connection.sci b/modules/scicos/macros/scicos_scicos/bad_connection.sci
new file mode 100755
index 000000000..baf83baad
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/bad_connection.sci
@@ -0,0 +1,131 @@
+//  Xcos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Alan Layec <alan.layec@inria.fr>
+//  Copyright (C) 2011 <bernard.dujardin@contrib.scilab.org>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function bad_connection(path_out,prt_out,nout,outtyp,path_in,prt_in,nin,intyp,typ)
+    // alert for badly connected blocks
+    // path_out : Path of the "from block" in scs_m
+    // path_in  : Path of the "to block" in scs_m
+    // Alan, 28/12/06 : added rhs parameter : outtyp/intyp and typ flag.
+    // typ : a flag. If not present or equal to zero then
+    //               display a message concerning size.
+    //               Else if equal to 1 then display a message
+    //               concerning type.
+    //!
+
+    if %scicos_debug_gr then
+        disp("bad_connection...")
+    end
+
+    rhs = argn(2) ;
+    if (rhs == 8) then typ=0, end
+
+    if type(path_out)==15 then //set of modelica blocks
+        // look for modelica bloc associated with prt_out
+        outports=list()
+        for b=path_out,
+            path=list();
+            for l=b(1:$-1),
+                path($+1)=l;path($+1)="model";path($+1)="rpar";path($+1)="objs";
+            end
+            path($+1)=b($);
+            if size(path)==1 then path=path(1),end
+            mb=scs_m.objs(path)
+            k=find(mb.graphics.out_implicit=="E")
+            for kk=k,outports($+1)=path,end
+        end
+        path_out=outports(prt_out)
+    end
+    if type(path_in)==15 then //set of modelica blocks
+        // look for modelica bloc associated with prt_in
+        inports=list()
+        for b=path_in,
+            path=list();
+            for l=b(1:$-1),
+                path($+1)=l;path($+1)="model";path($+1)="rpar";path($+1)="objs";
+            end
+            path($+1)=b($);
+            if size(path)==1 then path=path(1),end
+            mb=scs_m.objs(path)
+            k=find(mb.graphics.in_implicit=="E")
+            for kk=k,inports($+1)=path,end
+        end
+        path_in=inports(prt_in)
+    end
+
+    if type(path_out)==15 then //problem with implicit block
+        messagebox([gettext("Problem with the block generated from modelica blocks.")],"warning", "modal")
+        return;
+    end
+
+
+    // warn the output port block
+    if typ==0 then
+        msg = "<html><body>";
+        msg = msg + gettext("Block has connected output port<br />with incompatible size:");
+        msg = msg + "<ul>";
+        msg = msg + "<li>" + msprintf(gettext("Output port %s size is: %s"),string(prt_out), sci2exp(nout)) + "</li>";
+        if prt_in <> -1 then
+            msg = msg + "<li>" + msprintf(gettext("Input port %s size is: %s"),string(prt_in), sci2exp(nin)) + "</li>";
+        end
+        msg = msg + "</ul>";
+        msg = msg + "</body></html>";
+    else
+        msg = "<html><body>";
+        msg = gettext("Block has connected output port<br />with incompatible type.");
+        msg = msg + "<ul>";
+        msg = msg + "<li>" + msprintf(gettext("Output port %s type is: %s"),string(prt_out), sci2exp(outtyp)) + "</li>";
+        if prt_in <> -1 then
+            msg = msg + "<li>" + msprintf(gettext("Input port %s type is: %s"),string(prt_in), sci2exp(intyp)) + "</li>";
+        end
+        msg = msg + "</ul>";
+        msg = msg + "</body></html>";
+    end
+
+    hilite_path(path_out, msg);
+
+    // warn the input port block
+    if prt_in <> -1 then
+        if typ==0 then
+            msg = "<html><body>";
+            msg = msg + gettext("Block has connected input port<br />with incompatible size:");
+            msg = msg + "<ul>";
+            msg = msg + "<li>" + msprintf(gettext("Output port %s size is: %s"),string(prt_out), sci2exp(nout)) + "</li>";
+            msg = msg + "<li>" + msprintf(gettext("Input port %s size is: %s"),string(prt_in), sci2exp(nin)) + "</li>";
+            msg = msg + "</ul>";
+            msg = msg + "</body></html>";
+        else
+            msg = "<html><body>";
+            msg = msg + gettext("Block has connected input port<br />with incompatible type:");
+            msg = msg + "<ul>";
+            msg = msg + "<li>" + msprintf(gettext("Output port %s type is: %s"),string(prt_out), sci2exp(outtyp)) + "</li>";
+            msg = msg + "<li>" + msprintf(gettext("Input port %s type is: %s"),string(prt_in), sci2exp(intyp)) + "</li>";
+            msg = msg + "</ul>";
+            msg = msg + "</body></html>";
+        end
+
+        if or(path_in<>path_out) then
+            hilite_path(path_in, msg)
+        end
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/build_block.bin b/modules/scicos/macros/scicos_scicos/build_block.bin
new file mode 100755
index 000000000..4daa6ae18
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/build_block.bin
diff --git a/modules/scicos/macros/scicos_scicos/build_block.sci b/modules/scicos/macros/scicos_scicos/build_block.sci
new file mode 100755
index 000000000..d452cfd07
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/build_block.sci
@@ -0,0 +1,86 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) DIGITEO - 2010 - Jérôme PICARD
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [model, ok] = build_block(o)
+
+    // build the simulation function associated with the block if necessary
+
+    model    = o.model;
+    graphics = o.graphics;
+    if model.sim(1)=="scifunc" then
+        if model.ipar <> 0 then
+            model.opar=model.ipar;
+            model.ipar=0;
+        end
+        if isempty(model.opar) <> %f then
+            messagebox(sprintf(gettext("%s: Error: A scifunc block has not been defined."), "build_block"),"modal","error");
+            ok = %f
+            return
+        end
+        model.sim = list(genmac(model.opar,size(model.in,"*"),size(model.out,"*")),3);
+    elseif type(model.sim) == 15 then
+        modsim = modulo(model.sim(2),10000)
+        if int(modsim/1000) == 1 then   // Fortran Block
+            funam = model.sim(1)
+            if ~c_link(funam) then
+                tt = graphics.exprs(2);
+                ok = scicos_block_link(funam, tt, "f")
+            end
+        elseif int(modsim/1000) == 2 then   //  C Block
+            [model,ok]=recur_scicos_block_link(o,"c")
+        elseif model.sim(2) == 30004 then //modelica generic file type 30004
+            //funam = model.sim(1); tt = graphics.exprs(2);
+            if type(graphics.exprs) == 15 then // compatibility
+                funam = model.sim(1);
+                tt    = graphics.exprs(2);
+            else
+                funam = model.equations.model
+                tt    = graphics.exprs.funtxt;
+            end
+            [dirF, nameF, extF] = fileparts(funam);
+            [modelica_path, modelica_directory] = getModelicaPath();
+            if (extF == "") then
+                funam = modelica_directory + nameF + ".mo";
+                mputl(tt, funam);
+            end
+
+            //next lines removed in ScicosLab
+            //       //++ Check that modelica compiler is available
+            //       //++ Otherwise, give some feedback and quit
+            //       if ~with_modelica_compiler() then
+            //         messagebox(sprintf(gettext("%s: Error: Modelica compiler (MODELICAC) is unavailable."), "build_block"),"modal","error");
+            //         ok = %f
+            //       end
+
+
+            //       compilerpath = 'modelicac' //** thanks to automatic detection
+
+            //       // build compilation command line, execute it and test for result
+            //       strCmd = compilerpath + ' -c ' + funam + ' -o ' + fullfile(tarpath, nameF + '.moc')
+            //       if execstr('unix_s(''' + strCmd + ''')', 'errcatch') <> 0 then
+            //         error(sprintf(gettext("%s: Error : the following command line failed to execute: %s.\n"), "build_block", strCmd))
+            //         ok = %f
+            //       end
+        end
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/build_modelica_block.bin b/modules/scicos/macros/scicos_scicos/build_modelica_block.bin
new file mode 100755
index 000000000..9ae3399e6
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/build_modelica_block.bin
diff --git a/modules/scicos/macros/scicos_scicos/build_modelica_block.sci b/modules/scicos/macros/scicos_scicos/build_modelica_block.sci
new file mode 100755
index 000000000..0553715ad
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/build_modelica_block.sci
@@ -0,0 +1,77 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - Serge Steer <serge.steer@inria.fr> - 2003
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [model,ok]=build_modelica_block(blklstm,corinvm,cmmat,NiM,NoM,NvM,scs_m,path)
+    // given the blocks definitions in blklstm and connections in cmmat this
+    // function first create  the associated modelicablock  and writes its code
+    // in the file named 'imppart_'+name+'.mo' in the directory given by path
+    // Then modelica compiler is called to produce the C code of scicos block
+    // associated to this modelica block. filbally the C code is compiled and
+    // dynamically linked with Scilab.
+    // The correspondind model data structure is returned.
+
+
+    //## get the name of the generated main modelica file
+    name=stripblanks(scs_m.props.title(1))+"_im";
+
+    //## generation of the txt for the main modelica file
+    //## plus return ipar/rpar for the model of THE modelica block
+    [txt,rpar,ipar]=create_modelica(blklstm,corinvm,cmmat,NvM,name,scs_m);
+
+    //## write txt in the file path+name+'.mo'
+    path=pathconvert(stripblanks(path),%t,%t)
+    mputl(txt,path+name+".mo");
+    mprintf("%s\n",["--------------------------------------------\";
+    msprintf(_(" Main Modelica : %s"),path+name+".mo")
+    ""])
+
+    //## search for
+
+    Mblocks = [];
+    for i=1:lstsize(blklstm)
+        if type(blklstm(i).sim)==15 then
+            if blklstm(i).sim(2)==30004 then
+                o = scs_m(scs_full_path(corinvm(i)))
+                Mblocks=[Mblocks;
+                o.graphics.exprs.nameF]
+            end
+        end
+    end
+
+    //generating XML and Flat_Model
+    //## compile modelica files
+    [ok,name,nipar,nrpar,nopar,nz,nx,nx_der,nx_ns,nin,nout,nm,ng,dep_u]=compile_modelica(path+name+".mo",Mblocks);
+
+    if ~ok then return,end
+
+    //nx is the state dimension
+    //ng is the number of surfaces
+    //name1 of the model+flat
+
+    //build model data structure of the block equivalent to the implicit part
+    model=scicos_model(sim=list(name,10004),..
+    in=ones(nin,1),out=ones(nout,1),..
+    state=zeros(nx*2,1),..
+    dstate=zeros(nz,1),..
+    rpar=rpar,..
+    ipar=ipar,..
+    dep_ut=[dep_u %t],nzcross=ng,nmode=nm)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/buildmacros.sce b/modules/scicos/macros/scicos_scicos/buildmacros.sce
new file mode 100755
index 000000000..a39a7d3a7
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/buildmacros.sce
@@ -0,0 +1,16 @@
+
+// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab
+// Copyright (C) 2007-2008 - INRIA - Allan CORNET <allan.cornet@inria.fr>
+//
+// This file must be used under the terms of the CeCILL.
+// This source file is licensed as described in the file COPYING, which
+// you should have received as part of this distribution.  The terms
+// are also available at
+// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt
+
+if (isdef("genlib") == %f) then
+    exec(SCI+"/modules/functions/scripts/buildmacros/loadgenlib.sce");
+end
+//------------------------------------
+genlib("scicos_scicoslib","SCI/modules/scicos/macros/scicos_scicos",%f,%t);
+//------------------------------------
diff --git a/modules/scicos/macros/scicos_scicos/buildnewblock.bin b/modules/scicos/macros/scicos_scicos/buildnewblock.bin
new file mode 100755
index 000000000..1be3414f7
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/buildnewblock.bin
diff --git a/modules/scicos/macros/scicos_scicos/buildnewblock.sci b/modules/scicos/macros/scicos_scicos/buildnewblock.sci
new file mode 100755
index 000000000..f0291b7d4
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/buildnewblock.sci
@@ -0,0 +1,186 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Alan Layec <alan.layec@inria.fr>  - 2007
+//                      - Allan CORNET - 2008
+//                      - Rachid Djenidi
+//                      - Simone Mannori
+//
+//  Copyright (C) DIGITEO - Allan CORNET - 2010 - fully rewritten
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+//=============================================================================
+function [ok]=buildnewblock(blknam, files, filestan, filesint, libs, rpat, ldflags, cflags)
+
+    //** buildnewblock : generates Makefiles for
+    //                   the generated C code of a scicos block,
+    //                   compile and link it in Scilab
+    //
+    // Input : blknam : a prefix
+    //         files : files to be compiled
+    //         filestan : files to be compiled and included in
+    //         resu           the standalone code
+    //         filesint : files to be compiled and included in
+    //                    the interfacing of standalone code
+    //         libs : a vector of string of object files
+    //                    to include in the building process
+    //         rpat     : a target directory
+    //         ldflags  : linker flags
+    //         cflags   : C compiler flags
+    //
+    // Output :  ok : a flag to say if build is ok
+
+    //** check rhs paramaters
+    [lhs,rhs] = argn(0);
+
+    if rhs <= 1 then files    = blknam, end
+    if rhs <= 2 then filestan = "", end
+    if rhs <= 3 then filesint = "", end
+    if rhs <= 4 then libs     = "", end
+    if rhs <= 5 then rpat     = TMPDIR, end
+    if rhs <= 6 then ldflags  = "", end
+    if rhs <= 7 then cflags   = "", end
+
+    // Add .c extension if it is not already added
+    exts_files = fileext(files);
+    exts_filestan = fileext(filestan);
+    exts_filesint = fileext(filesint);
+
+    for i = 1:size(files, "*")
+        if exts_files(i) == "" & files(i) <> "" then
+            files(i) = files(i) + ".c";
+        end
+    end
+
+    for i = 1:size(filestan, "*")
+        if exts_filestan(i) == "" & filestan(i) <> "" then
+            filestan(i) = filestan(i) + ".c";
+        end
+    end
+
+    for i = 1:size(filesint, "*")
+        if exts_filesint(i) == "" & ~isdir(filesint(i)) & filesint(i) <> "" then
+            filesint(i) = filesint(i) + ".c";
+        end
+    end
+
+    // add a external file if it exists
+    // added for compatibility with 4.x
+    // By RN ...
+    if isfile(rpat + "/" + blknam + "f.f") then
+        files=[files, blknam + "f.f"];
+    end
+
+    //** adjust path and name of object files
+    //   to include in the building process
+    if (libs ~= emptystr() & libs <> []) then
+        libs = pathconvert(libs, %f, %t);
+    end
+
+    //** otherlibs treatment
+    [ok, libs, for_link] = link_olibs(libs, rpat);
+    if ~ok then
+        ok = %f;
+        message(["sorry compiling problem"; lasterror()]);
+        return;
+    end
+
+    //** unlink if necessary
+    [a, b] = c_link(blknam);
+    while a
+        ulink(b);
+        [a, b] = c_link(blknam);
+    end
+
+    //** save path in case of error in ilib_compile
+    oldpath = pwd();
+
+    if getos() <> "Windows" then
+        if isdir(SCI+"/../../include/scilab/scicos_blocks/") then
+            //** Binary version
+            cflags = cflags + " -I" + SCI + "/../../include/scilab/scicos/";
+            cflags = cflags + " -I" + SCI + "/../../include/scilab/scicos_blocks/";
+            cflags = cflags + " -I" + SCI + "/../../include/scilab/dynamic_link/";
+        else
+            //** it is a source version
+            cflags = cflags + " -I" + SCI + "/modules/scicos/includes/";
+            cflags = cflags + " -I" + SCI + "/modules/scicos_blocks/includes/";
+            cflags = cflags + " -I" + SCI + "/modules/dynamic_link/includes/";
+        end
+    else
+        // Load dynamic_link Internal lib if it's not already loaded
+        if ~exists("dynamic_linkwindowslib") then
+            load("SCI/modules/dynamic_link/macros/windows/lib");
+        end
+        cflags = cflags + strcat(" -I""" + dlwGetXcosIncludes() + """");
+        ldflags = ldflags + strcat(" """ + dlwGetLibrariesPath() + dlwGetXcosLibraries() + """");
+    end
+
+    if (rpat == "" | rpat == []) & isdir(filesint) then
+        // Prepare Block "Code Generation" from Menu
+        chdir(filesint);
+    else
+        // generate Block in TMPDIR (default)
+        chdir(TMPDIR);
+    end
+
+    // Since all files Xcos generated files of all diagrams are in the same TEMP directory
+    // Here, we force to rebuild (not a simple incremental build on Windows)
+    if getos() == "Windows" then
+        VC_rebuild_mode = dlwForceRebuild();
+        dlwForceRebuild(%t);
+    end
+
+    ierr = execstr("libn =ilib_for_link(blknam,files,"""",""c"","""",""loader.sce"","""",ldflags,cflags)","errcatch");
+
+    // restore previous build mode
+    if getos() == "Windows" then
+        dlwForceRebuild(VC_rebuild_mode);
+    end
+
+    if ierr <> 0 then
+        ok = %f;
+        chdir(oldpath);
+        disp(["sorry compiling problem"; lasterror()]);
+        return;
+    end
+
+    if (rpat == "" | rpat == []) & isdir(filesint) then
+        NAME_BLOCK_C_SCI = filesint + filesep() + blknam + "_c.sci";
+        if isfile(NAME_BLOCK_C_SCI) then
+            ierr = exec(NAME_BLOCK_C_SCI, "errcatch");
+            if ierr <> 0 then
+                ok = %f;
+                chdir(oldpath);
+                return
+            end
+        end
+    end
+
+    ierr = exec("loader.sce", "errcatch");
+    if ierr <> 0 then
+        ok = %f;
+    else
+        ok = %t;
+    end
+
+    chdir(oldpath);
+
+endfunction
+
+//=============================================================================
diff --git a/modules/scicos/macros/scicos_scicos/c_pass1.bin b/modules/scicos/macros/scicos_scicos/c_pass1.bin
new file mode 100755
index 000000000..291d2ea10
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/c_pass1.bin
diff --git a/modules/scicos/macros/scicos_scicos/c_pass1.sci b/modules/scicos/macros/scicos_scicos/c_pass1.sci
new file mode 100755
index 000000000..a31a5ede5
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/c_pass1.sci
@@ -0,0 +1,499 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Serge Steer <serge.steer@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function  [blklst,cmat,ccmat,cor,corinv,ok,scs_m,flgcdgen,freof]=c_pass1(scs_m,flgcdgen)
+    //derived from c_pass1 for implicit diagrams
+    //%Purpose
+    // Determine one level blocks and connections matrix
+    //%Parameters
+    // scs_m  :   scicos data structure
+    // ksup   :
+    // blklst : a list containing the "model" information structure for each block
+    //
+    // cmat   : nx6 matrix. Each row contains, in order, the block
+    //             number and the port number and the port type of an outgoing scicopath,
+    //             and the block number and the port number and the port type of the target
+    //             ingoing scicopath. for regular links
+    //
+    // ccmat  : nx4 matrix.  Each row contains, in order, the block
+    //             number and the port number  of an outgoing scicopath,
+    //             and the block number and the port number  of the target
+    //             ingoing scicopath for clock connections
+
+    // cor    : is a list with same recursive structure as scs_m each leaf
+    //          contains the index of associated block in blklst
+    // corinv : corinv(nb) is the path of nb ith block defined in blklst
+    //          in the scs_m structure
+    //!
+    // Serge Steer 2003, Copyright INRIA
+    // flgcdgen: is a flag containing the numbre of event input of the diagram
+    //           it is used only in the Codegeneration case.
+    // freof   : it is a vector containing the frequency and the offset of the major clock.
+    //           it is used only in the Codegeneration case.
+    // Fady Nassif 2007. INRIA.
+    //c_pass1;
+
+    if argn(2)<=1 then flgcdgen=-1, end
+    freof=[];
+    MaxBlock=countblocks(scs_m);
+    blklst=[];cmat=[],ccmat=[],cor=[],corinv=[]
+    [cor,corinvt,links_table,cur_fictitious,sco_mat,ok]=scicos_flat(scs_m);
+    if ~ok then
+        disp(mprintf("%s: flat failed", "c_pass1"));
+        return;
+    end
+    [links_table,sco_mat,ok]=global_case(links_table,sco_mat)
+    if ~ok then
+        disp(mprintf("%s: global case failed", "c_pass1"));
+        return;
+    end
+    index1=find((sco_mat(:,2)=="-1")& (sco_mat(:,5)<>"10"))
+    if index1<>[] then
+        for i=index1
+            [path]=findinlist(cor,-evstr(sco_mat(i,1)))
+            full_path=path(1)
+            if flgcdgen<>-1 then full_path=[numk full_path];scs_m=all_scs_m;end
+            hilite_path(full_path,"Error in compilation, There is a FROM ''"+(sco_mat(i,3))+ "'' without a GOTO",%t)
+            ok=%f;
+            disp(mprintf("%s: invalid connection matrix", "c_pass1"));
+            return;
+        end
+    end
+
+    nb=size(corinvt);
+    reg=1:nb
+    //form the block lists
+
+    blklst=list();kr=0 ; //regular  block list
+    blklstm=list();km=0; //modelica block list
+
+    //if ind(i)>0  ith block is a regular  block and stored in blklst(ind(i))
+    //if ind(i)<0  ith block is a modelica block and stored in blklstm(-ind(i))
+
+    ind=[];
+
+    for kb=1:nb
+        o=scs_m(scs_full_path(corinvt(kb)));
+        if is_modelica_block(o) then
+            km=km+1;blklstm(km)=o.model;
+            ind(kb)=-km;
+            [modelx,ok]=build_block(o); // compile modelica block type 30004
+            if ~ok then
+                disp(mprintf("%s: unable to build modelica block", "c_pass1"));
+                return
+            end
+        else
+            [model,ok]=build_block(o);
+            if ~ok then
+                disp(mprintf("%s: unable to build block", "c_pass1"));
+                return,
+            end
+
+            if or(model.sim(1)==["plusblk"]) then
+                [model,links_table]=adjust_sum(model,links_table,kb);
+            end
+
+            kr=kr+1;blklst(kr)=model;
+            ind(kb)=kr;
+        end
+
+    end
+
+    if (find(sco_mat(:,5)==string(4))<>[]) then
+        if flgcdgen ==-1 then
+            [links_table,blklst,corinvt,ind,ok]=sample_clk(sco_mat,links_table,blklst,corinvt,scs_m,ind,flgcdgen)
+        else
+            [links_table,blklst,corinvt,ind,ok,scs_m,flgcdgen,freof]=sample_clk(sco_mat,links_table,blklst,corinvt,scs_m,ind,flgcdgen)
+        end
+        if ~ok then
+            disp(mprintf("%s: unable to sample the whole diagram", "c_pass1"));
+            return,
+        end
+    end
+    nb=size(corinvt)
+    nl=size(links_table,1)/2
+
+    // Check if size match !
+    if(size(links_table(:,1:3), "r") == size(matrix([1;1]*(1:nl),-1,1), "r") ..
+        & size(matrix([1;1]*(1:nl),-1,1), "r") == size(links_table(:,4), "r"))
+        links_table=[links_table(:,1:3) matrix([1;1]*(1:nl),-1,1) ..
+        links_table(:,4) ];
+    else
+        disp(mprintf("%s: invalid links table size", "c_pass1"));
+        return
+    end
+    imp=find(ind<0)
+
+    reg(imp)=[]
+
+    if imp==[] then //no modelica block exists
+        cmat=matfromT(links_table(find(links_table(:,5)==1),:),nb); //data flow links
+        ccmat=cmatfromT(links_table(find(links_table(:,5)==-1),:),nb); //event links
+        corinv=corinvt
+    else // mixed diagram
+        nm=size(imp,"*") //number of modelica blocks
+        nr=nb-nm //number of regular blocks
+        cmmat=mmatfromT(links_table(find(links_table(:,5)==2),:),nb); //modelica links
+        cmat=matfromT(links_table(find(links_table(:,5)==1),:),nb); //data flow links
+        ccmat=cmatfromT(links_table(find(links_table(:,5)==-1),:),nb);//event links
+
+        //build connections between modelica world and regular one. These
+        //links should be data flow links
+        // links from modelica world to regular world
+        fromM=find(dsearch(cmat(:,1),imp,"d")>0);
+
+        // links from regular world to modelica world
+        toM=find(dsearch(cmat(:,3),imp,"d")>0);
+
+        // merge the modelica to modelica as data flow links
+        [varM, kfrom, kto] = intersect(fromM, toM);
+        fromM(kfrom) = [];
+        toM(kto) = [];
+
+        NoM=size(fromM,"*");
+        if NoM>0 then
+            //add modelica Output ports in Modelica world
+            mo=modelica();mo.model="OutPutPort";mo.outputs="vo";mo.inputs="vi";
+            for k=1:NoM,blklstm($+1)=scicos_model(equations=mo);end
+            //add modelica connections to these Output ports, set negative
+            //value to port numbers to avoid conflits with other blocks
+            cmmat=[cmmat;
+            cmat(fromM,1:2) zeros(NoM,1) -(nm+(1:NoM)'),ones(NoM,1),ones(NoM,1)];
+
+            nm=nm+NoM;
+            //add regular connection with regular block replacing the modelica world
+            cmat(fromM,1:2)=[-(nr+1)*ones(NoM,1),(1:NoM)'];
+        end
+
+        NiM=size(toM,"*");
+        if NiM>0 then
+            //add modelica Input ports in Modelica world
+            mo=modelica();mo.model="InPutPort";mo.outputs="vo";mo.inputs="vi";
+            for k=1:NiM,blklstm($+1)=scicos_model(equations=mo);end
+            //add modelica connections to these Input ports  set negative
+            //value to port numbers to avoid conflits with other blocks
+            cmmat=[cmmat;
+            -(nm+(1:NiM)'), ones(NiM,1),zeros(NiM,1), cmat(toM,3:4), ones(NiM,1) ];
+
+            nm=nm+NiM;
+            //add regular connection with regular block replacing the modelica world
+            cmat(toM,3:4)=[-(nr+1)*ones(NiM,1),(1:NiM)'];
+        end
+
+        NvM=size(varM, "*");
+        if NvM>0 then
+            //add modelica Values (both input and output) ports in Modelica world
+            l=[cmat(varM,1:2), zeros(NvM,1), cmat(varM,3:4), ones(NvM,1)];
+            cmmat=[cmmat;
+            l];
+
+            // remove the corresponding explicit link
+            cmat(varM, :) = [];
+        end
+
+        // modelica blocks with events ports are not allowed yet
+        if size(ccmat,1)>0 then
+            if or(dsearch(ccmat(:,[1 3]),imp,"d")>0) then
+                messagebox("An implicit block has an event port","modal","error");
+                disp(mprintf("%s: implicit block with event port", "c_pass1"));
+                ok=%f;return
+            end
+        end
+
+        //renumber blocks according to their types
+
+        corinv=list();corinvm=list();
+
+        for kb=1:nb
+
+            if ind(kb)<0 then // modelica block
+
+                km=-ind(kb);
+
+                //replace by negative value to avoid conflicts
+
+                cmmat(find(cmmat(:,1)==kb),1)=-km ;
+
+                cmmat(find(cmmat(:,4)==kb),4)=-km;
+
+                corinvm(km)=corinvt(kb);
+
+            else
+
+                kr=ind(kb);
+
+                cmat (find(cmat (:,1)==kb),1)=-kr;
+
+                cmat (find(cmat (:,3)==kb),3)=-kr;
+
+                ccmat(find(ccmat(:,1)==kb),1)=-kr;
+
+                ccmat(find(ccmat(:,3)==kb),3)=-kr;
+
+                corinv(kr)=corinvt(kb);
+
+            end
+
+        end
+
+        //renumbering done, replace negative value by positive ones
+
+
+
+        cmat(:,[1 3])=abs(cmat(:,[1 3])) ;
+
+        ccmat(:,[1 3])=abs(ccmat(:,[1 3])) ;
+
+        cmmat=abs(cmmat) ;
+
+        //create regular block associated to all modelica blocks
+
+        [model,ok]=build_modelica_block(blklstm,corinvm,cmmat,NiM,NoM,NvM,scs_m,TMPDIR+"/");
+
+        if ~ok then
+            disp(mprintf("%s: build the modelica meta-block failed", "c_pass1"));
+            return
+        end
+
+        blklst(nr+1)=model;
+
+        //make compiled modelica block refer to the set of corresponding
+
+        //modelica blocks
+
+        corinv(nr+1)=corinvm //it may be useful to adapt function making use
+
+        //of corinv
+
+        //adjust the numbering of regular block in sco_mat
+
+        //if modelica's blocks exist
+
+        //Fady 08/11/2007
+
+        for i=1:size(sco_mat,1)
+
+            if eval(sco_mat(i,1))<MaxBlock then
+
+                sco_mat(i,1)=string(ind(eval(sco_mat(i,1))))
+
+            end
+
+        end
+
+        sco_mat=[sco_mat;[string(size(blklst)) "-1" "scicostimeclk0" "1" "10"]]
+
+    end
+
+    cor=update_cor(cor,reg)
+
+
+
+    // Taking care of the clk 0;
+
+    //*** this part has been taken from c_pass2 modified and placed here it must be tested ***
+
+    //Fady 08/11/2007
+
+    nbl=size(blklst)
+
+    fff=ones(nbl,1)==1
+
+    clkptr=zeros(nbl+1,1);clkptr(1)=1; typ_l=fff;
+
+    for i=1:nbl
+
+        ll=blklst(i);
+
+        clkptr(i+1)=clkptr(i)+size(ll.evtout,"*");
+
+        //tblock(i)=ll.dep_ut($);
+
+        typ_l(i)=ll.blocktype=="l";
+
+    end
+
+    all_out=[]
+
+    for k=1:size(clkptr,1)-1
+
+        if ~typ_l(k) then
+
+            kk=[1:(clkptr(k+1)-clkptr(k))]'
+
+            all_out=[all_out;[k*ones(kk),kk]]
+
+        end
+
+    end
+
+    all_out=[all_out;[0,0]]
+    //add time event if needed
+    tblock=find((sco_mat(:,2)=="-1")&(sco_mat(:,5)=="10"))
+    ind=sco_mat(tblock,1);
+    if ind<>[] then
+        ind=eval(ind(:))
+        //ind=find(tblock)
+        //ind=ind(:)
+        for k=ind'
+            ccmat=[ccmat;[all_out,ones(all_out)*[k,0;0,0]]]
+        end
+        for Ii=1:length(blklst)
+            if type(blklst(Ii).sim(1))==10 then
+                if part(blklst(Ii).sim(1),1:7)=="capteur" then
+                    ccmat=[ccmat;[0 0 Ii 0]]
+                end
+            end
+        end
+    end
+    //***
+endfunction
+//**-----------------------------------------------------------------------------------------------------------------
+
+function [model,links_table]=adjust_sum(model,links_table,k)
+    //sum blocks have variable number of input ports, adapt the associated
+    //model data structure and input connection to take into account the
+    //actual number of connected ports
+    // Serge Steer 2003, Copyright INRIA
+    in=find(links_table(:,1)==k&links_table(:,3)==1)
+    nin=size(in,"*")
+    model.in=-ones(nin,1)
+    links_table(in,2)=(1:nin)'
+endfunction
+
+
+function mat=mmatfromT(Ts,nb)
+    //S. Steer, R. Nikoukhah 2003. Copyright INRIA
+    Ts(:,1)=abs(Ts(:,1));
+    K=unique(Ts(find(Ts(:,1)>nb),1)); // identificator of blocks to be removed
+    //remove superblocks port and split connections
+    Ts=remove_fictitious(Ts,K)
+
+    // from connection matrix
+    Imat=[];
+    for u=matrix(unique(Ts(:,4)),1,-1)
+        kue=matrix(find(Ts(:,4)==u),-1,1); //identical links
+        Imat=[Imat;[kue(2:$)  kue(1).*ones(kue(2:$))]];
+    end
+    mat=[Ts(Imat(:,1),1:3)  Ts(Imat(:,2),1:3)]
+endfunction
+
+
+function mat=matfromT(Ts,nb)
+    //S. Steer, R. Nikoukhah 2003. Copyright INRIA
+
+    Ts(:,1)=abs(Ts(:,1))
+    K=unique(Ts(find(Ts(:,1)>nb),1)); // identificator of blocks to be removed
+    //remove superblocks port and split connections
+    Ts=remove_fictitious(Ts,K)
+
+    // from connection matrix
+    Imat=[];
+    for u=matrix(unique(Ts(:,4)),1,-1)
+        kue=matrix(find(Ts(:,4)==u&Ts(:,3)==-1),-1,1); //look for outputs
+        jue=matrix(find(Ts(:,4)==u&Ts(:,3)==1),-1,1); //look for inputs
+        Imat=[Imat;[ones(jue).*.kue jue.*.ones(kue)]];
+    end
+    mat=[Ts(Imat(:,1),1:2)  Ts(Imat(:,2),1:2)]
+endfunction
+
+function mat=cmatfromT(Ts,nb)
+    //S. Steer, R. Nikoukhah 2003. Copyright INRIA
+    //this function has been modified to support
+    // CLKGOTO et CLKFROM
+    // Fady NASSIF: 11/07/2007
+    k=find(Ts(:,1)<0) //superblock ports links and CLKGOTO/CLKFROM
+    K=unique(Ts(k,1));
+    Ts=remove_fictitious(Ts,K)
+
+    if Ts==[] then mat=[],return,end
+    //  if size(Ts,1)<>int(size(Ts,1)/2)*2 then disp('PB'),pause,end
+    [s,k]=gsort(Ts(:,[4,3]),"lr","i");Ts=Ts(k,:)
+    // modified to support the CLKGOTO/CLKFROM
+    //mat=[Ts(1:2:$,1:2) Ts(2:2:$,1:2)]
+    //----------------------------------
+
+    J=find(Ts(:,3)==1); //find the destination block of the link
+    v=find([Ts(:,3);-1]==-1) // find the source block of the link
+    // many destination blocks can be connected to one source block
+    // so we have to find the number of destination blocks for each source block
+    // v(2:$)-v(1:$-1)-1
+    // then create the vector I that must be compatible with the vector J.
+    I=duplicate(v(1:$-1),v(2:$)-v(1:$-1)-1);
+    mat=[Ts(I,1:2),Ts(J,1:2)]
+
+    //----------------------------------
+    K=unique(Ts(Ts(:,1)>nb))
+    Imat=[];
+    for u=matrix(K,1,-1)
+        jue=matrix(find(mat(:,1)==u),-1,1); //look for outputs
+        kue=matrix(find(mat(:,3)==u),-1,1); //look for inputs
+        Imat=[ones(jue).*.kue jue.*.ones(kue)];
+        mat1=[mat(Imat(:,1),1:2), mat(Imat(:,2),3:4)];
+        mat([jue;kue],:)=[];
+        mat=[mat;mat1];
+    end
+
+endfunction
+
+function Ts=remove_fictitious(Ts,K)
+    //removes fictitious blocks connected links are replaced by a single one
+    //S. Steer, R. Nikoukhah 2003. Copyright INRIA
+    count=min(Ts(:,4))
+    for i=1:size(K,"*")
+        ki=K(i);
+        v1=find(Ts(:,1)==ki);
+        if v1<>[] then
+            v=unique(Ts(v1,4));
+            Ts(v1,:)=[];
+            if size(v)==1 then
+                ind=find(Ts(:,4)==v);
+            else
+                ind = find(dsearch(Ts(:,4),gsort(v,"g","i"),"d")<>0);
+            end
+            if size(ind,"*")>1 then
+                count=count-1;
+                Ts(ind,4)=count
+            else
+                Ts(ind,:)=[]
+            end
+        end
+    end
+endfunction
+
+function cor=update_cor(cor,reg)
+    n=size(cor)
+    for k=1:n
+        if type(cor(k))==15 then
+            cor(k)=update_cor(cor(k),reg)
+        else
+            p=find(cor(k)==reg)
+            if p<>[] then
+                cor(k)=p
+            elseif cor(k)<0 then  // GOTO FROM cases
+                cor(k)=0
+            elseif cor(k)<>0 then
+                cor(k)=size(reg,"*")+1
+            end
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/c_pass2.bin b/modules/scicos/macros/scicos_scicos/c_pass2.bin
new file mode 100755
index 000000000..ce70baab7
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/c_pass2.bin
diff --git a/modules/scicos/macros/scicos_scicos/c_pass2.sci b/modules/scicos/macros/scicos_scicos/c_pass2.sci
new file mode 100755
index 000000000..04cf4f1e4
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/c_pass2.sci
@@ -0,0 +1,2615 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function cpr=c_pass2(bllst,connectmat,clkconnect,cor,corinv,flag)
+    // cor    ; correspondance table with initial block ordering
+    //
+    // bllst: list with nblk elts where nblk denotes number of blocks.
+    //        Each element must be a list with 16 elements:
+    //          1- a list containing function name and function type
+    //          2- vector of number of inputs
+    //          3- vector of number of outputs
+    //          4- vector of number of clock inputs
+    //          5- vector of number of clock outputs
+    //          6- vector (column) of continuous initial condition
+    //          7- vector (column) of discrete initial condition
+    //          8- vector (column) of real parameters
+    //          9- vector (column) of integer parameters
+    //          10- string: 'l' for synchro (ifthenelse,eselect) or 'm'
+    //          (memo) or 'x' for blocks that need to be called during
+    //          integration even in the absence of state (only if with workspace)
+    //          11- vector of size <number of clock outputs> including
+    //              preprogrammed event firing times (<0 if no firing)
+    //          12- boolean vector (column): 1:nin entry for dependence on u,
+    //          last on t
+    //          13- block label
+    //          14- number of zero crossings
+    //          15- number of modes
+    //          16- empty list (equation for modelica blocks)
+    //
+    // connectmat: nx4 matrix. Each row contains, in order, the block
+    //             number and the port number of an outgoing scicopath,
+    //             and the block number and the port number of the target
+    //             ingoing scicopath.
+    //
+    // clkconnect: same as connectmat but for clock scicopaths.
+    //
+    // define some constants
+    if argn(2) <6 then flag="verbose",end
+    show_trace=%f
+    if show_trace then mprintf("c_pass1:\t%f\n", timer()),end
+
+    show_pause=%f;
+    show_comment=%f;
+
+    if bllst==list() then
+        messagebox(_("No block can be activated"),"modal","error")
+        cpr=list()
+        ok=%f;
+        return
+    end
+
+    //correction of clkconnect.. Must be done before
+    clkconnect(find(clkconnect(:,2)==0),2)=1;
+
+
+
+
+    if exists("%scicos_solver")==0 then %scicos_solver=0,end
+
+    clkptr=1,cliptr=1,typ_l=[],
+    nblk=size(bllst)
+
+    //take care of the heritage
+    [bllst,inplnk,outlnk,clkptr,cliptr,inpptr,outptr,dep_u,dep_uptr,dep_t,..
+    typ_l,typ_r,typ_m,tblock,typ_cons,typ_zx,ok]=mini_extract_info(bllst,..
+    connectmat,clkconnect)
+    if show_trace then mprintf("c_pass20:\t%f\n", timer()),end
+    if ~ok then
+        cpr=list()
+        return
+    end
+    [outoin,outoinptr]=conn_mat(inpptr,outptr,inplnk,outlnk)
+
+    [critev]=critical_events(connectmat,clkconnect,dep_t,typ_r,..
+    typ_l,typ_zx,outoin,outoinptr,clkptr)
+    [clkconnect,exe_cons]=pak_ersi(connectmat,clkconnect,typ_r,..
+    typ_l,outoin,outoinptr,tblock,typ_cons,clkptr)
+
+
+    [ordclk,ordptr,cord,typ_l,clkconnect,connectmat,bllst,dep_t,dep_u,..
+    dep_uptr,corinv,clkptr,cliptr,critev,ok]=paksazi2(typ_l,clkconnect,..
+    connectmat,bllst,dep_t,dep_u,dep_uptr,corinv,clkptr,cliptr,critev)
+
+    if ~ok then
+        cpr=list()
+        return
+    end
+
+    if show_pause then
+        mprintf("fin de paksazi")
+        pause
+    end
+
+    if show_trace then mprintf("c_pass31:\t%f\n", timer()),end
+
+    //extract various info from bllst
+    [lnksz,lnktyp,inplnk,outlnk,clkptr,cliptr,inpptr,outptr,xptr,zptr,..
+    ozptr,typ_mod,rpptr,ipptr,opptr,xc0,xcd0,xd0,oxd0,rpar,..
+    ipar,opar,typ_z,typ_x,typ_m,funs,funtyp,initexe,labels,uids,..
+    bexe,boptr,blnk,blptr,ok]=extract_info(bllst,connectmat,clkconnect,typ_l);
+    typ_z0=typ_z;
+
+
+
+    if ~ok then
+        messagebox(_("Problem in port size or type."),"modal","error");
+        cpr=list()
+        return,
+    end
+
+    if show_trace then mprintf("c_pass41:\t%f\n", timer()),end
+
+    //form a matrix which gives destinations of each block
+    [outoin,outoinptr]=conn_mat(inpptr,outptr,inplnk,outlnk)
+    [evoutoin,evoutoinptr]=synch_clkconnect(typ_l,clkconnect)
+    //
+    if show_trace then mprintf("c_pass50:\t%f\n", timer()),end
+
+    [execlk_cons]=discard(clkptr,cliptr,clkconnect,exe_cons)
+
+    clkconnect=[];exe_cons=[]
+
+    if show_trace then mprintf("c_pass501:\t%f\n", timer()),end
+
+    // Set execution scheduling tables
+    [ordclk,iord,oord,zord,typ_z,ok]=scheduler(inpptr,outptr,clkptr,execlk_cons,..
+    outoin,outoinptr,evoutoin,evoutoinptr,typ_z,typ_x,typ_l,bexe,boptr,blnk,blptr,..
+    ordclk,ordptr,cord,dep_t,dep_u,dep_uptr);
+
+    if ~ok then
+        cpr=list()
+        return,
+    end
+
+    if show_trace then mprintf("c_pass51:\t%f\n", timer()),end
+    //form scicos arguments
+
+    nb=size(typ_z,"*");
+    zcptr=ones(nb+1,1);
+    modptr=ones(nb+1,1);
+
+    for i=1:nb
+        zcptr(i+1)=zcptr(i)+typ_z(i)
+        modptr(i+1)=modptr(i)+sign(typ_z(i))*typ_mod(i);
+    end
+
+    ztyp=sign(typ_z0)  //completement inutile pour simulation
+    // utiliser pour la generation de code
+
+    if xptr($)==1 & zcptr($)>1 then
+        mess=msprintf(_("No continuous-time state. Thresholds are ignored; this \nmay be OK if you don''t generate external events with them.\nIf you want to reactivate the thresholds, then you need\n\nto include a block with continuous-time state in your diagram.\n   You can for example include DUMMY CLSS block (linear palette)."))
+        messagebox(mess,"modal","error");
+    end
+
+    subscr=[]
+    ncblk=0;nxblk=0;ndblk=0;ndcblk=0;
+    sim=scicos_sim(funs=funs,xptr=xptr,zptr=zptr,ozptr=ozptr,..
+    zcptr=zcptr,inpptr=inpptr,outptr=outptr,..
+    inplnk=inplnk,outlnk=outlnk,rpar=rpar,rpptr=rpptr,..
+    ipar=ipar,ipptr=ipptr,opar=opar,opptr=opptr,..
+    clkptr=clkptr,ordptr=ordptr,execlk=ordclk,..
+    ordclk=ordclk,cord=cord,oord=oord,zord=zord,..
+    critev=critev(:),nb=nb,ztyp=ztyp,nblk=nblk,..
+    ndcblk=ndcblk,subscr=subscr,funtyp=funtyp,..
+    iord=iord,labels=labels,uids=uids,modptr=modptr);
+
+    //initialize agenda
+    [tevts,evtspt,pointi]=init_agenda(initexe,clkptr)
+    if show_trace then mprintf("c_pass61:\t%f\n", timer()),end
+
+    //mod=0*ones(modptr($)-1,1)
+
+    outtb=list();
+    outtb=buildouttb(lnksz,lnktyp);
+
+    iz0=zeros(nb,1);
+
+    if max(funtyp)>10000 &%scicos_solver==0 then
+        warning(_("Diagram contains implicit blocks, compiling for implicit Solver."))
+        %scicos_solver=100
+    end
+    if or(%scicos_solver==[100, 101, 102]) then xc0=[xc0;xcd0],end
+    state=scicos_state()
+    state.x=xc0
+    state.z=xd0
+    state.oz=oxd0
+    state.iz=iz0
+    state.tevts=tevts
+    state.evtspt=evtspt
+    state.pointi=pointi
+    state.outtb=outtb
+    //  state.mod=mod
+
+    cpr=scicos_cpr(state=state,sim=sim,cor=cor,corinv=corinv);
+
+    if show_trace then mprintf("c_pass71:\t%f\n", timer()),end
+
+endfunction
+
+
+//donne les sources d'activation du sch�ma
+function [vec_clk]=get_clocks(clkconnect,clkptr)
+    vec_clk=[]
+    if (find(clkconnect(:,1)==0) ~=[]) then
+        //activation continue
+        vec_clk=[vec_clk;0 0];
+    end
+    for blk=1:size(clkptr,1)-1
+        if ~typ_l(blk) then
+            for port=1:clkptr(blk+1)-clkptr(blk)
+                vec_clk=[vec_clk; blk port];
+            end
+        end
+    end
+endfunction
+
+
+
+//insere le vecteur primary dans vec_clk apr�s la ligne comptenant le bloc i
+function vec_clk0=set_primary_clk(vec_clk,primary,i)
+
+    if vec_clk~=[] then
+        n_vc0=find(vec_clk==i)
+        n_vc0=n_vc0($)
+        vec_clk0=vec_clk(1:n_vc0)
+        vec_clk1=vec_clk(n_vc0+1:size(vec_clk,1))
+        for k=1:size(primary,1)
+            if find(primary(k)==vec_clk0)==[] then
+                vec_clk0($+1)=primary(k)
+            end
+        end
+        for k=1:size(vec_clk1,1)
+            if find(vec_clk1(k)==vec_clk0)==[] then
+                vec_clk0($+1)=vec_clk1(k)
+            end
+        end
+    else
+        vec_clk0=primary
+    end
+
+endfunction
+
+//insere la sous-matrice primary dans vec_clk apr�s la ligne k
+function vec_clk0=set_primary_clkport(vec_clk,primary,i)
+
+    if vec_clk~=[] then
+        vec_clk0=vec_clk(1:i,:)
+        vec_clk1=vec_clk(i+1:size(vec_clk,1),:)
+        for k=1:size(primary,1)
+            f=find(primary(k,1)==vec_clk0(:,1))
+            if f==[] then
+                vec_clk0=[vec_clk0;primary(k,:)]
+            end
+        end
+        n_vc1=size(vec_clk1,1)
+        if n_vc1>0 then
+            for k=1:n_vc1
+                f=find(vec_clk1(k,1)==vec_clk0(:,1))
+                if f==[] then
+                    vec_clk0=[vec_clk0;vec_clk1(k,:)]
+                end
+            end
+        end
+    else
+        vec_clk0=primary
+    end
+
+endfunction
+
+//insere la sous-matrice ordoclk0 dans ordclk apr�s le block k
+function [ordptr,ordclk,blocs_traites]=set_ordclk(ordclk,..
+    ordoclk0,k,j,ordptr,blocs_traites)
+    if ordoclk0~=[] then
+        if ordclk==[] then
+            ordclk=[ordclk;ordoclk0];
+            ordptr($+1)=ordptr($)+size(ordoclk0,1);
+            blocs_traites=[blocs_traites;k] //k
+        else
+            m=max(find(blocs_traites==k))
+            if j>1 & m~=[] then
+                ordclk=[ordclk(1:ordptr(m+1)-1,:);ordoclk0;ordclk(ordptr(m+1):$,:)]
+                ordptr=[ordptr(1:m+1);ordptr(m+1:$)+size(ordoclk0,1)]
+                blocs_traites=[blocs_traites(1:m);k;blocs_traites(m+1:$)]
+            else
+                ind=find(blocs_traites <k)
+                m=max(ind)
+                if m==size(blocs_traites,1) then
+                    ordclk=[ordclk;ordoclk0]
+                    ordptr($+1)=ordptr($)+size(ordoclk0,1);
+                    blocs_traites=[blocs_traites;k]
+                else
+                    if m~=[] then
+                        ordclk=[ordclk(1:ordptr(m+1)-1,:);ordoclk0;ordclk(ordptr(m+1):$,:)]
+                        ordptr=[ordptr(1:m+1);ordptr(m+1:$)+size(ordoclk0,1)]
+                        blocs_traites=[blocs_traites(1:m);k;blocs_traites(m+1:$)]
+                    else
+                        ordclk=[ordoclk0;ordclk]
+                        ordptr=[1;ordptr+size(ordoclk0,1)]
+                        blocs_traites=[k;blocs_traites]
+                    end
+                end
+            end
+        end
+    else
+        if j>1 & find((blocs_traites==k))~=[] then
+            m=max(find(blocs_traites==k))
+            ordptr=[ordptr(1:m+1);ordptr(m+1:$)+size(ordoclk0,1)]
+            blocs_traites=[blocs_traites(1:m);k;blocs_traites(m+1:$)]
+        else
+            ind=find(blocs_traites <k)
+            m=max(ind)
+            if m==size(blocs_traites,1) then
+                ordptr($+1)=ordptr($)+size(ordoclk0,1);
+                blocs_traites=[blocs_traites;k]
+            else
+                if m~=[] then
+                    ordptr=[ordptr(1:m+1);ordptr(m+1:$)+size(ordoclk0,1)]
+                    blocs_traites=[blocs_traites(1:m);k;blocs_traites(m+1:$)]
+                else
+                    ordptr=[1;ordptr+size(ordoclk0,1)]
+                    blocs_traites=[k;blocs_traites]
+                end
+            end
+        end
+    end
+endfunction
+
+
+//donne les blocs activant blk
+function [parents]=get_parents(parents,blk)
+    f=find(clkconnect(:,3)==blk)
+    n_f=size(f,2)
+    if n_f>0 then
+        for i=1:n_f
+            clki1=clkconnect(f(i),1)
+            clki2=clkconnect(f(i),2)
+            g=find(clki1==parents(:,1))
+            if g==[] | (g~=[] & parents(g,2)~=clki2) then
+                parents=[parents;clki1,clki2]
+            end
+        end
+    end
+endfunction
+
+
+function [blks,blksptr]=depend_on(connectmat,dep_u,dep_uptr)
+    // returns the blocks on which depend directly  a block
+    blks=[];blksptr=1
+    for i=1:size(dep_uptr,"*")-1
+        indport=find(dep_u(dep_uptr(i):dep_uptr(i+1)-1));
+        f=[]
+        for j=indport
+            f=[f,find(connectmat(:,3)==i&connectmat(:,4)==j)]
+        end
+        blkis=unique(connectmat(f,1))
+        blks=[blks;blkis]
+        blksptr=[blksptr;blksptr($)+size(blkis,"*")]
+    end
+endfunction
+
+function [eblks,eblksptr]=update_event_depend_on(eblks,eblksptr,clkconnect,cliptr,bls)
+    // updates the blocks activating a block
+    nb1=size(cliptr,"*")
+    eblksptr($:nb1)=eblksptr($)
+    for i=bls
+        f=find(clkconnect(:,3)==i)
+        blkis=unique(clkconnect(f,1))
+        dblkis=size(blkis,"*")-(eblksptr(i+1)-eblksptr(i))
+        Ibef=eblksptr(1):eblksptr(i)-1;
+        Iaft=eblksptr(i+1):eblksptr($)-1;
+        eblks=[eblks(Ibef);blkis;eblks(Iaft)]
+        eblksptr(i+1:$)=eblksptr(i+1:$)+dblkis
+    end
+endfunction
+
+
+function [fblks,fblksptr]=update_event_activates(fblks,fblksptr,clkconnect,clkptr,bls)
+    // returns the blocks activated by a block (assumed typ_l)
+    nb1=size(cliptr,"*")
+    fblksptr($:nb1)=fblksptr($)
+    for i=bls
+        f=find(clkconnect(:,1)==i)
+        blkis=unique(clkconnect(f,3))
+        dblkis=size(blkis,"*")-(fblksptr(i+1)-fblksptr(i))
+        Ibef=fblksptr(1):fblksptr(i)-1;
+        Iaft=fblksptr(i+1):fblksptr($)-1;
+        fblks=[fblks(Ibef);blkis;fblks(Iaft)]
+        fblksptr(i+1:$)=fblksptr(i+1:$)+dblkis
+    end
+endfunction
+
+
+function [eblks,eblksptr]=event_depend_on(clkconnect,cliptr)
+    // returns the blocks activating a block
+    eblks=[];eblksptr=1
+    for i=1:size(cliptr,"*")-1
+        f=find(clkconnect(:,3)==i)
+        blkis=unique(clkconnect(f,1))
+        eblks=[eblks;blkis]
+        eblksptr=[eblksptr;eblksptr($)+size(blkis,"*")]
+    end
+endfunction
+
+
+function [fblks,fblksptr]=event_activates(clkconnect,clkptr)
+    // returns the blocks activated by a block of type typ_l
+    fblks=[];fblksptr=1
+    for i=1:size(typ_l,"*")
+        if typ_l(i) then
+            f=find(clkconnect(:,1)==i)
+            blkis=unique(clkconnect(f,3))
+            fblks=[fblks;blkis]
+        else
+            blkis=[]
+        end
+        fblksptr=[fblksptr;fblksptr($)+size(blkis,"*")]
+    end
+endfunction
+
+
+function uni=merge_mat(m1,m2)
+    // for  m1 and m2 with two columns containing >=0 values
+    uni=[m1;m2]
+    n=max(uni(:,2))+1;
+    [j,ind]=unique(uni(:,1)*n+uni(:,2))
+    uni=uni(-gsort(-ind),:)
+endfunction
+
+function [typ_l,clkconnect,connectmat,vbllst,dep_t,dep_u,dep_uptr,..
+    corinv,clkptr,cliptr,critev]=duplicate_block(bl,typ_l,clkconnect,..
+    connectmat,vbllst,dep_t,dep_u,dep_uptr,corinv,clkptr,cliptr,critev)
+
+    nblock=size(typ_l,1)+1
+    g=find(clkconnect(:,1)==bl)
+    if g<> [] then
+        xx=clkconnect(g,:)
+        xx(:,1)=nblock
+        clkconnect=[clkconnect;xx]
+    end
+
+    g=find(connectmat(:,3)==bl)
+    xx=connectmat(g,:)
+    xx(:,3)=nblock*ones(size(xx,1),1)
+    connectmat=[connectmat;xx]
+
+    typ_l($+1)=%t
+    critev=[critev;critev(clkptr(bl):clkptr(bl+1)-1)]
+    vbllst(nblock)=vbllst(bl)
+    dep_t(nblock)=dep_t(bl)
+    dep_u=[dep_u;dep_u(dep_uptr(bl))]
+    dep_uptr($+1)=dep_uptr($)+1
+
+    corinv(nblock)=corinv(bl)
+    clkptr(nblock+1)=clkptr(nblock)+clkptr(bl+1)-clkptr(bl)
+    cliptr(nblock+1)=cliptr(nblock)+cliptr(bl+1)-cliptr(bl)
+
+endfunction
+
+function [childs]=get_allchilds(primary,fblks,fblksptr,typ_l)
+
+    oldtaille=0
+    childs=primary(:)'
+    taille=size(childs,"*")
+
+    while oldtaille<>taille
+        oldtaille=taille
+        for i=childs(typ_l(childs))
+            bb=fblks(fblksptr(i):fblksptr(i+1)-1)
+            childs=union(childs,bb)
+        end
+        taille=size(childs,"*")
+    end
+endfunction
+
+
+function ok=is_alg_event_loop(typ_l,clkconnect)
+    clkconnect(find(clkconnect(:,1)==0),:)=[]
+    lclkconnect=clkconnect(typ_l(clkconnect(:,1))&typ_l(clkconnect(:,3)),[1,3])
+    n=size(typ_l,"*")
+    oldvec=zeros(n,1)
+    vec(lclkconnect(:,1))=1
+    i=0
+    ok=%f
+    while i<=n
+        i=i+1
+        oldvec=vec  // not optimal to use large v
+        vec(lclkconnect(:,2))=vec(lclkconnect(:,1))+1
+        if and(vec==oldvec) then
+            ok=%t
+            return
+        end
+    end
+endfunction
+
+function [ordclk,ordptr,cord,typ_l,clkconnect,connectmat,bllst,dep_t,dep_u,dep_uptr,corinv,clkptr,cliptr,critev,ok]=paksazi2(typ_l,clkconnect,connectmat,bllst,dep_t,dep_u,dep_uptr,corinv,clkptr,cliptr,critev)
+
+    ordclk=[];ordptr=1;cord=[];
+    lordclk=list()
+
+    vbllst=1:length(bllst)
+
+    zz=get_clocks(clkconnect,clkptr)
+    //testing event algebraic loops
+    ok=is_alg_event_loop(typ_l,clkconnect)
+    if ~ok then
+        disp(mprintf("%s: alg_event_loop failed", "c_pass2"));
+        messagebox(_("Algebraic loop on events."),"modal","error");
+        return
+    end
+
+
+    ok=%t
+    [fblks,fblksptr]=event_activates(clkconnect,clkptr)
+    [blks,blksptr]=depend_on(connectmat,dep_u,dep_uptr)
+    [eblks,eblksptr]=event_depend_on(clkconnect,cliptr)
+
+
+    for i=1:size(zz,1)
+
+        nblock=size(typ_l,1);  // number of blocks in diagram
+
+        todo=zz(i,:)
+        while todo<>[]
+
+            blk=todo(1,1);port=todo(1,2);
+            if blk==0 |find(definedfields(lordclk)==clkptr(blk)+port-1)==[] then
+
+                f=find(clkconnect(:,1)==blk&clkconnect(:,2)==port);
+                if f<>[] then
+                    primary0=clkconnect(f,3);prt0=clkconnect(f,4)
+                else
+                    primary0=[]
+                end
+
+                if  show_comment then mprintf("Processing blk " + string(blk) + " port "+...
+                + string(port) + "\n"),end
+
+                if primary0<>[] then  // delete redundant links
+                    [jj,k]=unique(primary0*(1+max(prt0))+prt0)
+                    index=setdiff(1:size(primary0,1),k)
+                    clkconnect(f(index),:)=[]  // does not affect e(f)blks
+
+                    primary=unique(primary0)
+
+                    [balg,vec]=ini_ordo3(primary)
+                    if balg then
+                        disp(mprintf("%s: ini_ordo (3) failed", "c_pass2"));
+                        messagebox(_("Algebraic loop."),"modal","error"),
+                        ok=%f
+                        return
+                    end
+
+                    pvec=vec(primary)+.5*typ_l(primary) // same order typ_l to the right
+                    [mi,In]=gsort(-pvec)
+                    primary=primary(In)
+                    lp=find(typ_l(primary))
+                    lprimary=primary(lp)
+
+                    bouclalg=%f
+                    lp_backw=lp($:-1:1)
+                    for i=lp_backw
+                        for J=primary(i+1:$)'
+                            if intersect(get_allchilds(primary(i)),get_allchilds(J))<>[] then
+                                bouclalg=%t
+                                break
+                            end
+                        end
+                        if bouclalg then break,end
+                    end
+
+                    if show_comment&bouclalg then mprintf("found intersect \n"),end
+
+                    if ~bouclalg then
+                        [bouclalg,Vec,typ_l,clkconnect,connectmat,bllst,dep_t,dep_u,..
+                        dep_uptr,corinv,clkptr,cliptr,critev]=ini_ordo2(primary,..
+                        clkconnect,connectmat,bllst,typ_l,dep_t,dep_u,dep_uptr,..
+                        corinv,clkptr,cliptr,critev)
+                        if bouclalg then
+                            if show_comment then mprintf("found non convergence\n"),pause,end
+                            i=lp(1)  // first typ_l
+                            if i==[] then
+                                disp(mprintf("%s: ini_ordo (2) failed", "c_pass2"));
+                                messagebox(_("Algebraic loop."),"modal","error")
+                                ok=%f
+                                return
+                            end
+                            J=primary(i+1:$)
+                        end
+                    end
+
+                    if bouclalg then
+                        modif=%f
+                        bl=primary(i)
+
+                        nout=clkptr(bl+1)-clkptr(bl)
+                        //duplicate bl if it receives other links
+                        f=find(clkconnect(:,1)==blk&clkconnect(:,2)==port&clkconnect(:,3)==bl)
+                        h=find(clkconnect(:,3)==bl)  // this is always one
+                        if size(f,2)<>size(h,2) then
+                            nblock=nblock+1
+                            clkconnect(f,3)=nblock
+                            if  show_comment then
+                                mprintf("duplicating pivot"+string(bl)+" to obtain "+string(nblock) + "\n"),
+                            end
+                            [typ_l,clkconnect,connectmat,vbllst,dep_t,dep_u,dep_uptr,..
+                            corinv,clkptr,cliptr,critev]=duplicate_block(bl,typ_l,clkconnect,..
+                            connectmat,vbllst,dep_t,dep_u,dep_uptr,corinv,clkptr,cliptr,critev)
+                            vec(nblock)=vec(bl)
+                            //update pointer
+                            blks_bl=blks(blksptr(bl):blksptr(bl+1)-1)
+                            blks=[blks;blks_bl]
+                            blksptr($+1)=blksptr($)+size(blks_bl,"*")
+                            //
+                            bls=[bl,nblock,fblks(fblksptr(bl):fblksptr(bl+1)-1)']
+                            [eblks,eblksptr]=..
+                            update_event_depend_on(eblks,eblksptr,clkconnect,cliptr,bls)
+                            bl=nblock  // use new block as pivot
+                            lprimary(i)=bl
+                        end
+
+                        for bli=J(:)'
+                            modif=%t
+                            f=find(clkconnect(:,1)==blk&clkconnect(:,2)==port&clkconnect(:,3)==bli)
+                            clkconnect(f,1)=bl
+                            clkconnect(f,2)=1
+                            xx= clkconnect(f,:)
+                            for jj=2:nout
+                                if  show_comment then
+                                    mprintf("No block duplication but link between "+string(blk)+..
+                                    " and "+string(bli)+" replaced with links from "+..
+                                    string(bl)+" to "+string(bli) + "\n"),
+                                end
+                                xx(:,2)=jj;
+                                clkconnect=[clkconnect;xx]
+                            end
+                        end
+
+                        [eblks,eblksptr]=update_event_depend_on(eblks,eblksptr,clkconnect,cliptr,J(:)')
+                        bls=[blk,bl];bls(find(bls==0))=[];bls=bls(typ_l(bls)); //exclude non typ_l and 0
+                        [fblks,fblksptr]=update_event_activates(fblks,fblksptr,clkconnect,clkptr,bls)
+
+                        // can (must) be done outside the for loop
+                        //  [fblks2,fblksptr2]=event_activates(clkconnect,clkptr)
+                        //  [eblks2,eblksptr2]=event_depend_on(clkconnect,cliptr)
+                        //but then it must be updated
+                        //  if norm(eblksptr-eblksptr2)>0 then mprintf('roro2');pause,end
+                        //  if norm(fblksptr-fblksptr2)>0 then mprintf('soso2');pause,end
+                        //  if norm(eblks-eblks2)>0 then mprintf('roro');pause,end
+                        //  if norm(fblks-fblks2)>0 then mprintf('soso');pause,end
+
+
+                        if ~modif then messagebox(_("Algebraic loop."),"modal","error"),ok=%f,return,end
+                    else
+                        primary0=primary0(k);
+                        prt0=prt0(k)
+                        [primary0,prt0]=aggregate(primary0,prt0)
+                        [mi,In]=gsort(-Vec(primary0))
+                        if blk<>0 then
+                            lordclk(clkptr(blk)+port-1)=[primary0(In),prt0(In)]
+
+                            if  show_comment then
+                                mprintf("for blk port "+string(blk)+" "+string(port)+..
+                                " ordclk is :\n"), disp(lordclk(clkptr(blk)+port-1)),
+                            end
+                        else
+                            cord=[primary0(In),prt0(In)]
+                        end
+
+                        todo(1,:)=[]
+                        L=[];
+                        for Bi=lprimary'
+                            C=[1:clkptr(Bi+1)-clkptr(Bi)]'
+                            L=[L;Bi*ones(C),C]
+                        end
+                        todo=merge_mat(todo,L)
+                    end
+                else
+                    if blk<>0 then
+                        J=clkptr(blk)+port-1
+                        lordclk(J)=[]
+                        if  show_comment then
+                            mprintf("for blk port "+string(blk)+" "+string(port)+..
+                            " ordclk is"), mprintf(lordclk(J) + "\n"),
+                        end
+                    else
+                        cord=[]
+                    end
+
+                    todo(1,:)=[]
+                end
+            else
+                todo(1,:)=[]
+            end
+        end
+    end
+
+    for J=1:clkptr($)-1
+        ordclk=[ordclk;lordclk(J)]
+        ordptr=[ordptr;ordptr($)+size(lordclk(J),1)]
+    end
+
+    bllst=list(bllst(vbllst))
+
+endfunction
+
+function  [primary0,port0]=aggregate(primary0,port0)
+    primary=discardprimary([primary0,port0]) // must rewrite
+    primary0=primary(:,1);port0=primary(:,2)
+endfunction
+
+
+function [parents]=get_parents2(parents,blk,port)
+    k=size(parents,1)+1;
+    f=find(clkconnect(:,3)==blk)
+    n_f=size(f,2)
+    if n_f>0 then
+        for i=1:n_f
+            if clkconnect(f(i),4)==port then
+                clki1=clkconnect(f(i),1)
+                clki2=clkconnect(f(i),2)
+                g=find(clki1==parents(:,1))
+                if g==[] | (g~=[] & parents(g,2)~=clki2) then
+                    parents(k,1)=clki1
+                    parents(k,2)=clki2
+                    k=k+1
+                end
+            end
+        end
+    end
+endfunction
+
+//suppression des liens inutiles
+function [clkconnect,amaj]=find_del_inutile(clkconnect,vec_plus,typ_l)
+    amaj=[]
+    for i=1:size(vec_plus,1)
+        blk=vec_plus(i,1)
+        port=vec_plus(i,2)
+        parents=get_parents2([],blk,port)
+        j=1
+        done=%f
+        n_p=size(parents,1)
+        while j<=n_p & ~done
+            par1=parents(j,1)
+            if par1~=0 & typ_l(par1) then
+                n_out=clkptr(par1+1)-clkptr(par1)
+                f=find(par1==parents(:,1))
+                if size(f,2)==n_out then
+                    if show_comment then
+                        mprintf("find_del_inutile:")
+                        mprintf("link between blocks "+string(par1)+" and "+string(blk)+..
+                        " are deleted\n")
+                        pause
+                    end
+                    [clkconnect]=del_inutile(clkconnect,par1,n_out,blk,port)
+                    done=%t
+                    amaj=[amaj;par1;blk]
+                end
+            end
+            j=j+1
+        end
+    end
+endfunction
+
+function [clkconnect]=del_inutile(clkconnect,blk0,n_out,blk,port)
+    f=find(clkconnect(:,1)==blk0)
+    del=[]
+    for i=1:size(f,2)
+        if clkconnect(f(i),3)==blk & clkconnect(f(i),4)==port then
+            del=[del;f(i)]
+        end
+    end
+    clkconnect(del,:)=[]
+    p=get_parents([],blk0)
+    n_p=size(p,1)
+    for i=1:n_p
+        clkconnect($+1,:)=[p(i,1),p(i,2),blk,port]
+    end
+endfunction
+
+
+function  blk0=get_father(blk1,vectmp)
+    gg=find(clkconnect(:,3)==blk1) // parents of blk1
+    del=find(clkconnect(gg,1)==0)
+    gg(del)=[]  // remove continuous-time source
+    // it is inactive
+    hh=find(vectmp(clkconnect(gg,1))>0) // keep active ones
+    blk0=unique(clkconnect(gg(hh),1)) // active parent(s)
+    blk0=blk0(typ_l(blk0)) // can be a vector
+endfunction
+
+function [bouclalg,vec,typ_l,clkconnect,connectmat,bllst,dep_t,dep_u,..
+    dep_uptr,corinv,clkptr,cliptr,critev]=ini_ordo2(primary,..
+    clkconnect,connectmat,bllst,typ_l,dep_t,dep_u,dep_uptr,corinv,clkptr,..
+    cliptr,critev)
+
+    n_p=size(primary,1)
+
+    nblock=size(typ_l,1);
+    //initialisation de vec
+    //on initialise vec � -1
+    vec=-ones(nblock,1)
+    vec(primary(:,1))=1
+
+    bouclalg=%f
+    fromfixe=%f
+    oldvec2=[]
+    counter2=0
+
+    [wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr]=prim_calc(primary)
+
+    while ~fromfixe
+        vec=update_vec3(vec,wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr)
+        //
+        if and(vec==oldvec2) then
+            fromfixe=%t
+        else
+            oldvec2=vec
+        end
+        counter2=counter2+1
+        if (counter2>n_p+1) then
+            bouclalg=%t
+            //      mprintf('Algebraic Loop detection.')
+            break
+        end
+    end
+endfunction
+
+function [bouclalg,vec]=ini_ordo3(primary)
+
+    n_p=size(primary,1)
+
+    nblock=size(typ_l,1);
+    //initialisation de vec
+    //on initialise vec � -1
+    vec=-ones(nblock,1)
+    vec(primary(:,1))=0
+
+    bouclalg=%f
+    fromfixe=%f
+    oldvec2=[]
+    counter2=0
+
+    [wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr]=prim_calc(primary)
+
+    while ~fromfixe
+        vec=update_vec4(vec,wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr)
+
+        if and(vec==oldvec2) then
+            fromfixe=%t
+        else
+            oldvec2=vec
+        end
+        counter2=counter2+1
+        if (counter2>n_p+1) then
+            bouclalg=%t
+            //      mprintf('Algebraic Loop detection.')
+            break
+        end
+    end
+endfunction
+
+
+function  vec=update_vec3(vec,wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr)
+    for i=1:size(wprimptr,"*")-1
+        w=wprim(wprimptr(i):wprimptr(i+1)-1)
+        g0=g0prim(g0primptr(i):g0primptr(i+1)-1)
+        g=gprim(gprimptr(i):gprimptr(i+1)-1)
+        // detecting algebraic loops within a single cluster
+        //mprintf([px,py,size(blks,'*')])
+        vec(w)=max(vec(w))
+        if (g0 ~= []) then
+            vec(w(1))=max(vec(w(1)),max(vec(g0))+1)
+        end
+        //g=g(find(vec(g)>-1))  //not optimal  test max(vec(g))
+        if g~=[] then
+            vec(w)=vec(w)-1
+            vec(w)=max(vec(w),max(vec(g)))+1
+        end
+    end
+endfunction
+
+function  vec=update_vec4(vec,wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr)
+    for i=1:size(wprimptr,"*")-1
+        w=wprim(wprimptr(i):wprimptr(i+1)-1)
+        g0=g0prim(g0primptr(i):g0primptr(i+1)-1)
+        if g0<>[] then vec(w(1))=max(vec(w(1)),max(vec(g0))), end
+        vec(w(2:$))=vec(w(1))+1
+    end
+endfunction
+
+function [wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr]=prim_calc(primary)
+    wprim=[];wprimptr=1
+    gprim=[];gprimptr=1
+    g0prim=[];g0primptr=1
+
+
+    for i=1:size(primary,"*")
+        w0=primary(i)
+        if typ_l(w0) then
+            w=get_allchilds(w0,fblks,fblksptr,typ_l)
+            j=find(w==w0)
+            w([1,j])=w([j,1])  // put w0 on top
+        else
+            w=w0;
+        end
+        wprim=[wprim;w(:)]
+        wprimptr($+1)=wprimptr($)+size(w,"*")
+
+        px=blksptr(w(1));py=blksptr(w(1)+1)-1
+        //mprintf([px,py,size(blks,'*')])
+        g0prim=[g0prim;blks(px:py)]
+        g0primptr($+1)=g0primptr($)+size(px:py,2)
+
+        g=[]
+        for i1=2:size(w,"*") // 1 is done already
+            px=blksptr(w(i1));py=blksptr(w(i1)+1)-1
+            g=[g;blks(px:py)]
+        end
+        gprim=[gprim;g]
+        gprimptr($+1)=gprimptr($)+size(g,"*")
+    end
+endfunction
+
+function primary=discardprimary(primary)
+    // discard
+    mma=max(primary(:,2))+1
+    con=mma*primary(:,1)+primary(:,2)
+    [junk,ind]=gsort(-con);con=-junk
+    primary=primary(ind,:)
+    // discard duplicate calls to the same block port
+    if size(con,"*")>=2 then
+        primary(find(con(2:$)-con(1:$-1)==0),:)=[]
+    end
+    // group calls to different ports of the same block.
+    primary=[primary(:,1),2^(primary(:,2)-ones(primary(:,2)))]
+    primary=int(primary)
+    con=primary(:,1)
+    clkconnectjj=[]
+    if size(con,"*")>=2 then
+        iini=[find(con(2:$)-con(1:$-1)<>0),size(primary,1)]
+    else
+        iini=1
+    end
+    for ii=iini
+        clkconnectjj=[clkconnectjj;[primary(ii,1),..
+        mysum(primary(find(primary(:,1)==primary(ii,1)),2))]]
+    end
+    primary=clkconnectjj
+endfunction
+
+
+
+
+function [ordclk,iord,oord,zord,typ_z,ok]=scheduler(inpptr,outptr,clkptr,execlk_cons,..
+    outoin,outoinptr,evoutoin,evoutoinptr,typ_z,typ_x,typ_l,bexe,boptr,..
+    blnk,blptr,ordclk,ordptr,cord,dep_t,dep_u,dep_uptr);
+
+    nblk=size(typ_x,1)
+    //compute iord
+    if execlk_cons<>[] then
+        vec=-ones(1,nblk)
+        no_tu_dep=execlk_cons(:,1)
+        wec=zeros(1,nblk)
+        wec(no_tu_dep')=execlk_cons(:,2)'
+        vec(no_tu_dep)=0*no_tu_dep'
+        [r,ok]=newc_tree2(vec,outoin,outoinptr,dep_u,dep_uptr)
+
+        iord=[r,wec(r)']
+    else
+        iord=[]
+    end
+    //
+    if ~ok then
+        disp(mprintf("%s: scheduling failed", "c_pass2"));
+        messagebox(_("Algebraic loop."),"modal","error");
+        iord=[],oord=[],zord=[],critev=[]
+        return,
+    end
+
+    n=size(cord,1)
+    vec=-ones(1,nblk);
+    vec(cord(:,1))=0;
+    typp=zeros(typ_l);typp(typ_l)=1
+
+    ext_cord1=cord;
+    j=1
+    while %t
+        ii=ext_cord1(j,1)
+        if typ_l(ii)
+            for i=[clkptr(ii):clkptr(ii+1)-1]
+                ext_cord1=[ext_cord1;ordclk([ordptr(i):ordptr(i+1)-1],:)];
+            end
+        end
+        j=j+1
+        if j>size(ext_cord1,1) then break;end
+    end
+    // code to replace faulty unique which reorders
+    yy=ext_cord1(:,1)'
+    [xx,kkn]=unique(yy);
+    ext_cord=yy(-gsort(-kkn))
+    //ext_cord=unique(ext_cord1(:,1)');
+    //for i=ext_cord
+    //  if typ_l(i) then typ_z(i)=clkptr(i+1)-clkptr(i)-1;end
+    //end  // adding zero crossing surfaces to cont. time synchros
+
+    //a supprimer
+
+    [ext_cord_old,ok]=newc_tree3(vec,dep_u,dep_uptr,typp);
+
+    if or(gsort(ext_cord_old)<>gsort(ext_cord)) then pause,end
+    //
+    //pour mettre a zero les typ_z qui ne sont pas dans ext_cord
+    //noter que typ_z contient les tailles des nzcross (peut etre >1)
+    typ_z(ext_cord)=-typ_z(ext_cord)
+    typ_z=-min(typ_z,0)
+
+    if ~ok then mprintf("serious bug, report.");pause;end
+    // ext_cord=ext_cord(n+1:$);
+
+    typ_z_save=typ_z
+
+    fin=0
+    while ~fin
+        fin=1
+        for i=ext_cord($:-1:1)
+            for ii=[outoin(outoinptr(i):outoinptr(i+1)-1,1)',..
+                evoutoin(evoutoinptr(i):evoutoinptr(i+1)-1,1)']
+                //ii est un block affecte par changement de sortie du
+                //i-eme block de oord
+                if typ_z(ii) then
+                    if typ_z(i)==0 then typ_z(i)=1;fin=0;end
+                end
+                if typ_x(ii) then
+                    if ~typ_x(i) then typ_x(i)=%t;fin=0;end
+                end
+                if typ_z(i)&typ_x(i) then break,end
+            end
+        end
+    end
+    //supprimer les blocks a supprimer
+    ind=find(typ_z(cord(:,1)));
+    zord=cord(ind,:)
+    ind=find(typ_x(cord(:,1)));
+    oord=cord(ind,:)
+    typ_z=typ_z_save
+    //critev: vecteur indiquant si evenement est important pour tcrit
+    //Donc les blocks indiques sont des blocks susceptibles de produire
+    //des discontinuites quand l'evenement se produit
+    maX=max([ext_cord1(:,2);ordclk(:,2)])+1;
+    cordX=ext_cord1(:,1)*maX+ext_cord1(:,2);
+
+    // 1: important; 0:non
+    //n=clkptr(nblk+1)-1 //nb d'evenement
+    n=size(ordptr,"*")-1 //nb d'evenement
+
+    //a priori tous les evenemets sont non-importants
+    //critev=zeros(n,1)
+    for i=1:n
+        for hh=ordptr(i):ordptr(i+1)-1
+            jj= ordclk(hh,1) //block excite par evenement i
+            //Following line is not correct because of ever active synchros
+            if or(jj*maX+ordclk(hh,2)==cordX) then
+                ordclk(hh,2)=-ordclk(hh,2)
+            end
+        end
+    end
+endfunction
+
+function [ord,ok]=tree3(vec,dep_ut,typ_l)
+    //compute blocks execution tree
+    ok=%t
+    nb=size(vec,"*")
+    for j=1:nb+2
+        fini=%t
+        for i=1:nb
+            if vec(i)==j-1&typ_l(i)<>-1 then
+                if j==nb+2 then
+                    disp(mprintf("%s: tree (3) failed", "c_pass2"));
+                    messagebox(_("Algebraic loop."),"modal","error");ok=%f;ord=[];return;
+                end
+                if typ_l(i)==1 then
+                    fini=%f;
+                    kk=bexe(boptr(i):boptr(i+1)-1)';
+                else
+                    kk=[];
+                    for ii=blnk(blptr(i):blptr(i+1)-1)'
+                        if vec(ii)>-1 & (dep_ut(ii,1) | (typ_l(ii)==1)) then
+                            fini=%f;
+                            kk=[kk ii];
+                        end
+                    end
+                end
+                vec(kk)=j*ones(kk) ;   //mprintf(vec)
+            end
+        end
+        if fini then break;end
+    end
+    [k,ord]=gsort(-vec);
+    ord(find(k==1))=[];
+endfunction
+
+function [clkconnectj_cons]=discard(clkptr,cliptr,clkconnect,exe_cons)
+
+    if exe_cons<>[] then
+        clkconnectj=exe_cons
+        mma=max(clkconnectj(:,2))+1
+        con=mma*(clkconnectj(:,1))+clkconnectj(:,2)
+        [junk,ind]=gsort(-con);con=-junk
+        clkconnectj=clkconnectj(ind,:)
+        // discard duplicate calls to the same block port
+        if size(con,"*")>=2 then
+            clkconnectj(find(con(2:$)-con(1:$-1)==0),:)=[]
+        end
+        // group calls to different ports of the same block.
+        clkconnectj=[clkconnectj(:,1),2^(clkconnectj(:,2)-ones(clkconnectj(:,2)))]
+        clkconnectj=int(clkconnectj)
+        con=clkconnectj(:,1)
+        clkconnectj_cons=[]
+        if size(con,"*")>=2 then
+            iini=[find(con(2:$)-con(1:$-1)<>0),size(clkconnectj,1)]
+        else
+            iini=1
+        end
+        for ii=iini
+            clkconnectj_cons=[clkconnectj_cons;[clkconnectj(ii,1),..
+            mysum(clkconnectj(find(clkconnectj(:,1)==clkconnectj(ii,1)),2))]]
+        end
+    else
+        clkconnectj_cons=[]
+    end
+endfunction
+
+function a=mysum(b)
+    if b<>[] then a=sum(b), else a=[], end
+endfunction
+
+function [lnksz,lnktyp,inplnk,outlnk,clkptr,cliptr,inpptr,outptr,xptr,zptr,..
+    ozptr,typ_mod,rpptr,ipptr,opptr,xc0,xcd0,xd0,oxd0,rpar,..
+    ipar,opar,typ_z,typ_x,typ_m,funs,funtyp,initexe,labels,uids,..
+    bexe,boptr,blnk,blptr,ok]=extract_info(bllst,connectmat,clkconnect,typ_l)
+
+    ok=%t
+    nbl=length(bllst)
+    clkptr=zeros(nbl+1,1);clkptr(1)=1
+    cliptr=clkptr;inpptr=cliptr;outptr=inpptr;
+    xptr=1;zptr=1;ozptr=1;
+    rpptr=clkptr;ipptr=clkptr;opptr=clkptr;
+    //
+    xc0=[];xcd0=[];xd0=[];
+    oxd0=list()
+    rpar=[];ipar=[];
+    opar=list();
+
+    fff=ones(nbl,1)==1
+    typ_z=zeros(nbl,1);typ_x=fff;typ_m=fff;typ_mod=zeros(nbl,1);
+
+    initexe=[];
+    funs=list();
+    funtyp=zeros(typ_z)
+    labels=[]
+    uids=[]
+    [ok,bllst]=adjust_inout(bllst,connectmat)
+    if ok then
+        [ok,bllst]=adjust_typ(bllst,connectmat)
+    end
+
+    // placed here to make sure nzcross and nmode correctly updated
+    if ~ok then
+        lnksz=[],lnktyp=[],inplnk=[],outlnk=[],clkptr=[],cliptr=[],inpptr=[],outptr=[],..
+        xptr=[],zptr=[],ozptr=[],rpptr=[],ipptr=[],opptr=[],xc0=[],..
+        xcd0=[],xd0=[],oxd0=list(),rpar=[],ipar=[],opar=list(),..
+        typ_z=[],typ_x=[],typ_m=[],funs=[],funtyp=[],initexe=[],..
+        labels=[],uids=[],bexe=[],boptr=[],blnk=[],blptr=[]
+        return;
+    end
+    for i=1:nbl
+        ll=bllst(i)
+
+        if type(ll.sim)==15 then
+            funs(i)=ll.sim(1)
+            funtyp(i,1)=ll.sim(2)
+        else
+            funs(i)=ll.sim;
+            funtyp(i,1)=0;
+        end
+        if funtyp(i,1)>999&funtyp(i,1)<10000 then
+            if ~c_link(funs(i)) then
+                messagebox(msprintf(_("A C or Fortran block is used but not linked.\n"+..
+                "You can save your compiled diagram and load it.\n"+..
+                "This will automatically link the C or Fortran function.")),"modal","error")
+            end
+        end
+        inpnum=ll.in;outnum=ll.out;cinpnum=ll.evtin;coutnum=ll.evtout;
+        //
+        inpptr(i+1)=inpptr(i)+size(inpnum,"*")
+        outptr(i+1)=outptr(i)+size(outnum,"*")
+        cliptr(i+1)=cliptr(i)+size(cinpnum,"*")
+        clkptr(i+1)=clkptr(i)+size(coutnum,"*")
+        //
+        X0=ll.state(:)
+        if funtyp(i,1)<10000 then
+            xcd0=[xcd0;0*X0]
+            xc0=[xc0;X0]
+            xptr(i+1)=xptr(i)+size(ll.state,"*")
+        else
+            xcd0=[xcd0;X0($/2+1:$)]
+            xc0=[xc0;X0(1:$/2)]
+            xptr(i+1)=xptr(i)+size(ll.state,"*")/2
+        end
+
+        //dstate
+        if (funtyp(i,1)==3 | funtyp(i,1)==5 | funtyp(i,1)==10005) then //sciblocks
+            if ll.dstate==[] then xd0k=[]; else xd0k=var2vec(ll.dstate);end
+        else
+            xd0k=ll.dstate(:)
+        end
+        xd0=[xd0;xd0k]
+        zptr(i+1)=zptr(i)+size(xd0k,"*")
+
+        //odstate
+        if type(ll.odstate)==15 then
+            if ((funtyp(i,1)==5) | (funtyp(i,1)==10005)) then //sciblocks : don't extract
+                if lstsize(ll.odstate)>0 then
+                    oxd0($+1)=ll.odstate
+                    ozptr(i+1)=ozptr(i)+1;
+                else
+                    ozptr(i+1)=ozptr(i);
+                end
+            elseif ((funtyp(i,1)==4)    | (funtyp(i,1)==10004) |...
+                (funtyp(i,1)==2004) | (funtyp(i,1)==12004))  //C blocks : extract
+                ozsz=lstsize(ll.odstate);
+                if ozsz>0 then
+                    for j=1:ozsz, oxd0($+1)=ll.odstate(j), end;
+                    ozptr(i+1)=ozptr(i)+ozsz;
+                else
+                    ozptr(i+1)=ozptr(i);
+                end
+            else
+                ozptr(i+1)=ozptr(i);
+            end
+        else
+            //add an error message here please !
+            ozptr(i+1)=ozptr(i);
+        end
+
+        //mod
+        typ_mod(i)=ll.nmode;
+        if typ_mod(i)<0 then
+            messagebox(msprintf(_("Number of modes in block #%d cannot be determined."),i),"modal","error")
+            ok=%f
+        end
+
+        //real paramaters
+        if (funtyp(i,1)==3 | funtyp(i,1)==5 | funtyp(i,1)==10005) then //sciblocks
+            if ll.rpar==[] then rpark=[]; else rpark=var2vec(ll.rpar);end
+        else
+            rpark=ll.rpar(:)
+        end
+        rpar=[rpar;rpark]
+        rpptr(i+1)=rpptr(i)+size(rpark,"*")
+
+        //integer parameters
+        if type(ll.ipar)==1 then
+            ipar=[ipar;ll.ipar(:)]
+            ipptr(i+1)=ipptr(i)+size(ll.ipar,"*")
+        else
+            ipptr(i+1)=ipptr(i)
+        end
+
+        //object parameters
+        if type(ll.opar)==15 then
+            if ((funtyp(i,1)==5) | (funtyp(i,1)==10005)) then //sciblocks : don't extract
+                if lstsize(ll.opar)>0 then
+                    opar($+1)=ll.opar
+                    opptr(i+1)=opptr(i)+1;
+                else
+                    opptr(i+1)=opptr(i);
+                end
+            elseif ((funtyp(i,1)==4)    | (funtyp(i,1)==10004) |...
+                (funtyp(i,1)==2004) | (funtyp(i,1)==12004)) then //C blocks : extract
+                oparsz=lstsize(ll.opar);
+                if oparsz>0 then
+                    for j=1:oparsz, opar($+1)=ll.opar(j), end;
+                    opptr(i+1)=opptr(i)+oparsz;
+                else
+                    opptr(i+1)=opptr(i);
+                end
+            else
+                opptr(i+1)=opptr(i);
+            end
+        else
+            //add an error message here please !
+            opptr(i+1)=opptr(i);
+        end
+
+        //    typ_z(i)=ll.blocktype=='z'
+        typ_z(i)=ll.nzcross
+        if typ_z(i)<0 then
+            messagebox(msprintf(_("Number of zero crossings in block #%d cannot be determined."),i),"modal","error")
+            ok=%f
+        end
+        typ_x(i)=ll.state<>[]|ll.blocktype=="x" // some blocks like delay
+        // need to be in oord even
+        // without state
+
+        typ_m(i)=ll.blocktype=="m"
+        //
+        if ll.evtout<>[] then
+            ll11=ll.firing
+            prt=find(ll11>=zeros(ll11))
+            nprt=prod(size(prt))
+            initexe=[initexe;[i*ones(nprt,1),matrix(prt,nprt,1),matrix(ll11(prt),nprt,1)]];
+        end
+
+        if type(ll.label)==10 then
+            labels=[labels;ll.label(1)]
+        else
+            labels=[labels;" "]
+        end
+
+        if type(ll.uid)==10 then
+            uids=[uids;ll.uid(1)]
+        else
+            uids=[uids;" "]
+        end
+    end
+
+    clkconnect=clkconnect(find(clkconnect(:,1)<>0),:);
+
+    con=clkptr(clkconnect(:,1))+clkconnect(:,2)-1;
+    [junk,ind]=gsort(-con);con=-junk;
+    clkconnect=clkconnect(ind,:);
+    //
+    bclkconnect=clkconnect(:,[1 3]);
+    boptr=1;
+    bexe=[];
+    for i=1:nbl
+        r=bclkconnect(find(bclkconnect(:,1)==i),2);
+        bexe=[bexe;r];
+        boptr=[boptr;boptr($)+size(r,1)];
+    end
+    //
+
+    blptr=1;
+    blnk=[];
+
+    for i=1:nbl
+        r=connectmat(find(connectmat(:,1)==i),3:4);
+        blnk=[blnk;r];
+        blptr=[blptr;blptr($)+size(r,1)];
+    end
+    //
+
+    nlnk=size(connectmat,1)
+    inplnk=zeros(inpptr($)-1,1);outlnk=zeros(outptr($)-1,1);ptlnk=1;
+    lnksz=[];lnktyp=[];
+    for jj=1:nlnk
+        ko=outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1)
+        ki=inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1)
+        if ko<>0 & ki<>0 then
+            if ko>ki then
+                outlnk(outlnk>ko)=outlnk(outlnk>ko)-1
+                outlnk(outlnk==ko)=ki
+                inplnk(inplnk>ko)=inplnk(inplnk>ko)-1
+                inplnk(inplnk==ko)=ki
+                ptlnk=-1+ptlnk
+                lnksz(ko,1)=[];
+                lnksz(ko,2)=[];
+                lnktyp(ko) =[];
+            elseif ki>ko
+                outlnk(outlnk>ki)=outlnk(outlnk>ki)-1
+                outlnk(outlnk==ki)=ko
+                inplnk(inplnk>ki)=inplnk(inplnk>ki)-1
+                inplnk(inplnk==ki)=ko
+                ptlnk=-1+ptlnk
+                lnksz(ki,1)=[];
+                lnksz(ki,2)=[];
+                lnktyp(ki) =[];
+            end
+        elseif ko<>0 then
+            inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1)=ko
+        elseif ki<>0 then
+            outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1)=ki
+        else
+            outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1)=ptlnk
+            inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1)=ptlnk
+            lnksz(ptlnk,1)=bllst(connectmat(jj,1)).out(connectmat(jj,2));
+            lnksz(ptlnk,2)=bllst(connectmat(jj,1)).out2(connectmat(jj,2));
+            lnktyp(ptlnk)=bllst(connectmat(jj,1)).outtyp(connectmat(jj,2));
+            ptlnk=1+ptlnk
+        end
+    end
+
+    //store unconnected outputs, if any, at the end of outtb
+    unco=find(outlnk==0);
+    for j=unco
+        m=max(find(outptr<=j))
+        n=j-outptr(m)+1
+        nm=bllst(m).out(n)
+        if nm<1 then
+            under_connection(corinv(m),n,nm,-1,0,0,1),ok=%f,return,
+        end
+        nm2=bllst(m).out2(n)
+        if nm2<1 then
+            under_connection(corinv(m),n,nm2,-1,0,0,1),ok=%f,return,
+        end
+        lnksz($+1,1)=bllst(m).out(n);
+        lnksz($,2)=bllst(m).out2(n);
+        lnktyp($+1)=bllst(m).outtyp(n);
+        outlnk(j)=max(outlnk)+1
+    end
+
+    //store unconnected inputs, if any, at the end of outtb
+    unco=find(inplnk==0);
+    for j=unco
+        m=max(find(inpptr<=j))
+        n=j-inpptr(m)+1
+        nm=bllst(m).in(n)
+        if nm<1 then
+            under_connection(corinv(m),n,nm,-2,0,0,1),ok=%f,return,
+        end
+        nm2=bllst(m).in2(n)
+        if nm2<1 then
+            under_connection(corinv(m),n,nm2,-2,0,0,1),ok=%f,return,
+        end
+        lnksz($+1,1)=bllst(m).in(n);
+        lnksz($,2)=bllst(m).in2(n);
+        lnktyp($+1)=bllst(m).intyp(n);
+        inplnk(j)=max([inplnk;max(outlnk)])+1
+    end
+
+endfunction
+
+function [outoin,outoinptr]=conn_mat(inpptr,outptr,inplnk,outlnk)
+    outoin=[];outoinptr=1
+    nblk=size(inpptr,1)-1
+    for i=1:nblk
+        k=outptr(i):outptr(i+1)-1
+        ii=[]
+        for j=outlnk(k)'
+            ii=[ii,find(inplnk==j)]
+        end
+        outoini=[];jj=0
+        for j=ii
+            m=max(find(inpptr<=j))
+            n=j-inpptr(m)+1
+            outoini=[outoini;[m,n]]
+            jj=jj+1
+        end
+        outoinptr=[outoinptr;outoinptr($)+jj]
+        outoin=[outoin;outoini]
+    end
+endfunction
+
+function [ord,ok]=tree2(vec,outoin,outoinptr,dep_ut)
+    //compute blocks execution tree
+    ok=%t;
+
+    nb=size(vec,"*");
+    for j=1:nb+2
+        fini=%t
+        for i=1:nb
+            if vec(i)==j-1 then
+                if j==nb+2 then
+                    disp(mprintf("%s: tree (2) failed", "c_pass2"));
+                    messagebox(_("Algebraic loop."),"modal","error");ok=%f;ord=[];return;
+                end
+                for k=outoinptr(i):outoinptr(i+1)-1
+                    ii=outoin(k,1);
+                    //indport=find(dep_u(dep_uptr(ii):dep_uptr(ii+1)-1)==1);
+                    //if (indport ~=[] &vec(ii)>-1) then
+                    if (dep_ut(ii) &vec(ii)>-1) then
+                        fini=%f;
+                        vec(ii)=j;
+                    end
+                end
+            end
+        end
+        if fini then break;end
+    end
+
+    [k,ord]=gsort(-vec);
+    ord(find(k==1))=[];
+    ord=ord(:)
+endfunction
+
+
+//adjust_inout : it resolves positive, negative and null size
+//               of in/out port dimensions of connected block.
+//               If it's not done in a first pass, the second
+//               pass try to resolve negative or null port
+//               dimensions by asking user to informed dimensions
+//               with underconnection function.
+//               It is a fixed point algorithm.
+//
+//in parameters  : bllst : list of blocks
+//
+//                 connectmat : matrix of connection
+//                              connectmat(lnk,1) : source block
+//                              connectmat(lnk,2) : source port
+//                              connectmat(lnk,3) : target block
+//                              connectmat(lnk,4) : target port
+//
+//out parameters : ok : a boolean flag to known if adjust_inout have
+//                      succeeded to resolve the in/out port size
+//                      - ok = %t : all size have been resolved in bllst
+//                      - ok = %f : problem in size adjustement
+//
+//                 bllst : modified list of blocks
+//
+//18/05/06, Alan  : improvement in order to take into
+//                  account two dimensional port size.
+//
+//28/12/06, Alan : type for source port and target port must
+//                 be the same.
+//
+//29/12/06, Fady : type for source and target can be different
+//                 in one condition that they are double and complex.
+//                 the result on the link will be complex.
+//
+//04/01/07, Fady : Can test the case of negatives equals target's dimensions.
+//
+//19/01/07, Alan : - Return correct information for user in editor
+//                   with preceding test of Fady in the first pass
+//                 - Second pass reviewed : under_connection returns two dimensions now
+//
+//10/05/07, Alan : - if-then-else event-select case
+
+function [ok,bllst]=adjust_inout(bllst,connectmat)
+
+    //Adjust in2/out2, inttyp/outtyp
+    //in accordance to in/out in bllst
+    [ko,bllst]=adjust_in2out2(bllst);
+    if ~ko then ok=%f,return, end //if adjust_in2out2 failed then exit
+    //adjust_inout with flag ok=%f
+
+    nlnk=size(connectmat,1) //nlnk is the number of link
+
+    //loop on number of block (pass 1 and pass 2)
+    for hhjj=1:length(bllst)+1
+        //%%%%% pass 1 %%%%%//
+        for hh=1:length(bllst)+1 //second loop on number of block
+            ok=%t
+            for jj=1:nlnk //loop on number of link
+
+                //intyp/outtyp are the type of the
+                //target port and the source port of the observed link
+                outtyp = bllst(connectmat(jj,1)).outtyp(connectmat(jj,2))
+                intyp = bllst(connectmat(jj,3)).intyp(connectmat(jj,4))
+                //nnin/nnout are the size (two dimensions) of the
+                //target port and the source port of the observed link
+                //before adjust
+                nnout(1,1)=bllst(connectmat(jj,1)).out(connectmat(jj,2))
+                nnout(1,2)=bllst(connectmat(jj,1)).out2(connectmat(jj,2))
+                nnin(1,1)=bllst(connectmat(jj,3)).in(connectmat(jj,4))
+                nnin(1,2)=bllst(connectmat(jj,3)).in2(connectmat(jj,4))
+
+                //This Part is done in adjust_typ
+
+                //check intyp/outtyp
+                //            if intyp<>outtyp then
+                //              if (intyp==1 & outtyp==2) then
+                //                bllst(connectmat(jj,3)).intyp(connectmat(jj,4))=2;
+                //              elseif (intyp==2 & outtyp==1) then
+                //                bllst(connectmat(jj,1)).outtyp(connectmat(jj,2))=2;
+                //              else
+                //                if bllst(connectmat(jj,3)).sim(2)<0 //if-then-else/eselect case
+                //                  bllst(connectmat(jj,3)).intyp(connectmat(jj,4))=...
+                //                    bllst(connectmat(jj,1)).outtyp(connectmat(jj,2))
+                //                else
+                //                  bad_connection(corinv(connectmat(jj,1)),connectmat(jj,2),..
+                //                                 nnout,outtyp,..
+                //                                 corinv(connectmat(jj,3)),connectmat(jj,4),..
+                //                                 nnin,intyp,1)
+                //                  ok=%f;
+                //                  return
+                //                end
+                //              end
+                //            end
+
+                //loop on the two dimensions of source/target port
+                for ndim=1:2
+                    //check test source/target sizes
+                    //in case of negatif equal target dimensions
+                    //nin/nout are the size (two dimensions) of the
+                    //target port and the source port of the observed link
+                    nout(1,1)=bllst(connectmat(jj,1)).out(connectmat(jj,2))
+                    nout(1,2)=bllst(connectmat(jj,1)).out2(connectmat(jj,2))
+                    nin(1,1)=bllst(connectmat(jj,3)).in(connectmat(jj,4))
+                    nin(1,2)=bllst(connectmat(jj,3)).in2(connectmat(jj,4))
+
+                    //first case : dimension of source and
+                    //             target ports are explicitly informed
+                    //             informed with positive size
+                    if(nout(1,ndim)>0&nin(1,ndim)>0) then
+                        //if dimension of source and target port doesn't match
+                        //then call bad_connection, set flag ok to false and exit
+                        if nin(1,ndim)<>nout(1,ndim) then
+                            bad_connection(corinv(connectmat(jj,1)),connectmat(jj,2),..
+                            nnout,outtyp,..
+                            corinv(connectmat(jj,3)),connectmat(jj,4),..
+                            nnin,intyp)
+                            ok=%f;return
+                        end
+
+                        //second case : dimension of source port is
+                        //              positive and dimension of
+                        //              target port is negative
+                    elseif(nout(1,ndim)>0&nin(1,ndim)<0) then
+                        //find vector of input ports of target block with
+                        //first/second dimension equal to size nin(1,ndim)
+                        //and assign it to nout(1,ndim)
+                        ww=find(bllst(connectmat(jj,3)).in==nin(1,ndim))
+                        bllst(connectmat(jj,3)).in(ww)=nout(1,ndim)
+                        ww=find(bllst(connectmat(jj,3)).in2==nin(1,ndim))
+                        bllst(connectmat(jj,3)).in2(ww)=nout(1,ndim)
+
+                        //find vector of output ports of target block with
+                        //first/second dimension equal to size nin(1,ndim)
+                        //and assign it to nout(1,ndim)
+                        ww=find(bllst(connectmat(jj,3)).out==nin(1,ndim))
+                        bllst(connectmat(jj,3)).out(ww)=nout(1,ndim)
+                        ww=find(bllst(connectmat(jj,3)).out2==nin(1,ndim))
+                        bllst(connectmat(jj,3)).out2(ww)=nout(1,ndim)
+
+                        //find vector of output ports of target block with
+                        //ndim dimension equal to zero and sum the ndim
+                        //dimension of all input ports of target block
+                        //to be the new dimension of the ndim dimension
+                        //of the output ports of the target block
+                        if ndim==1 then
+                            ww=find(bllst(connectmat(jj,3)).out==0)
+                            if (ww<>[]&min(bllst(connectmat(jj,3)).in(:))>0) then
+                                bllst(connectmat(jj,3)).out(ww)=sum(bllst(connectmat(jj,3)).in(:))
+                            end
+                        elseif ndim==2 then
+                            ww=find(bllst(connectmat(jj,3)).out2==0)
+                            if (ww<>[]&min(bllst(connectmat(jj,3)).in2(:))>0) then
+                                bllst(connectmat(jj,3)).out2(ww)=sum(bllst(connectmat(jj,3)).in2(:))
+                            end
+                        end
+
+                        //if nzcross of the target block match with
+                        //the negative dimension nin(1,ndim) then
+                        //adjust it to nout(1,ndim)
+                        if bllst(connectmat(jj,3)).nzcross==nin(1,ndim) then
+                            bllst(connectmat(jj,3)).nzcross=nout(1,ndim)
+                        end
+                        //if nmode of the target block match with
+                        //the negative dimension nin(1,ndim) then
+                        //adjust it to nout(1,ndim)
+                        if bllst(connectmat(jj,3)).nmode==nin(1,ndim) then
+                            bllst(connectmat(jj,3)).nmode=nout(1,ndim)
+                        end
+
+                        //third case : dimension of source port is
+                        //             negative and dimension of
+                        //             target port is positive
+                    elseif(nout(1,ndim)<0&nin(1,ndim)>0) then
+                        //find vector of output ports of source block with
+                        //first/second dimension equal to size nout(1,ndim)
+                        //and assign it to nin(1,ndim)
+                        ww=find(bllst(connectmat(jj,1)).out==nout(1,ndim))
+                        bllst(connectmat(jj,1)).out(ww)=nin(1,ndim)
+                        ww=find(bllst(connectmat(jj,1)).out2==nout(1,ndim))
+                        bllst(connectmat(jj,1)).out2(ww)=nin(1,ndim)
+
+                        //find vector of input ports of source block with
+                        //first/second dimension equal to size nout(1,ndim)
+                        //and assign it to nin(1,ndim)
+                        ww=find(bllst(connectmat(jj,1)).in==nout(1,ndim))
+                        bllst(connectmat(jj,1)).in(ww)=nin(1,ndim)
+                        ww=find(bllst(connectmat(jj,1)).in2==nout(1,ndim))
+                        bllst(connectmat(jj,1)).in2(ww)=nin(1,ndim)
+
+                        //find vector of input ports of source block with
+                        //ndim dimension equal to zero and sum the ndim
+                        //dimension of all output ports of source block
+                        //to be the new dimension of the ndim dimension
+                        //of the input ports of the source block
+                        if ndim==1 then
+                            ww=find(bllst(connectmat(jj,1)).in==0)
+                            if (ww<>[]&min(bllst(connectmat(jj,1)).out(:))>0) then
+                                bllst(connectmat(jj,1)).in(ww)=sum(bllst(connectmat(jj,1)).out(:))
+                            end
+                        elseif ndim==2 then
+                            ww=find(bllst(connectmat(jj,1)).in2==0)
+                            if (ww<>[]&min(bllst(connectmat(jj,1)).out2(:))>0) then
+                                bllst(connectmat(jj,1)).in2(ww)=sum(bllst(connectmat(jj,1)).out2(:))
+                            end
+                        end
+
+                        //if nzcross of the source block match with
+                        //the negative dimension nout(1,ndim) then
+                        //adjust it to nin(1,ndim)
+                        if bllst(connectmat(jj,1)).nzcross==nout(1,ndim) then
+                            bllst(connectmat(jj,1)).nzcross=nin(1,ndim)
+                        end
+                        //if nmode of the source block match with
+                        //the negative dimension nout(1,ndim) then
+                        //adjust it to nin(1,ndim)
+                        if bllst(connectmat(jj,1)).nmode==nout(1,ndim) then
+                            bllst(connectmat(jj,1)).nmode=nin(1,ndim)
+                        end
+
+                        //fourth case : a dimension of source port is
+                        //              null
+                    elseif(nout(1,ndim)==0) then
+                        //set ww to be the vector of size of the ndim
+                        //dimension of input port of the source block
+                        if ndim==1 then
+                            ww=bllst(connectmat(jj,1)).in(:)
+                        elseif ndim==2 then
+                            ww=bllst(connectmat(jj,1)).in2(:)
+                        end
+
+                        //test if all size of the ndim dimension of input
+                        //port of the source block is positive
+                        if min(ww)>0 then
+                            //test if the dimension of the target port
+                            //is positive
+                            if nin(1,ndim)>0 then
+
+                                //if the sum of the size of the ndim dimension of the input
+                                //port of the source block is equal to the size of the ndim dimension
+                                //of the target port, then the size of the ndim dimension of the source
+                                //port is equal to nin(1,ndim)
+                                if sum(ww)==nin(1,ndim) then
+                                    if ndim==1 then
+                                        bllst(connectmat(jj,1)).out(connectmat(jj,2))=nin(1,ndim)
+                                    elseif ndim==2 then
+                                        bllst(connectmat(jj,1)).out2(connectmat(jj,2))=nin(1,ndim)
+                                    end
+                                    //else call bad_connection, set flag ok to false and exit
+                                else
+                                    bad_connection(corinv(connectmat(jj,1)),0,0,1,-1,0,0,1)
+                                    ok=%f;return
+                                end
+
+                                //if the ndim dimension of the target port is negative
+                                //then the size of the ndim dimension of the source port
+                                //is equal to the sum of the size of the ndim dimension
+                                //of input ports of source block, and flag ok is set to false
+                            else
+                                if ndim==1 then
+                                    bllst(connectmat(jj,1)).out(connectmat(jj,2))=sum(ww)
+                                elseif ndim==2 then
+                                    bllst(connectmat(jj,1)).out2(connectmat(jj,2))=sum(ww)
+                                end
+                                ok=%f
+                            end
+
+                        else
+                            //set nww to be the vector of all negative size of input ports
+                            //of the source block
+                            nww=ww(find(ww<0))
+
+                            //if all negative size have same size and if size of the
+                            //ndim dimension of the target port is positive then assign
+                            //size of the ndim dimension of the source port to nin(1,ndim)
+                            if norm(nww-nww(1),1)==0 & nin(1,ndim)>0 then
+                                if ndim==1 then
+                                    bllst(connectmat(jj,1)).out(connectmat(jj,2))=nin(1,ndim)
+                                elseif ndim==2 then
+                                    bllst(connectmat(jj,1)).out2(connectmat(jj,2))=nin(1,ndim)
+                                end
+
+                                //compute a size to be the difference between the size
+                                //of the ndim dimension of the target block and sum of positive
+                                //size of input ports of the source block divided by the number
+                                //of input ports of source block with same negative size
+                                k=(nin(1,ndim)-sum(ww(find(ww>0))))/size(nww,"*")
+
+                                //if this size is a positive integer then assign it
+                                //to the size of the ndim dimension of input ports of the
+                                //source block which have negative size
+                                if k==int(k)&k>0 then
+                                    if ndim==1 then
+                                        bllst(connectmat(jj,1)).in(find(ww<0))=k
+                                    elseif ndim==2 then
+                                        bllst(connectmat(jj,1)).in2(find(ww<0))=k
+                                    end
+                                    //else call bad_connection, set flag ok to false and exit
+                                else
+                                    bad_connection(corinv(connectmat(jj,1)),0,0,1,-1,0,0,1)
+                                    ok=%f;return
+                                end
+
+                                //set flag ok to false
+                            else
+                                ok=%f
+                            end
+
+                        end
+
+                        //fifth case : a dimension of target port is
+                        //             null
+                    elseif(nin(1,ndim)==0) then
+                        //set ww to be the vector of size of the ndim
+                        //dimension of output port of the target block
+                        if ndim==1 then
+                            ww=bllst(connectmat(jj,3)).out(:)
+                        elseif ndim==2 then
+                            ww=bllst(connectmat(jj,3)).out2(:)
+                        end
+
+                        //test if all size of the ndim dimension of output
+                        //port of the target block is positive
+                        if min(ww)>0 then
+                            //test if the dimension of the source port
+                            //is positive
+                            if nout(1,ndim)>0 then
+
+                                //if the sum of the size of the ndim dimension of the output
+                                //port of the target block is equal to the size of the ndim dimension
+                                //of the source port, then the size of the ndim dimension of the target
+                                //port is equal to nout(1,ndim)
+                                if sum(ww)==nout(1,ndim) then
+                                    if ndim==1 then
+                                        bllst(connectmat(jj,3)).in(connectmat(jj,4))=nout(1,ndim)
+                                    elseif ndim==2 then
+                                        bllst(connectmat(jj,3)).in2(connectmat(jj,4))=nout(1,ndim)
+                                    end
+                                    //else call bad_connection, set flag ok to false and exit
+                                else
+                                    bad_connection(corinv(connectmat(jj,3)),0,0,1,-1,0,0,1)
+                                    ok=%f;return
+                                end
+
+                                //if the ndim dimension of the source port is negative
+                                //then the size of the ndim dimension of the target port
+                                //is equal to the sum of the size of the ndim dimension
+                                //of output ports of target block, and flag ok is set to false
+                            else
+                                if ndim==1 then
+                                    bllst(connectmat(jj,3)).in(connectmat(jj,4))=sum(ww)
+                                elseif ndim==2 then
+                                    bllst(connectmat(jj,3)).in2(connectmat(jj,4))=sum(ww)
+                                end
+                                ok=%f
+                            end
+
+                        else
+                            //set nww to be the vector of all negative size of output ports
+                            //of the target block
+                            nww=ww(find(ww<0))
+
+                            //if all negative size have same size and if size of the
+                            //ndim dimension of the source port is positive then assign
+                            //size of the ndim dimension of the target port to nout(1,ndim)
+                            if norm(nww-nww(1),1)==0 & nout(1,ndim)>0 then
+                                if ndim==1 then
+                                    bllst(connectmat(jj,3)).in(connectmat(jj,4))=nout(1,ndim)
+                                elseif ndim==2 then
+                                    bllst(connectmat(jj,3)).in2(connectmat(jj,4))=nout(1,ndim)
+                                end
+
+                                //compute a size to be the difference between the size
+                                //of the ndim dimension of the source block and sum of positive
+                                //size of output ports of the target block divided by the number
+                                //of output ports of target block with same negative size
+                                k=(nout(1,ndim)-sum(ww(find(ww>0))))/size(nww,"*")
+
+                                //if this size is a positive integer then assign it
+                                //to the size of the ndim dimension of output ports of the
+                                //target block which have negative size
+                                if k==int(k)&k>0 then
+                                    if ndim==1 then
+                                        bllst(connectmat(jj,3)).out(find(ww<0))=k
+                                    elseif ndim==2 then
+                                        bllst(connectmat(jj,3)).out2(find(ww<0))=k
+                                    end
+                                    //else call bad_connection, set flag ok to false and exit
+                                else
+                                    bad_connection(corinv(connectmat(jj,3)),0,0,1,-1,0,0,1)
+                                    ok=%f;return
+                                end
+
+                                //set flag ok to false
+                            else
+                                ok=%f
+                            end
+
+                        end
+
+                        //sixth (& last) case : dimension of both source
+                        //                      and target port are negatives
+                    else
+                        ok=%f //set flag ok to false
+                    end
+                end
+            end
+            if ok then return, end //if ok is set true then exit adjust_inout
+        end
+        //if failed then display message
+        messagebox(msprintf(_("Not enough information to find port sizes.\n"+..
+        "I try to find the problem.")),"modal","info");
+
+        //%%%%% pass 2 %%%%%//
+        //Alan 19/01/07 : Warning  : Behavior have changed, To Be more Tested
+        findflag=%f //set findflag to false
+
+        for jj=1:nlnk //loop on number of block
+            //nin/nout are the size (two dimensions) of the
+            //target port and the source port of the observed link
+            nout(1,1)=bllst(connectmat(jj,1)).out(connectmat(jj,2))
+            nout(1,2)=bllst(connectmat(jj,1)).out2(connectmat(jj,2))
+            nin(1,1)=bllst(connectmat(jj,3)).in(connectmat(jj,4))
+            nin(1,2)=bllst(connectmat(jj,3)).in2(connectmat(jj,4))
+
+            //loop on the two dimensions of source/target port
+            //only case : target and source ports are both
+            //            negatives or null
+            if nout(1,1)<=0&nin(1,1)<=0 | nout(1,2)<=0&nin(1,2)<=0 then
+                findflag=%t;
+                //
+                ninnout=under_connection(corinv(connectmat(jj,1)),connectmat(jj,2),nout(1,ndim),..
+                corinv(connectmat(jj,3)),connectmat(jj,4),nin(1,ndim),1)
+                //
+                if size(ninnout,2) <> 2 then ok=%f;return;end
+                if ninnout==[] then ok=%f;return;end
+                if ninnout(1,1)<=0 | ninnout(1,2)<=0 then ok=%f;return;end
+                //
+                ww=find(bllst(connectmat(jj,1)).out==nout(1,1))
+                bllst(connectmat(jj,1)).out(ww)=ninnout(1,1)
+                ww=find(bllst(connectmat(jj,1)).out2==nout(1,1))
+                bllst(connectmat(jj,1)).out2(ww)=ninnout(1,1)
+
+                ww=find(bllst(connectmat(jj,1)).out==nout(1,2))
+                bllst(connectmat(jj,1)).out(ww)=ninnout(1,2)
+                ww=find(bllst(connectmat(jj,1)).out2==nout(1,2))
+                bllst(connectmat(jj,1)).out2(ww)=ninnout(1,2)
+                //
+
+                if bllst(connectmat(jj,1)).nzcross==nout(1,1) then
+                    bllst(connectmat(jj,1)).nzcross=ninnout(1,1)
+                end
+                if bllst(connectmat(jj,1)).nzcross==nout(1,2) then
+                    bllst(connectmat(jj,1)).nzcross=ninnout(1,2)
+                end
+                //
+                if bllst(connectmat(jj,1)).nmode==nout(1,1) then
+                    bllst(connectmat(jj,1)).nmode=ninnout(1,1)
+                end
+                if bllst(connectmat(jj,1)).nmode==nout(1,2) then
+                    bllst(connectmat(jj,1)).nmode=ninnout(1,2)
+                end
+                //
+                ww=find(bllst(connectmat(jj,1)).in==nout(1,1))
+                bllst(connectmat(jj,1)).in(ww)=ninnout(1,1)
+                ww=find(bllst(connectmat(jj,1)).in2==nout(1,1))
+                bllst(connectmat(jj,1)).in2(ww)=ninnout(1,1)
+
+                ww=find(bllst(connectmat(jj,1)).in==nout(1,2))
+                bllst(connectmat(jj,1)).in(ww)=ninnout(1,2)
+                ww=find(bllst(connectmat(jj,1)).in2==nout(1,2))
+                bllst(connectmat(jj,1)).in2(ww)=ninnout(1,2)
+                //
+                ww=find(bllst(connectmat(jj,1)).in==0)
+                if (ww<>[]&min(bllst(connectmat(jj,1)).out(:))>0) then
+                    bllst(connectmat(jj,1)).in(ww)=sum(bllst(connectmat(jj,1)).out)
+                end
+
+                ww=find(bllst(connectmat(jj,1)).in2==0)
+                if (ww<>[]&min(bllst(connectmat(jj,1)).out2(:))>0) then
+                    bllst(connectmat(jj,1)).in2(ww)=sum(bllst(connectmat(jj,1)).out2)
+                end
+                //
+                ww=find(bllst(connectmat(jj,3)).in==nin(1,1))
+                bllst(connectmat(jj,3)).in(ww)=ninnout(1,1)
+                ww=find(bllst(connectmat(jj,3)).in2==nin(1,1))
+                bllst(connectmat(jj,3)).in2(ww)=ninnout(1,1)
+
+                ww=find(bllst(connectmat(jj,3)).in==nin(1,2))
+                bllst(connectmat(jj,3)).in(ww)=ninnout(1,2)
+                ww=find(bllst(connectmat(jj,3)).in2==nin(1,2))
+                bllst(connectmat(jj,3)).in2(ww)=ninnout(1,2)
+                //
+                if bllst(connectmat(jj,3)).nzcross==nin(1,1) then
+                    bllst(connectmat(jj,3)).nzcross=ninnout(1,1)
+                end
+                if bllst(connectmat(jj,3)).nzcross==nin(1,2) then
+                    bllst(connectmat(jj,3)).nzcross=ninnout(1,2)
+                end
+                if bllst(connectmat(jj,3)).nmode==nin(1,1) then
+                    bllst(connectmat(jj,3)).nmode=ninnout(1,1)
+                end
+                if bllst(connectmat(jj,3)).nmode==nin(1,2) then
+                    bllst(connectmat(jj,3)).nmode=ninnout(1,2)
+                end
+                //
+                ww=find(bllst(connectmat(jj,3)).out==nin(1,1))
+                bllst(connectmat(jj,3)).out(ww)=ninnout(1,1)
+                ww=find(bllst(connectmat(jj,3)).out2==nin(1,1))
+                bllst(connectmat(jj,3)).out2(ww)=ninnout(1,1)
+
+                ww=find(bllst(connectmat(jj,3)).out==nin(1,2))
+                bllst(connectmat(jj,3)).out(ww)=ninnout(1,2)
+                ww=find(bllst(connectmat(jj,3)).out2==nin(1,2))
+                bllst(connectmat(jj,3)).out2(ww)=ninnout(1,2)
+                //
+                ww=find(bllst(connectmat(jj,3)).out==0)
+                if (ww<>[]&min(bllst(connectmat(jj,3)).in(:))>0) then
+                    bllst(connectmat(jj,3)).out(ww)=sum(bllst(connectmat(jj,3)).in(:))
+                end
+                ww=find(bllst(connectmat(jj,3)).out2==0)
+                if (ww<>[]&min(bllst(connectmat(jj,3)).in2(:))>0) then
+                    bllst(connectmat(jj,3)).out2(ww)=sum(bllst(connectmat(jj,3)).in2(:))
+                end
+            end
+        end
+
+        //if failed then display message
+        if ~findflag then
+            messagebox(msprintf(_("I cannot find a link with undetermined size.\n"+..
+            "My guess is that you have a block with unconnected \n"+..
+            "undetermined output ports.")),"modal","error");
+            ok=%f;return;
+        end
+    end
+endfunction
+
+function id = getBlockIds(path)
+    // Return a block id path from a block index path
+    //
+    // path: the path in the index form
+    // id: th path in the uid form
+
+    scs_m; // check scs_m access
+    id=[];
+
+    k = path(:);
+    for i = k
+        b = scs_m.objs(i);
+        if typeof(b) == "Block" &  size(scs_m.objs(i).doc) >= 1 then
+            id($ + 1) = scs_m.objs(i).doc(1);
+        end
+        if typeof(b.model.rpar) == "diagram" then
+            scs_m = b.model.rpar;
+        end
+    end
+endfunction
+
+//19/01/07, Alan : under_connection show bad link and returns two dimensions now
+function ninnout=under_connection(path_out,prt_out,nout,path_in,prt_in,nin,flagg)
+    // alert for badly connected blocks
+    // path_out : Path of the "from block" in scs_m
+    // path_in  : Path of the "to block" in scs_m
+    //!
+
+    if path_in==-1 then
+        msg = "<html><body>";
+        msg = msg + gettext("One of this block output has negative size.<br />Please check.");
+        msg = msg + "</body></html>";
+        hilite_path(path_out, msg);
+        ninnout=0
+        return
+    end
+
+    if path_in==-2 then
+        msg = "<html><body>";
+        msg = msg + gettext("Block input has negative size:");
+        msg = msg + "<ul>";
+        msg = msg + "<li>" + msprintf(gettext("Input port %s size is: %s"), string(prt_out), sci2exp(nout)) + "</li>";
+        msg = msg + "</ul>";
+        msg = msg + "</body></html>";
+        hilite_path(path_out, msg);
+        ninnout=0
+        return
+    end
+
+    // different use case (Unable to report on a non opened diagram)
+    if isdef("Code_gene_run") then
+        messagebox([gettext("Unable to report an error into a SuperBlock"); gettext("Please compile the diagram to report the error.")], "Compilation error", "error", "modal");
+        ninnout=0
+        return
+    end
+
+    msg = "<html><body>";
+    if flagg==1 then
+        msg = msg + gettext("<em>Please update the diagram to avoid this warning.</em><br />Block output port has a non-determined size:");
+        msg = msg + "<ul>";
+        msg = msg + "<li>" + msprintf(gettext("Output port %s size is: %s"), string(prt_out), sci2exp(nout)) + "</li>";
+        msg = msg + "<li>" + msprintf(gettext("Input port %s size is: %s"), string(prt_in), sci2exp(nin)) + "</li>";
+    else
+        msg = msg + gettext("<em>Please update the diagram to avoid this warning.</em><br />Block output port has a non-determined type:");
+        msg = msg + "<ul>";
+        msg = msg + "<li>" + msprintf(gettext("Output port %s type."), string(prt_out)) + "</li>";
+        msg = msg + "<li>" + msprintf(gettext("Input port %s type."), string(prt_in)) + "</li>";
+    end
+    msg = msg + "</ul>";
+    msg = msg + "</body></html>";
+    hilite_path(path_out, msg)
+
+    if or(path_in<>path_out) then
+        msg = "<html><body>";
+        if flagg==1 then
+            msg = msg + gettext("<em>Please update the diagram to avoid this warning.</em><br />Block input port has a non-determined size:");
+            msg = msg + "<ul>";
+            msg = msg + "<li>" + msprintf(gettext("Output port %s size is: %s"), string(prt_out), sci2exp(nout)) + "</li>";
+            msg = msg + "<li>" + msprintf(gettext("Input port %s size is: %s"), string(prt_in), sci2exp(nin)) + "</li>";
+        else
+            msg = msg + gettext("<em>Please update the diagram to avoid this warning.</em><br />Block input port has a non-determined type:");
+            msg = msg + "<ul>";
+            msg = msg + "<li>" + msprintf(gettext("Output port %s type."), string(prt_out)) + "</li>";
+            msg = msg + "<li>" + msprintf(gettext("Input port %s type."), string(prt_in)) + "</li>";
+        end
+        msg = msg + "</ul>";
+        msg = msg + "</body></html>";
+        hilite_path(path_in, msg)
+    end
+
+    mess=msprintf(_("Highlighted block(s) have connected ports \nwith  sizes that cannot be determined by the context.\nWhat is the size of this link?"))
+
+    if flagg==1 then
+        ninnout=evstr(dialog(mess,"[1,1]"))
+    else
+        ninnout=evstr(dialog(mess,"1"))
+    end
+endfunction
+
+function [clkconnect,exe_cons]=pak_ersi(connectmat,clkconnect,..
+    typ_r,typ_l,outoin,outoinptr,tblock,typ_cons,clkptr)
+
+    //add every event to the time event because time includes all events
+    all_out=[]
+    for k=1:size(clkptr,1)-1
+        if ~typ_l(k) then
+            kk=[1:(clkptr(k+1)-clkptr(k))]'
+            all_out=[all_out;[k*ones(kk),kk]]
+        end
+    end
+    all_out=[all_out;[0,0]]
+
+    //add time event if needed
+    ind=find(tblock)
+    ind=ind(:)
+    for k=ind'
+        clkconnect=[clkconnect;[all_out,ones(all_out)*[k,0;0,0]]]
+    end
+    if show_trace then mprintf("c_pass4444:\t%f\n", timer()),end
+    ind1=find(typ_cons)
+    ind=[ind;ind1(:)]
+    exe_cons=[ind,zeros(ind)]
+
+    vec=-ones(1,nblk);
+    vec(ind)=0
+    [r,ok]=newc_tree4(vec,outoin,outoinptr,typ_r)
+
+    exe_cons=[exe_cons;r]
+
+    if show_trace then mprintf("c_pass4445:\t%f\n", timer()),end
+
+    [clkr,clkc]=size(clkconnect);
+    mm=max(clkconnect(:,2))+1;
+    cll=clkconnect(:,1)*mm+clkconnect(:,2);
+    [cll,ind]=gsort(-cll);
+    clkconnect=clkconnect(ind,:);
+    if cll<>[] then mcll=max(-cll)+1, else mcll=1;end
+    cll=[-1;-cll;mcll];
+    ii=find(cll(2:$)-cll(1:$-1)<>0)
+
+    for k=1:size(ii,"*")-1
+        oo=[ii(k):ii(k+1)-1]
+        vec=-ones(1,nblk);
+        vec(clkconnect(oo,3))=0
+        [r,ok]=newc_tree4(vec,outoin,outoinptr,typ_r)
+        m=size(r,1)
+        r=[clkconnect(ii(k),1)*ones(m,1),clkconnect(ii(k),2)*ones(m,1),r]
+        clkconnect=[clkconnect;r]
+    end
+    // temporary fix to take care of conditional blocks inherting from
+    // constants: make these blocks always active
+
+    ind=setdiff(find(typ_l),clkconnect(:,3))
+    ind=ind(:)
+    for k=ind'
+        clkconnect=[clkconnect;[all_out,ones(all_out)*[k,0;0,0]]]
+    end
+    // end of  temoprary fix
+    if show_trace then mprintf("c_pass4446:\t%f\n", timer()),end
+endfunction
+
+function [r,ok]=tree4(vec,outoin,outoinptr,typ_r)
+    //compute blocks which inherit
+    ok=%t;
+    nb=size(vec,"*");
+    r=[];
+    for j=1:nb-1
+        fini=%t
+        for i=1:nb
+            if vec(i)==j-1 then
+                for k=outoinptr(i):outoinptr(i+1)-1
+                    ii=outoin(k,1);
+                    if (vec(ii)>-1)|typ_r(ii) then
+                        fini=%f;
+                        vec(ii)=j;
+                    end
+                    if typ_r(ii) then
+                        r=[r;outoin(k,:)]
+                    end
+                end
+            end
+        end
+        if fini then break;end
+    end
+endfunction
+
+function [bllst,inplnk,outlnk,clkptr,cliptr,inpptr,outptr,dep_u,dep_uptr,dep_t,..
+    typ_l,typ_r,typ_m,tblock,typ_cons,typ_zx,ok]=mini_extract_info(bllst,..
+    connectmat,clkconnect)
+    ok=%t
+    nbl=length(bllst)
+    clkptr=zeros(nbl+1,1);clkptr(1)=1
+    cliptr=clkptr;inpptr=cliptr;outptr=inpptr;
+    fff=ones(nbl,1)==1
+    typ_l=fff;typ_r=fff;typ_cons=fff;typ_m=fff;typ_zx=fff;
+    dep_t=ones(nbl,1)==1;
+    dep_u=[];dep_uptr=1;
+    tblock=fff
+    //tblock=[]  // specifies blocks that must be connected to time event.
+    //
+    for i=1:nbl
+        ll=bllst(i)
+        if (ll.state==[]&ll.nzcross==0) then typ_zx(i)=%f;end
+        inpnum=ll.in;outnum=ll.out;cinpnum=ll.evtin;coutnum=ll.evtout;
+        //
+        if cinpnum==[] then
+            // this block inherits
+            //ok=%f
+
+            typ_r(i)=~ll.dep_ut($)
+            tblock(i)=ll.dep_ut($)
+            //if block depends on time but has no event input port
+            if ~ll.dep_ut($) then
+                //inherits from the inputs
+                cinpnum=ones(inpnum)
+                bllst(i).evtin=cinpnum  //XXXXXXXXXXXXXXXXXXXXX
+            end
+            //
+        else
+            tblock(i)=ll.dep_ut($);typ_r(i)=%f
+        end
+        inpptr(i+1)=inpptr(i)+size(inpnum,"*")
+        outptr(i+1)=outptr(i)+size(outnum,"*")
+        cliptr(i+1)=cliptr(i)+size(cinpnum,"*")
+        clkptr(i+1)=clkptr(i)+size(coutnum,"*")
+        //
+
+        typ_l(i)=ll.blocktype=="l";typ_m(i)=ll.blocktype=="m";
+        typ_cons(i)=cinpnum==[]&inpnum==[]&~ll.dep_ut($)
+        //test of the dep_ut size
+        sizenin=size(ll.in,"*");
+        if (size(ll.dep_ut,"*") <> 2) then
+            if ( size(ll.dep_ut(1:$-1),"*") <> sizenin) then
+                messagebox(msprintf(_("the dep_ut size of the %s block is not correct.\n"+..
+                "It should be a colon vector of size %d."),..
+                ll.sim(1),sizenin+1),"modal","error");
+                ok=%f;
+            end
+        end
+
+        dep_t(i)=ll.dep_ut($);
+
+        if (size(ll.dep_ut,"*") == 2) then
+            if (sizenin == 1) then
+                dep_u($+1)=ll.dep_ut(1);
+                dep_uptr($+1)=dep_uptr($)+1;
+            elseif (sizenin > 1) then
+                dep_u=[dep_u;ones(sizenin,1)==1*ll.dep_ut(1)];
+                dep_uptr($+1)=dep_uptr($)+sizenin;
+            else
+                dep_uptr($+1)=dep_uptr($);
+            end
+        else
+            dep_u_i=ll.dep_ut(1:$-1);
+            dep_u=[dep_u;dep_u_i(:)];
+            dep_uptr($+1)=dep_uptr($)+sizenin;
+        end
+
+        //
+    end
+    if show_trace then mprintf("c_pass22222222:\t%f\n", timer()),end //'
+    nlnk=size(connectmat,1)
+    inplnk=zeros(inpptr($)-1,1);outlnk=zeros(outptr($)-1,1);ptlnk=1;
+
+    for jj=1:nlnk
+        ko=outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1)
+        ki=inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1)
+        if ko<>0 & ki<>0 then
+            if ko>ki then
+                outlnk(outlnk>ko)=outlnk(outlnk>ko)-1
+                outlnk(outlnk==ko)=ki
+                inplnk(inplnk>ko)=inplnk(inplnk>ko)-1
+                inplnk(inplnk==ko)=ki
+                ptlnk=-1+ptlnk
+            elseif ki>ko
+                outlnk(outlnk>ki)=outlnk(outlnk>ki)-1
+                outlnk(outlnk==ki)=ko
+                inplnk(inplnk>ki)=inplnk(inplnk>ki)-1
+                inplnk(inplnk==ki)=ko
+                ptlnk=-1+ptlnk
+            end
+        elseif ko<>0 then
+            inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1)=ko
+        elseif ki<>0 then
+            outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1)=ki
+        else
+            outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1)=ptlnk
+            inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1)=ptlnk
+            ptlnk=1+ptlnk
+        end
+    end
+
+    //store unconnected outputs, if any, at the end of outtb
+    for unco=find(outlnk==0);
+        outlnk(unco)=max(outlnk)+1
+    end
+
+    //store unconnected inputs, if any, at the end of outtb
+    for unco=find(inplnk==0);
+        inplnk(unco)=max([inplnk;max(outlnk)])+1
+    end
+endfunction
+
+function [evoutoin,evoutoinptr]=synch_clkconnect(typ_l,clkconnect)
+    nblk=size(typ_l,"*")
+    evoutoin=[];evoutoinptr=1
+    for i=1:nblk
+        if typ_l(i) then
+            dd=clkconnect(clkconnect(:,1)==i,3)
+        else
+            dd=[]
+        end
+        evoutoin=[evoutoin;dd]
+        evoutoinptr=[evoutoinptr;evoutoinptr($)+size(dd,"*")]
+    end
+endfunction
+
+function   clkconnect=cleanup(clkconnect)
+    mm=max(clkconnect)+1
+    cc=clkconnect(:,4)+mm*clkconnect(:,3)+clkconnect(:,2)*mm^2+..
+    clkconnect(:,1)*mm^3
+    [cc1,ind]=gsort(-cc)
+    clkconnect=clkconnect(ind,:)
+    ind=find(cc1(2:$)-cc1(1:$-1)==0)
+    clkconnect(ind,:)=[]
+endfunction
+
+//function mat=cleanup1(mat)
+//  mm=max(mat)+1
+//  cc=mat(:,1)*mm
+//  [cc1,ind]=gsort(-cc)
+//  mat=mat(ind,:)
+//  ind=find(cc1(2:$)-cc1(1:$-1)==0)
+//  mat(ind,:)=[]
+//endfunction
+
+function vec=intersection(vec1,vec2)
+    vec=[]
+    for i=1:size(vec1,1)
+        if find(vec1(i)==vec2)~=[] then
+            vec=[vec;vec1(i)]
+        end
+    end
+endfunction
+
+function  [r,ok]=newc_tree2(vec,outoin,outoinptr,dep_u,dep_uptr)
+    dd=zeros(dep_u);dd(dep_u)=1;
+    [r,ok2]=ctree2(vec,outoin,outoinptr,dd,dep_uptr)
+    ok=ok2==1
+endfunction
+
+function  [r,ok]=new_tree2(vec,outoin,outoinptr,dep_u,dep_uptr)
+    dd=zeros(dep_u);dd(dep_u)=1;
+    [r,ok2]=sci_tree2(vec,outoin,outoinptr,dd)
+    ok=ok2==1
+endfunction
+
+function  [r,ok]=new_tree3(vec,dep_ut,typ_l)
+    dd=zeros(dep_ut);dd(dep_ut)=1;
+    [r2,ok2]=sci_tree3(vec,dd,typ_l,bexe,boptr,blnk,blptr)
+    r=r2'
+    ok=ok2==1
+endfunction
+
+function  [r,ok]=newc_tree3(vec,dep_u,dep_uptr,typ_l)
+    dd=zeros(dep_u);dd(dep_u)=1;
+    [r2,ok2]=ctree3(vec,dd,dep_uptr,typ_l,bexe,boptr,blnk,blptr)
+    r=r2'
+    ok=ok2==1
+endfunction
+
+function  [r,ok]=new_tree4(vec,outoin,outoinptr,typ_r)
+    nd=zeros(size(vec,"*"),(max(outoin(:,2))+1));
+    ddd=zeros(typ_r);ddd(typ_r)=1;
+    [r1,r2]=sci_tree4(vec,outoin,outoinptr,nd,ddd)
+    r=[r1',r2']
+    ok=%t
+endfunction
+
+function  [r,ok]=newc_tree4(vec,outoin,outoinptr,typ_r)
+    nd=zeros(size(vec,"*"),(max(outoin(:,2))+1));
+    ddd=zeros(typ_r);ddd(typ_r)=1;
+    [r1,r2]=ctree4(vec,outoin,outoinptr,nd,ddd)
+    r=[r1',r2']
+    ok=%t
+endfunction
+
+function [critev]=critical_events(connectmat,clkconnect,dep_t,typ_r,..
+    typ_l,typ_zx,outoin,outoinptr,clkptr)
+
+    typ_c=typ_l<>typ_l;
+    typ_r=typ_r|dep_t
+
+    done1=%f
+    while ~done1
+        done1=%t
+        [clkr,clkc]=size(clkconnect);
+        mm=max(clkconnect)+1;
+
+        cll=clkconnect(:,1)*mm+clkconnect(:,2);
+        [cll,ind]=gsort(-cll);
+        clkconnect=clkconnect(ind,:);
+        cll=[-1;-cll;mm];
+        ii=find(cll(2:$)-cll(1:$-1)<>0)
+
+        for k=1:size(ii,"*")-1
+            oo=[ii(k):ii(k+1)-1]
+            vec=-ones(1,nblk);
+            vec(clkconnect(oo,3))=0
+            [r,ok]=newc_tree4(vec,outoin,outoinptr,typ_r)
+
+            m=size(r,1)
+            r=[clkconnect(ii(k),1)*ones(m,1),clkconnect(ii(k),2)*ones(m,1),r]
+            clkconnect=[clkconnect;r]
+        end
+
+        done=%f;
+        while ~done
+            done=%t;
+            for jj=find(typ_l&(~typ_c));
+                if ~or(jj==clkconnect(:,3)) then
+                    typ_r(clkconnect(find(jj==clkconnect(:,1)),3))=%t
+                    clkconnect(find(jj==clkconnect(:,1)),:)=[];
+                    typ_c(jj)=%t;
+                    done1=%f
+                    done=%f
+                end
+            end
+        end
+    end
+    critev=zeros(clkptr($)-1,1);
+    for bb=1:size(clkptr,1)-1
+        for i=clkptr(bb):clkptr(bb+1)-1
+            if or(typ_zx(clkconnect(find((clkconnect(:,1)==bb)&..
+                (clkconnect(:,2)==i-clkptr(bb)+1)),3))) then
+                critev(i)=1
+            end
+        end
+    end
+endfunction
+
+// adjust_typ: It resolves positive and negative port types.
+//		   Its Algorithm is based on the algorithm of adjust_inout
+// Fady NASSIF: 14/06/2007
+
+function [ok,bllst]=adjust_typ(bllst,connectmat)
+
+    for i=1:length(bllst)
+        if size(bllst(i).in,"*")<>size(bllst(i).intyp,"*") then
+            bllst(i).intyp=bllst(i).intyp(1)*ones(bllst(i).in);
+        end
+        if size(bllst(i).out,"*")<>size(bllst(i).outtyp,"*") then
+            bllst(i).outtyp=bllst(i).outtyp(1)*ones(bllst(i).out);
+        end
+    end
+    nlnk=size(connectmat,1)
+    for hhjj=1:length(bllst)+1
+        for hh=1:length(bllst)+1
+            ok=%t
+            for jj=1:nlnk
+                nnout(1,1)=bllst(connectmat(jj,1)).out(connectmat(jj,2))
+                nnout(1,2)=bllst(connectmat(jj,1)).out2(connectmat(jj,2))
+                nnin(1,1)=bllst(connectmat(jj,3)).in(connectmat(jj,4))
+                nnin(1,2)=bllst(connectmat(jj,3)).in2(connectmat(jj,4))
+                outtyp = bllst(connectmat(jj,1)).outtyp(connectmat(jj,2))
+                intyp = bllst(connectmat(jj,3)).intyp(connectmat(jj,4))
+
+                //first case : types of source and
+                //             target ports are explicitly informed
+                //             with positive types
+                if (intyp>0 & outtyp>0) then
+                    //if types of source and target port don't match and aren't double and complex
+                    //then call bad_connection, set flag ok to false and exit
+
+                    if intyp<>outtyp then
+                        if (intyp==1 & outtyp==2) then
+                            bllst(connectmat(jj,3)).intyp(connectmat(jj,4))=2;
+                        elseif (intyp==2 & outtyp==1) then
+                            bllst(connectmat(jj,1)).outtyp(connectmat(jj,2))=2;
+                        else
+                            bad_connection(corinv(connectmat(jj,1)),connectmat(jj,2),..
+                            nnout,outtyp,..
+                            corinv(connectmat(jj,3)),connectmat(jj,4),..
+                            nnin,intyp,1)
+                            ok=%f;
+                            return
+                        end
+                    end
+
+                    //second case : type of source port is
+                    //              positive and type of
+                    //              target port is negative
+                elseif(outtyp>0&intyp<0) then
+                    //find vector of input ports of target block with
+                    //type equal to intyp
+                    //and assign it to outtyp
+                    ww=find(bllst(connectmat(jj,3)).intyp==intyp)
+                    bllst(connectmat(jj,3)).intyp(ww)=outtyp
+
+                    //find vector of output ports of target block with
+                    //type equal to intyp
+                    //and assign it to outtyp
+                    ww=find(bllst(connectmat(jj,3)).outtyp==intyp)
+                    bllst(connectmat(jj,3)).outtyp(ww)=outtyp
+
+                    //third case : type of source port is
+                    //             negative and type of
+                    //             target port is positive
+                elseif(outtyp<0&intyp>0) then
+                    //find vector of output ports of source block with
+                    //type equal to outtyp
+                    //and assign it to intyp
+                    ww=find(bllst(connectmat(jj,1)).outtyp==outtyp)
+                    bllst(connectmat(jj,1)).outtyp(ww)=intyp
+
+                    //find vector of input ports of source block with
+                    //type equal to size outtyp
+                    //and assign it to intyp
+                    ww=find(bllst(connectmat(jj,1)).intyp==outtyp)
+                    bllst(connectmat(jj,1)).intyp(ww)=intyp
+
+
+                    //fourth (& last) case : type of both source
+                    //                      and target port are negatives
+                else
+                    ok=%f //set flag ok to false
+                end
+            end
+            if ok then return, end //if ok is set true then exit adjust_typ
+        end
+        //if failed then display message
+        messagebox(msprintf(_("Not enough information to find port type.\n"+..
+        "I will try to find the problem.")),"modal","info");
+        findflag=%f
+        for jj=1:nlnk
+            nouttyp=bllst(connectmat(jj,1)).outtyp(connectmat(jj,2))
+            nintyp=bllst(connectmat(jj,3)).intyp(connectmat(jj,4))
+
+            //loop on the two dimensions of source/target port
+            //only case : target and source ports are both
+            //            negative or null
+            if nouttyp<=0 & nintyp<=0 then
+                findflag=%t;
+                //
+                inouttyp=under_connection(corinv(connectmat(jj,1)),connectmat(jj,2),nouttyp,..
+                corinv(connectmat(jj,3)),connectmat(jj,4),nintyp,2)
+                //
+                if inouttyp<1|inouttyp>8 then ok=%f;return;end
+                //
+                ww=find(bllst(connectmat(jj,1)).outtyp==nouttyp)
+                bllst(connectmat(jj,1)).outtyp(ww)=inouttyp
+
+                //
+                ww=find(bllst(connectmat(jj,1)).intyp==nouttyp)
+                bllst(connectmat(jj,1)).intyp(ww)=inouttyp
+
+                ww=find(bllst(connectmat(jj,3)).intyp==nintyp)
+                bllst(connectmat(jj,3)).intyp(ww)=inouttyp
+                //
+                ww=find(bllst(connectmat(jj,3)).outtyp==nintyp)
+                bllst(connectmat(jj,3)).outtyp(ww)=inouttyp
+
+                //
+            end
+        end
+        //if failed then display message
+        if ~findflag then
+            messagebox(msprintf(_("I cannot find a link with undetermined size.\n"+..
+            "My guess is that you have a block with unconnected \n"+..
+            "undetermined types.")),"modal","error");
+            ok=%f;return;
+        end
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/c_pass3.bin b/modules/scicos/macros/scicos_scicos/c_pass3.bin
new file mode 100755
index 000000000..b03dc50d1
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/c_pass3.bin
diff --git a/modules/scicos/macros/scicos_scicos/c_pass3.sci b/modules/scicos/macros/scicos_scicos/c_pass3.sci
new file mode 100755
index 000000000..fb888b20f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/c_pass3.sci
@@ -0,0 +1,257 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Massoud Najafi <massoud.najafi@inria.fr>
+//                      - Alan Layec <alan.layec@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [cpr,ok]=c_pass3(scs_m,cpr)
+
+    // reconstruct the block list structure
+
+    bllst=list();
+    corinv=cpr.corinv;
+    sim=cpr.sim;
+
+    for k=1:size(corinv)
+        if type(corinv(k))==1 then
+
+            if corinv(k)>size(%cpr.cor) then ok=%f;cpr=list();return;end
+
+            if size(corinv(k),"*")==1 then
+                bllst(k)=scs_m.objs(corinv(k)).model;
+            else
+                path=get_subobj_path(corinv(k));path($+1)="model";
+                bllst(k)=scs_m(path);
+            end
+        else
+
+            //-Alan/Masoud 19/12/06-
+
+            //We force here update of parameters for THE modelica block
+
+            if findinlistcmd(cpr.corinv,size(cpr.cor),">")<>list() then ok=%f;return; end
+
+            [%state0,state,sim]=modipar(corinv(k),%state0,cpr.state,sim,scs_m,cpr.cor);
+            cpr.state=state;
+            m=scicos_model();
+            //here it is assumed that modelica blocs have only scalar inputs/outputs
+
+            m.in=ones(sim.inpptr(k+1)-sim.inpptr(k),1);
+            m.out=ones(sim.outptr(k+1)-sim.outptr(k),1);
+            if sim.funtyp(k)<10000 then
+                n=(sim.xptr(k+1)-sim.xptr(k))
+            else
+                n=2*(sim.xptr(k+1)-sim.xptr(k))
+            end
+
+            m.state=cpr.state.x(sim.xptr(k)+(0:n-1));
+            m.dstate=cpr.state.z(sim.zptr(k):sim.zptr(k+1)-1);
+            m.rpar=sim.rpar(sim.rpptr(k):sim.rpptr(k+1)-1);
+            m.ipar=sim.ipar(sim.ipptr(k):sim.ipptr(k+1)-1);
+            m.label="";
+            m.sim=list(sim.funs(k),sim.funtyp(k));
+            //here it is assumed that modelica blocs does not have output events
+            bllst(k)=m;
+        end
+    end
+
+    //
+    [inpptr,outptr,inplnk,outlnk,clkptr]= sim(["inpptr","outptr","inplnk","outlnk","clkptr"])
+
+    // computes undetermined port sizes
+
+    [ok,bllst]=adjust(bllst,inpptr,outptr,inplnk,outlnk)
+
+    if ~ok then return; end
+
+    [lnksz,lnktyp]=lnkptrcomp(bllst,inpptr,outptr,inplnk,outlnk)
+
+    //
+    xptr=1;zptr=1;ozptr=1;rpptr=1;ipptr=1;opptr=1;
+    xc0=[];xcd0=[];xd0=[];oxd0=list();
+    rpar=[];ipar=[];opar=list();initexe=[];funtyp=[];labels=[];
+    funs=list();
+    //
+    for i=1:length(bllst)
+        ll=bllst(i)
+        labels=[labels;ll.label];
+        //fun and funtype
+        if type(ll.sim)==15 then
+            if ll.sim(1)<>"scifunc" then
+                funs(i)=ll.sim(1)  // replace except for compiled scifunc
+            else
+                funs(i)=%cpr.sim.funs(i)
+            end
+            funtyp(i,1)=ll.sim(2);
+        else
+            funs(i)=ll.sim;
+            funtyp(i,1)=0;
+        end
+
+        //state
+        X0=ll.state(:)
+        if funtyp(i,1)<10000 then
+            xcd0=[xcd0;0*X0]
+            xc0=[xc0;X0]
+            xptr(i+1)=xptr(i)+size(ll.state,"*")
+        else
+            xcd0=[xcd0;X0($/2+1:$)]
+            xc0=[xc0;X0(1:$/2)]
+            xptr(i+1)=xptr(i)+size(ll.state,"*")/2
+        end
+
+        //discrete state
+        if (funtyp(i,1)==3 | funtyp(i,1)==5 | funtyp(i,1)==10005) then //sciblocks
+            if ll.dstate==[] then xd0k=[]; else xd0k=var2vec(ll.dstate);end
+        else
+            xd0k=ll.dstate(:)
+        end
+        xd0=[xd0;xd0k];
+        zptr=[zptr;zptr($)+size(xd0k,"*")]
+        //object discrete state
+        if type(ll.odstate)==15 then
+            if ((funtyp(i,1)==5) | (funtyp(i,1)==10005)) then //sciblocks : don't extract
+                if lstsize(ll.odstate)>0 then
+                    oxd0($+1)=ll.odstate
+                    ozptr=[ozptr;ozptr($)+1];
+                else
+                    ozptr=[ozptr;ozptr($)];
+                end
+            elseif ((funtyp(i,1)==4) | (funtyp(i,1)==10004) | (funtyp(i,1)==2004))  //C blocks : extract
+                ozsz=lstsize(ll.odstate);
+                if ozsz>0 then
+                    for j=1:ozsz, oxd0($+1)=ll.odstate(j), end;
+                    ozptr=[ozptr;ozptr($)+ozsz];
+                else
+                    ozptr=[ozptr;ozptr($)];
+                end
+            else
+                ozptr=[ozptr;ozptr($)];
+            end
+        else
+            //add an error message here please !
+            ozptr=[ozptr;ozptr($)];
+        end
+
+        //rpar
+        if (funtyp(i,1)==3 | funtyp(i,1)==5 | funtyp(i,1)==10005) then //sciblocks
+            if ll.rpar==[] then rpark=[]; else rpark=var2vec(ll.rpar);end
+        else
+            rpark=ll.rpar(:)
+        end
+        rpar=[rpar;rpark]
+        rpptr=[rpptr;rpptr($)+size(rpark,"*")]
+        //ipar
+        if type(ll.ipar)==1 then
+            ipar=[ipar;ll.ipar(:)]
+            ipptr=[ipptr;ipptr($)+size(ll.ipar,"*")]
+        else
+            ipptr=[ipptr;ipptr($)]
+        end
+
+        //opar
+        if type(ll.opar)==15 then
+            if ((funtyp(i,1)==5) | (funtyp(i,1)==10005)) then //sciblocks : don't extract
+                if lstsize(ll.opar)>0 then
+                    opar($+1)=ll.opar
+                    opptr=[opptr;opptr($)+1];
+                else
+                    opptr=[opptr;opptr($)];
+                end
+            elseif ((funtyp(i,1)==4) | (funtyp(i,1)==10004) | (funtyp(i,1)==2004)) then //C blocks : extract
+                oparsz=lstsize(ll.opar);
+                if oparsz>0 then
+                    for j=1:oparsz, opar($+1)=ll.opar(j), end;
+                    opptr=[opptr;opptr($)+oparsz];
+                else
+                    opptr=[opptr;opptr($)];
+                end
+            else
+                opptr=[opptr;opptr($)];
+            end
+        else
+            //add an error message here please !
+            opptr=[opptr;opptr($)];
+        end
+        //
+        if ll.evtout<>[] then
+            ll11=ll.firing
+            if type(ll11)==4 then
+                //this is for backward compatibility
+                prt=find(ll11);nprt=prod(size(prt))
+                initexe=[initexe;[i*ones(nprt,1),matrix(prt,nprt,1),zeros(nprt,1)]]
+            else
+                prt=find(ll11>=zeros(ll11));nprt=prod(size(prt))
+                initexe=[initexe;..
+                [i*ones(nprt,1),matrix(prt,nprt,1),matrix(ll11(prt),nprt,1)]];
+            end
+        end
+    end
+
+    //initialize agenda
+
+    [tevts,evtspt,pointi]=init_agenda(initexe,clkptr)
+
+    sim.funtyp=funtyp
+    sim.funs=funs
+    sim.xptr=xptr
+    sim.zptr=zptr
+    sim.ozptr=ozptr
+    sim.inpptr=inpptr
+    sim.outptr=outptr
+    sim.inplnk=inplnk
+    sim.outlnk=outlnk
+    sim.rpar=rpar
+    sim.rpptr=rpptr
+    sim.ipar=ipar
+    sim.ipptr=ipptr
+    sim.opar=opar
+    sim.opptr=opptr
+    sim.clkptr=clkptr
+    sim.labels=labels
+    cpr.sim=sim;
+    outtb=list();
+
+    outtb=buildouttb(lnksz,lnktyp);
+
+    if exists("%scicos_solver")==0 then %scicos_solver=0,end
+
+    if max(funtyp)>10000 &%scicos_solver<100 then
+        messagebox(["Diagram contains Implicit blocks,"
+        "Compiling for implicit Solver"],"modal")
+        %scicos_solver=100
+    end
+
+    if (or (%scicos_solver == [100 101 102])) then xc0=[xc0;xcd0],end
+
+    nb=size(clkptr,"*")-1;
+    iz0=zeros(nb,1);
+    state=cpr.state
+    state.x=xc0;
+    state.z=xd0;
+    state.oz=oxd0;
+    state.iz=iz0;
+    state.tevts=tevts;
+    state.evtspt=evtspt;
+    state.pointi=pointi;
+    state.outtb=outtb
+    cpr.state=state
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/check_io.bin b/modules/scicos/macros/scicos_scicos/check_io.bin
new file mode 100755
index 000000000..b752347ac
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/check_io.bin
diff --git a/modules/scicos/macros/scicos_scicos/check_io.sci b/modules/scicos/macros/scicos_scicos/check_io.sci
new file mode 100755
index 000000000..e05ae58af
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/check_io.sci
@@ -0,0 +1,141 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [model,graphics,ok]=check_io(model,graphics,in,out,clkin,clkout,in_implicit,out_implicit)
+    // check_io first check if given number of ports agree with block connection
+    // and then changes block structure
+    //%parameters
+    // model   : initial and resulting block model structure
+    // graphics: initial and resulting block graphics structure
+    // in      : new input ports sizes
+    // nout    : new output ports sizes
+    // nclkin  : new event input ports sizes
+    // nclkout : new event output ports sizes
+    // in_impl : index of implicit input ports, the other ports are supposed to be explicit
+    // out_impl: index of implicit output ports , the other ports are supposed to be explicit
+    // ok      : error flag
+    //           ok==%f : some of input parameters are incorrects or
+    //                    attempt to add/delete ports when some are connected
+    //           ok==%t  : changes of block structure has been performed
+    //!
+    if argn(2)<=6 then in_implicit=[],out_implicit=[],end
+    // check_io first check if given number of ports agree with block connection
+    in=int(in(:));nin=size(in,1)
+
+    out=int(out(:));nout=size(out,1);
+
+    clkin=int(clkin(:));nclkin=size(clkin,1);
+    if nclkin>0 then
+        if min(clkin)<1 then
+            message("Event input ports sizes must be positive")
+            ok=%f
+            return
+        end
+    end
+
+
+    clkout=int(clkout(:));nclkout=size(clkout,1);
+    if nclkout>0 then
+        if min(clkout)<1 then
+            message("Event output ports sizes must be positive")
+            ok=%f
+            return
+        end
+    end
+
+
+    [label,ip1,op1,cip1,cop1]=(graphics.exprs,graphics.pin,graphics.pout,..
+    graphics.pein,graphics.peout)
+
+    [in1,out1,clkin1,clkout1]=(model.in,model.out,model.evtin,model.evtout)
+
+    n1=size(in1(:,1),"*");n=size(in(:,1),"*")
+    if n1>n then
+        ip1=ip1(1:n)
+    else
+        ip1=[ip1;zeros(n-n1,1)]
+    end
+
+    n1=size(out1,"*");n=size(out,"*")
+    if n1>n then
+        op1=op1(1:n)
+    else
+        op1=[op1;zeros(n-n1,1)]
+    end
+
+    n1=size(clkin1,"*");n=size(clkin,"*")
+    if n1>n then
+        cip1=cip1(1:n)
+    else
+        cip1=[cip1;zeros(n-n1,1)];
+    end
+
+    n1=size(clkout1,"*");n=size(clkout,"*")
+    if n1>n then
+        cop1=cop1(1:n);
+    else
+        cop1=[cop1;zeros(n-n1,1)];
+    end
+
+    I="E";
+
+
+    if ip1<>[] then
+        in_impl=I(ones(ip1)); in_impl(in_implicit)="I";
+    else
+        in_impl=[]
+    end
+
+
+    if op1<>[] then
+        out_impl=I(ones(op1));  out_impl(out_implicit)="I";
+    else
+        out_impl=[]
+    end
+
+    ok=%t
+
+    graphics.pin=ip1
+    graphics.pout=op1
+    graphics.pein=cip1
+    graphics.peout=cop1
+    graphics.in_implicit=in_impl
+    graphics.out_implicit=out_impl
+
+    if size(in1,2)<=1 then
+        model.in=in
+    elseif size(in1,2)==2 then //This appears not to be useful, retained if case of?
+        disp("check_io : unexpected case")
+        model.in=[in,2*ones(in)];
+    end
+
+    if size(out1,2)<=1 then
+        model.out=out
+    elseif size(out1,2)==2 then //This appears not to be useful, retained if case of?
+        disp("check_io : unexpected case")
+        model.out=[out,2*ones(out)];
+    end
+    model.evtin=clkin
+    model.evtout=clkout
+
+
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/check_mac.bin b/modules/scicos/macros/scicos_scicos/check_mac.bin
new file mode 100755
index 000000000..1c4a3ff7d
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/check_mac.bin
diff --git a/modules/scicos/macros/scicos_scicos/check_mac.sci b/modules/scicos/macros/scicos_scicos/check_mac.sci
new file mode 100755
index 000000000..fb47f6401
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/check_mac.sci
@@ -0,0 +1,29 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function ok=check_mac(txt)
+    //errcatch doesnt work poperly
+    ok=%t
+    if execstr("comp(mac)","errcatch")<>0 then
+        messagebox(["Incorrect syntax: ";lasterror()],"modal")
+        ok=%f
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/color.tst b/modules/scicos/macros/scicos_scicos/color.tst
new file mode 100755
index 000000000..b5f1b0004
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/color.tst
@@ -0,0 +1,61 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+xsetech([0 0 1 1],[0 0 1 1])
+orig=[0 0]
+sz=[1 1]
+
+thick=xget('thickness');xset('thickness',2);
+xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);
+xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;
+orig(1)+(1-1/5)*sz(1),orig(1)+sz(1)/5];
+yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;
+orig(2)+sz(2)/5,orig(2)+(1-1/5)*sz(2)];
+xarrows(xx,yy);
+t=(0:0.3:2*%pi)'
+xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);
+yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);
+xpoly(xx,yy,'lines');
+xset('thickness',thick)
+
+
+
+orig=[0.5 0.5]
+
+
+
+wd=xget('wdim').*[1.016,1.12];
+thick=xget('thickness');xset('thickness',2);
+p=wd(2)/wd(1);p=1;
+rx=sz(1)*p/2;ry=sz(2)/2;
+xarcs([orig(1)+0.05*sz(1);
+orig(2)+0.95*sz(2);
+   0.9*sz(1)*p;
+   0.9*sz(2);
+   0;
+   360*64],default_color(-1));
+xset('thickness',1);
+xx=[orig(1)+rx    orig(1)+rx;
+    orig(1)+rx    orig(1)+rx+0.6*rx*cos(%pi/6)];
+yy=[orig(2)+ry    orig(2)+ry ;
+  orig(2)+1.8*ry  orig(2)+ry+0.6*ry*sin(%pi/6)];
+xsegs(xx,yy,10);
+xset('thickness',thick);
diff --git a/modules/scicos/macros/scicos_scicos/compile_init_modelica.bin b/modules/scicos/macros/scicos_scicos/compile_init_modelica.bin
new file mode 100755
index 000000000..6a7d643fe
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/compile_init_modelica.bin
diff --git a/modules/scicos/macros/scicos_scicos/compile_init_modelica.sci b/modules/scicos/macros/scicos_scicos/compile_init_modelica.sci
new file mode 100755
index 000000000..ec5587ccc
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/compile_init_modelica.sci
@@ -0,0 +1,140 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+// Compilation needed by the graphical interface for intitialization
+
+function   [ok]=compile_init_modelica(xmlmodel,paremb,jaco)
+
+    if exists("%scicos_solver")==0 then
+        %scicos_solver = 0 ;
+    end
+
+    if ~exists("%scicos_debug_gr") then
+        %scicos_debug_gr = %f; //** debug mode : default is "%f"
+    end
+
+
+    MODELICAC_FILENAME = "modelicac";
+    if getos() == "Windows" then
+        MODELICAC_FILENAME = MODELICAC_FILENAME + ".exe";
+    end
+
+    // called by Initilization IHM
+    lines(0);
+    global icpr;
+
+    //set paths for generated files
+    outpath = pathconvert(TMPDIR,%t,%t);
+
+    // created files for initialization
+    xmlfile = outpath + xmlmodel + "_init.xml"; // file created by translator
+    namei = xmlmodel + "i";
+    Flati = outpath + xmlmodel + "i.mo";
+    FlatCi = outpath + xmlmodel + "i.c";    // computational C function associated to the flat model for initialization
+    incidencei = outpath + xmlmodel + "i_incidence_matrix.xml";
+    Flat_functions = outpath + xmlmodel + "_functions" + ".mo"; // file created by translator
+
+    //--------------------------------------------------------------------
+    ok = xml2modelica(xmlfile, Flati)
+    if ~ok then return,end
+
+    if jaco == "0" then
+        JAC = "";
+    else
+        JAC = " -jac "; // to generate the analytical jacobian
+    end
+
+    tmpdir = pathconvert(TMPDIR, %t, %t);  //for error log and  shell scripts
+
+    exe = """" + pathconvert(getmodelicacpath() + MODELICAC_FILENAME, %f, %t) + """";
+    Flati = " """ + Flati + """";
+
+    // generates the computational C function associated to the flat model
+    instr = exe + Flati + "" + JAC + " -with-init-in """ + strsubst(xmlfile,"\","/") + ..
+    """ -with-init-out """ + strsubst(xmlfile,"\","/") + """ -o """ + ..
+    FlatCi + """";
+
+
+    if getos() == "Windows" then
+        mputl(instr, tmpdir + "igenm.bat");
+        instr = tmpdir + "igenm.bat";
+    end
+
+    [rep,stat,err]=unix_g(instr);
+    if stat == 0 then
+        mprintf("%s"," Init C code   : "+FlatCi);
+        mprintf("\n\r");
+
+        ok = Link_modelica_C(FlatCi);
+        [nipar, nrpar, nopar, nz, nx, nx_der, nx_ns, nin, nout, nm, ng, dep_u] = reading_incidence(incidencei);
+
+        if (~ok) then
+            return;
+        end
+
+    else
+        messagebox(err, _("Modelica compiler (flat2C)"), "error", "modal");
+        ok = %f;
+        return
+    end
+
+    //build model data structure of the block equivalent to the implicit
+    bllst = bllst;
+    nblock = length(bllst);
+    mdl = bllst(nblock);
+    mdl.sim = list(namei, 10004);
+    mdl.state = zeros(nx * 2, 1);
+    mdl.dstate = zeros(nz, 1);
+    mdl.nzcross = ng;
+    mdl.nmode = nm;
+    mdl.in = ones(nin, 1);
+    mdl.out = ones(nout, 1);
+    mdl.dep_ut = [dep_u, %t];
+    bllst(nblock) = mdl;
+    if size(connectmat, 2) == 6 then
+        connectmat = connectmat(:,[1 2 4 5]);
+    end
+    scs_m = null();
+
+    icpr = list();
+    if exists(%scicos_solver) == 0 | (exists(%scicos_solver) <> 0 & %scicos_solver < 100) then
+        %scicos_solver = 100;
+    end
+    icpr = c_pass2(bllst, connectmat, clkconnect, cor, corinv);
+
+    if icpr == list() then
+        ok = %f;
+        return,
+    end
+
+    // suppressing display blocks
+    Ignore=["bouncexy", "cscope", "cmscope", "canimxy", "canimxy3d", "cevscpe", "cfscope", "cscopexy", ..
+    "cscopexy3d", "cscopxy", "cscopxy3d", "cmatview", "cmat3d", "affich", "affich2", "BPLATFORM"];
+
+    for i = 1:length(icpr.sim.funs)
+        if type(icpr.sim.funs(i)) <> 13 then
+            if find(icpr.sim.funs(i)(1) == Ignore) <> [] then
+                icpr.sim.funs(i)(1) = "trash";
+            end
+        end
+    end
+endfunction
+//-----------------------------------------------------------------------------
+
diff --git a/modules/scicos/macros/scicos_scicos/compile_modelica.bin b/modules/scicos/macros/scicos_scicos/compile_modelica.bin
new file mode 100755
index 000000000..b28efcf0f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/compile_modelica.bin
diff --git a/modules/scicos/macros/scicos_scicos/compile_modelica.sci b/modules/scicos/macros/scicos_scicos/compile_modelica.sci
new file mode 100755
index 000000000..b0feda73b
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/compile_modelica.sci
@@ -0,0 +1,141 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Serge Steer <serge.steer@inria.fr> - 2003
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [ok,name,nipar,nrpar,nopar,nz,nx,nx_der,nx_ns,nin,nout,nm,ng,dep_u]=compile_modelica(filemo,Mblocks)
+
+    // Copyright INRIA
+    // Modelica_Init becomes true only in "Modelicainitialize_.sci"
+    if exists("%Modelica_Init")==0 then %Modelica_Init=%f;end
+    if exists("%Jacobian")==0 then %Jacobian=%t; end
+    if exists("%Modelica_ParEmb")==0 then %Modelica_ParEmb=%t; end
+
+    //Initialize lhs arguments in case of return on error
+    name="";
+    dep_u=%t; nipar=0;nrpar=0;nopar=0;
+    nz=0;nx=0;nx_der=0;nx_ns=0;nin=0;nout=0;nm=0;ng=0;
+
+    // modelica UI initialization is always ignored
+    running="off";
+
+    //set paths for generated files
+    outpath=pathconvert(TMPDIR,%t,%t);
+
+
+    name=basename(filemo)
+    namef=name+"f";
+
+
+    //Flat modelica file generated by translator
+    Flat=outpath+namef+".mo";// flat modelica file path
+
+    //xml files generated by translator and/or edited by Initialization GUI
+    xmlfile=outpath+namef+"_init.xml";// initialization XML
+    Relfile=outpath+namef+"_relations.xml";
+
+    //files generated by modelicac
+    Cfile=outpath+name+".c" //C code of the simulation function
+    incidence=outpath+name+"_incidence_matrix.xml" //incidence matrix
+
+    //files generated for the scicos simulation by translator
+    Flat_functions=outpath+namef+"_functions.mo";
+    xmlfileTMP=outpath+name+"Sim.xml";
+
+    //do not update C code if not required this allows C code
+    //modifications for debugging purposes
+    updateC=needcompile<>0|fileinfo(Cfile)==[]| %Modelica_Init
+
+    if updateC  then
+
+        //Generate the flat model if it does not exist yet (It may have been
+        //generated by the initialization GUI
+        if ( %Modelica_Init ) then
+            if (fileinfo(xmlfile)==[]) then
+                overwrite=%t;//Yes
+            else
+                overwrite=messagebox([_("The initialization file already exists!");
+                _("Do you want to overwrite it?") ],..
+                "","question",[_("Yes"),_("No")],"modal")==1
+            end
+        else
+            // do not generate the flat file when it is already generated by
+            // the initialization GUI
+            overwrite=(running <>"1")
+        end
+
+        if overwrite then
+            // generate with filemo the Modelica flat model,the xml files,
+            //  and files needed for the scicos simulation
+            [ok]=translator(filemo,Mblocks,modelica_libs,Flat)
+            if ~ok then  dep_u=%t; return,end
+        end
+
+        // if the initialisation GUI is used
+        if (%Modelica_Init) then //---------------------------
+            mprintf("%s"," Init XML file : "+xmlfile); mprintf("\n\r");
+            mprintf("%s"," Init Rel file : "+Relfile); mprintf("\n\r");
+            name=Flat;
+            //<<ALERT dep_u of the initialization block is obtained only when the  C
+            // code is generated.
+            dep_u=%t;
+            ok=%t,
+            return;
+        else
+            mprintf("%s\n"," Flat Modelica : "+Flat);
+        end
+
+        //Generate the C file with modelicac
+        //---------------------------------------------------------------------
+        ok=modelicac(Flat,Flat_functions,xmlfileTMP,%Jacobian,Cfile,running=="1")
+
+        if ~ok then return,end
+        mprintf(" Simulation C code :%s\n", Cfile);
+        //---------------------------------------------------------------------
+    end // if update
+
+    [nipar,nrpar,nopar,nz,nx,nx_der,nx_ns,nin,nout,nm,ng,dep_u]=reading_incidence(incidence)
+    depu(dep_u)="T";  depu(~dep_u)="F";depu=strcat(depu);
+
+    txt = [_("Modelica blocks are reduced to a block with:") ;
+    msprintf(_("Number of differential states: %d"),nx_der);
+    msprintf(_("Number of algebraic states: %d"),nx-nx_der);
+    msprintf(_("Number of discrete time states  : %d"),nz);
+    msprintf(_("Number of zero-crossing surfaces: %d"),ng);
+    msprintf(_("Number of modes  : %d"),nm);
+    msprintf(_("Number of inputs : %d"),nin);
+    msprintf(_("Number of outputs: %d"),nout);
+    msprintf(_("Input/output dependency:[%s]"),depu)
+    msprintf(_("Analytical Jacobian: enabled  (%%Jacobian=%s)"),sci2exp(%Jacobian));
+    msprintf(_("Parameter embedding mode: enabled (%%Modelica_ParEmb=%s)"),sci2exp(%Modelica_ParEmb))
+    ""
+    msprintf(_("Generated files path: %s"),outpath)
+    ""];
+
+    if getscilabmode() <> "NWNI" then
+        messagebox(txt, "info");
+    else
+        disp(txt);
+    end
+
+    //compile and link the generated C file
+    ok=Link_modelica_C(Cfile)
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/context_evstr.bin b/modules/scicos/macros/scicos_scicos/context_evstr.bin
new file mode 100755
index 000000000..96227b567
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/context_evstr.bin
diff --git a/modules/scicos/macros/scicos_scicos/context_evstr.sci b/modules/scicos/macros/scicos_scicos/context_evstr.sci
new file mode 100755
index 000000000..1a9178701
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/context_evstr.sci
@@ -0,0 +1,50 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [%vv_list,%ierr_vec,err_mess,%ok]=context_evstr(%str,%scicos_context,%typ)
+    // Copyright INRIA
+    // Evaluate Scicos Context utility function
+    %ok=%t
+    err_mess=[];lasterror();
+    %mm=getfield(1,%scicos_context)
+    for %mi=%mm(3:$)
+        if execstr(%mi+"=%scicos_context(%mi)","errcatch")<>0 then
+            err_mess=lasterror()
+            if err_mess==[] then err_mess="Error in evaluating "+%mi,end
+            %ok=%f
+            return
+        end
+    end
+    %nn=prod(size(%str))
+    %ierr_vec=zeros(%nn,1)
+    %vv_list=list()
+    for %kk=1:%nn
+        if %typ(2*%kk-1)(1)<>"str" then
+            [%vv_list(%kk),%ierr_vec(%kk)]=evstr(%str(%kk));
+            %err_mes=lasterror()
+            if %err_mes<>[] then
+                err_mess(%kk)=%err_mes;%ok=%f;
+            end
+        else
+            %vv_list(%kk)=%str(%kk);
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/cos2cosf.bin b/modules/scicos/macros/scicos_scicos/cos2cosf.bin
new file mode 100755
index 000000000..6836c82f9
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/cos2cosf.bin
diff --git a/modules/scicos/macros/scicos_scicos/cos2cosf.sci b/modules/scicos/macros/scicos_scicos/cos2cosf.sci
new file mode 100755
index 000000000..bf795a666
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/cos2cosf.sci
@@ -0,0 +1,233 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function ierr = cos2cosf(u,scs_m,count)
+
+    //write scilab instructions whose evaluation
+    //returns the  value of scicos data structure scs_m.
+    //in the opened file associated with logical unit u
+
+    [lhs,rhs]=argn(0)
+    ierr=0;
+    if rhs<3 then
+        count=0,
+        lname="scs_m"
+    else
+        count=count+1
+        lname="scs_m_"+string(count)
+    end
+
+    lmax=80;
+
+    //////////////////
+    txt=[];
+
+    //version
+    txt=[txt;"version="""+get_scicos_version()+""",.."];
+
+    //scicos_params
+    tt=[];
+    fields=getfield(1,scs_m.props);
+    for i=1:lstsize(scs_m.props)-1
+        field_nam=fields(i+1);
+        if field_nam=="title" then field_nam="Title", end
+        tt2=sci2exp(getfield(i+1,scs_m.props),lmax);
+        tt2(1)=field_nam+"="+tt2(1);
+        if i<>lstsize(scs_m.props)-1 then
+            tt2($)=tt2($)+",";
+        end
+        tt=[tt;tt2];
+    end
+
+    tt=my_strcat(tt);
+    txt=[txt;
+    "props=scicos_params(..";
+    "      "+tt(1)];
+    for i=2:size(tt,1)
+        txt=[txt;"      "+tt(i)];
+    end
+    txt($)=txt($)+")";
+
+    //scicos_diagram
+    txt=["scicos_diagram(..";txt];
+    txt($)=txt($)+")";
+
+    //final work
+    txt(1)=lname+"="+txt(1);
+    bl1=" ";
+    for i=2:size(txt,1)
+        txt(i)=part(bl1,1:length(lname)+1)+txt(i);
+    end
+    //////////////////
+
+    ierr=execstr("write(u,txt,''(a)'')","errcatch");
+    if ierr<>0 then return, end;
+
+    t=[];
+
+    for k=1:lstsize(scs_m.objs)
+
+        o=scs_m.objs(k)
+        if typeof(o)=="Block" then
+            lhs=lname+".objs("+string(k)+")="
+
+            if o.model.sim=="super"| o.model.sim=="csuper"| o.model.sim(1)=="asuper" then  //Super blocks
+                cos2cosf(u,o.model.rpar,count);//model.rpar
+            end
+            //////////////////
+            txt=[];
+
+            //gui
+            tt=sci2exp(o.gui);
+            txt=[txt;"gui="+tt(1)];
+            for i=2:size(tt,1)
+                txt=[txt;"         "+tt(i)];
+            end
+            txt($)=txt($)+",..";
+
+            //scicos_graphics
+            tt=[];
+            fields=getfield(1,o.graphics);
+            for i=1:lstsize(o.graphics)-1
+                field_nam=fields(i+1);
+                tt2=sci2exp(getfield(i+1,o.graphics),lmax);
+                tt2(1)=field_nam+"="+tt2(1);
+                if i<>lstsize(o.graphics)-1 then
+                    tt2($)=tt2($)+",";
+                end
+                tt=[tt;tt2];
+            end
+
+            tt=my_strcat(tt);
+            txt=[txt;
+            "graphics=scicos_graphics(..";
+            "         "+tt(1)];
+            for i=2:size(tt,1)
+                txt=[txt;"         "+tt(i)];
+            end
+            txt($)=txt($)+"),..";
+
+            //scicos_model
+            tt=[];
+            fields=getfield(1,o.model);
+            for i=1:lstsize(o.model)-1
+                field_nam=fields(i+1);
+                if field_nam=="rpar"&(o.model.sim=="super"| o.model.sim=="csuper"| o.model.sim(1)=="asuper") then
+                    tt2="scs_m_"+string(count+1);
+                else
+                    tt2=sci2exp(getfield(i+1,o.model),lmax);
+                end
+                tt2(1)=field_nam+"="+tt2(1);
+                if i<>lstsize(o.model)-1 then
+                    tt2($)=tt2($)+",";
+                end
+                tt=[tt;tt2];
+            end
+
+            tt=my_strcat(tt);
+            txt=[txt;
+            "model=scicos_model(..";
+            "         "+tt(1)];
+            for i=2:size(tt,1)
+                txt=[txt;"         "+tt(i)];
+            end
+            txt($)=txt($)+"),..";
+
+            //doc
+            tt=sci2exp(o.doc,50);
+            txt=[txt;"doc="+tt(1)];
+            for i=2:size(tt,1)
+                txt=[txt;"         "+tt(i)];
+            end
+
+            //scicos_block
+            txt=["scicos_block(..";txt];
+            txt($)=txt($)+")";
+
+            //final work
+            txt(1)=lhs+txt(1);
+            bl1=" ";
+            for i=2:size(txt,1)
+                txt(i)=part(bl1,1:length(lhs))+txt(i);
+            end
+            write(u,txt,"(a)");
+            ///////////////
+        else //link
+            lhs=lname+".objs("+string(k)+")="
+            if typeof(o)=="Link" then
+                //scicos_link
+                tt=[];
+                txt=[];
+                fields=getfield(1,o);
+                for i=1:lstsize(o)-1
+                    field_nam=fields(i+1);
+                    tt2=sci2exp(getfield(i+1,o),lmax);
+                    tt2(1)=field_nam+"="+tt2(1);
+                    if i<>lstsize(o)-1 then
+                        tt2($)=tt2($)+",";
+                    end
+                    tt=[tt;tt2];
+                end
+
+                tt=my_strcat(tt);
+                txt=[txt;
+                "scicos_link(..";
+                "  "+tt(1)];
+                for i=2:size(tt,1)
+                    txt=[txt;"  "+tt(i)];
+                end
+                txt($)=txt($)+")";
+
+                //final work
+                txt(1)=lhs+txt(1);
+                bl1=" ";
+                for i=2:size(txt,1)
+                    txt(i)=part(bl1,1:length(lhs))+txt(i);
+                end
+                write(u,txt,"(a)");
+
+            else // ??
+                // Alan : JESAISPASIYADAUTRESOBJS
+                // QUEDESBLOCKSETDESLINKSDANSSCICOS
+                // ALORSJELAISSELEVIEUCODE
+                t=[]
+                t1=sci2exp(o,lmax-length(lhs))
+                n1=size(t1,1)
+                bl1=" ";bl1=part(bl1,1:length(lhs))
+                t=[t;lhs+t1(1);bl1(ones(n1-1,1))+t1(2:$)]
+                write(u,t,"(a)");
+            end
+        end
+    end
+
+endfunction
+
+function txt_out=my_strcat(txt)
+    txt_out=[]
+    for i=1:size(txt,1)
+        txt_out(i)=txt(i);
+        if length(txt_out(i))<>0 then
+            if part(txt_out(i),length(txt_out(i)))=="," then
+                txt_out(i)=txt_out(i)+"..";
+            end
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/countblocks.bin b/modules/scicos/macros/scicos_scicos/countblocks.bin
new file mode 100755
index 000000000..36ea49561
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/countblocks.bin
diff --git a/modules/scicos/macros/scicos_scicos/countblocks.sci b/modules/scicos/macros/scicos_scicos/countblocks.sci
new file mode 100755
index 000000000..d66309a03
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/countblocks.sci
@@ -0,0 +1,38 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function n=countblocks(scs_m)
+    // count number of blocks used in the scicos data structure scs_m
+
+    n=0
+    for o=scs_m.objs
+        x=getfield(1,o)
+        if x(1)=="Block" then
+            if o.model.sim=="super"|o.model.sim=="csuper" then
+                n=n+countblocks(o.model.rpar)
+            else
+                n=n+1
+            end
+        else
+            n=n+1
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/create_modelica.bin b/modules/scicos/macros/scicos_scicos/create_modelica.bin
new file mode 100755
index 000000000..00d39185c
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/create_modelica.bin
diff --git a/modules/scicos/macros/scicos_scicos/create_modelica.sci b/modules/scicos/macros/scicos_scicos/create_modelica.sci
new file mode 100755
index 000000000..14eefad38
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/create_modelica.sci
@@ -0,0 +1,333 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [txt,rpar,ipar] = create_modelica(blklst,corinvm,cmat,NvM,name,scs_m)
+
+    if exists("%Modelica_Init")==0 then
+        // Modelica_Init becomes true only in "Modelicainitialize_.sci"
+        %Modelica_Init=%f;
+    end
+    if exists("%Modelica_ParEmb")==0 then
+        %Modelica_ParEmb=%t;
+    end
+
+    Parembed=%Modelica_ParEmb & ~%Modelica_Init;
+
+    txt=[];tab=ascii(9)
+    rpar=[];//will contain all parameters associated with the all modelica blocs
+    ipar=[];//will contain the "adress" of each block in rpar
+    models=[]//will contain the model declaration part
+    eqns=[]//will contain the modelica equations part
+    Pin=[]
+    Bnumbers=[]
+    Bnam=[]
+    Bnames=[]
+    nb=size(blklst)
+    Params=[];
+    for k=1:nb
+        ipar(k)=0
+        o=blklst(k);
+        //#########
+        //## Params
+        //#########
+        mo=o.equations;
+        np=size(mo.parameters(1),"*");
+        P=[];
+        //** mo.parameters have size=2
+        //** it only contains parameters
+        if np<>0 then
+            if lstsize(mo.parameters)==2 then
+                mo.parameters(3)=zeros(1,np)
+            end
+        end
+
+        for j=1:np
+            //## loop on number of param value
+            //## can be both scalar or array
+            Parj=mo.parameters(1)(j)
+            Parjv=mo.parameters(2)(j)
+            Parj_in=Parj+"_"+string(k)+string(j)
+
+            if type(Parjv)==1 then // if Real/Complex	Integers are used with "fixed=true"
+                rpar=[rpar;matrix(Parjv,-1,1)]
+                ipar(k)=ipar(k)+size(Parjv,"*")
+            end
+            //======================================================
+            Params=[Params;construct_Pars(Parj_in,Parjv,Parembed)]
+            if mo.parameters(3)(j)==0 then
+                P=[P;Parj+"="+Parj_in]
+            elseif mo.parameters(3)(j)==1 then
+                //eParjv=construct_redeclar(Parjv)
+                P=[P;Parj+"(start="+Parj_in+")"];
+            elseif mo.parameters(3)(j)==2 then
+                //eParjv=construct_redeclar(Parjv)
+                P=[P;Parj+"(start="+Parj_in+",fixed=true)"];
+            end
+            //======================================================
+        end
+
+        //#########
+        //## models
+        //#########
+        Bnumbers=[Bnumbers k];
+
+        //## update list of names of modelica blocks
+        // Modelica compiler complains about ID containing dots
+        // So remove them Modelica.package.subpackage => Modelica_DOT_package_DOT_subpackage
+        Bnam = [Bnam, get_model_name(strsubst(mo.model, ".", "_DOT_"),Bnam)];
+        Bnames = [Bnames, Bnam($)]
+
+        if P==[] then
+            models=[models;
+            "  "+mo.model+" "+tab+Bnames($)];
+        else
+            models=[models;
+            "  "+mo.model+" "+tab+Bnames($)+"("+strcat(P,", ")+")"];
+        end
+
+        //## Add gr_i identification in comments of models
+        if mo.model<>"OutPutPort" & mo.model<>"InPutPort" then
+            //## retrieve the object in the scs_m structure
+            o_scsm = scs_m(scs_full_path(corinvm(k)));
+            //## get the structure graphics
+            o_gr  = o_scsm.graphics;
+            //## get the identification field
+            id = stripblanks(o_gr.id)
+
+            if id<>"" then
+                models($)=models($)+" """+id+""";"
+            else
+                models($)=models($)+";"
+            end
+        else
+            models($)=models($)+";"
+        end
+
+        //rajouter les ports
+    end
+    ipar=cumsum([1;ipar(:)])
+
+    //links
+    for k=1:size(cmat,1)
+        from=cmat(k,1:3)
+        to=cmat(k,4:6)
+        if from(1)==0 then //input port
+            nb=nb+1
+            Bnumbers=[Bnumbers nb];
+            Bnames=[Bnames,"B"+string(nb)];
+            models=[models;"  InPutPort"+" "+tab+"B"+string(nb)+";"];
+            n1="B"+string(nb)
+        elseif from(3)==1 then
+            p1=blklst(from(1)).equations.inputs(from(2))
+            n1=Bnames(find(Bnumbers==from(1)))
+        else
+            p1=blklst(from(1)).equations.outputs(from(2))
+            n1=Bnames(find(Bnumbers==from(1)))
+        end
+
+        if to(1)==0 then //output port
+            nb=nb+1
+            Bnumbers=[Bnumbers nb];
+            Bnames=[Bnames,"B"+string(nb)];
+            models=[models;"  OutPutPort"+" "+tab+"B"+string(nb)+";"];
+            n1="B"+string(nb)
+        elseif to(3)==1 then
+            p2=blklst(to(1)).equations.inputs(to(2))
+            n2=Bnames(find(Bnumbers==to(1)))
+        else
+            if size(blklst(to(1)).equations.outputs,"*")<to(2) then pause,end
+            p2=blklst(to(1)).equations.outputs(to(2))
+            n2=Bnames(find(Bnumbers==to(1)))
+        end
+
+        if or(blklst(from(1)).equations.model==["InPutPort","OutPutPort"]) ...
+            | or(blklst(to(1)).equations.model==["InPutPort","OutPutPort"]) ...
+            | (k > (size(cmat,1) - NvM)) ...
+            then
+            eqns=[eqns
+            "  "+n1+"."+p1+" = "+n2+"."+p2+";"]
+        else
+            eqns=[eqns
+            "  connect ("+n1+"."+p1+","+n2+"."+p2+");"]
+        end
+    end
+
+    txt=[txt;
+    "model "+name
+    Params
+    models
+    "equation"
+    eqns
+    "end "+name+";"]
+endfunction
+
+function r=validvar_modelica(s)
+    r=validvar(s);
+
+    if r then
+        bad_char=["%" "#" "$"]
+        for j=1:size(bad_char,2)
+            if strindex(s,bad_char(j)) then
+                r=%f
+                return
+            end
+        end
+    end
+endfunction
+
+
+
+function r=write_nD_format(x)
+    sx=size(x)
+
+    if size(sx,"*")==2 then // Matrix/Vector
+        [nD1,nD2]=size(x)
+        if nD1==1 then // rows vector
+            r="{"+strcat(string(x),",")+"}"
+            r=strsubst(r,"D","e");
+            return r;
+        elseif nD2==1   then // column vector
+            N=nD1;
+            cmd=")"
+        else  //matrix
+            N=sx(1);
+            cmd=",:)"
+        end
+    else // hypermatrix
+        // typeof(x)==hypermat
+        //  xd=x.entries
+        //  sdims=x.dims(2:$)
+        //  N=x.dims(1)
+        //  cmd=':)'
+        //  n=size(sx,'c')
+        //  for i=1:n-2;cmd=':,'+cmd;end;
+        //  cmd=','+cmd;
+    end
+    r=[];
+    for i=1:N
+        cmdx="write_nD_format(x("+string(i)+cmd+")";
+        execstr("r(i)="+cmdx,"errcatch")
+    end
+    r="{"+strcat(r,",")+"}";
+endfunction
+
+// a 2x3 matrix {{xx,xx,xx},{xx,xx,xx}}
+// A[2] {xx,xx}
+// A[1,2] {{xx,xx}}
+// A[2,1] {{xx},{xx}}
+// A[1,1,2] {{{xx,xx}}}
+// a=rand(2,3)
+// a=[3,4];
+// a=[4;2];
+// a=rand(2,3);
+// a=rand(1,2,3,4,5);
+// a=[1 2 3 4 1 4];a(:,:,2)=[5 6 7 8 1 5] ;
+//if typeof(a)== 'hypermat' then
+// disp('not supported')
+//end
+//sa=write_nD_format(a)
+
+
+function     Pari=construct_Pars(Pari,opari,Parembed)
+
+    if Pari==[] then
+        return " "
+    end
+    // Pars='  parameter Real '+Pars+'(fixed=false);'
+    [atemp]=format();
+    format(20);// writing in long format
+
+    //erpar=string(rpar); will put 1e-16 to zero in a vector containing
+    //big numbers
+
+    C=opari;
+    [a1,b1]=size(C);
+    npi=a1*b1;
+    if typeof(C)== "hypermat" then
+        messagebox(_("Hyper Matrix is not supported"),"error","modal")
+        return
+    end
+
+    if (type(C)==1) then
+        if isreal(C) then
+            par_type="Real"
+        else
+            par_type="Complex"
+        end
+        FIXED="false"
+    elseif (typeof(C)=="int32") | (typeof(C)=="int16") |...
+        (typeof(C)=="int8") |(typeof(C)=="uint32") |...
+        (typeof(C)=="uint16") | (typeof(C)=="uint8") then
+        par_type="Integer"
+        FIXED="true"
+    else
+        par_type="UnKnown_Type"
+        FIXED="???"
+        messagebox(_("Type not recognized"),"error","modal");ok=%f;
+    end
+
+    if ~Parembed then
+        FIXED="true"
+    end
+
+    if (npi==1) then,
+        eopari=strsubst(string(C),"D","e");
+        fixings="(fixed="+FIXED+") "
+    else
+        eopari=write_nD_format(C)
+        fixings="(each fixed="+FIXED+") ";
+        [d1,d2]=size(C);
+        if (d1==1) then
+            Pari=Pari+"["+string(d2)+"]"; //[d2]
+        else
+            Pari=Pari+"["+string(d1)+","+string(d2)+"]"; //[d1,d2]
+        end
+    end
+    Pari="  parameter "+par_type+" "+Pari+ fixings+"="+eopari+ "  """+Pari+""""+";"
+    format(atemp(2))// restituing the format
+
+endfunction
+
+function eopari = construct_redeclar(opari)
+
+    [atemp]=format();
+    format(20);// writing in long format
+    C=opari;
+    npi=size(C,"*");
+
+    if typeof(C)== "hypermat" then
+        messagebox(_("Hyper Matrix is not supported"),"error","modal")
+        return
+    end
+    if  ~isreal(C) then
+        messagebox(_("Complex Matrix is not supported"),"error","modal")
+        return
+    end
+
+    if (npi==1) then,
+        eopari=strsubst(string(C),"D","e");
+    else
+        eopari=write_nD_format(C)
+    end
+
+    format(atemp(2))// restituing the format
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/default_color.bin b/modules/scicos/macros/scicos_scicos/default_color.bin
new file mode 100755
index 000000000..ecef9edbb
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/default_color.bin
diff --git a/modules/scicos/macros/scicos_scicos/default_color.sci b/modules/scicos/macros/scicos_scicos/default_color.sci
new file mode 100755
index 000000000..6cdbd363d
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/default_color.sci
@@ -0,0 +1,36 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function clr=default_color(typ)
+
+    if typ==-1 then //event links
+        clr=options("Link")(2),
+    elseif typ==0 then  //text, block shape,
+        if size(options("Background"),"*")>=2 then //compatibility
+            clr=options("Background")(2),
+        else
+            clr=1
+        end
+    elseif typ==1 | typ==2 then //regular links
+
+        clr=options("Link")(1),
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/default_options.bin b/modules/scicos/macros/scicos_scicos/default_options.bin
new file mode 100755
index 000000000..50a93208a
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/default_options.bin
diff --git a/modules/scicos/macros/scicos_scicos/default_options.sci b/modules/scicos/macros/scicos_scicos/default_options.sci
new file mode 100755
index 000000000..dfb76eafb
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/default_options.sci
@@ -0,0 +1,43 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function options = default_options()
+
+    options=scsoptlist()
+    col3d=[0.8 0.8 0.8]
+    //if xget('use color')==1 then   //suppose always color screen
+    options("3D")=list(%t,33)   // we add gray to color map
+    //else
+    //  options('3D')=list(%f,0)
+    //  col3d=[]
+    //end
+    options("Background")=[8 1] //white,black
+    options("Link")=[1,5] //black,red
+    options("ID")=list([4 1 10 1],[4 1 2 1])
+    options("Cmap")=col3d
+
+endfunction
+
+function options = scsoptlist(varargin)
+    lt = ["scsopt","3D","Background","Link","ID","Cmap"]
+    options = tlist(lt,varargin(:))
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/delete_unconnected.bin b/modules/scicos/macros/scicos_scicos/delete_unconnected.bin
new file mode 100755
index 000000000..c9fa824d5
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/delete_unconnected.bin
diff --git a/modules/scicos/macros/scicos_scicos/delete_unconnected.sci b/modules/scicos/macros/scicos_scicos/delete_unconnected.sci
new file mode 100755
index 000000000..ce7c06d33
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/delete_unconnected.sci
@@ -0,0 +1,101 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function scs_m=delete_unconnected(scs_m);
+
+    n = lstsize(scs_m.objs);
+
+    if n==0 then
+        return
+    end ; //** exit point
+
+    DEL=[];
+    DELL=[]
+    finish=%f
+
+    while ~finish
+        finish = %t
+        for k=1:n  //loop on scs_m objects
+            x = getfield(1,scs_m.objs(k))
+            if x(1)=="Block" then
+                if scs_m.objs(k).gui<>"SUM_f"&scs_m.objs(k).gui<>"SOM_f" then
+                    if find(scs_m.objs(k).gui==["IFTHEL_f","ESELECT_f"]) then
+                        kk=[find(scs_m.objs(k).graphics.pein==0),find(scs_m.objs(k).graphics.pin==0)]
+                        if kk<> [] // a synchro block is not active, remove it
+                            [scs_m,DEL1,DELL1]=do_delete1(scs_m,k,%f)
+                            DEL=[DEL DEL1]
+                            DELL=[DELL DELL1]
+                            finish=%f
+                        end
+                    else
+                        kk=[find(scs_m.objs(k).graphics.pin==0)]
+                        if kk<>[] then // at least one  input port is not connected delete the block
+                            if or(getfield(1,scs_m.objs(k).graphics)=="in_implicit") then
+                                if or(scs_m.objs(k).graphics.in_implicit(kk)<>"I") then
+                                    [scs_m,DEL1,DELL1]=do_delete1(scs_m,k,%f)
+                                    DEL=[DEL DEL1]
+                                    DELL=[DELL DELL1]
+                                    finish=%f
+                                end
+                            else
+                                [scs_m,DEL1,DELL1]=do_delete1(scs_m,k,%f)
+                                DEL=[DEL DEL1]
+                                DELL=[DELL DELL1]
+                                finish=%f
+                            end
+                        end
+                    end
+                end
+            end
+        end
+    end
+
+    //suppress rigth-most deleted elements
+    while getfield(1,scs_m.objs($))=="Deleted" then
+        scs_m.objs($)=null();
+        if lstsize(scs_m.objs)==0 then
+            break
+        end
+    end
+
+    // Notify by hiliting and message
+    if DEL<>[] then
+        // ind_del are deleted and not relinked blocks/links indexes of DEL
+        if DELL <> [] then
+            deleted = DEL(find(DEL<>DELL));
+        else
+            deleted = DEL;
+        end
+
+        // Store updated scs_m and retrieve the previous one
+        scs_save = scs_m;
+        scs_m = scs_m_s;
+
+        msg = gettext("Block is ignored because of undefined input(s).");
+        for del=deleted
+            hilite_path([path del], msg);
+        end
+
+        // Restore the updated scs_m
+        scs_m = scs_save;
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/dialog.bin b/modules/scicos/macros/scicos_scicos/dialog.bin
new file mode 100755
index 000000000..1230d4a61
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/dialog.bin
diff --git a/modules/scicos/macros/scicos_scicos/dialog.sci b/modules/scicos/macros/scicos_scicos/dialog.sci
new file mode 100755
index 000000000..1f3d93c6b
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/dialog.sci
@@ -0,0 +1,25 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function result = dialog(labels,valueini)
+    // interface to x_dialog primitive to allow simple overloading for live demo
+    result = x_dialog(labels, valueini);
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/dig_bound_compound.bin b/modules/scicos/macros/scicos_scicos/dig_bound_compound.bin
new file mode 100755
index 000000000..1a7291650
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/dig_bound_compound.bin
diff --git a/modules/scicos/macros/scicos_scicos/dig_bound_compound.sci b/modules/scicos/macros/scicos_scicos/dig_bound_compound.sci
new file mode 100755
index 000000000..416c2980b
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/dig_bound_compound.sci
@@ -0,0 +1,100 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+//** rotate compound : get dig_bound of a compound
+//**
+//** input : - blk the index of the compound (the i child of axe)
+//**         -
+//** output : rect
+//**
+//** 25/11/08, Alan
+//** 22/06/09, Serge Steer INRIA
+//  - input argument replaced by the compound handle
+//  - removed the useless unglue + glue instruction using the compuound
+//    children list
+// Copyright INRIA
+function [rect]=dig_bound_compound(gh_blk)
+    //gh_blk handle on a compound object
+
+    xmin = 100000;
+    xmax = -xmin;
+    ymin = xmin;
+    ymax = -xmin;
+    C=gh_blk.children
+    for i=1:size(C,"*")
+        select C(i).type
+        case "Rectangle" then
+            //disp('rectangle')
+
+            xmin=min(xmin,C(i).data(1));
+            ymin=min(ymin,C(i).data(2));
+            xmax=max(xmax,C(i).data(3)+C(i).data(1));
+            ymax=max(ymax,C(i).data(4)+C(i).data(2));
+
+        case "Text" then
+            //disp('text')
+
+            //** get bounding box of text with no rotation
+            rectstr = stringbox(C(i).text,C(i).data(1),...
+            C(i).data(2))
+
+            xmin=min(xmin,rectstr(1,1));
+            ymin=min(ymin,rectstr(2,1));
+            xmax=max(xmax,rectstr(1,3));
+            ymax=max(ymax,rectstr(2,3));
+
+        case "Polyline" then
+            //disp('polyline')
+
+            xmin=min(xmin,min(C(i).data(:,1)));
+            ymin=min(ymin,min(C(i).data(:,2)));
+            xmax=max(xmax,max(C(i).data(:,1)));
+            ymax=max(ymax,max(C(i).data(:,2)));
+
+        case "Compound" then
+            //disp('compound')
+
+            [rectcmpd]=dig_bound_compound(C(i))
+            xmin=min(xmin,rectcmpd(1,1));
+            ymin=min(ymin,rectcmpd(1,2));
+            xmax=max(xmax,rectcmpd(1,3));
+            ymax=max(ymax,rectcmpd(1,4));
+
+        case "Segs" then
+            //disp('Segs')
+
+            xmin=min(xmin,min(C(i).data(:,1)));
+            ymin=min(ymin,min(C(i).data(:,2)));
+            xmax=max(xmax,max(C(i).data(:,1)));
+            ymax=max(ymax,max(C(i).data(:,2)));
+
+        case "Arc" then
+            //disp('Arc')
+
+            xmin=min(xmin,C(i).data(1));
+            ymin=min(ymin,C(i).data(2));
+            xmax=max(xmax,C(i).data(3)+C(i).data(1));
+            ymax=max(ymax,C(i).data(4)+C(i).data(2));
+        end
+    end
+
+    rect=[xmin ymin xmax ymax]
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/do_compile.bin b/modules/scicos/macros/scicos_scicos/do_compile.bin
new file mode 100755
index 000000000..ab84f02d8
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_compile.bin
diff --git a/modules/scicos/macros/scicos_scicos/do_compile.sci b/modules/scicos/macros/scicos_scicos/do_compile.sci
new file mode 100755
index 000000000..34b65b83e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_compile.sci
@@ -0,0 +1,109 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function  [%cpr,ok] = do_compile(scs_m)
+    show_trace = %f //** tracing and profiling (probably by Alan L. )
+    if show_trace then
+        disp("c_pass0:"+string(timer()));
+    end
+
+    if exists("%scicos_solver")==0 then
+        %scicos_solver = 0 ;
+    end
+
+    par = scs_m.props;
+
+    if alreadyran then
+        // terminate current simulation
+        do_terminate();
+    end
+
+    timer() ; //** profiling timer
+
+    IN=[];OUT=[];
+    for i=1:lstsize(scs_m.objs)
+        if typeof(scs_m.objs(i))=="Block" then
+            if scs_m.objs(i).gui=="IN_f" then
+                scs_m.objs(i).gui="INPUTPORT";
+                scs_m.objs(i).model.sim="bidon"
+                IN=[IN scs_m.objs(i).model.ipar]
+            elseif scs_m.objs(i).gui=="OUT_f" then
+                scs_m.objs(i).gui="OUTPUTPORT";
+                scs_m.objs(i).model.sim="bidon"
+                OUT=[OUT  scs_m.objs(i).model.ipar]
+            end
+        end
+    end
+
+    IN=-gsort(-IN);
+    if or(IN<>[1:size(IN,"*")]) then
+        ok=%f;%cpr=list()
+        messagebox("Input ports are not numbered properly.","modal")
+        return
+    end
+
+    OUT=-gsort(-OUT);
+    if or(OUT<>[1:size(OUT,"*")]) then
+        ok=%f;%cpr=list()
+        messagebox("Output ports are not numbered properly.","modal")
+        return
+    end
+
+    //** First PASSAGE
+    [bllst,connectmat,clkconnect,cor,corinv,ok] = c_pass1(scs_m);
+
+    if show_trace then
+        disp("c_pass1:"+string(timer()))
+    end
+
+    if ~ok then %cpr=list()
+        return ; //** incase of any error EXIT
+    end
+
+    if size(connectmat,2)==6 then
+        connectmat = connectmat(:,[1 2 4 5])
+    end
+
+
+    scs_m = null() ;
+
+    if ~ok then %cpr=list()
+        return
+    end
+
+    // newc_pass2 destroys the corinv component associated
+    // to the modelica blocks preserve it
+    // clast=corinv($)
+    // if type(clast)==15 then corinv($)=clast(1),klast=size(corinv),end
+    // %cpr=newc_pass2(bllst,connectmat,clkconnect,cor,corinv);
+    // newc_pass2 destroys the corinv component associated
+    // to the modelica blocks
+    // if type(clast)==15 then %cpr.corinv(klast)=clast,end
+
+
+    //** Second PASSAGE
+    %cpr = c_pass2(bllst,connectmat,clkconnect,cor,corinv);
+
+    if %cpr==list() then
+        ok = %f ;
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/do_compile_superblock42.bin b/modules/scicos/macros/scicos_scicos/do_compile_superblock42.bin
new file mode 100755
index 000000000..d2c4c6233
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_compile_superblock42.bin
diff --git a/modules/scicos/macros/scicos_scicos/do_compile_superblock42.sci b/modules/scicos/macros/scicos_scicos/do_compile_superblock42.sci
new file mode 100755
index 000000000..9e8d1c478
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_compile_superblock42.sci
@@ -0,0 +1,6005 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Alan Layec <alan.layec@inria.fr>
+//                      - Ramine Nikoukhah <ramine.nikoukhah@inria.fr>
+//                      - Rachid Djenidi
+//
+//                      - Scilab 5 update by Simone Mannori
+//
+//  Copyright (C) DIGITEO - 2010 - Allan CORNET
+//  Copyright (C) Scilab Enterprises - 2012 - Bruno JOFRET
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+//**---------------------------------------------------------------------------------------------------------------------------------
+//
+//16/06/07 Author : ?, A. Layec
+//
+function [Code,actt,proto]=call_actuator(i)
+    nin=inpptr(i+1)-inpptr(i);  //** number of input ports
+    nout=outptr(i+1)-outptr(i); //** number of output ports
+
+    if funtyp(i)==0 then
+        if nin==0 then
+            uk    = 0;
+            nuk_1 = 0;
+            nuk_2 = 0;
+            uk_t  = 1;
+            //Code($+1)=+'  args[0]=(double *)outtbptr[0]);';
+        else
+            uk    = inplnk(inpptr(i));
+            nuk_1 = size(outtb(uk),1);
+            nuk_2 = size(outtb(uk),2);
+            uk_t  = mat2scs_c_nb(outtb(uk));
+            //Code($+1)=' args[0]=('+mat2scs_c_ptr(outtb(uk))+' *)outtbptr['+string(uk-1)+'];';
+        end
+    end
+    //pour la fonction gui ont a : num de bloc l'adresse dans
+    //nouveau  z et la taille du port
+    actt=[i uk nuk_1 nuk_2 uk_t bllst(i).ipar]
+
+    Code($+1)="block_"+rdnom+"["+string(i-1)+"].nevprt=nevprt;"
+
+    Code=["/* Call of actuator (blk nb "+string(i)+") */"
+    Code;
+    "nport = "+string(nbact)+";";
+    rdnom+"_actuator(&flag, &nport, &block_"+rdnom+"["+string(i-1)+"].nevprt, told, "+..
+    "("+mat2scs_c_ptr(outtb(uk))+" *)outtbptr["+string(uk-1)+"], &nrd_"+string(nuk_1)+", &nrd_"+..
+    string(nuk_2)+", &nrd_"+string(uk_t)+",bbb);"];
+
+    proto="void "+rdnom+"_actuator("+..
+    "int *, int *, int *, double *, void *, int *, int *,int *,int);"
+    proto=cformatline(proto,70);
+endfunction
+
+//CallBlock : generate C calling sequence
+//            of a scicos block
+//
+//inputs : bk   : bloc index
+//         pt   : evt activation number
+//         flag : flag
+//
+//output : txt  :
+//
+//16/06/07 Authors : Alan Layec
+function txt=call_block42(bk,pt,flag)
+    txt=[]
+    //**
+    if flag==2 & ((zptr(bk+1)-zptr(bk))+..
+        (ozptr(bk+1)-ozptr(bk))+..
+        (xptr(bk+1)-xptr(bk)+..
+        with_work(bk))==0 |..
+        pt<=0) & ~(stalone & or(bk==actt(:,1))) then
+        return // block without state or continuously activated
+    end
+    if flag==0 & ((xptr(bk+1)-xptr(bk))==0) then
+        return // block without continuous state
+    end
+    if flag==9 & ((zcptr(bk+1)-zcptr(bk))==0) then
+        return // block without continuous state
+    end
+    if flag==3 & ((clkptr(bk+1)-clkptr(bk))==0) then
+        return
+    end
+
+    //** adjust pt
+    if ~(flag==3 & ((zcptr(bk+1)-zcptr(bk))<>0)) then
+        pt=abs(pt)
+    end
+
+    //** add comment
+    txt=[txt;
+    get_comment("call_blk",list(funs(bk),funtyp(bk),bk,labels(bk)));]
+
+    //** set nevprt and flag for called block
+    txt=[txt;
+    "block_"+rdnom+"["+string(bk-1)+"].nevprt = "+string(pt)+";"
+    "local_flag = "+string(flag)+";"]
+
+    //**see if its bidon, actuator or sensor
+    if funs(bk)=="bidon" then
+        txt=[];
+        return
+    elseif funs(bk)=="bidon2" then
+        txt=[];
+        return
+    elseif or(bk==actt(:,1)) then
+        ind=find(bk==actt(:,1))
+        uk=actt(ind,2)
+        nuk_1=actt(ind,3)
+        nuk_2=actt(ind,4)
+        uk_t=actt(ind,5)
+        txt = [txt;
+        "nport = "+string(ind)+";"]
+        txt = [txt;
+        rdnom+"_actuator(&local_flag, &nport, &block_"+rdnom+"["+string(bk-1)+"].nevprt, \"
+        get_blank(rdnom+"_actuator")+" &t, ("+mat2scs_c_ptr(outtb(uk))+" *)"+rdnom+"_block_outtbptr["+string(uk-1)+"], \"
+        get_blank(rdnom+"_actuator")+" &nrd_"+string(nuk_1)+", &nrd_"+string(nuk_2)+", &nrd_"+string(uk_t)+",bbb);"]
+        txt = [txt;
+        "if(local_flag < 0) return(5 - local_flag);"]
+        return
+    elseif or(bk==capt(:,1)) then
+        ind=find(bk==capt(:,1))
+        yk=capt(ind,2);
+        nyk_1=capt(ind,3);
+        nyk_2=capt(ind,4);
+        yk_t=capt(ind,5);
+        txt = [txt;
+        "nport = "+string(ind)+";"]
+        txt = [txt;
+        rdnom+"_sensor(&local_flag, &nport, &block_"+rdnom+"["+string(bk-1)+"].nevprt, \"
+        get_blank(rdnom+"_sensor")+" &t, ("+mat2scs_c_ptr(outtb(yk))+" *)"+rdnom+"_block_outtbptr["+string(yk-1)+"], \"
+        get_blank(rdnom+"_sensor")+" &nrd_"+string(nyk_1)+", &nrd_"+string(nyk_2)+", &nrd_"+string(yk_t)+",aaa);"]
+        txt = [txt;
+        "if(local_flag < 0) return(5 - local_flag);"]
+        return
+    end
+
+    //**
+    nx=xptr(bk+1)-xptr(bk);
+    nz=zptr(bk+1)-zptr(bk);
+    nrpar=rpptr(bk+1)-rpptr(bk);
+    nipar=ipptr(bk+1)-ipptr(bk);
+    nin=inpptr(bk+1)-inpptr(bk);  //* number of input ports */
+    nout=outptr(bk+1)-outptr(bk); //* number of output ports */
+
+    //**
+    //l'adresse du pointeur de ipar
+    if nipar<>0 then ipar=ipptr(bk), else ipar=1;end
+    //l'adresse du pointeur de rpar
+    if nrpar<>0 then rpar=rpptr(bk), else rpar=1; end
+    //l'adresse du pointeur de z attention -1 pas sur
+    if nz<>0 then z=zptr(bk)-1, else z=0;end
+    //l'adresse du pointeur de x
+    if nx<>0 then x=xptr(bk)-1, else x=0;end
+
+    //**
+    ftyp=funtyp(bk)
+    if ftyp>2000 then ftyp=ftyp-2000,end
+    if ftyp>1000 then ftyp=ftyp-1000,end
+
+    //** check function type
+    if ftyp < 0 then //** ifthenelse eselect blocks
+        txt = [];
+        return;
+    else
+        if (ftyp<>0 & ftyp<>1 & ftyp<>2 & ftyp<>3 & ftyp<>4) then
+            disp("types other than 0,1,2,3 or 4 are not supported.")
+            txt = [];
+            return;
+        end
+    end
+
+    select ftyp
+
+    case 0 then
+        //**** input/output addresses definition ****//
+        if nin>1 then
+            for k=1:nin
+                uk=inplnk(inpptr(bk)-1+k);
+                nuk=size(outtb(uk),"*");
+                txt=[txt;
+                "rdouttb["+string(k-1)+"]=(double *)"+rdnom+"_block_outtbptr["+string(uk-1)+"];"]
+            end
+            txt=[txt;
+            "args[0]=&(rdouttb[0]);"]
+        elseif nin==0
+            uk=0;
+            nuk=0;
+            txt=[txt;
+            "args[0]=(double *)"+rdnom+"_block_outtbptr[0];"]
+        else
+            uk=inplnk(inpptr(bk));
+            nuk=size(outtb(uk),"*");
+            txt=[txt;
+            "args[0]=(double *)"+rdnom+"_block_outtbptr["+string(uk-1)+"];"]
+        end
+
+        if nout>1 then
+            for k=1:nout
+                yk=outlnk(outptr(bk)-1+k);
+                nyk=size(outtb(yk),"*");
+                txt=[txt;
+                "rdouttb["+string(k+nin-1)+"]=(double *)"+rdnom+"_block_outtbptr["+string(yk-1)+"];"];
+            end
+            txt=[txt;
+            "args[1]=&(rdouttb["+string(nin)+"]);"];
+        elseif nout==0
+            yk=0;
+            nyk=0;
+            txt=[txt;
+            "args[1]=(double *)"+rdnom+"_block_outtbptr[0];"];
+        else
+            yk=outlnk(outptr(bk));
+            nyk=size(outtb(yk),"*"),;
+            txt=[txt;
+            "args[1]=(double *)"+rdnom+"_block_outtbptr["+string(yk-1)+"];"];
+        end
+        //*******************************************//
+
+        //*********** call seq definition ***********//
+        txtc=["(&local_flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,&t,block_"+rdnom+"["+string(bk-1)+"].xd, \";
+        "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \";
+        "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \";
+        "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \";
+        "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar, \";
+        "(double *)args[0],&nrd_"+string(nuk)+",(double *)args[1],&nrd_"+string(nyk)+");"];
+        if (funtyp(bk)>2000 & funtyp(bk)<3000)
+            blank = get_blank(funs(bk)+"( ");
+            txtc(1) = funs(bk)+txtc(1);
+        elseif (funtyp(bk)<2000)
+            txtc(1) = "C2F("+funs(bk)+")"+txtc(1);
+            blank = get_blank("C2F("+funs(bk)+") ");
+        end
+        txtc(2:$) = blank + txtc(2:$);
+        txt = [txt;txtc];
+        //*******************************************//
+
+
+        //**
+    case 1 then
+        //*********** call seq definition ***********//
+        txtc=["(&local_flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,&t,block_"+rdnom+"["+string(bk-1)+"].xd, \";
+        "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \";
+        "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \";
+        "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \";
+        "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar"];
+        if (funtyp(bk)>2000 & funtyp(bk)<3000)
+            blank = get_blank(funs(bk)+"( ");
+            txtc(1) = funs(bk)+txtc(1);
+        elseif (funtyp(bk)<2000)
+            txtc(1) = "C2F("+funs(bk)+")"+txtc(1);
+            blank = get_blank("C2F("+funs(bk)+") ");
+        end
+        if nin>=1 | nout>=1 then
+            txtc($)=txtc($)+", \"
+            txtc=[txtc;""]
+            if nin>=1 then
+                for k=1:nin
+                    uk=inplnk(inpptr(bk)-1+k);
+                    nuk=size(outtb(uk),"*");
+                    txtc($)=txtc($)+"(double *)"+rdnom+"_block_outtbptr["+string(uk-1)+"],&nrd_"+string(nuk)+",";
+                end
+                txtc($)=part(txtc($),1:length(txtc($))-1); //remove last ,
+            end
+            if nout>=1 then
+                if nin>=1 then
+                    txtc($)=txtc($)+", \"
+                    txtc=[txtc;""]
+                end
+                for k=1:nout
+                    yk=outlnk(outptr(bk)-1+k);
+                    nyk=size(outtb(yk),"*");
+                    txtc($)=txtc($)+"(double *)"+rdnom+"_block_outtbptr["+string(yk-1)+"],&nrd_"+string(nyk)+",";
+                end
+                txtc($)=part(txtc($),1:length(txtc($))-1); //remove last ,
+            end
+        end
+
+        if ztyp(bk) then
+            txtc($)=txtc($)+", \"
+            txtc=[txtc;
+            "block_"+rdnom+"["+string(bk-1)+"].g,&block_"+rdnom+"["+string(bk-1)+"].ng);"]
+        else
+            txtc($)=txtc($)+");";
+        end
+
+        txtc(2:$) = blank + txtc(2:$);
+        txt = [txt;txtc];
+        //*******************************************//
+
+        //**
+    case 2 then
+
+        //*********** call seq definition ***********//
+        txtc=[funs(bk)+"(&local_flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,&t,block_"+rdnom+"["+string(bk-1)+"].xd, \";
+        "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \";
+        "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \";
+        "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \";
+        "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar, \";
+        "(double **)block_"+rdnom+"["+string(bk-1)+"].inptr,block_"+rdnom+"["+string(bk-1)+"].insz,&block_"+rdnom+"["+string(bk-1)+"].nin, \";
+        "(double **)block_"+rdnom+"["+string(bk-1)+"].outptr,block_"+rdnom+"["+string(bk-1)+"].outsz, &block_"+rdnom+"["+string(bk-1)+"].nout"];
+        if ~ztyp(bk) then
+            txtc($)=txtc($)+");";
+        else
+            txtc($)=txtc($)+", \";
+            txtc=[txtc;
+            "block_"+rdnom+"["+string(bk-1)+"].g,&block_"+rdnom+"["+string(bk-1)+"].ng);"]
+        end
+        blank = get_blank(funs(bk)+"( ");
+        txtc(2:$) = blank + txtc(2:$);
+        txt = [txt;txtc];
+        //*******************************************//
+
+        //**
+    case 4 then
+        txt=[txt;
+        funs(bk)+"(&block_"+rdnom+"["+string(bk-1)+"],local_flag);"];
+
+    end
+
+    txt =[txt;"if(local_flag < 0) return(5 - local_flag);"]
+
+endfunction
+
+//CallBlock : generate C calling sequence
+//            of a scicos block
+//
+//inputs : bk   : bloc index
+//         pt   :
+//         flag :block_'+rdnom+'[
+//
+//output : txt  :
+//
+//16/06/07 Authors : R.Nikoukhah, A.Layec
+function txt=call_block4(bk)
+    //   if flag==2 & ((zptr(bk+1)-zptr(bk))+(ozptr(bk+1)-ozptr(bk))==0 | pt<=0) then
+    //     return // block without discrete state or continuously activated
+    //            // If work allocated in the absence of z and oz, it does not work
+    //   end
+
+    //**
+    nx=xptr(bk+1)-xptr(bk);
+    nz=zptr(bk+1)-zptr(bk);
+    nrpar=rpptr(bk+1)-rpptr(bk);
+    nipar=ipptr(bk+1)-ipptr(bk);
+    nin=inpptr(bk+1)-inpptr(bk);  //* number of input ports */
+    nout=outptr(bk+1)-outptr(bk); //* number of output ports */
+
+    //**
+    //l'adresse du pointeur de ipar
+    if nipar<>0 then ipar=ipptr(bk), else ipar=1;end
+    //l'adresse du pointeur de rpar
+    if nrpar<>0 then rpar=rpptr(bk), else rpar=1; end
+    //l'adresse du pointeur de z attention -1 pas sur
+    if nz<>0 then z=zptr(bk)-1, else z=0;end
+    //l'adresse du pointeur de x
+    if nx<>0 then x=xptr(bk)-1, else x=0;end
+
+    //**
+    ftyp=funtyp(bk)
+    if ftyp>2000 then ftyp=ftyp-2000,end
+    if ftyp>1000 then ftyp=ftyp-1000,end
+
+    //** check function type
+    if ftyp < 0 then //** ifthenelse eselect blocks
+        txt = [];
+        return;
+    else
+        if (ftyp<>0 & ftyp<>1 & ftyp<>2 & ftyp<>3 & ftyp<>4) then
+            disp("types other than 0,1,2,3 or 4 are not supported.")
+            txt = [];
+            return;
+        end
+    end
+
+    //** add comment
+    txt=[get_comment("call_blk",list(funs(bk),funtyp(bk),bk,labels(bk)));]
+
+    //** write nevprt activation
+    //   nclock=abs(pt);
+    txt=[txt;
+    "block_"+rdnom+"["+string(bk-1)+"].nevprt=nevprt;"]
+
+    select ftyp
+        //** zero funtyp
+    case 0 then
+        //**** input/output addresses definition ****//
+        if nin>1 then
+            for k=1:nin
+                uk=inplnk(inpptr(bk)-1+k);
+                nuk=size(outtb(uk),"*");
+                TYPE=mat2scs_c_ptr(outtb(uk));//scilab index start from 1
+                txt=[txt;
+                "rdouttb["+string(k-1)+"]=("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(uk-1)+"];"]
+            end
+            txt=[txt;
+            "args[0]=&(rdouttb[0]);"]
+        elseif nin==0
+            uk=0;
+            nuk=0;
+            txt=[txt;
+            "args[0]=(SCSREAL_COP *)"+rdnom+"_block_outtbptr[0];"]
+        else
+            uk=inplnk(inpptr(bk));
+            nuk=size(outtb(uk),"*");
+            TYPE=mat2scs_c_ptr(outtb(uk));//scilab index start from 1
+            txt=[txt;
+            "args[0]=("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(uk-1)+"];"]
+        end
+
+        if nout>1 then
+            for k=1:nout
+                yk=outlnk(outptr(bk)-1+k);
+                nyk=size(outtb(yk),"*");
+                TYPE=mat2scs_c_ptr(outtb(yk));//scilab index start from 1
+                txt=[txt;
+                "rdouttb["+string(k+nin-1)+"]=("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(yk-1)+"];"];
+            end
+            txt=[txt;
+            "args[1]=&(rdouttb["+string(nin)+"]);"];
+        elseif nout==0
+            yk=0;
+            nyk=0;
+            txt=[txt;
+            "args[1]=(SCSREAL_COP *)"+rdnom+"_block_outtbptr[0];"];
+        else
+            yk=outlnk(outptr(bk));
+            nyk=size(outtb(yk),"*"),;
+            TYPE=mat2scs_c_ptr(outtb(yk));//scilab index start from 1
+            txt=[txt;
+            "args[1]=("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(yk-1)+"];"];
+        end
+        //*******************************************//
+
+        //*********** call seq definition ***********//
+        txtc=["(&flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,told,block_"+rdnom+"["+string(bk-1)+"].xd, \";
+        "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \";
+        "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \";
+        "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \";
+        "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar, \";
+        "(double *)args[0],&nrd_"+string(nuk)+",(double *)args[1],&nrd_"+string(nyk)+");"];
+        if (funtyp(bk)>2000 & funtyp(bk)<3000)
+            blank = get_blank(funs(bk)+"( ");
+            txtc(1) = funs(bk)+txtc(1);
+        elseif (funtyp(bk)<2000)
+            txtc(1) = "C2F("+funs(bk)+")"+txtc(1);
+            blank = get_blank("C2F("+funs(bk)+") ");
+        end
+        txtc(2:$) = blank + txtc(2:$);
+        txt = [txt;txtc];
+        //*******************************************//
+
+
+        //**
+    case 1 then
+        //**** input/output addresses definition ****//
+        //       if nin>=1 then
+        //         for k=1:nin
+        //           uk=inplnk(inpptr(i)-1+k);
+        //           nuk=size(outtb(uk),'*');
+        //         end
+        //       end
+        //       if nout>=1 then
+        //         for k=1:nout
+        //           yk=outlnk(outptr(i)-1+k);
+        //           nyk=size(outtb(yk),'*');
+        //         end
+        //       end
+        //*******************************************//
+
+        //*********** call seq definition ***********//
+        txtc=["(&flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,told,block_"+rdnom+"["+string(bk-1)+"].xd, \";
+        "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \";
+        "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \";
+        "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \";
+        "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar"];
+        if (funtyp(bk)>2000 & funtyp(bk)<3000)
+            blank = get_blank(funs(bk)+"( ");
+            txtc(1) = funs(bk)+txtc(1);
+        elseif (funtyp(bk)<2000)
+            txtc(1) = "C2F("+funs(bk)+")"+txtc(1);
+            blank = get_blank("C2F("+funs(bk)+") ");
+        end
+        if nin>=1 | nout>=1 then
+            txtc($)=txtc($)+", \"
+            txtc=[txtc;""]
+            if nin>=1 then
+                for k=1:nin
+                    uk=inplnk(inpptr(bk)-1+k);
+                    nuk=size(outtb(uk),"*");
+                    txtc($)=txtc($)+"(SCSREAL_COP *)"+rdnom+"_block_outtbptr["+string(uk-1)+"],&nrd_"+string(nuk)+",";
+                end
+                txtc($)=part(txtc($),1:length(txtc($))-1); //remove last ,
+            end
+            if nout>=1 then
+                if nin>=1 then
+                    txtc($)=txtc($)+", \"
+                    txtc=[txtc;""]
+                end
+                for k=1:nout
+                    yk=outlnk(outptr(bk)-1+k);
+                    nyk=size(outtb(yk),"*");
+                    txtc($)=txtc($)+"(SCSREAL_COP *)"+rdnom+"_block_outtbptr["+string(yk-1)+"],&nrd_"+string(nyk)+",";
+                end
+                txtc($)=part(txtc($),1:length(txtc($))-1); //remove last ,
+            end
+        end
+
+        if ztyp(bk) then
+            txtc($)=txtc($)+", \"
+            txtc=[txtc;"w,&nrd_0);"];
+        else
+            txtc($)=txtc($)+");";
+        end
+
+        txtc(2:$) = blank + txtc(2:$);
+        txt = [txt;txtc];
+        //*******************************************//
+
+        //**
+    case 2 then
+
+        //*********** call seq definition ***********//
+        txtc=[funs(bk)+"(&flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,told,block_"+rdnom+"["+string(bk-1)+"].xd, \";
+        "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \";
+        "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \";
+        "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \";
+        "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar, \";
+        "(double **)block_"+rdnom+"["+string(bk-1)+"].inptr,block_"+rdnom+"["+string(bk-1)+"].insz,&block_"+rdnom+"["+string(bk-1)+"].nin, \";
+        "(double **)block_"+rdnom+"["+string(bk-1)+"].outptr,block_"+rdnom+"["+string(bk-1)+"].outsz, &block_"+rdnom+"["+string(bk-1)+"].nout"];
+        if ~ztyp(bk) then
+            txtc($)=txtc($)+");";
+        else
+            txtc($)=txtc($)+", \";
+            txtc=[txtc;
+            "block_"+rdnom+"["+string(bk-1)+"].g,&block_"+rdnom+"["+string(bk-1)+"].ng);"]
+        end
+        blank = get_blank(funs(bk)+"( ");
+        txtc(2:$) = blank + txtc(2:$);
+        txt = [txt;txtc];
+        //*******************************************//
+
+        //**
+    case 4 then
+        txt=[txt;
+        funs(bk)+"(&block_"+rdnom+"["+string(bk-1)+"],flag);"];
+
+    end
+endfunction
+
+//
+//16/06/07 Author : ?, A. Layec
+//
+function [Code,capt,proto]=call_sensor(i)
+    nin=inpptr(i+1)-inpptr(i); ///* number of input ports */
+    nout=outptr(i+1)-outptr(i); ///* number of output ports */
+
+    //declaration des I/O des blocs de type 1
+    if funtyp(i)==0 then
+        if nout==0 then
+            yk    = 0;
+            nyk_1 = 0;
+            nyk_2 = 0;
+            yk_t  = 1;
+            //Code($+1)=+'  args[1]=(double *)(outtbptr[0]);';
+        else
+            yk    = outlnk(outptr(i));
+            nyk_1 = size(outtb(yk),1);
+            nyk_2 = size(outtb(yk),2);
+            yk_t  = mat2scs_c_nb(outtb(yk));
+            //Code($+1)='  args[1]=('+mat2scs_c_ptr(outtb(yk))+' *)(outtbptr['+string(yk-1)+']);';
+        end
+
+    end
+    capt=[i yk nyk_1 nyk_2 yk_t bllst(i).ipar]
+    Code($+1)="block_"+rdnom+"["+string(i-1)+"].nevprt=nevprt;"
+    Code=["/* Call of sensor (blk nb "+string(i)+") */"
+    Code;
+    "nport = "+string(nbcap)+";";
+    rdnom+"_sensor(&flag, &nport, &block_"+rdnom+"["+string(i-1)+"].nevprt, "+..
+    "told, ("+mat2scs_c_ptr(outtb(yk))+" *)(outtbptr["+string(yk-1)+"]), &nrd_"+string(nyk_1)+..
+    ", &nrd_"+string(nyk_2)+", &nrd_"+string(yk_t)+",aaa);"];
+    proto="void "+rdnom+"_sensor("+..
+    "int *, int *, int *, double *,void *, int *, int *,int *, int);"
+    proto=cformatline(proto,70);
+endfunction
+
+//Generates Code for dynamically linked Fortran and C Blocks
+function [CCode,FCode]=gen_blocks()
+    CCode=[]
+    FCode=[]
+
+    kdyn=find(funtyp>1000) //dynamically linked blocs
+    //100X : Fortran blocks
+    //200X : C blocks
+
+    if (size(kdyn,"*") >1)
+        kfuns=[];
+        //get the block data structure in the initial scs_m structure
+        if size(corinv(kdyn(1)),"*")==1 then
+            O=scs_m.objs(corinv(kdyn(1)));
+        else
+            path=list("objs");
+            for l=corinv(kdyn(1))(1:$-1)
+                path($+1)=l;
+                path($+1)="model";
+                path($+1)="rpar";
+                path($+1)="objs";
+            end
+            path($+1)=corinv(kdyn(1))($);
+            O=scs_m(path);
+        end
+        if funtyp(kdyn(1))>2000 then
+            //C block
+            CCode=[CCode;O.graphics.exprs(2)]
+        else
+            FCode=[FCode;O.graphics.exprs(2)]
+        end
+        kfuns=funs(kdyn(1));
+        for i=2:size(kdyn,"*")
+            //get the block data structure in the initial scs_m structure
+            if size(corinv(kdyn(i)),"*")==1 then
+                O=scs_m.objs(corinv(kdyn(i)));
+            else
+                path=list("objs");
+                for l=corinv(kdyn(i))(1:$-1)
+                    path($+1)=l;
+                    path($+1)="model";
+                    path($+1)="rpar";
+                    path($+1)="objs";
+                end
+                path($+1)=corinv(kdyn(i))($);
+                O=scs_m(path);
+            end
+            if (find(kfuns==funs(kdyn(i))) == [])
+                kfuns=[kfuns;funs(kdyn(i))];
+                if funtyp(kdyn(i))>2000  then
+                    //C block
+                    CCode=[CCode;O.graphics.exprs(2)]
+                else
+                    FCode=[FCode;O.graphics.exprs(2)]
+                end
+            end
+        end
+    elseif (size(kdyn,"*")==1)
+        //get the block data structure in the initial scs_m structure
+        if size(corinv(kdyn),"*")==1 then
+            O=scs_m.objs(corinv(kdyn));
+        else
+            path=list("objs");
+            for l=corinv(kdyn)(1:$-1)
+                path($+1)=l;
+                path($+1)="model";
+                path($+1)="rpar";
+                path($+1)="objs";
+            end
+            path($+1)=corinv(kdyn)($);
+            O=scs_m(path);
+        end
+        if funtyp(kdyn)>2000 then
+            //C block
+            CCode=[CCode;O.graphics.exprs(2)]
+        else
+            FCode=[FCode;O.graphics.exprs(2)]
+        end
+    end
+    if CCode==[]
+        CCode=["void no_ccode()"
+        "{"
+        "  return;"
+        "}"]
+    end
+endfunction
+
+//** Generates the C code for new block simulation
+//
+//12/07/07 Alan Layec
+function ok=gen_ccode42();
+
+    //** Generate code for scicos block
+
+    ierr=execstr("make_computational42(rpat+''/''+rdnom+''.c'')","errcatch")
+    if ierr<>0 then
+        message(lasterror())
+        ok=%f
+        return
+    end
+
+    //** Generate files for dynamically linked scicos blocks
+    [CCode,FCode]=gen_blocks()
+    if FCode<>[] then
+        ierr=execstr("mputl(FCode,rpat+''/''+rdnom+''f.f'')","errcatch")
+        if ierr<>0 then
+            message(lasterror())
+            ok=%f
+            return
+        end
+    end
+    if CCode<>[] then
+        ierr=execstr("mputl(CCode,rpat+''/''+rdnom+''_Cblocks.c'')","errcatch")
+        if ierr<>0 then
+            message(lasterror())
+            ok=%f
+            return
+        end
+    end
+
+    //** Generate _void_io.c
+    try
+        fd = mopen(rpat+"/"+rdnom+"_void_io.c", "wt")
+
+        mputl(["/*";
+        "**    Generated by Code_Generation toolbox of Xcos with "+getversion();
+        "**    Date : "+date();
+        "*/"], fd);
+
+        if (readGlobal <> [] | writeGlobal <> [])
+            mputl([""
+            "#include ""scicos_block4.h"""], fd);
+        end
+
+        mputl([""
+        "/*---------------------------------------- Actuators */"
+        "void "+rdnom+"_actuator(int *flag, int *nport, int *nevprt, double *t, void *u, int *nu1, int *nu2, int *ut, int *flag1)"
+        "{"
+        "  int k = 0,l = 0;"
+        "}"
+        "/*---------------------------------------- Sensor */"
+        "void "+rdnom+"_sensor(int *flag, int *nport, int *nevprt, double *t, void *y, int *ny1, int *ny2, int *yt, int *flag1)"
+        "{"
+        "  int k = 0,l = 0;"
+        "}"], fd)
+
+        // Generate global data read <=> FromWorkspace.
+        if readGlobal <> []
+            for i = readGlobal
+                mputl(["/*---------------------------------------- Read variable "+i+" */"
+                "void readGlobal_"+i+"(scicos_block *block, int flag)"
+                "{"
+                "    // Read a scilab Environment variable "+i
+                "    fromws_c(block, flag);"
+                "}"
+                ], fd);
+            end
+        end
+
+        // Generate global data write <=> ToWorkspace.
+        if writeGlobal <> []
+            for i = writeGlobal
+                mputl(["/*---------------------------------------- Write variable "+i+" */"
+                "void writeGlobal_"+i+"(scicos_block *block, int flag)"
+                "{"
+                "    // Write a scilab environment variable "+i
+                "    // to a C one : global"+i
+                "    tows_c(block, flag);"
+                "}"
+                ], fd);
+            end
+        end
+
+        mclose(fd);
+    catch
+        message(lasterror())
+        ok=%f
+        return
+    end
+
+    //** Generate _standalone.c
+
+    ierr=execstr("make_standalone42(rpat+''/''+rdnom+''_standalone.c'')","errcatch")
+    if ierr<>0 then
+        message(lasterror())
+        ok=%f
+        return
+    end
+
+    //** This copy is indispensable only for stand alone code generation
+    //** not supported in Scilab 5
+
+    //** copy source code of machine.h/scicos_block4.h
+    //   in target path
+    //   txt=mgetl(SCI+'/modules/core/includes/machine.h');
+    //   ierr=execstr('mputl(txt,rpat+''/machine.h'')','errcatch')
+    //   if ierr<>0 then
+    //     message(lasterror())
+    //     ok=%f
+    //     return
+    //   end
+    //
+    //   txt=mgetl(SCI+'/modules/scicos_blocks/includes/scicos_block4.h');
+    //   ierr=execstr('mputl(txt,rpat+''/scicos_block4.h'')','errcatch')
+    //   if ierr<>0 then
+    //     message(lasterror())
+    //     ok=%f
+    //     return
+    //   end
+
+    //** Generate _act_sens_events.c
+    Code=["/*"
+    "**    Generated by Code_Generation toolbox of Xcos with "+getversion()
+    "**    Date :"+date()
+    "*/"
+    ""
+    "#include <stdio.h>"
+    "#include <stdlib.h>"
+    "#include <math.h>"
+    "#include <string.h>"
+    "extern void **"+rdnom+"_block_outtbptr;"
+    "extern char input[50],output[50];"
+    "FILE *fprr = NULL, *fprw = NULL;"
+    make_outevents()
+    make_actuator(%t)
+    make_sensor(%t)]
+
+    created=[];
+    reponse=[];
+
+    created=fileinfo(rpat+"/"+rdnom+"_act_sens_events.c")
+    if created~=[] then
+        reponse=messagebox(["File: """+rdnom+"_act_sens_events.c"" already exists,";
+        "do you want to replace it ?"],"modal","question",["Yes","No"]);
+    end
+
+    if reponse==1 |  reponse==[] then
+        ierr=execstr("mputl(Code,rpat+''/''+rdnom+''_act_sens_events.c'')", ...
+        "errcatch")
+        if ierr<>0 then
+            message(lasterror())
+            ok=%f
+            return
+        end
+    end
+
+    try
+        if (readGlobal <> [] | writeGlobal <> [])
+            fd = mopen(rpat+"/"+rdnom+"_read_write_global.c", "wt")
+            mputl(["/*"
+            "**    Generated by Code_Generation toolbox of Xcos with "+getversion()
+            "**    Date :"+date()
+            "*/"
+            ""
+            "// Uncomment this to log each To Workspace variable update"
+            "//#define VERBOSE"
+            ""
+            "#ifdef VERBOSE"
+            "#include <stdio.h>"
+            "#endif"
+            "#include <stdlib.h>"
+            "#include <string.h>"
+            "#include ""scicos_block4.h"""
+            ""
+            "double get_scicos_time();"
+            ""
+            ], fd);
+            if writeGlobal <> []
+                // Generate global C variables
+                // #define global_XXX_Size
+                // static double **global_XXX
+                // static int global_XXX_Index (to manage buffer like variables)
+                for i = 1:size(writeGlobal, "*")
+                    mputl(["/*---------------------------------------- Global Variable "+writeGlobal(i)+" */"
+                    "#define global_"+writeGlobal(i)+"_Size    "+string(writeGlobalSize(i))
+                    "static double **global_"+writeGlobal(i)+";"
+                    "static int global_"+writeGlobal(i)+"_Index = 0;"
+                    ], fd);
+                end
+            end
+
+            if readGlobal <> []
+                // Generate global C variables
+                // #define global_XXX_Size
+                // #define global_XXX_Time_Size
+                // static double **global_XXX
+                // static double global_XXX_Time (manage time <-> values association)
+                for i = 1:size(readGlobal, "*")
+                    mputl(["/*---------------------------------------- Global Variable "+readGlobal(i)+" */"
+                    "#define global_"+readGlobal(i)+"_Size    "+string(readGlobalSize(i))
+                    "#define global_"+readGlobal(i)+"_Time_Size    "+string(readGlobalTimeSize(i))
+                    "static double **global_"+readGlobal(i)+";"
+                    "static double *global_"+readGlobal(i)+"_Time = 0;"
+                    ], fd);
+                end
+            end
+
+
+
+            if (readGlobal <> [])
+                for i = 1:size(readGlobal, "*")
+                    mputl(["/*---------------------------------------- Read variable "+readGlobal(i)+" */"
+                    "void readGlobal_"+readGlobal(i)+"(scicos_block *block, int flag)"
+                    "{"
+                    "    int i = 0;"
+                    "    int j = 0;"
+                    "    double *y_d = NULL;"
+                    ""
+                    "    /* Read a scilab Environment variable "+readGlobal(i)+" */"
+                    "    switch(flag)"
+                    "    {"
+                    ], fd)
+                    //
+                    // Init case : allocate data / timetable
+                    // Feal data/timetable with values from Scilab.
+                    //
+                    mputl(["    case 4 : /* init */"
+                    "    {"
+                    "        // Allocate time table"
+                    "        global_"+readGlobal(i)+"_Time = (double *) malloc(global_"+readGlobal(i)+"_Time_Size * sizeof(double));"
+                    "        memset(global_"+readGlobal(i)+"_Time, 0x0, global_"+readGlobal(i)+"_Time_Size * sizeof(double));"
+                    ""
+                    "        // Allocate data"
+                    "        global_"+readGlobal(i)+" = (double **) malloc(global_"+readGlobal(i)+"_Time_Size * sizeof(double *));"
+                    "        for (i = 0 ; i < global_"+readGlobal(i)+"_Time_Size ; ++i)"
+                    "        {"
+                    "            global_"+readGlobal(i)+"[i] = (double *) malloc( global_"+readGlobal(i)+"_Size * sizeof(double));"
+                    "            memset(global_"+readGlobal(i)+"[i], 0x0, global_"+readGlobal(i)+"_Size * sizeof(double));"
+                    "        }"
+                    ""
+                    ], fd);
+                    // Save format
+                    oldFormat = format();
+                    format(25);
+
+                    // Fead timetable
+                    for (j = 1:readGlobalTimeSize(i))
+                        mputl(["        global_"+readGlobal(i)+"_Time["+string(j-1)+"] = " + ...
+                        strsubst(string(evstr(readGlobal(i)+".time("+string(j)+")")), "D", "E")+";"
+                        ], fd)
+                    end
+                    // Fead data
+                    for (j = 1:readGlobalTimeSize(i))
+                        for (k = 1:readGlobalSize(i))
+                            mputl(["        global_"+readGlobal(i)+"["+string(j-1)+"]["+string(k-1)+"] = " + ...
+                            strsubst(string(evstr(readGlobal(i)+".values("+string(j)+", "+string(k)+")")), "D", "E")+";"
+                            ], fd)
+
+                        end
+                    end
+
+                    // Restore format
+                    format(oldFormat(2), oldFormat(1));
+
+                    mputl([""
+                    "        break;"
+                    "    }"
+                    ],fd);
+                    //
+                    // Output update case :
+                    //
+                    mputl(["    case 1 : /* output update */"
+                    "    {"
+                    "        j = 0;"
+                    "        while(get_scicos_time() >  global_"+readGlobal(i)+"_Time[j] && j < global_"+readGlobal(i)+"_Time_Size)"
+                    "        {"
+                    "            j++;"
+                    "        }"
+                    "        y_d = GetRealOutPortPtrs(block,1);"
+                    "        if (j == global_"+readGlobal(i)+"_Time_Size)"
+                    "        {"
+                    "            memset(y_d, 0x0, global_"+readGlobal(i)+"_Size * sizeof(double));"
+                    "        }"
+                    "        else"
+                    "        {"
+                    "            memcpy(y_d, global_"+readGlobal(i)+"[j], global_"+readGlobal(i)+"_Size * sizeof(double));"
+                    "        }"
+                    "        break;"
+                    "    }"
+                    ],fd);
+                    //
+                    // End, free memory.
+                    //
+                    mputl(["    case 5 : /* END */"
+                    "    {"
+                    "        for (i = 0 ; i < global_"+readGlobal(i)+"_Time_Size ; ++i)"
+                    "        {"
+                    "            free(global_"+readGlobal(i)+"[i]);"
+                    "        }"
+                    "        free(global_"+readGlobal(i)+");"
+                    "        break;"
+                    "    }"
+                    ],fd);
+                    // Close switch + function declaration
+                    mputl(["    }"
+                    "}"
+                    ], fd);
+                end
+            end
+
+            if writeGlobal <> []
+                for i = 1:size(writeGlobal, "*")
+                    mputl(["/*---------------------------------------- Write variable "+writeGlobal(i)+" */"
+                    "void writeGlobal_"+writeGlobal(i)+"(scicos_block *block, int flag)"
+                    "{"
+                    "    int i = 0;"
+                    "    int j = 0;"
+                    "    int nu = block->insz[0];"
+                    "    int nu2 = block->insz[1];"
+                    ""
+                    "    /* Write a scilab environment variable "+writeGlobal(i)+" */"
+                    "    /* to a C one : global_"+writeGlobal(i)+" */"
+                    "    switch(flag)"
+                    "    {"
+                    "    case 4 : /* init */"
+                    "    {"
+                    "        global_"+writeGlobal(i)+" = (double **) malloc(global_"+writeGlobal(i)+"_Size * sizeof(double *));"
+                    "        for (i = 0 ; i < global_"+writeGlobal(i)+"_Size ; ++i)"
+                    "        {"
+                    "            global_"+writeGlobal(i)+"[i] = (double *) malloc(nu * nu2 * sizeof(double));"
+                    "            memset(global_"+writeGlobal(i)+"[i], 0x0, nu * nu2 * sizeof(double));"
+                    "        }"
+                    "        global_"+writeGlobal(i)+"_Index = -1;"
+                    "#ifdef VERBOSE"
+                    "        printf(""C_"+writeGlobal(i)+".values = zeros(%d, %d, %d)\n"", global_"+writeGlobal(i)+"_Size, nu, nu2);"
+                    "        printf(""C_"+writeGlobal(i)+".time = -%%inf * ones(%d, 1)\n"", global_"+writeGlobal(i)+"_Size);"
+                    "#endif"
+                    "        break;"
+                    "    }"
+                    "    case 2 : /* state update */"
+                    "    {"
+                    "        global_"+writeGlobal(i)+"_Index = (global_"+writeGlobal(i)+"_Index + 1) % global_"+writeGlobal(i)+"_Size;"
+                    "        memcpy(global_"+writeGlobal(i)+"[global_"+writeGlobal(i)+"_Index], block->inptr[i], nu * nu2 * sizeof(double));"
+                    "#ifdef VERBOSE"
+                    "        printf(""C_"+writeGlobal(i)+".time(%d) = %.25E;\n"", global_"+writeGlobal(i)+"_Index + 1, get_scicos_time());"
+                    "        for (j = 0 ; j < nu * nu2 ; ++j)"
+                    "        {"
+                    "            printf(""C_"+writeGlobal(i)+".values(%d, %d) = %.25E;\n"", global_"+writeGlobal(i)+"_Index + 1, j + 1, global_"+writeGlobal(i)+"[global_"+writeGlobal(i)+"_Index][j]);"
+                    "        }"
+                    "#endif /* !VERBOSE */"
+                    "        break;"
+                    "    }"
+                    "    case 5 : /* end */"
+                    "    {"
+                    "#ifdef VERBOSE"
+                    "        //reshape to fit scilab behaviour"
+                    "        printf(""C_"+writeGlobal(i)+".time = C_"+writeGlobal(i)+".time(C_"+writeGlobal(i)+".time <> -%%inf);\n"");"
+                    "        printf(""C_"+writeGlobal(i)+".values = C_"+writeGlobal(i)+".values(1:size(C_"+writeGlobal(i)+".time, ''*''), :);\n"");"
+                    "#endif"
+                    "        for (i = 0 ; i < global_"+writeGlobal(i)+"_Size ; ++i)"
+                    "        {"
+                    "            free(global_"+writeGlobal(i)+"[i]);"
+                    "        }"
+                    "        free(global_"+writeGlobal(i)+");"
+                    "        break;"
+                    "    }"
+                    "    }"
+                    "}"
+                    ], fd);
+                end
+            end
+
+            mclose(fd);
+        end
+    catch
+        message(lasterror())
+        ok=%f
+        return
+    end
+
+endfunction
+
+//creates the Scicos GUI function associated with the new block
+//
+//Author : Rachid Djenidi, A.Layec
+//
+//20/06/07, A.Layec : update with in2,out2,intyp,outtyp
+//27/06/07, A.Layec : update opar,oz
+//
+function ok=gen_gui42();
+    clkinput=ones(clkIN)';
+    clkoutput=ones(clkOUT)';
+    for i=1:length(bllst)
+        deput=[%t,%f]
+        if (bllst(i).dep_ut(2) == %t) then
+            deput(1,2)=%t;
+            break;
+        end
+    end
+    Code=["function [sciblk, s1, s2] = "+rdnom+"_c(job,sciblk,e1)"
+    "// Interfacing function  of generated Xcos block "+rdnom
+    "//    Generated by the Xcos Code_Generation tool with "+getversion();
+    "//    Date : "+date();
+    "//"
+    "  s1= []; s2 = [];"
+    "  select job";
+    "  case ""set"" then";
+    "  case ""define"" then"
+    "    "+sci2exp(capt(:,3),"in",70); //input ports sizes 1
+    "    "+sci2exp(capt(:,4),"in2",70); //input ports sizes 2
+    "    "+sci2exp(scs_c_nb2scs_nb(capt(:,5)),"intyp",70); //input ports type
+    "    "+sci2exp(actt(:,3),"out",70); //output ports sizes 1
+    "    "+sci2exp(actt(:,4),"out2",70); //output ports sizes 2
+    "    "+sci2exp(scs_c_nb2scs_nb(actt(:,5)),"outtyp",70); //output ports type
+    "    "+sci2exp(cpr.state.x,"x",70); //initial continuous state
+    "    "+sci2exp(cpr.state.z,"z",70); //initial discrete state
+    "    work=zeros("+string(nblk)+",1)";
+    "    Z=[z;work]";
+    "    "+sci2exp(lstcat(cpr.state.oz,cpr.state.outtb),"odstate",70);
+    "    "+sci2exp(cpr.sim.rpar,"rpar",70); //real parameters
+    "    "+sci2exp(cpr.sim.ipar,"ipar",70); //integer parameters
+    "    "+sci2exp(cpr.sim.opar,"opar",70); //object parameters
+    "    "+sci2exp(clkinput,"clkinput",70);
+    "    "+sci2exp(clkoutput,"clkoutput",70);
+    "    "+sci2exp(FIRING,"firing",70);
+    "    nzcross="+string(sum(cpr.sim.zcptr(2:$)-cpr.sim.zcptr(1:$-1)))';
+    "    nmode="+string(sum(cpr.sim.modptr(2:$)-cpr.sim.modptr(1:$-1)))';
+    "    "+sci2exp(deput,"dep_ut",70);
+    "    model=scicos_model(sim=list(''"+rdnom+"'',4),...";
+    "                       in=in,..."
+    "                       in2=in2,..."
+    "                       intyp=intyp,..."
+    "                       out=out,..."
+    "                       out2=out2,..."
+    "                       outtyp=outtyp,..."
+    "                       evtin=clkinput,..."
+    "                       evtout=clkoutput,..."
+    "                       firing=firing,..."
+    "                       state=x,..."
+    "                       dstate=Z,..."
+    "                       odstate=odstate,..."
+    "                       rpar=rpar,..."
+    "                       ipar=ipar,..."
+    "                       opar=opar,..."
+    "                       blocktype=''c'',..."
+    "                       dep_ut=dep_ut,..."
+    "                       nzcross=nzcross,..."
+    "                       nmode=nmode)";
+    "    gr_i=""xstringb(orig(1),orig(2),"""""+rdnom+""""",sz(1),sz(2),""""fill"""")""";
+    "    sciblk = standard_define([2 2],model,[],gr_i);";
+    "    style_properties = [""blockWithLabel"";";
+    "                        ""verticalLabelPosition=middle"";";
+    "                        ""verticalAlign=middle"";";
+    "                        ""displayedLabel="+rdnom+"""];";
+    "    sciblk.graphics.style = strcat(style_properties,"";"");";
+    "  end"
+    "endfunction"];
+    //Create file
+    ierr=execstr("mputl(Code,rpat+""/""+rdnom+""_c.sci"")","errcatch")
+    if ierr<>0 then
+        message(lasterror())
+        ok=%f
+    end
+endfunction
+
+function  [ok,XX,alreadyran,flgcdgen,szclkINTemp,freof] = do_compile_superblock42(XX,all_scs_m,numk,alreadyran)
+    // Transforms a given Scicos discrete and continuous SuperBlock into a C defined Block
+
+    scs_m=XX.model.rpar
+    par=scs_m.props;
+    if alreadyran then
+        //terminate current simulation
+        do_terminate()
+        alreadyran=%f
+    end
+    hname=scs_m.props.title(1) //superblock name
+    //***********************************************************
+    //Check blocks properties and adapt them if necessary
+    //***********************************************************
+
+    IN=[];
+    OUT=[];
+    clkIN=[];
+    clkOUT=[];
+    numa=[];
+    numc=[];
+    writeGlobal = [];
+    writeGlobalSize = [];
+    readGlobal = [];
+    readGlobalTimeSize = [];
+    readGlobalSize = [];
+
+    for i=1:size(scs_m.objs)
+        if typeof(scs_m.objs(i))=="Block" then
+            if scs_m.objs(i).gui=="CLKOUT_f" then
+                ok=%f;%cpr=list();
+                message("Superblock should not have any activation output port.")
+                return
+            elseif scs_m.objs(i).gui=="IN_f" then
+                //replace input ports by sensor blocks
+                numc=numc+1
+                scs_m.objs(i).gui="INPUTPORTEVTS";
+                scs_m.objs(i).model.evtin=1
+                scs_m.objs(i).model.sim(1)="capteur"+string(numc)
+                IN=[IN scs_m.objs(i).model.ipar]
+            elseif scs_m.objs(i).gui=="OUT_f" then
+                //replace output ports by actuator blocks
+                numa=numa+1
+                scs_m.objs(i).gui="OUTPUTPORTEVTS";
+                scs_m.objs(i).model.sim(1)="actionneur"+string(numa)
+                OUT=[OUT  scs_m.objs(i).model.ipar]
+            elseif scs_m.objs(i).gui=="CLKINV_f" then
+                //replace event input ports by  fictious block
+                scs_m.objs(i).gui="EVTGEN_f";
+                scs_m.objs(i).model.sim(1)="bidon"
+                clkIN=[clkIN scs_m.objs(i).model.ipar];
+                //elseif scs_m.objs(i).model.dep_ut(2)==%t then
+                //check for time dependency PAS IICI
+                //ok=%f;%cpr=list()
+                //message('a block have time dependence.')
+                //return
+            elseif scs_m.objs(i).gui=="CLKOUTV_f" then
+                scs_m.objs(i).gui="EVTOUT_f";
+                scs_m.objs(i).model.sim(1)="bidon2"
+                clkOUT=[clkOUT scs_m.objs(i).model.ipar];
+            end
+        end
+    end
+
+    //Check if input/output ports are numered properly
+    IN=-gsort(-IN);
+    if or(IN<>[1:size(IN,"*")]) then
+        ok=%f;%cpr=list()
+        message("Input ports are not numbered properly.")
+        return
+    end
+    OUT=-gsort(-OUT);
+    if or(OUT<>[1:size(OUT,"*")]) then
+        ok=%f;%cpr=list()
+        message("Output ports are not numbered properly.")
+        return
+    end
+    clkIN=-gsort(-clkIN);
+    if or(clkIN<>[1:size(clkIN,"*")]) then
+        ok=%f;%cpr=list()
+        message("Event input ports are not numbered properly.")
+        return
+    end
+    clkOUT=-gsort(-clkOUT);
+    if or(clkOUT<>[1:size(clkOUT,"*")]) then
+        ok=%f;%cpr=list()
+        message("Event output ports are not numbered properly.")
+        return
+    end
+
+    //Check if there is more than one clock in the diagram
+    szclkIN=size(clkIN,2);
+    if szclkIN==0 then
+        szclkIN=[]
+    end
+    flgcdgen=szclkIN;
+    [bllst,connectmat,clkconnect,cor,corinv,ok,scs_m,flgcdgen,freof]=c_pass1(scs_m,flgcdgen);
+
+    // Check for any To Workspace/FromWorkspace block
+    for i = 1:size(bllst)
+        if bllst(i).sim(1) == "tows_c" then
+            // Explore scs_m to find original block
+            towsObjIndex = corinv(i);
+            towsObj = scs_m.objs(towsObjIndex(1));
+            for j = 2:size(towsObjIndex, "*")
+                towsObj = towsObj.model.rpar.objs(towsObjIndex(j));
+            end
+            bllst(i).sim(1) = "writeGlobal_" + ...
+            towsObj.graphics.exprs(2);
+            // Force state to enable case 2 call
+            // on generated code
+            bllst(i).dstate = 0;
+            writeGlobal = [writeGlobal towsObj.graphics.exprs(2)];
+            writeGlobalSize = [writeGlobalSize bllst(i).ipar(1)];
+        elseif bllst(i).sim(1) == "fromws_c" then
+            fromwsObjIndex = corinv(i);
+            fromwsObj = scs_m.objs(fromwsObjIndex(1));
+            for j = 2:size(fromwsObjIndex, "*")
+                fromwsObj = fromwsObj.model.rpar.objs(fromwsObjIndex(j));
+            end
+            bllst(i).sim(1) = "readGlobal_" + fromwsObj.graphics.exprs(1);
+            readGlobal = [readGlobal fromwsObj.graphics.exprs(1)];
+            readGlobalTimeSize = [readGlobalTimeSize evstr("size(" + fromwsObj.graphics.exprs(1) + ".time, ""*"")")]
+            readGlobalSize = [readGlobalSize evstr("size(" + fromwsObj.graphics.exprs(1) + ".values(1, :), ""*"")")]
+        end
+    end
+
+    if flgcdgen<> szclkIN
+        clkIN=[clkIN flgcdgen]
+    end
+    szclkINTemp=szclkIN;
+    szclkIN=flgcdgen;
+    // [bllst,connectmat,clkconnect,cor,corinv,ok]=c_pass1(scs_m);
+
+    //Test for  ALWAYS_ACTIVE sblock (RN -25/06/07)
+    ALWAYS_ACTIVE=%f;
+    for blki=bllst
+        if blki.dep_ut($) then
+            ALWAYS_ACTIVE=%t;
+            break;
+        end
+    end
+    if ALWAYS_ACTIVE then
+        CAPTEURS=[];
+        for Ii=1:length(bllst)
+            if part(bllst(Ii).sim(1),1:7)=="capteur" then
+                bllst(Ii).dep_ut($)=%t
+                //       elseif part(bllst(Ii).sim(1),1:10)=='actionneur' then
+                //         bllst(Ii).dep_ut($)=%t
+            end
+        end
+    end
+
+    if ~ok then
+        message("Sorry: problem in the pre-compilation step.")
+        return
+    end
+    a=[];
+    b=[];
+    tt=[];
+    howclk=[];
+    allhowclk=[];
+    allhowclk2=[];
+    cap=[];
+    act=[];
+
+    ///**********************************
+    for i=1:size(bllst)
+        // check for a scilab function block
+        if type(bllst(i).sim(1)) == 13 then
+            ok=%f;
+            %cpr=list();
+            message(_("Superblock should not contains any Scilab function block."))
+            return
+        end
+
+        for j=1:size(bllst)
+            if (bllst(i).sim(1)=="actionneur"+string(j)) then
+                if tt<>i then
+                    act=[act;i];
+                    tt=i;
+                end
+            elseif (bllst(i).sim(1)=="capteur"+string(j)) then
+                if tt<>i then
+                    cap=[cap;i];
+                    tt=i;
+                end
+            elseif (bllst(i).sim(1)=="bidon") then
+                if tt<>i then
+                    allhowclk=[allhowclk;i];
+                    tt=i;
+                end
+            elseif (bllst(i).sim(1)=="bidon2") then
+                if tt<>i then
+                    allhowclk2=[allhowclk2;i];
+                    tt=i;
+                end
+            end
+        end
+    end
+    ///**********************************
+    if szclkIN>1 then
+        //replace the N Event inputs by a fictious block with 2^N as many event
+        //outputs
+        output=ones((2^szclkIN)-1,1)
+        bllst($+1)=scicos_model(sim=list("bidon",1),evtout=output,..
+        blocktype="d",..
+        firing=-output',dep_ut=[%f %f])
+        corinv(size(bllst))=size(bllst)+1;
+        howclk=size(bllst)
+        // adjust the links accordingly
+        for i=1:(2^szclkIN)-1
+            vec=codebinaire(i,szclkIN)
+            for j=1:szclkIN
+                if vec(j)*allhowclk(j)>=1 then
+                    for k=1:size(clkconnect,1)
+                        if clkconnect(k,1)==allhowclk(j) then
+                            clkconnect=[clkconnect;[howclk i clkconnect(k,3:4)]]
+                        end
+                    end
+                end
+            end
+        end
+    elseif szclkIN==[]&~ALWAYS_ACTIVE then
+        //superblock has no Event input, add a fictious clock
+        output=ones((2^(size(cap,"*")))-1,1)
+        if (output == []) then
+            output=0;
+        end
+        bllst($+1)=scicos_model(sim=list("bidon",1),evtout=output,..
+        firing=-output,blocktype="d",dep_ut=[%f %f])
+        corinv(size(bllst))=size(bllst)+1;
+        howclk=size(bllst);
+    elseif szclkIN==1  then
+        howclk=allhowclk;
+    end
+
+    //mise en ordre de clkconnect
+    if szclkIN>1 then
+        newclkconnect=clkconnect;
+        clkconnect=[];
+        for i=1:size(newclkconnect,1)-1
+            if or(newclkconnect(i,:)<>newclkconnect(i+1,:)) then
+                clkconnect=[clkconnect;newclkconnect(i,:)]
+            end
+        end
+        if or(newclkconnect($-1,:)<>newclkconnect($,:)) then
+            clkconnect=[clkconnect;newclkconnect($,:)]
+        end
+
+        //suppression des blocs bidons
+        newclkconnect=clkconnect;nkt=[];
+        for i=1:szclkIN
+            for k=1:size(newclkconnect,1)
+                if newclkconnect(k,1)~=allhowclk(i) then
+                    nkt=[nkt;newclkconnect(k,:)];
+                end
+            end
+            newclkconnect=nkt;
+            nkt=[];
+        end
+        clkconnect=newclkconnect;
+    end
+
+    //**************************************************
+    // nouveau clkconnect avec liaisons sur les capteurs
+    //**************************************************
+
+    //
+    // Generate block activation fo C code
+    //
+    n=size(cap,1)
+    if ~(szclkIN==[]) then
+        // Activate sensors on each clock pulse.
+        generatedConnection = [];
+        for i=1:n
+            if szclkIN>1 then
+                for j=1:(2^szclkIN)-1
+                    generatedConnection = [generatedConnection ; [howclk j cap(i) 1]];
+                end
+            elseif szclkIN==1 then
+                generatedConnection = [generatedConnection ; [howclk 1 cap(i) 1]];
+            end
+        end
+        clkconnect = [clkconnect ; generatedConnection]
+    elseif ~ALWAYS_ACTIVE then
+        // Generate all possible activations for sensors, based on number of blocks.
+        //codage de l'activation des capteurs dans le cas de l'heritage
+        generatedConnection = [];
+        for i=1:2^n-1
+            vec=codebinaire(i,n);
+            for j=1:n
+                if (vec(j)==1) then
+                    generatedConnection = [generatedConnection ; [howclk i cap(j) 1]];
+                end
+            end
+        end
+        clkconnect = [clkconnect ; generatedConnection]
+    end
+
+    FIRING=[]
+    for i=1:size(allhowclk2,1)
+        j = find(clkconnect(:,3)==allhowclk2(i))
+        if j<>[] then
+            FIRING=[FIRING;bllst(clkconnect(j,1)).firing(clkconnect(j,2))]
+        end
+    end
+
+    Code_gene_run=[];
+
+    //** OLD GRAPHICS
+    //** %windo=xget('window')
+
+    cpr=c_pass2(bllst,connectmat,clkconnect,cor,corinv)
+
+    if cpr==list() then ok=%f,return, end
+
+    //** Alan's patch 5/07/07: try to solve
+    //   which blocks use work
+    funs_save=cpr.sim.funs;
+    funtyp_save=cpr.sim.funtyp;
+    with_work = zeros(cpr.sim.nblk,1)
+    for i=1:lstsize(cpr.sim.funs)
+        if part(cpr.sim.funs(i),1:10)=="actionneur" then
+            cpr.sim.funs(i) ="bidon"
+            cpr.sim.funtyp(i) = 1
+        elseif part(cpr.sim.funs(i),1:7)=="capteur" then
+            cpr.sim.funs(i) ="bidon"
+            cpr.sim.funtyp(i) = 1
+        end
+    end
+
+    //**
+    //** retrieve all open Scilab windows with winsid()
+    //**
+
+    BeforeCG_WinList = winsid();
+
+    ierr=execstr("[state,t]=scicosim(cpr.state,0,0,cpr.sim,"+..
+    "''start'',scs_m.props.tol)","errcatch")
+    if ierr==0 then
+        for i=1:cpr.sim.nblk
+            if state.iz(i)<>0 then
+                with_work(i)=%t
+            end
+        end
+        ierr=execstr("[state,t]=scicosim(state,0,0,cpr.sim,"+..
+        "''finish'',scs_m.props.tol)","errcatch")
+    end
+
+    //**
+    //** retrieve all open Scilab windows with winsid
+    //** and close the additional windows open since first
+    //**
+
+    //** This code does not cover 100% of the possible situations because the user can
+    //** destroy one or more Scicos wins manually during this intermediate phase
+    //** This code is 100% functional if the user does not close manually any win.
+    //** TO BE updated in Scilab 5.0
+
+    AfterCG_WinList = winsid();
+
+    AfterCG_size = size(AfterCG_WinList); //** matrix
+    AfterCG_size = AfterCG_size(2) ; //** vector length
+
+    BeforeCG_size = size(BeforeCG_WinList); //** matrix
+    BeforeCG_size = BeforeCG_size(2) ; //** vector length
+
+    if (or(AfterCG_WinList<>BeforeCG_WinList)) & (AfterCG_size>BeforeCG_size) then
+        //** means that a scope or other scicos object has created some
+        //** output window
+
+        DiffCG_Winlist = AfterCG_WinList<>BeforeCG_WinList ; //** T/F mismatch
+        DiffCG_Index = find(DiffCG_Winlist); //** recover the mismatched indexes only
+
+        for win_idx = DiffCG_Index
+            delete( scf( AfterCG_WinList(win_idx) ) ) ; //** clear the spurious windows
+        end
+
+    end
+    //**------------- end of windows cleaning ----------------------------------------
+
+    cpr.sim.funs=funs_save;
+    cpr.sim.funtyp=funtyp_save;
+
+    //** OLD GRAPHICS
+    //** xset('window',%windo)
+
+    ///////////////////
+    //les pointeurs de cpr :
+    x=cpr.state.x;
+    z=cpr.state.z;
+    outtb=cpr.state.outtb;
+
+    //RN
+    zcptr=cpr.sim.zcptr;
+    ozptr=cpr.sim.ozptr;
+    rpptr=cpr.sim.rpptr;
+    ipptr=cpr.sim.ipptr;
+    opptr=cpr.sim.opptr;
+    funs=cpr.sim.funs;
+    xptr=cpr.sim.xptr;
+    zptr=cpr.sim.zptr;
+    inpptr=cpr.sim.inpptr;
+    inplnk=cpr.sim.inplnk;
+    outptr=cpr.sim.outptr;
+    outlnk=cpr.sim.outlnk;
+    //@l@n lnkptr=cpr.sim.lnkptr;
+    ordclk=cpr.sim.ordclk;
+    funtyp=cpr.sim.funtyp;
+    cord=cpr.sim.cord;
+    ncord=size(cord,1);
+    nblk=cpr.sim.nb;
+    ztyp=cpr.sim.ztyp;
+    clkptr=cpr.sim.clkptr
+    labels=cpr.sim.labels;
+    //taille totale de z : nztotal
+    nztotal=size(z,1);
+
+    //*******************************
+    //Checking if superblock is valid
+    //*******************************
+    msg=[]
+    for i=1:length(funs)-1
+        if funtyp(i)==3 then
+            msg=[msg;"Type 3 block''s not allowed"]
+            break;
+        end
+        if msg<>[] then message(msg),ok=%f,return,end
+    end
+
+    //********************************************************
+    // Change logical units for readf and writef blocks if any ???
+    //********************************************************
+    lunit=0
+    for d=1:length(funs)
+        if funs(d)=="readf"  then
+            z(zptr(d)+2)=lunit
+            lunit=lunit+1;
+        elseif funs(d)=="writef"
+            z(zptr(d)+1)=lunit
+            lunit=lunit+1;
+        end
+    end
+
+    //***********************************
+    // Get the name of the file
+    //***********************************
+    foo=3;
+    okk=%f;
+    rdnom="foo";
+    rpat=pwd();
+    [x,ierr] = fileinfo(rpat);
+    S_IWRITE = 128; // mask write permission
+    if (ierr <> 0 | bitand(x(2), S_IWRITE) == 0) then
+        rpat = TMPDIR;
+    end
+
+    libs="";
+    label1=[hname;rpat+"/"+hname;""];
+
+    while %t do
+        ok=%t  // to avoid infinite loop
+        [okk,..
+        rdnom,..
+        rpat,..
+        libs,..
+        label1]=scicos_getvalue("Set code generator parameters :",..
+        ["New block''s name :";
+        "Created files Path :";
+        "Other object files to link with (if any)"],..
+        list("str",1,"str",1,"str",1),label1);
+        if okk==%f then
+            ok=%f
+            return
+        end
+        rpat=stripblanks(rpat);
+
+        //** 1/07/06 Alan trying to solve multiple libraries during week-end
+        if strindex(libs,"''")<>[] | strindex(libs,"""")<>[] then
+            ierr=execstr("libs=evstr(libs)","errcatch")
+            if ierr<>0  then
+                message(["Can''t solve other files to link"])
+                ok=%f;
+                return
+            end
+        end
+
+        //** Alan, I put a warning here in order to inform the user
+        //** that the name of the superblock will change
+        //** because the space char in name isn't allowed.
+        if grep(rdnom," ")<>[] then
+            message(["Superblock name cannot contains space characters.";
+            "space chars will be automatically substituted by ""_"" "])
+        end
+        rdnom = strsubst(rdnom," ","_");
+
+        //** Put a warning here in order to inform the user
+        //** that the name of the superblock will change
+        //** because the "-" char could generate GCC problems
+        //** (the C functions contains the name of the superblock).
+        if grep(rdnom,"-")<>[] then
+            message(["For full C compiler compatibility ";
+            "Superblock name cannot contains ""-"" characters";
+            """-"" chars will be automatically substituted by ""_"" "])
+        end
+        rdnom = strsubst(rdnom,"-","_");
+
+        dirinfo=fileinfo(rpat)
+
+        if dirinfo==[] then
+            [pathrp,fnamerp,extensionrp]=fileparts(rpat)
+            ok=mkdir(pathrp,fnamerp+extensionrp)
+            if ~ok then
+                messagebox("Directory "+rpat+" cannot be created","modal","info");
+            end
+        elseif filetype(dirinfo(2))<>"Directory" then
+            ok=%f;
+            messagebox(rpat+" is not a directory","modal","error");
+        end
+
+        if stripblanks(rdnom)==emptystr() then
+            ok=%f;
+            messagebox("sorry C file name not defined","modal","error");
+        end
+        if ok then break,end
+    end
+
+    //////////////////////////////////////////////////
+    maxnrpar=max(rpptr(2:$)-rpptr(1:$-1))
+    maxnipar=max(ipptr(2:$)-ipptr(1:$-1))
+    maxnx=max(xptr(2:$)-xptr(1:$-1))
+    maxnz=max(zptr(2:$)-zptr(1:$-1))
+    maxnin=max(inpptr(2:$)-inpptr(1:$-1))
+    maxnout=max(outptr(2:$)-outptr(1:$-1))
+    maxdim=[];
+    for i=1:lstsize(cpr.state.outtb)
+        maxdim=max(size(cpr.state.outtb(i)))
+    end
+    maxtotal=max([maxnrpar;maxnipar;maxnx;maxnz;maxnin;maxnout;maxdim]);
+
+    //************************************************************************
+    //generate the call to the blocks and blocs simulation function prototypes
+    //************************************************************************
+    wfunclist=list();
+    nbcap=0;nbact=0;capt=[];actt=[];Protostalone=[];Protos=[];
+    dfuns=[]
+    for i=1:length(funs)
+        if or(i==act) then //block is an actuator
+            nbact=nbact+1;
+            [Code,actti,protoi]=call_actuator(i)
+            wfunclist($+1)=[Code;"if(flag < 0 ) return(5 - flag);"]
+            if nbact==1 then Protostalone=[Protostalone;"";protoi],end
+            actt=[actt;actti]
+        elseif or(i==cap) then //block is a sensor
+            nbcap=nbcap+1;
+            [Code,capti,protoi]=call_sensor(i)
+            wfunclist($+1)=[Code;"if(flag < 0 ) return(5 - flag);"]
+            if nbcap==1 then Protostalone=[Protostalone;"";protoi] ,end
+            capt=[capt;capti]
+        elseif funs(i)=="bidon"
+            wfunclist($+1)=" "
+        elseif funs(i)=="bidon2"
+            wfunclist($+1)=" "
+        else
+            ki=find(funs(i)==dfuns)
+            dfuns=[dfuns;funs(i)]
+            //[Code,protoi]=call_block(i)
+            [Code]=call_block4(i)
+            if Code<>[] then
+                wfunclist($+1)=[Code;"if(flag < 0 ) return(5 - flag);"]
+            else
+                wfunclist($+1)=" ";
+            end
+            if ki==[] then
+                Protos=[Protos;"";BlockProto(i)];
+                Protostalone=[Protostalone;"";BlockProto(i)];
+            end
+        end
+    end
+
+    //**************************************
+    //on prend en compte l'ordre des numerotation graphique des
+    //capteur et des actionneur
+    [junk,index]=gsort(-actt(:,$));
+    actt=actt(index,1:$) ;
+    [junk,index]=gsort(-capt(:,$));
+    capt=capt(index,1:$) ;
+
+    //***************************************************
+    //Compute the initial state and outtb (links)  values
+    //***************************************************
+    //petite modification pour uniformiser les fichiers capteurs
+    //et actionneurs ???
+    rdcpr=cpr.sim.funs;
+    for r=1:length(cap),rdcpr(cap(r))="bidon";end
+    for r=1:length(act),rdcpr(act(r))="bidon";end
+    Total_rdcpr=cpr.sim;Total_rdcpr.funs=rdcpr;
+    //
+    tcur=0;
+    tf=scs_m.props.tf;
+    tolerances=scs_m.props.tol;
+    //[state,t]=scicosim(cpr.state,tcur,tf,Total_rdcpr,'start',tolerances);
+    //cpr.state=state;
+    z=cpr.state.z;
+    outtb=cpr.state.outtb;
+    //[junk_state,t]=scicosim(cpr.state,tcur,tf,Total_rdcpr,'finish',tolerances);
+
+    //***********************************
+    // Scilab and C files generation
+    //***********************************
+
+    //** generate scilab interfacing function
+    //   of the generated scicos block
+    ok=gen_gui42();
+
+
+    //** generate C files
+    //   of the generated scicos block
+    if ok then
+        ok=gen_ccode42()
+    end
+
+    //** Generates Makefile, loader
+    //   and compile and link C files
+
+    //** def files to build
+    files=[rdnom rdnom+"_void_io" rdnom+"_Cblocks"]
+
+    //** def files to build for standalone
+    filestan=[rdnom+"_standalone" rdnom+"_act_sens_events" rdnom+"_Cblocks"]
+
+    if ok then
+        ok = buildnewblock(rdnom,files,filestan,rpat,libs,"","")
+    end
+
+    //**
+    //if ok then ok=gen_loader(),end
+
+    if ok then
+        //load the gui function
+        exec(rpat+"/"+rdnom+"_c.sci");
+        //Change diagram superblock to new generated block
+        XX=update_block(XX);
+        execstr(rdnom+"_c=resume("+rdnom+"_c)")
+    else
+        message([_("Generated block cannot be linked with Scilab.")])
+    end
+
+endfunction
+
+//BlockProto : generate prototype
+//            of a scicos block
+//
+//inputs : bk   : bloc index
+//
+//output : txt  :
+//
+//16/06/07 Author : A.Layec
+function [txt]=BlockProto(bk)
+
+    nin=inpptr(bk+1)-inpptr(bk);  //* number of input ports */
+    nout=outptr(bk+1)-outptr(bk); //* number of output ports */
+
+    //**
+    ftyp=funtyp(bk)
+    if ftyp>2000 then ftyp=ftyp-2000,end
+    if ftyp>1000 then ftyp=ftyp-1000,end
+
+    //** check function type
+    if ftyp < 0 then //** ifthenelse eselect blocks
+        txt = [];
+        return;
+    else
+        if (ftyp<>0 & ftyp<>1 & ftyp<>2 & ftyp<>3 & ftyp<>4) then
+            disp("types other than 0,1,2,3 or 4 are not yet supported.")
+            txt = [];
+            return;
+        end
+    end
+
+    //** add comment
+    txt=[get_comment("proto_blk",list(funs(bk),funtyp(bk),bk,labels(bk)));]
+
+    select ftyp
+        //** zero funtyp
+    case 0 then
+
+        //*********** prototype definition ***********//
+        txtp=["(int *, int *, double *, double *, double *, int *, double *, \";
+        " int *, double *, int *, double *, int *,int *, int *, \";
+        " double *, int *, double *, int *);"];
+        if (funtyp(bk)>2000 & funtyp(bk)<3000)
+            blank = get_blank("void "+funs(bk)+"(");
+            txtp(1) = "void "+funs(bk)+txtp(1);
+        elseif (funtyp(bk)<2000)
+            txtp(1) = "void C2F("+funs(bk)+")"+txtp(1);
+            blank = get_blank("void C2F("+funs(bk)+")");
+        end
+        txtp(2:$) = blank + txtp(2:$);
+        txt = [txt;txtp];
+        //*******************************************//
+
+
+        //**
+    case 1 then
+
+        //*********** prototype definition ***********//
+        txtp=["(int *, int *, double *, double *, double *, int *, double *, \";
+        " int *, double *, int *, double *, int *,int *, int *";]
+        if (funtyp(bk)>2000 & funtyp(bk)<3000)
+            blank = get_blank("void "+funs(bk)+"(");
+            txtp(1) = "void "+funs(bk)+txtp(1);
+        elseif (funtyp(bk)<2000)
+            txtp(1) = "void C2F("+funs(bk)+")"+txtp(1);
+            blank = get_blank("void C2F("+funs(bk)+")");
+        end
+        if nin>=1 | nout>=1 then
+            txtp($)=txtp($)+", \"
+            txtp=[txtp;""]
+            if nin>=1 then
+                for k=1:nin
+                    txtp($)=txtp($)+" double *, int * ,"
+                end
+                txtp($)=part(txtp($),1:length(txtp($))-1); //remove last ,
+            end
+            if nout>=1 then
+                if nin>=1 then
+                    txtp($)=txtp($)+", \"
+                    txtp=[txtp;""]
+                end
+                for k=1:nout
+                    txtp($)=txtp($)+" double *, int * ,"
+                end
+                txtp($)=part(txtp($),1:length(txtp($))-1); //remove last ,
+            end
+        end
+
+        if ztyp(bk) then
+            txtp($)=txtp($)+", \"
+            txtp=[txtp;" double *,int *);"];
+        else
+            txtp($)=txtp($)+");";
+        end
+
+        txtp(2:$) = blank + txtp(2:$);
+        txt = [txt;txtp];
+        //*******************************************//
+
+        //**
+    case 2 then
+
+        //*********** prototype definition ***********//
+
+        txtp=["void "+funs(bk)+...
+        "(int *, int *, double *, double *, double *, int *, double *, \";
+        " int *, double *, int *, double *, int *, int *, int *, \"
+        " double **, int *, int *, double **,int *, int *"];
+        if ~ztyp(bk) then
+            txtp($)=txtp($)+");";
+        else
+            txtp($)=txtp($)+", \";
+            txtp=[txtp;
+            " double *,int *);"]
+        end
+        blank = get_blank("void "+funs(bk));
+        txtp(2:$) = blank + txtp(2:$);
+        txt = [txt;txtp];
+        //********************************************//
+
+        //**
+    case 4 then
+        txt=[txt;
+        "void "+funs(bk)+"(scicos_block *, int );"];
+
+    end
+endfunction
+
+//Generating the routine for actuators interfacing
+//
+//
+//Authors : R. Djenid, R. Nikoukhah, A. Layec
+//
+//actt=[i uk nuk_1 nuk_2 uk_t bllst(i).ipar]
+function Code=make_actuator(standalone)
+    Call=["/*"
+    "**    Generated by Code_Generation toolbox of Xcos with "+getversion()
+    "**    Date : "+date()
+    "*/"
+    ""
+    "/*"+part("-",ones(1,40))+" Actuators */";
+    "void "+rdnom+"_actuator(int *flag, int *nport, int *nevprt, double *t, void *u, int *nu1, int *nu2, int *ut, int flag1)"]
+
+    comments=["     /*"
+    "      * To be customized for standalone execution";
+    "      * flag  : specifies the action to be done"
+    "      * nport : specifies the  index of the Super Bloc"
+    "      *         regular input (The input ports are numbered"
+    "      *         from the top to the bottom )"
+    "      * nevprt: indicates if an activation had been received"
+    "      *         0 = no activation"
+    "      *         1 = activation"
+    "      * t     : the current time value"
+    "      * u     : the vector inputs value"
+    "      * nu1   : the input size 1"
+    "      * nu2   : the input size 2"
+    "      * ut    : the input type"
+    "      * flag1 : learn mode (0 from terminal,1 from input file"
+    "      */"]
+
+    dcl=["{"
+    "  int j,k,l;"];
+
+    if standalone then
+        a_actuator=["  /* skeleton to be customized */"
+        "    switch (*flag) {"
+        "    /* OutputUpdate (*flag==1) will be called on each iteration */"
+        "    case 1 :"
+        "      /*if(*nevprt>0) { get the input value */"
+        "        switch (*ut) {"
+        "        case 10 :"
+        "          for (l=0;l<*nu2;l++) {"
+        "            for (k=0;k<*nu1;k++) {"
+        "              printf(""Actuator: time=%f, "+...
+        "u(%d,%d) of actuator %d is %f "+...
+        "\n"", \"
+        "                     *t, k, l, *nport,"+...
+        "*((double *) u+(k+l*(*nu1))));"
+        "            }"
+        "          }"
+        "          break;"
+        ""
+        "        case 11 :"
+        "          for (l=0;l<*nu2;l++) {"
+        "            for (k=0;k<*nu1;k++) {"
+        "              printf(""Actuator: time=%f, "+...
+        "u(%d,%d) of actuator %d is %f,%f "+...
+        "\n"", \"
+        "                     *t, k, l, *nport,"+...
+        "*((double *) u+(k+l*(*nu1))),"+...
+        "*((double *) u+((*nu1)*(*nu2)+k+l*(*nu1))));"
+        "            }"
+        "          }"
+        "          break;"
+        ""
+        "        case 81 :"
+        "          for (l=0;l<*nu2;l++) {"
+        "            for (k=0;k<*nu1;k++) {"
+        "              printf(""Actuator: time=%f, "+...
+        "u(%d,%d) of actuator %d is %i "+...
+        "\n"", \"
+        "                     *t, k, l, *nport,"+...
+        "*((char *) u+(k+l*(*nu1))));"
+        "            }"
+        "          }"
+        "          break;"
+        ""
+        "        case 82 :"
+        "          for (l=0;l<*nu2;l++) {"
+        "            for (k=0;k<*nu1;k++) {"
+        "              printf(""Actuator: time=%f, "+...
+        "u(%d,%d) of actuator %d is %hd "+...
+        "\n"", \"
+        "                     *t, k, l, *nport,"+...
+        "*((short *) u+(k+l*(*nu1))));"
+        "            }"
+        "          }"
+        "          break;"
+        ""
+        "        case 84 :"
+        "          for (l=0;l<*nu2;l++) {"
+        "            for (k=0;k<*nu1;k++) {"
+        "              printf(""Actuator: time=%f, "+...
+        "u(%d,%d) of actuator %d is %ld "+...
+        "\n"", \"
+        "                     *t, k, l, *nport,"+...
+        "*((long *) u+(k+l*(*nu1))));"
+        "            }"
+        "          }"
+        "          break;"
+        ""
+        "        case 811 :"
+        "          for (l=0;l<*nu2;l++) {"
+        "            for (k=0;k<*nu1;k++) {"
+        "              printf(""Actuator: time=%f, "+...
+        "u(%d,%d) of actuator %d is %d "+...
+        "\n"", \"
+        "                     *t, k, l, *nport,"+...
+        "*((unsigned char *) u+(k+l*(*nu1))));"
+        "            }"
+        "          }"
+        "          break;"
+        ""
+        "        case 812 :"
+        "          for (l=0;l<*nu2;l++) {"
+        "            for (k=0;k<*nu1;k++) {"
+        "              printf(""Actuator: time=%f, "+...
+        "u(%d,%d) of actuator %d is %hu "+...
+        "\n"", \"
+        "                     *t, k, l, *nport,"+...
+        "*((unsigned short *) u+(k+l*(*nu1))));"
+        "            }"
+        "          }"
+        "          break;"
+        ""
+        "        case 814 :"
+        "          for (l=0;l<*nu2;l++) {"
+        "            for (k=0;k<*nu1;k++) {"
+        "              printf(""Actuator: time=%f, "+...
+        "u(%d,%d) of actuator %d is %lu "+...
+        "\n"", \"
+        "                     *t, k, l, *nport,"+...
+        "*((unsigned long *) u+(k+l*(*nu1))));"
+        "            }"
+        "          }"
+        "          break;"
+        "        }"
+        "      /*} */"
+        "      break;"
+        "    case 4 : /* actuator initialisation */"
+        "      /* do whatever you want to initialize the actuator */"
+        "      break;"
+        "    case 5 : /* actuator ending */"
+        "      /* do whatever you want to end the actuator */"
+        "      break;"
+        "    }"]
+    else
+        a_actuator=[]
+    end
+
+    // pour fprintf
+    nc=size(act,"*") // Alan : d'o? viens act ?????
+    // reponse : de do_compile_superblock!
+    typ=["""%f "]; //time
+    for i=1:nc
+        typ($)=typ($)+""" \"
+        typ=[typ;""""];
+        for j=1:sum(actt(i,3)*actt(i,4))
+            //typ=typ+'%f ';
+            typ($)=typ($)+scs_c_n2c_fmt(actt(i,5))+" ";
+        end
+    end
+    typ($)=typ($)+"\n"", \"
+    typ(1)="    fprintf(fprw,"+typ(1);
+    bl    ="                 ";
+    if size(typ,1) <> 1 then
+        typ(2:$) = bl+typ(2:$);
+    end
+    //Code1='    fprintf(fprw, '"'+typ+' \n'",*t'
+    Code1=[typ;bl+"*t"];
+    //actt=[i uk nuk_1 nuk_2 uk_t bllst(i).ipar]
+    for i=1:size(actt,1)
+        ni=actt(i,3)*actt(i,4) // dimension of ith output
+        Code1($)=Code1($)+","
+        Code1=[Code1;bl];
+        for j=1:ni
+            if actt(i,5)<>11 then
+                Code1($)=Code1($)+...
+                "*((("+scs_c_n2c_typ(actt(i,5))+" *)("+...
+                rdnom+"_block_outtbptr+"+string(actt(i,2)-1)+"))"+...
+                "+"+string(j-1)+")";
+            else //CAS CMPLX
+                Code1($)=Code1($)+...
+                "*((("+scs_c_n2c_typ(actt(i,5))+" *)("+...
+                rdnom+"_block_outtbptr+"+string(actt(i,2)-1)+"))"+...
+                "+"+string((j-1))+"), "+...
+                "*((("+scs_c_n2c_typ(actt(i,5))+" *)("+...
+                rdnom+"_block_outtbptr+"+string(actt(i,2)-1)+"))"+...
+                "+"+string(ni+(j-1))+")";
+            end
+            if j<>ni then
+                Code1($)=Code1($)+", ";
+            end
+        end
+    end
+    Code1($)=Code1($)+");"
+
+    Code=[]
+
+    if nc==1|~standalone then
+        Code=[Call
+        comments
+        dcl
+        "  if (flag1 == 0) {"
+        a_actuator
+        "  }"
+        "  else if (flag1 == 1) {"
+        "    if (*flag == 4 && *nport == 1) {"
+        "      fprw=fopen(output,'"wt'");"
+        "      if( fprw == NULL )"
+        "        {"
+        "          printf('"Error opening file: %s\n'", output);"
+        "          return;"
+        "        }"
+        "    }else if (*flag == 2 /* && *nevprt>0 */) {"
+        Code1
+        "    }else if (*flag == 5 && *nport == 1) {"
+        "      fclose(fprw);"
+        "    }"
+        "  }"
+        "}"]
+    elseif nc>1 then
+        S="  switch (*nport) {"
+        for k=1:nc
+            S=[S;
+            "  case "+string(k)+" :/* Port number "+string(k)+" ----------*/"
+            "  "+a_actuator
+            "  break;"]
+        end
+        S=[S;"  }"]
+
+        Code=[Code
+        Call
+        comments
+        dcl
+        "  if (flag1 == 0){"
+        S
+        "  }"
+        "  else if (flag1 == 1) {"
+        "    if (*flag == 4 && *nport == 1) {"
+        "      fprw=fopen(output,'"wt'");"
+        "      if( fprw == NULL ) {"
+        "        printf('"Error opening file: %s\n'", output);"
+        "        return;"
+        "        }"
+        "    }"
+        "    else if (*flag == 2 /*&& *nevprt>0*/ ) {"
+        Code1
+        "    }"
+        "    else if (*flag == 5 && *nport == 1) {"
+        "      fclose(fprw);"
+        "    }"
+        "  }"
+        "}"]
+    end
+endfunction
+
+//** Generates the scicos computational function
+//   associated with the block
+//12/07/07 Alan Layec
+function make_computational42(filename)
+    z=cpr.state.z;
+    oz=cpr.state.oz;
+    outtb=cpr.state.outtb;
+    tevts=cpr.state.tevts;
+    evtspt=cpr.state.evtspt;
+    outptr=cpr.sim.outptr;
+    funtyp=cpr.sim.funtyp;
+    clkptr=cpr.sim.clkptr;
+    ordptr=cpr.sim.ordptr;
+    pointi=cpr.state.pointi;
+    ztyp=cpr.sim.ztyp;
+    zcptr=cpr.sim.zcptr;
+    zptr=cpr.sim.zptr;
+    ozptr=cpr.sim.ozptr;
+    opptr=cpr.sim.opptr;
+    opar=cpr.sim.opar;
+    rpptr=cpr.sim.rpptr;
+    ipptr=cpr.sim.ipptr;
+    inpptr=cpr.sim.inpptr;
+    funs=cpr.sim.funs;
+    xptr=cpr.sim.xptr;
+    modptr=cpr.sim.modptr;
+    inplnk=cpr.sim.inplnk;
+    nblk=cpr.sim.nb;
+    outlnk=cpr.sim.outlnk;
+    oord=cpr.sim.oord;
+    zord=cpr.sim.zord;
+    iord=cpr.sim.iord;
+    noord=size(cpr.sim.oord,1);
+    nzord=size(cpr.sim.zord,1);
+    niord=size(cpr.sim.iord,1);
+
+    Indent="  ";
+    Indent2=Indent+Indent;
+    BigIndent="          ";
+
+    nZ=size(z,"*"); //** index of work in z
+    nO=lstsize(oz); //** index of outtb in oz
+
+    stalone=%f
+
+    // Open file to write in
+    fd = mopen(filename, "wt");
+
+    mputl(["/*"
+    "**    SCILAB Computational function"
+    "**    Generated by Code_Generation toolbox of Xcos with "+getversion()
+    "**    Date : "+date()
+    "*/"
+    ""
+    "/* ---- Headers ---- */"
+    "#include <stdio.h>"
+    "#include <stdlib.h>"
+    "#include <memory.h>"
+    "#include <string.h>"
+    "#include ""machine.h"" "
+    "#include ""scicos.h"" "
+    "#include ""scicos_malloc.h"" "
+    "#include ""scicos_free.h"" "
+    "#ifndef max"
+    "#define max(a,b) ((a) >= (b) ? (a) : (b))"
+    "#endif"
+    "#ifndef min"
+    "#define min(a,b) ((a) <= (b) ? (a) : (b))"
+    "#endif"], fd);
+
+    mputl([Protos ; ""], fd);
+
+    mputl(["/* Table of constant values */"
+    "static int nrd_"+string(0:maxtotal)'+" = "+string(0:maxtotal)'+";"], fd);
+
+    if maxtotal<10 then
+        mputl("static int nrd_10 = 10;", fd);
+    end
+    if maxtotal<11 then
+        mputl("static int nrd_11 = 11;", fd);
+    end
+
+    if maxtotal<81 then
+        mputl("static int nrd_81 = 81;", fd);
+    end
+    if maxtotal<82 then
+        mputl("static int nrd_82 = 82;", fd);
+    end
+    if maxtotal<84 then
+        mputl("static int nrd_84 = 84;", fd);
+    end
+    if maxtotal<811 then
+        mputl("static int nrd_811 = 811;", fd);
+    end
+    if maxtotal<812 then
+        mputl("static int nrd_812 = 812;", fd);
+    end
+    if maxtotal<814 then
+        mputl("static int nrd_814 = 814;", fd);
+    end
+
+    mputl([""
+    "/* Some general static variables */"
+    "static double zero=0;"
+    "static double w[1];"
+    "static int aaa=0, bbb=0;"], fd);
+
+    mputl([""
+    "/*"+part("-",ones(1,40))+" Block Computational function */ ";
+    "int  "+rdnom+"(scicos_block *block, int flag)"
+    "{"
+    "  /* declaration of local variables for that block struct */"
+    "  double* z      = block->z;"
+    "  void **ozptr   = block->ozptr;"
+    "  void **oparptr = block->oparptr;"
+    "  int nopar      = block->nopar;"
+    "  double* x      = block->x;"
+    "  double* xd     = block->xd;"
+    "  double* res    = block->res;"
+    "  void** u       = block->inptr;"
+    "  void** y       = block->outptr;"
+    "  int nevprt     = block->nevprt;"
+    "  double* rpar   = block->rpar;"
+    "  int nrpar      = block->nrpar;"
+    "  int* ipar      = block->ipar;"
+    "  int nipar      = block->nipar;"
+    "  double* g      = block->g;"
+    "  int* mode      = block->mode;"
+    "  void **work    = block->work;"
+    ""
+    "  double t     = get_scicos_time();"
+    "  int    phase = get_phase_simulation();"
+    ""
+    "  int kf = 0;"
+    "  int i = 0;"
+    "  int* reentryflag = NULL;"
+    ""
+    "  double *args[100];"
+    "  int local_flag;"
+    "  int nport;"
+    "  void **"+rdnom+"_block_outtbptr;"
+    "  scicos_block *block_"+rdnom+";"
+    ""
+    "  /*  work of blocks are catenated at the end of z */"
+    "  work = (void **)(z+"+string(nZ)+");"
+    ""
+    "  /*  "+rdnom+"_block_outtbptr is catenated at the end of oz */"
+    "  "+rdnom+"_block_outtbptr = (void **)(ozptr+"+string(nO)+");"
+    ""
+    "  /* struct of all blocks are stored in work of that block struct */"
+    "  block_"+rdnom+"=(scicos_block*) *block->work;"
+    ""
+    "  /* Copy inputs in the block outtb */"], fd);
+
+
+    for i=1:size(capt,1)
+        ni=capt(i,3)*capt(i,4); //** dimension of ith input
+        if capt(i,5)<>11 then
+            mputl(["  memcpy(*("+rdnom+"_block_outtbptr+"+string(capt(i,2)-1)+"),"+...
+            "*(u+"+string(capt(i,6)-1)+"),"+...
+            string(ni)+"*sizeof("+mat2c_typ(capt(i,5))+"));"], fd);
+        else //** Cas cmplx
+            mputl(["  memcpy(*("+rdnom+"_block_outtbptr+"+string(capt(i,2)-1)+"),"+...
+            "*(u+"+string(capt(i,6)-1)+"),"+...
+            string(2*ni)+"*sizeof("+mat2c_typ(capt(i,5))+"));"], fd);
+        end
+    end
+
+    mputl([""
+    "  if (flag != 4 && flag != 6 && flag != 5){"
+    "    reentryflag=(int*) ((scicos_block *)(*block->work)+"+string(nblk)+");"
+    "    if (*reentryflag==0){"
+    "      *reentryflag=1;"], fd);
+
+    for kf=1:nblk
+        nin=inpptr(kf+1)-inpptr(kf);  //** number of input ports
+        nout=outptr(kf+1)-outptr(kf); //** number of output ports
+        nx=xptr(kf+1)-xptr(kf);
+        ng=zcptr(kf+1)-zcptr(kf);
+        nmode=modptr(kf+1)-modptr(kf);
+
+        //** add comment
+        mputl([""
+        "      "+get_comment("set_blk",list(funs(kf),funtyp(kf),kf,labels(kf)));], fd);
+
+        for k=1:nin
+            lprt=inplnk(inpptr(kf)-1+k);
+            mputl(["      block_"+rdnom+"["+string(kf-1)+"].inptr["+string(k-1)+"]  = "+...
+            rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd);
+        end
+        for k=1:nout
+            lprt=outlnk(outptr(kf)-1+k);
+            mputl(["      block_"+rdnom+"["+string(kf-1)+"].outptr["+string(k-1)+"] = "+...
+            rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd);
+        end
+        mputl(["      block_"+rdnom+"["+string(kf-1)+"].z         = &(z["+...
+        string(zptr(kf)-1)+"]);"], fd);
+        if nx <> 0 then
+            mputl(["      block_"+rdnom+"["+string(kf-1)+"].x         = &(x["+...
+            string(xptr(kf)-1)+"]);"], fd);
+        else
+            mputl(["      block_"+rdnom+"["+string(kf-1)+"].x         = &(zero);"
+            "      block_"+rdnom+"["+string(kf-1)+"].xd        = w;"], fd);
+        end
+        if ng <> 0 then
+            mputl(["      block_"+rdnom+"["+string(kf-1)+"].g         = &(g["+...
+            string(zcptr(kf)-1)+"]);"], fd);
+        else
+            mputl(["      block_"+rdnom+"["+string(kf-1)+"].g         = &(zero);";], fd);
+        end
+        if nmode <> 0 then
+            mputl(["      block_"+rdnom+"["+string(kf-1)+"].mode      = &(mode["+...
+            string(modptr(kf)-1)+"]);"], fd);
+        end
+        if (part(funs(kf),1:7) ~= "capteur" &...
+            part(funs(kf),1:10) ~= "actionneur" &...
+            funs(kf) ~= "bidon" &...
+            funs(kf) ~= "bidon2") then
+            //** rpar **//
+            if (rpptr(kf+1)-rpptr(kf)>0) then
+                mputl(["      block_"+rdnom+"["+string(kf-1)+"].rpar      = &(rpar["+...
+                string(rpptr(kf)-1)+"]);"], fd);
+            end
+            //** ipar **//
+            if (ipptr(kf+1)-ipptr(kf)>0) then
+                mputl(["      block_"+rdnom+"["+string(kf-1)+"].ipar      = &(ipar["+...
+                string(ipptr(kf)-1)+"]);"], fd);
+            end
+            //** opar **//
+            if (opptr(kf+1)-opptr(kf)>0) then
+                nopar = opptr(kf+1)-opptr(kf);
+                for k=1:nopar
+                    mputl(["      block_"+rdnom+"["+string(kf-1)+"].oparptr["+string(k-1)+...
+                    "] = oparptr["+string(opptr(kf)-1+k-1)+"];"], fd);
+                end
+            end
+            //** oz **//
+            if (ozptr(kf+1)-ozptr(kf)>0) then
+                noz = ozptr(kf+1)-ozptr(kf);
+                for k=1:noz
+                    mputl(["      block_"+rdnom+"["+string(kf-1)+"].ozptr["+string(k-1)+...
+                    "]  = ozptr["+string(ozptr(kf)-1+k-1)+"];"], fd);
+                end
+            end
+        end
+        mputl(["      block_"+rdnom+"["+string(kf-1)+"].work      ="+...
+        " (void **)(((double *)work)+"+string(kf-1)+");"], fd);
+    end
+
+    mputl(["    }"
+    "  }"
+    ""
+    ], fd);
+
+    /////////////////////////////////////////////
+
+
+    //** find activation number
+    blks=find(funtyp>-1);
+    evs=[];
+
+    for blk=blks
+        for ev=clkptr(blk):clkptr(blk+1)-1
+            if funs(blk)=="bidon" then
+                if ev > clkptr(howclk) -1
+                    evs=[evs,ev];
+                end
+            end
+        end
+    end
+
+    //** flag 0
+    flag = 0;
+
+    block_has_output=%f
+    txt   = [];
+    txt22 = [];
+
+    for kf=1:nblk
+        nx=xptr(kf+1)-xptr(kf);
+        if nx <> 0 then
+            txt=[txt;
+            "    block_"+rdnom+"["+string(kf-1)+"].xd=&(xd["+...
+            string(xptr(kf)-1)+"]);"]
+        end
+        if part(funs(kf),1:10) == "actionneur" then
+            block_has_output=%t
+        end
+    end
+    if txt<>[] then
+        txt22=[txt22;
+        "    "+get_comment("update_xd",list())
+        txt
+        ""
+        ]
+    end
+    txt22=[txt22;
+    write_code_odoit(1) //** first pass
+    write_code_odoit(0) //** second pass
+    ]
+
+    if txt22<>[] then
+        mputl(["  if (flag == 0) { "+get_comment("flag",list(flag))
+        txt22
+        "  }"], fd);
+    end
+
+    //** flag 1,2,3
+    for flag=[1,2,3]
+
+        txt3=[]
+
+        //** continuous time blocks must be activated
+        //** for flag 1
+        if flag==1 then
+            txt = write_code_cdoit(flag);
+
+            if txt <> [] then
+                txt3=[txt3;
+                Indent+"  switch (nevprt) {"
+                ];
+                txt3=[txt3;
+                Indent2+"  case "+string(0)+" : "+...
+                get_comment("ev",list(0))
+                "    "+txt;
+                ];
+                txt3=[txt3;"      break;";""]
+            end
+        else
+            txt=[];
+        end
+
+        //** blocks with input discrete event must be activated
+        //** for flag 1, 2 and 3
+        if size(evs,2)>=1 then
+            txt4=[]
+            //**
+            for ev=evs
+                txt2=write_code_doit(ev,flag);
+                if txt2<>[] then
+                    //** adjust event number because of bidon block
+                    new_ev=ev-(clkptr(howclk)-1)
+                    //**
+                    txt4=[txt4;
+                    Indent2+["  case "+string(new_ev)+" : "+...
+                    get_comment("ev",list(new_ev))
+                    txt2];
+                    "      break;";""]
+                end
+            end
+
+            //**
+            if txt == [] then
+                if txt4 <> [] then
+                    txt3=[txt3;
+                    Indent+"  switch (nevprt) {"
+                    txt4
+                    "    }"];
+                end
+            else
+                txt3=[txt3;
+                txt4]
+            end
+        end
+
+        //**
+        if txt <> [] then
+            txt3=[txt3;
+            "    }"];
+        end
+
+        //**
+        if txt3<>[] then
+            if flag==1 & txt22==[] then
+                mputl(["  if (flag == "+string(flag)+") { "+...
+                get_comment("flag",list(flag))
+                txt3
+                "  }"], fd);
+            else
+                mputl(["  else if (flag == "+string(flag)+") { "+...
+                get_comment("flag",list(flag))
+                txt3
+                "  }"], fd);
+            end
+        end
+    end
+
+    //** flag 9
+    ng=zcptr($)-1;
+    if (ng ~= 0) then
+        flag = 9;
+        mputl(["  else if (flag == "+string(flag)+") { "+...
+        get_comment("flag",list(flag))], fd);
+
+        txt=[]
+        for kf=1:nblk
+            if zcptr(kf+1)-zcptr(kf) <> 0 then
+                txt=[txt;
+                "    block_"+rdnom+"["+string(kf-1)+"].g="+...
+                "&(g["+string(zcptr(kf)-1)+"]);"]
+            end
+        end
+
+        mputl(["    "+get_comment("update_g",list())
+        txt
+        ""
+        write_code_zdoit()
+        ], fd);
+
+        mputl(["  }"], fd);
+    end
+
+    //** flag 4
+    mputl(["  else if (flag == 4) { "+get_comment("flag",list(4))
+    "    if ((*block->work=scicos_malloc(sizeof(scicos_block)*"+...
+    string(nblk)+"+sizeof(int)))== NULL) return 0;";
+    "    reentryflag=(int*) ((scicos_block *)(*block->work)+"+string(nblk)+");"
+    "    *reentryflag=0;"
+    "    block_"+rdnom+"=(scicos_block*) *block->work;"], fd);
+
+    for kf=1:nblk
+        nin=inpptr(kf+1)-inpptr(kf);  //* number of input ports */
+        nout=outptr(kf+1)-outptr(kf); //* number of output ports */
+        nx=xptr(kf+1)-xptr(kf);
+        ng=zcptr(kf+1)-zcptr(kf);
+        nmode=modptr(kf+1)-modptr(kf);
+
+        //** add comment
+        mputl([""
+        "    "+get_comment("set_blk",list(funs(kf),funtyp(kf),kf,labels(kf)));], fd);
+
+        mputl(["    block_"+rdnom+"["+string(kf-1)+"].type   = "+...
+        string(funtyp(kf))+";";
+        "    block_"+rdnom+"["+string(kf-1)+"].ztyp   = "+...
+        string(ztyp(kf))+";";
+        "    block_"+rdnom+"["+string(kf-1)+"].ng     = "+...
+        string(zcptr(kf+1)-zcptr(kf))+";"], fd);
+
+        if nx <> 0 then
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].nx     = "+...
+            string(nx)+";";
+            "    block_"+rdnom+"["+string(kf-1)+"].x      = &(x["+...
+            string(xptr(kf)-1)+"]);"], fd);
+        else
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].nx     = 0;";
+            "    block_"+rdnom+"["+string(kf-1)+"].x      = &(zero);"
+            "    block_"+rdnom+"["+string(kf-1)+"].xd     = w;"], fd);
+        end
+
+        if ng <> 0 then
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].g      = &(g["+...
+            string(zcptr(kf)-1)+"]);"], fd);
+        else
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].g      = &(zero);";], fd);
+        end
+        if nmode <> 0 then
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].mode   = &(mode["+...
+            string(modptr(kf)-1)+"]);"], fd);
+        end
+        mputl(["    block_"+rdnom+"["+string(kf-1)+"].nz     = "+...
+        string(zptr(kf+1)-zptr(kf))+";";
+        "    block_"+rdnom+"["+string(kf-1)+"].noz    = "+...
+        string(ozptr(kf+1)-ozptr(kf))+";";
+        "    block_"+rdnom+"["+string(kf-1)+"].nrpar  = "+...
+        string(rpptr(kf+1)-rpptr(kf))+";";
+        "    block_"+rdnom+"["+string(kf-1)+"].nopar  = "+...
+        string(opptr(kf+1)-opptr(kf))+";";
+        "    block_"+rdnom+"["+string(kf-1)+"].nipar  = "+...
+        string(ipptr(kf+1)-ipptr(kf))+";"
+        "    block_"+rdnom+"["+string(kf-1)+"].nin    = "+...
+        string(inpptr(kf+1)-inpptr(kf))+";";
+        "    block_"+rdnom+"["+string(kf-1)+"].nout   = "+...
+        string(outptr(kf+1)-outptr(kf))+";";
+        "    block_"+rdnom+"["+string(kf-1)+"].nevout = "+...
+        string(clkptr(kf+1)-clkptr(kf))+";";
+        "    block_"+rdnom+"["+string(kf-1)+"].nmode  = "+...
+        string(modptr(kf+1)-modptr(kf))+";"], fd);
+
+        mputl(["    if ((block_"+rdnom+"["+string(kf-1)+"].evout  = "+...
+        "calloc(block_"+rdnom+"["+string(kf-1)+"].nevout,sizeof(double)))== NULL) return 0;"], fd);
+
+        //***************************** input port *****************************//
+        //** alloc insz/inptr **//
+        mputl(["    if ((block_"+rdnom+"["+string(kf-1)+"].insz   = "+...
+        "malloc(3*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nin))== NULL) return 0;";
+        "    if ((block_"+rdnom+"["+string(kf-1)+"].inptr  = "+...
+        "malloc(sizeof(void *)*block_"+rdnom+"["+string(kf-1)+"].nin))== NULL) return 0;"], fd);
+
+        //** inptr **//
+        for k=1:nin
+            lprt=inplnk(inpptr(kf)-1+k);
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].inptr["+string(k-1)+"]  = "+...
+            rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd);
+        end
+
+        //** 1st dim **//
+        for k=1:nin
+            lprt=inplnk(inpptr(kf)-1+k);
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1))+"]   = "+...
+            string(size(outtb(lprt),1))+";"], fd);
+        end
+
+        //** 2dn dim **//
+        for k=1:nin
+            lprt=inplnk(inpptr(kf)-1+k);
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1)+nin)+"]   = "+...
+            string(size(outtb(lprt),2))+";"], fd);
+        end
+
+        //** typ **//
+        for k=1:nin
+            lprt=inplnk(inpptr(kf)-1+k);
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1)+2*nin)+"]   = "+...
+            mat2scs_c_typ(outtb(lprt))+";"], fd);
+        end
+        //**********************************************************************//
+
+        //***************************** output port *****************************//
+        //** alloc outsz/outptr **//
+        mputl(["    if ((block_"+rdnom+"["+string(kf-1)+"].outsz  = "+...
+        "malloc(3*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nout))== NULL) return 0;";
+        "    if ((block_"+rdnom+"["+string(kf-1)+"].outptr = "+...
+        "malloc(sizeof(void*)*block_"+rdnom+"["+string(kf-1)+"].nout))== NULL) return 0;"], fd);
+
+        //** outptr **//
+        for k=1:nout
+            lprt=outlnk(outptr(kf)-1+k);
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].outptr["+string(k-1)+"] = "+...
+            rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd);
+        end
+
+        //** 1st dim **//
+        for k=1:nout
+            lprt=outlnk(outptr(kf)-1+k);
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1))+...
+            "]  = "+string(size(outtb(lprt),1))+";"], fd);
+        end
+
+        //** 2dn dim **//
+        for k=1:nout
+            lprt=outlnk(outptr(kf)-1+k);
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1)+nout)+...
+            "]  = "+string(size(outtb(lprt),2))+";"], fd)
+        end
+
+        //** typ **//
+        for k=1:nout
+            lprt=outlnk(outptr(kf)-1+k);
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1)+2*nout)+...
+            "]  = "+mat2scs_c_typ(outtb(lprt))+";"], fd);
+        end
+        //**********************************************************************//
+
+        mputl(["    block_"+rdnom+"["+string(kf-1)+"].z         = &(z["+...
+        string(zptr(kf)-1)+"]);"], fd);
+
+        //***************************** object state *****************************//
+        if (ozptr(kf+1)-ozptr(kf)>0) then
+            noz = ozptr(kf+1)-ozptr(kf);
+            mputl(["    if ((block_"+rdnom+"["+string(kf-1)+"].ozptr = "+...
+            "malloc(sizeof(void *)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;";
+            "    if ((block_"+rdnom+"["+string(kf-1)+"].ozsz  = "+...
+            "malloc(2*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;";
+            "    if ((block_"+rdnom+"["+string(kf-1)+"].oztyp = "+...
+            "malloc(sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;";], fd);
+
+            //** ozptr **//
+            for k=1:noz
+                mputl(["    block_"+rdnom+"["+string(kf-1)+"].ozptr["+string(k-1)+...
+                "]  = ozptr["+string(ozptr(kf)-1+k-1)+"];"], fd);
+            end
+
+            //** 1st dim **//
+            for k=1:noz
+                mputl(["    block_"+rdnom+"["+string(kf-1)+"].ozsz["+string(k-1)+...
+                "]   = "+string(size(oz(ozptr(kf)-1+k),1))+";"], fd);
+            end
+
+            //** 2nd dim **//
+            for k=1:noz
+                mputl(["    block_"+rdnom+"["+string(kf-1)+"].ozsz["+string(k-1)+...
+                "]   = "+string(size(oz(ozptr(kf)-1+k),2))+";"], fd);
+            end
+
+            //** typ **//
+            for k=1:noz
+                mputl(["    block_"+rdnom+"["+string(kf-1)+"].oztyp["+string(k-1)+...
+                "]  = "+mat2scs_c_typ(oz(ozptr(kf)-1+k))+";"], fd);
+            end
+        end
+        //************************************************************************//
+
+        if (part(funs(kf),1:7) ~= "capteur" &...
+            part(funs(kf),1:10) ~= "actionneur" &...
+            funs(kf) ~= "bidon" &...
+            funs(kf) ~= "bidon2") then
+            if (rpptr(kf+1)-rpptr(kf)>0) then
+                mputl(["    block_"+rdnom+"["+string(kf-1)+...
+                "].rpar      = &(rpar["+string(rpptr(kf)-1)+"]);"], fd);
+            end
+            if (ipptr(kf+1)-ipptr(kf)>0) then
+                mputl(["    block_"+rdnom+"["+string(kf-1)+...
+                "].ipar      = &(ipar["+string(ipptr(kf)-1)+"]);"], fd);
+            end
+            //** opar
+            if (opptr(kf+1)-opptr(kf)>0) then
+                mputl(["    if ((block_"+rdnom+"["+string(kf-1)+"].oparptr = "+...
+                "malloc(sizeof(void *)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL) return 0;";
+                "    if ((block_"+rdnom+"["+string(kf-1)+"].oparsz  = "+...
+                "malloc(2*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL) return 0;";
+                "    if ((block_"+rdnom+"["+string(kf-1)+"].opartyp = "+...
+                "malloc(sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL) return 0;";
+                ], fd);
+                nopar = opptr(kf+1)-opptr(kf);
+                //** oparptr **//
+                for k=1:nopar
+                    mputl(["    block_"+rdnom+"["+string(kf-1)+"].oparptr["+string(k-1)+...
+                    "]  = oparptr["+string(opptr(kf)-1+k-1)+"];"], fd);
+                end
+                //** 1st dim **//
+                for k=1:nopar
+                    mputl(["    block_"+rdnom+"["+string(kf-1)+"].oparsz["+string(k-1)+...
+                    "]   = "+string(size(opar(opptr(kf)-1+k),1))+";"], fd);
+                end
+                //** 2dn dim **//
+                for k=1:nopar
+                    mputl(["    block_"+rdnom+"["+string(kf-1)+"].oparsz["+string(nopar+(k-1))+...
+                    "]   = "+string(size(opar(opptr(kf)-1+k),2))+";"], fd)
+                end
+                //** typ **//
+                for k=1:nopar
+                    mputl(["    block_"+rdnom+"["+string(kf-1)+"].opartyp["+string(k-1)+...
+                    "]  = "+mat2scs_c_typ(opar(opptr(kf)-1+k))+";"], fd)
+                end
+            end
+        end
+
+        mputl(["    block_"+rdnom+"["+string(kf-1)+...
+        "].work      = (void **)(((double *)work)+"+string(kf-1)+");"
+        "    block_"+rdnom+"["+string(kf-1)+...
+        "].nevprt    = nevprt;"], fd);
+
+    end //for kf=1:nblk
+
+    //** init
+    for kf=1:nblk
+        //     if or(kf==act) | or(kf==cap) then
+        //       if stalone then
+        //         txt = call_block42(kf,0,4);
+        //         if txt <> [] then
+        //           Code=[Code;
+        //                 '';
+        //                 '    '+txt];
+        //         end
+        //       end
+        //     else
+        txt = call_block42(kf,0,4);
+        if txt <> [] then
+            mputl(["";
+            "    "+txt], fd);
+        end
+        //     end
+    end
+
+    //** cst blocks and it's dep
+    txt=write_code_idoit()
+
+    if txt<>[] then
+        mputl([""
+        "    /* initial blocks must be called with flag 1 */"
+        txt], fd);
+    end
+    //   for kf=iord(:,1)'
+    // //     if or(kf==act) then
+    // //       if stalone then
+    // //         txt = call_block42(kf,0,1);
+    // //         if txt <> [] then
+    // //           Code=[Code;
+    // //                 '';
+    // //                 '    '+txt];
+    // //         end
+    // //       end
+    // //     else
+    //       txt = call_block42(kf,0,1);
+    //       if txt <> [] then
+    //         Code=[Code;
+    //               '';
+    //               '    '+txt];
+    //       end
+    // //     end
+    //   end
+
+    mputl(["  }"], fd);
+
+    //** flag 5
+    mputl(["  else if (flag == 5) { "+get_comment("flag",list(5))
+    "    block_"+rdnom+"=*block->work;"], fd);
+
+    for kf=1:nblk
+        nin=inpptr(kf+1)-inpptr(kf);  //* number of input ports */
+        nout=outptr(kf+1)-outptr(kf); //* number of output ports */
+
+        //** add comment
+        txt=mputl([""
+        "    "+get_comment("set_blk",list(funs(kf),funtyp(kf),kf,labels(kf)));], fd);
+
+        for k=1:nin
+            lprt=inplnk(inpptr(kf)-1+k);
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].inptr["+string(k-1)+...
+            "]  = "+rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd);
+        end
+        for k=1:nout
+            lprt=outlnk(outptr(kf)-1+k);
+            mputl(["    block_"+rdnom+"["+string(kf-1)+"].outptr["+string(k-1)+...
+            "] = "+rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd);
+        end
+        mputl(["    block_"+rdnom+"["+string(kf-1)+"].z=&(z["+...
+        string(zptr(kf)-1)+"]);"], fd);
+        if (part(funs(kf),1:7) ~= "capteur" &...
+            part(funs(kf),1:10) ~= "actionneur" &...
+            funs(kf) ~= "bidon" &...
+            funs(kf) ~= "bidon2") then
+            //** rpar **//
+            if (rpptr(kf+1)-rpptr(kf)>0) then
+                mputl(["    block_"+rdnom+"["+string(kf-1)+...
+                "].rpar=&(rpar["+string(rpptr(kf)-1)+"]);"], fd);
+            end
+            //** ipar **//
+            if (ipptr(kf+1)-ipptr(kf)>0) then
+                mputl(["    block_"+rdnom+"["+string(kf-1)+...
+                "].ipar=&(ipar["+string(ipptr(kf)-1)+"]);"], fd);
+            end
+            //** opar **//
+            if (opptr(kf+1)-opptr(kf)>0) then
+                nopar = opptr(kf+1)-opptr(kf);
+                for k=1:nopar
+                    mputl(["    block_"+rdnom+"["+string(kf-1)+"].oparptr["+string(k-1)+...
+                    "]  = oparptr["+string(opptr(kf)-1+k-1)+"];"], fd);
+                end
+            end
+            //** oz **//
+            if (ozptr(kf+1)-ozptr(kf)>0) then
+                noz = ozptr(kf+1)-ozptr(kf);
+                for k=1:noz
+                    mputl(["    block_"+rdnom+"["+string(kf-1)+"].ozptr["+string(k-1)+...
+                    "]  = ozptr["+string(ozptr(kf)-1+k-1)+"];"], fd);
+                end
+            end
+        end
+
+        mputl(["    block_"+rdnom+"["+string(kf-1)+...
+        "].work=(void **)(((double *)work)+"+string(kf-1)+");"], fd)
+    end
+
+    for kf=1:nblk
+        //     if or(kf==act) | or(kf==cap) then
+        //       if stalone then
+        //         txt = call_block42(kf,0,5);
+        //         if txt <> [] then
+        //           Code=[Code;
+        //                 '';
+        //                 '    '+txt];
+        //         end
+        //       end
+        //     else
+        txt = call_block42(kf,0,5);
+        if txt <> [] then
+            mputl(["";
+            "    "+txt], fd);
+        end
+        //     end
+    end
+
+    mputl([""
+    "    for (kf = 0; kf < "+string(nblk)+"; ++kf) {"
+    "      if (block_"+rdnom+"[kf].insz!=NULL) {"
+    "        free(block_"+rdnom+"[kf].insz);"
+    "      }else {"
+    "        break;"
+    "      }"
+    "      if (block_"+rdnom+"[kf].outsz!=NULL){"
+    "        free(block_"+rdnom+"[kf].outsz);"
+    "      }else {"
+    "        break;"
+    "      }"
+    "      if (block_"+rdnom+"[kf].nopar!=0){"
+    "        if (block_"+rdnom+"[kf].oparptr!=NULL){"
+    "          free(block_"+rdnom+"[kf].oparptr);"
+    "        }else {"
+    "          break;"
+    "        }"
+    "        if (block_"+rdnom+"[kf].oparsz!=NULL){"
+    "          free(block_"+rdnom+"[kf].oparsz);"
+    "        }else {"
+    "          break;"
+    "        }"
+    "        if (block_"+rdnom+"[kf].opartyp!=NULL){"
+    "          free(block_"+rdnom+"[kf].opartyp);"
+    "        }else {"
+    "          break;"
+    "        }"
+    "      }"
+    "      if (block_"+rdnom+"[kf].noz!=0){"
+    "        if (block_"+rdnom+"[kf].ozptr!=NULL){"
+    "          free(block_"+rdnom+"[kf].ozptr);"
+    "        }else {"
+    "          break;"
+    "        }"
+    "        if (block_"+rdnom+"[kf].ozsz!=NULL){"
+    "          free(block_"+rdnom+"[kf].ozsz);"
+    "        }else {"
+    "          break;"
+    "        }"
+    "        if (block_"+rdnom+"[kf].oztyp!=NULL){"
+    "          free(block_"+rdnom+"[kf].oztyp);"
+    "        }else {"
+    "          break;"
+    "        }"
+    "      }"
+    "      if (block_"+rdnom+"[kf].evout!=NULL){"
+    "        free(block_"+rdnom+"[kf].evout);"
+    "      }else {"
+    "        break;"
+    "      }"
+    "    }"
+    "    scicos_free(block_"+rdnom+");"
+    "  }"
+    ""], fd);
+
+    for i=1:size(actt,1)
+        ni=actt(i,3)*actt(i,4); // dimension of ith input
+        if actt(i,5)<>11 then
+            mputl(["  memcpy(*(y+"+string(actt(i,6)-1)+"),"+...
+            "*("+rdnom+"_block_outtbptr+"+string(actt(i,2)-1)+"),"+...
+            string(ni)+"*sizeof("+mat2c_typ(actt(i,5))+"));"], fd);
+        else //** Cas cmplx
+            mputl(["  memcpy(*(y+"+string(actt(i,6)-1)+"),"+...
+            "*("+rdnom+"_block_outtbptr+"+string(actt(i,2)-1)+"),"+...
+            string(2*ni)+"*sizeof("+mat2c_typ(actt(i,5))+"));"], fd);
+        end
+    end
+
+    //**
+    mputl(["  return 0;"
+    ""
+    "} /* "+rdnom+" */"], fd);
+
+    mclose(fd);
+
+endfunction
+
+//generates skeleton of external world events handling function
+function Code=make_outevents()
+    z="0"
+    if szclkIN==[] then
+        newszclkIN=0;
+    else
+        newszclkIN=szclkIN;
+    end
+
+    Code=[ "/*"+part("-",ones(1,40))+"  External events handling function */";
+    "void "+rdnom+"_events(int *nevprt,double *t)";
+    "{"
+    "/*  set next event time and associated events ports"
+    " *  nevprt has binary expression b1..b"+string(newszclkIN)+" where bi is a bit"
+    " *  bi is set to 1 if an activation is received by port i. Note that"
+    " *  more than one activation can be received simultaneously"
+    " *  Caution: at least one bi should be equal to one */"
+    ""]
+
+    if (newszclkIN <> 0) then
+        Code=[Code;
+        "    int i,p,b[]={"+strcat(z(ones(1,newszclkIN)),",")+"};"
+        ""
+        "/* this is an example for the activation of events ports */"
+        "    b[0]=1;"]
+
+        if newszclkIN>1 then
+            for bb=2:newszclkIN
+                Code($+1)="    b["+string(bb-1)+"]=1;"
+            end
+        end
+
+        Code=[Code;
+        ""
+        "/* definition of the step time  */"
+        "    *t = *t + 0.1;"
+        ""
+        "/* External events handling process */"
+        "    *nevprt=0;p=1;"
+        "    for (i=0;i<"+string(newszclkIN)+";i++) {"
+        "      *nevprt=*nevprt+b[i]*p;"
+        "      p=p*2;"
+        "    }"
+        "}"]
+    else
+        Code=[Code;
+        "";
+        "/* definition of the step time  */"
+        "    *t = *t + 0.1;"
+        "}"]
+    end
+endfunction
+
+//Generating the routine for sensors interfacing
+//
+//
+//Author : R. Djenidi, R. Nikoukhah, A. Layec
+//
+function Code=make_sensor(standalone)
+    Call=["/*"+part("-",ones(1,40))+" Sensor */";
+    "void "+rdnom+"_sensor(int *flag, int *nport, int *nevprt, double *t, void *y, int *ny1, int *ny2, int *yt, int *flag1)"]
+
+    comments=["     /*"
+    "      * To be customized for standalone execution";
+    "      * flag  : specifies the action to be done"
+    "      * nport : specifies the  index of the Super Bloc"
+    "      *         regular input (The input ports are numbered"
+    "      *         from the top to the bottom )"
+    "      * nevprt: indicates if an activation had been received"
+    "      *         0 = no activation"
+    "      *         1 = activation"
+    "      * t     : the current time value"
+    "      * y     : the vector outputs value"
+    "      * ny1   : the output size 1"
+    "      * ny2   : the output size 2"
+    "      * yt    : the output type"
+    "      * flag1 : learn mode (0 from terminal,1 from input file"
+    "      */"]
+
+    dcl=["{"
+    "  int j,k,l;"
+    "  double temps;"]
+
+    if standalone then
+
+        a_sensor=["    switch (*flag) {"
+        "    case 1 : /* set the output value */"
+        "      printf(""Require outputs of sensor number %d\n"", *nport);"
+        "      printf(""time is: %f\n"", *t);"
+        "      printf(""sizes of the sensor output is: %d,%d\n"", *ny1,*ny2);"
+        "      switch (*yt) {"
+        "      case 10 :"
+        "        printf(""type of the sensor output is: %d (double) \n"", *yt);"
+        "        puts(""Please set the sensor output values"");"
+        "        for (l=0;l<*ny2;l++) {"
+        "          for (k=0;k<*ny1;k++) {"
+        "            printf(""y(%d,%d) : "",k,l);"
+        "            scanf(""%lf"", (double *) y+(k+l*(*ny1)));"
+        "          }"
+        "        }"
+        "        break;"
+        ""
+        "      case 11 :"
+        "        printf(""type of the sensor output is: %d (complex) \n"", *yt);"
+        "        puts(""Please set the sensor output values"");"
+        "        for (l=0;l<*ny2;l++) {"
+        "          for (k=0;k<*ny1;k++) {"
+        "            printf(""y(%d,%d) real part : "",k,l);"
+        "            scanf(""%lf"", (double *) y+(k+l*(*ny1)));"
+        "            printf(""y(%d,%d) imag part : "",k,l);"
+        "            scanf(""%lf"", (double *) y+((*ny1)*(*ny2)+k+l*(*ny1)));"
+        "          }"
+        "        }"
+        "        break;"
+        ""
+        "      case 81 :"
+        "        printf(""type of the sensor output is: %d (char) \n"", *yt);"
+        "        puts(""Please set the sensor output values"");"
+        "        for (l=0;l<*ny2;l++) {"
+        "          for (k=0;k<*ny1;k++) {"
+        "            printf(""y(%d,%d) : "",k,l);"
+        "            scanf(""%i"", (char *) y+(k+l*(*ny1)));"
+        "          }"
+        "        }"
+        "        break;"
+        ""
+        "      case 82 :"
+        "        printf(""type of the sensor output is: %d (char) \n"", *yt);"
+        "        puts(""Please set the sensor output values"");"
+        "        for (l=0;l<*ny2;l++) {"
+        "          for (k=0;k<*ny1;k++) {"
+        "            printf(""y(%d,%d) : "",k,l);"
+        "            scanf(""%hd"", (short *) y+(k+l*(*ny1)));"
+        "          }"
+        "        }"
+        "        break;"
+        ""
+        "      case 84 :"
+        "        printf(""type of the sensor output is: %d (long) \n"", *yt);"
+        "        puts(""Please set the sensor output values"");"
+        "        for (l=0;l<*ny2;l++) {"
+        "          for (k=0;k<*ny1;k++) {"
+        "            printf(""y(%d,%d) : "",k,l);"
+        "            scanf(""%ld"", (long *) y+(k+l*(*ny1)));"
+        "          }"
+        "        }"
+        "        break;"
+        ""
+        "      case 811 :"
+        "        printf(""type of the sensor output is: %d (unsigned char) \n"", *yt);"
+        "        puts(""Please set the sensor output values"");"
+        "        for (l=0;l<*ny2;l++) {"
+        "          for (k=0;k<*ny1;k++) {"
+        "            printf(""y(%d,%d) : "",k,l);"
+        "            scanf(""%d"", (unsigned char *) y+(k+l*(*ny1)));"
+        "          }"
+        "        }"
+        "        break;"
+        ""
+        "      case 812 :"
+        "        printf(""type of the sensor output is: %d (unsigned short) \n"", *yt);"
+        "        puts(""Please set the sensor output values"");"
+        "        for (l=0;l<*ny2;l++) {"
+        "          for (k=0;k<*ny1;k++) {"
+        "            printf(""y(%d,%d) : "",k,l);"
+        "            scanf(""%hu"", (unsigned short *) y+(k+l*(*ny1)));"
+        "          }"
+        "        }"
+        "        break;"
+        ""
+        "      case 814 :"
+        "        printf(""type of the sensor output is: %d (unsigned long) \n"", *yt);"
+        "        puts(""Please set the sensor output values"");"
+        "        for (l=0;l<*ny2;l++) {"
+        "          for (k=0;k<*ny1;k++) {"
+        "            printf(""y(%d,%d) : "",k,l);"
+        "            scanf(""%lu"", (unsigned long *) y+(k+l*(*ny1)));"
+        "          }"
+        "        }"
+        "        break;"
+        ""
+        "      }"
+        "      break;"
+        "    case 4 : /* sensor initialisation */"
+        "      /* do whatever you want to initialize the sensor */"
+        "      break;"
+        "    case 5 : /* sensor ending */"
+        "      /* do whatever you want to end the sensor */"
+        "      break;"
+        "    }"]
+    else
+        a_sensor=[]
+    end
+
+    nc=size(cap,"*")
+
+    // pour fscanf
+    typ=["""%lf "]; //temps
+    for i=1:nc
+        typ($)=typ($)+""" \"
+        typ=[typ;""""];
+        for j=1:sum(capt(i,3)*capt(i,4))
+            //typ=typ+'%f ';
+            typ($)=typ($)+scs_c_n2c_fmt(capt(i,5))+" ";
+        end
+    end
+    typ($)=typ($)+"\n"", \"
+    typ=strsubst(typ,"%f","%lf");
+    typ(1)="    fscanf(fprr,"+typ(1);
+    bl    ="                ";
+    if size(typ,1) <> 1 then
+        typ(2:$) = bl+typ(2:$);
+    end
+    //Code1=['      fscanf( fprr, '"'+typ+' \n'",&temps']
+    Code1=[typ;bl+"&temps"];
+    for i=1:size(capt,1)
+        ni=capt(i,3)*capt(i,4); // dimension of ith input
+        Code1($)=Code1($)+",";
+        Code1=[Code1;bl];
+        for j=1:ni
+            if capt(i,5)<>11 then
+                Code1($)=Code1($)+...
+                "("+scs_c_n2c_typ(capt(i,5))+" *)("+...
+                rdnom+"_block_outtbptr+"+string(capt(i,2)-1)+")"+...
+                "+"+string(j-1)+"";
+            else //CAS CMPLX
+                Code1($)=Code1($)+...
+                "("+scs_c_n2c_typ(capt(i,5))+" *)("+...
+                rdnom+"_block_outtbptr+"+string(capt(i,2)-1)+")"+...
+                "+"+string((j-1))+", "+...
+                "("+scs_c_n2c_typ(capt(i,5))+" *)("+...
+                rdnom+"_block_outtbptr+"+string(capt(i,2)-1)+")"+...
+                "+"+string(ni+(j-1))+"";
+            end
+            if j<>ni then
+                Code1($)=Code1($)+", ";
+            end
+        end
+    end
+    Code1($)=Code1($)+");"
+
+    Code=[]
+    if nc==1|~standalone then
+        Code=[Code;
+        Call
+        comments
+        dcl
+        "  if (flag1 == 0) {"
+        a_sensor;
+        "  } "
+        "  else if (flag1 == 1) {"
+        "    if (*flag == 4 && *nport == 1) {"
+        "      fprr=fopen(input,'"r'");"
+        "      if( fprr == NULL ) {"
+        "        printf('"Error opening file: %s\n'", input);"
+        "        return;"
+        "      }"
+        "    }"
+        "    else if (*flag == 1) {"
+        Code1
+        "    }"
+        "    else if (*flag == 5 && *nport == 1) {"
+        "      fclose(fprr);"
+        "    }"
+        "  }"
+        "}"];
+
+    elseif nc>1 then
+        S="  switch (*nport) {"
+        for k=1:nc
+            S=[S;
+            "  case "+string(k)+" : /* Port number "+string(k)+" ----------*/"
+            "  "+a_sensor
+            "  break;"]
+        end
+        S=[S;"  }"]
+
+        Code=[Code
+        Call
+        comments
+        dcl
+        "  if (flag1 == 0) {"
+        S
+        "  }"
+        "  else if (flag1 == 1){"
+        "    if (*flag == 4 && *nport == 1) {"
+        "      fprr=fopen(input,'"r'");"
+        "      if( fprr == NULL ) {"
+        "        printf('"Error opening file: %s\n'", input);"
+        "        return ;"
+        "      }"
+        "    }"
+        "    else if (*flag == 1) {"
+        Code1
+        "    }"
+        "    else if (*flag == 5 && *nport == 1) {"
+        "      fclose(fprr);"
+        "    }"
+        "  }"
+        "}"]
+    end
+endfunction
+
+//generates code of the standalone simulation procedure
+//
+//
+// rmq : La fonction zdoit n'est pas utilis?e pour le moment
+function make_standalone42(filename)
+
+    x=cpr.state.x;
+    modptr=cpr.sim.modptr;
+    rpptr=cpr.sim.rpptr;
+    ipptr=cpr.sim.ipptr;
+    opptr=cpr.sim.opptr;
+    rpar=cpr.sim.rpar;
+    ipar=cpr.sim.ipar;
+    opar=cpr.sim.opar;
+    oz=cpr.state.oz;
+    ordptr=cpr.sim.ordptr;
+    oord=cpr.sim.oord;
+    zord=cpr.sim.zord;
+    iord=cpr.sim.iord;
+    tevts=cpr.state.tevts;
+    evtspt=cpr.state.evtspt;
+    zptr=cpr.sim.zptr;
+    clkptr=cpr.sim.clkptr;
+    ordptr=cpr.sim.ordptr;
+    pointi=cpr.state.pointi;
+    funs=cpr.sim.funs;
+    noord=size(cpr.sim.oord,1);
+    nzord=size(cpr.sim.zord,1);
+    niord=size(cpr.sim.iord,1);
+
+    Indent="  ";
+    Indent2=Indent+Indent;
+    BigIndent="          ";
+
+    work=zeros(nblk,1)
+    Z=[z;zeros(lstsize(outtb),1);work]';
+    nX=size(x,"*");
+    nztotal=size(z,1);
+
+    stalone = %t;
+
+    fd = mopen(filename, "wt");
+
+    mputl(["/*"
+    "**    Code prototype for standalone use"
+    "**    Generated by Code_Generation toolbox of Xcos with "+getversion()
+    "**    Date : "+date()
+    "*/"
+    ""
+    "/* To learn how to use the standalone code, type '"./standalone -h'" */"
+    ""
+    "/* ---- Headers ---- */"
+    "#include <stdio.h>"
+    "#include <stdlib.h>"
+    "#include <math.h>"
+    "#include <string.h>"
+    "#include <memory.h>"
+    "#include '"scicos_block4.h'""
+    "#include '"machine.h'""
+    "#ifndef max"
+    "#define max(a,b) ((a) >= (b) ? (a) : (b))"
+    "#endif"
+    "#ifndef min"
+    "#define min(a,b) ((a) <= (b) ? (a) : (b))"
+    "#endif"
+    ""
+    "/* ---- Internals functions declaration ---- */"
+    "int "+rdnom+"_sim(double, double, double, int);"
+    Protostalone
+    ""], fd);
+
+
+
+    if x<>[] then
+        mputl(["/* Code prototype for standalone use  */"
+        "int C2F("+rdnom+"simblk)(double , double *, double *);"
+        "int dset(int *n, double *dx, double *dy, int *incy);"
+        "int ode1();"
+        "int ode2();"
+        "int ode4();"
+        ""], fd);
+    end
+
+    mputl(["/* Table of constant values */"
+    "static int nrd_"+string(0:maxtotal)'+" = "+string(0:maxtotal)'+";"], fd);
+
+    if maxtotal<10 then
+        mputl(["static int nrd_10 = 10;"], fd);
+    end
+    if maxtotal<11 then
+        mputl(["static int nrd_11 = 11;"], fd)
+    end
+
+    if maxtotal<81 then
+        mputl(["static int nrd_81 = 81;"], fd);
+    end
+    if maxtotal<82 then
+        mputl(["static int nrd_82 = 82;"], fd);
+    end
+    if maxtotal<84 then
+        mputl(["static int nrd_84 = 84;"], fd);
+    end
+    if maxtotal<811 then
+        mputl(["static int nrd_811 = 811;"], fd);
+    end
+    if maxtotal<812 then
+        mputl(["static int nrd_812 = 812;"], fd);
+    end
+    if maxtotal<814 then
+        mputl(["static int nrd_814 = 814;"], fd);
+    end
+
+    mputl([""
+    "/* Some general static variables */"
+    "static double zero=0;"
+    "static double w[1];"
+    "static int aaa=0, bbb=0;"
+    "void **"+rdnom+"_block_outtbptr;"], fd); //** !!
+
+    mputl([make_static_standalone42()], fd);
+
+    mputl(["static void usage();"
+    ""
+    "/* Main program */"
+    "int main(int argc, char *argv[])"
+    "{"
+    "  double tf=30;"  // FIXME : Add current simulation tf.
+    "  double dt=0.1;" // FIXME : Try to figure out what is the given Simulation step.
+    "  double h=0.001;"
+    "  int solver=3;"
+    "  char * progname = argv[0];"
+    "  int c;"
+    "  strcpy(input,'"'");"
+    "  strcpy(output,'"'");"
+    "  while ((c = getopt(argc , argv, '"i:o:d:t:e:s:hv'")) != -1)"
+    "    switch (c) {"
+    "    case ''i'':"
+    "      strcpy(input,argv[optind-1]);"
+    "      break;"
+    "    case ''o'':"
+    "      strcpy(output,argv[optind-1]);"
+    "      break;"
+    "    case ''d'':"
+    "      strcpy(s,argv[optind-1]);"
+    "      dt=strtod(s,p);"
+    "      break;"
+    "    case ''t'':"
+    "      strcpy(sf,argv[optind-1]);"
+    "      tf=strtod(sf,p);"
+    "      break;"
+    "    case ''e'':"
+    "      strcpy(se,argv[optind-1]);"
+    "      h=strtod(se,p);"
+    "      break;"
+    "    case ''s'':"
+    "      strcpy(ss,argv[optind-1]);"
+    "      solver=(int) strtod(ss,p);"
+    "      break;"
+    "    case ''h'':"
+    "      usage(progname);"
+    "      printf(""Options : \n'");"
+    "      printf(""     -h for the help  \n"");"
+    "      printf(""     -v for printing the Scilab Version \n"");"
+    "      printf(""     -i for input file name, by default is Terminal \n"");"
+    "      printf(""     -o for output file name, by default is Terminal \n"");"
+    "      printf(""     -d for the clock period, by default is 0.1 \n"");"
+    "      printf(""     -t for the final time, by default is 30 \n"");"
+    "      printf(""     -e for the solvers step size, by default is 0.001 \n"");"
+    "      printf(""     -s integer parameter for select the numerical solver : \n"");"
+    "      printf(""        1 for Euler''s method \n"");"
+    "      printf(""        2 for Heun''s method \n"");"
+    "      printf(""        3 (default value) for the Fourth-Order Runge-Kutta"+...
+    " (RK4) Formula \n"");"
+    "      return 0;"
+    "      break;"
+    "    case ''v'':"
+    "      printf(""Generated by Code_Generation toolbox of Xcos """
+    "             ""with "+getversion()+" version \n"");"
+    "      return 0;"
+    "      break;"
+    "    case ''?'':"
+    "      errflg++;"
+    "      break;"
+    "    }"
+    "    if (errflg){"
+    "      usage(progname);"
+    "      return 0;"
+    "    }"
+    " "
+    "  "+rdnom+"_sim(tf,dt,h,solver);"
+    "  return 0;"
+    "}"
+    ""
+    "static void usage(prog)"
+    "       char *prog;"
+    "{"
+    "  fprintf(stderr, ""Usage: %s [-h] [-v] [-i arg] [-o arg] """
+    "                  ""[-d arg] [-t arg] [-e arg] [-s arg]\n"", prog);"
+    "}"
+    ""], fd);
+
+    mputl(["/*"+part("-",ones(1,40))+"  External simulation function */"
+    "int "+rdnom+"_sim(tf,dt,h,solver)"
+    ""
+    "   double tf,dt,h;"
+    "   int solver;"
+    "{"
+    "  double t;"
+    "  int nevprt=1;"
+    "  int local_flag;"
+    "  int nport;"
+    "  int i;"
+    "  double *args[100];"
+    ""], fd);
+
+    if (x <> []) then
+        mputl(["  double tout;"
+        "  double he=0.1;"
+        ""], fd);
+    end
+
+    mputl(["  /* Initial values */"
+    ""
+    "  /* Note that z[]=[z_initial_condition;outtbptr;work]"
+    cformatline("     z_initial_condition={"+...
+    strcat(string(z),",")+"};",70)
+    cformatline("     outtbptr={"+...
+    strcat(string(zeros(lstsize(outtb),1)),"," )+"};",70)
+    cformatline("     work= {"+...
+    strcat(string(work),"," )+"};",70)
+    "  */"
+    ""
+    cformatline("  double z[]={"+strcat(string(Z),",")+"};",70)], fd);
+
+    if size(z,1) <> 0 then
+        for i=1:(length(zptr)-1)
+            if zptr(i+1)-zptr(i)>0 then
+                if size(corinv(i),"*")==1 then
+                    OO=scs_m.objs(corinv(i))
+                else
+                    path=list("objs")
+                    for l=cpr.corinv(i)(1:$-1)
+                        path($+1)=l;path($+1)="model"
+                        path($+1)="rpar"
+                        path($+1)="objs"
+                    end
+                    path($+1)=cpr.corinv(i)($)
+                    OO=scs_m(path)
+                end
+                aaa=OO.gui
+                bbb=emptystr(3,1);
+                if and(aaa+bbb~=["INPUTPORTEVTS";"OUTPUTPORTEVTS";"EVTGEN_f"]) then
+                    mputl(["";
+                    "  /* Routine name of block: "+strcat(string(cpr.sim.funs(i)));
+                    "     Gui name of block: "+strcat(string(OO.gui));
+                    //'/* Name block: '+strcat(string(cpr.sim.funs(i)));
+                    //'Object number in diagram: '+strcat(string(cpr.corinv(i)));
+                    "     Compiled structure index: "+strcat(string(i));], fd);
+                    if stripblanks(OO.model.label)~=emptystr() then
+                        mputl([cformatline("     Label: "+strcat(string(OO.model.label)),70)], fd);
+                    end
+                    if stripblanks(OO.graphics.exprs(1))~=emptystr() then
+                        mputl([cformatline("     Exprs: "+strcat(OO.graphics.exprs(1),","),70)], fd);
+                    end
+                    if stripblanks(OO.graphics.id)~=emptystr() then
+                        mputl([cformatline("     Identification: "+..
+                        strcat(string(OO.graphics.id)),70)], fd);
+                    end
+                    mputl([cformatline("     z={"+...
+                    strcat(string(z(zptr(i):zptr(i+1)-1)),",")+"};",70)
+                    " */"], fd);
+                end
+            end
+        end
+    end
+
+    //** declaration of oz
+    Code_oz = [];
+    for i=1:lstsize(oz)
+        if mat2scs_c_nb(oz(i)) <> 11 then
+            Code_oz=[Code_oz;
+            cformatline("  "+mat2c_typ(oz(i))+...
+            " oz_"+string(i)+"[]={"+...
+            strcat(string(oz(i)(:)),",")+"};",70)]
+        else //** cmplx test
+            Code_oz=[Code_oz;
+            cformatline("  "+mat2c_typ(oz(i))+...
+            " oz_"+string(i)+"[]={"+...
+            strcat(string([real(oz(i)(:));
+            imag(oz(i)(:))]),",")+"};",70)]
+        end
+    end
+
+    if Code_oz <> [] then
+        mputl(["  /* oz declaration */"
+        Code_oz], fd);
+    end
+
+    //** declaration of outtb
+    Code_outtb = [];
+    for i=1:lstsize(outtb)
+        if mat2scs_c_nb(outtb(i)) <> 11 then
+            Code_outtb=[Code_outtb;
+            cformatline("  "+mat2c_typ(outtb(i))+...
+            " outtb_"+string(i)+"[]={"+...
+            strcat(string(outtb(i)(:)),",")+"};",70)]
+        else //** cmplx test
+            Code_outtb=[Code_outtb;
+            cformatline("  "+mat2c_typ(outtb(i))+...
+            " outtb_"+string(i)+"[]={"+...
+            strcat(string([real(outtb(i)(:));
+            imag(outtb(i)(:))]),",")+"};",70)]
+        end
+    end
+
+    if Code_outtb<>[] then
+        mputl([""
+        "  /* outtb declaration */"
+        Code_outtb
+        ""], fd);
+    end
+
+    Code_outtbptr=[];
+    for i=1:lstsize(outtb)
+        Code_outtbptr=[Code_outtbptr;
+        "  "+rdnom+"_block_outtbptr["+...
+        string(i-1)+"] = (void *) outtb_"+string(i)+";"];
+    end
+
+    //** declaration of work
+    mputl(["  /* work ptr declaration */"
+    "  void **work;"
+    ""
+    //## affectation of work
+    "  /* Get work ptr of blocks */"
+    "  work = (void **)(z+"+string(size(z,"*")+lstsize(outtb))+");"
+    ""], fd);
+
+    //## affection of outtbptr
+    if Code_outtb<>[] then
+        mputl(["  /* Get outtbptr ptr of blocks */"
+        "  "+rdnom+"_block_outtbptr = (void **)(z+"+string(nztotal)+");"
+        ""], fd);
+    end
+    if Code_outtbptr<>[] then
+        mputl([Code_outtbptr
+        ""], fd);
+    end
+
+    for kf=1:nblk
+        nx=xptr(kf+1)-xptr(kf);       //** number of continuous state
+        nin=inpptr(kf+1)-inpptr(kf);  //** number of input ports
+        nout=outptr(kf+1)-outptr(kf); //** number of output ports
+
+        //** add comment
+        mputl([""
+        "  "+get_comment("set_blk",list(funs(kf),funtyp(kf),kf,labels(kf)));], fd);
+
+        mputl(["  block_"+rdnom+"["+string(kf-1)+"].type   = "+string(funtyp(kf))+";";
+        "  block_"+rdnom+"["+string(kf-1)+"].ztyp   = "+string(ztyp(kf))+";";
+        "  block_"+rdnom+"["+string(kf-1)+"].ng     = "+string(zcptr(kf+1)-zcptr(kf))+";";
+        "  block_"+rdnom+"["+string(kf-1)+"].nz     = "+string(zptr(kf+1)-zptr(kf))+";";
+        "  block_"+rdnom+"["+string(kf-1)+"].noz    = "+string(ozptr(kf+1)-ozptr(kf))+";";
+        "  block_"+rdnom+"["+string(kf-1)+"].nrpar  = "+string(rpptr(kf+1)-rpptr(kf))+";";
+        "  block_"+rdnom+"["+string(kf-1)+"].nopar  = "+string(opptr(kf+1)-opptr(kf))+";";
+        "  block_"+rdnom+"["+string(kf-1)+"].nipar  = "+string(ipptr(kf+1)-ipptr(kf))+";"
+        "  block_"+rdnom+"["+string(kf-1)+"].nin    = "+string(inpptr(kf+1)-inpptr(kf))+";";
+        "  block_"+rdnom+"["+string(kf-1)+"].nout   = "+string(outptr(kf+1)-outptr(kf))+";";
+        "  block_"+rdnom+"["+string(kf-1)+"].nevout = "+string(clkptr(kf+1)-clkptr(kf))+";";
+        "  block_"+rdnom+"["+string(kf-1)+"].nmode  = "+string(modptr(kf+1)-modptr(kf))+";";], fd);
+
+        if nx <> 0 then
+            mputl(["  block_"+rdnom+"["+string(kf-1)+"].nx = "+string(nx)+";";
+            "  block_"+rdnom+"["+string(kf-1)+"].x  = &(x["+string(xptr(kf)-1)+"]);"
+            "  block_"+rdnom+"["+string(kf-1)+"].xd = &(xd["+string(xptr(kf)-1)+"]);"], fd);
+        end
+
+        mputl(["  if ((block_"+rdnom+"["+string(kf-1)+"].evout  = "+...
+        "calloc(block_"+rdnom+"["+string(kf-1)+"].nevout,sizeof(double)))== NULL) return 0;"], fd);
+
+        //***************************** input port *****************************//
+        //** alloc insz/inptr **//
+        mputl(["  if ((block_"+rdnom+"["+string(kf-1)+"].inptr  = "+...
+        "malloc(sizeof(double*)*block_"+rdnom+"["+string(kf-1)+"].nin))== NULL) return 0;";
+        "  if ((block_"+rdnom+"["+string(kf-1)+"].insz   = "+...
+        "malloc(3*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nin))== NULL) return 0;"], fd);
+
+        //** inptr **//
+        for k=1:nin
+            lprt=inplnk(inpptr(kf)-1+k);
+            mputl(["  block_"+rdnom+"["+string(kf-1)+"].inptr["+string(k-1)+...
+            "]  = "+rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd);
+        end
+
+        //** 1st dim **//
+        for k=1:nin
+            lprt=inplnk(inpptr(kf)-1+k);
+            mputl(["  block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1))+...
+            "]   = "+string(size(outtb(lprt),1))+";"], fd);
+        end
+
+        //** 2dn dim **//
+        for k=1:nin
+            lprt=inplnk(inpptr(kf)-1+k);
+            mputl(["  block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1)+nin)+...
+            "]   = "+string(size(outtb(lprt),2))+";"], fd);
+        end
+
+        //** typ **//
+        for k=1:nin
+            lprt=inplnk(inpptr(kf)-1+k);
+            mputl(["  block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1)+2*nin)+...
+            "]   = "+mat2scs_c_typ(outtb(lprt))+";"], fd);
+        end
+        //**********************************************************************//
+
+        //***************************** output port *****************************//
+        //** alloc outsz/outptr **//
+        mputl(["  if ((block_"+rdnom+"["+string(kf-1)+"].outsz  = "+...
+        "malloc(3*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nout))== NULL) return 0;";
+        "  if ((block_"+rdnom+"["+string(kf-1)+"].outptr = "+...
+        "malloc(sizeof(double*)*block_"+rdnom+"["+string(kf-1)+"].nout))== NULL) return 0;"], fd);
+
+        //** outptr **//
+        for k=1:nout
+            lprt=outlnk(outptr(kf)-1+k);
+            mputl(["  block_"+rdnom+"["+string(kf-1)+"].outptr["+string(k-1)+...
+            "] = "+rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd);
+        end
+
+        //** 1st dim **//
+        for k=1:nout
+            lprt=outlnk(outptr(kf)-1+k);
+            mputl(["  block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1))+...
+            "]  = "+string(size(outtb(lprt),1))+";"], fd);
+        end
+
+        //** 2dn dim **//
+        for k=1:nout
+            lprt=outlnk(outptr(kf)-1+k);
+            mputl(["  block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1)+nout)+...
+            "]  = "+string(size(outtb(lprt),2))+";"], fd);
+        end
+
+        //** typ **//
+        for k=1:nout
+            lprt=outlnk(outptr(kf)-1+k);
+            mputl(["  block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1)+2*nout)+...
+            "]  = "+mat2scs_c_typ(outtb(lprt))+";"], fd);
+        end
+        //**********************************************************************//
+
+        mputl(["  block_"+rdnom+"["+string(kf-1)+...
+        "].z = &(z["+string(zptr(kf)-1)+"]);"], fd);
+
+        if (part(funs(kf),1:7) ~= "capteur" &...
+            part(funs(kf),1:10) ~= "actionneur" &...
+            funs(kf) ~= "bidon") then
+            //** rpar **//
+            if (rpptr(kf+1)-rpptr(kf)>0) then
+                mputl([ "  block_"+rdnom+"["+string(kf-1)+...
+                "].rpar=&(RPAR1["+string(rpptr(kf)-1)+"]);"], fd);
+            end
+            //** ipar **//
+            if (ipptr(kf+1)-ipptr(kf)>0) then
+                mputl(["  block_"+rdnom+"["+string(kf-1)+...
+                "].ipar=&(IPAR1["+string(ipptr(kf)-1)+"]);"], fd);
+            end
+            //** opar **//
+            if (opptr(kf+1)-opptr(kf)>0) then
+                mputl(["  if ((block_"+rdnom+"["+string(kf-1)+"].oparptr = "+...
+                "malloc(sizeof(void *)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL ) return 0;";
+                "  if ((block_"+rdnom+"["+string(kf-1)+"].oparsz  = "+...
+                "malloc(2*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL ) return 0;";
+                "  if ((block_"+rdnom+"["+string(kf-1)+"].opartyp = "+...
+                "malloc(sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL ) return 0;";
+                ], fd);
+                nopar = opptr(kf+1)-opptr(kf);
+                //** oparptr **//
+                for k=1:nopar
+                    mputl(["  block_"+rdnom+"["+string(kf-1)+"].oparptr["+string(k-1)+...
+                    "]   = (void *) OPAR_"+string(opptr(kf)-1+k)+";"], fd);
+                end
+                //** 1st dim **//
+                for k=1:nopar
+                    mputl(["  block_"+rdnom+"["+string(kf-1)+"].oparsz["+string(k-1)+...
+                    "]    = "+string(size(opar(opptr(kf)-1+k),1))+";"], fd);
+                end
+                //** 2dn dim **//
+                for k=1:nopar
+                    mputl(["  block_"+rdnom+"["+string(kf-1)+"].oparsz["+string(nopar+(k-1))+...
+                    "]    = "+string(size(opar(opptr(kf)-1+k),2))+";"], fd);
+                end
+                //** typ **//
+                for k=1:nopar
+                    mputl(["  block_"+rdnom+"["+string(kf-1)+"].opartyp["+string(k-1)+...
+                    "]   = "+mat2scs_c_typ(opar(opptr(kf)-1+k))+";"], fd);
+                end
+            end
+            //** oz **//
+            if (ozptr(kf+1)-ozptr(kf)>0) then
+                noz = ozptr(kf+1)-ozptr(kf);
+                mputl(["  if ((block_"+rdnom+"["+string(kf-1)+"].ozptr = "+...
+                "malloc(sizeof(void *)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;";
+                "  if ((block_"+rdnom+"["+string(kf-1)+"].ozsz  = "+...
+                "malloc(2*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;";
+                "  if ((block_"+rdnom+"["+string(kf-1)+"].oztyp = "+...
+                "malloc(sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;";], fd);
+                //** ozptr **//
+                for k=1:noz
+                    mputl(["  block_"+rdnom+"["+string(kf-1)+"].ozptr["+string(k-1)+...
+                    "]  = (void *) oz_"+string(ozptr(kf)-1+k)+";"], fd);
+                end
+                //** 1st dim **//
+                for k=1:noz
+                    mputl(["  block_"+rdnom+"["+string(kf-1)+"].ozsz["+string(k-1)+...
+                    "]  = "+string(size(oz(ozptr(kf)-1+k),1))+";"], fd);
+                end
+                //** 2nd dim **//
+                for k=1:noz
+                    mputl(["  block_"+rdnom+"["+string(kf-1)+"].ozsz["+string(noz+(k-1))+...
+                    "]  = "+string(size(oz(ozptr(kf)-1+k),2))+";"], fd);
+                end
+                //** typ **//
+                for k=1:noz
+                    mputl(["  block_"+rdnom+"["+string(kf-1)+"].oztyp["+string(k-1)+...
+                    "]  = "+mat2scs_c_typ(oz(ozptr(kf)-1+k))+";"], fd);
+                end
+            end
+        end
+        mputl(["  block_"+rdnom+"["+string(kf-1)+"].work = "+...
+        "(void **)(((double *)work)+"+string(kf-1)+");"], fd);
+    end
+
+    mputl(["  if (strlen(input) > 0)"
+    "    aaa=1;"
+    "  if (strlen(output)> 0)"
+    "    bbb=1;"
+    ""
+    "  /* set initial time */"
+    "  t=0.0;"
+    ""], fd);
+
+    //** init
+    mputl(["  "+get_comment("flag",list(4))], fd);
+
+    for kf=1:nblk
+        if or(kf==act) | or(kf==cap) then
+            txt = call_block42(kf,0,4);
+            if txt <> [] then
+                mputl(["";
+                "  "+txt], fd);
+            end
+        else
+            txt = call_block42(kf,0,4);
+            if txt <> [] then
+                mputl(["";
+                "  "+txt], fd);
+            end
+        end
+    end
+
+    //** cst blocks and it's dep
+    txt=write_code_idoit()
+
+    if txt<>[] then
+        mputl([""
+        "    /* Initial blocks must be called with flag 1 */"
+        txt], fd);
+    end
+
+    //** begin input main loop on time
+    mputl([""
+    "  while (t < tf) {";
+    "    /* */"
+    "    sci_time=t;"
+    ""], fd);
+
+    //** find source activation number
+    blks=find(funtyp>-1);
+    evs=[];
+
+    for blk=blks
+        for ev=clkptr(blk):clkptr(blk+1)-1
+            if funs(blk)=="bidon" then
+                if ev > clkptr(howclk) -1
+                    evs=[evs,ev];
+                end
+            end
+        end
+    end
+
+    //** flag 1,2,3
+    for flag=[1,2,3]
+
+        txt3=[]
+
+        //** continuous time blocks must be activated
+        //** for flag 1
+        if flag==1 then
+            txt = write_code_cdoit(flag);
+
+            if txt <> [] then
+                txt3=[""
+                "    "+get_comment("ev",list(0))
+                txt;
+                ];
+            end
+        end
+
+        //** blocks with input discrete event must be activated
+        //** for flag 1, 2 and 3
+        if size(evs,2)>=1 then
+            txt4=[]
+            //**
+            for ev=evs
+                txt2=write_code_doit(ev,flag);
+                if txt2<>[] then
+                    //** adjust event number because of bidon block
+                    new_ev=ev-(clkptr(howclk)-1)
+                    //**
+                    txt4=[txt4;
+                    Indent2+["  case "+string(new_ev)+" : "+...
+                    get_comment("ev",list(new_ev))
+                    txt2];
+                    "      break;";""]
+                end
+            end
+
+            //**
+            if txt4 <> [] then
+                txt3=[txt3;
+                Indent+"  /* Discrete activations */"
+                Indent+"  switch (nevprt) {"
+                txt4
+                "    }"];
+            end
+        end
+
+        //**
+        if txt3<>[] then
+            mputl(["    "+get_comment("flag",list(flag))
+            txt3], fd);
+        end
+    end
+
+    if x<>[] then
+        mputl([""
+        "    tout=t;"
+        ""
+        "   /* integrate until the cumulative add of the integration"
+        "    * time step doesn''t cross the sample time step"
+        "    */"
+        "    while (tout+h<t+dt){"
+        "      switch (solver) {"
+        "      case 1:"
+        "        ode1(C2F("+rdnom+"simblk),tout,h);"
+        "        break;"
+        "      case 2:"
+        "        ode2(C2F("+rdnom+"simblk),tout,h);"
+        "        break;"
+        "      case 3:"
+        "        ode4(C2F("+rdnom+"simblk),tout,h);"
+        "        break;"
+        "      default :"
+        "        ode4(C2F("+rdnom+"simblk),tout,h);"
+        "        break;"
+        "        }"
+        "       tout=tout+h;"
+        "    }"
+        ""
+        "    /* integration for the remainder piece of time */"
+        "    he=t+dt-tout;"
+        "    switch (solver) {"
+        "    case 1:"
+        "      ode1(C2F("+rdnom+"simblk),tout,he);"
+        "      break;"
+        "    case 2:"
+        "      ode2(C2F("+rdnom+"simblk),tout,he);"
+        "      break;"
+        "    case 3:"
+        "      ode4(C2F("+rdnom+"simblk),tout,he);"
+        "      break;"
+        "    default :"
+        "      ode4(C2F("+rdnom+"simblk),tout,he);"
+        "      break;"
+        "    }"], fd);
+    end
+
+    //** fix bug provided by Roberto Bucher
+    //** Alan, 13/10/07
+    if nX <> 0 then
+        mputl([""
+        "    /* update ptrs of continuous array */"], fd);
+        for kf=1:nblk
+            nx=xptr(kf+1)-xptr(kf);  //** number of continuous state
+            if nx<>0 then
+                mputl(["    block_"+rdnom+"["+string(kf-1)+"].nx = "+...
+                string(nx)+";";
+                "    block_"+rdnom+"["+string(kf-1)+"].x  = "+...
+                "&(x["+string(xptr(kf)-1)+"]);"
+                "    block_"+rdnom+"["+string(kf-1)+"].xd = "+...
+                "&(xd["+string(xptr(kf)-1)+"]);"], fd);
+            end
+        end
+    end
+
+    mputl([""
+    "    /* update current time */"
+    "    t=t+dt;"
+    "  }"
+    //** flag 5
+    ""
+    " sci_time = tf;"
+    ""
+    "  "+get_comment("flag",list(5))], fd);
+
+    for kf=1:nblk
+        if or(kf==act) | or(kf==cap) then
+            txt = call_block42(kf,0,5);
+            if txt <> [] then
+                mputl(["";
+                "  "+txt], fd);
+            end
+        else
+            txt = call_block42(kf,0,5);
+            if txt <> [] then
+                mputl(["";
+                "  "+txt], fd);
+            end
+        end
+    end
+
+    mputl([""
+    "  return 0;"
+    "}"
+    ""
+    "/*"+part("-",ones(1,40))+"  Lapack messag function */";
+    "void C2F(xerbla)(char *SRNAME,int *INFO,long int L)"
+    "{"
+    "  printf(""** On entry to %s, parameter number %d"""
+    "         ""  had an illegal value\n"",SRNAME,*INFO);"
+    "}"
+    ""
+    "void set_block_error(int err)"
+    "{"
+    "  return;"
+    "}"
+    ""
+    "int get_phase_simulation()"
+    "{"
+    "  return 1;"
+    "}"
+    ""
+    "void * scicos_malloc(size_t size)"
+    "{"
+    "  return malloc(size);"
+    "}"
+    ""
+    "void scicos_free(void *p)"
+    "{"
+    "  free(p);"
+    "}"
+    ""
+    "double get_scicos_time()"
+    "{"
+    "  return sci_time;"
+    "}"
+    ""
+    "void do_cold_restart()"
+    "{"
+    "  return;"
+    "}"
+    ""
+    "void sciprint (char *fmt)"
+    "{"
+    "  return;"
+    "}"
+    ""
+    "int getopt (int argc, char *argv[], char *optstring)"
+    "{"
+    "  char *group, option, *sopt;"
+    "  int len;"
+    "  option = -1;"
+    "  optarg = NULL;"
+    "  while ( optind < argc )"
+    "    { "
+    "      group = argv[optind];"
+    "      if ( *group != ''-'' )"
+    "        {"
+    "         option = -1;"
+    "         optarg = group;"
+    "         optind++;"
+    "         break;"
+    "        }"
+    "      len = strlen (group);"
+    "      group = group + offset;"
+    "      if ( *group == ''-'' )"
+    "        {"
+    "         group++;"
+    "         offset += 2;"
+    "        }"
+    "      else"
+    "        offset++ ;"
+    "      option = *group ;"
+    "      sopt = strchr ( optstring, option ) ;"
+    "      if ( sopt != NULL )"
+    "        {"
+    "         sopt++ ;"
+    "         if ( *sopt == '':'' )"
+    "           {"
+    "             optarg = group + 1;"
+    "             if ( *optarg == ''\0'' )"
+    "                optarg = argv[++optind];"
+    "             if ( *optarg == ''-'' )"
+    "                {"
+    "                 fprintf ( stderr, '"\n%s: illegal option -- %c'","
+    "                           argv[0], option );"
+    "                 option = ''?'';"
+    "                 break;"
+    "                }"
+    "             else"
+    "                {"
+    "                 optind++;"
+    "                 offset = 0;"
+    "                 break;"
+    "                }"
+    "           }"
+    "         if ( offset >= len )"
+    "           {"
+    "             optind++;"
+    "             offset = 0;"
+    "           }"
+    "         break;"
+    "        }"
+    "      else"
+    "        {"
+    "         fprintf ( stderr, '"\n%s: illegal option -- %c'", argv[0], option );"
+    "         option = ''?'';"
+    "         break;"
+    "        }"
+    "    }"
+    "  return ( option );"
+    "}"
+    ""], fd);
+
+    if (x <> []) then
+        mputl(["int C2F("+rdnom+"simblk)(t, x, xd)"
+        ""
+        "   double t, *x, *xd;"
+        ""
+        "     /*"
+        "      *  !purpose"
+        "      *  compute state derivative of the continuous part"
+        "      *  !calling sequence"
+        "      *  neq   : integer the size of the  continuous state"
+        "      *  t     : current time"
+        "      *  x     : double precision vector whose contains the continuous state"
+        "      *  xd    : double precision vector, contain the computed derivative"
+        "      *  of the state"
+        "      */"
+        "{"
+        "  int phase=2;"
+        "  int local_flag;"
+        "  int nport;"
+        "  int nevprt=1;"
+        "  double *args[100];"
+        "  dset(&neq, &c_b14,xd , &c__1);"
+        ""
+        "    "+get_comment("update_xd",list())], fd);
+
+        for kf=1:nblk
+            if (xptr(kf+1)-xptr(kf)) > 0 then
+                mputl(["    block_"+rdnom+"["+string(kf-1)+"].x="+...
+                "&(x["+string(xptr(kf)-1)+"]);"
+                "    block_"+rdnom+"["+string(kf-1)+"].xd="+...
+                "&(xd["+string(xptr(kf)-1)+"]);"], fd);
+            end
+        end
+
+        mputl([""
+        write_code_odoit(1)
+        write_code_odoit(0)
+        ""
+        "  return 0;"
+        "}"
+        ""
+        "int dset(int *n, double *dx, double *dy, int *incy)"
+        "{"
+        "    int iMax = 0;"
+        "    int i = 0, iy = 0;"
+        "    --dy;"
+        "    if (*n <= 0) return 0;"
+        "    iy = 1;"
+        "    if (*incy < 0)"
+        "    {"
+        "      iy = (-(*n) + 1) * *incy + 1;"
+        "    }"
+        "    iMax = *n;"
+        "    for (i = 1; i <= iMax; ++i)"
+        "    {"
+        "      dy[iy] = *dx;"
+        "      iy += *incy;"
+        "    }"
+        "    return 0;"
+        "}"
+        ""
+        "/* Euler''s Method */"
+        "int ode1(f,t,h)"
+        "  int (*f) ();"
+        "  double t, h;"
+        "{"
+        "  int i;"
+        ""
+        "  /**/"
+        "  (*f)(t,x, xd);"
+        ""
+        "  for (i=0;i<neq;i++) {"
+        "   x[i]=x[i]+h*xd[i];"
+        "  }"
+        ""
+        "  return 0;"
+        "}"
+        ""
+        "/* Heun''s Method */"
+        "int ode2(f,t,h)"
+        "  int (*f) ();"
+        "  double t, h;"
+        "{"
+        "  int i;"
+        "  double y["+string(nX)+"],yh["+string(nX)+"],temp,f0["+string(nX)+"],th;"
+        ""
+        "  /**/"
+        "  memcpy(y,x,neq*sizeof(double));"
+        "  memcpy(f0,xd,neq*sizeof(double));"
+        ""
+        "  /**/"
+        "  (*f)(t,y, f0);"
+        ""
+        "  /**/"
+        "  for (i=0;i<neq;i++) {"
+        "    x[i]=y[i]+h*f0[i];"
+        "  }"
+        "  th=t+h;"
+        "  for (i=0;i<neq;i++) {"
+        "    yh[i]=y[i]+h*f0[i];"
+        "  }"
+        "  (*f)(th,yh, xd);"
+        ""
+        "  /**/"
+        "  temp=0.5*h;"
+        "  for (i=0;i<neq;i++) {"
+        "    x[i]=y[i]+temp*(f0[i]+xd[i]);"
+        "  }"
+        ""
+        "  return 0;"
+        "}"
+        ""
+        "/* Fourth-Order Runge-Kutta (RK4) Formula */"
+        "int ode4(f,t,h)"
+        "  int (*f) ();"
+        "  double t, h;"
+        "{"
+        "  int i;"
+        "  double y["+string(nX)+"],yh["+string(nX)+"],"+...
+        "temp,f0["+string(nX)+"],th,th2,"+...
+        "f1["+string(nX)+"],f2["+string(nX)+"];"
+        ""
+        "  /**/"
+        "  memcpy(y,x,neq*sizeof(double));"
+        "  memcpy(f0,xd,neq*sizeof(double));"
+        ""
+        "  /**/"
+        "  (*f)(t,y, f0);"
+        ""
+        "  /**/"
+        "  for (i=0;i<neq;i++) {"
+        "    x[i]=y[i]+h*f0[i];"
+        "  }"
+        "  th2=t+h/2;"
+        "  for (i=0;i<neq;i++) {"
+        "    yh[i]=y[i]+(h/2)*f0[i];"
+        "  }"
+        "  (*f)(th2,yh, f1);"
+        ""
+        "  /**/"
+        "  temp=0.5*h;"
+        "  for (i=0;i<neq;i++) {"
+        "    x[i]=y[i]+temp*f1[i];"
+        "  }"
+        "  for (i=0;i<neq;i++) {"
+        "    yh[i]=y[i]+(h/2)*f1[i];"
+        "  }"
+        "  (*f)(th2,yh, f2);"
+        ""
+        "  /**/"
+        "  for (i=0;i<neq;i++) {"
+        "    x[i]=y[i]+h*f2[i];"
+        "  }"
+        "  th=t+h;"
+        "  for (i=0;i<neq;i++) {"
+        "    yh[i]=y[i]+h*f2[i];"
+        "  }"
+        "  (*f)(th2,yh, xd);"
+        ""
+        "  /**/"
+        "  temp=h/6;"
+        "  for (i=0;i<neq;i++) {"
+        "    x[i]=y[i]+temp*(f0[i]+2.0*f1[i]+2.0*f2[i]+xd[i]);"
+        "  }"
+        ""
+        "return 0;"
+        "}"], fd);
+    end
+
+    mclose(fd);
+endfunction
+
+//generates  static table definitions
+//
+//Author : Rachid Djenidi, Alan Layec
+function txt=make_static_standalone42()
+    oldFormat = format();
+    format(25);
+    txt=[];
+
+    //*** Continuous state ***//
+    if x <> [] then
+        txt=[txt;
+        "/* def continuous state */"
+        cformatline("double x[]={"+strcat(string(x),",")+"};",70)
+        cformatline("double xd[]={"+strcat(string(x),",")+"};",70)
+        "static int c__1 = 1;"
+        "static double c_b14 = 0.;"
+        "static int neq="+string(nX)+";"
+        ""]
+    end
+    //************************//
+
+    txt=[txt;
+    "char input[50], output[50],s[1],sf[1],se[1],ss[1],**p;"
+    "static double sci_time;"
+    "static int errflg = 0;"
+    "static char *optarg = NULL ;"
+    "static int optind = 1, offset = 0 ;"
+    "scicos_block block_"+rdnom+"["+string(nblk)+"];"
+    ""];
+
+    //*** Real parameters ***//
+    if size(rpar,1) <> 0 then
+        txt=[txt;
+        "/* def real parameters */"
+        "static double RPAR1[ ] = {"];
+
+        for i=1:(length(rpptr)-1)
+            if rpptr(i+1)-rpptr(i)>0  then
+
+                if size(corinv(i),"*")==1 then
+                    OO=scs_m.objs(corinv(i));
+                else
+                    path=list("objs");
+                    for l=cpr.corinv(i)(1:$-1)
+                        path($+1)=l;
+                        path($+1)="model";
+                        path($+1)="rpar";
+                        path($+1)="objs";
+                    end
+                    path($+1)=cpr.corinv(i)($);
+                    OO=scs_m(path);
+                end
+
+                //** Add comments **//
+                txt($+1)="/* Routine name of block: "+strcat(string(cpr.sim.funs(i)));
+                txt($+1)=" * Gui name of block: "+strcat(string(OO.gui));
+                txt($+1)=" * Compiled structure index: "+strcat(string(i));
+
+                if stripblanks(OO.model.label)~=emptystr() then
+                    txt=[txt;cformatline(" * Label: "+strcat(string(OO.model.label)),70)];
+                end
+                if stripblanks(OO.graphics.exprs(1))~=emptystr() then
+                    txt=[txt;cformatline(" * Exprs: "+strcat(OO.graphics.exprs(1),","),70)];
+                end
+                if stripblanks(OO.graphics.id)~=emptystr() then
+                    txt=[txt;
+                    cformatline(" * Identification: "+strcat(string(OO.graphics.id)),70)];
+                end
+                txt=[txt;" * rpar="];
+                txt($+1)=" */";
+                //******************//
+
+                txt=[txt;
+                cformatline(strcat(msprintf("%.25E,\n",rpar(rpptr(i):rpptr(i+1)-1))),70);
+                ""]
+
+            end
+        end
+        txt=[txt;
+        "};"
+        ""]
+
+    else
+        txt($+1)="static double RPAR1[1];";
+    end
+    //***********************//
+
+    //*** Integer parameters ***//
+    if size(ipar,1) <> 0 then
+        txt=[txt;
+        "/* def integer parameters */"
+        "static int IPAR1[ ] = {"];
+
+        for i=1:(length(ipptr)-1)
+            if ipptr(i+1)-ipptr(i)>0  then
+                if size(corinv(i),"*")==1 then
+                    OO=scs_m.objs(corinv(i));
+                else
+                    path=list("objs");
+                    for l=cpr.corinv(i)(1:$-1)
+                        path($+1)=l
+                        path($+1)="model"
+                        path($+1)="rpar"
+                        path($+1)="objs"
+                    end
+                    path($+1)=cpr.corinv(i)($);
+                    OO=scs_m(path);
+                end
+
+                //** Add comments **//
+                txt($+1)="/* Routine name of block: "+strcat(string(cpr.sim.funs(i)));
+                txt($+1)=" * Gui name of block: "+strcat(string(OO.gui));
+                txt($+1)=" * Compiled structure index: "+strcat(string(i));
+                if stripblanks(OO.model.label)~=emptystr() then
+                    txt=[txt;cformatline(" * Label: "+strcat(string(OO.model.label)),70)];
+                end
+
+                if stripblanks(OO.graphics.exprs(1))~=emptystr() then
+                    txt=[txt;
+                    cformatline(" * Exprs: "+strcat(OO.graphics.exprs(1),","),70)];
+                end
+                if stripblanks(OO.graphics.id)~=emptystr() then
+                    txt=[txt;
+                    cformatline(" * Identification: "+strcat(string(OO.graphics.id)),70)];
+                end
+                txt=[txt;
+                cformatline(" * ipar= {"+strcat(string(ipar(ipptr(i):ipptr(i+1)-1)),",")+"};",70)];
+                txt($+1)=" */";
+                //******************//
+
+                txt=[txt;cformatline(strcat(string(ipar(ipptr(i):ipptr(i+1)-1))+","),70)];
+                txt($+1)="";
+            end
+        end
+        txt=[txt;
+        "};"
+        ""]
+    else
+        txt($+1)="static int IPAR1[1];";
+    end
+    //**************************//
+
+    //Alan added opar (27/06/07)
+    //*** Object parameters ***//
+    if lstsize(opar)<>0 then
+        txt=[txt;
+        "/* def object parameters */"]
+        for i=1:(length(opptr)-1)
+            if opptr(i+1)-opptr(i)>0  then
+
+                if size(corinv(i),"*")==1 then
+                    OO=scs_m.objs(corinv(i));
+                else
+                    path=list("objs");
+                    for l=cpr.corinv(i)(1:$-1)
+                        path($+1)=l;
+                        path($+1)="model";
+                        path($+1)="rpar";
+                        path($+1)="objs";
+                    end
+                    path($+1)=cpr.corinv(i)($);
+                    OO=scs_m(path);
+                end
+
+                //** Add comments **//
+                txt($+1)="";
+                txt($+1)="/* Routine name of block: "+strcat(string(cpr.sim.funs(i)));
+                txt($+1)=" * Gui name of block: "+strcat(string(OO.gui));
+                txt($+1)=" * Compiled structure index: "+strcat(string(i));
+                if stripblanks(OO.model.label)~=emptystr() then
+                    txt=[txt;cformatline(" * Label: "+strcat(string(OO.model.label)),70)];
+                end
+                if stripblanks(OO.graphics.id)~=emptystr() then
+                    txt=[txt;
+                    cformatline(" * Identification: "+strcat(string(OO.graphics.id)),70)];
+                end
+                txt($+1)=" */";
+                //******************//
+
+
+                for j=1:opptr(i+1)-opptr(i)
+                    txt =[txt;
+                    cformatline("static "+mat2c_typ(opar(opptr(i)+j-1)) +...
+                    " OPAR_"+string(opptr(i)+j-1) + "[] = {"+...
+                    strcat(string(opar(opptr(i)+j-1)),",")+"};",70)]
+                end
+            end
+        end
+    end
+    //*************************//
+
+    txt=[txt;
+    ""]
+    format(oldFormat(2), oldFormat(1));
+endfunction
+
+//utilitary fonction used to format long C instruction
+//t : a string containing a C instruction
+//l : max line length allowed
+
+//Author : Rachid Djenidi
+function t1=cformatline(t ,l)
+    // Force format to avoid precision loss
+    oldFormat = format();
+    format(25);
+
+    sep=[",","+"]
+    l1=l-2
+    t1=[]
+    kw=strindex(t," ")
+    nw=0
+    if kw<>[] then
+        if kw(1)==1 then // there is leading blanks
+            k1=find(kw(2:$)-kw(1:$-1)<>1)
+            if k1==[] then // there is a single blank
+                nw=1
+            else
+                nw=kw(k1(1))
+            end
+        end
+    end
+    t=part(t,nw+1:length(t));
+    bl=part(" ",ones(1,nw))
+    l1=l-nw;first=%t
+    while %t
+        if length(t)<=l then
+            t1=[t1;bl+t]
+            break
+        end
+        k=strindex(t,sep);
+        if k==[] then
+            t1=[t1;bl+t]
+            break
+        end
+        k($+1)=length(t)+1 // positions of the commas
+        i=find(k(1:$-1)<=l&k(2:$)>l) //nearest left comma (reltively to l)
+        if i==[] then
+            i=1
+        end
+        t1=[t1;bl+part(t,1:k(i))]
+        t=part(t,k(i)+1:length(t))
+        if first then
+            l1=l1-2;bl=bl+"  ";
+            first=%f;
+        end
+    end
+
+    format(oldFormat(2), oldFormat(1));
+endfunction
+
+//
+// Generate Matrix of all binary code from
+// 1 to 2^n-1
+//
+function vec = binaryTable(n)
+    n = int(n);
+    vec = [];
+    for i = 1:n
+        accu = [];
+        for j = 1:2^(n-i-1)
+            accu = [accu ; zeros(2^(i-1),1) ; ones(2^(i-1),1)]
+        end
+        vec = [accu, vec]
+    end
+    vec=vec(2:$, :); // Remove first line [ 0 --- 0 ]
+endfunction
+
+//used in do_compile_superblock
+function vec=codebinaire(v,szclkIN)
+    vec=zeros(1,szclkIN)
+    for i=1:szclkIN
+        w=v/2;
+        vec(i)=v-2*int(w);
+        v=int(w);
+    end
+endfunction
+
+function t=filetype(m)
+    m=int32(m)
+    filetypes=["Directory","Character device","Block device",...
+    "Regular file","FIFO","Symbolic link","Socket"]
+    bits=[16384,8192,24576,32768,4096,40960,49152]
+    m=int32(m)&int32(61440)
+    t=filetypes(find(m==int32(bits)))
+endfunction
+
+//get_blank : return blanks with a length
+//            of the given input string
+//
+//input : str : a string
+//
+//output : txt : blanks
+//
+//16/06/07 Author : A.Layec
+function [txt] = get_blank(str)
+    txt="";
+    for i=1:length(str)
+        txt=txt+" ";
+    end
+endfunction
+
+// get_comment : return a C comment
+//               for generated code
+//
+//input : typ : a string
+//        param : a list
+//
+//output : a C comment
+//
+//16/06/07 Author : A.Layec
+function [txt]=get_comment(typ,param)
+    txt = [];
+    select typ
+        //** main flag
+    case "flag" then
+        select param(1)
+        case 0 then
+            txt = "/* Continuous state computation */"
+        case 1 then
+            txt = "/* Output computation */"
+        case 2 then
+            txt = "/* Discrete state computation */"
+        case 3 then
+            txt = "/* Output Event computation */"
+        case 4 then
+            txt = "/* Initialization */"
+        case 5 then
+            txt = "/* Ending */"
+        case 9 then
+            txt = "/* Update zero crossing surfaces */"
+        end
+        //** blocks activated on event number
+    case "ev" then
+        txt = "/* Blocks activated on the event number "+string(param(1))+" */"
+
+        //** blk calling sequence
+    case "call_blk" then
+        txt = ["/* Call of ''"+param(1) + ...
+        "'' (type "+string(param(2))+" - blk nb "+...
+        string(param(3))+" - uid "+param(4)];
+        if ztyp(param(3)) then
+            txt=txt+" - with zcross) */";
+        else
+            txt=txt+") */";
+        end
+        //** proto calling sequence
+    case "proto_blk" then
+        txt = ["/* prototype of ''"+param(1) + ...
+        "'' (type "+string(param(2))];
+        if ztyp(param(3)) then
+            txt=txt+" - with zcross) */";
+        else
+            txt=txt+") */";
+        end
+        //** ifthenelse calling sequence
+    case "ifthenelse_blk" then
+        txt = ["/* Call of ''if-then-else'' blk (blk nb "+...
+        string(param(1))+") */"]
+        //** eventselect calling sequence
+    case "evtselect_blk" then
+        txt = ["/* Call of ''event-select'' blk (blk nb "+...
+        string(param(1))+") */"]
+        //** set block structure
+    case "set_blk" then
+        txt = ["/* set blk struc. of ''"+param(1) + ...
+        "'' (type "+string(param(2))+" - blk nb "+...
+        string(param(3))++" - uid "+param(4)+") */"];
+        //** Update xd vector ptr
+    case "update_xd" then
+        txt = ["/* Update xd vector ptr */"];
+        //** Update g vector ptr
+    case "update_g" then
+        txt = ["/* Update g vector ptr */"];
+    else
+        break;
+    end
+endfunction
+
+//mat2c_typ : matrix to C type
+//sci2c_ttyp : get the C string of a scicos type
+//
+//input : outtb : a matrix
+//
+//output : txt : the string of the C scicos type
+//               of the data of outtb
+//
+//16/06/07 Author : A.Layec
+function [txt]=mat2c_typ(outtb)
+    select type(outtb)
+        //real matrix
+    case 1 then
+        if isreal(outtb) then
+            txt = "double"
+        else
+            txt = "double"
+        end
+        //integer matrix
+    case 8 then
+        select typeof(outtb)
+        case "int32" then
+            txt = "long"
+        case "int16" then
+            txt = "short"
+        case "int8" then
+            txt = "char"
+        case "uint32" then
+            txt = "unsigned long"
+        case "uint16" then
+            txt = "unsigned short"
+        case "uint8" then
+            txt = "unsigned char"
+        end
+    else
+        break;
+    end
+endfunction
+
+//mat2scs_c_nb  matrix to scicos C number (sci2sci_n)
+//
+//input : outtb : a matrix
+//
+//output : c_nb : the scicos C number
+//
+//16/06/07 Author : A.Layec
+function [c_nb]=mat2scs_c_nb(outtb)
+    select type(outtb)
+        //real matrix
+    case 1 then
+        if isreal(outtb) then
+            c_nb = 10
+        else
+            c_nb = 11
+        end
+        //integer matrix
+    case 8 then
+        select typeof(outtb)
+        case "int32" then
+            c_nb = 84
+        case "int16" then
+            c_nb = 82
+        case "int8" then
+            c_nb = 81
+        case "uint32" then
+            c_nb = 814
+        case "uint16" then
+            c_nb = 812
+        case "uint8" then
+            c_nb = 811
+        end
+    else
+        break;
+    end
+endfunction
+
+//mat2scs_c_ptr matrix to scicos C ptr (sci2c_typ)
+//
+//input : outtb : a matrix
+//
+//output : txt : the string of the C scicos type
+//               of the data of outtb
+//
+//16/06/07 Author : A.Layec
+function [txt]=mat2scs_c_ptr(outtb)
+    select type(outtb)
+        //real matrix
+    case 1 then
+        if isreal(outtb) then
+            txt = "SCSREAL_COP"
+        else
+            txt = "SCSCOMPLEX_COP"
+        end
+        //integer matrix
+    case 8 then
+        select typeof(outtb)
+        case "int32" then
+            txt = "SCSINT32_COP"
+        case "int16" then
+            txt = "SCSINT16_COP"
+        case "int8" then
+            txt = "SCSINT8_COP"
+        case "uint32" then
+            txt = "SCSUINT32_COP"
+        case "uint16" then
+            txt = "SCSUINT16_COP"
+        case "uint8" then
+            txt = "SCSUINT8_COP"
+        end
+    else
+        break;
+    end
+endfunction
+
+//mat2scs_c_typ matrix to scicos C type
+//
+//input : outtb : a matrix
+//
+//output : txt : the string of the C scicos type
+//               of the data of outtb
+//
+//16/06/07 Author : A.Layec
+function [txt]=mat2scs_c_typ(outtb)
+    select type(outtb)
+        //real matrix
+    case 1 then
+        if isreal(outtb) then
+            txt = "SCSREAL_N"
+        else
+            txt = "SCSCOMPLEX_N"
+        end
+        //integer matrix
+    case 8 then
+        select typeof(outtb)
+        case "int32" then
+            txt = "SCSINT32_N"
+        case "int16" then
+            txt = "SCSINT16_N"
+        case "int8" then
+            txt = "SCSINT8_N"
+        case "uint32" then
+            txt = "SCSUINT32_N"
+        case "uint16" then
+            txt = "SCSUINT16_N"
+        case "uint8" then
+            txt = "SCSUINT8_N"
+        end
+    else
+        break;
+    end
+endfunction
+
+//scs_c_n2c_fmt : scicos C number to C format
+//
+//input : c_nb : a C scicos type
+//
+//output : txt : the string of the C format string
+//               of the data of outtb
+//
+//16/06/07 Author : A.Layec
+function [txt]=scs_c_n2c_fmt(c_nb)
+    select c_nb
+        //real matrix
+    case 10 then
+        txt = "%f";
+        //complex matrix
+    case 11 then
+        txt = "%f,%f";
+        //int8 matrix
+    case 81 then
+        txt = "%d";
+        //int16 matrix
+    case 82 then
+        txt = "%d";
+        //int32 matrix
+    case 84 then
+        txt = "%d";
+        //uint8 matrix
+    case 811 then
+        txt = "%d";
+        //uint16 matrix
+    case 812 then
+        txt = "%d";
+        //uint32 matrix
+    case 814 then
+        txt = "%d";
+    else
+        txt="%f"
+        break;
+    end
+endfunction
+
+//scs_c_n2c_typ scicos C number to C type
+//
+//input : c_nb : a C scicos number
+//
+//output : txt : the string of the C format string
+//               of the data of outtb
+//
+//16/06/07 Author : A.Layec
+function [txt]=scs_c_n2c_typ(c_nb)
+    select c_nb
+        //real matrix
+    case 10 then
+        txt = "double";
+        //complex matrix
+    case 11 then
+        txt = "double";
+        //int8 matrix
+    case 81 then
+        txt = "char";
+        //int16 matrix
+    case 82 then
+        txt = "short";
+        //int32 matrix
+    case 84 then
+        txt = "long";
+        //uint8 matrix
+    case 811 then
+        txt = "unsigned char";
+        //uint16 matrix
+    case 812 then
+        txt = "unsigned short";
+        //uint32 matrix
+    case 814 then
+        txt = "unsigned long";
+    else
+        txt="double"
+        break;
+    end
+endfunction
+
+//scs_c_nb2scs_nb : scicos C number to scicos number
+//
+//input : c_nb  : the scicos C number type
+//
+//output : scs_nb : the scilab number type
+//
+//16/06/07 Author : A.Layec
+function [scs_nb]=scs_c_nb2scs_nb(c_nb)
+    scs_nb=zeros(size(c_nb,1),size(c_nb,2));
+    for i=1:size(c_nb,1)
+        for j=1:size(c_nb,2)
+            select (c_nb(i,j))
+            case 10 then
+                scs_nb(i,j) = 1
+            case 11 then
+                scs_nb(i,j) = 2
+            case 81 then
+                scs_nb(i,j) = 5
+            case 82 then
+                scs_nb(i,j) = 4
+            case 84 then
+                scs_nb(i,j) = 3
+            case 811 then
+                scs_nb(i,j) = 8
+            case 812 then
+                scs_nb(i,j) = 7
+            case 814 then
+                scs_nb(i,j) = 6
+            else
+                scs_nb(i,j) = 1
+            end
+        end
+    end
+endfunction
+
+//used in do_compile_superblock
+function XX=update_block(XX)
+    execstr("o="+rdnom+"_c(''define'')")
+    XX.model=o.model
+    XX.gui=rdnom+"_c";
+    XX.graphics.gr_i=o.graphics.gr_i
+endfunction
+
+//write_code_cdoit : generate body of the code for
+//                   for all time dependant blocks
+//
+//input : flag : flag number for block's call
+//
+//output : txt for cord blocks
+//
+//12/07/07 Alan Layec
+function [txt]=write_code_cdoit(flag)
+    txt=[];
+
+    for j=1:ncord
+        bk=cord(j,1);
+        pt=cord(j,2);
+        //** blk
+        if funtyp(bk)>-1 then
+            if or(bk==act) | or(bk==cap) then
+                if stalone then
+                    txt2=call_block42(bk,pt,flag);
+                    if txt2<>[] then
+                        txt=[txt;
+                        "    "+txt2
+                        ""];
+                    end
+                end
+            else
+                txt2=call_block42(bk,pt,flag);
+                if txt2<>[] then
+                    txt=[txt;
+                    "    "+txt2
+                    ""];
+                end
+            end
+            //** ifthenelse blk
+        elseif funtyp(bk)==-1 then
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            thentxt=write_code_doit(clkptr(bk),flag);
+            elsetxt=write_code_doit(clkptr(bk)+1,flag);
+            if thentxt<>[] | elsetxt<>[] then
+                txt=[txt;
+                "    "+get_comment("ifthenelse_blk",list(bk));]
+                //** C **//
+                tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    if("+tmp_+">0) {"]
+                //*******//
+                txt=[txt;
+                Indent+thentxt];
+                if elsetxt<>[] then
+                    //** C **//
+                    txt=[txt;
+                    "    }";
+                    "    else {";]
+                    //*******//
+                    txt=[txt;
+                    Indent+elsetxt];
+                end
+                //** C **//
+                txt=[txt;
+                "    }"]
+                //*******//
+            end
+            //** eventselect blk
+        elseif funtyp(bk)==-2 then
+            Noutport=clkptr(bk+1)-clkptr(bk);
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            II=[];
+            switchtxt=list()
+            for i=1: Noutport
+                switchtxt(i)=write_code_doit(clkptr(bk)+i-1,flag);
+                if switchtxt(i)<>[] then II=[II i];end
+            end
+            if II<>[] then
+                txt=[txt;
+                "    "+get_comment("evtselect_blk",list(bk));]
+                //** C **//
+                tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    i=max(min((int) "+...
+                tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);"
+                "    switch(i)"
+                "    {"]
+                //*******//
+                for i=II
+                    //** C **//
+                    txt=[txt;
+                    "     case "+string(i)+" :";]
+                    //*******//
+                    txt=[txt;
+                    BigIndent+write_code_doit(clkptr(bk)+i-1,flag);]
+                    //** C **//
+                    txt=[txt;
+                    BigIndent+"break;"]
+                    //*******//
+                end
+                //** C **//
+                txt=[txt;
+                "    }"];
+                //*******//
+            end
+            //** Unknown block
+        else
+            error("Unknown block type "+string(bk));
+        end
+    end
+
+endfunction
+
+//write_code_doit : generate body of the code for
+//                  ordering calls of blocks during
+//                  flag 1,2 & flag 3
+//
+//input : ev  : evt number for block's call
+//       flag : flag number for block's call
+//
+//output : txt for flag 1 or 2, or flag 3
+//
+//12/07/07 Alan Layec
+function [txt]=write_code_doit(ev,flag)
+    txt=[];
+
+    for j=ordptr(ev):ordptr(ev+1)-1
+        bk=ordclk(j,1);
+        pt=ordclk(j,2);
+        //** blk
+        if funtyp(bk)>-1 then
+            if or(bk==act) | or(bk==cap) then
+                if stalone then
+                    txt2=call_block42(bk,pt,flag);
+                    if txt2<>[] then
+                        txt=[txt;
+                        "    "+txt2
+                        ""];
+                    end
+                end
+            else
+                txt2=call_block42(bk,pt,flag);
+                if txt2<>[] then
+                    txt=[txt;
+                    "    "+txt2
+                    ""];
+                end
+            end
+            //** ifthenelse blk
+        elseif funtyp(bk)==-1 then
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            thentxt=write_code_doit(clkptr(bk),flag);
+            elsetxt=write_code_doit(clkptr(bk)+1,flag);
+            if thentxt<>[] | elsetxt<>[] then
+                txt=[txt;
+                "    "+get_comment("ifthenelse_blk",list(bk));]
+                //** C **//
+                tmp_ = "*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    if("+tmp_+">0) {"]
+                //*******//
+                txt=[txt;
+                Indent+thentxt]
+                if elsetxt<>[] then
+                    //** C **//
+                    txt=[txt;
+                    "    }";
+                    "    else {";]
+                    //*******//
+                    txt=[txt;
+                    Indent+elsetxt];
+                end
+                //** C **//
+                txt=[txt;
+                "    }"]
+                //*******//
+            end
+            //** eventselect blk
+        elseif funtyp(bk)==-2 then
+            Noutport=clkptr(bk+1)-clkptr(bk);
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            II=[];
+            switchtxt=list()
+            for i=1: Noutport
+                switchtxt(i)=write_code_doit(clkptr(bk)+i-1,flag);
+                if switchtxt(i)<>[] then II=[II i];end
+            end
+            if II<>[] then
+                txt=[txt;
+                "    "+get_comment("evtselect_blk",list(bk));]
+                tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                //** C **//
+                txt=[txt;
+                "    i=max(min((int) "+...
+                tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);"
+                "    switch(i)"
+                "    {"]
+                //*******//
+                for i=II
+                    //** C **//
+                    txt=[txt;
+                    "     case "+string(i)+" :";]
+                    //*******//
+                    txt=[txt;
+                    BigIndent+write_code_doit(clkptr(bk)+i-1,flag);]
+                    //** C **//
+                    txt=[txt;
+                    BigIndent+"break;"]
+                    //*******//
+                end
+                //** C **//
+                txt=[txt;
+                "    }"]
+                //*******//
+            end
+            //** Unknown block
+        else
+            error("Unknown block type "+string(bk));
+        end
+    end
+
+endfunction
+
+//write_code_idoit : generate body of the code for
+//                   ordering calls of initial
+//                   called blocks
+//
+//input : nothing (blocks are called with flag 1)
+//
+//output : txt for iord
+//
+//15/07/07 Alan Layec
+function [txt]=write_code_idoit()
+    txt=[];
+
+    for j=1:niord
+        bk=iord(j,1);
+        pt=iord(j,2);
+        //** blk
+        if funtyp(bk)>-1 then
+            if or(bk==act) then
+                if stalone then
+                    txt2=call_block42(bk,pt,1);
+                    if txt2<>[] then
+                        txt=[txt;
+                        "    "+txt2
+                        ""];
+                    end
+                end
+            else
+                txt2=call_block42(bk,pt,1);
+                if txt2<>[] then
+                    txt=[txt;
+                    "    "+txt2
+                    ""];
+                end
+            end
+            //** ifthenelse blk
+        elseif funtyp(bk)==-1 then
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            thentxt=write_code_doit(clkptr(bk),1);
+            elsetxt=write_code_doit(clkptr(bk)+1,1);
+            if thentxt<>[] | elsetxt<>[] then
+                txt=[txt;
+                "    "+get_comment("ifthenelse_blk",list(bk));]
+                //** C **//
+                tmp_ = "*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    if("+tmp_+">0) {"]
+                //*******//
+                txt=[txt;
+                Indent+thentxt];
+                if elsetxt<>[] then
+                    //** C **//
+                    txt=[txt;
+                    "    }";
+                    "    else {";]
+                    //*******//
+                    txt=[txt;
+                    Indent+elsetxt];
+                end
+                //** C **//
+                txt=[txt;
+                "    }"]
+                //*******//
+            end
+            //** eventselect blk
+        elseif funtyp(bk)==-2 then
+            Noutport=clkptr(bk+1)-clkptr(bk);
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            II=[];
+            switchtxt=list()
+            for i=1: Noutport
+                switchtxt(i)=write_code_doit(clkptr(bk)+i-1,1);
+                if switchtxt(i)<>[] then II=[II i];end
+            end
+            if II<>[] then
+                txt=[txt;
+                "    "+get_comment("evtselect_blk",list(bk));]
+                //** C **//
+                tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    i=max(min((int) "+...
+                tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);"]
+                txt=[txt;
+                "    switch(i)"
+                "    {"]
+                //*******//
+                for i=II
+                    //** C **//
+                    txt=[txt;
+                    "     case "+string(i)+" :";]
+                    //*******//
+                    txt=[txt;
+                    BigIndent+write_code_doit(clkptr(bk)+i-1,1);]
+                    //** C **//
+                    txt=[txt;
+                    BigIndent+"break;"]
+                    //*******//
+                end
+                //** C **//
+                txt=[txt;
+                "    }"];
+                //*******//
+            end
+            //** Unknown block
+        else
+            error("Unknown block type "+string(bk));
+        end
+    end
+
+endfunction
+
+//write_code_odoit : generate body of the code for
+//                   ordering calls of blocks before
+//                   continuous time integration
+//
+//input : flag : flag number for block's call
+//
+//output : txt for flag 0
+//
+//12/07/07 Alan Layec
+function [txt]=write_code_odoit(flag)
+    txt=[];
+
+    for j=1:noord
+        bk=oord(j,1);
+        pt=oord(j,2);
+        //** blk
+        if funtyp(bk)>-1 then
+            txt2=call_block42(bk,pt,flag);
+            if txt2<>[] then
+                txt=[txt;
+                "    "+txt2
+                ""];
+            end
+            //** ifthenelse blk
+        elseif funtyp(bk)==-1 then
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            thentxt=write_code_ozdoit(clkptr(bk),flag);
+            elsetxt=write_code_ozdoit(clkptr(bk)+1,flag);
+            if thentxt<>[] | elsetxt<>[] then
+                txt=[txt;
+                "    "+get_comment("ifthenelse_blk",list(bk));]
+                //** C **//
+                tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    if ((block_"+rdnom+"["+string(bk-1)+"].nmode<0"+...
+                " && "+tmp_+">0)"+...
+                " || \"
+                "        (block_"+rdnom+"["+string(bk-1)+"].nmode>0"+...
+                " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==1)) {"]
+                //*******//
+                txt=[txt;
+                Indent+thentxt]
+                //** C **//
+                txt=[txt;
+                "    }"];
+                //*******//
+                if elsetxt<>[] then
+                    //** C **//
+                    txt=[txt;
+                    "    else if  ((block_"+rdnom+"["+string(bk-1)+"].nmode<0"+...
+                    " && "+tmp_+"<=0)"+...
+                    " || \"
+                    "              (block_"+rdnom+"["+string(bk-1)+"].nmode>0"+...
+                    " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==2)) {";]
+                    //*******//
+                    txt=[txt;
+                    Indent+elsetxt]
+                    //** C **//
+                    txt=[txt;
+                    "    }"];
+                    //*******//
+                end
+            end
+            //** eventselect blk
+        elseif funtyp(bk)==-2 then
+            Noutport=clkptr(bk+1)-clkptr(bk);
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            II=[];
+            switchtxt=list()
+            for i=1: Noutport
+                switchtxt(i)=write_code_ozdoit(clkptr(bk)+i-1,flag);
+                if switchtxt(i)<>[] then II=[II i];end
+            end
+            if II<>[] then
+                txt=[txt;
+                "    "+get_comment("evtselect_blk",list(bk));]
+                //** C **//
+                tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    if (block_"+rdnom+"["+string(bk-1)+"].nmode<0) {";
+                "      i=max(min((int) "+...
+                tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);"
+                "    }"
+                "    else {"
+                "      i=block_"+rdnom+"["+string(bk-1)+"].mode[0];"
+                "    }"]
+                txt=[txt;
+                "    switch(i)"
+                "    {"];
+                //*******//
+                for i=II
+                    //** C **//
+                    txt=[txt;
+                    "     case "+string(i)+" :";]
+                    //*******//
+                    txt=[txt;
+                    BigIndent+write_code_ozdoit(clkptr(bk)+i-1,flag);]
+                    //** C **//
+                    txt=[txt;
+                    BigIndent+"break;"]
+                    //*******//
+                end
+                //** C **//
+                txt=[txt;
+                "    }"];
+                //*******//
+            end
+            //** Unknown block
+        else
+            error("Unknown block type "+string(bk));
+        end
+    end
+
+endfunction
+
+//write_code_ozdoit : generate body of the code for both
+//                    flag 0 & flag 9
+//
+//input: ev  : evt number for block's call
+//      flag : flag number for block's call
+//
+//output : txt for flag 0 or flag 9
+//
+//12/07/07 Alan Layec
+function [txt]=write_code_ozdoit(ev,flag)
+    txt=[];
+
+    for j=ordptr(ev):ordptr(ev+1)-1
+        bk=ordclk(j,1);
+        pt=ordclk(j,2);
+        //** blk
+        if funtyp(bk)>-1 then
+            if (or(bk==act) | or(bk==cap)) & (flag==1) then
+                if stalone then
+                    txt=[txt;
+                    "    "+call_block42(bk,pt,flag)
+                    ""];
+                end
+            else
+                txt2=call_block42(bk,pt,flag);
+                if txt2<>[] then
+                    txt=[txt;
+                    "    "+txt2
+                    ""];
+                end
+            end
+            //** ifthenelse blk
+        elseif funtyp(bk)==-1 then
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            thentxt=write_code_ozdoit(clkptr(bk),flag);
+            elsetxt=write_code_ozdoit(clkptr(bk)+1,flag);
+            if thentxt<>[] | elsetxt<>[] then
+                txt=[txt;
+                "    "+get_comment("ifthenelse_blk",list(bk));]
+                //** C **//
+                tmp_ = "*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    if (((phase==1"+...
+                " || block_"+rdnom+"["+string(bk-1)+"].nmode==0)"+...
+                " && "+tmp_+">0)"+...
+                " || \"
+                "        ((phase!=1"+...
+                " && block_"+rdnom+"["+string(bk-1)+"].nmode!=0)"+...
+                " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==1)) {"]
+                //*******//
+                txt=[txt;
+                Indent+thentxt]
+                //** C **//
+                txt=[txt;
+                "    }"];
+                //*******//
+                if elsetxt<>[] then
+                    //** C **//
+                    txt=[txt;
+                    "      else if (((phase==1"+...
+                    " || block_"+rdnom+"["+string(bk-1)+"].nmode==0)"+...
+                    " && "+tmp_+"<=0)"+...
+                    " || \"
+                    "               ((phase!=1"+...
+                    " && block_"+rdnom+"["+string(bk-1)+"].nmode!=0)"+...
+                    " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==2)) {";]
+                    //*******//
+                    txt=[txt;
+                    Indent+elsetxt]
+                    //** C **//
+                    txt=[txt;
+                    "    }"];
+                    //*******//
+                end
+            end
+            //** eventselect blk
+        elseif funtyp(bk)==-2 then
+            Noutport=clkptr(bk+1)-clkptr(bk);
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            II=[];
+            switchtxt=list()
+            for i=1: Noutport
+                switchtxt(i)=write_code_ozdoit(clkptr(bk)+i-1,flag);
+                if switchtxt(i)<>[] then II=[II i];end
+            end
+            if II<>[] then
+                txt=[txt;
+                "    "+get_comment("evtselect_blk",list(bk));]
+                //** C **//
+                tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    if (phase==1 || block_"+rdnom+"["+string(bk-1)+"].nmode==0) {";
+                "      i=max(min((int) "+...
+                tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);"
+                "    }"
+                "    else {"
+                "      i=block_"+rdnom+"["+string(bk-1)+"].mode[0];"
+                "    }"]
+                txt=[txt;
+                "    switch(i)"
+                "    {"];
+                //*******//
+                for i=II
+                    //** C **//
+                    txt=[txt;
+                    "     case "+string(i)+" :";]
+                    //*******//
+                    txt=[txt;
+                    BigIndent+write_code_ozdoit(clkptr(bk)+i-1,flag);]
+                    //** C **//
+                    txt=[txt;
+                    BigIndent+"break;"]
+                    //*******//
+                end
+                //** C **//
+                txt=[txt;
+                "    }"];
+                //*******//
+            end
+            //** Unknown block
+        else
+            error("Unknown block type "+string(bk));
+        end
+    end
+
+endfunction
+
+//write_code_zdoit : generate body of the code for
+//                   ordering calls of blocks before
+//                   continuous time zero crossing
+//                   detection
+//
+//input : noting
+//
+//output : txt for flag 9
+//
+//12/07/07 Alan Layec
+function [txt]=write_code_zdoit()
+    txt=[];
+
+    //** first pass (flag 1)
+    for j=1:nzord
+        bk=zord(j,1);
+        pt=zord(j,2);
+        //** blk
+        if funtyp(bk)>-1 then
+            if or(bk==act) | or(bk==cap) then
+                if stalone then
+                    txt=[txt;
+                    "    "+call_block42(bk,pt,1)
+                    ""];
+                end
+            else
+                txt2=call_block42(bk,pt,1);
+                if txt2<>[] then
+                    txt=[txt;
+                    "    "+txt2
+                    ""];
+                end
+            end
+            //** ifthenelse blk
+        elseif funtyp(bk)==-1 then
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            thentxt=write_code_ozdoit(clkptr(bk),1);
+            elsetxt=write_code_ozdoit(clkptr(bk)+1,1);
+            if thentxt<>[] | elsetxt<>[] then
+                txt=[txt;
+                "    "+get_comment("ifthenelse_blk",list(bk));]
+                //** C **//
+                tmp_ = "*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    if (((phase==1"+...
+                " || block_"+rdnom+"["+string(bk-1)+"].nmode==0)"+...
+                " && "+tmp_+">0)"+...
+                " || \"
+                "        ((phase!=1"+...
+                " && block_"+rdnom+"["+string(bk-1)+"].nmode!=0)"+...
+                " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==1)) {"]
+                //*******//
+                txt=[txt;
+                Indent+thentxt]
+                //** C **//
+                txt=[txt;
+                "    }"];
+                //*******//
+                if elsetxt<>[] then
+                    //** C **//
+                    txt=[txt;
+                    "      else if (((phase==1"+...
+                    " || block_"+rdnom+"["+string(bk-1)+"].nmode==0)"+...
+                    " && "+tmp_+"<=0)"+...
+                    " || \"
+                    "               ((phase!=1"+...
+                    " && block_"+rdnom+"["+string(bk-1)+"].nmode!=0)"+...
+                    " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==2)) {";]
+                    //*******//
+                    txt=[txt;
+                    Indent+elsetxt]
+                    //** C **//
+                    txt=[txt;
+                    "    }"];
+                    //*******//
+                end
+            end
+            //** eventselect blk
+        elseif funtyp(bk)==-2 then
+            Noutport=clkptr(bk+1)-clkptr(bk);
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            II=[];
+            switchtxt=list()
+            for i=1: Noutport
+                switchtxt(i)=write_code_ozdoit(clkptr(bk)+i-1,1);
+                if switchtxt(i)<>[] then II=[II i];end
+            end
+            if II<>[] then
+                txt=[txt;
+                "    "+get_comment("evtselect_blk",list(bk));]
+                //** C **//
+                tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+                txt=[txt;
+                "    if (phase==1 || block_"+rdnom+"["+string(bk-1)+"].nmode==0){";
+                "      i=max(min((int) "+...
+                tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);"
+                "    else {"
+                "      i=block_"+rdnom+"["+string(bk-1)+"].mode[0];"
+                "    }"]
+                txt=[txt;
+                "      switch(i)"
+                "      {"];
+                //*******//
+                for i=II
+                    //** C **//
+                    txt=[txt;
+                    "       case "+string(i)+" :";]
+                    //*******//
+                    txt=[txt;
+                    BigIndent+write_code_ozdoit(clkptr(bk)+i-1,1);]
+                    //** C **//
+                    txt=[txt;
+                    BigIndent+"break;"]
+                    //*******//
+                end
+                //** C **//
+                txt=[txt;
+                "      }"];
+                //*******//
+            end
+            //** Unknown block
+        else
+            error("Unknown block type "+string(bk));
+        end
+    end
+
+    //** second pass (flag 9)
+    for j=1:nzord
+        bk=zord(j,1);
+        pt=zord(j,2);
+        //** blk
+        if funtyp(bk)>-1 then
+            if or(bk==act) | or(bk==cap) then
+                if stalone then
+                    txt=[txt;
+                    "    "+call_block42(bk,pt,9)
+                    ""];
+                end
+            else
+                txt2=call_block42(bk,pt,9);
+                if txt2<>[] then
+                    txt=[txt;
+                    "    "+txt2
+                    ""];
+                end
+            end
+
+            //** ifthenelse blk
+        elseif funtyp(bk)==-1 then
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            //** C **//
+            tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+            //*******//
+            thentxt=write_code_zzdoit(clkptr(bk),9);
+            elsetxt=write_code_zzdoit(clkptr(bk)+1,9);
+            txt=[txt;
+            "    "+get_comment("ifthenelse_blk",list(bk));]
+            //** C **//
+            txt=[txt;
+            "    g["+string(zcptr(bk)-1)+"]=(double)"+tmp_+";"]
+            //*******//
+            if thentxt<>[] | elsetxt<>[] then
+                //** C **//
+                txt=[txt;
+                "    if (g["+string(zcptr(bk)-1)+"] > 0.){"]
+                //*******//
+                txt=[txt;
+                Indent+thentxt]
+                //** C **//
+                txt=[txt;
+                "      }"]
+                //*******//
+                if elsetxt <> [] then
+                    //** C **//
+                    txt=[txt;
+                    "      else {"]
+                    //*******//
+                    txt=[txt;
+                    Indent+elsetxt]
+                    //** C **//
+                    txt=[txt;
+                    "      }"]
+                    //*******//
+                end
+            end
+            //** C **//
+            txt=[txt;
+            "    if(phase==1 && block_"+rdnom+"["+string(bk-1)+"].nmode > 0){"
+            "      if (g["+string(zcptr(bk)-1)+"] > 0.){"
+            "        block_"+rdnom+"["+string(bk-1)+"].mode[0] = 1;"
+            "      }"
+            "      else {"
+            "        block_"+rdnom+"["+string(bk-1)+"].mode[0] = 2;"
+            "      }"
+            "    }"]
+            //*******//
+            //** eventselect blk
+        elseif funtyp(bk)==-2 then
+            Noutport=clkptr(bk+1)-clkptr(bk);
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1));  //** scilab index start from 1
+            //** C **//
+            tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+            //*******//
+            II=[];
+            switchtxt=list()
+            for i=1:Noutport
+                switchtxt(i)=write_code_zzdoit(clkptr(bk)+i-1,9);
+                if switchtxt(i)<>[] then II=[II i];end
+            end
+            txt=[txt;
+            "    "+get_comment("evtselect_blk",list(bk));]
+            if II<>[] then
+                //** C **//
+                txt=[txt;
+                "    j=max(min((int) "+...
+                tmp_+",block_"+rdnom+"["+string(bk-1)+"].nevout),1);"]
+                txt=[txt;
+                "    switch(j)"
+                "    {"];
+                //*******//
+                for i=II
+                    //** C **//
+                    txt=[txt;
+                    "     case "+string(j)+" :";]
+                    //*******//
+                    txt=[txt;
+                    BigIndent+write_code_zzdoit(clkptr(bk)+i-1,9);]
+                    //** C **//
+                    txt=[txt;
+                    BigIndent+"break;"]
+                    //*******//
+                end
+                //** C **//
+                txt=[txt;
+                "    }"];
+                //*******//
+            end
+            //** C **//
+            txt=[txt;
+            "  for (jj=0;jj<block_"+rdnom+"["+string(fun-1)+"].nevout-1;++jj) {"
+            "    g["+string(zcptr(bk)-1)+"+jj]=(double)"+tmp_+"-(double)(jj+2);"
+            "  }"
+            "  if(phase==1 && block_"+rdnom+"["+string(bk-1)+"].nmode>0){"
+            "    j=max(min((int) "+tmp_+","
+            "              block_"+rdnom+"["+string(bk-1)+"].nevout),1);"
+            "    block_"+rdnom+"["+string(bk-1)+"].mode[0]= j;"
+            "  }"]
+            //*******//
+            //** Unknown block
+        else
+            error("Unknown block type "+string(bk));
+        end
+    end
+
+endfunction
+
+//write_code_zzdoit : generate body of the code for
+//                    flag 9
+//
+//input: ev  : evt number for block's call
+//      flag : flag number for block's call
+//
+//output : txt for flag 9
+//
+//12/07/07 Alan Layec
+function [txt]=write_code_zzdoit(ev,flag)
+    txt=[];
+
+    for j=ordptr(ev):ordptr(ev+1)-1
+        bk=ordclk(j,1);
+        pt=ordclk(j,2);
+        //** blk
+        if funtyp(bk)>-1 then
+            if or(bk==act) | or(bk==cap) then
+                if stalone then
+                    txt=[txt;
+                    "    "+call_block42(bk,pt,flag)
+                    ""];
+                end
+            else
+                txt2=call_block42(bk,pt,flag);
+                if txt2<>[] then
+                    txt=[txt;
+                    "    "+txt2
+                    ""];
+                end
+            end
+            //** ifthenelse blk
+        elseif funtyp(bk)==-1 then
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1
+            //** C **//
+            tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+            //*******//
+            thentxt=write_code_zzdoit(clkptr(bk),9);
+            elsetxt=write_code_zzdoit(clkptr(bk)+1,9);
+            txt=[txt;
+            "    "+get_comment("ifthenelse_blk",list(bk));]
+            //** C **//
+            txt=[txt;
+            "    g["+string(zcptr(bk)-1)+"]=(double)"+tmp_+";"]
+            //*******//
+            if thentxt<>[] | elsetxt<>[] then
+                //** C **//
+                txt=[txt;
+                "    if (g["+string(zcptr(bk)-1)+"] > 0.){"]
+                //*******//
+                txt=[txt;
+                Indent+thentxt]
+                //** C **//
+                txt=[txt;
+                "      }"]
+                //*******//
+                if elsetxt <> [] then
+                    //** C **//
+                    txt=[txt;
+                    "      else {"]
+                    //*******//
+                    txt=[txt;
+                    Indent+elsetxt]
+                    //** C **//
+                    txt=[txt;
+                    "      }"]
+                    //*******//
+                end
+            end
+            //** C **//
+            txt=[txt;
+            "    if(phase==1 && block_"+rdnom+"["+string(bk-1)+"].nmode > 0){"
+            "      if (g["+string(zcptr(bk)-1)+"] > 0.){"
+            "        block_"+rdnom+"["+string(bk-1)+"].mode[0] = 1;"
+            "      }"
+            "      else {"
+            "        block_"+rdnom+"["+string(bk-1)+"].mode[0] = 2;"
+            "      }"
+            "    }"]
+            //*******//
+
+            //** eventselect blk
+        elseif funtyp(bk)==-2 then
+            Noutport=clkptr(bk+1)-clkptr(bk);
+            ix=-1+inplnk(inpptr(bk));
+            TYPE=mat2c_typ(outtb(ix+1));  //** scilab index start from 1
+            //** C **//
+            tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])"
+            //*******//
+            II=[];
+            switchtxt=list()
+            for i=1:Noutport
+                switchtxt(i)=write_code_zzdoit(clkptr(bk)+i-1,9);
+                if switchtxt(i)<>[] then II=[II i];end
+            end
+            txt=[txt;
+            "    "+get_comment("evtselect_blk",list(bk));]
+            if II<>[] then
+                //** C **//
+                txt=[txt;
+                "    j=max(min((int) "+...
+                tmp_+",block_"+rdnom+"["+string(bk-1)+"].nevout),1);"]
+                txt=[txt;
+                "    switch(j)"
+                "    {"];
+                //*******//
+                for i=II
+                    //** C **//
+                    txt=[txt;
+                    "     case "+string(j)+" :";]
+                    //*******//
+                    txt=[txt;
+                    BigIndent+write_code_zzdoit(clkptr(bk)+i-1,9);]
+                    //** C **//
+                    txt=[txt;
+                    BigIndent+"break;"]
+                    //*******//
+                end
+                //** C **//
+                txt=[txt;
+                "    }"];
+                //*******//
+            end
+            //** C **//
+            txt=[txt;
+            "  for (jj=0;jj<block_"+rdnom+"["+string(fun-1)+"].nevout-1;++jj) {"
+            "    g["+string(zcptr(bk)-1)+"+jj]=(double)"+tmp_+"-(double)(jj+2);"
+            "  }"
+            "  if(phase==1 && block_"+rdnom+"["+string(bk-1)+"].nmode>0){"
+            "    j=max(min((int) "+tmp_+","
+            "              block_"+rdnom+"["+string(bk-1)+"].nevout),1);"
+            "    block_"+rdnom+"["+string(bk-1)+"].mode[0]= j;"
+            "  }"]
+            //*******//
+
+            //** Unknown block
+        else
+            error("Unknown block type "+string(bk));
+        end
+    end
+
+endfunction
+
+
diff --git a/modules/scicos/macros/scicos_scicos/do_delete1.bin b/modules/scicos/macros/scicos_scicos/do_delete1.bin
new file mode 100755
index 000000000..7f05da707
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_delete1.bin
diff --git a/modules/scicos/macros/scicos_scicos/do_delete1.sci b/modules/scicos/macros/scicos_scicos/do_delete1.sci
new file mode 100755
index 000000000..c678ae673
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_delete1.sci
@@ -0,0 +1,253 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [scs_m,DEL,DELL]=do_delete1(scs_m,K,gr)
+    //!
+    //
+    //**  30 August 2007 :
+    //**                BEWARE: this code is BUGGED : see the residual split after delete
+    //**                        this bug is older than Simone (see scilab 3.1.1)
+    //**
+    //** 22 June 2006 : New Graphics Interface update
+    //
+    // Perform deletion of scs_m object whose index are given in the vector
+    // K and all other relevant objects (link, splits,..)
+    //
+    // deleted objects:
+    //  - are replaced by the value : mlist('Deleted')
+    //  - not to change the indexing: use do_purge to suppress them and to renumber objects
+    //
+    //**  Perform deletion of [scs_m] object whose index are given in the vector
+    //**  [K] and all other relevant objects (link, splits,..) in recursive way
+    //
+    //**  Deleted objects are replaced by the value : mlist('Deleted')
+    //**  ---> not to change the indexing:
+    //**  ---> use [do_purge] to suppress them and to renumber objects
+    //**  Similar strategy is used for the ghraphics object: to mantain the coherency
+    //**  from the grphics object "gh_curwin.children.children(gr_k)" [Compund] list and the
+    //**  scs_o.objs(k) data structure with the equation
+    //**
+    //**         gr_k = get_gri(k, o_size(1))
+    //**
+    //**  where
+    //**
+    //**       o_size = size(gh_curwin.children.children); // o_size(1) => length  o_size(2) => 1
+    //**
+    //**  the graphics "Compound" object are NOT deleted BUT set to "invisible" with the propriety
+    //**
+    //**       gh_object.visible = "off" // You can't see me, by John Cena :) ... ask enrico.mannori
+    //**
+    //**  OK: ...looks simple... until you begin to fight with the code ...
+    //**
+
+    DEL = []  // table of deleted objects
+    DELL= [] // table of redefined links
+    outin = ["out","in"]
+
+    //**	Delete object until "K" is empty
+    //** ----------------------------------------------------------------------------------------------
+    while K<>[] do
+
+        k = K(1); K(1) = [] ;
+
+        o = scs_m.objs(k);
+
+        if find(DEL==k)==[] then
+            typ = typeof(o);
+        else
+            typ = "Deleted"
+        end
+
+        DEL=[DEL k]
+
+        //**----------------------------------- Link -------------------------------------------
+        if typ=="Link" then
+
+            [ct,from,to]=(o.ct,o.from,o.to)
+
+            //  free connected ports
+            if ct(2)==2 then //Implicit link
+
+                if or(scs_m.objs(from(1)).graphics.pin==k) & from(3)==1 then
+                    scs_m.objs(from(1))=mark_prt(scs_m.objs(from(1)),from(2),"in",ct(2),0)
+                else //or(scs_m.objs(from(1)).graphics.pout==k) then
+                    scs_m.objs(from(1))=mark_prt(scs_m.objs(from(1)),from(2),"out",ct(2),0)
+                end
+
+                if or(scs_m.objs(to(1)).graphics.pin==k) & to(3)==1 then
+                    scs_m.objs(to(1))=mark_prt(scs_m.objs(to(1)),to(2),"in",ct(2),0)
+                else // or(scs_m.objs(to(1)).graphics.pout==k) then
+                    scs_m.objs(to(1))=mark_prt(scs_m.objs(to(1)),to(2),"out",ct(2),0)
+                end
+
+            else
+                scs_m.objs(from(1))=mark_prt(scs_m.objs(from(1)),from(2),"out",ct(2),0)
+                scs_m.objs(to(1))=mark_prt(scs_m.objs(to(1)),to(2),"in",ct(2),0)
+            end
+
+            fromblock=scs_m.objs(from(1));
+            toblock=scs_m.objs(to(1));
+
+            if or(fromblock.gui==["SPLIT_f" "CLKSPLIT_f" "IMPSPLIT_f"]) then
+                //user kills a split  output link:
+
+                //get links connected to the split block
+                connected=get_connected(scs_m,from(1))
+                if size(setdiff(connected,K),"*")==2 then
+                    //RN: 22-7-2004 setdiff added above
+                    //create a unique link with the split input and remaining
+                    //output link and suppress the split block
+                    if find(connected(2)==DEL)<>[] then // delete split
+                        K = [from(1) K]
+                    else
+                        ksplit=from(1)
+                        DEL=[DEL  ksplit]       //suppress split block
+                        o1=scs_m.objs(connected(1));from1=o1.to;
+                        o2=scs_m.objs(connected(2));
+
+                        //create a unique link
+                        if o1.from(1)==ksplit&o2.from(1)==ksplit then
+                            //the two links come from the split: invert o1
+                            w=o1.to;o1.to=o1.from;o1.from=w;
+                            o1.xx=o1.xx($:-1:1);o1.yy=o1.yy($:-1:1);
+                        elseif o1.to(1)==ksplit(1)&o2.to(1)==ksplit then
+                            //the two links go from the split: invert o2
+                            w=o2.to;o2.to=o2.from;o2.from=w;
+                            o2.xx=o2.xx($:-1:1);o2.yy=o2.yy($:-1:1);
+                        elseif o1.to(1)<>ksplit then
+                            //o1 comes from the split while o2 goes to the split,
+                            //switch o1 and o2
+                            [o1,o2]=(o2,o1),
+                            connected=connected([2 1]);
+                        end
+
+                        //now we can assume that o1 goes to the split and o2 comes
+                        //from the split
+                        from1=o1.to;to2=o2.to;ct2=o2.ct
+                        //the links comes from connected(1) block and
+                        //goes to connected(2) block
+                        x1=o1.xx;y1=o1.yy
+                        if x1($-1)==x1($)&o2.xx(1)==o2.xx(2)|.. // both segs are vertical
+                            y1($-1)==y1($)&o2.yy(1)==o2.yy(2) then //both segs are horiz
+                            o1.xx=[x1(1:$-1);o2.xx(2:$)];
+                            o1.yy=[y1(1:$-1);o2.yy(2:$)];
+                        else
+                            o1.xx=[x1(1:$-1);o2.xx];
+                            o1.yy=[y1(1:$-1);o2.yy];
+                        end
+                        o1.to=o2.to;
+
+                        DEL = [DEL connected(1)] // suppress one link
+                        DELL=[DELL  connected(1)]
+                        scs_m.objs(connected(2))=o1 //change link
+
+                        scs_m.objs(to2(1))=mark_prt(scs_m.objs(to2(1)),to2(2),outin(to2(3)+1),ct2(2),..
+                        connected(2))
+                        scs_m.objs(o1.from(1))=mark_prt(scs_m.objs(o1.from(1)),o1.from(2),..
+                        outin(o1.from(3)+1),o1.ct(2),connected(2))
+
+                    end // delete split
+                end //get links connected to the split block
+            end // erase and delete link
+
+            if toblock.gui=="SPLIT_f"|toblock.gui=="CLKSPLIT_f" then //
+                //user kills a split input link
+                //ask for split deletion
+                K=[K to(1)]
+            elseif toblock.gui=="IMPSPLIT_f" then
+                //user kills a IMPsplit  link:
+
+                //get links connected to the split block
+                connected=get_connected(scs_m,to(1))
+                if size(connected,"*")==2 then
+                    //create a unique link with the split input and remaining
+                    //output link and suppress the split block
+                    if find(connected(2)==DEL)<>[] then // delete split
+                        K=[to(1) K]
+                    else
+
+                        DEL=[DEL  to(1)]       //suppress split block
+
+                        o1=scs_m.objs(connected(1));
+                        o2=scs_m.objs(connected(2));
+                        //o1 and o2 are the links that comes from the split
+
+                        //create a unique link
+                        to1=o1.to; //number of block at the boundary of link o1
+                        to2=o2.to; //number of block at the boundary of link o2
+                        if (o1.xx(1)==o1.xx(2)& o2.xx(1)==o2.xx(2))| ..
+                            (o1.yy(1)==o1.yy(2)& o2.yy(1)==o2.yy(2)) then
+                            o1.xx=o1.xx(2:$);o1.yy=o1.yy(2:$)
+                        end
+                        o1.xx=[o1.xx($:-1:1);o2.xx]
+                        o1.yy=[o1.yy($:-1:1);o2.yy]
+                        o1.from=o1.to
+                        o1.to=o2.to;
+
+
+                        DEL=[DEL connected(1)] // suppress one link
+                        DELL=[DELL  connected(1)]
+                        scs_m.objs(connected(2))=o1 //change link
+
+                        scs_m.objs(to1(1))=mark_prt(scs_m.objs(to1(1)),..
+                        to1(2),outin(to1(3)+1),o1.ct(2),connected(2))
+                        scs_m.objs(to2(1))=mark_prt(scs_m.objs(to2(1)),to2(2),..
+                        outin(to2(3)+1),ct(2), ...
+                        connected(2))
+                    end //if find(connected(2)==DEL)<>[]
+
+                end //if size(connected,'*')==2
+
+            end //elseif toblock.gui=='IMPSPLIT_f'
+
+            //** -------------------------------------- Block ---------------------------------------
+        elseif typ=="Block" then
+
+            // get connected links
+            connected=get_connected(scs_m,k)
+            //ask for connected links deletion
+            K=[K connected]
+
+
+            //**--------------------------------------- Text ----------------------------------------
+        elseif typ=="Text" then
+            //** do nothing :)
+
+            //** ---------------------------- already "Deleted" object :) ----------------------------
+        elseif typ=="Deleted" then
+            //** do nothing :)
+
+            //** ---------------------------  in all the other possibles cases -----------------------
+        else
+
+            messagebox("This object can''t be deleted","modal");
+
+        end //** link / Block / Text / Deleted / other...
+
+    end //** ... end of while ()
+    //**---------------------------------- end of main while() loop ---------------------------
+
+
+    //** Scan all the deleted elements and update the graphics datastrucure
+    for k = DEL
+        scs_m.objs(k) = mlist("Deleted"); //** mark the object as "Deleted"
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/do_edit_pal.bug b/modules/scicos/macros/scicos_scicos/do_edit_pal.bug
new file mode 100755
index 000000000..95457ed66
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_edit_pal.bug
@@ -0,0 +1,32 @@
+function [scicos_palnew]=do_edit_pal(scicos_pal)
+// Copyright INRIA
+scicos_palnew=[]
+load('.scicos_pal')
+  txt=scicos_pal(:,2);
+txtnew=txt
+ld=%f
+while ld=%f
+  txtnew=x_dialog('Edit the list of palettes below',txtnew)
+  if txtnew==[]|txt==txtnew then scicos_palnew=[];return;end
+  scicos_palnew=[]
+  for i=1:size(txtnew,1)
+    txtnew(i)=stripblanks(txtnew(i))
+    l=length(txtnew(i))
+    if l<>0 then
+      k=strindex(txtnew(i),'/');if k=[] then k=0;end
+      h=strindex(txtnew(i),'\');if h=[] then h=0;end
+      m=max(k,h); 
+      n=strindex(txtnew(i),'.cosf')
+      if n=[] then n=strindex(txtnew(i),'.cos');end
+      if n=[] then 
+	messagebox('All files must end with .cos or .cosf','modal')
+	scicos_palnew=[]
+	ld=%f;break
+      end
+      a=part(txtnew(i),m+1:n);
+      scicos_palnew=[scicos_palnew;[a,txtnew(i)]];
+      ld=%t
+    end
+  end
+end
+
diff --git a/modules/scicos/macros/scicos_scicos/do_eval.bin b/modules/scicos/macros/scicos_scicos/do_eval.bin
new file mode 100755
index 000000000..479ac7189
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_eval.bin
diff --git a/modules/scicos/macros/scicos_scicos/do_eval.sci b/modules/scicos/macros/scicos_scicos/do_eval.sci
new file mode 100755
index 000000000..e26bc94db
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_eval.sci
@@ -0,0 +1,207 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) DIGITEO - 2010 - Jérôme PICARD
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [scs_m,cpr,needcompile,ok]=do_eval(scs_m,cpr,%scicos_context)
+    // This function (re)-evaluates blocks in the scicos data structure scs_m
+
+    ok=%t
+    needcompile1=max(2,needcompile)
+    %mprt=funcprot()
+    funcprot(0)
+    scicos_getvalue=setvalue;
+    getvalue=setvalue;
+
+    function scicosmessage(txt)
+        messagebox(["In block " + o.gui + ": ";
+        txt;
+        "current parameter value kept"],"Warning","modal");
+        %scicos_prob = resume(%t)
+    endfunction
+
+    // overload message
+    // This function is used to alert the user on setvalue
+    // (invalid exprs we keep the previous parameters)
+    function message(str)
+        if length(arg1.doc) >= 1 then
+            uid = arg1.doc(1);
+            uid = [full_uids uid];
+
+            html = "<html><body>";
+            html = html + "<em>" + gettext("Evaluation problem: value not updated from context.") + "</em><br/>";
+            html = html + strcat(str, "<br/>") + "<br/>";
+            html = html + "</body></html>";
+            warnBlockByUID(uid, html);
+        else
+            txt = gettext("Evaluation problem: value not updated from context.");
+            txt = [txt ; str];
+            disp(txt);
+        end
+
+        %scicos_prob = resume(%t)
+    endfunction
+
+    // path on do_eval hierarchy loop
+    if ~isdef("full_uids") then
+        full_uids = [];
+    end
+
+    global %scicos_prob
+    %scicos_prob=%f
+
+    //## overload some functions used in GUI
+    deff("[ok,tt]        =  FORTR(funam,tt,i,o)","ok=%t")
+    deff("[ok,tt,cancel] =  CFORTR2(funam,tt,i,o)","ok=%t,cancel=%f")
+    deff("[ok,tt,cancel] =  CC4(funam,tt,i,o)","ok=%t,cancel=%f")
+    deff("[ok,tt]        =  CFORTR(funam,tt,i,o)","ok=%t")
+    deff("[x,y,ok,gc]    =  edit_curv(x,y,job,tit,gc)","ok=%t")
+    deff("[ok,tt,dep_ut] = genfunc1(tt,ni,no,nci,nco,nx,nz,nrp,type_)",..
+    "dep_ut=model.dep_ut;ok=%t")
+    deff("result         = dialog(labels,valueini)","result=valueini")
+    deff("[result,Quit]  = scstxtedit(valueini,v2)","result=valueini,Quit=0")
+    deff("[ok,tt]        = MODCOM(funam,tt,vinp,vout,vparam,vparamv,vpprop)",..
+    "[dirF, nameF, extF] = fileparts(funam);..
+    [modelica_path, modelica_directory] = getModelicaPath();..
+    funam1 = []; ..
+    if (extF == """")  then, ..
+        funam1 = modelica_directory + nameF + "".mo""; ..
+    elseif fileinfo(funam) == [] then, ..
+        funam1 = funam; ..
+    end; ..
+    if funam1 <> [] then, ..
+        mputl(tt, funam1); ..
+    end");
+    %nx=lstsize(scs_m.objs)
+    funcprot(%mprt)
+    for %kk=1:%nx
+        o=scs_m.objs(%kk)
+        if typeof(o)=="Block" then
+            model=o.model
+            if model.sim=="super"| (model.sim=="csuper"& ~isequal(model.ipar,1)) then  //exclude mask
+                sblock=model.rpar
+                context=sblock.props.context
+                [scicos_context1,ierr]=script2var(context,%scicos_context)
+                if ierr <>0 then
+                    %now_win=xget("window")
+                    scicosmessage(["Cannot evaluate a context";lasterror()])
+                    xset("window",%now_win)
+                else
+                    previous_full_uids = full_uids;
+                    if length(o.doc) >= 1 then
+                        full_uids = [full_uids o.doc(1)];
+                    end
+                    [sblock,%w,needcompile2,ok]=do_eval(sblock,list(),scicos_context1)
+                    needcompile1=max(needcompile1,needcompile2)
+                    full_uids = previous_full_uids;
+                    if ok then
+                        scs_m.objs(%kk).model.rpar=sblock
+                    else
+                        return
+                    end
+                end
+            elseif o.model.sim(1)=="asuper" then
+            else
+                model=o.model
+                if ~isdef(o.gui) | ~or(type(evstr(o.gui) == [13 11])) then
+                    if length(o.doc) >= 1 then
+                        uid = [full_uids o.doc(1)];
+
+                        html = "<html><body>";
+                        html = html + "<em>" + gettext("Evaluation problem: Unknown block") + "</em><br/>";
+                        html = html + "</body></html>";
+                        warnBlockByUID(uid, html);
+                    else
+                        error("do_eval: " + gettext("Evaluation problem: Unknown block") + " " + o.gui);
+                    end
+                end
+
+                %scicos_prob=%f
+                ier=execstr("o="+o.gui+"(''set'',o)","errcatch", "m")
+                if ier==0& %scicos_prob==%f then
+                    needcompile1=max(needcompile1,needcompile) // for scifunc_block
+                    model_n=o.model
+                    if or(model.blocktype<>model_n.blocktype)|.. // type 'c','d','z','l'
+                        or(model.dep_ut<>model_n.dep_ut)|..
+                        (model.nzcross<>model_n.nzcross)|..
+                        (model.nmode<>model_n.nmode) then
+                        needcompile1=4
+                    end
+                    if (size(model.in,"*")<>size(model_n.in,"*"))|..
+                        (size(model.out,"*")<>size(model_n.out,"*"))|..
+                        (size(model.evtin,"*")<>size(model_n.evtin,"*")) then
+                        // number of input (evt or regular ) or output  changed
+                        needcompile1=4
+                    end
+                    if model.sim=="input"|model.sim=="output" then
+                        if model.ipar<>model_n.ipar then
+                            needcompile1=4
+                        end
+                    end
+
+                    itisanMBLOCK=%f
+                    if prod(size(model.sim))>1 then
+                        if (model.sim(2)==30004) then
+                            itisanMBLOCK=%t
+                        end
+                    end
+
+                    if (prod(size(model.sim))==1 & ~model.equations==list()) | itisanMBLOCK then
+                        if ~isequal(model.equations.parameters,model_n.equations.parameters) then
+                            param_name   = model.equations.parameters(1);
+                            param_name_n = model_n.equations.parameters(1);
+                            if ~isequal(param_name,param_name_n) then
+                                needcompile1=4
+                            else
+                                for i=1:length(model.equations.parameters(2))
+                                    if or((model.equations.parameters(2)(i))<>(model_n.equations.parameters(2)(i))) then
+                                        needcompile=0
+
+                                        // the initialization XML files is re-created by translator if needed
+                                        // XML=TMPDIR+'/'+stripblanks(scs_m.props.title(1))+'_imf_init.xml';
+                                        // if ~deletefile(XML) then
+                                        //   messagebox(msprintf(_('Unable to delete the file: %s'),XML),'error','modal');
+                                        // end
+
+                                        // the XML simulation is no more created with Xcos
+                                        // XMLTMP=TMPDIR+'/'+stripblanks(scs_m.props.title(1))+'_imSim.xml'
+                                        // if ~deletefile(XMLTMP) then
+                                        //   messagebox(msprintf(_('Unable to delete the file: %s'),XMLTMP),'error','modal');
+                                        // end
+
+                                        break;
+                                    end
+                                end
+                            end
+                        end
+                    end
+
+                    scs_m.objs(%kk)=o
+                else
+                    error(msprintf(gettext("%s: Error while calling block %s [uid=''%s'']: invalid parameter (ier=%f, %%scicos_prob=%%%s).\n"), "do_eval", o.gui, o.model.uid, ier, string(%scicos_prob)));
+                    ok=%f
+                    return
+                end
+            end
+        end
+    end
+    needcompile=needcompile1
+    if needcompile==4 then cpr=list(),end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/do_purge.bin b/modules/scicos/macros/scicos_scicos/do_purge.bin
new file mode 100755
index 000000000..37514e974
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_purge.bin
diff --git a/modules/scicos/macros/scicos_scicos/do_purge.sci b/modules/scicos/macros/scicos_scicos/do_purge.sci
new file mode 100755
index 000000000..b9edaf4f9
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_purge.sci
@@ -0,0 +1,78 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function scs_m_new = do_purge(scs_m)
+
+    // suppress deleted elements in a scicos data structure
+    nx = lstsize(scs_m.objs);
+
+    // get index of deleted blocks
+    deleted=[];
+    for k=1:nx
+        typ = typeof(scs_m.objs(k));
+        if typ=="Deleted" then
+            deleted = [deleted,k];
+        elseif typ=="Block" then
+            if scs_m.objs(k).model.sim=="super" then
+                scs_m.objs(k).model.rpar = do_purge(scs_m.objs(k).model.rpar)
+            end
+        end
+
+    end
+
+    if deleted==[] then // nothing has to be done
+        scs_m_new = scs_m
+        return ; //** EXIT point
+    end
+
+    retained = 1:nx;
+    retained(deleted)=[];
+
+    // compute index cross table
+    old_to_new = ones(1,nx);
+    old_to_new(deleted) = 0*deleted;
+    old_to_new = rtitr(1,%z-1,old_to_new)';
+
+    scs_m_new = scicos_diagram( version=get_scicos_version() );
+    scs_m_new.props = scs_m.props
+    for k=1:size(retained,"*")
+        o = scs_m.objs(retained(k))
+        if typeof(o)=="Block" then
+            if o.graphics.pin<>[] then
+                o.graphics.pin = old_to_new(o.graphics.pin+1);
+            end
+            if o.graphics.pout<>[] then
+                o.graphics.pout = old_to_new(o.graphics.pout+1);
+            end
+            if o.graphics.pein<>[] then
+                o.graphics.pein = old_to_new(o.graphics.pein+1);
+            end
+            if o.graphics.peout<>[] then
+                o.graphics.peout = old_to_new(o.graphics.peout+1);
+            end
+        elseif typeof(o)=="Link" then
+            o.from(1) = old_to_new(o.from(1)+1);
+            o.to(1) = old_to_new(o.to(1)+1);
+        end
+        scs_m_new.objs(k)=o;
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/do_terminate.bin b/modules/scicos/macros/scicos_scicos/do_terminate.bin
new file mode 100755
index 000000000..a1d1e3989
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_terminate.bin
diff --git a/modules/scicos/macros/scicos_scicos/do_terminate.sci b/modules/scicos/macros/scicos_scicos/do_terminate.sci
new file mode 100755
index 000000000..b4763945d
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_terminate.sci
@@ -0,0 +1,104 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [alreadyran,%cpr] = do_terminate(scs_m,%cpr)
+    // Terminate the current simulation
+    // Ne rend pas la main à l'utilisateur en cas d'erreur
+
+
+    //** if sim or and state is not in %cpr
+    if prod(size(%cpr))<2 then
+        alreadyran = %f ;
+        return          ;  //** EXIT
+    end
+
+    par = scs_m.props ;
+
+    //** if the simulation have already ran
+    //** and is not finished
+    if alreadyran then
+        alreadyran = %f ;
+        state=%cpr.state;
+
+        //** win = xget('window');
+        gh_win = gcf();
+
+        //** run scicosim via 'finish' flag
+        ierr = execstr("[state,t]=scicosim(%cpr.state,par.tf,par.tf,%cpr.sim,"+..
+        "''finish'',par.tol)","errcatch")
+
+        //** xset('window',win)
+        scf(gh_win);
+
+        %cpr ; //get write access at the variable
+        %cpr.state = state ;//not always called with second arg
+
+        //**----------------------------------
+        if ierr<>0 then
+            str_err=split_lasterror(lasterror());
+            title_err="End problem."
+
+            kfun = curblock() ;
+            corinv = %cpr.corinv
+            if kfun<>0 then  //** block error
+                path = corinv(kfun)
+
+                if type(path)==15 then //** modelica block
+                    spec_err="The modelica block returns the error :";
+                    messagebox([title_err;spec_err;str_err],"modal");
+
+                else //** all other type of blocks
+                    obj_path=path(1:$-1)
+                    spec_err="block"
+                    blk=path($)
+                    scs_m_n=scs_m;
+                    //** check if we can open a window
+                    //** Alan: we can improve that piece of code
+                    //**       to also returns the name of the comput. func.
+                    for i=1:size(path,"*")
+                        if scs_m_n.objs(path(i)).model.sim=="super" then
+                            scs_m_n=scs_m_n.objs(path(i)).model.rpar;
+                        elseif scs_m_n.objs(path(i)).model.sim=="csuper" then
+                            obj_path=path(1:i-1);
+                            blk=path(i);
+                            //spec_err='csuper block (block '+string(path(i+1))+')'
+                            spec_err="csuper block"
+                            break;
+                        end
+                    end
+                    spec_err="The highlighted "+spec_err+" returns the error :";
+                    //**
+                    scf(curwin)
+                    //** call bad_connection
+                    bad_connection(path,...
+                    [title_err;spec_err;str_err],0,1,0,-1,0,1)
+                end
+            else//** simulateur error
+                messagebox(["End problem:";str_err],"modal")
+            end
+        end
+        //**---------------------------------
+
+        //** xset('window',curwin)
+        scf(curwin);
+
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/do_update.bin b/modules/scicos/macros/scicos_scicos/do_update.bin
new file mode 100755
index 000000000..b22f72182
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_update.bin
diff --git a/modules/scicos/macros/scicos_scicos/do_update.sci b/modules/scicos/macros/scicos_scicos/do_update.sci
new file mode 100755
index 000000000..1b31dc026
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_update.sci
@@ -0,0 +1,124 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [%cpr,%state0,needcompile,alreadyran,ok]=do_update(%cpr,%state0,needcompile)
+    //Update an already compiled scicos diagram compilation result according to
+    //parameter changes
+    //!
+    ok=%t
+    select needcompile
+    case 0 then  // only parameter changes
+        if size(newparameters)<>0 then
+            cor=%cpr.cor
+            [%state0,state,sim,ok]=modipar(newparameters,%state0,%cpr.state,%cpr.sim)
+            if ~ok then
+                alreadyran=do_terminate();
+                disp("Partial compilation failed. Attempting a full compilation.");
+                needcompile=4
+                [%cpr,ok]=do_compile(scs_m)
+                if ok then
+                    %state0=%cpr.state
+                    needcompile=0
+                    return;
+                end
+            end
+            %cpr.state=state,%cpr.sim=sim
+        end
+    case 1 then // parameter changes and/or port sizes change
+        if size(newparameters)<>0 then
+            // update parameters or states
+            cor=%cpr.cor
+            [%state0,state,sim,ok]=modipar(newparameters,%state0,%cpr.state,%cpr.sim)
+            if (~ok| findinlistcmd(%cpr.corinv,size(cor),">")<>list() ) then
+                alreadyran=do_terminate()
+                disp("Partial compilation failed. Attempting a full compilation.");
+                needcompile=4
+                [%cpr,ok]=do_compile(scs_m)
+                if ok then
+                    %state0=%cpr.state
+                    needcompile=0
+                end
+                return;
+            end
+            %cpr.state=state,%cpr.sim=sim
+        end
+        //update port sizes.
+        // NB: if modelica part block size has been changed, the diagram is recompiled
+        bllst=list();
+        corinv=%cpr.corinv
+        sim=%cpr.sim
+        for k=1:size(corinv)
+            if type(corinv(k))==1 then //dont take care of modelica blocks
+                if size(corinv(k),"*")==1 then
+                    bllst(k)=scs_m.objs(corinv(k)).model;
+                else
+                    path=list("objs");
+                    for l=corinv(k)(1:$-1),
+                        path($+1)=l;
+                        path($+1)="model";
+                        path($+1)="rpar";path($+1)="objs";
+                    end
+                    path($+1)=corinv(k)($);
+                    path($+1)="model";
+                    bllst(k)=scs_m(path);
+                end
+            else // modelica block
+                //build a fake bllst(k) only for in and out fields
+                m=scicos_model();
+                m.in=ones(sim.inpptr(k+1)-sim.inpptr(k),1)
+                m.out=ones(sim.outptr(k+1)-sim.outptr(k),1)
+                bllst(k)=m;
+            end
+        end
+        [ok,bllst]=adjust(bllst,sim("inpptr"),sim("outptr"),sim("inplnk"),..
+        sim("outlnk"))
+        if ok then
+            [lnksz,lnktyp]=lnkptrcomp(bllst,sim("inpptr"),sim("outptr"),...
+            sim("inplnk"),sim("outlnk"))
+            %cpr.state("outtb")=buildouttb(lnksz,lnktyp)
+            %state0("outtb")=buildouttb(lnksz,lnktyp)
+            needcompile=0
+        end
+
+    case 2 then // partial recompilation
+        alreadyran=do_terminate()
+        [%cpr,ok]=c_pass3(scs_m,%cpr)
+        if ok then
+            %state0=%cpr.state
+            needcompile=0;
+            return;
+        end
+        disp("Partial compilation failed. Attempting a full compilation.");
+        [%cpr,ok]=do_compile(scs_m)
+        if ok then
+            %state0=%cpr.state
+            needcompile=0
+        end
+    case 4 then  // full compilation
+        alreadyran=do_terminate()
+        [%cpr,ok]=do_compile(scs_m)
+        if ok then
+            %state0=%cpr.state
+            needcompile=0
+        end
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/do_version.bin b/modules/scicos/macros/scicos_scicos/do_version.bin
new file mode 100755
index 000000000..0da93bce3
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_version.bin
diff --git a/modules/scicos/macros/scicos_scicos/do_version.sci b/modules/scicos/macros/scicos_scicos/do_version.sci
new file mode 100755
index 000000000..8042e0ce1
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/do_version.sci
@@ -0,0 +1,2328 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) DIGITEO - 2010 - Jérôme PICARD
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function scs_m=do_version(scs_m,version)
+
+    // available versions of Scicos
+    availableVersions = [ ..
+    "scicos2.2"; ..
+    "scicos2.3"; ..
+    "scicos2.3.1"; ..
+    "scicos2.4"; ..
+    "scicos2.5.1"; ..
+    "scicos2.7"; ..
+    "scicos2.7.1"; ..
+    "scicos2.7.2"; ..
+    "scicos2.7.3"; ..
+    "scicos4"; ..
+    "scicos4.0.1"; ..
+    "scicos4.0.2"; ..
+    "scicos4.2"; ..
+    "scicos4.0.1"; ..
+    "scicos4.0.2"; ..
+    "scicos4.2"; ..
+    "scicos4.3"; ..
+    "scicos4.4"];
+
+    if ~or(version==availableVersions) then
+        error("No version update defined to "+version+" version")
+    end
+
+    if version=="scicos2.2" then scs_m=do_version22(scs_m);version="scicos2.3";end
+    if version=="scicos2.3" then scs_m=do_version23(scs_m);version="scicos2.3.1";end
+    if version=="scicos2.3.1" then scs_m=do_version231(scs_m); version="scicos2.4";end
+    if version=="scicos2.4" then scs_m=do_version251(scs_m),version="scicos2.5.1";end
+    if version=="scicos2.5.1" then
+        ncl=lines()
+        lines(0)
+        disp("This is an old scicos diagram. I have to translate.")
+        scs_m=do_versionxx(scs_m);scs_m=do_version27(scs_m);version="scicos2.7";
+        disp("I am now going to clean your diagram. Block numbers may change.")
+        scs_m=do_purge(scs_m);
+        disp("Save the diagram (under a different name just in case)")
+        lines(ncl(2))
+    end
+    if version=="scicos2.7" then
+        disp("This is an old scicos diagram. I have to translate. Be patient.")
+        scs_m=do_version271(scs_m),
+        version="scicos2.7.1";
+    end
+    if version=="scicos2.7.1" then scs_m=do_version272(scs_m),version="scicos2.7.2";end
+    if version=="scicos2.7.2" then scs_m=do_version273(scs_m),version="scicos2.7.3";end
+    if version=="scicos2.7.3" | version=="scicos4" |...
+        version=="scicos4.0.1" | version=="scicos4.0.2" then
+        version="scicos4.2";
+        //*** do certification ***//
+        scs_m=update_scs_m(scs_m,version);
+        //*** update scope ***//
+        scs_m=do_version42(scs_m);
+        //*********************************//
+    end
+    if version=="scicos4.2" then
+        ncl=lines(); lines(0);
+        version="scicos4.3";
+        //*** do certification ***//
+        scs_m=update_scs_m(scs_m,version);
+        scs_m=do_version43(scs_m);
+        lines(ncl(2))
+    end
+
+    if or(version==["scicos4.3";"scicos4.4"]) then
+        ncl=lines(); lines(0);
+        version="scicos4.3";
+        scs_m=update_scs_m(scs_m,version);
+        scs_m=do_version43(scs_m);
+        scs_m.version = version;
+        lines(ncl(2))
+    end
+endfunction
+
+function scs_m_new=do_version43(scs_m)
+    //disp('do_version43');
+    scs_m_new=scs_m;
+
+    //@@ adjust ID.fonts
+    scs_m_new.props.options.ID(1)=[scs_m.props.options.ID(1)(1),scs_m.props.options.ID(1)(2),2,1];
+    scs_m_new.props.options.ID(2)=[scs_m.props.options.ID(2)(1),scs_m.props.options.ID(2)(2),10,1];
+
+    n=size(scs_m.objs);
+    for j=1:n //loop on objects
+        o=scs_m.objs(j);
+        if typeof(o)=="Block" then
+            omod=o.model;
+
+            // Clear the doc fields if it contains a function pointer
+            if type(o.doc) == 15 & size(o.doc) > 1 & (type(o.doc(1)) == 11 | type(o.doc(1)) == 13) then
+                scs_m_new.objs(j).doc = list();
+            end
+
+            //@@ sbloc
+            if omod.sim=="super"|omod.sim=="csuper"|omod.sim(1)=="asuper" then
+                rpar=do_version43(omod.rpar)
+                scs_m_new.objs(j).model.rpar=rpar
+            end
+
+            //@@ Change gr_i of MUX if needed
+            if o.gui=="MUX" then
+                gr_i=["txt=''Mux'';"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                id=o.graphics.id
+                if id=="Mux" then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == " " then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i == " " then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of DEMUX if needed
+            elseif o.gui=="DEMUX" then
+                gr_i=["txt=''Demux'';"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                id=o.graphics.id
+                if id=="Demux" then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == "" then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i == "" then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of FROMWSB
+            elseif o.gui=="FROMWSB" then
+                gr_i=["xstringb(orig(1),orig(2),''From workspace'',sz(1),sz(2),''fill'')"
+                "txt=varnam;"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                id=""
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                else
+                    scs_m_new.objs(j).graphics.gr_i=gr_i
+                end
+
+                //@@ Change gr_i of TOWS_c
+            elseif o.gui=="TOWS_c" then
+                gr_i=["xstringb(orig(1),orig(2),''To workspace'',sz(1),sz(2),''fill'')"
+                "txt=varnam;"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                id=""
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                else
+                    scs_m_new.objs(j).graphics.gr_i=gr_i
+                end
+
+                //@@ Change gr_i of INTEGRAL_m if needed
+            elseif o.gui=="INTEGRAL_m" | o.gui=="INTEGRAL" then
+                gr_i=["thick=xget(''thickness'')"
+                "pat=xget(''pattern'')"
+                "fnt=xget(''font'')"
+                "xpoly(orig(1)+[0.7;0.62;0.549;0.44;0.364;0.291]*sz(1),orig(2)+[0.947;0.947;0.884;0.321;0.255;0.255]*sz(2),"'lines"')"
+                "txt=''1/s'';"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"
+                "xset(''thickness'',thick)"
+                "xset(''pattern'',pat)"
+                "xset(''font'',fnt(1),fnt(2))"]
+                old_gri=["thick=xget(''thickness'')"
+                "pat=xget(''pattern'')"
+                "fnt=xget(''font'')"
+                "xpoly(orig(1)+[0.7;0.62;0.549;0.44;0.364;0.291]*sz(1),orig(2)+[0.947;0.947;0.884;0.321;0.255;0.255]*sz(2),"'lines"')"
+                "xset(''thickness'',thick)"
+                "xset(''pattern'',pat)"
+                "xset(''font'',fnt(1),fnt(2))"
+                ]
+                id=o.graphics.id
+                if id=="1/s" then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of PRODUCT if needed
+            elseif o.gui=="PRODUCT" then
+                gr_i=["[x,y,typ]=standard_inputs(o) ";
+                "dd=sz(1)/8,de=0,"
+                "if ~arg1.graphics.flip then dd=6*sz(1)/8,de=-sz(1)/8,end"
+                "for k=1:size(x,''*'')";
+                "if size(sgn,1)>1 then"
+                "  if sgn(k)>0 then";
+                "    xstring(orig(1)+dd,y(k)-4,''*'')";
+                "  else";
+                "    xstring(orig(1)+dd,y(k)-4,''/'')";
+                "  end";
+                "end";
+                "end";
+                "xx=sz(1)*[.8 .8 .4  .4]+orig(1)+de";
+                "yy=sz(2)*[.2 .8 .8  .2]+orig(2)";
+                "xpoly(xx,yy,''lines'')"
+                "txt=''Product'';"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                old_gri=["[x,y,typ]=standard_inputs(o) ";
+                "dd=sz(1)/8,de=0,"
+                "if ~arg1.graphics.flip then dd=6*sz(1)/8,de=-sz(1)/8,end"
+                "for k=1:size(x,''*'')";
+                "if size(sgn,1)>1 then"
+                "  if sgn(k)>0 then";
+                "    xstring(orig(1)+dd,y(k)-4,''*'')";
+                "  else";
+                "    xstring(orig(1)+dd,y(k)-4,''/'')";
+                "  end";
+                "end";
+                "end";
+                "xx=sz(1)*[.8 .8 .4  .4]+orig(1)+de";
+                "yy=sz(2)*[.2 .8 .8  .2]+orig(2)";
+                "xpoly(xx,yy,''lines'')"]
+                id=o.graphics.id
+                if id=="1/s" then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of DERIV if needed
+            elseif o.gui=="DERIV" then
+                gr_i=["xstringb(orig(1),orig(2),'' du/dt   '',sz(1),sz(2),''fill'');"
+                "txt=''s'';"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                old_gri=["xstringb(orig(1),orig(2),''  du/dt  '',sz(1),sz(2),''fill'');"]
+                id=o.graphics.id
+                if id=="s" then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of JKFLIPFLOP if needed
+            elseif o.gui=="JKFLIPFLOP" then
+                gr_i=["[x,y,typ]=standard_inputs(o) ";
+                "dd=sz(1)/8,de=5.5*sz(1)/8";
+                "txt=''J'';"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "rectstr=stringbox(txt,orig(1)+dd,y(1)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+dd,y(1)-4,txt,w,h,''fill'')";
+                "txt=''clk'';"
+                "rectstr=stringbox(txt,orig(1)+dd,y(2)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+dd,y(2)-4,txt,w,h,''fill'')";
+                "txt=''K'';"
+                "rectstr=stringbox(txt,orig(1)+dd,y(3)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+dd,y(3)-4,txt,w,h,''fill'')";
+                "[x,y,typ]=standard_outputs(o) ";
+                "txt=''Q'';"
+                "rectstr=stringbox(txt,orig(1)+de,y(1)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+de,y(1)-4,txt,w,h,''fill'')";
+                "txt=''!Q'';"
+                "rectstr=stringbox(txt,orig(1)+4.5*dd,y(2)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+4.5*dd,y(2)-4,txt,w,h,''fill'')";
+                "txt=''JK FLIP-FLOP'';"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                old_gri=["[x,y,typ]=standard_inputs(o) ";
+                "dd=sz(1)/8,de=6*sz(1)/8";
+                "xstring(orig(1)+dd,y(1)-4,''J'')";
+                "xstring(orig(1)+dd,y(2)-4,''clk'')";
+                "xstring(orig(1)+dd,y(3)-4,''K'')";
+                "[x,y,typ]=standard_outputs(o) ";
+                "xstring(orig(1)+de,y(1)-4,''Q'')";
+                "xstring(orig(1)+5*dd,y(2)-4,''!Q'')"]
+                id=o.graphics.id
+                if id=="JK FLIP-FLOP" then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of SRFLIPFLOP if needed
+            elseif o.gui=="SRFLIPFLOP" then
+                gr_i=["[x,y,typ]=standard_inputs(o) ";
+                "dd=sz(1)/8,de=5.5*sz(1)/8";
+                "txt=''S'';"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "rectstr=stringbox(txt,orig(1)+dd,y(1)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+dd,y(1)-4,txt,w,h,''fill'')";
+                "txt=''R'';"
+                "rectstr=stringbox(txt,orig(1)+dd,y(2)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+dd,y(2)-4,txt,w,h,''fill'')";
+                "[x,y,typ]=standard_outputs(o) ";
+                "txt=''Q'';"
+                "rectstr=stringbox(txt,orig(1)+de,y(1)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+de,y(1)-4,txt,w,h,''fill'')";
+                "txt=''!Q'';"
+                "rectstr=stringbox(txt,orig(1)+4.5*dd,y(2)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+4.5*dd,y(2)-4,txt,w,h,''fill'')";
+                "txt=''SR FLIP-FLOP'';"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                old_gri=["[x,y,typ]=standard_inputs(o) ";
+                "dd=sz(1)/8,de=6*sz(1)/8";
+                "xstring(orig(1)+dd,y(1)-4,''S'')";
+                "xstring(orig(1)+dd,y(2)-4,''R'')";
+                "[x,y,typ]=standard_outputs(o) ";
+                "xstring(orig(1)+de,y(1)-4,''Q'')";
+                "xstring(orig(1)+5*dd,y(2)-4,''!Q'')"]
+                id=o.graphics.id
+                if id=="SR FLIP-FLOP" then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of DLATCH if needed
+            elseif o.gui=="DLATCH" then
+                gr_i=["[x,y,typ]=standard_inputs(o) ";
+                "dd=sz(1)/8,de=5.5*sz(1)/8";
+                "txt=''D'';"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "rectstr=stringbox(txt,orig(1)+dd,y(1)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+dd,y(1)-4,txt,w,h,''fill'')";
+                "txt=''C'';"
+                "rectstr=stringbox(txt,orig(1)+dd,y(2)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+dd,y(2)-4,txt,w,h,''fill'')";
+                "txt=''Q'';"
+                "rectstr=stringbox(txt,orig(1)+de,y(1)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+de,y(1)-4,txt,w,h,''fill'')";
+                "txt=''!Q'';"
+                "rectstr=stringbox(txt,orig(1)+4.5*dd,y(2)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+4.5*dd,y(2)-4,txt,w,h,''fill'')";
+                "txt=''DLATCH'';"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                old_gri=["[x,y,typ]=standard_inputs(o) ";
+                "dd=sz(1)/8,de=6*sz(1)/8";
+                "xstring(orig(1)+dd,y(1)-4,''D'')";
+                "xstring(orig(1)+dd,y(2)-4,''C'')";
+                "xstring(orig(1)+de,y(1)-4,''Q'')";
+                "xstring(orig(1)+5*dd,y(2)-4,''!Q'')"]
+                id=o.graphics.id
+                if id=="DLATCH" then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of DFLIPFLOP if needed
+            elseif o.gui=="DFLIPFLOP" then
+                gr_i=["[x,y,typ]=standard_inputs(o) ";
+                "dd=sz(1)/8,de=5.5*sz(1)/8";
+                "txt=''D'';"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "rectstr=stringbox(txt,orig(1)+dd,y(1)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+dd,y(1)-4,txt,w,h,''fill'')";
+                "txt=''clk'';"
+                "rectstr=stringbox(txt,orig(1)+dd,y(2)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+dd,y(2)-4,txt,w,h,''fill'')";
+                "txt=''en'';"
+                "rectstr=stringbox(txt,orig(1)+dd,y(3)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+dd,y(3)-4,txt,w,h,''fill'')";
+                "[x,y,typ]=standard_outputs(o) ";
+                "txt=''Q'';"
+                "rectstr=stringbox(txt,orig(1)+de,y(1)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+de,y(1)-4,txt,w,h,''fill'')";
+                "txt=''!Q'';"
+                "rectstr=stringbox(txt,orig(1)+4.5*dd,y(2)-4,0,1,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+4.5*dd,y(2)-4,txt,w,h,''fill'')";
+                "txt=''D FLIP-FLOP'';"
+                "style=5;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                old_gri=["[x,y,typ]=standard_inputs(o) ";
+                "dd=sz(1)/8,de=6*sz(1)/8";
+                "xstring(orig(1)+dd,y(1)-4,''D'')";
+                "xstring(orig(1)+dd,y(2)-4,''clk'')";
+                "xstring(orig(1)+dd,y(3)-4,''en'')";
+                "[x,y,typ]=standard_outputs(o) ";
+                "xstring(orig(1)+de,y(1)-4,''Q'')";
+                "xstring(orig(1)+5*dd,y(2)-4,''!Q'')"]
+                id=o.graphics.id
+                if id=="D FLIP-FLOP" then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of CLKGotoTagVisibility if needed
+            elseif o.gui=="CLKGotoTagVisibility" then
+                gr_i=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');";
+                "wd=xget(''wdim'').*[1.016,1.12];";
+                "thick=xget(''thickness'');xset(''thickness'',2);";
+                "p=wd(2)/wd(1);p=1;";
+                "xarcs([orig(1)+0.05*sz(1);";
+                "orig(2)+0.95*sz(2);";
+                "0.9*sz(1)*p;";
+                "0.9*sz(2);";
+                "0;";
+                "360*64],scs_color(5));";
+                "txt=[''Goto Tag'';''Visibility'' ];"
+                "style=5;"
+                "gh_axes = gca();"
+                "axes_font_style = gh_axes.font_style ;"
+                "axes_font_size  = gh_axes.font_size  ;"
+                "gh_axes.font_style = 5;"
+                "gh_axes.font_size  = 1;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-5,txt,w,h,''fill'');"
+                "gh_axes.font_style = axes_font_style ;"
+                "gh_axes.font_size  = axes_font_size  ;"
+                "xset(''thickness'',thick)"]
+                old_gri=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');";
+                "wd=xget(''wdim'').*[1.016,1.12];";
+                "thick=xget(''thickness'');xset(''thickness'',2);";
+                "p=wd(2)/wd(1);p=1;";
+                "xarcs([orig(1)+0.05*sz(1);";
+                "orig(2)+0.95*sz(2);";
+                "0.9*sz(1)*p;";
+                "0.9*sz(2);";
+                "0;";
+                "360*64],scs_color(5));";
+                "xset(''thickness'',thick)"]
+                id=o.graphics.id
+                if id==["Goto Tag";"Visibility"] then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of GotoTagVisibilityMO if needed
+            elseif o.gui=="GotoTagVisibilityMO" then
+                gr_i=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');";
+                "wd=xget(''wdim'').*[1.016,1.12];";
+                "thick=xget(''thickness'');xset(''thickness'',2);";
+                "p=wd(2)/wd(1);p=1;";
+                "xarcs([orig(1)+0.05*sz(1);";
+                "orig(2)+0.95*sz(2);";
+                "0.9*sz(1)*p;";
+                "0.9*sz(2);";
+                "0;";
+                "360*64],scs_color(3));";
+                "txt=[''Goto Tag'';''Visibility'' ];"
+                "style=5;"
+                "gh_axes = gca();"
+                "axes_font_style = gh_axes.font_style ;"
+                "axes_font_size  = gh_axes.font_size  ;"
+                "gh_axes.font_style = 5;"
+                "gh_axes.font_size  = 1;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-5,txt,w,h,''fill'');"
+                "gh_axes.font_style = axes_font_style ;"
+                "gh_axes.font_size  = axes_font_size  ;"
+                "xset(''thickness'',thick)"]
+                old_gri=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');";
+                "wd=xget(''wdim'').*[1.016,1.12];";
+                "thick=xget(''thickness'');xset(''thickness'',2);";
+                "p=wd(2)/wd(1);p=1;";
+                "xarcs([orig(1)+0.05*sz(1);";
+                "orig(2)+0.95*sz(2);";
+                "0.9*sz(1)*p;";
+                "0.9*sz(2);";
+                "0;";
+                "360*64],scs_color(3));";
+                "xset(''thickness'',thick)"]
+                id=o.graphics.id
+                if id==["Goto Tag";"Visibility"] then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of GotoTagVisibility if needed
+            elseif o.gui=="GotoTagVisibility" then
+                gr_i=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');"
+                "txt=[''Goto Tag'';''Visibility'' ];"
+                "style=5;"
+                "gh_axes = gca();"
+                "axes_font_style = gh_axes.font_style ;"
+                "axes_font_size  = gh_axes.font_size  ;"
+                "gh_axes.font_style = 5;"
+                "gh_axes.font_size  = 1;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-5,txt,w,h,''fill'');"
+                "gh_axes.font_style = axes_font_style ;"
+                "gh_axes.font_size  = axes_font_size  ;"]
+                old_gri=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');"]
+                id=o.graphics.id
+                if id==["Goto Tag";"Visibility"] then id="",end
+                scs_m_new.objs(j).graphics.id=id
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of Inductor if needed
+            elseif o.gui=="Inductor" then
+                gr_i=["tt=linspace(0.04,0.96,100)'';"
+                "xpoly(tt*sz(1)+orig(1),+orig(2)+abs(sin(18*(tt-0.04)))*sz(2),""lines"");";
+                "xx=orig(1)+[0 0.04 0.04 0.04 0]*sz(1);";
+                "yy=orig(2)+[1/2 1/2 0  1/2 1/2]*sz(2);";
+                "xpoly(xx,yy) ";
+                "xx=orig(1)+[0.96 0.96 1   0.96 0.96 ]*sz(1);";
+                "yy=orig(2)+[abs(sin(18*0.92))   1/2   1/2 1/2 abs(sin(18*0.92))]*sz(2);";
+                "xpoly(xx,yy) ";
+                "txt=''L= ''+L;"
+                "style=2;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"]
+                old_gri=["tt=linspace(0.04,0.96,100)'';"
+                "xpoly(tt*sz(1)+orig(1),+orig(2)+abs(sin(18*(tt-0.04)))*sz(2),""lines"");";
+                "xx=orig(1)+[0 0.04 0.04 0.04 0]*sz(1);";
+                "yy=orig(2)+[1/2 1/2 0  1/2 1/2]*sz(2);";
+                "xpoly(xx,yy) ";
+                "xx=orig(1)+[0.96 0.96 1   0.96 0.96 ]*sz(1);";
+                "yy=orig(2)+[abs(sin(18*0.92))   1/2   1/2 1/2 abs(sin(18*0.92))]*sz(2);";
+                "xpoly(xx,yy) ";
+                "rect=xstringl(0,0,''L=''+L)"
+                "xstring(orig(1)+(sz(1)-rect(3))/2,orig(2)-rect(4)*1.2,''L=''+L)"]
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of Capacitor if needed
+            elseif o.gui=="Capacitor" then
+                gr_i=["xset(''thickness'',2)"
+                "xx=orig(1)+[0 1/3 1/3 1/3 ]*sz(1);";
+                "yy=orig(2)+[1/2 1/2 1 0]*sz(2);";
+                "xpoly(xx,yy);"
+                "xsegs(orig(1)+ sz(1)*2/3*[1 1 1 3/2],orig(2)+(sz(2)*1/2)*[2 0 1 1],0);";
+                "if orient then"
+                "  xrects([orig(1)+sz(1)*1/2;orig(2)+sz(2);sz(1)*1/6;sz(2)],scs_color(33));"
+                "  xstring(orig(1)+sz(1)*1/12,orig(2)+sz(2)*3/4,''+'');";
+                "  xstring(orig(1)+sz(1)*7/8,orig(2)+sz(2)*3/4,''-'');";
+                "else"
+                "  xrects([orig(1)+sz(1)*1/3;orig(2)+sz(2);sz(1)*1/6;sz(2)],scs_color(33));"
+                "  xstring(orig(1)+sz(1)*1/12,orig(2)+sz(2)*3/4,''-'');";
+                "  xstring(orig(1)+sz(1)*7/8,orig(2)+sz(2)*3/4,''+'');";
+                "end"
+                "txt=''C= ''+C;"
+                "style=2;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"
+                "e.font_style=style;"]
+                old_gri=["xset(''thickness'',2)"
+                "xx=orig(1)+[0 1/3 1/3 1/3 ]*sz(1);";
+                "yy=orig(2)+[1/2 1/2 1 0]*sz(2);";
+                "xpoly(xx,yy);"
+                "xsegs(orig(1)+ sz(1)*2/3*[1 1 1 3/2],orig(2)+(sz(2)*1/2)*[2 0 1 1],0);";
+                "if orient then"
+                "  xrects([orig(1)+sz(1)*1/2;orig(2)+sz(2);sz(1)*1/6;sz(2)],scs_color(33));"
+                "  xstring(orig(1)+sz(1)*1/12,orig(2)+sz(2)*3/4,''+'');";
+                "  xstring(orig(1)+sz(1)*7/8,orig(2)+sz(2)*3/4,''-'');";
+                "else"
+                "  xrects([orig(1)+sz(1)*1/3;orig(2)+sz(2);sz(1)*1/6;sz(2)],scs_color(33));"
+                "  xstring(orig(1)+sz(1)*1/12,orig(2)+sz(2)*3/4,''-'');";
+                "  xstring(orig(1)+sz(1)*7/8,orig(2)+sz(2)*3/4,''+'');";
+                "end"
+                "rect=xstringl(0,0,''C=''+C)"
+                "xstring(orig(1)+(sz(1)-rect(3))/2,orig(2)-rect(4)*1.2,''C= ''+C);"]
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+                //@@ Change gr_i of Resistor if needed
+            elseif o.gui=="Resistor" then
+                gr_i=["xx=[0,1,1,7,7,8,7,7,1,1]/8;";
+                "yy=[1,1,0,0,1,1,1,2,2,1]/2;";
+                "xpoly(orig(1)+xx*sz(1),orig(2)+yy*sz(2)); "
+                "txt=''R= ''+R;"
+                "style=2;"
+                "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);"
+                "if ~exists(''%zoom'') then %zoom=1, end;"
+                "w=(rectstr(1,3)-rectstr(1,2))*%zoom;"
+                "h=(rectstr(2,2)-rectstr(2,4))*%zoom;"
+                "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');"
+                "e=gce();"]
+                old_gri=["xx=[0,1,1,7,7,8,7,7,1,1]/8;";
+                "yy=[1,1,0,0,1,1,1,2,2,1]/2;";
+                "xpoly(orig(1)+xx*sz(1),orig(2)+yy*sz(2)); "
+                "rect=xstringl(0,0,''R=''+R)"
+                "xstring(orig(1)+(sz(1)-rect(3))/2,orig(2)-rect(4)*1.2,''R=''+R);"]
+                if (type(scs_m_new.objs(j).graphics.gr_i)==15) then
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2))
+                    end
+                else
+                    if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then
+                        scs_m_new.objs(j).graphics.gr_i=gr_i
+                    end
+                end
+
+            end
+        end
+    end
+endfunction
+
+
+//*** update scope ***//
+function scs_m_new=do_version42(scs_m)
+    scs_m_new=scs_m
+    n=size(scs_m.objs);
+    for j=1:n //loop on objects
+        o=scs_m.objs(j);
+        if typeof(o)=="Block" then
+            omod=o.model;
+            //SUPER BLOCK
+            if omod.sim=="super"|omod.sim=="csuper" then
+                rpar=do_version42(omod.rpar)
+                scs_m_new.objs(j).model.rpar=rpar
+                //name of gui and sim list change
+            elseif o.gui=="SCOPE_f" then
+                scs_m_new.objs(j).gui="CSCOPE"
+                scs_m_new.objs(j).model.dstate=[]
+                //Alan's patch 01/10/07 : remove the last parameter
+                // (inheritance not used in cscope)
+                ipar = scs_m_new.objs(j).model.ipar(:);
+                scs_m_new.objs(j).model.ipar = ipar(1:$-1);
+                scs_m_new.objs(j).model.sim=list("cscope", 4)
+                in = scs_m_new.objs(j).model.in(:);
+                a = size(in,1);
+                in2 = ones(a,1);
+                scs_m_new.objs(j).model.in2 = in2;
+                scs_m_new.objs(j).model.intyp = in2;
+                //Alan's patch 04/10/07 : update exprs
+                exprs = scs_m.objs(j).graphics.exprs;
+                if size(exprs)<9 then exprs(9)="0",end // compatibility
+                if size(exprs)<10 then exprs(10)=emptystr(),end // compatibility
+                scs_m_new.objs(j).graphics.exprs=exprs;
+            elseif o.gui=="CSCOPE" then
+                //Alan's patch 04/10/07 : update exprs
+                exprs = scs_m.objs(j).graphics.exprs;
+                if size(exprs)<10 then exprs(10)=emptystr(),end // compatibility
+                scs_m_new.objs(j).graphics.exprs=exprs;
+            elseif o.gui=="BOUNCEXY" then
+                in = scs_m_new.objs(j).model.in(:);
+                a = size(in,1);
+                in2 = ones(a,1);
+                scs_m_new.objs(j).model.in2 = in2;
+                scs_m_new.objs(j).model.intyp = in2;
+            elseif o.gui=="MSCOPE_f" then
+                //Alan's patch 04/10/07 : update exprs
+                exprs = scs_m.objs(j).graphics.exprs;
+                if size(exprs)<10 then exprs(10)="0",end // compatibility
+                if size(exprs)<11 then exprs(11)=emptystr(),end // compatibility
+                scs_m_new.objs(j).graphics.exprs=exprs;
+                scs_m_new.objs(j).gui="CMSCOPE"
+                scs_m_new.objs(j).model.dstate=[]
+                scs_m_new.objs(j).model.sim=list("cmscope", 4)
+                in = scs_m_new.objs(j).model.in(:);
+                a = size(in,1);
+                B=stripblanks(scs_m.objs(j).graphics.exprs(8));
+                B(1:a)=B;
+                B = strcat(B', " ");
+                scs_m_new.objs(j).graphics.exprs(8) = B;
+                rpar=scs_m_new.objs(j).model.rpar(:);
+                N=scs_m_new.objs(j).model.ipar(2);
+                period = [];
+                for i=1:N
+                    period(i)=rpar(2);
+                end
+                scs_m_new.objs(j).model.rpar = [rpar(1);period(:);rpar(3:size(rpar,1))]
+                in2 = ones(a,1);
+                scs_m_new.objs(j).model.in2 = in2;
+                scs_m_new.objs(j).model.intyp = in2;
+            elseif o.gui=="ANIMXY_f" then
+                scs_m_new.objs(j).gui="CANIMXY"
+                scs_m_new.objs(j).model.dstate=[]
+                scs_m_new.objs(j).model.sim=list("canimxy", 4)
+                in = scs_m_new.objs(j).model.in(:);
+                a = size(in,1);
+                in2 = ones(a,1);
+                scs_m_new.objs(j).model.in2 = in2;
+                scs_m_new.objs(j).model.intyp = in2;
+                scs_m_new.objs(j).graphics.exprs = [string(1);scs_m_new.objs(j).graphics.exprs(:)]
+                scs_m_new.objs(j).model.ipar = [scs_m_new.objs(j).model.ipar(:);1]
+                //Alan's patch 04/10/07 : update exprs
+                exprs = scs_m_new.objs(j).graphics.exprs(:)
+                if size(exprs,"*")==8 then exprs=[1;exprs(1:3);"[]";"[]";exprs(4:8)],end
+                scs_m_new.objs(j).graphics.exprs=exprs;
+            elseif o.gui=="EVENTSCOPE_f" then
+                scs_m_new.objs(j).gui="CEVENTSCOPE"
+                scs_m_new.objs(j).model.dstate=[]
+                scs_m_new.objs(j).model.sim=list("cevscpe", 4)
+                in = scs_m_new.objs(j).model.in(:);
+                a = size(in,1);
+                in2 = ones(a,1);
+                scs_m_new.objs(j).model.in2 = in2;
+                scs_m_new.objs(j).model.intyp = in2;
+            elseif o.gui=="FSCOPE_f" then
+                scs_m_new.objs(j).gui="CFSCOPE"
+                scs_m_new.objs(j).model.dstate=[]
+                scs_m_new.objs(j).model.sim=list("cfscope", 4)
+                in = scs_m_new.objs(j).model.in(:);
+                a = size(in,1);
+                in2 = ones(a,1);
+                scs_m_new.objs(j).model.in2 = in2;
+                scs_m_new.objs(j).model.intyp = in2;
+                //Alan's patch 04/10/07 : update exprs
+                exprs = scs_m.objs(j).graphics.exprs;
+                if size(exprs)<9 then exprs(9)="0",end // compatibility
+                scs_m_new.objs(j).graphics.exprs=exprs;
+            elseif o.gui=="SCOPXY_f" then
+                scs_m_new.objs(j).gui="CSCOPXY"
+                scs_m_new.objs(j).model.dstate=[]
+                scs_m_new.objs(j).model.sim=list("cscopxy", 4)
+                in = scs_m_new.objs(j).model.in(:);
+                a = size(in,1);
+                in2 = ones(a,1);
+                scs_m_new.objs(j).model.in2 = in2;
+                scs_m_new.objs(j).model.intyp = in2;
+                scs_m_new.objs(j).graphics.exprs = [string(1);scs_m_new.objs(j).graphics.exprs(:)]
+                scs_m_new.objs(j).model.ipar = [scs_m_new.objs(j).model.ipar(:);1]
+            elseif o.gui=="CMSCOPE" then
+                //Alan's patch 04/10/07 : update exprs
+                exprs = scs_m.objs(j).graphics.exprs;
+                if size(exprs)<11 then exprs(11)=emptystr(),end // compatibility
+                scs_m_new.objs(j).graphics.exprs=exprs;
+                scs_m_new.objs(j).model.dstate=[]
+                in = scs_m_new.objs(j).model.in(:);
+                a = size(in,1);
+                B=stripblanks(scs_m.objs(j).graphics.exprs(8));
+                B(1:a)=B;
+                B = strcat(B', " ");
+                scs_m_new.objs(j).graphics.exprs(8)=B;
+                rpar=scs_m_new.objs(j).model.rpar(:);
+                N=scs_m_new.objs(j).model.ipar(2);
+                period = [];
+                for i=1:N
+                    period(i)=rpar(2);
+                end
+                scs_m_new.objs(j).model.rpar = [rpar(1);period(:);rpar(3:size(rpar,1))]
+                in2 = ones(a,1);
+                scs_m_new.objs(j).model.in2 = in2;
+                scs_m_new.objs(j).model.intyp = in2;
+            elseif o.gui=="IN_f" then
+                scs_m_new.objs(j).model.out    = -1;
+                scs_m_new.objs(j).model.out2   = -2;
+                scs_m_new.objs(j).model.outtyp = -1;
+            elseif o.gui=="OUT_f" then
+                scs_m_new.objs(j).model.in    = -1;
+                scs_m_new.objs(j).model.in2   = -2;
+                scs_m_new.objs(j).model.intyp = -1;
+            elseif o.gui=="INIMPL_f" then
+                scs_m_new.objs(j).model.out    = -1;
+                scs_m_new.objs(j).model.out2   = 1;
+                scs_m_new.objs(j).model.outtyp = -1;
+            elseif o.gui=="OUTIMPL_f" then
+                scs_m_new.objs(j).model.in    = -1;
+                scs_m_new.objs(j).model.in2   = 1;
+                scs_m_new.objs(j).model.intyp = -1;
+            end
+        end
+    end
+endfunction
+
+function scs_m_new=do_version273(scs_m)
+    scs_m_new=scs_m;
+    n=size(scs_m.objs);
+    for i=1:n //loop on objects
+        o=scs_m.objs(i);
+        if typeof(o)=="Block" then
+            omod=o.model;
+            T=getfield(1,omod)
+            if T($)<>"equations" then
+                T($+1)="equations"
+                setfield(1,T,omod)
+                setfield($+1,list(),omod)
+            end
+            if omod.sim=="super"|omod.sim=="csuper" then
+                rpar=do_version273(omod.rpar)
+                setfield($+1,getfield($,omod),omod)
+                setfield($-1,0,omod)
+                omod.rpar=rpar
+            elseif omod.sim(1)=="ifthel" then // |omod.sim(1)=='eselect' then
+                setfield($+1,getfield($,omod),omod)
+                setfield($-1,1,omod)
+                setfield($-2,1,omod)
+            else
+                setfield($+1,getfield($,omod),omod)
+                setfield($-1,0,omod)
+            end
+            xx=getfield(1,omod);
+            yy=xx($);
+            xx($)="nmode"
+            xx($+1)=yy;
+            setfield(1,xx,omod)
+            o.model= omod
+            scs_m_new.objs(i)=o
+        elseif typeof(o)=="Link" then
+            if size(o.from,"*")==2 then o.from(3)=0;end
+            if size(o.to,"*")==2 then o.to(3)=1;end
+            scs_m_new.objs(i)=o
+        end
+    end
+endfunction
+
+
+function scs_m_new=do_version272(scs_m)
+
+    scs_m_new=scs_m
+    for i=1:lstsize(scs_m.objs)
+
+        if typeof(scs_m.objs(i))=="Block" then
+            grphic=scs_m.objs(i).graphics
+            chmps=size(getfield(1,grphic))
+            if or(getfield(1,grphic)=="in_implicit")&..
+                size(grphic.in_implicit,"*")==size(grphic.pin,"*") then
+                in_implicit=grphic.in_implicit
+            else
+                I="E";
+                in_implicit=I(ones(grphic.pin(:)));
+            end
+
+            if or(getfield(1,grphic)=="out_implicit")&..
+                size(grphic.out_implicit,"*")==size(grphic.pout,"*") then
+                out_implicit=grphic.out_implicit
+            else
+                I="E";
+                out_implicit=I(ones(grphic.pout(:)));
+            end
+
+            scs_m_new.objs(i).graphics=mlist(["graphics","orig","sz","flip","exprs","pin",..
+            "pout","pein","peout","gr_i","id","in_implicit","out_implicit"],..
+            grphic.orig,grphic.sz,grphic.flip,grphic.exprs,grphic.pin,..
+            grphic.pout,grphic.pein,grphic.peout,grphic.gr_i,grphic.id,..
+            in_implicit,out_implicit)
+
+            if or(scs_m_new.objs(i).model.sim==["super","csuper"]) then
+                rpar=do_version272(scs_m_new.objs(i).model.rpar)
+                scs_m_new.objs(i).model.rpar=rpar
+            end
+        end
+    end
+endfunction
+
+function scs_m_new=do_version271(scs_m)
+    scs_m_new=scs_m;
+    n=size(scs_m.objs);
+    for i=1:n //loop on objects
+        o=scs_m.objs(i);
+        if typeof(o)=="Block" then
+            omod=o.model;
+            if omod.sim=="super"|omod.sim=="csuper" then
+                rpar=do_version271(omod.rpar)
+                setfield($+1,0,omod)
+                omod.rpar=rpar
+            elseif omod.sim=="zcross" then
+                setfield($+1,omod.in,omod)
+                omod.sim=list(omod.sim,1)
+            elseif omod.sim=="lusat" then
+                setfield($+1,2*omod.in,omod)
+                omod.sim=list(omod.sim,1)
+            else
+                setfield($+1,0,omod)
+            end
+            setfield(1,[getfield(1,omod),"nzcross"],omod)
+            o.model= omod
+            scs_m_new.objs(i)=o
+        end
+    end
+endfunction
+
+function scs_m=do_version251(scs_m)
+    nx=size(scs_m)
+    obsolete=%f
+    for k=2:nx
+        o=scs_m(k)
+        if o(1)=="Block" then
+            model=o(3)
+            if model(1)=="super"|model(1)=="csuper" then
+                model(8)=do_version251(model(8))
+                o(3)=model
+                scs_m(k)=o
+            elseif o(5)=="SOM_f" then
+                if and(model(8)==1) then
+                    model(8)=[]
+                    model(1)=list("plusblk",2)
+                    scs_m(k)(3)=model
+                    scs_m(k)(5)="SUM_f"
+                else
+                    scs_m(k)(3)(1)=list("sum",2)
+                    obsolete=%t
+                end
+            elseif o(5)=="AFFICH_f" then
+                scs_m(k)(3)(7)=[0;-1;0;0;1;1]
+                scs_m(k)(2)(9)=["xset(''font'',ipar(1),ipar(2))";
+                "str='' ''+part(''0'',ones(1,ipar(5)-ipar(6)-2))+''.''+part(''0'',ones(1,ipar(6)))"
+                "rr=xstringl(orig(1),orig(2),str)"
+                "xstring(orig(1)+max(0,(sz(1)-rr(3))/2),orig(2)+max(0,(sz(2)-rr(4))/2),str)"]
+            elseif o(5)=="c_block" then
+                model(1)(2)=model(1)(2)-int(model(1)(2)/1000)*1000+2000
+                scs_m(k)(3)=model
+                tt=scs_m(k)(2)(4)(2)
+                ii=grep(tt,"machine.h")
+                if size(ii,"*")==1 then
+                    tt(ii)="#include <machine.h>",
+                    scs_m(k)(2)(4)(2)=tt
+                end
+            end
+        elseif o(1)=="Link" then
+            if size(o(2),"*")==1 then
+                o(2)=o(2)*[1;1];o(3)=o(3)*[1;1];
+                scs_m(k)=o
+            end
+        end
+    end
+    if obsolete then
+        messagebox(["Diagram contains obsolete signed blocks sum"
+        "They are drawn in brown, they work as before but,"
+        "please replace them with the new block sum"],"modal")
+    end
+
+endfunction
+function scs_m=do_version231(scs_m)
+    //2.3.1 to 2.4 version
+    if size(scs_m(1))<5 then scs_m(1)(5)=" ",end  //compatibility
+    if type(scs_m(1)(5))<>10 then scs_m(1)(5)=" ",end //compatibility
+    if size(scs_m(1))<6 then //compatibility
+        wpar=scs_m(1)
+        wpar(6)=list()
+        wpar(7)=list(%t,[0.8 0.8 0.8])
+        wpar(8)=[]
+        wpar(9)=[]
+        wpar(10)=[]
+        scs_m(1)=wpar
+    end
+
+    if size(scs_m(1)(1),"*") <4 then scs_m(1)(1)=[scs_m(1)(1),0,0],end //compatibility
+
+
+    scs_m(1)(1)(2)=max(scs_m(1)(1)(2),450)
+    if size(scs_m(1))<6 then
+        options=default_options()
+        doc=list() //documentation structure
+        wpar=scs_m(1)
+        wpar(6)=list()
+        wpar(7)=options
+        wpar(8)=[]
+        wpar(9)=[]
+        wpar(10)=doc
+        scs_m(1)=wpar
+    end
+    wsiz=scs_m(1)(1)
+    if size(wsiz,"*")<6 then //compatibility
+        if size(wsiz,"*")<4 then wsiz(3)=0;wsiz(4)=0;end
+        wsiz(5)=wsiz(1);wsiz(6)=wsiz(2);
+        scs_m(1)(1)=wsiz;
+    end
+    if type(scs_m(1)(7))==15 then //options
+        old_opt=scs_m(1)(7)
+        options=default_options()
+        options("3D")(1)=old_opt(1)
+        options("Cmap")=old_opt(2)
+        scs_m(1)(7)=options
+    end
+
+    nx=size(scs_m)
+    for k=2:nx
+        o=scs_m(k)
+        if o(1)=="Block" then
+            model=o(3)
+            if model(1)=="super"|model(1)=="csuper" then
+                model(8)=do_version231(model(8))
+                o(3)=model
+                scs_m(k)=o
+            elseif model(1)(1)=="ifthel" then
+                model(1)=list("ifthel",-1)
+                scs_m(k)(3)=model
+            elseif model(1)(1)=="eselect" then
+                model(1)=list("eselect",-1)
+                scs_m(k)(3)=model
+            end
+        end
+    end
+
+
+endfunction
+function x_new=do_version23(scs_m)
+    //2.3 to 2.3.1
+    x_new=list()
+    x_new(1)=scs_m(1)
+    nx=size(scs_m)
+    for k=2:nx
+        o=scs_m(k)
+        if o(1)=="Link" then
+        elseif o(1)=="Block" then
+            model=o(3)
+            if model(1)=="super"|model(1)=="csuper" then
+                model(8)=do_version23(model(8))
+                o(3)=model
+                o=block2_version(o)
+                scs_m(k)=o
+            else
+                o=block2_version(o)
+            end
+        end
+        x_new(k)=o;
+    end
+
+
+endfunction
+function o=block2_version(o)
+    if o(3)(6)<>[] then o(3)(12)(2)=%t;end
+
+endfunction
+
+
+function o=block_version(o)
+    [graphics,model]=o(2:3)
+    for k=2:5, model(k)=ones(model(k),1),end
+    blocktype=o(5)
+    ok=%t
+    label=" "
+    gr_i=" "
+    select blocktype
+    case "ABSBLK_f" then
+        model(2)=-1
+        model(3)=-1
+        label=" "
+        gr_i="xstringb(orig(1),orig(2),''abs'',sz(1),sz(2),''fill'')"
+    case "ANIMXY_f" then
+        [rpar,ipar]=model([8:9])
+        model(9)=[model(9);0;[-1;-1];[-1;-1]]
+        win=ipar(1);N=ipar(3);clrs=ipar(4);siz=ipar(5)
+        xmin=rpar(1);xmax=rpar(2);ymin=rpar(3);ymax=rpar(4)
+        label=[string(clrs);
+        string(siz);
+        string(win);
+        "[]";
+        "[]";
+        string(xmin);
+        string(xmax);
+        string(ymin);
+        string(ymax);
+        string(N)]
+        gr_i=["thick=xget(''thickness'');xset(''thickness'',2);";
+        "t=(0:0.3:2*%pi)'';";
+        "xx=orig(1)+(1/5+(cos(2.2*t)+1)*3/10)*sz(1);";
+        "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);";
+        "xpoly(xx,yy,''lines'');"
+        "xset(''thickness'',thick);"]
+    case "BOUND_f" then
+        rpar=model(8);in=model(2);nin=sum(in)
+        if nin<>1 then
+            write(%io(2),["Pb with BOUND_f block";
+            "previously block has more than one input port";
+            "It is better to change it with the new block version";
+            "preceded by a multiplexer"])
+        end
+        thresh=rpar(1:nin),v=rpar(nin+1:2*nin)
+        label=[strcat(sci2exp(thresh));
+        strcat(sci2exp(v))]
+        gr_i=["thick=xget(''thickness'');xset(''thickness'',2);";
+        "xx=orig(1)+[1/5;1/2;1/2;1-1/5]*sz(1);";
+        "yy=orig(2)+[1/2;1/2;1-1/5;1-1/5]*sz(2);";
+        "xpoly(xx,yy,''lines'');";
+        "xset(''thickness'',1);";
+        "xpoly(orig(1)+[1/9;1/5]*sz(1),orig(2)+[1/2;1/2]*sz(2),''lines'');";
+        "xpoly(orig(1)+[1/2;1-1/9]*sz(1),orig(2)+[1/2;1/2]*sz(2),''lines'');";
+        "xpoly(orig(1)+[1/2;1/2]*sz(1),orig(2)+[1/9;1/2]*sz(2),''lines'');";
+        "xpoly(orig(1)+[1/2;1/2]*sz(1),orig(2)+[1-1/5;1-1/9]*sz(2),''lines'');";
+        "xset(''thickness'',thick);"]
+    case "CLINDUMMY_f" then
+        label=[]
+        gr_i=["xstringb(orig(1),orig(2),[''DUMMY'';''CLSS''],sz(1),sz(2),''fill'');"]
+    case "CLKIN_f" then
+        prt=model(9);
+        label=string(prt)
+        gr_i=[]
+    case "CLKOUT_f" then
+        prt=model(9);
+        label=string(prt)
+        gr_i=[]
+    case "CLKSPLIT_f" then
+        label=[]
+        gr_i=[]
+    case "CLKSOM_f" then
+        label=[]
+        gr_i=[]
+    case "CLOCK_f" then
+        orig=o(2)(1)
+        sz=o(2)(2)
+        oo=o(3)(8)
+        dt=0.1
+        for ko=2:size(oo)
+            if oo(ko)(3)(1)=="evtdly" then
+                dt=oo(ko)(3)(8)
+                break
+            end
+        end
+        o = list("Block",..
+        list([0,0],[2,2],%t,[],[],[],[],0,..
+        list(..
+        ["wd=xget(''wdim'').*[1.016,1.12];";
+        "thick=xget(''thickness'');xset(''thickness'',2);";
+        "p=wd(2)/wd(1);p=1;";
+        "rx=sz(1)*p/2;ry=sz(2)/2;";
+        "xarcs([orig(1)+0.05*sz(1);";
+        "orig(2)+0.95*sz(2);";
+        "   0.9*sz(1)*p;";
+        "   0.9*sz(2);";
+        "   0;";
+        "   360*64],scs_color(5));";
+        "xset(''thickness'',1);";
+        "xx=[orig(1)+rx    orig(1)+rx;";
+        "    orig(1)+rx    orig(1)+rx+0.6*rx*cos(%pi/6)];";
+        "yy=[orig(2)+ry    orig(2)+ry ;";
+        "  orig(2)+1.8*ry  orig(2)+ry+0.6*ry*sin(%pi/6)];";
+        "xsegs(xx,yy,scs_color(10));";
+        "xset(''thickness'',thick);"],[])),..
+        list("csuper",[],[],[],1,[]," ",..
+        list(list([600,400,0,0],"foo",[],[]),..
+        list("Block",list([399,162],[20,20],%t,"1",[],[],6,[],[]),..
+        list("output",[],[],1,[],[],[],[],1,"d",[],[%f,%f]," ",list())," ","CLKOUT_f"),..
+        list("Block",list([320,232],[40,40],%t,["0.1";"0.1"],[],[],7,4,..
+        ["dt=model(8);";
+        "txt=[''Delay'';string(dt)];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]),..
+        list("evtdly",[],[],1,1,[],[],0.1,[],"d",0.1,[%f,%f]," ",list())," ","EVTDLY_f"),..
+        list("Link",[340;340;380.71066],[226.28571;172;172],"drawlink"," ",[0,0],[5,-1],[3,1],..
+        [5,1]),..
+        list("Block",list([380.71066;172],[1,1],%t," ",[],[],4,[6;7]),..
+        list("lsplit",[],[],1,[1;1],[],[],[],[],"d",[-1,-1],[%t,%f]," ",list())," ","CLKSPLIT_f"),..
+        list("Link",[380.71066;399],[172;172],"drawlink"," ",[0,0],[5,-1],[5,1],[2,1]),..
+        list("Link",[380.71066;380.71066;340;340],[172;301.9943;301.9943;277.71429],"drawlink"," ",..
+        [0,0],[5,-1],[5,2],[3,1])),[],"h",[],[%f,%f])," ","CLOCK_f")
+
+        o(2)(1)=orig
+        o(2)(2)=sz
+        xx=o(3)(8)(3)
+        xx(2)(4)=string([dt;dt])
+        xx(3)(11)=dt
+        xx(3)(8)=dt
+        o(3)(8)(3)=xx
+        model=o(3)
+    else
+        ok=%f
+    end
+
+    if ok then
+        graphics(4)=label
+        graphics(9)=gr_i
+        o(2)=graphics
+        model(13)=" ";model(14)=list()
+        o(3)=model
+        o=replace_firing(o)
+        return
+    end
+
+    ok=%t
+    select blocktype
+    case "CLR_f" then
+        ipar=model(9);model(9)=[]
+        ns=size(model(6),"*");nin=1;nout=1;
+        rpar=model(8);
+        A=matrix(rpar(1:ns*ns),ns,ns);
+        B=matrix(rpar(ns*ns+1:ns*(ns+nin)),ns,nin);
+        C=matrix(rpar(ns*(ns+nin)+1:ns*(ns+nin+nout)),nout,ns);
+        D=rpar(ns*(ns+nin+nout)+1);
+        H=ss2tf(syslin("c",A,B,C,D));
+        H=clean(H);
+        if type(H)==16 then
+            num=H(2);den=H(3)
+        else
+            num=H,den=1
+        end
+        label=[sci2exp(num);sci2exp(den)]
+        gr_i=["xstringb(orig(1),orig(2),[''Num(s)'';''-----'';''Den(s)''],sz(1),sz(2),''fill'');"]
+    case "CLSS_f" then
+        in=model(2);out=model(3)
+        nin=sum(in)
+        nout=sum(out)
+        x0=model(6),
+        rpar=model(8)
+        ns=prod(size(x0))
+        A=matrix(rpar(1:ns*ns),ns,ns)
+        B=matrix(rpar(ns*ns+1:ns*(ns+nin)),ns,nin)
+        C=matrix(rpar(ns*(ns+nin)+1:ns*(ns+nin+nout)),nout,ns)
+        D=matrix(rpar(ns*(ns+nin+nout)+1:ns*(ns+nin+nout)+(nin*nout)),nout,nin)
+        label=[  strcat(sci2exp(A));
+        strcat(sci2exp(B));
+        strcat(sci2exp(C));
+        strcat(sci2exp(D));
+        strcat(sci2exp(x0))]
+        gr_i=["txt=[''xd=Ax+Bu'';''y=Cx+Du''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+        model(2)=nin;model(3)=nout
+    case "CONST_f" then
+        C=model(8);model(3)=sum(model(3))
+        label=[strcat(sci2exp(C))]
+        gr_i=["model=arg1(3);C=model(8);";
+        "dx=sz(1)/5;dy=sz(2)/10;";
+        "w=sz(1)-2*dx;h=sz(2)-2*dy;";
+        "xstringb(orig(1)+dx,orig(2)+dy,string(C),w,h,''fill'');"]
+    case "COSBLK_f" then
+        in=model(2);nin=sum(in)
+        if nin<>1 then
+            write(%io(2),["Pb with COSBLK_f block";
+            "previously block has more than one input port";
+            "It is better to change it with the new block version";
+            "preceded by a multiplexer and followed by a demultiplxer"])
+        end
+        label=" "
+        gr_i=["xstringb(orig(1),orig(2),[''cos''],sz(1),sz(2),''fill'');"]
+    case "CURV_f" then
+        label=[]
+        gr_i=["model=arg1(3);rpar=model(8);ipar=model(9);n=ipar(1);";
+        "thick=xget(''thickness'');xset(''thickness'',2);";
+        "xx=rpar(1:n);yy=rpar(n+1:2*n);";
+        "rect=rpar(2*n+1:2*n+4);";
+        "mxx=rect(3)-rect(1);";
+        "mxy=rect(4)-rect(2);";
+        "xx=orig(1)+sz(1)*(1/10+(4/5)*((xx-rect(1))/mxx));";
+        "yy=orig(2)+sz(2)*(1/10+(4/5)*((yy-rect(2))/mxy));";
+        "xpoly(xx,yy,''lines'');";
+        "xset(''thickness'',thick);"]
+    case "DELAY_f" then
+        orig=o(2)(1)
+        sz=o(2)(2)
+        oo=o(3)(8)
+        dt=[];z0=[]
+        for ko=2:size(oo)
+            if oo(ko)(3)(1)=="evtdly" then
+                dt=oo(ko)(3)(8)
+            elseif oo(ko)(3)(1)=="register" then
+                z0=oo(ko)(3)(7)
+            end
+        end
+        if dt==[]|z0==[] then
+            write(%io(2), "Pb with DELAY_f block dt or z0 not found")
+            pause
+        end
+        o=DELAY_f("define")
+        o(2)(1)=orig
+        o(2)(2)=sz
+        o(3)(8)(4)(2)(4)=sci2exp(z0)
+        o(3)(8)(5)(2)(4)=sci2exp(dt)
+        o(3)(8)(5)(3)(8)=dt
+        o(3)(8)(5)(3)(11)=0
+        o(3)(8)(4)(3)(7)=z0(:)
+        model=o(3)
+        label=[]
+        gr_i=["b1=xstringl(0,0,''e'');";
+        "b2=xstringl(0,0,''-Ts'');";
+        "h=-b1(2)+max(0,sz(2)-0.5*b1(4)+b2(4))/2;";
+        "w=max(0,sz(1)-b1(3)-b1(4))/2;";
+        "xstring(orig(1)+w,orig(2)+h,''e'');";
+        "xstring(orig(1)+w+b1(3)/2,orig(2)+h+b1(4)*0.5,''-Ts'');"]
+    case "DLRADAPT_f" then
+        [dstate,rpar,ipar]=model(7:9)
+        m=ipar(1);
+        n=ipar(2)
+        npt=ipar(3)
+        p=rpar(1:npt)
+
+        rn=matrix(rpar(npt+1:npt+m*npt)+%i*rpar(npt+m*npt+1:npt+2*m*npt),npt,m)
+        rd=matrix(rpar(npt+2*m*npt+1:npt+(2*m+n)*npt)+..
+        %i*rpar(npt+(2*m+n)*npt+1:npt+2*(m+n)*npt),npt,n)
+        g=rpar(npt+2*(m+n)*npt+1:npt+2*(m+n)*npt+npt)
+        last_u=dstate(1:m);last_y=dstate(m+1:m+n)
+        label=[sci2exp(p);
+        sci2exp(rn);
+        sci2exp(rd);
+        sci2exp(g);
+        sci2exp(last_u);
+        sci2exp(last_y)]
+        gr_i=["txt=[''N(z,p)'';''-----'';''D(z,p)''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+    case "DLR_f" then
+        model(9)=[];model(10)="d"
+        ns=size(model(7),"*");nin=1;nout=1;
+        rpar=model(8);
+        A=matrix(rpar(1:ns*ns),ns,ns);
+        B=matrix(rpar(ns*ns+1:ns*(ns+nin)),ns,nin);
+        C=matrix(rpar(ns*(ns+nin)+1:ns*(ns+nin+nout)),nout,ns);
+        D=rpar(ns*(ns+nin+nout)+1);
+        H=ss2tf(syslin("d",A,B,C,D));
+        H=clean(H);
+        if type(H)==16 then
+            num=H(2);den=H(3)
+        else
+            num=H,den=1
+        end
+        label=[sci2exp(num);sci2exp(den)]
+        gr_i=["txt=[''Num(z)'';''-----'';''Den(z)''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+    case "DLSS_f" then
+        in=model(2);out=model(3)
+        nin=sum(in)
+        nout=sum(out)
+        x0=model(6),rpar=model(8)
+        ns=prod(size(x0))
+        A=matrix(rpar(1:ns*ns),ns,ns)
+        B=matrix(rpar(ns*ns+1:ns*(ns+nin)),ns,nin)
+        C=matrix(rpar(ns*(ns+nin)+1:ns*(ns+nin+nout)),nout,ns)
+        D=matrix(rpar(ns*(ns+nin+nout)+1:ns*(ns+nin+nout)+(nin*nout)),nout,nin)
+
+        label=[  strcat(sci2exp(A));
+        strcat(sci2exp(B));
+        strcat(sci2exp(C));
+        strcat(sci2exp(D));
+        strcat(sci2exp(x0))]
+        gr_i=["txt=[''x+=Ax+Bu'';''y=Cx+Du''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+    case "EVENTSCOPE_f" then
+        [nclock,rpar,ipar]=model([4 8 9])
+        win=ipar(1);
+        per=rpar(1);
+        wdim=[-1;-1]
+        wpos=[-1;-1]
+        clrs=[1;3;5;7;9;11;13;15];
+        model(9)=[win;1;clrs;wpos(:);wdim(:)]
+        label=[sci2exp(nclock);
+        strcat(sci2exp(clrs)," ");
+        string(win);
+        sci2exp([]);
+        sci2exp([]);
+        string(per)]
+        gr_i=["thick=xget(''thickness'');xset(''thickness'',2);";
+        "xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);";
+        "xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;";
+        "orig(1)+(1-1/5)*sz(1),orig(1)+sz(1)/5];";
+        "yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;";
+        "orig(2)+sz(2)/5,orig(2)+(1-1/5)*sz(2)];";
+        "xarrows(xx,yy);";
+        "t=(0:0.3:2*%pi)'';";
+        "xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);";
+        "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);";
+        "xpoly(xx,yy,''lines'');";
+        "xset(''thickness'',thick);"]
+    case "EVTDLY_f" then
+        dt=model(8);
+        if model(11) then ff=0; else ff=-1; end
+        model(11)=ff
+        label=[string(dt);string(ff)]
+        gr_i=["dt=model(8);";
+        "txt=[''Delay'';string(dt)];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+    case "EVTGEN_f" then
+        tt=model(11);
+        label=string(tt)
+        gr_i=["xstringb(orig(1),orig(2),''Event'',sz(1),sz(2),''fill'');"]
+    case "FOR_f" then
+        write(%io(2),"FOR block nor more exist")
+    else
+        ok=%f
+    end
+    if ok then
+        graphics(4)=label
+        graphics(9)=gr_i
+        o(2)=graphics
+        model(13)=" ";model(14)=list()
+        o(3)=model
+        o=replace_firing(o)
+        return
+    end
+    ok=%t
+    select blocktype
+    case "GAIN_f" then
+        [in,out]=model(2:3)
+        gain=matrix(model(8),out,in)
+        label=[strcat(sci2exp(gain))]
+        gr_i=["[nin,nout]=model(2:3);";
+        "if nin*nout==1 then gain=string(model(8)),else gain=''Gain'',end";
+        "dx=sz(1)/5;";
+        "dy=sz(2)/10;";
+        "xx=orig(1)+      [1 4 1 1]*dx;";
+        "yy=orig(2)+sz(2)-[1 5 9 1]*dy;";
+        "xpoly(xx,yy,''lines'');";
+        "w=sz(1)-2*dx;h=sz(2)-2*dy;";
+        "xstringb(orig(1)+dx,orig(2)+dy,gain,w,h,''fill'');"]
+    case "GENERAL_f" then
+        in=model(2);out=model(5)
+        label=[strcat(sci2exp(in));strcat(sci2exp(out))]
+        gr_i=["xstringb(orig(1),orig(2),''GENERAL'',sz(1),sz(2),''fill'');"]
+    case "GENSIN_f" then
+        rpar=model(8)
+        label=[string(rpar(1));string(rpar(2));string(rpar(3))]
+        gr_i=["txt=[''sinusoid'';''generator''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+    case "GENSQR_f" then
+        //rpar=model(8); ?
+        Amplitude=model(7)
+        label=string(Amplitude)
+        gr_i=["txt=[''square wave'';''generator''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+    case "HALT_f" then
+        n=model(9);
+        label=string(n)
+        gr_i=["xstringb(orig(1),orig(2),''STOP'',sz(1),sz(2),''fill'');"]
+    case "IFTHEL_f" then
+        label=[]
+        model(11)=[-1,-1]
+        gr_i=["txt=[''If in>=0'';'' '';'' then    else''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+    case "INTEGRAL_f" then
+        x0=model(6);
+        label=strcat(sci2exp(x0))
+        gr_i=["xstringb(orig(1),orig(2),''  1/s  '',sz(1),sz(2),''fill'');"]
+    case "INVBLK_f" then
+        model(2)=-1;model(3)=-1
+        label=" "
+        gr_i=["xstringb(orig(1),orig(2),''1/u'',sz(1),sz(2),''fill'');"]
+    case "IN_f" then
+        prt=model(9);
+        label=[string(prt)]
+        model(3)=-1
+        gr_i=[]
+    case "LOGBLK_f" then
+        a=model(8)
+        in=model(2)
+        label=[string(a)]
+        model(2)=-1;model(3)=-1
+        gr_i=["xstringb(orig(1),orig(2),''log'',sz(1),sz(2),''fill'');"]
+    case "LOOKUP_f" then
+        model(10)="c"
+        gr_i=["rpar=model(8);n=size(rpar,''*'')/2;";
+        "thick=xget(''thickness'');xset(''thickness'',2);";
+        "xx=rpar(1:n);yy=rpar(n+1:2*n);";
+        "mnx=min(xx);xx=xx-mnx*ones(xx);mxx=max(xx);";
+        "xx=orig(1)+sz(1)*(1/10+(4/5)*xx/mxx);";
+        "mnx=min(yy);yy=yy-mnx*ones(yy);mxx=max(yy);";
+        "yy=orig(2)+sz(2)*(1/10+(4/5)*yy/mxx);";
+        "xpoly(xx,yy,''lines'');";
+        "xset(''thickness'',thick);"]
+        label=[]
+    case "MAX_f" then
+        in=model(2);nin=sum(in)
+        if nin<>1 then
+            write(%io(2),["Pb with MAX_f block";
+            "previously block has more than one input port";
+            "It is better to change it with the new block version";
+            "preceded by a multiplexer"])
+        end
+        label=" "
+        gr_i=["xstringb(orig(1),orig(2),''Max'',sz(1),sz(2),''fill'');"]
+    case "MCLOCK_f" then
+        label=[]
+        gr_i=["txt=[''2freq clock'';''  f/n     f''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"]
+    case "MFCLCK_f" then
+        dt=model(8)
+        nn=model(9)
+        label=[string(dt);string(nn)]
+        gr_i=["txt=[''M. freq'';''clock''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"]
+    case "MIN_f" then
+        in=model(2);nin=sum(in)
+        if nin<>1 then
+            write(%io(2),["Pb with MIN_f block";
+            "previously block has more than one input port";
+            "It is better to change it with the new block version";
+            "preceded by a multiplexer"])
+        end
+        label=" "
+        gr_i=["xstringb(orig(1),orig(2),''MIN'',sz(1),sz(2),''fill'')"]
+    case "NEGTOPOS_f" then
+        label=[]
+        gr_i=["xstringb(orig(1),orig(2),'' - to + '',sz(1),sz(2),''fill'');"]
+    case "OUT_f" then
+        prt=model(9);
+        model(2)=-1
+        label=[string(prt)]
+        gr_i=[]
+    case "POSTONEG_f" then
+        label=[]
+        gr_i=["xstringb(orig(1),orig(2),'' + to - '',sz(1),sz(2),''fill'')"]
+    case "POWBLK_f" then
+        in=model(2);nin=sum(in)
+        if nin<>1 then
+            write(%io(2),["Pb with MIN_f block";
+            "previously block has more than one input port";
+            "It is better to change it with the new block version";
+            "preceded by a multiplexer and followed by a demux"])
+        end
+        if model(8)<>[] then
+            a=model(8)
+        else
+            a=model(9)
+        end
+        in=model(2)
+        label=[string(a)]
+        gr_i=["xstringb(orig(1),orig(2),''u^a'',sz(1),sz(2),''fill'');"]
+    case "PROD_f" then
+        label=[]
+        gr_i=[]
+        model(1)=list("prod",2)
+    case "QUANT_f" then
+        rpar=model(8);ipar=model(9);
+        pas=rpar(1)
+        meth=ipar
+        label=[string(pas);string(meth)]
+        gr_i=["thick=xget(''thickness'');xset(''thickness'',2);";
+        "xx=orig(1)+[1;2;2;3;3;4;4]/5*sz(1);";
+        "yy= orig(2)+[1;1;2;2;3;3;4]/5*sz(2);";
+        "xpoly(xx,yy,''lines'');";
+        "xset(''thickness'',thick);"]
+    case "RAND_f" then
+        rpar=model(8);flag=model(9);
+        out=model(3);nout=sum(out)
+        if nout<>1 then
+            write(%io(2),["Pb with RAND_f block";
+            "previously block has more than one output port";
+            "It is better to change it with the new block version";
+            " followed by a demux"])
+        end
+
+        a=rpar(1:nout)
+        b=rpar(nout+1:2*nout)
+        label=[string(flag);sci2exp(a(:));sci2exp(b(:))]
+        gr_i=["txt=[''random'';''generator''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"]
+    case "REGISTER_f" then
+        z0=model(7)
+        label=strcat(string(z0),";")
+
+        gr_i=["dly=model(8);";
+        "txt=[''Shift'';''Register'';string(dly)];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"]
+    else
+        ok=%f
+    end
+    if ok then
+        graphics(4)=label
+        graphics(9)=gr_i
+        o(2)=graphics
+        model(13)=" ";model(14)=list()
+        o(3)=model
+        o=replace_firing(o)
+        return
+    end
+    ok=%t
+    select blocktype
+    case "RFILE_f" then
+        [out,state,ipar]=model([3 7 9])
+        nout=sum(out)
+        ievt=ipar(3);N=ipar(4);
+        imask=5+ipar(1)+ipar(2)
+        if ievt<>0 then tmask=ipar(imask),else tmask=[],end
+        outmask=ipar(imask+ievt:imask+nout+ievt-1)
+        lunit=state(2)
+        ievt=ipar(3);N=ipar(4);
+        imask=5+ipar(1)+ipar(2)
+        if ievt<>0 then tmask=ipar(imask),else tmask=[],end
+        outmask=ipar(imask+ievt:imask+nout+ievt-1)
+        lfil=ipar(1)
+        lfmt=ipar(2)
+        if lfil>0 then fname=_code2str(ipar(5:4+lfil)),else fname=" ",end
+        if lfmt>0 then Fmt=_code2str(ipar(5+lfil:4+lfil+lfmt)),else Fmt=" ",end
+        label=[ sci2exp(tmask);
+        sci2exp(outmask);
+        fname;
+        Fmt;
+        string(N);
+        sci2exp(out)]
+        gr_i=["txt=[''read from'';''input file''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"]
+    case "SAT_f" then
+        rpar=model(8)
+        minp=rpar(1),maxp=rpar(2),pente=rpar(3)
+        label=[string(minp);string(maxp);string(pente)]
+
+        gr_i=["thick=xget(''thickness'');xset(''thickness'',2);";
+        "xx=orig(1)+[4/5;1/2+1/5;1/2-1/5;1/5]*sz(1);";
+        "yy=orig(2)+[1-1/5;1-1/5;1/5;1/5]*sz(2);";
+        "xpoly(xx,yy,''lines'');";
+        "xset(''thickness'',thick)"]
+    case "SAWTOOTH_f" then
+        model(10)="c"
+        gr_i=["txt=[''sawtooth'';''generator''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+    case "SCOPE_f" then
+        [in,rpar,ipar]=model([2 8 9])
+        in=model(2);nin=sum(in)
+        if nin<>1 then
+            write(%io(2),["Pb with SCOPE_f block";
+            "previously block has more than one input port";
+            "It is better to change it with the new block version";
+            "preceded by a multiplexer"])
+        end
+        win=ipar(1);N=ipar(3);
+        clrs=-ipar(4:nin+3)
+        if size(clrs,"*")<8 then clrs(8)=1;end
+
+        wdim=[-1;-1]
+        wpos=[-1;-1]
+        model(9)=[win;1;N;clrs;wpos(:);wdim(:)]
+        dt=rpar(1);ymin=rpar(2);ymax=rpar(3);per=rpar(4)
+        label=[strcat(string(clrs)," ");
+        string(win);
+        sci2exp([]);
+        sci2exp([]);
+        string(ymin);
+        string(ymax);
+        string(per);
+        string(N)];
+
+        gr_i=["thick=xget(''thickness'');xset(''thickness'',2);";
+        "xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);";
+        "xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;";
+        "orig(1)+(1-1/5)*sz(1),orig(1)+sz(1)/5];";
+        "yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;";
+        "orig(2)+sz(2)/5,orig(2)+(1-1/5)*sz(2)];";
+        "xarrows(xx,yy);";
+        "t=(0:0.3:2*%pi)'';";
+        "xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);";
+        "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);";
+        "xpoly(xx,yy,''lines'');";
+        "xset(''thickness'',thick)"]
+    case "SCOPXY_f" then
+        [rpar,ipar]=model(8:9)
+        win=ipar(1);N=ipar(3);clrs=-ipar(4);siz=ipar(5)
+        xmin=rpar(1);xmax=rpar(2);ymin=rpar(3);ymax=rpar(4)
+        wdim=[-1;-1]
+        wpos=[-1;-1]
+        label=[sci2exp(clrs);
+        sci2exp(siz);
+        string(win);
+        sci2exp([]);
+        sci2exp([]);
+        string(xmin);
+        string(xmax);
+        string(ymin);
+        string(ymax);
+        string(N)];
+        model(9)=[win;1;N;clrs;siz;1;wpos(:);wdim(:)]
+        gr_i=["thick=xget(''thickness'');xset(''thickness'',2);";
+        "t=(0:0.2:2*%pi)'';";
+        "xx=orig(1)+(1/5+(cos(3*t)+1)*3/10)*sz(1);";
+        "yy=orig(2)+(1/4.3+(sin(t+1)+1)*3/10)*sz(2);";
+        "xpoly(xx,yy,''lines'');";
+        "xset(''thickness'',thick)"]
+    case "SELECT_f" then
+        z0=model(7);nin=size(model(2),1);
+        label=[string(nin);string(z0-1)]
+        model(1)=list("selector",2)
+        gr_i=["xstringb(orig(1),orig(2),''Selector'',sz(1),sz(2),''fill'');"]
+    case "SINBLK_f" then
+        in=model(2);nin=sum(in)
+        if nin<>1 then
+            write(%io(2),["Pb with MIN_f block";
+            "previously block has more than one input port";
+            "It is better to change it with the new block version";
+            "preceded by a multiplexer and followed by a demux"])
+        end
+        label=" "
+        gr_i=["xstringb(orig(1),orig(2),''sin'',sz(1),sz(2),''fill'')"]
+    case "SOM_f" then
+        sgn=model(8);
+        label=sci2exp(sgn)
+        model(1)=list("sum",2)
+        gr_i=[]
+    case "SPLIT_f" then
+        label=[]
+        gr_i=[]
+    case "SUPER_f" then
+        label=[]
+        gr_i=["thick=xget(''thickness'');xset(''thickness'',2);";
+        "xx=orig(1)+      [2 4 4]*(sz(1)/7);";
+        "yy=orig(2)+sz(2)-[2 2 6]*(sz(2)/10);";
+        "xrects([xx;yy;[sz(1)/7;sz(2)/5]*ones(1,3)]);";
+        "xx=orig(1)+      [1 2 3 4 5 6 3.5 3.5 3.5 4 5 5.5 5.5 5.5]*sz(1)/7;";
+        "yy=orig(2)+sz(2)-[3 3 3 3 3 3 3   7   7   7 7 7   7   3  ]*sz(2)/10;";
+        "xsegs(xx,yy,0);";
+        "xset(''thickness'',thick)"]
+    case "TANBLK_f" then
+        in=model(2);nin=sum(in)
+        if nin<>1 then
+            write(%io(2),["Pb with TANBLK_f block";
+            "previously block has more than one input port";
+            "It is better to change it with the new block version";
+            "preceded by a multiplexer and followed by a demux"])
+        end
+        label=" "
+        gr_i=["xstringb(orig(1),orig(2),''tan'',sz(1),sz(2),''fill'');"]
+    case "TCLSS_f" then
+        in=model(2);nin=sum(in)
+        out=model(3);nout=sum(out)
+        x0=model(6),rpar=model(8)
+
+        ns=prod(size(x0));nin=nin-ns
+        A=matrix(rpar(1:ns*ns),ns,ns)
+        B=matrix(rpar(ns*ns+1:ns*(ns+nin)),ns,nin)
+        C=matrix(rpar(ns*(ns+nin)+1:ns*(ns+nin+nout)),nout,ns)
+        D=matrix(rpar(ns*(ns+nin+nout)+1:ns*(ns+nin+nout)+(nin*nout)),nout,nin)
+        nin1=nin;nout1=nout
+
+        label=[strcat(sci2exp(A));
+        strcat(sci2exp(B));
+        strcat(sci2exp(C));
+        strcat(sci2exp(D));
+        strcat(sci2exp(x0))]
+        gr_i=["txt=[''Jump'';''(A,B,C,D)''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"]
+    else
+        ok=%f
+    end
+    if ok then
+        graphics(4)=label
+        graphics(9)=gr_i
+        o(2)=graphics
+        model(13)=" "
+        model(14)=list()
+        o(3)=model
+        o=replace_firing(o)
+        return
+    end
+    ok=%t
+    select blocktype
+    case "TEXT_f" then
+        ipar=model(9)
+        font=ipar(1);siz=ipar(2)
+        label=[graphics(4);string(font);string(siz)]
+        gr_i=[]
+    case "TIME_f" then
+        label=[]
+        gr_i=["wd=xget(''wdim'').*[1.016,1.12];";
+        "thick=xget(''thickness'');xset(''thickness'',2);";
+        "p=wd(2)/wd(1);p=1;";
+        "rx=sz(1)*p/2;ry=sz(2)/2;";
+        "xarc(orig(1)+0.05*sz(1),orig(2)+0.95*sz(2),0.9*sz(1)*p,0.9*sz(2),0,360*64);";
+        "xset(''thickness'',1);";
+        "xx=[orig(1)+rx    orig(1)+rx;";
+        "orig(1)+rx    orig(1)+rx+0.6*rx*cos(%pi/6)];";
+        "yy=[orig(2)+ry    orig(2)+ry ;";
+        "     orig(2)+1.8*ry  orig(2)+ry+0.6*ry*sin(%pi/6)];";
+        "xsegs(xx,yy,0);";
+        "xset(''thickness'',thick);"]
+    case "TRASH_f" then
+        in=model(2);nin=sum(in)
+        if nin<>1 then
+            write(%io(2),["Pb with MIN_f block";
+            "previously block has more than one input port";
+            "It is better to change it with the new block version";
+            "preceded by a multiplexer"])
+        end
+        label=" "
+        gr_i=["xstringb(orig(1),orig(2),''Trash'',sz(1),sz(2),''fill'')"]
+    case "WFILE_f" then
+        state=model(7)
+        [in,ipar]=model([2  9])
+        N=ipar(3);
+        lunit=state(2)
+        N=ipar(4)
+        lfil=ipar(1)
+        lfmt=ipar(2)
+        if lfil>0 then fname=_code2str(ipar(5:4+lfil)),else fname=" ",end
+        if lfmt>0 then Fmt=_code2str(ipar(5+lfil:4+lfil+lfmt)),else Fmt=" ",end
+        label=[sci2exp(in);
+        fname;
+        Fmt;
+        string(N)]
+
+        gr_i=["txt=[''write to'';''output file''];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"]
+    case "ZCROSS_f" then
+        in=model(2)
+        label=strcat(sci2exp(in))
+        gr_i=["xstringb(orig(1),orig(2),''Zcross'',sz(1),sz(2),''fill'');"]
+    case "func_block" then
+        write(%io(2),["PB with func_block";
+        "version change is not implemented"])
+        label=[]
+        gr_i=["xstringb(orig(1),orig(2),''Func'',sz(1),sz(2),''fill'');"]
+    case "m_sin" then
+        rpar=model(8);gain=rpar(1);phase=rpar(2)
+        label=[string(gain);string(phase)]
+        gr_i=[]
+    case "sci_block" then
+        write(%io(2),["PB with sci_block";
+        "version change is not implemented"])
+        label=[]
+        gr_i=["xstringb(orig(1),orig(2),''Sci_Block'',sz(1),sz(2),''fill'');"]
+    case "scifunc_block" then
+        write(%io(2),["PB with scifunc_block";
+        "version change is not implemented"])
+        i1=model(2);o1=model(3);ci1=model(4);co1=model(5);x1=model(6);
+        z1=model(7);auto1=model(11);type_1=model(10);
+        tt=model(9),rpar=model(8)
+        label=list([sci2exp(i1);sci2exp(o1);sci2exp(ci1);sci2exp(co1);
+        strcat(sci2exp(x1));strcat(sci2exp(z1));type_1;
+        strcat(sci2exp(rpar));sci2exp(auto1)],tt)
+
+        gr_i=["xstringb(orig(1),orig(2),''Scifunc'',sz(1),sz(2),''fill'');"]
+    case "standard_block" then
+        write(%io(2),["PB with standard_block";
+        "version change is not implemented"])
+        label=[]
+        gr_i=[]
+    else
+        disp(blocktype+" unknown, parameters values may be lost, please check")
+        label=[]
+        gr_i=[]
+    end
+    graphics(4)=label
+    graphics(9)=gr_i
+    o(2)=graphics
+    model(13)=" "
+    model(14)=list()
+    o(3)=model
+    o=replace_firing(o)
+
+endfunction
+
+function o=replace_firing(o)
+    firing=o(3)(11)
+    cout=o(3)(5)
+    if firing==%f|firing==0 then
+        o(3)(11)=-ones(cout)
+        //disp('firing changed from %f to '+sci2exp(o(3)(11))+' in '+o(3)(1)(1))
+    elseif firing==%t|firing==1  then
+        o(3)(11)=0*cout
+        //disp('firing changed from %t to '+sci2exp(o(3)(11))+' in '+o(3)(1)(1))
+    elseif firing==[] then
+        o(3)(11)=[]
+    else
+        write(%io(2),"Problem with block "+o(3)(1)(1))
+        pause
+    end
+
+endfunction
+function x_new=do_version22(scs_m)
+    x_new=list()
+    wpar=scs_m(1)
+    wsiz=wpar(1)
+
+    if size(wsiz,"*")>=4 then x_new=scs_m,return,end
+
+    wpar(3)(4)=wpar(4)+1
+    x_new(1)=wpar
+    nx=size(scs_m)
+    for k=2:nx
+        o=scs_m(k)
+        if o(1)=="Link" then
+        elseif o(1)=="Block" then
+            model=o(3)
+            if model(1)=="super"|model(1)=="csuper" then
+                model(8)=do_version22(model(8))
+                o(3)=model
+                o=block_version(o)
+                scs_m(k)=o
+            else
+                o=block_version(o)
+            end
+        elseif o(1)=="Text" then
+            o=block_version(o)
+        end
+        x_new(k)=o;
+    end
+endfunction
+
+function scs_m_new=do_version27(scs_m)
+    if typeof(scs_m)=="diagram" then
+        //following code reported into do_version273
+        //     scs_m_new=scs_m,
+        //     nlstsize=lstsize(scs_m_new.objs)
+        //     for k=1:nlstsize
+        //       if typeof(scs_m_new.objs(k))=='Link' then
+        //  o=scs_m_new.objs(k)
+        //  if size(o.from,'*')==2 then o.from(3)=0,end
+        //  if size(o.to,'*')==2 then o.to(3)=1,end
+        //  scs_m_new.objs(k)=o
+        //       elseif typeof(scs_m_new.objs(k))=='Block' then
+
+        //       end
+        //     end
+        scs_m_new=scs_m
+        return,
+    end
+    scs_m_new=scicos_diagram()
+    tf=scs_m(1)(4)
+    if tf==[] then tf=100;end
+    tol=scs_m(1)(3)
+    if size(tol,"*")<4 then tol(4)=tf+1,end
+    if size(tol,"*")<5 then tol(5)=0,end
+    if size(tol,"*")<6 then tol(6)=0,end
+    for iix=size(scs_m(1))+1:10,scs_m(1)(iix)=[];end
+    scs_m_new.props=scicos_params(wpar=scs_m(1)(1),Title=scs_m(1)(2),..
+    tol=tol,tf=tf,..
+    context=scs_m(1)(5),options=scs_m(1)(7),..
+    doc=scs_m(1)(10))
+
+    if scs_m(1)(7).Background==[] then
+        scs_m_new.props.options.Background=[8 1]
+    end
+
+    scs_m_new.objs(1)=mlist("Deleted") // not to change the internal numbering
+    n=lstsize(scs_m)
+    back_col=8   //white background
+
+    mprintf(".")
+
+    for i=2:n //loop on objects
+        o=scs_m(i);
+        if o(1)=="Block" then
+            if size(o(2)) > 8 then
+                if type(o(2)(9))==15 then
+                    gr_io=o(2)(9)(1);
+                    if o(2)(9)(2)<>[] then
+                        back_col=o(2)(9)(2);,
+                    end
+                else
+                    gr_io=o(2)(9);
+                    back_col=8
+                end
+                gr_i=convert_gri(o(5),gr_io);
+                if gr_i==[] then gr_i=gr_io;, end
+            elseif size(o(2)) < 9 then
+                gr_i=[];
+                back_col=8
+            end
+            gr_i=list(gr_i,back_col)
+
+            mdl=o(3);
+            if size(o(3))<=12 then
+                mdl(13)=""; mdl(14)=[] ; mdl(15)="";
+            elseif size(o(3))<=13 then
+                mdl(14)=[] ; mdl(15)="";
+            elseif size(o(3))<=14 then
+                mdl(15)="";
+            end
+
+            if mdl(1)(1)=="super"|mdl(1)(1)=="csuper" then
+                if type(mdl(8))==15 then
+                    mdl(8)=do_version27(mdl(8))
+                end
+            end
+
+            graphics=scicos_graphics27(orig=o(2)(1),sz=o(2)(2),flip=o(2)(3),..
+            exprs=o(2)(4),pin=o(2)(5),pout=o(2)(6),..
+            pein=o(2)(7),peout=o(2)(8),gr_i=gr_i,..
+            id=mdl(15))
+
+
+            model=scicos_model27(sim=mdl(1),in=mdl(2),out=mdl(3),evtin=mdl(4),..
+            evtout=mdl(5),state=mdl(6),dstate=mdl(7),..
+            rpar=mdl(8),ipar=mdl(9),blocktype=mdl(10),..
+            firing=mdl(11),dep_ut=mdl(12),label=mdl(13))
+
+
+            objsi=scicos_block(graphics=graphics,model=model,gui=o(5),..
+            doc=mdl(14))
+            if objsi.gui=="ESELECT_f" then objsi.model.sim(2)=-2,end
+            scs_m_new.objs(i)=objsi
+
+        elseif o(1)=="Link" then
+            from=o(8);from(3)=0;
+            to=o(9);to(3)=1;
+
+            objsi=scicos_link(xx=o(2),yy=o(3),id=o(5),thick=o(6),..
+            ct=o(7),from=from,to=to)
+            scs_m_new.objs(i)=objsi
+        elseif o(1)=="Text" then
+
+            objsi=TEXT_f("define")
+            objsi.model.rpar=o(3)(8)
+            objsi.model.ipar=o(3)(9)
+            objsi.graphics.orig=o(2)(1)
+            objsi.graphics.sz=o(2)(2)
+            objsi.graphics.exprs=o(2)(4)
+            scs_m_new.objs(i)=objsi
+        elseif o(1)=="Deleted" then
+            scs_m_new.objs(i)=tlist("Deleted")
+        end
+    end
+
+    [%cpr,edited]=resume(list(),%t) // doit etre enleve
+endfunction
+
+function  gr_i=convert_gri(name,gri)
+    gr_i=[];
+    select name
+    case "BIGSOM_f" then
+        gr_i=["[x,y,typ]=standard_inputs(o) ";
+        "sgn=o.model.rpar";
+        "for k=1:size(x,''*'')";
+        "  if sgn(k)>0 then";
+        "    xstring(orig(1)+sz(1)/8 ,y(k)-4,''+'')";
+        "  else";
+        "    xstring(orig(1)+sz(1)/8 ,y(k)-4,''-'')";
+        "  end";
+        "end";
+        "xx=sz(1)*[.8 .4 0.75 .4 .8]+orig(1)";
+        "yy=sz(2)*[.8 .8 .5 .2 .2]+orig(2)";
+        "xpoly(xx,yy,''lines'')"]
+
+    case "CONST_f" then
+        gr_i=["dx=sz(1)/5;dy=sz(2)/10;";
+        "w=sz(1)-2*dx;h=sz(2)-2*dy;";
+        "txt=C;"
+        "xstringb(orig(1)+dx,orig(2)+dy,txt,w,h,''fill'');"]
+
+    case "CURV_f" then
+        gr_i=["model=arg1.model;rpar=model.rpar;ipar=model.ipar;n=ipar(1);";
+        "thick=xget(''thickness'');xset(''thickness'',2);";
+        "xx=rpar(1:n);yy=rpar(n+1:2*n);";
+        "rect=rpar(2*n+1:2*n+4);";
+        "mxx=rect(3)-rect(1);";
+        "mxy=rect(4)-rect(2);";
+        "xx=orig(1)+sz(1)*(1/10+(4/5)*((xx-rect(1))/mxx));";
+        "yy=orig(2)+sz(2)*(1/10+(4/5)*((yy-rect(2))/mxy));";
+        "xpoly(xx,yy,''lines'');";
+        "xset(''thickness'',thick);"]
+
+    case "EVTDLY_f" then
+        gr_i=["dt=model.rpar;";
+        "txt=[''Delay'';string(dt)];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+
+    case "EVTGEN_f" then
+        gr_i=["tt=model.firing;";
+        "txt=[''Event at'';''time ''+string(tt)];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]
+
+    case "GAIN_f" then
+
+        gr_i=["gain=C,"
+        "dx=sz(1)/5;";
+        "dy=sz(2)/10;";
+        "xx=orig(1)+      [1 4 1 1]*dx;";
+        "yy=orig(2)+sz(2)-[1 5 9 1]*dy;";
+        "xpoly(xx,yy,''lines'');";
+        "w=sz(1)-2*dx;h=sz(2)-2*dy;";
+        "xstringb(orig(1)+dx,orig(2)+dy,gain,w,h,''fill'');"]
+
+    case "LOOKUP_f" then
+        gr_i=["rpar=model.rpar;n=size(rpar,''*'')/2;";
+        "thick=xget(''thickness'');xset(''thickness'',2);";
+        "xx=rpar(1:n);yy=rpar(n+1:2*n);";
+        "mnx=min(xx);xx=xx-mnx*ones(xx);mxx=max(xx);";
+        "xx=orig(1)+sz(1)*(1/10+(4/5)*xx/mxx);";
+        "mnx=min(yy);yy=yy-mnx*ones(yy);mxx=max(yy);";
+        "yy=orig(2)+sz(2)*(1/10+(4/5)*yy/mxx);";
+        "xpoly(xx,yy,''lines'');";
+        "xset(''thickness'',thick);"]
+
+    case "REGISTER_f" then
+
+        gr_i=["dly=model.rpar;";
+        "txt=[''Shift'';''Register'';string(dly)];";
+        "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"]
+    case "SWITCH_f" then
+
+        gr_i="xstringb(orig(1),orig(2),[''switch'';string(model.ipar+1)],sz(1),sz(2),''fill'');"
+    case "EXPBLK_f" then
+        gr_i="xstringb(orig(1),orig(2),''a^u'',sz(1),sz(2),''fill'');"
+    case "POWBLK_f" then
+        gr_i="xstringb(orig(1),orig(2),''u^a'',sz(1),sz(2),''fill'');"
+
+    end
+endfunction
+
+
+function scs_m_new=do_versionxx(scs_m)
+    //A SUPPRIMER CF ci dessus
+    if typeof(scs_m)=="diagram" then scs_m_new=scs_m,return,end
+    if typeof(scs_m(1))<>"params" then scs_m_new=scs_m,return,end
+    scs_m_new=scicos_diagram()
+    scs_m_new.props=scs_m(1)
+    scs_m_new.objs(1)=mlist("Deleted") // not to change the internal numbering
+    n=lstsize(scs_m)
+    for i=2:n //loop on objects
+        o=scs_m(i)
+        scs_m_new.objs(i)=o
+        if typeof(o)=="Block" then
+            if o.model.sim(1)=="super"| o.model.sim(1)=="csuper" then
+                scs_m_new.objs(i).model.rpar=do_versionxx(o.model.rpar)
+            end
+        end
+    end
+    edited=resume(%t)
+endfunction
+
+
+function model=scicos_model27(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10,v11,v12,v13)
+    //initialisation de model mlist
+    if exists("sim","local")==0 then sim="",end
+    if exists("in","local")==0 then in=[],end
+    if exists("out","local")==0 then out=[],end
+    if exists("evtin","local")==0 then evtin=[],end
+    if exists("evtout","local")==0 then evtout=[],end
+    if exists("state","local")==0 then state=[],end
+    if exists("dstate","local")==0 then dstate=[],end
+    if exists("rpar","local")==0 then rpar=[],end
+    if exists("ipar","local")==0 then ipar=[],end
+    if exists("blocktype","local")==0 then blocktype="c",end
+    if exists("firing","local")==0 then firing=[],end
+    if exists("dep_ut","local")==0 then dep_ut=[%f %f],end
+    if exists("label","local")==0 then label="",end
+
+    model=mlist(["model","sim","in","out","evtin","evtout","state","dstate",..
+    "rpar","ipar","blocktype","firing","dep_ut","label"],..
+    sim,in,out,evtin,evtout,state,dstate,..
+    rpar,ipar,blocktype,firing,dep_ut,label)
+endfunction
+
+function graphics=scicos_graphics27(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10)
+    //initialisation de graphics mlist
+    if exists("orig","local")==0 then orig=[0 0],end
+    if exists("sz","local")==0 then sz=[20 20],end
+    if exists("flip","local")==0 then flip=%t,end
+    if exists("exprs","local")==0 then exprs=[],end
+    if exists("pin","local")==0 then pin=[],end
+    if exists("pout","local")==0 then pout=[],end
+    if exists("pein","local")==0 then pein=[],end
+    if exists("peout","local")==0 then peout=[],end
+    if exists("gr_i","local")==0 then gr_i=[],end
+    if exists("id","local")==0 then id="",end
+
+    graphics=mlist(["graphics","orig","sz","flip","exprs","pin",..
+    "pout","pein","peout","gr_i","id"],..
+    orig,sz,flip,exprs,pin,pout,pein,peout,gr_i,id)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/entity_menu.sce b/modules/scicos/macros/scicos_scicos/entity_menu.sce
new file mode 100755
index 000000000..c0b94bdfc
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/entity_menu.sce
@@ -0,0 +1,520 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function add_entity_menu(win, emen)
+    if argn(2)<1 then
+        win = get(gcf(),"figure_id")
+        scf(win)
+    end
+    if argn(2)<2 then emen="Edit",end
+    old = gcf()
+    EntityMenus=["Browser","Copy","Paste","Move","Delete","Insert","Ok","Cancel"];
+    //delmenu(win,'Entities')
+
+    addmenu(win,emen,EntityMenus,list(2,"entity_menu"));
+    //seteventhandler('entity_handler')
+    scf(old)
+endfunction
+
+
+
+function entity_menu(k,win)
+    old=gcf();fig=scf(win)
+    seteventhandler("")
+    select k
+    case 1 then //browser
+        ged(5,win)
+    case 2 then //copy
+        copy_entity()
+    case 3 then //past
+        paste_entity()
+    case 4 then //move
+        move_entity()
+    case 5 then //Delete Entity
+        delete_entity()
+    case 6 then //New entity
+        new_entity()
+    case 7 then //ok
+        fig.user_data="ok"
+    case 8 then //cancel
+        fig.user_data="cancel"
+        //txt=gen_code()
+        //mputl(txt,TMPDIR+'/foo.txt')
+    end
+    seteventhandler("ged_eventhandler")
+    scf(old)
+endfunction
+
+function new_entity()
+    entities=["Rectangle","Segment","Polyline","Text","Circle"]
+    sel=x_choose(entities,"Select the Entity type")
+    f=gcf();
+    rep(3)=-1
+    select sel
+    case 1 then //Rectangle
+        [btn,xc,yc]=xclick()
+        xrect(xc,yc,0,0)
+        r=gce();r.foreground=-1;
+        while rep(3)==-1 do
+            rep=xgetmouse()
+            r.data=[min(xc,rep(1)),max(yc,rep(2)),abs(xc-rep(1)),abs(yc-rep(2))]
+        end
+
+    case 2 then //Segment
+        [btn,xc,yc]=xclick()
+        xsegs([xc;xc],[yc;yc])
+        r=gce();r.foreground=-1;
+        while rep(3)==-1 do
+            rep=xgetmouse()
+            r.data=[xc,yc;rep(1),rep(2)]
+        end
+
+    case 3 then //Polyline
+        [btn,xc,yc]=xclick()
+        xpoly([xc;xc],[yc;yc])
+        r=gce();r.foreground=-1;
+        while %t
+            while rep(3)==-1 do
+                rep=xgetmouse()
+                r.data($,:)=[rep(1),rep(2)]
+            end
+            if rep(3)==2 then break,end
+            rep(3)=-1;
+            r.data=[r.data;r.data($,:)]
+        end
+    case 4 then //Text
+        text = x_dialog("Enter the new text here.","") ;
+        if ( text <> [] & text <> "" ) then
+            // do nothing if cancel button has been pressed or no text entered
+            // get the position of the text
+            xstring(0, 0, text ) ;
+            r=gce();
+            if r.type=="Text" then
+                while rep(3)==-1 do
+                    rep=xgetmouse()
+                    r.data=[rep(1),rep(2)]
+                end
+            else //compound
+                y0=0
+                while rep(3)==-1 do
+                    rep=xgetmouse()
+                    y0=r.children($).data(2)
+                    for k=1:size(r.children,"*")
+                        rk=r.children(k)
+                        rk.data=[rep(1),rk.data(2)+rep(2)-y0]
+                    end
+                    y0=rep(2)
+                end
+            end
+        end
+    case 5 then //Circle
+        [btn,xc,yc]=xclick()
+        xarc(xc,yc,0,0,0,64*360)
+        r=gce();r.foreground=-1;
+        while rep(3)==-1 do
+            rep=xgetmouse()
+            r.data=[min(xc,rep(1)),max(yc,rep(2)),abs(xc-rep(1)),abs(yc-rep(2)),0,360]
+        end
+
+    end
+endfunction
+
+function delete_entity()
+    gedx=ged
+    [btn,xc,yc]=xclick()
+    [xc,yc]=xchange(xc,yc,"f2i")
+    h=ged_getobject([xc,yc])
+    if h<>[] then delete(h),end
+endfunction
+
+function move_entity()
+    gedx=ged
+    [btn,xc,yc]=xclick()
+    pos=[xc,yc]
+    [xc,yc]=xchange(xc,yc,"f2i")
+    r=ged_getobject([xc,yc])
+    if r==[] return,end
+    mprintf("debut move\n")
+    rep(3)=-1
+    select r.type
+    case "Rectangle" then
+        while rep(3)==-1 do
+            rep=xgetmouse()
+            r.data(1:2)= r.data(1:2)+(rep(1:2)-pos)
+            pos=rep(1:2)
+        end
+    case "Segs" then //Segment
+        while rep(3)==-1 do
+            rep=xgetmouse()
+            r.data=r.data+ones(r.data(:,1))*(rep(1:2)-pos)
+            pos=rep(1:2)
+        end
+    case "Polyline" then //Polyline
+        while rep(3)==-1 do
+            rep=xgetmouse()
+            r.data=r.data+ones(r.data(:,1))*(rep(1:2)-pos)
+            pos=rep(1:2)
+        end
+    case "Text" then //Text
+        if r.parent.type=="Axes" then
+            while rep(3)==-1 do
+                rep=xgetmouse()
+                r.data=r.data+(rep(1:2)-pos)
+                pos=rep(1:2)
+            end
+        else
+            r=r.parent
+            while rep(3)==-1 do
+                rep=xgetmouse()
+                for k=1:size(r.children,"*")
+                    rk=r.children(k)
+                    rk.data=rk.data+(rep(1:2)-pos)
+                end
+                pos=rep(1:2)
+            end
+        end
+    case "Arc" then //Circle
+        while rep(3)==-1 do
+            rep=xgetmouse()
+            r.data(1:2)= r.data(1:2)+(rep(1:2)-pos)
+            pos=rep(1:2)
+        end
+
+    end
+    mprintf("fin move\n")
+endfunction
+
+
+function copy_entity()
+    gedx=ged;
+    [btn,xc,yc]=xclick()
+    [xc,yc]=xchange(xc,yc,"f2i")
+    r=ged_getobject([xc,yc])
+    if r==[] return,end
+    twinkle(r,1);
+    save(TMPDIR+"/G_Clipboard",r)
+endfunction
+
+
+function paste_entity()
+    // check the file
+    [info,err] = fileinfo(TMPDIR + "/G_Clipboard" ) ;
+
+    if err <> 0 then
+        return ;
+    end
+
+    // create the saved object
+    load(TMPDIR+"/G_Clipboard") ;
+endfunction
+
+function txt=gen_code(win)
+    old=gcf()
+    if argn(2)>=1 then scf(win);end
+    ax=gca()
+    txt=[]
+    for k=size(ax.children,"*"):-1:1
+        txt=[txt;
+        graphical_object_code(ax.children(k))]
+
+    end
+    if txt==[] then txt=" ",end
+    scf(old)
+endfunction
+
+function txt=graphical_object_code(rk)
+    txt=[]
+    select rk.type
+    case "Rectangle" then
+        dx="orig(1)+sz(1)*"+num2string(rk.data(1))
+        dy="orig(2)+sz(2)*"+num2string(rk.data(2))
+        sx="sz(1)*"+num2string(rk.data(3))
+        sy="sz(2)*"+num2string(rk.data(4))
+        txt=[txt;
+        "xrect("+strcat([dx,dy,sx,sy],",")+");"
+        rect_opt(rk)]
+
+    case "Arc" then
+        dx="orig(1)+sz(1)*"+num2string(rk.data(1))
+        dy="orig(2)+sz(2)*"+num2string(rk.data(2))
+        sx="sz(1)*"+num2string(rk.data(3))
+        sy="sz(2)*"+num2string(rk.data(4))
+        a1=num2string(rk.data(5)*64)
+        a2=num2string(rk.data(6)*64)
+
+        txt=[txt;
+        "xarc("+strcat([dx,dy,sx,sy,a1,a2],",")+");"
+        arc_opt(rk)]
+
+    case "Segs" then
+        dx="orig(1)+sz(1)*["+strcat(num2string(rk.data(:,1)),";")+"]"
+        dy="orig(2)+sz(2)*["+strcat(num2string(rk.data(:,2)),";")+"]"
+        col=sci2exp(rk.segs_color,0)
+        txt=[txt;
+        "xsegs("+dx+","+dy+","+col+");"
+        seg_opt(rk)]
+
+    case "Polyline" then
+        dx="orig(1)+sz(1)*["+strcat(num2string(rk.data(:,1)),";")+"]"
+        dy="orig(2)+sz(2)*["+strcat(num2string(rk.data(:,2)),";")+"]"
+        txt=[txt;
+        "xpoly("+dx+","+dy+");"
+        poly_opt(rk)]
+
+    case "Text" then
+        dx="orig(1)+sz(1)*"+num2string(rk.data(1))
+        dy="orig(2)+sz(2)*"+num2string(rk.data(2))
+        t=sci2exp(rk.text,0)
+        t="["+strsubst(t,char(10),""";""")+"]"
+        if rk.text_box_mode <> "filled" then
+            txt=[txt;
+            "xstring("+dx+","+dy+","+t+");"
+            text_opt(rk)]
+        else //patch because of xstringb patch in scicos
+            w="sz(1)*"+num2string(rk.text_box(1))
+            h="sz(2)*"+num2string(rk.text_box(2))
+
+            txt=[txt;
+            "xstringb("+dx+","+dy+","+t+","+w+","+h+",''fill'');"
+            textb_opt(rk)]
+        end
+    case "Compound" then //multiple line string
+        n=size(rk.children,"*")
+        if n==1 then
+            txt=[txt;
+            graphical_object_code(rk.children)];
+        else
+            for i=n:-1:1
+                txt=[txt;
+                graphical_object_code(rk.children(i));
+                "e"+string(i)+"=e;"]
+            end
+            txt=[txt;
+            "glue(["+strcat("e"+string(1:n),",")+"]);"]
+        end
+    else
+        mprintf("Graphical object of type "+rk.type+" not yet handled\n")
+    end
+endfunction
+
+function opts=rect_opt(e)
+    opts=[mark_opt(e);line_opt(e);fill_opt(e);clip_opt(e)];
+    if opts<>[] then
+        opts=["e=gce()";opts]
+        opts=strcat(opts,";")+";"
+    end
+endfunction
+
+function opts=arc_opt(e)
+    opts=[line_opt(e);fill_opt(e);clip_opt(e)];
+    if opts<>[] then
+        opts=["e=gce()";opts]
+        opts=strcat(opts,";")+";"
+    end
+endfunction
+
+function opts=seg_opt(e)
+    markopt=mark_opt(e)
+    lineopt=line_opt(e)
+    if rk.arrow_size>0 then
+        arrowopt="e.arrow_size="+string(e.arrow_size)
+    else
+        arrowopt=[]
+    end
+    opts=[markopt;lineopt;arrowopt];
+    if opts<>[] then
+        opts=["e=gce()";opts]
+        opts=strcat(opts,";")+";"
+    end
+endfunction
+
+function opts=poly_opt(e)
+    markopt=mark_opt(e)
+    lineopt=line_opt(e)
+    fillopt=fill_opt(e)
+    arrowopt=arrow_opt(e)
+
+    opts=[markopt;lineopt;fillopt;arrowopt];
+    if opts<>[] then
+        opts=["e=gce()";opts]
+        opts=strcat(opts,";")+";"
+    end
+endfunction
+
+function opts=text_opt(e)
+    fontopt=font_opt(e)
+    boxopt=box_opt(e)
+    lineopt=[];
+    if rk.fill_mode == "on" then
+        lineopt="e.fill_mode="+sci2exp(e.fill_mode)
+        if e.foreground<>-1 then
+            lineopt=[lineopt
+            "e.foreground="+sci2exp(e.foreground)]
+        end
+    end
+    opts=[fontopt;boxopt;lineopt]
+    if opts<>[] then
+        opts=["e=gce()";opts]
+        opts= strcat(opts,";")+";"
+    end
+endfunction
+
+function opts=textb_opt(e)
+    fontopt=font_opt(e)
+    lineopt=[];
+    if rk.fill_mode == "on" then
+        lineopt="e.fill_mode="+sci2exp(e.fill_mode)
+        if e.foreground<>-1 then
+            lineopt=[lineopt
+            "e.foreground="+sci2exp(e.foreground)]
+        end
+    end
+    opts=[fontopt;lineopt]
+    if opts<>[] then
+        opts=["e=gce()";opts]
+        opts= strcat(opts,";")+";"
+    end
+endfunction
+
+function markopt=mark_opt(e)
+    markopt=[]
+    if e.mark_mode=="on" then
+        markopt=[markopt;
+        "e.mark_mode=''on''"]
+        if e.mark_style<>0 then
+            markopt=[markopt;
+            "e.mark_style="+string(e.mark_style)]
+        end
+        if e.mark_size<>0 then
+            markopt=[markopt;
+            "e.mark_size="+string(e.mark_size)]
+        end
+        if e.mark_foreground<>-1 then
+            markopt=[markopt;
+            "e.mark_foreground="+string(e.mark_foreground)]
+        end
+        if e.mark_background<>-1 then
+            markopt=[markopt;
+            "e.mark_background="+string(e.mark_background)]
+        end
+    end
+endfunction
+function lineopt=line_opt(e)
+    lineopt=[]
+    t=e.type
+    if e.line_mode=="on" then
+        lineopt=[lineopt;
+        "e.line_mode="+sci2exp(e.line_mode)]
+        if e.line_style<>0 then
+            lineopt=[lineopt;
+            "e.line_style="+string(e.line_style)]
+        end
+        if e.thickness>1 then
+            lineopt=[lineopt;
+            "e.thickness="+string(e.thickness)]
+        end
+        if t<>"Segs"&e.foreground<>-1 then
+            lineopt=[lineopt;
+            "e.foreground="+string(e.foreground)]
+        end
+    end
+endfunction
+
+function fillopt=fill_opt(e)
+    fillopt=[]
+    if e.fill_mode=="on" then
+        fillopt=[fillopt;
+        "e.fill_mode="+sci2exp(e.fill_mode)]
+        if e.background<>-2 then
+            fillopt=[fillopt;
+            "e.background="+string(e.background)]
+        end
+    end
+endfunction
+function arrowopt=arrow_opt(e)
+    arrowopt=[]
+    if e.polyline_style<>1 then
+        arrowopt=[arrowopt;
+        "e.polyline_style="+sci2exp(e.polyline_style)
+        "e.arrow_size_factor="+string(e.arrow_size_factor)]
+    end
+endfunction
+function fontopt=font_opt(e)
+    fontopt=[]
+    if e.font_foreground<>-1 then
+        fontopt=[fontopt;
+        "e.font_foreground="+string(e.font_foreground)]
+    end
+    if e.font_style<>6 then
+        fontopt=[fontopt;
+        "e.font_style="+string(e.font_style)]
+    end
+    if e.font_size<>1 then
+        fontopt=[fontopt;
+        "e.font_size="+string(e.font_size)]
+    end
+    if e.font_angle<>0 then
+        fontopt=[fontopt;
+        "e.font_angle="+string(e.font_angle)]
+    end
+endfunction
+
+function boxopt=box_opt(e)
+    boxopt=[]
+    if e.text_box_mode<>"off" then
+        boxopt=[boxopt;
+        "e.text_box_mode="+sci2exp(e.text_box_mode)]
+    end
+    if or(e.text_box<>[0 0]) then
+        boxopt=[boxopt;
+        "e.text_box="+sci2exp(e.text_box)]
+    end
+    if e.box<>"off" then
+        boxopt=[boxopt;
+        "e.box="+sci2exp(e.box)]
+    end
+    if e.background<>-2 then
+        boxopt=[boxopt;
+        "e.background="+sci2exp(e.background)]
+    end
+    if e.fill_mode<>"off" then
+        boxopt=[boxopt;
+        "e.fill_mode="+sci2exp(e.fill_mode)];
+
+    end
+endfunction
+
+function clipopt=clip_opt(e)
+    clipopt=[]
+    if e.clip_state<>"off" then
+        clipopt=[clipopt;
+        "e.clip_state="+sci2exp(e.clip_state)
+        "e.clip_box="+sci2exp(e.clip_box)]
+    end
+endfunction
+
+
+function s=num2string(a)
+    s=matrix(msprintf("%.2f\n",a(:)),size(a))
+    s=strsubst(s,".00","")
+endfunction
+
+
diff --git a/modules/scicos/macros/scicos_scicos/extract_implicit.bin b/modules/scicos/macros/scicos_scicos/extract_implicit.bin
new file mode 100755
index 000000000..2799c07e6
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/extract_implicit.bin
diff --git a/modules/scicos/macros/scicos_scicos/extract_implicit.sci b/modules/scicos/macros/scicos_scicos/extract_implicit.sci
new file mode 100755
index 000000000..cb112049b
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/extract_implicit.sci
@@ -0,0 +1,144 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [blklstr,cmatr,ccmat,cor,corinv,ok]=extract_implicit(blklst,cmat,ccmat)
+
+    imp=[];blklstr=[];cmatr=[];ok=%t
+
+    nb=size(blklst);
+    for k=1:nb
+        if or(getfield(1,blklst(k))=="equations") then
+            if blklst(k).equations<>list() then imp=[imp,k];end
+        end
+    end
+    if imp==[] then [blklstr,cmatr]=(blklst,cmat), return,end
+
+    if size(ccmat,1)>0 then
+        if or(dsearch(ccmat(:,1),imp,"d")<>0) then
+            messagebox("An implicit block has an event input","modal","error");
+            ok=%f
+            return
+        end
+        if  or(dsearch(ccmat(:,3),imp,"d")<>0) then
+            messagebox("An implicit block has an event output","modal","error");
+            ok=%f
+            return
+        end
+    end
+    indfrom=dsearch(cmat(:,1),imp,"d")
+    indto=dsearch(cmat(:,4),imp,"d")
+
+    I=find(indfrom<>0&indto<>0) //links between two implicit blocs
+    Iin=find(indfrom==0&indto<>0)
+    Iout=find(indfrom<>0&indto==0)
+
+    blklsti=list(blklst(imp)); //the implicit blocks list
+    cmati=cmat(I,:);
+
+    //add blocks for input and outputs
+    nbi=size(blklsti);
+    N=size(Iin,"*");
+    if N>0
+        mo=modelica();mo.model="InPutPort";mo.outputs="vo";mo.inputs="vi";
+        for k=1:N
+            blklsti($+1)=scicos_model(equations=mo);
+        end
+        ci=cmat(Iin,:);ci(:,1)=-(nbi+(1:N))';ci(:,2)=1;
+        cmati=[cmati;ci];
+        nbi=nbi+N;
+    end
+    N=size(Iout,"*")
+    if N>0
+        mo=modelica();mo.model="OutPutPort";mo.outputs="vo";mo.inputs="vi";
+        for k=1:N
+            blklsti($+1)=scicos_model(equations=mo);
+        end
+        co=cmat(Iout,:);co(:,4)=-(nbi+(1:N)');co(:,5)=1;
+        cmati=[cmati;co];
+        nbi=nbi+N;
+    end
+
+    //renumber links connecting implicit blocs
+    for k=1:size(cmati,1)
+        l=find(cmati(k,1)==imp);if l<>[] then cmati(k,1)=l;end
+        l=find(cmati(k,4)==imp);if l<>[] then cmati(k,4)=l;end
+    end
+    cmati=abs(cmati)
+
+    name="imppart_"+stripblanks(scs_m.props.title(1));
+    txt=create_modelica( blklsti,cmati,name);
+    mputl(txt,scs_m.props.title(2)+name+".mo");
+    [ok,name1,nx,ng]=compile_modelica(scs_m.props.title(2)+name+".mo");
+    if ~ok then return,end
+    reg=1:nb;reg(imp)=[];
+    blklstr=list(blklst(reg)); //the regular blocks list
+
+    //add the block equivalent to the implicit part
+    nx=nx*2//should be read from generated C code
+    blklstr($+1)=scicos_model(sim=list(name,10002),..
+    in=ones(Iin'),out=ones(Iout'),state=zeros(nx,1),..
+    dep_ut=[%f %t],nzcross=ng)
+    nbr=size(blklstr)
+    cmatr=cmat;cmatr([I,Iin,Iout],:)=[];
+    //renumber links connecting regular blocs
+    N=size(Iin,"*");
+    if N>0
+        ci=cmat(Iin,:);ci(:,4)=-nbr;ci(:,5)=(1:N)';
+        cmatr=[cmatr;ci];
+    end
+    N=size(Iout,"*")
+    if N>0
+        co=cmat(Iout,:);co(:,1)=-nbr;co(:,2)=(1:N)';
+        cmatr=[cmatr;co];
+    end
+    for k=1:size(cmatr,1)
+        l=find(cmatr(k,1)==reg);if l<>[] then cmatr(k,1)=l;end
+        l=find(cmatr(k,4)==reg);if l<>[] then cmatr(k,4)=l;end
+    end
+    cmatr=abs(cmatr)
+
+    //renumber ccmat
+    for k=1:size(ccmat,1)
+        l=find(ccmat(k,1)==reg);if l<>[] then ccmat(k,1)=l;end
+        l=find(ccmat(k,3)==reg);if l<>[] then ccmat(k,3)=l;end
+    end
+    //update corinv, we choose imp(1) to represent all implicits blocs!
+    corinv=list(corinv([reg,imp(1)]))
+    //update cor
+
+    cor=update_cor(cor,reg)
+endfunction
+
+function cor=update_cor(cor,reg)
+    n=size(cor)
+    for k=1:n
+        if type(cor(k))==15 then
+            cor(k)=update_cor(cor(k),reg)
+        else
+            p=find(cor(k)==reg)
+            if p<>[] then
+                cor(k)=p
+            elseif cor(k)<>0 then
+                cor(k)=size(reg,"*")+1
+            end
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/findinlist.bin b/modules/scicos/macros/scicos_scicos/findinlist.bin
new file mode 100755
index 000000000..95e35f043
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/findinlist.bin
diff --git a/modules/scicos/macros/scicos_scicos/findinlist.sci b/modules/scicos/macros/scicos_scicos/findinlist.sci
new file mode 100755
index 000000000..5b88da13c
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/findinlist.sci
@@ -0,0 +1,38 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [path]=findinlist(L,v,path)
+    //recherche si un element de valeur v existe dans la liste L
+    global paths
+    if and(type(L)<>(15:17)) then error("First argument should be a list"),end
+    firstlevel=argn(2)<3
+    if firstlevel then paths=list(),path=[];end
+    for k=1:size(L)
+        l=L(k)
+        if or(type(l)==(15:17)) then
+            findinlist(l,v,[path,k])
+        elseif isequal(l,v) then
+            paths($+1)=[path k]
+        else
+        end
+    end
+    if firstlevel then path=paths,clearglobal paths,end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/findinlistcmd.bin b/modules/scicos/macros/scicos_scicos/findinlistcmd.bin
new file mode 100755
index 000000000..b229b9391
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/findinlistcmd.bin
diff --git a/modules/scicos/macros/scicos_scicos/findinlistcmd.sci b/modules/scicos/macros/scicos_scicos/findinlistcmd.sci
new file mode 100755
index 000000000..07ebce7e6
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/findinlistcmd.sci
@@ -0,0 +1,51 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [path]=findinlistcmd(L,v,oper,path)
+    //recherche si un element de valeur v existe dans la liste L
+    global paths
+    if and(type(L)<>(15:17)) then error("First argument should be a list"),end
+    firstlevel=argn(2)<4
+    if firstlevel then paths=list(),path=[];end
+    for k=1:size(L)
+        l=L(k)
+        if or(type(l)==(15:17)) then
+            findinlistcmd(l,v,oper,[path,k])
+        else
+            if oper=="=" then
+                if and(l(:)==v) then
+                    paths($+1)=[path k]
+                end
+            elseif oper==">" then
+                if or(l(:) > v) then
+                    paths($+1)=[path k]
+                end
+            elseif oper=="<" then
+                if or(l(:) < v) then
+                    paths($+1)=[path k]
+                end
+            else
+            end
+        end
+    end
+    if firstlevel then path=paths,clearglobal paths,end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/gen_modelica.bin b/modules/scicos/macros/scicos_scicos/gen_modelica.bin
new file mode 100755
index 000000000..9bfc327ea
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/gen_modelica.bin
diff --git a/modules/scicos/macros/scicos_scicos/gen_modelica.sci b/modules/scicos/macros/scicos_scicos/gen_modelica.sci
new file mode 100755
index 000000000..890207d82
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/gen_modelica.sci
@@ -0,0 +1,114 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function txt=gen_modelica(scs_m,name)
+    txt=[];tab=ascii(9)
+    models=[]
+    eqns=[]
+    Pin=[]
+    Bnumbers=[]
+    Bnames=[]
+
+    IN=[];OUT=[];
+    scs_m;
+    for i=1:size(scs_m.objs)
+        if typeof(scs_m.objs(i))=="Block" then
+            if scs_m.objs(i).gui=="IN_f" then
+                scs_m.objs(i).gui="INPUTPORT";
+                mo=modelica();mo.model="InPutPort";mo.outputs="vo";mo.inputs="vi";
+                scs_m.objs(i).model.equations=mo;
+                IN=[IN scs_m.objs(i).model.ipar]
+            elseif scs_m.objs(i).gui=="OUT_f" then
+                scs_m.objs(i).gui="OUTPUTPORT";
+                mo=modelica();mo.model="OutPutPort";mo.outputs="vo";mo.inputs= "vi";
+                scs_m.objs(i).model.equations=mo
+                OUT=[OUT  scs_m.objs(i).model.ipar]
+            end
+        end
+    end
+
+    [blklst,cmat,ccmat,cor,corinv,ok]=pass1(scs_m);
+    if ~ok then return,end
+
+    //blocks
+    for k=1:size(blklst)
+        o=blklst(k);
+        if and(getfield(1,o)<>"equations")
+            messagebox("block numbered "+string(k)+" is not a Modelica block","modal")
+            txt=[]
+            return
+        end
+        if typeof(o.equations)<>"modelica" then
+            messagebox("block numbered "+string(k)+" is not a Modelica block","modal")
+            txt=[]
+            return
+        end
+        mo=o.equations;
+        np=size(mo.parameters(1),1);
+        P=[];
+        for l=1:np
+            pexp=sci2exp(mo.parameters(2)(l))
+
+            P=[P;
+            mo.parameters(1)(l)+"="+value2modelica(mo.parameters(2)(l))];
+        end
+        Bnumbers=[Bnumbers k];
+        Bnames=[Bnames,"B"+string(k)];
+        if P==[] then
+            models=[models;"  "+mo.model+" "+tab+"B"+string(k)+";"];
+        else
+            models=[models;"  "+mo.model+" "+tab+"B"+string(k)+"("+strcat(P,", ")+");"];
+        end
+    end
+    //links
+    for k=1:size(cmat,1)
+        from=cmat(k,1:3)
+        to=cmat(k,4:6)
+        if from(3)==1 then
+            p1=blklst(from(1)).equations.inputs(from(2))
+        else
+            p1=blklst(from(1)).equations.outputs(from(2))
+        end
+        n1=Bnames(find(Bnumbers==from(1)))
+        if to(3)==1 then
+            p2=blklst(to(1)).equations.inputs(to(2))
+        else
+            p2=blklst(to(1)).equations.outputs(to(2))
+        end
+        n2=Bnames(find(Bnumbers==to(1)))
+        if or(blklst(from(1)).equations.model==["InPutPort","OutPutPort"]) ...
+            | or(blklst(to(1)).equations.model==["InPutPort","OutPutPort"]) ...
+            then
+            eqns=[eqns
+            "  "+n1+"."+p1+" = "+n2+"."+p2+";"]
+        else
+            eqns=[eqns
+            "  connect ("+n1+"."+p1+","+n2+"."+p2+");"]
+        end
+    end
+    txt=[txt;
+    "class "+name
+    models
+    "equation"
+    eqns
+    "end "+name+";"]
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/genfunc.bin b/modules/scicos/macros/scicos_scicos/genfunc.bin
new file mode 100755
index 000000000..1b883fdec
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/genfunc.bin
diff --git a/modules/scicos/macros/scicos_scicos/genfunc.sci b/modules/scicos/macros/scicos_scicos/genfunc.sci
new file mode 100755
index 000000000..64684f4c2
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/genfunc.sci
@@ -0,0 +1,58 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [ok,mac,txt]=genfunc(txt)
+    [lhs,rhs]=argn(0)
+    if rhs<1 then txt=" ",end
+    mac=[]
+    while %t do
+        txt=dialog(["Set Function Block";
+        " "
+        "Enter Scilab instructions defining"
+        "y as a function of u"],txt)
+
+
+        if txt==[] then ok=%f,return,end
+        // check if txt defines y from u
+        deff("[]=mac()",txt)
+        vars=macrovar(mac)
+        if or(vars(3)=="u")&or(vars(5)=="y") then break,end
+    end
+    ok=%t
+    deff("[%_1,%_2]=mac(%_model,%_x,%_z,u,%_clock,%_flag,%_rpar,%_ipar)",..
+    ["%_1=[];%_2=[];";
+    "select %_flag";
+    "case 1 then";
+    txt
+    "%_1=y";
+    "case -1 then ";
+    "  %_model=list(%_model(1),1,1,[],[],[],[],[],[],''c'',%f,[%t %f])";
+    "  %_1=list(%_model,'' '')";
+    "case -2 then ";
+    "  txt=%_model.ipar";
+    "  [ok,mac,txt]=genfunc(txt)";
+    "  if ok then "
+    "    %_model.sim=mac"
+    "    %_model.ipar=txt"
+    "    %_1=list(model,%_x)"
+    "  end"
+    "end"])
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/genfunc1.bin b/modules/scicos/macros/scicos_scicos/genfunc1.bin
new file mode 100755
index 000000000..ed096beac
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/genfunc1.bin
diff --git a/modules/scicos/macros/scicos_scicos/genfunc1.sci b/modules/scicos/macros/scicos_scicos/genfunc1.sci
new file mode 100755
index 000000000..1b888b384
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/genfunc1.sci
@@ -0,0 +1,260 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [ok,tt,dep_ut]=genfunc1(tt,inp,out,nci,nco,nx,nz,nrp,type_)
+    // manages dialog to get  definition (with scilab instruction) of a new scicos
+    // block
+    //!
+    ni=size(inp,"*")
+    no=size(out,"*")
+
+    mac=[];ok=%f,dep_ut=[]
+    if size(tt)<>7 then
+        [txt1,txt0,txt2,txt3,txt4,txt5,txt6]=(" "," "," "," "," "," "," ")
+    else
+        [txt1,txt0,txt2,txt3,txt4,txt5,txt6]=tt(1:7)
+    end
+    dep_u=%f;dep_t=%f
+    depp="t";deqq="t";
+
+    u=emptystr(),
+    for k=1:ni,u=u+"u"+string(k)+",",end
+    dep=["t,","x,","z,",u,"n_evi,","rpar"]
+
+
+
+    if nx==0 then dep(2)=emptystr(),end
+    if nz==0 then dep(3)=emptystr(),end
+    //if nci==0 then dep(5)=emptystr(),end
+    if nrp==0 then dep(6)=emptystr(),end
+
+
+    //flag = 1
+    if no>0 then
+        depp=strcat(dep([1:5,6]))
+        w=[]
+        for k=1:no,w=[w;"y"+string(k)+" (size: "+string(out(k))+")"],end
+        while %t do
+            txt1=dialog(["Define function which computes the output";
+            " "
+            "Enter Scilab instructions defining";
+            w;
+            "as a functions of "+depp],txt1)
+            if txt1==[] then return,end
+            // check if txt defines y from u
+            mac=null();deff("[]=mac()",txt1,"n")
+            ok1=check_mac(mac)
+            if ok1 then
+                vars=macrovar(mac)
+                for k=1:ni
+                    if or(vars(3)=="u"+string(k)) then dep_u=%t,end
+                end
+                if or(vars(3)=="t") then dep_t=%t,end
+                w=[];w(no)=%f;
+                for k=1:no,if or(vars(5)=="y"+string(k)) then w(k)=%t,end,end
+                if ~and(w) then
+                    k1=find(~w)
+                    w=[];for k=1:size(k1,"*"),w=[w;"y"+string(k)+" (size: "+string(out(k))+")"],end
+                    messagebox("You did not define "+strcat(w,",")+" !","modal")
+                else
+                    break
+                end
+            end
+        end
+    else
+        txt1=[]
+    end
+
+    //flag = 2
+    if nx>0 then
+        // xdot
+        depp=strcat(dep([1:4,6]))
+        while %t do
+            if txt0==[] then txt0=" ",end
+            txt0=dialog(["Define continuous states evolution";
+            " "
+            "Enter Scilab instructions defining:";
+            "derivative of continuous state xd (size:"+string(nx)+")"
+            "as  function(s) of "+depp],txt0)
+
+            if txt0==[] then return,end
+            mac=null();deff("[]=mac()",txt0,"n")
+            ok1=check_mac(mac)
+            if ok1 then
+                vars=macrovar(mac)
+                if or(vars(5)=="xd") then
+                    break,
+                else
+                    messagebox("You did not define xd !","modal")
+                end
+            end
+        end
+    else
+        txt0="xd=[]"
+    end
+    if (nci>0&(nx>0|nz>0))|nz>0 then // x+ z+
+        depp=strcat(dep([1:5,6]))
+        while %t do
+            if txt2==[] then txt2=" ",end
+            t1=[]
+            if nx>0 then
+                t1=[t1;"-new continuous state x (size:"+string(nx)+")"]
+            end
+            if nz>0 then
+                t1=[t1;"-new discrete state z (size:"+string(nz)+")"]
+            end
+
+            txt2=dialog(["You may define:";
+            t1
+            "at event time, as functions of "+depp],txt2)
+            if txt2==[] then return,end
+            mac=null();deff("[]=mac()",txt2,"n")
+            ok1=check_mac(mac)
+            if ok1 then
+                vars=macrovar(mac)
+                if ~or(vars(5)=="x") then txt3=[txt3;"x=[]"];end
+                if ~or(vars(5)=="z") then txt3=[txt3;"z=[]"];end
+                break;
+            end
+        end
+    else
+        txt2=" "
+    end // end of x+ z+
+
+    //flag = 3
+    if nci>0&nco>0 then
+        depp=strcat(dep)
+
+        while %t do
+            if txt3==[] then txt3=" ",end
+            txt3=dialog(["Using "+depp+",you may set "
+            "vector of output time events t_evo (size:"+string(nco)+")"
+            "at event time. "],txt3)
+            if txt3==[] then return,end
+            mac=null();deff("[]=mac()",txt3,"n")
+            //   alan.layec
+            ok1=check_mac(mac)
+            if ok1 then
+                vars=macrovar(mac)
+                if ~or(vars(5)=="t_evo") then txt3=[txt3;"t_evo=[]"];end
+                break;
+            end
+        end
+    else
+        txt3=" "
+    end
+
+    //flag = 4
+    depp=strcat(dep([2 3 6]))
+    t1=[]
+    if nx>0 then
+        t1=[t1;"- continuous state x (size:"+string(nx)+")"]
+    end
+    if nz>0 then
+        t1=[t1;"- discrete state z (size:"+string(nz)+")"]
+    end
+    if t1<>[] then
+        t1=["You may also reinitialize:";
+        t1]
+    end
+    while %t do
+        if txt4==[] then txt4=" ",end
+        txt4=dialog(["You may do whatever needed for initialization :"
+        "File or graphic opening...,"
+        t1
+        "as  function(s) of "+depp],txt4)
+        if txt4==[] then return,end
+        mac=null();deff("[]=mac()",txt4,"n")
+        ok1=check_mac(mac)
+        if ok1 then break,end
+    end
+
+    //flag = 5
+    depp=strcat(dep([2 3 6]))
+    t1=[]
+    if nx>0 then
+        t1=[t1;"- continuous state x (size:"+string(nx)+")"]
+    end
+    if nz>0 then
+        t1=[t1;"- discrete state z (size:"+string(nz)+")"]
+    end
+    if t1<>[] then
+        t1=["You may also change final value of:";t1]
+    end
+    while %t do
+        if txt5==[] then txt5=" ",end
+        txt5=dialog(["You may do whatever needed to finish :"
+        "File or graphic closing...,"
+        t1
+        "as  function(s) of "+depp],txt5)
+        if txt5==[] then return,end
+        mac=null();deff("[]=mac()",txt5,"n")
+        ok1=check_mac(mac)
+        if ok1 then break,end
+    end
+
+    //flag = 6
+    if nx>0|nz>0|no>0 then
+        t1=[]
+        if nx>0 then
+            t1=[t1;"- state x (size:"+string(nx)+")"]
+        end
+        if nz>0 then
+            t1=[t1;"- state z (size:"+string(nz)+")"]
+        end
+        w=[]
+        for k=1:no
+            w=[w;"- output y"+string(k)+" (size : "+string(out(k))+")"]
+        end
+        t1=[t1;w]
+
+        depp=strcat(dep([2:4,6]))
+
+        while %t do
+            txt6=dialog(["You may define here functions imposing contraints";
+            "on initial inputs, states and outputs";
+            "Note: these functions may be called more than once";
+            " ";
+            "Enter Scilab instructions defining:"
+            t1;
+            "as a function of "+depp],txt6)
+            if txt6==[] then return,end
+
+            mac=null();deff("[]=mac()",txt6,"n")
+            ok1=check_mac(mac)
+            if ok1 then
+                vars=macrovar(mac)
+                for k=1:no
+                    if and(vars(5)<>"y"+string(k)) then txt6=[txt6;"y"+string(k)+"=[]"],end
+                end
+                break,
+            end
+        end
+    else
+        txt6=[]
+    end
+
+    ok=%t
+    tt=list(txt1,txt0,txt2,txt3,txt4,txt5,txt6)
+
+
+    dep_ut=[dep_u dep_t]
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/genfunc2.bin b/modules/scicos/macros/scicos_scicos/genfunc2.bin
new file mode 100755
index 000000000..96821677a
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/genfunc2.bin
diff --git a/modules/scicos/macros/scicos_scicos/genfunc2.sci b/modules/scicos/macros/scicos_scicos/genfunc2.sci
new file mode 100755
index 000000000..9bd66fd02
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/genfunc2.sci
@@ -0,0 +1,260 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [ok,tt,dep_ut]=genfunc2(tt,inp,out,nci,nco,nx,nz,nrp,type_)
+    // manages dialog to get  definition (with scilab instruction) of a new scicos
+    // block
+    //!
+    ni=size(inp,1)
+    no=size(out,1)
+
+    mac=[];ok=%f,dep_ut=[]
+    if size(tt)<>7 then
+        [txt1,txt0,txt2,txt3,txt4,txt5,txt6]=(" "," "," "," "," "," "," ")
+    else
+        [txt1,txt0,txt2,txt3,txt4,txt5,txt6]=tt(1:7)
+    end
+    dep_u=%f;dep_t=%f
+    depp="t";deqq="t";
+
+    u=emptystr(),
+    for k=1:ni,u=u+"u"+string(k)+",",end
+    dep=["t,","x,","z,",u,"n_evi,","rpar"]
+
+
+
+    if nx==0 then dep(2)=emptystr(),end
+    if nz==0 then dep(3)=emptystr(),end
+    //if nci==0 then dep(5)=emptystr(),end
+    if nrp==0 then dep(6)=emptystr(),end
+
+
+    //flag = 1
+    if no>0 then
+        depp=strcat(dep([1:5,6]))
+        w=[]
+        for k=1:no,w=[w;"y"+string(k)+" (size: "+string(out(k))+")"],end
+        while %t do
+            txt1=dialog(["Define function which computes the output";
+            " "
+            "Enter Scilab instructions defining";
+            w;
+            "as a functions of "+depp],txt1)
+            if txt1==[] then return,end
+            // check if txt defines y from u
+            mac=null();deff("[]=mac()",txt1,"n")
+            ok1=check_mac(mac)
+            if ok1 then
+                vars=macrovar(mac)
+                for k=1:ni
+                    if or(vars(3)=="u"+string(k)) then dep_u=%t,end
+                end
+                if or(vars(3)=="t") then dep_t=%t,end
+                w=[];w(no)=%f;
+                for k=1:no,if or(vars(5)=="y"+string(k)) then w(k)=%t,end,end
+                if ~and(w) then
+                    k1=find(~w)
+                    w=[];for k=1:size(k1,"*"),w=[w;"y"+string(k)+" (size: "+string(out(k))+")"],end
+                    messagebox("You did not define "+strcat(w,",")+" !","modal")
+                else
+                    break
+                end
+            end
+        end
+    else
+        txt1=" "
+    end
+
+    //flag = 2
+    if nx>0 then
+        // xdot
+        depp=strcat(dep([1:4,6]))
+        while %t do
+            if txt0==[] then txt0=" ",end
+            txt0=dialog(["Define continuous states evolution";
+            " "
+            "Enter Scilab instructions defining:";
+            "derivative of continuous state xd (size:"+string(nx)+")"
+            "as  function(s) of "+depp],txt0)
+
+            if txt0==[] then return,end
+            mac=null();deff("[]=mac()",txt0,"n")
+            ok1=check_mac(mac)
+            if ok1 then
+                vars=macrovar(mac)
+                if or(vars(5)=="xd") then
+                    break,
+                else
+                    messagebox("You did not define xd !","modal")
+                end
+            end
+        end
+    else
+        txt0="xd=[]"
+    end
+    if (nci>0&(nx>0|nz>0))|nz>0 then // x+ z+
+        depp=strcat(dep([1:5,6]))
+        while %t do
+            if txt2==[] then txt2=" ",end
+            t1=[]
+            if nx>0 then
+                t1=[t1;"-new continuous state x (size:"+string(nx)+")"]
+            end
+            if nz>0 then
+                t1=[t1;"-new discrete state z (size:"+string(nz)+")"]
+            end
+
+            txt2=dialog(["You may define:";
+            t1
+            "at event time, as functions of "+depp],txt2)
+            if txt2==[] then return,end
+            mac=null();deff("[]=mac()",txt2,"n")
+            ok1=check_mac(mac)
+            if ok1 then
+                vars=macrovar(mac)
+                if ~or(vars(5)=="x") then txt3=[txt3;"x=[]"];end
+                if ~or(vars(5)=="z") then txt3=[txt3;"z=[]"];end
+                break;
+            end
+        end
+    else
+        txt2=" "
+    end // end of x+ z+
+
+    //flag = 3
+    if nci>0&nco>0 then
+        depp=strcat(dep)
+
+        while %t do
+            if txt3==[] then txt3=" ",end
+            txt3=dialog(["Using "+depp+",you may set "
+            "vector of output time events t_evo (size:"+string(nco)+")"
+            "at event time. "],txt3)
+            if txt3==[] then return,end
+            mac=null();deff("[]=mac()",txt3,"n")
+            ok1=check_mac(mac)
+            if ok1 then
+                vars=macrovar(mac)
+                if ~or(vars(5)=="t_evo") then txt3=[txt3;"t_evo=[]"];end
+                break;
+            end
+        end
+    else
+        txt3=" "
+    end
+
+    //flag = 4
+    depp=strcat(dep([2 3 6]))
+    t1=[]
+    if nx>0 then
+        t1=[t1;"- continuous state x (size:"+string(nx)+")"]
+    end
+    if nz>0 then
+        t1=[t1;"- discrete state z (size:"+string(nz)+")"]
+    end
+    if t1<>[] then
+        t1=["You may also reinitialize:";
+        t1]
+    end
+    while %t do
+        if txt4==[] then txt4=" ",end
+        txt4=dialog(["You may do whatever needed for initialization :"
+        "File or graphic opening...,"
+        t1
+        "as  function(s) of "+depp],txt4)
+        if txt4==[] then return,end
+        mac=null();deff("[]=mac()",txt4,"n")
+        ok1=check_mac(mac)
+        if ok1 then break,end
+    end
+
+    //flag = 5
+    depp=strcat(dep([2 3 6]))
+    t1=[]
+    if nx>0 then
+        t1=[t1;"- continuous state x (size:"+string(nx)+")"]
+    end
+    if nz>0 then
+        t1=[t1;"- discrete state z (size:"+string(nz)+")"]
+    end
+    if t1<>[] then
+        t1=["You may also change final value of:";t1]
+    end
+    while %t do
+        if txt5==[] then txt5=" ",end
+        txt5=dialog(["You may do whatever needed to finish :"
+        "File or graphic closing...,"
+        t1
+        "as  function(s) of "+depp],txt5)
+        if txt5==[] then return,end
+        mac=null();deff("[]=mac()",txt5,"n")
+        ok1=check_mac(mac)
+        if ok1 then break,end
+    end
+
+    //flag = 6
+    if nx>0|nz>0|no>0 then
+        t1=[]
+        if nx>0 then
+            t1=[t1;"- state x (size:"+string(nx)+")"]
+        end
+        if nz>0 then
+            t1=[t1;"- state z (size:"+string(nz)+")"]
+        end
+        w=[]
+        for k=1:no
+            w=[w;"- output y"+string(k)+" (size : "+string(out(k))+")"]
+        end
+        t1=[t1;w]
+
+        depp=strcat(dep([2:4,6]))
+
+        while %t do
+            if txt6==[] then txt6=" ",end
+            txt6=dialog(["You may define here functions imposing contraints";
+            "on initial inputs, states and outputs";
+            "Note: these functions may be called more than once";
+            " ";
+            "Enter Scilab instructions defining:"
+            t1;
+            "as a function of "+depp],txt6)
+            if txt6==[] then return,end
+
+            mac=null();deff("[]=mac()",txt6,"n")
+            ok1=check_mac(mac)
+            if ok1 then
+                vars=macrovar(mac)
+                for k=1:no
+                    if and(vars(5)<>"y"+string(k)) then txt6=[txt6;"y"+string(k)+"=[]"],end
+                end
+                break,
+            end
+        end
+    else
+        txt6=" "
+    end
+
+    ok=%t
+    tt=list(txt1,txt0,txt2,txt3,txt4,txt5,txt6)
+
+
+    dep_ut=[dep_u dep_t]
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/genmac.bin b/modules/scicos/macros/scicos_scicos/genmac.bin
new file mode 100755
index 000000000..f6a82d29c
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/genmac.bin
diff --git a/modules/scicos/macros/scicos_scicos/genmac.sci b/modules/scicos/macros/scicos_scicos/genmac.sci
new file mode 100755
index 000000000..d838c2a0a
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/genmac.sci
@@ -0,0 +1,90 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function mac=genmac(tt,nin,nout)
+    [txt1,txt0,txt2,txt3,txt4,txt5,txt6]=tt(1:7)
+    mac=null()
+    //    [y,  x,  z,  tvec,xd]=func(flag,nevprt,t,x,z,rpar,ipar,u)
+    blank="  "
+    // if txt2_1<>' ' then
+    //  txt2=[txt2;
+    //      'if n_evi<>0 then'
+    //         blank(ones(txt2_1))+txt2_1
+    //      'end']
+    //end
+    semi=";"
+
+
+    txt1=blank(ones(txt1))+txt1+semi(ones(txt1))
+    txt2=blank(ones(txt2))+txt2+semi(ones(txt2))
+    txt3=blank(ones(txt3))+txt3+semi(ones(txt3))
+    txt4=blank(ones(txt4))+txt4+semi(ones(txt4))
+    txt5=blank(ones(txt5))+txt5+semi(ones(txt5))
+    txt6=blank(ones(txt6))+txt6+semi(ones(txt6))
+
+    u="u"
+    if nin>0 then
+        get_u=blank+"["+strcat(u(ones(1,nin))+string(1:nin),",")+"]=u(:)"
+    else
+        get_u=[]
+    end
+    y="y"
+    set_y=blank+"y=list("+strcat(y(ones(1,nout))+string(1:nout),",")+")"
+    mac_txt=[
+    get_u
+    "select %_flag";
+    "case 0 then";
+    txt0
+    "  t_evo=[]";
+    "  y=list()";
+    "case 1 then";
+    txt1
+    "  t_evo=[]";
+    "  xd=[]";
+    set_y;
+    "case 2 then";
+    txt2
+    "  y=list()";
+    "  t_evo=[]";
+    "  xd=[]";
+    "case 3 then";
+    txt3
+    "  xd=[]";
+    "  y=list()";
+    "case 4 then";
+    txt4
+    "  y=list()";
+    "  t_evo=[]";
+    "  xd=[]";
+    "case 5 then";
+    txt5
+    "  y=list()";
+    "  t_evo=[]";
+    "  xd=[]";
+    "case 6 then";
+    txt6
+    "  t_evo=[]";
+    "  xd=[]";
+    set_y
+    "end";]
+
+    deff("[y,x,z,t_evo,xd]=mac(%_flag,n_evi,t,x,z,rpar,ipar,u)",mac_txt)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/get2index.bin b/modules/scicos/macros/scicos_scicos/get2index.bin
new file mode 100755
index 000000000..b39fc3a1e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get2index.bin
diff --git a/modules/scicos/macros/scicos_scicos/get2index.sci b/modules/scicos/macros/scicos_scicos/get2index.sci
new file mode 100755
index 000000000..fdaf4478b
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get2index.sci
@@ -0,0 +1,81 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [scs_m_i, cpr_i, sflag] = get2index(object, k)
+    //
+    //**               scs_m_i : Object numeber (index) in the diagram (scs_m)
+    //**
+    //**               cpr_i   : Compiled structure index
+    //**
+    //** the code is derived from
+    //**
+    //** "Info" -> GetInfo -> do_block_info -> get_block_info ->  standard_document
+    //
+    //
+    //pause
+
+    sflag=[]
+    object_type = typeof(object)
+    //
+    if object_type=="Block" then
+
+        scs_m_i = k ;
+        //disp('ici');pause
+        if %cpr<>list()&needcompile<>4&k<>-1 then
+            cor = %cpr.cor
+            corinv = %cpr.corinv
+            path = list()
+            for kp=1:size(super_path,"*")
+                path(kp) = super_path(kp)
+            end
+            path($+1) = k
+            ind = cor(path)
+
+            //** if ind>0 & ind<=size(corinv) then
+            cpr_i = cor(path) ; //** the good one
+            //disp('ici');pause
+            if type(cpr_i)==15 then
+                tmp_cpr=[];
+                sflag="*"
+                ssflag=""
+                for i=1:size(cpr_i)
+                    if type(cpr_i(i))<>15 then
+                        if cpr_i(i)<>0&cpr_i(i)<=size(corinv) then
+                            tmp_cpr=[tmp_cpr,cpr_i(i)]
+                        end
+                    else //another sblock
+                        ssflag=" *"
+                    end
+                end
+                cpr_i="["+strcat(string(tmp_cpr)," ")+ssflag+"]";
+            end
+            //** else
+            //**  cpr_i= -7; //** ['Compiled structure Index   : suppressed'; ' ']
+            //**end
+        else
+            cpr_i= -9; //**   ['Compiled structure Index   : Not available';' ']
+        end
+    else
+        scs_m_i = [] ;
+        cpr_i   = [] ;
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/get_connected.bin b/modules/scicos/macros/scicos_scicos/get_connected.bin
new file mode 100755
index 000000000..7ae848231
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_connected.bin
diff --git a/modules/scicos/macros/scicos_scicos/get_connected.sci b/modules/scicos/macros/scicos_scicos/get_connected.sci
new file mode 100755
index 000000000..f32b939f2
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_connected.sci
@@ -0,0 +1,65 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function connected=get_connected(scs_m,k,typ)
+    //return the vector of number of link connected to a given block
+    //   scs_m      :   structure of blocks and links
+    //   k          :   block_number
+    //   typ        :   'in','out','clkin','clkout'
+    //   connected  :   vector of connected link numbers
+    [lhs,rhs]=argn(0)
+
+    connected=[]
+
+    //disp('get_connected')
+    // pause
+    if rhs<=2 then // all connected links
+        graphics=scs_m.objs(k).graphics
+
+        ip=graphics.pin
+        connected=[connected ip(find(ip>0))']
+
+        op=graphics.pout
+        connected=[connected op(find(op>0))']
+
+        cip=graphics.pein
+        connected=[connected cip(find(cip>0))']
+
+        cop=graphics.peout
+        connected=[connected cop(find(cop>0))']
+    else
+
+        if typ=="in" then
+            ip=scs_m.objs(k).graphics.pin
+            connected=[connected ip(find(ip>0))'],
+        elseif typ=="out" then
+            op=scs_m.objs(k).graphics.pout
+            connected=[connected op(find(op>0))'],
+        elseif typ=="clkin" then
+            cip=scs_m.objs(k).graphics.pein
+            connected=[connected cip(find(cip>0))'],
+        elseif typ=="clkout" then
+            cop=scs_m.objs(k).graphics.peout
+            connected=[connected cop(find(cop>0))'],
+        end
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.bin b/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.bin
new file mode 100755
index 000000000..74313ffcf
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.bin
diff --git a/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.sci b/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.sci
new file mode 100755
index 000000000..bb16abc43
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.sci
@@ -0,0 +1,51 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function [libss,ok,cancel]=get_dynamic_lib_dir(tt,funam,flag)
+    // Copyright INRIA
+    cancel=%f
+    cur_wd = pwd();
+    chdir(TMPDIR);
+    mputl(tt,funam+"."+flag);
+    libss="";
+    label="";
+    ok=%f
+    while ~ok then
+        [ok,libss,label]=scicos_getvalue("Linking the "+funam+" function","External libraries (if any)",list("str",1),label);
+        if ~ok then chdir(cur_wd);cancel=%t,return;end
+        // for multiple libraries
+        if strindex(libss,"''")<>[] | strindex(libss,"""")<>[] then
+            ierr=execstr("libss=evstr(libss)","errcatch")
+            if ierr<>0  then
+                messagebox(["Can''t solve other files to link"],"modal")
+                chdir(cur_wd);
+                ok=%f;
+            end
+        else
+            libss=tokens(libss,[" ",";"])
+        end
+        for i=1:size(libss,"*")
+            lib_dll=libss(i) + getdynlibext();
+            ifexst=fileinfo(lib_dll)
+            if ifexst==[] then messagebox ("the library "+lib_dll+" doesn''t exists","modal");ok=%f;end
+        end
+    end
+    chdir(cur_wd);
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/get_errorcmd.bin b/modules/scicos/macros/scicos_scicos/get_errorcmd.bin
new file mode 100755
index 000000000..312248578
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_errorcmd.bin
diff --git a/modules/scicos/macros/scicos_scicos/get_errorcmd.sci b/modules/scicos/macros/scicos_scicos/get_errorcmd.sci
new file mode 100755
index 000000000..452935b57
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_errorcmd.sci
@@ -0,0 +1,108 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Alan Layec <alan.layec@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function cmd=get_errorcmd(path,scs_m_in,title_err,mess_err)
+    //** get_errorcmd : return a Scicos_commands strings
+    //** to select/hilite and display error messages for block
+    //** defined by his main scs_m path.
+    //** If the block is included in a super block, the editor
+    //** will open the correspondig windows by the use of the
+    //** scicos global variable %diagram_path_objective and
+    //** %scicos_navig.
+    //**
+    //** exemple of use :
+    //**       path=corinv(kfun);
+    //**       global Scicos_commands;
+    //**       Scicos_commands=get_errorcmd(path,'my Title error','error message');
+    //**
+    //** inputs : path : the path of the object which have
+    //**                 generated an error in a scs_m
+    //**
+    //**          scs_m_in : a scicos diagram data structure
+    //**                 (if any. if not scs_m is semi global)
+    //**
+    //**          title_err : the title of the error box message
+    //**                      (if any)
+    //**
+    //**          mess_err : the message of the error box message
+    //**                      (if any)
+    //**
+    //** nb : the string message will be formated as this :
+    //**      str_err=[title;
+    //**               specific message for type of block;
+    //**               mess_err]
+    //**
+    //** output : cmd  : the Scicos_commands strings
+    //**
+    //** Alan, 11/10/07 : Initial rev
+    //Copyright INRIA
+
+    //** first generate an empty cmd
+    cmd=[]
+
+    //** generte empty spec_err
+    spec_err=[]
+
+    //** check number of rhs arg
+    rhs = argn(2) ;
+    if (rhs == 1) then
+        title_err=[]
+        mess_err=[]
+    elseif (rhs == 2) then
+        if typeof(scs_m_in)=="diagram" then
+            scs_m=scs_m_in
+            mess_err=[]
+        elseif typeof(scs_m_in)=="string" then
+            title_err=scs_m_in
+            mess_err=[]
+        end
+    elseif (rhs == 3) then
+        if typeof(scs_m_in)=="diagram" then
+            scs_m=scs_m_in
+        elseif typeof(scs_m_in)=="string" then
+            mess_err=title_err
+            title_err=scs_m_in
+        end
+    end
+
+    //** **************
+    //** modelica block
+    //** **************
+    if type(path)==15 then
+
+        spec_err="The modelica block returns the error :";
+        //** create cmd
+        cmd=["messagebox([''"+title_err+"'';"+...
+        "''"+spec_err+"'';"+...
+        strcat("''"+mess_err+"''",";")+"],''modal'');"]
+
+        //** ************************
+        //** all other type of blocks
+        //** ************************
+    else
+        msg = "<html><body>" + title_err + ": <br/>";
+        msg = msg + strcat(mess_err, "<br/>");
+        msg = msg + "</body></html>";
+        hilite_path(path, msg);
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/get_model_name.bin b/modules/scicos/macros/scicos_scicos/get_model_name.bin
new file mode 100755
index 000000000..0e7bca72e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_model_name.bin
diff --git a/modules/scicos/macros/scicos_scicos/get_model_name.sci b/modules/scicos/macros/scicos_scicos/get_model_name.sci
new file mode 100755
index 000000000..0a98ce7ae
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_model_name.sci
@@ -0,0 +1,45 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function model_name=get_model_name(mo_model,Bnames)
+    //Copyright INRIA
+    //## return an unique name for a modelica model
+    //## for the compiled modelica structure
+    //##
+    //## inputs :
+    //##   mo_model : a string that gives the name of the model
+    //##              in the modelica list (equations) of a modelica block.
+    //##
+    //##   Bnames   : vector of strings of already attribuate models name
+    //##
+    //## output :
+    //##   model_name : the output string of the model name
+    //##
+
+    ind = 1;
+    model_name = strsubst(mo_model," ","") + string(ind);
+
+    while find(model_name==Bnames) <> [] then
+        ind = ind + 1;
+        model_name=strsubst(mo_model," ","") + string(ind);
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/get_subobj_path.bin b/modules/scicos/macros/scicos_scicos/get_subobj_path.bin
new file mode 100755
index 000000000..1eed497ce
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_subobj_path.bin
diff --git a/modules/scicos/macros/scicos_scicos/get_subobj_path.sci b/modules/scicos/macros/scicos_scicos/get_subobj_path.sci
new file mode 100755
index 000000000..6c252422f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_subobj_path.sci
@@ -0,0 +1,36 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function full_path=get_subobj_path(path)
+    // path      : vector of integer gives the path of the required block from
+    //             top level (main diagram) to bottom level (required block).
+    //             Each vector entry is a block index in the current level structure.
+    // full_path : is the  path relative to scs_m  of the required block
+    //             scs_m.objs(full_path) is the data structure of the required block
+
+    full_path=list("objs",path(1));
+    for l=path(2:$),
+        full_path($+1)="model";
+        full_path($+1)="rpar";
+        full_path($+1)="objs";
+        full_path($+1)=l;
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/get_tree_elt.bin b/modules/scicos/macros/scicos_scicos/get_tree_elt.bin
new file mode 100755
index 000000000..51ad3a14f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_tree_elt.bin
diff --git a/modules/scicos/macros/scicos_scicos/get_tree_elt.sci b/modules/scicos/macros/scicos_scicos/get_tree_elt.sci
new file mode 100755
index 000000000..6e08308db
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/get_tree_elt.sci
@@ -0,0 +1,34 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function  value=get_tree_elt(tree,path)
+    // tree  : a recursive list
+    // path  : a vector of index giving top to bottom path
+    // value : new value for the pointed tree element
+
+    n=prod(size(path))
+
+
+    for k=1:n
+        tree=tree(path(k))
+    end
+    value=tree
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/getmodelicacpath.bin b/modules/scicos/macros/scicos_scicos/getmodelicacpath.bin
new file mode 100755
index 000000000..65016a20b
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/getmodelicacpath.bin
diff --git a/modules/scicos/macros/scicos_scicos/getmodelicacpath.sci b/modules/scicos/macros/scicos_scicos/getmodelicacpath.sci
new file mode 100755
index 000000000..fbaed02f3
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/getmodelicacpath.sci
@@ -0,0 +1,67 @@
+//
+// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab
+// Copyright (C) 2009 - DIGITEO - Vincent COUVERT
+//
+// This file must be used under the terms of the CeCILL.
+// This source file is licensed as described in the file COPYING, which
+// you should have received as part of this distribution.  The terms
+// are also available at
+// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt
+//
+//
+function compilerpath = getmodelicacpath()
+
+    MODELICAC_FILENAME = "modelicac";
+
+    compilerpath = "";
+
+    if getos() == "Windows" then
+        // --- WINDOWS ---
+        MODELICAC_FILENAME = MODELICAC_FILENAME + ".exe";
+        defaultPath = SCI + "/bin/";
+
+        if isfile(defaultPath + MODELICAC_FILENAME) then
+            compilerpath = defaultPath;
+        else
+            compilerpath = "";
+        end
+
+    else
+        // --- LINUX/MACOS ---
+
+        // Check if source tree version
+        if isdir(SCI+"/modules/core/includes/") then
+            defaultPath = SCI + "/modules/scicos/";
+
+            if isfile(defaultPath + MODELICAC_FILENAME) then
+                compilerpath = defaultPath;
+            else
+                compilerpath = "";
+            end
+        end
+
+        // Check if binary version
+        if compilerpath=="" & isdir(SCI+"/../../include/scilab/") then
+            defaultPath = SCI + "/../../bin/";
+
+            if isfile(defaultPath + MODELICAC_FILENAME) then
+                compilerpath = defaultPath;
+            else
+                compilerpath = "";
+            end
+        end
+
+        // Check if system version
+        if compilerpath=="" & isdir("/usr/include/scilab/") then
+            defaultPath = "/usr/bin/";
+
+            if isfile(defaultPath + MODELICAC_FILENAME) then
+                compilerpath = defaultPath;
+            else
+                compilerpath = "";
+            end
+        end
+
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/global_case.bin b/modules/scicos/macros/scicos_scicos/global_case.bin
new file mode 100755
index 000000000..ddc40eddf
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/global_case.bin
diff --git a/modules/scicos/macros/scicos_scicos/global_case.sci b/modules/scicos/macros/scicos_scicos/global_case.sci
new file mode 100755
index 000000000..55214c2e3
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/global_case.sci
@@ -0,0 +1,48 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [links_table,sco_mat,ok]=global_case(links_table,sco_mat)
+    [s,k]=gsort(sco_mat(:,2))
+    sco_mat=sco_mat(k,:);
+    index=find((sco_mat(:,2)=="1")&(sco_mat(:,4)=="3"))
+    if index<> [] then
+        for i=1:size(index,"*")
+            indexx=find((sco_mat(index(:),3)==sco_mat(index(i),3))&(sco_mat(index(:),5)==sco_mat(index(i),5)))
+            if size(indexx,"*")>1 then
+                messagebox(["Error In Compilation";"You cannot have multiple global GOTO with the same tag"],"modal")
+                ok=%f
+                return
+            end
+        end
+        for i=index
+            index1=find((sco_mat(:,2)=="-1")&(sco_mat(:,3)==sco_mat(i,3))&(sco_mat(:,5)==sco_mat(i,5)))
+            if index1<>[] then
+                for j=index1
+                    index2=find(links_table(:,1)==-evstr(sco_mat(j,1)))
+                    if index2<>[] then
+                        links_table(index2',1)=-evstr(sco_mat(i,1))
+                    end
+                end
+                sco_mat(index1,:)=[]
+            end
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/haltscicos.bin b/modules/scicos/macros/scicos_scicos/haltscicos.bin
new file mode 100755
index 000000000..30aac9d44
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/haltscicos.bin
diff --git a/modules/scicos/macros/scicos_scicos/haltscicos.sci b/modules/scicos/macros/scicos_scicos/haltscicos.sci
new file mode 100755
index 000000000..b4c082af7
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/haltscicos.sci
@@ -0,0 +1,27 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function haltscicos(menus, win_id)
+    //** This is just a *CLEVER* function used for the "halt" button that
+    //** stop the Scicos simulation
+    sleep(1); //** DO NOT REMOVE IT
+    sci_haltscicos();
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/hilite_path.bin b/modules/scicos/macros/scicos_scicos/hilite_path.bin
new file mode 100755
index 000000000..784538047
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/hilite_path.bin
diff --git a/modules/scicos/macros/scicos_scicos/hilite_path.sci b/modules/scicos/macros/scicos_scicos/hilite_path.sci
new file mode 100755
index 000000000..ab1320f15
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/hilite_path.sci
@@ -0,0 +1,68 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function hilite_path(path,mess,with_intermediates)
+    //hilite a block included in a superblock hierarchy and displays a
+    //message.   If required all the intermediate superblocs are displayed
+    //first entry of the path must be a bloc of currently opened diagram
+
+    if argn(2)<2 then mess=" ",end
+
+    // retrieve the root diagram
+    if isdef("scs_m_s") then
+        diagram = scs_m_s;
+    elseif isdef("scs_m") then
+        diagram = scs_m;
+    else
+        error("scs_m variable does not exist");
+    end
+
+    uid = []; // empty uid path
+
+    // construct the uid path from the index path
+    for i = 1:length(path)
+        index = path(i);
+        if typeof(diagram.objs(index)) == "Block" then
+            o = diagram.objs(index);
+
+            // masked superblock case
+            if isempty(o.doc) then
+                // we abort because blocks do not have uuid inside
+                // masked superblocks
+                break;
+            end
+
+            // normal case
+            uid($+1) = diagram.objs(index).doc(1) + "";
+
+            if diagram.objs(index).model.sim == "super" then
+                diagram = diagram.objs(index).model.rpar;
+            else
+                break;
+            end
+        end
+    end
+
+    if uid <> [] then
+        warnBlockByUID(uid, strcat(mess, " "));
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/init_agenda.bin b/modules/scicos/macros/scicos_scicos/init_agenda.bin
new file mode 100755
index 000000000..572faf795
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/init_agenda.bin
diff --git a/modules/scicos/macros/scicos_scicos/init_agenda.sci b/modules/scicos/macros/scicos_scicos/init_agenda.sci
new file mode 100755
index 000000000..f1f8f44f0
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/init_agenda.sci
@@ -0,0 +1,53 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [tevts,evtspt,pointi]=init_agenda(initexe,clkptr)
+
+    // order initial firing events in chronological order.
+    nblk=size(clkptr,1)-1
+    timevec=initexe(:,3)
+    if timevec<>[] then
+        [timevec,indtime]=gsort(-timevec)
+        initexe=initexe(indtime,:)
+    else
+        initexe=[]
+    end
+    timevec=[]
+    //initialize agenda
+    ninit=size(initexe,1)
+    pointi=0
+    nevts=clkptr(nblk+1)-1 //time events agenda size
+    tevts=0*ones(nevts,1)
+    if initexe<>[] then
+        tevts(clkptr(initexe(:,1))+initexe(:,2)-1)=initexe(:,3)
+    end
+    evtspt=-ones(nevts,1)
+
+    if ninit>0 then
+        pointi=clkptr(initexe(1,1))+initexe(1,2)-1;
+        evtspt(pointi)=0
+    end
+    if ninit>1 then
+        evtspt(clkptr(initexe(1:ninit-1,1))+initexe(1:ninit-1,2)-1)=..
+        clkptr(initexe(2:ninit,1))+initexe(2:ninit,2)-1;
+        evtspt(clkptr(initexe(ninit,1))+initexe(ninit,2)-1)=0;
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/is_modelica_block.bin b/modules/scicos/macros/scicos_scicos/is_modelica_block.bin
new file mode 100755
index 000000000..33982d45c
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/is_modelica_block.bin
diff --git a/modules/scicos/macros/scicos_scicos/is_modelica_block.sci b/modules/scicos/macros/scicos_scicos/is_modelica_block.sci
new file mode 100755
index 000000000..e221e49bd
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/is_modelica_block.sci
@@ -0,0 +1,29 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function r=is_modelica_block(o)
+    //checks if the block o is a modelica block
+    if or(getfield(1,o.model)=="equations") then
+        r=o.model.equations<>list()
+    else
+        r=%f
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/lib b/modules/scicos/macros/scicos_scicos/lib
new file mode 100755
index 000000000..2cad4137f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/lib
diff --git a/modules/scicos/macros/scicos_scicos/link_olibs.bin b/modules/scicos/macros/scicos_scicos/link_olibs.bin
new file mode 100755
index 000000000..431b7e1f4
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/link_olibs.bin
diff --git a/modules/scicos/macros/scicos_scicos/link_olibs.sci b/modules/scicos/macros/scicos_scicos/link_olibs.sci
new file mode 100755
index 000000000..e158a9874
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/link_olibs.sci
@@ -0,0 +1,104 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Alan Layec <alan.layec@inria.fr>   - 2007
+//                      - Allan CORNET - 2008
+//                      - Rachid Djenidi
+//                      - Simone Mannori
+//
+//  Copyright (C) DIGITEO - Allan CORNET - 2010
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+//**
+//------------------------------------------------------------------------
+//** link_olibs   : links otherlibs in scilab
+//                  for scicos C generated block
+//
+// Input : libs   : a matrix of string containing path + name
+//                 of the libraries
+//
+//         rpat   : a target directory for temporary generated files
+//
+// Output : ok    : a boolean variable to say if job has succed
+//          libs  : a matrix of string containing path + name
+//                  of the libraries
+//          for_link : a vector of strings with link cmd
+//                     for exec or for loader.sce
+//
+function [ok, libs, for_link] = link_olibs(libs,rpat)
+
+    //** get lhs,rhs nb paramaters
+    [lhs,rhs] = argn(0);
+
+    //** declare  and set local variables
+    ok = %t;
+    xlibs = [];
+    for_link = [],
+
+    //** get out from this function if
+    //   there is nothing to do
+    if ( (libs == "") | (libs == []) ) then return, end
+
+    for i = 1:size(libs, "*")
+        [_path, _name , _ext] = fileparts(libs(i));
+        dynlibname = _path + _name + getdynlibext();
+        if isfile(dynlibname) then
+            for_link = [for_link; dynlibname];
+            ierr = execstr("link(for_link($))","errcatch");
+            if ierr <> 0 then
+                messagebox(_("Cannot load dynamic library: ") + for_link($) ,"modal","error");
+                libs = [];
+                for_link = [];
+                ok = %f;
+                return
+            else
+                if getos() == "Windows" then
+                    xlibs = [xlibs; _path + _name + ".lib"];
+                else
+                    xlibs = [xlibs; libs(i)];
+                end
+            end
+        else
+            messagebox([_("Can''t include ") + dynlibname; _("This file does not exist"); lasterror()], "modal", "error");
+            libs = [];
+            for_link = [];
+            ok = %f;
+            return
+        end
+    end
+
+    //** add double quote for include in
+    //   Makefile
+    libs = xlibs;
+    if getos() == "Windows" then
+        libs = """" + libs + """";
+    else
+        libs = "''" + libs + "''";
+    end
+
+    //** return link cmd for for_link
+    if (for_link <> []) then
+        for_link = "link(""" + for_link + """);";
+    end
+
+    //** concatenate libs for Makefile
+    if (size(libs,1) <> 1) then
+        libs = strcat(libs," ");
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/lnkptrcomp.bin b/modules/scicos/macros/scicos_scicos/lnkptrcomp.bin
new file mode 100755
index 000000000..cfb81871f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/lnkptrcomp.bin
diff --git a/modules/scicos/macros/scicos_scicos/lnkptrcomp.sci b/modules/scicos/macros/scicos_scicos/lnkptrcomp.sci
new file mode 100755
index 000000000..08fa682f3
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/lnkptrcomp.sci
@@ -0,0 +1,50 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Alan Layec <alan.layec@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [lnksz,lnktyp]=lnkptrcomp(bllst,inpptr,outptr,inplnk,outlnk)
+
+    lnkbsz=[];ptlnk=[];lnksz=[];lnktyp=[];
+    for blkout=1:length(bllst)
+        for portout=1:outptr(blkout+1)-outptr(blkout)
+            ptlnk=outlnk(outptr(blkout)+portout-1)
+            lnkbsz(outlnk(outptr(blkout)+portout-1))=bllst(blkout).out(portout);
+            lnksz(ptlnk,1)=bllst(blkout).out(portout);
+            lnksz(ptlnk,2)=bllst(blkout).out2(portout);
+            lnktyp(ptlnk)=bllst(blkout).outtyp(portout);
+        end
+    end
+
+    //27/09/07 Alan's patch : do test here for unconnected inputs
+    if inplnk<>[] | outlnk<>[] then
+        unco=find(inplnk>max(outlnk))
+        for j=unco
+            m=max(find(inpptr<=j))
+            n=j-inpptr(m)+1
+            lnksz($+1,1)=bllst(m).in(n);
+            lnksz($,2)=bllst(m).in2(n);
+            lnktyp($+1)=bllst(m).intyp(n);
+        end
+    end
+
+    //lnkptr=cumsum([1;lnkbsz])
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/loadpallibs.bin b/modules/scicos/macros/scicos_scicos/loadpallibs.bin
new file mode 100755
index 000000000..593acde3c
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/loadpallibs.bin
diff --git a/modules/scicos/macros/scicos_scicos/loadpallibs.sci b/modules/scicos/macros/scicos_scicos/loadpallibs.sci
new file mode 100755
index 000000000..ce92620bf
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/loadpallibs.sci
@@ -0,0 +1,33 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function loadpallibs()
+    //to be called by exec(loadpallibs)
+    if ~(exists("scicos_pal_libs")) then
+        [modelica_libs, scicos_pal_libs, %scicos_with_grid, %scs_wgrid] = initial_scicos_tables();
+    end
+    for d = scicos_pal_libs
+        execstr(["if exists(''scs"+convstr(d)+"lib'')==0 then"
+        "  load(''SCI/modules/scicos_blocks/macros/"+d+"/lib'');"
+        "end"]);
+    end
+    clear d
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/mark_prt.bin b/modules/scicos/macros/scicos_scicos/mark_prt.bin
new file mode 100755
index 000000000..d03da6347
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/mark_prt.bin
diff --git a/modules/scicos/macros/scicos_scicos/mark_prt.sci b/modules/scicos/macros/scicos_scicos/mark_prt.sci
new file mode 100755
index 000000000..833244481
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/mark_prt.sci
@@ -0,0 +1,47 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function o=mark_prt(o,prt_number,inout,typ,v)
+    //mark a port of a block free or used
+    // o           : block data structure
+    // prt_number  : port number
+    // inout       : port orientation ('in' or 'out')
+    // typ         : port type
+    //               1  : standard port
+    //              -1  : event port
+    // v           : value to assign
+    //               k>0 : port is connected to link #k
+    //               0 : port is free
+
+    if inout=="out" then //set an output port
+        if typ==1 | typ==2 then  //standard (regular or implicit) port
+            o.graphics.pout(prt_number)=v;
+        else //clock port
+            o.graphics.peout(prt_number)=v;
+        end
+    else //set an input port
+        if typ==1 | typ==2 then  //standard (regular or implicit) port
+            o.graphics.pin(prt_number)=v;
+        else //clock port
+            o.graphics.pein(prt_number)=v;
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/message.bin b/modules/scicos/macros/scicos_scicos/message.bin
new file mode 100755
index 000000000..0a956bf59
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/message.bin
diff --git a/modules/scicos/macros/scicos_scicos/message.sci b/modules/scicos/macros/scicos_scicos/message.sci
new file mode 100755
index 000000000..65ee509f1
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/message.sci
@@ -0,0 +1,45 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function num=message(strings ,buttons, modal)
+    //interface to message primitive to allow simple overloading for live demo
+    [lhs,rhs]=argn(0)
+    if rhs==3 then
+        if modal == %t then
+            if buttons == "" then
+                num=messagebox(strings, "modal", "scilab");
+            else
+                num=messagebox(strings, "modal", "scilab", buttons);
+            end
+        else //non modal messagebox
+            if buttons == "" then
+                num=messagebox(strings,"scilab");
+            else
+                num=messagebox(strings, "scilab", buttons);
+            end
+        end
+    elseif rhs==2 then
+        num=messagebox(strings, "modal", "scilab", buttons);
+    else
+        num=1
+        messagebox(strings, "modal", "scilab");
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/mfrequ_clk.bin b/modules/scicos/macros/scicos_scicos/mfrequ_clk.bin
new file mode 100755
index 000000000..e08a6b0c0
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/mfrequ_clk.bin
diff --git a/modules/scicos/macros/scicos_scicos/mfrequ_clk.sci b/modules/scicos/macros/scicos_scicos/mfrequ_clk.sci
new file mode 100755
index 000000000..ee372f990
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/mfrequ_clk.sci
@@ -0,0 +1,104 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function [m,den,off,count,m1,fir,frequ,offset,ok]=mfrequ_clk(frequ,offset)
+    // copyright: INRIA
+    // Anthor: Fady NASSIF
+    // Date: 2007-2008
+    m=[];den=[];off=[];count=[];m1=[];fir=[];
+    v=[frequ;offset];
+    v=v(find(v<>0));
+    min_v=min(v);max_v=max(v);
+    if (max_v/min_v)>1e5 then message(["The difference between the frequencies is very large";..
+        "the clocks could not be synchronized"]);
+        ok=%f;
+        return;
+    end
+    // we call this function to get the least common denominator.
+    [pgcd,den]=fixedpointgcd(v);//find the pgcd and the common denominator of the vector v
+    [m1,k]=uni(frequ,offset); // m1 is a vector of different frequencies or same frequencies with different offsets
+    // k is the index.
+    frequ=frequ(k);  // delete the dupplicated frequencies.
+    frd1=uint32(round((frequ.*double(den)))); // this will be used to construct the counter of the simulation.
+    ppcm=lcm(frd1); // find the least common multiple of the frequencies.
+    frd1=double(frd1);
+    offset=offset(k); // delete the dupplicated offset.
+    //constructing the first element of the opar of the m_frequ block.
+    // the first column contains the delay.
+    // the second element contains the event output number to activate.
+    // the third column contains the time.
+    if size(frequ,"*")>1 then   // more than one frequency
+        mat=[];
+        for i=1:size(frequ,"*")
+            mat1=[offset(i)*den:frd1(i):double(ppcm)]';// for each frequency
+            mat=[mat;[mat1 2^(i-1)*ones(size(mat1,"*"),1)]]; // contains the frequency and the corresponding output.
+        end
+        [n,k]=gsort(mat(:,1),"g","i");
+        mat=mat(k,:);  // sorting the mat matrix (increasingly).
+        // if two outputs are called at the same time they are replaced by an other output; the intersection of the two.
+        if size(mat,1)>10000 then
+            num=messagebox(["Warning: Your system is too hard to synchronize it will take some time";
+            "And the stacksize has to be increase";
+            " A scilab crash may occur";
+            "Do You want me to continue?"],"modal",["No","Yes"])
+            if num==1 then
+                ok=%f;
+                return
+            end
+        end
+        vv=mat(2:$,1)-mat(1:$-1,1);
+        vv=[1;vv;1];
+        kkk=find(vv(:)==0);
+        kk=find(vv);
+        for i=1:size(kk,2)-1
+            mat(kk(i),2)=sum(mat(kk(i):kk(i+1)-1,2));
+        end
+        mat(kkk(:),:)=[];
+
+        //constructing the first element of opar
+        m=[mat(1,1);mat(2:$,1)-mat(1:$-1,1)]; //contains the first element of the chain and the delay.
+        last_delay=double(ppcm)-mat($,1)+mat(1,1)  // finding the last delay.
+        // In other world finding the delay between the last element
+        // and the first element of mat. So we can have a cycle.
+        if last_delay<>0 then   // all the offset are different from 0.
+            m($+1)=last_delay  // we add the last delay to m.
+            m=[m,[mat(:,2);mat(1,2)],[mat(:,1);double(ppcm)+mat(1,1)]]  // the event output for the last element
+            // will be equal to the first one.
+            // the time will be the lcm+the delay of the first element
+        else     // there is at least one offset that is equal to 0.
+            m=[m,mat(:,2),mat(:,1)];  // we don't have to add the last delay because in this case it will be equal to 0.
+        end
+        count=int32(m(1,1));   // we put the first element of the matrix in a variable that will initialise the counter.
+        m(1,:)=[];    // we delete the first row of the matrix. the delay is conserv in the variable count.
+        mn=(2**size(m1,"*"))-1;  // find the number of event output.
+        fir=-ones(1,mn);  // put all the element of the firing to -1
+        fir(mat(1,2))=mat(1,1)/double(den);// programming the corresponding event output
+        // by the first element of the matrix mat.(first delay).
+        off=0;  // the offset in this case will be equal to 0 because it is implemented in the calculation
+        // of the delay.
+    else
+        // case of one frequency
+        m=[frd1 1 frd1];  // put the delay in the matrix. the delay will be equal to the one frequency.
+        count=int32(0);   //  the counter will begin by 0.
+        mat=m;
+        off=offset;       // the offset is put in the variable off. used by the simulator.
+        fir=off;          // program the event output of the block by the corresponding offset.
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/modelica.bin b/modules/scicos/macros/scicos_scicos/modelica.bin
new file mode 100755
index 000000000..4242d7b87
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/modelica.bin
diff --git a/modules/scicos/macros/scicos_scicos/modelica.sci b/modules/scicos/macros/scicos_scicos/modelica.sci
new file mode 100755
index 000000000..ac21e626e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/modelica.sci
@@ -0,0 +1,31 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function mo=modelica(v1,v2,v3,v4)
+
+    if exists("model","local")==0 then model=[], end
+    if exists("inputs","local")==0 then inputs=[], end
+    if exists("outputs","local")==0 then outputs=[], end
+    if exists("parameters","local")==0 then parameters=list([],list()), end
+
+    mo=tlist(["modelica","model","inputs","outputs","parameters"],...
+    model,inputs,outputs,parameters)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/modelicac.bin b/modules/scicos/macros/scicos_scicos/modelicac.bin
new file mode 100755
index 000000000..355e3ed21
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/modelicac.bin
diff --git a/modules/scicos/macros/scicos_scicos/modelicac.sci b/modules/scicos/macros/scicos_scicos/modelicac.sci
new file mode 100755
index 000000000..67fd4ced5
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/modelicac.sci
@@ -0,0 +1,79 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function  ok = modelicac(Flat, Flat_functions, xmlfileTMP, Jacobian, Cfile, with_gui, init)
+    //Scilab interface with external tool modelicac
+
+    MODELICAC_FILENAME = "modelicac";
+    if getos() == "Windows" then
+        MODELICAC_FILENAME = MODELICAC_FILENAME + ".exe";
+    end
+
+    if argn(2) < 7 then init = %f,end
+    incidence = "";
+    tmpdir = pathconvert(TMPDIR, %t, %t);  //for error log and  shell scripts
+    xmlfileTMP = pathconvert(xmlfileTMP, %f, %t);
+    Cfile = pathconvert(Cfile, %f, %t);
+
+    if fileinfo(Flat_functions) == [] then
+        Flat_functions = " ";
+    else
+        Flat_functions = """" + Flat_functions + """";
+    end
+
+    if ( (with_gui) & (fileinfo(xmlfileTMP) <> []) ) then // if GUI is running
+        XMLfiles = " -with-init-in """ + strsubst(xmlfileTMP, "\", "/") + """ -with-init-out """ + strsubst(xmlfileTMP,"\","/") + """";
+    else
+        XMLfiles = "";
+    end
+
+    exe = """" + pathconvert(getmodelicacpath() + MODELICAC_FILENAME, %f, %t) + """";
+
+    Flat = """" + Flat + """";
+    out = "-o """ + Cfile + """";
+
+    if Jacobian then
+        JAC = " -jac ";
+    else
+        JAC="";
+    end
+
+    instr = strcat([exe, Flat, Flat_functions, XMLfiles, out, JAC], " ");
+
+    if getos() == "Windows" then
+        if init then
+            mputl(instr,tmpdir+"igenm.bat");
+            instr = tmpdir + "igenm.bat";
+        else
+            mputl(instr, tmpdir + "genm2.bat");
+            instr = tmpdir + "genm2.bat";
+        end
+    end
+
+    [rep,stat,err]=unix_g(instr);
+    if stat <> 0 then
+        messagebox(err, _("Modelica compiler"), "error", "modal");
+        ok=%f;
+        return
+    end
+
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/modipar.bin b/modules/scicos/macros/scicos_scicos/modipar.bin
new file mode 100755
index 000000000..ed504b1e9
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/modipar.bin
diff --git a/modules/scicos/macros/scicos_scicos/modipar.sci b/modules/scicos/macros/scicos_scicos/modipar.sci
new file mode 100755
index 000000000..bbdf7d65a
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/modipar.sci
@@ -0,0 +1,304 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [%state0,state,sim,ok]=modipar(newparameters,%state0,state,sim,scs_m,cor)
+    //store modified parameters in compiled structure state,sim
+    //newparameters gives modified blocks numbers in original structure scs_m
+    //cor is the correspondance table from original structure to compiled one
+    xptr=sim.xptr
+    zptr=sim.zptr
+    ozptr=sim.ozptr
+    rpptr=sim.rpptr
+    ipptr=sim.ipptr
+    opptr=sim.opptr
+    ipar=sim.ipar
+    rpar=sim.rpar
+    opar=sim.opar
+    ztyp=sim.ztyp
+    labels=sim.labels
+    st=state.x
+    dst=state.z
+    odst=state.oz
+    st0=%state0.x
+    dst0=%state0.z
+    odst0=%state0.oz
+
+    Impl=%f
+    if xptr($)-1 < size(st,"*") then
+        std=st($/2+1:$)
+        st=st(1:$/2)
+        std0=st0($/2+1:$)
+        st0=st0(1:$/2)
+        Impl=%t
+    end
+
+    nb=prod(size(rpptr))-1
+    for k=newparameters
+        if prod(size(k))==1 then //parameter of a simple block
+            kc=cor(k) //index of modified block in compiled structure
+            o=scs_m.objs(k)
+        else
+            kc=get_tree_elt(cor,k);
+            o=scs_m(get_subobj_path(k))
+        end
+        if is_modelica_block(o) then
+            parameters=o.model.equations.parameters
+            rpark=[];for p=parameters(2),rpark=[rpark;p(:)];end
+            ipark=ipar(ipptr(kc):ipptr(kc+1)-1)
+            corinvm=%cpr.corinv(kc);
+            J=[];
+            if findinlistcmd(%cpr.corinv,size(cor),">")<>list() then ok=%f;return; end
+            //if %cpr.corinv(kc-1)>size(cor) then ok=%f;return;end
+            for jj=1:size(corinvm)
+                if and(corinvm(jj)==k)  then J=jj;break,end
+            end
+            nek=size(rpark,"*")-(ipark(J+1)-ipark(J))
+            if nek<>0 then
+                warning("variying number of parameter for modelica block is not yet implemented")
+            end
+            rpar(rpptr(kc)+ipark(J)-1:rpptr(kc)+ipark(J+1)-2)=rpark
+        else
+            statekd=[]
+            om=o.model
+            [fun,statek,dstatek,odstatek,rpark,ipark,opark]=...
+            (om.sim,om.state,om.dstate,om.odstate,om.rpar,om.ipar,om.opar);
+            if type(fun)==15 then
+                if (fun(2)==3 | fun(2)==5 |  fun(2)==10005) then
+                    if rpark<>[] then rpark=var2vec(rpark); end
+                    if dstatek<>[] then dstatek=var2vec(dstatek),end
+                end
+                if fun(2)>10000 then
+                    statekd=statek($/2+1:$)
+                    statek=statek(1:$/2)
+                end
+            end
+
+            if kc>0 then
+                //Change continuous state
+                nek=prod(size(statek))-(xptr(kc+1)-xptr(kc))
+                sel=xptr(kc+1):xptr($)-1
+                if nek<>0&sel<>[] then
+                    st(nek+sel)=st(sel)
+                    st0(nek+sel)=st0(sel)
+                    if Impl then
+                        std(nek+sel)=std(sel)
+                        std0(nek+sel)=std0(sel)
+                    end
+                end
+
+                if nek<0 then
+                    st($+nek+1:$)=[],st0($+nek+1:$)=[],
+                    if Impl then std($+nek+1:$)=[],std0($+nek+1:$)=[],end
+                end
+
+                xptr(kc+1:$)=xptr(kc+1:$)+nek
+                st(xptr(kc):xptr(kc+1)-1)=statek(:),
+                st0(xptr(kc):xptr(kc+1)-1)=statek(:),
+                if Impl then
+                    if statekd==[] then statekd=0*statek,end
+                    std(xptr(kc):xptr(kc+1)-1)=statekd(:),
+                    std0(xptr(kc):xptr(kc+1)-1)=statekd(:),
+                end
+
+                //Change discrete state
+                nek=prod(size(dstatek))-(zptr(kc+1)-zptr(kc))
+                sel=zptr(kc+1):zptr($)-1
+                if nek<>0&sel<>[] then
+                    dst(nek+sel)=dst(sel)
+                    dst0(nek+sel)=dst0(sel)
+                end
+
+                if nek<0 then
+                    dst($+nek+1:$)=[],dst0($+nek+1:$)=[],
+                end
+
+                zptr(kc+1:$)=zptr(kc+1:$)+nek
+                dst(zptr(kc):zptr(kc+1)-1)=dstatek(:)
+                dst0(zptr(kc):zptr(kc+1)-1)=dstatek(:)
+
+                //Change objects discrete state
+                if ((type(odstatek)<>15) | ...
+                    (type(fun)<>15)) then //old sci blocks or odstatek not a list
+                    nek=-(ozptr(kc+1)-ozptr(kc))
+                elseif ((fun(2)==5) | (fun(2)==10005)) then // sciblocks type 5 | 10005
+                    if lstsize(odstatek)>0 then
+                        nek=1-(ozptr(kc+1)-ozptr(kc)) //nombre d'états supplémentaires
+                    else
+                        nek=-(ozptr(kc+1)-ozptr(kc))
+                    end
+                elseif ((fun(2)==4) | (fun(2)==10004) | (fun(2)==2004)) then // C blocks type 4 | 10004
+                    nek=lstsize(odstatek)-(ozptr(kc+1)-ozptr(kc))
+                else // other C and sci blocks
+                    nek=-(ozptr(kc+1)-ozptr(kc))
+                end
+                sel=ozptr(kc+1):ozptr($)-1
+
+                if nek<>0&sel<>[] then
+                    while lstsize(odst)<max(nek+sel), odst($+1)=[], end
+                    while lstsize(odst0)<max(nek+sel), odst0($+1)=[], end
+                    if nek>0 then sel=gsort(sel), end
+                    for j=sel
+                        odst(j+nek)=odst(j)
+                        odst0(j+nek)=odst0(j)
+                    end
+                end
+                ozptr(kc+1:$)=ozptr(kc+1:$)+nek;
+
+                if ((type(odstatek)==15) & (type(fun)==15)) then
+                    if ((fun(2)==5) | (fun(2)==10005)) then // sciblocks
+                        if lstsize(odstatek)>0 then
+                            odst(ozptr(kc))=odstatek;
+                            odst0(ozptr(kc))=odstatek;
+                        end
+                    elseif ((fun(2)==4) | (fun(2)==10004) | (fun(2)==2004)) then  // C blocks
+                        for j=1:lstsize(odstatek)
+                            odst(ozptr(kc)+j-1)=odstatek(j);
+                            odst0(ozptr(kc)+j-1)=odstatek(j);
+                        end
+                    end
+                end
+
+                //## rebuild odst list if nek < 0
+                if nek < 0 then
+                    n_odst = list(); n_odst0 = list();
+                    for j=1:max(ozptr)-1
+                        n_odst(j)=odst(j);
+                        n_odst0(j)=odst0(j);
+                    end
+                    odst = n_odst; odst0 = n_odst0;
+                    clear n_odst; clear n_odst0;
+                end
+
+                //Change real parameters
+                nek=prod(size(rpark))-(rpptr(kc+1)-rpptr(kc))
+                sel=rpptr(kc+1):rpptr($)-1
+                if nek<>0&sel<>[] then
+                    rpar(nek+sel)=rpar(sel)
+                end
+
+                if nek<0 then
+                    rpar($+nek+1:$)=[]
+                end
+
+                rpptr(kc+1:$)=rpptr(kc+1:$)+nek
+                rpar(rpptr(kc):rpptr(kc+1)-1)=rpark(:),
+
+                //Change integer parameters
+                if type(ipark)==1 then   //scifunc
+                    nek=prod(size(ipark))-(ipptr(kc+1)-ipptr(kc))
+                    sel=ipptr(kc+1):ipptr($)-1
+                    if nek<>0&sel<>[] then
+                        ipar(nek+sel)=ipar(sel)
+                    end
+
+                    if nek<0 then
+                        ipar($+nek+1:$)=[]
+                    end
+
+                    ipptr(kc+1:$)=ipptr(kc+1:$)+nek
+                    ipar(ipptr(kc):ipptr(kc+1)-1)=ipark(:),
+                end
+                //Change objects parameters
+                if ((type(opark)<>15) | ...
+                    (type(fun)<>15)) then //old sci blocks or odstatek not a list
+                    nek=-(opptr(kc+1)-opptr(kc))
+                elseif ((fun(2)==5) | (fun(2)==10005)) then // sciblocks
+                    if lstsize(opark)>0 then
+                        nek=1-(opptr(kc+1)-opptr(kc)) //nombre de paramï¿½tres supplï¿½mentaires
+                    else
+                        nek=-(opptr(kc+1)-opptr(kc))
+                    end
+                elseif ((fun(2)==4) | (fun(2)==10004) | (fun(2)==2004)) then //C blocks
+                    nek=lstsize(opark)-(opptr(kc+1)-opptr(kc))
+                else // other C and sci blocks
+                    nek=-(opptr(kc+1)-opptr(kc))
+                end
+                sel=opptr(kc+1):opptr($)-1
+                if nek<>0&sel<>[] then
+                    while lstsize(opar)<max(nek+sel), opar($+1)=[], end
+                    if nek>0 then sel=gsort(sel), end
+                    for j=sel, opar(j+nek)=opar(j); end
+                end
+                opptr(kc+1:$)=opptr(kc+1:$)+nek;
+                if ((type(opark)==15) & (type(fun)==15)) then
+                    if ((fun(2)==5) | (fun(2)==10005)) then // sciblocks
+                        if lstsize(opark)>0 then
+                            opar(opptr(kc))=opark;
+                        end
+                    elseif ((fun(2)==4) | (fun(2)==10004) | (fun(2)==2004)) then //C blocks
+                        for j=1:lstsize(opark), opar(opptr(kc)+j-1)=opark(j), end
+                    end
+                end
+                //## rebuild opar list if nek < 0
+                if nek < 0 then
+                    n_opar = list();
+                    for j=1:max(opptr)-1
+                        n_opar(j)=opar(j);
+                    end
+                    opar = n_opar;
+                    clear n_opar;
+                end
+
+
+                //Change simulation routine
+                if type(sim("funs")(kc))<>13 then   //scifunc
+                    sim("funs")(kc)=fun(1);
+                    if prod(size(fun))> 1 then
+                        sim("funtyp")(kc)=fun(2);
+                    else
+                        sim("funtyp")(kc)==0;
+                    end
+                end
+
+                //Change label
+                labels(kc)=o.model.label
+            end
+        end
+    end
+
+    sim.xptr=xptr
+    sim.zptr=zptr
+    sim.ozptr=ozptr
+    sim.rpar=rpar
+    sim.rpptr=rpptr
+    sim.ipar=ipar
+    sim.ipptr=ipptr
+    sim.opar=opar
+    sim.opptr=opptr
+    sim.labels=labels
+
+    if Impl then
+        state.x=[st;std]
+    else
+        state.x=st
+    end
+
+    state.z=dst
+    state.oz=odst
+    if Impl then
+        %state0.x=[st0;std0]
+    else
+        %state0.x=st0
+    end
+    %state0.z=dst0
+    %state0.oz=odst0
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/names b/modules/scicos/macros/scicos_scicos/names
new file mode 100755
index 000000000..93868a63f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/names
@@ -0,0 +1,126 @@
+%Block_e
+%Block_p
+%b_i_graphics
+%b_i_model
+%c_i_block
+%c_i_graphics
+%c_i_model
+%debug_scicos
+%diagram_p
+%graphics_e
+%graphics_i_Block
+%graphics_p
+%l_i_block
+%l_i_graphics
+%l_i_model
+%model_e
+%model_i_Block
+%model_p
+%params_p
+%s_i_block
+%s_i_graphics
+%s_i_model
+CC4
+CFORTR
+CFORTR2
+Compute_cic
+FORTR
+Link_modelica_C
+MODCOM
+adjust
+adjust_in2out2
+bad_connection
+build_block
+build_modelica_block
+buildnewblock
+c_pass1
+c_pass2
+c_pass3
+check_io
+check_mac
+compile_init_modelica
+compile_modelica
+context_evstr
+cos2cosf
+countblocks
+create_modelica
+default_color
+default_options
+delete_unconnected
+dialog
+dig_bound_compound
+do_compile
+do_compile_superblock42
+do_delete1
+do_eval
+do_purge
+do_terminate
+do_update
+do_version
+extract_implicit
+findinlist
+findinlistcmd
+gen_modelica
+genfunc
+genfunc1
+genfunc2
+genmac
+get2index
+get_connected
+get_dynamic_lib_dir
+get_errorcmd
+get_model_name
+get_subobj_path
+get_tree_elt
+getmodelicacpath
+global_case
+haltscicos
+hilite_path
+init_agenda
+is_modelica_block
+link_olibs
+lnkptrcomp
+loadpallibs
+mark_prt
+message
+mfrequ_clk
+modelica
+modelicac
+modipar
+reading_incidence
+recur_scicos_block_link
+sample_clk
+scicos_block
+scicos_block_link
+scicos_cpr
+scicos_diagram
+scicos_flat
+scicos_graphics
+scicos_include_paths
+scicos_link
+scicos_model
+scicos_params
+scicos_sim
+scicos_state
+scicos_txtedit
+script2var
+scs_full_path
+scs_show
+scstxtedit
+set_io
+setvalue
+shiftcors
+split_lasterror
+standard_define
+standard_draw
+standard_draw_ports
+standard_draw_ports_up
+standard_inputs
+standard_origin
+standard_outputs
+translator
+update_scs_m
+update_version
+validvar
+value2modelica
+xml2modelica
diff --git a/modules/scicos/macros/scicos_scicos/reading_incidence.bin b/modules/scicos/macros/scicos_scicos/reading_incidence.bin
new file mode 100755
index 000000000..33bc93d39
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/reading_incidence.bin
diff --git a/modules/scicos/macros/scicos_scicos/reading_incidence.sci b/modules/scicos/macros/scicos_scicos/reading_incidence.sci
new file mode 100755
index 000000000..c989429f1
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/reading_incidence.sci
@@ -0,0 +1,128 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function [nipar,nrpar,nopar,nz,nx,nx_der,nx_ns,nin,nout,nm,ng,dep_u]=reading_incidence(incidence)
+    // this function creates the matrix dep_u given by the xml format.
+    // It is used for modelica compiler.
+    // number of lines represents the number of input, number of columns represents the number of outputs.
+    // Fady 02/09/08
+    xmlformat=mgetl(incidence);
+    typ=[];input_name=[];order=[];depend=[];
+    global txtline;txtline=0;
+    corresp_table=["<number_of_integer_parameters","nipar";
+    "<number_of_real_parameters","nrpar";
+    "<number_of_string_parameters","nopar";
+    "<number_of_discrete_variables","nz";
+    "<number_of_continuous_states","nx_der";
+    "<number_of_continuous_variables","nx_ns";
+    "<number_of_continuous_unknowns","nx";
+    "<number_of_inputs","nin";
+    "<number_of_outputs","nout";
+    "<number_of_modes","nm";
+    "<number_of_zero_crossings","ng"]
+    while and(typ<>"</model") do
+        typ=get_typ(xmlformat);
+        if typ(1)=="<model_info" then
+            typ=get_typ(xmlformat);
+            while typ(1)<>"</model_info" do
+                val=corresp_table(find(corresp_table==typ(1)),2)
+                ttyp=tokens(typ(2),"<");
+                execstr(val+"="+ttyp(1)+";");
+                typ=get_typ(xmlformat);
+            end
+        elseif typ(1)=="<identifiers" then
+            while typ(1)<>"</identifiers"
+                typ=get_typ(xmlformat);
+                if typ(1)=="<input" then
+                    ttyp=tokens(typ(2),"<");
+                    input_name=[input_name;ttyp(1)];
+                end
+            end
+        elseif typ(1)=="<outputs" then
+            while typ(1)<>"</outputs" do
+                typ=get_typ(xmlformat);
+                if typ(1)=="<output" then
+                    while typ(1)<>"</output" do
+                        typ=get_typ(xmlformat);
+                        if typ(1)=="<order" then
+                            ttyp=tokens(typ(2),"<");
+                            ord=evstr(ttyp(1));
+                        elseif typ(1)=="<dependencies"
+                            dep_flag=%f;
+                            while typ(1)<>"</dependencies" then
+                                typ=get_typ(xmlformat);
+                                if typ(1)=="<input" then
+                                    dep_flag=%t;
+                                    ttyp=tokens(typ(2),"<");
+                                    depend=[depend;ttyp(1)];
+                                    order=[order;ord];
+                                end
+                            end
+                            if ~dep_flag then
+                                order=[order;ord]
+                                depend=[depend;"NAN"];
+                            end
+                        end
+                    end
+                end
+            end
+        end
+    end
+    clearglobal txtline;
+    //  if depend<>[] then
+    //    dep_u=(ones(size(input_name,'*'),size(unique(depend),'*'))==zeros(size(input_name,'*'),size(unique(depend),'*')))
+    //  else
+    //    dep_u=%f
+    //  end
+    //  ind=find(depend=='NAN')
+    //  depend(ind(:))=[];
+    //  order(ind(:))=[];
+    //  for i=1:size(depend,'*')
+    //    in_num=find(input_name==depend(i));
+    //    dep_u(in_num,order(i)+1)=%t;
+    //  end
+
+    nu=size(input_name,"*");
+    dep_u=ones(1,nu)==zeros(1,nu);
+    for i=1:nu
+        if find(depend==input_name(i))==[] then
+            dep_u(1,i)=%f;
+        else
+            dep_u(1,i)=%t;
+        end
+    end
+    // remind taht inputs are numbered according to their position in the
+    // diagram and not in the Modelica block.InPutPortx.viis the x-th
+    // input in the whole diagram!
+
+endfunction
+
+
+function t=read_new_line(txt)
+    global txtline
+    txtline=txtline+1;
+    t=txt(txtline)
+endfunction
+
+function typ=get_typ(txt)
+    t=read_new_line(txt);
+    typ=tokens(t);
+    typ=tokens(typ(1),">");
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.bin b/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.bin
new file mode 100755
index 000000000..f7c2dfdfe
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.bin
diff --git a/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.sci b/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.sci
new file mode 100755
index 000000000..032d01a17
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.sci
@@ -0,0 +1,79 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function [model,ok]=recur_scicos_block_link(o,flag)
+    // Copyright INRIA
+    model=o.model;ok=%t;
+    if or(o.model.sim(1)==["super","csuper","asuper"]) then
+        obj=o.model.rpar;
+        for i=1:size(obj.objs)
+            o1=obj.objs(i);
+            if typeof(o1)=="Block"
+
+                if (or(o1.model.sim(1)==["super","csuper","asuper"])) then
+                    [model,ok]=recur_scicos_block_link(o1,flag)
+                    if ~ok then return; end
+                elseif type(o1.model.sim)==15
+                    if or(int(o1.model.sim(2)/1000)==[1,2]) then
+                        model=o1.model
+                        funam=o1.model.sim(1)
+                        if ~c_link(funam) then
+                            tt=o1.graphics.exprs(2)
+                            mputl(tt,TMPDIR+"/"+funam+".c")
+                            ok=buildnewblock(funam,funam,"","","",TMPDIR,"","")
+                            if ~ok then return; end
+                        end
+                    end
+                end
+            end
+        end
+        if o.model.sim(1)=="asuper" then
+            model=o.graphics.exprs(3)
+            funam=model.sim(1)
+            if ~c_link(funam) then
+                if size(o.graphics.exprs)==4 then
+                    if type(o.graphics.exprs(4))==15 then
+                        intern_funam=o.graphics.exprs(4)(2);
+                        if ~c_link(intern_funam) then
+                            tt=o.graphics.exprs(4)(1);
+                            mputl(tt,TMPDIR+"/"+intern_funam+"."+flag)
+                            ok=buildnewblock(intern_funam,intern_funam,"","","",TMPDIR,"","")
+                            if ~ok then return; end
+                        end
+                    end
+                end
+                tt=o.graphics.exprs(2)
+                mputl(tt,TMPDIR+"/"+funam+".c")
+                ok=buildnewblock(funam,funam,"","","",TMPDIR,"","")
+                if ~ok then return; end
+            end
+        end
+    elseif or(int(o.model.sim(2)/1000)==[1,2]) then
+        model=o.model
+        funam=o.model.sim(1)
+        if ~c_link(funam) then
+            tt=o.graphics.exprs(2)
+            mputl(tt,TMPDIR+"/"+funam+".c")
+            ok=buildnewblock(funam,funam,"","","",TMPDIR,"","")
+            if ~ok then return; end
+        end
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/sample_clk.bin b/modules/scicos/macros/scicos_scicos/sample_clk.bin
new file mode 100755
index 000000000..45144859d
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/sample_clk.bin
diff --git a/modules/scicos/macros/scicos_scicos/sample_clk.sci b/modules/scicos/macros/scicos_scicos/sample_clk.sci
new file mode 100755
index 000000000..0a7ad3c37
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/sample_clk.sci
@@ -0,0 +1,295 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [Ts,bllst,corinv,indout,ok,scs_m,flgcdgen,freof]=sample_clk(MAT,Ts,bllst,corinv,scs_m,indout,flgcdgen)
+
+    // This function takes care of the synchronize clocks.
+    // Two ways are used for that calculation.
+    // the first one uses a fast clock connected to a counter which is connected to an event select.
+    // This method used the two functions clock_major and update_diag. It is used for the moment in the code generation
+    // and it may be used in the future in the atomics blocks.
+    // The second method generates an event at a specific time using the multifrequency block.
+    // It uses the s_clk2 function. it is used in the compilation of all the diagram.
+    // The compilation using the second method is faster than using the first one but the first method generates periodic events.
+    // Fady NASSIF 2008. Copyright INRIA.
+
+    //input: -MAT: a M*5 matrix. This matrix is the sco_mat given by the scicos_flat function.
+    //             When the fifth column is equal to '4' then the corresponding block is the SampleCLK block.
+    //       -Ts: the links_table given by th scicos_flat function.
+    //	 -bllst: block list.same definition as in c_pass1.
+    //	 -corinv: same definition as in c_pass1.
+    //	 -scs_m: diagram
+    //	 -indout: index used in c_pass1 to separate modelica blocks from regular blocks.
+    //	 -flgcdgen: -1 when the function is not called by the code generation
+    //	 	    it takes the number of event input of the superblock when it is called under the code generation.
+    //
+    // This part can be used in the next version to choose between the two methods.
+    // ------------
+    //   [num]=x_choose(['event select';'multiple frequency'],..
+    //                    ["You have to choose a method for the sample time computation:";..
+    //                     "The first method is a periodic synchronize system";..
+    //                     "it uses the event select block to generate events"; "at every clock time (regular period)";..
+    //                     "The number of outputs is equal to the least common"; "multiple of the input frequencies ";..
+    //                     "The second method uses the multi-frequency block";..
+    //                     "it generates an event only on the used time";..
+    //                     "The default value is select method"])
+    //num=scs_m.props.tol(8)
+    //the test will be done on num and not on the flgcdgen
+    //---------------------------------------------------------------------
+
+    if flgcdgen==-1 then
+        [Ts,bllst,corinv,indout,ok]=s_clk2(MAT,Ts,bllst,corinv,scs_m,indout)
+    else
+        [frequ,offset,freqdiv,den,flg,ok]=clock_major(MAT)
+        if ok then
+            [Ts,corinv,bllst,indout,ok,scs_m,flgcdgen,freof]=update_diag(scs_m,corinv,Ts,frequ,offset,freqdiv,bllst,den,flg,indout,flgcdgen)
+        end
+    end
+endfunction
+
+function [frequ,offset,freqdiv,den,flg,ok]=clock_major(MAT)
+
+    // this function calculates the frequency and the offset of the fastest clock
+    //modification to support double
+    // output parameters:	-frequ:   the frequency of the major clock.
+    //		    	-offset:  the offset of the major clock.
+    //			-freqdiv: A vector containing the frequencies of all the SampleClk multiplied by the common denominator.
+    //			-den: The common denominator.
+    //			-flg: 0 if there is one frequency and one offset
+    //			      1 else case.
+    //			-ok: flag for error.
+
+    ok=%t;
+    flg=1;
+    index=find(MAT(:,5)==string(4));
+    if index<>[] then
+        freq1=evstr(MAT(index,3));
+        offset1=evstr(MAT(index,4));
+    end
+    freqdiv=unique(freq1);
+    if size(unique(offset1),"*")==1 then  // case of one offset
+        if size(freqdiv,"*")==1 then flg=0;end // case of one offset and one frequency.
+        v=freq1;
+        v=v(find(v<>0));
+        min_v=min(v);max_v=max(v);
+        if (max_v/min_v)>1e5 then messagebox(["The difference between the frequencies is very large";..
+            "the clocks could not be synchronized"],"modal");
+            ok=%f;Ts=[];bllst=[];corinv=list();indout=[];
+            return;
+        end
+        [frequ,den]=fixedpointgcd(v); //computing the pgcd of the frequencies
+        offset=offset1(1);
+    else // case of multiple offset
+        v=[freq1;offset1]
+        v=v(find(v<>0));
+        min_v=min(v);max_v=max(v);
+        if (max_v/min_v)>1e5 then messagebox(["The difference between the frequencies is very large";..
+            "the clocks could not be synchronized"],"modal");
+            ok=%f;Ts=[];bllst=[];corinv=list();indout=[];
+            return;
+        end
+        [frequ,den]=fixedpointgcd(v);//computes the pgcd of the frequencies and the offsets.
+        offset=0;
+    end
+    freqdiv=uint32(freqdiv*double(den));
+    frequ=double(frequ)/double(den);
+    if frequ==[] then frequ=0;end
+    if offset==[] then offset=0; end
+    if (offset > frequ) then
+        offset=modulo(offset,frequ)
+        if (offset~=0) then ok=%f; end
+    end
+endfunction
+
+function [Ts,corinv,bllst,indout,ok,scs_m,flgcdgen,freof]=update_diag(scs_m,corinv,Ts,frequ,offset,freqdiv,bllst,den,flg,indout,flgcdgen)
+    //modification to support double
+    ok=%t
+    n=lstsize(scs_m.objs)
+
+    // when the function is called by the code generator we add an input event to the diagram
+    // the major clock will be put outside the superblock. it will be explicitly drawn.
+    // In the other case the major clock will be implicitly used in the diagram.
+
+    if flgcdgen<>-1 then // when the function is called by the codegeneration.
+        flgcdgen=flgcdgen+1 	// the flgcdgen contains the number of event input.
+        // we incremented to be able to add the sampleclk to the diagram at the end
+        // Adding the event input block.
+        bllst($+1)=scicos_model(sim=list("bidon",0),in=[],in2=[],intyp=1,out=[],out2=[],..
+        outtyp=1,evtin=[],evtout=1,state=[],dstate=[],odstate=list(),..
+        rpar=[],ipar=flgcdgen,opar=list(),blocktype="d",firing=-1,..
+        dep_ut=[%f,%f],label="",nzcross=0,nmode=0,equations=list());
+        freof=[frequ;offset];
+        // Drawing the block in the scs_m
+        blk=CLKINV_f("define");
+        blk.gui="EVTGEN_f";
+        blk.model.ipar=flgcdgen;
+        blk.model.sim(1)="bidon";
+        blk.graphics.exprs=sci2exp(flgcdgen);
+        blk.graphics.sz=[20 30];
+        blk.graphics.peout=20
+        scs_m.objs($+1)=blk
+    else
+        bllst($+1)=scicos_model(sim=list("evtdly4",4),in=[],in2=[],intyp=1,out=[],out2=[],..
+        outtyp=1,evtin=1,evtout=1,state=[],dstate=[],odstate=list(),..
+        rpar=[frequ;offset],ipar=[],opar=list(),blocktype="d",firing=offset,..
+        dep_ut=[%f,%f],label="",nzcross=0,nmode=0,equations=list());
+        scs_m.objs(n+1)=EVTDLY_c("define");
+        scs_m.objs(n+1).model.rpar=[frequ;offset];
+        scs_m.objs(n+1).model.firing=offset;
+        freof=[frequ;offset];
+    end
+    corinv($+1)=n+1
+    nb=size(corinv)
+    nc=size(bllst);
+    // nb and nc defers in the diagrams that contains modelicas blocks.
+    indout($+1)=nc;
+    if flgcdgen==-1 then
+        // linking the output of the evtdly to its input.
+        Ts($+1:$+2,:)=[nb 1 -1 -1;..
+        nb 1 1  -1]
+    end
+    if flg then //more then one frequency or offset
+
+        nn=lcm(freqdiv);
+        nn=double(nn)/(frequ*(double(den)));// the number of output of the event select block
+        //Adding the counter to the block list.
+        bllst($+1)=scicos_model(sim=list("counter",4),in=[],in2=[],intyp=1,out=1,out2=1,..
+        outtyp=1,evtin=1,evtout=[],state=[],dstate=0,odstate=list(),..
+        rpar=[],ipar=[1;double(nn);1],opar=list(),blocktype="c",firing=[],..
+        dep_ut=[%f,%f],label="",nzcross=0,nmode=0,equations=list());
+        // Adding the event select to the block list.
+        bllst($+1)=scicos_model(sim=list("eselect",-2),in=1,in2=1,intyp=-1,out=[],out2=[],..
+        outtyp=1,evtin=[],evtout=ones(nn,1),state=[],dstate=[],odstate=list(),..
+        rpar=[],ipar=[],opar=list(),blocktype="l",firing=-ones(nn,1),..
+        dep_ut=[%t,%f],label="",nzcross=0,nmode=0,equations=list());
+
+        corinv($+1)=n+2
+        //we have to add the counter and the eventselect block to the scs_m
+        //to be compatible with the code generation
+        scs_m.objs(n+2)=Counter("define");
+        scs_m.objs(n+2).model.ipar=[1;double(nn);1];
+        corinv($+1)=n+3
+        scs_m.objs(n+3)=ESELECT_f("define");
+        scs_m.objs(n+3).model.evtout=ones(nn,1);
+        scs_m.objs(n+3).model.firing=-ones(nn,1);
+        nc=size(bllst)
+        nb=size(corinv)
+        indout($+1)=nc-1;
+        indout($+1)=nc;
+        // linking the event output of the evntdly or the bidon to the counter.
+        // and linking the regular output of the counter to the event select.
+        Ts($+1:$+4,:)=[nb-2 1 -1 -1;..
+        nb-1,1,1,-1;..
+        nb-1,1,-1,1;..
+        nb,1,1,1]
+        // replacing the SampleClk by the output of the event select
+        index=find(MAT(:,5)==string(4))
+        for i=index
+            num=-evstr(MAT(i,1))
+            Ts(find(Ts(:,1)==num),1)=-num
+            K=0:nn-1;
+            M=find(modulo(int(K*frequ*den),int(evstr(MAT(i,3))*double(den)))==0)';
+            ON=ones(size(M,"*"),1)
+            Ts($+1:2:$+2*size(M,"*"),:)=[nb*ON M+ON*(evstr(MAT(i,4))-offset)*double(den) -ON -ON]
+            N=[1:size(M,"*")]';
+            Ts($+1-(2*size(M,"*")-2):2:$+1,:)=[-num*ON N ON -ON]
+        end
+    else
+        nb=size(corinv)
+        index=find(MAT(:,5)==string(4))
+        ON=ones(size(index,"*"),1)
+        Ts($+1:2:$+2*size(index,"*"),:)=[nb*ON ON -ON -ON]
+        num=-evstr(MAT(index,1))
+        //   N=[1:size(index,'*')]';
+        Ts($+1-(2*size(index,"*")-2):2:$+1,:)=[-num ON ON -ON]
+        for i=1:size(index,"*")
+            Ts(find(Ts(:,1)==num(i)),1)=-num(i)
+        end
+    end
+endfunction
+
+function [Ts,bllst,corinv,indout,ok]=s_clk2(MAT,Ts,bllst,corinv,scs_m,indout)
+    ok=%t
+    index=find(MAT(:,5)==string(4)) //index of SampleCLK blocks
+    MAT1=MAT(index,:);
+    frequ=evstr(MAT1(:,3));  // frequencies of the sampleCLK
+    offset=evstr(MAT1(:,4)); // offsets of the SampleCLK
+    offset=offset(:);frequ=frequ(:);
+    [m,den,off,count,m1,fir,frequ,offset,ok]=mfrequ_clk(frequ,offset);
+    if ~ok then return;end
+    mn=(2**size(m1,"*"))-1;//number of event outputs.
+    n=lstsize(scs_m.objs);
+    bllst($+1)=scicos_model(sim=list("m_frequ",4),in=[],in2=[],intyp=1,out=[],out2=[],outtyp=1,..
+    evtin=1,evtout=ones(mn,1),state=[],dstate=[],odstate=list(),rpar=[],ipar=[],..
+    opar=list(m,double(den),off,count),blocktype="d",firing=fir,dep_ut=[%f,%f],..
+    label="",nzcross=0,nmode=0,equations=list());
+    corinv($+1)=n+1;
+    nb=size(corinv);
+    nc=size(bllst);// nc differs from nb if the diagram contains modelica's block
+    indout($+1)=nc;
+    k=1:mn;
+    //connecting all the event outputs to the event input of the M_Frequ block
+    Ts($+1:2:$+2*mn,:)=[nb*ones(mn,1) k' -ones(mn,2)]
+    Ts($+1-(2*mn-2):2:$+1,:)=[nb*ones(mn,1) ones(mn,2) -ones(mn,1)]
+    //replacing the SampleCLK by the outputs of the M_frequ
+    for i=1:size(frequ,"*")
+        num=evstr(MAT1(find((evstr(MAT1(:,3))==frequ(i))&(evstr(MAT1(:,4))==offset(i))),1))
+        for ii=num'
+            Ts(find(Ts(:,1)==-ii),1)=ii;
+            j=2**(i-1):2**i:mn;
+            v=j;
+            for k=1:2**(i-1)-1;
+                v=[v,j+k]
+            end
+            v=(unique(v))
+            ON=ones(size(v,"*"),1)
+            N=[1:size(v,"*")]';
+            Ts($+1:2:$+2*size(v,"*"),:)=[nb*ON v' -ON -ON]
+            Ts($+1-(2*size(v,"*")-2):2:$+1,:)=[ii*ON N ON -ON]
+        end
+    end
+endfunction
+
+function [m,k]=uni(fr,of)
+    k=[];
+    m=[];
+    ot=[];
+    for i=1:size(fr,"*")
+        istreated=%f;
+        ind=find(m==fr(i));
+        if ind==[] then
+            m=[m;fr(i)];
+            ot=[ot;of(i)];
+            k=[k;i];
+        else
+            for j=ind
+                if of(i)==ot(j) then
+                    istreated=%t
+                end
+            end
+            if ~istreated then
+                m=[m;fr(i)];
+                ot=[ot;of(i)]
+                k=[k;i];
+            end
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_block.bin b/modules/scicos/macros/scicos_scicos/scicos_block.bin
new file mode 100755
index 000000000..453fd4d83
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_block.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_block.sci b/modules/scicos/macros/scicos_scicos/scicos_block.sci
new file mode 100755
index 000000000..598e10dcc
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_block.sci
@@ -0,0 +1,30 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function blk=scicos_block(v1,v2,v3,v4,v5)
+    //Block data structure initialization
+    if exists("graphics","local")==0 then graphics=scicos_graphics(),end
+    if exists("model","local")==0 then model=scicos_model(),end
+    if exists("gui","local")==0 then gui="",end
+    if exists("doc","local")==0 then doc=list(),end
+
+    blk=mlist(["Block","graphics","model","gui","doc"],graphics,model,gui,doc)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_block_link.bin b/modules/scicos/macros/scicos_scicos/scicos_block_link.bin
new file mode 100755
index 000000000..1e5b1d24b
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_block_link.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_block_link.sci b/modules/scicos/macros/scicos_scicos/scicos_block_link.sci
new file mode 100755
index 000000000..e6231391b
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_block_link.sci
@@ -0,0 +1,59 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) DIGITEO - Clément DAVID <clement.david@scilab.org>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function ok = scicos_block_link(funam, txt, flag, libs)
+    // Link a new funame block with txt implementation.
+    //
+    // Parameters:
+    //  funam: the name of the function
+    //  txt: the code
+    //  flag: language type ('c' or 'f')
+    //  libs: the libs to link with
+
+    // pre-condition
+    if flag <> "c" & flag <> "f" then
+        ok = %f;
+        messagebox(gettext("Sorry: Only C or FORTRAN languages are supported","modal"));
+        return;
+    end
+    if stripblanks(funam)==emptystr() then
+        ok = %f;
+        messagebox(gettext("Sorry file name not defined in "+flag+" block","modal"));
+        return;
+    end
+    if ~exists("libs", "l") then
+        libs = "";
+    end
+
+    // put the txt to a temp file
+    cur_wd = pwd();
+    chdir(TMPDIR);
+    mputl(txt, funam + "." + flag);
+
+    // call the standard block link function
+    ok = buildnewblock(funam, funam + "." + flag, "", "", libs, TMPDIR, "", "");
+
+    // post
+    chdir(cur_wd);
+    ok = %t;
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/scicos_cpr.bin b/modules/scicos/macros/scicos_scicos/scicos_cpr.bin
new file mode 100755
index 000000000..69bcc4ac6
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_cpr.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_cpr.sci b/modules/scicos/macros/scicos_scicos/scicos_cpr.sci
new file mode 100755
index 000000000..9889448a1
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_cpr.sci
@@ -0,0 +1,30 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function cpr=scicos_cpr(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10)
+    //initialisation de cpr tlist
+    if exists("state","local")==0 then state=scicos_state(),end
+    if exists("sim","local")==0 then sim=scicos_sim(),end
+    if exists("cor","local")==0 then cor=list(),end
+    if exists("corinv","local")==0 then corinv=list(),end
+    cpr=tlist(["cpr","state","sim","cor","corinv"],..
+    state,sim,cor,corinv)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_diagram.bin b/modules/scicos/macros/scicos_scicos/scicos_diagram.bin
new file mode 100755
index 000000000..b39e9c8a0
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_diagram.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_diagram.sci b/modules/scicos/macros/scicos_scicos/scicos_diagram.sci
new file mode 100755
index 000000000..5ea1793aa
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_diagram.sci
@@ -0,0 +1,30 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function scs_m=scicos_diagram(v1,v2,v3)
+    if exists("props","local")==0 then props=scicos_params(),end
+    if exists("objs","local")==0 then objs=list(),end
+    if exists("version","local")==0 then version="",end
+    if exists("contrib","local")==0 then contrib=list(),end
+
+    scs_m=mlist(["diagram","props","objs","version","contrib"],...
+    props,objs,version,contrib)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_flat.bin b/modules/scicos/macros/scicos_scicos/scicos_flat.bin
new file mode 100755
index 000000000..43d90e60a
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_flat.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_flat.sci b/modules/scicos/macros/scicos_scicos/scicos_flat.sci
new file mode 100755
index 000000000..5610397fb
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_flat.sci
@@ -0,0 +1,456 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Ramine Nikoukhah <ramine.nikoukhah@inria.fr> - 2003
+//                      - Serge Steer <serge.steer@inria.fr>           - 2003
+//                      - Fady Nassif <fady.nassif@inria.fr>           - 2007
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function  [cor,corinv,links_table,cur_fictitious,sco_mat,ok, IN, OUT, EIN, EOUT]=scicos_flat(scs_m,ksup,MaxBlock)
+    //This function takes a hierarchical Scicos diagram and computes the
+    //"flat" equivalent, removing "non computational" blocs like splits.
+    //S. Steer, R. Nikoukhah 2003. Copyright INRIA
+
+    //NB::--------------------------------------------------------------
+    // Modifying this function to take care of the GOTO FROM SampleCLK and VirtualCLK0 blocks.
+    // A negatif number in cor and in links_table is refer to a GOTO,FROM
+    // GotoTagVisibility, SampleCLK, VirtualCLK0. in other words the blocks that are virtual.
+    // These blocks are removed in the compilation part.
+    // Modification of shiftcors. It will not shift the negatives numbers.
+    // A sco_mat is a string matrix composed by the :
+    // For the blocks GOTO, FROM, VirtualCLK0
+    //	- the first column : the negatif of the number of the virtual block in the cor.
+    //	- the second column: 1 if it is a GOTO; -1 if it is a FROM.
+    //                           The VirtualCLK0 is considered as a GOTO.
+    //	- the third column : the tag value. 'scicostimeclk0' is used in the case of the VirtualCLK0
+    //	- the forth column : the tag visibility
+    //                           For the GOTO: + 2: scoped
+    //                                         + 3: global
+    //                           For the FROM: + 1
+    //                           For the VirtualCLK0: 2
+    //	- the fifth column : 1=regular 2=event 3=modelica 10=VirtualCLK0
+    // For the SampleCLK:
+    //	- the first column : the negatif of the number of the virtual block in the cor.
+    //	- the second column: the value 1.
+    //	- the third column : The frequency value.
+    //	- the forth column : The offset value.
+    //	- the fifth column : the value 4.
+    // Another two string matrices are used for the GOTO/FROM blocks. The loc_mat it is used when the GOTO
+    // block is local. The from_mat to match the local from with the local goto.
+    // A tag_exprs matrices is used for the GotoTagVisibility and the VirtualCLK0:
+    // it is composed by:
+    //       - the first column: The tag value. 'scicostimeclk0' in the VirtualCLK0 case.
+    //       - the second column: 1=regular 2=event 3=modelica 10=VirtualCLK0
+    // The local and scoped cases are studied in this function.
+    // The global case is studied in the function global_case in c_pass1.
+    // A Modification of update_cor in c_pass1. For the negatives numbers
+    // the cor will be set to 0. (In this case the blocks are considered as IN_f ...)
+    // Fady NASSIF 2007. INRIA.
+    //-------------------------------------------------------------------
+
+    if argn(2)<=1 then ksup=0;end //used for recursion
+    if ksup==0 then   // main scheme
+        MaxBlock=countblocks(scs_m);
+        //last created fictitious block (clock split,clock sum,super_blocks, superbloc))
+        cur_fictitious=MaxBlock
+        path=[];       // for delete_unconnected
+        scs_m_s=scs_m ;// for delete_unconnected
+    end
+    //-------------- suppress blocks with an unconnected regular port --------------
+    scs_m=delete_unconnected(scs_m);
+
+    //list of blocks with are not retained in the final block list
+    blocks_to_remove=["CLKSPLIT_f" "SPLIT_f" "IMPSPLIT_f" "CLKSOM_f" "CLKSOMV_f" "NRMSOM_f" "PAL_f" "xcos_block"]
+    port_blocks=["IN_f","INIMPL_f","OUT_f","OUTIMPL_f","CLKIN_f","CLKINV_f","CLKOUT_f","CLKOUTV_f"]
+    block_goto=["GOTO","CLKGOTO","GOTOMO"]
+    block_from=["FROM","CLKFROM","FROMMO"]
+    block_tag=["GotoTagVisibility","CLKGotoTagVisibility","GotoTagVisibilityMO"]
+    n=lstsize(scs_m.objs) //number of "objects" in the data structure
+    //-------------- initialize outputs --------------
+    nb=0;
+    links_table=[]; //
+    corinv=list();
+    cor=list();for k=1:n, cor(k)=0;end
+
+    ok=%t;
+    IN=[];OUT=[];EIN=[];EOUT=[];
+    Links=[] //to memorize links position in the data structure
+    mod_blk_exist=%f;
+    //-------------- Analyse blocks --------------
+    loc_mat=[];from_mat=[];tag_exprs=[];sco_mat=[];
+    for k=1:n //loop on all objects
+        o=scs_m.objs(k);
+        x=getfield(1,o);
+        cor(k)=0
+        if x(1)=="Block" then
+            if or(o.gui==block_goto) then
+                cur_fictitious=cur_fictitious+1;
+                cor(k)=-cur_fictitious;
+                if (o.graphics.exprs(2)=="1") then
+                    loc_mat=[loc_mat;[string(cur_fictitious),string(1),(o.graphics.exprs(1)),string(find(block_goto(:)==o.gui))]]
+                    locomat=[];
+                    for i=1:size(loc_mat,1)
+                        locomat=[locomat;strcat([loc_mat(i,3) loc_mat(i,4)])]
+                    end
+                    vec=unique(locomat)
+                    if size(vec,1)<>size(loc_mat,1) then
+                        if flgcdgen<>-1 then path=[numk path];scs_m=all_scs_m; end
+                        if (ksup==0)|flgcdgen<>-1  then
+                            hilite_path([path,k],"There is another local GOTO in this diagram with the same tag ''"+loc_mat($,3)+"''",%t);
+                        else
+                            hilite_path([path,k], "There is another local GOTO in this diagram with the same tag ''"+loc_mat($,3)+"''",%t);
+                        end
+                        disp(mprintf("%s: goto tag not unique", "scicos_flat"));
+                        ok=%f;return
+                    end
+                else
+                    sco_mat=[sco_mat;[string(cur_fictitious),string(1),o.graphics.exprs(1),o.graphics.exprs(2),string(find(block_goto(:)==o.gui))]]
+                end
+            elseif or(o.gui==block_from) then
+                cur_fictitious=cur_fictitious+1;
+                cor(k)=-cur_fictitious
+                sco_mat=[sco_mat;[string(cur_fictitious),string(-1),o.graphics.exprs(1),string(1),string(find(block_from(:)==o.gui))]]
+                from_mat=[from_mat;[string(cur_fictitious),string(-1),o.graphics.exprs(1),string(find(block_from(:)==o.gui))]]
+            elseif or(o.gui==block_tag) then
+                tag_exprs=[tag_exprs;[o.graphics.exprs(1),string(find(block_tag(:)==o.gui))]]
+                cur_fictitious=cur_fictitious+1;
+                cor(k)=-cur_fictitious
+            elseif o.gui=="SampleCLK" then
+                if o.graphics.peout<>0 then
+                    cur_fictitious=cur_fictitious+1;
+                    cor(k)=-cur_fictitious
+                    [Nf,Df]=rat(o.model.rpar(1),1d-9);
+                    [No,Do]=rat(o.model.rpar(2),1d-9);
+                    sco_mat=[sco_mat;[string(cur_fictitious),string(1),string(Nf)+"/"+string(Df),..
+                    string(No)+"/"+string(Do),string(4)]]
+                end
+                //Adding the VirtualCLK0. Fady 18/11/2007
+            elseif o.gui=="VirtualCLK0" then
+                cur_fictitious=cur_fictitious+1;
+                cor(k)=-cur_fictitious
+                sco_mat=[sco_mat;[string(cur_fictitious),string(1),"scicostimeclk0",..
+                string(2),string(10)]]
+                tag_exprs=[tag_exprs;["scicostimeclk0",string(10)]]
+            elseif or(o.gui==blocks_to_remove) then
+                cur_fictitious=cur_fictitious+1;
+                cor(k)=cur_fictitious
+            elseif o.gui=="SUM_f"|o.gui=="SOM_f" then
+                nb=nb+1;
+                corinv(nb)=k;
+                cor(k)=nb
+                //scs_m=adjust_sum(scs_m,k)
+            elseif or(o.gui==port_blocks) then
+                //here we suppose to be inside a superblock
+                //may be we can handle this blocks just as blocks_to_remove
+                if ksup==0 then
+                    scs_m=scs_m_s
+                    hilite_path([path,k],gettext("I/O blocks must be only used in a Super Block"),%f)
+                    disp(mprintf("%s: Port out of hierarchy", "scicos_flat"));
+                    ok=%f;return
+                end
+                connected=get_connected(scs_m,k)
+                if connected==[] then
+                    scs_m=scs_m_s
+                    hilite_path([path,k],gettext("This Super block input port is not connected."),%t)
+                    disp(mprintf("%s: Not connected super block input", "scicos_flat"));
+                    ok=%f;return
+                end
+                if or(o.gui==["IN_f","INIMPL_f"]) then
+                    pind=Pind(1)
+                    IN=[IN o.model.ipar]
+                elseif or(o.gui==["OUT_f","OUTIMPL_f"]) then
+                    pind=Pind(2)
+                    OUT=[OUT o.model.ipar]
+                elseif or(o.gui==["CLKIN_f","CLKINV_f"]) then
+                    pind=Pind(3)
+                    EIN=[EIN o.model.ipar]
+                elseif or(o.gui==["CLKOUT_f","CLKOUTV_f"]) then
+                    pind=Pind(4)
+                    EOUT=[EOUT o.model.ipar]
+                end
+                //connect the link to the fictitious bloc replacing the superblock
+                if scs_m.objs(connected).from(1)==k then
+                    scs_m.objs(connected).from(1)=-(pind+o.model.ipar)
+                end
+                if scs_m.objs(connected).to(1)==k then
+                    scs_m.objs(connected).to(1)=-(pind+o.model.ipar)
+                end
+            elseif o.model.sim(1)=="asuper" then
+                nb=nb+1
+                corinv(nb)=k
+                cor(k)=nb
+                if o.graphics.exprs(3).dep_ut($)==%t then
+                    sco_mat=[sco_mat;[string(nb) "-1" "scicostimeclk0" "1" "10"]]
+                end
+            elseif o.model.sim=="super"|o.model.sim=="csuper" then
+                path=[path k] //superbloc path in the hierarchy
+                //replace superbloc by a set of fictitious blocks (one per port)
+                //and reconnect links connected to the superblock to these
+                //ficitious blocks
+                Pinds=[];if exists("Pind") then Pinds=Pind,end
+                Pind=[] //base of ports numbering
+                //mprintf("entering superblock at level "+string(size(path,'*'))+"\r\n")
+                nb_pin=size(scs_m.objs(k).graphics("pin"),1);
+                nb_pein=size(scs_m.objs(k).graphics("pein"),1);
+                for port_type=["pin","pout","pein","peout"]
+                    Pind=[Pind cur_fictitious]
+                    ip=scs_m.objs(k).graphics(port_type);
+                    ki=find(ip>0)
+                    for kk=ki
+                        kc=ip(kk)
+                        //**  a link is connected to the same sblock on both ends
+                        if scs_m.objs(kc).to(1)==scs_m.objs(kc).from(1) then
+                            //** regular input port
+                            if port_type=="pin" then
+                                scs_m.objs(kc).to(1)=-(cur_fictitious+scs_m.objs(kc).to(2));
+                                scs_m.objs(kc).to(2)=1
+
+                                if scs_m.objs(kc).from(3)==0 then //** in connected to out
+                                    scs_m.objs(kc).from(1)=-(cur_fictitious+scs_m.objs(kc).from(2)+nb_pin);
+                                    scs_m.objs(kc).from(2)=1
+                                else //** in connected to in
+                                    scs_m.objs(kc).from(1)=-(cur_fictitious+scs_m.objs(kc).from(2));
+                                    scs_m.objs(kc).from(2)=1
+                                end
+
+                                //** regular output port
+                            elseif port_type=="pout" then
+                                scs_m.objs(kc).from(1)=-(cur_fictitious+scs_m.objs(kc).from(2));
+                                scs_m.objs(kc).from(2)=1
+
+                                if scs_m.objs(kc).to(3)==0 then //** out connected to out
+                                    scs_m.objs(kc).to(1)=-(cur_fictitious+scs_m.objs(kc).to(2));
+                                    scs_m.objs(kc).to(2)=1
+                                end
+
+                                //** event input port
+                            elseif port_type=="pein" then
+                                scs_m.objs(kc).to(1)=-(cur_fictitious+scs_m.objs(kc).to(2));
+                                scs_m.objs(kc).to(2)=1
+
+                                scs_m.objs(kc).from(1)=-(cur_fictitious+scs_m.objs(kc).from(2)+nb_pein);
+                                scs_m.objs(kc).from(2)=1
+
+                                //** peout and pein are never connected to themselves
+                            end
+
+                        elseif scs_m.objs(kc).to(1)==k then  // a link going to the superblock
+                            scs_m.objs(kc).to(1)=-(cur_fictitious+scs_m.objs(kc).to(2));
+                            scs_m.objs(kc).to(2)=1
+
+                        elseif scs_m.objs(kc).from(1)==k then  // a link coming from the superblock
+                            scs_m.objs(kc).from(1)=-(cur_fictitious+scs_m.objs(kc).from(2));
+                            scs_m.objs(kc).from(2)=1
+                        end
+                    end
+                    cur_fictitious=cur_fictitious+size(ip,"*")
+                end
+
+
+                //Analyze the superblock contents
+                [cors,corinvs,lt,cur_fictitious,scop_mat,ok, localIN, localOUT, localEIN, localEOUT]=scicos_flat(o.model.rpar,cur_fictitious,MaxBlock)
+                if ~ok then
+                    disp(mprintf("%s: Invalid super block at %d", "scicos_flat", k));
+                    return
+                end
+
+                // check if the ports has the right order
+                localIN=-gsort(-localIN);
+                if or(localIN<>[1:size(localIN,"*")]) then
+                    ok=%f;
+                    msg=gettext("Input ports are not numbered properly.")
+                    hilite_path(path,msg,%t)
+                    disp(mprintf("%s: Input ports are not numbered properly.", "scicos_flat"))
+                    return
+                end
+                localOUT=-gsort(-localOUT);
+                if or(localOUT<>[1:size(localOUT,"*")]) then
+                    ok=%f;
+                    msg=gettext("Output ports are not numbered properly.")
+                    hilite_path(path,msg,%t)
+                    disp(mprintf("%s: Output ports are not numbered properly.", "scicos_flat"))
+                    return
+                end
+                localEIN=-gsort(-localEIN);
+                if or(localEIN<>[1:size(localEIN,"*")]) then
+                    ok=%f;
+                    msg=gettext("Event input ports are not numbered properly.")
+                    hilite_path(path,msg,%t)
+                    disp(mprintf("%s: Event input ports are not numbered properly.", "scicos_flat"))
+                    return
+                end
+                localEOUT=-gsort(-localEOUT);
+                if or(localEOUT<>[1:size(localEOUT,"*")]) then
+                    ok=%f;
+                    msg=gettext("Event output ports are not numbered properly.")
+                    hilite_path(path,msg,%t)
+                    disp(mprintf("%s: Event output ports are not numbered properly.", "scicos_flat"))
+                    return
+                end
+
+                //shifting the scop_mat for regular blocks. Fady 08/11/2007
+                if scop_mat<>[] then
+                    v_mat=find(eval(scop_mat(:,1))<MaxBlock)
+                    v_mat=v_mat(:)
+                    for j=v_mat
+                        scop_mat(j,1)=string(eval(scop_mat(j,1))+nb)
+                    end
+                end
+                //Adding the scop_mat to the old sco_mat.
+                sco_mat=[sco_mat;scop_mat]
+                nbs=size(corinvs)
+
+                //catenate superbloc data with current data
+
+                f=find(lt(:,1)>0&lt(:,1)<=nbs);if f<>[] then lt(f,1)=lt(f,1)+nb,end
+                links_table=[links_table;lt]
+
+                for kk=1:nbs, corinv(nb+kk)=[k,corinvs(kk)];end
+                cors=shiftcors(cors,nb)
+                //	cur_fictitious=cur_fictitious+nb
+                cor(k)=cors
+                nb=nb+nbs
+                Pind=Pinds
+                path($)=[]
+
+            else //standard blocks
+                nb=nb+1
+                corinv(nb)=k
+                //[model,ok]=build_block(o.model)
+                cor(k)=nb
+                //Adding the always activated blocks to the sco_mat to take care of the enabling if exists.
+                //Fady 18/11/2007
+                if ~is_modelica_block(o) then
+                    if o.model.dep_ut($) then
+                        sco_mat=[sco_mat;[string(nb) "-1" "scicostimeclk0" "1" "10"]]
+                    end
+                else
+                    mod_blk_exist=%t // Flag for the existance of modelica's blocks
+                end
+            end
+        elseif x(1)=="Deleted"|x(1)=="Text" then
+            //this objects are ignored
+        else //links
+            Links=[Links k] // memorize their position for use during links analysis
+        end
+    end //end of loop on objects
+
+    if ksup==0&nb==0 then
+        messagebox(msprintf(gettext("%s: Empty diagram"), "Xcos"),"modal")
+        ok=%f
+        disp(msprintf("%s: Empty diagram", "scicos_flat"));
+        return
+    end
+    //-------------- Analyse  links --------------
+    for k=Links
+        o=scs_m.objs(k);
+        f=0
+        if o.from(1)<0|o.from(1)>MaxBlock then //Link coming from a superblock input port
+        else
+            o.from(1)=cor(o.from(1));
+        end
+        if o.to(1)<0 |o.to(1)>MaxBlock then //Link going to a superblock output port
+        else
+            o.to(1)=cor(o.to(1)),
+        end
+
+        if o.ct(2)==2 //implicit links
+            //if abs(o.from(1))==125|abs(o.to(1))==125 then pause,end
+            links_table=[links_table
+            o.from(1:3)    o.ct(2)
+            o.to(1:3)      o.ct(2) ]
+        else //regular or event links
+            links_table=[links_table
+            o.from(1:2)  -1  o.ct(2) //outputs are tagged with -1
+            o.to(1:2)    1   o.ct(2) ] //inputs are tagged with 1
+        end
+    end
+    // Warning in case of modelica's blocks in an enabled diagram.
+    // Fady 18/11/2007
+    tof=find((sco_mat(:,2)=="1")& (sco_mat(:,5)=="10"))
+    if tof<>[] then
+        if mod_blk_exist then
+            messagebox("Warning the enable does not consider the modelica blocks","modal")
+        end
+    end
+    //----------------------Goto From Analyses--------------------------
+    // Local case
+    if loc_mat<>[] then
+        for i=1:size(loc_mat,1)
+            index1=find((from_mat(:,2)=="-1")&(from_mat(:,3)==loc_mat(i,3))&(from_mat(:,4)==loc_mat(i,4)))
+            for j=index1
+                index2=find(links_table(:,1)==-evstr(from_mat(j,1)))
+                // 	     for k=index2
+                // 		  links_table(k,1)=-evstr(loc_mat(i,1))
+                // 	     end
+                if index2<>[] then
+                    links_table(index2',1)=-evstr(loc_mat(i,1))
+                end
+                index2=find(sco_mat(:,1)==from_mat(j,1))
+                sco_mat(index2',:)=[]
+            end
+        end
+    end
+    //scoped case
+    if tag_exprs<>[] then
+        //to be modified !!!!!
+        //      vec=unique(tag_exprs)
+        for i=1:size(tag_exprs,1)
+            index=find((tag_exprs(:,1)==tag_exprs(i,1))&(tag_exprs(:,2)==tag_exprs(i,2)))
+            if size(index,"*") > 1  then
+                messagebox(["Error In Compilation. You cannot have multiple GotoTagVisibility";..
+                " with the same tag value in the same scs_m"],"modal")
+                ok=%f;
+                disp(mprintf("%s: Multiple GotoTagVisibility at the same level", "scicos_flat"));
+                return
+            end
+        end
+
+        for i=1:size(tag_exprs,1)
+            index=find((sco_mat(:,2)=="1")&(sco_mat(:,3)==tag_exprs(i,1))&(sco_mat(:,4)=="2")&(sco_mat(:,5)==tag_exprs(i,2)))
+            if index<>[] then
+                if size(index,"*")>1 then
+                    messagebox(["Error in compilation";"Multiple GOTO are taged by the same GotoTagVisibility"],"modal")
+                    ok=%f
+                    disp(mprintf("%s: Shared GotoTagVisibility across GOTO", "scicos_flat"));
+                    return
+                end
+                index1=find((sco_mat(:,2)=="-1")&(sco_mat(:,3)==tag_exprs(i,1))&(sco_mat(:,5)==tag_exprs(i,2)))
+                if index1<>[] then
+                    for j=index1
+                        index2=find(links_table(:,1)==-evstr(sco_mat(j,1)))
+                        if index2<>[] then
+                            links_table(index2',1)=-evstr(sco_mat(index,1))
+                        end
+                        //linking the always active blocks to the VirtualCLK0 if exists.
+                        if sco_mat(j,5)=="10" then
+                            links_table($+1,:)=[-evstr(sco_mat(index,1)) 1 -1 -1]
+                            links_table($+1,:)=[evstr(sco_mat(j,1)) 0 1 -1]
+                        end
+                    end
+                end
+                sco_mat([index1';index'],:)=[]
+                //sco_mat(index,:)=[]
+            end
+        end
+    end
+    //global case
+    // function global_case in c_pass1
+    //------------------------------------------------------------------------
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_graphics.bin b/modules/scicos/macros/scicos_scicos/scicos_graphics.bin
new file mode 100755
index 000000000..68d6fd830
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_graphics.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_graphics.sci b/modules/scicos/macros/scicos_scicos/scicos_graphics.sci
new file mode 100755
index 000000000..bf385ca07
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_graphics.sci
@@ -0,0 +1,61 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function graphics=scicos_graphics(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10,...
+    v11,v12,v13,v14,v15,v16,v17,v18,v19,v20)
+    //initialisation de graphics mlist
+    if exists("orig","local")==0 then orig=[0 0],end
+    if exists("sz","local")==0 then sz=[20 20],end
+    if exists("flip","local")==0 then flip=%t,end
+    if exists("theta","local")==0 then theta=0,end
+    if exists("exprs","local")==0 then exprs=[],end
+    if exists("pin","local")==0 then pin=[],end
+    if exists("pout","local")==0 then pout=[],end
+    if exists("pein","local")==0 then pein=[],end
+    if exists("peout","local")==0 then peout=[],end
+    if exists("gr_i","local")==0 then gr_i=[],end
+    if exists("id","local")==0 then id="",end
+    if exists("in_implicit","local")==0 then
+        I="E";
+        in_implicit=I(ones(pin(:)));
+    end
+    if exists("out_implicit","local")==0 then
+        I="E";
+        out_implicit=I(ones(pout(:)));
+    end
+    if exists("in_style","local")==0 then
+        in_style=emptystr(pin);
+    end
+    if exists("out_style","local")==0 then
+        out_style=emptystr(pout);
+    end
+    if exists("in_label","local")==0 then
+        in_label=emptystr(pin);
+    end
+    if exists("out_label","local")==0 then
+        out_label=emptystr(pout);
+    end
+    if exists("style","local")==0 then style="" + [],end
+
+    graphics=mlist(["graphics","orig","sz","flip","theta","exprs","pin",..
+    "pout","pein","peout","gr_i","id","in_implicit","out_implicit","in_style","out_style","in_label","out_label","style"],..
+    orig,sz,flip,theta,exprs,pin,pout,pein,peout,gr_i,id,in_implicit,out_implicit,in_style,out_style,in_label,out_label,style)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_include_paths.bin b/modules/scicos/macros/scicos_scicos/scicos_include_paths.bin
new file mode 100755
index 000000000..f9c3b9eb1
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_include_paths.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_include_paths.sci b/modules/scicos/macros/scicos_scicos/scicos_include_paths.sci
new file mode 100755
index 000000000..17c0a4e92
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_include_paths.sci
@@ -0,0 +1,46 @@
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) DIGITEO - 2010 - Allan CORNET
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function p = scicos_include_paths(modules)
+
+    if argn(2) < 1 then
+        modules = ["scicos_blocks", "dynamic_link", "scicos", "core"];
+    end
+
+    p = [];
+
+    if getos() == "Windows" then
+        // Windows
+        p= """" + SCI + "/modules/" + modules + "/includes" + """";
+    else
+        //Unix
+        if isdir(SCI+"/modules/core/includes/") then
+            // source version
+            p = SCI + "/modules/" + modules + "/includes";
+        elseif isdir(SCI+"/../../include/scilab/core/") then
+            // binary version
+            p = SCI + "/../../include/scilab/" + modules;
+        elseif isdir("/usr/include/scilab/") then
+            // packaged version
+            p = [];
+        end
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_link.bin b/modules/scicos/macros/scicos_scicos/scicos_link.bin
new file mode 100755
index 000000000..49785c7d3
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_link.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_link.sci b/modules/scicos/macros/scicos_scicos/scicos_link.sci
new file mode 100755
index 000000000..0f42bbaa9
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_link.sci
@@ -0,0 +1,34 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function lnk=scicos_link(v1,v2,v3,v4,v5,v6,v7,v8)
+    //initialisation de link mlist
+    if exists("xx","local")==0 then xx=[],end
+    if exists("yy","local")==0 then yy=[],end
+    if exists("id","local")==0 then id="",end
+    if exists("thick","local")==0 then thick=[0,0],end
+    if exists("ct","local")==0 then ct=[1,1],end
+    if exists("from","local")==0 then from=[],end
+    if exists("to","local")==0 then to=[],end
+    lnk=mlist(["Link","xx","yy","id","thick","ct","from","to"],..
+    xx,yy,id,thick,ct,from,to)
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_model.bin b/modules/scicos/macros/scicos_scicos/scicos_model.bin
new file mode 100755
index 000000000..c3024fcc2
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_model.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_model.sci b/modules/scicos/macros/scicos_scicos/scicos_model.sci
new file mode 100755
index 000000000..a0c4d8757
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_model.sci
@@ -0,0 +1,56 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function model=scicos_model(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10,v11,v12,v13,v14,v15,v16,...
+    v17,v18,v19,v20,v21,v22,v23,v24,v25,v26)
+
+    //initialisation de model mlist
+    if exists("sim","local")==0 then sim="",end
+    if exists("in","local")==0 then in=[],end
+    if exists("in2","local")==0 then in2=[],end
+    if exists("intyp","local")==0 then intyp=1,end
+    if exists("out","local")==0 then out=[],end
+    if exists("out2","local")==0 then out2=[],end
+    if exists("outtyp","local")==0 then outtyp=1,end
+    if exists("evtin","local")==0 then evtin=[],end
+    if exists("evtout","local")==0 then evtout=[],end
+    if exists("state","local")==0 then state=[],end
+    if exists("dstate","local")==0 then dstate=[],end
+    if exists("odstate","local")==0 then odstate=list(),end
+    if exists("opar","local")==0 then opar=list(),end
+    if exists("rpar","local")==0 then rpar=[],end
+    if exists("ipar","local")==0 then ipar=[],end
+    if exists("blocktype","local")==0 then blocktype="c",end
+    if exists("firing","local")==0 then firing=[],end
+    if exists("dep_ut","local")==0 then dep_ut=[%f %f],end
+    if exists("label","local")==0 then label="",end
+    if exists("nzcross","local")==0 then nzcross=0,end
+    if exists("nmode","local")==0 then nmode=0,end
+    if exists("equations","local")==0 then equations=list(),end
+    if exists("uid","local")==0 then uid="",end
+
+    model=mlist(["model","sim","in","in2","intyp","out","out2","outtyp",...
+    "evtin","evtout","state","dstate","odstate","rpar","ipar","opar",...
+    "blocktype","firing","dep_ut","label","nzcross",..
+    "nmode","equations","uid"],..
+    sim,in,in2,intyp,out,out2,outtyp,evtin,evtout,state,dstate,odstate,..
+    rpar,ipar,opar,blocktype,firing,dep_ut,label,nzcross,nmode,equations,uid)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_params.bin b/modules/scicos/macros/scicos_scicos/scicos_params.bin
new file mode 100755
index 000000000..7e9a1ca8e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_params.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_params.sci b/modules/scicos/macros/scicos_scicos/scicos_params.sci
new file mode 100755
index 000000000..9deaf8c1e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_params.sci
@@ -0,0 +1,48 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function params=scicos_params(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10)
+    if exists("wpar","local")==0 then wpar=[600,450,0,0,600,450],end
+    if exists("title","local")==0 & exists("Title","local")==0 then
+        titlex="Untitled"
+    else
+        if exists("title","local")==1 then
+            titlex=title
+        elseif exists("Title","local")==1 then
+            titlex=Title
+        end
+    end
+    if exists("tf","local")==0 then tf=100000,end
+    if exists("tol","local")==0 then tol=[1.d-6,1.d-6,1.d-10,tf+1,0,1,0],end
+    if exists("context","local")==0 then context=[],end
+    void1=[]
+    if exists("options","local")==0 then options=default_options(),end
+    void2=[]
+    void3=[]
+    if exists("doc","local")==0 then doc=list(),end
+
+    params=tlist(["params","wpar","title","tol","tf","context",..
+    "void1","options","void2","void3","doc"],..
+    wpar,titlex,tol,tf,context,void1,options,void2,..
+    void3,doc)
+
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/scicos_sim.bin b/modules/scicos/macros/scicos_scicos/scicos_sim.bin
new file mode 100755
index 000000000..8f12b04b0
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_sim.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_sim.sci b/modules/scicos/macros/scicos_scicos/scicos_sim.sci
new file mode 100755
index 000000000..3a32c7211
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_sim.sci
@@ -0,0 +1,75 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function sim=scicos_sim(v1,v2,v3,v4,v5,..
+    v6,v7,v8,v9,v10,..
+    v11,v12,v13,v14,v15,..
+    v16,v17,v18,v19,v20,..
+    v21,v22,v23,v24,v25,..
+    v26,v27,v28,v29,v30,..
+    v31,v32,v33,v34,v35,..
+    v36,v37,v38,v39,v40)
+    if exists("funs","local")==0 then funs=[],end
+    if exists("xptr","local")==0 then xptr=[],end
+    if exists("zptr","local")==0 then zptr=[],end
+    if exists("ozptr","local")==0 then ozptr=[],end
+    if exists("zcptr","local")==0 then zcptr=[],end
+    if exists("inpptr","local")==0 then inpptr=[],end
+    if exists("outptr","local")==0 then outptr=[],end
+    if exists("inplnk","local")==0 then inplnk=[],end
+    if exists("outlnk","local")==0 then outlnk=[],end
+    if exists("rpar","local")==0 then rpar=[],end
+    if exists("rpptr","local")==0 then rpptr=[],end
+    if exists("ipar","local")==0 then ipar=[],end
+    if exists("ipptr","local")==0 then ipptr=[],end
+    if exists("opar","local")==0 then opar=list(),end
+    if exists("opptr","local")==0 then opptr=[],end
+    if exists("clkptr","local")==0 then clkptr=[],end
+    if exists("ordptr","local")==0 then ordptr=[],end
+    if exists("execlk","local")==0 then execlk=[],end
+    if exists("ordclk","local")==0 then ordclk=[],end
+    if exists("cord","local")==0 then cord=[],end
+    if exists("oord","local")==0 then oord=[],end
+    if exists("zord","local")==0 then zord=[],end
+    if exists("critev","local")==0 then critev=[],end
+    if exists("nb","local")==0 then nb=[],end
+    if exists("ztyp","local")==0 then ztyp=[],end
+    if exists("nblk","local")==0 then nblk=[],end
+    if exists("ndcblk","local")==0 then ndcblk=[],end
+    if exists("subscr","local")==0 then subscr=[],end
+    if exists("funtyp","local")==0 then funtyp=[],end
+    if exists("iord","local")==0 then iord=[],end
+    if exists("labels","local")==0 then labels=[],end
+    if exists("modptr","local")==0 then modptr=[],end
+    if exists("uids","local")==0 then uids=[],end
+    sim=tlist(["scs","funs","xptr","zptr","ozptr",..
+    "zcptr","inpptr","outptr","inplnk","outlnk","rpar",..
+    "rpptr","ipar","ipptr","opar","opptr",..
+    "clkptr","ordptr","execlk","ordclk","cord","oord","zord",..
+    "critev","nb","ztyp","nblk","ndcblk","subscr","funtyp",..
+    "iord","labels","modptr","uids"],..
+    funs,xptr,zptr,ozptr,zcptr,inpptr,..
+    outptr,inplnk,outlnk,rpar,rpptr,ipar,ipptr,..
+    opar,opptr,clkptr,ordptr,..
+    execlk,ordclk,cord,oord,zord,..
+    critev,nb,ztyp,nblk,ndcblk,..
+    subscr,funtyp,iord,labels,modptr,uids)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_state.bin b/modules/scicos/macros/scicos_scicos/scicos_state.bin
new file mode 100755
index 000000000..4e367e025
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_state.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_state.sci b/modules/scicos/macros/scicos_scicos/scicos_state.sci
new file mode 100755
index 000000000..06d2b731f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_state.sci
@@ -0,0 +1,34 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function state=scicos_state(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10,v11)
+    //initialisation de state mlist
+    if exists("x","local")==0 then x=[],end
+    if exists("z","local")==0 then z=[],end
+    if exists("oz","local")==0 then oz=list,end
+    if exists("iz","local")==0 then iz=[],end
+    if exists("tevts","local")==0 then tevts=[],end
+    if exists("evtspt","local")==0 then evtspt=[],end
+    if exists("pointi","local")==0 then pointi=1,end
+    if exists("outtb","local")==0 then outtb=list(),end
+    state=tlist(["xcs","x","z","oz","iz","tevts","evtspt","pointi","outtb"],..
+    x,z,iz,tevts,evtspt,pointi,outtb)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scicos_txtedit.bin b/modules/scicos/macros/scicos_scicos/scicos_txtedit.bin
new file mode 100755
index 000000000..24cb0fd12
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_txtedit.bin
diff --git a/modules/scicos/macros/scicos_scicos/scicos_txtedit.sci b/modules/scicos/macros/scicos_scicos/scicos_txtedit.sci
new file mode 100755
index 000000000..a7155b304
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scicos_txtedit.sci
@@ -0,0 +1,30 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function param=scicos_txtedit(v1,v2,v3,v4,v5)
+    // Copyright INRIA
+    // Scicos text editor param structure
+    if exists("typ","local")==0 then typ="", end
+    if exists("ttitle","local")==0 then ttitle="", end
+    if exists("head","local")==0 then head=[], end
+    if exists("clos","local")==0 then clos=0, end
+
+    param=mlist(["TxtEdit","typ","title","head","clos"],typ,ttitle,head,clos)
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/script2var.bin b/modules/scicos/macros/scicos_scicos/script2var.bin
new file mode 100755
index 000000000..b1e8e3ff1
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/script2var.bin
diff --git a/modules/scicos/macros/scicos_scicos/script2var.sci b/modules/scicos/macros/scicos_scicos/script2var.sci
new file mode 100755
index 000000000..635ffbeb8
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/script2var.sci
@@ -0,0 +1,89 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) 2011 - INRIA - Serge Steer
+
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [%ll,%ierr] = script2var(%txt, %ll)
+    //** [%scicos_context, ierr] = script2var(context, %scicos_context)
+    //** context is the scs_m.props.context (string array) associated with the current level
+    //** %scicos_context  is a struct containing the values defined by the
+    //    calling contexts
+    //**
+    //** 10 Jan 2006
+    //local variable names are prefixed with a %  to limit conflicts with
+    //variables  defined in %txt instructions
+    %ierr = 0 ; //** init
+
+    //next lines checks if variable defined in %ll struct can be evaluated
+    //why ???
+    %mm = fieldnames(%ll)';
+    for %mi=%mm
+        if execstr(%mi+"=%ll(%mi)","errcatch")<>0 then
+            mprintf("%s\n",lasterror())
+            %ierr=1
+            return
+        end
+    end
+    [%ll,%ierr] = getvardef(%txt,%ll)
+    if %ierr<>0 then return, end
+endfunction
+
+//**--------------------------------------------------------------------------
+function [%ll,%ierr]=getvardef(%txt,%ll)
+    //extend and modify the %scicos_context variable (%ll) with the variable
+    //defined in the current level scs_m.props.context (%txt) instructions
+
+    //local variable names are prefixed with a %  to limit conflicts with
+    //variables  defined in %txt instructions
+
+    %nww="";%ierr=0;  // to make sure %nww and %ierr does not enter the difference
+    if isempty(%txt) then return,end
+    %nww=size(who("get"),"*")
+
+    %ierr=execstr(%txt,"errcatch")
+    if %ierr<>0 then mprintf("%s\n",lasterror()), return,end
+
+    %mm=who("get")
+    %mm=%mm(1:size(%mm,"*")-%nww)
+    //%mm contains the list of the variables defined by execstr(%txt,'errcatch')
+    for %mi=%mm(:)'
+        if %mi=="scs_m" then
+            mprintf(_("The variable name %s cannot be used as block parameter: ignored"),"scs_m");
+            continue
+        elseif %mi=="ans" then
+            continue
+        end
+
+        clear %v
+        %v=evstr(%mi);
+
+        if typeof(%v)=="scs_m" then
+            mprintf(_("The variable name %s cannot be used as block parameter: ignored"),"scs_m")
+            continue
+        elseif or(type(%v)==[11 13 14]) then
+            continue
+        end
+
+        %ll(%mi)=%v;
+        clear %v
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/scs_full_path.bin b/modules/scicos/macros/scicos_scicos/scs_full_path.bin
new file mode 100755
index 000000000..5897dde40
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scs_full_path.bin
diff --git a/modules/scicos/macros/scicos_scicos/scs_full_path.sci b/modules/scicos/macros/scicos_scicos/scs_full_path.sci
new file mode 100755
index 000000000..4986982b2
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scs_full_path.sci
@@ -0,0 +1,31 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - Serge Steer <serge.steer@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function path=scs_full_path(P)
+    // Given a path in the superclock hierachy, this function returns a path
+    // in the scs_m data structure
+    // P is a vector of numbers. All but the last entries are Superblocks index
+    // path is a list such as scs_m(path) is the required object
+
+    path=list("objs");
+    for l=P(1:$-1),path($+1)=l;path($+1)="model";path($+1)= "rpar";path($+1)="objs";end
+    path($+1)=P($);
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scs_show.bin b/modules/scicos/macros/scicos_scicos/scs_show.bin
new file mode 100755
index 000000000..34d6a5fe5
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scs_show.bin
diff --git a/modules/scicos/macros/scicos_scicos/scs_show.sci b/modules/scicos/macros/scicos_scicos/scs_show.sci
new file mode 100755
index 000000000..61aea6699
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scs_show.sci
@@ -0,0 +1,47 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function scs_show(scs_m, win)
+    //**
+    //** 24 Nov 2006: Super simplified version
+    //**
+
+    if %scicos_debug_gr then
+        disp(_("scs_show active..."))
+    end
+
+    gh_curwin = scf(win) ;
+
+    if ~set_cmap(scs_m.props.options("Cmap")) then // add colors if required
+        scs_m.props.options("3D")(1)=%f //disable 3D block shape
+    end
+
+    options = scs_m.props.options ; //** not used
+
+    set_background(gh_curwin)     ;
+    pwindow_set_size(gh_curwin)   ;
+    window_set_size(gh_curwin)    ;
+
+    scs_m.props.title(1) = msprintf(_("Scilab Graphics of %s"),scs_m.props.title(1))
+
+    drawobjs(scs_m, gh_curwin)
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/scstxtedit.bin b/modules/scicos/macros/scicos_scicos/scstxtedit.bin
new file mode 100755
index 000000000..f2b31006e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scstxtedit.bin
diff --git a/modules/scicos/macros/scicos_scicos/scstxtedit.sci b/modules/scicos/macros/scicos_scicos/scstxtedit.sci
new file mode 100755
index 000000000..0d60cbbbe
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/scstxtedit.sci
@@ -0,0 +1,62 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+//## scstxtedit : Input function of the text editor
+//##    We exit from that function if Quit or use
+//##    the commit button.
+//##
+//## Inputs : str_in : the input text to edit
+//##          clos : a flag to close the window
+//##                 0 : No
+//##                 1 : close
+//##
+//##          str_out : the edited output text
+//##                   can be [] if abort
+//##          Quit : a flag to say if the buffer has been
+//##                 closed
+//##                 0 : No
+//##                 1 : Quit
+//##
+function [str_out,Quit] = scstxtedit(str_in,ptxtedit)
+    //** check lhs/rhs arg
+    [lhs,rhs]=argn(0)
+
+    //## param from ptxtedit
+    clos = ptxtedit.clos
+    typ  = ptxtedit.typ
+    head = ptxtedit.head
+
+    if clos<>1 then
+        if head==[] then
+            str_out = dialog(["DIALOG"], str_in) ;
+        else
+            str_out = dialog([head], str_in) ;
+        end
+    else
+        str_out=[];
+    end
+
+    if str_out == [] then
+        Quit = 1
+    else
+        Quit = 0
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/set_io.bin b/modules/scicos/macros/scicos_scicos/set_io.bin
new file mode 100755
index 000000000..867dae496
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/set_io.bin
diff --git a/modules/scicos/macros/scicos_scicos/set_io.sci b/modules/scicos/macros/scicos_scicos/set_io.sci
new file mode 100755
index 000000000..429854bf4
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/set_io.sci
@@ -0,0 +1,284 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [model,...
+    graphics,...
+    ok]=set_io(model,...
+    graphics,...
+    in#,...
+    out#,...
+    clkin,...
+    clkout,...
+    in_implicit,...
+    out_implicit)
+    // CHECK
+    if argn(2)<=6 then
+        in_implicit=[]
+    out_implicit=[], end
+    deff("[str__err]=str__err(err__,"+...
+    "str__#)",...
+    ["str__err=''ERROR''"
+    "select err__"
+    "case 1 then"
+    "str__err=str__#+...
+    ''put port "+...
+    "must be "+...
+    " list''"
+    "case 2 then"
+    "str__err=str__#+...
+    ''put list "+...
+    "must have "+...
+    "a size "+...
+    "of 2''"
+    "case 3 then"
+    "str__err=''First entry of ''+...
+    str__#+...
+    ''put list "+...
+    " must  be "+...
+    "double "+...
+    "or integer''"
+    "case 4 then"
+    "str__err=''Second entry of ''+...
+    str__#+...
+    ''put list "+...
+    "must  be "+...
+    "double "+...
+    "or integer''"
+    "case 10 then"
+    "str__err=str__#+...
+    ''put port "+...
+    "sizes "+...
+    "must have "+...
+    "a dimension "+...
+    "of nx2''"
+    "case 11 then"
+    "str__err=str__#+...
+    ''put port "+...
+    "sizes and ''+...
+    str__#+...
+    ''put port "+...
+    "type "+...
+    "must have "+...
+    "the same number "+...
+    "of rows''"
+    "case 100 then"
+    "str__err=str__#+...
+    ''put port "+...
+    "type must "+...
+    "be <=8''"
+    "end"])
+    deff("[var,"+...
+    "vart,"+...
+    "ierr,"+...
+    "ko]=extract__(var#)",...
+    ["ko=%f"
+    "ierr=0"
+    "var=[]"
+    "vart=1"
+    "if type(var#)<>15 then"
+    "ierr=1,"
+    "resume, end"
+    "if var#<>list() then"
+    "if lstsize(var#)<>2 then"
+    "ierr=2,"
+    "resume, end"
+    "for i=1:2"
+    "if ~(type(var#(i))==1|"+...
+    "type(var#(i))==8) then"
+    "ierr=2+i,"
+    "resume, end"
+    "end"
+    "if var#(1)<>[] then"
+    "if size(var#(1),2)<>2 then"
+    "ierr=10,"
+    "resume, end"
+    "if size(var#(1),1)<>"+...
+    "size(var#(2)(:),1) then"
+    "ierr=11,"
+    "resume, end"
+    "if max(var#(2))>8 then"
+    "ierr=100,"
+    "resume, end"
+    "var=int(var#(1))"
+    "vart=int(var#(2)(:))"
+    "end"
+    "end"
+    "ko=%t"])
+    [in,...
+    in_t,...
+    err__,...
+    ko]=extract__(in#)
+    if ~ko then
+        messagebox("set_io : "+ str__err(err__,"in") , "modal")
+        ok=%f
+    return, end
+    [out,..
+    out_t,...
+    err__,...
+    ko]=extract__(out#)
+    if ~ko then
+        messagebox("set_io : "+ str__err(err__, "out") ,"modal")
+        ok=%f
+    return, end
+
+    clkin=int(clkin(:))
+    nclkin=size(clkin,1)
+    if nclkin>0 then
+        if min(clkin)<1 then
+            messagebox("set_io : " + "Event input ports sizes must be positive","modal")
+            ok=%f
+        return, end
+    end
+    clkout=int(clkout(:))
+    nclkout=size(clkout,1)
+    if nclkout>0 then
+        if min(clkout)<1 then
+            messagebox("set_io : "+ "Event output ports sizes must be positive","modal")
+            ok=%f
+        return, end
+    end
+
+    // set_io first check if given numbe
+    // of ports agree with block connection
+    [label,...
+    ip1,...
+    op1,...
+    cip1,...
+    cop1]=(graphics.exprs,...
+    graphics.pin,...
+    graphics.pout,...
+    graphics.pein,...
+    graphics.peout)
+    [in1,...
+    in2,...
+    intyp,...
+    out1,...
+    out2,...
+    outtyp,...
+    clkin1,...
+    clkout1]=(model.in,...
+    model.in2,...
+    model.intyp,...
+    model.out,...
+    model.out2,...
+    model.outtyp,...
+    model.evtin,...
+    model.evtout)
+
+    n1=size(in1(:,1),"*") //current number of input port of model
+    n=size(in(:,1),"*") //given number of input port
+    if n1>n then
+        //    if or(ip1(n+1:$)>0) then
+        //      messagebox('set_io : '+'Connected ports cannot be suppressed','modal')
+        //       ok=%f
+        //        return, end
+        ip1=ip1(1:n)
+    else
+        ip1=[ip1;zeros(n-n1,1)]
+    end
+    n1=size(out1(:,1),"*")
+    n=size(out(:,1),"*")
+    if n1>n then
+        //    if or(op1(n+1:$)>0) then
+        //      messagebox('set_io : '+...
+        //               'Connected ports cannot be suppressed', 'modal')
+        //       ok=%f
+        //        return, end
+        op1=op1(1:n)
+    else
+        op1=[op1;zeros(n-n1,1)]
+    end
+
+    n1=size(clkin1,"*")
+    n=size(clkin,"*")
+    if n1>n then
+        //    if or(cip1(n+1:$)>0) then
+        //      messagebox('set_io : '+...
+        //               'Connected ports cannot be suppressed','modal')
+        //       ok=%f
+        //        return, end
+        cip1=cip1(1:n)
+    else
+        cip1=[cip1;zeros(n-n1,1)]
+    end
+    n1=size(clkout1,"*")
+    n=size(clkout,"*")
+    if n1>n then
+        //    if or(cop1(n+1:$)>0) then
+        //      messagebox('set_io : '+...
+        //               'Connected ports cannot be suppressed','modal')
+        //       ok=%f
+        //        return, end
+        cop1=cop1(1:n)
+    else
+        cop1=[cop1;zeros(n-n1,1)]
+    end
+
+    I="E"
+
+    if ip1<>[] then
+        in_impl=I(ones(ip1))
+        in_impl(in_implicit)="I"
+        //    kk=size(graphics.in_implicit,'*')
+        //     k=find(ip1<>0) //connected links
+        //      k=k(find(k<=kk))
+        //    if or(graphics.in_implicit(k)<>in_impl(k)) then
+        //      messagebox('set_io : '+...
+        //               'Connected ports types cannot be changed','modal')
+        //       ok=%f
+        //        return, end
+    else
+        in_impl=[]
+    end
+    if op1<>[] then
+        out_impl=I(ones(op1))
+        out_impl(out_implicit)="I"
+        //    kk=size(graphics.out_implicit,'*')
+        //     k=find(op1<>0) //connected links
+        //      k=k(find(k<=kk))
+        //    if or(graphics.out_implicit(k)<>out_impl(k)) then
+        //      messagebox('set_io : '+...
+        //               'Connected ports types cannot be changed','modal')
+        //       ok=%f
+        //        return, end
+    else
+        out_impl=[]
+    end
+
+    // SET
+    ok=%t
+    graphics.pin=ip1
+    graphics.pout=op1
+    graphics.pein=cip1
+    graphics.peout=cop1
+    graphics.in_implicit=in_impl
+    graphics.out_implicit=out_impl
+    model.in=in(:,1)
+    model.in2=in(:,2)
+    model.intyp=in_t
+    model.out=out(:,1)
+    model.out2=out(:,2)
+    model.outtyp=out_t
+    model.evtin=clkin
+    model.evtout=clkout
+
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/setvalue.bin b/modules/scicos/macros/scicos_scicos/setvalue.bin
new file mode 100755
index 000000000..0d1ad7bfd
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/setvalue.bin
diff --git a/modules/scicos/macros/scicos_scicos/setvalue.sci b/modules/scicos/macros/scicos_scicos/setvalue.sci
new file mode 100755
index 000000000..742c1aac3
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/setvalue.sci
@@ -0,0 +1,282 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//                      - Alan Layec <alan.layec@inria.fr>
+//  Copyright (C) 2010 - DIGITEO - Clément DAVID <clement.david@scilab.org>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [%ok,%1,%2,%3,%4,%5,...
+    %6,%7,%8,%9,%10,...
+    %11,%12,%13,%14,%15,...
+    %16,%17,%18,%19,%20,...
+    %21,%22,%23,%24,%25,...
+    %26,%27,%28,%29,%30]=setvalue(%desc,%lables,%typ,%ini)
+
+    // To avoid infinite loops in set section of blocks during eval
+    if %scicos_prob==%t then
+        %ok=%f
+        [%1,%2,%3,%4,%5,...
+        %6,%7,%8,%9,%10,...
+        %11,%12,%13,%14,%15,...
+        %16,%17,%18,%19,%20,...
+        %21,%22,%23,%24,%25,...
+        %26,%27,%28,%29,%30]=(0,0,0,0,0,...
+        0,0,0,0,0,...
+        0,0,0,0,0,...
+        0,0,0,0,0,...
+        0,0,0,0,0,...
+        0,0,0,0,0)
+    return;end
+    //  setvalues -  data acquisition, getvalue equivalent without dialog
+    //%Syntax
+    //  [%ok,x1,..,x18]=setvalue(desc,labels,typ,ini)
+    //%Parameters
+    //  desc    : column vector of strings, dialog general comment
+    //  labels  : n column vector of strings, labels(i) is the label of
+    //            the ith required value
+    //  typ     : list(typ1,dim1,..,typn,dimn)
+    //            typi : defines the type of the ith required value
+    //                   if may have the following values:
+    //                   'mat' : stands for matrix of scalars
+    //                   'col' : stands for column vector of scalars
+    //                   'row' : stands for row vector of scalars
+    //                   'vec' : stands for  vector of scalars
+    //                   'str' : stands for string
+    //                   'lis' : stands for list
+    //                   'pol' : stands for polynomials
+    //                   'r'   : stands for rational
+    //            dimi : defines the size of the ith required value
+    //                   it must be
+    //                    - an integer or a 2-vector of integers (-1 stands for
+    //                      arbitrary dimension)
+    //                    - an evaluatable character string
+    //  ini     : n column vector of strings, ini(i) gives the suggested
+    //            response for the ith required value
+    //  %ok      : boolean ,%t if %ok button pressed, %f if cancel button pressed
+    //  xi      : contains the ith required value if %ok==%t
+    //%Description
+    // getvalues function uses ini strings to evaluate required args
+    // with error checking,
+    //%Remarks
+    // All correct scilab syntax may be used as responses, for matrices
+    // and vectors getvalues automatically adds [ ] around the given response
+    // before numerical evaluation
+    //%Example
+    // labels=['magnitude';'frequency';'phase    '];
+    // [ampl,freq,ph]=setvalue('define sine signal',labels,..
+    //            list('vec',1,'vec',1,'vec',1),['0.85';'10^2';'%pi/3'])
+    //
+    //%See also
+    // x_mdialog, dialog
+    //!
+    // 17/01/07 -Alan- - %scicos_context behavior reviewed in accordance to context_evstr macro
+    //                 - pass int in field of type vec/mat/row/col (F. Nassif's Work)
+    //
+    // 05/02/07 -Alan- : update to %20 rhs parameters
+    //
+    // Copyright INRIA
+    [%lhs,%rhs]=argn(0)
+
+    %nn=prod(size(%lables))
+    if %lhs<>%nn+2&%lhs<>%nn+1 then error(41),end
+    if size(%typ)<>2*%nn then
+        error("typ : list(''type'',[sizes],...)")
+    end
+    %1=[];%2=[];%3=[];%4=[];%5=[];
+    %6=[];%7=[];%8=[];%9=[];%10=[];
+    %11=[];%12=[];%13=[];%14=[],%15=[];
+    %16=[];%17=[];%18=[];%19=[],%20=[];
+    %21=[];%22=[];%23=[];%24=[],%25=[];
+    %26=[];%27=[];%28=[];%29=[],%30=[];
+
+    if %rhs==3 then  %ini=emptystr(%nn,1),end
+    %ok=%t
+    while %t do
+        %str=%ini;
+        if %str==[] then %ok=%f,break,end
+        for %kk=1:%nn
+            %cod=ascii(%str(%kk))
+            %spe=find(%cod==10)
+            if %spe<>[] then
+                %semi=ascii(";")
+                %cod(%spe)=%semi*ones(%spe')
+                %str(%kk)=ascii(%cod)
+            end
+        end
+
+        [%vv_list,%ierr_vec]=context_evstr(%str,%scicos_context,%typ);
+
+        %noooo=0
+        for %kk=1:%nn
+            %vv=%vv_list(%kk)
+            %ierr=%ierr_vec(%kk)
+            select part(%typ(2*%kk-1),1:6)
+            case "mat   "
+                if %ierr<>0  then
+                    %noooo=-%kk,break,
+                end
+                //29/12/06
+                //the type of %vv is accepted if it is constant or integer
+                if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                [%mmmm,%nnnnn]=size(%vv)
+                %ssss=string(%sz(1))+"-by-"+string(%sz(2)) + " matrix"
+                if %mmmm*%nnnnn==0 then
+                    if  %sz(1)>=0&%sz(2)>=0&%sz(1)*%sz(2)<>0 then %noooo=%kk,break,end
+                else
+                    if %sz(1)>=0 then if %mmmm<>%sz(1) then %noooo=%kk,break,end,end
+                    if %sz(2)>=0 then if %nnnnn<>%sz(2) then %noooo=%kk,break,end,end
+                end
+            case "vec   "
+                if %ierr<>0  then
+                    %noooo=-%kk,break,
+                end
+                //17/01/07
+                //the type of %vv is accepted if it is constant or integer
+                if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                %ssss=string(%sz(1))
+                %nnnnn=prod(size(%vv))
+                if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end
+            case "intvec"
+                if %ierr<>0  then
+                    %noooo=-%kk,break,
+                end
+                //the type of %vv is accepted if it is constant or integer
+                if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                %ssss=string(%sz(1))
+                %nnnnn=prod(size(%vv))
+                if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end
+            case "pol   "
+                if %ierr<>0  then
+                    %noooo=-%kk,break,
+                end
+                if %ierr<>0 then %noooo=-%kk;break,end
+                if (type(%vv)>2 & type(%vv)<>8) then %noooo=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                %ssss=string(%sz(1))
+                %nnnnn=prod(size(%vv))
+                if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end
+            case "row   "
+                if %ierr<>0  then
+                    %noooo=-%kk,break,
+                end
+                //17/01/07
+                //the type of %vv is accepted if it is constant or integer
+                if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                if %sz(1)<0 then
+                    %ssss="1-by-n matrix"
+                else
+                    %ssss="1-by-"+string(%sz(1))+" matrix"
+                end
+                [%mmmm,%nnnnn]=size(%vv)
+                if %mmmm<>1 then %noooo=%kk,break,end,
+                if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end
+            case "col   "
+                if %ierr<>0  then
+                    %noooo=-%kk,break,
+                end
+                //17/01/07
+                //the type of %vv is accepted if it is constant or integer
+                if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                if %sz(1)<0 then
+                    %ssss="m-by-1 matrix"
+                else
+                    %ssss=string(%sz(1))+"-by-1 matrix"
+                end
+                [%mmmm,%nnnnn]=size(%vv)
+                if %nnnnn<>1 then %noooo=%kk,break,end,
+                if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end
+            case "str   "
+                clear %vv
+                %vv=%str(%kk)
+                if type(%vv)<>10 then %noooo=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                %ssss=string(%sz(1))
+                %nnnnn=prod(size(%vv))
+                if %sz(1)>=0 then if %nnnnn<>1 then %noooo=%kk,break,end,end
+            case "lis   "
+                if %ierr<>0  then
+                    %noooo=-%kk,break,
+                end
+                if type(%vv)<>15& type(%vv)<>16& type(%vv)<>17 then %noooo=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                %ssss=string(%sz(1))
+                %nnnnn=size(%vv)
+                if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end
+            case "r     "
+                if %ierr<>0  then
+                    %noooo=-%kk,break,
+                end
+                if type(%vv)<>16 then %noooo=-%kk,break,end
+                if typeof(%vv)<>"rational" then %noooo=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                [%mmmm,%nnnnn]=size(%vv(2))
+                %ssss=string(%sz(1))+"-by-"+string(%sz(2))
+                if %mmmm*%nnnnn==0 then
+                    if  %sz(1)>=0&%sz(2)>=0&%sz(1)*%sz(2)<>0 then %noooo=%kk,break,end
+                else
+                    if %sz(1)>=0 then if %mmmm<>%sz(1) then %noooo=%kk,break,end,end
+                    if %sz(2)>=0 then if %nnnnn<>%sz(2) then %noooo=%kk,break,end,end
+                end
+            case "gen   "
+                //accept all
+            else
+                str = gettext("%s: Type %s is not implemented.\n");
+                mess = msprintf(str, arg1.gui + "(''set'')", %typ(2*%kk-1));
+                if length(arg1.doc) > 0 then
+                    warnBlockByUID(arg1.doc(1), mess); // arg1 is from the block interface function
+                else
+                    error(mess);
+                end
+            end
+            execstr("%"+string(%kk)+"=%vv")
+            clear %vv
+        end
+        if %noooo>0 then
+            str = gettext("%s: Wrong size for block parameter ''%s'': %s expected, getting %s");
+            mess = msprintf(str, arg1.gui + "(''set'')", %lables(%noooo), %ssss, %ini(%noooo));
+            if length(arg1.doc) > 0 then
+                warnBlockByUID(arg1.doc(1), mess); // arg1 is from the block interface function
+            else
+                disp(mess);
+            end
+            %ini=%str
+            %ok=%f;break
+        elseif %noooo<0 then
+            str = gettext("%s: Wrong type for block parameter ''%s'': %s(%s) expected, getting %s");
+            mess = msprintf(str, arg1.gui + "(''set'')", %lables(-%noooo), %typ(-2*%noooo-1), strcat(string(%typ(-2*%noooo))," by "), %ini(-%noooo));
+            if length(arg1.doc) > 0 then
+                warnBlockByUID(arg1.doc(1), mess); // arg1 is from the block interface function
+            else
+                disp(mess);
+            end
+            %ini=%str
+            %ok=%f;break
+        else
+            break
+        end
+    end
+    if %lhs==%nn+2 then
+        execstr("%"+string(%lhs-1)+"=%str")
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/shiftcors.bin b/modules/scicos/macros/scicos_scicos/shiftcors.bin
new file mode 100755
index 000000000..c3827b83e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/shiftcors.bin
diff --git a/modules/scicos/macros/scicos_scicos/shiftcors.sci b/modules/scicos/macros/scicos_scicos/shiftcors.sci
new file mode 100755
index 000000000..c96b11d71
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/shiftcors.sci
@@ -0,0 +1,32 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function cors=shiftcors(cors,ns)
+    n=size(cors)
+    for k=1:n
+        if type(cors(k))==15 then
+            cors(k)=shiftcors(cors(k),ns)
+        else
+            if cors(k)<0 then cors(k)=cors(k);
+            elseif cors(k)<>0 then cors(k)=cors(k)+ns,end
+        end
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/split_lasterror.bin b/modules/scicos/macros/scicos_scicos/split_lasterror.bin
new file mode 100755
index 000000000..473217102
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/split_lasterror.bin
diff --git a/modules/scicos/macros/scicos_scicos/split_lasterror.sci b/modules/scicos/macros/scicos_scicos/split_lasterror.sci
new file mode 100755
index 000000000..5ee5d1aa1
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/split_lasterror.sci
@@ -0,0 +1,47 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - Alan Layec <alan.layec@inria.fr>
+//  Copyright (C) 2012-2012 - Scilab Enterprises - Bruno JOFRET
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function str_out=split_lasterror(str_in)
+    //** Fix the unreadable error messages
+    //** returned by the simulator.
+    //** Alan, 11/10/07 : Initial rev
+    str_out = [];
+    for nLine = 1:size(str_in, "r")
+        ind_bl=strindex(str_in(nLine)," ");
+
+        // Find some room in a line with more than 50 characters.
+        if find(ind_bl > 50) <> [] then
+            ind_bl2 = ind_bl;
+            nind = [];
+            for i = 1:size(ind_bl,2)
+                if ind_bl2(i) > 50 then
+                    nind = [nind ; ind_bl(i)];
+                    ind_bl2 = ind_bl2 - ind_bl2(i);
+                end
+            end
+            str_out = [str_out ; strsplit(str_in(nLine),nind)]
+        else
+            str_out = [str_out ; str_in(nLine)];
+        end
+
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/standard_define.bin b/modules/scicos/macros/scicos_scicos/standard_define.bin
new file mode 100755
index 000000000..dbe5283a1
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_define.bin
diff --git a/modules/scicos/macros/scicos_scicos/standard_define.sci b/modules/scicos/macros/scicos_scicos/standard_define.sci
new file mode 100755
index 000000000..f0d390cea
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_define.sci
@@ -0,0 +1,52 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function o=standard_define(sz,model,label,gr_i)
+    //initialize graphic part of the block data structure
+
+    if argn(2)<4 then gr_i=[],end
+
+    nin=size(model.in,1);
+    if nin>0 then pin(nin,1)=0,else pin=[],end
+
+    nout=size(model.out,1);
+    if nout>0 then pout(nout,1)=0,else pout=[],end
+
+    ncin=size(model.evtin,1);
+    if ncin>0 then pein(ncin,1)=0,else pein=[],end
+
+    ncout=size(model.evtout,1);
+    if ncout>0 then peout(ncout,1)=0,else peout=[],end
+
+    if type(gr_i)<>15 then gr_i=list(gr_i,8),end
+    if gr_i(2)==[] then gr_i(2)=8,end
+    if gr_i(2)==0 then gr_i(2)=[],end
+
+    graphics=scicos_graphics(sz=sz,pin=pin,pout=pout,pein=pein,peout=peout, ...
+    gr_i=gr_i,exprs=label)
+
+    //  if model.sim(1)=='super' then
+    //    o=scicos_block(graphics=graphics,model=model,gui='SUPER_f')
+    //  else
+    [ln,mc]=where()
+    o=scicos_block(graphics=graphics,model=model,gui=mc(2))
+    //  end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/standard_draw.bin b/modules/scicos/macros/scicos_scicos/standard_draw.bin
new file mode 100755
index 000000000..3041e473d
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_draw.bin
diff --git a/modules/scicos/macros/scicos_scicos/standard_draw.sci b/modules/scicos/macros/scicos_scicos/standard_draw.sci
new file mode 100755
index 000000000..569358f36
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_draw.sci
@@ -0,0 +1,251 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function standard_draw (o, frame, draw_ports, up)
+    //
+    //
+    //** This function is used to draw the object from the most of (but NOT all) the interface functions
+    //**
+    //** 21 Nov 2006 : some save/restore patch moved to upper level "drawobj.sci"
+    //** 22 Jun 2009  (Serge Steer INRIA)
+    //   -  gh_curwin.children use replaced by gh_axes to get the
+    //      axes children because uimenu are now children of the figure
+    //   -  use gh_blk for argument of dig_bound_compound
+    //   -  use of gh_text to set text properties of the indentifier (instead
+    //      of modifying  the correponding axes properties
+
+    xf = 60 ; yf = 40 ;
+
+    [lhs,rhs] = argn(0)
+
+    if rhs==1 then
+        frame=%t
+    end
+
+    if rhs<3 then
+        draw_ports = standard_draw_ports     //** left right ports
+        //** the function 'standard_draw_ports' it's copied in 'draw_ports'
+    elseif rhs==4 then                       //** otherwise
+        draw_ports = standard_draw_ports_up  //** up / down ports
+    end                                      //** the function 'standard_draw_ports_up' it's copied in 'draw_ports'
+
+    nin   = size(o.model.in,1);
+    nout  = size(o.model.out,1);
+    clkin = size(o.model.evtin,1);
+    clkout= size(o.model.evtout,1);
+    [orig,sz,orient] = (o.graphics.orig,o.graphics.sz,o.graphics.flip)
+
+    //** Default values -------------------
+    thick = 1              ; //** patch Simone
+    e = 4 ;
+    With3D = options("3D")(1)
+    //** ----------------------------------
+
+    gr_i = o.graphics.gr_i
+
+    if type(gr_i) == 15 then
+        [gr_i,coli] = gr_i(1:2) ;
+    else
+        coli = [] ;
+    end
+
+    //** --------------------------------------- draw box ------------------------------------------------
+    if frame then
+        if With3D then  //** this is the code relative to the block's "window dressing"
+            //**---------- 3D Mode ON -----------------------------------------------------------------------
+            #Color3D = options("3D")(2)
+            // xpoly([orig(1)+e;orig(1)+sz(1);orig(1)+sz(1)],[orig(2)+sz(2);orig(2)+sz(2);orig(2)+e],'lines')
+            xrect( orig(1)+e, orig(2)+sz(2), sz(1)-e, sz(2)-e) ;
+            gh_e = gce(); //** new graphics :)
+            gh_e.thickness = 0 ;
+            gh_e.foreground = #Color3D ;
+
+            if coli<>[] then
+                gh_e.fill_mode = "on"  ;
+                gh_e.background = coli ;
+            end
+
+            xx = [ orig(1)   , orig(1)
+            orig(1)   , orig(1)+sz(1)-e
+            orig(1)+e , orig(1)+sz(1)
+            orig(1)+e , orig(1)+e] ;
+
+            yy = [orig(2)         , orig(2)
+            orig(2)+sz(2)-e , orig(2)
+            orig(2)+sz(2)   , orig(2)+e
+            orig(2)+e       , orig(2)+e];
+
+            xfpolys(xx,yy,-[1,1]*#Color3D); //** fill a set of polygons
+            gh_e = gce()              ;
+            gh_c = gh_e.children(1:2) ;
+            gh_c.foreground = default_color(0) ;
+            gh_c.thickness = 2 ;
+
+        else //** not in 3D mode
+            //**----------3D Mode OFF -------------------------------------------------------------------------
+            e = 0 ;
+            xrect(orig(1),orig(2)+sz(2),sz(1),sz(2)) ;
+            gh_e = gce()       ;
+            gh_e.thickness = 2 ;
+
+            if coli<>[] then
+                gh_e.fill_mode = "on"  ;
+                gh_e.background = coli ;
+            end
+
+        end //** of 3D mode ON/OFF
+    end //** of the frame mode
+    draw_ports(o) ; //** 'standard_draw_ports' or 'standard_draw_ports_up'
+    //** --------------------------------------------------------------------------------------------------------------
+
+    //** ---- scs_m , %cpr Indexes Show including information on internal superblocks ---------------------------------
+    if exists("%scicos_with_grid") then
+        if %scicos_with_grid then
+            scs_m_i=[]; cpr_i=[] ; sflag=[] ;
+            win_id = gh_current_window.figure_id
+
+            kc = find(win_id==windows(:,2))
+
+            pal = windows(kc,1);
+
+            if pal > 0 then
+                if ~exists("scs_m_index") then scs_m_index=-1, end
+                [scs_m_i, cpr_i, sflag] = get2index(o, scs_m_index);
+
+                txt_index = [];
+                if scs_m_i<>[] & cpr_i<>[] then
+                    if sflag<>[] then
+                        txt_index = string(scs_m_i)+"s, "+cpr_i+"c";
+                    else
+                        txt_index = string(scs_m_i)+"s, "+string(cpr_i)+"c";
+                    end
+                end
+
+                gh_axes = gca(); //** get the Axes proprieties
+
+                // draw indexes
+                if txt_index<>[] then
+
+                    //@@ compute bbox
+                    rect = stringbox(txt_index, orig(1), orig(2), 0,...
+                    options.ID(1)(1), options.ID(1)(2));
+
+                    w = (rect(1,3)-rect(1,2)) * %zoom;
+                    w = max(w, sz(1));
+                    h = (rect(2,2)-rect(2,4)) * 1.3 * %zoom/1.4;
+
+                    //@@ fill txt_index in a box
+                    xstringb(orig(1) + sz(1) / 2 - w / 2, orig(2) + sz(2), txt_index , w, h,"fill") ;
+                    gh_txt = gce();
+                    gh_txt.font_style = options.ID(1)(1) ;
+                    gh_txt.font_size  = options.ID(1)(2) ;
+
+                end
+            end
+        end
+    end //** of on/off control
+    //** --------------------------------------------------------------------------------------------------------------
+
+    //** --------------------------------- draw gr_i ---------------------------------
+    o_size=size(gh_axes.children)
+    deff("c=scs_color(c)"," ") ; //** on line function definition
+    gr_i = [gr_i]; //** simple but not simpler :)
+    model = o.model
+    if With3D & frame then
+        orig = orig + e ;
+        sz   = sz - e   ;
+    end
+    //@@ Alan,28/11/08 : protect variables of standard_draw
+    deff("ierr=exec_gr_i(gr_i)","ierr=execstr(gr_i,''errcatch'',''n'');") ; //** on line function definition
+    //** Check of the graphics object has generated any error
+    if exec_gr_i(gr_i)<>0 then
+        messagebox(["Error in Icon defintion"; lasterror()],"modal")
+    end
+    //** -----------------------------------------------------------------------------
+
+    //** -------------------------------- Identification --------------------------------------------------------------
+
+    ident = o.graphics.id
+
+    // draw Identification
+    if ident<>[] & ident<>"" then
+
+
+        //@@ compute bbox of gr object
+
+        p_size=size(gh_axes.children);
+        if p_size(1)-o_size(1)<>0 then
+            gh_blk=glue(gh_axes.children(1:(p_size(1)-o_size(1))));
+            rect=dig_bound_compound(gh_blk)
+            //@@ Alan,28/11/08 : I redraw all here because glue/unglue op change
+            //@@                 some properties of objects in the compound
+            //unglue(gh_blk)
+            delete(gh_blk)
+            exec_gr_i(gr_i) //@@ no test here : this have been done previously
+        else
+            rect=[orig(1) orig(2) orig(1)+sz(1) orig(2)+sz(2)]
+        end
+        if With3D & frame then
+            rect(1,1)=rect(1,1)-e
+            rect(1,2)=rect(1,2)-e
+            orig = orig - e ;
+            sz   = sz + e   ;
+        end
+        //rect(1,1)=min(rect(1,1),orig(1))
+        rect(1,2)=min(rect(1,2),orig(2))
+        //rect(1,3)=max(rect(1,3),orig(1)+sz(1))
+        rect(1,4)=max(rect(1,4),orig(2)+sz(2))
+
+        //@@ compute bbox
+        rectstr = stringbox(ident, rect(1,1), rect(1,2), 0,...
+        options.ID(1)(1), options.ID(1)(2));
+        w=(rectstr(1,3)-rectstr(1,2)) * %zoom;
+        h=(rectstr(2,2)-rectstr(2,4)) * %zoom;
+
+        //@@ fill ident in a box
+        xstringb(orig(1) + sz(1) / 2 - w / 2, rect(1,2) - (h*1.1) , ident , ...
+        w, h,"fill") ;
+        //@@ Serge 22 Jun 2009
+        gh_text=gce();
+        gh_text.font_style = options.ID(1)(1) ;
+        gh_text.font_size  = options.ID(1)(2) ;
+        gh_text.font_foreground = options.ID(1)(3) ; //@@
+
+        //@@ set visible
+        if gh_axes.children(1).type == "Text" then
+            if options.ID(1)(4)==0 then
+                gh_axes.children(1).visible="off"
+            else
+                gh_axes.children(1).visible="on"
+            end
+        else //@@compound
+            for i=1:size(gh_axes.children(1).children,1)
+                if options.ID(1)(4)==0 then
+                    gh_axes.children(1).children(i).visible="off"
+                else
+                    gh_axes.children(1).children(i).visible="on"
+                end
+            end
+        end
+    end
+    //** --------------------------- Identification End --------------------------------------------------------------
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/standard_draw_ports.bin b/modules/scicos/macros/scicos_scicos/standard_draw_ports.bin
new file mode 100755
index 000000000..69330a7f8
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_draw_ports.bin
diff --git a/modules/scicos/macros/scicos_scicos/standard_draw_ports.sci b/modules/scicos/macros/scicos_scicos/standard_draw_ports.sci
new file mode 100755
index 000000000..f5045b0c5
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_draw_ports.sci
@@ -0,0 +1,211 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function standard_draw_ports(o)
+
+    nin = size(o.model.in,1);
+    nout= size(o.model.out,1);
+    inporttype  = o.graphics.in_implicit
+    outporttype = o.graphics.out_implicit
+    clkin  = size(o.model.evtin,1);
+    clkout = size(o.model.evtout,1);
+
+    [orig,sz,orient]=(o.graphics.orig,o.graphics.sz,o.graphics.flip)
+
+    // xset('pattern',default_color(0));
+    // xset('thickness',1)
+    // draw input/output ports
+    //------------------------
+
+    //** --------- For the implict mode only ----------
+    //if o.model.sim=='inimpl'  then pause, end
+    //** -----------------------------------------------
+
+
+    if orient then  //standard orientation
+        // set port shape
+        out1=[ 0  -1
+        1   0
+        0   1
+        0  -1]*diag([xf/7,yf/14])
+
+        in1= [-1  -1
+        0   0
+        -1   1
+        -1  -1]*diag([xf/7,yf/14])
+
+        out2=[ 0  -1
+        1  -1
+        1   1
+        0   1]*diag([xf/7,yf/14])
+
+        in2= [-1  -1
+        0  -1
+        0   1
+        -1   1]*diag([xf/7,yf/14])
+        dy=sz(2)/(nout+1)
+
+        //** xset('pattern',default_color(1))
+
+        for k=1:nout
+
+            if outporttype==[] then
+                xfpoly( out1(:,1)+ones(4,1)*(orig(1)+sz(1)), out1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k), 1)
+            else
+                if outporttype(k)=="E" then
+                    xfpoly(out1(:,1)+ones(4,1)*(orig(1)+sz(1)),out1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1)
+                elseif outporttype(k)=="I" then
+                    xpoly(out2(:,1)+ones(4,1)*(orig(1)+sz(1)), out2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),"lines",1)
+                end
+            end
+
+            // gh_e = gce();
+            // gh_e.thickness = 1 ;
+            // gh_e.foreground = default_color(1)
+
+
+        end //** end of for
+
+        dy=sz(2)/(nin+1)
+
+        for k=1:nin
+
+            if inporttype==[] then
+                xfpoly(in1(:,1)+ones(4,1)*orig(1), in1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1)
+            else
+                if inporttype(k)=="E" then
+                    xfpoly(in1(:,1)+ones(4,1)*orig(1), in1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1)
+                elseif inporttype(k)=="I" then
+                    xfpoly(in2(:,1)+ones(4,1)*orig(1), in2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1)
+                end
+            end
+
+            // gh_e = gce();
+            // gh_e.thickness = 1 ;
+            // gh_e.foreground = default_color(1)
+
+
+        end //** end of for
+
+    else //tilded orientation
+        out1=[0  -1
+        -1   0
+        0   1
+        0  -1]*diag([xf/7,yf/14])
+
+        in1= [1  -1
+        0   0
+        1   1
+        1  -1]*diag([xf/7,yf/14])
+
+        out2=[0  -1
+        -1  -1
+        -1   1
+        0   1]*diag([xf/7,yf/14])
+
+        in2= [1  -1
+        0  -1
+        0   1
+        1   1]*diag([xf/7,yf/14])
+
+
+        dy=sz(2)/(nout+1)
+
+        // xset('pattern',default_color(1))
+        for k=1:nout
+
+            if outporttype==[] then
+                xfpoly(out1(:,1)+ones(4,1)*orig(1)-1, out1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1)
+            else
+                if outporttype(k)=="E" then
+                    xfpoly(out1(:,1)+ones(4,1)*orig(1)-1, out1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1)
+                elseif outporttype(k)=="I" then
+                    xpoly(out2(:,1)+ones(4,1)*orig(1)-1, out2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),"lines",1)
+                end
+            end
+
+            //gh_e = gce();
+            //gh_e.thickness = 1 ;
+            // gh_e.foreground = default_color(1)
+
+        end //** end of for
+
+        dy=sz(2)/(nin+1)
+        for k=1:nin
+            if inporttype==[] then
+                xfpoly(in1(:,1)+ones(4,1)*(orig(1)+sz(1))+1, in1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1)
+            else
+                if inporttype(k)=="E" then
+                    xfpoly(in1(:,1)+ones(4,1)*(orig(1)+sz(1))+1, in1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1)
+                elseif inporttype(k)=="I" then
+                    xfpoly(in2(:,1)+ones(4,1)*(orig(1)+sz(1))+1, in2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1)
+                end
+            end
+
+        end //** end of for
+
+        // gh_e = gce();
+        // gh_e.thickness = 1 ;
+        // gh_e.foreground = default_color(1)
+
+    end
+
+    //**----------------------------------------------------------------------------------------------------
+    // draw input/output clock ports
+    //------------------------
+    // set port shape
+
+    out= [-1  0
+    0 -1
+    1  0
+    -1  0]*diag([xf/14,yf/7])
+
+
+    in= [-1  1
+    0  0
+    1  1
+    -1  1]*diag([xf/14,yf/7])
+
+
+    dx=sz(1)/(clkout+1)
+    //** xset('pattern',default_color(-1))
+
+    for k=1:clkout
+        xfpoly(out(:,1)+ones(4,1)*(orig(1)+k*dx), out(:,2)+ones(4,1)*orig(2),1)
+        gh_e = gce();
+        // gh_e.thickness = 1 ;
+        gh_e.foreground = default_color(-1); //** non so perche' ...
+        gh_e.background = default_color(-1); //**      ...  ma funziona :)
+        // pause
+    end
+
+    dx=sz(1)/(clkin+1)
+    for k=1:clkin
+        xfpoly(in(:,1)+ones(4,1)*(orig(1)+k*dx), in(:,2)+ones(4,1)*(orig(2)+sz(2)),1);
+        gh_e = gce();
+        // gh_e.thickness = 1 ;
+        gh_e.foreground = default_color(-1);
+        gh_e.background = default_color(-1);
+    end
+
+    //** xset('pattern',default_color(0))
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.bin b/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.bin
new file mode 100755
index 000000000..d31c1564f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.bin
diff --git a/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.sci b/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.sci
new file mode 100755
index 000000000..e01d882e3
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.sci
@@ -0,0 +1,56 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function standard_draw_ports_up(o)
+
+    nin=size(o.model.in,1);
+
+    inporttype=o.graphics.in_implicit
+    nout=size(o.model.out,1);
+    outporttype=o.graphics.out_implicit
+    [orig,sz,orient]=(o.graphics.orig,o.graphics.sz,o.graphics.flip)
+    xset("pattern",default_color(0));
+
+    // set port shape
+
+    out2=[0  -1
+    -1  -1
+    -1   1
+    0   1]*diag([xf/7,yf/14])
+
+    in2= [1  -1
+    0  -1
+    0   1
+    1   1]*diag([xf/7,yf/14])
+
+
+    dy=sz(2)/3
+    xset("pattern",default_color(1))
+    xpoly(out2(:,1)+ones(4,1)*orig(1)-1,..
+    out2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*2),"lines",1)
+    xpoly(in2(:,1)+ones(4,1)*(orig(1)+sz(1))+1,..
+    in2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*2),"lines",1)
+    xfpoly(out2(:,1)+ones(4,1)*orig(1)-1,..
+    out2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy),1)
+    xfpoly(in2(:,1)+ones(4,1)*(orig(1)+sz(1))+1,..
+    in2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy),1)
+
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/standard_inputs.bin b/modules/scicos/macros/scicos_scicos/standard_inputs.bin
new file mode 100755
index 000000000..92307a1da
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_inputs.bin
diff --git a/modules/scicos/macros/scicos_scicos/standard_inputs.sci b/modules/scicos/macros/scicos_scicos/standard_inputs.sci
new file mode 100755
index 000000000..6bd490a4e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_inputs.sci
@@ -0,0 +1,76 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [x,y,typ]=standard_inputs(o)
+    //get position of inputs ports and clock inputs port for a standard block
+    //  the input ports are located on the left (or rigth if tilded) vertical
+    //    side of the block, regularly located from top to bottom
+    //  the clock input ports are located on the top horizontal side
+    //    side of the block, regularly located from left to right
+    xf=60
+    yf=40
+    graphics=o.graphics
+    model=o.model
+    orig=graphics.orig;sz=graphics.sz;orient=graphics.flip;
+    inp=size(model.in,1);clkinp=size(model.evtin,1);
+    if orient then
+        xo=orig(1)
+        dx=-xf/7
+    else
+        xo=orig(1)+sz(1)
+        dx=yf/7
+    end
+
+    typ=[];
+
+    //if o.model.sim=='valve' then pause,end
+    if inp==0 then
+        x=[];y=[];
+    else
+        y=orig(2)+sz(2)-(sz(2)/(inp+1))*(1:inp)
+        x=(xo+dx)*ones(y)
+        for k=1:inp
+            if o.graphics.in_implicit==[] then
+                typ=ones(x)
+            else
+                if o.graphics.in_implicit(k)=="E" then
+                    typ=[typ ones(x(k))]
+                elseif  o.graphics.in_implicit(k)=="I" then
+                    typ=[typ 2*ones(x(k))]
+                end
+            end
+        end
+    end
+
+    if clkinp<>0 then
+        x=[x,orig(1)+(sz(1)/(clkinp+1))*(1:clkinp)]
+        y=[y,(orig(2)+yf/7+sz(2))*ones(1,clkinp)]
+        typ=[typ,-ones(1,clkinp)]
+    end
+endfunction
+
+
+
+
+
+
+
+
diff --git a/modules/scicos/macros/scicos_scicos/standard_origin.bin b/modules/scicos/macros/scicos_scicos/standard_origin.bin
new file mode 100755
index 000000000..c1c889283
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_origin.bin
diff --git a/modules/scicos/macros/scicos_scicos/standard_origin.sci b/modules/scicos/macros/scicos_scicos/standard_origin.sci
new file mode 100755
index 000000000..ff0b54119
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_origin.sci
@@ -0,0 +1,26 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [x,y]=standard_origin(o)
+    //orig=o(2)(1)
+    orig=o.graphics.orig
+    x=orig(1);y=orig(2);
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/standard_outputs.bin b/modules/scicos/macros/scicos_scicos/standard_outputs.bin
new file mode 100755
index 000000000..9ca50ec11
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_outputs.bin
diff --git a/modules/scicos/macros/scicos_scicos/standard_outputs.sci b/modules/scicos/macros/scicos_scicos/standard_outputs.sci
new file mode 100755
index 000000000..a2d1ad9b3
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/standard_outputs.sci
@@ -0,0 +1,75 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function [x,y,typ]=standard_outputs(o)
+    //get position of inputs ports and clock inputs port for a standard block
+    //  the output ports are located on the right (or left if tilded) vertical
+    //    side of the block, regularly located from bottom to top
+    //  the clock output ports are located on the bottom horizontal side
+    //     of the block, regularly located from left to right
+    //!
+    xf=60
+    yf=40
+
+    graphics=o.graphics
+    model=o.model
+    orig=graphics.orig;sz=graphics.sz;orient=graphics.flip;
+
+    out=size(model.out,1);clkout=size(model.evtout,1);
+
+    if orient then
+        xo=orig(1)+sz(1)
+        dx=xf/7
+    else
+        xo=orig(1)
+        dx=-xf/7
+    end
+
+    typ=[];
+
+    // output port location
+    if out==0 then
+        x=[];y=[];
+    else
+        y=orig(2)+sz(2)-(sz(2)/(out+1))*(1:out)
+        x=(xo+dx)*ones(y)
+        for k=1:out
+            if o.graphics.out_implicit==[] then
+                typ=ones(x)
+            else
+                if o.graphics.out_implicit(k)=="E" then
+                    typ=[typ ones(x(k))]
+                elseif  o.graphics.out_implicit(k)=="I" then
+                    typ=[typ 2*ones(x(k))]
+                end
+            end
+        end
+    end
+
+
+    // clock output  port location
+    if clkout<>0 then
+        x=[x,orig(1)+(sz(1)/(clkout+1))*(1:clkout)]
+        y=[y,(orig(2)-yf/7)*ones(1,clkout)]
+        typ=[typ,-ones(1,clkout)]
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/translator.bin b/modules/scicos/macros/scicos_scicos/translator.bin
new file mode 100755
index 000000000..5ccd5e60b
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/translator.bin
diff --git a/modules/scicos/macros/scicos_scicos/translator.sci b/modules/scicos/macros/scicos_scicos/translator.sci
new file mode 100755
index 000000000..2c03c0952
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/translator.sci
@@ -0,0 +1,113 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function [ok]=translator(filemo,Mblocks,_Modelica_libs,Flat)
+    //Generate the flat model of the Modelica model given in the filemo file
+    //and the Modelica libraries. Interface to the external tool
+    //translator.
+    // if <name> is the basename of filemo this function produces
+    // - the flat Modelica model file in outpath+name+'f.mo'
+    // - the flat xml representation file in  outpath+name+'f_init.xml'
+    // - the flat xml  file in  outpath+name+'f_relations.xml'
+
+    // TO DO : rename filename too generic
+    TRANSLATOR_FILENAME = "modelicat";
+    if getos() == "Windows" then
+        TRANSLATOR_FILENAME = TRANSLATOR_FILENAME + ".exe";
+    end
+
+    mlibs = pathconvert(_Modelica_libs,%f,%t);
+    filemo = pathconvert(filemo,%f,%t);
+    Flat = pathconvert(Flat,%f,%t);
+
+    name = basename(filemo);
+    namef = name + "f";
+
+    [modelica_libs,modelica_directory] = getModelicaPath();
+
+    molibs = [];
+
+    for k = 1:size(Mblocks,"r")
+        funam = stripblanks(Mblocks(k));
+        [dirF, nameF, extF] = fileparts(funam);
+        if (extF == ".mo") then
+            molibs = [molibs; """" + funam + """"];
+        else
+            molibs = [molibs; """" + modelica_directory + funam + ".mo" + """"]
+        end
+    end
+
+    // directories for translator libraries
+    for k = 1:size(mlibs,"*")
+        modelica_directories = mlibs(k);
+        if modelica_directories<> [] then
+            molibs = [molibs; """" + modelica_directories + """"];
+        end
+    end
+
+    translator_libs = strcat(" -lib "+ molibs);
+
+    // build the sequence of -lib arguments for translator
+    if getos() == "Windows" then, Limit=1000;else, Limit=3500;end
+    if (length(translator_libs)>Limit) then
+        // OS limitation may restrict the length of shell command line
+        // arguments. If there are too many .mo file we catenate them into a
+        // single MYMOPACKAGE.mo file
+        messagebox(msprintf(_("There are too many Modelica files.\n" + ..
+        "it would be better to define several \n" + ..
+        "Modelica programs in a single file.")),"warning","modal");
+        mymopac = pathconvert(outpath+"MYMOPACKAGE.mo",%f,%t);
+        txt = [];
+        for k = 1:size(molibs,"*")
+            [pathx,fnamex,extensionx] = fileparts(molibs(k));
+            if (fnamex <> "MYMOPACKAGE") then
+                txt = [txt; mgetl(evstr(molibs(k)))];
+            end
+        end
+        mputl(txt, mymopac);
+        translator_libs= " -lib """+mymopac+"""";
+    end
+    translator_libs = translator_libs + "  -lib """ + filemo + """"
+
+    //Build the shell instruction for calling the translator
+
+    exe = getmodelicacpath() + TRANSLATOR_FILENAME
+    exe = """" + pathconvert(getmodelicacpath() + TRANSLATOR_FILENAME,%f,%t) + """ ";
+
+    out =" -o """+Flat+"""" //flat modelica
+    Errfile = outpath + "S_translator.err""";
+
+    // with the with-init option
+    instr = exe + translator_libs + out + " -with-init -command """ + name + " " + namef + ";"" >""" + Errfile
+
+    if getos() == "Windows" then
+        mputl(instr,outpath+"/gent.bat")
+        instr = outpath + "/gent.bat";
+    end
+
+    if execstr("unix_s(instr)","errcatch") <> 0 then
+        messagebox([_("-------Modelica translator error message:-----");
+        mgetl(outpath + "S_translator.err")], "error", "modal");
+        ok = %f,
+    else
+        ok = %t
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/update_scs_m.bin b/modules/scicos/macros/scicos_scicos/update_scs_m.bin
new file mode 100755
index 000000000..dd3b02f5e
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/update_scs_m.bin
diff --git a/modules/scicos/macros/scicos_scicos/update_scs_m.sci b/modules/scicos/macros/scicos_scicos/update_scs_m.sci
new file mode 100755
index 000000000..710e4ab3a
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/update_scs_m.sci
@@ -0,0 +1,242 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function scs_m_new = update_scs_m(scs_m,version)
+    // update_scs_m : function to do certification of
+    //                main data structure of
+    //                a scicos diagram (scs_m)
+    //                for current version of scicos
+    //
+    //   certification is done through initial value of fields in :
+    //      scicos_diagram()
+    //         scicos_params()
+    //         scicos_block()
+    //            scicos_graphics()
+    //            scicos_model()
+    //         scicos_link()
+    //
+    // Initial rev 12/05/07 : Alan
+    // Copyright INRIA
+    rhs = argn(2)
+    if rhs<2 then
+        version=get_scicos_version();
+    end
+
+    scs_m_new = scicos_diagram();
+
+    F = getfield(1,scs_m);
+
+    for i=2:size(F,2)
+
+        select F(i)
+
+            //******************* props *******************//
+        case "props" then
+
+            sprops = scs_m.props;
+            T = getfield(1,scs_m.props);
+            T_txt = [];
+            for j=2:size(T,2)
+                T_txt = T_txt + strsubst(T(1,j),"title","Title") + ...
+                "=" + "sprops." + T(1,j);
+                if j<>size(T,2) then
+                    T_txt = T_txt + ",";
+                end
+            end
+            T_txt = "sprops=scicos_params(" + T_txt + ")";
+            execstr(T_txt)
+            scs_m_new.props = sprops;
+            //*********************************************//
+
+            //******************** objs *******************//
+        case "objs" then
+
+            for j=1:lstsize(scs_m.objs) //loop on objects
+
+                o=scs_m.objs(j);
+
+                select typeof(o)
+
+                    //************** Block ***************//
+                case "Block" then
+
+                    o_new=scicos_block();
+                    T = getfield(1,o);
+
+                    for k=2:size(T,2)
+                        select T(k)
+                            //*********** graphics **********//
+                        case "graphics" then
+                            ogra  = o.graphics;
+                            G     = getfield(1,ogra);
+                            G_txt = [];
+                            for l=2:size(G,2)
+                                G_txt = G_txt + G(1,l) + ...
+                                "=" + "ogra." + G(1,l);
+                                if l<>size(G,2) then
+                                    G_txt = G_txt + ",";
+                                end
+                            end
+                            G_txt = "ogra=scicos_graphics(" + G_txt + ")";
+                            execstr(G_txt)
+                            o_new.graphics = ogra;
+                            //*******************************//
+
+                            //************* model ***********//
+                        case "model" then
+                            omod  = o.model;
+                            M     = getfield(1,o.model);
+                            M_txt = [];
+                            for l=2:size(M,2)
+                                M_txt = M_txt + M(1,l) + ...
+                                "=" + "omod." + M(1,l);
+                                if l<>size(M,2) then
+                                    M_txt = M_txt + ",";
+                                end
+                            end
+                            M_txt = "omod=scicos_model(" + M_txt + ")";
+                            execstr(M_txt)
+                            //******** super block case ********//
+                            if omod.sim=="super"|omod.sim=="csuper" then
+                                rpar=update_scs_m(omod.rpar,version)
+                                omod.rpar=rpar
+                            end
+                            o_new.model = omod;
+                            //*******************************//
+
+                            //************* doc ***********//
+                        case "doc" then
+                            o_new.doc = list();
+                            //*******************************//
+
+                            //************* other ***********//
+                        else
+                            T_txt = "o."+T(k);
+                            T_txt = "o_new." + T(k) + "=" + T_txt;
+                            execstr(T_txt)
+                            //*******************************//
+
+                        end  //end of select T(k)
+                    end  //end of for k=
+                    scs_m_new.objs(j) = o_new;
+                    //************************************//
+
+                    //************** Link ****************//
+                case "Link" then
+
+                    T     = getfield(1,o);
+                    T_txt = [];
+                    for k=2:size(T,2)
+                        T_txt = T_txt + T(1,k) + ...
+                        "=" + "o." + T(1,k);
+                        if k<>size(T,2) then
+                            T_txt = T_txt + ",";
+                        end
+                    end
+                    T_txt = "o_new=scicos_link(" + T_txt + ")";
+                    execstr(T_txt)
+                    scs_m_new.objs(j) = o_new;
+                    //************************************//
+
+                    //************** Text ****************//
+                case "Text" then
+                    o_new = mlist(["Text","graphics","model","void","gui"],...
+                    scicos_graphics(),scicos_model()," ","TEXT_f")
+
+                    T     = getfield(1,o);
+                    T_txt = [];
+                    for k=2:size(T,2)
+                        select T(k)
+                            //*********** graphics **********//
+                        case "graphics" then
+                            ogra  = o.graphics;
+                            G     = getfield(1,ogra);
+                            G_txt = [];
+                            for l=2:size(G,2)
+                                G_txt = G_txt + G(1,l) + ...
+                                "=" + "ogra." + G(1,l);
+                                if l<>size(G,2) then
+                                    G_txt = G_txt + ",";
+                                end
+                            end
+                            G_txt = "ogra=scicos_graphics(" + G_txt + ")";
+                            execstr(G_txt)
+                            o_new.graphics = ogra;
+                            //*******************************//
+
+                            //************* model ***********//
+                        case "model" then
+                            omod  = o.model;
+                            M     = getfield(1,o.model);
+                            M_txt = [];
+                            for l=2:size(M,2)
+                                M_txt = M_txt + M(1,l) + ...
+                                "=" + "omod." + M(1,l);
+                                if l<>size(M,2) then
+                                    M_txt = M_txt + ",";
+                                end
+                            end
+                            M_txt = "omod=scicos_model(" + M_txt + ")";
+                            execstr(M_txt)
+                            //******** super block case ********//
+                            if omod.sim=="super"|omod.sim=="csuper" then
+                                rpar=update_scs_m(omod.rpar,version)
+                                omod.rpar=rpar
+                            end
+                            o_new.model = omod;
+                            //*******************************//
+
+                            //************* other ***********//
+                        else
+                            T_txt = "o."+T(k);
+                            T_txt = "o_new." + T(k) + "=" + T_txt;
+                            execstr(T_txt)
+                            //*******************************//
+
+                        end  //end of select T(k)
+                    end  //end of for k=
+                    scs_m_new.objs(j) = o_new;
+                    //************************************//
+
+                    //************* other ***********//
+                else  // JESAISPASIYADAUTRESOBJS
+                    // QUEDESBLOCKSDESLINKETDUTEXTESDANSSCICOS
+                    // ALORSICIJEFAISRIEN
+                    scs_m_new.objs(j) = o;
+                    //************************************//
+
+                end //end of select typeof(o)
+
+            end //end of for j=
+            //*********************************************//
+
+            //** version **//
+        case "version" then
+            //do nothing here
+            //this should be done later
+
+        end  //end of select  F(i)
+
+    end //end of for i=
+
+    //**update version **//
+    scs_m_new.version = version;
+endfunction
+
diff --git a/modules/scicos/macros/scicos_scicos/update_version.bin b/modules/scicos/macros/scicos_scicos/update_version.bin
new file mode 100755
index 000000000..97ef9933f
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/update_version.bin
diff --git a/modules/scicos/macros/scicos_scicos/update_version.sci b/modules/scicos/macros/scicos_scicos/update_version.sci
new file mode 100755
index 000000000..a1d5d3edd
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/update_version.sci
@@ -0,0 +1,40 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function [ierr,scicos_ver,scs_m_out]=update_version(scs_m_in)
+
+    //## contrib update
+
+    //## scicos update
+    current_version = get_scicos_version()
+    scicos_ver = find_scicos_version(scs_m_in)
+
+    if scicos_ver<>current_version then
+        txt_to_run = "scs_m_out=do_version(scs_m_in,scicos_ver)"
+        ierr=execstr(txt_to_run,"errcatch")
+        if ierr<>0 then
+            scs_m_out=scs_m_in
+        end
+    else
+        scs_m_out=scs_m_in
+        ierr=0
+    end
+
+endfunction
+\ No newline at end of file
diff --git a/modules/scicos/macros/scicos_scicos/validvar.bin b/modules/scicos/macros/scicos_scicos/validvar.bin
new file mode 100755
index 000000000..912eec051
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/validvar.bin
diff --git a/modules/scicos/macros/scicos_scicos/validvar.sci b/modules/scicos/macros/scicos_scicos/validvar.sci
new file mode 100755
index 000000000..6301dff37
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/validvar.sci
@@ -0,0 +1,48 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - Serge Steer <serge.steer@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function r=validvar(s)
+    //Serge Steer, 08/10/2007
+    //Alan restricted validvar for operation, 29/03/08
+
+    //check if the string s is a valid identifier
+    s=stripblanks(s)
+    r=%f
+    if size(s,"*")<>1 then return, end
+    if s=="" then return, end
+
+    //create a function with s as single statement
+    if execstr("deff(''foo'',s)","errcatch") then return, end
+    t=macr2tree(foo) //syntax tree
+    instr=t.statements(2) //ignore leading and trailing EOL
+
+    //lhs should be "ans"
+    if size(instr.lhs)<>1 then return,end
+    if instr.lhs(1).name<>"ans" then return,end
+
+    //expression should be just a reference to s
+    if typeof(instr.expression)<>"operation" then return, end
+    if instr.expression.operator<>"ext" then return,end
+    if size(instr.expression.operands)<>1 then return,end
+    if instr.expression.operands(1).name<>s  then return,end
+
+    r=%t
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/value2modelica.bin b/modules/scicos/macros/scicos_scicos/value2modelica.bin
new file mode 100755
index 000000000..e53818cc5
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/value2modelica.bin
diff --git a/modules/scicos/macros/scicos_scicos/value2modelica.sci b/modules/scicos/macros/scicos_scicos/value2modelica.sci
new file mode 100755
index 000000000..a85aeb247
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/value2modelica.sci
@@ -0,0 +1,49 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+
+function txt=value2modelica(v)
+    [m,n]=size(v)
+    if m==1&n==1 then
+        txt=stripblanks(sci2exp(v))
+        kdot=strindex(txt,".")
+        if kdot==[] then return,end
+        if kdot==1 then
+            txt="0"+txt
+        else
+            if or(part(txt,kdot-1)==["+","-"]) then
+                txt=part(txt,1:kdot-1)+"0"+part(txt,kdot:length(txt))
+            end
+        end
+    else //matrix case
+        txt=stripblanks(sci2exp(v,0))
+        kdot=strindex(txt,".")
+        if kdot==[] then return,end
+        k=strindex(part(txt,kdot-1),["+","-",",",";","["])
+        if k==[] then return,end
+        t=txt;txt="";k0=1;
+        for i=k
+            ki=kdot(i);
+            txt=txt+part(t,k0:ki-1)+"0";
+            k0=ki;
+        end
+        txt=txt+part(t,k0:length(t))
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_scicos/xml2modelica.bin b/modules/scicos/macros/scicos_scicos/xml2modelica.bin
new file mode 100755
index 000000000..7a26b4e09
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/xml2modelica.bin
diff --git a/modules/scicos/macros/scicos_scicos/xml2modelica.sci b/modules/scicos/macros/scicos_scicos/xml2modelica.sci
new file mode 100755
index 000000000..ff79a1888
--- /dev/null
+++ b/modules/scicos/macros/scicos_scicos/xml2modelica.sci
@@ -0,0 +1,60 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ../license.txt
+//
+function  ok=xml2modelica(xmlfile,Flati)
+    // Generate the Modelica model file Flati with
+    // the xml file given by the initialization interface.
+    // Interface to the external tool xml2modelica.exe
+    // if <name> is the basename of filemo this function produces
+    // - the flat Modelica model file in outpath+name+'fi.mo'
+
+    //Scilab interface  with external tool xml2modelica
+
+    XML2MODELICA_FILENAME = "XML2Modelica";
+    if getos() == "Windows" then
+        XML2MODELICA_FILENAME = XML2MODELICA_FILENAME + ".exe";
+    end
+
+    tmpdir = pathconvert(TMPDIR, %t, %t);  //for error log and  shell scripts
+    xmlfile = pathconvert(xmlfile, %f, %t);
+    Flati = pathconvert(Flati, %f, %t);
+
+    exe = """" + pathconvert(XML2MODELICA_FILENAME, %f, %t) + """ ";
+    in = """" + xmlfile + """";
+    out = "-o """ + Flati + """";
+    option = "-init";  // generates a flat modelica file for the initialization
+    instr = strcat([exe in option out], " ");
+
+    if getos() == "Windows" then,
+        mputl(instr, tmpdir + "igenx.bat");
+        instr = tmpdir + "igenx.bat";
+    end
+
+    [rep,stat,err]=unix_g(instr);
+    if stat == 0 then
+        mprintf("%s\n", " xml->Modelica : " + Flati);
+        ok = %t;
+    else
+        messagebox(err, _("XML to Modelica"), "error", "modal");
+        ok = %f;
+        return
+    end
+endfunction
+
diff --git a/modules/scicos/macros/scicos_utils/block_parameter_error.bin b/modules/scicos/macros/scicos_utils/block_parameter_error.bin
new file mode 100755
index 000000000..74bb203f7
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/block_parameter_error.bin
diff --git a/modules/scicos/macros/scicos_utils/block_parameter_error.sci b/modules/scicos/macros/scicos_utils/block_parameter_error.sci
new file mode 100755
index 000000000..c02fdf16f
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/block_parameter_error.sci
@@ -0,0 +1,32 @@
+//
+// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab
+// Copyright (C) 2011 - Bernard DUJARDIN <develop.dujardin@numericable.fr>
+//
+// This file must be used under the terms of the CeCILL.
+// This source file is licensed as described in the file COPYING, which
+// you should have received as part of this distribution.  The terms
+// are also available at
+// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt
+//
+//
+
+function block_parameter_error(inform, expected)
+    // Displays a parameter input error box for an Xcos block
+    // Parameters
+    // inform: a string, type of the error
+    // expected: a string, expected value
+
+    rhs=argn(2)
+    if rhs <> 2 then
+        error(msprintf(gettext("%s: Wrong number of input arguments: %d expected.\n"), "block_parameter_error", 2))
+    end
+    if typeof(inform) <> "string" then
+        error(msprintf(gettext("%s: Wrong type for input argument #%d: String array expected.\n"), "block_parameter_error", 1 ))
+    end
+    if typeof(expected) <> "string"
+        error(msprintf(gettext("%s: Wrong type for input argument #%d: String array expected.\n"),"block_parameter_error", 2));
+    end
+
+    boxmsg = [" "; inform; " "; expected];
+    messagebox(boxmsg, gettext("Xcos block parameter error"), "error","modal");
+endfunction
diff --git a/modules/scicos/macros/scicos_utils/buildmacros.sce b/modules/scicos/macros/scicos_utils/buildmacros.sce
new file mode 100755
index 000000000..383855a59
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/buildmacros.sce
@@ -0,0 +1,16 @@
+
+// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab
+// Copyright (C) 2007-2008 - INRIA - Allan CORNET <allan.cornet@inria.fr>
+//
+// This file must be used under the terms of the CeCILL.
+// This source file is licensed as described in the file COPYING, which
+// you should have received as part of this distribution.  The terms
+// are also available at
+// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt
+
+if (isdef("genlib") == %f) then
+    exec(SCI+"/modules/functions/scripts/buildmacros/loadgenlib.sce");
+end
+//------------------------------------
+genlib("scicos_utilslib","SCI/modules/scicos/macros/scicos_utils",%f,%t);
+//------------------------------------
diff --git a/modules/scicos/macros/scicos_utils/find_scicos_version.bin b/modules/scicos/macros/scicos_utils/find_scicos_version.bin
new file mode 100755
index 000000000..373c13184
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/find_scicos_version.bin
diff --git a/modules/scicos/macros/scicos_utils/find_scicos_version.sci b/modules/scicos/macros/scicos_utils/find_scicos_version.sci
new file mode 100755
index 000000000..3b143c85f
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/find_scicos_version.sci
@@ -0,0 +1,78 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ./license.txt
+//
+
+function [scicos_ver]=find_scicos_version(scs_m)
+    //**
+    //** find_scicos_version try to retrieve a version of a
+    //** scs_m
+    //**
+    //** 21/08/07: Alan, inital revision
+    //**
+
+    if ~exists("scicos_ver") then
+        scicos_ver = "scicos2.2";
+    else
+        scicos_ver = scicos_ver;
+    end
+
+    if type(scs_m)==17 then
+        //case for diagrams >= 4.2
+        if find(getfield(1,scs_m)=="version")<>[] then
+            if scs_m.version<>"" then
+                scicos_ver=scs_m.version
+            else
+                n=size(scs_m.objs);
+                for j=1:n //loop on objects
+                    o=scs_m.objs(j);
+                    if typeof(o)=="Block" then
+                        if find(getfield(1,o.model)=="equations")<>[] then
+                            scicos_ver = "scicos2.7.3"
+                            break;
+                        else
+                            //** the last version supported here is scicos2.7
+                            //** other tests can be done
+                            scicos_ver = "scicos2.7"
+                            break;
+                        end
+                    end
+                end //** end for
+            end
+            //case for diagrams < 4.2
+        else
+            n=size(scs_m.objs);
+            for j=1:n //loop on objects
+                o=scs_m.objs(j);
+                if typeof(o)=="Block" then
+                    if find(getfield(1,o.model)=="equations")<>[] then
+                        scicos_ver = "scicos2.7.3"
+                        break;
+                    else
+                        //** the last version supported here is scicos2.7
+                        //** other tests can be done
+                        scicos_ver = "scicos2.7"
+                        break;
+                    end
+                end
+            end //** end for
+        end
+    end
+
+endfunction
diff --git a/modules/scicos/macros/scicos_utils/fixedpointgcd.bin b/modules/scicos/macros/scicos_utils/fixedpointgcd.bin
new file mode 100755
index 000000000..50056875b
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/fixedpointgcd.bin
diff --git a/modules/scicos/macros/scicos_utils/fixedpointgcd.sci b/modules/scicos/macros/scicos_utils/fixedpointgcd.sci
new file mode 100755
index 000000000..e6c9248dd
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/fixedpointgcd.sci
@@ -0,0 +1,13 @@
+function [value,denom_com]=fixedpointgcd(v)
+    // This function computes the PGCD of a double vector.
+    x=log10(v);
+    f=round((min(x)+max(x))/2);
+    v=v./10^(f);
+    [N,D]=rat(v,1d-9);
+    denom_com=lcm(uint32(D));
+    N=uint32(N)*denom_com./uint32(D);
+    value=gcd(N);
+    if f>0 then value=value*10^f;
+    else denom_com=double(denom_com)*10^(-f);
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_utils/get_scicos_version.bin b/modules/scicos/macros/scicos_utils/get_scicos_version.bin
new file mode 100755
index 000000000..a7d664def
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/get_scicos_version.bin
diff --git a/modules/scicos/macros/scicos_utils/get_scicos_version.sci b/modules/scicos/macros/scicos_utils/get_scicos_version.sci
new file mode 100755
index 000000000..7ef336c02
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/get_scicos_version.sci
@@ -0,0 +1,25 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ./license.txt
+//
+
+function [scicos_ver]=get_scicos_version()
+    //INRIA
+    scicos_ver = "scicos4.3";
+endfunction
diff --git a/modules/scicos/macros/scicos_utils/initial_scicos_tables.bin b/modules/scicos/macros/scicos_utils/initial_scicos_tables.bin
new file mode 100755
index 000000000..28d0b5297
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/initial_scicos_tables.bin
diff --git a/modules/scicos/macros/scicos_utils/initial_scicos_tables.sci b/modules/scicos/macros/scicos_utils/initial_scicos_tables.sci
new file mode 100755
index 000000000..3d0192d0a
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/initial_scicos_tables.sci
@@ -0,0 +1,20 @@
+
+function [modelica_libs, scicos_pal_libs, ..
+    %scicos_with_grid, %scs_wgrid] = initial_scicos_tables()
+
+    //**        This function is called from "scicos" "scicos_simulate" "lincos" "steadycos"
+
+
+    %scicos_with_grid = %f;//** define grid
+    %scs_wgrid = [10;10;12];//**define aspect of grid
+
+
+    //Scicos palettes libs list ========================================================
+    scicos_pal_libs = ["Branching","Events","Misc","Sinks","Threshold","Linear","MatrixOp","NonLinear","Sources","Electrical","Hydraulics","PDE","IntegerOp"];
+
+    //Scicos Modelica librabry path definitions========================================
+    modelica_libs = getModelicaPath();
+
+    //** This is the END, the END my friend". By The Doors, Apocalypse Now.
+endfunction
+
diff --git a/modules/scicos/macros/scicos_utils/lib b/modules/scicos/macros/scicos_utils/lib
new file mode 100755
index 000000000..3c03be8a2
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/lib
diff --git a/modules/scicos/macros/scicos_utils/names b/modules/scicos/macros/scicos_utils/names
new file mode 100755
index 000000000..c91bf1217
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/names
@@ -0,0 +1,9 @@
+block_parameter_error
+find_scicos_version
+fixedpointgcd
+get_scicos_version
+initial_scicos_tables
+returntoscilab
+scicos_getvalue
+scicos_workspace_init
+with_modelica_compiler
diff --git a/modules/scicos/macros/scicos_utils/returntoscilab.bin b/modules/scicos/macros/scicos_utils/returntoscilab.bin
new file mode 100755
index 000000000..a6dc26362
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/returntoscilab.bin
diff --git a/modules/scicos/macros/scicos_utils/returntoscilab.sci b/modules/scicos/macros/scicos_utils/returntoscilab.sci
new file mode 100755
index 000000000..df3acfbbf
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/returntoscilab.sci
@@ -0,0 +1,39 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ./license.txt
+//
+
+function [txt,files]=returntoscilab()
+    files= listfiles(TMPDIR+"/Workspace")
+    n=size(files,1)
+    if n==0 then
+        txt=[],
+        return,
+    else
+        txtg="["+files(1)
+        txtd="resume("+files(1)
+        for i=2:n
+            txtg=txtg+","+files(i)
+            txtd=txtd+","+files(i)
+        end
+        txtg=txtg+"]"
+        txtd=txtd+")"
+        txt=txtg+"="+txtd
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_utils/scicos_getvalue.bin b/modules/scicos/macros/scicos_utils/scicos_getvalue.bin
new file mode 100755
index 000000000..4092be6fa
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/scicos_getvalue.bin
diff --git a/modules/scicos/macros/scicos_utils/scicos_getvalue.sci b/modules/scicos/macros/scicos_utils/scicos_getvalue.sci
new file mode 100755
index 000000000..37bafdda3
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/scicos_getvalue.sci
@@ -0,0 +1,311 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) 2010 - DIGITEO - Clément DAVID <clement.david@scilab.org>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ./license.txt
+//
+
+function [%ok,%1,%2,%3,%4,%5,...
+    %6,%7,%8,%9,%10,...
+    %11,%12,%13,%14,%15,...
+    %16,%17,%18,%19,%20,...
+    %21,%22,%23,%24,%25,...
+    %26,%27,%28,%29,%30]=scicos_getvalue(%desc,%labels,%typ,%ini)
+    //  getvalues - %window dialog for data acquisition
+    //%Synta%
+    //  [%ok,%1,..,%30]=getvalue(desc,labels,typ,ini)
+    //%Parameters
+    //  desc    : column vector of strings, dialog general comment
+    //  labels  : n column vector of strings, labels(i) is the label of
+    //            the ith required value
+    //  typ     : list(typ1,dim1,..,typn,dimn)
+    //            typi : defines the type of the ith required value
+    //                   if may have the following values:
+    //                   'mat'    : stands for matrix of scalars
+    //                   'col'    : stands for column vector of scalars
+    //                   'row'    : stands for row vector of scalars
+    //                   'vec'    : stands for  vector of scalars
+    //                   'intvec' : stands for  vector of integers i.e int(x) == x
+    //                   'str'    : stands for vector of strings
+    //                   'lis'    : stands for list
+    //                   'pol'    : stands for polynomials
+    //                   'r'      : stands for rational
+    //            dimi : defines the size of the ith required value
+    //                   it must be
+    //                    - an integer or a 2-vector of integers (-1 stands for
+    //                      arbitrary dimension)
+    //                    - an evaluatable character string
+    //  ini     : n column vector of strings, ini(i) gives the suggested
+    //            response for the ith required value
+    //  %ok      : boolean ,%t if %ok button pressed, %f if cancel button pressed
+    //  xi      : contains the ith required value if %ok==%t
+    //%Description
+    // getvalues macro encapsulate x_mdialog function with error checking,
+    // evaluation of numerical response, ...
+    //%Remarks
+    // All correct scilab syntax may be used as responses, for matrices
+    // and vectors getvalues automatically adds [ ] around the given response
+    // before numerical evaluation
+    //%Example
+    // labels=['magnitude';'frequency';'phase    '];
+    // [ampl,freq,ph]=getvalue('define sine signal',labels,..
+    //            list('vec',1,'vec',1,'vec',1),['0.85';'10^2';'%pi/3'])
+    //
+    //%See also
+    // x_mdialog, x_dialog
+
+    //!
+    // 01/09/10 Clément DAVID: update to %30 rhs parameters
+    // 17/01/07 -Alan- This version of getvalue is different of scilab 4.1 :
+    //         - %scicos_context behavior reviewed in accordance to context_evstr macro
+    //         - (u)int(8/16/32) allowed in field of type vec/mat/row/col (F. Nassif's Work)
+    //
+    // 05/02/07 -Alan- : update to %20 rhs parameters
+    //
+    // 12/02/07 -Alan- : fix (variable evaluation of %scicos_context)
+    //
+    // Copyright INRIA
+    [%lhs,%rhs]=argn(0)
+
+    %nn=prod(size(%labels))
+    if %lhs<>%nn+2&%lhs<>%nn+1 then error(41),end
+    if size(%typ)<>2*%nn then
+        error("%typ : list(''type'',[sizes],...)")
+    end
+    %1=[];%2=[];%3=[];%4=[];%5=[];
+    %6=[];%7=[];%8=[];%9=[];%10=[];
+    %11=[];%12=[];%13=[];%14=[];%15=[];
+    %16=[];%17=[];%18=[];%19=[];%20=[];
+    %21=[];%22=[];%23=[];%24=[];%25=[];
+    %26=[];%27=[];%28=[];%29=[];%30=[];
+
+    if %rhs==3 then  %ini=emptystr(%nn,1),end
+
+    // Transform a list of strings into a vector of strings
+    // Has no effect if %ini is already a vector of strings
+    // An empty item in the source list is converted to an empty string in the
+    //  destination vector
+    // %ini = cat(1,%ini(:))
+    if typeof(%ini) <> "string"
+        %new_ini = []
+        for k = 1:length(%ini)
+            if isempty(%ini(k))
+                %new_ini(k) = ""
+            else
+                %new_ini(k) = %ini(k)
+            end
+        end
+        %ini = %new_ini
+    end
+
+    %ok=%t
+    while %t do
+        %ini=matrix(%ini, size(%labels));
+        %str=x_mdialog(%desc,%labels,%ini)
+        if %str==[] then %ok=%f,%str=[];break,end
+        for %kk=1:%nn
+            %cod=ascii(%str(%kk))
+            %spe=find(%cod==10)
+            if %spe<>[] then
+                %semi=ascii(";")
+                %cod(%spe)=%semi*ones(%spe')
+                %str(%kk)=ascii(%cod)
+            end
+        end
+
+        if exists("%scicos_context")
+            %mm=getfield(1,%scicos_context)
+            for %mi=%mm(3:$)
+                if execstr(%mi+"=%scicos_context(%mi)","errcatch")<>0 then
+                    disp(lasterror())
+                    %ok=%f
+                    return
+                end
+            end
+        end
+
+        %nok=0
+        for %kk=1:%nn
+            select part(%typ(2*%kk-1),1:6)
+            case "mat   "
+                if exists("%scicos_context") then
+                    [%vv,%ierr]=evstr(%str(%kk))
+                else
+                    %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch");
+                end
+                if %ierr<>0 then %nok=-%kk;break,end
+                //29/12/06
+                //the type of %vv is accepted if it is constant or integer
+                if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                [%mv,%nv]=size(%vv)
+                %ssz=string(%sz(1))+" x "+string(%sz(2))
+                if %mv*%nv==0 then
+                    if  %sz(1)>=0&%sz(2)>=0&%sz(1)*%sz(2)<>0 then %nok=%kk,break,end
+                else
+                    if %sz(1)>=0 then if %mv<>%sz(1) then %nok=%kk,break,end,end
+                    if %sz(2)>=0 then if %nv<>%sz(2) then %nok=%kk,break,end,end
+                end
+            case "vec   "
+                if exists("%scicos_context") then
+                    [%vv,%ierr]=evstr(%str(%kk))
+                else
+                    %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch")
+                end
+                if %ierr<>0 then %nok=-%kk;break,end
+                //17/01/07
+                //the type of %vv is accepted if it is constant or integer
+                if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                %ssz=string(%sz(1))
+                %nv=prod(size(%vv))
+                if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end
+            case "intvec"
+                if exists("%scicos_context") then
+                    [%vv,%ierr]=evstr(%str(%kk))
+                else
+                    %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch")
+                end
+                if %ierr<>0 then %nok=-%kk;break,end
+                //17/01/07
+                //the type of %vv is accepted if it is constant or integer
+                if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                if and(int(%vv) == %vv) == %f then
+                    %nok=-%kk;
+                    break;
+                end
+                %ssz=string(%sz(1))
+                %nv=prod(size(%vv))
+                if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end
+            case "pol   "
+                if exists("%scicos_context") then
+                    [%vv,%ierr]=evstr(%str(%kk))
+                else
+                    %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch");
+                end
+                if %ierr<>0 then %nok=-%kk;break,end
+                if type(%vv)>2 then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                %ssz=string(%sz(1))
+                %nv=prod(size(%vv))
+                if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end
+            case "row   "
+                if exists("%scicos_context") then
+                    [%vv,%ierr]=evstr(%str(%kk))
+                else
+                    %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch");
+                end
+                if %ierr<>0 then %nok=-%kk;break,end
+                //17/01/07
+                //the type of %vv is accepted if it is constant or integer
+                if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                if %sz(1)<0 then
+                    %ssz="1 x *"
+                else
+                    %ssz="1 x "+string(%sz(1))
+                end
+                [%mv,%nv]=size(%vv)
+                if %mv<>1 then %nok=%kk,break,end,
+                if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end
+            case "col   "
+                if exists("%scicos_context") then
+                    [%vv,%ierr]=evstr(%str(%kk))
+                else
+                    %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch");
+                end
+                if %ierr<>0 then %nok=-%kk;break,end
+                //17/01/07
+                //the type of %vv is accepted if it is constant or integer
+                if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                if %sz(1)<0 then
+                    %ssz="* x 1"
+                else
+                    %ssz=string(%sz(1))+" x 1"
+                end
+                [%mv,%nv]=size(%vv)
+                if %nv<>1 then %nok=%kk,break,end,
+                if %sz(1)>=0 then if %mv<>%sz(1) then %nok=%kk,break,end,end
+            case "str   "
+                %sde=%str(%kk)
+                %spe=find(ascii(%str(%kk))==10)
+                %spe($+1)=length(%sde)+1
+                %vv=[];%kk1=1
+                for %kkk=1:size(%spe,"*")
+                    %vv(%kkk,1)=part(%sde,%kk1:%spe(%kkk)-1)
+                    %kk1=%spe(%kkk)+1
+                end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                %ssz=string(%sz(1))
+                %nv=prod(size(%vv))
+                if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end
+            case "lis   "
+                if exists("%scicos_context") then
+                    [%vv,%ierr]=evstr(%str(%kk))
+                else
+                    %ierr=execstr("%vv="+%str(%kk),"errcatch");
+                end
+                if %ierr<>0 then %nok=-%kk;break,end
+                if type(%vv)<>15& type(%vv)<>16& type(%vv)<>17 then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                %ssz=string(%sz(1))
+                %nv=size(%vv)
+                if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end
+            case "r     "
+                if exists("%scicos_context") then
+                    [%vv,%ierr]=evstr(%str(%kk))
+                else
+                    %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch");
+                end
+                if %ierr<>0 then %nok=-%kk;break,end
+                if type(%vv)<>16 then %nok=-%kk,break,end
+                if typeof(%vv)<>"rational" then %nok=-%kk,break,end
+                %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end
+                [%mv,%nv]=size(%vv(2))
+                %ssz=string(%sz(1))+" x "+string(%sz(2))
+                if %mv*%nv==0 then
+                    if  %sz(1)>=0&%sz(2)>=0&%sz(1)*%sz(2)<>0 then %nok=%kk,break,end
+                else
+                    if %sz(1)>=0 then if %mv<>%sz(1) then %nok=%kk,break,end,end
+                    if %sz(2)>=0 then if %nv<>%sz(2) then %nok=%kk,break,end,end
+                end
+            else
+                error(msprintf(_("%s: Type %s is not implemented.\n"),"getvalue", %typ(2*%kk-1)))
+            end
+            execstr("%"+string(%kk)+"=%vv")
+        end
+        if %nok>0 then
+            messagebox(msprintf(_("Answer given for %s \n has invalid dimension: \n waiting for dimension %s.\n"), %labels(%nok), %ssz), "modal");
+            %ini=%str
+        elseif %nok<0 then
+            if %ierr==0 then
+                messagebox(msprintf(_("Answer given for %s \n has incorrect type %s.\n"), %labels(-%nok), %typ(-2*%nok-1)), "modal");
+            else
+                messagebox(msprintf(_("Answer given for %s \n is incorrect: %s.\n"), %labels(-%nok), lasterror()), "modal");
+            end
+            %ini=%str
+        else
+            break
+        end
+    end
+    if %lhs==%nn+2 then
+        execstr("%"+string(%lhs-1)+"=%str")
+    end
+endfunction
diff --git a/modules/scicos/macros/scicos_utils/scicos_workspace_init.bin b/modules/scicos/macros/scicos_utils/scicos_workspace_init.bin
new file mode 100755
index 000000000..d1500c5a2
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/scicos_workspace_init.bin
diff --git a/modules/scicos/macros/scicos_utils/scicos_workspace_init.sci b/modules/scicos/macros/scicos_utils/scicos_workspace_init.sci
new file mode 100755
index 000000000..e3b7008d7
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/scicos_workspace_init.sci
@@ -0,0 +1,56 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ./license.txt
+//
+//
+function scicos_workspace_init()
+    //preserve all variables of type struct having a "time" and a "value"
+    //field in temporary binary files
+    path=TMPDIR+"/Workspace/"
+    mkdir(path);
+
+
+    //prepare the fromworkspace stuff We need to store all variables of
+    //type struct which have 2 fields "values" and "time". these variables
+    //are stored into Scilab binary files whose name are the variable names
+    //and which contain 2 variables "x" and "t"
+    //
+    prt=funcprot(),funcprot(0)
+    varnames = who("get")   ;
+    varnames = varnames(1:$-predef()+1);  //** exclude protected variables
+    varnames(varnames=="ans")=[];
+    for var=varnames'
+        v=evstr(var);
+        if typeof(v)=="st" then
+            fn=fieldnames(v)
+            if and(fn==["values";"time"] | fn==["time";"values"]) then
+                if execstr("x=v.values","errcatch")==0 then
+                    if execstr("t=v.time","errcatch") ==0 then
+                        // remove deprecation warning on save, this will be reimplemented on 6.x
+                        warnMode = warning("query");
+                        warning("off");
+                        execstr("save("""+path+var+""",x,t)")
+                        warning(warnMode);
+                    end
+                end
+            end
+        end
+    end
+    funcprot(prt)
+endfunction
diff --git a/modules/scicos/macros/scicos_utils/with_modelica_compiler.bin b/modules/scicos/macros/scicos_utils/with_modelica_compiler.bin
new file mode 100755
index 000000000..a51850bd9
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/with_modelica_compiler.bin
diff --git a/modules/scicos/macros/scicos_utils/with_modelica_compiler.sci b/modules/scicos/macros/scicos_utils/with_modelica_compiler.sci
new file mode 100755
index 000000000..bce2d1b95
--- /dev/null
+++ b/modules/scicos/macros/scicos_utils/with_modelica_compiler.sci
@@ -0,0 +1,33 @@
+//  Scicos
+//
+//  Copyright (C) INRIA - METALAU Project <scicos@inria.fr>
+//  Copyright (C) INRIA - 2008 - Allan CORNET
+//
+// This program is free software; you can redistribute it and/or modify
+// it under the terms of the GNU General Public License as published by
+// the Free Software Foundation; either version 2 of the License, or
+// (at your option) any later version.
+//
+// This program is distributed in the hope that it will be useful,
+// but WITHOUT ANY WARRANTY; without even the implied warranty of
+// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+// GNU General Public License for more details.
+//
+// You should have received a copy of the GNU General Public License
+// along with this program; if not, write to the Free Software
+// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+//
+// See the file ./license.txt
+//
+
+function r = with_modelica_compiler()
+
+    if exists("scicos_scicoslib") == 0 then
+        load("SCI/modules/scicos/macros/scicos_scicos/lib") ;
+    end
+
+    // check if modelica compiler exists in current $PATH
+    r = ~isempty(getmodelicacpath());
+
+endfunction
+
author	Shashank	2017-05-29 12:40:26 +0530
committer	Shashank	2017-05-29 12:40:26 +0530
commit	0345245e860375a32c9a437c4a9d9cae807134e9 (patch)
tree	ad51ecbfa7bcd3cc5f09834f1bb8c08feaa526a4 /modules/scicos/macros
download	scilab_for_xcos_on_cloud-0345245e860375a32c9a437c4a9d9cae807134e9.tar.gz scilab_for_xcos_on_cloud-0345245e860375a32c9a437c4a9d9cae807134e9.tar.bz2 scilab_for_xcos_on_cloud-0345245e860375a32c9a437c4a9d9cae807134e9.zip