From 0345245e860375a32c9a437c4a9d9cae807134e9 Mon Sep 17 00:00:00 2001 From: Shashank Date: Mon, 29 May 2017 12:40:26 +0530 Subject: CMSCOPE changed --- modules/scicos/macros/buildmacros.sce | 20 + modules/scicos/macros/scicos_auto/buildmacros.sce | 16 + modules/scicos/macros/scicos_auto/lib | Bin 0 -> 380 bytes modules/scicos/macros/scicos_auto/lincos.bin | Bin 0 -> 42396 bytes modules/scicos/macros/scicos_auto/lincos.sci | 290 + modules/scicos/macros/scicos_auto/names | 3 + .../scicos/macros/scicos_auto/scicos_simulate.bin | Bin 0 -> 56424 bytes .../scicos/macros/scicos_auto/scicos_simulate.sci | 427 ++ modules/scicos/macros/scicos_auto/steadycos.bin | Bin 0 -> 39804 bytes modules/scicos/macros/scicos_auto/steadycos.sci | 269 + modules/scicos/macros/scicos_scicos/%Block_e.bin | Bin 0 -> 1608 bytes modules/scicos/macros/scicos_scicos/%Block_e.sci | 34 + modules/scicos/macros/scicos_scicos/%Block_p.bin | Bin 0 -> 4272 bytes modules/scicos/macros/scicos_scicos/%Block_p.sci | 56 + .../scicos/macros/scicos_scicos/%b_i_graphics.bin | Bin 0 -> 664 bytes .../scicos/macros/scicos_scicos/%b_i_graphics.sci | 25 + modules/scicos/macros/scicos_scicos/%b_i_model.bin | Bin 0 -> 1148 bytes modules/scicos/macros/scicos_scicos/%b_i_model.sci | 26 + modules/scicos/macros/scicos_scicos/%c_i_block.bin | Bin 0 -> 752 bytes modules/scicos/macros/scicos_scicos/%c_i_block.sci | 25 + .../scicos/macros/scicos_scicos/%c_i_graphics.bin | Bin 0 -> 664 bytes .../scicos/macros/scicos_scicos/%c_i_graphics.sci | 25 + modules/scicos/macros/scicos_scicos/%c_i_model.bin | Bin 0 -> 1148 bytes modules/scicos/macros/scicos_scicos/%c_i_model.sci | 26 + .../scicos/macros/scicos_scicos/%debug_scicos.bin | Bin 0 -> 832 bytes .../scicos/macros/scicos_scicos/%debug_scicos.sci | 29 + modules/scicos/macros/scicos_scicos/%diagram_p.bin | Bin 0 -> 1560 bytes modules/scicos/macros/scicos_scicos/%diagram_p.sci | 34 + .../scicos/macros/scicos_scicos/%graphics_e.bin | Bin 0 -> 1312 bytes .../scicos/macros/scicos_scicos/%graphics_e.sci | 29 + .../macros/scicos_scicos/%graphics_i_Block.bin | Bin 0 -> 360 bytes .../macros/scicos_scicos/%graphics_i_Block.sci | 24 + .../scicos/macros/scicos_scicos/%graphics_p.bin | Bin 0 -> 1080 bytes .../scicos/macros/scicos_scicos/%graphics_p.sci | 30 + modules/scicos/macros/scicos_scicos/%l_i_block.bin | Bin 0 -> 636 bytes modules/scicos/macros/scicos_scicos/%l_i_block.sci | 25 + .../scicos/macros/scicos_scicos/%l_i_graphics.bin | Bin 0 -> 664 bytes .../scicos/macros/scicos_scicos/%l_i_graphics.sci | 25 + modules/scicos/macros/scicos_scicos/%l_i_model.bin | Bin 0 -> 1148 bytes modules/scicos/macros/scicos_scicos/%l_i_model.sci | 26 + modules/scicos/macros/scicos_scicos/%model_e.bin | Bin 0 -> 1300 bytes modules/scicos/macros/scicos_scicos/%model_e.sci | 29 + .../scicos/macros/scicos_scicos/%model_i_Block.bin | Bin 0 -> 360 bytes .../scicos/macros/scicos_scicos/%model_i_Block.sci | 24 + modules/scicos/macros/scicos_scicos/%model_p.bin | Bin 0 -> 2092 bytes modules/scicos/macros/scicos_scicos/%model_p.sci | 40 + modules/scicos/macros/scicos_scicos/%params_p.bin | Bin 0 -> 1240 bytes modules/scicos/macros/scicos_scicos/%params_p.sci | 34 + modules/scicos/macros/scicos_scicos/%s_i_block.bin | Bin 0 -> 636 bytes modules/scicos/macros/scicos_scicos/%s_i_block.sci | 25 + .../scicos/macros/scicos_scicos/%s_i_graphics.bin | Bin 0 -> 664 bytes .../scicos/macros/scicos_scicos/%s_i_graphics.sci | 25 + modules/scicos/macros/scicos_scicos/%s_i_model.bin | Bin 0 -> 1148 bytes modules/scicos/macros/scicos_scicos/%s_i_model.sci | 26 + modules/scicos/macros/scicos_scicos/CC4.bin | Bin 0 -> 10188 bytes modules/scicos/macros/scicos_scicos/CC4.sci | 121 + modules/scicos/macros/scicos_scicos/CFORTR.bin | Bin 0 -> 6392 bytes modules/scicos/macros/scicos_scicos/CFORTR.sci | 84 + modules/scicos/macros/scicos_scicos/CFORTR2.bin | Bin 0 -> 17484 bytes modules/scicos/macros/scicos_scicos/CFORTR2.sci | 164 + .../scicos/macros/scicos_scicos/Compute_cic.bin | Bin 0 -> 34060 bytes .../scicos/macros/scicos_scicos/Compute_cic.sci | 257 + modules/scicos/macros/scicos_scicos/FORTR.bin | Bin 0 -> 5860 bytes modules/scicos/macros/scicos_scicos/FORTR.sci | 75 + .../macros/scicos_scicos/Link_modelica_C.bin | Bin 0 -> 6228 bytes .../macros/scicos_scicos/Link_modelica_C.sci | 75 + modules/scicos/macros/scicos_scicos/MODCOM.bin | Bin 0 -> 21436 bytes modules/scicos/macros/scicos_scicos/MODCOM.sci | 211 + modules/scicos/macros/scicos_scicos/Sinks.cosf | 837 +++ modules/scicos/macros/scicos_scicos/adjust.bin | Bin 0 -> 64332 bytes modules/scicos/macros/scicos_scicos/adjust.sci | 465 ++ .../scicos/macros/scicos_scicos/adjust_in2out2.bin | Bin 0 -> 5500 bytes .../scicos/macros/scicos_scicos/adjust_in2out2.sci | 58 + .../scicos/macros/scicos_scicos/bad_connection.bin | Bin 0 -> 18512 bytes .../scicos/macros/scicos_scicos/bad_connection.sci | 131 + .../scicos/macros/scicos_scicos/build_block.bin | Bin 0 -> 9984 bytes .../scicos/macros/scicos_scicos/build_block.sci | 86 + .../macros/scicos_scicos/build_modelica_block.bin | Bin 0 -> 8972 bytes .../macros/scicos_scicos/build_modelica_block.sci | 77 + .../scicos/macros/scicos_scicos/buildmacros.sce | 16 + .../scicos/macros/scicos_scicos/buildnewblock.bin | Bin 0 -> 20284 bytes .../scicos/macros/scicos_scicos/buildnewblock.sci | 186 + modules/scicos/macros/scicos_scicos/c_pass1.bin | Bin 0 -> 70328 bytes modules/scicos/macros/scicos_scicos/c_pass1.sci | 499 ++ modules/scicos/macros/scicos_scicos/c_pass2.bin | Bin 0 -> 399136 bytes modules/scicos/macros/scicos_scicos/c_pass2.sci | 2615 +++++++++ modules/scicos/macros/scicos_scicos/c_pass3.bin | Bin 0 -> 35472 bytes modules/scicos/macros/scicos_scicos/c_pass3.sci | 257 + modules/scicos/macros/scicos_scicos/check_io.bin | Bin 0 -> 15612 bytes modules/scicos/macros/scicos_scicos/check_io.sci | 141 + modules/scicos/macros/scicos_scicos/check_mac.bin | Bin 0 -> 896 bytes modules/scicos/macros/scicos_scicos/check_mac.sci | 29 + modules/scicos/macros/scicos_scicos/color.tst | 61 + .../macros/scicos_scicos/compile_init_modelica.bin | Bin 0 -> 14860 bytes .../macros/scicos_scicos/compile_init_modelica.sci | 140 + .../macros/scicos_scicos/compile_modelica.bin | Bin 0 -> 18680 bytes .../macros/scicos_scicos/compile_modelica.sci | 141 + .../scicos/macros/scicos_scicos/context_evstr.bin | Bin 0 -> 3548 bytes .../scicos/macros/scicos_scicos/context_evstr.sci | 50 + modules/scicos/macros/scicos_scicos/cos2cosf.bin | Bin 0 -> 27212 bytes modules/scicos/macros/scicos_scicos/cos2cosf.sci | 233 + .../scicos/macros/scicos_scicos/countblocks.bin | Bin 0 -> 1820 bytes .../scicos/macros/scicos_scicos/countblocks.sci | 38 + .../macros/scicos_scicos/create_modelica.bin | Bin 0 -> 36936 bytes .../macros/scicos_scicos/create_modelica.sci | 333 ++ .../scicos/macros/scicos_scicos/default_color.bin | Bin 0 -> 1556 bytes .../scicos/macros/scicos_scicos/default_color.sci | 36 + .../macros/scicos_scicos/default_options.bin | Bin 0 -> 2412 bytes .../macros/scicos_scicos/default_options.sci | 43 + .../macros/scicos_scicos/delete_unconnected.bin | Bin 0 -> 9616 bytes .../macros/scicos_scicos/delete_unconnected.sci | 101 + modules/scicos/macros/scicos_scicos/dialog.bin | Bin 0 -> 608 bytes modules/scicos/macros/scicos_scicos/dialog.sci | 25 + .../macros/scicos_scicos/dig_bound_compound.bin | Bin 0 -> 10444 bytes .../macros/scicos_scicos/dig_bound_compound.sci | 100 + modules/scicos/macros/scicos_scicos/do_compile.bin | Bin 0 -> 9984 bytes modules/scicos/macros/scicos_scicos/do_compile.sci | 109 + .../scicos_scicos/do_compile_superblock42.bin | Bin 0 -> 829896 bytes .../scicos_scicos/do_compile_superblock42.sci | 6005 ++++++++++++++++++++ modules/scicos/macros/scicos_scicos/do_delete1.bin | Bin 0 -> 41648 bytes modules/scicos/macros/scicos_scicos/do_delete1.sci | 253 + .../scicos/macros/scicos_scicos/do_edit_pal.bug | 32 + modules/scicos/macros/scicos_scicos/do_eval.bin | Bin 0 -> 27640 bytes modules/scicos/macros/scicos_scicos/do_eval.sci | 207 + modules/scicos/macros/scicos_scicos/do_purge.bin | Bin 0 -> 7324 bytes modules/scicos/macros/scicos_scicos/do_purge.sci | 78 + .../scicos/macros/scicos_scicos/do_terminate.bin | Bin 0 -> 9692 bytes .../scicos/macros/scicos_scicos/do_terminate.sci | 104 + modules/scicos/macros/scicos_scicos/do_update.bin | Bin 0 -> 14204 bytes modules/scicos/macros/scicos_scicos/do_update.sci | 124 + modules/scicos/macros/scicos_scicos/do_version.bin | Bin 0 -> 364580 bytes modules/scicos/macros/scicos_scicos/do_version.sci | 2328 ++++++++ .../scicos/macros/scicos_scicos/entity_menu.sce | 520 ++ .../macros/scicos_scicos/extract_implicit.bin | Bin 0 -> 20984 bytes .../macros/scicos_scicos/extract_implicit.sci | 144 + modules/scicos/macros/scicos_scicos/findinlist.bin | Bin 0 -> 2856 bytes modules/scicos/macros/scicos_scicos/findinlist.sci | 38 + .../scicos/macros/scicos_scicos/findinlistcmd.bin | Bin 0 -> 4200 bytes .../scicos/macros/scicos_scicos/findinlistcmd.sci | 51 + .../scicos/macros/scicos_scicos/gen_modelica.bin | Bin 0 -> 13832 bytes .../scicos/macros/scicos_scicos/gen_modelica.sci | 114 + modules/scicos/macros/scicos_scicos/genfunc.bin | Bin 0 -> 4216 bytes modules/scicos/macros/scicos_scicos/genfunc.sci | 58 + modules/scicos/macros/scicos_scicos/genfunc1.bin | Bin 0 -> 31004 bytes modules/scicos/macros/scicos_scicos/genfunc1.sci | 260 + modules/scicos/macros/scicos_scicos/genfunc2.bin | Bin 0 -> 31120 bytes modules/scicos/macros/scicos_scicos/genfunc2.sci | 260 + modules/scicos/macros/scicos_scicos/genmac.bin | Bin 0 -> 7912 bytes modules/scicos/macros/scicos_scicos/genmac.sci | 90 + modules/scicos/macros/scicos_scicos/get2index.bin | Bin 0 -> 6132 bytes modules/scicos/macros/scicos_scicos/get2index.sci | 81 + .../scicos/macros/scicos_scicos/get_connected.bin | Bin 0 -> 6092 bytes .../scicos/macros/scicos_scicos/get_connected.sci | 65 + .../macros/scicos_scicos/get_dynamic_lib_dir.bin | Bin 0 -> 4636 bytes .../macros/scicos_scicos/get_dynamic_lib_dir.sci | 51 + .../scicos/macros/scicos_scicos/get_errorcmd.bin | Bin 0 -> 9668 bytes .../scicos/macros/scicos_scicos/get_errorcmd.sci | 108 + .../scicos/macros/scicos_scicos/get_model_name.bin | Bin 0 -> 2708 bytes .../scicos/macros/scicos_scicos/get_model_name.sci | 45 + .../macros/scicos_scicos/get_subobj_path.bin | Bin 0 -> 2556 bytes .../macros/scicos_scicos/get_subobj_path.sci | 36 + .../scicos/macros/scicos_scicos/get_tree_elt.bin | Bin 0 -> 1252 bytes .../scicos/macros/scicos_scicos/get_tree_elt.sci | 34 + .../macros/scicos_scicos/getmodelicacpath.bin | Bin 0 -> 3892 bytes .../macros/scicos_scicos/getmodelicacpath.sci | 67 + .../scicos/macros/scicos_scicos/global_case.bin | Bin 0 -> 4540 bytes .../scicos/macros/scicos_scicos/global_case.sci | 48 + modules/scicos/macros/scicos_scicos/haltscicos.bin | Bin 0 -> 808 bytes modules/scicos/macros/scicos_scicos/haltscicos.sci | 27 + .../scicos/macros/scicos_scicos/hilite_path.bin | Bin 0 -> 4900 bytes .../scicos/macros/scicos_scicos/hilite_path.sci | 68 + .../scicos/macros/scicos_scicos/init_agenda.bin | Bin 0 -> 4564 bytes .../scicos/macros/scicos_scicos/init_agenda.sci | 53 + .../macros/scicos_scicos/is_modelica_block.bin | Bin 0 -> 936 bytes .../macros/scicos_scicos/is_modelica_block.sci | 29 + modules/scicos/macros/scicos_scicos/lib | Bin 0 -> 3340 bytes modules/scicos/macros/scicos_scicos/link_olibs.bin | Bin 0 -> 6136 bytes modules/scicos/macros/scicos_scicos/link_olibs.sci | 104 + modules/scicos/macros/scicos_scicos/lnkptrcomp.bin | Bin 0 -> 4580 bytes modules/scicos/macros/scicos_scicos/lnkptrcomp.sci | 50 + .../scicos/macros/scicos_scicos/loadpallibs.bin | Bin 0 -> 1464 bytes .../scicos/macros/scicos_scicos/loadpallibs.sci | 33 + modules/scicos/macros/scicos_scicos/mark_prt.bin | Bin 0 -> 3572 bytes modules/scicos/macros/scicos_scicos/mark_prt.sci | 47 + modules/scicos/macros/scicos_scicos/message.bin | Bin 0 -> 2592 bytes modules/scicos/macros/scicos_scicos/message.sci | 45 + modules/scicos/macros/scicos_scicos/mfrequ_clk.bin | Bin 0 -> 20320 bytes modules/scicos/macros/scicos_scicos/mfrequ_clk.sci | 104 + modules/scicos/macros/scicos_scicos/modelica.bin | Bin 0 -> 1784 bytes modules/scicos/macros/scicos_scicos/modelica.sci | 31 + modules/scicos/macros/scicos_scicos/modelicac.bin | Bin 0 -> 6156 bytes modules/scicos/macros/scicos_scicos/modelicac.sci | 79 + modules/scicos/macros/scicos_scicos/modipar.bin | Bin 0 -> 48168 bytes modules/scicos/macros/scicos_scicos/modipar.sci | 304 + modules/scicos/macros/scicos_scicos/names | 126 + .../macros/scicos_scicos/reading_incidence.bin | Bin 0 -> 13952 bytes .../macros/scicos_scicos/reading_incidence.sci | 128 + .../scicos_scicos/recur_scicos_block_link.bin | Bin 0 -> 9224 bytes .../scicos_scicos/recur_scicos_block_link.sci | 79 + modules/scicos/macros/scicos_scicos/sample_clk.bin | Bin 0 -> 59564 bytes modules/scicos/macros/scicos_scicos/sample_clk.sci | 295 + .../scicos/macros/scicos_scicos/scicos_block.bin | Bin 0 -> 1916 bytes .../scicos/macros/scicos_scicos/scicos_block.sci | 30 + .../macros/scicos_scicos/scicos_block_link.bin | Bin 0 -> 4044 bytes .../macros/scicos_scicos/scicos_block_link.sci | 59 + modules/scicos/macros/scicos_scicos/scicos_cpr.bin | Bin 0 -> 2028 bytes modules/scicos/macros/scicos_scicos/scicos_cpr.sci | 30 + .../scicos/macros/scicos_scicos/scicos_diagram.bin | Bin 0 -> 1760 bytes .../scicos/macros/scicos_scicos/scicos_diagram.sci | 30 + .../scicos/macros/scicos_scicos/scicos_flat.bin | Bin 0 -> 81596 bytes .../scicos/macros/scicos_scicos/scicos_flat.sci | 456 ++ .../macros/scicos_scicos/scicos_graphics.bin | Bin 0 -> 7744 bytes .../macros/scicos_scicos/scicos_graphics.sci | 61 + .../macros/scicos_scicos/scicos_include_paths.bin | Bin 0 -> 2588 bytes .../macros/scicos_scicos/scicos_include_paths.sci | 46 + .../scicos/macros/scicos_scicos/scicos_link.bin | Bin 0 -> 2716 bytes .../scicos/macros/scicos_scicos/scicos_link.sci | 34 + .../scicos/macros/scicos_scicos/scicos_model.bin | Bin 0 -> 8656 bytes .../scicos/macros/scicos_scicos/scicos_model.sci | 56 + .../scicos/macros/scicos_scicos/scicos_params.bin | Bin 0 -> 4292 bytes .../scicos/macros/scicos_scicos/scicos_params.sci | 48 + modules/scicos/macros/scicos_scicos/scicos_sim.bin | Bin 0 -> 11800 bytes modules/scicos/macros/scicos_scicos/scicos_sim.sci | 75 + .../scicos/macros/scicos_scicos/scicos_state.bin | Bin 0 -> 3116 bytes .../scicos/macros/scicos_scicos/scicos_state.sci | 34 + .../scicos/macros/scicos_scicos/scicos_txtedit.bin | Bin 0 -> 1836 bytes .../scicos/macros/scicos_scicos/scicos_txtedit.sci | 30 + modules/scicos/macros/scicos_scicos/script2var.bin | Bin 0 -> 8500 bytes modules/scicos/macros/scicos_scicos/script2var.sci | 89 + .../scicos/macros/scicos_scicos/scs_full_path.bin | Bin 0 -> 2140 bytes .../scicos/macros/scicos_scicos/scs_full_path.sci | 31 + modules/scicos/macros/scicos_scicos/scs_show.bin | Bin 0 -> 2740 bytes modules/scicos/macros/scicos_scicos/scs_show.sci | 47 + modules/scicos/macros/scicos_scicos/scstxtedit.bin | Bin 0 -> 1764 bytes modules/scicos/macros/scicos_scicos/scstxtedit.sci | 62 + modules/scicos/macros/scicos_scicos/set_io.bin | Bin 0 -> 24572 bytes modules/scicos/macros/scicos_scicos/set_io.sci | 284 + modules/scicos/macros/scicos_scicos/setvalue.bin | Bin 0 -> 45944 bytes modules/scicos/macros/scicos_scicos/setvalue.sci | 282 + modules/scicos/macros/scicos_scicos/shiftcors.bin | Bin 0 -> 1604 bytes modules/scicos/macros/scicos_scicos/shiftcors.sci | 32 + .../macros/scicos_scicos/split_lasterror.bin | Bin 0 -> 2744 bytes .../macros/scicos_scicos/split_lasterror.sci | 47 + .../macros/scicos_scicos/standard_define.bin | Bin 0 -> 4708 bytes .../macros/scicos_scicos/standard_define.sci | 52 + .../scicos/macros/scicos_scicos/standard_draw.bin | Bin 0 -> 35532 bytes .../scicos/macros/scicos_scicos/standard_draw.sci | 251 + .../macros/scicos_scicos/standard_draw_ports.bin | Bin 0 -> 28752 bytes .../macros/scicos_scicos/standard_draw_ports.sci | 211 + .../scicos_scicos/standard_draw_ports_up.bin | Bin 0 -> 6612 bytes .../scicos_scicos/standard_draw_ports_up.sci | 56 + .../macros/scicos_scicos/standard_inputs.bin | Bin 0 -> 7036 bytes .../macros/scicos_scicos/standard_inputs.sci | 76 + .../macros/scicos_scicos/standard_origin.bin | Bin 0 -> 576 bytes .../macros/scicos_scicos/standard_origin.sci | 26 + .../macros/scicos_scicos/standard_outputs.bin | Bin 0 -> 7044 bytes .../macros/scicos_scicos/standard_outputs.sci | 75 + modules/scicos/macros/scicos_scicos/translator.bin | Bin 0 -> 12732 bytes modules/scicos/macros/scicos_scicos/translator.sci | 113 + .../scicos/macros/scicos_scicos/update_scs_m.bin | Bin 0 -> 24948 bytes .../scicos/macros/scicos_scicos/update_scs_m.sci | 242 + .../scicos/macros/scicos_scicos/update_version.bin | Bin 0 -> 1448 bytes .../scicos/macros/scicos_scicos/update_version.sci | 40 + modules/scicos/macros/scicos_scicos/validvar.bin | Bin 0 -> 3852 bytes modules/scicos/macros/scicos_scicos/validvar.sci | 48 + .../scicos/macros/scicos_scicos/value2modelica.bin | Bin 0 -> 4188 bytes .../scicos/macros/scicos_scicos/value2modelica.sci | 49 + .../scicos/macros/scicos_scicos/xml2modelica.bin | Bin 0 -> 5352 bytes .../scicos/macros/scicos_scicos/xml2modelica.sci | 60 + .../macros/scicos_utils/block_parameter_error.bin | Bin 0 -> 3572 bytes .../macros/scicos_utils/block_parameter_error.sci | 32 + modules/scicos/macros/scicos_utils/buildmacros.sce | 16 + .../macros/scicos_utils/find_scicos_version.bin | Bin 0 -> 5264 bytes .../macros/scicos_utils/find_scicos_version.sci | 78 + .../scicos/macros/scicos_utils/fixedpointgcd.bin | Bin 0 -> 2288 bytes .../scicos/macros/scicos_utils/fixedpointgcd.sci | 13 + .../macros/scicos_utils/get_scicos_version.bin | Bin 0 -> 200 bytes .../macros/scicos_utils/get_scicos_version.sci | 25 + .../macros/scicos_utils/initial_scicos_tables.bin | Bin 0 -> 2676 bytes .../macros/scicos_utils/initial_scicos_tables.sci | 20 + modules/scicos/macros/scicos_utils/lib | Bin 0 -> 528 bytes modules/scicos/macros/scicos_utils/names | 9 + .../scicos/macros/scicos_utils/returntoscilab.bin | Bin 0 -> 1868 bytes .../scicos/macros/scicos_utils/returntoscilab.sci | 39 + .../scicos/macros/scicos_utils/scicos_getvalue.bin | Bin 0 -> 51936 bytes .../scicos/macros/scicos_utils/scicos_getvalue.sci | 311 + .../macros/scicos_utils/scicos_workspace_init.bin | Bin 0 -> 5132 bytes .../macros/scicos_utils/scicos_workspace_init.sci | 56 + .../macros/scicos_utils/with_modelica_compiler.bin | Bin 0 -> 976 bytes .../macros/scicos_utils/with_modelica_compiler.sci | 33 + 290 files changed, 26058 insertions(+) create mode 100755 modules/scicos/macros/buildmacros.sce create mode 100755 modules/scicos/macros/scicos_auto/buildmacros.sce create mode 100755 modules/scicos/macros/scicos_auto/lib create mode 100755 modules/scicos/macros/scicos_auto/lincos.bin create mode 100755 modules/scicos/macros/scicos_auto/lincos.sci create mode 100755 modules/scicos/macros/scicos_auto/names create mode 100755 modules/scicos/macros/scicos_auto/scicos_simulate.bin create mode 100755 modules/scicos/macros/scicos_auto/scicos_simulate.sci create mode 100755 modules/scicos/macros/scicos_auto/steadycos.bin create mode 100755 modules/scicos/macros/scicos_auto/steadycos.sci create mode 100755 modules/scicos/macros/scicos_scicos/%Block_e.bin create mode 100755 modules/scicos/macros/scicos_scicos/%Block_e.sci create mode 100755 modules/scicos/macros/scicos_scicos/%Block_p.bin create mode 100755 modules/scicos/macros/scicos_scicos/%Block_p.sci create mode 100755 modules/scicos/macros/scicos_scicos/%b_i_graphics.bin create mode 100755 modules/scicos/macros/scicos_scicos/%b_i_graphics.sci create mode 100755 modules/scicos/macros/scicos_scicos/%b_i_model.bin create mode 100755 modules/scicos/macros/scicos_scicos/%b_i_model.sci create mode 100755 modules/scicos/macros/scicos_scicos/%c_i_block.bin create mode 100755 modules/scicos/macros/scicos_scicos/%c_i_block.sci create mode 100755 modules/scicos/macros/scicos_scicos/%c_i_graphics.bin create mode 100755 modules/scicos/macros/scicos_scicos/%c_i_graphics.sci create mode 100755 modules/scicos/macros/scicos_scicos/%c_i_model.bin create mode 100755 modules/scicos/macros/scicos_scicos/%c_i_model.sci create mode 100755 modules/scicos/macros/scicos_scicos/%debug_scicos.bin create mode 100755 modules/scicos/macros/scicos_scicos/%debug_scicos.sci create mode 100755 modules/scicos/macros/scicos_scicos/%diagram_p.bin create mode 100755 modules/scicos/macros/scicos_scicos/%diagram_p.sci create mode 100755 modules/scicos/macros/scicos_scicos/%graphics_e.bin create mode 100755 modules/scicos/macros/scicos_scicos/%graphics_e.sci create mode 100755 modules/scicos/macros/scicos_scicos/%graphics_i_Block.bin create mode 100755 modules/scicos/macros/scicos_scicos/%graphics_i_Block.sci create mode 100755 modules/scicos/macros/scicos_scicos/%graphics_p.bin create mode 100755 modules/scicos/macros/scicos_scicos/%graphics_p.sci create mode 100755 modules/scicos/macros/scicos_scicos/%l_i_block.bin create mode 100755 modules/scicos/macros/scicos_scicos/%l_i_block.sci create mode 100755 modules/scicos/macros/scicos_scicos/%l_i_graphics.bin create mode 100755 modules/scicos/macros/scicos_scicos/%l_i_graphics.sci create mode 100755 modules/scicos/macros/scicos_scicos/%l_i_model.bin create mode 100755 modules/scicos/macros/scicos_scicos/%l_i_model.sci create mode 100755 modules/scicos/macros/scicos_scicos/%model_e.bin create mode 100755 modules/scicos/macros/scicos_scicos/%model_e.sci create mode 100755 modules/scicos/macros/scicos_scicos/%model_i_Block.bin create mode 100755 modules/scicos/macros/scicos_scicos/%model_i_Block.sci create mode 100755 modules/scicos/macros/scicos_scicos/%model_p.bin create mode 100755 modules/scicos/macros/scicos_scicos/%model_p.sci create mode 100755 modules/scicos/macros/scicos_scicos/%params_p.bin create mode 100755 modules/scicos/macros/scicos_scicos/%params_p.sci create mode 100755 modules/scicos/macros/scicos_scicos/%s_i_block.bin create mode 100755 modules/scicos/macros/scicos_scicos/%s_i_block.sci create mode 100755 modules/scicos/macros/scicos_scicos/%s_i_graphics.bin create mode 100755 modules/scicos/macros/scicos_scicos/%s_i_graphics.sci create mode 100755 modules/scicos/macros/scicos_scicos/%s_i_model.bin create mode 100755 modules/scicos/macros/scicos_scicos/%s_i_model.sci create mode 100755 modules/scicos/macros/scicos_scicos/CC4.bin create mode 100755 modules/scicos/macros/scicos_scicos/CC4.sci create mode 100755 modules/scicos/macros/scicos_scicos/CFORTR.bin create mode 100755 modules/scicos/macros/scicos_scicos/CFORTR.sci create mode 100755 modules/scicos/macros/scicos_scicos/CFORTR2.bin create mode 100755 modules/scicos/macros/scicos_scicos/CFORTR2.sci create mode 100755 modules/scicos/macros/scicos_scicos/Compute_cic.bin create mode 100755 modules/scicos/macros/scicos_scicos/Compute_cic.sci create mode 100755 modules/scicos/macros/scicos_scicos/FORTR.bin create mode 100755 modules/scicos/macros/scicos_scicos/FORTR.sci create mode 100755 modules/scicos/macros/scicos_scicos/Link_modelica_C.bin create mode 100755 modules/scicos/macros/scicos_scicos/Link_modelica_C.sci create mode 100755 modules/scicos/macros/scicos_scicos/MODCOM.bin create mode 100755 modules/scicos/macros/scicos_scicos/MODCOM.sci create mode 100755 modules/scicos/macros/scicos_scicos/Sinks.cosf create mode 100755 modules/scicos/macros/scicos_scicos/adjust.bin create mode 100755 modules/scicos/macros/scicos_scicos/adjust.sci create mode 100755 modules/scicos/macros/scicos_scicos/adjust_in2out2.bin create mode 100755 modules/scicos/macros/scicos_scicos/adjust_in2out2.sci create mode 100755 modules/scicos/macros/scicos_scicos/bad_connection.bin create mode 100755 modules/scicos/macros/scicos_scicos/bad_connection.sci create mode 100755 modules/scicos/macros/scicos_scicos/build_block.bin create mode 100755 modules/scicos/macros/scicos_scicos/build_block.sci create mode 100755 modules/scicos/macros/scicos_scicos/build_modelica_block.bin create mode 100755 modules/scicos/macros/scicos_scicos/build_modelica_block.sci create mode 100755 modules/scicos/macros/scicos_scicos/buildmacros.sce create mode 100755 modules/scicos/macros/scicos_scicos/buildnewblock.bin create mode 100755 modules/scicos/macros/scicos_scicos/buildnewblock.sci create mode 100755 modules/scicos/macros/scicos_scicos/c_pass1.bin create mode 100755 modules/scicos/macros/scicos_scicos/c_pass1.sci create mode 100755 modules/scicos/macros/scicos_scicos/c_pass2.bin create mode 100755 modules/scicos/macros/scicos_scicos/c_pass2.sci create mode 100755 modules/scicos/macros/scicos_scicos/c_pass3.bin create mode 100755 modules/scicos/macros/scicos_scicos/c_pass3.sci create mode 100755 modules/scicos/macros/scicos_scicos/check_io.bin create mode 100755 modules/scicos/macros/scicos_scicos/check_io.sci create mode 100755 modules/scicos/macros/scicos_scicos/check_mac.bin create mode 100755 modules/scicos/macros/scicos_scicos/check_mac.sci create mode 100755 modules/scicos/macros/scicos_scicos/color.tst create mode 100755 modules/scicos/macros/scicos_scicos/compile_init_modelica.bin create mode 100755 modules/scicos/macros/scicos_scicos/compile_init_modelica.sci create mode 100755 modules/scicos/macros/scicos_scicos/compile_modelica.bin create mode 100755 modules/scicos/macros/scicos_scicos/compile_modelica.sci create mode 100755 modules/scicos/macros/scicos_scicos/context_evstr.bin create mode 100755 modules/scicos/macros/scicos_scicos/context_evstr.sci create mode 100755 modules/scicos/macros/scicos_scicos/cos2cosf.bin create mode 100755 modules/scicos/macros/scicos_scicos/cos2cosf.sci create mode 100755 modules/scicos/macros/scicos_scicos/countblocks.bin create mode 100755 modules/scicos/macros/scicos_scicos/countblocks.sci create mode 100755 modules/scicos/macros/scicos_scicos/create_modelica.bin create mode 100755 modules/scicos/macros/scicos_scicos/create_modelica.sci create mode 100755 modules/scicos/macros/scicos_scicos/default_color.bin create mode 100755 modules/scicos/macros/scicos_scicos/default_color.sci create mode 100755 modules/scicos/macros/scicos_scicos/default_options.bin create mode 100755 modules/scicos/macros/scicos_scicos/default_options.sci create mode 100755 modules/scicos/macros/scicos_scicos/delete_unconnected.bin create mode 100755 modules/scicos/macros/scicos_scicos/delete_unconnected.sci create mode 100755 modules/scicos/macros/scicos_scicos/dialog.bin create mode 100755 modules/scicos/macros/scicos_scicos/dialog.sci create mode 100755 modules/scicos/macros/scicos_scicos/dig_bound_compound.bin create mode 100755 modules/scicos/macros/scicos_scicos/dig_bound_compound.sci create mode 100755 modules/scicos/macros/scicos_scicos/do_compile.bin create mode 100755 modules/scicos/macros/scicos_scicos/do_compile.sci create mode 100755 modules/scicos/macros/scicos_scicos/do_compile_superblock42.bin create mode 100755 modules/scicos/macros/scicos_scicos/do_compile_superblock42.sci create mode 100755 modules/scicos/macros/scicos_scicos/do_delete1.bin create mode 100755 modules/scicos/macros/scicos_scicos/do_delete1.sci create mode 100755 modules/scicos/macros/scicos_scicos/do_edit_pal.bug create mode 100755 modules/scicos/macros/scicos_scicos/do_eval.bin create mode 100755 modules/scicos/macros/scicos_scicos/do_eval.sci create mode 100755 modules/scicos/macros/scicos_scicos/do_purge.bin create mode 100755 modules/scicos/macros/scicos_scicos/do_purge.sci create mode 100755 modules/scicos/macros/scicos_scicos/do_terminate.bin create mode 100755 modules/scicos/macros/scicos_scicos/do_terminate.sci create mode 100755 modules/scicos/macros/scicos_scicos/do_update.bin create mode 100755 modules/scicos/macros/scicos_scicos/do_update.sci create mode 100755 modules/scicos/macros/scicos_scicos/do_version.bin create mode 100755 modules/scicos/macros/scicos_scicos/do_version.sci create mode 100755 modules/scicos/macros/scicos_scicos/entity_menu.sce create mode 100755 modules/scicos/macros/scicos_scicos/extract_implicit.bin create mode 100755 modules/scicos/macros/scicos_scicos/extract_implicit.sci create mode 100755 modules/scicos/macros/scicos_scicos/findinlist.bin create mode 100755 modules/scicos/macros/scicos_scicos/findinlist.sci create mode 100755 modules/scicos/macros/scicos_scicos/findinlistcmd.bin create mode 100755 modules/scicos/macros/scicos_scicos/findinlistcmd.sci create mode 100755 modules/scicos/macros/scicos_scicos/gen_modelica.bin create mode 100755 modules/scicos/macros/scicos_scicos/gen_modelica.sci create mode 100755 modules/scicos/macros/scicos_scicos/genfunc.bin create mode 100755 modules/scicos/macros/scicos_scicos/genfunc.sci create mode 100755 modules/scicos/macros/scicos_scicos/genfunc1.bin create mode 100755 modules/scicos/macros/scicos_scicos/genfunc1.sci create mode 100755 modules/scicos/macros/scicos_scicos/genfunc2.bin create mode 100755 modules/scicos/macros/scicos_scicos/genfunc2.sci create mode 100755 modules/scicos/macros/scicos_scicos/genmac.bin create mode 100755 modules/scicos/macros/scicos_scicos/genmac.sci create mode 100755 modules/scicos/macros/scicos_scicos/get2index.bin create mode 100755 modules/scicos/macros/scicos_scicos/get2index.sci create mode 100755 modules/scicos/macros/scicos_scicos/get_connected.bin create mode 100755 modules/scicos/macros/scicos_scicos/get_connected.sci create mode 100755 modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.bin create mode 100755 modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.sci create mode 100755 modules/scicos/macros/scicos_scicos/get_errorcmd.bin create mode 100755 modules/scicos/macros/scicos_scicos/get_errorcmd.sci create mode 100755 modules/scicos/macros/scicos_scicos/get_model_name.bin create mode 100755 modules/scicos/macros/scicos_scicos/get_model_name.sci create mode 100755 modules/scicos/macros/scicos_scicos/get_subobj_path.bin create mode 100755 modules/scicos/macros/scicos_scicos/get_subobj_path.sci create mode 100755 modules/scicos/macros/scicos_scicos/get_tree_elt.bin create mode 100755 modules/scicos/macros/scicos_scicos/get_tree_elt.sci create mode 100755 modules/scicos/macros/scicos_scicos/getmodelicacpath.bin create mode 100755 modules/scicos/macros/scicos_scicos/getmodelicacpath.sci create mode 100755 modules/scicos/macros/scicos_scicos/global_case.bin create mode 100755 modules/scicos/macros/scicos_scicos/global_case.sci create mode 100755 modules/scicos/macros/scicos_scicos/haltscicos.bin create mode 100755 modules/scicos/macros/scicos_scicos/haltscicos.sci create mode 100755 modules/scicos/macros/scicos_scicos/hilite_path.bin create mode 100755 modules/scicos/macros/scicos_scicos/hilite_path.sci create mode 100755 modules/scicos/macros/scicos_scicos/init_agenda.bin create mode 100755 modules/scicos/macros/scicos_scicos/init_agenda.sci create mode 100755 modules/scicos/macros/scicos_scicos/is_modelica_block.bin create mode 100755 modules/scicos/macros/scicos_scicos/is_modelica_block.sci create mode 100755 modules/scicos/macros/scicos_scicos/lib create mode 100755 modules/scicos/macros/scicos_scicos/link_olibs.bin create mode 100755 modules/scicos/macros/scicos_scicos/link_olibs.sci create mode 100755 modules/scicos/macros/scicos_scicos/lnkptrcomp.bin create mode 100755 modules/scicos/macros/scicos_scicos/lnkptrcomp.sci create mode 100755 modules/scicos/macros/scicos_scicos/loadpallibs.bin create mode 100755 modules/scicos/macros/scicos_scicos/loadpallibs.sci create mode 100755 modules/scicos/macros/scicos_scicos/mark_prt.bin create mode 100755 modules/scicos/macros/scicos_scicos/mark_prt.sci create mode 100755 modules/scicos/macros/scicos_scicos/message.bin create mode 100755 modules/scicos/macros/scicos_scicos/message.sci create mode 100755 modules/scicos/macros/scicos_scicos/mfrequ_clk.bin create mode 100755 modules/scicos/macros/scicos_scicos/mfrequ_clk.sci create mode 100755 modules/scicos/macros/scicos_scicos/modelica.bin create mode 100755 modules/scicos/macros/scicos_scicos/modelica.sci create mode 100755 modules/scicos/macros/scicos_scicos/modelicac.bin create mode 100755 modules/scicos/macros/scicos_scicos/modelicac.sci create mode 100755 modules/scicos/macros/scicos_scicos/modipar.bin create mode 100755 modules/scicos/macros/scicos_scicos/modipar.sci create mode 100755 modules/scicos/macros/scicos_scicos/names create mode 100755 modules/scicos/macros/scicos_scicos/reading_incidence.bin create mode 100755 modules/scicos/macros/scicos_scicos/reading_incidence.sci create mode 100755 modules/scicos/macros/scicos_scicos/recur_scicos_block_link.bin create mode 100755 modules/scicos/macros/scicos_scicos/recur_scicos_block_link.sci create mode 100755 modules/scicos/macros/scicos_scicos/sample_clk.bin create mode 100755 modules/scicos/macros/scicos_scicos/sample_clk.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_block.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_block.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_block_link.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_block_link.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_cpr.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_cpr.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_diagram.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_diagram.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_flat.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_flat.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_graphics.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_graphics.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_include_paths.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_include_paths.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_link.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_link.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_model.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_model.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_params.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_params.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_sim.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_sim.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_state.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_state.sci create mode 100755 modules/scicos/macros/scicos_scicos/scicos_txtedit.bin create mode 100755 modules/scicos/macros/scicos_scicos/scicos_txtedit.sci create mode 100755 modules/scicos/macros/scicos_scicos/script2var.bin create mode 100755 modules/scicos/macros/scicos_scicos/script2var.sci create mode 100755 modules/scicos/macros/scicos_scicos/scs_full_path.bin create mode 100755 modules/scicos/macros/scicos_scicos/scs_full_path.sci create mode 100755 modules/scicos/macros/scicos_scicos/scs_show.bin create mode 100755 modules/scicos/macros/scicos_scicos/scs_show.sci create mode 100755 modules/scicos/macros/scicos_scicos/scstxtedit.bin create mode 100755 modules/scicos/macros/scicos_scicos/scstxtedit.sci create mode 100755 modules/scicos/macros/scicos_scicos/set_io.bin create mode 100755 modules/scicos/macros/scicos_scicos/set_io.sci create mode 100755 modules/scicos/macros/scicos_scicos/setvalue.bin create mode 100755 modules/scicos/macros/scicos_scicos/setvalue.sci create mode 100755 modules/scicos/macros/scicos_scicos/shiftcors.bin create mode 100755 modules/scicos/macros/scicos_scicos/shiftcors.sci create mode 100755 modules/scicos/macros/scicos_scicos/split_lasterror.bin create mode 100755 modules/scicos/macros/scicos_scicos/split_lasterror.sci create mode 100755 modules/scicos/macros/scicos_scicos/standard_define.bin create mode 100755 modules/scicos/macros/scicos_scicos/standard_define.sci create mode 100755 modules/scicos/macros/scicos_scicos/standard_draw.bin create mode 100755 modules/scicos/macros/scicos_scicos/standard_draw.sci create mode 100755 modules/scicos/macros/scicos_scicos/standard_draw_ports.bin create mode 100755 modules/scicos/macros/scicos_scicos/standard_draw_ports.sci create mode 100755 modules/scicos/macros/scicos_scicos/standard_draw_ports_up.bin create mode 100755 modules/scicos/macros/scicos_scicos/standard_draw_ports_up.sci create mode 100755 modules/scicos/macros/scicos_scicos/standard_inputs.bin create mode 100755 modules/scicos/macros/scicos_scicos/standard_inputs.sci create mode 100755 modules/scicos/macros/scicos_scicos/standard_origin.bin create mode 100755 modules/scicos/macros/scicos_scicos/standard_origin.sci create mode 100755 modules/scicos/macros/scicos_scicos/standard_outputs.bin create mode 100755 modules/scicos/macros/scicos_scicos/standard_outputs.sci create mode 100755 modules/scicos/macros/scicos_scicos/translator.bin create mode 100755 modules/scicos/macros/scicos_scicos/translator.sci create mode 100755 modules/scicos/macros/scicos_scicos/update_scs_m.bin create mode 100755 modules/scicos/macros/scicos_scicos/update_scs_m.sci create mode 100755 modules/scicos/macros/scicos_scicos/update_version.bin create mode 100755 modules/scicos/macros/scicos_scicos/update_version.sci create mode 100755 modules/scicos/macros/scicos_scicos/validvar.bin create mode 100755 modules/scicos/macros/scicos_scicos/validvar.sci create mode 100755 modules/scicos/macros/scicos_scicos/value2modelica.bin create mode 100755 modules/scicos/macros/scicos_scicos/value2modelica.sci create mode 100755 modules/scicos/macros/scicos_scicos/xml2modelica.bin create mode 100755 modules/scicos/macros/scicos_scicos/xml2modelica.sci create mode 100755 modules/scicos/macros/scicos_utils/block_parameter_error.bin create mode 100755 modules/scicos/macros/scicos_utils/block_parameter_error.sci create mode 100755 modules/scicos/macros/scicos_utils/buildmacros.sce create mode 100755 modules/scicos/macros/scicos_utils/find_scicos_version.bin create mode 100755 modules/scicos/macros/scicos_utils/find_scicos_version.sci create mode 100755 modules/scicos/macros/scicos_utils/fixedpointgcd.bin create mode 100755 modules/scicos/macros/scicos_utils/fixedpointgcd.sci create mode 100755 modules/scicos/macros/scicos_utils/get_scicos_version.bin create mode 100755 modules/scicos/macros/scicos_utils/get_scicos_version.sci create mode 100755 modules/scicos/macros/scicos_utils/initial_scicos_tables.bin create mode 100755 modules/scicos/macros/scicos_utils/initial_scicos_tables.sci create mode 100755 modules/scicos/macros/scicos_utils/lib create mode 100755 modules/scicos/macros/scicos_utils/names create mode 100755 modules/scicos/macros/scicos_utils/returntoscilab.bin create mode 100755 modules/scicos/macros/scicos_utils/returntoscilab.sci create mode 100755 modules/scicos/macros/scicos_utils/scicos_getvalue.bin create mode 100755 modules/scicos/macros/scicos_utils/scicos_getvalue.sci create mode 100755 modules/scicos/macros/scicos_utils/scicos_workspace_init.bin create mode 100755 modules/scicos/macros/scicos_utils/scicos_workspace_init.sci create mode 100755 modules/scicos/macros/scicos_utils/with_modelica_compiler.bin create mode 100755 modules/scicos/macros/scicos_utils/with_modelica_compiler.sci (limited to 'modules/scicos/macros') diff --git a/modules/scicos/macros/buildmacros.sce b/modules/scicos/macros/buildmacros.sce new file mode 100755 index 000000000..1fc8c45d3 --- /dev/null +++ b/modules/scicos/macros/buildmacros.sce @@ -0,0 +1,20 @@ + +// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab +// Copyright (C) 2007-2008 - INRIA - Allan CORNET +// Copyright (C) 2008 - INRIA - Pierre MARECHAL +// +// This file must be used under the terms of the CeCILL. +// This source file is licensed as described in the file COPYING, which +// you should have received as part of this distribution. The terms +// are also available at +// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt + +lines(0); +CurrentDirScicos = get_absolute_file_path("buildmacros.sce"); +macrosdirs = ["scicos_auto","scicos_utils","scicos_scicos"]; + +for i=1:size(macrosdirs,"*") do + exec(CurrentDirScicos+"/"+macrosdirs(i)+"/buildmacros.sce"); +end + +clear my_script_path CurrentDirScicos macrosdirs diff --git a/modules/scicos/macros/scicos_auto/buildmacros.sce b/modules/scicos/macros/scicos_auto/buildmacros.sce new file mode 100755 index 000000000..5ce4f79d8 --- /dev/null +++ b/modules/scicos/macros/scicos_auto/buildmacros.sce @@ -0,0 +1,16 @@ + +// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab +// Copyright (C) 2007-2008 - INRIA - Allan CORNET +// +// This file must be used under the terms of the CeCILL. +// This source file is licensed as described in the file COPYING, which +// you should have received as part of this distribution. The terms +// are also available at +// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt + +if (isdef("genlib") == %f) then + exec(SCI+"/modules/functions/scripts/buildmacros/loadgenlib.sce"); +end +//------------------------------------ +genlib("scicos_autolib","SCI/modules/scicos/macros/scicos_auto",%f,%t); +//------------------------------------ diff --git a/modules/scicos/macros/scicos_auto/lib b/modules/scicos/macros/scicos_auto/lib new file mode 100755 index 000000000..9be083f6e Binary files /dev/null and b/modules/scicos/macros/scicos_auto/lib differ diff --git a/modules/scicos/macros/scicos_auto/lincos.bin b/modules/scicos/macros/scicos_auto/lincos.bin new file mode 100755 index 000000000..de2bed985 Binary files /dev/null and b/modules/scicos/macros/scicos_auto/lincos.bin differ diff --git a/modules/scicos/macros/scicos_auto/lincos.sci b/modules/scicos/macros/scicos_auto/lincos.sci new file mode 100755 index 000000000..06632dd1f --- /dev/null +++ b/modules/scicos/macros/scicos_auto/lincos.sci @@ -0,0 +1,290 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// Copyright (C) DIGITEO - Clément DAVID +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ./license.txt +// + +function sys = lincos(scs_m,x0,u0,param) + // NAME + // lincos - Constructs by linearization a linear state-space + // model from a general dynamical system described by a + // scicos diagram + + // CALLING SEQUENCE + // + // sys = lincos(scs_m [,x0,u0 [,param] ]) + // + // + // PARAMETERS + // + // scs_m: a Scicos data structure + // x0: column vector. Continuous state around which linearization to be done (default 0) + // u0: column vector. Input around which linearization to be done (default 0) + // param: list with two elements (default list(1.d-6,0)) + // param(1): scalar. Perturbation level for linearization; the following variation is used + // del([x;u])_i = param(1)+param(1)*1d-4*abs([x;u])_i + // param(2): scalar. Time t. + // + // sys: state-space system + // + // DESCRIPTION + // Constructs by linearization a linear state-space + // model from a general dynamical system described by a + // scicos diagram scs_m. Input and output ports, normally + // used inside superblocks, should be used to specify + // inputs and outputs in the scicos diagram. Suppose the + // scicos diagram to be linearized is called mysystem and + // it is saved in mysystem.cos in the current directory. The scicos + // diagram scs_m can be obtained either by + // scs_m = scicos('mysystem.cos'); + // followed by a quit in the scicos menu, or by + // load('mysystem.cos') + // which creates by default a variable called scs_m. + + + //** This function can be (ab)used from the Scilab command line and + //** inside a Scicos "context". In order to handle the different situations, + //** the required library are loaded if not already present in the + //** "semiglobal-local-environment". + + if ~exists("scicos_diagram") then + loadXcosLibs(); + end + + if exists("scicos_scicoslib")==0 then + load("SCI/modules/scicos/macros/scicos_scicos/lib") ; + end + + if exists("scicos_autolib")==0 then + load("SCI/modules/scicos/macros/scicos_auto/lib") ; + end + + if exists("scicos_utilslib")==0 then + load("SCI/modules/scicos/macros/scicos_utils/lib") ; + end + + // Define Scicos data tables =========================================== + if ( ~isdef("modelica_libs") | .. + ~isdef("scicos_pal_libs") ) then + [modelica_libs, scicos_pal_libs, %scicos_with_grid, %scs_wgrid] = initial_scicos_tables(); + end + // ===================================================================== + [lhs, rhs] = argn(0); + + if rhs < 1 then + error(msprintf(gettext("%s: Wrong number of input argument(s): At least %d expected.\n"), "lincos", 1)); + end + if typeof(scs_m)<>"diagram" & typeof(scs_m)<>"cpr" then + error(msprintf(gettext("%s: Wrong type for input argument #%d: A diagram expected.\n"), "lincos", 1)); + end + + // compile and post-process the diagram + if typeof(scs_m)=="diagram" then + + // Propagate context through all blocks + %state0 = list(); + needcompile = 4; + %cpr = struct(); + %cpr.state = %state0; + %scicos_context = struct(); + context = scs_m.props.context; + + [%scicos_context, ierr] = script2var(context, %scicos_context); + [scs_m,%cpr,needcompile,ok] = do_eval(scs_m, %cpr, %scicos_context); + if ~ok then + error(msprintf(gettext("%s: Error during block parameters evaluation.\n"), "lincos")); + end + + IN = []; + OUT = []; + + // check version + current_version = get_scicos_version() + scicos_ver = find_scicos_version(scs_m) + if scicos_ver<>current_version then + scs_m=do_version(scs_m, scicos_ver); + end + + // looking for I/O + for i=1:size(scs_m.objs) + if typeof(scs_m.objs(i))=="Block" then + if or(scs_m.objs(i).gui==["IN_f", "INPUTPORT"]) then + scs_m.objs(i).gui="INPUTPORT"; + IN=[IN scs_m.objs(i).model.ipar] + elseif or(scs_m.objs(i).gui==["OUT_f", "OUTPUTPORT"]) then + scs_m.objs(i).gui="OUTPUTPORT"; + OUT=[OUT scs_m.objs(i).model.ipar] + elseif or(scs_m.objs(i).gui==["CLKIN_f","CLKINV_f", "INPUTPORTEVTS"]) then + scs_m.objs(i).gui="INPUTPORTEVTS"; + scs_m.objs(i).model.sim(1)="bidon" + elseif or(scs_m.objs(i).gui==["CLKOUT_f","CLKOUTV_f", "OUTPUTPORTEVTS"]) then + scs_m.objs(i).gui="OUTPUTPORTEVTS"; + scs_m.objs(i).model.sim(1)="bidon" + end + end + end + + if IN == [] then + error(msprintf(gettext("%s: Unable to find diagram inputs\n"), "lincos")); + end + if OUT == [] then + error(msprintf(gettext("%s: Unable to find diagram outputs\n"), "lincos")); + end + + IN=-gsort(-IN); + if or(IN<>[1:size(IN,"*")]) then + error(msprintf(gettext("%s: Input ports are not numbered properly.\n"),"lincos")) + end + + OUT=-gsort(-OUT); + if or(OUT<>[1:size(OUT,"*")]) then + error(msprintf(gettext("%s: Output ports are not numbered properly.\n"),"lincos")) + end + + //compile scs_m + [bllst, connectmat, clkconnect,cor,corinv,ok] = c_pass1(scs_m); + if ~ok then + error(msprintf(gettext("%s: Diagram does not compile in pass %d.\n"),"lincos",1)); + end + + %cpr = c_pass2(bllst,connectmat,clkconnect,cor,corinv); + + if %cpr==list() then + ok = %f ; + end + + if ~ok then + error(msprintf(gettext("%s: Diagram does not compile in pass %d.\n"),"lincos",2)) + end + + // compile and post-process the diagram end + end + + sim = %cpr.sim; + state = %cpr.state; + // + inplnk = sim.inplnk; + inpptr = sim.inpptr; + outlnk = sim.outlnk; + outptr = sim.outptr; + ipptr = sim.ipptr; + + ki=[];ko=[];nyptr=1; + for kfun=1:length(sim.funs) + if sim.funs(kfun)=="output" then + sim.funs(kfun)="bidon" + ko=[ko;[kfun,sim.ipar(ipptr(kfun))]]; + elseif sim.funs(kfun)=="input" then + sim.funs(kfun)="bidon" + ki=[ki;[kfun,sim.ipar(ipptr(kfun))]]; + end + end + + [junk,ind]=gsort(-ko(:,2));ko=ko(ind,1); + [junk,ind]=gsort(-ki(:,2));ki=ki(ind,1); + + pointo=[]; + for k=ko' + pointo=[pointo;inplnk(inpptr(k))] + end + pointi=[]; + + for k=ki' + pointi=[pointi;outlnk(outptr(k))] + end + + nx=size(state.x,"*"); + nu=0; for k=pointi', nu=nu+size(state.outtb(k),"*"), end + ny=0; for k=pointo', ny=ny+size(state.outtb(k),"*"), end + + if rhs<3 then + x0=zeros(nx,1);u0=zeros(nu,1); + else + if size(x0,"*")<>nx then + if nx == 0 then + error(msprintf(gettext("%s: Wrong size for input argument #%d: Empty matrix expected.\n"), "lincos", 2)); + else + error(msprintf(gettext("%s: Wrong size for input argument #%d: %d-by-%d matrix expected.\n"),"lincos", 2, nx, 1)) + end + elseif size(u0,"*")<>nu then + if nx == 0 then + error(msprintf(gettext("%s: Wrong size for input argument #%d: Empty matrix expected.\n"), "lincos", 3)); + else + error(msprintf(gettext("%s: Wrong size for input argument #%d: %d-by-%d matrix expected.\n"),"lincos", 3, nx, 1)) + end + end + end + + if rhs==4 then + del = param(1)+param(1)*1d-4*abs([x0;u0]) + t = param(2) + else + del = 1.d-6*(1+1d-4*abs([x0;u0]) ) + t = 0; + end + + x0 = x0(:); + u0 = u0(:); + + state.x=x0; + + Uind = 1 + for k=pointi' + state.outtb(k) = matrix(u0(Uind:Uind+size(state.outtb(k),"*")-1),size(state.outtb(k))); + Uind = size(state.outtb(k),"*")+1; + end + + [state,t]=scicosim(state,t,t,sim,"start",[.1,.1,.1,.1]); + [state,t]=scicosim(state,t,t,sim,"linear",[.1,.1,.1,.1]); + Yind=1 + for k=pointo' + y0(Yind:Yind+size(state.outtb(k),"*")-1)=state.outtb(k)(:); + Yind=size(state.outtb(k),"*")+1 + end + xp0=state.x; + zo0=[xp0;y0]; + + F=zeros(nx+ny,nx+nu); + z0=[x0;u0]; + zer=zeros(nx+nu,1); + + for i=1:nx+nu + dz=zer;dz(i)=del(i); + z=z0+dz; + state.x=z(1:nx); + Uind=nx+1 + for k=pointi' + state.outtb(k)=matrix(z(Uind:Uind+size(state.outtb(k),"*")-1),size(state.outtb(k))); + Uind=size(state.outtb(k),"*")+1; + end + [state,t]=scicosim(state,t,t,sim,"linear",[.1,.1,.1,.1]); + zo=[] + Yind=1 + for k=pointo' + zo(Yind:Yind+size(state.outtb(k),"*")-1)=state.outtb(k)(:); + Yind=size(state.outtb(k),"*")+1 + end + zo=[state.x;zo]; + F(:,i)=(zo-zo0)/del(i); + end + [state,t]=scicosim(state,t,t,sim,"finish",[.1,.1,.1,.1]); + + sys = syslin("c",F(1:nx,1:nx),F(1:nx,nx+1:nx+nu),F(nx+1:nx+ny,1:nx),F(nx+1:nx+ny,nx+1:nx+nu)); + +endfunction diff --git a/modules/scicos/macros/scicos_auto/names b/modules/scicos/macros/scicos_auto/names new file mode 100755 index 000000000..10baea247 --- /dev/null +++ b/modules/scicos/macros/scicos_auto/names @@ -0,0 +1,3 @@ +lincos +scicos_simulate +steadycos diff --git a/modules/scicos/macros/scicos_auto/scicos_simulate.bin b/modules/scicos/macros/scicos_auto/scicos_simulate.bin new file mode 100755 index 000000000..8405cc1b2 Binary files /dev/null and b/modules/scicos/macros/scicos_auto/scicos_simulate.bin differ diff --git a/modules/scicos/macros/scicos_auto/scicos_simulate.sci b/modules/scicos/macros/scicos_auto/scicos_simulate.sci new file mode 100755 index 000000000..2235c8661 --- /dev/null +++ b/modules/scicos/macros/scicos_auto/scicos_simulate.sci @@ -0,0 +1,427 @@ +// Scicos +// +// Copyright (C) Scilab Enterprises - 2013 - Bruno JOFRET +// Copyright (C) INRIA - METALAU Project +// Copyright (C) 2011 - INRIA - Serge Steer + +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ./license.txt +// + +function Info = scicos_simulate(scs_m, Info, updated_vars, flag, Ignb) + // Function for running scicos simulation in batch mode + // Info = scicos_simulate(scs_m[,Info][,updated_vars][,flag][,Ignb]) + // + // scs_m: scicos diagram (obtained by "load file.cos"). Note that + // the version of file.cos must be the current version. If not, load + // into scicos and save. + // + // updated_vars: a scilab struct containing values of + // symbolic variables used in the context and Scicos blocks. This + // is often used to change a parameter in the diagram context. In that + // case, make sure that in the diagram context the variable is defined such + // that it can be modified. Say a variable "a" is to be defined in the + // context having value 1, and later in batch mode, we want to change + // the value of "a". In that case, in the context of the diagram place: + // if ~exists('a') then a=1,end + // If you want then to run the simulation in batch mode using the value + // a=2, set: + // updated_vars.a=2 + // + // Info: a list. It must be list() at the first call, then use output + // Info as input Info for the next calls. Info contains compilation and + // simulation information and is used to avoid recompilation when not + // needed. + // + // flag: string. If it equals 'nw' (no window), then blocks using + // graphical windows are not executed. Note that the list of such + // blocks must be updated as new blocks are added. + // + // Ignb : matrix of string : The name of blocks to ignore. + // If flag is set and equal to 'nw' then Ignb contains + // name of blocks that are added to the list + // of blocks to ignore. + // + + + //** check/set rhs parameters + //--------------------------- + if argn(2) == 1 then + //scicos_simulate(scs_m) + Info = list() + updated_vars = struct() + flag = "" + Ignb = "" + elseif argn(2) == 2 then + //scicos_simulate(scs_m, Info) + //or scicos_simulate(scs_m,updated_vars) + //or scicos_simulate(scs_m,flag) + select typeof(Info) + case "st" then //scicos_simulate(scs_m,updated_vars) + updated_vars = Info + Info=list() + ku=2 + flag = "" + case "string" then //scicos_simulate(scs_m,flag) + flag=Info + Info=list() + kf=2 + updated_vars = struct() + else //scicos_simulate(scs_m,Info) + flag = "" + updated_vars = struct() + ki=2 + end + Ignb = "" + elseif argn(2) == 3 then + //scicos_simulate(scs_m, Info,updated_vars) or scicos_simulate(scs_m, Info,"nw") + if type(updated_vars) == 10 then + flag = updated_vars + updated_vars = struct() + else + ku=3 + flag = "" + end + Ignb = "" + elseif argn(2) >= 4 then + //scicos_simulate(scs_m, Info,updated_vars,"nw") or + //scicos_simulate(scs_m, Info,"nw",updated_vars) + ku=3;kf=4 + if type(updated_vars) == 10 then + [updated_vars,flag]=(flag,updated_vars) + kf=3;ku=4 + end + if argn(2) == 4 then Ignb = "",end + else + error(msprintf(_("%s: Wrong number of input arguments. Must be between %d and %d.\n"),... + "scicos_simulate", 1, 5)) + end + + //Check variable types + if typeof(scs_m)<>"diagram" then + error(msprintf(_("%s: Wrong type for input argument #%d: %s data structure expected.\n"),... + "scicos_simulate",1,"scs_m")) + end + if type(Info)<>15 then + error(msprintf(_("%s: Wrong type for input argument #%d: A list expected.\n"),.. + "scicos_simulate",2)) + end + if typeof(updated_vars)<>"st" then + error(msprintf(_("%s: Wrong type for input argument #%d: A list expected.\n"),... + "scicos_simulate",ku)) + end + if and(stripblanks(flag)<>["nw" ""]) then + error(msprintf(_("%s: Wrong value for input argument #%d: ''%s'' expected.\n"),... + "scicos_simulate",kf,"nw")) + end + if type(Ignb) <> 10 then + error(msprintf(_("%s: Wrong type for input argument #%d: String array expected.\n"),... + "scicos_simulate",5)) + end + + if or(sciargs() == "-nogui")|or(sciargs() == "-nwni") then + flag = "nw" + end + //**blocks to ignore requested by user + Ignb = matrix(Ignb,1,-1)//make it row vector + + //**blocks to ignore in any cases + Ignore=["affich",... + "affich2"] + //**blocks to ignore with flag=="nw" + Ignoreb = ["bouncexy", ... + "cscope", ... + "cmscope", ... + "canimxy", ... + "canimxy3d", ... + "cevscpe", ... + "cfscope", ... + "cscopxy", ... + "cscopxy3d", ... + "cmatview", ... + "cmat3d", ... + "bplatform2"] + + //** load the scicos function libraries + //------------------------------------ + + if exists("scicos_scicoslib")==0 then + load("SCI/modules/scicos/macros/scicos_scicos/lib") ; + end + + if exists("scicos_autolib")==0 then + load("SCI/modules/scicos/macros/scicos_auto/lib") ; + end + + if exists("scicos_utilslib")==0 then + load("SCI/modules/scicos/macros/scicos_utils/lib") ; + end + + // Define Scicos data tables =========================================== + [modelica_libs, scicos_pal_libs, %scicos_with_grid, %scs_wgrid] = initial_scicos_tables(); + // ===================================================================== + + //** initialize a "scicos_debug_gr" variable + %scicos_debug_gr = %f; + + + //** redefine some functions + prot = funcprot();funcprot(0); + do_terminate = do_terminate1 + funcprot(prot) + + + //check version + current_version = get_scicos_version() + scicos_ver = find_scicos_version(scs_m) + + //do version + if scicos_ver <> current_version then + ierr = execstr("scs_m = do_version(scs_m, scicos_ver)","errcatch") + if ierr <> 0 then + messagebox(_("Can''t convert old diagram (problem in version)"),"modal") + return + end + end + + //** prepare from and to workspace stuff + //------------------------------------- + scicos_workspace_init() + + if flag == "nw" then + Ignore = [Ignore,Ignoreb] + end + //add user ignored blocks if any + Ignore = [Ignore, Ignb] + + //** retrieve Info list + if Info <> list() then + [%tcur, %cpr, alreadyran, needstart, needcompile, %state0] = Info(:) + else + %tcur = 0; + %cpr = list(); + alreadyran = %f; + needstart = %t; + needcompile = 4; + %state0 = list(); + end + + //** set solver + tolerances = scs_m.props.tol + solver = tolerances(6) + %scicos_solver = solver + //** set variables of context + [%scicos_context, ierr] = script2var(scs_m.props.context,struct()) + //overload %scicos_context variables with those defined by updated_vars + contextvars=fieldnames(%scicos_context) + updatedvars=fieldnames(updated_vars) + for k=1:size(updatedvars,"*") + u=updatedvars(k) + if or(u==contextvars) then + %scicos_context(u)=updated_vars(u) + else + mprintf(_("Warning the variable %s does not match any context variable name\nignored"),u) + end + end + if ierr == 0 then //++ no error + [scs_m, %cpr, needcompile, ok] = do_eval(scs_m, %cpr,%scicos_context) + if ~ok then + error(msprintf(gettext("%s: Error during block parameters evaluation.\n"), "scicos_simulate")); + end + if needcompile <> 4 & size(%cpr) > 0 then + %state0 = %cpr.state + end + alreadyran = %f + else + error(["Incorrect context definition, " + lasterror()]) + end + + // perform block suppression only on partial compilation and full compilation + if needcompile > 1 then + need_suppress =%t + else + need_suppress = %f + end + + [%cpr, %state0_n, needcompile, alreadyran, ok] = do_update(%cpr, ... + %state0, needcompile) + + if ~ok then + error(msprintf(gettext("%s: Error during block parameters update.\n"), "scicos_simulate")); + end + + if or(%state0_n <> %state0) then //initial state has been changed + %state0 = %state0_n + [alreadyran, %cpr, Resume_line, TOWS_vals, Names] = do_terminate1(scs_m, %cpr) + choix = [] + end + if (%cpr.sim.xptr($) - 1) < size(%cpr.state.x,"*") & solver < 100 then + warning(msprintf(_("Diagram has been compiled for implicit solver\nswitching to implicit solver.\n"))) + solver = 100 + tolerances(6) = solver + elseif (%cpr.sim.xptr($) - 1) == size(%cpr.state.x,"*") & ... + (or (solver == [100 101 102])) & size(%cpr.state.x,"*") <> 0 then + warning(msprintf(_("Diagram has been compiled for explicit solver\nswitching to explicit solver.\n"))) + solver = 0 + tolerances(6) = solver + end + + if need_suppress then //this is done only once + for i = 1:length(%cpr.sim.funs) + if type(%cpr.sim.funs(i)) <> 13 then + if find(%cpr.sim.funs(i)(1) == Ignore) <> [] then + if (%cpr.sim.funs(i)(1) == "bplatform2") then + %cpr.sim.funtyp(i) = 4; // BPLATFORM block has function type 5, so need to set it to 4, like the trash block. + end + %cpr.sim.funs(i)(1) = "trash"; + end + end + end + end + + if needstart then //scicos initialization + if alreadyran then + [alreadyran, %cpr, Resume_line, TOWS_vals, Names] = do_terminate1(scs_m, %cpr) + alreadyran = %f + end + %tcur = 0 + %cpr.state = %state0 + tf = scs_m.props.tf; + if tf*tolerances == [] then + error(_("Simulation parameters not set:")); + end + ierr = execstr("[state, t] = scicosim(%cpr.state, %tcur, tf, %cpr.sim," + .. + "''start'', tolerances)","errcatch") + if ierr <> 0 then + error(_("Initialization problem:")) + end + %cpr.state = state + end + + ierr = execstr("[state, t] = scicosim(%cpr.state, %tcur, tf, %cpr.sim," + .. + "''run'', tolerances)","errcatch") + if ierr == 0 then + %cpr.state = state + alreadyran = %t + if (tf - t) < tolerances(3) then + needstart = %t + [alreadyran, %cpr, Resume_line, TOWS_vals, Names] = do_terminate1(scs_m, %cpr) + for i=1:size(Names, "c") + ierr = execstr(Names(i)+" = TOWS_vals("+string(i)+");", "errcatch"); + if ierr <> 0 then + str_err = split_lasterror(lasterror()); + message(["Simulation problem" ; "Unable to find To Workspace Variable {"+Names(i)+"}:" ; str_err]); + break; + end + end + else + %tcur = t + end + else + error([_("Simulation problem: ");lasterror()]) + end + + Info = list(%tcur, %cpr, alreadyran, needstart, needcompile, %state0) + + // Executing the resume() function at the end, because it does not return control + if ~isempty(Names) then + execstr(Resume_line); + end +endfunction + +function [alreadyran, %cpr, Resume_line, TOWS_vals, Names] = do_terminate1(scs_m, %cpr) + // Copyright INRIA + + // Default return values + Resume_line = ""; + TOWS_vals = struct("values",[],"time",[]); + Names = []; + + if prod(size(%cpr)) < 2 then + alreadyran = %f + return + end + + par = scs_m.props; + + if alreadyran then + alreadyran = %f + // terminate current simulation + ierr = execstr("[state, t] = scicosim(%cpr.state, par.tf, par.tf, %cpr.sim, ''finish'', par.tol)", "errcatch") + + %cpr.state = state + if ierr <> 0 then + error([_("End problem: ");lasterror()]) + end + + // Restore saved variables in Scilab environment ("To workspace" block) + + // First step: Search the %cpr tree for TOWS_c blocks, and extract the variable names. + path = %cpr.sim; + buff_sizes = []; + increment = 1; + for i=1:size(path.funs) + increment2 = path.ipptr(i+1); + if (increment2 - increment <> 0) then // ipar has at least a few elements + space = increment2 - increment; // The number of elements that the current block pushed into ipar + if (path.funs(i) == "tows_c") then // Found a Tow_workspace block + varNameLen = space - 2; // Space minus 'buffer_size' and 'var length' ipar elements + varNameCode = path.ipar(increment+2:increment+2+varNameLen-1); // varName is stored in Scilab code + varName = ascii(varNameCode); + Names = [Names varName]; // Append varName in Names + buff_size = path.ipar(increment); // Retrieve buffer size + buff_sizes = [buff_sizes buff_size]; + end + increment = increment2; + end + end + // At the end, Names contains the string names of the variables and buff_sizes the respective buffer sizes + + // Second step: Link the variable names to their values vectors, + //and call '[names(1), names(2), ...] = resume(names(1), names(2), ...)' to save the variable into Scilab + if ~isempty(Names) then + for i=1:size(Names, "c") + execstr("NamesIval = "+Names(i)+"_val;"); + execstr("NamesIvalt = "+Names(i)+"_valt;"); + // If input is a matrix, use function matrix() to reshape the saved values + // Check condition using time vector, if we have more values than time stamps, split it + if (size(NamesIval, "r") > size(NamesIvalt, "r")) then // In this case, size(Names(i), 'r') = buff_sizes(i) * nCols2 + nRows = size(NamesIvalt, "r"); + nCols = size(NamesIval, "c"); + nCols2 = size(NamesIval, "r") / nRows; + NamesIval = matrix(NamesIval, nCols, nCols2, nRows); + end + if i == 1 then + // Replace default struct with value vector of first element of 'Names' + TOWS_vals.values = NamesIval; + TOWS_vals.time = NamesIvalt; + Resume_line_args = Names(1); + else + ierr = execstr("TOWS_vals = [TOWS_vals struct(''values'', NamesIval, ''time'', NamesIvalt)];", "errcatch"); + if ierr <> 0 then + str_err = split_lasterror(lasterror()); + message(["Simulation problem" ; "Unable to find To Workspace Variable {"+Names(i)+"}:" ; str_err]); + break; + end + Resume_line_args = Resume_line_args + ", " + Names(i); // Concatenate the variable names up to the last one + end + end + Resume_line = "[" + Resume_line_args + "] = resume(" + Resume_line_args + ");"; // Build the message + // Will execute Resume_line at the end of the main function, because it does not return control + end + end +endfunction diff --git a/modules/scicos/macros/scicos_auto/steadycos.bin b/modules/scicos/macros/scicos_auto/steadycos.bin new file mode 100755 index 000000000..74619b0ff Binary files /dev/null and b/modules/scicos/macros/scicos_auto/steadycos.bin differ diff --git a/modules/scicos/macros/scicos_auto/steadycos.sci b/modules/scicos/macros/scicos_auto/steadycos.sci new file mode 100755 index 000000000..38eb06495 --- /dev/null +++ b/modules/scicos/macros/scicos_auto/steadycos.sci @@ -0,0 +1,269 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// Copyright (C) DIGITEO - Clément DAVID +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ./license.txt +// + +function [X,U,Y,XP] = steadycos(scs_m,X,U,Y,Indx,Indu,Indy,Indxp,param) + // NAME + // steadycos - Finds an equilibrium state of a general + // dynamical system described by a scicos diagram + + // CALLING SEQUENCE + // + // [X,U,Y,XP] = steadycos(scs_m,X,U,Y,Indx,Indu,Indy [,Indxp [,param ] ]) + // + // scs_m: a Scicos data structure + // X: column vector. Continuous state. Can be set to [] if zero. + // U: column vector. Input. Can be set to [] if zero. + // Y: column vector. Output. Can be set to [] if zero. + // Indx: index of entries of X that are not fixed. If all can vary, set to 1:$ + // Indu: index of entries of U that are not fixed. If all can vary, set to 1:$ + // Indy: index of entries of Y that are not fixed. If all can vary, set to 1:$ + // Indxp: index of entries of XP (derivative of x) that need not be zero. + // If all can vary, set to 1:$. Default []. + // param: list with two elements (default list(1.d-6,0)) + // param(1): scalar. Perturbation level for linearization; the following variation is used + // del([x;u])_i = param(1)+param(1)*1d-4*abs([x;u])_i + // param(2): scalar. Time t. + // + + //** This function can be (ab)used from the Scilab command line and + //** inside a Scicos "context". In order to handle the different situations, + //** the required library are loaded if not already present in the + //** "semiglobal-local-environment". + + if ~exists("scicos_diagram") then + loadXcosLibs(); + end + + if exists("scicos_scicoslib")==0 then + load("SCI/modules/scicos/macros/scicos_scicos/lib") ; + end + + if exists("scicos_autolib")==0 then + load("SCI/modules/scicos/macros/scicos_auto/lib") ; + end + + if exists("scicos_utilslib")==0 then + load("SCI/modules/scicos/macros/scicos_utils/lib") ; + end + + // Define Scicos data tables =========================================== + if ( ~isdef("modelica_libs") | .. + ~isdef("scicos_pal_libs") ) then + [modelica_libs, scicos_pal_libs, %scicos_with_grid, %scs_wgrid] = initial_scicos_tables(); + end + // ===================================================================== + + [lhs,rhs] = argn(0) ; + + if rhs < 1 then + error(msprintf(gettext("%s: Wrong number of input argument(s): At least %d expected.\n"), "steadycos", 1)); + end + if typeof(scs_m)<>"diagram" & typeof(scs_m)<>"cpr" then + error(msprintf(gettext("%s: Wrong type for input argument #%d: A diagram expected.\n"), "steadycos", 1)); + end + + // compile and post-process the diagram + if typeof(scs_m)=="diagram" then + + // Propagate context through all blocks + %state0 = list(); + needcompile = 4; + %cpr = struct(); + %cpr.state = %state0; + %scicos_context = struct(); + context = scs_m.props.context; + + [%scicos_context, ierr] = script2var(context, %scicos_context); + [scs_m,%cpr,needcompile,ok] = do_eval(scs_m, %cpr, %scicos_context); + if ~ok then + error(msprintf(gettext("%s: Error during block parameters evaluation.\n"), "lincos")); + end + + IN = []; + OUT = []; + + // check and do version + current_version = get_scicos_version() + scicos_ver = find_scicos_version(scs_m) + if scicos_ver<>current_version then + scs_m=do_version(scs_m,scicos_ver); + end + + if rhs==7 then + Indxp=[ ];param=list(1.d-6,0) + elseif rhs==8 then + param=list(1.d-6,0) + elseif rhs==9 then + else + error(msprintf(gettext("%s: Wrong number of input arguments: %d to %d expected.\n"), "steadycos", 7, 9)); + end + + for i=1:length(scs_m.objs) + if typeof(scs_m.objs(i))=="Block" then + if or(scs_m.objs(i).gui==["IN_f", "INPUTPORT"]) then + scs_m.objs(i).gui="INPUTPORT"; + IN=[IN scs_m.objs(i).model.ipar] + elseif or(scs_m.objs(i).gui==["OUT_f", "OUTPUTPORT"]) then + scs_m.objs(i).gui="OUTPUTPORT"; + OUT=[OUT scs_m.objs(i).model.ipar] + end + end + end + + if IN == [] then + error(msprintf(gettext("%s: Unable to find diagram inputs\n"), "steadycos")); + end + if OUT == [] then + error(msprintf(gettext("%s: Unable to find diagram outputs\n"), "steadycos")); + end + + IN=-gsort(-IN); + if or(IN<>[1:size(IN,"*")]) then + error(msprintf(gettext("%s: Input ports are not numbered properly.\n"), "steadycos")) + end + + OUT=-gsort(-OUT); + if or(OUT<>[1:size(OUT,"*")]) then + error(msprintf(gettext("%s: Output ports are not numbered properly.\n"), "steadycos")) + end + + // compile scs_m + [bllst,connectmat,clkconnect,cor,corinv,ok] = c_pass1(scs_m); + if ~ok then + error(msprintf(gettext("%s: Diagram does not compile in pass %d.\n"),"steadycos",1)); + end + %cpr = c_pass2(bllst,connectmat,clkconnect,cor,corinv); + if %cpr==list() then + ok=%f, + end + if ~ok then + error(msprintf(gettext("%s: Diagram does not compile in pass %d.\n"),"steadycos",2)); + end + + // compile and post-process the diagram end + end + + sim=%cpr.sim;state=%cpr.state; + // + inplnk=sim.inplnk;inpptr=sim.inpptr; + outlnk=sim.outlnk;outptr=sim.outptr;ipptr=sim.ipptr; + + ki=[];ko=[];nyptr=1; + for kfun=1:length(sim.funs) + if sim.funs(kfun)=="output" then + sim.funs(kfun)="bidon" + ko=[ko;[kfun,sim.ipar(ipptr(kfun))]]; + + elseif sim.funs(kfun)=="input" then + sim.funs(kfun)="bidon" + ki=[ki;[kfun,sim.ipar(ipptr(kfun))]]; + + end + end + [junk,ind]=gsort(-ko(:,2));ko=ko(ind,1); + [junk,ind]=gsort(-ki(:,2));ki=ki(ind,1); + + pointo=[]; + for k=ko' + pointo=[pointo;inplnk(inpptr(k))] + end + pointi=[]; + for k=ki' + pointi=[pointi;outlnk(outptr(k))] + end + nx=size(state.x,"*"); + nu=0; for k=pointi', nu=nu+size(state.outtb(k),"*"), end + ny=0; for k=pointo', ny=ny+size(state.outtb(k),"*"), end + + if X==[] then X=zeros(nx,1);end + if Y==[] then Y=zeros(ny,1);end + if U==[] then U=zeros(nu,1);end + if param(1)==0 then param(1)=1.d-6;end + + t = param(2) + + ux0 = [U(Indu);X(Indx)]; + sindu = size(U(Indu),"*"); + sindx = size(X(Indx),"*"); + [err,uxopt,gopt] = optim(cost,ux0) + U(Indu) = uxopt(1:sindu); + X(Indx) = uxopt(sindu+1:sindx+sindu); + state.x = X; + Uind=1 + + for k=pointi' + state.outtb(k) = matrix(U(Uind:Uind+size(state.outtb(k),"*")-1),size(state.outtb(k))); + Uind = size(state.outtb(k),"*")+1; + end + + [state,t] = scicosim(state,t,t,sim,"start",[.1,.1,.1,.1]); + [state,t] = scicosim(state,t,t,sim,"linear",[.1,.1,.1,.1]); + [state,t] = scicosim(state,t,t,sim,"finish",[.1,.1,.1,.1]); + + XP=state.x; + Yind=1 + + for k=pointo' + Y(Yind:Yind+size(state.outtb(k),"*")-1) = state.outtb(k)(:); + Yind = size(state.outtb(k),"*")+1 + end + +endfunction +//**------------------------------------------------------------------------------------------- + +function [f,g,ind]=cost(ux,ind) + state; + X; + U; + X(Indx)=ux(sindu+1:sindx+sindu); + U(Indu)=ux(1:sindu); + state.x=X; + Uind=1 + for k=pointi' + state.outtb(k) = matrix(U(Uind:Uind+size(state.outtb(k),"*")-1),size(state.outtb(k))); + Uind = size(state.outtb(k),"*")+1; + end + // state.outtb(pointi)=U; + + [state,t] = scicosim(state,t,t,sim,"start",[.1,.1,.1,.1]); + [state,t] = scicosim(state,t,t,sim,"linear",[.1,.1,.1,.1]); + [state,t] = scicosim(state,t,t,sim,"finish",[.1,.1,.1,.1]); + + zer=ones(X);zer(Indxp)=0;xp=zer.*state.x; + + Yind=1 + for k=pointo' + y(Yind:Yind+size(state.outtb(k),"*")-1)=state.outtb(k)(:); + Yind = size(state.outtb(k),"*")+1 + end + // y=state.outtb(pointo); + zer = ones(y); + zer(Indy) = 0; + err = zer.*(Y-y); + f=.5*(norm(xp,2)+norm(err,2)); + + sys = lincos(%cpr,X,U,param); //** lincos is used here + + g = xp'*[sys.B(:,Indu) sys.A(:,Indx)] - err'*[sys.D(:,Indu) sys.C(:,Indx)]; + +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/%Block_e.bin b/modules/scicos/macros/scicos_scicos/%Block_e.bin new file mode 100755 index 000000000..e391c73ef Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%Block_e.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%Block_e.sci b/modules/scicos/macros/scicos_scicos/%Block_e.sci new file mode 100755 index 000000000..07ea438aa --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%Block_e.sci @@ -0,0 +1,34 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function varargout=%Block_e(i,o) + //function used only for backward compatibility of scicos blocks gui + warning("Obsolete use of o(i) in this scicos block") + varargout=list() + for k=1:size(i,"*") + ik=i(k) + if ik==1 then + varargout($+1)="Block" + else + varargout($+1)=getfield(ik,o) + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%Block_p.bin b/modules/scicos/macros/scicos_scicos/%Block_p.bin new file mode 100755 index 000000000..417197671 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%Block_p.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%Block_p.sci b/modules/scicos/macros/scicos_scicos/%Block_p.sci new file mode 100755 index 000000000..6287851a2 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%Block_p.sci @@ -0,0 +1,56 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function %Block_p(block) + txt=["GUI : "+block.gui + "Graphics: " + " "+graphics2txt(block.graphics) + "Model : " + " "+model2txt(block.model)] + write(%io(2),txt,"(a)") +endfunction + +function txt=graphics2txt(graphics) + fn=getfield(1,graphics) + txt=[] + for k=2:size(fn,"*") + txt=[txt + sci2exp(graphics(fn(k)),fn(k))] + end +endfunction + +function txt=model2txt(model) + sim=model.sim + if type(sim)==15 then + txt=sim(1)+" type: "+string(sim(2)) + else + txt=sim+" type: 0" + end + fn=getfield(1,model) + for k=3:size(fn,"*") + if fn(k)=="rpar" & type(model(fn(k)))==15 then + txt=[txt;fn(k)+" : SuperBlock"]; + else + txt=[txt + sci2exp(model(fn(k)),fn(k))]; + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%b_i_graphics.bin b/modules/scicos/macros/scicos_scicos/%b_i_graphics.bin new file mode 100755 index 000000000..94e38c125 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%b_i_graphics.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%b_i_graphics.sci b/modules/scicos/macros/scicos_scicos/%b_i_graphics.sci new file mode 100755 index 000000000..20cb6ff98 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%b_i_graphics.sci @@ -0,0 +1,25 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function g=%b_i_graphics(i,b,g) + //function used only for backward compatibility of scicos blocks gui + setfield(i+1,b,g) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%b_i_model.bin b/modules/scicos/macros/scicos_scicos/%b_i_model.bin new file mode 100755 index 000000000..99f28c0c1 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%b_i_model.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%b_i_model.sci b/modules/scicos/macros/scicos_scicos/%b_i_model.sci new file mode 100755 index 000000000..da9a2fbb8 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%b_i_model.sci @@ -0,0 +1,26 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function m=%b_i_model(i,b,m) + //function used only for backward compatibility of scicos blocks gui + if i>13 then warning("Field "+string(i)+" no longer in model, check"),end + setfield(i+1,b,m) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%c_i_block.bin b/modules/scicos/macros/scicos_scicos/%c_i_block.bin new file mode 100755 index 000000000..99da9215d Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%c_i_block.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%c_i_block.sci b/modules/scicos/macros/scicos_scicos/%c_i_block.sci new file mode 100755 index 000000000..91f89238f --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%c_i_block.sci @@ -0,0 +1,25 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function o=%c_i_block(i,b,o) + //function used only for backward compatibility of scicos blocks gui + if i<>1 then setfield(i,b,o),end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%c_i_graphics.bin b/modules/scicos/macros/scicos_scicos/%c_i_graphics.bin new file mode 100755 index 000000000..dcfe2d467 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%c_i_graphics.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%c_i_graphics.sci b/modules/scicos/macros/scicos_scicos/%c_i_graphics.sci new file mode 100755 index 000000000..cdba9d78c --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%c_i_graphics.sci @@ -0,0 +1,25 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function g=%c_i_graphics(i,b,g) + //function used only for backward compatibility of scicos blocks gui + setfield(i+1,b,g) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%c_i_model.bin b/modules/scicos/macros/scicos_scicos/%c_i_model.bin new file mode 100755 index 000000000..49dc36880 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%c_i_model.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%c_i_model.sci b/modules/scicos/macros/scicos_scicos/%c_i_model.sci new file mode 100755 index 000000000..ea3641795 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%c_i_model.sci @@ -0,0 +1,26 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function m=%c_i_model(i,b,m) + //function used only for backward compatibility of scicos blocks gui + if i>13 then warning("Field "+string(i)+" no longer in model, check"),end + setfield(i+1,b,m) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%debug_scicos.bin b/modules/scicos/macros/scicos_scicos/%debug_scicos.bin new file mode 100755 index 000000000..f99f48325 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%debug_scicos.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%debug_scicos.sci b/modules/scicos/macros/scicos_scicos/%debug_scicos.sci new file mode 100755 index 000000000..50dc73ff6 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%debug_scicos.sci @@ -0,0 +1,29 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [block] = %debug_scicos(block,flag) + if execstr("load(TMPDIR+''/debug_scicos'')","errcatch")<>0 then + disp("Instantiate the Debug block") + else + [block] = debug_scicos(block,flag) + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%diagram_p.bin b/modules/scicos/macros/scicos_scicos/%diagram_p.bin new file mode 100755 index 000000000..48803c642 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%diagram_p.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%diagram_p.sci b/modules/scicos/macros/scicos_scicos/%diagram_p.sci new file mode 100755 index 000000000..fa9320fe8 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%diagram_p.sci @@ -0,0 +1,34 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function %diagram_p(scs_m) + %params_p(scs_m.props) + nams=[] + for o=scs_m.objs + if typeof(o)=="Block" then + nams=[nams;o.gui] + end + end + if nams <> [] then + nums=part(string(1:size(nams,"*"))',1:6) + write(%io(2),nums+nams,"(a)") + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%graphics_e.bin b/modules/scicos/macros/scicos_scicos/%graphics_e.bin new file mode 100755 index 000000000..061280b82 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%graphics_e.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%graphics_e.sci b/modules/scicos/macros/scicos_scicos/%graphics_e.sci new file mode 100755 index 000000000..18e19e1f9 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%graphics_e.sci @@ -0,0 +1,29 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function varargout=%graphics_e(i,o) + //function used only for backward compatibility of scicos blocks gui + warning("Obsolete use of graphics(i) in this scicos block") + varargout=list() + for k=1:size(i,"*") + varargout($+1)=getfield(i(k)+1,o) + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%graphics_i_Block.bin b/modules/scicos/macros/scicos_scicos/%graphics_i_Block.bin new file mode 100755 index 000000000..ee03e4050 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%graphics_i_Block.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%graphics_i_Block.sci b/modules/scicos/macros/scicos_scicos/%graphics_i_Block.sci new file mode 100755 index 000000000..0edce5f45 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%graphics_i_Block.sci @@ -0,0 +1,24 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function g=%graphics_i_Block(i,b,g) + setfield(i,b,g) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%graphics_p.bin b/modules/scicos/macros/scicos_scicos/%graphics_p.bin new file mode 100755 index 000000000..31ded4dcc Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%graphics_p.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%graphics_p.sci b/modules/scicos/macros/scicos_scicos/%graphics_p.sci new file mode 100755 index 000000000..ce052bcce --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%graphics_p.sci @@ -0,0 +1,30 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function %graphics_p(graphics) + fn=getfield(1,graphics) + txt=[] + for k=2:size(fn,"*") + txt=[txt + sci2exp(graphics(fn(k)),fn(k))] + end + write(%io(2),txt,"(a)") +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%l_i_block.bin b/modules/scicos/macros/scicos_scicos/%l_i_block.bin new file mode 100755 index 000000000..81b71c550 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%l_i_block.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%l_i_block.sci b/modules/scicos/macros/scicos_scicos/%l_i_block.sci new file mode 100755 index 000000000..19b2e04b3 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%l_i_block.sci @@ -0,0 +1,25 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function o=%l_i_block(i,b,o) + //function used only for backward compatibility of scicos blocks gui + setfield(i,b,o) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%l_i_graphics.bin b/modules/scicos/macros/scicos_scicos/%l_i_graphics.bin new file mode 100755 index 000000000..fb663e044 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%l_i_graphics.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%l_i_graphics.sci b/modules/scicos/macros/scicos_scicos/%l_i_graphics.sci new file mode 100755 index 000000000..e7ace032d --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%l_i_graphics.sci @@ -0,0 +1,25 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function g=%l_i_graphics(i,b,g) + //function used only for backward compatibility of scicos blocks gui + setfield(i+1,b,g) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%l_i_model.bin b/modules/scicos/macros/scicos_scicos/%l_i_model.bin new file mode 100755 index 000000000..20057f5b3 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%l_i_model.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%l_i_model.sci b/modules/scicos/macros/scicos_scicos/%l_i_model.sci new file mode 100755 index 000000000..fe1f35ef5 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%l_i_model.sci @@ -0,0 +1,26 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function m=%l_i_model(i,b,m) + //function used only for backward compatibility of scicos blocks gui + if i>13 then warning("Field "+string(i)+" no longer in model, check"),end + setfield(i+1,b,m) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%model_e.bin b/modules/scicos/macros/scicos_scicos/%model_e.bin new file mode 100755 index 000000000..25e41d107 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%model_e.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%model_e.sci b/modules/scicos/macros/scicos_scicos/%model_e.sci new file mode 100755 index 000000000..00ced7b14 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%model_e.sci @@ -0,0 +1,29 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function varargout=%model_e(i,o) + //function used only for backward compatibility of scicos blocks gui + warning("Obsolete use of model(i) in this scicos block") + varargout=list() + for k=1:size(i,"*") + varargout($+1)=getfield(i(k)+1,o) + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%model_i_Block.bin b/modules/scicos/macros/scicos_scicos/%model_i_Block.bin new file mode 100755 index 000000000..a956bf297 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%model_i_Block.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%model_i_Block.sci b/modules/scicos/macros/scicos_scicos/%model_i_Block.sci new file mode 100755 index 000000000..14fd59dd8 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%model_i_Block.sci @@ -0,0 +1,24 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function g=%model_i_Block(i,b,g) + setfield(i,b,g) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%model_p.bin b/modules/scicos/macros/scicos_scicos/%model_p.bin new file mode 100755 index 000000000..672557c4d Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%model_p.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%model_p.sci b/modules/scicos/macros/scicos_scicos/%model_p.sci new file mode 100755 index 000000000..11ac4b812 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%model_p.sci @@ -0,0 +1,40 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function %model_p(model) + + sim=model.sim + if type(sim)==15 then + if type(sim(1))==13 then + txt="scifunc" + else + txt=sim(1)+" type: "+string(sim(2)) + end + else + txt=sim+" type: 0" + end + fn=getfield(1,model) + for k=3:size(fn,"*") + txt=[txt + sci2exp(model(fn(k)),fn(k))] + end + write(%io(2),txt,"(a)") +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%params_p.bin b/modules/scicos/macros/scicos_scicos/%params_p.bin new file mode 100755 index 000000000..849fd5e3c Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%params_p.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%params_p.sci b/modules/scicos/macros/scicos_scicos/%params_p.sci new file mode 100755 index 000000000..02bd86d6e --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%params_p.sci @@ -0,0 +1,34 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function %params_p(par) + write(%io(2),params2txt(par),"(a)") +endfunction + +function txt=params2txt(par) + fn=getfield(1,par) + txt=[] + for k=2:size(fn,"*") + txt=[txt + sci2exp(par(fn(k)),fn(k))] + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/%s_i_block.bin b/modules/scicos/macros/scicos_scicos/%s_i_block.bin new file mode 100755 index 000000000..d5a94ab14 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%s_i_block.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%s_i_block.sci b/modules/scicos/macros/scicos_scicos/%s_i_block.sci new file mode 100755 index 000000000..066de9578 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%s_i_block.sci @@ -0,0 +1,25 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function o=%s_i_block(i,b,o) + //function used only for backward compatibility of scicos blocks gui + setfield(i,b,o) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%s_i_graphics.bin b/modules/scicos/macros/scicos_scicos/%s_i_graphics.bin new file mode 100755 index 000000000..71c0486cb Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%s_i_graphics.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%s_i_graphics.sci b/modules/scicos/macros/scicos_scicos/%s_i_graphics.sci new file mode 100755 index 000000000..db813d681 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%s_i_graphics.sci @@ -0,0 +1,25 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function g=%s_i_graphics(i,b,g) + //function used only for backward compatibility of scicos blocks gui + setfield(i+1,b,g) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/%s_i_model.bin b/modules/scicos/macros/scicos_scicos/%s_i_model.bin new file mode 100755 index 000000000..3abf96781 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/%s_i_model.bin differ diff --git a/modules/scicos/macros/scicos_scicos/%s_i_model.sci b/modules/scicos/macros/scicos_scicos/%s_i_model.sci new file mode 100755 index 000000000..abd18d912 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/%s_i_model.sci @@ -0,0 +1,26 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function m=%s_i_model(i,b,m) + //function used only for backward compatibility of scicos blocks gui + if i>13 then warning("Field "+string(i)+" no longer in model, check"),end + setfield(i+1,b,m) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/CC4.bin b/modules/scicos/macros/scicos_scicos/CC4.bin new file mode 100755 index 000000000..8ca51d641 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/CC4.bin differ diff --git a/modules/scicos/macros/scicos_scicos/CC4.sci b/modules/scicos/macros/scicos_scicos/CC4.sci new file mode 100755 index 000000000..f7fb15579 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/CC4.sci @@ -0,0 +1,121 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function [ok,tt,cancel]=CC4(funam,tt) + // Copyright INRIA + // + cancel=%f + + if tt==[] then + + textmp=["#include ""scicos_block4.h"""; + "" + "void "+funam+"(scicos_block *block,int flag)"; + ]; + ttext=[]; + textmp($+1)="{" + textmp=[textmp] + + textmp($+1)=" /* init */" + textmp($+1)=" if (flag == 4) {" + textmp($+1)=" "; + if out<>0 then + textmp($+1)=" /* output computation */ "; + textmp($+1)=" } else if(flag == 1) {" + textmp($+1)=" "; + end + + if nx<>0 then + textmp($+1)=" /* derivative or residual computation */" + textmp($+1)=" } else if(flag == 0) {" + textmp($+1)=" "; + end + + if nzcr<>0 then + textmp($+1)=" /* zero crossing surface and mode computation */" + textmp($+1)=" } else if(flag == 9) {" + textmp($+1)=" "; + end + + if nz<>0 then + textmp($+1)=" /* computation of next discrete state*/ " + textmp($+1)=" } else if(flag == 2) { " + textmp($+1)=" "; + + elseif min(nx,nzcr+nevin)>0 then + textmp($+1)=" /* computation of jumped state*/ " + textmp($+1)=" } else if(flag == 2) {" + textmp($+1)=" "; + end + + if nevout<>0 then + textmp($+1)=" /* computation of output event times*/" + textmp($+1)=" } else if(flag == 3) {" + textmp($+1)=" " + end + textmp($+1)=" /* ending */" + textmp($+1)=" } else if (flag == 5) {" + textmp($+1)=" "; + textmp($+1)=" }" + textmp($+1)="}" + textmp=[textmp;" "; ttext]; + else + textmp=tt; + end + + tt = textmp + ok = %t + //## set param of scstxtedit + ptxtedit=scicos_txtedit(clos = 0,... + typ = "Cfunc",... + head = ["Function definition in C"; + "Here is a skeleton of the functions which"; + " you should edit."]); + + while 1==1 + + [txt,Quit] = scstxtedit(textmp,ptxtedit); + + if ptxtedit.clos==1 then + break; + end + + if txt<>[] then + [libss,ok,cancel]=get_dynamic_lib_dir(txt,funam,"c") + + if ~cancel & ok then + [ok]=scicos_block_link(funam,txt,"c",libss) + if ok then + ptxtedit.clos=1 + tt=txt + ok = %t; + end + textmp=txt; + end + end + + if Quit==1 then + ok = %f; + cancel =%t; + break; + end + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/CFORTR.bin b/modules/scicos/macros/scicos_scicos/CFORTR.bin new file mode 100755 index 000000000..f91f85108 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/CFORTR.bin differ diff --git a/modules/scicos/macros/scicos_scicos/CFORTR.sci b/modules/scicos/macros/scicos_scicos/CFORTR.sci new file mode 100755 index 000000000..367887afc --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/CFORTR.sci @@ -0,0 +1,84 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [ok,tt]=CFORTR(funam,tt,inp,out) + // + ni=size(inp,"*") + no=size(out,"*") + if tt==[] then + + tete1=["#include ";"#include ";... + "void "+funam+"(flag,nevprt,t,xd,x,nx,z,nz,tvec,";.. + " ntvec,rpar,nrpar,ipar,nipar"] + + tete2= " " + decl="" + for i=1:ni + tete2=tete2+",u"+string(i)+",nu"+string(i) + decl=decl+",*nu"+string(i) + end + for i=1:no + tete2=tete2+",y"+string(i)+",ny"+string(i) + decl=decl+",*ny"+string(i) + end + tete2=tete2+")" + + tete3=[" double *t,xd[],x[],z[],tvec[];";.. + " int *flag,*nevprt,*nx,*nz,*ntvec,*nrpar,ipar[],*nipar"+decl+";"] + + + tete4= " double rpar[]" + for i=1:ni + tete4=tete4+",u"+string(i)+"[]" + end + for i=1:no + tete4=tete4+",y"+string(i)+"[]" + end + tetev=[" ";" "] + + textmp=[tete1;tete2;tetev;tete3;tete4+";"; + "/* modify below this line */"; + "{" + "}" + tetev]; + else + textmp=tt; + end + + while 1==1 + [txt]=x_dialog(["Function definition in C"; + "Here is a skeleton of the functions which you should edit"],.. + textmp); + + if txt<>[] then + tt=txt + [ok]=scicos_block_link(funam,tt,"c") + if ok then + textmp=txt; + end + break; + else + ok=%f;break; + end + end + + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/CFORTR2.bin b/modules/scicos/macros/scicos_scicos/CFORTR2.bin new file mode 100755 index 000000000..63027bdb2 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/CFORTR2.bin differ diff --git a/modules/scicos/macros/scicos_scicos/CFORTR2.sci b/modules/scicos/macros/scicos_scicos/CFORTR2.sci new file mode 100755 index 000000000..59cf905c5 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/CFORTR2.sci @@ -0,0 +1,164 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [ok,tt,cancel]=CFORTR2(funam,tt) + + // + cancel=%f + + if tt==[] then + + textmp=[ + "#include "; + "#include "; + "#include "; + "void "+funam+"(scicos_block *block,int flag)"; + ]; + ttext=[]; + textmp($+1)="{" + textmp=[textmp; + " /* "; + " int block->nevprt;" + " int block->nz;" + " double* block->z;" + " int block->nx;" + " double* block->x;" + " double* block->xd;" + " double* block->res;" + " int block->nin;" + " int *block->insz;" + " double **block->inptr;" + " int block->nout;" + " int *block->outsz;" + " double **block->outptr;" + " int block->nevout;" + " int block->nrpar;" + " double *block->rpar;" + " int block->nipar;" + " int *block->ipar;" + " int block->ng;" + " double *block->g;" + " int *block->jroot;" + " char block->label[41];" + " */"] + + textmp($+1)=" if (flag == 4) { /* initialization */" + textmp($+1)=" "+funam+"_bloc_init(block,flag);" + ttext=[ttext;"int "+funam+"_bloc_init(scicos_block *block,int flag)"; + "{"; + "return 0;}"]; + textmp($+1)=" " + if nout<>0 then + textmp($+1)=" } else if(flag == 1) { /* output computation*/" + textmp($+1)=" set_block_error("+funam+"_bloc_outputs(block,flag));" + ttext=[ttext;"int "+funam+"_bloc_outputs(scicos_block *block,int flag)"; + "{"; + "return 0;}"]; + end + + if nx<>0 then + textmp($+1)=" } else if(flag == 0) { /* derivative or residual computation*/", + textmp($+1)=" set_block_error("+funam+"_bloc_deriv(block,flag));" + ttext=[ttext;"int "+funam+"_bloc_deriv(scicos_block *block,int flag)"; + "{"; + "return 0;}"]; + end + + if ng <>0 then + textmp($+1)=" } else if(flag == 9) {/* zero crossing surface and mode computation*/", + textmp($+1)=" set_block_error("+funam+"_bloc_zcross(block,flag));"; + ttext=[ttext;"int "+funam+"_bloc_zcross(scicos_block *block,int flag)"; + "{"; + "return 0;}"]; + end + + if nz<>0 then + textmp($+1)=" } else if(flag == 2) { /* computation of next discrte state*/ ", + textmp($+1)=" set_block_error("+funam+"_bloc_states(block,flag));"; + ttext=[ttext;"int "+funam+"_bloc_states(scicos_block *block,int flag)"; + "{"; + "return 0;}"]; + elseif min(nx,ng+nevin)>0 then + textmp($+1)=" } else if(flag == 2) { /* computation of jumped state*/ ", + textmp($+1)=" set_block_error("+funam+"_bloc_states(block,flag));"; + ttext=[ttext;"int "+funam+"_bloc_states(scicos_block *block,int flag)"; + "{"; + "return 0;}"]; + end + + if nevout<>0 then + textmp($+1)=" } else if(flag == 3) { /* computation of output event times*/", + textmp($+1)=" set_block_error("+funam+"_bloc_evtout(block,flag));"; + ttext=[ttext;"int "+funam+"_bloc_evtout(scicos_block *block,int flag)"; + "{"; + "return 0;}"]; + end + textmp($+1)=" } else if (flag == 5) { /* ending */" + textmp($+1)=" set_block_error("+funam+"_bloc_ending(block,flag));"; + ttext=[ttext;"int "+funam+"_bloc_ending(scicos_block *block,int flag)"; + "{"; + "return 0;}"]; + textmp($+1)=" }" + textmp($+1)="}" + textmp=[textmp;" "; ttext]; + else + textmp=tt; + end + + tt = textmp + ok = %t + //## set param of scstxtedit + ptxtedit=scicos_txtedit(clos = 0,... + typ = "Cfunc",... + head = ["Function definition in C"; + "Here is a skeleton of the functions which"; + " you should edit."]); + + while 1==1 + + [txt,Quit] = scstxtedit(textmp,ptxtedit); + + if ptxtedit.clos==1 then + break; + end + + if txt<>[] then + [libss,ok,cancel]=get_dynamic_lib_dir(txt,funam,"c") + + if ~cancel & ok then + [ok]=scicos_block_link(funam,txt,"c",libss) + if ok then + ptxtedit.clos=1 + tt=txt + ok = %t; + end + textmp=txt; + end + end + + if Quit==1 then + ok = %f; + cancel =%t; + break; + end + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/Compute_cic.bin b/modules/scicos/macros/scicos_scicos/Compute_cic.bin new file mode 100755 index 000000000..a4275fc29 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/Compute_cic.bin differ diff --git a/modules/scicos/macros/scicos_scicos/Compute_cic.sci b/modules/scicos/macros/scicos_scicos/Compute_cic.sci new file mode 100755 index 000000000..7ff47fd02 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/Compute_cic.sci @@ -0,0 +1,257 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function ok=Compute_cic(method,Nunknowns) + global icpr + ok=%f + + if icpr==list() then + return + end + + tolerances=scs_m.props.tol + solver=tolerances(6) + if (and (solver <> [100 101 102])) then solver=100; end + tolerances(6)=solver + Atol=tolerances(1) + Rtol=tolerances(2) + %tcur=0; + tf=tolerances(3) + state=icpr.state; + nx=size(state.x,"r"); + nx2=round(nx/2); + nxModelica=evstr(Nunknowns); + + if nxModelica~=nx2 then + messagebox(msprintf(_("Your model contains states defined in standard Scicos blocks.\n"+.. + "Current initialization interface does not support mixed models.")),"error","modal"); + return + end + + //------------------------------ + ierr=0; + try + ierr=execstr("[state,t]=scicosim(state,%tcur,tf,icpr.sim,''start'',tolerances)","errcatch") + if ierr<>0 then + messagebox(msprintf(_("Initialisation problem in %s "),"Scicosim-start"),"error","modal"); + return + end + catch + messagebox(msprintf(_("Initialisation problem in %s "),"Scicosim-start"),"error","modal"); + return + end + //-------------------------------------------------------------- + Ida_ierr=0; + if method=="Ida (init)" then + try + // scicos menu, not any more in xcos + // setmenu(curwin,'stop') + Ida_ierr=execstr("[state,t]=scicosim(state,%tcur,tf,icpr.sim,''run'',tolerances)","errcatch") + // unsetmenu(curwin,'stop') + if Ida_ierr<>0 then, + messagebox(msprintf(_("Initialisation problem in %s "),"Sundials"),"error","modal"); + end + catch + messagebox(msprintf(_("Initialisation problem in %s "),"Sundials"),"error","modal"); + end + end + //-------------------------------------------------------------- + if method=="Kinsol" then + try + // scicos menu, not any more in xcos + // setmenu(curwin,'stop') + ierr=execstr("[state2,t]=scicosim(state,%tcur,tf,icpr.sim,''Kinsol'',tolerances)","errcatch") + if ierr==0 & (or(isnan(state2.x)) | or(isinf(state2.x))) then + ierr=-1; + end + if ierr==0 then + state=state2; + end + // unsetmenu(curwin,'stop') + if ierr<>0 then, + messagebox(msprintf(_("Initialisation problem in %s "),"Kinsol"),"error","modal"); + end + catch + messagebox(msprintf(_("Initialisation problem in %s "),"Kinsol"),"error","modal"); + end + end + //-------------------------------------------------------------- + if method=="Fsolve" then + try + x0=state.x(1:nx2); + [xres]=fsolve(x0,fsim); + ierr=0 + if or(isnan(xres)) | or(isinf(xres)) then + ierr=-1; + end + if ierr==0 then + for i=1:nx2, state.x(i)=xres(i);end + fsim(xres);// just to perform an idoit to update outputs in mixed_models + end + catch + messagebox(msprintf(_("Initialisation problem in %s "),"Fsolve"), "error","modal"); + end + end + //-------------------------------------------------------------- + if method=="Optim" then + try + x0=state.x(1:nx2); + [f,xres]=optim(fsumsquare,x0); + ierr=0 + if or(isnan(xres)) | or(isinf(xres)) then + ierr=-1; + end + if ierr==0 then + for i=1:nx2, state.x(i)=xres(i);end + fsim(xres);// just to perform an idoit to update outputs in mixed_models + end + catch + messagebox(msprintf(_("Initialisation problem in the %s method"),"Optim"), "error","modal"); + end + end + //-------------------------------------------------------------- + if method=="Nelder_Mead" then + try + x0=state.x(1:nx2); + [xmin,fmin,epsilo,ls,fs] = neldermead(rand(nx2,nx2+1),Atol,1,0.5,1.5) + + for i=1:nx2, state.x(i)=xmin(i);end + catch + messagebox(msprintf(_("Initialisation problem in the %s method")," Nelder_Mead"), "error","modal"); + end + end + //-------------------------------------------------------------- + if method=="Hompack77" then + try + ierr=execstr("[state,t]=scicosim(state,%tcur,tf,icpr.sim,''hompack77'',tolerances)","errcatch") + if ierr<>0 then, + messagebox(msprintf(_("Initialisation problem in the %s method"),"hompack77"), "error","modal"); + end + catch + messagebox(msprintf(_("Initialisation problem in the %s method"),"hompack77"), "error","modal"); + end + + end + //-------------------------------------------------------------- + if method=="Fsolve_Stepping" then + x0=state.x(1:nx2); + Res0=fsim(x0); + Lambda=0; + Steps=1000; + xres=x0; + for i=1:Steps + Lambda=i/Steps; + [xres]=fsolve(xres,fsim_step); + if modulo(i,10)==0 then, + disp("Source-stepping: progress="+string(i/Steps*100)+"%, Error="+string(norm(fsim_step(xres)))); + end + end + for i=1:nx2, state.x(i)=xres(i);end + end + //-------------------------------------------------------------- + if method=="Sundials_Stepping" then + end + //-------------------------------------------------------------- + Err="?" + if Ida_ierr==0 & ierr==0 then + ss=fsim(state.x(1:nx2));if ss~=[] then Err=string(max(abs(ss)));else Err="0";end//using inf norm + end + + try + if Ida_ierr==0 then //cossimdaskr is followed by a cosend in case of error + ierr=execstr("[state,t]=scicosim(state,%tcur,tf,icpr.sim,''finish'',tolerances)","errcatch") + if ierr<>0 then + messagebox(_("Initialisation problem in the finish phase"), "error","modal"); + return + end + end + catch + messagebox(_("Initialisation problem in the finish phase"), "error","modal"); + return + end + ok=%t; +endfunction + +//------------------------------------------------------------ +function res=fsim(xin) + nx=size(xin,"r"); + if nx==0 then res=[];return ;end + state1=state + for i=1:nx, state1.x(i)=xin(i);end + ierr=execstr("[state2,t]=scicosim(state1,%tcur,tf,icpr.sim,''linear'',tolerances)","errcatch") + res=state2.x(1:nx); +endfunction + +function res=fsim_step(xin) + res=fsim(xin)-(1-Lambda)*Res0; +endfunction + + +function [sumsq,grad,ind]=fsumsquare(xin,ind) + nx=size(xin,"r"); + tolerances=scs_m.props.tol; + atol=tolerances(1); + rtol=tolerances(2); + + grad=[] + if ind==2 | ind==4 | ind==3 then + res=fsim(xin); + sumsq=0; for i=1:nx,sumsq=sumsq+res(i)*res(i);end + end + + if ind==3 | ind==4 then + for j=1:nx + xin_p=xin; + ewt_j=1/(abs(xin_p(j)*rtol+atol+%eps)); + delta_j=max(abs(xin_p(j))*%eps,1/ewt_j); + xin_p(j)=xin_p(j)+delta_j; + res_p=fsim(xin_p); + sumsq_p=0; for i=1:nx,sumsq_p=sumsq_p+(res_p(i)^2-res(i)^2)/delta_j;end + grad(j)=sumsq_p; + end + end + +endfunction + + +function [xmin,fmin,epsilo,ls,fs] = neldermead(s,epsil,alpha,beta,gama) + // saved in the last versions +endfunction + + +function y=fsim2(x) + x0=x(1);x1=x(2);x2=x(3);x3=x(4); + x4=x(5);x5=x(6);x6=x(7);x7=x(8); + + v0 = -x3; + v1 = -x2; + + y(1) = x4+v0; + y(2) = x6+v1; + y(3) = x7-x6; + y(4) = x5-x4; + y(5) = 1e-14-x3*x2; + y(6) = v0+x2; + y(7) = v0+abs(x1); + y(8) = v1+abs(x0); + + disp(y'); +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/FORTR.bin b/modules/scicos/macros/scicos_scicos/FORTR.bin new file mode 100755 index 000000000..39ad31053 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/FORTR.bin differ diff --git a/modules/scicos/macros/scicos_scicos/FORTR.sci b/modules/scicos/macros/scicos_scicos/FORTR.sci new file mode 100755 index 000000000..7303b695d --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/FORTR.sci @@ -0,0 +1,75 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [ok,tt]=FORTR(funam,tt,inp,out) + // + ni=size(inp,"*") + no=size(out,"*") + if tt==[] then + + tete1=[" subroutine "+funam+"(flag,nevprt,t,xd,x,nx,z,nz,tvec,";.. + " $ ntvec,rpar,nrpar,ipar,nipar"] + + tete2= " $ " + for i=1:ni + tete2=tete2+",u"+string(i)+",nu"+string(i) + end + for i=1:no + tete2=tete2+",y"+string(i)+",ny"+string(i) + end + tete2=tete2+")" + + tete3=[" double precision t,xd(*),x(*),z(*),tvec(*)";.. + " integer flag,nevprt,nx,nz,ntvec,nrpar,ipar(*)"] + + tete4= " double precision rpar(*)" + for i=1:ni + tete4=tete4+",u"+string(i)+"(*)" + end + for i=1:no + tete4=tete4+",y"+string(i)+"(*)" + end + tetec=["c";"c"];tetev=[" ";" "]; + tetend=" end" + + textmp=[tete1;tete2;tetec;tete3;tete4;tetec;tetev;tetec;tetend]; + else + textmp=tt; + end + + while 1==1 + [txt]=x_dialog(["Function definition in fortran"; + "Here is a skeleton of the functions which you should edit"],.. + textmp); + + if txt<>[] then + tt=txt + [ok]=scicos_block_link(funam,tt,"f") + if ok then + textmp=txt; + end + break; + else + ok=%f;break; + end + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/Link_modelica_C.bin b/modules/scicos/macros/scicos_scicos/Link_modelica_C.bin new file mode 100755 index 000000000..cc50d1845 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/Link_modelica_C.bin differ diff --git a/modules/scicos/macros/scicos_scicos/Link_modelica_C.sci b/modules/scicos/macros/scicos_scicos/Link_modelica_C.sci new file mode 100755 index 000000000..64deb6152 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/Link_modelica_C.sci @@ -0,0 +1,75 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// Copyright (C) DIGITEO - 2010 - Allan CORNET +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +// ----------------------------------------------------------------------------- +function ok = Link_modelica_C(Cfile) + mlibs = pathconvert(modelica_libs, %t, %t); + Cfile = pathconvert(Cfile, %f, %t) + name = basename(Cfile); + path = fileparts(Cfile, "path"); + + // build the list of external functions libraries + // remove repreated directories from mlibs + rep = []; + for k = 1:size(mlibs, "*") + for j = k + 1:size(mlibs, "*") + if stripblanks(mlibs(k)) == stripblanks(mlibs(j)) then + rep = [rep, j]; + end + end + end + mlibs(rep) = []; + + // add dynamic libraries in same directory that .mo + // compatibility feature with 4.x.x + libs = []; + ext = getdynlibext(); + for k = 1:size(mlibs, "*") + fileSearched = findfiles(mlibs(k), "*" + ext); + for j = 1:size(fileSearched, "*") + [pathx, fnamex, extensionx] = fileparts(fileSearched(j)); + libsname = fullfile(pathx, fnamex); + if getos() == "Windows" then + libsname = strsubst(libsname, "\", "/"); + end + libs = [libs; libsname]; + end + end + + // add modelica_libs to the list of directories to be searched for *.h + IncludePaths = ""; + extToSearch = ".h"; + + for k = 1:size(mlibs, "*") + pathSearch = mlibs(k); + pathSearch = strsubst(pathSearch, "\", "/"); + filesFounded = findfiles(pathSearch, "*" + ext); + if filesFounded <> [] then + IncludePaths = IncludePaths + " -I""" + pathSearch + """"; + end + end + + //** build shared library with the C code + files = name; + ok = buildnewblock(name, files, "", "", libs, TMPDIR, "", IncludePaths); + +endfunction +// ----------------------------------------------------------------------------- diff --git a/modules/scicos/macros/scicos_scicos/MODCOM.bin b/modules/scicos/macros/scicos_scicos/MODCOM.bin new file mode 100755 index 000000000..0a779970f Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/MODCOM.bin differ diff --git a/modules/scicos/macros/scicos_scicos/MODCOM.sci b/modules/scicos/macros/scicos_scicos/MODCOM.sci new file mode 100755 index 000000000..3263dd10d --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/MODCOM.sci @@ -0,0 +1,211 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [ok,tt]=MODCOM(funam,tt,vinp,vout,vparam,vparamv,vpprop) + // + [dirF,nameF,extF]=fileparts(funam); + + //the new head + class_txt_new=build_classhead(funam,vinp,vout,vparam,vparamv,vpprop) + + if (tt==[]) then + tete4= ["";" // Real x(start=1), y(start=2);"] + tete5="equation"; + + tete6=[" // exemple"]; + tete7=" //der(x)=x-x*y;"; + tete8=" //der(y)+2*y=x*y;"; + tete9="end "+nameF+";"; + textmp=[class_txt_new;tete4;tete5;tete6;tete7;tete8;tete9]; + else + modif=%f; + for i=1:size(tt,"*") + if strindex(stripblanks(tt(i)),... + "////do not modif above this line ////")<>[] then + //Alan, 07/10/07 + //tt(1:i-1) : the current head + textmp=[class_txt_new;tt(i+1:$)] + modif=%t + break + end + end + if ~modif then textmp=tt, end; + end + + editblk=%f + //## set param of scstxtedit + ptxtedit = scicos_txtedit(clos = 0,... + typ = "ModelicaClass",... + head = ["Function definition in Modelica"; + "Here is a skeleton of the functions"+... + " which you should edit"]) + + while %t + + if (extF=="" | (extF==".mo" & fileinfo(funam)==[])) then + editblk=%t; + [txt,Quit] = scstxtedit(textmp,ptxtedit); + elseif (extF==".mo" & fileinfo(funam)<>[]) then + txt=tt; + end + + + if ptxtedit.clos==1 then + break; + end + + if txt<>[] then + //## TODO : compilation + //## printf("Compil !!"); + ok=%t; + + //** saving in the filename + if ok then + tarpath=pathconvert(TMPDIR+"/Modelica/",%f,%t); + + if (extF=="") then + funam=tarpath+nameF+".mo"; + mputl(txt,funam); + elseif fileinfo(funam)==[] then + mputl(txt,funam); + end + ptxtedit.clos = 1; + tt = txt; + end + textmp = txt; + end + + if editblk then + if Quit==1 then + ok=%f; + break; + end + elseif txt==[] then + ok=%f; // cancel bouton + break + end + end +endfunction + +//build_classhead : build the head of the modelica function +function class_txt=build_classhead(funam,vinp,vout,vparam,vparamv,vpprop) + + [dirF,nameF,extF]=fileparts(funam); + + ni=size(vinp,"r"); //** number of inputs + no=size(vout,"r"); //** number of outputs + np=size(vparam,"r"); //** number of params + + tete1=["class "+nameF] + + //** parameters head + if np<>0 then + tete1b= " //parameters"; + for i=1:np + //** param + if vpprop(i)==0 then + head=" parameter Real " + if size(vparamv(i),"*")==1 then + head=head+msprintf("%s = %e;", vparam(i), vparamv(i)); + else + head=head+vparam(i)+"["+string(size(vparamv(i),"*"))+"]={"; + for j=1:size(vparamv(i),"*") + head=head+msprintf("%e", vparamv(i)(j)); + if j<>size(vparamv(i),"*") then + head=head+"," + end + end + head=head+"};" + end + //** state + elseif vpprop(i)==1 then + head=" Real " + if size(vparamv(i),"*")==1 then + head=head+msprintf("%s (start=%e);", vparam(i), vparamv(i)); + else + head=head+vparam(i)+"["+string(size(vparamv(i),"*"))+"](start={"; + for j=1:size(vparamv(i),"*") + head=head+msprintf("%e", vparamv(i)(j)); + if j<>size(vparamv(i),"*") then + head=head+"," + end + end + head=head+"});" + end + //** fixed state + elseif vpprop(i)==2 then + head=" Real " + if size(vparamv(i),"*")==1 then + head=head+msprintf("%s (fixed=true,start=%e);", vparam(i), vparamv(i)); + else + head=head+vparam(i)+"["+string(size(vparamv(i),"*"))+"](start={"; + P_fix="fixed={" + for j=1:size(vparamv(i),"*") + head=head+msprintf("%e", vparamv(i)(j)); + P_fix=P_fix+"true" + if j<>size(vparamv(i),"*") then + head=head+"," + P_fix=P_fix+"," + end + end + head=head+"},"+P_fix+"});" + end + end + tete1b=[tete1b + head] + end + else + tete1b=[]; + end + + //** inputs head + if ni<>0 then + tete2= " Real "; + for i=1:ni + tete2=tete2+vinp(i); + if (i==ni) then tete2=tete2+";";else tete2=tete2+",";end + end + tete2=[" //input variables"; + tete2]; + else + tete2=[]; + end + + //** outputs head + if no<>0 then + tete3= " Real " + for i=1:no + tete3=tete3+vout(i); + if (i==no) then tete3=tete3+";";else tete3=tete3+",";end + end + tete3=[" //output variables"; + tete3]; + else + tete3=[]; + end + + tete4=" ////do not modif above this line ////" + //----------------------------------------- + + class_txt=[tete1; + " ////automatically generated ////"; + tete1b;tete2;tete3;tete4] +endfunction diff --git a/modules/scicos/macros/scicos_scicos/Sinks.cosf b/modules/scicos/macros/scicos_scicos/Sinks.cosf new file mode 100755 index 000000000..0b96104ab --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/Sinks.cosf @@ -0,0 +1,837 @@ +scs_m=scicos_diagram(.. + version="scicos4.2",.. + props=scicos_params(.. + wpar=[600,450,0,0,600,450],.. + Title=["Sinks","SCI/modules/scicos/macros/scicos_scicos/"],.. + tol=[0.0001,0.000001,1.000E-10,100001,0,0],.. + tf=100000,.. + context=[],.. + void1=[],.. + options=tlist(["scsopt","3D","Background","Link","ID","Cmap"],list(%t,33),[8,1],[1,5],.. + list([5,1],[4,1]),[0.8,0.8,0.8]),.. + void2=[],.. + void3=[],.. + doc=list())) +scs_m.objs(1)=scicos_block(.. + gui="AFFICH_m",.. + graphics=scicos_graphics(.. + orig=[0,0],.. + sz=[60,40],.. + flip=%t,.. + theta=0,.. + exprs=["[1,1]";"1";"1";"1";"5";"1";"0"],.. + pin=0,.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["fnt=xget(''font'')"; + "xset(''font'',ipar(1),ipar(2))"; + "str='' ''+part(''0'',ones(1,ipar(5)-ipar(6)-2))+''.''+part(''0'',ones(1,ipar(6)))"; + "str(1:model.in*model.in2)=str"; + "str=matrix(str,model.in,model.in2)"; + "rr=xstringl(orig(1),orig(2),str)"; + "xstring(orig(1)+max(0,(sz(1)-rr(3))/2),orig(2)+max(0,(sz(2)-rr(4))/2),str)"; + "xset(''font'',fnt(1),fnt(2))"],8),.. + id="",.. + in_implicit="E",.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("affich2",4),.. + in=1,.. + in2=1,.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[-1;0;0;1;1;0;0],.. + odstate=list(),.. + rpar=[],.. + ipar=[1;1;1;1000;5;1;1],.. + opar=list(),.. + blocktype="c",.. + firing=[],.. + dep_ut=[%t,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(2)=scicos_block(.. + gui="CMSCOPE",.. + graphics=scicos_graphics(.. + orig=[90,0],.. + sz=[40,40],.. + flip=%t,.. + theta=0,.. + exprs=["1 1";"1 3 5 7 9 11 13 15";"-1";"[]";"[]";"-1 -5";"1 5";"30 30";"20";"0";""],.. + pin=[0;0],.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list("xstringb(orig(1),orig(2),''MScope'',sz(1),sz(2),''fill'')",8),.. + id="",.. + in_implicit=["E";"E"],.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("cmscope",4),.. + in=[1;1],.. + in2=[1;1],.. + intyp=[1;1],.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[0;30;30;-1;1;-5;5],.. + ipar=[-1;2;20;-1;-1;-1;-1;1;1;1;3],.. + opar=list(),.. + blocktype="c",.. + firing=[],.. + dep_ut=[%t,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(3)=scicos_block(.. + gui="CSCOPXY",.. + graphics=scicos_graphics(.. + orig=[160,0],.. + sz=[40,40],.. + flip=%t,.. + theta=0,.. + exprs=["1";"4";"1";"-1";"[]";"[600;400]";"-15";"15";"-15";"15";"2"],.. + pin=[0;0],.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["thick=xget(''thickness'');xset(''thickness'',2);"; + "t=(0:0.2:2*%pi)'';"; + "xx=orig(1)+(1/5+(cos(3*t)+1)*3/10)*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t+1)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick)"],8),.. + id="",.. + in_implicit=["E";"E"],.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("cscopxy",4),.. + in=[1;1],.. + in2=[1;1],.. + intyp=[1;1],.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[-15;15;-15;15],.. + ipar=[-1;1;2;4;1;1;-1;-1;600;400;1],.. + opar=list(),.. + blocktype="d",.. + firing=[],.. + dep_ut=[%f,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(4)=scicos_block(.. + gui="WRITEC_f",.. + graphics=scicos_graphics(.. + orig=[230,0],.. + sz=[60,40],.. + flip=%t,.. + theta=0,.. + exprs=["1";"foo";"c ";"2";"0"],.. + pin=0,.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["txt=[''write to'';''C binary file''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"],8),.. + id="",.. + in_implicit="E",.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("writec",2),.. + in=1,.. + in2=[],.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[-1;0;0;0;0;0],.. + odstate=list(),.. + rpar=[],.. + ipar=[3;12;40;40;2;0;15;24;24],.. + opar=list(),.. + blocktype="d",.. + firing=[],.. + dep_ut=[%t,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(5)=scicos_block(.. + gui="CANIMXY",.. + graphics=scicos_graphics(.. + orig=[320,0],.. + sz=[40,40],.. + flip=%t,.. + theta=0,.. + exprs=["1";"-4";"1";"-1";"[]";"[]";"-15";"15";"-15";"15";"2"],.. + pin=[0;0],.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["thick=xget(''thickness'');xset(''thickness'',2);"; + "t=(0:0.3:2*%pi)'';"; + "xx=orig(1)+(1/5+(cos(2.2*t)+1)*3/10)*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick);"],8),.. + id="",.. + in_implicit=["E";"E"],.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("canimxy",4),.. + in=[1;1],.. + in2=[1;1],.. + intyp=[1;1],.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[-15;15;-15;15],.. + ipar=[-1;1;2;-4;1;0;-1;-1;-1;-1;1],.. + opar=list(),.. + blocktype="d",.. + firing=[],.. + dep_ut=[%f,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(6)=scicos_block(.. + gui="CSCOPE",.. + graphics=scicos_graphics(.. + orig=[390,0],.. + sz=[40,40],.. + flip=%t,.. + theta=0,.. + exprs=["1 3 5 7 9 11 13 15";"-1";"[]";"[600;400]";"-15";"15";"30";"20";"0";""],.. + pin=0,.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["thick=xget(''thickness'');xset(''thickness'',2);"; + "xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);"; + "xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;"; + "orig(1)+(1-1/4)*sz(1),orig(1)+sz(1)/5];"; + "yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;"; + "orig(2)+sz(2)/5,orig(2)+(1-1/3)*sz(2)];"; + "xarrows(xx,yy);"; + "t=(0:0.3:2*%pi)'';"; + "xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick)"],8),.. + id="",.. + in_implicit="E",.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("cscope",4),.. + in=-1,.. + in2=1,.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[0;-15;15;30],.. + ipar=[-1;1;20;1;3;5;7;9;11;13;15;-1;-1;600;400],.. + opar=list(),.. + blocktype="c",.. + firing=[],.. + dep_ut=[%t,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(7)=scicos_block(.. + gui="OUTIMPL_f",.. + graphics=scicos_graphics(.. + orig=[0,70],.. + sz=[20,20],.. + flip=%t,.. + theta=0,.. + exprs="1",.. + pin=0,.. + pout=[],.. + pein=[],.. + peout=[],.. + gr_i=list("prt=string(model.ipar);xstringb(orig(1),orig(2),prt,sz(1),sz(2))",8),.. + id="",.. + in_implicit="I",.. + out_implicit=[]),.. + model=scicos_model(.. + sim="outimpl",.. + in=-1,.. + in2=1,.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=[],.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[],.. + ipar=1,.. + opar=list(),.. + blocktype="c",.. + firing=[],.. + dep_ut=[%f,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=tlist(["modelica","model","inputs","outputs","parameters"],"PORT","n",[],.. + list([],list()))),.. + doc=list()) +scs_m.objs(8)=scicos_block(.. + gui="CLKOUTV_f",.. + graphics=scicos_graphics(.. + orig=[50,70],.. + sz=[20,30],.. + flip=%t,.. + theta=0,.. + exprs="1",.. + pin=[],.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(" ",8),.. + id="",.. + in_implicit=[],.. + out_implicit=[]),.. + model=scicos_model(.. + sim="output",.. + in=[],.. + in2=[],.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[],.. + ipar=1,.. + opar=list(),.. + blocktype="d",.. + firing=[],.. + dep_ut=[%f,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(9)=scicos_block(.. + gui="CEVENTSCOPE",.. + graphics=scicos_graphics(.. + orig=[100,70],.. + sz=[40,40],.. + flip=%t,.. + theta=0,.. + exprs=["1";"1";"-1";"[]";"[600;400]";"30"],.. + pin=[],.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["thick=xget(''thickness'');xset(''thickness'',2);"; + "xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);"; + "xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;"; + "orig(1)+(1-1/5)*sz(1),orig(1)+sz(1)/5];"; + "yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;"; + "orig(2)+sz(2)/5,orig(2)+(1-1/5)*sz(2)];"; + "xarrows(xx,yy);"; + "t=(0:0.3:2*%pi)'';"; + "xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick);"],8),.. + id="",.. + in_implicit=[],.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("cevscpe",4),.. + in=[],.. + in2=[],.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=30,.. + ipar=[-1;1;1;-1;-1;600;400],.. + opar=list(),.. + blocktype="d",.. + firing=[],.. + dep_ut=[%f,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(10)=scicos_block(.. + gui="OUT_f",.. + graphics=scicos_graphics(.. + orig=[170,70],.. + sz=[20,20],.. + flip=%t,.. + theta=0,.. + exprs="1",.. + pin=0,.. + pout=[],.. + pein=[],.. + peout=[],.. + gr_i=list(" ",8),.. + id="",.. + in_implicit="E",.. + out_implicit=[]),.. + model=scicos_model(.. + sim="output",.. + in=-1,.. + in2=-2,.. + intyp=-1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=[],.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[],.. + ipar=1,.. + opar=list(),.. + blocktype="c",.. + firing=[],.. + dep_ut=[%f,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(11)=scicos_block(.. + gui="WFILE_f",.. + graphics=scicos_graphics(.. + orig=[220,70],.. + sz=[60,40],.. + flip=%t,.. + theta=0,.. + exprs=["1";"foo";"(7(e10.3,1x))";"2"],.. + pin=0,.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["txt=[''write to'';''output file''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"],8),.. + id="",.. + in_implicit="E",.. + out_implicit=[]),.. + model=scicos_model(.. + sim="writef",.. + in=1,.. + in2=[],.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[-1;0;0;0;0;0],.. + odstate=list(),.. + rpar=[],.. + ipar=[3;13;0;2;15;24;24;41;7;41;14;1;0;51;3;52;1;33;42;42],.. + opar=list(),.. + blocktype="d",.. + firing=[],.. + dep_ut=[%t,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(12)=scicos_block(.. + gui="CFSCOPE",.. + graphics=scicos_graphics(.. + orig=[310,70],.. + sz=[40,40],.. + flip=%t,.. + theta=0,.. + exprs=["1 3 5 7 9 11 13 15";"-1";"[]";"[600;400]";"-15";"15";"30";"2";"1"],.. + pin=[],.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["thick=xget(''thickness'');xset(''thickness'',2);"; + "xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);"; + "xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;"; + "orig(1)+(1-1/4)*sz(1),orig(1)+sz(1)/5];"; + "yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;"; + "orig(2)+sz(2)/5,orig(2)+(1-1/3)*sz(2)];"; + "xarrows(xx,yy);"; + "t=(0:0.3:2*%pi)'';"; + "xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick)"],8),.. + id="",.. + in_implicit=[],.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("cfscope",4),.. + in=[],.. + in2=[],.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[0;-15;15;30],.. + ipar=[-1;1;2;1;3;5;7;9;11;13;15;-1;-1;600;400;1;1],.. + opar=list(),.. + blocktype="c",.. + firing=[],.. + dep_ut=[%t,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(13)=scicos_block(.. + gui="WRITEAU_f",.. + graphics=scicos_graphics(.. + orig=[380,70],.. + sz=[60,40],.. + flip=%t,.. + theta=0,.. + exprs=["2";"0"],.. + pin=0,.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["txt=[''write AU to'';''/dev/audio''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"],8),.. + id="",.. + in_implicit="E",.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("writeau",2),.. + in=1,.. + in2=[],.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[-1;0;0;0;0;0],.. + odstate=list(),.. + rpar=[],.. + ipar=[10;30;12;40;2;0;48;13;14;31;48;10;30;13;18;24],.. + opar=list(),.. + blocktype="d",.. + firing=[],.. + dep_ut=[%t,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(14)=scicos_block(.. + gui="CSCOPXY3D",.. + graphics=scicos_graphics(.. + orig=[0,140],.. + sz=[40,40],.. + flip=%t,.. + theta=0,.. + exprs=["1"; + "1 2 3 4 5 6 7 13"; + "1 1 1 1 1 1 1 1"; + "-1"; + "[]"; + "[600;400]"; + "-15 15"; + "-15 15"; + "-15 15"; + "50 280"; + "2"],.. + pin=[0;0;0],.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["thick=xget(''thickness'');xset(''thickness'',2);"; + "t=(0:0.2:2*%pi)'';"; + "xx=orig(1)+(1/5+(cos(3*t)+1)*3/10)*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t+1)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick)"],8),.. + id="",.. + in_implicit=["E";"E";"E"],.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("cscopxy3d",4),.. + in=[1;1;1],.. + in2=[1;1;1],.. + intyp=[1;1;1],.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[-15;15;-15;15;-15;15;50;280],.. + ipar=[-1;8;2;1;2;3;4;5;6;7;13;1;1;1;1;1;1;1;1;8;-1;-1;600;400;1],.. + opar=list(),.. + blocktype="d",.. + firing=[],.. + dep_ut=[%f,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(15)=scicos_block(.. + gui="CANIMXY3D",.. + graphics=scicos_graphics(.. + orig=[70,140],.. + sz=[40,40],.. + flip=%t,.. + theta=0,.. + exprs=["1"; + "1 2 3 4 5 6 7 13"; + "1 1 1 1 1 1 1 1"; + "-1"; + "[]"; + "[]"; + "-15 15"; + "-15 15"; + "-15 15"; + "50 280"; + "2"],.. + pin=[0;0;0],.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["thick=xget(''thickness'');xset(''thickness'',2);"; + "t=(0:0.3:2*%pi)'';"; + "xx=orig(1)+(1/5+(cos(2.2*t)+1)*3/10)*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick);"],8),.. + id="",.. + in_implicit=["E";"E";"E"],.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("canimxy3d",4),.. + in=[1;1;1],.. + in2=[1;1;1],.. + intyp=[1;1;1],.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[-15;15;-15;15;-15;15;50;280],.. + ipar=[-1;8;2;1;2;3;4;5;6;7;13;1;1;1;1;1;1;1;1;8;-1;-1;-1;-1;1],.. + opar=list(),.. + blocktype="d",.. + firing=[],.. + dep_ut=[%f,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(16)=scicos_block(.. + gui="CMATVIEW",.. + graphics=scicos_graphics(.. + orig=[140,140],.. + sz=[40,40],.. + flip=%t,.. + theta=0,.. + exprs=["jetcolormap(25)";"0";"100"],.. + pin=0,.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list("xstringb(orig(1),orig(2),''Mat. View'',sz(1),sz(2),''fill'')",8),.. + id="",.. + in_implicit="E",.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("cmatview",4),.. + in=-1,.. + in2=-2,.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[0.24;1;0;0;0;0;0;0;0;0;0;0.02;0.18;0.34;0.5;0.66;0.82;0.98;1;1;1;1;1;1;0.9; + 0.74;0.58;0;0;0;0.06;0.22;0.38;0.54;0.7;0.86;1;1;1;1;1;1;1;0.86;0.7;0.54;0.38; + 0.22;0.06;0;0;0;0.58;0.74;0.9;1;1;1;1;1;1;0.98;0.82;0.66;0.5;0.34;0.18;0.02;0; + 0;0;0;0;0;0;0;0],.. + ipar=[0;100;25],.. + opar=list(),.. + blocktype="c",.. + firing=[],.. + dep_ut=[%t,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(17)=scicos_block(.. + gui="CMAT3D",.. + graphics=scicos_graphics(.. + orig=[210,140],.. + sz=[40,40],.. + flip=%t,.. + theta=0,.. + exprs=["-1";"-1";"jetcolormap(25)";"0";"100"],.. + pin=0,.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list("xstringb(orig(1),orig(2),''Mat. 3D'',sz(1),sz(2),''fill'')",8),.. + id="",.. + in_implicit="E",.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("cmat3d",4),.. + in=-1,.. + in2=-2,.. + intyp=1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[0;0;0;0;0;0;0;0;0;0.02;0.18;0.34;0.5;0.66;0.82;0.98;1;1;1;1;1;1;0.9;0.74;0.58; + 0;0;0;0.06;0.22;0.38;0.54;0.7;0.86;1;1;1;1;1;1;1;0.86;0.7;0.54;0.38;0.22;0.06; + 0;0;0;0.58;0.74;0.9;1;1;1;1;1;1;0.98;0.82;0.66;0.5;0.34;0.18;0.02;0;0;0;0;0;0; + 0;0;0;-1;-1],.. + ipar=[0;100;25;1;1],.. + opar=list(),.. + blocktype="c",.. + firing=[],.. + dep_ut=[%t,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) +scs_m.objs(18)=scicos_block(.. + gui="TOWS_c",.. + graphics=scicos_graphics(.. + orig=[280,140],.. + sz=[70,40],.. + flip=%t,.. + theta=0,.. + exprs=["128","A","0"],.. + pin=0,.. + pout=[],.. + pein=0,.. + peout=[],.. + gr_i=list(.. + ["txt=[''To workspace''];";"xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"],.. + 8),.. + id="A",.. + in_implicit="E",.. + out_implicit=[]),.. + model=scicos_model(.. + sim=list("tows_c",4),.. + in=-1,.. + in2=-2,.. + intyp=-1,.. + out=[],.. + out2=[],.. + outtyp=1,.. + evtin=1,.. + evtout=[],.. + state=[],.. + dstate=[],.. + odstate=list(),.. + rpar=[],.. + ipar=[128;1;-10],.. + opar=list(),.. + blocktype="d",.. + firing=[],.. + dep_ut=[%f,%f],.. + label="",.. + nzcross=0,.. + nmode=0,.. + equations=list()),.. + doc=list()) diff --git a/modules/scicos/macros/scicos_scicos/adjust.bin b/modules/scicos/macros/scicos_scicos/adjust.bin new file mode 100755 index 000000000..c8b998a2c Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/adjust.bin differ diff --git a/modules/scicos/macros/scicos_scicos/adjust.sci b/modules/scicos/macros/scicos_scicos/adjust.sci new file mode 100755 index 000000000..588ac5b9f --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/adjust.sci @@ -0,0 +1,465 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Alan Layec +// - Fady Nassif +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [ok,bllst]=adjust(bllst,inpptr,outptr,inplnk,outlnk) + // + //adjust : a piece of the adjust_inout function. + // Only one pass -see c_pass2.sci- + // + // + //in parameters : bllst : list of blocks + // inpptr : vector of regular input port number + // (of size nblk+1) + // outptr : vector of regular output port number + // (of size nblk+1) + // inplnk : vector of link number connected to regular input port + // (of size max(inpptr)-1) + // outlnk : vector of link number connected to regular output port + // (of size max(outptr)-1) + // + //out parameters : ok : a boolean flag to known if adjust_inout have + // succeeded to resolve the in/out port size + // - ok = %t : all size have been resolved in bllst + // - ok = %f : problem in size adjustement + // bllst : modified list of blocks + // + //18/05/06, Alan : improvement in order to take into + //account two dimensional ports size. + // + //28/12/06, Alan : type for source port and target port must + // be the same. + // + //04/01/07, Fady :Can test the case of negatives equals target's dimensions. + // + //10/05/07, Alan : - if-then-else event-select case + + + + //Adjust in2/out2, inttyp/outtyp + //in accordance to in/out in bllst + [ko,bllst]=adjust_in2out2(bllst); + if ~ko then ok=%f,return, end //if adjust_in2out2 failed then exit + //adjust_inout with flag ok=%f + // + [outoin,outoinptr]=connmat(inpptr,outptr,inplnk,outlnk) + for i=1:length(bllst) + if size(bllst(i).in,1)<>size(bllst(i).intyp,2) then + bllst(i).intyp=bllst(i).intyp(1)*ones(size(bllst(i).in,1),1); + end + if size(bllst(i).out,1)<>size(bllst(i).outtyp,2) then + bllst(i).outtyp=bllst(i).outtyp(1)*ones(size(bllst(i).out,1),1); + end + end + //loop on number of block + for hh=1:length(bllst) + ok=%t + for blkout=1:length(bllst) //second loop on number of block + for portout=1:outptr(blkout+1)-outptr(blkout) //loop on number of regular + //output port + jj=outptr(blkout)+portout-1 //get current number of output port + + if [outoinptr(jj):outoinptr(jj+1)-1]<>[] then + for kk=outoinptr(jj):outoinptr(jj+1)-1 //loop on + blkin=outoin(kk,1) // + portin=outoin(kk,2) // + + //nnin/nnout are the size (two dimensions) of the + //target port and the source port of the observed link + //before adjust + nnout(1,1)=bllst(blkout).out(portout) + nnout(1,2)=bllst(blkout).out2(portout) + nnin(1,1)=bllst(blkin).in(portin) + nnin(1,2)=bllst(blkin).in2(portin) + //intyp/outtyp are the type of the + //target port and the source port of the observed link + intyp=bllst(blkin).intyp(portin) + outtyp=bllst(blkout).outtyp(portout) + + //check intyp outtyp + if(intyp>0 & outtyp>0) then + if intyp<>outtyp then + if (intyp==1 & outtyp==2) then + bllst(blkin).intyp(portin)=2; + elseif (intyp==2 & outtyp==1) then + bllst(blkout).outtyp(portout)=2; + else + bad_connection(corinv(blkout),portout,.. + nnout,outtyp,.. + corinv(blkin),portin,.. + nnin,intyp,1) + ok=%f; + return + end + end + elseif(outtyp>0&intyp<0) then + ww=find(bllst(blkin).intyp==intyp) + bllst(blkin).intyp(ww)=outtyp + ww=find(bllst(blkin).outtyp==intyp) + bllst(blkin).outtyp(ww)=outtyp + elseif(outtyp<0&intyp>0) then + ww=find(bllst(blkout).outtyp==outtyp) + bllst(blkout).outtyp(ww)=intyp + ww=find(bllst(blkout).intyp==outtyp) + bllst(blkout).intyp(ww)=intyp + else + ok=%f + end + + //loop on the two dimensions of source/target port + for ndim=1:2 + //nin/nout are the size (two dimensions) of the + //target port and the source port of the observed link + nout(1,1)=bllst(blkout).out(portout) + nout(1,2)=bllst(blkout).out2(portout) + nin(1,1)=bllst(blkin).in(portin) + nin(1,2)=bllst(blkin).in2(portin) + + //first case : dimension of source and + // target ports are explicitly informed + // informed with positive size + if (nout(1,ndim)>0&nin(1,ndim)>0) then + //if dimension of source and target port doesn't match + //then call bad_connection, set flag ok to false and exit + if nin(1,ndim)<>nout(1,ndim) then + bad_connection(corinv(blkout),portout,.. + nnout,outtyp,.. + corinv(blkin),portin,nnin,intyp) + ok=%f;return + end + + //second case : dimension of source port is + // positive and dimension of + // target port is negative + elseif (nout(1,ndim)>0&nin(1,ndim)<0) then + //find vector of input ports of target block with + //first/second dimension equal to size nin(1,ndim) + //and assign it to nout(1,ndim) + ww=find(bllst(blkin).in==nin(1,ndim)) + if ww<>[] then + bllst(blkin).in(ww)=nout(1,ndim) + end + ww=find(bllst(blkin).in2==nin(1,ndim)) + if ww<>[] then + bllst(blkin).in2(ww)=nout(1,ndim) + end + //find vector of output ports of target block with + //first/second dimension equal to size nin(1,ndim) + //and assign it to nout(1,ndim) + ww=find(bllst(blkin).out==nin(1,ndim)) + if ww<>[] then + bllst(blkin).out(ww)=nout(1,ndim) + end + ww=find(bllst(blkin).out2==nin(1,ndim)) + if ww<>[] then + bllst(blkin).out2(ww)=nout(1,ndim) + end + + + //third case : dimension of source port is + // negative and dimension of + // target port is positive + elseif (nout(1,ndim)<0&nin(1,ndim)>0) then + //find vector of output ports of source block with + //first/second dimension equal to size nout(1,ndim) + //and assign it to nin(1,ndim) + ww=find(bllst(blkout).out==nout(1,ndim)) + if ww<>[] then + bllst(blkout).out(ww)=nin(1,ndim) + end + ww=find(bllst(blkout).out2==nout(1,ndim)) + if ww<>[] then + bllst(blkout).out2(ww)=nin(1,ndim) + end + //find vector of input ports of source block with + //first/second dimension equal to size nout(1,ndim) + //and assign it to nin(1,ndim) + ww=find(bllst(blkout).in==nout(1,ndim)) + if ww<>[] then + bllst(blkout).in(ww)=nin(1,ndim) + end + ww=find(bllst(blkout).in2==nout(1,ndim)) + if ww<>[] then + bllst(blkout).in2(ww)=nin(1,ndim) + end + + + //fourth case : a dimension of source port is + // null + elseif (nout(1,ndim)==0) then + //set ww to be the vector of size of the ndim + //dimension of input port of the source block + if ndim==1 then + ww=bllst(blkout).in(:) + elseif ndim==2 then + ww=bllst(blkout).in2(:) + end + + //test if all size of the ndim dimension of input + //port of the source block is positive + if min(ww)>0 then + + //test if the dimension of the target port + //is positive + if nin(1,ndim)>0 then + + //if the sum of the size of the ndim dimension of the input + //port of the source block is equal to the size of the ndim dimension + //of the target port, then the size of the ndim dimension of the source + //port is equal to the size of ndim dimension of the target port + if sum(ww)==nin(1,ndim) then + if ndim==1 then + bllst(blkout).out(portout)=nin(1,ndim) + elseif ndim==2 then + bllst(blkout).out2(portout)=nin(1,ndim) + end + //else call bad_connection, set flag ok to false and exit + else + bad_connection(corinv(blkout),0,0,1,-1,0,0,1) + ok=%f;return + end + + //if the ndim dimension of the target port is negative + //then the size of the ndim dimension of the source port + //is equal to the sum of the size of the ndim dimension + //of input ports of source block, and flag ok is set to false + else + if ndim==1 then + bllst(blkout).out(portout)=sum(ww) + elseif ndim==2 then + bllst(blkout).out2(portout)=sum(ww) + end + ok=%f + end + + else + //set nww to be the vector of all negative size of input ports + //of the source block + nww=ww(find(ww<0)) + + //if all negative size have same size and if size of the + //ndim dimension of target port is positive then assign + //size of the ndim dimension of the source port to nin(1,ndim) + if norm(nww-nww(1),1)==0 & nin(1,ndim)>0 then + if ndim==1 then + bllst(blkout).out(portout)=nin(1,ndim) + elseif ndim==2 then + bllst(blkout).out2(portout)=nin(1,ndim) + end + + //compute a size to be the difference between the size + //of the ndim dimension of target block and sum of positive + //size of input ports of source block divided by the number + //of input ports of source block with same negative size + k=(nin(1,ndim)-sum(ww(find(ww>0))))/size(nww,"*") + + //if this size is a positive integer then assign it + //to the size of the ndim dimension of input ports of the + //source block which have negative size + if k==int(k)&k>0 then + if ndim==1 then + bllst(blkout).in(find(ww<0))=k + elseif ndim==2 then + bllst(blkout).in2(find(ww<0))=k + end + + //else call bad_connection, set flag ok to false and exit + else + bad_connection(corinv(blkout),0,0,1,-1,0,0,1) + ok=%f;return + end + + //set flag ok to false + else + ok=%f + end + + end + + //fifth case : a dimension of target port is + // null + elseif (nin(1,ndim)==0) then + //set ww to be the vector of size of the ndim + //dimension of output port of the target block + if ndim==1 then + ww=bllst(blkin).out(:) + elseif ndim==2 then + ww=bllst(blkin).out2(:) + end + + //test if all size of the ndim dimension of output + //port of the target block is positive + if min(ww)>0 then + //test if the dimension of the source port + //is positive + if nout(1,ndim)>0 then + + //if the sum of the size of the ndim dimension of the output + //port of the target block is equal to the size of the ndim dimension + //of the source port, then the size of the ndim dimension of the target + //port is equal to nout(1,ndim) + if sum(ww)==nout(1,ndim) then + if ndim==1 then + bllst(blkin).in(portin)=nout(1,ndim) + elseif ndim==1 then + bllst(blkin).in2(portin)=nout(1,ndim) + end + //else call bad_connection, set flag ok to false and exit + else + bad_connection(corinv(blkin),0,0,1,-1,0,0,1) + ok=%f;return + end + else + //if the ndim dimension of the source port is negative + //then the size of the ndim dimension of the target port + //is equal to the sum of the size of the ndim dimension + //of output ports of target block, and flag ok is set to false + if ndim==1 then + bllst(blkin).in(portin)=sum(ww) + elseif ndim==2 then + bllst(blkin).in2(portin)=sum(ww) + end + ok=%f + end + + else + //set nww to be the vector of all negative size of output ports + //of the target block + nww=ww(find(ww<0)) + + //if all negative size have same size and if size of the + //ndim dimension of the source port is positive then assign + //size of the ndim dimension of the target port to nout(1,ndim) + if norm(nww-nww(1),1)==0 & nout(1,ndim)>0 then + if ndim==1 then + bllst(blkin).in(portin)=nout(1,ndim) + elseif ndim==2 then + bllst(blkin).in2(portin)=nout(1,ndim) + end + + //compute a size to be the difference between the size + //of the ndim dimension of the source block and sum of positive + //size of output ports of the target block divided by the number + //of output ports of target block with same negative size + k=(nout(1,ndim)-sum(ww(find(ww>0))))/size(nww,"*") + + //if this size is a positive integer then assign it + //to the size of the ndim dimension of output ports of the + //target block which have negative size + if k==int(k)&k>0 then + if ndim==1 then + bllst(blkin).out(find(ww<0))=k + elseif ndim==2 then + bllst(blkin).out2(find(ww<0))=k + end + + //else call bad_connection, set flag ok to false and exit + else + bad_connection(corinv(blkin),0,0,1,-1,0,0,1) + ok=%f;return + end + + //set flag ok to false + else + ok=%f + end + end + + //sixth (& last) case : dimension of both source + // and target port are negatives + else + ok=%f //set flag ok to false + end + + end + end + else + //there is no target port + nout(1,1)=bllst(blkout).out(portout) + nout(1,2)=bllst(blkout).out2(portout) + //loop on the two dimensions of source port + for ndim=1:2 + //a dimension of the source port is + // null + if (nout(1,ndim)==0) then + if ndim==1 then + ww=bllst(blkout).in(:) + if min(ww)>0 then + bllst(blkout).out(portout)=sum(ww) + ok=%f + end + elseif ndim==2 then + ww=bllst(blkout).in2(:) + if min(ww)>0 then + bllst(blkout).out2(portout)=sum(ww) + ok=%f + end + end + end + end + end + end + end + + if ok then return, end //if ok then exit adjust + end + //if failed then display message and set flag ok to false + messagebox(["Not enough information to determine port sizes"; + "Compile the diagram before running."],"modal"); + ok=%f + +endfunction + +//connmat : +// +//in parameters : inpptr : vector of regular input port number +// (of size nblk+1) +// outptr : vector of regular output port number +// (of size nblk+1) +// inplnk : vector of link number connected to regular input port +// (of size max(inpptr)-1) +// outlnk : vector of link number connected to regular output port +// (of size max(outptr)-1) +// +//out parameters : outoin : +// +// outoinptr : +// +function [outoin,outoinptr]=connmat(inpptr,outptr,inplnk,outlnk) + outoin=[];outoinptr=1 + for k=1:outptr($)-1 + ii=[] + for j=outlnk(k) + ii=[ii;find(inplnk==j)] + end + outoini=[];jj=0 + for j=ii + // m=int32(max(find(inpptr<=int32(j)))) + m=max(find(inpptr<=j)) + n=j-inpptr(m)+1 + outoini=[outoini;[m,n]] + jj=jj+1 + end + outoinptr=[outoinptr;outoinptr($)+jj] + outoin=[outoin;outoini] + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/adjust_in2out2.bin b/modules/scicos/macros/scicos_scicos/adjust_in2out2.bin new file mode 100755 index 000000000..91d9b5dd9 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/adjust_in2out2.bin differ diff --git a/modules/scicos/macros/scicos_scicos/adjust_in2out2.sci b/modules/scicos/macros/scicos_scicos/adjust_in2out2.sci new file mode 100755 index 000000000..46ba92b8c --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/adjust_in2out2.sci @@ -0,0 +1,58 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [ok,bllst]=adjust_in2out2(bllst) + //adjust_in2out2 + //Alan + //adjust in2,intyp,out2, outtyp in accordance to + //in out (for compatibility) + ok=%t + nblk=size(bllst); + //Check dimension of vectors in/in2,out/out2 + //and intyp/outyp for each block + for i=1:nblk + //input port + sz_in=size(bllst(i).in,"*"); + sz_in2=size(bllst(i).in2,"*"); + sz_intyp=size(bllst(i).intyp,"*"); + //adjust dimension of in2 + if sz_in2 +// - Alan Layec +// Copyright (C) 2011 +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function bad_connection(path_out,prt_out,nout,outtyp,path_in,prt_in,nin,intyp,typ) + // alert for badly connected blocks + // path_out : Path of the "from block" in scs_m + // path_in : Path of the "to block" in scs_m + // Alan, 28/12/06 : added rhs parameter : outtyp/intyp and typ flag. + // typ : a flag. If not present or equal to zero then + // display a message concerning size. + // Else if equal to 1 then display a message + // concerning type. + //! + + if %scicos_debug_gr then + disp("bad_connection...") + end + + rhs = argn(2) ; + if (rhs == 8) then typ=0, end + + if type(path_out)==15 then //set of modelica blocks + // look for modelica bloc associated with prt_out + outports=list() + for b=path_out, + path=list(); + for l=b(1:$-1), + path($+1)=l;path($+1)="model";path($+1)="rpar";path($+1)="objs"; + end + path($+1)=b($); + if size(path)==1 then path=path(1),end + mb=scs_m.objs(path) + k=find(mb.graphics.out_implicit=="E") + for kk=k,outports($+1)=path,end + end + path_out=outports(prt_out) + end + if type(path_in)==15 then //set of modelica blocks + // look for modelica bloc associated with prt_in + inports=list() + for b=path_in, + path=list(); + for l=b(1:$-1), + path($+1)=l;path($+1)="model";path($+1)="rpar";path($+1)="objs"; + end + path($+1)=b($); + if size(path)==1 then path=path(1),end + mb=scs_m.objs(path) + k=find(mb.graphics.in_implicit=="E") + for kk=k,inports($+1)=path,end + end + path_in=inports(prt_in) + end + + if type(path_out)==15 then //problem with implicit block + messagebox([gettext("Problem with the block generated from modelica blocks.")],"warning", "modal") + return; + end + + + // warn the output port block + if typ==0 then + msg = ""; + msg = msg + gettext("Block has connected output port
with incompatible size:"); + msg = msg + "
    "; + msg = msg + "
  • " + msprintf(gettext("Output port %s size is: %s"),string(prt_out), sci2exp(nout)) + "
    • "; + if prt_in <> -1 then + msg = msg + "
  • " + msprintf(gettext("Input port %s size is: %s"),string(prt_in), sci2exp(nin)) + "
    • "; + end + msg = msg + "
"; + msg = msg + ""; + else + msg = ""; + msg = gettext("Block has connected output port
with incompatible type."); + msg = msg + "
    "; + msg = msg + "
  • " + msprintf(gettext("Output port %s type is: %s"),string(prt_out), sci2exp(outtyp)) + "
    • "; + if prt_in <> -1 then + msg = msg + "
  • " + msprintf(gettext("Input port %s type is: %s"),string(prt_in), sci2exp(intyp)) + "
    • "; + end + msg = msg + "
"; + msg = msg + ""; + end + + hilite_path(path_out, msg); + + // warn the input port block + if prt_in <> -1 then + if typ==0 then + msg = ""; + msg = msg + gettext("Block has connected input port
with incompatible size:"); + msg = msg + "
    "; + msg = msg + "
  • " + msprintf(gettext("Output port %s size is: %s"),string(prt_out), sci2exp(nout)) + "
    • "; + msg = msg + "
  • " + msprintf(gettext("Input port %s size is: %s"),string(prt_in), sci2exp(nin)) + "
    • "; + msg = msg + "
"; + msg = msg + ""; + else + msg = ""; + msg = msg + gettext("Block has connected input port
with incompatible type:"); + msg = msg + "
    "; + msg = msg + "
  • " + msprintf(gettext("Output port %s type is: %s"),string(prt_out), sci2exp(outtyp)) + "
    • "; + msg = msg + "
  • " + msprintf(gettext("Input port %s type is: %s"),string(prt_in), sci2exp(intyp)) + "
    • "; + msg = msg + "
"; + msg = msg + ""; + end + + if or(path_in<>path_out) then + hilite_path(path_in, msg) + end + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/build_block.bin b/modules/scicos/macros/scicos_scicos/build_block.bin new file mode 100755 index 000000000..4daa6ae18 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/build_block.bin differ diff --git a/modules/scicos/macros/scicos_scicos/build_block.sci b/modules/scicos/macros/scicos_scicos/build_block.sci new file mode 100755 index 000000000..d452cfd07 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/build_block.sci @@ -0,0 +1,86 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// Copyright (C) DIGITEO - 2010 - Jérôme PICARD +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [model, ok] = build_block(o) + + // build the simulation function associated with the block if necessary + + model = o.model; + graphics = o.graphics; + if model.sim(1)=="scifunc" then + if model.ipar <> 0 then + model.opar=model.ipar; + model.ipar=0; + end + if isempty(model.opar) <> %f then + messagebox(sprintf(gettext("%s: Error: A scifunc block has not been defined."), "build_block"),"modal","error"); + ok = %f + return + end + model.sim = list(genmac(model.opar,size(model.in,"*"),size(model.out,"*")),3); + elseif type(model.sim) == 15 then + modsim = modulo(model.sim(2),10000) + if int(modsim/1000) == 1 then // Fortran Block + funam = model.sim(1) + if ~c_link(funam) then + tt = graphics.exprs(2); + ok = scicos_block_link(funam, tt, "f") + end + elseif int(modsim/1000) == 2 then // C Block + [model,ok]=recur_scicos_block_link(o,"c") + elseif model.sim(2) == 30004 then //modelica generic file type 30004 + //funam = model.sim(1); tt = graphics.exprs(2); + if type(graphics.exprs) == 15 then // compatibility + funam = model.sim(1); + tt = graphics.exprs(2); + else + funam = model.equations.model + tt = graphics.exprs.funtxt; + end + [dirF, nameF, extF] = fileparts(funam); + [modelica_path, modelica_directory] = getModelicaPath(); + if (extF == "") then + funam = modelica_directory + nameF + ".mo"; + mputl(tt, funam); + end + + //next lines removed in ScicosLab + // //++ Check that modelica compiler is available + // //++ Otherwise, give some feedback and quit + // if ~with_modelica_compiler() then + // messagebox(sprintf(gettext("%s: Error: Modelica compiler (MODELICAC) is unavailable."), "build_block"),"modal","error"); + // ok = %f + // end + + + // compilerpath = 'modelicac' //** thanks to automatic detection + + // // build compilation command line, execute it and test for result + // strCmd = compilerpath + ' -c ' + funam + ' -o ' + fullfile(tarpath, nameF + '.moc') + // if execstr('unix_s(''' + strCmd + ''')', 'errcatch') <> 0 then + // error(sprintf(gettext("%s: Error : the following command line failed to execute: %s.\n"), "build_block", strCmd)) + // ok = %f + // end + end + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/build_modelica_block.bin b/modules/scicos/macros/scicos_scicos/build_modelica_block.bin new file mode 100755 index 000000000..9ae3399e6 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/build_modelica_block.bin differ diff --git a/modules/scicos/macros/scicos_scicos/build_modelica_block.sci b/modules/scicos/macros/scicos_scicos/build_modelica_block.sci new file mode 100755 index 000000000..0553715ad --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/build_modelica_block.sci @@ -0,0 +1,77 @@ +// Scicos +// +// Copyright (C) INRIA - Serge Steer - 2003 +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [model,ok]=build_modelica_block(blklstm,corinvm,cmmat,NiM,NoM,NvM,scs_m,path) + // given the blocks definitions in blklstm and connections in cmmat this + // function first create the associated modelicablock and writes its code + // in the file named 'imppart_'+name+'.mo' in the directory given by path + // Then modelica compiler is called to produce the C code of scicos block + // associated to this modelica block. filbally the C code is compiled and + // dynamically linked with Scilab. + // The correspondind model data structure is returned. + + + //## get the name of the generated main modelica file + name=stripblanks(scs_m.props.title(1))+"_im"; + + //## generation of the txt for the main modelica file + //## plus return ipar/rpar for the model of THE modelica block + [txt,rpar,ipar]=create_modelica(blklstm,corinvm,cmmat,NvM,name,scs_m); + + //## write txt in the file path+name+'.mo' + path=pathconvert(stripblanks(path),%t,%t) + mputl(txt,path+name+".mo"); + mprintf("%s\n",["--------------------------------------------\"; + msprintf(_(" Main Modelica : %s"),path+name+".mo") + ""]) + + //## search for + + Mblocks = []; + for i=1:lstsize(blklstm) + if type(blklstm(i).sim)==15 then + if blklstm(i).sim(2)==30004 then + o = scs_m(scs_full_path(corinvm(i))) + Mblocks=[Mblocks; + o.graphics.exprs.nameF] + end + end + end + + //generating XML and Flat_Model + //## compile modelica files + [ok,name,nipar,nrpar,nopar,nz,nx,nx_der,nx_ns,nin,nout,nm,ng,dep_u]=compile_modelica(path+name+".mo",Mblocks); + + if ~ok then return,end + + //nx is the state dimension + //ng is the number of surfaces + //name1 of the model+flat + + //build model data structure of the block equivalent to the implicit part + model=scicos_model(sim=list(name,10004),.. + in=ones(nin,1),out=ones(nout,1),.. + state=zeros(nx*2,1),.. + dstate=zeros(nz,1),.. + rpar=rpar,.. + ipar=ipar,.. + dep_ut=[dep_u %t],nzcross=ng,nmode=nm) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/buildmacros.sce b/modules/scicos/macros/scicos_scicos/buildmacros.sce new file mode 100755 index 000000000..a39a7d3a7 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/buildmacros.sce @@ -0,0 +1,16 @@ + +// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab +// Copyright (C) 2007-2008 - INRIA - Allan CORNET +// +// This file must be used under the terms of the CeCILL. +// This source file is licensed as described in the file COPYING, which +// you should have received as part of this distribution. The terms +// are also available at +// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt + +if (isdef("genlib") == %f) then + exec(SCI+"/modules/functions/scripts/buildmacros/loadgenlib.sce"); +end +//------------------------------------ +genlib("scicos_scicoslib","SCI/modules/scicos/macros/scicos_scicos",%f,%t); +//------------------------------------ diff --git a/modules/scicos/macros/scicos_scicos/buildnewblock.bin b/modules/scicos/macros/scicos_scicos/buildnewblock.bin new file mode 100755 index 000000000..1be3414f7 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/buildnewblock.bin differ diff --git a/modules/scicos/macros/scicos_scicos/buildnewblock.sci b/modules/scicos/macros/scicos_scicos/buildnewblock.sci new file mode 100755 index 000000000..f0291b7d4 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/buildnewblock.sci @@ -0,0 +1,186 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Alan Layec - 2007 +// - Allan CORNET - 2008 +// - Rachid Djenidi +// - Simone Mannori +// +// Copyright (C) DIGITEO - Allan CORNET - 2010 - fully rewritten +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +//============================================================================= +function [ok]=buildnewblock(blknam, files, filestan, filesint, libs, rpat, ldflags, cflags) + + //** buildnewblock : generates Makefiles for + // the generated C code of a scicos block, + // compile and link it in Scilab + // + // Input : blknam : a prefix + // files : files to be compiled + // filestan : files to be compiled and included in + // resu the standalone code + // filesint : files to be compiled and included in + // the interfacing of standalone code + // libs : a vector of string of object files + // to include in the building process + // rpat : a target directory + // ldflags : linker flags + // cflags : C compiler flags + // + // Output : ok : a flag to say if build is ok + + //** check rhs paramaters + [lhs,rhs] = argn(0); + + if rhs <= 1 then files = blknam, end + if rhs <= 2 then filestan = "", end + if rhs <= 3 then filesint = "", end + if rhs <= 4 then libs = "", end + if rhs <= 5 then rpat = TMPDIR, end + if rhs <= 6 then ldflags = "", end + if rhs <= 7 then cflags = "", end + + // Add .c extension if it is not already added + exts_files = fileext(files); + exts_filestan = fileext(filestan); + exts_filesint = fileext(filesint); + + for i = 1:size(files, "*") + if exts_files(i) == "" & files(i) <> "" then + files(i) = files(i) + ".c"; + end + end + + for i = 1:size(filestan, "*") + if exts_filestan(i) == "" & filestan(i) <> "" then + filestan(i) = filestan(i) + ".c"; + end + end + + for i = 1:size(filesint, "*") + if exts_filesint(i) == "" & ~isdir(filesint(i)) & filesint(i) <> "" then + filesint(i) = filesint(i) + ".c"; + end + end + + // add a external file if it exists + // added for compatibility with 4.x + // By RN ... + if isfile(rpat + "/" + blknam + "f.f") then + files=[files, blknam + "f.f"]; + end + + //** adjust path and name of object files + // to include in the building process + if (libs ~= emptystr() & libs <> []) then + libs = pathconvert(libs, %f, %t); + end + + //** otherlibs treatment + [ok, libs, for_link] = link_olibs(libs, rpat); + if ~ok then + ok = %f; + message(["sorry compiling problem"; lasterror()]); + return; + end + + //** unlink if necessary + [a, b] = c_link(blknam); + while a + ulink(b); + [a, b] = c_link(blknam); + end + + //** save path in case of error in ilib_compile + oldpath = pwd(); + + if getos() <> "Windows" then + if isdir(SCI+"/../../include/scilab/scicos_blocks/") then + //** Binary version + cflags = cflags + " -I" + SCI + "/../../include/scilab/scicos/"; + cflags = cflags + " -I" + SCI + "/../../include/scilab/scicos_blocks/"; + cflags = cflags + " -I" + SCI + "/../../include/scilab/dynamic_link/"; + else + //** it is a source version + cflags = cflags + " -I" + SCI + "/modules/scicos/includes/"; + cflags = cflags + " -I" + SCI + "/modules/scicos_blocks/includes/"; + cflags = cflags + " -I" + SCI + "/modules/dynamic_link/includes/"; + end + else + // Load dynamic_link Internal lib if it's not already loaded + if ~exists("dynamic_linkwindowslib") then + load("SCI/modules/dynamic_link/macros/windows/lib"); + end + cflags = cflags + strcat(" -I""" + dlwGetXcosIncludes() + """"); + ldflags = ldflags + strcat(" """ + dlwGetLibrariesPath() + dlwGetXcosLibraries() + """"); + end + + if (rpat == "" | rpat == []) & isdir(filesint) then + // Prepare Block "Code Generation" from Menu + chdir(filesint); + else + // generate Block in TMPDIR (default) + chdir(TMPDIR); + end + + // Since all files Xcos generated files of all diagrams are in the same TEMP directory + // Here, we force to rebuild (not a simple incremental build on Windows) + if getos() == "Windows" then + VC_rebuild_mode = dlwForceRebuild(); + dlwForceRebuild(%t); + end + + ierr = execstr("libn =ilib_for_link(blknam,files,"""",""c"","""",""loader.sce"","""",ldflags,cflags)","errcatch"); + + // restore previous build mode + if getos() == "Windows" then + dlwForceRebuild(VC_rebuild_mode); + end + + if ierr <> 0 then + ok = %f; + chdir(oldpath); + disp(["sorry compiling problem"; lasterror()]); + return; + end + + if (rpat == "" | rpat == []) & isdir(filesint) then + NAME_BLOCK_C_SCI = filesint + filesep() + blknam + "_c.sci"; + if isfile(NAME_BLOCK_C_SCI) then + ierr = exec(NAME_BLOCK_C_SCI, "errcatch"); + if ierr <> 0 then + ok = %f; + chdir(oldpath); + return + end + end + end + + ierr = exec("loader.sce", "errcatch"); + if ierr <> 0 then + ok = %f; + else + ok = %t; + end + + chdir(oldpath); + +endfunction + +//============================================================================= diff --git a/modules/scicos/macros/scicos_scicos/c_pass1.bin b/modules/scicos/macros/scicos_scicos/c_pass1.bin new file mode 100755 index 000000000..291d2ea10 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/c_pass1.bin differ diff --git a/modules/scicos/macros/scicos_scicos/c_pass1.sci b/modules/scicos/macros/scicos_scicos/c_pass1.sci new file mode 100755 index 000000000..a31a5ede5 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/c_pass1.sci @@ -0,0 +1,499 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Serge Steer +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [blklst,cmat,ccmat,cor,corinv,ok,scs_m,flgcdgen,freof]=c_pass1(scs_m,flgcdgen) + //derived from c_pass1 for implicit diagrams + //%Purpose + // Determine one level blocks and connections matrix + //%Parameters + // scs_m : scicos data structure + // ksup : + // blklst : a list containing the "model" information structure for each block + // + // cmat : nx6 matrix. Each row contains, in order, the block + // number and the port number and the port type of an outgoing scicopath, + // and the block number and the port number and the port type of the target + // ingoing scicopath. for regular links + // + // ccmat : nx4 matrix. Each row contains, in order, the block + // number and the port number of an outgoing scicopath, + // and the block number and the port number of the target + // ingoing scicopath for clock connections + + // cor : is a list with same recursive structure as scs_m each leaf + // contains the index of associated block in blklst + // corinv : corinv(nb) is the path of nb ith block defined in blklst + // in the scs_m structure + //! + // Serge Steer 2003, Copyright INRIA + // flgcdgen: is a flag containing the numbre of event input of the diagram + // it is used only in the Codegeneration case. + // freof : it is a vector containing the frequency and the offset of the major clock. + // it is used only in the Codegeneration case. + // Fady Nassif 2007. INRIA. + //c_pass1; + + if argn(2)<=1 then flgcdgen=-1, end + freof=[]; + MaxBlock=countblocks(scs_m); + blklst=[];cmat=[],ccmat=[],cor=[],corinv=[] + [cor,corinvt,links_table,cur_fictitious,sco_mat,ok]=scicos_flat(scs_m); + if ~ok then + disp(mprintf("%s: flat failed", "c_pass1")); + return; + end + [links_table,sco_mat,ok]=global_case(links_table,sco_mat) + if ~ok then + disp(mprintf("%s: global case failed", "c_pass1")); + return; + end + index1=find((sco_mat(:,2)=="-1")& (sco_mat(:,5)<>"10")) + if index1<>[] then + for i=index1 + [path]=findinlist(cor,-evstr(sco_mat(i,1))) + full_path=path(1) + if flgcdgen<>-1 then full_path=[numk full_path];scs_m=all_scs_m;end + hilite_path(full_path,"Error in compilation, There is a FROM ''"+(sco_mat(i,3))+ "'' without a GOTO",%t) + ok=%f; + disp(mprintf("%s: invalid connection matrix", "c_pass1")); + return; + end + end + + nb=size(corinvt); + reg=1:nb + //form the block lists + + blklst=list();kr=0 ; //regular block list + blklstm=list();km=0; //modelica block list + + //if ind(i)>0 ith block is a regular block and stored in blklst(ind(i)) + //if ind(i)<0 ith block is a modelica block and stored in blklstm(-ind(i)) + + ind=[]; + + for kb=1:nb + o=scs_m(scs_full_path(corinvt(kb))); + if is_modelica_block(o) then + km=km+1;blklstm(km)=o.model; + ind(kb)=-km; + [modelx,ok]=build_block(o); // compile modelica block type 30004 + if ~ok then + disp(mprintf("%s: unable to build modelica block", "c_pass1")); + return + end + else + [model,ok]=build_block(o); + if ~ok then + disp(mprintf("%s: unable to build block", "c_pass1")); + return, + end + + if or(model.sim(1)==["plusblk"]) then + [model,links_table]=adjust_sum(model,links_table,kb); + end + + kr=kr+1;blklst(kr)=model; + ind(kb)=kr; + end + + end + + if (find(sco_mat(:,5)==string(4))<>[]) then + if flgcdgen ==-1 then + [links_table,blklst,corinvt,ind,ok]=sample_clk(sco_mat,links_table,blklst,corinvt,scs_m,ind,flgcdgen) + else + [links_table,blklst,corinvt,ind,ok,scs_m,flgcdgen,freof]=sample_clk(sco_mat,links_table,blklst,corinvt,scs_m,ind,flgcdgen) + end + if ~ok then + disp(mprintf("%s: unable to sample the whole diagram", "c_pass1")); + return, + end + end + nb=size(corinvt) + nl=size(links_table,1)/2 + + // Check if size match ! + if(size(links_table(:,1:3), "r") == size(matrix([1;1]*(1:nl),-1,1), "r") .. + & size(matrix([1;1]*(1:nl),-1,1), "r") == size(links_table(:,4), "r")) + links_table=[links_table(:,1:3) matrix([1;1]*(1:nl),-1,1) .. + links_table(:,4) ]; + else + disp(mprintf("%s: invalid links table size", "c_pass1")); + return + end + imp=find(ind<0) + + reg(imp)=[] + + if imp==[] then //no modelica block exists + cmat=matfromT(links_table(find(links_table(:,5)==1),:),nb); //data flow links + ccmat=cmatfromT(links_table(find(links_table(:,5)==-1),:),nb); //event links + corinv=corinvt + else // mixed diagram + nm=size(imp,"*") //number of modelica blocks + nr=nb-nm //number of regular blocks + cmmat=mmatfromT(links_table(find(links_table(:,5)==2),:),nb); //modelica links + cmat=matfromT(links_table(find(links_table(:,5)==1),:),nb); //data flow links + ccmat=cmatfromT(links_table(find(links_table(:,5)==-1),:),nb);//event links + + //build connections between modelica world and regular one. These + //links should be data flow links + // links from modelica world to regular world + fromM=find(dsearch(cmat(:,1),imp,"d")>0); + + // links from regular world to modelica world + toM=find(dsearch(cmat(:,3),imp,"d")>0); + + // merge the modelica to modelica as data flow links + [varM, kfrom, kto] = intersect(fromM, toM); + fromM(kfrom) = []; + toM(kto) = []; + + NoM=size(fromM,"*"); + if NoM>0 then + //add modelica Output ports in Modelica world + mo=modelica();mo.model="OutPutPort";mo.outputs="vo";mo.inputs="vi"; + for k=1:NoM,blklstm($+1)=scicos_model(equations=mo);end + //add modelica connections to these Output ports, set negative + //value to port numbers to avoid conflits with other blocks + cmmat=[cmmat; + cmat(fromM,1:2) zeros(NoM,1) -(nm+(1:NoM)'),ones(NoM,1),ones(NoM,1)]; + + nm=nm+NoM; + //add regular connection with regular block replacing the modelica world + cmat(fromM,1:2)=[-(nr+1)*ones(NoM,1),(1:NoM)']; + end + + NiM=size(toM,"*"); + if NiM>0 then + //add modelica Input ports in Modelica world + mo=modelica();mo.model="InPutPort";mo.outputs="vo";mo.inputs="vi"; + for k=1:NiM,blklstm($+1)=scicos_model(equations=mo);end + //add modelica connections to these Input ports set negative + //value to port numbers to avoid conflits with other blocks + cmmat=[cmmat; + -(nm+(1:NiM)'), ones(NiM,1),zeros(NiM,1), cmat(toM,3:4), ones(NiM,1) ]; + + nm=nm+NiM; + //add regular connection with regular block replacing the modelica world + cmat(toM,3:4)=[-(nr+1)*ones(NiM,1),(1:NiM)']; + end + + NvM=size(varM, "*"); + if NvM>0 then + //add modelica Values (both input and output) ports in Modelica world + l=[cmat(varM,1:2), zeros(NvM,1), cmat(varM,3:4), ones(NvM,1)]; + cmmat=[cmmat; + l]; + + // remove the corresponding explicit link + cmat(varM, :) = []; + end + + // modelica blocks with events ports are not allowed yet + if size(ccmat,1)>0 then + if or(dsearch(ccmat(:,[1 3]),imp,"d")>0) then + messagebox("An implicit block has an event port","modal","error"); + disp(mprintf("%s: implicit block with event port", "c_pass1")); + ok=%f;return + end + end + + //renumber blocks according to their types + + corinv=list();corinvm=list(); + + for kb=1:nb + + if ind(kb)<0 then // modelica block + + km=-ind(kb); + + //replace by negative value to avoid conflicts + + cmmat(find(cmmat(:,1)==kb),1)=-km ; + + cmmat(find(cmmat(:,4)==kb),4)=-km; + + corinvm(km)=corinvt(kb); + + else + + kr=ind(kb); + + cmat (find(cmat (:,1)==kb),1)=-kr; + + cmat (find(cmat (:,3)==kb),3)=-kr; + + ccmat(find(ccmat(:,1)==kb),1)=-kr; + + ccmat(find(ccmat(:,3)==kb),3)=-kr; + + corinv(kr)=corinvt(kb); + + end + + end + + //renumbering done, replace negative value by positive ones + + + + cmat(:,[1 3])=abs(cmat(:,[1 3])) ; + + ccmat(:,[1 3])=abs(ccmat(:,[1 3])) ; + + cmmat=abs(cmmat) ; + + //create regular block associated to all modelica blocks + + [model,ok]=build_modelica_block(blklstm,corinvm,cmmat,NiM,NoM,NvM,scs_m,TMPDIR+"/"); + + if ~ok then + disp(mprintf("%s: build the modelica meta-block failed", "c_pass1")); + return + end + + blklst(nr+1)=model; + + //make compiled modelica block refer to the set of corresponding + + //modelica blocks + + corinv(nr+1)=corinvm //it may be useful to adapt function making use + + //of corinv + + //adjust the numbering of regular block in sco_mat + + //if modelica's blocks exist + + //Fady 08/11/2007 + + for i=1:size(sco_mat,1) + + if eval(sco_mat(i,1))[] then + ind=eval(ind(:)) + //ind=find(tblock) + //ind=ind(:) + for k=ind' + ccmat=[ccmat;[all_out,ones(all_out)*[k,0;0,0]]] + end + for Ii=1:length(blklst) + if type(blklst(Ii).sim(1))==10 then + if part(blklst(Ii).sim(1),1:7)=="capteur" then + ccmat=[ccmat;[0 0 Ii 0]] + end + end + end + end + //*** +endfunction +//**----------------------------------------------------------------------------------------------------------------- + +function [model,links_table]=adjust_sum(model,links_table,k) + //sum blocks have variable number of input ports, adapt the associated + //model data structure and input connection to take into account the + //actual number of connected ports + // Serge Steer 2003, Copyright INRIA + in=find(links_table(:,1)==k&links_table(:,3)==1) + nin=size(in,"*") + model.in=-ones(nin,1) + links_table(in,2)=(1:nin)' +endfunction + + +function mat=mmatfromT(Ts,nb) + //S. Steer, R. Nikoukhah 2003. Copyright INRIA + Ts(:,1)=abs(Ts(:,1)); + K=unique(Ts(find(Ts(:,1)>nb),1)); // identificator of blocks to be removed + //remove superblocks port and split connections + Ts=remove_fictitious(Ts,K) + + // from connection matrix + Imat=[]; + for u=matrix(unique(Ts(:,4)),1,-1) + kue=matrix(find(Ts(:,4)==u),-1,1); //identical links + Imat=[Imat;[kue(2:$) kue(1).*ones(kue(2:$))]]; + end + mat=[Ts(Imat(:,1),1:3) Ts(Imat(:,2),1:3)] +endfunction + + +function mat=matfromT(Ts,nb) + //S. Steer, R. Nikoukhah 2003. Copyright INRIA + + Ts(:,1)=abs(Ts(:,1)) + K=unique(Ts(find(Ts(:,1)>nb),1)); // identificator of blocks to be removed + //remove superblocks port and split connections + Ts=remove_fictitious(Ts,K) + + // from connection matrix + Imat=[]; + for u=matrix(unique(Ts(:,4)),1,-1) + kue=matrix(find(Ts(:,4)==u&Ts(:,3)==-1),-1,1); //look for outputs + jue=matrix(find(Ts(:,4)==u&Ts(:,3)==1),-1,1); //look for inputs + Imat=[Imat;[ones(jue).*.kue jue.*.ones(kue)]]; + end + mat=[Ts(Imat(:,1),1:2) Ts(Imat(:,2),1:2)] +endfunction + +function mat=cmatfromT(Ts,nb) + //S. Steer, R. Nikoukhah 2003. Copyright INRIA + //this function has been modified to support + // CLKGOTO et CLKFROM + // Fady NASSIF: 11/07/2007 + k=find(Ts(:,1)<0) //superblock ports links and CLKGOTO/CLKFROM + K=unique(Ts(k,1)); + Ts=remove_fictitious(Ts,K) + + if Ts==[] then mat=[],return,end + // if size(Ts,1)<>int(size(Ts,1)/2)*2 then disp('PB'),pause,end + [s,k]=gsort(Ts(:,[4,3]),"lr","i");Ts=Ts(k,:) + // modified to support the CLKGOTO/CLKFROM + //mat=[Ts(1:2:$,1:2) Ts(2:2:$,1:2)] + //---------------------------------- + + J=find(Ts(:,3)==1); //find the destination block of the link + v=find([Ts(:,3);-1]==-1) // find the source block of the link + // many destination blocks can be connected to one source block + // so we have to find the number of destination blocks for each source block + // v(2:$)-v(1:$-1)-1 + // then create the vector I that must be compatible with the vector J. + I=duplicate(v(1:$-1),v(2:$)-v(1:$-1)-1); + mat=[Ts(I,1:2),Ts(J,1:2)] + + //---------------------------------- + K=unique(Ts(Ts(:,1)>nb)) + Imat=[]; + for u=matrix(K,1,-1) + jue=matrix(find(mat(:,1)==u),-1,1); //look for outputs + kue=matrix(find(mat(:,3)==u),-1,1); //look for inputs + Imat=[ones(jue).*.kue jue.*.ones(kue)]; + mat1=[mat(Imat(:,1),1:2), mat(Imat(:,2),3:4)]; + mat([jue;kue],:)=[]; + mat=[mat;mat1]; + end + +endfunction + +function Ts=remove_fictitious(Ts,K) + //removes fictitious blocks connected links are replaced by a single one + //S. Steer, R. Nikoukhah 2003. Copyright INRIA + count=min(Ts(:,4)) + for i=1:size(K,"*") + ki=K(i); + v1=find(Ts(:,1)==ki); + if v1<>[] then + v=unique(Ts(v1,4)); + Ts(v1,:)=[]; + if size(v)==1 then + ind=find(Ts(:,4)==v); + else + ind = find(dsearch(Ts(:,4),gsort(v,"g","i"),"d")<>0); + end + if size(ind,"*")>1 then + count=count-1; + Ts(ind,4)=count + else + Ts(ind,:)=[] + end + end + end +endfunction + +function cor=update_cor(cor,reg) + n=size(cor) + for k=1:n + if type(cor(k))==15 then + cor(k)=update_cor(cor(k),reg) + else + p=find(cor(k)==reg) + if p<>[] then + cor(k)=p + elseif cor(k)<0 then // GOTO FROM cases + cor(k)=0 + elseif cor(k)<>0 then + cor(k)=size(reg,"*")+1 + end + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/c_pass2.bin b/modules/scicos/macros/scicos_scicos/c_pass2.bin new file mode 100755 index 000000000..ce70baab7 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/c_pass2.bin differ diff --git a/modules/scicos/macros/scicos_scicos/c_pass2.sci b/modules/scicos/macros/scicos_scicos/c_pass2.sci new file mode 100755 index 000000000..04cf4f1e4 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/c_pass2.sci @@ -0,0 +1,2615 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function cpr=c_pass2(bllst,connectmat,clkconnect,cor,corinv,flag) + // cor ; correspondance table with initial block ordering + // + // bllst: list with nblk elts where nblk denotes number of blocks. + // Each element must be a list with 16 elements: + // 1- a list containing function name and function type + // 2- vector of number of inputs + // 3- vector of number of outputs + // 4- vector of number of clock inputs + // 5- vector of number of clock outputs + // 6- vector (column) of continuous initial condition + // 7- vector (column) of discrete initial condition + // 8- vector (column) of real parameters + // 9- vector (column) of integer parameters + // 10- string: 'l' for synchro (ifthenelse,eselect) or 'm' + // (memo) or 'x' for blocks that need to be called during + // integration even in the absence of state (only if with workspace) + // 11- vector of size including + // preprogrammed event firing times (<0 if no firing) + // 12- boolean vector (column): 1:nin entry for dependence on u, + // last on t + // 13- block label + // 14- number of zero crossings + // 15- number of modes + // 16- empty list (equation for modelica blocks) + // + // connectmat: nx4 matrix. Each row contains, in order, the block + // number and the port number of an outgoing scicopath, + // and the block number and the port number of the target + // ingoing scicopath. + // + // clkconnect: same as connectmat but for clock scicopaths. + // + // define some constants + if argn(2) <6 then flag="verbose",end + show_trace=%f + if show_trace then mprintf("c_pass1:\t%f\n", timer()),end + + show_pause=%f; + show_comment=%f; + + if bllst==list() then + messagebox(_("No block can be activated"),"modal","error") + cpr=list() + ok=%f; + return + end + + //correction of clkconnect.. Must be done before + clkconnect(find(clkconnect(:,2)==0),2)=1; + + + + + if exists("%scicos_solver")==0 then %scicos_solver=0,end + + clkptr=1,cliptr=1,typ_l=[], + nblk=size(bllst) + + //take care of the heritage + [bllst,inplnk,outlnk,clkptr,cliptr,inpptr,outptr,dep_u,dep_uptr,dep_t,.. + typ_l,typ_r,typ_m,tblock,typ_cons,typ_zx,ok]=mini_extract_info(bllst,.. + connectmat,clkconnect) + if show_trace then mprintf("c_pass20:\t%f\n", timer()),end + if ~ok then + cpr=list() + return + end + [outoin,outoinptr]=conn_mat(inpptr,outptr,inplnk,outlnk) + + [critev]=critical_events(connectmat,clkconnect,dep_t,typ_r,.. + typ_l,typ_zx,outoin,outoinptr,clkptr) + [clkconnect,exe_cons]=pak_ersi(connectmat,clkconnect,typ_r,.. + typ_l,outoin,outoinptr,tblock,typ_cons,clkptr) + + + [ordclk,ordptr,cord,typ_l,clkconnect,connectmat,bllst,dep_t,dep_u,.. + dep_uptr,corinv,clkptr,cliptr,critev,ok]=paksazi2(typ_l,clkconnect,.. + connectmat,bllst,dep_t,dep_u,dep_uptr,corinv,clkptr,cliptr,critev) + + if ~ok then + cpr=list() + return + end + + if show_pause then + mprintf("fin de paksazi") + pause + end + + if show_trace then mprintf("c_pass31:\t%f\n", timer()),end + + //extract various info from bllst + [lnksz,lnktyp,inplnk,outlnk,clkptr,cliptr,inpptr,outptr,xptr,zptr,.. + ozptr,typ_mod,rpptr,ipptr,opptr,xc0,xcd0,xd0,oxd0,rpar,.. + ipar,opar,typ_z,typ_x,typ_m,funs,funtyp,initexe,labels,uids,.. + bexe,boptr,blnk,blptr,ok]=extract_info(bllst,connectmat,clkconnect,typ_l); + typ_z0=typ_z; + + + + if ~ok then + messagebox(_("Problem in port size or type."),"modal","error"); + cpr=list() + return, + end + + if show_trace then mprintf("c_pass41:\t%f\n", timer()),end + + //form a matrix which gives destinations of each block + [outoin,outoinptr]=conn_mat(inpptr,outptr,inplnk,outlnk) + [evoutoin,evoutoinptr]=synch_clkconnect(typ_l,clkconnect) + // + if show_trace then mprintf("c_pass50:\t%f\n", timer()),end + + [execlk_cons]=discard(clkptr,cliptr,clkconnect,exe_cons) + + clkconnect=[];exe_cons=[] + + if show_trace then mprintf("c_pass501:\t%f\n", timer()),end + + // Set execution scheduling tables + [ordclk,iord,oord,zord,typ_z,ok]=scheduler(inpptr,outptr,clkptr,execlk_cons,.. + outoin,outoinptr,evoutoin,evoutoinptr,typ_z,typ_x,typ_l,bexe,boptr,blnk,blptr,.. + ordclk,ordptr,cord,dep_t,dep_u,dep_uptr); + + if ~ok then + cpr=list() + return, + end + + if show_trace then mprintf("c_pass51:\t%f\n", timer()),end + //form scicos arguments + + nb=size(typ_z,"*"); + zcptr=ones(nb+1,1); + modptr=ones(nb+1,1); + + for i=1:nb + zcptr(i+1)=zcptr(i)+typ_z(i) + modptr(i+1)=modptr(i)+sign(typ_z(i))*typ_mod(i); + end + + ztyp=sign(typ_z0) //completement inutile pour simulation + // utiliser pour la generation de code + + if xptr($)==1 & zcptr($)>1 then + mess=msprintf(_("No continuous-time state. Thresholds are ignored; this \nmay be OK if you don''t generate external events with them.\nIf you want to reactivate the thresholds, then you need\n\nto include a block with continuous-time state in your diagram.\n You can for example include DUMMY CLSS block (linear palette).")) + messagebox(mess,"modal","error"); + end + + subscr=[] + ncblk=0;nxblk=0;ndblk=0;ndcblk=0; + sim=scicos_sim(funs=funs,xptr=xptr,zptr=zptr,ozptr=ozptr,.. + zcptr=zcptr,inpptr=inpptr,outptr=outptr,.. + inplnk=inplnk,outlnk=outlnk,rpar=rpar,rpptr=rpptr,.. + ipar=ipar,ipptr=ipptr,opar=opar,opptr=opptr,.. + clkptr=clkptr,ordptr=ordptr,execlk=ordclk,.. + ordclk=ordclk,cord=cord,oord=oord,zord=zord,.. + critev=critev(:),nb=nb,ztyp=ztyp,nblk=nblk,.. + ndcblk=ndcblk,subscr=subscr,funtyp=funtyp,.. + iord=iord,labels=labels,uids=uids,modptr=modptr); + + //initialize agenda + [tevts,evtspt,pointi]=init_agenda(initexe,clkptr) + if show_trace then mprintf("c_pass61:\t%f\n", timer()),end + + //mod=0*ones(modptr($)-1,1) + + outtb=list(); + outtb=buildouttb(lnksz,lnktyp); + + iz0=zeros(nb,1); + + if max(funtyp)>10000 &%scicos_solver==0 then + warning(_("Diagram contains implicit blocks, compiling for implicit Solver.")) + %scicos_solver=100 + end + if or(%scicos_solver==[100, 101, 102]) then xc0=[xc0;xcd0],end + state=scicos_state() + state.x=xc0 + state.z=xd0 + state.oz=oxd0 + state.iz=iz0 + state.tevts=tevts + state.evtspt=evtspt + state.pointi=pointi + state.outtb=outtb + // state.mod=mod + + cpr=scicos_cpr(state=state,sim=sim,cor=cor,corinv=corinv); + + if show_trace then mprintf("c_pass71:\t%f\n", timer()),end + +endfunction + + +//donne les sources d'activation du sch�ma +function [vec_clk]=get_clocks(clkconnect,clkptr) + vec_clk=[] + if (find(clkconnect(:,1)==0) ~=[]) then + //activation continue + vec_clk=[vec_clk;0 0]; + end + for blk=1:size(clkptr,1)-1 + if ~typ_l(blk) then + for port=1:clkptr(blk+1)-clkptr(blk) + vec_clk=[vec_clk; blk port]; + end + end + end +endfunction + + + +//insere le vecteur primary dans vec_clk apr�s la ligne comptenant le bloc i +function vec_clk0=set_primary_clk(vec_clk,primary,i) + + if vec_clk~=[] then + n_vc0=find(vec_clk==i) + n_vc0=n_vc0($) + vec_clk0=vec_clk(1:n_vc0) + vec_clk1=vec_clk(n_vc0+1:size(vec_clk,1)) + for k=1:size(primary,1) + if find(primary(k)==vec_clk0)==[] then + vec_clk0($+1)=primary(k) + end + end + for k=1:size(vec_clk1,1) + if find(vec_clk1(k)==vec_clk0)==[] then + vec_clk0($+1)=vec_clk1(k) + end + end + else + vec_clk0=primary + end + +endfunction + +//insere la sous-matrice primary dans vec_clk apr�s la ligne k +function vec_clk0=set_primary_clkport(vec_clk,primary,i) + + if vec_clk~=[] then + vec_clk0=vec_clk(1:i,:) + vec_clk1=vec_clk(i+1:size(vec_clk,1),:) + for k=1:size(primary,1) + f=find(primary(k,1)==vec_clk0(:,1)) + if f==[] then + vec_clk0=[vec_clk0;primary(k,:)] + end + end + n_vc1=size(vec_clk1,1) + if n_vc1>0 then + for k=1:n_vc1 + f=find(vec_clk1(k,1)==vec_clk0(:,1)) + if f==[] then + vec_clk0=[vec_clk0;vec_clk1(k,:)] + end + end + end + else + vec_clk0=primary + end + +endfunction + +//insere la sous-matrice ordoclk0 dans ordclk apr�s le block k +function [ordptr,ordclk,blocs_traites]=set_ordclk(ordclk,.. + ordoclk0,k,j,ordptr,blocs_traites) + if ordoclk0~=[] then + if ordclk==[] then + ordclk=[ordclk;ordoclk0]; + ordptr($+1)=ordptr($)+size(ordoclk0,1); + blocs_traites=[blocs_traites;k] //k + else + m=max(find(blocs_traites==k)) + if j>1 & m~=[] then + ordclk=[ordclk(1:ordptr(m+1)-1,:);ordoclk0;ordclk(ordptr(m+1):$,:)] + ordptr=[ordptr(1:m+1);ordptr(m+1:$)+size(ordoclk0,1)] + blocs_traites=[blocs_traites(1:m);k;blocs_traites(m+1:$)] + else + ind=find(blocs_traites 1 & find((blocs_traites==k))~=[] then + m=max(find(blocs_traites==k)) + ordptr=[ordptr(1:m+1);ordptr(m+1:$)+size(ordoclk0,1)] + blocs_traites=[blocs_traites(1:m);k;blocs_traites(m+1:$)] + else + ind=find(blocs_traites 0 then + for i=1:n_f + clki1=clkconnect(f(i),1) + clki2=clkconnect(f(i),2) + g=find(clki1==parents(:,1)) + if g==[] | (g~=[] & parents(g,2)~=clki2) then + parents=[parents;clki1,clki2] + end + end + end +endfunction + + +function [blks,blksptr]=depend_on(connectmat,dep_u,dep_uptr) + // returns the blocks on which depend directly a block + blks=[];blksptr=1 + for i=1:size(dep_uptr,"*")-1 + indport=find(dep_u(dep_uptr(i):dep_uptr(i+1)-1)); + f=[] + for j=indport + f=[f,find(connectmat(:,3)==i&connectmat(:,4)==j)] + end + blkis=unique(connectmat(f,1)) + blks=[blks;blkis] + blksptr=[blksptr;blksptr($)+size(blkis,"*")] + end +endfunction + +function [eblks,eblksptr]=update_event_depend_on(eblks,eblksptr,clkconnect,cliptr,bls) + // updates the blocks activating a block + nb1=size(cliptr,"*") + eblksptr($:nb1)=eblksptr($) + for i=bls + f=find(clkconnect(:,3)==i) + blkis=unique(clkconnect(f,1)) + dblkis=size(blkis,"*")-(eblksptr(i+1)-eblksptr(i)) + Ibef=eblksptr(1):eblksptr(i)-1; + Iaft=eblksptr(i+1):eblksptr($)-1; + eblks=[eblks(Ibef);blkis;eblks(Iaft)] + eblksptr(i+1:$)=eblksptr(i+1:$)+dblkis + end +endfunction + + +function [fblks,fblksptr]=update_event_activates(fblks,fblksptr,clkconnect,clkptr,bls) + // returns the blocks activated by a block (assumed typ_l) + nb1=size(cliptr,"*") + fblksptr($:nb1)=fblksptr($) + for i=bls + f=find(clkconnect(:,1)==i) + blkis=unique(clkconnect(f,3)) + dblkis=size(blkis,"*")-(fblksptr(i+1)-fblksptr(i)) + Ibef=fblksptr(1):fblksptr(i)-1; + Iaft=fblksptr(i+1):fblksptr($)-1; + fblks=[fblks(Ibef);blkis;fblks(Iaft)] + fblksptr(i+1:$)=fblksptr(i+1:$)+dblkis + end +endfunction + + +function [eblks,eblksptr]=event_depend_on(clkconnect,cliptr) + // returns the blocks activating a block + eblks=[];eblksptr=1 + for i=1:size(cliptr,"*")-1 + f=find(clkconnect(:,3)==i) + blkis=unique(clkconnect(f,1)) + eblks=[eblks;blkis] + eblksptr=[eblksptr;eblksptr($)+size(blkis,"*")] + end +endfunction + + +function [fblks,fblksptr]=event_activates(clkconnect,clkptr) + // returns the blocks activated by a block of type typ_l + fblks=[];fblksptr=1 + for i=1:size(typ_l,"*") + if typ_l(i) then + f=find(clkconnect(:,1)==i) + blkis=unique(clkconnect(f,3)) + fblks=[fblks;blkis] + else + blkis=[] + end + fblksptr=[fblksptr;fblksptr($)+size(blkis,"*")] + end +endfunction + + +function uni=merge_mat(m1,m2) + // for m1 and m2 with two columns containing >=0 values + uni=[m1;m2] + n=max(uni(:,2))+1; + [j,ind]=unique(uni(:,1)*n+uni(:,2)) + uni=uni(-gsort(-ind),:) +endfunction + +function [typ_l,clkconnect,connectmat,vbllst,dep_t,dep_u,dep_uptr,.. + corinv,clkptr,cliptr,critev]=duplicate_block(bl,typ_l,clkconnect,.. + connectmat,vbllst,dep_t,dep_u,dep_uptr,corinv,clkptr,cliptr,critev) + + nblock=size(typ_l,1)+1 + g=find(clkconnect(:,1)==bl) + if g<> [] then + xx=clkconnect(g,:) + xx(:,1)=nblock + clkconnect=[clkconnect;xx] + end + + g=find(connectmat(:,3)==bl) + xx=connectmat(g,:) + xx(:,3)=nblock*ones(size(xx,1),1) + connectmat=[connectmat;xx] + + typ_l($+1)=%t + critev=[critev;critev(clkptr(bl):clkptr(bl+1)-1)] + vbllst(nblock)=vbllst(bl) + dep_t(nblock)=dep_t(bl) + dep_u=[dep_u;dep_u(dep_uptr(bl))] + dep_uptr($+1)=dep_uptr($)+1 + + corinv(nblock)=corinv(bl) + clkptr(nblock+1)=clkptr(nblock)+clkptr(bl+1)-clkptr(bl) + cliptr(nblock+1)=cliptr(nblock)+cliptr(bl+1)-cliptr(bl) + +endfunction + +function [childs]=get_allchilds(primary,fblks,fblksptr,typ_l) + + oldtaille=0 + childs=primary(:)' + taille=size(childs,"*") + + while oldtaille<>taille + oldtaille=taille + for i=childs(typ_l(childs)) + bb=fblks(fblksptr(i):fblksptr(i+1)-1) + childs=union(childs,bb) + end + taille=size(childs,"*") + end +endfunction + + +function ok=is_alg_event_loop(typ_l,clkconnect) + clkconnect(find(clkconnect(:,1)==0),:)=[] + lclkconnect=clkconnect(typ_l(clkconnect(:,1))&typ_l(clkconnect(:,3)),[1,3]) + n=size(typ_l,"*") + oldvec=zeros(n,1) + vec(lclkconnect(:,1))=1 + i=0 + ok=%f + while i<=n + i=i+1 + oldvec=vec // not optimal to use large v + vec(lclkconnect(:,2))=vec(lclkconnect(:,1))+1 + if and(vec==oldvec) then + ok=%t + return + end + end +endfunction + +function [ordclk,ordptr,cord,typ_l,clkconnect,connectmat,bllst,dep_t,dep_u,dep_uptr,corinv,clkptr,cliptr,critev,ok]=paksazi2(typ_l,clkconnect,connectmat,bllst,dep_t,dep_u,dep_uptr,corinv,clkptr,cliptr,critev) + + ordclk=[];ordptr=1;cord=[]; + lordclk=list() + + vbllst=1:length(bllst) + + zz=get_clocks(clkconnect,clkptr) + //testing event algebraic loops + ok=is_alg_event_loop(typ_l,clkconnect) + if ~ok then + disp(mprintf("%s: alg_event_loop failed", "c_pass2")); + messagebox(_("Algebraic loop on events."),"modal","error"); + return + end + + + ok=%t + [fblks,fblksptr]=event_activates(clkconnect,clkptr) + [blks,blksptr]=depend_on(connectmat,dep_u,dep_uptr) + [eblks,eblksptr]=event_depend_on(clkconnect,cliptr) + + + for i=1:size(zz,1) + + nblock=size(typ_l,1); // number of blocks in diagram + + todo=zz(i,:) + while todo<>[] + + blk=todo(1,1);port=todo(1,2); + if blk==0 |find(definedfields(lordclk)==clkptr(blk)+port-1)==[] then + + f=find(clkconnect(:,1)==blk&clkconnect(:,2)==port); + if f<>[] then + primary0=clkconnect(f,3);prt0=clkconnect(f,4) + else + primary0=[] + end + + if show_comment then mprintf("Processing blk " + string(blk) + " port "+... + + string(port) + "\n"),end + + if primary0<>[] then // delete redundant links + [jj,k]=unique(primary0*(1+max(prt0))+prt0) + index=setdiff(1:size(primary0,1),k) + clkconnect(f(index),:)=[] // does not affect e(f)blks + + primary=unique(primary0) + + [balg,vec]=ini_ordo3(primary) + if balg then + disp(mprintf("%s: ini_ordo (3) failed", "c_pass2")); + messagebox(_("Algebraic loop."),"modal","error"), + ok=%f + return + end + + pvec=vec(primary)+.5*typ_l(primary) // same order typ_l to the right + [mi,In]=gsort(-pvec) + primary=primary(In) + lp=find(typ_l(primary)) + lprimary=primary(lp) + + bouclalg=%f + lp_backw=lp($:-1:1) + for i=lp_backw + for J=primary(i+1:$)' + if intersect(get_allchilds(primary(i)),get_allchilds(J))<>[] then + bouclalg=%t + break + end + end + if bouclalg then break,end + end + + if show_comment&bouclalg then mprintf("found intersect \n"),end + + if ~bouclalg then + [bouclalg,Vec,typ_l,clkconnect,connectmat,bllst,dep_t,dep_u,.. + dep_uptr,corinv,clkptr,cliptr,critev]=ini_ordo2(primary,.. + clkconnect,connectmat,bllst,typ_l,dep_t,dep_u,dep_uptr,.. + corinv,clkptr,cliptr,critev) + if bouclalg then + if show_comment then mprintf("found non convergence\n"),pause,end + i=lp(1) // first typ_l + if i==[] then + disp(mprintf("%s: ini_ordo (2) failed", "c_pass2")); + messagebox(_("Algebraic loop."),"modal","error") + ok=%f + return + end + J=primary(i+1:$) + end + end + + if bouclalg then + modif=%f + bl=primary(i) + + nout=clkptr(bl+1)-clkptr(bl) + //duplicate bl if it receives other links + f=find(clkconnect(:,1)==blk&clkconnect(:,2)==port&clkconnect(:,3)==bl) + h=find(clkconnect(:,3)==bl) // this is always one + if size(f,2)<>size(h,2) then + nblock=nblock+1 + clkconnect(f,3)=nblock + if show_comment then + mprintf("duplicating pivot"+string(bl)+" to obtain "+string(nblock) + "\n"), + end + [typ_l,clkconnect,connectmat,vbllst,dep_t,dep_u,dep_uptr,.. + corinv,clkptr,cliptr,critev]=duplicate_block(bl,typ_l,clkconnect,.. + connectmat,vbllst,dep_t,dep_u,dep_uptr,corinv,clkptr,cliptr,critev) + vec(nblock)=vec(bl) + //update pointer + blks_bl=blks(blksptr(bl):blksptr(bl+1)-1) + blks=[blks;blks_bl] + blksptr($+1)=blksptr($)+size(blks_bl,"*") + // + bls=[bl,nblock,fblks(fblksptr(bl):fblksptr(bl+1)-1)'] + [eblks,eblksptr]=.. + update_event_depend_on(eblks,eblksptr,clkconnect,cliptr,bls) + bl=nblock // use new block as pivot + lprimary(i)=bl + end + + for bli=J(:)' + modif=%t + f=find(clkconnect(:,1)==blk&clkconnect(:,2)==port&clkconnect(:,3)==bli) + clkconnect(f,1)=bl + clkconnect(f,2)=1 + xx= clkconnect(f,:) + for jj=2:nout + if show_comment then + mprintf("No block duplication but link between "+string(blk)+.. + " and "+string(bli)+" replaced with links from "+.. + string(bl)+" to "+string(bli) + "\n"), + end + xx(:,2)=jj; + clkconnect=[clkconnect;xx] + end + end + + [eblks,eblksptr]=update_event_depend_on(eblks,eblksptr,clkconnect,cliptr,J(:)') + bls=[blk,bl];bls(find(bls==0))=[];bls=bls(typ_l(bls)); //exclude non typ_l and 0 + [fblks,fblksptr]=update_event_activates(fblks,fblksptr,clkconnect,clkptr,bls) + + // can (must) be done outside the for loop + // [fblks2,fblksptr2]=event_activates(clkconnect,clkptr) + // [eblks2,eblksptr2]=event_depend_on(clkconnect,cliptr) + //but then it must be updated + // if norm(eblksptr-eblksptr2)>0 then mprintf('roro2');pause,end + // if norm(fblksptr-fblksptr2)>0 then mprintf('soso2');pause,end + // if norm(eblks-eblks2)>0 then mprintf('roro');pause,end + // if norm(fblks-fblks2)>0 then mprintf('soso');pause,end + + + if ~modif then messagebox(_("Algebraic loop."),"modal","error"),ok=%f,return,end + else + primary0=primary0(k); + prt0=prt0(k) + [primary0,prt0]=aggregate(primary0,prt0) + [mi,In]=gsort(-Vec(primary0)) + if blk<>0 then + lordclk(clkptr(blk)+port-1)=[primary0(In),prt0(In)] + + if show_comment then + mprintf("for blk port "+string(blk)+" "+string(port)+.. + " ordclk is :\n"), disp(lordclk(clkptr(blk)+port-1)), + end + else + cord=[primary0(In),prt0(In)] + end + + todo(1,:)=[] + L=[]; + for Bi=lprimary' + C=[1:clkptr(Bi+1)-clkptr(Bi)]' + L=[L;Bi*ones(C),C] + end + todo=merge_mat(todo,L) + end + else + if blk<>0 then + J=clkptr(blk)+port-1 + lordclk(J)=[] + if show_comment then + mprintf("for blk port "+string(blk)+" "+string(port)+.. + " ordclk is"), mprintf(lordclk(J) + "\n"), + end + else + cord=[] + end + + todo(1,:)=[] + end + else + todo(1,:)=[] + end + end + end + + for J=1:clkptr($)-1 + ordclk=[ordclk;lordclk(J)] + ordptr=[ordptr;ordptr($)+size(lordclk(J),1)] + end + + bllst=list(bllst(vbllst)) + +endfunction + +function [primary0,port0]=aggregate(primary0,port0) + primary=discardprimary([primary0,port0]) // must rewrite + primary0=primary(:,1);port0=primary(:,2) +endfunction + + +function [parents]=get_parents2(parents,blk,port) + k=size(parents,1)+1; + f=find(clkconnect(:,3)==blk) + n_f=size(f,2) + if n_f>0 then + for i=1:n_f + if clkconnect(f(i),4)==port then + clki1=clkconnect(f(i),1) + clki2=clkconnect(f(i),2) + g=find(clki1==parents(:,1)) + if g==[] | (g~=[] & parents(g,2)~=clki2) then + parents(k,1)=clki1 + parents(k,2)=clki2 + k=k+1 + end + end + end + end +endfunction + +//suppression des liens inutiles +function [clkconnect,amaj]=find_del_inutile(clkconnect,vec_plus,typ_l) + amaj=[] + for i=1:size(vec_plus,1) + blk=vec_plus(i,1) + port=vec_plus(i,2) + parents=get_parents2([],blk,port) + j=1 + done=%f + n_p=size(parents,1) + while j<=n_p & ~done + par1=parents(j,1) + if par1~=0 & typ_l(par1) then + n_out=clkptr(par1+1)-clkptr(par1) + f=find(par1==parents(:,1)) + if size(f,2)==n_out then + if show_comment then + mprintf("find_del_inutile:") + mprintf("link between blocks "+string(par1)+" and "+string(blk)+.. + " are deleted\n") + pause + end + [clkconnect]=del_inutile(clkconnect,par1,n_out,blk,port) + done=%t + amaj=[amaj;par1;blk] + end + end + j=j+1 + end + end +endfunction + +function [clkconnect]=del_inutile(clkconnect,blk0,n_out,blk,port) + f=find(clkconnect(:,1)==blk0) + del=[] + for i=1:size(f,2) + if clkconnect(f(i),3)==blk & clkconnect(f(i),4)==port then + del=[del;f(i)] + end + end + clkconnect(del,:)=[] + p=get_parents([],blk0) + n_p=size(p,1) + for i=1:n_p + clkconnect($+1,:)=[p(i,1),p(i,2),blk,port] + end +endfunction + + +function blk0=get_father(blk1,vectmp) + gg=find(clkconnect(:,3)==blk1) // parents of blk1 + del=find(clkconnect(gg,1)==0) + gg(del)=[] // remove continuous-time source + // it is inactive + hh=find(vectmp(clkconnect(gg,1))>0) // keep active ones + blk0=unique(clkconnect(gg(hh),1)) // active parent(s) + blk0=blk0(typ_l(blk0)) // can be a vector +endfunction + +function [bouclalg,vec,typ_l,clkconnect,connectmat,bllst,dep_t,dep_u,.. + dep_uptr,corinv,clkptr,cliptr,critev]=ini_ordo2(primary,.. + clkconnect,connectmat,bllst,typ_l,dep_t,dep_u,dep_uptr,corinv,clkptr,.. + cliptr,critev) + + n_p=size(primary,1) + + nblock=size(typ_l,1); + //initialisation de vec + //on initialise vec � -1 + vec=-ones(nblock,1) + vec(primary(:,1))=1 + + bouclalg=%f + fromfixe=%f + oldvec2=[] + counter2=0 + + [wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr]=prim_calc(primary) + + while ~fromfixe + vec=update_vec3(vec,wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr) + // + if and(vec==oldvec2) then + fromfixe=%t + else + oldvec2=vec + end + counter2=counter2+1 + if (counter2>n_p+1) then + bouclalg=%t + // mprintf('Algebraic Loop detection.') + break + end + end +endfunction + +function [bouclalg,vec]=ini_ordo3(primary) + + n_p=size(primary,1) + + nblock=size(typ_l,1); + //initialisation de vec + //on initialise vec � -1 + vec=-ones(nblock,1) + vec(primary(:,1))=0 + + bouclalg=%f + fromfixe=%f + oldvec2=[] + counter2=0 + + [wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr]=prim_calc(primary) + + while ~fromfixe + vec=update_vec4(vec,wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr) + + if and(vec==oldvec2) then + fromfixe=%t + else + oldvec2=vec + end + counter2=counter2+1 + if (counter2>n_p+1) then + bouclalg=%t + // mprintf('Algebraic Loop detection.') + break + end + end +endfunction + + +function vec=update_vec3(vec,wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr) + for i=1:size(wprimptr,"*")-1 + w=wprim(wprimptr(i):wprimptr(i+1)-1) + g0=g0prim(g0primptr(i):g0primptr(i+1)-1) + g=gprim(gprimptr(i):gprimptr(i+1)-1) + // detecting algebraic loops within a single cluster + //mprintf([px,py,size(blks,'*')]) + vec(w)=max(vec(w)) + if (g0 ~= []) then + vec(w(1))=max(vec(w(1)),max(vec(g0))+1) + end + //g=g(find(vec(g)>-1)) //not optimal test max(vec(g)) + if g~=[] then + vec(w)=vec(w)-1 + vec(w)=max(vec(w),max(vec(g)))+1 + end + end +endfunction + +function vec=update_vec4(vec,wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr) + for i=1:size(wprimptr,"*")-1 + w=wprim(wprimptr(i):wprimptr(i+1)-1) + g0=g0prim(g0primptr(i):g0primptr(i+1)-1) + if g0<>[] then vec(w(1))=max(vec(w(1)),max(vec(g0))), end + vec(w(2:$))=vec(w(1))+1 + end +endfunction + +function [wprim,wprimptr,g0prim,g0primptr,gprim,gprimptr]=prim_calc(primary) + wprim=[];wprimptr=1 + gprim=[];gprimptr=1 + g0prim=[];g0primptr=1 + + + for i=1:size(primary,"*") + w0=primary(i) + if typ_l(w0) then + w=get_allchilds(w0,fblks,fblksptr,typ_l) + j=find(w==w0) + w([1,j])=w([j,1]) // put w0 on top + else + w=w0; + end + wprim=[wprim;w(:)] + wprimptr($+1)=wprimptr($)+size(w,"*") + + px=blksptr(w(1));py=blksptr(w(1)+1)-1 + //mprintf([px,py,size(blks,'*')]) + g0prim=[g0prim;blks(px:py)] + g0primptr($+1)=g0primptr($)+size(px:py,2) + + g=[] + for i1=2:size(w,"*") // 1 is done already + px=blksptr(w(i1));py=blksptr(w(i1)+1)-1 + g=[g;blks(px:py)] + end + gprim=[gprim;g] + gprimptr($+1)=gprimptr($)+size(g,"*") + end +endfunction + +function primary=discardprimary(primary) + // discard + mma=max(primary(:,2))+1 + con=mma*primary(:,1)+primary(:,2) + [junk,ind]=gsort(-con);con=-junk + primary=primary(ind,:) + // discard duplicate calls to the same block port + if size(con,"*")>=2 then + primary(find(con(2:$)-con(1:$-1)==0),:)=[] + end + // group calls to different ports of the same block. + primary=[primary(:,1),2^(primary(:,2)-ones(primary(:,2)))] + primary=int(primary) + con=primary(:,1) + clkconnectjj=[] + if size(con,"*")>=2 then + iini=[find(con(2:$)-con(1:$-1)<>0),size(primary,1)] + else + iini=1 + end + for ii=iini + clkconnectjj=[clkconnectjj;[primary(ii,1),.. + mysum(primary(find(primary(:,1)==primary(ii,1)),2))]] + end + primary=clkconnectjj +endfunction + + + + +function [ordclk,iord,oord,zord,typ_z,ok]=scheduler(inpptr,outptr,clkptr,execlk_cons,.. + outoin,outoinptr,evoutoin,evoutoinptr,typ_z,typ_x,typ_l,bexe,boptr,.. + blnk,blptr,ordclk,ordptr,cord,dep_t,dep_u,dep_uptr); + + nblk=size(typ_x,1) + //compute iord + if execlk_cons<>[] then + vec=-ones(1,nblk) + no_tu_dep=execlk_cons(:,1) + wec=zeros(1,nblk) + wec(no_tu_dep')=execlk_cons(:,2)' + vec(no_tu_dep)=0*no_tu_dep' + [r,ok]=newc_tree2(vec,outoin,outoinptr,dep_u,dep_uptr) + + iord=[r,wec(r)'] + else + iord=[] + end + // + if ~ok then + disp(mprintf("%s: scheduling failed", "c_pass2")); + messagebox(_("Algebraic loop."),"modal","error"); + iord=[],oord=[],zord=[],critev=[] + return, + end + + n=size(cord,1) + vec=-ones(1,nblk); + vec(cord(:,1))=0; + typp=zeros(typ_l);typp(typ_l)=1 + + ext_cord1=cord; + j=1 + while %t + ii=ext_cord1(j,1) + if typ_l(ii) + for i=[clkptr(ii):clkptr(ii+1)-1] + ext_cord1=[ext_cord1;ordclk([ordptr(i):ordptr(i+1)-1],:)]; + end + end + j=j+1 + if j>size(ext_cord1,1) then break;end + end + // code to replace faulty unique which reorders + yy=ext_cord1(:,1)' + [xx,kkn]=unique(yy); + ext_cord=yy(-gsort(-kkn)) + //ext_cord=unique(ext_cord1(:,1)'); + //for i=ext_cord + // if typ_l(i) then typ_z(i)=clkptr(i+1)-clkptr(i)-1;end + //end // adding zero crossing surfaces to cont. time synchros + + //a supprimer + + [ext_cord_old,ok]=newc_tree3(vec,dep_u,dep_uptr,typp); + + if or(gsort(ext_cord_old)<>gsort(ext_cord)) then pause,end + // + //pour mettre a zero les typ_z qui ne sont pas dans ext_cord + //noter que typ_z contient les tailles des nzcross (peut etre >1) + typ_z(ext_cord)=-typ_z(ext_cord) + typ_z=-min(typ_z,0) + + if ~ok then mprintf("serious bug, report.");pause;end + // ext_cord=ext_cord(n+1:$); + + typ_z_save=typ_z + + fin=0 + while ~fin + fin=1 + for i=ext_cord($:-1:1) + for ii=[outoin(outoinptr(i):outoinptr(i+1)-1,1)',.. + evoutoin(evoutoinptr(i):evoutoinptr(i+1)-1,1)'] + //ii est un block affecte par changement de sortie du + //i-eme block de oord + if typ_z(ii) then + if typ_z(i)==0 then typ_z(i)=1;fin=0;end + end + if typ_x(ii) then + if ~typ_x(i) then typ_x(i)=%t;fin=0;end + end + if typ_z(i)&typ_x(i) then break,end + end + end + end + //supprimer les blocks a supprimer + ind=find(typ_z(cord(:,1))); + zord=cord(ind,:) + ind=find(typ_x(cord(:,1))); + oord=cord(ind,:) + typ_z=typ_z_save + //critev: vecteur indiquant si evenement est important pour tcrit + //Donc les blocks indiques sont des blocks susceptibles de produire + //des discontinuites quand l'evenement se produit + maX=max([ext_cord1(:,2);ordclk(:,2)])+1; + cordX=ext_cord1(:,1)*maX+ext_cord1(:,2); + + // 1: important; 0:non + //n=clkptr(nblk+1)-1 //nb d'evenement + n=size(ordptr,"*")-1 //nb d'evenement + + //a priori tous les evenemets sont non-importants + //critev=zeros(n,1) + for i=1:n + for hh=ordptr(i):ordptr(i+1)-1 + jj= ordclk(hh,1) //block excite par evenement i + //Following line is not correct because of ever active synchros + if or(jj*maX+ordclk(hh,2)==cordX) then + ordclk(hh,2)=-ordclk(hh,2) + end + end + end +endfunction + +function [ord,ok]=tree3(vec,dep_ut,typ_l) + //compute blocks execution tree + ok=%t + nb=size(vec,"*") + for j=1:nb+2 + fini=%t + for i=1:nb + if vec(i)==j-1&typ_l(i)<>-1 then + if j==nb+2 then + disp(mprintf("%s: tree (3) failed", "c_pass2")); + messagebox(_("Algebraic loop."),"modal","error");ok=%f;ord=[];return; + end + if typ_l(i)==1 then + fini=%f; + kk=bexe(boptr(i):boptr(i+1)-1)'; + else + kk=[]; + for ii=blnk(blptr(i):blptr(i+1)-1)' + if vec(ii)>-1 & (dep_ut(ii,1) | (typ_l(ii)==1)) then + fini=%f; + kk=[kk ii]; + end + end + end + vec(kk)=j*ones(kk) ; //mprintf(vec) + end + end + if fini then break;end + end + [k,ord]=gsort(-vec); + ord(find(k==1))=[]; +endfunction + +function [clkconnectj_cons]=discard(clkptr,cliptr,clkconnect,exe_cons) + + if exe_cons<>[] then + clkconnectj=exe_cons + mma=max(clkconnectj(:,2))+1 + con=mma*(clkconnectj(:,1))+clkconnectj(:,2) + [junk,ind]=gsort(-con);con=-junk + clkconnectj=clkconnectj(ind,:) + // discard duplicate calls to the same block port + if size(con,"*")>=2 then + clkconnectj(find(con(2:$)-con(1:$-1)==0),:)=[] + end + // group calls to different ports of the same block. + clkconnectj=[clkconnectj(:,1),2^(clkconnectj(:,2)-ones(clkconnectj(:,2)))] + clkconnectj=int(clkconnectj) + con=clkconnectj(:,1) + clkconnectj_cons=[] + if size(con,"*")>=2 then + iini=[find(con(2:$)-con(1:$-1)<>0),size(clkconnectj,1)] + else + iini=1 + end + for ii=iini + clkconnectj_cons=[clkconnectj_cons;[clkconnectj(ii,1),.. + mysum(clkconnectj(find(clkconnectj(:,1)==clkconnectj(ii,1)),2))]] + end + else + clkconnectj_cons=[] + end +endfunction + +function a=mysum(b) + if b<>[] then a=sum(b), else a=[], end +endfunction + +function [lnksz,lnktyp,inplnk,outlnk,clkptr,cliptr,inpptr,outptr,xptr,zptr,.. + ozptr,typ_mod,rpptr,ipptr,opptr,xc0,xcd0,xd0,oxd0,rpar,.. + ipar,opar,typ_z,typ_x,typ_m,funs,funtyp,initexe,labels,uids,.. + bexe,boptr,blnk,blptr,ok]=extract_info(bllst,connectmat,clkconnect,typ_l) + + ok=%t + nbl=length(bllst) + clkptr=zeros(nbl+1,1);clkptr(1)=1 + cliptr=clkptr;inpptr=cliptr;outptr=inpptr; + xptr=1;zptr=1;ozptr=1; + rpptr=clkptr;ipptr=clkptr;opptr=clkptr; + // + xc0=[];xcd0=[];xd0=[]; + oxd0=list() + rpar=[];ipar=[]; + opar=list(); + + fff=ones(nbl,1)==1 + typ_z=zeros(nbl,1);typ_x=fff;typ_m=fff;typ_mod=zeros(nbl,1); + + initexe=[]; + funs=list(); + funtyp=zeros(typ_z) + labels=[] + uids=[] + [ok,bllst]=adjust_inout(bllst,connectmat) + if ok then + [ok,bllst]=adjust_typ(bllst,connectmat) + end + + // placed here to make sure nzcross and nmode correctly updated + if ~ok then + lnksz=[],lnktyp=[],inplnk=[],outlnk=[],clkptr=[],cliptr=[],inpptr=[],outptr=[],.. + xptr=[],zptr=[],ozptr=[],rpptr=[],ipptr=[],opptr=[],xc0=[],.. + xcd0=[],xd0=[],oxd0=list(),rpar=[],ipar=[],opar=list(),.. + typ_z=[],typ_x=[],typ_m=[],funs=[],funtyp=[],initexe=[],.. + labels=[],uids=[],bexe=[],boptr=[],blnk=[],blptr=[] + return; + end + for i=1:nbl + ll=bllst(i) + + if type(ll.sim)==15 then + funs(i)=ll.sim(1) + funtyp(i,1)=ll.sim(2) + else + funs(i)=ll.sim; + funtyp(i,1)=0; + end + if funtyp(i,1)>999&funtyp(i,1)<10000 then + if ~c_link(funs(i)) then + messagebox(msprintf(_("A C or Fortran block is used but not linked.\n"+.. + "You can save your compiled diagram and load it.\n"+.. + "This will automatically link the C or Fortran function.")),"modal","error") + end + end + inpnum=ll.in;outnum=ll.out;cinpnum=ll.evtin;coutnum=ll.evtout; + // + inpptr(i+1)=inpptr(i)+size(inpnum,"*") + outptr(i+1)=outptr(i)+size(outnum,"*") + cliptr(i+1)=cliptr(i)+size(cinpnum,"*") + clkptr(i+1)=clkptr(i)+size(coutnum,"*") + // + X0=ll.state(:) + if funtyp(i,1)<10000 then + xcd0=[xcd0;0*X0] + xc0=[xc0;X0] + xptr(i+1)=xptr(i)+size(ll.state,"*") + else + xcd0=[xcd0;X0($/2+1:$)] + xc0=[xc0;X0(1:$/2)] + xptr(i+1)=xptr(i)+size(ll.state,"*")/2 + end + + //dstate + if (funtyp(i,1)==3 | funtyp(i,1)==5 | funtyp(i,1)==10005) then //sciblocks + if ll.dstate==[] then xd0k=[]; else xd0k=var2vec(ll.dstate);end + else + xd0k=ll.dstate(:) + end + xd0=[xd0;xd0k] + zptr(i+1)=zptr(i)+size(xd0k,"*") + + //odstate + if type(ll.odstate)==15 then + if ((funtyp(i,1)==5) | (funtyp(i,1)==10005)) then //sciblocks : don't extract + if lstsize(ll.odstate)>0 then + oxd0($+1)=ll.odstate + ozptr(i+1)=ozptr(i)+1; + else + ozptr(i+1)=ozptr(i); + end + elseif ((funtyp(i,1)==4) | (funtyp(i,1)==10004) |... + (funtyp(i,1)==2004) | (funtyp(i,1)==12004)) //C blocks : extract + ozsz=lstsize(ll.odstate); + if ozsz>0 then + for j=1:ozsz, oxd0($+1)=ll.odstate(j), end; + ozptr(i+1)=ozptr(i)+ozsz; + else + ozptr(i+1)=ozptr(i); + end + else + ozptr(i+1)=ozptr(i); + end + else + //add an error message here please ! + ozptr(i+1)=ozptr(i); + end + + //mod + typ_mod(i)=ll.nmode; + if typ_mod(i)<0 then + messagebox(msprintf(_("Number of modes in block #%d cannot be determined."),i),"modal","error") + ok=%f + end + + //real paramaters + if (funtyp(i,1)==3 | funtyp(i,1)==5 | funtyp(i,1)==10005) then //sciblocks + if ll.rpar==[] then rpark=[]; else rpark=var2vec(ll.rpar);end + else + rpark=ll.rpar(:) + end + rpar=[rpar;rpark] + rpptr(i+1)=rpptr(i)+size(rpark,"*") + + //integer parameters + if type(ll.ipar)==1 then + ipar=[ipar;ll.ipar(:)] + ipptr(i+1)=ipptr(i)+size(ll.ipar,"*") + else + ipptr(i+1)=ipptr(i) + end + + //object parameters + if type(ll.opar)==15 then + if ((funtyp(i,1)==5) | (funtyp(i,1)==10005)) then //sciblocks : don't extract + if lstsize(ll.opar)>0 then + opar($+1)=ll.opar + opptr(i+1)=opptr(i)+1; + else + opptr(i+1)=opptr(i); + end + elseif ((funtyp(i,1)==4) | (funtyp(i,1)==10004) |... + (funtyp(i,1)==2004) | (funtyp(i,1)==12004)) then //C blocks : extract + oparsz=lstsize(ll.opar); + if oparsz>0 then + for j=1:oparsz, opar($+1)=ll.opar(j), end; + opptr(i+1)=opptr(i)+oparsz; + else + opptr(i+1)=opptr(i); + end + else + opptr(i+1)=opptr(i); + end + else + //add an error message here please ! + opptr(i+1)=opptr(i); + end + + // typ_z(i)=ll.blocktype=='z' + typ_z(i)=ll.nzcross + if typ_z(i)<0 then + messagebox(msprintf(_("Number of zero crossings in block #%d cannot be determined."),i),"modal","error") + ok=%f + end + typ_x(i)=ll.state<>[]|ll.blocktype=="x" // some blocks like delay + // need to be in oord even + // without state + + typ_m(i)=ll.blocktype=="m" + // + if ll.evtout<>[] then + ll11=ll.firing + prt=find(ll11>=zeros(ll11)) + nprt=prod(size(prt)) + initexe=[initexe;[i*ones(nprt,1),matrix(prt,nprt,1),matrix(ll11(prt),nprt,1)]]; + end + + if type(ll.label)==10 then + labels=[labels;ll.label(1)] + else + labels=[labels;" "] + end + + if type(ll.uid)==10 then + uids=[uids;ll.uid(1)] + else + uids=[uids;" "] + end + end + + clkconnect=clkconnect(find(clkconnect(:,1)<>0),:); + + con=clkptr(clkconnect(:,1))+clkconnect(:,2)-1; + [junk,ind]=gsort(-con);con=-junk; + clkconnect=clkconnect(ind,:); + // + bclkconnect=clkconnect(:,[1 3]); + boptr=1; + bexe=[]; + for i=1:nbl + r=bclkconnect(find(bclkconnect(:,1)==i),2); + bexe=[bexe;r]; + boptr=[boptr;boptr($)+size(r,1)]; + end + // + + blptr=1; + blnk=[]; + + for i=1:nbl + r=connectmat(find(connectmat(:,1)==i),3:4); + blnk=[blnk;r]; + blptr=[blptr;blptr($)+size(r,1)]; + end + // + + nlnk=size(connectmat,1) + inplnk=zeros(inpptr($)-1,1);outlnk=zeros(outptr($)-1,1);ptlnk=1; + lnksz=[];lnktyp=[]; + for jj=1:nlnk + ko=outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1) + ki=inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1) + if ko<>0 & ki<>0 then + if ko>ki then + outlnk(outlnk>ko)=outlnk(outlnk>ko)-1 + outlnk(outlnk==ko)=ki + inplnk(inplnk>ko)=inplnk(inplnk>ko)-1 + inplnk(inplnk==ko)=ki + ptlnk=-1+ptlnk + lnksz(ko,1)=[]; + lnksz(ko,2)=[]; + lnktyp(ko) =[]; + elseif ki>ko + outlnk(outlnk>ki)=outlnk(outlnk>ki)-1 + outlnk(outlnk==ki)=ko + inplnk(inplnk>ki)=inplnk(inplnk>ki)-1 + inplnk(inplnk==ki)=ko + ptlnk=-1+ptlnk + lnksz(ki,1)=[]; + lnksz(ki,2)=[]; + lnktyp(ki) =[]; + end + elseif ko<>0 then + inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1)=ko + elseif ki<>0 then + outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1)=ki + else + outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1)=ptlnk + inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1)=ptlnk + lnksz(ptlnk,1)=bllst(connectmat(jj,1)).out(connectmat(jj,2)); + lnksz(ptlnk,2)=bllst(connectmat(jj,1)).out2(connectmat(jj,2)); + lnktyp(ptlnk)=bllst(connectmat(jj,1)).outtyp(connectmat(jj,2)); + ptlnk=1+ptlnk + end + end + + //store unconnected outputs, if any, at the end of outtb + unco=find(outlnk==0); + for j=unco + m=max(find(outptr<=j)) + n=j-outptr(m)+1 + nm=bllst(m).out(n) + if nm<1 then + under_connection(corinv(m),n,nm,-1,0,0,1),ok=%f,return, + end + nm2=bllst(m).out2(n) + if nm2<1 then + under_connection(corinv(m),n,nm2,-1,0,0,1),ok=%f,return, + end + lnksz($+1,1)=bllst(m).out(n); + lnksz($,2)=bllst(m).out2(n); + lnktyp($+1)=bllst(m).outtyp(n); + outlnk(j)=max(outlnk)+1 + end + + //store unconnected inputs, if any, at the end of outtb + unco=find(inplnk==0); + for j=unco + m=max(find(inpptr<=j)) + n=j-inpptr(m)+1 + nm=bllst(m).in(n) + if nm<1 then + under_connection(corinv(m),n,nm,-2,0,0,1),ok=%f,return, + end + nm2=bllst(m).in2(n) + if nm2<1 then + under_connection(corinv(m),n,nm2,-2,0,0,1),ok=%f,return, + end + lnksz($+1,1)=bllst(m).in(n); + lnksz($,2)=bllst(m).in2(n); + lnktyp($+1)=bllst(m).intyp(n); + inplnk(j)=max([inplnk;max(outlnk)])+1 + end + +endfunction + +function [outoin,outoinptr]=conn_mat(inpptr,outptr,inplnk,outlnk) + outoin=[];outoinptr=1 + nblk=size(inpptr,1)-1 + for i=1:nblk + k=outptr(i):outptr(i+1)-1 + ii=[] + for j=outlnk(k)' + ii=[ii,find(inplnk==j)] + end + outoini=[];jj=0 + for j=ii + m=max(find(inpptr<=j)) + n=j-inpptr(m)+1 + outoini=[outoini;[m,n]] + jj=jj+1 + end + outoinptr=[outoinptr;outoinptr($)+jj] + outoin=[outoin;outoini] + end +endfunction + +function [ord,ok]=tree2(vec,outoin,outoinptr,dep_ut) + //compute blocks execution tree + ok=%t; + + nb=size(vec,"*"); + for j=1:nb+2 + fini=%t + for i=1:nb + if vec(i)==j-1 then + if j==nb+2 then + disp(mprintf("%s: tree (2) failed", "c_pass2")); + messagebox(_("Algebraic loop."),"modal","error");ok=%f;ord=[];return; + end + for k=outoinptr(i):outoinptr(i+1)-1 + ii=outoin(k,1); + //indport=find(dep_u(dep_uptr(ii):dep_uptr(ii+1)-1)==1); + //if (indport ~=[] &vec(ii)>-1) then + if (dep_ut(ii) &vec(ii)>-1) then + fini=%f; + vec(ii)=j; + end + end + end + end + if fini then break;end + end + + [k,ord]=gsort(-vec); + ord(find(k==1))=[]; + ord=ord(:) +endfunction + + +//adjust_inout : it resolves positive, negative and null size +// of in/out port dimensions of connected block. +// If it's not done in a first pass, the second +// pass try to resolve negative or null port +// dimensions by asking user to informed dimensions +// with underconnection function. +// It is a fixed point algorithm. +// +//in parameters : bllst : list of blocks +// +// connectmat : matrix of connection +// connectmat(lnk,1) : source block +// connectmat(lnk,2) : source port +// connectmat(lnk,3) : target block +// connectmat(lnk,4) : target port +// +//out parameters : ok : a boolean flag to known if adjust_inout have +// succeeded to resolve the in/out port size +// - ok = %t : all size have been resolved in bllst +// - ok = %f : problem in size adjustement +// +// bllst : modified list of blocks +// +//18/05/06, Alan : improvement in order to take into +// account two dimensional port size. +// +//28/12/06, Alan : type for source port and target port must +// be the same. +// +//29/12/06, Fady : type for source and target can be different +// in one condition that they are double and complex. +// the result on the link will be complex. +// +//04/01/07, Fady : Can test the case of negatives equals target's dimensions. +// +//19/01/07, Alan : - Return correct information for user in editor +// with preceding test of Fady in the first pass +// - Second pass reviewed : under_connection returns two dimensions now +// +//10/05/07, Alan : - if-then-else event-select case + +function [ok,bllst]=adjust_inout(bllst,connectmat) + + //Adjust in2/out2, inttyp/outtyp + //in accordance to in/out in bllst + [ko,bllst]=adjust_in2out2(bllst); + if ~ko then ok=%f,return, end //if adjust_in2out2 failed then exit + //adjust_inout with flag ok=%f + + nlnk=size(connectmat,1) //nlnk is the number of link + + //loop on number of block (pass 1 and pass 2) + for hhjj=1:length(bllst)+1 + //%%%%% pass 1 %%%%%// + for hh=1:length(bllst)+1 //second loop on number of block + ok=%t + for jj=1:nlnk //loop on number of link + + //intyp/outtyp are the type of the + //target port and the source port of the observed link + outtyp = bllst(connectmat(jj,1)).outtyp(connectmat(jj,2)) + intyp = bllst(connectmat(jj,3)).intyp(connectmat(jj,4)) + //nnin/nnout are the size (two dimensions) of the + //target port and the source port of the observed link + //before adjust + nnout(1,1)=bllst(connectmat(jj,1)).out(connectmat(jj,2)) + nnout(1,2)=bllst(connectmat(jj,1)).out2(connectmat(jj,2)) + nnin(1,1)=bllst(connectmat(jj,3)).in(connectmat(jj,4)) + nnin(1,2)=bllst(connectmat(jj,3)).in2(connectmat(jj,4)) + + //This Part is done in adjust_typ + + //check intyp/outtyp + // if intyp<>outtyp then + // if (intyp==1 & outtyp==2) then + // bllst(connectmat(jj,3)).intyp(connectmat(jj,4))=2; + // elseif (intyp==2 & outtyp==1) then + // bllst(connectmat(jj,1)).outtyp(connectmat(jj,2))=2; + // else + // if bllst(connectmat(jj,3)).sim(2)<0 //if-then-else/eselect case + // bllst(connectmat(jj,3)).intyp(connectmat(jj,4))=... + // bllst(connectmat(jj,1)).outtyp(connectmat(jj,2)) + // else + // bad_connection(corinv(connectmat(jj,1)),connectmat(jj,2),.. + // nnout,outtyp,.. + // corinv(connectmat(jj,3)),connectmat(jj,4),.. + // nnin,intyp,1) + // ok=%f; + // return + // end + // end + // end + + //loop on the two dimensions of source/target port + for ndim=1:2 + //check test source/target sizes + //in case of negatif equal target dimensions + //nin/nout are the size (two dimensions) of the + //target port and the source port of the observed link + nout(1,1)=bllst(connectmat(jj,1)).out(connectmat(jj,2)) + nout(1,2)=bllst(connectmat(jj,1)).out2(connectmat(jj,2)) + nin(1,1)=bllst(connectmat(jj,3)).in(connectmat(jj,4)) + nin(1,2)=bllst(connectmat(jj,3)).in2(connectmat(jj,4)) + + //first case : dimension of source and + // target ports are explicitly informed + // informed with positive size + if(nout(1,ndim)>0&nin(1,ndim)>0) then + //if dimension of source and target port doesn't match + //then call bad_connection, set flag ok to false and exit + if nin(1,ndim)<>nout(1,ndim) then + bad_connection(corinv(connectmat(jj,1)),connectmat(jj,2),.. + nnout,outtyp,.. + corinv(connectmat(jj,3)),connectmat(jj,4),.. + nnin,intyp) + ok=%f;return + end + + //second case : dimension of source port is + // positive and dimension of + // target port is negative + elseif(nout(1,ndim)>0&nin(1,ndim)<0) then + //find vector of input ports of target block with + //first/second dimension equal to size nin(1,ndim) + //and assign it to nout(1,ndim) + ww=find(bllst(connectmat(jj,3)).in==nin(1,ndim)) + bllst(connectmat(jj,3)).in(ww)=nout(1,ndim) + ww=find(bllst(connectmat(jj,3)).in2==nin(1,ndim)) + bllst(connectmat(jj,3)).in2(ww)=nout(1,ndim) + + //find vector of output ports of target block with + //first/second dimension equal to size nin(1,ndim) + //and assign it to nout(1,ndim) + ww=find(bllst(connectmat(jj,3)).out==nin(1,ndim)) + bllst(connectmat(jj,3)).out(ww)=nout(1,ndim) + ww=find(bllst(connectmat(jj,3)).out2==nin(1,ndim)) + bllst(connectmat(jj,3)).out2(ww)=nout(1,ndim) + + //find vector of output ports of target block with + //ndim dimension equal to zero and sum the ndim + //dimension of all input ports of target block + //to be the new dimension of the ndim dimension + //of the output ports of the target block + if ndim==1 then + ww=find(bllst(connectmat(jj,3)).out==0) + if (ww<>[]&min(bllst(connectmat(jj,3)).in(:))>0) then + bllst(connectmat(jj,3)).out(ww)=sum(bllst(connectmat(jj,3)).in(:)) + end + elseif ndim==2 then + ww=find(bllst(connectmat(jj,3)).out2==0) + if (ww<>[]&min(bllst(connectmat(jj,3)).in2(:))>0) then + bllst(connectmat(jj,3)).out2(ww)=sum(bllst(connectmat(jj,3)).in2(:)) + end + end + + //if nzcross of the target block match with + //the negative dimension nin(1,ndim) then + //adjust it to nout(1,ndim) + if bllst(connectmat(jj,3)).nzcross==nin(1,ndim) then + bllst(connectmat(jj,3)).nzcross=nout(1,ndim) + end + //if nmode of the target block match with + //the negative dimension nin(1,ndim) then + //adjust it to nout(1,ndim) + if bllst(connectmat(jj,3)).nmode==nin(1,ndim) then + bllst(connectmat(jj,3)).nmode=nout(1,ndim) + end + + //third case : dimension of source port is + // negative and dimension of + // target port is positive + elseif(nout(1,ndim)<0&nin(1,ndim)>0) then + //find vector of output ports of source block with + //first/second dimension equal to size nout(1,ndim) + //and assign it to nin(1,ndim) + ww=find(bllst(connectmat(jj,1)).out==nout(1,ndim)) + bllst(connectmat(jj,1)).out(ww)=nin(1,ndim) + ww=find(bllst(connectmat(jj,1)).out2==nout(1,ndim)) + bllst(connectmat(jj,1)).out2(ww)=nin(1,ndim) + + //find vector of input ports of source block with + //first/second dimension equal to size nout(1,ndim) + //and assign it to nin(1,ndim) + ww=find(bllst(connectmat(jj,1)).in==nout(1,ndim)) + bllst(connectmat(jj,1)).in(ww)=nin(1,ndim) + ww=find(bllst(connectmat(jj,1)).in2==nout(1,ndim)) + bllst(connectmat(jj,1)).in2(ww)=nin(1,ndim) + + //find vector of input ports of source block with + //ndim dimension equal to zero and sum the ndim + //dimension of all output ports of source block + //to be the new dimension of the ndim dimension + //of the input ports of the source block + if ndim==1 then + ww=find(bllst(connectmat(jj,1)).in==0) + if (ww<>[]&min(bllst(connectmat(jj,1)).out(:))>0) then + bllst(connectmat(jj,1)).in(ww)=sum(bllst(connectmat(jj,1)).out(:)) + end + elseif ndim==2 then + ww=find(bllst(connectmat(jj,1)).in2==0) + if (ww<>[]&min(bllst(connectmat(jj,1)).out2(:))>0) then + bllst(connectmat(jj,1)).in2(ww)=sum(bllst(connectmat(jj,1)).out2(:)) + end + end + + //if nzcross of the source block match with + //the negative dimension nout(1,ndim) then + //adjust it to nin(1,ndim) + if bllst(connectmat(jj,1)).nzcross==nout(1,ndim) then + bllst(connectmat(jj,1)).nzcross=nin(1,ndim) + end + //if nmode of the source block match with + //the negative dimension nout(1,ndim) then + //adjust it to nin(1,ndim) + if bllst(connectmat(jj,1)).nmode==nout(1,ndim) then + bllst(connectmat(jj,1)).nmode=nin(1,ndim) + end + + //fourth case : a dimension of source port is + // null + elseif(nout(1,ndim)==0) then + //set ww to be the vector of size of the ndim + //dimension of input port of the source block + if ndim==1 then + ww=bllst(connectmat(jj,1)).in(:) + elseif ndim==2 then + ww=bllst(connectmat(jj,1)).in2(:) + end + + //test if all size of the ndim dimension of input + //port of the source block is positive + if min(ww)>0 then + //test if the dimension of the target port + //is positive + if nin(1,ndim)>0 then + + //if the sum of the size of the ndim dimension of the input + //port of the source block is equal to the size of the ndim dimension + //of the target port, then the size of the ndim dimension of the source + //port is equal to nin(1,ndim) + if sum(ww)==nin(1,ndim) then + if ndim==1 then + bllst(connectmat(jj,1)).out(connectmat(jj,2))=nin(1,ndim) + elseif ndim==2 then + bllst(connectmat(jj,1)).out2(connectmat(jj,2))=nin(1,ndim) + end + //else call bad_connection, set flag ok to false and exit + else + bad_connection(corinv(connectmat(jj,1)),0,0,1,-1,0,0,1) + ok=%f;return + end + + //if the ndim dimension of the target port is negative + //then the size of the ndim dimension of the source port + //is equal to the sum of the size of the ndim dimension + //of input ports of source block, and flag ok is set to false + else + if ndim==1 then + bllst(connectmat(jj,1)).out(connectmat(jj,2))=sum(ww) + elseif ndim==2 then + bllst(connectmat(jj,1)).out2(connectmat(jj,2))=sum(ww) + end + ok=%f + end + + else + //set nww to be the vector of all negative size of input ports + //of the source block + nww=ww(find(ww<0)) + + //if all negative size have same size and if size of the + //ndim dimension of the target port is positive then assign + //size of the ndim dimension of the source port to nin(1,ndim) + if norm(nww-nww(1),1)==0 & nin(1,ndim)>0 then + if ndim==1 then + bllst(connectmat(jj,1)).out(connectmat(jj,2))=nin(1,ndim) + elseif ndim==2 then + bllst(connectmat(jj,1)).out2(connectmat(jj,2))=nin(1,ndim) + end + + //compute a size to be the difference between the size + //of the ndim dimension of the target block and sum of positive + //size of input ports of the source block divided by the number + //of input ports of source block with same negative size + k=(nin(1,ndim)-sum(ww(find(ww>0))))/size(nww,"*") + + //if this size is a positive integer then assign it + //to the size of the ndim dimension of input ports of the + //source block which have negative size + if k==int(k)&k>0 then + if ndim==1 then + bllst(connectmat(jj,1)).in(find(ww<0))=k + elseif ndim==2 then + bllst(connectmat(jj,1)).in2(find(ww<0))=k + end + //else call bad_connection, set flag ok to false and exit + else + bad_connection(corinv(connectmat(jj,1)),0,0,1,-1,0,0,1) + ok=%f;return + end + + //set flag ok to false + else + ok=%f + end + + end + + //fifth case : a dimension of target port is + // null + elseif(nin(1,ndim)==0) then + //set ww to be the vector of size of the ndim + //dimension of output port of the target block + if ndim==1 then + ww=bllst(connectmat(jj,3)).out(:) + elseif ndim==2 then + ww=bllst(connectmat(jj,3)).out2(:) + end + + //test if all size of the ndim dimension of output + //port of the target block is positive + if min(ww)>0 then + //test if the dimension of the source port + //is positive + if nout(1,ndim)>0 then + + //if the sum of the size of the ndim dimension of the output + //port of the target block is equal to the size of the ndim dimension + //of the source port, then the size of the ndim dimension of the target + //port is equal to nout(1,ndim) + if sum(ww)==nout(1,ndim) then + if ndim==1 then + bllst(connectmat(jj,3)).in(connectmat(jj,4))=nout(1,ndim) + elseif ndim==2 then + bllst(connectmat(jj,3)).in2(connectmat(jj,4))=nout(1,ndim) + end + //else call bad_connection, set flag ok to false and exit + else + bad_connection(corinv(connectmat(jj,3)),0,0,1,-1,0,0,1) + ok=%f;return + end + + //if the ndim dimension of the source port is negative + //then the size of the ndim dimension of the target port + //is equal to the sum of the size of the ndim dimension + //of output ports of target block, and flag ok is set to false + else + if ndim==1 then + bllst(connectmat(jj,3)).in(connectmat(jj,4))=sum(ww) + elseif ndim==2 then + bllst(connectmat(jj,3)).in2(connectmat(jj,4))=sum(ww) + end + ok=%f + end + + else + //set nww to be the vector of all negative size of output ports + //of the target block + nww=ww(find(ww<0)) + + //if all negative size have same size and if size of the + //ndim dimension of the source port is positive then assign + //size of the ndim dimension of the target port to nout(1,ndim) + if norm(nww-nww(1),1)==0 & nout(1,ndim)>0 then + if ndim==1 then + bllst(connectmat(jj,3)).in(connectmat(jj,4))=nout(1,ndim) + elseif ndim==2 then + bllst(connectmat(jj,3)).in2(connectmat(jj,4))=nout(1,ndim) + end + + //compute a size to be the difference between the size + //of the ndim dimension of the source block and sum of positive + //size of output ports of the target block divided by the number + //of output ports of target block with same negative size + k=(nout(1,ndim)-sum(ww(find(ww>0))))/size(nww,"*") + + //if this size is a positive integer then assign it + //to the size of the ndim dimension of output ports of the + //target block which have negative size + if k==int(k)&k>0 then + if ndim==1 then + bllst(connectmat(jj,3)).out(find(ww<0))=k + elseif ndim==2 then + bllst(connectmat(jj,3)).out2(find(ww<0))=k + end + //else call bad_connection, set flag ok to false and exit + else + bad_connection(corinv(connectmat(jj,3)),0,0,1,-1,0,0,1) + ok=%f;return + end + + //set flag ok to false + else + ok=%f + end + + end + + //sixth (& last) case : dimension of both source + // and target port are negatives + else + ok=%f //set flag ok to false + end + end + end + if ok then return, end //if ok is set true then exit adjust_inout + end + //if failed then display message + messagebox(msprintf(_("Not enough information to find port sizes.\n"+.. + "I try to find the problem.")),"modal","info"); + + //%%%%% pass 2 %%%%%// + //Alan 19/01/07 : Warning : Behavior have changed, To Be more Tested + findflag=%f //set findflag to false + + for jj=1:nlnk //loop on number of block + //nin/nout are the size (two dimensions) of the + //target port and the source port of the observed link + nout(1,1)=bllst(connectmat(jj,1)).out(connectmat(jj,2)) + nout(1,2)=bllst(connectmat(jj,1)).out2(connectmat(jj,2)) + nin(1,1)=bllst(connectmat(jj,3)).in(connectmat(jj,4)) + nin(1,2)=bllst(connectmat(jj,3)).in2(connectmat(jj,4)) + + //loop on the two dimensions of source/target port + //only case : target and source ports are both + // negatives or null + if nout(1,1)<=0&nin(1,1)<=0 | nout(1,2)<=0&nin(1,2)<=0 then + findflag=%t; + // + ninnout=under_connection(corinv(connectmat(jj,1)),connectmat(jj,2),nout(1,ndim),.. + corinv(connectmat(jj,3)),connectmat(jj,4),nin(1,ndim),1) + // + if size(ninnout,2) <> 2 then ok=%f;return;end + if ninnout==[] then ok=%f;return;end + if ninnout(1,1)<=0 | ninnout(1,2)<=0 then ok=%f;return;end + // + ww=find(bllst(connectmat(jj,1)).out==nout(1,1)) + bllst(connectmat(jj,1)).out(ww)=ninnout(1,1) + ww=find(bllst(connectmat(jj,1)).out2==nout(1,1)) + bllst(connectmat(jj,1)).out2(ww)=ninnout(1,1) + + ww=find(bllst(connectmat(jj,1)).out==nout(1,2)) + bllst(connectmat(jj,1)).out(ww)=ninnout(1,2) + ww=find(bllst(connectmat(jj,1)).out2==nout(1,2)) + bllst(connectmat(jj,1)).out2(ww)=ninnout(1,2) + // + + if bllst(connectmat(jj,1)).nzcross==nout(1,1) then + bllst(connectmat(jj,1)).nzcross=ninnout(1,1) + end + if bllst(connectmat(jj,1)).nzcross==nout(1,2) then + bllst(connectmat(jj,1)).nzcross=ninnout(1,2) + end + // + if bllst(connectmat(jj,1)).nmode==nout(1,1) then + bllst(connectmat(jj,1)).nmode=ninnout(1,1) + end + if bllst(connectmat(jj,1)).nmode==nout(1,2) then + bllst(connectmat(jj,1)).nmode=ninnout(1,2) + end + // + ww=find(bllst(connectmat(jj,1)).in==nout(1,1)) + bllst(connectmat(jj,1)).in(ww)=ninnout(1,1) + ww=find(bllst(connectmat(jj,1)).in2==nout(1,1)) + bllst(connectmat(jj,1)).in2(ww)=ninnout(1,1) + + ww=find(bllst(connectmat(jj,1)).in==nout(1,2)) + bllst(connectmat(jj,1)).in(ww)=ninnout(1,2) + ww=find(bllst(connectmat(jj,1)).in2==nout(1,2)) + bllst(connectmat(jj,1)).in2(ww)=ninnout(1,2) + // + ww=find(bllst(connectmat(jj,1)).in==0) + if (ww<>[]&min(bllst(connectmat(jj,1)).out(:))>0) then + bllst(connectmat(jj,1)).in(ww)=sum(bllst(connectmat(jj,1)).out) + end + + ww=find(bllst(connectmat(jj,1)).in2==0) + if (ww<>[]&min(bllst(connectmat(jj,1)).out2(:))>0) then + bllst(connectmat(jj,1)).in2(ww)=sum(bllst(connectmat(jj,1)).out2) + end + // + ww=find(bllst(connectmat(jj,3)).in==nin(1,1)) + bllst(connectmat(jj,3)).in(ww)=ninnout(1,1) + ww=find(bllst(connectmat(jj,3)).in2==nin(1,1)) + bllst(connectmat(jj,3)).in2(ww)=ninnout(1,1) + + ww=find(bllst(connectmat(jj,3)).in==nin(1,2)) + bllst(connectmat(jj,3)).in(ww)=ninnout(1,2) + ww=find(bllst(connectmat(jj,3)).in2==nin(1,2)) + bllst(connectmat(jj,3)).in2(ww)=ninnout(1,2) + // + if bllst(connectmat(jj,3)).nzcross==nin(1,1) then + bllst(connectmat(jj,3)).nzcross=ninnout(1,1) + end + if bllst(connectmat(jj,3)).nzcross==nin(1,2) then + bllst(connectmat(jj,3)).nzcross=ninnout(1,2) + end + if bllst(connectmat(jj,3)).nmode==nin(1,1) then + bllst(connectmat(jj,3)).nmode=ninnout(1,1) + end + if bllst(connectmat(jj,3)).nmode==nin(1,2) then + bllst(connectmat(jj,3)).nmode=ninnout(1,2) + end + // + ww=find(bllst(connectmat(jj,3)).out==nin(1,1)) + bllst(connectmat(jj,3)).out(ww)=ninnout(1,1) + ww=find(bllst(connectmat(jj,3)).out2==nin(1,1)) + bllst(connectmat(jj,3)).out2(ww)=ninnout(1,1) + + ww=find(bllst(connectmat(jj,3)).out==nin(1,2)) + bllst(connectmat(jj,3)).out(ww)=ninnout(1,2) + ww=find(bllst(connectmat(jj,3)).out2==nin(1,2)) + bllst(connectmat(jj,3)).out2(ww)=ninnout(1,2) + // + ww=find(bllst(connectmat(jj,3)).out==0) + if (ww<>[]&min(bllst(connectmat(jj,3)).in(:))>0) then + bllst(connectmat(jj,3)).out(ww)=sum(bllst(connectmat(jj,3)).in(:)) + end + ww=find(bllst(connectmat(jj,3)).out2==0) + if (ww<>[]&min(bllst(connectmat(jj,3)).in2(:))>0) then + bllst(connectmat(jj,3)).out2(ww)=sum(bllst(connectmat(jj,3)).in2(:)) + end + end + end + + //if failed then display message + if ~findflag then + messagebox(msprintf(_("I cannot find a link with undetermined size.\n"+.. + "My guess is that you have a block with unconnected \n"+.. + "undetermined output ports.")),"modal","error"); + ok=%f;return; + end + end +endfunction + +function id = getBlockIds(path) + // Return a block id path from a block index path + // + // path: the path in the index form + // id: th path in the uid form + + scs_m; // check scs_m access + id=[]; + + k = path(:); + for i = k + b = scs_m.objs(i); + if typeof(b) == "Block" & size(scs_m.objs(i).doc) >= 1 then + id($ + 1) = scs_m.objs(i).doc(1); + end + if typeof(b.model.rpar) == "diagram" then + scs_m = b.model.rpar; + end + end +endfunction + +//19/01/07, Alan : under_connection show bad link and returns two dimensions now +function ninnout=under_connection(path_out,prt_out,nout,path_in,prt_in,nin,flagg) + // alert for badly connected blocks + // path_out : Path of the "from block" in scs_m + // path_in : Path of the "to block" in scs_m + //! + + if path_in==-1 then + msg = ""; + msg = msg + gettext("One of this block output has negative size.
Please check."); + msg = msg + ""; + hilite_path(path_out, msg); + ninnout=0 + return + end + + if path_in==-2 then + msg = ""; + msg = msg + gettext("Block input has negative size:"); + msg = msg + "
    "; + msg = msg + "
  • " + msprintf(gettext("Input port %s size is: %s"), string(prt_out), sci2exp(nout)) + "
    • "; + msg = msg + "
"; + msg = msg + ""; + hilite_path(path_out, msg); + ninnout=0 + return + end + + // different use case (Unable to report on a non opened diagram) + if isdef("Code_gene_run") then + messagebox([gettext("Unable to report an error into a SuperBlock"); gettext("Please compile the diagram to report the error.")], "Compilation error", "error", "modal"); + ninnout=0 + return + end + + msg = ""; + if flagg==1 then + msg = msg + gettext("Please update the diagram to avoid this warning.
Block output port has a non-determined size:"); + msg = msg + "
    "; + msg = msg + "
  • " + msprintf(gettext("Output port %s size is: %s"), string(prt_out), sci2exp(nout)) + "
    • "; + msg = msg + "
  • " + msprintf(gettext("Input port %s size is: %s"), string(prt_in), sci2exp(nin)) + "
    • "; + else + msg = msg + gettext("Please update the diagram to avoid this warning.
    Block output port has a non-determined type:"); + msg = msg + "
      "; + msg = msg + "
    • " + msprintf(gettext("Output port %s type."), string(prt_out)) + "
      • "; + msg = msg + "
    • " + msprintf(gettext("Input port %s type."), string(prt_in)) + "
      • "; + end + msg = msg + "
    "; + msg = msg + ""; + hilite_path(path_out, msg) + + if or(path_in<>path_out) then + msg = ""; + if flagg==1 then + msg = msg + gettext("Please update the diagram to avoid this warning.
    Block input port has a non-determined size:"); + msg = msg + "
      "; + msg = msg + "
    • " + msprintf(gettext("Output port %s size is: %s"), string(prt_out), sci2exp(nout)) + "
      • "; + msg = msg + "
    • " + msprintf(gettext("Input port %s size is: %s"), string(prt_in), sci2exp(nin)) + "
      • "; + else + msg = msg + gettext("Please update the diagram to avoid this warning.
      Block input port has a non-determined type:"); + msg = msg + "
        "; + msg = msg + "
      • " + msprintf(gettext("Output port %s type."), string(prt_out)) + "
        • "; + msg = msg + "
      • " + msprintf(gettext("Input port %s type."), string(prt_in)) + "
        • "; + end + msg = msg + "
      "; + msg = msg + ""; + hilite_path(path_in, msg) + end + + mess=msprintf(_("Highlighted block(s) have connected ports \nwith sizes that cannot be determined by the context.\nWhat is the size of this link?")) + + if flagg==1 then + ninnout=evstr(dialog(mess,"[1,1]")) + else + ninnout=evstr(dialog(mess,"1")) + end +endfunction + +function [clkconnect,exe_cons]=pak_ersi(connectmat,clkconnect,.. + typ_r,typ_l,outoin,outoinptr,tblock,typ_cons,clkptr) + + //add every event to the time event because time includes all events + all_out=[] + for k=1:size(clkptr,1)-1 + if ~typ_l(k) then + kk=[1:(clkptr(k+1)-clkptr(k))]' + all_out=[all_out;[k*ones(kk),kk]] + end + end + all_out=[all_out;[0,0]] + + //add time event if needed + ind=find(tblock) + ind=ind(:) + for k=ind' + clkconnect=[clkconnect;[all_out,ones(all_out)*[k,0;0,0]]] + end + if show_trace then mprintf("c_pass4444:\t%f\n", timer()),end + ind1=find(typ_cons) + ind=[ind;ind1(:)] + exe_cons=[ind,zeros(ind)] + + vec=-ones(1,nblk); + vec(ind)=0 + [r,ok]=newc_tree4(vec,outoin,outoinptr,typ_r) + + exe_cons=[exe_cons;r] + + if show_trace then mprintf("c_pass4445:\t%f\n", timer()),end + + [clkr,clkc]=size(clkconnect); + mm=max(clkconnect(:,2))+1; + cll=clkconnect(:,1)*mm+clkconnect(:,2); + [cll,ind]=gsort(-cll); + clkconnect=clkconnect(ind,:); + if cll<>[] then mcll=max(-cll)+1, else mcll=1;end + cll=[-1;-cll;mcll]; + ii=find(cll(2:$)-cll(1:$-1)<>0) + + for k=1:size(ii,"*")-1 + oo=[ii(k):ii(k+1)-1] + vec=-ones(1,nblk); + vec(clkconnect(oo,3))=0 + [r,ok]=newc_tree4(vec,outoin,outoinptr,typ_r) + m=size(r,1) + r=[clkconnect(ii(k),1)*ones(m,1),clkconnect(ii(k),2)*ones(m,1),r] + clkconnect=[clkconnect;r] + end + // temporary fix to take care of conditional blocks inherting from + // constants: make these blocks always active + + ind=setdiff(find(typ_l),clkconnect(:,3)) + ind=ind(:) + for k=ind' + clkconnect=[clkconnect;[all_out,ones(all_out)*[k,0;0,0]]] + end + // end of temoprary fix + if show_trace then mprintf("c_pass4446:\t%f\n", timer()),end +endfunction + +function [r,ok]=tree4(vec,outoin,outoinptr,typ_r) + //compute blocks which inherit + ok=%t; + nb=size(vec,"*"); + r=[]; + for j=1:nb-1 + fini=%t + for i=1:nb + if vec(i)==j-1 then + for k=outoinptr(i):outoinptr(i+1)-1 + ii=outoin(k,1); + if (vec(ii)>-1)|typ_r(ii) then + fini=%f; + vec(ii)=j; + end + if typ_r(ii) then + r=[r;outoin(k,:)] + end + end + end + end + if fini then break;end + end +endfunction + +function [bllst,inplnk,outlnk,clkptr,cliptr,inpptr,outptr,dep_u,dep_uptr,dep_t,.. + typ_l,typ_r,typ_m,tblock,typ_cons,typ_zx,ok]=mini_extract_info(bllst,.. + connectmat,clkconnect) + ok=%t + nbl=length(bllst) + clkptr=zeros(nbl+1,1);clkptr(1)=1 + cliptr=clkptr;inpptr=cliptr;outptr=inpptr; + fff=ones(nbl,1)==1 + typ_l=fff;typ_r=fff;typ_cons=fff;typ_m=fff;typ_zx=fff; + dep_t=ones(nbl,1)==1; + dep_u=[];dep_uptr=1; + tblock=fff + //tblock=[] // specifies blocks that must be connected to time event. + // + for i=1:nbl + ll=bllst(i) + if (ll.state==[]&ll.nzcross==0) then typ_zx(i)=%f;end + inpnum=ll.in;outnum=ll.out;cinpnum=ll.evtin;coutnum=ll.evtout; + // + if cinpnum==[] then + // this block inherits + //ok=%f + + typ_r(i)=~ll.dep_ut($) + tblock(i)=ll.dep_ut($) + //if block depends on time but has no event input port + if ~ll.dep_ut($) then + //inherits from the inputs + cinpnum=ones(inpnum) + bllst(i).evtin=cinpnum //XXXXXXXXXXXXXXXXXXXXX + end + // + else + tblock(i)=ll.dep_ut($);typ_r(i)=%f + end + inpptr(i+1)=inpptr(i)+size(inpnum,"*") + outptr(i+1)=outptr(i)+size(outnum,"*") + cliptr(i+1)=cliptr(i)+size(cinpnum,"*") + clkptr(i+1)=clkptr(i)+size(coutnum,"*") + // + + typ_l(i)=ll.blocktype=="l";typ_m(i)=ll.blocktype=="m"; + typ_cons(i)=cinpnum==[]&inpnum==[]&~ll.dep_ut($) + //test of the dep_ut size + sizenin=size(ll.in,"*"); + if (size(ll.dep_ut,"*") <> 2) then + if ( size(ll.dep_ut(1:$-1),"*") <> sizenin) then + messagebox(msprintf(_("the dep_ut size of the %s block is not correct.\n"+.. + "It should be a colon vector of size %d."),.. + ll.sim(1),sizenin+1),"modal","error"); + ok=%f; + end + end + + dep_t(i)=ll.dep_ut($); + + if (size(ll.dep_ut,"*") == 2) then + if (sizenin == 1) then + dep_u($+1)=ll.dep_ut(1); + dep_uptr($+1)=dep_uptr($)+1; + elseif (sizenin > 1) then + dep_u=[dep_u;ones(sizenin,1)==1*ll.dep_ut(1)]; + dep_uptr($+1)=dep_uptr($)+sizenin; + else + dep_uptr($+1)=dep_uptr($); + end + else + dep_u_i=ll.dep_ut(1:$-1); + dep_u=[dep_u;dep_u_i(:)]; + dep_uptr($+1)=dep_uptr($)+sizenin; + end + + // + end + if show_trace then mprintf("c_pass22222222:\t%f\n", timer()),end //' + nlnk=size(connectmat,1) + inplnk=zeros(inpptr($)-1,1);outlnk=zeros(outptr($)-1,1);ptlnk=1; + + for jj=1:nlnk + ko=outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1) + ki=inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1) + if ko<>0 & ki<>0 then + if ko>ki then + outlnk(outlnk>ko)=outlnk(outlnk>ko)-1 + outlnk(outlnk==ko)=ki + inplnk(inplnk>ko)=inplnk(inplnk>ko)-1 + inplnk(inplnk==ko)=ki + ptlnk=-1+ptlnk + elseif ki>ko + outlnk(outlnk>ki)=outlnk(outlnk>ki)-1 + outlnk(outlnk==ki)=ko + inplnk(inplnk>ki)=inplnk(inplnk>ki)-1 + inplnk(inplnk==ki)=ko + ptlnk=-1+ptlnk + end + elseif ko<>0 then + inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1)=ko + elseif ki<>0 then + outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1)=ki + else + outlnk(outptr(connectmat(jj,1))+connectmat(jj,2)-1)=ptlnk + inplnk(inpptr(connectmat(jj,3))+connectmat(jj,4)-1)=ptlnk + ptlnk=1+ptlnk + end + end + + //store unconnected outputs, if any, at the end of outtb + for unco=find(outlnk==0); + outlnk(unco)=max(outlnk)+1 + end + + //store unconnected inputs, if any, at the end of outtb + for unco=find(inplnk==0); + inplnk(unco)=max([inplnk;max(outlnk)])+1 + end +endfunction + +function [evoutoin,evoutoinptr]=synch_clkconnect(typ_l,clkconnect) + nblk=size(typ_l,"*") + evoutoin=[];evoutoinptr=1 + for i=1:nblk + if typ_l(i) then + dd=clkconnect(clkconnect(:,1)==i,3) + else + dd=[] + end + evoutoin=[evoutoin;dd] + evoutoinptr=[evoutoinptr;evoutoinptr($)+size(dd,"*")] + end +endfunction + +function clkconnect=cleanup(clkconnect) + mm=max(clkconnect)+1 + cc=clkconnect(:,4)+mm*clkconnect(:,3)+clkconnect(:,2)*mm^2+.. + clkconnect(:,1)*mm^3 + [cc1,ind]=gsort(-cc) + clkconnect=clkconnect(ind,:) + ind=find(cc1(2:$)-cc1(1:$-1)==0) + clkconnect(ind,:)=[] +endfunction + +//function mat=cleanup1(mat) +// mm=max(mat)+1 +// cc=mat(:,1)*mm +// [cc1,ind]=gsort(-cc) +// mat=mat(ind,:) +// ind=find(cc1(2:$)-cc1(1:$-1)==0) +// mat(ind,:)=[] +//endfunction + +function vec=intersection(vec1,vec2) + vec=[] + for i=1:size(vec1,1) + if find(vec1(i)==vec2)~=[] then + vec=[vec;vec1(i)] + end + end +endfunction + +function [r,ok]=newc_tree2(vec,outoin,outoinptr,dep_u,dep_uptr) + dd=zeros(dep_u);dd(dep_u)=1; + [r,ok2]=ctree2(vec,outoin,outoinptr,dd,dep_uptr) + ok=ok2==1 +endfunction + +function [r,ok]=new_tree2(vec,outoin,outoinptr,dep_u,dep_uptr) + dd=zeros(dep_u);dd(dep_u)=1; + [r,ok2]=sci_tree2(vec,outoin,outoinptr,dd) + ok=ok2==1 +endfunction + +function [r,ok]=new_tree3(vec,dep_ut,typ_l) + dd=zeros(dep_ut);dd(dep_ut)=1; + [r2,ok2]=sci_tree3(vec,dd,typ_l,bexe,boptr,blnk,blptr) + r=r2' + ok=ok2==1 +endfunction + +function [r,ok]=newc_tree3(vec,dep_u,dep_uptr,typ_l) + dd=zeros(dep_u);dd(dep_u)=1; + [r2,ok2]=ctree3(vec,dd,dep_uptr,typ_l,bexe,boptr,blnk,blptr) + r=r2' + ok=ok2==1 +endfunction + +function [r,ok]=new_tree4(vec,outoin,outoinptr,typ_r) + nd=zeros(size(vec,"*"),(max(outoin(:,2))+1)); + ddd=zeros(typ_r);ddd(typ_r)=1; + [r1,r2]=sci_tree4(vec,outoin,outoinptr,nd,ddd) + r=[r1',r2'] + ok=%t +endfunction + +function [r,ok]=newc_tree4(vec,outoin,outoinptr,typ_r) + nd=zeros(size(vec,"*"),(max(outoin(:,2))+1)); + ddd=zeros(typ_r);ddd(typ_r)=1; + [r1,r2]=ctree4(vec,outoin,outoinptr,nd,ddd) + r=[r1',r2'] + ok=%t +endfunction + +function [critev]=critical_events(connectmat,clkconnect,dep_t,typ_r,.. + typ_l,typ_zx,outoin,outoinptr,clkptr) + + typ_c=typ_l<>typ_l; + typ_r=typ_r|dep_t + + done1=%f + while ~done1 + done1=%t + [clkr,clkc]=size(clkconnect); + mm=max(clkconnect)+1; + + cll=clkconnect(:,1)*mm+clkconnect(:,2); + [cll,ind]=gsort(-cll); + clkconnect=clkconnect(ind,:); + cll=[-1;-cll;mm]; + ii=find(cll(2:$)-cll(1:$-1)<>0) + + for k=1:size(ii,"*")-1 + oo=[ii(k):ii(k+1)-1] + vec=-ones(1,nblk); + vec(clkconnect(oo,3))=0 + [r,ok]=newc_tree4(vec,outoin,outoinptr,typ_r) + + m=size(r,1) + r=[clkconnect(ii(k),1)*ones(m,1),clkconnect(ii(k),2)*ones(m,1),r] + clkconnect=[clkconnect;r] + end + + done=%f; + while ~done + done=%t; + for jj=find(typ_l&(~typ_c)); + if ~or(jj==clkconnect(:,3)) then + typ_r(clkconnect(find(jj==clkconnect(:,1)),3))=%t + clkconnect(find(jj==clkconnect(:,1)),:)=[]; + typ_c(jj)=%t; + done1=%f + done=%f + end + end + end + end + critev=zeros(clkptr($)-1,1); + for bb=1:size(clkptr,1)-1 + for i=clkptr(bb):clkptr(bb+1)-1 + if or(typ_zx(clkconnect(find((clkconnect(:,1)==bb)&.. + (clkconnect(:,2)==i-clkptr(bb)+1)),3))) then + critev(i)=1 + end + end + end +endfunction + +// adjust_typ: It resolves positive and negative port types. +// Its Algorithm is based on the algorithm of adjust_inout +// Fady NASSIF: 14/06/2007 + +function [ok,bllst]=adjust_typ(bllst,connectmat) + + for i=1:length(bllst) + if size(bllst(i).in,"*")<>size(bllst(i).intyp,"*") then + bllst(i).intyp=bllst(i).intyp(1)*ones(bllst(i).in); + end + if size(bllst(i).out,"*")<>size(bllst(i).outtyp,"*") then + bllst(i).outtyp=bllst(i).outtyp(1)*ones(bllst(i).out); + end + end + nlnk=size(connectmat,1) + for hhjj=1:length(bllst)+1 + for hh=1:length(bllst)+1 + ok=%t + for jj=1:nlnk + nnout(1,1)=bllst(connectmat(jj,1)).out(connectmat(jj,2)) + nnout(1,2)=bllst(connectmat(jj,1)).out2(connectmat(jj,2)) + nnin(1,1)=bllst(connectmat(jj,3)).in(connectmat(jj,4)) + nnin(1,2)=bllst(connectmat(jj,3)).in2(connectmat(jj,4)) + outtyp = bllst(connectmat(jj,1)).outtyp(connectmat(jj,2)) + intyp = bllst(connectmat(jj,3)).intyp(connectmat(jj,4)) + + //first case : types of source and + // target ports are explicitly informed + // with positive types + if (intyp>0 & outtyp>0) then + //if types of source and target port don't match and aren't double and complex + //then call bad_connection, set flag ok to false and exit + + if intyp<>outtyp then + if (intyp==1 & outtyp==2) then + bllst(connectmat(jj,3)).intyp(connectmat(jj,4))=2; + elseif (intyp==2 & outtyp==1) then + bllst(connectmat(jj,1)).outtyp(connectmat(jj,2))=2; + else + bad_connection(corinv(connectmat(jj,1)),connectmat(jj,2),.. + nnout,outtyp,.. + corinv(connectmat(jj,3)),connectmat(jj,4),.. + nnin,intyp,1) + ok=%f; + return + end + end + + //second case : type of source port is + // positive and type of + // target port is negative + elseif(outtyp>0&intyp<0) then + //find vector of input ports of target block with + //type equal to intyp + //and assign it to outtyp + ww=find(bllst(connectmat(jj,3)).intyp==intyp) + bllst(connectmat(jj,3)).intyp(ww)=outtyp + + //find vector of output ports of target block with + //type equal to intyp + //and assign it to outtyp + ww=find(bllst(connectmat(jj,3)).outtyp==intyp) + bllst(connectmat(jj,3)).outtyp(ww)=outtyp + + //third case : type of source port is + // negative and type of + // target port is positive + elseif(outtyp<0&intyp>0) then + //find vector of output ports of source block with + //type equal to outtyp + //and assign it to intyp + ww=find(bllst(connectmat(jj,1)).outtyp==outtyp) + bllst(connectmat(jj,1)).outtyp(ww)=intyp + + //find vector of input ports of source block with + //type equal to size outtyp + //and assign it to intyp + ww=find(bllst(connectmat(jj,1)).intyp==outtyp) + bllst(connectmat(jj,1)).intyp(ww)=intyp + + + //fourth (& last) case : type of both source + // and target port are negatives + else + ok=%f //set flag ok to false + end + end + if ok then return, end //if ok is set true then exit adjust_typ + end + //if failed then display message + messagebox(msprintf(_("Not enough information to find port type.\n"+.. + "I will try to find the problem.")),"modal","info"); + findflag=%f + for jj=1:nlnk + nouttyp=bllst(connectmat(jj,1)).outtyp(connectmat(jj,2)) + nintyp=bllst(connectmat(jj,3)).intyp(connectmat(jj,4)) + + //loop on the two dimensions of source/target port + //only case : target and source ports are both + // negative or null + if nouttyp<=0 & nintyp<=0 then + findflag=%t; + // + inouttyp=under_connection(corinv(connectmat(jj,1)),connectmat(jj,2),nouttyp,.. + corinv(connectmat(jj,3)),connectmat(jj,4),nintyp,2) + // + if inouttyp<1|inouttyp>8 then ok=%f;return;end + // + ww=find(bllst(connectmat(jj,1)).outtyp==nouttyp) + bllst(connectmat(jj,1)).outtyp(ww)=inouttyp + + // + ww=find(bllst(connectmat(jj,1)).intyp==nouttyp) + bllst(connectmat(jj,1)).intyp(ww)=inouttyp + + ww=find(bllst(connectmat(jj,3)).intyp==nintyp) + bllst(connectmat(jj,3)).intyp(ww)=inouttyp + // + ww=find(bllst(connectmat(jj,3)).outtyp==nintyp) + bllst(connectmat(jj,3)).outtyp(ww)=inouttyp + + // + end + end + //if failed then display message + if ~findflag then + messagebox(msprintf(_("I cannot find a link with undetermined size.\n"+.. + "My guess is that you have a block with unconnected \n"+.. + "undetermined types.")),"modal","error"); + ok=%f;return; + end + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/c_pass3.bin b/modules/scicos/macros/scicos_scicos/c_pass3.bin new file mode 100755 index 000000000..b03dc50d1 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/c_pass3.bin differ diff --git a/modules/scicos/macros/scicos_scicos/c_pass3.sci b/modules/scicos/macros/scicos_scicos/c_pass3.sci new file mode 100755 index 000000000..fb888b20f --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/c_pass3.sci @@ -0,0 +1,257 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Massoud Najafi +// - Alan Layec +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [cpr,ok]=c_pass3(scs_m,cpr) + + // reconstruct the block list structure + + bllst=list(); + corinv=cpr.corinv; + sim=cpr.sim; + + for k=1:size(corinv) + if type(corinv(k))==1 then + + if corinv(k)>size(%cpr.cor) then ok=%f;cpr=list();return;end + + if size(corinv(k),"*")==1 then + bllst(k)=scs_m.objs(corinv(k)).model; + else + path=get_subobj_path(corinv(k));path($+1)="model"; + bllst(k)=scs_m(path); + end + else + + //-Alan/Masoud 19/12/06- + + //We force here update of parameters for THE modelica block + + if findinlistcmd(cpr.corinv,size(cpr.cor),">")<>list() then ok=%f;return; end + + [%state0,state,sim]=modipar(corinv(k),%state0,cpr.state,sim,scs_m,cpr.cor); + cpr.state=state; + m=scicos_model(); + //here it is assumed that modelica blocs have only scalar inputs/outputs + + m.in=ones(sim.inpptr(k+1)-sim.inpptr(k),1); + m.out=ones(sim.outptr(k+1)-sim.outptr(k),1); + if sim.funtyp(k)<10000 then + n=(sim.xptr(k+1)-sim.xptr(k)) + else + n=2*(sim.xptr(k+1)-sim.xptr(k)) + end + + m.state=cpr.state.x(sim.xptr(k)+(0:n-1)); + m.dstate=cpr.state.z(sim.zptr(k):sim.zptr(k+1)-1); + m.rpar=sim.rpar(sim.rpptr(k):sim.rpptr(k+1)-1); + m.ipar=sim.ipar(sim.ipptr(k):sim.ipptr(k+1)-1); + m.label=""; + m.sim=list(sim.funs(k),sim.funtyp(k)); + //here it is assumed that modelica blocs does not have output events + bllst(k)=m; + end + end + + // + [inpptr,outptr,inplnk,outlnk,clkptr]= sim(["inpptr","outptr","inplnk","outlnk","clkptr"]) + + // computes undetermined port sizes + + [ok,bllst]=adjust(bllst,inpptr,outptr,inplnk,outlnk) + + if ~ok then return; end + + [lnksz,lnktyp]=lnkptrcomp(bllst,inpptr,outptr,inplnk,outlnk) + + // + xptr=1;zptr=1;ozptr=1;rpptr=1;ipptr=1;opptr=1; + xc0=[];xcd0=[];xd0=[];oxd0=list(); + rpar=[];ipar=[];opar=list();initexe=[];funtyp=[];labels=[]; + funs=list(); + // + for i=1:length(bllst) + ll=bllst(i) + labels=[labels;ll.label]; + //fun and funtype + if type(ll.sim)==15 then + if ll.sim(1)<>"scifunc" then + funs(i)=ll.sim(1) // replace except for compiled scifunc + else + funs(i)=%cpr.sim.funs(i) + end + funtyp(i,1)=ll.sim(2); + else + funs(i)=ll.sim; + funtyp(i,1)=0; + end + + //state + X0=ll.state(:) + if funtyp(i,1)<10000 then + xcd0=[xcd0;0*X0] + xc0=[xc0;X0] + xptr(i+1)=xptr(i)+size(ll.state,"*") + else + xcd0=[xcd0;X0($/2+1:$)] + xc0=[xc0;X0(1:$/2)] + xptr(i+1)=xptr(i)+size(ll.state,"*")/2 + end + + //discrete state + if (funtyp(i,1)==3 | funtyp(i,1)==5 | funtyp(i,1)==10005) then //sciblocks + if ll.dstate==[] then xd0k=[]; else xd0k=var2vec(ll.dstate);end + else + xd0k=ll.dstate(:) + end + xd0=[xd0;xd0k]; + zptr=[zptr;zptr($)+size(xd0k,"*")] + //object discrete state + if type(ll.odstate)==15 then + if ((funtyp(i,1)==5) | (funtyp(i,1)==10005)) then //sciblocks : don't extract + if lstsize(ll.odstate)>0 then + oxd0($+1)=ll.odstate + ozptr=[ozptr;ozptr($)+1]; + else + ozptr=[ozptr;ozptr($)]; + end + elseif ((funtyp(i,1)==4) | (funtyp(i,1)==10004) | (funtyp(i,1)==2004)) //C blocks : extract + ozsz=lstsize(ll.odstate); + if ozsz>0 then + for j=1:ozsz, oxd0($+1)=ll.odstate(j), end; + ozptr=[ozptr;ozptr($)+ozsz]; + else + ozptr=[ozptr;ozptr($)]; + end + else + ozptr=[ozptr;ozptr($)]; + end + else + //add an error message here please ! + ozptr=[ozptr;ozptr($)]; + end + + //rpar + if (funtyp(i,1)==3 | funtyp(i,1)==5 | funtyp(i,1)==10005) then //sciblocks + if ll.rpar==[] then rpark=[]; else rpark=var2vec(ll.rpar);end + else + rpark=ll.rpar(:) + end + rpar=[rpar;rpark] + rpptr=[rpptr;rpptr($)+size(rpark,"*")] + //ipar + if type(ll.ipar)==1 then + ipar=[ipar;ll.ipar(:)] + ipptr=[ipptr;ipptr($)+size(ll.ipar,"*")] + else + ipptr=[ipptr;ipptr($)] + end + + //opar + if type(ll.opar)==15 then + if ((funtyp(i,1)==5) | (funtyp(i,1)==10005)) then //sciblocks : don't extract + if lstsize(ll.opar)>0 then + opar($+1)=ll.opar + opptr=[opptr;opptr($)+1]; + else + opptr=[opptr;opptr($)]; + end + elseif ((funtyp(i,1)==4) | (funtyp(i,1)==10004) | (funtyp(i,1)==2004)) then //C blocks : extract + oparsz=lstsize(ll.opar); + if oparsz>0 then + for j=1:oparsz, opar($+1)=ll.opar(j), end; + opptr=[opptr;opptr($)+oparsz]; + else + opptr=[opptr;opptr($)]; + end + else + opptr=[opptr;opptr($)]; + end + else + //add an error message here please ! + opptr=[opptr;opptr($)]; + end + // + if ll.evtout<>[] then + ll11=ll.firing + if type(ll11)==4 then + //this is for backward compatibility + prt=find(ll11);nprt=prod(size(prt)) + initexe=[initexe;[i*ones(nprt,1),matrix(prt,nprt,1),zeros(nprt,1)]] + else + prt=find(ll11>=zeros(ll11));nprt=prod(size(prt)) + initexe=[initexe;.. + [i*ones(nprt,1),matrix(prt,nprt,1),matrix(ll11(prt),nprt,1)]]; + end + end + end + + //initialize agenda + + [tevts,evtspt,pointi]=init_agenda(initexe,clkptr) + + sim.funtyp=funtyp + sim.funs=funs + sim.xptr=xptr + sim.zptr=zptr + sim.ozptr=ozptr + sim.inpptr=inpptr + sim.outptr=outptr + sim.inplnk=inplnk + sim.outlnk=outlnk + sim.rpar=rpar + sim.rpptr=rpptr + sim.ipar=ipar + sim.ipptr=ipptr + sim.opar=opar + sim.opptr=opptr + sim.clkptr=clkptr + sim.labels=labels + cpr.sim=sim; + outtb=list(); + + outtb=buildouttb(lnksz,lnktyp); + + if exists("%scicos_solver")==0 then %scicos_solver=0,end + + if max(funtyp)>10000 &%scicos_solver<100 then + messagebox(["Diagram contains Implicit blocks," + "Compiling for implicit Solver"],"modal") + %scicos_solver=100 + end + + if (or (%scicos_solver == [100 101 102])) then xc0=[xc0;xcd0],end + + nb=size(clkptr,"*")-1; + iz0=zeros(nb,1); + state=cpr.state + state.x=xc0; + state.z=xd0; + state.oz=oxd0; + state.iz=iz0; + state.tevts=tevts; + state.evtspt=evtspt; + state.pointi=pointi; + state.outtb=outtb + cpr.state=state + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/check_io.bin b/modules/scicos/macros/scicos_scicos/check_io.bin new file mode 100755 index 000000000..b752347ac Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/check_io.bin differ diff --git a/modules/scicos/macros/scicos_scicos/check_io.sci b/modules/scicos/macros/scicos_scicos/check_io.sci new file mode 100755 index 000000000..e05ae58af --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/check_io.sci @@ -0,0 +1,141 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [model,graphics,ok]=check_io(model,graphics,in,out,clkin,clkout,in_implicit,out_implicit) + // check_io first check if given number of ports agree with block connection + // and then changes block structure + //%parameters + // model : initial and resulting block model structure + // graphics: initial and resulting block graphics structure + // in : new input ports sizes + // nout : new output ports sizes + // nclkin : new event input ports sizes + // nclkout : new event output ports sizes + // in_impl : index of implicit input ports, the other ports are supposed to be explicit + // out_impl: index of implicit output ports , the other ports are supposed to be explicit + // ok : error flag + // ok==%f : some of input parameters are incorrects or + // attempt to add/delete ports when some are connected + // ok==%t : changes of block structure has been performed + //! + if argn(2)<=6 then in_implicit=[],out_implicit=[],end + // check_io first check if given number of ports agree with block connection + in=int(in(:));nin=size(in,1) + + out=int(out(:));nout=size(out,1); + + clkin=int(clkin(:));nclkin=size(clkin,1); + if nclkin>0 then + if min(clkin)<1 then + message("Event input ports sizes must be positive") + ok=%f + return + end + end + + + clkout=int(clkout(:));nclkout=size(clkout,1); + if nclkout>0 then + if min(clkout)<1 then + message("Event output ports sizes must be positive") + ok=%f + return + end + end + + + [label,ip1,op1,cip1,cop1]=(graphics.exprs,graphics.pin,graphics.pout,.. + graphics.pein,graphics.peout) + + [in1,out1,clkin1,clkout1]=(model.in,model.out,model.evtin,model.evtout) + + n1=size(in1(:,1),"*");n=size(in(:,1),"*") + if n1>n then + ip1=ip1(1:n) + else + ip1=[ip1;zeros(n-n1,1)] + end + + n1=size(out1,"*");n=size(out,"*") + if n1>n then + op1=op1(1:n) + else + op1=[op1;zeros(n-n1,1)] + end + + n1=size(clkin1,"*");n=size(clkin,"*") + if n1>n then + cip1=cip1(1:n) + else + cip1=[cip1;zeros(n-n1,1)]; + end + + n1=size(clkout1,"*");n=size(clkout,"*") + if n1>n then + cop1=cop1(1:n); + else + cop1=[cop1;zeros(n-n1,1)]; + end + + I="E"; + + + if ip1<>[] then + in_impl=I(ones(ip1)); in_impl(in_implicit)="I"; + else + in_impl=[] + end + + + if op1<>[] then + out_impl=I(ones(op1)); out_impl(out_implicit)="I"; + else + out_impl=[] + end + + ok=%t + + graphics.pin=ip1 + graphics.pout=op1 + graphics.pein=cip1 + graphics.peout=cop1 + graphics.in_implicit=in_impl + graphics.out_implicit=out_impl + + if size(in1,2)<=1 then + model.in=in + elseif size(in1,2)==2 then //This appears not to be useful, retained if case of? + disp("check_io : unexpected case") + model.in=[in,2*ones(in)]; + end + + if size(out1,2)<=1 then + model.out=out + elseif size(out1,2)==2 then //This appears not to be useful, retained if case of? + disp("check_io : unexpected case") + model.out=[out,2*ones(out)]; + end + model.evtin=clkin + model.evtout=clkout + + +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/check_mac.bin b/modules/scicos/macros/scicos_scicos/check_mac.bin new file mode 100755 index 000000000..1c4a3ff7d Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/check_mac.bin differ diff --git a/modules/scicos/macros/scicos_scicos/check_mac.sci b/modules/scicos/macros/scicos_scicos/check_mac.sci new file mode 100755 index 000000000..fb47f6401 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/check_mac.sci @@ -0,0 +1,29 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function ok=check_mac(txt) + //errcatch doesnt work poperly + ok=%t + if execstr("comp(mac)","errcatch")<>0 then + messagebox(["Incorrect syntax: ";lasterror()],"modal") + ok=%f + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/color.tst b/modules/scicos/macros/scicos_scicos/color.tst new file mode 100755 index 000000000..b5f1b0004 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/color.tst @@ -0,0 +1,61 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +xsetech([0 0 1 1],[0 0 1 1]) +orig=[0 0] +sz=[1 1] + +thick=xget('thickness');xset('thickness',2); +xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10); +xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5; +orig(1)+(1-1/5)*sz(1),orig(1)+sz(1)/5]; +yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5; +orig(2)+sz(2)/5,orig(2)+(1-1/5)*sz(2)]; +xarrows(xx,yy); +t=(0:0.3:2*%pi)' +xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1); +yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2); +xpoly(xx,yy,'lines'); +xset('thickness',thick) + + + +orig=[0.5 0.5] + + + +wd=xget('wdim').*[1.016,1.12]; +thick=xget('thickness');xset('thickness',2); +p=wd(2)/wd(1);p=1; +rx=sz(1)*p/2;ry=sz(2)/2; +xarcs([orig(1)+0.05*sz(1); +orig(2)+0.95*sz(2); + 0.9*sz(1)*p; + 0.9*sz(2); + 0; + 360*64],default_color(-1)); +xset('thickness',1); +xx=[orig(1)+rx orig(1)+rx; + orig(1)+rx orig(1)+rx+0.6*rx*cos(%pi/6)]; +yy=[orig(2)+ry orig(2)+ry ; + orig(2)+1.8*ry orig(2)+ry+0.6*ry*sin(%pi/6)]; +xsegs(xx,yy,10); +xset('thickness',thick); diff --git a/modules/scicos/macros/scicos_scicos/compile_init_modelica.bin b/modules/scicos/macros/scicos_scicos/compile_init_modelica.bin new file mode 100755 index 000000000..6a7d643fe Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/compile_init_modelica.bin differ diff --git a/modules/scicos/macros/scicos_scicos/compile_init_modelica.sci b/modules/scicos/macros/scicos_scicos/compile_init_modelica.sci new file mode 100755 index 000000000..ec5587ccc --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/compile_init_modelica.sci @@ -0,0 +1,140 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +// Compilation needed by the graphical interface for intitialization + +function [ok]=compile_init_modelica(xmlmodel,paremb,jaco) + + if exists("%scicos_solver")==0 then + %scicos_solver = 0 ; + end + + if ~exists("%scicos_debug_gr") then + %scicos_debug_gr = %f; //** debug mode : default is "%f" + end + + + MODELICAC_FILENAME = "modelicac"; + if getos() == "Windows" then + MODELICAC_FILENAME = MODELICAC_FILENAME + ".exe"; + end + + // called by Initilization IHM + lines(0); + global icpr; + + //set paths for generated files + outpath = pathconvert(TMPDIR,%t,%t); + + // created files for initialization + xmlfile = outpath + xmlmodel + "_init.xml"; // file created by translator + namei = xmlmodel + "i"; + Flati = outpath + xmlmodel + "i.mo"; + FlatCi = outpath + xmlmodel + "i.c"; // computational C function associated to the flat model for initialization + incidencei = outpath + xmlmodel + "i_incidence_matrix.xml"; + Flat_functions = outpath + xmlmodel + "_functions" + ".mo"; // file created by translator + + //-------------------------------------------------------------------- + ok = xml2modelica(xmlfile, Flati) + if ~ok then return,end + + if jaco == "0" then + JAC = ""; + else + JAC = " -jac "; // to generate the analytical jacobian + end + + tmpdir = pathconvert(TMPDIR, %t, %t); //for error log and shell scripts + + exe = """" + pathconvert(getmodelicacpath() + MODELICAC_FILENAME, %f, %t) + """"; + Flati = " """ + Flati + """"; + + // generates the computational C function associated to the flat model + instr = exe + Flati + "" + JAC + " -with-init-in """ + strsubst(xmlfile,"\","/") + .. + """ -with-init-out """ + strsubst(xmlfile,"\","/") + """ -o """ + .. + FlatCi + """"; + + + if getos() == "Windows" then + mputl(instr, tmpdir + "igenm.bat"); + instr = tmpdir + "igenm.bat"; + end + + [rep,stat,err]=unix_g(instr); + if stat == 0 then + mprintf("%s"," Init C code : "+FlatCi); + mprintf("\n\r"); + + ok = Link_modelica_C(FlatCi); + [nipar, nrpar, nopar, nz, nx, nx_der, nx_ns, nin, nout, nm, ng, dep_u] = reading_incidence(incidencei); + + if (~ok) then + return; + end + + else + messagebox(err, _("Modelica compiler (flat2C)"), "error", "modal"); + ok = %f; + return + end + + //build model data structure of the block equivalent to the implicit + bllst = bllst; + nblock = length(bllst); + mdl = bllst(nblock); + mdl.sim = list(namei, 10004); + mdl.state = zeros(nx * 2, 1); + mdl.dstate = zeros(nz, 1); + mdl.nzcross = ng; + mdl.nmode = nm; + mdl.in = ones(nin, 1); + mdl.out = ones(nout, 1); + mdl.dep_ut = [dep_u, %t]; + bllst(nblock) = mdl; + if size(connectmat, 2) == 6 then + connectmat = connectmat(:,[1 2 4 5]); + end + scs_m = null(); + + icpr = list(); + if exists(%scicos_solver) == 0 | (exists(%scicos_solver) <> 0 & %scicos_solver < 100) then + %scicos_solver = 100; + end + icpr = c_pass2(bllst, connectmat, clkconnect, cor, corinv); + + if icpr == list() then + ok = %f; + return, + end + + // suppressing display blocks + Ignore=["bouncexy", "cscope", "cmscope", "canimxy", "canimxy3d", "cevscpe", "cfscope", "cscopexy", .. + "cscopexy3d", "cscopxy", "cscopxy3d", "cmatview", "cmat3d", "affich", "affich2", "BPLATFORM"]; + + for i = 1:length(icpr.sim.funs) + if type(icpr.sim.funs(i)) <> 13 then + if find(icpr.sim.funs(i)(1) == Ignore) <> [] then + icpr.sim.funs(i)(1) = "trash"; + end + end + end +endfunction +//----------------------------------------------------------------------------- + diff --git a/modules/scicos/macros/scicos_scicos/compile_modelica.bin b/modules/scicos/macros/scicos_scicos/compile_modelica.bin new file mode 100755 index 000000000..b28efcf0f Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/compile_modelica.bin differ diff --git a/modules/scicos/macros/scicos_scicos/compile_modelica.sci b/modules/scicos/macros/scicos_scicos/compile_modelica.sci new file mode 100755 index 000000000..b0feda73b --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/compile_modelica.sci @@ -0,0 +1,141 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Serge Steer - 2003 +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [ok,name,nipar,nrpar,nopar,nz,nx,nx_der,nx_ns,nin,nout,nm,ng,dep_u]=compile_modelica(filemo,Mblocks) + + // Copyright INRIA + // Modelica_Init becomes true only in "Modelicainitialize_.sci" + if exists("%Modelica_Init")==0 then %Modelica_Init=%f;end + if exists("%Jacobian")==0 then %Jacobian=%t; end + if exists("%Modelica_ParEmb")==0 then %Modelica_ParEmb=%t; end + + //Initialize lhs arguments in case of return on error + name=""; + dep_u=%t; nipar=0;nrpar=0;nopar=0; + nz=0;nx=0;nx_der=0;nx_ns=0;nin=0;nout=0;nm=0;ng=0; + + // modelica UI initialization is always ignored + running="off"; + + //set paths for generated files + outpath=pathconvert(TMPDIR,%t,%t); + + + name=basename(filemo) + namef=name+"f"; + + + //Flat modelica file generated by translator + Flat=outpath+namef+".mo";// flat modelica file path + + //xml files generated by translator and/or edited by Initialization GUI + xmlfile=outpath+namef+"_init.xml";// initialization XML + Relfile=outpath+namef+"_relations.xml"; + + //files generated by modelicac + Cfile=outpath+name+".c" //C code of the simulation function + incidence=outpath+name+"_incidence_matrix.xml" //incidence matrix + + //files generated for the scicos simulation by translator + Flat_functions=outpath+namef+"_functions.mo"; + xmlfileTMP=outpath+name+"Sim.xml"; + + //do not update C code if not required this allows C code + //modifications for debugging purposes + updateC=needcompile<>0|fileinfo(Cfile)==[]| %Modelica_Init + + if updateC then + + //Generate the flat model if it does not exist yet (It may have been + //generated by the initialization GUI + if ( %Modelica_Init ) then + if (fileinfo(xmlfile)==[]) then + overwrite=%t;//Yes + else + overwrite=messagebox([_("The initialization file already exists!"); + _("Do you want to overwrite it?") ],.. + "","question",[_("Yes"),_("No")],"modal")==1 + end + else + // do not generate the flat file when it is already generated by + // the initialization GUI + overwrite=(running <>"1") + end + + if overwrite then + // generate with filemo the Modelica flat model,the xml files, + // and files needed for the scicos simulation + [ok]=translator(filemo,Mblocks,modelica_libs,Flat) + if ~ok then dep_u=%t; return,end + end + + // if the initialisation GUI is used + if (%Modelica_Init) then //--------------------------- + mprintf("%s"," Init XML file : "+xmlfile); mprintf("\n\r"); + mprintf("%s"," Init Rel file : "+Relfile); mprintf("\n\r"); + name=Flat; + //< "NWNI" then + messagebox(txt, "info"); + else + disp(txt); + end + + //compile and link the generated C file + ok=Link_modelica_C(Cfile) + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/context_evstr.bin b/modules/scicos/macros/scicos_scicos/context_evstr.bin new file mode 100755 index 000000000..96227b567 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/context_evstr.bin differ diff --git a/modules/scicos/macros/scicos_scicos/context_evstr.sci b/modules/scicos/macros/scicos_scicos/context_evstr.sci new file mode 100755 index 000000000..1a9178701 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/context_evstr.sci @@ -0,0 +1,50 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [%vv_list,%ierr_vec,err_mess,%ok]=context_evstr(%str,%scicos_context,%typ) + // Copyright INRIA + // Evaluate Scicos Context utility function + %ok=%t + err_mess=[];lasterror(); + %mm=getfield(1,%scicos_context) + for %mi=%mm(3:$) + if execstr(%mi+"=%scicos_context(%mi)","errcatch")<>0 then + err_mess=lasterror() + if err_mess==[] then err_mess="Error in evaluating "+%mi,end + %ok=%f + return + end + end + %nn=prod(size(%str)) + %ierr_vec=zeros(%nn,1) + %vv_list=list() + for %kk=1:%nn + if %typ(2*%kk-1)(1)<>"str" then + [%vv_list(%kk),%ierr_vec(%kk)]=evstr(%str(%kk)); + %err_mes=lasterror() + if %err_mes<>[] then + err_mess(%kk)=%err_mes;%ok=%f; + end + else + %vv_list(%kk)=%str(%kk); + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/cos2cosf.bin b/modules/scicos/macros/scicos_scicos/cos2cosf.bin new file mode 100755 index 000000000..6836c82f9 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/cos2cosf.bin differ diff --git a/modules/scicos/macros/scicos_scicos/cos2cosf.sci b/modules/scicos/macros/scicos_scicos/cos2cosf.sci new file mode 100755 index 000000000..bf795a666 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/cos2cosf.sci @@ -0,0 +1,233 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function ierr = cos2cosf(u,scs_m,count) + + //write scilab instructions whose evaluation + //returns the value of scicos data structure scs_m. + //in the opened file associated with logical unit u + + [lhs,rhs]=argn(0) + ierr=0; + if rhs<3 then + count=0, + lname="scs_m" + else + count=count+1 + lname="scs_m_"+string(count) + end + + lmax=80; + + ////////////////// + txt=[]; + + //version + txt=[txt;"version="""+get_scicos_version()+""",.."]; + + //scicos_params + tt=[]; + fields=getfield(1,scs_m.props); + for i=1:lstsize(scs_m.props)-1 + field_nam=fields(i+1); + if field_nam=="title" then field_nam="Title", end + tt2=sci2exp(getfield(i+1,scs_m.props),lmax); + tt2(1)=field_nam+"="+tt2(1); + if i<>lstsize(scs_m.props)-1 then + tt2($)=tt2($)+","; + end + tt=[tt;tt2]; + end + + tt=my_strcat(tt); + txt=[txt; + "props=scicos_params(.."; + " "+tt(1)]; + for i=2:size(tt,1) + txt=[txt;" "+tt(i)]; + end + txt($)=txt($)+")"; + + //scicos_diagram + txt=["scicos_diagram(..";txt]; + txt($)=txt($)+")"; + + //final work + txt(1)=lname+"="+txt(1); + bl1=" "; + for i=2:size(txt,1) + txt(i)=part(bl1,1:length(lname)+1)+txt(i); + end + ////////////////// + + ierr=execstr("write(u,txt,''(a)'')","errcatch"); + if ierr<>0 then return, end; + + t=[]; + + for k=1:lstsize(scs_m.objs) + + o=scs_m.objs(k) + if typeof(o)=="Block" then + lhs=lname+".objs("+string(k)+")=" + + if o.model.sim=="super"| o.model.sim=="csuper"| o.model.sim(1)=="asuper" then //Super blocks + cos2cosf(u,o.model.rpar,count);//model.rpar + end + ////////////////// + txt=[]; + + //gui + tt=sci2exp(o.gui); + txt=[txt;"gui="+tt(1)]; + for i=2:size(tt,1) + txt=[txt;" "+tt(i)]; + end + txt($)=txt($)+",.."; + + //scicos_graphics + tt=[]; + fields=getfield(1,o.graphics); + for i=1:lstsize(o.graphics)-1 + field_nam=fields(i+1); + tt2=sci2exp(getfield(i+1,o.graphics),lmax); + tt2(1)=field_nam+"="+tt2(1); + if i<>lstsize(o.graphics)-1 then + tt2($)=tt2($)+","; + end + tt=[tt;tt2]; + end + + tt=my_strcat(tt); + txt=[txt; + "graphics=scicos_graphics(.."; + " "+tt(1)]; + for i=2:size(tt,1) + txt=[txt;" "+tt(i)]; + end + txt($)=txt($)+"),.."; + + //scicos_model + tt=[]; + fields=getfield(1,o.model); + for i=1:lstsize(o.model)-1 + field_nam=fields(i+1); + if field_nam=="rpar"&(o.model.sim=="super"| o.model.sim=="csuper"| o.model.sim(1)=="asuper") then + tt2="scs_m_"+string(count+1); + else + tt2=sci2exp(getfield(i+1,o.model),lmax); + end + tt2(1)=field_nam+"="+tt2(1); + if i<>lstsize(o.model)-1 then + tt2($)=tt2($)+","; + end + tt=[tt;tt2]; + end + + tt=my_strcat(tt); + txt=[txt; + "model=scicos_model(.."; + " "+tt(1)]; + for i=2:size(tt,1) + txt=[txt;" "+tt(i)]; + end + txt($)=txt($)+"),.."; + + //doc + tt=sci2exp(o.doc,50); + txt=[txt;"doc="+tt(1)]; + for i=2:size(tt,1) + txt=[txt;" "+tt(i)]; + end + + //scicos_block + txt=["scicos_block(..";txt]; + txt($)=txt($)+")"; + + //final work + txt(1)=lhs+txt(1); + bl1=" "; + for i=2:size(txt,1) + txt(i)=part(bl1,1:length(lhs))+txt(i); + end + write(u,txt,"(a)"); + /////////////// + else //link + lhs=lname+".objs("+string(k)+")=" + if typeof(o)=="Link" then + //scicos_link + tt=[]; + txt=[]; + fields=getfield(1,o); + for i=1:lstsize(o)-1 + field_nam=fields(i+1); + tt2=sci2exp(getfield(i+1,o),lmax); + tt2(1)=field_nam+"="+tt2(1); + if i<>lstsize(o)-1 then + tt2($)=tt2($)+","; + end + tt=[tt;tt2]; + end + + tt=my_strcat(tt); + txt=[txt; + "scicos_link(.."; + " "+tt(1)]; + for i=2:size(tt,1) + txt=[txt;" "+tt(i)]; + end + txt($)=txt($)+")"; + + //final work + txt(1)=lhs+txt(1); + bl1=" "; + for i=2:size(txt,1) + txt(i)=part(bl1,1:length(lhs))+txt(i); + end + write(u,txt,"(a)"); + + else // ?? + // Alan : JESAISPASIYADAUTRESOBJS + // QUEDESBLOCKSETDESLINKSDANSSCICOS + // ALORSJELAISSELEVIEUCODE + t=[] + t1=sci2exp(o,lmax-length(lhs)) + n1=size(t1,1) + bl1=" ";bl1=part(bl1,1:length(lhs)) + t=[t;lhs+t1(1);bl1(ones(n1-1,1))+t1(2:$)] + write(u,t,"(a)"); + end + end + end + +endfunction + +function txt_out=my_strcat(txt) + txt_out=[] + for i=1:size(txt,1) + txt_out(i)=txt(i); + if length(txt_out(i))<>0 then + if part(txt_out(i),length(txt_out(i)))=="," then + txt_out(i)=txt_out(i)+".."; + end + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/countblocks.bin b/modules/scicos/macros/scicos_scicos/countblocks.bin new file mode 100755 index 000000000..36ea49561 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/countblocks.bin differ diff --git a/modules/scicos/macros/scicos_scicos/countblocks.sci b/modules/scicos/macros/scicos_scicos/countblocks.sci new file mode 100755 index 000000000..d66309a03 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/countblocks.sci @@ -0,0 +1,38 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function n=countblocks(scs_m) + // count number of blocks used in the scicos data structure scs_m + + n=0 + for o=scs_m.objs + x=getfield(1,o) + if x(1)=="Block" then + if o.model.sim=="super"|o.model.sim=="csuper" then + n=n+countblocks(o.model.rpar) + else + n=n+1 + end + else + n=n+1 + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/create_modelica.bin b/modules/scicos/macros/scicos_scicos/create_modelica.bin new file mode 100755 index 000000000..00d39185c Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/create_modelica.bin differ diff --git a/modules/scicos/macros/scicos_scicos/create_modelica.sci b/modules/scicos/macros/scicos_scicos/create_modelica.sci new file mode 100755 index 000000000..14eefad38 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/create_modelica.sci @@ -0,0 +1,333 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [txt,rpar,ipar] = create_modelica(blklst,corinvm,cmat,NvM,name,scs_m) + + if exists("%Modelica_Init")==0 then + // Modelica_Init becomes true only in "Modelicainitialize_.sci" + %Modelica_Init=%f; + end + if exists("%Modelica_ParEmb")==0 then + %Modelica_ParEmb=%t; + end + + Parembed=%Modelica_ParEmb & ~%Modelica_Init; + + txt=[];tab=ascii(9) + rpar=[];//will contain all parameters associated with the all modelica blocs + ipar=[];//will contain the "adress" of each block in rpar + models=[]//will contain the model declaration part + eqns=[]//will contain the modelica equations part + Pin=[] + Bnumbers=[] + Bnam=[] + Bnames=[] + nb=size(blklst) + Params=[]; + for k=1:nb + ipar(k)=0 + o=blklst(k); + //######### + //## Params + //######### + mo=o.equations; + np=size(mo.parameters(1),"*"); + P=[]; + //** mo.parameters have size=2 + //** it only contains parameters + if np<>0 then + if lstsize(mo.parameters)==2 then + mo.parameters(3)=zeros(1,np) + end + end + + for j=1:np + //## loop on number of param value + //## can be both scalar or array + Parj=mo.parameters(1)(j) + Parjv=mo.parameters(2)(j) + Parj_in=Parj+"_"+string(k)+string(j) + + if type(Parjv)==1 then // if Real/Complex Integers are used with "fixed=true" + rpar=[rpar;matrix(Parjv,-1,1)] + ipar(k)=ipar(k)+size(Parjv,"*") + end + //====================================================== + Params=[Params;construct_Pars(Parj_in,Parjv,Parembed)] + if mo.parameters(3)(j)==0 then + P=[P;Parj+"="+Parj_in] + elseif mo.parameters(3)(j)==1 then + //eParjv=construct_redeclar(Parjv) + P=[P;Parj+"(start="+Parj_in+")"]; + elseif mo.parameters(3)(j)==2 then + //eParjv=construct_redeclar(Parjv) + P=[P;Parj+"(start="+Parj_in+",fixed=true)"]; + end + //====================================================== + end + + //######### + //## models + //######### + Bnumbers=[Bnumbers k]; + + //## update list of names of modelica blocks + // Modelica compiler complains about ID containing dots + // So remove them Modelica.package.subpackage => Modelica_DOT_package_DOT_subpackage + Bnam = [Bnam, get_model_name(strsubst(mo.model, ".", "_DOT_"),Bnam)]; + Bnames = [Bnames, Bnam($)] + + if P==[] then + models=[models; + " "+mo.model+" "+tab+Bnames($)]; + else + models=[models; + " "+mo.model+" "+tab+Bnames($)+"("+strcat(P,", ")+")"]; + end + + //## Add gr_i identification in comments of models + if mo.model<>"OutPutPort" & mo.model<>"InPutPort" then + //## retrieve the object in the scs_m structure + o_scsm = scs_m(scs_full_path(corinvm(k))); + //## get the structure graphics + o_gr = o_scsm.graphics; + //## get the identification field + id = stripblanks(o_gr.id) + + if id<>"" then + models($)=models($)+" """+id+""";" + else + models($)=models($)+";" + end + else + models($)=models($)+";" + end + + //rajouter les ports + end + ipar=cumsum([1;ipar(:)]) + + //links + for k=1:size(cmat,1) + from=cmat(k,1:3) + to=cmat(k,4:6) + if from(1)==0 then //input port + nb=nb+1 + Bnumbers=[Bnumbers nb]; + Bnames=[Bnames,"B"+string(nb)]; + models=[models;" InPutPort"+" "+tab+"B"+string(nb)+";"]; + n1="B"+string(nb) + elseif from(3)==1 then + p1=blklst(from(1)).equations.inputs(from(2)) + n1=Bnames(find(Bnumbers==from(1))) + else + p1=blklst(from(1)).equations.outputs(from(2)) + n1=Bnames(find(Bnumbers==from(1))) + end + + if to(1)==0 then //output port + nb=nb+1 + Bnumbers=[Bnumbers nb]; + Bnames=[Bnames,"B"+string(nb)]; + models=[models;" OutPutPort"+" "+tab+"B"+string(nb)+";"]; + n1="B"+string(nb) + elseif to(3)==1 then + p2=blklst(to(1)).equations.inputs(to(2)) + n2=Bnames(find(Bnumbers==to(1))) + else + if size(blklst(to(1)).equations.outputs,"*") (size(cmat,1) - NvM)) ... + then + eqns=[eqns + " "+n1+"."+p1+" = "+n2+"."+p2+";"] + else + eqns=[eqns + " connect ("+n1+"."+p1+","+n2+"."+p2+");"] + end + end + + txt=[txt; + "model "+name + Params + models + "equation" + eqns + "end "+name+";"] +endfunction + +function r=validvar_modelica(s) + r=validvar(s); + + if r then + bad_char=["%" "#" "$"] + for j=1:size(bad_char,2) + if strindex(s,bad_char(j)) then + r=%f + return + end + end + end +endfunction + + + +function r=write_nD_format(x) + sx=size(x) + + if size(sx,"*")==2 then // Matrix/Vector + [nD1,nD2]=size(x) + if nD1==1 then // rows vector + r="{"+strcat(string(x),",")+"}" + r=strsubst(r,"D","e"); + return r; + elseif nD2==1 then // column vector + N=nD1; + cmd=")" + else //matrix + N=sx(1); + cmd=",:)" + end + else // hypermatrix + // typeof(x)==hypermat + // xd=x.entries + // sdims=x.dims(2:$) + // N=x.dims(1) + // cmd=':)' + // n=size(sx,'c') + // for i=1:n-2;cmd=':,'+cmd;end; + // cmd=','+cmd; + end + r=[]; + for i=1:N + cmdx="write_nD_format(x("+string(i)+cmd+")"; + execstr("r(i)="+cmdx,"errcatch") + end + r="{"+strcat(r,",")+"}"; +endfunction + +// a 2x3 matrix {{xx,xx,xx},{xx,xx,xx}} +// A[2] {xx,xx} +// A[1,2] {{xx,xx}} +// A[2,1] {{xx},{xx}} +// A[1,1,2] {{{xx,xx}}} +// a=rand(2,3) +// a=[3,4]; +// a=[4;2]; +// a=rand(2,3); +// a=rand(1,2,3,4,5); +// a=[1 2 3 4 1 4];a(:,:,2)=[5 6 7 8 1 5] ; +//if typeof(a)== 'hypermat' then +// disp('not supported') +//end +//sa=write_nD_format(a) + + +function Pari=construct_Pars(Pari,opari,Parembed) + + if Pari==[] then + return " " + end + // Pars=' parameter Real '+Pars+'(fixed=false);' + [atemp]=format(); + format(20);// writing in long format + + //erpar=string(rpar); will put 1e-16 to zero in a vector containing + //big numbers + + C=opari; + [a1,b1]=size(C); + npi=a1*b1; + if typeof(C)== "hypermat" then + messagebox(_("Hyper Matrix is not supported"),"error","modal") + return + end + + if (type(C)==1) then + if isreal(C) then + par_type="Real" + else + par_type="Complex" + end + FIXED="false" + elseif (typeof(C)=="int32") | (typeof(C)=="int16") |... + (typeof(C)=="int8") |(typeof(C)=="uint32") |... + (typeof(C)=="uint16") | (typeof(C)=="uint8") then + par_type="Integer" + FIXED="true" + else + par_type="UnKnown_Type" + FIXED="???" + messagebox(_("Type not recognized"),"error","modal");ok=%f; + end + + if ~Parembed then + FIXED="true" + end + + if (npi==1) then, + eopari=strsubst(string(C),"D","e"); + fixings="(fixed="+FIXED+") " + else + eopari=write_nD_format(C) + fixings="(each fixed="+FIXED+") "; + [d1,d2]=size(C); + if (d1==1) then + Pari=Pari+"["+string(d2)+"]"; //[d2] + else + Pari=Pari+"["+string(d1)+","+string(d2)+"]"; //[d1,d2] + end + end + Pari=" parameter "+par_type+" "+Pari+ fixings+"="+eopari+ " """+Pari+""""+";" + format(atemp(2))// restituing the format + +endfunction + +function eopari = construct_redeclar(opari) + + [atemp]=format(); + format(20);// writing in long format + C=opari; + npi=size(C,"*"); + + if typeof(C)== "hypermat" then + messagebox(_("Hyper Matrix is not supported"),"error","modal") + return + end + if ~isreal(C) then + messagebox(_("Complex Matrix is not supported"),"error","modal") + return + end + + if (npi==1) then, + eopari=strsubst(string(C),"D","e"); + else + eopari=write_nD_format(C) + end + + format(atemp(2))// restituing the format + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/default_color.bin b/modules/scicos/macros/scicos_scicos/default_color.bin new file mode 100755 index 000000000..ecef9edbb Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/default_color.bin differ diff --git a/modules/scicos/macros/scicos_scicos/default_color.sci b/modules/scicos/macros/scicos_scicos/default_color.sci new file mode 100755 index 000000000..6cdbd363d --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/default_color.sci @@ -0,0 +1,36 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function clr=default_color(typ) + + if typ==-1 then //event links + clr=options("Link")(2), + elseif typ==0 then //text, block shape, + if size(options("Background"),"*")>=2 then //compatibility + clr=options("Background")(2), + else + clr=1 + end + elseif typ==1 | typ==2 then //regular links + + clr=options("Link")(1), + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/default_options.bin b/modules/scicos/macros/scicos_scicos/default_options.bin new file mode 100755 index 000000000..50a93208a Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/default_options.bin differ diff --git a/modules/scicos/macros/scicos_scicos/default_options.sci b/modules/scicos/macros/scicos_scicos/default_options.sci new file mode 100755 index 000000000..dfb76eafb --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/default_options.sci @@ -0,0 +1,43 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function options = default_options() + + options=scsoptlist() + col3d=[0.8 0.8 0.8] + //if xget('use color')==1 then //suppose always color screen + options("3D")=list(%t,33) // we add gray to color map + //else + // options('3D')=list(%f,0) + // col3d=[] + //end + options("Background")=[8 1] //white,black + options("Link")=[1,5] //black,red + options("ID")=list([4 1 10 1],[4 1 2 1]) + options("Cmap")=col3d + +endfunction + +function options = scsoptlist(varargin) + lt = ["scsopt","3D","Background","Link","ID","Cmap"] + options = tlist(lt,varargin(:)) +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/delete_unconnected.bin b/modules/scicos/macros/scicos_scicos/delete_unconnected.bin new file mode 100755 index 000000000..c9fa824d5 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/delete_unconnected.bin differ diff --git a/modules/scicos/macros/scicos_scicos/delete_unconnected.sci b/modules/scicos/macros/scicos_scicos/delete_unconnected.sci new file mode 100755 index 000000000..ce7c06d33 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/delete_unconnected.sci @@ -0,0 +1,101 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function scs_m=delete_unconnected(scs_m); + + n = lstsize(scs_m.objs); + + if n==0 then + return + end ; //** exit point + + DEL=[]; + DELL=[] + finish=%f + + while ~finish + finish = %t + for k=1:n //loop on scs_m objects + x = getfield(1,scs_m.objs(k)) + if x(1)=="Block" then + if scs_m.objs(k).gui<>"SUM_f"&scs_m.objs(k).gui<>"SOM_f" then + if find(scs_m.objs(k).gui==["IFTHEL_f","ESELECT_f"]) then + kk=[find(scs_m.objs(k).graphics.pein==0),find(scs_m.objs(k).graphics.pin==0)] + if kk<> [] // a synchro block is not active, remove it + [scs_m,DEL1,DELL1]=do_delete1(scs_m,k,%f) + DEL=[DEL DEL1] + DELL=[DELL DELL1] + finish=%f + end + else + kk=[find(scs_m.objs(k).graphics.pin==0)] + if kk<>[] then // at least one input port is not connected delete the block + if or(getfield(1,scs_m.objs(k).graphics)=="in_implicit") then + if or(scs_m.objs(k).graphics.in_implicit(kk)<>"I") then + [scs_m,DEL1,DELL1]=do_delete1(scs_m,k,%f) + DEL=[DEL DEL1] + DELL=[DELL DELL1] + finish=%f + end + else + [scs_m,DEL1,DELL1]=do_delete1(scs_m,k,%f) + DEL=[DEL DEL1] + DELL=[DELL DELL1] + finish=%f + end + end + end + end + end + end + end + + //suppress rigth-most deleted elements + while getfield(1,scs_m.objs($))=="Deleted" then + scs_m.objs($)=null(); + if lstsize(scs_m.objs)==0 then + break + end + end + + // Notify by hiliting and message + if DEL<>[] then + // ind_del are deleted and not relinked blocks/links indexes of DEL + if DELL <> [] then + deleted = DEL(find(DEL<>DELL)); + else + deleted = DEL; + end + + // Store updated scs_m and retrieve the previous one + scs_save = scs_m; + scs_m = scs_m_s; + + msg = gettext("Block is ignored because of undefined input(s)."); + for del=deleted + hilite_path([path del], msg); + end + + // Restore the updated scs_m + scs_m = scs_save; + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/dialog.bin b/modules/scicos/macros/scicos_scicos/dialog.bin new file mode 100755 index 000000000..1230d4a61 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/dialog.bin differ diff --git a/modules/scicos/macros/scicos_scicos/dialog.sci b/modules/scicos/macros/scicos_scicos/dialog.sci new file mode 100755 index 000000000..1f3d93c6b --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/dialog.sci @@ -0,0 +1,25 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function result = dialog(labels,valueini) + // interface to x_dialog primitive to allow simple overloading for live demo + result = x_dialog(labels, valueini); +endfunction diff --git a/modules/scicos/macros/scicos_scicos/dig_bound_compound.bin b/modules/scicos/macros/scicos_scicos/dig_bound_compound.bin new file mode 100755 index 000000000..1a7291650 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/dig_bound_compound.bin differ diff --git a/modules/scicos/macros/scicos_scicos/dig_bound_compound.sci b/modules/scicos/macros/scicos_scicos/dig_bound_compound.sci new file mode 100755 index 000000000..416c2980b --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/dig_bound_compound.sci @@ -0,0 +1,100 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +//** rotate compound : get dig_bound of a compound +//** +//** input : - blk the index of the compound (the i child of axe) +//** - +//** output : rect +//** +//** 25/11/08, Alan +//** 22/06/09, Serge Steer INRIA +// - input argument replaced by the compound handle +// - removed the useless unglue + glue instruction using the compuound +// children list +// Copyright INRIA +function [rect]=dig_bound_compound(gh_blk) + //gh_blk handle on a compound object + + xmin = 100000; + xmax = -xmin; + ymin = xmin; + ymax = -xmin; + C=gh_blk.children + for i=1:size(C,"*") + select C(i).type + case "Rectangle" then + //disp('rectangle') + + xmin=min(xmin,C(i).data(1)); + ymin=min(ymin,C(i).data(2)); + xmax=max(xmax,C(i).data(3)+C(i).data(1)); + ymax=max(ymax,C(i).data(4)+C(i).data(2)); + + case "Text" then + //disp('text') + + //** get bounding box of text with no rotation + rectstr = stringbox(C(i).text,C(i).data(1),... + C(i).data(2)) + + xmin=min(xmin,rectstr(1,1)); + ymin=min(ymin,rectstr(2,1)); + xmax=max(xmax,rectstr(1,3)); + ymax=max(ymax,rectstr(2,3)); + + case "Polyline" then + //disp('polyline') + + xmin=min(xmin,min(C(i).data(:,1))); + ymin=min(ymin,min(C(i).data(:,2))); + xmax=max(xmax,max(C(i).data(:,1))); + ymax=max(ymax,max(C(i).data(:,2))); + + case "Compound" then + //disp('compound') + + [rectcmpd]=dig_bound_compound(C(i)) + xmin=min(xmin,rectcmpd(1,1)); + ymin=min(ymin,rectcmpd(1,2)); + xmax=max(xmax,rectcmpd(1,3)); + ymax=max(ymax,rectcmpd(1,4)); + + case "Segs" then + //disp('Segs') + + xmin=min(xmin,min(C(i).data(:,1))); + ymin=min(ymin,min(C(i).data(:,2))); + xmax=max(xmax,max(C(i).data(:,1))); + ymax=max(ymax,max(C(i).data(:,2))); + + case "Arc" then + //disp('Arc') + + xmin=min(xmin,C(i).data(1)); + ymin=min(ymin,C(i).data(2)); + xmax=max(xmax,C(i).data(3)+C(i).data(1)); + ymax=max(ymax,C(i).data(4)+C(i).data(2)); + end + end + + rect=[xmin ymin xmax ymax] + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/do_compile.bin b/modules/scicos/macros/scicos_scicos/do_compile.bin new file mode 100755 index 000000000..ab84f02d8 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/do_compile.bin differ diff --git a/modules/scicos/macros/scicos_scicos/do_compile.sci b/modules/scicos/macros/scicos_scicos/do_compile.sci new file mode 100755 index 000000000..34b65b83e --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/do_compile.sci @@ -0,0 +1,109 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [%cpr,ok] = do_compile(scs_m) + show_trace = %f //** tracing and profiling (probably by Alan L. ) + if show_trace then + disp("c_pass0:"+string(timer())); + end + + if exists("%scicos_solver")==0 then + %scicos_solver = 0 ; + end + + par = scs_m.props; + + if alreadyran then + // terminate current simulation + do_terminate(); + end + + timer() ; //** profiling timer + + IN=[];OUT=[]; + for i=1:lstsize(scs_m.objs) + if typeof(scs_m.objs(i))=="Block" then + if scs_m.objs(i).gui=="IN_f" then + scs_m.objs(i).gui="INPUTPORT"; + scs_m.objs(i).model.sim="bidon" + IN=[IN scs_m.objs(i).model.ipar] + elseif scs_m.objs(i).gui=="OUT_f" then + scs_m.objs(i).gui="OUTPUTPORT"; + scs_m.objs(i).model.sim="bidon" + OUT=[OUT scs_m.objs(i).model.ipar] + end + end + end + + IN=-gsort(-IN); + if or(IN<>[1:size(IN,"*")]) then + ok=%f;%cpr=list() + messagebox("Input ports are not numbered properly.","modal") + return + end + + OUT=-gsort(-OUT); + if or(OUT<>[1:size(OUT,"*")]) then + ok=%f;%cpr=list() + messagebox("Output ports are not numbered properly.","modal") + return + end + + //** First PASSAGE + [bllst,connectmat,clkconnect,cor,corinv,ok] = c_pass1(scs_m); + + if show_trace then + disp("c_pass1:"+string(timer())) + end + + if ~ok then %cpr=list() + return ; //** incase of any error EXIT + end + + if size(connectmat,2)==6 then + connectmat = connectmat(:,[1 2 4 5]) + end + + + scs_m = null() ; + + if ~ok then %cpr=list() + return + end + + // newc_pass2 destroys the corinv component associated + // to the modelica blocks preserve it + // clast=corinv($) + // if type(clast)==15 then corinv($)=clast(1),klast=size(corinv),end + // %cpr=newc_pass2(bllst,connectmat,clkconnect,cor,corinv); + // newc_pass2 destroys the corinv component associated + // to the modelica blocks + // if type(clast)==15 then %cpr.corinv(klast)=clast,end + + + //** Second PASSAGE + %cpr = c_pass2(bllst,connectmat,clkconnect,cor,corinv); + + if %cpr==list() then + ok = %f ; + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/do_compile_superblock42.bin b/modules/scicos/macros/scicos_scicos/do_compile_superblock42.bin new file mode 100755 index 000000000..d2c4c6233 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/do_compile_superblock42.bin differ diff --git a/modules/scicos/macros/scicos_scicos/do_compile_superblock42.sci b/modules/scicos/macros/scicos_scicos/do_compile_superblock42.sci new file mode 100755 index 000000000..9e8d1c478 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/do_compile_superblock42.sci @@ -0,0 +1,6005 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Alan Layec +// - Ramine Nikoukhah +// - Rachid Djenidi +// +// - Scilab 5 update by Simone Mannori +// +// Copyright (C) DIGITEO - 2010 - Allan CORNET +// Copyright (C) Scilab Enterprises - 2012 - Bruno JOFRET +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +//**--------------------------------------------------------------------------------------------------------------------------------- +// +//16/06/07 Author : ?, A. Layec +// +function [Code,actt,proto]=call_actuator(i) + nin=inpptr(i+1)-inpptr(i); //** number of input ports + nout=outptr(i+1)-outptr(i); //** number of output ports + + if funtyp(i)==0 then + if nin==0 then + uk = 0; + nuk_1 = 0; + nuk_2 = 0; + uk_t = 1; + //Code($+1)=+' args[0]=(double *)outtbptr[0]);'; + else + uk = inplnk(inpptr(i)); + nuk_1 = size(outtb(uk),1); + nuk_2 = size(outtb(uk),2); + uk_t = mat2scs_c_nb(outtb(uk)); + //Code($+1)=' args[0]=('+mat2scs_c_ptr(outtb(uk))+' *)outtbptr['+string(uk-1)+'];'; + end + end + //pour la fonction gui ont a : num de bloc l'adresse dans + //nouveau z et la taille du port + actt=[i uk nuk_1 nuk_2 uk_t bllst(i).ipar] + + Code($+1)="block_"+rdnom+"["+string(i-1)+"].nevprt=nevprt;" + + Code=["/* Call of actuator (blk nb "+string(i)+") */" + Code; + "nport = "+string(nbact)+";"; + rdnom+"_actuator(&flag, &nport, &block_"+rdnom+"["+string(i-1)+"].nevprt, told, "+.. + "("+mat2scs_c_ptr(outtb(uk))+" *)outtbptr["+string(uk-1)+"], &nrd_"+string(nuk_1)+", &nrd_"+.. + string(nuk_2)+", &nrd_"+string(uk_t)+",bbb);"]; + + proto="void "+rdnom+"_actuator("+.. + "int *, int *, int *, double *, void *, int *, int *,int *,int);" + proto=cformatline(proto,70); +endfunction + +//CallBlock : generate C calling sequence +// of a scicos block +// +//inputs : bk : bloc index +// pt : evt activation number +// flag : flag +// +//output : txt : +// +//16/06/07 Authors : Alan Layec +function txt=call_block42(bk,pt,flag) + txt=[] + //** + if flag==2 & ((zptr(bk+1)-zptr(bk))+.. + (ozptr(bk+1)-ozptr(bk))+.. + (xptr(bk+1)-xptr(bk)+.. + with_work(bk))==0 |.. + pt<=0) & ~(stalone & or(bk==actt(:,1))) then + return // block without state or continuously activated + end + if flag==0 & ((xptr(bk+1)-xptr(bk))==0) then + return // block without continuous state + end + if flag==9 & ((zcptr(bk+1)-zcptr(bk))==0) then + return // block without continuous state + end + if flag==3 & ((clkptr(bk+1)-clkptr(bk))==0) then + return + end + + //** adjust pt + if ~(flag==3 & ((zcptr(bk+1)-zcptr(bk))<>0)) then + pt=abs(pt) + end + + //** add comment + txt=[txt; + get_comment("call_blk",list(funs(bk),funtyp(bk),bk,labels(bk)));] + + //** set nevprt and flag for called block + txt=[txt; + "block_"+rdnom+"["+string(bk-1)+"].nevprt = "+string(pt)+";" + "local_flag = "+string(flag)+";"] + + //**see if its bidon, actuator or sensor + if funs(bk)=="bidon" then + txt=[]; + return + elseif funs(bk)=="bidon2" then + txt=[]; + return + elseif or(bk==actt(:,1)) then + ind=find(bk==actt(:,1)) + uk=actt(ind,2) + nuk_1=actt(ind,3) + nuk_2=actt(ind,4) + uk_t=actt(ind,5) + txt = [txt; + "nport = "+string(ind)+";"] + txt = [txt; + rdnom+"_actuator(&local_flag, &nport, &block_"+rdnom+"["+string(bk-1)+"].nevprt, \" + get_blank(rdnom+"_actuator")+" &t, ("+mat2scs_c_ptr(outtb(uk))+" *)"+rdnom+"_block_outtbptr["+string(uk-1)+"], \" + get_blank(rdnom+"_actuator")+" &nrd_"+string(nuk_1)+", &nrd_"+string(nuk_2)+", &nrd_"+string(uk_t)+",bbb);"] + txt = [txt; + "if(local_flag < 0) return(5 - local_flag);"] + return + elseif or(bk==capt(:,1)) then + ind=find(bk==capt(:,1)) + yk=capt(ind,2); + nyk_1=capt(ind,3); + nyk_2=capt(ind,4); + yk_t=capt(ind,5); + txt = [txt; + "nport = "+string(ind)+";"] + txt = [txt; + rdnom+"_sensor(&local_flag, &nport, &block_"+rdnom+"["+string(bk-1)+"].nevprt, \" + get_blank(rdnom+"_sensor")+" &t, ("+mat2scs_c_ptr(outtb(yk))+" *)"+rdnom+"_block_outtbptr["+string(yk-1)+"], \" + get_blank(rdnom+"_sensor")+" &nrd_"+string(nyk_1)+", &nrd_"+string(nyk_2)+", &nrd_"+string(yk_t)+",aaa);"] + txt = [txt; + "if(local_flag < 0) return(5 - local_flag);"] + return + end + + //** + nx=xptr(bk+1)-xptr(bk); + nz=zptr(bk+1)-zptr(bk); + nrpar=rpptr(bk+1)-rpptr(bk); + nipar=ipptr(bk+1)-ipptr(bk); + nin=inpptr(bk+1)-inpptr(bk); //* number of input ports */ + nout=outptr(bk+1)-outptr(bk); //* number of output ports */ + + //** + //l'adresse du pointeur de ipar + if nipar<>0 then ipar=ipptr(bk), else ipar=1;end + //l'adresse du pointeur de rpar + if nrpar<>0 then rpar=rpptr(bk), else rpar=1; end + //l'adresse du pointeur de z attention -1 pas sur + if nz<>0 then z=zptr(bk)-1, else z=0;end + //l'adresse du pointeur de x + if nx<>0 then x=xptr(bk)-1, else x=0;end + + //** + ftyp=funtyp(bk) + if ftyp>2000 then ftyp=ftyp-2000,end + if ftyp>1000 then ftyp=ftyp-1000,end + + //** check function type + if ftyp < 0 then //** ifthenelse eselect blocks + txt = []; + return; + else + if (ftyp<>0 & ftyp<>1 & ftyp<>2 & ftyp<>3 & ftyp<>4) then + disp("types other than 0,1,2,3 or 4 are not supported.") + txt = []; + return; + end + end + + select ftyp + + case 0 then + //**** input/output addresses definition ****// + if nin>1 then + for k=1:nin + uk=inplnk(inpptr(bk)-1+k); + nuk=size(outtb(uk),"*"); + txt=[txt; + "rdouttb["+string(k-1)+"]=(double *)"+rdnom+"_block_outtbptr["+string(uk-1)+"];"] + end + txt=[txt; + "args[0]=&(rdouttb[0]);"] + elseif nin==0 + uk=0; + nuk=0; + txt=[txt; + "args[0]=(double *)"+rdnom+"_block_outtbptr[0];"] + else + uk=inplnk(inpptr(bk)); + nuk=size(outtb(uk),"*"); + txt=[txt; + "args[0]=(double *)"+rdnom+"_block_outtbptr["+string(uk-1)+"];"] + end + + if nout>1 then + for k=1:nout + yk=outlnk(outptr(bk)-1+k); + nyk=size(outtb(yk),"*"); + txt=[txt; + "rdouttb["+string(k+nin-1)+"]=(double *)"+rdnom+"_block_outtbptr["+string(yk-1)+"];"]; + end + txt=[txt; + "args[1]=&(rdouttb["+string(nin)+"]);"]; + elseif nout==0 + yk=0; + nyk=0; + txt=[txt; + "args[1]=(double *)"+rdnom+"_block_outtbptr[0];"]; + else + yk=outlnk(outptr(bk)); + nyk=size(outtb(yk),"*"),; + txt=[txt; + "args[1]=(double *)"+rdnom+"_block_outtbptr["+string(yk-1)+"];"]; + end + //*******************************************// + + //*********** call seq definition ***********// + txtc=["(&local_flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,&t,block_"+rdnom+"["+string(bk-1)+"].xd, \"; + "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \"; + "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \"; + "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \"; + "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar, \"; + "(double *)args[0],&nrd_"+string(nuk)+",(double *)args[1],&nrd_"+string(nyk)+");"]; + if (funtyp(bk)>2000 & funtyp(bk)<3000) + blank = get_blank(funs(bk)+"( "); + txtc(1) = funs(bk)+txtc(1); + elseif (funtyp(bk)<2000) + txtc(1) = "C2F("+funs(bk)+")"+txtc(1); + blank = get_blank("C2F("+funs(bk)+") "); + end + txtc(2:$) = blank + txtc(2:$); + txt = [txt;txtc]; + //*******************************************// + + + //** + case 1 then + //*********** call seq definition ***********// + txtc=["(&local_flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,&t,block_"+rdnom+"["+string(bk-1)+"].xd, \"; + "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \"; + "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \"; + "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \"; + "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar"]; + if (funtyp(bk)>2000 & funtyp(bk)<3000) + blank = get_blank(funs(bk)+"( "); + txtc(1) = funs(bk)+txtc(1); + elseif (funtyp(bk)<2000) + txtc(1) = "C2F("+funs(bk)+")"+txtc(1); + blank = get_blank("C2F("+funs(bk)+") "); + end + if nin>=1 | nout>=1 then + txtc($)=txtc($)+", \" + txtc=[txtc;""] + if nin>=1 then + for k=1:nin + uk=inplnk(inpptr(bk)-1+k); + nuk=size(outtb(uk),"*"); + txtc($)=txtc($)+"(double *)"+rdnom+"_block_outtbptr["+string(uk-1)+"],&nrd_"+string(nuk)+","; + end + txtc($)=part(txtc($),1:length(txtc($))-1); //remove last , + end + if nout>=1 then + if nin>=1 then + txtc($)=txtc($)+", \" + txtc=[txtc;""] + end + for k=1:nout + yk=outlnk(outptr(bk)-1+k); + nyk=size(outtb(yk),"*"); + txtc($)=txtc($)+"(double *)"+rdnom+"_block_outtbptr["+string(yk-1)+"],&nrd_"+string(nyk)+","; + end + txtc($)=part(txtc($),1:length(txtc($))-1); //remove last , + end + end + + if ztyp(bk) then + txtc($)=txtc($)+", \" + txtc=[txtc; + "block_"+rdnom+"["+string(bk-1)+"].g,&block_"+rdnom+"["+string(bk-1)+"].ng);"] + else + txtc($)=txtc($)+");"; + end + + txtc(2:$) = blank + txtc(2:$); + txt = [txt;txtc]; + //*******************************************// + + //** + case 2 then + + //*********** call seq definition ***********// + txtc=[funs(bk)+"(&local_flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,&t,block_"+rdnom+"["+string(bk-1)+"].xd, \"; + "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \"; + "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \"; + "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \"; + "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar, \"; + "(double **)block_"+rdnom+"["+string(bk-1)+"].inptr,block_"+rdnom+"["+string(bk-1)+"].insz,&block_"+rdnom+"["+string(bk-1)+"].nin, \"; + "(double **)block_"+rdnom+"["+string(bk-1)+"].outptr,block_"+rdnom+"["+string(bk-1)+"].outsz, &block_"+rdnom+"["+string(bk-1)+"].nout"]; + if ~ztyp(bk) then + txtc($)=txtc($)+");"; + else + txtc($)=txtc($)+", \"; + txtc=[txtc; + "block_"+rdnom+"["+string(bk-1)+"].g,&block_"+rdnom+"["+string(bk-1)+"].ng);"] + end + blank = get_blank(funs(bk)+"( "); + txtc(2:$) = blank + txtc(2:$); + txt = [txt;txtc]; + //*******************************************// + + //** + case 4 then + txt=[txt; + funs(bk)+"(&block_"+rdnom+"["+string(bk-1)+"],local_flag);"]; + + end + + txt =[txt;"if(local_flag < 0) return(5 - local_flag);"] + +endfunction + +//CallBlock : generate C calling sequence +// of a scicos block +// +//inputs : bk : bloc index +// pt : +// flag :block_'+rdnom+'[ +// +//output : txt : +// +//16/06/07 Authors : R.Nikoukhah, A.Layec +function txt=call_block4(bk) + // if flag==2 & ((zptr(bk+1)-zptr(bk))+(ozptr(bk+1)-ozptr(bk))==0 | pt<=0) then + // return // block without discrete state or continuously activated + // // If work allocated in the absence of z and oz, it does not work + // end + + //** + nx=xptr(bk+1)-xptr(bk); + nz=zptr(bk+1)-zptr(bk); + nrpar=rpptr(bk+1)-rpptr(bk); + nipar=ipptr(bk+1)-ipptr(bk); + nin=inpptr(bk+1)-inpptr(bk); //* number of input ports */ + nout=outptr(bk+1)-outptr(bk); //* number of output ports */ + + //** + //l'adresse du pointeur de ipar + if nipar<>0 then ipar=ipptr(bk), else ipar=1;end + //l'adresse du pointeur de rpar + if nrpar<>0 then rpar=rpptr(bk), else rpar=1; end + //l'adresse du pointeur de z attention -1 pas sur + if nz<>0 then z=zptr(bk)-1, else z=0;end + //l'adresse du pointeur de x + if nx<>0 then x=xptr(bk)-1, else x=0;end + + //** + ftyp=funtyp(bk) + if ftyp>2000 then ftyp=ftyp-2000,end + if ftyp>1000 then ftyp=ftyp-1000,end + + //** check function type + if ftyp < 0 then //** ifthenelse eselect blocks + txt = []; + return; + else + if (ftyp<>0 & ftyp<>1 & ftyp<>2 & ftyp<>3 & ftyp<>4) then + disp("types other than 0,1,2,3 or 4 are not supported.") + txt = []; + return; + end + end + + //** add comment + txt=[get_comment("call_blk",list(funs(bk),funtyp(bk),bk,labels(bk)));] + + //** write nevprt activation + // nclock=abs(pt); + txt=[txt; + "block_"+rdnom+"["+string(bk-1)+"].nevprt=nevprt;"] + + select ftyp + //** zero funtyp + case 0 then + //**** input/output addresses definition ****// + if nin>1 then + for k=1:nin + uk=inplnk(inpptr(bk)-1+k); + nuk=size(outtb(uk),"*"); + TYPE=mat2scs_c_ptr(outtb(uk));//scilab index start from 1 + txt=[txt; + "rdouttb["+string(k-1)+"]=("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(uk-1)+"];"] + end + txt=[txt; + "args[0]=&(rdouttb[0]);"] + elseif nin==0 + uk=0; + nuk=0; + txt=[txt; + "args[0]=(SCSREAL_COP *)"+rdnom+"_block_outtbptr[0];"] + else + uk=inplnk(inpptr(bk)); + nuk=size(outtb(uk),"*"); + TYPE=mat2scs_c_ptr(outtb(uk));//scilab index start from 1 + txt=[txt; + "args[0]=("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(uk-1)+"];"] + end + + if nout>1 then + for k=1:nout + yk=outlnk(outptr(bk)-1+k); + nyk=size(outtb(yk),"*"); + TYPE=mat2scs_c_ptr(outtb(yk));//scilab index start from 1 + txt=[txt; + "rdouttb["+string(k+nin-1)+"]=("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(yk-1)+"];"]; + end + txt=[txt; + "args[1]=&(rdouttb["+string(nin)+"]);"]; + elseif nout==0 + yk=0; + nyk=0; + txt=[txt; + "args[1]=(SCSREAL_COP *)"+rdnom+"_block_outtbptr[0];"]; + else + yk=outlnk(outptr(bk)); + nyk=size(outtb(yk),"*"),; + TYPE=mat2scs_c_ptr(outtb(yk));//scilab index start from 1 + txt=[txt; + "args[1]=("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(yk-1)+"];"]; + end + //*******************************************// + + //*********** call seq definition ***********// + txtc=["(&flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,told,block_"+rdnom+"["+string(bk-1)+"].xd, \"; + "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \"; + "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \"; + "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \"; + "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar, \"; + "(double *)args[0],&nrd_"+string(nuk)+",(double *)args[1],&nrd_"+string(nyk)+");"]; + if (funtyp(bk)>2000 & funtyp(bk)<3000) + blank = get_blank(funs(bk)+"( "); + txtc(1) = funs(bk)+txtc(1); + elseif (funtyp(bk)<2000) + txtc(1) = "C2F("+funs(bk)+")"+txtc(1); + blank = get_blank("C2F("+funs(bk)+") "); + end + txtc(2:$) = blank + txtc(2:$); + txt = [txt;txtc]; + //*******************************************// + + + //** + case 1 then + //**** input/output addresses definition ****// + // if nin>=1 then + // for k=1:nin + // uk=inplnk(inpptr(i)-1+k); + // nuk=size(outtb(uk),'*'); + // end + // end + // if nout>=1 then + // for k=1:nout + // yk=outlnk(outptr(i)-1+k); + // nyk=size(outtb(yk),'*'); + // end + // end + //*******************************************// + + //*********** call seq definition ***********// + txtc=["(&flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,told,block_"+rdnom+"["+string(bk-1)+"].xd, \"; + "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \"; + "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \"; + "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \"; + "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar"]; + if (funtyp(bk)>2000 & funtyp(bk)<3000) + blank = get_blank(funs(bk)+"( "); + txtc(1) = funs(bk)+txtc(1); + elseif (funtyp(bk)<2000) + txtc(1) = "C2F("+funs(bk)+")"+txtc(1); + blank = get_blank("C2F("+funs(bk)+") "); + end + if nin>=1 | nout>=1 then + txtc($)=txtc($)+", \" + txtc=[txtc;""] + if nin>=1 then + for k=1:nin + uk=inplnk(inpptr(bk)-1+k); + nuk=size(outtb(uk),"*"); + txtc($)=txtc($)+"(SCSREAL_COP *)"+rdnom+"_block_outtbptr["+string(uk-1)+"],&nrd_"+string(nuk)+","; + end + txtc($)=part(txtc($),1:length(txtc($))-1); //remove last , + end + if nout>=1 then + if nin>=1 then + txtc($)=txtc($)+", \" + txtc=[txtc;""] + end + for k=1:nout + yk=outlnk(outptr(bk)-1+k); + nyk=size(outtb(yk),"*"); + txtc($)=txtc($)+"(SCSREAL_COP *)"+rdnom+"_block_outtbptr["+string(yk-1)+"],&nrd_"+string(nyk)+","; + end + txtc($)=part(txtc($),1:length(txtc($))-1); //remove last , + end + end + + if ztyp(bk) then + txtc($)=txtc($)+", \" + txtc=[txtc;"w,&nrd_0);"]; + else + txtc($)=txtc($)+");"; + end + + txtc(2:$) = blank + txtc(2:$); + txt = [txt;txtc]; + //*******************************************// + + //** + case 2 then + + //*********** call seq definition ***********// + txtc=[funs(bk)+"(&flag,&block_"+rdnom+"["+string(bk-1)+"].nevprt,told,block_"+rdnom+"["+string(bk-1)+"].xd, \"; + "block_"+rdnom+"["+string(bk-1)+"].x,&block_"+rdnom+"["+string(bk-1)+"].nx, \"; + "block_"+rdnom+"["+string(bk-1)+"].z,&block_"+rdnom+"["+string(bk-1)+"].nz,block_"+rdnom+"["+string(bk-1)+"].evout, \"; + "&block_"+rdnom+"["+string(bk-1)+"].nevout,block_"+rdnom+"["+string(bk-1)+"].rpar,&block_"+rdnom+"["+string(bk-1)+"].nrpar, \"; + "block_"+rdnom+"["+string(bk-1)+"].ipar,&block_"+rdnom+"["+string(bk-1)+"].nipar, \"; + "(double **)block_"+rdnom+"["+string(bk-1)+"].inptr,block_"+rdnom+"["+string(bk-1)+"].insz,&block_"+rdnom+"["+string(bk-1)+"].nin, \"; + "(double **)block_"+rdnom+"["+string(bk-1)+"].outptr,block_"+rdnom+"["+string(bk-1)+"].outsz, &block_"+rdnom+"["+string(bk-1)+"].nout"]; + if ~ztyp(bk) then + txtc($)=txtc($)+");"; + else + txtc($)=txtc($)+", \"; + txtc=[txtc; + "block_"+rdnom+"["+string(bk-1)+"].g,&block_"+rdnom+"["+string(bk-1)+"].ng);"] + end + blank = get_blank(funs(bk)+"( "); + txtc(2:$) = blank + txtc(2:$); + txt = [txt;txtc]; + //*******************************************// + + //** + case 4 then + txt=[txt; + funs(bk)+"(&block_"+rdnom+"["+string(bk-1)+"],flag);"]; + + end +endfunction + +// +//16/06/07 Author : ?, A. Layec +// +function [Code,capt,proto]=call_sensor(i) + nin=inpptr(i+1)-inpptr(i); ///* number of input ports */ + nout=outptr(i+1)-outptr(i); ///* number of output ports */ + + //declaration des I/O des blocs de type 1 + if funtyp(i)==0 then + if nout==0 then + yk = 0; + nyk_1 = 0; + nyk_2 = 0; + yk_t = 1; + //Code($+1)=+' args[1]=(double *)(outtbptr[0]);'; + else + yk = outlnk(outptr(i)); + nyk_1 = size(outtb(yk),1); + nyk_2 = size(outtb(yk),2); + yk_t = mat2scs_c_nb(outtb(yk)); + //Code($+1)=' args[1]=('+mat2scs_c_ptr(outtb(yk))+' *)(outtbptr['+string(yk-1)+']);'; + end + + end + capt=[i yk nyk_1 nyk_2 yk_t bllst(i).ipar] + Code($+1)="block_"+rdnom+"["+string(i-1)+"].nevprt=nevprt;" + Code=["/* Call of sensor (blk nb "+string(i)+") */" + Code; + "nport = "+string(nbcap)+";"; + rdnom+"_sensor(&flag, &nport, &block_"+rdnom+"["+string(i-1)+"].nevprt, "+.. + "told, ("+mat2scs_c_ptr(outtb(yk))+" *)(outtbptr["+string(yk-1)+"]), &nrd_"+string(nyk_1)+.. + ", &nrd_"+string(nyk_2)+", &nrd_"+string(yk_t)+",aaa);"]; + proto="void "+rdnom+"_sensor("+.. + "int *, int *, int *, double *,void *, int *, int *,int *, int);" + proto=cformatline(proto,70); +endfunction + +//Generates Code for dynamically linked Fortran and C Blocks +function [CCode,FCode]=gen_blocks() + CCode=[] + FCode=[] + + kdyn=find(funtyp>1000) //dynamically linked blocs + //100X : Fortran blocks + //200X : C blocks + + if (size(kdyn,"*") >1) + kfuns=[]; + //get the block data structure in the initial scs_m structure + if size(corinv(kdyn(1)),"*")==1 then + O=scs_m.objs(corinv(kdyn(1))); + else + path=list("objs"); + for l=corinv(kdyn(1))(1:$-1) + path($+1)=l; + path($+1)="model"; + path($+1)="rpar"; + path($+1)="objs"; + end + path($+1)=corinv(kdyn(1))($); + O=scs_m(path); + end + if funtyp(kdyn(1))>2000 then + //C block + CCode=[CCode;O.graphics.exprs(2)] + else + FCode=[FCode;O.graphics.exprs(2)] + end + kfuns=funs(kdyn(1)); + for i=2:size(kdyn,"*") + //get the block data structure in the initial scs_m structure + if size(corinv(kdyn(i)),"*")==1 then + O=scs_m.objs(corinv(kdyn(i))); + else + path=list("objs"); + for l=corinv(kdyn(i))(1:$-1) + path($+1)=l; + path($+1)="model"; + path($+1)="rpar"; + path($+1)="objs"; + end + path($+1)=corinv(kdyn(i))($); + O=scs_m(path); + end + if (find(kfuns==funs(kdyn(i))) == []) + kfuns=[kfuns;funs(kdyn(i))]; + if funtyp(kdyn(i))>2000 then + //C block + CCode=[CCode;O.graphics.exprs(2)] + else + FCode=[FCode;O.graphics.exprs(2)] + end + end + end + elseif (size(kdyn,"*")==1) + //get the block data structure in the initial scs_m structure + if size(corinv(kdyn),"*")==1 then + O=scs_m.objs(corinv(kdyn)); + else + path=list("objs"); + for l=corinv(kdyn)(1:$-1) + path($+1)=l; + path($+1)="model"; + path($+1)="rpar"; + path($+1)="objs"; + end + path($+1)=corinv(kdyn)($); + O=scs_m(path); + end + if funtyp(kdyn)>2000 then + //C block + CCode=[CCode;O.graphics.exprs(2)] + else + FCode=[FCode;O.graphics.exprs(2)] + end + end + if CCode==[] + CCode=["void no_ccode()" + "{" + " return;" + "}"] + end +endfunction + +//** Generates the C code for new block simulation +// +//12/07/07 Alan Layec +function ok=gen_ccode42(); + + //** Generate code for scicos block + + ierr=execstr("make_computational42(rpat+''/''+rdnom+''.c'')","errcatch") + if ierr<>0 then + message(lasterror()) + ok=%f + return + end + + //** Generate files for dynamically linked scicos blocks + [CCode,FCode]=gen_blocks() + if FCode<>[] then + ierr=execstr("mputl(FCode,rpat+''/''+rdnom+''f.f'')","errcatch") + if ierr<>0 then + message(lasterror()) + ok=%f + return + end + end + if CCode<>[] then + ierr=execstr("mputl(CCode,rpat+''/''+rdnom+''_Cblocks.c'')","errcatch") + if ierr<>0 then + message(lasterror()) + ok=%f + return + end + end + + //** Generate _void_io.c + try + fd = mopen(rpat+"/"+rdnom+"_void_io.c", "wt") + + mputl(["/*"; + "** Generated by Code_Generation toolbox of Xcos with "+getversion(); + "** Date : "+date(); + "*/"], fd); + + if (readGlobal <> [] | writeGlobal <> []) + mputl(["" + "#include ""scicos_block4.h"""], fd); + end + + mputl(["" + "/*---------------------------------------- Actuators */" + "void "+rdnom+"_actuator(int *flag, int *nport, int *nevprt, double *t, void *u, int *nu1, int *nu2, int *ut, int *flag1)" + "{" + " int k = 0,l = 0;" + "}" + "/*---------------------------------------- Sensor */" + "void "+rdnom+"_sensor(int *flag, int *nport, int *nevprt, double *t, void *y, int *ny1, int *ny2, int *yt, int *flag1)" + "{" + " int k = 0,l = 0;" + "}"], fd) + + // Generate global data read <=> FromWorkspace. + if readGlobal <> [] + for i = readGlobal + mputl(["/*---------------------------------------- Read variable "+i+" */" + "void readGlobal_"+i+"(scicos_block *block, int flag)" + "{" + " // Read a scilab Environment variable "+i + " fromws_c(block, flag);" + "}" + ], fd); + end + end + + // Generate global data write <=> ToWorkspace. + if writeGlobal <> [] + for i = writeGlobal + mputl(["/*---------------------------------------- Write variable "+i+" */" + "void writeGlobal_"+i+"(scicos_block *block, int flag)" + "{" + " // Write a scilab environment variable "+i + " // to a C one : global"+i + " tows_c(block, flag);" + "}" + ], fd); + end + end + + mclose(fd); + catch + message(lasterror()) + ok=%f + return + end + + //** Generate _standalone.c + + ierr=execstr("make_standalone42(rpat+''/''+rdnom+''_standalone.c'')","errcatch") + if ierr<>0 then + message(lasterror()) + ok=%f + return + end + + //** This copy is indispensable only for stand alone code generation + //** not supported in Scilab 5 + + //** copy source code of machine.h/scicos_block4.h + // in target path + // txt=mgetl(SCI+'/modules/core/includes/machine.h'); + // ierr=execstr('mputl(txt,rpat+''/machine.h'')','errcatch') + // if ierr<>0 then + // message(lasterror()) + // ok=%f + // return + // end + // + // txt=mgetl(SCI+'/modules/scicos_blocks/includes/scicos_block4.h'); + // ierr=execstr('mputl(txt,rpat+''/scicos_block4.h'')','errcatch') + // if ierr<>0 then + // message(lasterror()) + // ok=%f + // return + // end + + //** Generate _act_sens_events.c + Code=["/*" + "** Generated by Code_Generation toolbox of Xcos with "+getversion() + "** Date :"+date() + "*/" + "" + "#include " + "#include " + "#include " + "#include " + "extern void **"+rdnom+"_block_outtbptr;" + "extern char input[50],output[50];" + "FILE *fprr = NULL, *fprw = NULL;" + make_outevents() + make_actuator(%t) + make_sensor(%t)] + + created=[]; + reponse=[]; + + created=fileinfo(rpat+"/"+rdnom+"_act_sens_events.c") + if created~=[] then + reponse=messagebox(["File: """+rdnom+"_act_sens_events.c"" already exists,"; + "do you want to replace it ?"],"modal","question",["Yes","No"]); + end + + if reponse==1 | reponse==[] then + ierr=execstr("mputl(Code,rpat+''/''+rdnom+''_act_sens_events.c'')", ... + "errcatch") + if ierr<>0 then + message(lasterror()) + ok=%f + return + end + end + + try + if (readGlobal <> [] | writeGlobal <> []) + fd = mopen(rpat+"/"+rdnom+"_read_write_global.c", "wt") + mputl(["/*" + "** Generated by Code_Generation toolbox of Xcos with "+getversion() + "** Date :"+date() + "*/" + "" + "// Uncomment this to log each To Workspace variable update" + "//#define VERBOSE" + "" + "#ifdef VERBOSE" + "#include " + "#endif" + "#include " + "#include " + "#include ""scicos_block4.h""" + "" + "double get_scicos_time();" + "" + ], fd); + if writeGlobal <> [] + // Generate global C variables + // #define global_XXX_Size + // static double **global_XXX + // static int global_XXX_Index (to manage buffer like variables) + for i = 1:size(writeGlobal, "*") + mputl(["/*---------------------------------------- Global Variable "+writeGlobal(i)+" */" + "#define global_"+writeGlobal(i)+"_Size "+string(writeGlobalSize(i)) + "static double **global_"+writeGlobal(i)+";" + "static int global_"+writeGlobal(i)+"_Index = 0;" + ], fd); + end + end + + if readGlobal <> [] + // Generate global C variables + // #define global_XXX_Size + // #define global_XXX_Time_Size + // static double **global_XXX + // static double global_XXX_Time (manage time <-> values association) + for i = 1:size(readGlobal, "*") + mputl(["/*---------------------------------------- Global Variable "+readGlobal(i)+" */" + "#define global_"+readGlobal(i)+"_Size "+string(readGlobalSize(i)) + "#define global_"+readGlobal(i)+"_Time_Size "+string(readGlobalTimeSize(i)) + "static double **global_"+readGlobal(i)+";" + "static double *global_"+readGlobal(i)+"_Time = 0;" + ], fd); + end + end + + + + if (readGlobal <> []) + for i = 1:size(readGlobal, "*") + mputl(["/*---------------------------------------- Read variable "+readGlobal(i)+" */" + "void readGlobal_"+readGlobal(i)+"(scicos_block *block, int flag)" + "{" + " int i = 0;" + " int j = 0;" + " double *y_d = NULL;" + "" + " /* Read a scilab Environment variable "+readGlobal(i)+" */" + " switch(flag)" + " {" + ], fd) + // + // Init case : allocate data / timetable + // Feal data/timetable with values from Scilab. + // + mputl([" case 4 : /* init */" + " {" + " // Allocate time table" + " global_"+readGlobal(i)+"_Time = (double *) malloc(global_"+readGlobal(i)+"_Time_Size * sizeof(double));" + " memset(global_"+readGlobal(i)+"_Time, 0x0, global_"+readGlobal(i)+"_Time_Size * sizeof(double));" + "" + " // Allocate data" + " global_"+readGlobal(i)+" = (double **) malloc(global_"+readGlobal(i)+"_Time_Size * sizeof(double *));" + " for (i = 0 ; i < global_"+readGlobal(i)+"_Time_Size ; ++i)" + " {" + " global_"+readGlobal(i)+"[i] = (double *) malloc( global_"+readGlobal(i)+"_Size * sizeof(double));" + " memset(global_"+readGlobal(i)+"[i], 0x0, global_"+readGlobal(i)+"_Size * sizeof(double));" + " }" + "" + ], fd); + // Save format + oldFormat = format(); + format(25); + + // Fead timetable + for (j = 1:readGlobalTimeSize(i)) + mputl([" global_"+readGlobal(i)+"_Time["+string(j-1)+"] = " + ... + strsubst(string(evstr(readGlobal(i)+".time("+string(j)+")")), "D", "E")+";" + ], fd) + end + // Fead data + for (j = 1:readGlobalTimeSize(i)) + for (k = 1:readGlobalSize(i)) + mputl([" global_"+readGlobal(i)+"["+string(j-1)+"]["+string(k-1)+"] = " + ... + strsubst(string(evstr(readGlobal(i)+".values("+string(j)+", "+string(k)+")")), "D", "E")+";" + ], fd) + + end + end + + // Restore format + format(oldFormat(2), oldFormat(1)); + + mputl(["" + " break;" + " }" + ],fd); + // + // Output update case : + // + mputl([" case 1 : /* output update */" + " {" + " j = 0;" + " while(get_scicos_time() > global_"+readGlobal(i)+"_Time[j] && j < global_"+readGlobal(i)+"_Time_Size)" + " {" + " j++;" + " }" + " y_d = GetRealOutPortPtrs(block,1);" + " if (j == global_"+readGlobal(i)+"_Time_Size)" + " {" + " memset(y_d, 0x0, global_"+readGlobal(i)+"_Size * sizeof(double));" + " }" + " else" + " {" + " memcpy(y_d, global_"+readGlobal(i)+"[j], global_"+readGlobal(i)+"_Size * sizeof(double));" + " }" + " break;" + " }" + ],fd); + // + // End, free memory. + // + mputl([" case 5 : /* END */" + " {" + " for (i = 0 ; i < global_"+readGlobal(i)+"_Time_Size ; ++i)" + " {" + " free(global_"+readGlobal(i)+"[i]);" + " }" + " free(global_"+readGlobal(i)+");" + " break;" + " }" + ],fd); + // Close switch + function declaration + mputl([" }" + "}" + ], fd); + end + end + + if writeGlobal <> [] + for i = 1:size(writeGlobal, "*") + mputl(["/*---------------------------------------- Write variable "+writeGlobal(i)+" */" + "void writeGlobal_"+writeGlobal(i)+"(scicos_block *block, int flag)" + "{" + " int i = 0;" + " int j = 0;" + " int nu = block->insz[0];" + " int nu2 = block->insz[1];" + "" + " /* Write a scilab environment variable "+writeGlobal(i)+" */" + " /* to a C one : global_"+writeGlobal(i)+" */" + " switch(flag)" + " {" + " case 4 : /* init */" + " {" + " global_"+writeGlobal(i)+" = (double **) malloc(global_"+writeGlobal(i)+"_Size * sizeof(double *));" + " for (i = 0 ; i < global_"+writeGlobal(i)+"_Size ; ++i)" + " {" + " global_"+writeGlobal(i)+"[i] = (double *) malloc(nu * nu2 * sizeof(double));" + " memset(global_"+writeGlobal(i)+"[i], 0x0, nu * nu2 * sizeof(double));" + " }" + " global_"+writeGlobal(i)+"_Index = -1;" + "#ifdef VERBOSE" + " printf(""C_"+writeGlobal(i)+".values = zeros(%d, %d, %d)\n"", global_"+writeGlobal(i)+"_Size, nu, nu2);" + " printf(""C_"+writeGlobal(i)+".time = -%%inf * ones(%d, 1)\n"", global_"+writeGlobal(i)+"_Size);" + "#endif" + " break;" + " }" + " case 2 : /* state update */" + " {" + " global_"+writeGlobal(i)+"_Index = (global_"+writeGlobal(i)+"_Index + 1) % global_"+writeGlobal(i)+"_Size;" + " memcpy(global_"+writeGlobal(i)+"[global_"+writeGlobal(i)+"_Index], block->inptr[i], nu * nu2 * sizeof(double));" + "#ifdef VERBOSE" + " printf(""C_"+writeGlobal(i)+".time(%d) = %.25E;\n"", global_"+writeGlobal(i)+"_Index + 1, get_scicos_time());" + " for (j = 0 ; j < nu * nu2 ; ++j)" + " {" + " printf(""C_"+writeGlobal(i)+".values(%d, %d) = %.25E;\n"", global_"+writeGlobal(i)+"_Index + 1, j + 1, global_"+writeGlobal(i)+"[global_"+writeGlobal(i)+"_Index][j]);" + " }" + "#endif /* !VERBOSE */" + " break;" + " }" + " case 5 : /* end */" + " {" + "#ifdef VERBOSE" + " //reshape to fit scilab behaviour" + " printf(""C_"+writeGlobal(i)+".time = C_"+writeGlobal(i)+".time(C_"+writeGlobal(i)+".time <> -%%inf);\n"");" + " printf(""C_"+writeGlobal(i)+".values = C_"+writeGlobal(i)+".values(1:size(C_"+writeGlobal(i)+".time, ''*''), :);\n"");" + "#endif" + " for (i = 0 ; i < global_"+writeGlobal(i)+"_Size ; ++i)" + " {" + " free(global_"+writeGlobal(i)+"[i]);" + " }" + " free(global_"+writeGlobal(i)+");" + " break;" + " }" + " }" + "}" + ], fd); + end + end + + mclose(fd); + end + catch + message(lasterror()) + ok=%f + return + end + +endfunction + +//creates the Scicos GUI function associated with the new block +// +//Author : Rachid Djenidi, A.Layec +// +//20/06/07, A.Layec : update with in2,out2,intyp,outtyp +//27/06/07, A.Layec : update opar,oz +// +function ok=gen_gui42(); + clkinput=ones(clkIN)'; + clkoutput=ones(clkOUT)'; + for i=1:length(bllst) + deput=[%t,%f] + if (bllst(i).dep_ut(2) == %t) then + deput(1,2)=%t; + break; + end + end + Code=["function [sciblk, s1, s2] = "+rdnom+"_c(job,sciblk,e1)" + "// Interfacing function of generated Xcos block "+rdnom + "// Generated by the Xcos Code_Generation tool with "+getversion(); + "// Date : "+date(); + "//" + " s1= []; s2 = [];" + " select job"; + " case ""set"" then"; + " case ""define"" then" + " "+sci2exp(capt(:,3),"in",70); //input ports sizes 1 + " "+sci2exp(capt(:,4),"in2",70); //input ports sizes 2 + " "+sci2exp(scs_c_nb2scs_nb(capt(:,5)),"intyp",70); //input ports type + " "+sci2exp(actt(:,3),"out",70); //output ports sizes 1 + " "+sci2exp(actt(:,4),"out2",70); //output ports sizes 2 + " "+sci2exp(scs_c_nb2scs_nb(actt(:,5)),"outtyp",70); //output ports type + " "+sci2exp(cpr.state.x,"x",70); //initial continuous state + " "+sci2exp(cpr.state.z,"z",70); //initial discrete state + " work=zeros("+string(nblk)+",1)"; + " Z=[z;work]"; + " "+sci2exp(lstcat(cpr.state.oz,cpr.state.outtb),"odstate",70); + " "+sci2exp(cpr.sim.rpar,"rpar",70); //real parameters + " "+sci2exp(cpr.sim.ipar,"ipar",70); //integer parameters + " "+sci2exp(cpr.sim.opar,"opar",70); //object parameters + " "+sci2exp(clkinput,"clkinput",70); + " "+sci2exp(clkoutput,"clkoutput",70); + " "+sci2exp(FIRING,"firing",70); + " nzcross="+string(sum(cpr.sim.zcptr(2:$)-cpr.sim.zcptr(1:$-1)))'; + " nmode="+string(sum(cpr.sim.modptr(2:$)-cpr.sim.modptr(1:$-1)))'; + " "+sci2exp(deput,"dep_ut",70); + " model=scicos_model(sim=list(''"+rdnom+"'',4),..."; + " in=in,..." + " in2=in2,..." + " intyp=intyp,..." + " out=out,..." + " out2=out2,..." + " outtyp=outtyp,..." + " evtin=clkinput,..." + " evtout=clkoutput,..." + " firing=firing,..." + " state=x,..." + " dstate=Z,..." + " odstate=odstate,..." + " rpar=rpar,..." + " ipar=ipar,..." + " opar=opar,..." + " blocktype=''c'',..." + " dep_ut=dep_ut,..." + " nzcross=nzcross,..." + " nmode=nmode)"; + " gr_i=""xstringb(orig(1),orig(2),"""""+rdnom+""""",sz(1),sz(2),""""fill"""")"""; + " sciblk = standard_define([2 2],model,[],gr_i);"; + " style_properties = [""blockWithLabel"";"; + " ""verticalLabelPosition=middle"";"; + " ""verticalAlign=middle"";"; + " ""displayedLabel="+rdnom+"""];"; + " sciblk.graphics.style = strcat(style_properties,"";"");"; + " end" + "endfunction"]; + //Create file + ierr=execstr("mputl(Code,rpat+""/""+rdnom+""_c.sci"")","errcatch") + if ierr<>0 then + message(lasterror()) + ok=%f + end +endfunction + +function [ok,XX,alreadyran,flgcdgen,szclkINTemp,freof] = do_compile_superblock42(XX,all_scs_m,numk,alreadyran) + // Transforms a given Scicos discrete and continuous SuperBlock into a C defined Block + + scs_m=XX.model.rpar + par=scs_m.props; + if alreadyran then + //terminate current simulation + do_terminate() + alreadyran=%f + end + hname=scs_m.props.title(1) //superblock name + //*********************************************************** + //Check blocks properties and adapt them if necessary + //*********************************************************** + + IN=[]; + OUT=[]; + clkIN=[]; + clkOUT=[]; + numa=[]; + numc=[]; + writeGlobal = []; + writeGlobalSize = []; + readGlobal = []; + readGlobalTimeSize = []; + readGlobalSize = []; + + for i=1:size(scs_m.objs) + if typeof(scs_m.objs(i))=="Block" then + if scs_m.objs(i).gui=="CLKOUT_f" then + ok=%f;%cpr=list(); + message("Superblock should not have any activation output port.") + return + elseif scs_m.objs(i).gui=="IN_f" then + //replace input ports by sensor blocks + numc=numc+1 + scs_m.objs(i).gui="INPUTPORTEVTS"; + scs_m.objs(i).model.evtin=1 + scs_m.objs(i).model.sim(1)="capteur"+string(numc) + IN=[IN scs_m.objs(i).model.ipar] + elseif scs_m.objs(i).gui=="OUT_f" then + //replace output ports by actuator blocks + numa=numa+1 + scs_m.objs(i).gui="OUTPUTPORTEVTS"; + scs_m.objs(i).model.sim(1)="actionneur"+string(numa) + OUT=[OUT scs_m.objs(i).model.ipar] + elseif scs_m.objs(i).gui=="CLKINV_f" then + //replace event input ports by fictious block + scs_m.objs(i).gui="EVTGEN_f"; + scs_m.objs(i).model.sim(1)="bidon" + clkIN=[clkIN scs_m.objs(i).model.ipar]; + //elseif scs_m.objs(i).model.dep_ut(2)==%t then + //check for time dependency PAS IICI + //ok=%f;%cpr=list() + //message('a block have time dependence.') + //return + elseif scs_m.objs(i).gui=="CLKOUTV_f" then + scs_m.objs(i).gui="EVTOUT_f"; + scs_m.objs(i).model.sim(1)="bidon2" + clkOUT=[clkOUT scs_m.objs(i).model.ipar]; + end + end + end + + //Check if input/output ports are numered properly + IN=-gsort(-IN); + if or(IN<>[1:size(IN,"*")]) then + ok=%f;%cpr=list() + message("Input ports are not numbered properly.") + return + end + OUT=-gsort(-OUT); + if or(OUT<>[1:size(OUT,"*")]) then + ok=%f;%cpr=list() + message("Output ports are not numbered properly.") + return + end + clkIN=-gsort(-clkIN); + if or(clkIN<>[1:size(clkIN,"*")]) then + ok=%f;%cpr=list() + message("Event input ports are not numbered properly.") + return + end + clkOUT=-gsort(-clkOUT); + if or(clkOUT<>[1:size(clkOUT,"*")]) then + ok=%f;%cpr=list() + message("Event output ports are not numbered properly.") + return + end + + //Check if there is more than one clock in the diagram + szclkIN=size(clkIN,2); + if szclkIN==0 then + szclkIN=[] + end + flgcdgen=szclkIN; + [bllst,connectmat,clkconnect,cor,corinv,ok,scs_m,flgcdgen,freof]=c_pass1(scs_m,flgcdgen); + + // Check for any To Workspace/FromWorkspace block + for i = 1:size(bllst) + if bllst(i).sim(1) == "tows_c" then + // Explore scs_m to find original block + towsObjIndex = corinv(i); + towsObj = scs_m.objs(towsObjIndex(1)); + for j = 2:size(towsObjIndex, "*") + towsObj = towsObj.model.rpar.objs(towsObjIndex(j)); + end + bllst(i).sim(1) = "writeGlobal_" + ... + towsObj.graphics.exprs(2); + // Force state to enable case 2 call + // on generated code + bllst(i).dstate = 0; + writeGlobal = [writeGlobal towsObj.graphics.exprs(2)]; + writeGlobalSize = [writeGlobalSize bllst(i).ipar(1)]; + elseif bllst(i).sim(1) == "fromws_c" then + fromwsObjIndex = corinv(i); + fromwsObj = scs_m.objs(fromwsObjIndex(1)); + for j = 2:size(fromwsObjIndex, "*") + fromwsObj = fromwsObj.model.rpar.objs(fromwsObjIndex(j)); + end + bllst(i).sim(1) = "readGlobal_" + fromwsObj.graphics.exprs(1); + readGlobal = [readGlobal fromwsObj.graphics.exprs(1)]; + readGlobalTimeSize = [readGlobalTimeSize evstr("size(" + fromwsObj.graphics.exprs(1) + ".time, ""*"")")] + readGlobalSize = [readGlobalSize evstr("size(" + fromwsObj.graphics.exprs(1) + ".values(1, :), ""*"")")] + end + end + + if flgcdgen<> szclkIN + clkIN=[clkIN flgcdgen] + end + szclkINTemp=szclkIN; + szclkIN=flgcdgen; + // [bllst,connectmat,clkconnect,cor,corinv,ok]=c_pass1(scs_m); + + //Test for ALWAYS_ACTIVE sblock (RN -25/06/07) + ALWAYS_ACTIVE=%f; + for blki=bllst + if blki.dep_ut($) then + ALWAYS_ACTIVE=%t; + break; + end + end + if ALWAYS_ACTIVE then + CAPTEURS=[]; + for Ii=1:length(bllst) + if part(bllst(Ii).sim(1),1:7)=="capteur" then + bllst(Ii).dep_ut($)=%t + // elseif part(bllst(Ii).sim(1),1:10)=='actionneur' then + // bllst(Ii).dep_ut($)=%t + end + end + end + + if ~ok then + message("Sorry: problem in the pre-compilation step.") + return + end + a=[]; + b=[]; + tt=[]; + howclk=[]; + allhowclk=[]; + allhowclk2=[]; + cap=[]; + act=[]; + + ///********************************** + for i=1:size(bllst) + // check for a scilab function block + if type(bllst(i).sim(1)) == 13 then + ok=%f; + %cpr=list(); + message(_("Superblock should not contains any Scilab function block.")) + return + end + + for j=1:size(bllst) + if (bllst(i).sim(1)=="actionneur"+string(j)) then + if tt<>i then + act=[act;i]; + tt=i; + end + elseif (bllst(i).sim(1)=="capteur"+string(j)) then + if tt<>i then + cap=[cap;i]; + tt=i; + end + elseif (bllst(i).sim(1)=="bidon") then + if tt<>i then + allhowclk=[allhowclk;i]; + tt=i; + end + elseif (bllst(i).sim(1)=="bidon2") then + if tt<>i then + allhowclk2=[allhowclk2;i]; + tt=i; + end + end + end + end + ///********************************** + if szclkIN>1 then + //replace the N Event inputs by a fictious block with 2^N as many event + //outputs + output=ones((2^szclkIN)-1,1) + bllst($+1)=scicos_model(sim=list("bidon",1),evtout=output,.. + blocktype="d",.. + firing=-output',dep_ut=[%f %f]) + corinv(size(bllst))=size(bllst)+1; + howclk=size(bllst) + // adjust the links accordingly + for i=1:(2^szclkIN)-1 + vec=codebinaire(i,szclkIN) + for j=1:szclkIN + if vec(j)*allhowclk(j)>=1 then + for k=1:size(clkconnect,1) + if clkconnect(k,1)==allhowclk(j) then + clkconnect=[clkconnect;[howclk i clkconnect(k,3:4)]] + end + end + end + end + end + elseif szclkIN==[]&~ALWAYS_ACTIVE then + //superblock has no Event input, add a fictious clock + output=ones((2^(size(cap,"*")))-1,1) + if (output == []) then + output=0; + end + bllst($+1)=scicos_model(sim=list("bidon",1),evtout=output,.. + firing=-output,blocktype="d",dep_ut=[%f %f]) + corinv(size(bllst))=size(bllst)+1; + howclk=size(bllst); + elseif szclkIN==1 then + howclk=allhowclk; + end + + //mise en ordre de clkconnect + if szclkIN>1 then + newclkconnect=clkconnect; + clkconnect=[]; + for i=1:size(newclkconnect,1)-1 + if or(newclkconnect(i,:)<>newclkconnect(i+1,:)) then + clkconnect=[clkconnect;newclkconnect(i,:)] + end + end + if or(newclkconnect($-1,:)<>newclkconnect($,:)) then + clkconnect=[clkconnect;newclkconnect($,:)] + end + + //suppression des blocs bidons + newclkconnect=clkconnect;nkt=[]; + for i=1:szclkIN + for k=1:size(newclkconnect,1) + if newclkconnect(k,1)~=allhowclk(i) then + nkt=[nkt;newclkconnect(k,:)]; + end + end + newclkconnect=nkt; + nkt=[]; + end + clkconnect=newclkconnect; + end + + //************************************************** + // nouveau clkconnect avec liaisons sur les capteurs + //************************************************** + + // + // Generate block activation fo C code + // + n=size(cap,1) + if ~(szclkIN==[]) then + // Activate sensors on each clock pulse. + generatedConnection = []; + for i=1:n + if szclkIN>1 then + for j=1:(2^szclkIN)-1 + generatedConnection = [generatedConnection ; [howclk j cap(i) 1]]; + end + elseif szclkIN==1 then + generatedConnection = [generatedConnection ; [howclk 1 cap(i) 1]]; + end + end + clkconnect = [clkconnect ; generatedConnection] + elseif ~ALWAYS_ACTIVE then + // Generate all possible activations for sensors, based on number of blocks. + //codage de l'activation des capteurs dans le cas de l'heritage + generatedConnection = []; + for i=1:2^n-1 + vec=codebinaire(i,n); + for j=1:n + if (vec(j)==1) then + generatedConnection = [generatedConnection ; [howclk i cap(j) 1]]; + end + end + end + clkconnect = [clkconnect ; generatedConnection] + end + + FIRING=[] + for i=1:size(allhowclk2,1) + j = find(clkconnect(:,3)==allhowclk2(i)) + if j<>[] then + FIRING=[FIRING;bllst(clkconnect(j,1)).firing(clkconnect(j,2))] + end + end + + Code_gene_run=[]; + + //** OLD GRAPHICS + //** %windo=xget('window') + + cpr=c_pass2(bllst,connectmat,clkconnect,cor,corinv) + + if cpr==list() then ok=%f,return, end + + //** Alan's patch 5/07/07: try to solve + // which blocks use work + funs_save=cpr.sim.funs; + funtyp_save=cpr.sim.funtyp; + with_work = zeros(cpr.sim.nblk,1) + for i=1:lstsize(cpr.sim.funs) + if part(cpr.sim.funs(i),1:10)=="actionneur" then + cpr.sim.funs(i) ="bidon" + cpr.sim.funtyp(i) = 1 + elseif part(cpr.sim.funs(i),1:7)=="capteur" then + cpr.sim.funs(i) ="bidon" + cpr.sim.funtyp(i) = 1 + end + end + + //** + //** retrieve all open Scilab windows with winsid() + //** + + BeforeCG_WinList = winsid(); + + ierr=execstr("[state,t]=scicosim(cpr.state,0,0,cpr.sim,"+.. + "''start'',scs_m.props.tol)","errcatch") + if ierr==0 then + for i=1:cpr.sim.nblk + if state.iz(i)<>0 then + with_work(i)=%t + end + end + ierr=execstr("[state,t]=scicosim(state,0,0,cpr.sim,"+.. + "''finish'',scs_m.props.tol)","errcatch") + end + + //** + //** retrieve all open Scilab windows with winsid + //** and close the additional windows open since first + //** + + //** This code does not cover 100% of the possible situations because the user can + //** destroy one or more Scicos wins manually during this intermediate phase + //** This code is 100% functional if the user does not close manually any win. + //** TO BE updated in Scilab 5.0 + + AfterCG_WinList = winsid(); + + AfterCG_size = size(AfterCG_WinList); //** matrix + AfterCG_size = AfterCG_size(2) ; //** vector length + + BeforeCG_size = size(BeforeCG_WinList); //** matrix + BeforeCG_size = BeforeCG_size(2) ; //** vector length + + if (or(AfterCG_WinList<>BeforeCG_WinList)) & (AfterCG_size>BeforeCG_size) then + //** means that a scope or other scicos object has created some + //** output window + + DiffCG_Winlist = AfterCG_WinList<>BeforeCG_WinList ; //** T/F mismatch + DiffCG_Index = find(DiffCG_Winlist); //** recover the mismatched indexes only + + for win_idx = DiffCG_Index + delete( scf( AfterCG_WinList(win_idx) ) ) ; //** clear the spurious windows + end + + end + //**------------- end of windows cleaning ---------------------------------------- + + cpr.sim.funs=funs_save; + cpr.sim.funtyp=funtyp_save; + + //** OLD GRAPHICS + //** xset('window',%windo) + + /////////////////// + //les pointeurs de cpr : + x=cpr.state.x; + z=cpr.state.z; + outtb=cpr.state.outtb; + + //RN + zcptr=cpr.sim.zcptr; + ozptr=cpr.sim.ozptr; + rpptr=cpr.sim.rpptr; + ipptr=cpr.sim.ipptr; + opptr=cpr.sim.opptr; + funs=cpr.sim.funs; + xptr=cpr.sim.xptr; + zptr=cpr.sim.zptr; + inpptr=cpr.sim.inpptr; + inplnk=cpr.sim.inplnk; + outptr=cpr.sim.outptr; + outlnk=cpr.sim.outlnk; + //@l@n lnkptr=cpr.sim.lnkptr; + ordclk=cpr.sim.ordclk; + funtyp=cpr.sim.funtyp; + cord=cpr.sim.cord; + ncord=size(cord,1); + nblk=cpr.sim.nb; + ztyp=cpr.sim.ztyp; + clkptr=cpr.sim.clkptr + labels=cpr.sim.labels; + //taille totale de z : nztotal + nztotal=size(z,1); + + //******************************* + //Checking if superblock is valid + //******************************* + msg=[] + for i=1:length(funs)-1 + if funtyp(i)==3 then + msg=[msg;"Type 3 block''s not allowed"] + break; + end + if msg<>[] then message(msg),ok=%f,return,end + end + + //******************************************************** + // Change logical units for readf and writef blocks if any ??? + //******************************************************** + lunit=0 + for d=1:length(funs) + if funs(d)=="readf" then + z(zptr(d)+2)=lunit + lunit=lunit+1; + elseif funs(d)=="writef" + z(zptr(d)+1)=lunit + lunit=lunit+1; + end + end + + //*********************************** + // Get the name of the file + //*********************************** + foo=3; + okk=%f; + rdnom="foo"; + rpat=pwd(); + [x,ierr] = fileinfo(rpat); + S_IWRITE = 128; // mask write permission + if (ierr <> 0 | bitand(x(2), S_IWRITE) == 0) then + rpat = TMPDIR; + end + + libs=""; + label1=[hname;rpat+"/"+hname;""]; + + while %t do + ok=%t // to avoid infinite loop + [okk,.. + rdnom,.. + rpat,.. + libs,.. + label1]=scicos_getvalue("Set code generator parameters :",.. + ["New block''s name :"; + "Created files Path :"; + "Other object files to link with (if any)"],.. + list("str",1,"str",1,"str",1),label1); + if okk==%f then + ok=%f + return + end + rpat=stripblanks(rpat); + + //** 1/07/06 Alan trying to solve multiple libraries during week-end + if strindex(libs,"''")<>[] | strindex(libs,"""")<>[] then + ierr=execstr("libs=evstr(libs)","errcatch") + if ierr<>0 then + message(["Can''t solve other files to link"]) + ok=%f; + return + end + end + + //** Alan, I put a warning here in order to inform the user + //** that the name of the superblock will change + //** because the space char in name isn't allowed. + if grep(rdnom," ")<>[] then + message(["Superblock name cannot contains space characters."; + "space chars will be automatically substituted by ""_"" "]) + end + rdnom = strsubst(rdnom," ","_"); + + //** Put a warning here in order to inform the user + //** that the name of the superblock will change + //** because the "-" char could generate GCC problems + //** (the C functions contains the name of the superblock). + if grep(rdnom,"-")<>[] then + message(["For full C compiler compatibility "; + "Superblock name cannot contains ""-"" characters"; + """-"" chars will be automatically substituted by ""_"" "]) + end + rdnom = strsubst(rdnom,"-","_"); + + dirinfo=fileinfo(rpat) + + if dirinfo==[] then + [pathrp,fnamerp,extensionrp]=fileparts(rpat) + ok=mkdir(pathrp,fnamerp+extensionrp) + if ~ok then + messagebox("Directory "+rpat+" cannot be created","modal","info"); + end + elseif filetype(dirinfo(2))<>"Directory" then + ok=%f; + messagebox(rpat+" is not a directory","modal","error"); + end + + if stripblanks(rdnom)==emptystr() then + ok=%f; + messagebox("sorry C file name not defined","modal","error"); + end + if ok then break,end + end + + ////////////////////////////////////////////////// + maxnrpar=max(rpptr(2:$)-rpptr(1:$-1)) + maxnipar=max(ipptr(2:$)-ipptr(1:$-1)) + maxnx=max(xptr(2:$)-xptr(1:$-1)) + maxnz=max(zptr(2:$)-zptr(1:$-1)) + maxnin=max(inpptr(2:$)-inpptr(1:$-1)) + maxnout=max(outptr(2:$)-outptr(1:$-1)) + maxdim=[]; + for i=1:lstsize(cpr.state.outtb) + maxdim=max(size(cpr.state.outtb(i))) + end + maxtotal=max([maxnrpar;maxnipar;maxnx;maxnz;maxnin;maxnout;maxdim]); + + //************************************************************************ + //generate the call to the blocks and blocs simulation function prototypes + //************************************************************************ + wfunclist=list(); + nbcap=0;nbact=0;capt=[];actt=[];Protostalone=[];Protos=[]; + dfuns=[] + for i=1:length(funs) + if or(i==act) then //block is an actuator + nbact=nbact+1; + [Code,actti,protoi]=call_actuator(i) + wfunclist($+1)=[Code;"if(flag < 0 ) return(5 - flag);"] + if nbact==1 then Protostalone=[Protostalone;"";protoi],end + actt=[actt;actti] + elseif or(i==cap) then //block is a sensor + nbcap=nbcap+1; + [Code,capti,protoi]=call_sensor(i) + wfunclist($+1)=[Code;"if(flag < 0 ) return(5 - flag);"] + if nbcap==1 then Protostalone=[Protostalone;"";protoi] ,end + capt=[capt;capti] + elseif funs(i)=="bidon" + wfunclist($+1)=" " + elseif funs(i)=="bidon2" + wfunclist($+1)=" " + else + ki=find(funs(i)==dfuns) + dfuns=[dfuns;funs(i)] + //[Code,protoi]=call_block(i) + [Code]=call_block4(i) + if Code<>[] then + wfunclist($+1)=[Code;"if(flag < 0 ) return(5 - flag);"] + else + wfunclist($+1)=" "; + end + if ki==[] then + Protos=[Protos;"";BlockProto(i)]; + Protostalone=[Protostalone;"";BlockProto(i)]; + end + end + end + + //************************************** + //on prend en compte l'ordre des numerotation graphique des + //capteur et des actionneur + [junk,index]=gsort(-actt(:,$)); + actt=actt(index,1:$) ; + [junk,index]=gsort(-capt(:,$)); + capt=capt(index,1:$) ; + + //*************************************************** + //Compute the initial state and outtb (links) values + //*************************************************** + //petite modification pour uniformiser les fichiers capteurs + //et actionneurs ??? + rdcpr=cpr.sim.funs; + for r=1:length(cap),rdcpr(cap(r))="bidon";end + for r=1:length(act),rdcpr(act(r))="bidon";end + Total_rdcpr=cpr.sim;Total_rdcpr.funs=rdcpr; + // + tcur=0; + tf=scs_m.props.tf; + tolerances=scs_m.props.tol; + //[state,t]=scicosim(cpr.state,tcur,tf,Total_rdcpr,'start',tolerances); + //cpr.state=state; + z=cpr.state.z; + outtb=cpr.state.outtb; + //[junk_state,t]=scicosim(cpr.state,tcur,tf,Total_rdcpr,'finish',tolerances); + + //*********************************** + // Scilab and C files generation + //*********************************** + + //** generate scilab interfacing function + // of the generated scicos block + ok=gen_gui42(); + + + //** generate C files + // of the generated scicos block + if ok then + ok=gen_ccode42() + end + + //** Generates Makefile, loader + // and compile and link C files + + //** def files to build + files=[rdnom rdnom+"_void_io" rdnom+"_Cblocks"] + + //** def files to build for standalone + filestan=[rdnom+"_standalone" rdnom+"_act_sens_events" rdnom+"_Cblocks"] + + if ok then + ok = buildnewblock(rdnom,files,filestan,rpat,libs,"","") + end + + //** + //if ok then ok=gen_loader(),end + + if ok then + //load the gui function + exec(rpat+"/"+rdnom+"_c.sci"); + //Change diagram superblock to new generated block + XX=update_block(XX); + execstr(rdnom+"_c=resume("+rdnom+"_c)") + else + message([_("Generated block cannot be linked with Scilab.")]) + end + +endfunction + +//BlockProto : generate prototype +// of a scicos block +// +//inputs : bk : bloc index +// +//output : txt : +// +//16/06/07 Author : A.Layec +function [txt]=BlockProto(bk) + + nin=inpptr(bk+1)-inpptr(bk); //* number of input ports */ + nout=outptr(bk+1)-outptr(bk); //* number of output ports */ + + //** + ftyp=funtyp(bk) + if ftyp>2000 then ftyp=ftyp-2000,end + if ftyp>1000 then ftyp=ftyp-1000,end + + //** check function type + if ftyp < 0 then //** ifthenelse eselect blocks + txt = []; + return; + else + if (ftyp<>0 & ftyp<>1 & ftyp<>2 & ftyp<>3 & ftyp<>4) then + disp("types other than 0,1,2,3 or 4 are not yet supported.") + txt = []; + return; + end + end + + //** add comment + txt=[get_comment("proto_blk",list(funs(bk),funtyp(bk),bk,labels(bk)));] + + select ftyp + //** zero funtyp + case 0 then + + //*********** prototype definition ***********// + txtp=["(int *, int *, double *, double *, double *, int *, double *, \"; + " int *, double *, int *, double *, int *,int *, int *, \"; + " double *, int *, double *, int *);"]; + if (funtyp(bk)>2000 & funtyp(bk)<3000) + blank = get_blank("void "+funs(bk)+"("); + txtp(1) = "void "+funs(bk)+txtp(1); + elseif (funtyp(bk)<2000) + txtp(1) = "void C2F("+funs(bk)+")"+txtp(1); + blank = get_blank("void C2F("+funs(bk)+")"); + end + txtp(2:$) = blank + txtp(2:$); + txt = [txt;txtp]; + //*******************************************// + + + //** + case 1 then + + //*********** prototype definition ***********// + txtp=["(int *, int *, double *, double *, double *, int *, double *, \"; + " int *, double *, int *, double *, int *,int *, int *";] + if (funtyp(bk)>2000 & funtyp(bk)<3000) + blank = get_blank("void "+funs(bk)+"("); + txtp(1) = "void "+funs(bk)+txtp(1); + elseif (funtyp(bk)<2000) + txtp(1) = "void C2F("+funs(bk)+")"+txtp(1); + blank = get_blank("void C2F("+funs(bk)+")"); + end + if nin>=1 | nout>=1 then + txtp($)=txtp($)+", \" + txtp=[txtp;""] + if nin>=1 then + for k=1:nin + txtp($)=txtp($)+" double *, int * ," + end + txtp($)=part(txtp($),1:length(txtp($))-1); //remove last , + end + if nout>=1 then + if nin>=1 then + txtp($)=txtp($)+", \" + txtp=[txtp;""] + end + for k=1:nout + txtp($)=txtp($)+" double *, int * ," + end + txtp($)=part(txtp($),1:length(txtp($))-1); //remove last , + end + end + + if ztyp(bk) then + txtp($)=txtp($)+", \" + txtp=[txtp;" double *,int *);"]; + else + txtp($)=txtp($)+");"; + end + + txtp(2:$) = blank + txtp(2:$); + txt = [txt;txtp]; + //*******************************************// + + //** + case 2 then + + //*********** prototype definition ***********// + + txtp=["void "+funs(bk)+... + "(int *, int *, double *, double *, double *, int *, double *, \"; + " int *, double *, int *, double *, int *, int *, int *, \" + " double **, int *, int *, double **,int *, int *"]; + if ~ztyp(bk) then + txtp($)=txtp($)+");"; + else + txtp($)=txtp($)+", \"; + txtp=[txtp; + " double *,int *);"] + end + blank = get_blank("void "+funs(bk)); + txtp(2:$) = blank + txtp(2:$); + txt = [txt;txtp]; + //********************************************// + + //** + case 4 then + txt=[txt; + "void "+funs(bk)+"(scicos_block *, int );"]; + + end +endfunction + +//Generating the routine for actuators interfacing +// +// +//Authors : R. Djenid, R. Nikoukhah, A. Layec +// +//actt=[i uk nuk_1 nuk_2 uk_t bllst(i).ipar] +function Code=make_actuator(standalone) + Call=["/*" + "** Generated by Code_Generation toolbox of Xcos with "+getversion() + "** Date : "+date() + "*/" + "" + "/*"+part("-",ones(1,40))+" Actuators */"; + "void "+rdnom+"_actuator(int *flag, int *nport, int *nevprt, double *t, void *u, int *nu1, int *nu2, int *ut, int flag1)"] + + comments=[" /*" + " * To be customized for standalone execution"; + " * flag : specifies the action to be done" + " * nport : specifies the index of the Super Bloc" + " * regular input (The input ports are numbered" + " * from the top to the bottom )" + " * nevprt: indicates if an activation had been received" + " * 0 = no activation" + " * 1 = activation" + " * t : the current time value" + " * u : the vector inputs value" + " * nu1 : the input size 1" + " * nu2 : the input size 2" + " * ut : the input type" + " * flag1 : learn mode (0 from terminal,1 from input file" + " */"] + + dcl=["{" + " int j,k,l;"]; + + if standalone then + a_actuator=[" /* skeleton to be customized */" + " switch (*flag) {" + " /* OutputUpdate (*flag==1) will be called on each iteration */" + " case 1 :" + " /*if(*nevprt>0) { get the input value */" + " switch (*ut) {" + " case 10 :" + " for (l=0;l<*nu2;l++) {" + " for (k=0;k<*nu1;k++) {" + " printf(""Actuator: time=%f, "+... + "u(%d,%d) of actuator %d is %f "+... + "\n"", \" + " *t, k, l, *nport,"+... + "*((double *) u+(k+l*(*nu1))));" + " }" + " }" + " break;" + "" + " case 11 :" + " for (l=0;l<*nu2;l++) {" + " for (k=0;k<*nu1;k++) {" + " printf(""Actuator: time=%f, "+... + "u(%d,%d) of actuator %d is %f,%f "+... + "\n"", \" + " *t, k, l, *nport,"+... + "*((double *) u+(k+l*(*nu1))),"+... + "*((double *) u+((*nu1)*(*nu2)+k+l*(*nu1))));" + " }" + " }" + " break;" + "" + " case 81 :" + " for (l=0;l<*nu2;l++) {" + " for (k=0;k<*nu1;k++) {" + " printf(""Actuator: time=%f, "+... + "u(%d,%d) of actuator %d is %i "+... + "\n"", \" + " *t, k, l, *nport,"+... + "*((char *) u+(k+l*(*nu1))));" + " }" + " }" + " break;" + "" + " case 82 :" + " for (l=0;l<*nu2;l++) {" + " for (k=0;k<*nu1;k++) {" + " printf(""Actuator: time=%f, "+... + "u(%d,%d) of actuator %d is %hd "+... + "\n"", \" + " *t, k, l, *nport,"+... + "*((short *) u+(k+l*(*nu1))));" + " }" + " }" + " break;" + "" + " case 84 :" + " for (l=0;l<*nu2;l++) {" + " for (k=0;k<*nu1;k++) {" + " printf(""Actuator: time=%f, "+... + "u(%d,%d) of actuator %d is %ld "+... + "\n"", \" + " *t, k, l, *nport,"+... + "*((long *) u+(k+l*(*nu1))));" + " }" + " }" + " break;" + "" + " case 811 :" + " for (l=0;l<*nu2;l++) {" + " for (k=0;k<*nu1;k++) {" + " printf(""Actuator: time=%f, "+... + "u(%d,%d) of actuator %d is %d "+... + "\n"", \" + " *t, k, l, *nport,"+... + "*((unsigned char *) u+(k+l*(*nu1))));" + " }" + " }" + " break;" + "" + " case 812 :" + " for (l=0;l<*nu2;l++) {" + " for (k=0;k<*nu1;k++) {" + " printf(""Actuator: time=%f, "+... + "u(%d,%d) of actuator %d is %hu "+... + "\n"", \" + " *t, k, l, *nport,"+... + "*((unsigned short *) u+(k+l*(*nu1))));" + " }" + " }" + " break;" + "" + " case 814 :" + " for (l=0;l<*nu2;l++) {" + " for (k=0;k<*nu1;k++) {" + " printf(""Actuator: time=%f, "+... + "u(%d,%d) of actuator %d is %lu "+... + "\n"", \" + " *t, k, l, *nport,"+... + "*((unsigned long *) u+(k+l*(*nu1))));" + " }" + " }" + " break;" + " }" + " /*} */" + " break;" + " case 4 : /* actuator initialisation */" + " /* do whatever you want to initialize the actuator */" + " break;" + " case 5 : /* actuator ending */" + " /* do whatever you want to end the actuator */" + " break;" + " }"] + else + a_actuator=[] + end + + // pour fprintf + nc=size(act,"*") // Alan : d'o? viens act ????? + // reponse : de do_compile_superblock! + typ=["""%f "]; //time + for i=1:nc + typ($)=typ($)+""" \" + typ=[typ;""""]; + for j=1:sum(actt(i,3)*actt(i,4)) + //typ=typ+'%f '; + typ($)=typ($)+scs_c_n2c_fmt(actt(i,5))+" "; + end + end + typ($)=typ($)+"\n"", \" + typ(1)=" fprintf(fprw,"+typ(1); + bl =" "; + if size(typ,1) <> 1 then + typ(2:$) = bl+typ(2:$); + end + //Code1=' fprintf(fprw, '"'+typ+' \n'",*t' + Code1=[typ;bl+"*t"]; + //actt=[i uk nuk_1 nuk_2 uk_t bllst(i).ipar] + for i=1:size(actt,1) + ni=actt(i,3)*actt(i,4) // dimension of ith output + Code1($)=Code1($)+"," + Code1=[Code1;bl]; + for j=1:ni + if actt(i,5)<>11 then + Code1($)=Code1($)+... + "*((("+scs_c_n2c_typ(actt(i,5))+" *)("+... + rdnom+"_block_outtbptr+"+string(actt(i,2)-1)+"))"+... + "+"+string(j-1)+")"; + else //CAS CMPLX + Code1($)=Code1($)+... + "*((("+scs_c_n2c_typ(actt(i,5))+" *)("+... + rdnom+"_block_outtbptr+"+string(actt(i,2)-1)+"))"+... + "+"+string((j-1))+"), "+... + "*((("+scs_c_n2c_typ(actt(i,5))+" *)("+... + rdnom+"_block_outtbptr+"+string(actt(i,2)-1)+"))"+... + "+"+string(ni+(j-1))+")"; + end + if j<>ni then + Code1($)=Code1($)+", "; + end + end + end + Code1($)=Code1($)+");" + + Code=[] + + if nc==1|~standalone then + Code=[Call + comments + dcl + " if (flag1 == 0) {" + a_actuator + " }" + " else if (flag1 == 1) {" + " if (*flag == 4 && *nport == 1) {" + " fprw=fopen(output,'"wt'");" + " if( fprw == NULL )" + " {" + " printf('"Error opening file: %s\n'", output);" + " return;" + " }" + " }else if (*flag == 2 /* && *nevprt>0 */) {" + Code1 + " }else if (*flag == 5 && *nport == 1) {" + " fclose(fprw);" + " }" + " }" + "}"] + elseif nc>1 then + S=" switch (*nport) {" + for k=1:nc + S=[S; + " case "+string(k)+" :/* Port number "+string(k)+" ----------*/" + " "+a_actuator + " break;"] + end + S=[S;" }"] + + Code=[Code + Call + comments + dcl + " if (flag1 == 0){" + S + " }" + " else if (flag1 == 1) {" + " if (*flag == 4 && *nport == 1) {" + " fprw=fopen(output,'"wt'");" + " if( fprw == NULL ) {" + " printf('"Error opening file: %s\n'", output);" + " return;" + " }" + " }" + " else if (*flag == 2 /*&& *nevprt>0*/ ) {" + Code1 + " }" + " else if (*flag == 5 && *nport == 1) {" + " fclose(fprw);" + " }" + " }" + "}"] + end +endfunction + +//** Generates the scicos computational function +// associated with the block +//12/07/07 Alan Layec +function make_computational42(filename) + z=cpr.state.z; + oz=cpr.state.oz; + outtb=cpr.state.outtb; + tevts=cpr.state.tevts; + evtspt=cpr.state.evtspt; + outptr=cpr.sim.outptr; + funtyp=cpr.sim.funtyp; + clkptr=cpr.sim.clkptr; + ordptr=cpr.sim.ordptr; + pointi=cpr.state.pointi; + ztyp=cpr.sim.ztyp; + zcptr=cpr.sim.zcptr; + zptr=cpr.sim.zptr; + ozptr=cpr.sim.ozptr; + opptr=cpr.sim.opptr; + opar=cpr.sim.opar; + rpptr=cpr.sim.rpptr; + ipptr=cpr.sim.ipptr; + inpptr=cpr.sim.inpptr; + funs=cpr.sim.funs; + xptr=cpr.sim.xptr; + modptr=cpr.sim.modptr; + inplnk=cpr.sim.inplnk; + nblk=cpr.sim.nb; + outlnk=cpr.sim.outlnk; + oord=cpr.sim.oord; + zord=cpr.sim.zord; + iord=cpr.sim.iord; + noord=size(cpr.sim.oord,1); + nzord=size(cpr.sim.zord,1); + niord=size(cpr.sim.iord,1); + + Indent=" "; + Indent2=Indent+Indent; + BigIndent=" "; + + nZ=size(z,"*"); //** index of work in z + nO=lstsize(oz); //** index of outtb in oz + + stalone=%f + + // Open file to write in + fd = mopen(filename, "wt"); + + mputl(["/*" + "** SCILAB Computational function" + "** Generated by Code_Generation toolbox of Xcos with "+getversion() + "** Date : "+date() + "*/" + "" + "/* ---- Headers ---- */" + "#include " + "#include " + "#include " + "#include " + "#include ""machine.h"" " + "#include ""scicos.h"" " + "#include ""scicos_malloc.h"" " + "#include ""scicos_free.h"" " + "#ifndef max" + "#define max(a,b) ((a) >= (b) ? (a) : (b))" + "#endif" + "#ifndef min" + "#define min(a,b) ((a) <= (b) ? (a) : (b))" + "#endif"], fd); + + mputl([Protos ; ""], fd); + + mputl(["/* Table of constant values */" + "static int nrd_"+string(0:maxtotal)'+" = "+string(0:maxtotal)'+";"], fd); + + if maxtotal<10 then + mputl("static int nrd_10 = 10;", fd); + end + if maxtotal<11 then + mputl("static int nrd_11 = 11;", fd); + end + + if maxtotal<81 then + mputl("static int nrd_81 = 81;", fd); + end + if maxtotal<82 then + mputl("static int nrd_82 = 82;", fd); + end + if maxtotal<84 then + mputl("static int nrd_84 = 84;", fd); + end + if maxtotal<811 then + mputl("static int nrd_811 = 811;", fd); + end + if maxtotal<812 then + mputl("static int nrd_812 = 812;", fd); + end + if maxtotal<814 then + mputl("static int nrd_814 = 814;", fd); + end + + mputl(["" + "/* Some general static variables */" + "static double zero=0;" + "static double w[1];" + "static int aaa=0, bbb=0;"], fd); + + mputl(["" + "/*"+part("-",ones(1,40))+" Block Computational function */ "; + "int "+rdnom+"(scicos_block *block, int flag)" + "{" + " /* declaration of local variables for that block struct */" + " double* z = block->z;" + " void **ozptr = block->ozptr;" + " void **oparptr = block->oparptr;" + " int nopar = block->nopar;" + " double* x = block->x;" + " double* xd = block->xd;" + " double* res = block->res;" + " void** u = block->inptr;" + " void** y = block->outptr;" + " int nevprt = block->nevprt;" + " double* rpar = block->rpar;" + " int nrpar = block->nrpar;" + " int* ipar = block->ipar;" + " int nipar = block->nipar;" + " double* g = block->g;" + " int* mode = block->mode;" + " void **work = block->work;" + "" + " double t = get_scicos_time();" + " int phase = get_phase_simulation();" + "" + " int kf = 0;" + " int i = 0;" + " int* reentryflag = NULL;" + "" + " double *args[100];" + " int local_flag;" + " int nport;" + " void **"+rdnom+"_block_outtbptr;" + " scicos_block *block_"+rdnom+";" + "" + " /* work of blocks are catenated at the end of z */" + " work = (void **)(z+"+string(nZ)+");" + "" + " /* "+rdnom+"_block_outtbptr is catenated at the end of oz */" + " "+rdnom+"_block_outtbptr = (void **)(ozptr+"+string(nO)+");" + "" + " /* struct of all blocks are stored in work of that block struct */" + " block_"+rdnom+"=(scicos_block*) *block->work;" + "" + " /* Copy inputs in the block outtb */"], fd); + + + for i=1:size(capt,1) + ni=capt(i,3)*capt(i,4); //** dimension of ith input + if capt(i,5)<>11 then + mputl([" memcpy(*("+rdnom+"_block_outtbptr+"+string(capt(i,2)-1)+"),"+... + "*(u+"+string(capt(i,6)-1)+"),"+... + string(ni)+"*sizeof("+mat2c_typ(capt(i,5))+"));"], fd); + else //** Cas cmplx + mputl([" memcpy(*("+rdnom+"_block_outtbptr+"+string(capt(i,2)-1)+"),"+... + "*(u+"+string(capt(i,6)-1)+"),"+... + string(2*ni)+"*sizeof("+mat2c_typ(capt(i,5))+"));"], fd); + end + end + + mputl(["" + " if (flag != 4 && flag != 6 && flag != 5){" + " reentryflag=(int*) ((scicos_block *)(*block->work)+"+string(nblk)+");" + " if (*reentryflag==0){" + " *reentryflag=1;"], fd); + + for kf=1:nblk + nin=inpptr(kf+1)-inpptr(kf); //** number of input ports + nout=outptr(kf+1)-outptr(kf); //** number of output ports + nx=xptr(kf+1)-xptr(kf); + ng=zcptr(kf+1)-zcptr(kf); + nmode=modptr(kf+1)-modptr(kf); + + //** add comment + mputl(["" + " "+get_comment("set_blk",list(funs(kf),funtyp(kf),kf,labels(kf)));], fd); + + for k=1:nin + lprt=inplnk(inpptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].inptr["+string(k-1)+"] = "+... + rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd); + end + for k=1:nout + lprt=outlnk(outptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].outptr["+string(k-1)+"] = "+... + rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd); + end + mputl([" block_"+rdnom+"["+string(kf-1)+"].z = &(z["+... + string(zptr(kf)-1)+"]);"], fd); + if nx <> 0 then + mputl([" block_"+rdnom+"["+string(kf-1)+"].x = &(x["+... + string(xptr(kf)-1)+"]);"], fd); + else + mputl([" block_"+rdnom+"["+string(kf-1)+"].x = &(zero);" + " block_"+rdnom+"["+string(kf-1)+"].xd = w;"], fd); + end + if ng <> 0 then + mputl([" block_"+rdnom+"["+string(kf-1)+"].g = &(g["+... + string(zcptr(kf)-1)+"]);"], fd); + else + mputl([" block_"+rdnom+"["+string(kf-1)+"].g = &(zero);";], fd); + end + if nmode <> 0 then + mputl([" block_"+rdnom+"["+string(kf-1)+"].mode = &(mode["+... + string(modptr(kf)-1)+"]);"], fd); + end + if (part(funs(kf),1:7) ~= "capteur" &... + part(funs(kf),1:10) ~= "actionneur" &... + funs(kf) ~= "bidon" &... + funs(kf) ~= "bidon2") then + //** rpar **// + if (rpptr(kf+1)-rpptr(kf)>0) then + mputl([" block_"+rdnom+"["+string(kf-1)+"].rpar = &(rpar["+... + string(rpptr(kf)-1)+"]);"], fd); + end + //** ipar **// + if (ipptr(kf+1)-ipptr(kf)>0) then + mputl([" block_"+rdnom+"["+string(kf-1)+"].ipar = &(ipar["+... + string(ipptr(kf)-1)+"]);"], fd); + end + //** opar **// + if (opptr(kf+1)-opptr(kf)>0) then + nopar = opptr(kf+1)-opptr(kf); + for k=1:nopar + mputl([" block_"+rdnom+"["+string(kf-1)+"].oparptr["+string(k-1)+... + "] = oparptr["+string(opptr(kf)-1+k-1)+"];"], fd); + end + end + //** oz **// + if (ozptr(kf+1)-ozptr(kf)>0) then + noz = ozptr(kf+1)-ozptr(kf); + for k=1:noz + mputl([" block_"+rdnom+"["+string(kf-1)+"].ozptr["+string(k-1)+... + "] = ozptr["+string(ozptr(kf)-1+k-1)+"];"], fd); + end + end + end + mputl([" block_"+rdnom+"["+string(kf-1)+"].work ="+... + " (void **)(((double *)work)+"+string(kf-1)+");"], fd); + end + + mputl([" }" + " }" + "" + ], fd); + + ///////////////////////////////////////////// + + + //** find activation number + blks=find(funtyp>-1); + evs=[]; + + for blk=blks + for ev=clkptr(blk):clkptr(blk+1)-1 + if funs(blk)=="bidon" then + if ev > clkptr(howclk) -1 + evs=[evs,ev]; + end + end + end + end + + //** flag 0 + flag = 0; + + block_has_output=%f + txt = []; + txt22 = []; + + for kf=1:nblk + nx=xptr(kf+1)-xptr(kf); + if nx <> 0 then + txt=[txt; + " block_"+rdnom+"["+string(kf-1)+"].xd=&(xd["+... + string(xptr(kf)-1)+"]);"] + end + if part(funs(kf),1:10) == "actionneur" then + block_has_output=%t + end + end + if txt<>[] then + txt22=[txt22; + " "+get_comment("update_xd",list()) + txt + "" + ] + end + txt22=[txt22; + write_code_odoit(1) //** first pass + write_code_odoit(0) //** second pass + ] + + if txt22<>[] then + mputl([" if (flag == 0) { "+get_comment("flag",list(flag)) + txt22 + " }"], fd); + end + + //** flag 1,2,3 + for flag=[1,2,3] + + txt3=[] + + //** continuous time blocks must be activated + //** for flag 1 + if flag==1 then + txt = write_code_cdoit(flag); + + if txt <> [] then + txt3=[txt3; + Indent+" switch (nevprt) {" + ]; + txt3=[txt3; + Indent2+" case "+string(0)+" : "+... + get_comment("ev",list(0)) + " "+txt; + ]; + txt3=[txt3;" break;";""] + end + else + txt=[]; + end + + //** blocks with input discrete event must be activated + //** for flag 1, 2 and 3 + if size(evs,2)>=1 then + txt4=[] + //** + for ev=evs + txt2=write_code_doit(ev,flag); + if txt2<>[] then + //** adjust event number because of bidon block + new_ev=ev-(clkptr(howclk)-1) + //** + txt4=[txt4; + Indent2+[" case "+string(new_ev)+" : "+... + get_comment("ev",list(new_ev)) + txt2]; + " break;";""] + end + end + + //** + if txt == [] then + if txt4 <> [] then + txt3=[txt3; + Indent+" switch (nevprt) {" + txt4 + " }"]; + end + else + txt3=[txt3; + txt4] + end + end + + //** + if txt <> [] then + txt3=[txt3; + " }"]; + end + + //** + if txt3<>[] then + if flag==1 & txt22==[] then + mputl([" if (flag == "+string(flag)+") { "+... + get_comment("flag",list(flag)) + txt3 + " }"], fd); + else + mputl([" else if (flag == "+string(flag)+") { "+... + get_comment("flag",list(flag)) + txt3 + " }"], fd); + end + end + end + + //** flag 9 + ng=zcptr($)-1; + if (ng ~= 0) then + flag = 9; + mputl([" else if (flag == "+string(flag)+") { "+... + get_comment("flag",list(flag))], fd); + + txt=[] + for kf=1:nblk + if zcptr(kf+1)-zcptr(kf) <> 0 then + txt=[txt; + " block_"+rdnom+"["+string(kf-1)+"].g="+... + "&(g["+string(zcptr(kf)-1)+"]);"] + end + end + + mputl([" "+get_comment("update_g",list()) + txt + "" + write_code_zdoit() + ], fd); + + mputl([" }"], fd); + end + + //** flag 4 + mputl([" else if (flag == 4) { "+get_comment("flag",list(4)) + " if ((*block->work=scicos_malloc(sizeof(scicos_block)*"+... + string(nblk)+"+sizeof(int)))== NULL) return 0;"; + " reentryflag=(int*) ((scicos_block *)(*block->work)+"+string(nblk)+");" + " *reentryflag=0;" + " block_"+rdnom+"=(scicos_block*) *block->work;"], fd); + + for kf=1:nblk + nin=inpptr(kf+1)-inpptr(kf); //* number of input ports */ + nout=outptr(kf+1)-outptr(kf); //* number of output ports */ + nx=xptr(kf+1)-xptr(kf); + ng=zcptr(kf+1)-zcptr(kf); + nmode=modptr(kf+1)-modptr(kf); + + //** add comment + mputl(["" + " "+get_comment("set_blk",list(funs(kf),funtyp(kf),kf,labels(kf)));], fd); + + mputl([" block_"+rdnom+"["+string(kf-1)+"].type = "+... + string(funtyp(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].ztyp = "+... + string(ztyp(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].ng = "+... + string(zcptr(kf+1)-zcptr(kf))+";"], fd); + + if nx <> 0 then + mputl([" block_"+rdnom+"["+string(kf-1)+"].nx = "+... + string(nx)+";"; + " block_"+rdnom+"["+string(kf-1)+"].x = &(x["+... + string(xptr(kf)-1)+"]);"], fd); + else + mputl([" block_"+rdnom+"["+string(kf-1)+"].nx = 0;"; + " block_"+rdnom+"["+string(kf-1)+"].x = &(zero);" + " block_"+rdnom+"["+string(kf-1)+"].xd = w;"], fd); + end + + if ng <> 0 then + mputl([" block_"+rdnom+"["+string(kf-1)+"].g = &(g["+... + string(zcptr(kf)-1)+"]);"], fd); + else + mputl([" block_"+rdnom+"["+string(kf-1)+"].g = &(zero);";], fd); + end + if nmode <> 0 then + mputl([" block_"+rdnom+"["+string(kf-1)+"].mode = &(mode["+... + string(modptr(kf)-1)+"]);"], fd); + end + mputl([" block_"+rdnom+"["+string(kf-1)+"].nz = "+... + string(zptr(kf+1)-zptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].noz = "+... + string(ozptr(kf+1)-ozptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nrpar = "+... + string(rpptr(kf+1)-rpptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nopar = "+... + string(opptr(kf+1)-opptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nipar = "+... + string(ipptr(kf+1)-ipptr(kf))+";" + " block_"+rdnom+"["+string(kf-1)+"].nin = "+... + string(inpptr(kf+1)-inpptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nout = "+... + string(outptr(kf+1)-outptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nevout = "+... + string(clkptr(kf+1)-clkptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nmode = "+... + string(modptr(kf+1)-modptr(kf))+";"], fd); + + mputl([" if ((block_"+rdnom+"["+string(kf-1)+"].evout = "+... + "calloc(block_"+rdnom+"["+string(kf-1)+"].nevout,sizeof(double)))== NULL) return 0;"], fd); + + //***************************** input port *****************************// + //** alloc insz/inptr **// + mputl([" if ((block_"+rdnom+"["+string(kf-1)+"].insz = "+... + "malloc(3*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nin))== NULL) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].inptr = "+... + "malloc(sizeof(void *)*block_"+rdnom+"["+string(kf-1)+"].nin))== NULL) return 0;"], fd); + + //** inptr **// + for k=1:nin + lprt=inplnk(inpptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].inptr["+string(k-1)+"] = "+... + rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd); + end + + //** 1st dim **// + for k=1:nin + lprt=inplnk(inpptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1))+"] = "+... + string(size(outtb(lprt),1))+";"], fd); + end + + //** 2dn dim **// + for k=1:nin + lprt=inplnk(inpptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1)+nin)+"] = "+... + string(size(outtb(lprt),2))+";"], fd); + end + + //** typ **// + for k=1:nin + lprt=inplnk(inpptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1)+2*nin)+"] = "+... + mat2scs_c_typ(outtb(lprt))+";"], fd); + end + //**********************************************************************// + + //***************************** output port *****************************// + //** alloc outsz/outptr **// + mputl([" if ((block_"+rdnom+"["+string(kf-1)+"].outsz = "+... + "malloc(3*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nout))== NULL) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].outptr = "+... + "malloc(sizeof(void*)*block_"+rdnom+"["+string(kf-1)+"].nout))== NULL) return 0;"], fd); + + //** outptr **// + for k=1:nout + lprt=outlnk(outptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].outptr["+string(k-1)+"] = "+... + rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd); + end + + //** 1st dim **// + for k=1:nout + lprt=outlnk(outptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1))+... + "] = "+string(size(outtb(lprt),1))+";"], fd); + end + + //** 2dn dim **// + for k=1:nout + lprt=outlnk(outptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1)+nout)+... + "] = "+string(size(outtb(lprt),2))+";"], fd) + end + + //** typ **// + for k=1:nout + lprt=outlnk(outptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1)+2*nout)+... + "] = "+mat2scs_c_typ(outtb(lprt))+";"], fd); + end + //**********************************************************************// + + mputl([" block_"+rdnom+"["+string(kf-1)+"].z = &(z["+... + string(zptr(kf)-1)+"]);"], fd); + + //***************************** object state *****************************// + if (ozptr(kf+1)-ozptr(kf)>0) then + noz = ozptr(kf+1)-ozptr(kf); + mputl([" if ((block_"+rdnom+"["+string(kf-1)+"].ozptr = "+... + "malloc(sizeof(void *)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].ozsz = "+... + "malloc(2*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].oztyp = "+... + "malloc(sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;";], fd); + + //** ozptr **// + for k=1:noz + mputl([" block_"+rdnom+"["+string(kf-1)+"].ozptr["+string(k-1)+... + "] = ozptr["+string(ozptr(kf)-1+k-1)+"];"], fd); + end + + //** 1st dim **// + for k=1:noz + mputl([" block_"+rdnom+"["+string(kf-1)+"].ozsz["+string(k-1)+... + "] = "+string(size(oz(ozptr(kf)-1+k),1))+";"], fd); + end + + //** 2nd dim **// + for k=1:noz + mputl([" block_"+rdnom+"["+string(kf-1)+"].ozsz["+string(k-1)+... + "] = "+string(size(oz(ozptr(kf)-1+k),2))+";"], fd); + end + + //** typ **// + for k=1:noz + mputl([" block_"+rdnom+"["+string(kf-1)+"].oztyp["+string(k-1)+... + "] = "+mat2scs_c_typ(oz(ozptr(kf)-1+k))+";"], fd); + end + end + //************************************************************************// + + if (part(funs(kf),1:7) ~= "capteur" &... + part(funs(kf),1:10) ~= "actionneur" &... + funs(kf) ~= "bidon" &... + funs(kf) ~= "bidon2") then + if (rpptr(kf+1)-rpptr(kf)>0) then + mputl([" block_"+rdnom+"["+string(kf-1)+... + "].rpar = &(rpar["+string(rpptr(kf)-1)+"]);"], fd); + end + if (ipptr(kf+1)-ipptr(kf)>0) then + mputl([" block_"+rdnom+"["+string(kf-1)+... + "].ipar = &(ipar["+string(ipptr(kf)-1)+"]);"], fd); + end + //** opar + if (opptr(kf+1)-opptr(kf)>0) then + mputl([" if ((block_"+rdnom+"["+string(kf-1)+"].oparptr = "+... + "malloc(sizeof(void *)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].oparsz = "+... + "malloc(2*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].opartyp = "+... + "malloc(sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL) return 0;"; + ], fd); + nopar = opptr(kf+1)-opptr(kf); + //** oparptr **// + for k=1:nopar + mputl([" block_"+rdnom+"["+string(kf-1)+"].oparptr["+string(k-1)+... + "] = oparptr["+string(opptr(kf)-1+k-1)+"];"], fd); + end + //** 1st dim **// + for k=1:nopar + mputl([" block_"+rdnom+"["+string(kf-1)+"].oparsz["+string(k-1)+... + "] = "+string(size(opar(opptr(kf)-1+k),1))+";"], fd); + end + //** 2dn dim **// + for k=1:nopar + mputl([" block_"+rdnom+"["+string(kf-1)+"].oparsz["+string(nopar+(k-1))+... + "] = "+string(size(opar(opptr(kf)-1+k),2))+";"], fd) + end + //** typ **// + for k=1:nopar + mputl([" block_"+rdnom+"["+string(kf-1)+"].opartyp["+string(k-1)+... + "] = "+mat2scs_c_typ(opar(opptr(kf)-1+k))+";"], fd) + end + end + end + + mputl([" block_"+rdnom+"["+string(kf-1)+... + "].work = (void **)(((double *)work)+"+string(kf-1)+");" + " block_"+rdnom+"["+string(kf-1)+... + "].nevprt = nevprt;"], fd); + + end //for kf=1:nblk + + //** init + for kf=1:nblk + // if or(kf==act) | or(kf==cap) then + // if stalone then + // txt = call_block42(kf,0,4); + // if txt <> [] then + // Code=[Code; + // ''; + // ' '+txt]; + // end + // end + // else + txt = call_block42(kf,0,4); + if txt <> [] then + mputl([""; + " "+txt], fd); + end + // end + end + + //** cst blocks and it's dep + txt=write_code_idoit() + + if txt<>[] then + mputl(["" + " /* initial blocks must be called with flag 1 */" + txt], fd); + end + // for kf=iord(:,1)' + // // if or(kf==act) then + // // if stalone then + // // txt = call_block42(kf,0,1); + // // if txt <> [] then + // // Code=[Code; + // // ''; + // // ' '+txt]; + // // end + // // end + // // else + // txt = call_block42(kf,0,1); + // if txt <> [] then + // Code=[Code; + // ''; + // ' '+txt]; + // end + // // end + // end + + mputl([" }"], fd); + + //** flag 5 + mputl([" else if (flag == 5) { "+get_comment("flag",list(5)) + " block_"+rdnom+"=*block->work;"], fd); + + for kf=1:nblk + nin=inpptr(kf+1)-inpptr(kf); //* number of input ports */ + nout=outptr(kf+1)-outptr(kf); //* number of output ports */ + + //** add comment + txt=mputl(["" + " "+get_comment("set_blk",list(funs(kf),funtyp(kf),kf,labels(kf)));], fd); + + for k=1:nin + lprt=inplnk(inpptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].inptr["+string(k-1)+... + "] = "+rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd); + end + for k=1:nout + lprt=outlnk(outptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].outptr["+string(k-1)+... + "] = "+rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd); + end + mputl([" block_"+rdnom+"["+string(kf-1)+"].z=&(z["+... + string(zptr(kf)-1)+"]);"], fd); + if (part(funs(kf),1:7) ~= "capteur" &... + part(funs(kf),1:10) ~= "actionneur" &... + funs(kf) ~= "bidon" &... + funs(kf) ~= "bidon2") then + //** rpar **// + if (rpptr(kf+1)-rpptr(kf)>0) then + mputl([" block_"+rdnom+"["+string(kf-1)+... + "].rpar=&(rpar["+string(rpptr(kf)-1)+"]);"], fd); + end + //** ipar **// + if (ipptr(kf+1)-ipptr(kf)>0) then + mputl([" block_"+rdnom+"["+string(kf-1)+... + "].ipar=&(ipar["+string(ipptr(kf)-1)+"]);"], fd); + end + //** opar **// + if (opptr(kf+1)-opptr(kf)>0) then + nopar = opptr(kf+1)-opptr(kf); + for k=1:nopar + mputl([" block_"+rdnom+"["+string(kf-1)+"].oparptr["+string(k-1)+... + "] = oparptr["+string(opptr(kf)-1+k-1)+"];"], fd); + end + end + //** oz **// + if (ozptr(kf+1)-ozptr(kf)>0) then + noz = ozptr(kf+1)-ozptr(kf); + for k=1:noz + mputl([" block_"+rdnom+"["+string(kf-1)+"].ozptr["+string(k-1)+... + "] = ozptr["+string(ozptr(kf)-1+k-1)+"];"], fd); + end + end + end + + mputl([" block_"+rdnom+"["+string(kf-1)+... + "].work=(void **)(((double *)work)+"+string(kf-1)+");"], fd) + end + + for kf=1:nblk + // if or(kf==act) | or(kf==cap) then + // if stalone then + // txt = call_block42(kf,0,5); + // if txt <> [] then + // Code=[Code; + // ''; + // ' '+txt]; + // end + // end + // else + txt = call_block42(kf,0,5); + if txt <> [] then + mputl([""; + " "+txt], fd); + end + // end + end + + mputl(["" + " for (kf = 0; kf < "+string(nblk)+"; ++kf) {" + " if (block_"+rdnom+"[kf].insz!=NULL) {" + " free(block_"+rdnom+"[kf].insz);" + " }else {" + " break;" + " }" + " if (block_"+rdnom+"[kf].outsz!=NULL){" + " free(block_"+rdnom+"[kf].outsz);" + " }else {" + " break;" + " }" + " if (block_"+rdnom+"[kf].nopar!=0){" + " if (block_"+rdnom+"[kf].oparptr!=NULL){" + " free(block_"+rdnom+"[kf].oparptr);" + " }else {" + " break;" + " }" + " if (block_"+rdnom+"[kf].oparsz!=NULL){" + " free(block_"+rdnom+"[kf].oparsz);" + " }else {" + " break;" + " }" + " if (block_"+rdnom+"[kf].opartyp!=NULL){" + " free(block_"+rdnom+"[kf].opartyp);" + " }else {" + " break;" + " }" + " }" + " if (block_"+rdnom+"[kf].noz!=0){" + " if (block_"+rdnom+"[kf].ozptr!=NULL){" + " free(block_"+rdnom+"[kf].ozptr);" + " }else {" + " break;" + " }" + " if (block_"+rdnom+"[kf].ozsz!=NULL){" + " free(block_"+rdnom+"[kf].ozsz);" + " }else {" + " break;" + " }" + " if (block_"+rdnom+"[kf].oztyp!=NULL){" + " free(block_"+rdnom+"[kf].oztyp);" + " }else {" + " break;" + " }" + " }" + " if (block_"+rdnom+"[kf].evout!=NULL){" + " free(block_"+rdnom+"[kf].evout);" + " }else {" + " break;" + " }" + " }" + " scicos_free(block_"+rdnom+");" + " }" + ""], fd); + + for i=1:size(actt,1) + ni=actt(i,3)*actt(i,4); // dimension of ith input + if actt(i,5)<>11 then + mputl([" memcpy(*(y+"+string(actt(i,6)-1)+"),"+... + "*("+rdnom+"_block_outtbptr+"+string(actt(i,2)-1)+"),"+... + string(ni)+"*sizeof("+mat2c_typ(actt(i,5))+"));"], fd); + else //** Cas cmplx + mputl([" memcpy(*(y+"+string(actt(i,6)-1)+"),"+... + "*("+rdnom+"_block_outtbptr+"+string(actt(i,2)-1)+"),"+... + string(2*ni)+"*sizeof("+mat2c_typ(actt(i,5))+"));"], fd); + end + end + + //** + mputl([" return 0;" + "" + "} /* "+rdnom+" */"], fd); + + mclose(fd); + +endfunction + +//generates skeleton of external world events handling function +function Code=make_outevents() + z="0" + if szclkIN==[] then + newszclkIN=0; + else + newszclkIN=szclkIN; + end + + Code=[ "/*"+part("-",ones(1,40))+" External events handling function */"; + "void "+rdnom+"_events(int *nevprt,double *t)"; + "{" + "/* set next event time and associated events ports" + " * nevprt has binary expression b1..b"+string(newszclkIN)+" where bi is a bit" + " * bi is set to 1 if an activation is received by port i. Note that" + " * more than one activation can be received simultaneously" + " * Caution: at least one bi should be equal to one */" + ""] + + if (newszclkIN <> 0) then + Code=[Code; + " int i,p,b[]={"+strcat(z(ones(1,newszclkIN)),",")+"};" + "" + "/* this is an example for the activation of events ports */" + " b[0]=1;"] + + if newszclkIN>1 then + for bb=2:newszclkIN + Code($+1)=" b["+string(bb-1)+"]=1;" + end + end + + Code=[Code; + "" + "/* definition of the step time */" + " *t = *t + 0.1;" + "" + "/* External events handling process */" + " *nevprt=0;p=1;" + " for (i=0;i<"+string(newszclkIN)+";i++) {" + " *nevprt=*nevprt+b[i]*p;" + " p=p*2;" + " }" + "}"] + else + Code=[Code; + ""; + "/* definition of the step time */" + " *t = *t + 0.1;" + "}"] + end +endfunction + +//Generating the routine for sensors interfacing +// +// +//Author : R. Djenidi, R. Nikoukhah, A. Layec +// +function Code=make_sensor(standalone) + Call=["/*"+part("-",ones(1,40))+" Sensor */"; + "void "+rdnom+"_sensor(int *flag, int *nport, int *nevprt, double *t, void *y, int *ny1, int *ny2, int *yt, int *flag1)"] + + comments=[" /*" + " * To be customized for standalone execution"; + " * flag : specifies the action to be done" + " * nport : specifies the index of the Super Bloc" + " * regular input (The input ports are numbered" + " * from the top to the bottom )" + " * nevprt: indicates if an activation had been received" + " * 0 = no activation" + " * 1 = activation" + " * t : the current time value" + " * y : the vector outputs value" + " * ny1 : the output size 1" + " * ny2 : the output size 2" + " * yt : the output type" + " * flag1 : learn mode (0 from terminal,1 from input file" + " */"] + + dcl=["{" + " int j,k,l;" + " double temps;"] + + if standalone then + + a_sensor=[" switch (*flag) {" + " case 1 : /* set the output value */" + " printf(""Require outputs of sensor number %d\n"", *nport);" + " printf(""time is: %f\n"", *t);" + " printf(""sizes of the sensor output is: %d,%d\n"", *ny1,*ny2);" + " switch (*yt) {" + " case 10 :" + " printf(""type of the sensor output is: %d (double) \n"", *yt);" + " puts(""Please set the sensor output values"");" + " for (l=0;l<*ny2;l++) {" + " for (k=0;k<*ny1;k++) {" + " printf(""y(%d,%d) : "",k,l);" + " scanf(""%lf"", (double *) y+(k+l*(*ny1)));" + " }" + " }" + " break;" + "" + " case 11 :" + " printf(""type of the sensor output is: %d (complex) \n"", *yt);" + " puts(""Please set the sensor output values"");" + " for (l=0;l<*ny2;l++) {" + " for (k=0;k<*ny1;k++) {" + " printf(""y(%d,%d) real part : "",k,l);" + " scanf(""%lf"", (double *) y+(k+l*(*ny1)));" + " printf(""y(%d,%d) imag part : "",k,l);" + " scanf(""%lf"", (double *) y+((*ny1)*(*ny2)+k+l*(*ny1)));" + " }" + " }" + " break;" + "" + " case 81 :" + " printf(""type of the sensor output is: %d (char) \n"", *yt);" + " puts(""Please set the sensor output values"");" + " for (l=0;l<*ny2;l++) {" + " for (k=0;k<*ny1;k++) {" + " printf(""y(%d,%d) : "",k,l);" + " scanf(""%i"", (char *) y+(k+l*(*ny1)));" + " }" + " }" + " break;" + "" + " case 82 :" + " printf(""type of the sensor output is: %d (char) \n"", *yt);" + " puts(""Please set the sensor output values"");" + " for (l=0;l<*ny2;l++) {" + " for (k=0;k<*ny1;k++) {" + " printf(""y(%d,%d) : "",k,l);" + " scanf(""%hd"", (short *) y+(k+l*(*ny1)));" + " }" + " }" + " break;" + "" + " case 84 :" + " printf(""type of the sensor output is: %d (long) \n"", *yt);" + " puts(""Please set the sensor output values"");" + " for (l=0;l<*ny2;l++) {" + " for (k=0;k<*ny1;k++) {" + " printf(""y(%d,%d) : "",k,l);" + " scanf(""%ld"", (long *) y+(k+l*(*ny1)));" + " }" + " }" + " break;" + "" + " case 811 :" + " printf(""type of the sensor output is: %d (unsigned char) \n"", *yt);" + " puts(""Please set the sensor output values"");" + " for (l=0;l<*ny2;l++) {" + " for (k=0;k<*ny1;k++) {" + " printf(""y(%d,%d) : "",k,l);" + " scanf(""%d"", (unsigned char *) y+(k+l*(*ny1)));" + " }" + " }" + " break;" + "" + " case 812 :" + " printf(""type of the sensor output is: %d (unsigned short) \n"", *yt);" + " puts(""Please set the sensor output values"");" + " for (l=0;l<*ny2;l++) {" + " for (k=0;k<*ny1;k++) {" + " printf(""y(%d,%d) : "",k,l);" + " scanf(""%hu"", (unsigned short *) y+(k+l*(*ny1)));" + " }" + " }" + " break;" + "" + " case 814 :" + " printf(""type of the sensor output is: %d (unsigned long) \n"", *yt);" + " puts(""Please set the sensor output values"");" + " for (l=0;l<*ny2;l++) {" + " for (k=0;k<*ny1;k++) {" + " printf(""y(%d,%d) : "",k,l);" + " scanf(""%lu"", (unsigned long *) y+(k+l*(*ny1)));" + " }" + " }" + " break;" + "" + " }" + " break;" + " case 4 : /* sensor initialisation */" + " /* do whatever you want to initialize the sensor */" + " break;" + " case 5 : /* sensor ending */" + " /* do whatever you want to end the sensor */" + " break;" + " }"] + else + a_sensor=[] + end + + nc=size(cap,"*") + + // pour fscanf + typ=["""%lf "]; //temps + for i=1:nc + typ($)=typ($)+""" \" + typ=[typ;""""]; + for j=1:sum(capt(i,3)*capt(i,4)) + //typ=typ+'%f '; + typ($)=typ($)+scs_c_n2c_fmt(capt(i,5))+" "; + end + end + typ($)=typ($)+"\n"", \" + typ=strsubst(typ,"%f","%lf"); + typ(1)=" fscanf(fprr,"+typ(1); + bl =" "; + if size(typ,1) <> 1 then + typ(2:$) = bl+typ(2:$); + end + //Code1=[' fscanf( fprr, '"'+typ+' \n'",&temps'] + Code1=[typ;bl+"&temps"]; + for i=1:size(capt,1) + ni=capt(i,3)*capt(i,4); // dimension of ith input + Code1($)=Code1($)+","; + Code1=[Code1;bl]; + for j=1:ni + if capt(i,5)<>11 then + Code1($)=Code1($)+... + "("+scs_c_n2c_typ(capt(i,5))+" *)("+... + rdnom+"_block_outtbptr+"+string(capt(i,2)-1)+")"+... + "+"+string(j-1)+""; + else //CAS CMPLX + Code1($)=Code1($)+... + "("+scs_c_n2c_typ(capt(i,5))+" *)("+... + rdnom+"_block_outtbptr+"+string(capt(i,2)-1)+")"+... + "+"+string((j-1))+", "+... + "("+scs_c_n2c_typ(capt(i,5))+" *)("+... + rdnom+"_block_outtbptr+"+string(capt(i,2)-1)+")"+... + "+"+string(ni+(j-1))+""; + end + if j<>ni then + Code1($)=Code1($)+", "; + end + end + end + Code1($)=Code1($)+");" + + Code=[] + if nc==1|~standalone then + Code=[Code; + Call + comments + dcl + " if (flag1 == 0) {" + a_sensor; + " } " + " else if (flag1 == 1) {" + " if (*flag == 4 && *nport == 1) {" + " fprr=fopen(input,'"r'");" + " if( fprr == NULL ) {" + " printf('"Error opening file: %s\n'", input);" + " return;" + " }" + " }" + " else if (*flag == 1) {" + Code1 + " }" + " else if (*flag == 5 && *nport == 1) {" + " fclose(fprr);" + " }" + " }" + "}"]; + + elseif nc>1 then + S=" switch (*nport) {" + for k=1:nc + S=[S; + " case "+string(k)+" : /* Port number "+string(k)+" ----------*/" + " "+a_sensor + " break;"] + end + S=[S;" }"] + + Code=[Code + Call + comments + dcl + " if (flag1 == 0) {" + S + " }" + " else if (flag1 == 1){" + " if (*flag == 4 && *nport == 1) {" + " fprr=fopen(input,'"r'");" + " if( fprr == NULL ) {" + " printf('"Error opening file: %s\n'", input);" + " return ;" + " }" + " }" + " else if (*flag == 1) {" + Code1 + " }" + " else if (*flag == 5 && *nport == 1) {" + " fclose(fprr);" + " }" + " }" + "}"] + end +endfunction + +//generates code of the standalone simulation procedure +// +// +// rmq : La fonction zdoit n'est pas utilis?e pour le moment +function make_standalone42(filename) + + x=cpr.state.x; + modptr=cpr.sim.modptr; + rpptr=cpr.sim.rpptr; + ipptr=cpr.sim.ipptr; + opptr=cpr.sim.opptr; + rpar=cpr.sim.rpar; + ipar=cpr.sim.ipar; + opar=cpr.sim.opar; + oz=cpr.state.oz; + ordptr=cpr.sim.ordptr; + oord=cpr.sim.oord; + zord=cpr.sim.zord; + iord=cpr.sim.iord; + tevts=cpr.state.tevts; + evtspt=cpr.state.evtspt; + zptr=cpr.sim.zptr; + clkptr=cpr.sim.clkptr; + ordptr=cpr.sim.ordptr; + pointi=cpr.state.pointi; + funs=cpr.sim.funs; + noord=size(cpr.sim.oord,1); + nzord=size(cpr.sim.zord,1); + niord=size(cpr.sim.iord,1); + + Indent=" "; + Indent2=Indent+Indent; + BigIndent=" "; + + work=zeros(nblk,1) + Z=[z;zeros(lstsize(outtb),1);work]'; + nX=size(x,"*"); + nztotal=size(z,1); + + stalone = %t; + + fd = mopen(filename, "wt"); + + mputl(["/*" + "** Code prototype for standalone use" + "** Generated by Code_Generation toolbox of Xcos with "+getversion() + "** Date : "+date() + "*/" + "" + "/* To learn how to use the standalone code, type '"./standalone -h'" */" + "" + "/* ---- Headers ---- */" + "#include " + "#include " + "#include " + "#include " + "#include " + "#include '"scicos_block4.h'"" + "#include '"machine.h'"" + "#ifndef max" + "#define max(a,b) ((a) >= (b) ? (a) : (b))" + "#endif" + "#ifndef min" + "#define min(a,b) ((a) <= (b) ? (a) : (b))" + "#endif" + "" + "/* ---- Internals functions declaration ---- */" + "int "+rdnom+"_sim(double, double, double, int);" + Protostalone + ""], fd); + + + + if x<>[] then + mputl(["/* Code prototype for standalone use */" + "int C2F("+rdnom+"simblk)(double , double *, double *);" + "int dset(int *n, double *dx, double *dy, int *incy);" + "int ode1();" + "int ode2();" + "int ode4();" + ""], fd); + end + + mputl(["/* Table of constant values */" + "static int nrd_"+string(0:maxtotal)'+" = "+string(0:maxtotal)'+";"], fd); + + if maxtotal<10 then + mputl(["static int nrd_10 = 10;"], fd); + end + if maxtotal<11 then + mputl(["static int nrd_11 = 11;"], fd) + end + + if maxtotal<81 then + mputl(["static int nrd_81 = 81;"], fd); + end + if maxtotal<82 then + mputl(["static int nrd_82 = 82;"], fd); + end + if maxtotal<84 then + mputl(["static int nrd_84 = 84;"], fd); + end + if maxtotal<811 then + mputl(["static int nrd_811 = 811;"], fd); + end + if maxtotal<812 then + mputl(["static int nrd_812 = 812;"], fd); + end + if maxtotal<814 then + mputl(["static int nrd_814 = 814;"], fd); + end + + mputl(["" + "/* Some general static variables */" + "static double zero=0;" + "static double w[1];" + "static int aaa=0, bbb=0;" + "void **"+rdnom+"_block_outtbptr;"], fd); //** !! + + mputl([make_static_standalone42()], fd); + + mputl(["static void usage();" + "" + "/* Main program */" + "int main(int argc, char *argv[])" + "{" + " double tf=30;" // FIXME : Add current simulation tf. + " double dt=0.1;" // FIXME : Try to figure out what is the given Simulation step. + " double h=0.001;" + " int solver=3;" + " char * progname = argv[0];" + " int c;" + " strcpy(input,'"'");" + " strcpy(output,'"'");" + " while ((c = getopt(argc , argv, '"i:o:d:t:e:s:hv'")) != -1)" + " switch (c) {" + " case ''i'':" + " strcpy(input,argv[optind-1]);" + " break;" + " case ''o'':" + " strcpy(output,argv[optind-1]);" + " break;" + " case ''d'':" + " strcpy(s,argv[optind-1]);" + " dt=strtod(s,p);" + " break;" + " case ''t'':" + " strcpy(sf,argv[optind-1]);" + " tf=strtod(sf,p);" + " break;" + " case ''e'':" + " strcpy(se,argv[optind-1]);" + " h=strtod(se,p);" + " break;" + " case ''s'':" + " strcpy(ss,argv[optind-1]);" + " solver=(int) strtod(ss,p);" + " break;" + " case ''h'':" + " usage(progname);" + " printf(""Options : \n'");" + " printf("" -h for the help \n"");" + " printf("" -v for printing the Scilab Version \n"");" + " printf("" -i for input file name, by default is Terminal \n"");" + " printf("" -o for output file name, by default is Terminal \n"");" + " printf("" -d for the clock period, by default is 0.1 \n"");" + " printf("" -t for the final time, by default is 30 \n"");" + " printf("" -e for the solvers step size, by default is 0.001 \n"");" + " printf("" -s integer parameter for select the numerical solver : \n"");" + " printf("" 1 for Euler''s method \n"");" + " printf("" 2 for Heun''s method \n"");" + " printf("" 3 (default value) for the Fourth-Order Runge-Kutta"+... + " (RK4) Formula \n"");" + " return 0;" + " break;" + " case ''v'':" + " printf(""Generated by Code_Generation toolbox of Xcos """ + " ""with "+getversion()+" version \n"");" + " return 0;" + " break;" + " case ''?'':" + " errflg++;" + " break;" + " }" + " if (errflg){" + " usage(progname);" + " return 0;" + " }" + " " + " "+rdnom+"_sim(tf,dt,h,solver);" + " return 0;" + "}" + "" + "static void usage(prog)" + " char *prog;" + "{" + " fprintf(stderr, ""Usage: %s [-h] [-v] [-i arg] [-o arg] """ + " ""[-d arg] [-t arg] [-e arg] [-s arg]\n"", prog);" + "}" + ""], fd); + + mputl(["/*"+part("-",ones(1,40))+" External simulation function */" + "int "+rdnom+"_sim(tf,dt,h,solver)" + "" + " double tf,dt,h;" + " int solver;" + "{" + " double t;" + " int nevprt=1;" + " int local_flag;" + " int nport;" + " int i;" + " double *args[100];" + ""], fd); + + if (x <> []) then + mputl([" double tout;" + " double he=0.1;" + ""], fd); + end + + mputl([" /* Initial values */" + "" + " /* Note that z[]=[z_initial_condition;outtbptr;work]" + cformatline(" z_initial_condition={"+... + strcat(string(z),",")+"};",70) + cformatline(" outtbptr={"+... + strcat(string(zeros(lstsize(outtb),1)),"," )+"};",70) + cformatline(" work= {"+... + strcat(string(work),"," )+"};",70) + " */" + "" + cformatline(" double z[]={"+strcat(string(Z),",")+"};",70)], fd); + + if size(z,1) <> 0 then + for i=1:(length(zptr)-1) + if zptr(i+1)-zptr(i)>0 then + if size(corinv(i),"*")==1 then + OO=scs_m.objs(corinv(i)) + else + path=list("objs") + for l=cpr.corinv(i)(1:$-1) + path($+1)=l;path($+1)="model" + path($+1)="rpar" + path($+1)="objs" + end + path($+1)=cpr.corinv(i)($) + OO=scs_m(path) + end + aaa=OO.gui + bbb=emptystr(3,1); + if and(aaa+bbb~=["INPUTPORTEVTS";"OUTPUTPORTEVTS";"EVTGEN_f"]) then + mputl([""; + " /* Routine name of block: "+strcat(string(cpr.sim.funs(i))); + " Gui name of block: "+strcat(string(OO.gui)); + //'/* Name block: '+strcat(string(cpr.sim.funs(i))); + //'Object number in diagram: '+strcat(string(cpr.corinv(i))); + " Compiled structure index: "+strcat(string(i));], fd); + if stripblanks(OO.model.label)~=emptystr() then + mputl([cformatline(" Label: "+strcat(string(OO.model.label)),70)], fd); + end + if stripblanks(OO.graphics.exprs(1))~=emptystr() then + mputl([cformatline(" Exprs: "+strcat(OO.graphics.exprs(1),","),70)], fd); + end + if stripblanks(OO.graphics.id)~=emptystr() then + mputl([cformatline(" Identification: "+.. + strcat(string(OO.graphics.id)),70)], fd); + end + mputl([cformatline(" z={"+... + strcat(string(z(zptr(i):zptr(i+1)-1)),",")+"};",70) + " */"], fd); + end + end + end + end + + //** declaration of oz + Code_oz = []; + for i=1:lstsize(oz) + if mat2scs_c_nb(oz(i)) <> 11 then + Code_oz=[Code_oz; + cformatline(" "+mat2c_typ(oz(i))+... + " oz_"+string(i)+"[]={"+... + strcat(string(oz(i)(:)),",")+"};",70)] + else //** cmplx test + Code_oz=[Code_oz; + cformatline(" "+mat2c_typ(oz(i))+... + " oz_"+string(i)+"[]={"+... + strcat(string([real(oz(i)(:)); + imag(oz(i)(:))]),",")+"};",70)] + end + end + + if Code_oz <> [] then + mputl([" /* oz declaration */" + Code_oz], fd); + end + + //** declaration of outtb + Code_outtb = []; + for i=1:lstsize(outtb) + if mat2scs_c_nb(outtb(i)) <> 11 then + Code_outtb=[Code_outtb; + cformatline(" "+mat2c_typ(outtb(i))+... + " outtb_"+string(i)+"[]={"+... + strcat(string(outtb(i)(:)),",")+"};",70)] + else //** cmplx test + Code_outtb=[Code_outtb; + cformatline(" "+mat2c_typ(outtb(i))+... + " outtb_"+string(i)+"[]={"+... + strcat(string([real(outtb(i)(:)); + imag(outtb(i)(:))]),",")+"};",70)] + end + end + + if Code_outtb<>[] then + mputl(["" + " /* outtb declaration */" + Code_outtb + ""], fd); + end + + Code_outtbptr=[]; + for i=1:lstsize(outtb) + Code_outtbptr=[Code_outtbptr; + " "+rdnom+"_block_outtbptr["+... + string(i-1)+"] = (void *) outtb_"+string(i)+";"]; + end + + //** declaration of work + mputl([" /* work ptr declaration */" + " void **work;" + "" + //## affectation of work + " /* Get work ptr of blocks */" + " work = (void **)(z+"+string(size(z,"*")+lstsize(outtb))+");" + ""], fd); + + //## affection of outtbptr + if Code_outtb<>[] then + mputl([" /* Get outtbptr ptr of blocks */" + " "+rdnom+"_block_outtbptr = (void **)(z+"+string(nztotal)+");" + ""], fd); + end + if Code_outtbptr<>[] then + mputl([Code_outtbptr + ""], fd); + end + + for kf=1:nblk + nx=xptr(kf+1)-xptr(kf); //** number of continuous state + nin=inpptr(kf+1)-inpptr(kf); //** number of input ports + nout=outptr(kf+1)-outptr(kf); //** number of output ports + + //** add comment + mputl(["" + " "+get_comment("set_blk",list(funs(kf),funtyp(kf),kf,labels(kf)));], fd); + + mputl([" block_"+rdnom+"["+string(kf-1)+"].type = "+string(funtyp(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].ztyp = "+string(ztyp(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].ng = "+string(zcptr(kf+1)-zcptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nz = "+string(zptr(kf+1)-zptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].noz = "+string(ozptr(kf+1)-ozptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nrpar = "+string(rpptr(kf+1)-rpptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nopar = "+string(opptr(kf+1)-opptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nipar = "+string(ipptr(kf+1)-ipptr(kf))+";" + " block_"+rdnom+"["+string(kf-1)+"].nin = "+string(inpptr(kf+1)-inpptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nout = "+string(outptr(kf+1)-outptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nevout = "+string(clkptr(kf+1)-clkptr(kf))+";"; + " block_"+rdnom+"["+string(kf-1)+"].nmode = "+string(modptr(kf+1)-modptr(kf))+";";], fd); + + if nx <> 0 then + mputl([" block_"+rdnom+"["+string(kf-1)+"].nx = "+string(nx)+";"; + " block_"+rdnom+"["+string(kf-1)+"].x = &(x["+string(xptr(kf)-1)+"]);" + " block_"+rdnom+"["+string(kf-1)+"].xd = &(xd["+string(xptr(kf)-1)+"]);"], fd); + end + + mputl([" if ((block_"+rdnom+"["+string(kf-1)+"].evout = "+... + "calloc(block_"+rdnom+"["+string(kf-1)+"].nevout,sizeof(double)))== NULL) return 0;"], fd); + + //***************************** input port *****************************// + //** alloc insz/inptr **// + mputl([" if ((block_"+rdnom+"["+string(kf-1)+"].inptr = "+... + "malloc(sizeof(double*)*block_"+rdnom+"["+string(kf-1)+"].nin))== NULL) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].insz = "+... + "malloc(3*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nin))== NULL) return 0;"], fd); + + //** inptr **// + for k=1:nin + lprt=inplnk(inpptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].inptr["+string(k-1)+... + "] = "+rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd); + end + + //** 1st dim **// + for k=1:nin + lprt=inplnk(inpptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1))+... + "] = "+string(size(outtb(lprt),1))+";"], fd); + end + + //** 2dn dim **// + for k=1:nin + lprt=inplnk(inpptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1)+nin)+... + "] = "+string(size(outtb(lprt),2))+";"], fd); + end + + //** typ **// + for k=1:nin + lprt=inplnk(inpptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].insz["+string((k-1)+2*nin)+... + "] = "+mat2scs_c_typ(outtb(lprt))+";"], fd); + end + //**********************************************************************// + + //***************************** output port *****************************// + //** alloc outsz/outptr **// + mputl([" if ((block_"+rdnom+"["+string(kf-1)+"].outsz = "+... + "malloc(3*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nout))== NULL) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].outptr = "+... + "malloc(sizeof(double*)*block_"+rdnom+"["+string(kf-1)+"].nout))== NULL) return 0;"], fd); + + //** outptr **// + for k=1:nout + lprt=outlnk(outptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].outptr["+string(k-1)+... + "] = "+rdnom+"_block_outtbptr["+string(lprt-1)+"];"], fd); + end + + //** 1st dim **// + for k=1:nout + lprt=outlnk(outptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1))+... + "] = "+string(size(outtb(lprt),1))+";"], fd); + end + + //** 2dn dim **// + for k=1:nout + lprt=outlnk(outptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1)+nout)+... + "] = "+string(size(outtb(lprt),2))+";"], fd); + end + + //** typ **// + for k=1:nout + lprt=outlnk(outptr(kf)-1+k); + mputl([" block_"+rdnom+"["+string(kf-1)+"].outsz["+string((k-1)+2*nout)+... + "] = "+mat2scs_c_typ(outtb(lprt))+";"], fd); + end + //**********************************************************************// + + mputl([" block_"+rdnom+"["+string(kf-1)+... + "].z = &(z["+string(zptr(kf)-1)+"]);"], fd); + + if (part(funs(kf),1:7) ~= "capteur" &... + part(funs(kf),1:10) ~= "actionneur" &... + funs(kf) ~= "bidon") then + //** rpar **// + if (rpptr(kf+1)-rpptr(kf)>0) then + mputl([ " block_"+rdnom+"["+string(kf-1)+... + "].rpar=&(RPAR1["+string(rpptr(kf)-1)+"]);"], fd); + end + //** ipar **// + if (ipptr(kf+1)-ipptr(kf)>0) then + mputl([" block_"+rdnom+"["+string(kf-1)+... + "].ipar=&(IPAR1["+string(ipptr(kf)-1)+"]);"], fd); + end + //** opar **// + if (opptr(kf+1)-opptr(kf)>0) then + mputl([" if ((block_"+rdnom+"["+string(kf-1)+"].oparptr = "+... + "malloc(sizeof(void *)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL ) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].oparsz = "+... + "malloc(2*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL ) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].opartyp = "+... + "malloc(sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].nopar))== NULL ) return 0;"; + ], fd); + nopar = opptr(kf+1)-opptr(kf); + //** oparptr **// + for k=1:nopar + mputl([" block_"+rdnom+"["+string(kf-1)+"].oparptr["+string(k-1)+... + "] = (void *) OPAR_"+string(opptr(kf)-1+k)+";"], fd); + end + //** 1st dim **// + for k=1:nopar + mputl([" block_"+rdnom+"["+string(kf-1)+"].oparsz["+string(k-1)+... + "] = "+string(size(opar(opptr(kf)-1+k),1))+";"], fd); + end + //** 2dn dim **// + for k=1:nopar + mputl([" block_"+rdnom+"["+string(kf-1)+"].oparsz["+string(nopar+(k-1))+... + "] = "+string(size(opar(opptr(kf)-1+k),2))+";"], fd); + end + //** typ **// + for k=1:nopar + mputl([" block_"+rdnom+"["+string(kf-1)+"].opartyp["+string(k-1)+... + "] = "+mat2scs_c_typ(opar(opptr(kf)-1+k))+";"], fd); + end + end + //** oz **// + if (ozptr(kf+1)-ozptr(kf)>0) then + noz = ozptr(kf+1)-ozptr(kf); + mputl([" if ((block_"+rdnom+"["+string(kf-1)+"].ozptr = "+... + "malloc(sizeof(void *)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].ozsz = "+... + "malloc(2*sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;"; + " if ((block_"+rdnom+"["+string(kf-1)+"].oztyp = "+... + "malloc(sizeof(int)*block_"+rdnom+"["+string(kf-1)+"].noz))== NULL) return 0;";], fd); + //** ozptr **// + for k=1:noz + mputl([" block_"+rdnom+"["+string(kf-1)+"].ozptr["+string(k-1)+... + "] = (void *) oz_"+string(ozptr(kf)-1+k)+";"], fd); + end + //** 1st dim **// + for k=1:noz + mputl([" block_"+rdnom+"["+string(kf-1)+"].ozsz["+string(k-1)+... + "] = "+string(size(oz(ozptr(kf)-1+k),1))+";"], fd); + end + //** 2nd dim **// + for k=1:noz + mputl([" block_"+rdnom+"["+string(kf-1)+"].ozsz["+string(noz+(k-1))+... + "] = "+string(size(oz(ozptr(kf)-1+k),2))+";"], fd); + end + //** typ **// + for k=1:noz + mputl([" block_"+rdnom+"["+string(kf-1)+"].oztyp["+string(k-1)+... + "] = "+mat2scs_c_typ(oz(ozptr(kf)-1+k))+";"], fd); + end + end + end + mputl([" block_"+rdnom+"["+string(kf-1)+"].work = "+... + "(void **)(((double *)work)+"+string(kf-1)+");"], fd); + end + + mputl([" if (strlen(input) > 0)" + " aaa=1;" + " if (strlen(output)> 0)" + " bbb=1;" + "" + " /* set initial time */" + " t=0.0;" + ""], fd); + + //** init + mputl([" "+get_comment("flag",list(4))], fd); + + for kf=1:nblk + if or(kf==act) | or(kf==cap) then + txt = call_block42(kf,0,4); + if txt <> [] then + mputl([""; + " "+txt], fd); + end + else + txt = call_block42(kf,0,4); + if txt <> [] then + mputl([""; + " "+txt], fd); + end + end + end + + //** cst blocks and it's dep + txt=write_code_idoit() + + if txt<>[] then + mputl(["" + " /* Initial blocks must be called with flag 1 */" + txt], fd); + end + + //** begin input main loop on time + mputl(["" + " while (t < tf) {"; + " /* */" + " sci_time=t;" + ""], fd); + + //** find source activation number + blks=find(funtyp>-1); + evs=[]; + + for blk=blks + for ev=clkptr(blk):clkptr(blk+1)-1 + if funs(blk)=="bidon" then + if ev > clkptr(howclk) -1 + evs=[evs,ev]; + end + end + end + end + + //** flag 1,2,3 + for flag=[1,2,3] + + txt3=[] + + //** continuous time blocks must be activated + //** for flag 1 + if flag==1 then + txt = write_code_cdoit(flag); + + if txt <> [] then + txt3=["" + " "+get_comment("ev",list(0)) + txt; + ]; + end + end + + //** blocks with input discrete event must be activated + //** for flag 1, 2 and 3 + if size(evs,2)>=1 then + txt4=[] + //** + for ev=evs + txt2=write_code_doit(ev,flag); + if txt2<>[] then + //** adjust event number because of bidon block + new_ev=ev-(clkptr(howclk)-1) + //** + txt4=[txt4; + Indent2+[" case "+string(new_ev)+" : "+... + get_comment("ev",list(new_ev)) + txt2]; + " break;";""] + end + end + + //** + if txt4 <> [] then + txt3=[txt3; + Indent+" /* Discrete activations */" + Indent+" switch (nevprt) {" + txt4 + " }"]; + end + end + + //** + if txt3<>[] then + mputl([" "+get_comment("flag",list(flag)) + txt3], fd); + end + end + + if x<>[] then + mputl(["" + " tout=t;" + "" + " /* integrate until the cumulative add of the integration" + " * time step doesn''t cross the sample time step" + " */" + " while (tout+h 0 then + mputl(["" + " /* update ptrs of continuous array */"], fd); + for kf=1:nblk + nx=xptr(kf+1)-xptr(kf); //** number of continuous state + if nx<>0 then + mputl([" block_"+rdnom+"["+string(kf-1)+"].nx = "+... + string(nx)+";"; + " block_"+rdnom+"["+string(kf-1)+"].x = "+... + "&(x["+string(xptr(kf)-1)+"]);" + " block_"+rdnom+"["+string(kf-1)+"].xd = "+... + "&(xd["+string(xptr(kf)-1)+"]);"], fd); + end + end + end + + mputl(["" + " /* update current time */" + " t=t+dt;" + " }" + //** flag 5 + "" + " sci_time = tf;" + "" + " "+get_comment("flag",list(5))], fd); + + for kf=1:nblk + if or(kf==act) | or(kf==cap) then + txt = call_block42(kf,0,5); + if txt <> [] then + mputl([""; + " "+txt], fd); + end + else + txt = call_block42(kf,0,5); + if txt <> [] then + mputl([""; + " "+txt], fd); + end + end + end + + mputl(["" + " return 0;" + "}" + "" + "/*"+part("-",ones(1,40))+" Lapack messag function */"; + "void C2F(xerbla)(char *SRNAME,int *INFO,long int L)" + "{" + " printf(""** On entry to %s, parameter number %d""" + " "" had an illegal value\n"",SRNAME,*INFO);" + "}" + "" + "void set_block_error(int err)" + "{" + " return;" + "}" + "" + "int get_phase_simulation()" + "{" + " return 1;" + "}" + "" + "void * scicos_malloc(size_t size)" + "{" + " return malloc(size);" + "}" + "" + "void scicos_free(void *p)" + "{" + " free(p);" + "}" + "" + "double get_scicos_time()" + "{" + " return sci_time;" + "}" + "" + "void do_cold_restart()" + "{" + " return;" + "}" + "" + "void sciprint (char *fmt)" + "{" + " return;" + "}" + "" + "int getopt (int argc, char *argv[], char *optstring)" + "{" + " char *group, option, *sopt;" + " int len;" + " option = -1;" + " optarg = NULL;" + " while ( optind < argc )" + " { " + " group = argv[optind];" + " if ( *group != ''-'' )" + " {" + " option = -1;" + " optarg = group;" + " optind++;" + " break;" + " }" + " len = strlen (group);" + " group = group + offset;" + " if ( *group == ''-'' )" + " {" + " group++;" + " offset += 2;" + " }" + " else" + " offset++ ;" + " option = *group ;" + " sopt = strchr ( optstring, option ) ;" + " if ( sopt != NULL )" + " {" + " sopt++ ;" + " if ( *sopt == '':'' )" + " {" + " optarg = group + 1;" + " if ( *optarg == ''\0'' )" + " optarg = argv[++optind];" + " if ( *optarg == ''-'' )" + " {" + " fprintf ( stderr, '"\n%s: illegal option -- %c'"," + " argv[0], option );" + " option = ''?'';" + " break;" + " }" + " else" + " {" + " optind++;" + " offset = 0;" + " break;" + " }" + " }" + " if ( offset >= len )" + " {" + " optind++;" + " offset = 0;" + " }" + " break;" + " }" + " else" + " {" + " fprintf ( stderr, '"\n%s: illegal option -- %c'", argv[0], option );" + " option = ''?'';" + " break;" + " }" + " }" + " return ( option );" + "}" + ""], fd); + + if (x <> []) then + mputl(["int C2F("+rdnom+"simblk)(t, x, xd)" + "" + " double t, *x, *xd;" + "" + " /*" + " * !purpose" + " * compute state derivative of the continuous part" + " * !calling sequence" + " * neq : integer the size of the continuous state" + " * t : current time" + " * x : double precision vector whose contains the continuous state" + " * xd : double precision vector, contain the computed derivative" + " * of the state" + " */" + "{" + " int phase=2;" + " int local_flag;" + " int nport;" + " int nevprt=1;" + " double *args[100];" + " dset(&neq, &c_b14,xd , &c__1);" + "" + " "+get_comment("update_xd",list())], fd); + + for kf=1:nblk + if (xptr(kf+1)-xptr(kf)) > 0 then + mputl([" block_"+rdnom+"["+string(kf-1)+"].x="+... + "&(x["+string(xptr(kf)-1)+"]);" + " block_"+rdnom+"["+string(kf-1)+"].xd="+... + "&(xd["+string(xptr(kf)-1)+"]);"], fd); + end + end + + mputl(["" + write_code_odoit(1) + write_code_odoit(0) + "" + " return 0;" + "}" + "" + "int dset(int *n, double *dx, double *dy, int *incy)" + "{" + " int iMax = 0;" + " int i = 0, iy = 0;" + " --dy;" + " if (*n <= 0) return 0;" + " iy = 1;" + " if (*incy < 0)" + " {" + " iy = (-(*n) + 1) * *incy + 1;" + " }" + " iMax = *n;" + " for (i = 1; i <= iMax; ++i)" + " {" + " dy[iy] = *dx;" + " iy += *incy;" + " }" + " return 0;" + "}" + "" + "/* Euler''s Method */" + "int ode1(f,t,h)" + " int (*f) ();" + " double t, h;" + "{" + " int i;" + "" + " /**/" + " (*f)(t,x, xd);" + "" + " for (i=0;i [] then + txt=[txt; + "/* def continuous state */" + cformatline("double x[]={"+strcat(string(x),",")+"};",70) + cformatline("double xd[]={"+strcat(string(x),",")+"};",70) + "static int c__1 = 1;" + "static double c_b14 = 0.;" + "static int neq="+string(nX)+";" + ""] + end + //************************// + + txt=[txt; + "char input[50], output[50],s[1],sf[1],se[1],ss[1],**p;" + "static double sci_time;" + "static int errflg = 0;" + "static char *optarg = NULL ;" + "static int optind = 1, offset = 0 ;" + "scicos_block block_"+rdnom+"["+string(nblk)+"];" + ""]; + + //*** Real parameters ***// + if size(rpar,1) <> 0 then + txt=[txt; + "/* def real parameters */" + "static double RPAR1[ ] = {"]; + + for i=1:(length(rpptr)-1) + if rpptr(i+1)-rpptr(i)>0 then + + if size(corinv(i),"*")==1 then + OO=scs_m.objs(corinv(i)); + else + path=list("objs"); + for l=cpr.corinv(i)(1:$-1) + path($+1)=l; + path($+1)="model"; + path($+1)="rpar"; + path($+1)="objs"; + end + path($+1)=cpr.corinv(i)($); + OO=scs_m(path); + end + + //** Add comments **// + txt($+1)="/* Routine name of block: "+strcat(string(cpr.sim.funs(i))); + txt($+1)=" * Gui name of block: "+strcat(string(OO.gui)); + txt($+1)=" * Compiled structure index: "+strcat(string(i)); + + if stripblanks(OO.model.label)~=emptystr() then + txt=[txt;cformatline(" * Label: "+strcat(string(OO.model.label)),70)]; + end + if stripblanks(OO.graphics.exprs(1))~=emptystr() then + txt=[txt;cformatline(" * Exprs: "+strcat(OO.graphics.exprs(1),","),70)]; + end + if stripblanks(OO.graphics.id)~=emptystr() then + txt=[txt; + cformatline(" * Identification: "+strcat(string(OO.graphics.id)),70)]; + end + txt=[txt;" * rpar="]; + txt($+1)=" */"; + //******************// + + txt=[txt; + cformatline(strcat(msprintf("%.25E,\n",rpar(rpptr(i):rpptr(i+1)-1))),70); + ""] + + end + end + txt=[txt; + "};" + ""] + + else + txt($+1)="static double RPAR1[1];"; + end + //***********************// + + //*** Integer parameters ***// + if size(ipar,1) <> 0 then + txt=[txt; + "/* def integer parameters */" + "static int IPAR1[ ] = {"]; + + for i=1:(length(ipptr)-1) + if ipptr(i+1)-ipptr(i)>0 then + if size(corinv(i),"*")==1 then + OO=scs_m.objs(corinv(i)); + else + path=list("objs"); + for l=cpr.corinv(i)(1:$-1) + path($+1)=l + path($+1)="model" + path($+1)="rpar" + path($+1)="objs" + end + path($+1)=cpr.corinv(i)($); + OO=scs_m(path); + end + + //** Add comments **// + txt($+1)="/* Routine name of block: "+strcat(string(cpr.sim.funs(i))); + txt($+1)=" * Gui name of block: "+strcat(string(OO.gui)); + txt($+1)=" * Compiled structure index: "+strcat(string(i)); + if stripblanks(OO.model.label)~=emptystr() then + txt=[txt;cformatline(" * Label: "+strcat(string(OO.model.label)),70)]; + end + + if stripblanks(OO.graphics.exprs(1))~=emptystr() then + txt=[txt; + cformatline(" * Exprs: "+strcat(OO.graphics.exprs(1),","),70)]; + end + if stripblanks(OO.graphics.id)~=emptystr() then + txt=[txt; + cformatline(" * Identification: "+strcat(string(OO.graphics.id)),70)]; + end + txt=[txt; + cformatline(" * ipar= {"+strcat(string(ipar(ipptr(i):ipptr(i+1)-1)),",")+"};",70)]; + txt($+1)=" */"; + //******************// + + txt=[txt;cformatline(strcat(string(ipar(ipptr(i):ipptr(i+1)-1))+","),70)]; + txt($+1)=""; + end + end + txt=[txt; + "};" + ""] + else + txt($+1)="static int IPAR1[1];"; + end + //**************************// + + //Alan added opar (27/06/07) + //*** Object parameters ***// + if lstsize(opar)<>0 then + txt=[txt; + "/* def object parameters */"] + for i=1:(length(opptr)-1) + if opptr(i+1)-opptr(i)>0 then + + if size(corinv(i),"*")==1 then + OO=scs_m.objs(corinv(i)); + else + path=list("objs"); + for l=cpr.corinv(i)(1:$-1) + path($+1)=l; + path($+1)="model"; + path($+1)="rpar"; + path($+1)="objs"; + end + path($+1)=cpr.corinv(i)($); + OO=scs_m(path); + end + + //** Add comments **// + txt($+1)=""; + txt($+1)="/* Routine name of block: "+strcat(string(cpr.sim.funs(i))); + txt($+1)=" * Gui name of block: "+strcat(string(OO.gui)); + txt($+1)=" * Compiled structure index: "+strcat(string(i)); + if stripblanks(OO.model.label)~=emptystr() then + txt=[txt;cformatline(" * Label: "+strcat(string(OO.model.label)),70)]; + end + if stripblanks(OO.graphics.id)~=emptystr() then + txt=[txt; + cformatline(" * Identification: "+strcat(string(OO.graphics.id)),70)]; + end + txt($+1)=" */"; + //******************// + + + for j=1:opptr(i+1)-opptr(i) + txt =[txt; + cformatline("static "+mat2c_typ(opar(opptr(i)+j-1)) +... + " OPAR_"+string(opptr(i)+j-1) + "[] = {"+... + strcat(string(opar(opptr(i)+j-1)),",")+"};",70)] + end + end + end + end + //*************************// + + txt=[txt; + ""] + format(oldFormat(2), oldFormat(1)); +endfunction + +//utilitary fonction used to format long C instruction +//t : a string containing a C instruction +//l : max line length allowed + +//Author : Rachid Djenidi +function t1=cformatline(t ,l) + // Force format to avoid precision loss + oldFormat = format(); + format(25); + + sep=[",","+"] + l1=l-2 + t1=[] + kw=strindex(t," ") + nw=0 + if kw<>[] then + if kw(1)==1 then // there is leading blanks + k1=find(kw(2:$)-kw(1:$-1)<>1) + if k1==[] then // there is a single blank + nw=1 + else + nw=kw(k1(1)) + end + end + end + t=part(t,nw+1:length(t)); + bl=part(" ",ones(1,nw)) + l1=l-nw;first=%t + while %t + if length(t)<=l then + t1=[t1;bl+t] + break + end + k=strindex(t,sep); + if k==[] then + t1=[t1;bl+t] + break + end + k($+1)=length(t)+1 // positions of the commas + i=find(k(1:$-1)<=l&k(2:$)>l) //nearest left comma (reltively to l) + if i==[] then + i=1 + end + t1=[t1;bl+part(t,1:k(i))] + t=part(t,k(i)+1:length(t)) + if first then + l1=l1-2;bl=bl+" "; + first=%f; + end + end + + format(oldFormat(2), oldFormat(1)); +endfunction + +// +// Generate Matrix of all binary code from +// 1 to 2^n-1 +// +function vec = binaryTable(n) + n = int(n); + vec = []; + for i = 1:n + accu = []; + for j = 1:2^(n-i-1) + accu = [accu ; zeros(2^(i-1),1) ; ones(2^(i-1),1)] + end + vec = [accu, vec] + end + vec=vec(2:$, :); // Remove first line [ 0 --- 0 ] +endfunction + +//used in do_compile_superblock +function vec=codebinaire(v,szclkIN) + vec=zeros(1,szclkIN) + for i=1:szclkIN + w=v/2; + vec(i)=v-2*int(w); + v=int(w); + end +endfunction + +function t=filetype(m) + m=int32(m) + filetypes=["Directory","Character device","Block device",... + "Regular file","FIFO","Symbolic link","Socket"] + bits=[16384,8192,24576,32768,4096,40960,49152] + m=int32(m)&int32(61440) + t=filetypes(find(m==int32(bits))) +endfunction + +//get_blank : return blanks with a length +// of the given input string +// +//input : str : a string +// +//output : txt : blanks +// +//16/06/07 Author : A.Layec +function [txt] = get_blank(str) + txt=""; + for i=1:length(str) + txt=txt+" "; + end +endfunction + +// get_comment : return a C comment +// for generated code +// +//input : typ : a string +// param : a list +// +//output : a C comment +// +//16/06/07 Author : A.Layec +function [txt]=get_comment(typ,param) + txt = []; + select typ + //** main flag + case "flag" then + select param(1) + case 0 then + txt = "/* Continuous state computation */" + case 1 then + txt = "/* Output computation */" + case 2 then + txt = "/* Discrete state computation */" + case 3 then + txt = "/* Output Event computation */" + case 4 then + txt = "/* Initialization */" + case 5 then + txt = "/* Ending */" + case 9 then + txt = "/* Update zero crossing surfaces */" + end + //** blocks activated on event number + case "ev" then + txt = "/* Blocks activated on the event number "+string(param(1))+" */" + + //** blk calling sequence + case "call_blk" then + txt = ["/* Call of ''"+param(1) + ... + "'' (type "+string(param(2))+" - blk nb "+... + string(param(3))+" - uid "+param(4)]; + if ztyp(param(3)) then + txt=txt+" - with zcross) */"; + else + txt=txt+") */"; + end + //** proto calling sequence + case "proto_blk" then + txt = ["/* prototype of ''"+param(1) + ... + "'' (type "+string(param(2))]; + if ztyp(param(3)) then + txt=txt+" - with zcross) */"; + else + txt=txt+") */"; + end + //** ifthenelse calling sequence + case "ifthenelse_blk" then + txt = ["/* Call of ''if-then-else'' blk (blk nb "+... + string(param(1))+") */"] + //** eventselect calling sequence + case "evtselect_blk" then + txt = ["/* Call of ''event-select'' blk (blk nb "+... + string(param(1))+") */"] + //** set block structure + case "set_blk" then + txt = ["/* set blk struc. of ''"+param(1) + ... + "'' (type "+string(param(2))+" - blk nb "+... + string(param(3))++" - uid "+param(4)+") */"]; + //** Update xd vector ptr + case "update_xd" then + txt = ["/* Update xd vector ptr */"]; + //** Update g vector ptr + case "update_g" then + txt = ["/* Update g vector ptr */"]; + else + break; + end +endfunction + +//mat2c_typ : matrix to C type +//sci2c_ttyp : get the C string of a scicos type +// +//input : outtb : a matrix +// +//output : txt : the string of the C scicos type +// of the data of outtb +// +//16/06/07 Author : A.Layec +function [txt]=mat2c_typ(outtb) + select type(outtb) + //real matrix + case 1 then + if isreal(outtb) then + txt = "double" + else + txt = "double" + end + //integer matrix + case 8 then + select typeof(outtb) + case "int32" then + txt = "long" + case "int16" then + txt = "short" + case "int8" then + txt = "char" + case "uint32" then + txt = "unsigned long" + case "uint16" then + txt = "unsigned short" + case "uint8" then + txt = "unsigned char" + end + else + break; + end +endfunction + +//mat2scs_c_nb matrix to scicos C number (sci2sci_n) +// +//input : outtb : a matrix +// +//output : c_nb : the scicos C number +// +//16/06/07 Author : A.Layec +function [c_nb]=mat2scs_c_nb(outtb) + select type(outtb) + //real matrix + case 1 then + if isreal(outtb) then + c_nb = 10 + else + c_nb = 11 + end + //integer matrix + case 8 then + select typeof(outtb) + case "int32" then + c_nb = 84 + case "int16" then + c_nb = 82 + case "int8" then + c_nb = 81 + case "uint32" then + c_nb = 814 + case "uint16" then + c_nb = 812 + case "uint8" then + c_nb = 811 + end + else + break; + end +endfunction + +//mat2scs_c_ptr matrix to scicos C ptr (sci2c_typ) +// +//input : outtb : a matrix +// +//output : txt : the string of the C scicos type +// of the data of outtb +// +//16/06/07 Author : A.Layec +function [txt]=mat2scs_c_ptr(outtb) + select type(outtb) + //real matrix + case 1 then + if isreal(outtb) then + txt = "SCSREAL_COP" + else + txt = "SCSCOMPLEX_COP" + end + //integer matrix + case 8 then + select typeof(outtb) + case "int32" then + txt = "SCSINT32_COP" + case "int16" then + txt = "SCSINT16_COP" + case "int8" then + txt = "SCSINT8_COP" + case "uint32" then + txt = "SCSUINT32_COP" + case "uint16" then + txt = "SCSUINT16_COP" + case "uint8" then + txt = "SCSUINT8_COP" + end + else + break; + end +endfunction + +//mat2scs_c_typ matrix to scicos C type +// +//input : outtb : a matrix +// +//output : txt : the string of the C scicos type +// of the data of outtb +// +//16/06/07 Author : A.Layec +function [txt]=mat2scs_c_typ(outtb) + select type(outtb) + //real matrix + case 1 then + if isreal(outtb) then + txt = "SCSREAL_N" + else + txt = "SCSCOMPLEX_N" + end + //integer matrix + case 8 then + select typeof(outtb) + case "int32" then + txt = "SCSINT32_N" + case "int16" then + txt = "SCSINT16_N" + case "int8" then + txt = "SCSINT8_N" + case "uint32" then + txt = "SCSUINT32_N" + case "uint16" then + txt = "SCSUINT16_N" + case "uint8" then + txt = "SCSUINT8_N" + end + else + break; + end +endfunction + +//scs_c_n2c_fmt : scicos C number to C format +// +//input : c_nb : a C scicos type +// +//output : txt : the string of the C format string +// of the data of outtb +// +//16/06/07 Author : A.Layec +function [txt]=scs_c_n2c_fmt(c_nb) + select c_nb + //real matrix + case 10 then + txt = "%f"; + //complex matrix + case 11 then + txt = "%f,%f"; + //int8 matrix + case 81 then + txt = "%d"; + //int16 matrix + case 82 then + txt = "%d"; + //int32 matrix + case 84 then + txt = "%d"; + //uint8 matrix + case 811 then + txt = "%d"; + //uint16 matrix + case 812 then + txt = "%d"; + //uint32 matrix + case 814 then + txt = "%d"; + else + txt="%f" + break; + end +endfunction + +//scs_c_n2c_typ scicos C number to C type +// +//input : c_nb : a C scicos number +// +//output : txt : the string of the C format string +// of the data of outtb +// +//16/06/07 Author : A.Layec +function [txt]=scs_c_n2c_typ(c_nb) + select c_nb + //real matrix + case 10 then + txt = "double"; + //complex matrix + case 11 then + txt = "double"; + //int8 matrix + case 81 then + txt = "char"; + //int16 matrix + case 82 then + txt = "short"; + //int32 matrix + case 84 then + txt = "long"; + //uint8 matrix + case 811 then + txt = "unsigned char"; + //uint16 matrix + case 812 then + txt = "unsigned short"; + //uint32 matrix + case 814 then + txt = "unsigned long"; + else + txt="double" + break; + end +endfunction + +//scs_c_nb2scs_nb : scicos C number to scicos number +// +//input : c_nb : the scicos C number type +// +//output : scs_nb : the scilab number type +// +//16/06/07 Author : A.Layec +function [scs_nb]=scs_c_nb2scs_nb(c_nb) + scs_nb=zeros(size(c_nb,1),size(c_nb,2)); + for i=1:size(c_nb,1) + for j=1:size(c_nb,2) + select (c_nb(i,j)) + case 10 then + scs_nb(i,j) = 1 + case 11 then + scs_nb(i,j) = 2 + case 81 then + scs_nb(i,j) = 5 + case 82 then + scs_nb(i,j) = 4 + case 84 then + scs_nb(i,j) = 3 + case 811 then + scs_nb(i,j) = 8 + case 812 then + scs_nb(i,j) = 7 + case 814 then + scs_nb(i,j) = 6 + else + scs_nb(i,j) = 1 + end + end + end +endfunction + +//used in do_compile_superblock +function XX=update_block(XX) + execstr("o="+rdnom+"_c(''define'')") + XX.model=o.model + XX.gui=rdnom+"_c"; + XX.graphics.gr_i=o.graphics.gr_i +endfunction + +//write_code_cdoit : generate body of the code for +// for all time dependant blocks +// +//input : flag : flag number for block's call +// +//output : txt for cord blocks +// +//12/07/07 Alan Layec +function [txt]=write_code_cdoit(flag) + txt=[]; + + for j=1:ncord + bk=cord(j,1); + pt=cord(j,2); + //** blk + if funtyp(bk)>-1 then + if or(bk==act) | or(bk==cap) then + if stalone then + txt2=call_block42(bk,pt,flag); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + end + else + txt2=call_block42(bk,pt,flag); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + end + //** ifthenelse blk + elseif funtyp(bk)==-1 then + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + thentxt=write_code_doit(clkptr(bk),flag); + elsetxt=write_code_doit(clkptr(bk)+1,flag); + if thentxt<>[] | elsetxt<>[] then + txt=[txt; + " "+get_comment("ifthenelse_blk",list(bk));] + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " if("+tmp_+">0) {"] + //*******// + txt=[txt; + Indent+thentxt]; + if elsetxt<>[] then + //** C **// + txt=[txt; + " }"; + " else {";] + //*******// + txt=[txt; + Indent+elsetxt]; + end + //** C **// + txt=[txt; + " }"] + //*******// + end + //** eventselect blk + elseif funtyp(bk)==-2 then + Noutport=clkptr(bk+1)-clkptr(bk); + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + II=[]; + switchtxt=list() + for i=1: Noutport + switchtxt(i)=write_code_doit(clkptr(bk)+i-1,flag); + if switchtxt(i)<>[] then II=[II i];end + end + if II<>[] then + txt=[txt; + " "+get_comment("evtselect_blk",list(bk));] + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " i=max(min((int) "+... + tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);" + " switch(i)" + " {"] + //*******// + for i=II + //** C **// + txt=[txt; + " case "+string(i)+" :";] + //*******// + txt=[txt; + BigIndent+write_code_doit(clkptr(bk)+i-1,flag);] + //** C **// + txt=[txt; + BigIndent+"break;"] + //*******// + end + //** C **// + txt=[txt; + " }"]; + //*******// + end + //** Unknown block + else + error("Unknown block type "+string(bk)); + end + end + +endfunction + +//write_code_doit : generate body of the code for +// ordering calls of blocks during +// flag 1,2 & flag 3 +// +//input : ev : evt number for block's call +// flag : flag number for block's call +// +//output : txt for flag 1 or 2, or flag 3 +// +//12/07/07 Alan Layec +function [txt]=write_code_doit(ev,flag) + txt=[]; + + for j=ordptr(ev):ordptr(ev+1)-1 + bk=ordclk(j,1); + pt=ordclk(j,2); + //** blk + if funtyp(bk)>-1 then + if or(bk==act) | or(bk==cap) then + if stalone then + txt2=call_block42(bk,pt,flag); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + end + else + txt2=call_block42(bk,pt,flag); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + end + //** ifthenelse blk + elseif funtyp(bk)==-1 then + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + thentxt=write_code_doit(clkptr(bk),flag); + elsetxt=write_code_doit(clkptr(bk)+1,flag); + if thentxt<>[] | elsetxt<>[] then + txt=[txt; + " "+get_comment("ifthenelse_blk",list(bk));] + //** C **// + tmp_ = "*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " if("+tmp_+">0) {"] + //*******// + txt=[txt; + Indent+thentxt] + if elsetxt<>[] then + //** C **// + txt=[txt; + " }"; + " else {";] + //*******// + txt=[txt; + Indent+elsetxt]; + end + //** C **// + txt=[txt; + " }"] + //*******// + end + //** eventselect blk + elseif funtyp(bk)==-2 then + Noutport=clkptr(bk+1)-clkptr(bk); + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + II=[]; + switchtxt=list() + for i=1: Noutport + switchtxt(i)=write_code_doit(clkptr(bk)+i-1,flag); + if switchtxt(i)<>[] then II=[II i];end + end + if II<>[] then + txt=[txt; + " "+get_comment("evtselect_blk",list(bk));] + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + //** C **// + txt=[txt; + " i=max(min((int) "+... + tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);" + " switch(i)" + " {"] + //*******// + for i=II + //** C **// + txt=[txt; + " case "+string(i)+" :";] + //*******// + txt=[txt; + BigIndent+write_code_doit(clkptr(bk)+i-1,flag);] + //** C **// + txt=[txt; + BigIndent+"break;"] + //*******// + end + //** C **// + txt=[txt; + " }"] + //*******// + end + //** Unknown block + else + error("Unknown block type "+string(bk)); + end + end + +endfunction + +//write_code_idoit : generate body of the code for +// ordering calls of initial +// called blocks +// +//input : nothing (blocks are called with flag 1) +// +//output : txt for iord +// +//15/07/07 Alan Layec +function [txt]=write_code_idoit() + txt=[]; + + for j=1:niord + bk=iord(j,1); + pt=iord(j,2); + //** blk + if funtyp(bk)>-1 then + if or(bk==act) then + if stalone then + txt2=call_block42(bk,pt,1); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + end + else + txt2=call_block42(bk,pt,1); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + end + //** ifthenelse blk + elseif funtyp(bk)==-1 then + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + thentxt=write_code_doit(clkptr(bk),1); + elsetxt=write_code_doit(clkptr(bk)+1,1); + if thentxt<>[] | elsetxt<>[] then + txt=[txt; + " "+get_comment("ifthenelse_blk",list(bk));] + //** C **// + tmp_ = "*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " if("+tmp_+">0) {"] + //*******// + txt=[txt; + Indent+thentxt]; + if elsetxt<>[] then + //** C **// + txt=[txt; + " }"; + " else {";] + //*******// + txt=[txt; + Indent+elsetxt]; + end + //** C **// + txt=[txt; + " }"] + //*******// + end + //** eventselect blk + elseif funtyp(bk)==-2 then + Noutport=clkptr(bk+1)-clkptr(bk); + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + II=[]; + switchtxt=list() + for i=1: Noutport + switchtxt(i)=write_code_doit(clkptr(bk)+i-1,1); + if switchtxt(i)<>[] then II=[II i];end + end + if II<>[] then + txt=[txt; + " "+get_comment("evtselect_blk",list(bk));] + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " i=max(min((int) "+... + tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);"] + txt=[txt; + " switch(i)" + " {"] + //*******// + for i=II + //** C **// + txt=[txt; + " case "+string(i)+" :";] + //*******// + txt=[txt; + BigIndent+write_code_doit(clkptr(bk)+i-1,1);] + //** C **// + txt=[txt; + BigIndent+"break;"] + //*******// + end + //** C **// + txt=[txt; + " }"]; + //*******// + end + //** Unknown block + else + error("Unknown block type "+string(bk)); + end + end + +endfunction + +//write_code_odoit : generate body of the code for +// ordering calls of blocks before +// continuous time integration +// +//input : flag : flag number for block's call +// +//output : txt for flag 0 +// +//12/07/07 Alan Layec +function [txt]=write_code_odoit(flag) + txt=[]; + + for j=1:noord + bk=oord(j,1); + pt=oord(j,2); + //** blk + if funtyp(bk)>-1 then + txt2=call_block42(bk,pt,flag); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + //** ifthenelse blk + elseif funtyp(bk)==-1 then + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + thentxt=write_code_ozdoit(clkptr(bk),flag); + elsetxt=write_code_ozdoit(clkptr(bk)+1,flag); + if thentxt<>[] | elsetxt<>[] then + txt=[txt; + " "+get_comment("ifthenelse_blk",list(bk));] + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " if ((block_"+rdnom+"["+string(bk-1)+"].nmode<0"+... + " && "+tmp_+">0)"+... + " || \" + " (block_"+rdnom+"["+string(bk-1)+"].nmode>0"+... + " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==1)) {"] + //*******// + txt=[txt; + Indent+thentxt] + //** C **// + txt=[txt; + " }"]; + //*******// + if elsetxt<>[] then + //** C **// + txt=[txt; + " else if ((block_"+rdnom+"["+string(bk-1)+"].nmode<0"+... + " && "+tmp_+"<=0)"+... + " || \" + " (block_"+rdnom+"["+string(bk-1)+"].nmode>0"+... + " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==2)) {";] + //*******// + txt=[txt; + Indent+elsetxt] + //** C **// + txt=[txt; + " }"]; + //*******// + end + end + //** eventselect blk + elseif funtyp(bk)==-2 then + Noutport=clkptr(bk+1)-clkptr(bk); + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + II=[]; + switchtxt=list() + for i=1: Noutport + switchtxt(i)=write_code_ozdoit(clkptr(bk)+i-1,flag); + if switchtxt(i)<>[] then II=[II i];end + end + if II<>[] then + txt=[txt; + " "+get_comment("evtselect_blk",list(bk));] + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " if (block_"+rdnom+"["+string(bk-1)+"].nmode<0) {"; + " i=max(min((int) "+... + tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);" + " }" + " else {" + " i=block_"+rdnom+"["+string(bk-1)+"].mode[0];" + " }"] + txt=[txt; + " switch(i)" + " {"]; + //*******// + for i=II + //** C **// + txt=[txt; + " case "+string(i)+" :";] + //*******// + txt=[txt; + BigIndent+write_code_ozdoit(clkptr(bk)+i-1,flag);] + //** C **// + txt=[txt; + BigIndent+"break;"] + //*******// + end + //** C **// + txt=[txt; + " }"]; + //*******// + end + //** Unknown block + else + error("Unknown block type "+string(bk)); + end + end + +endfunction + +//write_code_ozdoit : generate body of the code for both +// flag 0 & flag 9 +// +//input: ev : evt number for block's call +// flag : flag number for block's call +// +//output : txt for flag 0 or flag 9 +// +//12/07/07 Alan Layec +function [txt]=write_code_ozdoit(ev,flag) + txt=[]; + + for j=ordptr(ev):ordptr(ev+1)-1 + bk=ordclk(j,1); + pt=ordclk(j,2); + //** blk + if funtyp(bk)>-1 then + if (or(bk==act) | or(bk==cap)) & (flag==1) then + if stalone then + txt=[txt; + " "+call_block42(bk,pt,flag) + ""]; + end + else + txt2=call_block42(bk,pt,flag); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + end + //** ifthenelse blk + elseif funtyp(bk)==-1 then + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + thentxt=write_code_ozdoit(clkptr(bk),flag); + elsetxt=write_code_ozdoit(clkptr(bk)+1,flag); + if thentxt<>[] | elsetxt<>[] then + txt=[txt; + " "+get_comment("ifthenelse_blk",list(bk));] + //** C **// + tmp_ = "*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " if (((phase==1"+... + " || block_"+rdnom+"["+string(bk-1)+"].nmode==0)"+... + " && "+tmp_+">0)"+... + " || \" + " ((phase!=1"+... + " && block_"+rdnom+"["+string(bk-1)+"].nmode!=0)"+... + " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==1)) {"] + //*******// + txt=[txt; + Indent+thentxt] + //** C **// + txt=[txt; + " }"]; + //*******// + if elsetxt<>[] then + //** C **// + txt=[txt; + " else if (((phase==1"+... + " || block_"+rdnom+"["+string(bk-1)+"].nmode==0)"+... + " && "+tmp_+"<=0)"+... + " || \" + " ((phase!=1"+... + " && block_"+rdnom+"["+string(bk-1)+"].nmode!=0)"+... + " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==2)) {";] + //*******// + txt=[txt; + Indent+elsetxt] + //** C **// + txt=[txt; + " }"]; + //*******// + end + end + //** eventselect blk + elseif funtyp(bk)==-2 then + Noutport=clkptr(bk+1)-clkptr(bk); + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + II=[]; + switchtxt=list() + for i=1: Noutport + switchtxt(i)=write_code_ozdoit(clkptr(bk)+i-1,flag); + if switchtxt(i)<>[] then II=[II i];end + end + if II<>[] then + txt=[txt; + " "+get_comment("evtselect_blk",list(bk));] + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " if (phase==1 || block_"+rdnom+"["+string(bk-1)+"].nmode==0) {"; + " i=max(min((int) "+... + tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);" + " }" + " else {" + " i=block_"+rdnom+"["+string(bk-1)+"].mode[0];" + " }"] + txt=[txt; + " switch(i)" + " {"]; + //*******// + for i=II + //** C **// + txt=[txt; + " case "+string(i)+" :";] + //*******// + txt=[txt; + BigIndent+write_code_ozdoit(clkptr(bk)+i-1,flag);] + //** C **// + txt=[txt; + BigIndent+"break;"] + //*******// + end + //** C **// + txt=[txt; + " }"]; + //*******// + end + //** Unknown block + else + error("Unknown block type "+string(bk)); + end + end + +endfunction + +//write_code_zdoit : generate body of the code for +// ordering calls of blocks before +// continuous time zero crossing +// detection +// +//input : noting +// +//output : txt for flag 9 +// +//12/07/07 Alan Layec +function [txt]=write_code_zdoit() + txt=[]; + + //** first pass (flag 1) + for j=1:nzord + bk=zord(j,1); + pt=zord(j,2); + //** blk + if funtyp(bk)>-1 then + if or(bk==act) | or(bk==cap) then + if stalone then + txt=[txt; + " "+call_block42(bk,pt,1) + ""]; + end + else + txt2=call_block42(bk,pt,1); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + end + //** ifthenelse blk + elseif funtyp(bk)==-1 then + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + thentxt=write_code_ozdoit(clkptr(bk),1); + elsetxt=write_code_ozdoit(clkptr(bk)+1,1); + if thentxt<>[] | elsetxt<>[] then + txt=[txt; + " "+get_comment("ifthenelse_blk",list(bk));] + //** C **// + tmp_ = "*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " if (((phase==1"+... + " || block_"+rdnom+"["+string(bk-1)+"].nmode==0)"+... + " && "+tmp_+">0)"+... + " || \" + " ((phase!=1"+... + " && block_"+rdnom+"["+string(bk-1)+"].nmode!=0)"+... + " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==1)) {"] + //*******// + txt=[txt; + Indent+thentxt] + //** C **// + txt=[txt; + " }"]; + //*******// + if elsetxt<>[] then + //** C **// + txt=[txt; + " else if (((phase==1"+... + " || block_"+rdnom+"["+string(bk-1)+"].nmode==0)"+... + " && "+tmp_+"<=0)"+... + " || \" + " ((phase!=1"+... + " && block_"+rdnom+"["+string(bk-1)+"].nmode!=0)"+... + " && block_"+rdnom+"["+string(bk-1)+"].mode[0]==2)) {";] + //*******// + txt=[txt; + Indent+elsetxt] + //** C **// + txt=[txt; + " }"]; + //*******// + end + end + //** eventselect blk + elseif funtyp(bk)==-2 then + Noutport=clkptr(bk+1)-clkptr(bk); + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + II=[]; + switchtxt=list() + for i=1: Noutport + switchtxt(i)=write_code_ozdoit(clkptr(bk)+i-1,1); + if switchtxt(i)<>[] then II=[II i];end + end + if II<>[] then + txt=[txt; + " "+get_comment("evtselect_blk",list(bk));] + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + txt=[txt; + " if (phase==1 || block_"+rdnom+"["+string(bk-1)+"].nmode==0){"; + " i=max(min((int) "+... + tmp_+",block_"+rdnom+"["+string(bk-1)+"].evout),1);" + " else {" + " i=block_"+rdnom+"["+string(bk-1)+"].mode[0];" + " }"] + txt=[txt; + " switch(i)" + " {"]; + //*******// + for i=II + //** C **// + txt=[txt; + " case "+string(i)+" :";] + //*******// + txt=[txt; + BigIndent+write_code_ozdoit(clkptr(bk)+i-1,1);] + //** C **// + txt=[txt; + BigIndent+"break;"] + //*******// + end + //** C **// + txt=[txt; + " }"]; + //*******// + end + //** Unknown block + else + error("Unknown block type "+string(bk)); + end + end + + //** second pass (flag 9) + for j=1:nzord + bk=zord(j,1); + pt=zord(j,2); + //** blk + if funtyp(bk)>-1 then + if or(bk==act) | or(bk==cap) then + if stalone then + txt=[txt; + " "+call_block42(bk,pt,9) + ""]; + end + else + txt2=call_block42(bk,pt,9); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + end + + //** ifthenelse blk + elseif funtyp(bk)==-1 then + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + //*******// + thentxt=write_code_zzdoit(clkptr(bk),9); + elsetxt=write_code_zzdoit(clkptr(bk)+1,9); + txt=[txt; + " "+get_comment("ifthenelse_blk",list(bk));] + //** C **// + txt=[txt; + " g["+string(zcptr(bk)-1)+"]=(double)"+tmp_+";"] + //*******// + if thentxt<>[] | elsetxt<>[] then + //** C **// + txt=[txt; + " if (g["+string(zcptr(bk)-1)+"] > 0.){"] + //*******// + txt=[txt; + Indent+thentxt] + //** C **// + txt=[txt; + " }"] + //*******// + if elsetxt <> [] then + //** C **// + txt=[txt; + " else {"] + //*******// + txt=[txt; + Indent+elsetxt] + //** C **// + txt=[txt; + " }"] + //*******// + end + end + //** C **// + txt=[txt; + " if(phase==1 && block_"+rdnom+"["+string(bk-1)+"].nmode > 0){" + " if (g["+string(zcptr(bk)-1)+"] > 0.){" + " block_"+rdnom+"["+string(bk-1)+"].mode[0] = 1;" + " }" + " else {" + " block_"+rdnom+"["+string(bk-1)+"].mode[0] = 2;" + " }" + " }"] + //*******// + //** eventselect blk + elseif funtyp(bk)==-2 then + Noutport=clkptr(bk+1)-clkptr(bk); + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + //*******// + II=[]; + switchtxt=list() + for i=1:Noutport + switchtxt(i)=write_code_zzdoit(clkptr(bk)+i-1,9); + if switchtxt(i)<>[] then II=[II i];end + end + txt=[txt; + " "+get_comment("evtselect_blk",list(bk));] + if II<>[] then + //** C **// + txt=[txt; + " j=max(min((int) "+... + tmp_+",block_"+rdnom+"["+string(bk-1)+"].nevout),1);"] + txt=[txt; + " switch(j)" + " {"]; + //*******// + for i=II + //** C **// + txt=[txt; + " case "+string(j)+" :";] + //*******// + txt=[txt; + BigIndent+write_code_zzdoit(clkptr(bk)+i-1,9);] + //** C **// + txt=[txt; + BigIndent+"break;"] + //*******// + end + //** C **// + txt=[txt; + " }"]; + //*******// + end + //** C **// + txt=[txt; + " for (jj=0;jj0){" + " j=max(min((int) "+tmp_+"," + " block_"+rdnom+"["+string(bk-1)+"].nevout),1);" + " block_"+rdnom+"["+string(bk-1)+"].mode[0]= j;" + " }"] + //*******// + //** Unknown block + else + error("Unknown block type "+string(bk)); + end + end + +endfunction + +//write_code_zzdoit : generate body of the code for +// flag 9 +// +//input: ev : evt number for block's call +// flag : flag number for block's call +// +//output : txt for flag 9 +// +//12/07/07 Alan Layec +function [txt]=write_code_zzdoit(ev,flag) + txt=[]; + + for j=ordptr(ev):ordptr(ev+1)-1 + bk=ordclk(j,1); + pt=ordclk(j,2); + //** blk + if funtyp(bk)>-1 then + if or(bk==act) | or(bk==cap) then + if stalone then + txt=[txt; + " "+call_block42(bk,pt,flag) + ""]; + end + else + txt2=call_block42(bk,pt,flag); + if txt2<>[] then + txt=[txt; + " "+txt2 + ""]; + end + end + //** ifthenelse blk + elseif funtyp(bk)==-1 then + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + //*******// + thentxt=write_code_zzdoit(clkptr(bk),9); + elsetxt=write_code_zzdoit(clkptr(bk)+1,9); + txt=[txt; + " "+get_comment("ifthenelse_blk",list(bk));] + //** C **// + txt=[txt; + " g["+string(zcptr(bk)-1)+"]=(double)"+tmp_+";"] + //*******// + if thentxt<>[] | elsetxt<>[] then + //** C **// + txt=[txt; + " if (g["+string(zcptr(bk)-1)+"] > 0.){"] + //*******// + txt=[txt; + Indent+thentxt] + //** C **// + txt=[txt; + " }"] + //*******// + if elsetxt <> [] then + //** C **// + txt=[txt; + " else {"] + //*******// + txt=[txt; + Indent+elsetxt] + //** C **// + txt=[txt; + " }"] + //*******// + end + end + //** C **// + txt=[txt; + " if(phase==1 && block_"+rdnom+"["+string(bk-1)+"].nmode > 0){" + " if (g["+string(zcptr(bk)-1)+"] > 0.){" + " block_"+rdnom+"["+string(bk-1)+"].mode[0] = 1;" + " }" + " else {" + " block_"+rdnom+"["+string(bk-1)+"].mode[0] = 2;" + " }" + " }"] + //*******// + + //** eventselect blk + elseif funtyp(bk)==-2 then + Noutport=clkptr(bk+1)-clkptr(bk); + ix=-1+inplnk(inpptr(bk)); + TYPE=mat2c_typ(outtb(ix+1)); //** scilab index start from 1 + //** C **// + tmp_="*(("+TYPE+" *)"+rdnom+"_block_outtbptr["+string(ix)+"])" + //*******// + II=[]; + switchtxt=list() + for i=1:Noutport + switchtxt(i)=write_code_zzdoit(clkptr(bk)+i-1,9); + if switchtxt(i)<>[] then II=[II i];end + end + txt=[txt; + " "+get_comment("evtselect_blk",list(bk));] + if II<>[] then + //** C **// + txt=[txt; + " j=max(min((int) "+... + tmp_+",block_"+rdnom+"["+string(bk-1)+"].nevout),1);"] + txt=[txt; + " switch(j)" + " {"]; + //*******// + for i=II + //** C **// + txt=[txt; + " case "+string(j)+" :";] + //*******// + txt=[txt; + BigIndent+write_code_zzdoit(clkptr(bk)+i-1,9);] + //** C **// + txt=[txt; + BigIndent+"break;"] + //*******// + end + //** C **// + txt=[txt; + " }"]; + //*******// + end + //** C **// + txt=[txt; + " for (jj=0;jj0){" + " j=max(min((int) "+tmp_+"," + " block_"+rdnom+"["+string(bk-1)+"].nevout),1);" + " block_"+rdnom+"["+string(bk-1)+"].mode[0]= j;" + " }"] + //*******// + + //** Unknown block + else + error("Unknown block type "+string(bk)); + end + end + +endfunction + + diff --git a/modules/scicos/macros/scicos_scicos/do_delete1.bin b/modules/scicos/macros/scicos_scicos/do_delete1.bin new file mode 100755 index 000000000..7f05da707 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/do_delete1.bin differ diff --git a/modules/scicos/macros/scicos_scicos/do_delete1.sci b/modules/scicos/macros/scicos_scicos/do_delete1.sci new file mode 100755 index 000000000..c678ae673 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/do_delete1.sci @@ -0,0 +1,253 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [scs_m,DEL,DELL]=do_delete1(scs_m,K,gr) + //! + // + //** 30 August 2007 : + //** BEWARE: this code is BUGGED : see the residual split after delete + //** this bug is older than Simone (see scilab 3.1.1) + //** + //** 22 June 2006 : New Graphics Interface update + // + // Perform deletion of scs_m object whose index are given in the vector + // K and all other relevant objects (link, splits,..) + // + // deleted objects: + // - are replaced by the value : mlist('Deleted') + // - not to change the indexing: use do_purge to suppress them and to renumber objects + // + //** Perform deletion of [scs_m] object whose index are given in the vector + //** [K] and all other relevant objects (link, splits,..) in recursive way + // + //** Deleted objects are replaced by the value : mlist('Deleted') + //** ---> not to change the indexing: + //** ---> use [do_purge] to suppress them and to renumber objects + //** Similar strategy is used for the ghraphics object: to mantain the coherency + //** from the grphics object "gh_curwin.children.children(gr_k)" [Compund] list and the + //** scs_o.objs(k) data structure with the equation + //** + //** gr_k = get_gri(k, o_size(1)) + //** + //** where + //** + //** o_size = size(gh_curwin.children.children); // o_size(1) => length o_size(2) => 1 + //** + //** the graphics "Compound" object are NOT deleted BUT set to "invisible" with the propriety + //** + //** gh_object.visible = "off" // You can't see me, by John Cena :) ... ask enrico.mannori + //** + //** OK: ...looks simple... until you begin to fight with the code ... + //** + + DEL = [] // table of deleted objects + DELL= [] // table of redefined links + outin = ["out","in"] + + //** Delete object until "K" is empty + //** ---------------------------------------------------------------------------------------------- + while K<>[] do + + k = K(1); K(1) = [] ; + + o = scs_m.objs(k); + + if find(DEL==k)==[] then + typ = typeof(o); + else + typ = "Deleted" + end + + DEL=[DEL k] + + //**----------------------------------- Link ------------------------------------------- + if typ=="Link" then + + [ct,from,to]=(o.ct,o.from,o.to) + + // free connected ports + if ct(2)==2 then //Implicit link + + if or(scs_m.objs(from(1)).graphics.pin==k) & from(3)==1 then + scs_m.objs(from(1))=mark_prt(scs_m.objs(from(1)),from(2),"in",ct(2),0) + else //or(scs_m.objs(from(1)).graphics.pout==k) then + scs_m.objs(from(1))=mark_prt(scs_m.objs(from(1)),from(2),"out",ct(2),0) + end + + if or(scs_m.objs(to(1)).graphics.pin==k) & to(3)==1 then + scs_m.objs(to(1))=mark_prt(scs_m.objs(to(1)),to(2),"in",ct(2),0) + else // or(scs_m.objs(to(1)).graphics.pout==k) then + scs_m.objs(to(1))=mark_prt(scs_m.objs(to(1)),to(2),"out",ct(2),0) + end + + else + scs_m.objs(from(1))=mark_prt(scs_m.objs(from(1)),from(2),"out",ct(2),0) + scs_m.objs(to(1))=mark_prt(scs_m.objs(to(1)),to(2),"in",ct(2),0) + end + + fromblock=scs_m.objs(from(1)); + toblock=scs_m.objs(to(1)); + + if or(fromblock.gui==["SPLIT_f" "CLKSPLIT_f" "IMPSPLIT_f"]) then + //user kills a split output link: + + //get links connected to the split block + connected=get_connected(scs_m,from(1)) + if size(setdiff(connected,K),"*")==2 then + //RN: 22-7-2004 setdiff added above + //create a unique link with the split input and remaining + //output link and suppress the split block + if find(connected(2)==DEL)<>[] then // delete split + K = [from(1) K] + else + ksplit=from(1) + DEL=[DEL ksplit] //suppress split block + o1=scs_m.objs(connected(1));from1=o1.to; + o2=scs_m.objs(connected(2)); + + //create a unique link + if o1.from(1)==ksplit&o2.from(1)==ksplit then + //the two links come from the split: invert o1 + w=o1.to;o1.to=o1.from;o1.from=w; + o1.xx=o1.xx($:-1:1);o1.yy=o1.yy($:-1:1); + elseif o1.to(1)==ksplit(1)&o2.to(1)==ksplit then + //the two links go from the split: invert o2 + w=o2.to;o2.to=o2.from;o2.from=w; + o2.xx=o2.xx($:-1:1);o2.yy=o2.yy($:-1:1); + elseif o1.to(1)<>ksplit then + //o1 comes from the split while o2 goes to the split, + //switch o1 and o2 + [o1,o2]=(o2,o1), + connected=connected([2 1]); + end + + //now we can assume that o1 goes to the split and o2 comes + //from the split + from1=o1.to;to2=o2.to;ct2=o2.ct + //the links comes from connected(1) block and + //goes to connected(2) block + x1=o1.xx;y1=o1.yy + if x1($-1)==x1($)&o2.xx(1)==o2.xx(2)|.. // both segs are vertical + y1($-1)==y1($)&o2.yy(1)==o2.yy(2) then //both segs are horiz + o1.xx=[x1(1:$-1);o2.xx(2:$)]; + o1.yy=[y1(1:$-1);o2.yy(2:$)]; + else + o1.xx=[x1(1:$-1);o2.xx]; + o1.yy=[y1(1:$-1);o2.yy]; + end + o1.to=o2.to; + + DEL = [DEL connected(1)] // suppress one link + DELL=[DELL connected(1)] + scs_m.objs(connected(2))=o1 //change link + + scs_m.objs(to2(1))=mark_prt(scs_m.objs(to2(1)),to2(2),outin(to2(3)+1),ct2(2),.. + connected(2)) + scs_m.objs(o1.from(1))=mark_prt(scs_m.objs(o1.from(1)),o1.from(2),.. + outin(o1.from(3)+1),o1.ct(2),connected(2)) + + end // delete split + end //get links connected to the split block + end // erase and delete link + + if toblock.gui=="SPLIT_f"|toblock.gui=="CLKSPLIT_f" then // + //user kills a split input link + //ask for split deletion + K=[K to(1)] + elseif toblock.gui=="IMPSPLIT_f" then + //user kills a IMPsplit link: + + //get links connected to the split block + connected=get_connected(scs_m,to(1)) + if size(connected,"*")==2 then + //create a unique link with the split input and remaining + //output link and suppress the split block + if find(connected(2)==DEL)<>[] then // delete split + K=[to(1) K] + else + + DEL=[DEL to(1)] //suppress split block + + o1=scs_m.objs(connected(1)); + o2=scs_m.objs(connected(2)); + //o1 and o2 are the links that comes from the split + + //create a unique link + to1=o1.to; //number of block at the boundary of link o1 + to2=o2.to; //number of block at the boundary of link o2 + if (o1.xx(1)==o1.xx(2)& o2.xx(1)==o2.xx(2))| .. + (o1.yy(1)==o1.yy(2)& o2.yy(1)==o2.yy(2)) then + o1.xx=o1.xx(2:$);o1.yy=o1.yy(2:$) + end + o1.xx=[o1.xx($:-1:1);o2.xx] + o1.yy=[o1.yy($:-1:1);o2.yy] + o1.from=o1.to + o1.to=o2.to; + + + DEL=[DEL connected(1)] // suppress one link + DELL=[DELL connected(1)] + scs_m.objs(connected(2))=o1 //change link + + scs_m.objs(to1(1))=mark_prt(scs_m.objs(to1(1)),.. + to1(2),outin(to1(3)+1),o1.ct(2),connected(2)) + scs_m.objs(to2(1))=mark_prt(scs_m.objs(to2(1)),to2(2),.. + outin(to2(3)+1),ct(2), ... + connected(2)) + end //if find(connected(2)==DEL)<>[] + + end //if size(connected,'*')==2 + + end //elseif toblock.gui=='IMPSPLIT_f' + + //** -------------------------------------- Block --------------------------------------- + elseif typ=="Block" then + + // get connected links + connected=get_connected(scs_m,k) + //ask for connected links deletion + K=[K connected] + + + //**--------------------------------------- Text ---------------------------------------- + elseif typ=="Text" then + //** do nothing :) + + //** ---------------------------- already "Deleted" object :) ---------------------------- + elseif typ=="Deleted" then + //** do nothing :) + + //** --------------------------- in all the other possibles cases ----------------------- + else + + messagebox("This object can''t be deleted","modal"); + + end //** link / Block / Text / Deleted / other... + + end //** ... end of while () + //**---------------------------------- end of main while() loop --------------------------- + + + //** Scan all the deleted elements and update the graphics datastrucure + for k = DEL + scs_m.objs(k) = mlist("Deleted"); //** mark the object as "Deleted" + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/do_edit_pal.bug b/modules/scicos/macros/scicos_scicos/do_edit_pal.bug new file mode 100755 index 000000000..95457ed66 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/do_edit_pal.bug @@ -0,0 +1,32 @@ +function [scicos_palnew]=do_edit_pal(scicos_pal) +// Copyright INRIA +scicos_palnew=[] +load('.scicos_pal') + txt=scicos_pal(:,2); +txtnew=txt +ld=%f +while ld=%f + txtnew=x_dialog('Edit the list of palettes below',txtnew) + if txtnew==[]|txt==txtnew then scicos_palnew=[];return;end + scicos_palnew=[] + for i=1:size(txtnew,1) + txtnew(i)=stripblanks(txtnew(i)) + l=length(txtnew(i)) + if l<>0 then + k=strindex(txtnew(i),'/');if k=[] then k=0;end + h=strindex(txtnew(i),'\');if h=[] then h=0;end + m=max(k,h); + n=strindex(txtnew(i),'.cosf') + if n=[] then n=strindex(txtnew(i),'.cos');end + if n=[] then + messagebox('All files must end with .cos or .cosf','modal') + scicos_palnew=[] + ld=%f;break + end + a=part(txtnew(i),m+1:n); + scicos_palnew=[scicos_palnew;[a,txtnew(i)]]; + ld=%t + end + end +end + diff --git a/modules/scicos/macros/scicos_scicos/do_eval.bin b/modules/scicos/macros/scicos_scicos/do_eval.bin new file mode 100755 index 000000000..479ac7189 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/do_eval.bin differ diff --git a/modules/scicos/macros/scicos_scicos/do_eval.sci b/modules/scicos/macros/scicos_scicos/do_eval.sci new file mode 100755 index 000000000..e26bc94db --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/do_eval.sci @@ -0,0 +1,207 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// Copyright (C) DIGITEO - 2010 - Jérôme PICARD +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [scs_m,cpr,needcompile,ok]=do_eval(scs_m,cpr,%scicos_context) + // This function (re)-evaluates blocks in the scicos data structure scs_m + + ok=%t + needcompile1=max(2,needcompile) + %mprt=funcprot() + funcprot(0) + scicos_getvalue=setvalue; + getvalue=setvalue; + + function scicosmessage(txt) + messagebox(["In block " + o.gui + ": "; + txt; + "current parameter value kept"],"Warning","modal"); + %scicos_prob = resume(%t) + endfunction + + // overload message + // This function is used to alert the user on setvalue + // (invalid exprs we keep the previous parameters) + function message(str) + if length(arg1.doc) >= 1 then + uid = arg1.doc(1); + uid = [full_uids uid]; + + html = ""; + html = html + "" + gettext("Evaluation problem: value not updated from context.") + "
      "; + html = html + strcat(str, "
      ") + "
      "; + html = html + ""; + warnBlockByUID(uid, html); + else + txt = gettext("Evaluation problem: value not updated from context."); + txt = [txt ; str]; + disp(txt); + end + + %scicos_prob = resume(%t) + endfunction + + // path on do_eval hierarchy loop + if ~isdef("full_uids") then + full_uids = []; + end + + global %scicos_prob + %scicos_prob=%f + + //## overload some functions used in GUI + deff("[ok,tt] = FORTR(funam,tt,i,o)","ok=%t") + deff("[ok,tt,cancel] = CFORTR2(funam,tt,i,o)","ok=%t,cancel=%f") + deff("[ok,tt,cancel] = CC4(funam,tt,i,o)","ok=%t,cancel=%f") + deff("[ok,tt] = CFORTR(funam,tt,i,o)","ok=%t") + deff("[x,y,ok,gc] = edit_curv(x,y,job,tit,gc)","ok=%t") + deff("[ok,tt,dep_ut] = genfunc1(tt,ni,no,nci,nco,nx,nz,nrp,type_)",.. + "dep_ut=model.dep_ut;ok=%t") + deff("result = dialog(labels,valueini)","result=valueini") + deff("[result,Quit] = scstxtedit(valueini,v2)","result=valueini,Quit=0") + deff("[ok,tt] = MODCOM(funam,tt,vinp,vout,vparam,vparamv,vpprop)",.. + "[dirF, nameF, extF] = fileparts(funam);.. + [modelica_path, modelica_directory] = getModelicaPath();.. + funam1 = []; .. + if (extF == """") then, .. + funam1 = modelica_directory + nameF + "".mo""; .. + elseif fileinfo(funam) == [] then, .. + funam1 = funam; .. + end; .. + if funam1 <> [] then, .. + mputl(tt, funam1); .. + end"); + %nx=lstsize(scs_m.objs) + funcprot(%mprt) + for %kk=1:%nx + o=scs_m.objs(%kk) + if typeof(o)=="Block" then + model=o.model + if model.sim=="super"| (model.sim=="csuper"& ~isequal(model.ipar,1)) then //exclude mask + sblock=model.rpar + context=sblock.props.context + [scicos_context1,ierr]=script2var(context,%scicos_context) + if ierr <>0 then + %now_win=xget("window") + scicosmessage(["Cannot evaluate a context";lasterror()]) + xset("window",%now_win) + else + previous_full_uids = full_uids; + if length(o.doc) >= 1 then + full_uids = [full_uids o.doc(1)]; + end + [sblock,%w,needcompile2,ok]=do_eval(sblock,list(),scicos_context1) + needcompile1=max(needcompile1,needcompile2) + full_uids = previous_full_uids; + if ok then + scs_m.objs(%kk).model.rpar=sblock + else + return + end + end + elseif o.model.sim(1)=="asuper" then + else + model=o.model + if ~isdef(o.gui) | ~or(type(evstr(o.gui) == [13 11])) then + if length(o.doc) >= 1 then + uid = [full_uids o.doc(1)]; + + html = ""; + html = html + "" + gettext("Evaluation problem: Unknown block") + "
      "; + html = html + ""; + warnBlockByUID(uid, html); + else + error("do_eval: " + gettext("Evaluation problem: Unknown block") + " " + o.gui); + end + end + + %scicos_prob=%f + ier=execstr("o="+o.gui+"(''set'',o)","errcatch", "m") + if ier==0& %scicos_prob==%f then + needcompile1=max(needcompile1,needcompile) // for scifunc_block + model_n=o.model + if or(model.blocktype<>model_n.blocktype)|.. // type 'c','d','z','l' + or(model.dep_ut<>model_n.dep_ut)|.. + (model.nzcross<>model_n.nzcross)|.. + (model.nmode<>model_n.nmode) then + needcompile1=4 + end + if (size(model.in,"*")<>size(model_n.in,"*"))|.. + (size(model.out,"*")<>size(model_n.out,"*"))|.. + (size(model.evtin,"*")<>size(model_n.evtin,"*")) then + // number of input (evt or regular ) or output changed + needcompile1=4 + end + if model.sim=="input"|model.sim=="output" then + if model.ipar<>model_n.ipar then + needcompile1=4 + end + end + + itisanMBLOCK=%f + if prod(size(model.sim))>1 then + if (model.sim(2)==30004) then + itisanMBLOCK=%t + end + end + + if (prod(size(model.sim))==1 & ~model.equations==list()) | itisanMBLOCK then + if ~isequal(model.equations.parameters,model_n.equations.parameters) then + param_name = model.equations.parameters(1); + param_name_n = model_n.equations.parameters(1); + if ~isequal(param_name,param_name_n) then + needcompile1=4 + else + for i=1:length(model.equations.parameters(2)) + if or((model.equations.parameters(2)(i))<>(model_n.equations.parameters(2)(i))) then + needcompile=0 + + // the initialization XML files is re-created by translator if needed + // XML=TMPDIR+'/'+stripblanks(scs_m.props.title(1))+'_imf_init.xml'; + // if ~deletefile(XML) then + // messagebox(msprintf(_('Unable to delete the file: %s'),XML),'error','modal'); + // end + + // the XML simulation is no more created with Xcos + // XMLTMP=TMPDIR+'/'+stripblanks(scs_m.props.title(1))+'_imSim.xml' + // if ~deletefile(XMLTMP) then + // messagebox(msprintf(_('Unable to delete the file: %s'),XMLTMP),'error','modal'); + // end + + break; + end + end + end + end + end + + scs_m.objs(%kk)=o + else + error(msprintf(gettext("%s: Error while calling block %s [uid=''%s'']: invalid parameter (ier=%f, %%scicos_prob=%%%s).\n"), "do_eval", o.gui, o.model.uid, ier, string(%scicos_prob))); + ok=%f + return + end + end + end + end + needcompile=needcompile1 + if needcompile==4 then cpr=list(),end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/do_purge.bin b/modules/scicos/macros/scicos_scicos/do_purge.bin new file mode 100755 index 000000000..37514e974 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/do_purge.bin differ diff --git a/modules/scicos/macros/scicos_scicos/do_purge.sci b/modules/scicos/macros/scicos_scicos/do_purge.sci new file mode 100755 index 000000000..b9edaf4f9 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/do_purge.sci @@ -0,0 +1,78 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function scs_m_new = do_purge(scs_m) + + // suppress deleted elements in a scicos data structure + nx = lstsize(scs_m.objs); + + // get index of deleted blocks + deleted=[]; + for k=1:nx + typ = typeof(scs_m.objs(k)); + if typ=="Deleted" then + deleted = [deleted,k]; + elseif typ=="Block" then + if scs_m.objs(k).model.sim=="super" then + scs_m.objs(k).model.rpar = do_purge(scs_m.objs(k).model.rpar) + end + end + + end + + if deleted==[] then // nothing has to be done + scs_m_new = scs_m + return ; //** EXIT point + end + + retained = 1:nx; + retained(deleted)=[]; + + // compute index cross table + old_to_new = ones(1,nx); + old_to_new(deleted) = 0*deleted; + old_to_new = rtitr(1,%z-1,old_to_new)'; + + scs_m_new = scicos_diagram( version=get_scicos_version() ); + scs_m_new.props = scs_m.props + for k=1:size(retained,"*") + o = scs_m.objs(retained(k)) + if typeof(o)=="Block" then + if o.graphics.pin<>[] then + o.graphics.pin = old_to_new(o.graphics.pin+1); + end + if o.graphics.pout<>[] then + o.graphics.pout = old_to_new(o.graphics.pout+1); + end + if o.graphics.pein<>[] then + o.graphics.pein = old_to_new(o.graphics.pein+1); + end + if o.graphics.peout<>[] then + o.graphics.peout = old_to_new(o.graphics.peout+1); + end + elseif typeof(o)=="Link" then + o.from(1) = old_to_new(o.from(1)+1); + o.to(1) = old_to_new(o.to(1)+1); + end + scs_m_new.objs(k)=o; + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/do_terminate.bin b/modules/scicos/macros/scicos_scicos/do_terminate.bin new file mode 100755 index 000000000..a1d1e3989 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/do_terminate.bin differ diff --git a/modules/scicos/macros/scicos_scicos/do_terminate.sci b/modules/scicos/macros/scicos_scicos/do_terminate.sci new file mode 100755 index 000000000..b4763945d --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/do_terminate.sci @@ -0,0 +1,104 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [alreadyran,%cpr] = do_terminate(scs_m,%cpr) + // Terminate the current simulation + // Ne rend pas la main à l'utilisateur en cas d'erreur + + + //** if sim or and state is not in %cpr + if prod(size(%cpr))<2 then + alreadyran = %f ; + return ; //** EXIT + end + + par = scs_m.props ; + + //** if the simulation have already ran + //** and is not finished + if alreadyran then + alreadyran = %f ; + state=%cpr.state; + + //** win = xget('window'); + gh_win = gcf(); + + //** run scicosim via 'finish' flag + ierr = execstr("[state,t]=scicosim(%cpr.state,par.tf,par.tf,%cpr.sim,"+.. + "''finish'',par.tol)","errcatch") + + //** xset('window',win) + scf(gh_win); + + %cpr ; //get write access at the variable + %cpr.state = state ;//not always called with second arg + + //**---------------------------------- + if ierr<>0 then + str_err=split_lasterror(lasterror()); + title_err="End problem." + + kfun = curblock() ; + corinv = %cpr.corinv + if kfun<>0 then //** block error + path = corinv(kfun) + + if type(path)==15 then //** modelica block + spec_err="The modelica block returns the error :"; + messagebox([title_err;spec_err;str_err],"modal"); + + else //** all other type of blocks + obj_path=path(1:$-1) + spec_err="block" + blk=path($) + scs_m_n=scs_m; + //** check if we can open a window + //** Alan: we can improve that piece of code + //** to also returns the name of the comput. func. + for i=1:size(path,"*") + if scs_m_n.objs(path(i)).model.sim=="super" then + scs_m_n=scs_m_n.objs(path(i)).model.rpar; + elseif scs_m_n.objs(path(i)).model.sim=="csuper" then + obj_path=path(1:i-1); + blk=path(i); + //spec_err='csuper block (block '+string(path(i+1))+')' + spec_err="csuper block" + break; + end + end + spec_err="The highlighted "+spec_err+" returns the error :"; + //** + scf(curwin) + //** call bad_connection + bad_connection(path,... + [title_err;spec_err;str_err],0,1,0,-1,0,1) + end + else//** simulateur error + messagebox(["End problem:";str_err],"modal") + end + end + //**--------------------------------- + + //** xset('window',curwin) + scf(curwin); + + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/do_update.bin b/modules/scicos/macros/scicos_scicos/do_update.bin new file mode 100755 index 000000000..b22f72182 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/do_update.bin differ diff --git a/modules/scicos/macros/scicos_scicos/do_update.sci b/modules/scicos/macros/scicos_scicos/do_update.sci new file mode 100755 index 000000000..1b31dc026 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/do_update.sci @@ -0,0 +1,124 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [%cpr,%state0,needcompile,alreadyran,ok]=do_update(%cpr,%state0,needcompile) + //Update an already compiled scicos diagram compilation result according to + //parameter changes + //! + ok=%t + select needcompile + case 0 then // only parameter changes + if size(newparameters)<>0 then + cor=%cpr.cor + [%state0,state,sim,ok]=modipar(newparameters,%state0,%cpr.state,%cpr.sim) + if ~ok then + alreadyran=do_terminate(); + disp("Partial compilation failed. Attempting a full compilation."); + needcompile=4 + [%cpr,ok]=do_compile(scs_m) + if ok then + %state0=%cpr.state + needcompile=0 + return; + end + end + %cpr.state=state,%cpr.sim=sim + end + case 1 then // parameter changes and/or port sizes change + if size(newparameters)<>0 then + // update parameters or states + cor=%cpr.cor + [%state0,state,sim,ok]=modipar(newparameters,%state0,%cpr.state,%cpr.sim) + if (~ok| findinlistcmd(%cpr.corinv,size(cor),">")<>list() ) then + alreadyran=do_terminate() + disp("Partial compilation failed. Attempting a full compilation."); + needcompile=4 + [%cpr,ok]=do_compile(scs_m) + if ok then + %state0=%cpr.state + needcompile=0 + end + return; + end + %cpr.state=state,%cpr.sim=sim + end + //update port sizes. + // NB: if modelica part block size has been changed, the diagram is recompiled + bllst=list(); + corinv=%cpr.corinv + sim=%cpr.sim + for k=1:size(corinv) + if type(corinv(k))==1 then //dont take care of modelica blocks + if size(corinv(k),"*")==1 then + bllst(k)=scs_m.objs(corinv(k)).model; + else + path=list("objs"); + for l=corinv(k)(1:$-1), + path($+1)=l; + path($+1)="model"; + path($+1)="rpar";path($+1)="objs"; + end + path($+1)=corinv(k)($); + path($+1)="model"; + bllst(k)=scs_m(path); + end + else // modelica block + //build a fake bllst(k) only for in and out fields + m=scicos_model(); + m.in=ones(sim.inpptr(k+1)-sim.inpptr(k),1) + m.out=ones(sim.outptr(k+1)-sim.outptr(k),1) + bllst(k)=m; + end + end + [ok,bllst]=adjust(bllst,sim("inpptr"),sim("outptr"),sim("inplnk"),.. + sim("outlnk")) + if ok then + [lnksz,lnktyp]=lnkptrcomp(bllst,sim("inpptr"),sim("outptr"),... + sim("inplnk"),sim("outlnk")) + %cpr.state("outtb")=buildouttb(lnksz,lnktyp) + %state0("outtb")=buildouttb(lnksz,lnktyp) + needcompile=0 + end + + case 2 then // partial recompilation + alreadyran=do_terminate() + [%cpr,ok]=c_pass3(scs_m,%cpr) + if ok then + %state0=%cpr.state + needcompile=0; + return; + end + disp("Partial compilation failed. Attempting a full compilation."); + [%cpr,ok]=do_compile(scs_m) + if ok then + %state0=%cpr.state + needcompile=0 + end + case 4 then // full compilation + alreadyran=do_terminate() + [%cpr,ok]=do_compile(scs_m) + if ok then + %state0=%cpr.state + needcompile=0 + end + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/do_version.bin b/modules/scicos/macros/scicos_scicos/do_version.bin new file mode 100755 index 000000000..0da93bce3 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/do_version.bin differ diff --git a/modules/scicos/macros/scicos_scicos/do_version.sci b/modules/scicos/macros/scicos_scicos/do_version.sci new file mode 100755 index 000000000..8042e0ce1 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/do_version.sci @@ -0,0 +1,2328 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// Copyright (C) DIGITEO - 2010 - Jérôme PICARD +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function scs_m=do_version(scs_m,version) + + // available versions of Scicos + availableVersions = [ .. + "scicos2.2"; .. + "scicos2.3"; .. + "scicos2.3.1"; .. + "scicos2.4"; .. + "scicos2.5.1"; .. + "scicos2.7"; .. + "scicos2.7.1"; .. + "scicos2.7.2"; .. + "scicos2.7.3"; .. + "scicos4"; .. + "scicos4.0.1"; .. + "scicos4.0.2"; .. + "scicos4.2"; .. + "scicos4.0.1"; .. + "scicos4.0.2"; .. + "scicos4.2"; .. + "scicos4.3"; .. + "scicos4.4"]; + + if ~or(version==availableVersions) then + error("No version update defined to "+version+" version") + end + + if version=="scicos2.2" then scs_m=do_version22(scs_m);version="scicos2.3";end + if version=="scicos2.3" then scs_m=do_version23(scs_m);version="scicos2.3.1";end + if version=="scicos2.3.1" then scs_m=do_version231(scs_m); version="scicos2.4";end + if version=="scicos2.4" then scs_m=do_version251(scs_m),version="scicos2.5.1";end + if version=="scicos2.5.1" then + ncl=lines() + lines(0) + disp("This is an old scicos diagram. I have to translate.") + scs_m=do_versionxx(scs_m);scs_m=do_version27(scs_m);version="scicos2.7"; + disp("I am now going to clean your diagram. Block numbers may change.") + scs_m=do_purge(scs_m); + disp("Save the diagram (under a different name just in case)") + lines(ncl(2)) + end + if version=="scicos2.7" then + disp("This is an old scicos diagram. I have to translate. Be patient.") + scs_m=do_version271(scs_m), + version="scicos2.7.1"; + end + if version=="scicos2.7.1" then scs_m=do_version272(scs_m),version="scicos2.7.2";end + if version=="scicos2.7.2" then scs_m=do_version273(scs_m),version="scicos2.7.3";end + if version=="scicos2.7.3" | version=="scicos4" |... + version=="scicos4.0.1" | version=="scicos4.0.2" then + version="scicos4.2"; + //*** do certification ***// + scs_m=update_scs_m(scs_m,version); + //*** update scope ***// + scs_m=do_version42(scs_m); + //*********************************// + end + if version=="scicos4.2" then + ncl=lines(); lines(0); + version="scicos4.3"; + //*** do certification ***// + scs_m=update_scs_m(scs_m,version); + scs_m=do_version43(scs_m); + lines(ncl(2)) + end + + if or(version==["scicos4.3";"scicos4.4"]) then + ncl=lines(); lines(0); + version="scicos4.3"; + scs_m=update_scs_m(scs_m,version); + scs_m=do_version43(scs_m); + scs_m.version = version; + lines(ncl(2)) + end +endfunction + +function scs_m_new=do_version43(scs_m) + //disp('do_version43'); + scs_m_new=scs_m; + + //@@ adjust ID.fonts + scs_m_new.props.options.ID(1)=[scs_m.props.options.ID(1)(1),scs_m.props.options.ID(1)(2),2,1]; + scs_m_new.props.options.ID(2)=[scs_m.props.options.ID(2)(1),scs_m.props.options.ID(2)(2),10,1]; + + n=size(scs_m.objs); + for j=1:n //loop on objects + o=scs_m.objs(j); + if typeof(o)=="Block" then + omod=o.model; + + // Clear the doc fields if it contains a function pointer + if type(o.doc) == 15 & size(o.doc) > 1 & (type(o.doc(1)) == 11 | type(o.doc(1)) == 13) then + scs_m_new.objs(j).doc = list(); + end + + //@@ sbloc + if omod.sim=="super"|omod.sim=="csuper"|omod.sim(1)=="asuper" then + rpar=do_version43(omod.rpar) + scs_m_new.objs(j).model.rpar=rpar + end + + //@@ Change gr_i of MUX if needed + if o.gui=="MUX" then + gr_i=["txt=''Mux'';" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + id=o.graphics.id + if id=="Mux" then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == " " then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i == " " then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of DEMUX if needed + elseif o.gui=="DEMUX" then + gr_i=["txt=''Demux'';" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + id=o.graphics.id + if id=="Demux" then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == "" then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i == "" then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of FROMWSB + elseif o.gui=="FROMWSB" then + gr_i=["xstringb(orig(1),orig(2),''From workspace'',sz(1),sz(2),''fill'')" + "txt=varnam;" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + id="" + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + else + scs_m_new.objs(j).graphics.gr_i=gr_i + end + + //@@ Change gr_i of TOWS_c + elseif o.gui=="TOWS_c" then + gr_i=["xstringb(orig(1),orig(2),''To workspace'',sz(1),sz(2),''fill'')" + "txt=varnam;" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + id="" + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + else + scs_m_new.objs(j).graphics.gr_i=gr_i + end + + //@@ Change gr_i of INTEGRAL_m if needed + elseif o.gui=="INTEGRAL_m" | o.gui=="INTEGRAL" then + gr_i=["thick=xget(''thickness'')" + "pat=xget(''pattern'')" + "fnt=xget(''font'')" + "xpoly(orig(1)+[0.7;0.62;0.549;0.44;0.364;0.291]*sz(1),orig(2)+[0.947;0.947;0.884;0.321;0.255;0.255]*sz(2),"'lines"')" + "txt=''1/s'';" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;" + "xset(''thickness'',thick)" + "xset(''pattern'',pat)" + "xset(''font'',fnt(1),fnt(2))"] + old_gri=["thick=xget(''thickness'')" + "pat=xget(''pattern'')" + "fnt=xget(''font'')" + "xpoly(orig(1)+[0.7;0.62;0.549;0.44;0.364;0.291]*sz(1),orig(2)+[0.947;0.947;0.884;0.321;0.255;0.255]*sz(2),"'lines"')" + "xset(''thickness'',thick)" + "xset(''pattern'',pat)" + "xset(''font'',fnt(1),fnt(2))" + ] + id=o.graphics.id + if id=="1/s" then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of PRODUCT if needed + elseif o.gui=="PRODUCT" then + gr_i=["[x,y,typ]=standard_inputs(o) "; + "dd=sz(1)/8,de=0," + "if ~arg1.graphics.flip then dd=6*sz(1)/8,de=-sz(1)/8,end" + "for k=1:size(x,''*'')"; + "if size(sgn,1)>1 then" + " if sgn(k)>0 then"; + " xstring(orig(1)+dd,y(k)-4,''*'')"; + " else"; + " xstring(orig(1)+dd,y(k)-4,''/'')"; + " end"; + "end"; + "end"; + "xx=sz(1)*[.8 .8 .4 .4]+orig(1)+de"; + "yy=sz(2)*[.2 .8 .8 .2]+orig(2)"; + "xpoly(xx,yy,''lines'')" + "txt=''Product'';" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + old_gri=["[x,y,typ]=standard_inputs(o) "; + "dd=sz(1)/8,de=0," + "if ~arg1.graphics.flip then dd=6*sz(1)/8,de=-sz(1)/8,end" + "for k=1:size(x,''*'')"; + "if size(sgn,1)>1 then" + " if sgn(k)>0 then"; + " xstring(orig(1)+dd,y(k)-4,''*'')"; + " else"; + " xstring(orig(1)+dd,y(k)-4,''/'')"; + " end"; + "end"; + "end"; + "xx=sz(1)*[.8 .8 .4 .4]+orig(1)+de"; + "yy=sz(2)*[.2 .8 .8 .2]+orig(2)"; + "xpoly(xx,yy,''lines'')"] + id=o.graphics.id + if id=="1/s" then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of DERIV if needed + elseif o.gui=="DERIV" then + gr_i=["xstringb(orig(1),orig(2),'' du/dt '',sz(1),sz(2),''fill'');" + "txt=''s'';" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + old_gri=["xstringb(orig(1),orig(2),'' du/dt '',sz(1),sz(2),''fill'');"] + id=o.graphics.id + if id=="s" then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of JKFLIPFLOP if needed + elseif o.gui=="JKFLIPFLOP" then + gr_i=["[x,y,typ]=standard_inputs(o) "; + "dd=sz(1)/8,de=5.5*sz(1)/8"; + "txt=''J'';" + "if ~exists(''%zoom'') then %zoom=1, end;" + "rectstr=stringbox(txt,orig(1)+dd,y(1)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+dd,y(1)-4,txt,w,h,''fill'')"; + "txt=''clk'';" + "rectstr=stringbox(txt,orig(1)+dd,y(2)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+dd,y(2)-4,txt,w,h,''fill'')"; + "txt=''K'';" + "rectstr=stringbox(txt,orig(1)+dd,y(3)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+dd,y(3)-4,txt,w,h,''fill'')"; + "[x,y,typ]=standard_outputs(o) "; + "txt=''Q'';" + "rectstr=stringbox(txt,orig(1)+de,y(1)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+de,y(1)-4,txt,w,h,''fill'')"; + "txt=''!Q'';" + "rectstr=stringbox(txt,orig(1)+4.5*dd,y(2)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+4.5*dd,y(2)-4,txt,w,h,''fill'')"; + "txt=''JK FLIP-FLOP'';" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + old_gri=["[x,y,typ]=standard_inputs(o) "; + "dd=sz(1)/8,de=6*sz(1)/8"; + "xstring(orig(1)+dd,y(1)-4,''J'')"; + "xstring(orig(1)+dd,y(2)-4,''clk'')"; + "xstring(orig(1)+dd,y(3)-4,''K'')"; + "[x,y,typ]=standard_outputs(o) "; + "xstring(orig(1)+de,y(1)-4,''Q'')"; + "xstring(orig(1)+5*dd,y(2)-4,''!Q'')"] + id=o.graphics.id + if id=="JK FLIP-FLOP" then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of SRFLIPFLOP if needed + elseif o.gui=="SRFLIPFLOP" then + gr_i=["[x,y,typ]=standard_inputs(o) "; + "dd=sz(1)/8,de=5.5*sz(1)/8"; + "txt=''S'';" + "if ~exists(''%zoom'') then %zoom=1, end;" + "rectstr=stringbox(txt,orig(1)+dd,y(1)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+dd,y(1)-4,txt,w,h,''fill'')"; + "txt=''R'';" + "rectstr=stringbox(txt,orig(1)+dd,y(2)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+dd,y(2)-4,txt,w,h,''fill'')"; + "[x,y,typ]=standard_outputs(o) "; + "txt=''Q'';" + "rectstr=stringbox(txt,orig(1)+de,y(1)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+de,y(1)-4,txt,w,h,''fill'')"; + "txt=''!Q'';" + "rectstr=stringbox(txt,orig(1)+4.5*dd,y(2)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+4.5*dd,y(2)-4,txt,w,h,''fill'')"; + "txt=''SR FLIP-FLOP'';" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + old_gri=["[x,y,typ]=standard_inputs(o) "; + "dd=sz(1)/8,de=6*sz(1)/8"; + "xstring(orig(1)+dd,y(1)-4,''S'')"; + "xstring(orig(1)+dd,y(2)-4,''R'')"; + "[x,y,typ]=standard_outputs(o) "; + "xstring(orig(1)+de,y(1)-4,''Q'')"; + "xstring(orig(1)+5*dd,y(2)-4,''!Q'')"] + id=o.graphics.id + if id=="SR FLIP-FLOP" then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of DLATCH if needed + elseif o.gui=="DLATCH" then + gr_i=["[x,y,typ]=standard_inputs(o) "; + "dd=sz(1)/8,de=5.5*sz(1)/8"; + "txt=''D'';" + "if ~exists(''%zoom'') then %zoom=1, end;" + "rectstr=stringbox(txt,orig(1)+dd,y(1)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+dd,y(1)-4,txt,w,h,''fill'')"; + "txt=''C'';" + "rectstr=stringbox(txt,orig(1)+dd,y(2)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+dd,y(2)-4,txt,w,h,''fill'')"; + "txt=''Q'';" + "rectstr=stringbox(txt,orig(1)+de,y(1)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+de,y(1)-4,txt,w,h,''fill'')"; + "txt=''!Q'';" + "rectstr=stringbox(txt,orig(1)+4.5*dd,y(2)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+4.5*dd,y(2)-4,txt,w,h,''fill'')"; + "txt=''DLATCH'';" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + old_gri=["[x,y,typ]=standard_inputs(o) "; + "dd=sz(1)/8,de=6*sz(1)/8"; + "xstring(orig(1)+dd,y(1)-4,''D'')"; + "xstring(orig(1)+dd,y(2)-4,''C'')"; + "xstring(orig(1)+de,y(1)-4,''Q'')"; + "xstring(orig(1)+5*dd,y(2)-4,''!Q'')"] + id=o.graphics.id + if id=="DLATCH" then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of DFLIPFLOP if needed + elseif o.gui=="DFLIPFLOP" then + gr_i=["[x,y,typ]=standard_inputs(o) "; + "dd=sz(1)/8,de=5.5*sz(1)/8"; + "txt=''D'';" + "if ~exists(''%zoom'') then %zoom=1, end;" + "rectstr=stringbox(txt,orig(1)+dd,y(1)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+dd,y(1)-4,txt,w,h,''fill'')"; + "txt=''clk'';" + "rectstr=stringbox(txt,orig(1)+dd,y(2)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+dd,y(2)-4,txt,w,h,''fill'')"; + "txt=''en'';" + "rectstr=stringbox(txt,orig(1)+dd,y(3)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+dd,y(3)-4,txt,w,h,''fill'')"; + "[x,y,typ]=standard_outputs(o) "; + "txt=''Q'';" + "rectstr=stringbox(txt,orig(1)+de,y(1)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+de,y(1)-4,txt,w,h,''fill'')"; + "txt=''!Q'';" + "rectstr=stringbox(txt,orig(1)+4.5*dd,y(2)-4,0,1,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+4.5*dd,y(2)-4,txt,w,h,''fill'')"; + "txt=''D FLIP-FLOP'';" + "style=5;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + old_gri=["[x,y,typ]=standard_inputs(o) "; + "dd=sz(1)/8,de=6*sz(1)/8"; + "xstring(orig(1)+dd,y(1)-4,''D'')"; + "xstring(orig(1)+dd,y(2)-4,''clk'')"; + "xstring(orig(1)+dd,y(3)-4,''en'')"; + "[x,y,typ]=standard_outputs(o) "; + "xstring(orig(1)+de,y(1)-4,''Q'')"; + "xstring(orig(1)+5*dd,y(2)-4,''!Q'')"] + id=o.graphics.id + if id=="D FLIP-FLOP" then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of CLKGotoTagVisibility if needed + elseif o.gui=="CLKGotoTagVisibility" then + gr_i=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');"; + "wd=xget(''wdim'').*[1.016,1.12];"; + "thick=xget(''thickness'');xset(''thickness'',2);"; + "p=wd(2)/wd(1);p=1;"; + "xarcs([orig(1)+0.05*sz(1);"; + "orig(2)+0.95*sz(2);"; + "0.9*sz(1)*p;"; + "0.9*sz(2);"; + "0;"; + "360*64],scs_color(5));"; + "txt=[''Goto Tag'';''Visibility'' ];" + "style=5;" + "gh_axes = gca();" + "axes_font_style = gh_axes.font_style ;" + "axes_font_size = gh_axes.font_size ;" + "gh_axes.font_style = 5;" + "gh_axes.font_size = 1;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-5,txt,w,h,''fill'');" + "gh_axes.font_style = axes_font_style ;" + "gh_axes.font_size = axes_font_size ;" + "xset(''thickness'',thick)"] + old_gri=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');"; + "wd=xget(''wdim'').*[1.016,1.12];"; + "thick=xget(''thickness'');xset(''thickness'',2);"; + "p=wd(2)/wd(1);p=1;"; + "xarcs([orig(1)+0.05*sz(1);"; + "orig(2)+0.95*sz(2);"; + "0.9*sz(1)*p;"; + "0.9*sz(2);"; + "0;"; + "360*64],scs_color(5));"; + "xset(''thickness'',thick)"] + id=o.graphics.id + if id==["Goto Tag";"Visibility"] then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of GotoTagVisibilityMO if needed + elseif o.gui=="GotoTagVisibilityMO" then + gr_i=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');"; + "wd=xget(''wdim'').*[1.016,1.12];"; + "thick=xget(''thickness'');xset(''thickness'',2);"; + "p=wd(2)/wd(1);p=1;"; + "xarcs([orig(1)+0.05*sz(1);"; + "orig(2)+0.95*sz(2);"; + "0.9*sz(1)*p;"; + "0.9*sz(2);"; + "0;"; + "360*64],scs_color(3));"; + "txt=[''Goto Tag'';''Visibility'' ];" + "style=5;" + "gh_axes = gca();" + "axes_font_style = gh_axes.font_style ;" + "axes_font_size = gh_axes.font_size ;" + "gh_axes.font_style = 5;" + "gh_axes.font_size = 1;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-5,txt,w,h,''fill'');" + "gh_axes.font_style = axes_font_style ;" + "gh_axes.font_size = axes_font_size ;" + "xset(''thickness'',thick)"] + old_gri=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');"; + "wd=xget(''wdim'').*[1.016,1.12];"; + "thick=xget(''thickness'');xset(''thickness'',2);"; + "p=wd(2)/wd(1);p=1;"; + "xarcs([orig(1)+0.05*sz(1);"; + "orig(2)+0.95*sz(2);"; + "0.9*sz(1)*p;"; + "0.9*sz(2);"; + "0;"; + "360*64],scs_color(3));"; + "xset(''thickness'',thick)"] + id=o.graphics.id + if id==["Goto Tag";"Visibility"] then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of GotoTagVisibility if needed + elseif o.gui=="GotoTagVisibility" then + gr_i=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');" + "txt=[''Goto Tag'';''Visibility'' ];" + "style=5;" + "gh_axes = gca();" + "axes_font_style = gh_axes.font_style ;" + "axes_font_size = gh_axes.font_size ;" + "gh_axes.font_style = 5;" + "gh_axes.font_size = 1;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-5,txt,w,h,''fill'');" + "gh_axes.font_style = axes_font_style ;" + "gh_axes.font_size = axes_font_size ;"] + old_gri=["xstringb(orig(1),orig(2),[''{''+arg1.graphics.exprs(1)+''}''],sz(1),sz(2),''fill'');"] + id=o.graphics.id + if id==["Goto Tag";"Visibility"] then id="",end + scs_m_new.objs(j).graphics.id=id + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of Inductor if needed + elseif o.gui=="Inductor" then + gr_i=["tt=linspace(0.04,0.96,100)'';" + "xpoly(tt*sz(1)+orig(1),+orig(2)+abs(sin(18*(tt-0.04)))*sz(2),""lines"");"; + "xx=orig(1)+[0 0.04 0.04 0.04 0]*sz(1);"; + "yy=orig(2)+[1/2 1/2 0 1/2 1/2]*sz(2);"; + "xpoly(xx,yy) "; + "xx=orig(1)+[0.96 0.96 1 0.96 0.96 ]*sz(1);"; + "yy=orig(2)+[abs(sin(18*0.92)) 1/2 1/2 1/2 abs(sin(18*0.92))]*sz(2);"; + "xpoly(xx,yy) "; + "txt=''L= ''+L;" + "style=2;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();"] + old_gri=["tt=linspace(0.04,0.96,100)'';" + "xpoly(tt*sz(1)+orig(1),+orig(2)+abs(sin(18*(tt-0.04)))*sz(2),""lines"");"; + "xx=orig(1)+[0 0.04 0.04 0.04 0]*sz(1);"; + "yy=orig(2)+[1/2 1/2 0 1/2 1/2]*sz(2);"; + "xpoly(xx,yy) "; + "xx=orig(1)+[0.96 0.96 1 0.96 0.96 ]*sz(1);"; + "yy=orig(2)+[abs(sin(18*0.92)) 1/2 1/2 1/2 abs(sin(18*0.92))]*sz(2);"; + "xpoly(xx,yy) "; + "rect=xstringl(0,0,''L=''+L)" + "xstring(orig(1)+(sz(1)-rect(3))/2,orig(2)-rect(4)*1.2,''L=''+L)"] + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of Capacitor if needed + elseif o.gui=="Capacitor" then + gr_i=["xset(''thickness'',2)" + "xx=orig(1)+[0 1/3 1/3 1/3 ]*sz(1);"; + "yy=orig(2)+[1/2 1/2 1 0]*sz(2);"; + "xpoly(xx,yy);" + "xsegs(orig(1)+ sz(1)*2/3*[1 1 1 3/2],orig(2)+(sz(2)*1/2)*[2 0 1 1],0);"; + "if orient then" + " xrects([orig(1)+sz(1)*1/2;orig(2)+sz(2);sz(1)*1/6;sz(2)],scs_color(33));" + " xstring(orig(1)+sz(1)*1/12,orig(2)+sz(2)*3/4,''+'');"; + " xstring(orig(1)+sz(1)*7/8,orig(2)+sz(2)*3/4,''-'');"; + "else" + " xrects([orig(1)+sz(1)*1/3;orig(2)+sz(2);sz(1)*1/6;sz(2)],scs_color(33));" + " xstring(orig(1)+sz(1)*1/12,orig(2)+sz(2)*3/4,''-'');"; + " xstring(orig(1)+sz(1)*7/8,orig(2)+sz(2)*3/4,''+'');"; + "end" + "txt=''C= ''+C;" + "style=2;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();" + "e.font_style=style;"] + old_gri=["xset(''thickness'',2)" + "xx=orig(1)+[0 1/3 1/3 1/3 ]*sz(1);"; + "yy=orig(2)+[1/2 1/2 1 0]*sz(2);"; + "xpoly(xx,yy);" + "xsegs(orig(1)+ sz(1)*2/3*[1 1 1 3/2],orig(2)+(sz(2)*1/2)*[2 0 1 1],0);"; + "if orient then" + " xrects([orig(1)+sz(1)*1/2;orig(2)+sz(2);sz(1)*1/6;sz(2)],scs_color(33));" + " xstring(orig(1)+sz(1)*1/12,orig(2)+sz(2)*3/4,''+'');"; + " xstring(orig(1)+sz(1)*7/8,orig(2)+sz(2)*3/4,''-'');"; + "else" + " xrects([orig(1)+sz(1)*1/3;orig(2)+sz(2);sz(1)*1/6;sz(2)],scs_color(33));" + " xstring(orig(1)+sz(1)*1/12,orig(2)+sz(2)*3/4,''-'');"; + " xstring(orig(1)+sz(1)*7/8,orig(2)+sz(2)*3/4,''+'');"; + "end" + "rect=xstringl(0,0,''C=''+C)" + "xstring(orig(1)+(sz(1)-rect(3))/2,orig(2)-rect(4)*1.2,''C= ''+C);"] + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + //@@ Change gr_i of Resistor if needed + elseif o.gui=="Resistor" then + gr_i=["xx=[0,1,1,7,7,8,7,7,1,1]/8;"; + "yy=[1,1,0,0,1,1,1,2,2,1]/2;"; + "xpoly(orig(1)+xx*sz(1),orig(2)+yy*sz(2)); " + "txt=''R= ''+R;" + "style=2;" + "rectstr=stringbox(txt,orig(1),orig(2),0,style,1);" + "if ~exists(''%zoom'') then %zoom=1, end;" + "w=(rectstr(1,3)-rectstr(1,2))*%zoom;" + "h=(rectstr(2,2)-rectstr(2,4))*%zoom;" + "xstringb(orig(1)+sz(1)/2-w/2,orig(2)-h-4,txt,w,h,''fill'');" + "e=gce();"] + old_gri=["xx=[0,1,1,7,7,8,7,7,1,1]/8;"; + "yy=[1,1,0,0,1,1,1,2,2,1]/2;"; + "xpoly(orig(1)+xx*sz(1),orig(2)+yy*sz(2)); " + "rect=xstringl(0,0,''R=''+R)" + "xstring(orig(1)+(sz(1)-rect(3))/2,orig(2)-rect(4)*1.2,''R=''+R);"] + if (type(scs_m_new.objs(j).graphics.gr_i)==15) then + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=list(gr_i,scs_m_new.objs(j).graphics.gr_i(2)) + end + else + if scs_m_new.objs(j).graphics.gr_i(1) == old_gri then + scs_m_new.objs(j).graphics.gr_i=gr_i + end + end + + end + end + end +endfunction + + +//*** update scope ***// +function scs_m_new=do_version42(scs_m) + scs_m_new=scs_m + n=size(scs_m.objs); + for j=1:n //loop on objects + o=scs_m.objs(j); + if typeof(o)=="Block" then + omod=o.model; + //SUPER BLOCK + if omod.sim=="super"|omod.sim=="csuper" then + rpar=do_version42(omod.rpar) + scs_m_new.objs(j).model.rpar=rpar + //name of gui and sim list change + elseif o.gui=="SCOPE_f" then + scs_m_new.objs(j).gui="CSCOPE" + scs_m_new.objs(j).model.dstate=[] + //Alan's patch 01/10/07 : remove the last parameter + // (inheritance not used in cscope) + ipar = scs_m_new.objs(j).model.ipar(:); + scs_m_new.objs(j).model.ipar = ipar(1:$-1); + scs_m_new.objs(j).model.sim=list("cscope", 4) + in = scs_m_new.objs(j).model.in(:); + a = size(in,1); + in2 = ones(a,1); + scs_m_new.objs(j).model.in2 = in2; + scs_m_new.objs(j).model.intyp = in2; + //Alan's patch 04/10/07 : update exprs + exprs = scs_m.objs(j).graphics.exprs; + if size(exprs)<9 then exprs(9)="0",end // compatibility + if size(exprs)<10 then exprs(10)=emptystr(),end // compatibility + scs_m_new.objs(j).graphics.exprs=exprs; + elseif o.gui=="CSCOPE" then + //Alan's patch 04/10/07 : update exprs + exprs = scs_m.objs(j).graphics.exprs; + if size(exprs)<10 then exprs(10)=emptystr(),end // compatibility + scs_m_new.objs(j).graphics.exprs=exprs; + elseif o.gui=="BOUNCEXY" then + in = scs_m_new.objs(j).model.in(:); + a = size(in,1); + in2 = ones(a,1); + scs_m_new.objs(j).model.in2 = in2; + scs_m_new.objs(j).model.intyp = in2; + elseif o.gui=="MSCOPE_f" then + //Alan's patch 04/10/07 : update exprs + exprs = scs_m.objs(j).graphics.exprs; + if size(exprs)<10 then exprs(10)="0",end // compatibility + if size(exprs)<11 then exprs(11)=emptystr(),end // compatibility + scs_m_new.objs(j).graphics.exprs=exprs; + scs_m_new.objs(j).gui="CMSCOPE" + scs_m_new.objs(j).model.dstate=[] + scs_m_new.objs(j).model.sim=list("cmscope", 4) + in = scs_m_new.objs(j).model.in(:); + a = size(in,1); + B=stripblanks(scs_m.objs(j).graphics.exprs(8)); + B(1:a)=B; + B = strcat(B', " "); + scs_m_new.objs(j).graphics.exprs(8) = B; + rpar=scs_m_new.objs(j).model.rpar(:); + N=scs_m_new.objs(j).model.ipar(2); + period = []; + for i=1:N + period(i)=rpar(2); + end + scs_m_new.objs(j).model.rpar = [rpar(1);period(:);rpar(3:size(rpar,1))] + in2 = ones(a,1); + scs_m_new.objs(j).model.in2 = in2; + scs_m_new.objs(j).model.intyp = in2; + elseif o.gui=="ANIMXY_f" then + scs_m_new.objs(j).gui="CANIMXY" + scs_m_new.objs(j).model.dstate=[] + scs_m_new.objs(j).model.sim=list("canimxy", 4) + in = scs_m_new.objs(j).model.in(:); + a = size(in,1); + in2 = ones(a,1); + scs_m_new.objs(j).model.in2 = in2; + scs_m_new.objs(j).model.intyp = in2; + scs_m_new.objs(j).graphics.exprs = [string(1);scs_m_new.objs(j).graphics.exprs(:)] + scs_m_new.objs(j).model.ipar = [scs_m_new.objs(j).model.ipar(:);1] + //Alan's patch 04/10/07 : update exprs + exprs = scs_m_new.objs(j).graphics.exprs(:) + if size(exprs,"*")==8 then exprs=[1;exprs(1:3);"[]";"[]";exprs(4:8)],end + scs_m_new.objs(j).graphics.exprs=exprs; + elseif o.gui=="EVENTSCOPE_f" then + scs_m_new.objs(j).gui="CEVENTSCOPE" + scs_m_new.objs(j).model.dstate=[] + scs_m_new.objs(j).model.sim=list("cevscpe", 4) + in = scs_m_new.objs(j).model.in(:); + a = size(in,1); + in2 = ones(a,1); + scs_m_new.objs(j).model.in2 = in2; + scs_m_new.objs(j).model.intyp = in2; + elseif o.gui=="FSCOPE_f" then + scs_m_new.objs(j).gui="CFSCOPE" + scs_m_new.objs(j).model.dstate=[] + scs_m_new.objs(j).model.sim=list("cfscope", 4) + in = scs_m_new.objs(j).model.in(:); + a = size(in,1); + in2 = ones(a,1); + scs_m_new.objs(j).model.in2 = in2; + scs_m_new.objs(j).model.intyp = in2; + //Alan's patch 04/10/07 : update exprs + exprs = scs_m.objs(j).graphics.exprs; + if size(exprs)<9 then exprs(9)="0",end // compatibility + scs_m_new.objs(j).graphics.exprs=exprs; + elseif o.gui=="SCOPXY_f" then + scs_m_new.objs(j).gui="CSCOPXY" + scs_m_new.objs(j).model.dstate=[] + scs_m_new.objs(j).model.sim=list("cscopxy", 4) + in = scs_m_new.objs(j).model.in(:); + a = size(in,1); + in2 = ones(a,1); + scs_m_new.objs(j).model.in2 = in2; + scs_m_new.objs(j).model.intyp = in2; + scs_m_new.objs(j).graphics.exprs = [string(1);scs_m_new.objs(j).graphics.exprs(:)] + scs_m_new.objs(j).model.ipar = [scs_m_new.objs(j).model.ipar(:);1] + elseif o.gui=="CMSCOPE" then + //Alan's patch 04/10/07 : update exprs + exprs = scs_m.objs(j).graphics.exprs; + if size(exprs)<11 then exprs(11)=emptystr(),end // compatibility + scs_m_new.objs(j).graphics.exprs=exprs; + scs_m_new.objs(j).model.dstate=[] + in = scs_m_new.objs(j).model.in(:); + a = size(in,1); + B=stripblanks(scs_m.objs(j).graphics.exprs(8)); + B(1:a)=B; + B = strcat(B', " "); + scs_m_new.objs(j).graphics.exprs(8)=B; + rpar=scs_m_new.objs(j).model.rpar(:); + N=scs_m_new.objs(j).model.ipar(2); + period = []; + for i=1:N + period(i)=rpar(2); + end + scs_m_new.objs(j).model.rpar = [rpar(1);period(:);rpar(3:size(rpar,1))] + in2 = ones(a,1); + scs_m_new.objs(j).model.in2 = in2; + scs_m_new.objs(j).model.intyp = in2; + elseif o.gui=="IN_f" then + scs_m_new.objs(j).model.out = -1; + scs_m_new.objs(j).model.out2 = -2; + scs_m_new.objs(j).model.outtyp = -1; + elseif o.gui=="OUT_f" then + scs_m_new.objs(j).model.in = -1; + scs_m_new.objs(j).model.in2 = -2; + scs_m_new.objs(j).model.intyp = -1; + elseif o.gui=="INIMPL_f" then + scs_m_new.objs(j).model.out = -1; + scs_m_new.objs(j).model.out2 = 1; + scs_m_new.objs(j).model.outtyp = -1; + elseif o.gui=="OUTIMPL_f" then + scs_m_new.objs(j).model.in = -1; + scs_m_new.objs(j).model.in2 = 1; + scs_m_new.objs(j).model.intyp = -1; + end + end + end +endfunction + +function scs_m_new=do_version273(scs_m) + scs_m_new=scs_m; + n=size(scs_m.objs); + for i=1:n //loop on objects + o=scs_m.objs(i); + if typeof(o)=="Block" then + omod=o.model; + T=getfield(1,omod) + if T($)<>"equations" then + T($+1)="equations" + setfield(1,T,omod) + setfield($+1,list(),omod) + end + if omod.sim=="super"|omod.sim=="csuper" then + rpar=do_version273(omod.rpar) + setfield($+1,getfield($,omod),omod) + setfield($-1,0,omod) + omod.rpar=rpar + elseif omod.sim(1)=="ifthel" then // |omod.sim(1)=='eselect' then + setfield($+1,getfield($,omod),omod) + setfield($-1,1,omod) + setfield($-2,1,omod) + else + setfield($+1,getfield($,omod),omod) + setfield($-1,0,omod) + end + xx=getfield(1,omod); + yy=xx($); + xx($)="nmode" + xx($+1)=yy; + setfield(1,xx,omod) + o.model= omod + scs_m_new.objs(i)=o + elseif typeof(o)=="Link" then + if size(o.from,"*")==2 then o.from(3)=0;end + if size(o.to,"*")==2 then o.to(3)=1;end + scs_m_new.objs(i)=o + end + end +endfunction + + +function scs_m_new=do_version272(scs_m) + + scs_m_new=scs_m + for i=1:lstsize(scs_m.objs) + + if typeof(scs_m.objs(i))=="Block" then + grphic=scs_m.objs(i).graphics + chmps=size(getfield(1,grphic)) + if or(getfield(1,grphic)=="in_implicit")&.. + size(grphic.in_implicit,"*")==size(grphic.pin,"*") then + in_implicit=grphic.in_implicit + else + I="E"; + in_implicit=I(ones(grphic.pin(:))); + end + + if or(getfield(1,grphic)=="out_implicit")&.. + size(grphic.out_implicit,"*")==size(grphic.pout,"*") then + out_implicit=grphic.out_implicit + else + I="E"; + out_implicit=I(ones(grphic.pout(:))); + end + + scs_m_new.objs(i).graphics=mlist(["graphics","orig","sz","flip","exprs","pin",.. + "pout","pein","peout","gr_i","id","in_implicit","out_implicit"],.. + grphic.orig,grphic.sz,grphic.flip,grphic.exprs,grphic.pin,.. + grphic.pout,grphic.pein,grphic.peout,grphic.gr_i,grphic.id,.. + in_implicit,out_implicit) + + if or(scs_m_new.objs(i).model.sim==["super","csuper"]) then + rpar=do_version272(scs_m_new.objs(i).model.rpar) + scs_m_new.objs(i).model.rpar=rpar + end + end + end +endfunction + +function scs_m_new=do_version271(scs_m) + scs_m_new=scs_m; + n=size(scs_m.objs); + for i=1:n //loop on objects + o=scs_m.objs(i); + if typeof(o)=="Block" then + omod=o.model; + if omod.sim=="super"|omod.sim=="csuper" then + rpar=do_version271(omod.rpar) + setfield($+1,0,omod) + omod.rpar=rpar + elseif omod.sim=="zcross" then + setfield($+1,omod.in,omod) + omod.sim=list(omod.sim,1) + elseif omod.sim=="lusat" then + setfield($+1,2*omod.in,omod) + omod.sim=list(omod.sim,1) + else + setfield($+1,0,omod) + end + setfield(1,[getfield(1,omod),"nzcross"],omod) + o.model= omod + scs_m_new.objs(i)=o + end + end +endfunction + +function scs_m=do_version251(scs_m) + nx=size(scs_m) + obsolete=%f + for k=2:nx + o=scs_m(k) + if o(1)=="Block" then + model=o(3) + if model(1)=="super"|model(1)=="csuper" then + model(8)=do_version251(model(8)) + o(3)=model + scs_m(k)=o + elseif o(5)=="SOM_f" then + if and(model(8)==1) then + model(8)=[] + model(1)=list("plusblk",2) + scs_m(k)(3)=model + scs_m(k)(5)="SUM_f" + else + scs_m(k)(3)(1)=list("sum",2) + obsolete=%t + end + elseif o(5)=="AFFICH_f" then + scs_m(k)(3)(7)=[0;-1;0;0;1;1] + scs_m(k)(2)(9)=["xset(''font'',ipar(1),ipar(2))"; + "str='' ''+part(''0'',ones(1,ipar(5)-ipar(6)-2))+''.''+part(''0'',ones(1,ipar(6)))" + "rr=xstringl(orig(1),orig(2),str)" + "xstring(orig(1)+max(0,(sz(1)-rr(3))/2),orig(2)+max(0,(sz(2)-rr(4))/2),str)"] + elseif o(5)=="c_block" then + model(1)(2)=model(1)(2)-int(model(1)(2)/1000)*1000+2000 + scs_m(k)(3)=model + tt=scs_m(k)(2)(4)(2) + ii=grep(tt,"machine.h") + if size(ii,"*")==1 then + tt(ii)="#include ", + scs_m(k)(2)(4)(2)=tt + end + end + elseif o(1)=="Link" then + if size(o(2),"*")==1 then + o(2)=o(2)*[1;1];o(3)=o(3)*[1;1]; + scs_m(k)=o + end + end + end + if obsolete then + messagebox(["Diagram contains obsolete signed blocks sum" + "They are drawn in brown, they work as before but," + "please replace them with the new block sum"],"modal") + end + +endfunction +function scs_m=do_version231(scs_m) + //2.3.1 to 2.4 version + if size(scs_m(1))<5 then scs_m(1)(5)=" ",end //compatibility + if type(scs_m(1)(5))<>10 then scs_m(1)(5)=" ",end //compatibility + if size(scs_m(1))<6 then //compatibility + wpar=scs_m(1) + wpar(6)=list() + wpar(7)=list(%t,[0.8 0.8 0.8]) + wpar(8)=[] + wpar(9)=[] + wpar(10)=[] + scs_m(1)=wpar + end + + if size(scs_m(1)(1),"*") <4 then scs_m(1)(1)=[scs_m(1)(1),0,0],end //compatibility + + + scs_m(1)(1)(2)=max(scs_m(1)(1)(2),450) + if size(scs_m(1))<6 then + options=default_options() + doc=list() //documentation structure + wpar=scs_m(1) + wpar(6)=list() + wpar(7)=options + wpar(8)=[] + wpar(9)=[] + wpar(10)=doc + scs_m(1)=wpar + end + wsiz=scs_m(1)(1) + if size(wsiz,"*")<6 then //compatibility + if size(wsiz,"*")<4 then wsiz(3)=0;wsiz(4)=0;end + wsiz(5)=wsiz(1);wsiz(6)=wsiz(2); + scs_m(1)(1)=wsiz; + end + if type(scs_m(1)(7))==15 then //options + old_opt=scs_m(1)(7) + options=default_options() + options("3D")(1)=old_opt(1) + options("Cmap")=old_opt(2) + scs_m(1)(7)=options + end + + nx=size(scs_m) + for k=2:nx + o=scs_m(k) + if o(1)=="Block" then + model=o(3) + if model(1)=="super"|model(1)=="csuper" then + model(8)=do_version231(model(8)) + o(3)=model + scs_m(k)=o + elseif model(1)(1)=="ifthel" then + model(1)=list("ifthel",-1) + scs_m(k)(3)=model + elseif model(1)(1)=="eselect" then + model(1)=list("eselect",-1) + scs_m(k)(3)=model + end + end + end + + +endfunction +function x_new=do_version23(scs_m) + //2.3 to 2.3.1 + x_new=list() + x_new(1)=scs_m(1) + nx=size(scs_m) + for k=2:nx + o=scs_m(k) + if o(1)=="Link" then + elseif o(1)=="Block" then + model=o(3) + if model(1)=="super"|model(1)=="csuper" then + model(8)=do_version23(model(8)) + o(3)=model + o=block2_version(o) + scs_m(k)=o + else + o=block2_version(o) + end + end + x_new(k)=o; + end + + +endfunction +function o=block2_version(o) + if o(3)(6)<>[] then o(3)(12)(2)=%t;end + +endfunction + + +function o=block_version(o) + [graphics,model]=o(2:3) + for k=2:5, model(k)=ones(model(k),1),end + blocktype=o(5) + ok=%t + label=" " + gr_i=" " + select blocktype + case "ABSBLK_f" then + model(2)=-1 + model(3)=-1 + label=" " + gr_i="xstringb(orig(1),orig(2),''abs'',sz(1),sz(2),''fill'')" + case "ANIMXY_f" then + [rpar,ipar]=model([8:9]) + model(9)=[model(9);0;[-1;-1];[-1;-1]] + win=ipar(1);N=ipar(3);clrs=ipar(4);siz=ipar(5) + xmin=rpar(1);xmax=rpar(2);ymin=rpar(3);ymax=rpar(4) + label=[string(clrs); + string(siz); + string(win); + "[]"; + "[]"; + string(xmin); + string(xmax); + string(ymin); + string(ymax); + string(N)] + gr_i=["thick=xget(''thickness'');xset(''thickness'',2);"; + "t=(0:0.3:2*%pi)'';"; + "xx=orig(1)+(1/5+(cos(2.2*t)+1)*3/10)*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');" + "xset(''thickness'',thick);"] + case "BOUND_f" then + rpar=model(8);in=model(2);nin=sum(in) + if nin<>1 then + write(%io(2),["Pb with BOUND_f block"; + "previously block has more than one input port"; + "It is better to change it with the new block version"; + "preceded by a multiplexer"]) + end + thresh=rpar(1:nin),v=rpar(nin+1:2*nin) + label=[strcat(sci2exp(thresh)); + strcat(sci2exp(v))] + gr_i=["thick=xget(''thickness'');xset(''thickness'',2);"; + "xx=orig(1)+[1/5;1/2;1/2;1-1/5]*sz(1);"; + "yy=orig(2)+[1/2;1/2;1-1/5;1-1/5]*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',1);"; + "xpoly(orig(1)+[1/9;1/5]*sz(1),orig(2)+[1/2;1/2]*sz(2),''lines'');"; + "xpoly(orig(1)+[1/2;1-1/9]*sz(1),orig(2)+[1/2;1/2]*sz(2),''lines'');"; + "xpoly(orig(1)+[1/2;1/2]*sz(1),orig(2)+[1/9;1/2]*sz(2),''lines'');"; + "xpoly(orig(1)+[1/2;1/2]*sz(1),orig(2)+[1-1/5;1-1/9]*sz(2),''lines'');"; + "xset(''thickness'',thick);"] + case "CLINDUMMY_f" then + label=[] + gr_i=["xstringb(orig(1),orig(2),[''DUMMY'';''CLSS''],sz(1),sz(2),''fill'');"] + case "CLKIN_f" then + prt=model(9); + label=string(prt) + gr_i=[] + case "CLKOUT_f" then + prt=model(9); + label=string(prt) + gr_i=[] + case "CLKSPLIT_f" then + label=[] + gr_i=[] + case "CLKSOM_f" then + label=[] + gr_i=[] + case "CLOCK_f" then + orig=o(2)(1) + sz=o(2)(2) + oo=o(3)(8) + dt=0.1 + for ko=2:size(oo) + if oo(ko)(3)(1)=="evtdly" then + dt=oo(ko)(3)(8) + break + end + end + o = list("Block",.. + list([0,0],[2,2],%t,[],[],[],[],0,.. + list(.. + ["wd=xget(''wdim'').*[1.016,1.12];"; + "thick=xget(''thickness'');xset(''thickness'',2);"; + "p=wd(2)/wd(1);p=1;"; + "rx=sz(1)*p/2;ry=sz(2)/2;"; + "xarcs([orig(1)+0.05*sz(1);"; + "orig(2)+0.95*sz(2);"; + " 0.9*sz(1)*p;"; + " 0.9*sz(2);"; + " 0;"; + " 360*64],scs_color(5));"; + "xset(''thickness'',1);"; + "xx=[orig(1)+rx orig(1)+rx;"; + " orig(1)+rx orig(1)+rx+0.6*rx*cos(%pi/6)];"; + "yy=[orig(2)+ry orig(2)+ry ;"; + " orig(2)+1.8*ry orig(2)+ry+0.6*ry*sin(%pi/6)];"; + "xsegs(xx,yy,scs_color(10));"; + "xset(''thickness'',thick);"],[])),.. + list("csuper",[],[],[],1,[]," ",.. + list(list([600,400,0,0],"foo",[],[]),.. + list("Block",list([399,162],[20,20],%t,"1",[],[],6,[],[]),.. + list("output",[],[],1,[],[],[],[],1,"d",[],[%f,%f]," ",list())," ","CLKOUT_f"),.. + list("Block",list([320,232],[40,40],%t,["0.1";"0.1"],[],[],7,4,.. + ["dt=model(8);"; + "txt=[''Delay'';string(dt)];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"]),.. + list("evtdly",[],[],1,1,[],[],0.1,[],"d",0.1,[%f,%f]," ",list())," ","EVTDLY_f"),.. + list("Link",[340;340;380.71066],[226.28571;172;172],"drawlink"," ",[0,0],[5,-1],[3,1],.. + [5,1]),.. + list("Block",list([380.71066;172],[1,1],%t," ",[],[],4,[6;7]),.. + list("lsplit",[],[],1,[1;1],[],[],[],[],"d",[-1,-1],[%t,%f]," ",list())," ","CLKSPLIT_f"),.. + list("Link",[380.71066;399],[172;172],"drawlink"," ",[0,0],[5,-1],[5,1],[2,1]),.. + list("Link",[380.71066;380.71066;340;340],[172;301.9943;301.9943;277.71429],"drawlink"," ",.. + [0,0],[5,-1],[5,2],[3,1])),[],"h",[],[%f,%f])," ","CLOCK_f") + + o(2)(1)=orig + o(2)(2)=sz + xx=o(3)(8)(3) + xx(2)(4)=string([dt;dt]) + xx(3)(11)=dt + xx(3)(8)=dt + o(3)(8)(3)=xx + model=o(3) + else + ok=%f + end + + if ok then + graphics(4)=label + graphics(9)=gr_i + o(2)=graphics + model(13)=" ";model(14)=list() + o(3)=model + o=replace_firing(o) + return + end + + ok=%t + select blocktype + case "CLR_f" then + ipar=model(9);model(9)=[] + ns=size(model(6),"*");nin=1;nout=1; + rpar=model(8); + A=matrix(rpar(1:ns*ns),ns,ns); + B=matrix(rpar(ns*ns+1:ns*(ns+nin)),ns,nin); + C=matrix(rpar(ns*(ns+nin)+1:ns*(ns+nin+nout)),nout,ns); + D=rpar(ns*(ns+nin+nout)+1); + H=ss2tf(syslin("c",A,B,C,D)); + H=clean(H); + if type(H)==16 then + num=H(2);den=H(3) + else + num=H,den=1 + end + label=[sci2exp(num);sci2exp(den)] + gr_i=["xstringb(orig(1),orig(2),[''Num(s)'';''-----'';''Den(s)''],sz(1),sz(2),''fill'');"] + case "CLSS_f" then + in=model(2);out=model(3) + nin=sum(in) + nout=sum(out) + x0=model(6), + rpar=model(8) + ns=prod(size(x0)) + A=matrix(rpar(1:ns*ns),ns,ns) + B=matrix(rpar(ns*ns+1:ns*(ns+nin)),ns,nin) + C=matrix(rpar(ns*(ns+nin)+1:ns*(ns+nin+nout)),nout,ns) + D=matrix(rpar(ns*(ns+nin+nout)+1:ns*(ns+nin+nout)+(nin*nout)),nout,nin) + label=[ strcat(sci2exp(A)); + strcat(sci2exp(B)); + strcat(sci2exp(C)); + strcat(sci2exp(D)); + strcat(sci2exp(x0))] + gr_i=["txt=[''xd=Ax+Bu'';''y=Cx+Du''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + model(2)=nin;model(3)=nout + case "CONST_f" then + C=model(8);model(3)=sum(model(3)) + label=[strcat(sci2exp(C))] + gr_i=["model=arg1(3);C=model(8);"; + "dx=sz(1)/5;dy=sz(2)/10;"; + "w=sz(1)-2*dx;h=sz(2)-2*dy;"; + "xstringb(orig(1)+dx,orig(2)+dy,string(C),w,h,''fill'');"] + case "COSBLK_f" then + in=model(2);nin=sum(in) + if nin<>1 then + write(%io(2),["Pb with COSBLK_f block"; + "previously block has more than one input port"; + "It is better to change it with the new block version"; + "preceded by a multiplexer and followed by a demultiplxer"]) + end + label=" " + gr_i=["xstringb(orig(1),orig(2),[''cos''],sz(1),sz(2),''fill'');"] + case "CURV_f" then + label=[] + gr_i=["model=arg1(3);rpar=model(8);ipar=model(9);n=ipar(1);"; + "thick=xget(''thickness'');xset(''thickness'',2);"; + "xx=rpar(1:n);yy=rpar(n+1:2*n);"; + "rect=rpar(2*n+1:2*n+4);"; + "mxx=rect(3)-rect(1);"; + "mxy=rect(4)-rect(2);"; + "xx=orig(1)+sz(1)*(1/10+(4/5)*((xx-rect(1))/mxx));"; + "yy=orig(2)+sz(2)*(1/10+(4/5)*((yy-rect(2))/mxy));"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick);"] + case "DELAY_f" then + orig=o(2)(1) + sz=o(2)(2) + oo=o(3)(8) + dt=[];z0=[] + for ko=2:size(oo) + if oo(ko)(3)(1)=="evtdly" then + dt=oo(ko)(3)(8) + elseif oo(ko)(3)(1)=="register" then + z0=oo(ko)(3)(7) + end + end + if dt==[]|z0==[] then + write(%io(2), "Pb with DELAY_f block dt or z0 not found") + pause + end + o=DELAY_f("define") + o(2)(1)=orig + o(2)(2)=sz + o(3)(8)(4)(2)(4)=sci2exp(z0) + o(3)(8)(5)(2)(4)=sci2exp(dt) + o(3)(8)(5)(3)(8)=dt + o(3)(8)(5)(3)(11)=0 + o(3)(8)(4)(3)(7)=z0(:) + model=o(3) + label=[] + gr_i=["b1=xstringl(0,0,''e'');"; + "b2=xstringl(0,0,''-Ts'');"; + "h=-b1(2)+max(0,sz(2)-0.5*b1(4)+b2(4))/2;"; + "w=max(0,sz(1)-b1(3)-b1(4))/2;"; + "xstring(orig(1)+w,orig(2)+h,''e'');"; + "xstring(orig(1)+w+b1(3)/2,orig(2)+h+b1(4)*0.5,''-Ts'');"] + case "DLRADAPT_f" then + [dstate,rpar,ipar]=model(7:9) + m=ipar(1); + n=ipar(2) + npt=ipar(3) + p=rpar(1:npt) + + rn=matrix(rpar(npt+1:npt+m*npt)+%i*rpar(npt+m*npt+1:npt+2*m*npt),npt,m) + rd=matrix(rpar(npt+2*m*npt+1:npt+(2*m+n)*npt)+.. + %i*rpar(npt+(2*m+n)*npt+1:npt+2*(m+n)*npt),npt,n) + g=rpar(npt+2*(m+n)*npt+1:npt+2*(m+n)*npt+npt) + last_u=dstate(1:m);last_y=dstate(m+1:m+n) + label=[sci2exp(p); + sci2exp(rn); + sci2exp(rd); + sci2exp(g); + sci2exp(last_u); + sci2exp(last_y)] + gr_i=["txt=[''N(z,p)'';''-----'';''D(z,p)''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + case "DLR_f" then + model(9)=[];model(10)="d" + ns=size(model(7),"*");nin=1;nout=1; + rpar=model(8); + A=matrix(rpar(1:ns*ns),ns,ns); + B=matrix(rpar(ns*ns+1:ns*(ns+nin)),ns,nin); + C=matrix(rpar(ns*(ns+nin)+1:ns*(ns+nin+nout)),nout,ns); + D=rpar(ns*(ns+nin+nout)+1); + H=ss2tf(syslin("d",A,B,C,D)); + H=clean(H); + if type(H)==16 then + num=H(2);den=H(3) + else + num=H,den=1 + end + label=[sci2exp(num);sci2exp(den)] + gr_i=["txt=[''Num(z)'';''-----'';''Den(z)''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + case "DLSS_f" then + in=model(2);out=model(3) + nin=sum(in) + nout=sum(out) + x0=model(6),rpar=model(8) + ns=prod(size(x0)) + A=matrix(rpar(1:ns*ns),ns,ns) + B=matrix(rpar(ns*ns+1:ns*(ns+nin)),ns,nin) + C=matrix(rpar(ns*(ns+nin)+1:ns*(ns+nin+nout)),nout,ns) + D=matrix(rpar(ns*(ns+nin+nout)+1:ns*(ns+nin+nout)+(nin*nout)),nout,nin) + + label=[ strcat(sci2exp(A)); + strcat(sci2exp(B)); + strcat(sci2exp(C)); + strcat(sci2exp(D)); + strcat(sci2exp(x0))] + gr_i=["txt=[''x+=Ax+Bu'';''y=Cx+Du''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + case "EVENTSCOPE_f" then + [nclock,rpar,ipar]=model([4 8 9]) + win=ipar(1); + per=rpar(1); + wdim=[-1;-1] + wpos=[-1;-1] + clrs=[1;3;5;7;9;11;13;15]; + model(9)=[win;1;clrs;wpos(:);wdim(:)] + label=[sci2exp(nclock); + strcat(sci2exp(clrs)," "); + string(win); + sci2exp([]); + sci2exp([]); + string(per)] + gr_i=["thick=xget(''thickness'');xset(''thickness'',2);"; + "xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);"; + "xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;"; + "orig(1)+(1-1/5)*sz(1),orig(1)+sz(1)/5];"; + "yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;"; + "orig(2)+sz(2)/5,orig(2)+(1-1/5)*sz(2)];"; + "xarrows(xx,yy);"; + "t=(0:0.3:2*%pi)'';"; + "xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick);"] + case "EVTDLY_f" then + dt=model(8); + if model(11) then ff=0; else ff=-1; end + model(11)=ff + label=[string(dt);string(ff)] + gr_i=["dt=model(8);"; + "txt=[''Delay'';string(dt)];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + case "EVTGEN_f" then + tt=model(11); + label=string(tt) + gr_i=["xstringb(orig(1),orig(2),''Event'',sz(1),sz(2),''fill'');"] + case "FOR_f" then + write(%io(2),"FOR block nor more exist") + else + ok=%f + end + if ok then + graphics(4)=label + graphics(9)=gr_i + o(2)=graphics + model(13)=" ";model(14)=list() + o(3)=model + o=replace_firing(o) + return + end + ok=%t + select blocktype + case "GAIN_f" then + [in,out]=model(2:3) + gain=matrix(model(8),out,in) + label=[strcat(sci2exp(gain))] + gr_i=["[nin,nout]=model(2:3);"; + "if nin*nout==1 then gain=string(model(8)),else gain=''Gain'',end"; + "dx=sz(1)/5;"; + "dy=sz(2)/10;"; + "xx=orig(1)+ [1 4 1 1]*dx;"; + "yy=orig(2)+sz(2)-[1 5 9 1]*dy;"; + "xpoly(xx,yy,''lines'');"; + "w=sz(1)-2*dx;h=sz(2)-2*dy;"; + "xstringb(orig(1)+dx,orig(2)+dy,gain,w,h,''fill'');"] + case "GENERAL_f" then + in=model(2);out=model(5) + label=[strcat(sci2exp(in));strcat(sci2exp(out))] + gr_i=["xstringb(orig(1),orig(2),''GENERAL'',sz(1),sz(2),''fill'');"] + case "GENSIN_f" then + rpar=model(8) + label=[string(rpar(1));string(rpar(2));string(rpar(3))] + gr_i=["txt=[''sinusoid'';''generator''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + case "GENSQR_f" then + //rpar=model(8); ? + Amplitude=model(7) + label=string(Amplitude) + gr_i=["txt=[''square wave'';''generator''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + case "HALT_f" then + n=model(9); + label=string(n) + gr_i=["xstringb(orig(1),orig(2),''STOP'',sz(1),sz(2),''fill'');"] + case "IFTHEL_f" then + label=[] + model(11)=[-1,-1] + gr_i=["txt=[''If in>=0'';'' '';'' then else''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + case "INTEGRAL_f" then + x0=model(6); + label=strcat(sci2exp(x0)) + gr_i=["xstringb(orig(1),orig(2),'' 1/s '',sz(1),sz(2),''fill'');"] + case "INVBLK_f" then + model(2)=-1;model(3)=-1 + label=" " + gr_i=["xstringb(orig(1),orig(2),''1/u'',sz(1),sz(2),''fill'');"] + case "IN_f" then + prt=model(9); + label=[string(prt)] + model(3)=-1 + gr_i=[] + case "LOGBLK_f" then + a=model(8) + in=model(2) + label=[string(a)] + model(2)=-1;model(3)=-1 + gr_i=["xstringb(orig(1),orig(2),''log'',sz(1),sz(2),''fill'');"] + case "LOOKUP_f" then + model(10)="c" + gr_i=["rpar=model(8);n=size(rpar,''*'')/2;"; + "thick=xget(''thickness'');xset(''thickness'',2);"; + "xx=rpar(1:n);yy=rpar(n+1:2*n);"; + "mnx=min(xx);xx=xx-mnx*ones(xx);mxx=max(xx);"; + "xx=orig(1)+sz(1)*(1/10+(4/5)*xx/mxx);"; + "mnx=min(yy);yy=yy-mnx*ones(yy);mxx=max(yy);"; + "yy=orig(2)+sz(2)*(1/10+(4/5)*yy/mxx);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick);"] + label=[] + case "MAX_f" then + in=model(2);nin=sum(in) + if nin<>1 then + write(%io(2),["Pb with MAX_f block"; + "previously block has more than one input port"; + "It is better to change it with the new block version"; + "preceded by a multiplexer"]) + end + label=" " + gr_i=["xstringb(orig(1),orig(2),''Max'',sz(1),sz(2),''fill'');"] + case "MCLOCK_f" then + label=[] + gr_i=["txt=[''2freq clock'';'' f/n f''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"] + case "MFCLCK_f" then + dt=model(8) + nn=model(9) + label=[string(dt);string(nn)] + gr_i=["txt=[''M. freq'';''clock''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"] + case "MIN_f" then + in=model(2);nin=sum(in) + if nin<>1 then + write(%io(2),["Pb with MIN_f block"; + "previously block has more than one input port"; + "It is better to change it with the new block version"; + "preceded by a multiplexer"]) + end + label=" " + gr_i=["xstringb(orig(1),orig(2),''MIN'',sz(1),sz(2),''fill'')"] + case "NEGTOPOS_f" then + label=[] + gr_i=["xstringb(orig(1),orig(2),'' - to + '',sz(1),sz(2),''fill'');"] + case "OUT_f" then + prt=model(9); + model(2)=-1 + label=[string(prt)] + gr_i=[] + case "POSTONEG_f" then + label=[] + gr_i=["xstringb(orig(1),orig(2),'' + to - '',sz(1),sz(2),''fill'')"] + case "POWBLK_f" then + in=model(2);nin=sum(in) + if nin<>1 then + write(%io(2),["Pb with MIN_f block"; + "previously block has more than one input port"; + "It is better to change it with the new block version"; + "preceded by a multiplexer and followed by a demux"]) + end + if model(8)<>[] then + a=model(8) + else + a=model(9) + end + in=model(2) + label=[string(a)] + gr_i=["xstringb(orig(1),orig(2),''u^a'',sz(1),sz(2),''fill'');"] + case "PROD_f" then + label=[] + gr_i=[] + model(1)=list("prod",2) + case "QUANT_f" then + rpar=model(8);ipar=model(9); + pas=rpar(1) + meth=ipar + label=[string(pas);string(meth)] + gr_i=["thick=xget(''thickness'');xset(''thickness'',2);"; + "xx=orig(1)+[1;2;2;3;3;4;4]/5*sz(1);"; + "yy= orig(2)+[1;1;2;2;3;3;4]/5*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick);"] + case "RAND_f" then + rpar=model(8);flag=model(9); + out=model(3);nout=sum(out) + if nout<>1 then + write(%io(2),["Pb with RAND_f block"; + "previously block has more than one output port"; + "It is better to change it with the new block version"; + " followed by a demux"]) + end + + a=rpar(1:nout) + b=rpar(nout+1:2*nout) + label=[string(flag);sci2exp(a(:));sci2exp(b(:))] + gr_i=["txt=[''random'';''generator''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"] + case "REGISTER_f" then + z0=model(7) + label=strcat(string(z0),";") + + gr_i=["dly=model(8);"; + "txt=[''Shift'';''Register'';string(dly)];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"] + else + ok=%f + end + if ok then + graphics(4)=label + graphics(9)=gr_i + o(2)=graphics + model(13)=" ";model(14)=list() + o(3)=model + o=replace_firing(o) + return + end + ok=%t + select blocktype + case "RFILE_f" then + [out,state,ipar]=model([3 7 9]) + nout=sum(out) + ievt=ipar(3);N=ipar(4); + imask=5+ipar(1)+ipar(2) + if ievt<>0 then tmask=ipar(imask),else tmask=[],end + outmask=ipar(imask+ievt:imask+nout+ievt-1) + lunit=state(2) + ievt=ipar(3);N=ipar(4); + imask=5+ipar(1)+ipar(2) + if ievt<>0 then tmask=ipar(imask),else tmask=[],end + outmask=ipar(imask+ievt:imask+nout+ievt-1) + lfil=ipar(1) + lfmt=ipar(2) + if lfil>0 then fname=_code2str(ipar(5:4+lfil)),else fname=" ",end + if lfmt>0 then Fmt=_code2str(ipar(5+lfil:4+lfil+lfmt)),else Fmt=" ",end + label=[ sci2exp(tmask); + sci2exp(outmask); + fname; + Fmt; + string(N); + sci2exp(out)] + gr_i=["txt=[''read from'';''input file''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"] + case "SAT_f" then + rpar=model(8) + minp=rpar(1),maxp=rpar(2),pente=rpar(3) + label=[string(minp);string(maxp);string(pente)] + + gr_i=["thick=xget(''thickness'');xset(''thickness'',2);"; + "xx=orig(1)+[4/5;1/2+1/5;1/2-1/5;1/5]*sz(1);"; + "yy=orig(2)+[1-1/5;1-1/5;1/5;1/5]*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick)"] + case "SAWTOOTH_f" then + model(10)="c" + gr_i=["txt=[''sawtooth'';''generator''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + case "SCOPE_f" then + [in,rpar,ipar]=model([2 8 9]) + in=model(2);nin=sum(in) + if nin<>1 then + write(%io(2),["Pb with SCOPE_f block"; + "previously block has more than one input port"; + "It is better to change it with the new block version"; + "preceded by a multiplexer"]) + end + win=ipar(1);N=ipar(3); + clrs=-ipar(4:nin+3) + if size(clrs,"*")<8 then clrs(8)=1;end + + wdim=[-1;-1] + wpos=[-1;-1] + model(9)=[win;1;N;clrs;wpos(:);wdim(:)] + dt=rpar(1);ymin=rpar(2);ymax=rpar(3);per=rpar(4) + label=[strcat(string(clrs)," "); + string(win); + sci2exp([]); + sci2exp([]); + string(ymin); + string(ymax); + string(per); + string(N)]; + + gr_i=["thick=xget(''thickness'');xset(''thickness'',2);"; + "xrect(orig(1)+sz(1)/10,orig(2)+(1-1/10)*sz(2),sz(1)*8/10,sz(2)*8/10);"; + "xx=[orig(1)+sz(1)/5,orig(1)+sz(1)/5;"; + "orig(1)+(1-1/5)*sz(1),orig(1)+sz(1)/5];"; + "yy=[orig(2)+sz(2)/5,orig(2)+sz(2)/5;"; + "orig(2)+sz(2)/5,orig(2)+(1-1/5)*sz(2)];"; + "xarrows(xx,yy);"; + "t=(0:0.3:2*%pi)'';"; + "xx=orig(1)+(1/5+3*t/(10*%pi))*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick)"] + case "SCOPXY_f" then + [rpar,ipar]=model(8:9) + win=ipar(1);N=ipar(3);clrs=-ipar(4);siz=ipar(5) + xmin=rpar(1);xmax=rpar(2);ymin=rpar(3);ymax=rpar(4) + wdim=[-1;-1] + wpos=[-1;-1] + label=[sci2exp(clrs); + sci2exp(siz); + string(win); + sci2exp([]); + sci2exp([]); + string(xmin); + string(xmax); + string(ymin); + string(ymax); + string(N)]; + model(9)=[win;1;N;clrs;siz;1;wpos(:);wdim(:)] + gr_i=["thick=xget(''thickness'');xset(''thickness'',2);"; + "t=(0:0.2:2*%pi)'';"; + "xx=orig(1)+(1/5+(cos(3*t)+1)*3/10)*sz(1);"; + "yy=orig(2)+(1/4.3+(sin(t+1)+1)*3/10)*sz(2);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick)"] + case "SELECT_f" then + z0=model(7);nin=size(model(2),1); + label=[string(nin);string(z0-1)] + model(1)=list("selector",2) + gr_i=["xstringb(orig(1),orig(2),''Selector'',sz(1),sz(2),''fill'');"] + case "SINBLK_f" then + in=model(2);nin=sum(in) + if nin<>1 then + write(%io(2),["Pb with MIN_f block"; + "previously block has more than one input port"; + "It is better to change it with the new block version"; + "preceded by a multiplexer and followed by a demux"]) + end + label=" " + gr_i=["xstringb(orig(1),orig(2),''sin'',sz(1),sz(2),''fill'')"] + case "SOM_f" then + sgn=model(8); + label=sci2exp(sgn) + model(1)=list("sum",2) + gr_i=[] + case "SPLIT_f" then + label=[] + gr_i=[] + case "SUPER_f" then + label=[] + gr_i=["thick=xget(''thickness'');xset(''thickness'',2);"; + "xx=orig(1)+ [2 4 4]*(sz(1)/7);"; + "yy=orig(2)+sz(2)-[2 2 6]*(sz(2)/10);"; + "xrects([xx;yy;[sz(1)/7;sz(2)/5]*ones(1,3)]);"; + "xx=orig(1)+ [1 2 3 4 5 6 3.5 3.5 3.5 4 5 5.5 5.5 5.5]*sz(1)/7;"; + "yy=orig(2)+sz(2)-[3 3 3 3 3 3 3 7 7 7 7 7 7 3 ]*sz(2)/10;"; + "xsegs(xx,yy,0);"; + "xset(''thickness'',thick)"] + case "TANBLK_f" then + in=model(2);nin=sum(in) + if nin<>1 then + write(%io(2),["Pb with TANBLK_f block"; + "previously block has more than one input port"; + "It is better to change it with the new block version"; + "preceded by a multiplexer and followed by a demux"]) + end + label=" " + gr_i=["xstringb(orig(1),orig(2),''tan'',sz(1),sz(2),''fill'');"] + case "TCLSS_f" then + in=model(2);nin=sum(in) + out=model(3);nout=sum(out) + x0=model(6),rpar=model(8) + + ns=prod(size(x0));nin=nin-ns + A=matrix(rpar(1:ns*ns),ns,ns) + B=matrix(rpar(ns*ns+1:ns*(ns+nin)),ns,nin) + C=matrix(rpar(ns*(ns+nin)+1:ns*(ns+nin+nout)),nout,ns) + D=matrix(rpar(ns*(ns+nin+nout)+1:ns*(ns+nin+nout)+(nin*nout)),nout,nin) + nin1=nin;nout1=nout + + label=[strcat(sci2exp(A)); + strcat(sci2exp(B)); + strcat(sci2exp(C)); + strcat(sci2exp(D)); + strcat(sci2exp(x0))] + gr_i=["txt=[''Jump'';''(A,B,C,D)''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"] + else + ok=%f + end + if ok then + graphics(4)=label + graphics(9)=gr_i + o(2)=graphics + model(13)=" " + model(14)=list() + o(3)=model + o=replace_firing(o) + return + end + ok=%t + select blocktype + case "TEXT_f" then + ipar=model(9) + font=ipar(1);siz=ipar(2) + label=[graphics(4);string(font);string(siz)] + gr_i=[] + case "TIME_f" then + label=[] + gr_i=["wd=xget(''wdim'').*[1.016,1.12];"; + "thick=xget(''thickness'');xset(''thickness'',2);"; + "p=wd(2)/wd(1);p=1;"; + "rx=sz(1)*p/2;ry=sz(2)/2;"; + "xarc(orig(1)+0.05*sz(1),orig(2)+0.95*sz(2),0.9*sz(1)*p,0.9*sz(2),0,360*64);"; + "xset(''thickness'',1);"; + "xx=[orig(1)+rx orig(1)+rx;"; + "orig(1)+rx orig(1)+rx+0.6*rx*cos(%pi/6)];"; + "yy=[orig(2)+ry orig(2)+ry ;"; + " orig(2)+1.8*ry orig(2)+ry+0.6*ry*sin(%pi/6)];"; + "xsegs(xx,yy,0);"; + "xset(''thickness'',thick);"] + case "TRASH_f" then + in=model(2);nin=sum(in) + if nin<>1 then + write(%io(2),["Pb with MIN_f block"; + "previously block has more than one input port"; + "It is better to change it with the new block version"; + "preceded by a multiplexer"]) + end + label=" " + gr_i=["xstringb(orig(1),orig(2),''Trash'',sz(1),sz(2),''fill'')"] + case "WFILE_f" then + state=model(7) + [in,ipar]=model([2 9]) + N=ipar(3); + lunit=state(2) + N=ipar(4) + lfil=ipar(1) + lfmt=ipar(2) + if lfil>0 then fname=_code2str(ipar(5:4+lfil)),else fname=" ",end + if lfmt>0 then Fmt=_code2str(ipar(5+lfil:4+lfil+lfmt)),else Fmt=" ",end + label=[sci2exp(in); + fname; + Fmt; + string(N)] + + gr_i=["txt=[''write to'';''output file''];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"] + case "ZCROSS_f" then + in=model(2) + label=strcat(sci2exp(in)) + gr_i=["xstringb(orig(1),orig(2),''Zcross'',sz(1),sz(2),''fill'');"] + case "func_block" then + write(%io(2),["PB with func_block"; + "version change is not implemented"]) + label=[] + gr_i=["xstringb(orig(1),orig(2),''Func'',sz(1),sz(2),''fill'');"] + case "m_sin" then + rpar=model(8);gain=rpar(1);phase=rpar(2) + label=[string(gain);string(phase)] + gr_i=[] + case "sci_block" then + write(%io(2),["PB with sci_block"; + "version change is not implemented"]) + label=[] + gr_i=["xstringb(orig(1),orig(2),''Sci_Block'',sz(1),sz(2),''fill'');"] + case "scifunc_block" then + write(%io(2),["PB with scifunc_block"; + "version change is not implemented"]) + i1=model(2);o1=model(3);ci1=model(4);co1=model(5);x1=model(6); + z1=model(7);auto1=model(11);type_1=model(10); + tt=model(9),rpar=model(8) + label=list([sci2exp(i1);sci2exp(o1);sci2exp(ci1);sci2exp(co1); + strcat(sci2exp(x1));strcat(sci2exp(z1));type_1; + strcat(sci2exp(rpar));sci2exp(auto1)],tt) + + gr_i=["xstringb(orig(1),orig(2),''Scifunc'',sz(1),sz(2),''fill'');"] + case "standard_block" then + write(%io(2),["PB with standard_block"; + "version change is not implemented"]) + label=[] + gr_i=[] + else + disp(blocktype+" unknown, parameters values may be lost, please check") + label=[] + gr_i=[] + end + graphics(4)=label + graphics(9)=gr_i + o(2)=graphics + model(13)=" " + model(14)=list() + o(3)=model + o=replace_firing(o) + +endfunction + +function o=replace_firing(o) + firing=o(3)(11) + cout=o(3)(5) + if firing==%f|firing==0 then + o(3)(11)=-ones(cout) + //disp('firing changed from %f to '+sci2exp(o(3)(11))+' in '+o(3)(1)(1)) + elseif firing==%t|firing==1 then + o(3)(11)=0*cout + //disp('firing changed from %t to '+sci2exp(o(3)(11))+' in '+o(3)(1)(1)) + elseif firing==[] then + o(3)(11)=[] + else + write(%io(2),"Problem with block "+o(3)(1)(1)) + pause + end + +endfunction +function x_new=do_version22(scs_m) + x_new=list() + wpar=scs_m(1) + wsiz=wpar(1) + + if size(wsiz,"*")>=4 then x_new=scs_m,return,end + + wpar(3)(4)=wpar(4)+1 + x_new(1)=wpar + nx=size(scs_m) + for k=2:nx + o=scs_m(k) + if o(1)=="Link" then + elseif o(1)=="Block" then + model=o(3) + if model(1)=="super"|model(1)=="csuper" then + model(8)=do_version22(model(8)) + o(3)=model + o=block_version(o) + scs_m(k)=o + else + o=block_version(o) + end + elseif o(1)=="Text" then + o=block_version(o) + end + x_new(k)=o; + end +endfunction + +function scs_m_new=do_version27(scs_m) + if typeof(scs_m)=="diagram" then + //following code reported into do_version273 + // scs_m_new=scs_m, + // nlstsize=lstsize(scs_m_new.objs) + // for k=1:nlstsize + // if typeof(scs_m_new.objs(k))=='Link' then + // o=scs_m_new.objs(k) + // if size(o.from,'*')==2 then o.from(3)=0,end + // if size(o.to,'*')==2 then o.to(3)=1,end + // scs_m_new.objs(k)=o + // elseif typeof(scs_m_new.objs(k))=='Block' then + + // end + // end + scs_m_new=scs_m + return, + end + scs_m_new=scicos_diagram() + tf=scs_m(1)(4) + if tf==[] then tf=100;end + tol=scs_m(1)(3) + if size(tol,"*")<4 then tol(4)=tf+1,end + if size(tol,"*")<5 then tol(5)=0,end + if size(tol,"*")<6 then tol(6)=0,end + for iix=size(scs_m(1))+1:10,scs_m(1)(iix)=[];end + scs_m_new.props=scicos_params(wpar=scs_m(1)(1),Title=scs_m(1)(2),.. + tol=tol,tf=tf,.. + context=scs_m(1)(5),options=scs_m(1)(7),.. + doc=scs_m(1)(10)) + + if scs_m(1)(7).Background==[] then + scs_m_new.props.options.Background=[8 1] + end + + scs_m_new.objs(1)=mlist("Deleted") // not to change the internal numbering + n=lstsize(scs_m) + back_col=8 //white background + + mprintf(".") + + for i=2:n //loop on objects + o=scs_m(i); + if o(1)=="Block" then + if size(o(2)) > 8 then + if type(o(2)(9))==15 then + gr_io=o(2)(9)(1); + if o(2)(9)(2)<>[] then + back_col=o(2)(9)(2);, + end + else + gr_io=o(2)(9); + back_col=8 + end + gr_i=convert_gri(o(5),gr_io); + if gr_i==[] then gr_i=gr_io;, end + elseif size(o(2)) < 9 then + gr_i=[]; + back_col=8 + end + gr_i=list(gr_i,back_col) + + mdl=o(3); + if size(o(3))<=12 then + mdl(13)=""; mdl(14)=[] ; mdl(15)=""; + elseif size(o(3))<=13 then + mdl(14)=[] ; mdl(15)=""; + elseif size(o(3))<=14 then + mdl(15)=""; + end + + if mdl(1)(1)=="super"|mdl(1)(1)=="csuper" then + if type(mdl(8))==15 then + mdl(8)=do_version27(mdl(8)) + end + end + + graphics=scicos_graphics27(orig=o(2)(1),sz=o(2)(2),flip=o(2)(3),.. + exprs=o(2)(4),pin=o(2)(5),pout=o(2)(6),.. + pein=o(2)(7),peout=o(2)(8),gr_i=gr_i,.. + id=mdl(15)) + + + model=scicos_model27(sim=mdl(1),in=mdl(2),out=mdl(3),evtin=mdl(4),.. + evtout=mdl(5),state=mdl(6),dstate=mdl(7),.. + rpar=mdl(8),ipar=mdl(9),blocktype=mdl(10),.. + firing=mdl(11),dep_ut=mdl(12),label=mdl(13)) + + + objsi=scicos_block(graphics=graphics,model=model,gui=o(5),.. + doc=mdl(14)) + if objsi.gui=="ESELECT_f" then objsi.model.sim(2)=-2,end + scs_m_new.objs(i)=objsi + + elseif o(1)=="Link" then + from=o(8);from(3)=0; + to=o(9);to(3)=1; + + objsi=scicos_link(xx=o(2),yy=o(3),id=o(5),thick=o(6),.. + ct=o(7),from=from,to=to) + scs_m_new.objs(i)=objsi + elseif o(1)=="Text" then + + objsi=TEXT_f("define") + objsi.model.rpar=o(3)(8) + objsi.model.ipar=o(3)(9) + objsi.graphics.orig=o(2)(1) + objsi.graphics.sz=o(2)(2) + objsi.graphics.exprs=o(2)(4) + scs_m_new.objs(i)=objsi + elseif o(1)=="Deleted" then + scs_m_new.objs(i)=tlist("Deleted") + end + end + + [%cpr,edited]=resume(list(),%t) // doit etre enleve +endfunction + +function gr_i=convert_gri(name,gri) + gr_i=[]; + select name + case "BIGSOM_f" then + gr_i=["[x,y,typ]=standard_inputs(o) "; + "sgn=o.model.rpar"; + "for k=1:size(x,''*'')"; + " if sgn(k)>0 then"; + " xstring(orig(1)+sz(1)/8 ,y(k)-4,''+'')"; + " else"; + " xstring(orig(1)+sz(1)/8 ,y(k)-4,''-'')"; + " end"; + "end"; + "xx=sz(1)*[.8 .4 0.75 .4 .8]+orig(1)"; + "yy=sz(2)*[.8 .8 .5 .2 .2]+orig(2)"; + "xpoly(xx,yy,''lines'')"] + + case "CONST_f" then + gr_i=["dx=sz(1)/5;dy=sz(2)/10;"; + "w=sz(1)-2*dx;h=sz(2)-2*dy;"; + "txt=C;" + "xstringb(orig(1)+dx,orig(2)+dy,txt,w,h,''fill'');"] + + case "CURV_f" then + gr_i=["model=arg1.model;rpar=model.rpar;ipar=model.ipar;n=ipar(1);"; + "thick=xget(''thickness'');xset(''thickness'',2);"; + "xx=rpar(1:n);yy=rpar(n+1:2*n);"; + "rect=rpar(2*n+1:2*n+4);"; + "mxx=rect(3)-rect(1);"; + "mxy=rect(4)-rect(2);"; + "xx=orig(1)+sz(1)*(1/10+(4/5)*((xx-rect(1))/mxx));"; + "yy=orig(2)+sz(2)*(1/10+(4/5)*((yy-rect(2))/mxy));"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick);"] + + case "EVTDLY_f" then + gr_i=["dt=model.rpar;"; + "txt=[''Delay'';string(dt)];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + + case "EVTGEN_f" then + gr_i=["tt=model.firing;"; + "txt=[''Event at'';''time ''+string(tt)];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'');"] + + case "GAIN_f" then + + gr_i=["gain=C," + "dx=sz(1)/5;"; + "dy=sz(2)/10;"; + "xx=orig(1)+ [1 4 1 1]*dx;"; + "yy=orig(2)+sz(2)-[1 5 9 1]*dy;"; + "xpoly(xx,yy,''lines'');"; + "w=sz(1)-2*dx;h=sz(2)-2*dy;"; + "xstringb(orig(1)+dx,orig(2)+dy,gain,w,h,''fill'');"] + + case "LOOKUP_f" then + gr_i=["rpar=model.rpar;n=size(rpar,''*'')/2;"; + "thick=xget(''thickness'');xset(''thickness'',2);"; + "xx=rpar(1:n);yy=rpar(n+1:2*n);"; + "mnx=min(xx);xx=xx-mnx*ones(xx);mxx=max(xx);"; + "xx=orig(1)+sz(1)*(1/10+(4/5)*xx/mxx);"; + "mnx=min(yy);yy=yy-mnx*ones(yy);mxx=max(yy);"; + "yy=orig(2)+sz(2)*(1/10+(4/5)*yy/mxx);"; + "xpoly(xx,yy,''lines'');"; + "xset(''thickness'',thick);"] + + case "REGISTER_f" then + + gr_i=["dly=model.rpar;"; + "txt=[''Shift'';''Register'';string(dly)];"; + "xstringb(orig(1),orig(2),txt,sz(1),sz(2),''fill'')"] + case "SWITCH_f" then + + gr_i="xstringb(orig(1),orig(2),[''switch'';string(model.ipar+1)],sz(1),sz(2),''fill'');" + case "EXPBLK_f" then + gr_i="xstringb(orig(1),orig(2),''a^u'',sz(1),sz(2),''fill'');" + case "POWBLK_f" then + gr_i="xstringb(orig(1),orig(2),''u^a'',sz(1),sz(2),''fill'');" + + end +endfunction + + +function scs_m_new=do_versionxx(scs_m) + //A SUPPRIMER CF ci dessus + if typeof(scs_m)=="diagram" then scs_m_new=scs_m,return,end + if typeof(scs_m(1))<>"params" then scs_m_new=scs_m,return,end + scs_m_new=scicos_diagram() + scs_m_new.props=scs_m(1) + scs_m_new.objs(1)=mlist("Deleted") // not to change the internal numbering + n=lstsize(scs_m) + for i=2:n //loop on objects + o=scs_m(i) + scs_m_new.objs(i)=o + if typeof(o)=="Block" then + if o.model.sim(1)=="super"| o.model.sim(1)=="csuper" then + scs_m_new.objs(i).model.rpar=do_versionxx(o.model.rpar) + end + end + end + edited=resume(%t) +endfunction + + +function model=scicos_model27(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10,v11,v12,v13) + //initialisation de model mlist + if exists("sim","local")==0 then sim="",end + if exists("in","local")==0 then in=[],end + if exists("out","local")==0 then out=[],end + if exists("evtin","local")==0 then evtin=[],end + if exists("evtout","local")==0 then evtout=[],end + if exists("state","local")==0 then state=[],end + if exists("dstate","local")==0 then dstate=[],end + if exists("rpar","local")==0 then rpar=[],end + if exists("ipar","local")==0 then ipar=[],end + if exists("blocktype","local")==0 then blocktype="c",end + if exists("firing","local")==0 then firing=[],end + if exists("dep_ut","local")==0 then dep_ut=[%f %f],end + if exists("label","local")==0 then label="",end + + model=mlist(["model","sim","in","out","evtin","evtout","state","dstate",.. + "rpar","ipar","blocktype","firing","dep_ut","label"],.. + sim,in,out,evtin,evtout,state,dstate,.. + rpar,ipar,blocktype,firing,dep_ut,label) +endfunction + +function graphics=scicos_graphics27(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10) + //initialisation de graphics mlist + if exists("orig","local")==0 then orig=[0 0],end + if exists("sz","local")==0 then sz=[20 20],end + if exists("flip","local")==0 then flip=%t,end + if exists("exprs","local")==0 then exprs=[],end + if exists("pin","local")==0 then pin=[],end + if exists("pout","local")==0 then pout=[],end + if exists("pein","local")==0 then pein=[],end + if exists("peout","local")==0 then peout=[],end + if exists("gr_i","local")==0 then gr_i=[],end + if exists("id","local")==0 then id="",end + + graphics=mlist(["graphics","orig","sz","flip","exprs","pin",.. + "pout","pein","peout","gr_i","id"],.. + orig,sz,flip,exprs,pin,pout,pein,peout,gr_i,id) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/entity_menu.sce b/modules/scicos/macros/scicos_scicos/entity_menu.sce new file mode 100755 index 000000000..c0b94bdfc --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/entity_menu.sce @@ -0,0 +1,520 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function add_entity_menu(win, emen) + if argn(2)<1 then + win = get(gcf(),"figure_id") + scf(win) + end + if argn(2)<2 then emen="Edit",end + old = gcf() + EntityMenus=["Browser","Copy","Paste","Move","Delete","Insert","Ok","Cancel"]; + //delmenu(win,'Entities') + + addmenu(win,emen,EntityMenus,list(2,"entity_menu")); + //seteventhandler('entity_handler') + scf(old) +endfunction + + + +function entity_menu(k,win) + old=gcf();fig=scf(win) + seteventhandler("") + select k + case 1 then //browser + ged(5,win) + case 2 then //copy + copy_entity() + case 3 then //past + paste_entity() + case 4 then //move + move_entity() + case 5 then //Delete Entity + delete_entity() + case 6 then //New entity + new_entity() + case 7 then //ok + fig.user_data="ok" + case 8 then //cancel + fig.user_data="cancel" + //txt=gen_code() + //mputl(txt,TMPDIR+'/foo.txt') + end + seteventhandler("ged_eventhandler") + scf(old) +endfunction + +function new_entity() + entities=["Rectangle","Segment","Polyline","Text","Circle"] + sel=x_choose(entities,"Select the Entity type") + f=gcf(); + rep(3)=-1 + select sel + case 1 then //Rectangle + [btn,xc,yc]=xclick() + xrect(xc,yc,0,0) + r=gce();r.foreground=-1; + while rep(3)==-1 do + rep=xgetmouse() + r.data=[min(xc,rep(1)),max(yc,rep(2)),abs(xc-rep(1)),abs(yc-rep(2))] + end + + case 2 then //Segment + [btn,xc,yc]=xclick() + xsegs([xc;xc],[yc;yc]) + r=gce();r.foreground=-1; + while rep(3)==-1 do + rep=xgetmouse() + r.data=[xc,yc;rep(1),rep(2)] + end + + case 3 then //Polyline + [btn,xc,yc]=xclick() + xpoly([xc;xc],[yc;yc]) + r=gce();r.foreground=-1; + while %t + while rep(3)==-1 do + rep=xgetmouse() + r.data($,:)=[rep(1),rep(2)] + end + if rep(3)==2 then break,end + rep(3)=-1; + r.data=[r.data;r.data($,:)] + end + case 4 then //Text + text = x_dialog("Enter the new text here.","") ; + if ( text <> [] & text <> "" ) then + // do nothing if cancel button has been pressed or no text entered + // get the position of the text + xstring(0, 0, text ) ; + r=gce(); + if r.type=="Text" then + while rep(3)==-1 do + rep=xgetmouse() + r.data=[rep(1),rep(2)] + end + else //compound + y0=0 + while rep(3)==-1 do + rep=xgetmouse() + y0=r.children($).data(2) + for k=1:size(r.children,"*") + rk=r.children(k) + rk.data=[rep(1),rk.data(2)+rep(2)-y0] + end + y0=rep(2) + end + end + end + case 5 then //Circle + [btn,xc,yc]=xclick() + xarc(xc,yc,0,0,0,64*360) + r=gce();r.foreground=-1; + while rep(3)==-1 do + rep=xgetmouse() + r.data=[min(xc,rep(1)),max(yc,rep(2)),abs(xc-rep(1)),abs(yc-rep(2)),0,360] + end + + end +endfunction + +function delete_entity() + gedx=ged + [btn,xc,yc]=xclick() + [xc,yc]=xchange(xc,yc,"f2i") + h=ged_getobject([xc,yc]) + if h<>[] then delete(h),end +endfunction + +function move_entity() + gedx=ged + [btn,xc,yc]=xclick() + pos=[xc,yc] + [xc,yc]=xchange(xc,yc,"f2i") + r=ged_getobject([xc,yc]) + if r==[] return,end + mprintf("debut move\n") + rep(3)=-1 + select r.type + case "Rectangle" then + while rep(3)==-1 do + rep=xgetmouse() + r.data(1:2)= r.data(1:2)+(rep(1:2)-pos) + pos=rep(1:2) + end + case "Segs" then //Segment + while rep(3)==-1 do + rep=xgetmouse() + r.data=r.data+ones(r.data(:,1))*(rep(1:2)-pos) + pos=rep(1:2) + end + case "Polyline" then //Polyline + while rep(3)==-1 do + rep=xgetmouse() + r.data=r.data+ones(r.data(:,1))*(rep(1:2)-pos) + pos=rep(1:2) + end + case "Text" then //Text + if r.parent.type=="Axes" then + while rep(3)==-1 do + rep=xgetmouse() + r.data=r.data+(rep(1:2)-pos) + pos=rep(1:2) + end + else + r=r.parent + while rep(3)==-1 do + rep=xgetmouse() + for k=1:size(r.children,"*") + rk=r.children(k) + rk.data=rk.data+(rep(1:2)-pos) + end + pos=rep(1:2) + end + end + case "Arc" then //Circle + while rep(3)==-1 do + rep=xgetmouse() + r.data(1:2)= r.data(1:2)+(rep(1:2)-pos) + pos=rep(1:2) + end + + end + mprintf("fin move\n") +endfunction + + +function copy_entity() + gedx=ged; + [btn,xc,yc]=xclick() + [xc,yc]=xchange(xc,yc,"f2i") + r=ged_getobject([xc,yc]) + if r==[] return,end + twinkle(r,1); + save(TMPDIR+"/G_Clipboard",r) +endfunction + + +function paste_entity() + // check the file + [info,err] = fileinfo(TMPDIR + "/G_Clipboard" ) ; + + if err <> 0 then + return ; + end + + // create the saved object + load(TMPDIR+"/G_Clipboard") ; +endfunction + +function txt=gen_code(win) + old=gcf() + if argn(2)>=1 then scf(win);end + ax=gca() + txt=[] + for k=size(ax.children,"*"):-1:1 + txt=[txt; + graphical_object_code(ax.children(k))] + + end + if txt==[] then txt=" ",end + scf(old) +endfunction + +function txt=graphical_object_code(rk) + txt=[] + select rk.type + case "Rectangle" then + dx="orig(1)+sz(1)*"+num2string(rk.data(1)) + dy="orig(2)+sz(2)*"+num2string(rk.data(2)) + sx="sz(1)*"+num2string(rk.data(3)) + sy="sz(2)*"+num2string(rk.data(4)) + txt=[txt; + "xrect("+strcat([dx,dy,sx,sy],",")+");" + rect_opt(rk)] + + case "Arc" then + dx="orig(1)+sz(1)*"+num2string(rk.data(1)) + dy="orig(2)+sz(2)*"+num2string(rk.data(2)) + sx="sz(1)*"+num2string(rk.data(3)) + sy="sz(2)*"+num2string(rk.data(4)) + a1=num2string(rk.data(5)*64) + a2=num2string(rk.data(6)*64) + + txt=[txt; + "xarc("+strcat([dx,dy,sx,sy,a1,a2],",")+");" + arc_opt(rk)] + + case "Segs" then + dx="orig(1)+sz(1)*["+strcat(num2string(rk.data(:,1)),";")+"]" + dy="orig(2)+sz(2)*["+strcat(num2string(rk.data(:,2)),";")+"]" + col=sci2exp(rk.segs_color,0) + txt=[txt; + "xsegs("+dx+","+dy+","+col+");" + seg_opt(rk)] + + case "Polyline" then + dx="orig(1)+sz(1)*["+strcat(num2string(rk.data(:,1)),";")+"]" + dy="orig(2)+sz(2)*["+strcat(num2string(rk.data(:,2)),";")+"]" + txt=[txt; + "xpoly("+dx+","+dy+");" + poly_opt(rk)] + + case "Text" then + dx="orig(1)+sz(1)*"+num2string(rk.data(1)) + dy="orig(2)+sz(2)*"+num2string(rk.data(2)) + t=sci2exp(rk.text,0) + t="["+strsubst(t,char(10),""";""")+"]" + if rk.text_box_mode <> "filled" then + txt=[txt; + "xstring("+dx+","+dy+","+t+");" + text_opt(rk)] + else //patch because of xstringb patch in scicos + w="sz(1)*"+num2string(rk.text_box(1)) + h="sz(2)*"+num2string(rk.text_box(2)) + + txt=[txt; + "xstringb("+dx+","+dy+","+t+","+w+","+h+",''fill'');" + textb_opt(rk)] + end + case "Compound" then //multiple line string + n=size(rk.children,"*") + if n==1 then + txt=[txt; + graphical_object_code(rk.children)]; + else + for i=n:-1:1 + txt=[txt; + graphical_object_code(rk.children(i)); + "e"+string(i)+"=e;"] + end + txt=[txt; + "glue(["+strcat("e"+string(1:n),",")+"]);"] + end + else + mprintf("Graphical object of type "+rk.type+" not yet handled\n") + end +endfunction + +function opts=rect_opt(e) + opts=[mark_opt(e);line_opt(e);fill_opt(e);clip_opt(e)]; + if opts<>[] then + opts=["e=gce()";opts] + opts=strcat(opts,";")+";" + end +endfunction + +function opts=arc_opt(e) + opts=[line_opt(e);fill_opt(e);clip_opt(e)]; + if opts<>[] then + opts=["e=gce()";opts] + opts=strcat(opts,";")+";" + end +endfunction + +function opts=seg_opt(e) + markopt=mark_opt(e) + lineopt=line_opt(e) + if rk.arrow_size>0 then + arrowopt="e.arrow_size="+string(e.arrow_size) + else + arrowopt=[] + end + opts=[markopt;lineopt;arrowopt]; + if opts<>[] then + opts=["e=gce()";opts] + opts=strcat(opts,";")+";" + end +endfunction + +function opts=poly_opt(e) + markopt=mark_opt(e) + lineopt=line_opt(e) + fillopt=fill_opt(e) + arrowopt=arrow_opt(e) + + opts=[markopt;lineopt;fillopt;arrowopt]; + if opts<>[] then + opts=["e=gce()";opts] + opts=strcat(opts,";")+";" + end +endfunction + +function opts=text_opt(e) + fontopt=font_opt(e) + boxopt=box_opt(e) + lineopt=[]; + if rk.fill_mode == "on" then + lineopt="e.fill_mode="+sci2exp(e.fill_mode) + if e.foreground<>-1 then + lineopt=[lineopt + "e.foreground="+sci2exp(e.foreground)] + end + end + opts=[fontopt;boxopt;lineopt] + if opts<>[] then + opts=["e=gce()";opts] + opts= strcat(opts,";")+";" + end +endfunction + +function opts=textb_opt(e) + fontopt=font_opt(e) + lineopt=[]; + if rk.fill_mode == "on" then + lineopt="e.fill_mode="+sci2exp(e.fill_mode) + if e.foreground<>-1 then + lineopt=[lineopt + "e.foreground="+sci2exp(e.foreground)] + end + end + opts=[fontopt;lineopt] + if opts<>[] then + opts=["e=gce()";opts] + opts= strcat(opts,";")+";" + end +endfunction + +function markopt=mark_opt(e) + markopt=[] + if e.mark_mode=="on" then + markopt=[markopt; + "e.mark_mode=''on''"] + if e.mark_style<>0 then + markopt=[markopt; + "e.mark_style="+string(e.mark_style)] + end + if e.mark_size<>0 then + markopt=[markopt; + "e.mark_size="+string(e.mark_size)] + end + if e.mark_foreground<>-1 then + markopt=[markopt; + "e.mark_foreground="+string(e.mark_foreground)] + end + if e.mark_background<>-1 then + markopt=[markopt; + "e.mark_background="+string(e.mark_background)] + end + end +endfunction +function lineopt=line_opt(e) + lineopt=[] + t=e.type + if e.line_mode=="on" then + lineopt=[lineopt; + "e.line_mode="+sci2exp(e.line_mode)] + if e.line_style<>0 then + lineopt=[lineopt; + "e.line_style="+string(e.line_style)] + end + if e.thickness>1 then + lineopt=[lineopt; + "e.thickness="+string(e.thickness)] + end + if t<>"Segs"&e.foreground<>-1 then + lineopt=[lineopt; + "e.foreground="+string(e.foreground)] + end + end +endfunction + +function fillopt=fill_opt(e) + fillopt=[] + if e.fill_mode=="on" then + fillopt=[fillopt; + "e.fill_mode="+sci2exp(e.fill_mode)] + if e.background<>-2 then + fillopt=[fillopt; + "e.background="+string(e.background)] + end + end +endfunction +function arrowopt=arrow_opt(e) + arrowopt=[] + if e.polyline_style<>1 then + arrowopt=[arrowopt; + "e.polyline_style="+sci2exp(e.polyline_style) + "e.arrow_size_factor="+string(e.arrow_size_factor)] + end +endfunction +function fontopt=font_opt(e) + fontopt=[] + if e.font_foreground<>-1 then + fontopt=[fontopt; + "e.font_foreground="+string(e.font_foreground)] + end + if e.font_style<>6 then + fontopt=[fontopt; + "e.font_style="+string(e.font_style)] + end + if e.font_size<>1 then + fontopt=[fontopt; + "e.font_size="+string(e.font_size)] + end + if e.font_angle<>0 then + fontopt=[fontopt; + "e.font_angle="+string(e.font_angle)] + end +endfunction + +function boxopt=box_opt(e) + boxopt=[] + if e.text_box_mode<>"off" then + boxopt=[boxopt; + "e.text_box_mode="+sci2exp(e.text_box_mode)] + end + if or(e.text_box<>[0 0]) then + boxopt=[boxopt; + "e.text_box="+sci2exp(e.text_box)] + end + if e.box<>"off" then + boxopt=[boxopt; + "e.box="+sci2exp(e.box)] + end + if e.background<>-2 then + boxopt=[boxopt; + "e.background="+sci2exp(e.background)] + end + if e.fill_mode<>"off" then + boxopt=[boxopt; + "e.fill_mode="+sci2exp(e.fill_mode)]; + + end +endfunction + +function clipopt=clip_opt(e) + clipopt=[] + if e.clip_state<>"off" then + clipopt=[clipopt; + "e.clip_state="+sci2exp(e.clip_state) + "e.clip_box="+sci2exp(e.clip_box)] + end +endfunction + + +function s=num2string(a) + s=matrix(msprintf("%.2f\n",a(:)),size(a)) + s=strsubst(s,".00","") +endfunction + + diff --git a/modules/scicos/macros/scicos_scicos/extract_implicit.bin b/modules/scicos/macros/scicos_scicos/extract_implicit.bin new file mode 100755 index 000000000..2799c07e6 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/extract_implicit.bin differ diff --git a/modules/scicos/macros/scicos_scicos/extract_implicit.sci b/modules/scicos/macros/scicos_scicos/extract_implicit.sci new file mode 100755 index 000000000..cb112049b --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/extract_implicit.sci @@ -0,0 +1,144 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [blklstr,cmatr,ccmat,cor,corinv,ok]=extract_implicit(blklst,cmat,ccmat) + + imp=[];blklstr=[];cmatr=[];ok=%t + + nb=size(blklst); + for k=1:nb + if or(getfield(1,blklst(k))=="equations") then + if blklst(k).equations<>list() then imp=[imp,k];end + end + end + if imp==[] then [blklstr,cmatr]=(blklst,cmat), return,end + + if size(ccmat,1)>0 then + if or(dsearch(ccmat(:,1),imp,"d")<>0) then + messagebox("An implicit block has an event input","modal","error"); + ok=%f + return + end + if or(dsearch(ccmat(:,3),imp,"d")<>0) then + messagebox("An implicit block has an event output","modal","error"); + ok=%f + return + end + end + indfrom=dsearch(cmat(:,1),imp,"d") + indto=dsearch(cmat(:,4),imp,"d") + + I=find(indfrom<>0&indto<>0) //links between two implicit blocs + Iin=find(indfrom==0&indto<>0) + Iout=find(indfrom<>0&indto==0) + + blklsti=list(blklst(imp)); //the implicit blocks list + cmati=cmat(I,:); + + //add blocks for input and outputs + nbi=size(blklsti); + N=size(Iin,"*"); + if N>0 + mo=modelica();mo.model="InPutPort";mo.outputs="vo";mo.inputs="vi"; + for k=1:N + blklsti($+1)=scicos_model(equations=mo); + end + ci=cmat(Iin,:);ci(:,1)=-(nbi+(1:N))';ci(:,2)=1; + cmati=[cmati;ci]; + nbi=nbi+N; + end + N=size(Iout,"*") + if N>0 + mo=modelica();mo.model="OutPutPort";mo.outputs="vo";mo.inputs="vi"; + for k=1:N + blklsti($+1)=scicos_model(equations=mo); + end + co=cmat(Iout,:);co(:,4)=-(nbi+(1:N)');co(:,5)=1; + cmati=[cmati;co]; + nbi=nbi+N; + end + + //renumber links connecting implicit blocs + for k=1:size(cmati,1) + l=find(cmati(k,1)==imp);if l<>[] then cmati(k,1)=l;end + l=find(cmati(k,4)==imp);if l<>[] then cmati(k,4)=l;end + end + cmati=abs(cmati) + + name="imppart_"+stripblanks(scs_m.props.title(1)); + txt=create_modelica( blklsti,cmati,name); + mputl(txt,scs_m.props.title(2)+name+".mo"); + [ok,name1,nx,ng]=compile_modelica(scs_m.props.title(2)+name+".mo"); + if ~ok then return,end + reg=1:nb;reg(imp)=[]; + blklstr=list(blklst(reg)); //the regular blocks list + + //add the block equivalent to the implicit part + nx=nx*2//should be read from generated C code + blklstr($+1)=scicos_model(sim=list(name,10002),.. + in=ones(Iin'),out=ones(Iout'),state=zeros(nx,1),.. + dep_ut=[%f %t],nzcross=ng) + nbr=size(blklstr) + cmatr=cmat;cmatr([I,Iin,Iout],:)=[]; + //renumber links connecting regular blocs + N=size(Iin,"*"); + if N>0 + ci=cmat(Iin,:);ci(:,4)=-nbr;ci(:,5)=(1:N)'; + cmatr=[cmatr;ci]; + end + N=size(Iout,"*") + if N>0 + co=cmat(Iout,:);co(:,1)=-nbr;co(:,2)=(1:N)'; + cmatr=[cmatr;co]; + end + for k=1:size(cmatr,1) + l=find(cmatr(k,1)==reg);if l<>[] then cmatr(k,1)=l;end + l=find(cmatr(k,4)==reg);if l<>[] then cmatr(k,4)=l;end + end + cmatr=abs(cmatr) + + //renumber ccmat + for k=1:size(ccmat,1) + l=find(ccmat(k,1)==reg);if l<>[] then ccmat(k,1)=l;end + l=find(ccmat(k,3)==reg);if l<>[] then ccmat(k,3)=l;end + end + //update corinv, we choose imp(1) to represent all implicits blocs! + corinv=list(corinv([reg,imp(1)])) + //update cor + + cor=update_cor(cor,reg) +endfunction + +function cor=update_cor(cor,reg) + n=size(cor) + for k=1:n + if type(cor(k))==15 then + cor(k)=update_cor(cor(k),reg) + else + p=find(cor(k)==reg) + if p<>[] then + cor(k)=p + elseif cor(k)<>0 then + cor(k)=size(reg,"*")+1 + end + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/findinlist.bin b/modules/scicos/macros/scicos_scicos/findinlist.bin new file mode 100755 index 000000000..95e35f043 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/findinlist.bin differ diff --git a/modules/scicos/macros/scicos_scicos/findinlist.sci b/modules/scicos/macros/scicos_scicos/findinlist.sci new file mode 100755 index 000000000..5b88da13c --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/findinlist.sci @@ -0,0 +1,38 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [path]=findinlist(L,v,path) + //recherche si un element de valeur v existe dans la liste L + global paths + if and(type(L)<>(15:17)) then error("First argument should be a list"),end + firstlevel=argn(2)<3 + if firstlevel then paths=list(),path=[];end + for k=1:size(L) + l=L(k) + if or(type(l)==(15:17)) then + findinlist(l,v,[path,k]) + elseif isequal(l,v) then + paths($+1)=[path k] + else + end + end + if firstlevel then path=paths,clearglobal paths,end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/findinlistcmd.bin b/modules/scicos/macros/scicos_scicos/findinlistcmd.bin new file mode 100755 index 000000000..b229b9391 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/findinlistcmd.bin differ diff --git a/modules/scicos/macros/scicos_scicos/findinlistcmd.sci b/modules/scicos/macros/scicos_scicos/findinlistcmd.sci new file mode 100755 index 000000000..07ebce7e6 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/findinlistcmd.sci @@ -0,0 +1,51 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [path]=findinlistcmd(L,v,oper,path) + //recherche si un element de valeur v existe dans la liste L + global paths + if and(type(L)<>(15:17)) then error("First argument should be a list"),end + firstlevel=argn(2)<4 + if firstlevel then paths=list(),path=[];end + for k=1:size(L) + l=L(k) + if or(type(l)==(15:17)) then + findinlistcmd(l,v,oper,[path,k]) + else + if oper=="=" then + if and(l(:)==v) then + paths($+1)=[path k] + end + elseif oper==">" then + if or(l(:) > v) then + paths($+1)=[path k] + end + elseif oper=="<" then + if or(l(:) < v) then + paths($+1)=[path k] + end + else + end + end + end + if firstlevel then path=paths,clearglobal paths,end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/gen_modelica.bin b/modules/scicos/macros/scicos_scicos/gen_modelica.bin new file mode 100755 index 000000000..9bfc327ea Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/gen_modelica.bin differ diff --git a/modules/scicos/macros/scicos_scicos/gen_modelica.sci b/modules/scicos/macros/scicos_scicos/gen_modelica.sci new file mode 100755 index 000000000..890207d82 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/gen_modelica.sci @@ -0,0 +1,114 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function txt=gen_modelica(scs_m,name) + txt=[];tab=ascii(9) + models=[] + eqns=[] + Pin=[] + Bnumbers=[] + Bnames=[] + + IN=[];OUT=[]; + scs_m; + for i=1:size(scs_m.objs) + if typeof(scs_m.objs(i))=="Block" then + if scs_m.objs(i).gui=="IN_f" then + scs_m.objs(i).gui="INPUTPORT"; + mo=modelica();mo.model="InPutPort";mo.outputs="vo";mo.inputs="vi"; + scs_m.objs(i).model.equations=mo; + IN=[IN scs_m.objs(i).model.ipar] + elseif scs_m.objs(i).gui=="OUT_f" then + scs_m.objs(i).gui="OUTPUTPORT"; + mo=modelica();mo.model="OutPutPort";mo.outputs="vo";mo.inputs= "vi"; + scs_m.objs(i).model.equations=mo + OUT=[OUT scs_m.objs(i).model.ipar] + end + end + end + + [blklst,cmat,ccmat,cor,corinv,ok]=pass1(scs_m); + if ~ok then return,end + + //blocks + for k=1:size(blklst) + o=blklst(k); + if and(getfield(1,o)<>"equations") + messagebox("block numbered "+string(k)+" is not a Modelica block","modal") + txt=[] + return + end + if typeof(o.equations)<>"modelica" then + messagebox("block numbered "+string(k)+" is not a Modelica block","modal") + txt=[] + return + end + mo=o.equations; + np=size(mo.parameters(1),1); + P=[]; + for l=1:np + pexp=sci2exp(mo.parameters(2)(l)) + + P=[P; + mo.parameters(1)(l)+"="+value2modelica(mo.parameters(2)(l))]; + end + Bnumbers=[Bnumbers k]; + Bnames=[Bnames,"B"+string(k)]; + if P==[] then + models=[models;" "+mo.model+" "+tab+"B"+string(k)+";"]; + else + models=[models;" "+mo.model+" "+tab+"B"+string(k)+"("+strcat(P,", ")+");"]; + end + end + //links + for k=1:size(cmat,1) + from=cmat(k,1:3) + to=cmat(k,4:6) + if from(3)==1 then + p1=blklst(from(1)).equations.inputs(from(2)) + else + p1=blklst(from(1)).equations.outputs(from(2)) + end + n1=Bnames(find(Bnumbers==from(1))) + if to(3)==1 then + p2=blklst(to(1)).equations.inputs(to(2)) + else + p2=blklst(to(1)).equations.outputs(to(2)) + end + n2=Bnames(find(Bnumbers==to(1))) + if or(blklst(from(1)).equations.model==["InPutPort","OutPutPort"]) ... + | or(blklst(to(1)).equations.model==["InPutPort","OutPutPort"]) ... + then + eqns=[eqns + " "+n1+"."+p1+" = "+n2+"."+p2+";"] + else + eqns=[eqns + " connect ("+n1+"."+p1+","+n2+"."+p2+");"] + end + end + txt=[txt; + "class "+name + models + "equation" + eqns + "end "+name+";"] +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/genfunc.bin b/modules/scicos/macros/scicos_scicos/genfunc.bin new file mode 100755 index 000000000..1b883fdec Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/genfunc.bin differ diff --git a/modules/scicos/macros/scicos_scicos/genfunc.sci b/modules/scicos/macros/scicos_scicos/genfunc.sci new file mode 100755 index 000000000..64684f4c2 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/genfunc.sci @@ -0,0 +1,58 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [ok,mac,txt]=genfunc(txt) + [lhs,rhs]=argn(0) + if rhs<1 then txt=" ",end + mac=[] + while %t do + txt=dialog(["Set Function Block"; + " " + "Enter Scilab instructions defining" + "y as a function of u"],txt) + + + if txt==[] then ok=%f,return,end + // check if txt defines y from u + deff("[]=mac()",txt) + vars=macrovar(mac) + if or(vars(3)=="u")&or(vars(5)=="y") then break,end + end + ok=%t + deff("[%_1,%_2]=mac(%_model,%_x,%_z,u,%_clock,%_flag,%_rpar,%_ipar)",.. + ["%_1=[];%_2=[];"; + "select %_flag"; + "case 1 then"; + txt + "%_1=y"; + "case -1 then "; + " %_model=list(%_model(1),1,1,[],[],[],[],[],[],''c'',%f,[%t %f])"; + " %_1=list(%_model,'' '')"; + "case -2 then "; + " txt=%_model.ipar"; + " [ok,mac,txt]=genfunc(txt)"; + " if ok then " + " %_model.sim=mac" + " %_model.ipar=txt" + " %_1=list(model,%_x)" + " end" + "end"]) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/genfunc1.bin b/modules/scicos/macros/scicos_scicos/genfunc1.bin new file mode 100755 index 000000000..ed096beac Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/genfunc1.bin differ diff --git a/modules/scicos/macros/scicos_scicos/genfunc1.sci b/modules/scicos/macros/scicos_scicos/genfunc1.sci new file mode 100755 index 000000000..1b888b384 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/genfunc1.sci @@ -0,0 +1,260 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [ok,tt,dep_ut]=genfunc1(tt,inp,out,nci,nco,nx,nz,nrp,type_) + // manages dialog to get definition (with scilab instruction) of a new scicos + // block + //! + ni=size(inp,"*") + no=size(out,"*") + + mac=[];ok=%f,dep_ut=[] + if size(tt)<>7 then + [txt1,txt0,txt2,txt3,txt4,txt5,txt6]=(" "," "," "," "," "," "," ") + else + [txt1,txt0,txt2,txt3,txt4,txt5,txt6]=tt(1:7) + end + dep_u=%f;dep_t=%f + depp="t";deqq="t"; + + u=emptystr(), + for k=1:ni,u=u+"u"+string(k)+",",end + dep=["t,","x,","z,",u,"n_evi,","rpar"] + + + + if nx==0 then dep(2)=emptystr(),end + if nz==0 then dep(3)=emptystr(),end + //if nci==0 then dep(5)=emptystr(),end + if nrp==0 then dep(6)=emptystr(),end + + + //flag = 1 + if no>0 then + depp=strcat(dep([1:5,6])) + w=[] + for k=1:no,w=[w;"y"+string(k)+" (size: "+string(out(k))+")"],end + while %t do + txt1=dialog(["Define function which computes the output"; + " " + "Enter Scilab instructions defining"; + w; + "as a functions of "+depp],txt1) + if txt1==[] then return,end + // check if txt defines y from u + mac=null();deff("[]=mac()",txt1,"n") + ok1=check_mac(mac) + if ok1 then + vars=macrovar(mac) + for k=1:ni + if or(vars(3)=="u"+string(k)) then dep_u=%t,end + end + if or(vars(3)=="t") then dep_t=%t,end + w=[];w(no)=%f; + for k=1:no,if or(vars(5)=="y"+string(k)) then w(k)=%t,end,end + if ~and(w) then + k1=find(~w) + w=[];for k=1:size(k1,"*"),w=[w;"y"+string(k)+" (size: "+string(out(k))+")"],end + messagebox("You did not define "+strcat(w,",")+" !","modal") + else + break + end + end + end + else + txt1=[] + end + + //flag = 2 + if nx>0 then + // xdot + depp=strcat(dep([1:4,6])) + while %t do + if txt0==[] then txt0=" ",end + txt0=dialog(["Define continuous states evolution"; + " " + "Enter Scilab instructions defining:"; + "derivative of continuous state xd (size:"+string(nx)+")" + "as function(s) of "+depp],txt0) + + if txt0==[] then return,end + mac=null();deff("[]=mac()",txt0,"n") + ok1=check_mac(mac) + if ok1 then + vars=macrovar(mac) + if or(vars(5)=="xd") then + break, + else + messagebox("You did not define xd !","modal") + end + end + end + else + txt0="xd=[]" + end + if (nci>0&(nx>0|nz>0))|nz>0 then // x+ z+ + depp=strcat(dep([1:5,6])) + while %t do + if txt2==[] then txt2=" ",end + t1=[] + if nx>0 then + t1=[t1;"-new continuous state x (size:"+string(nx)+")"] + end + if nz>0 then + t1=[t1;"-new discrete state z (size:"+string(nz)+")"] + end + + txt2=dialog(["You may define:"; + t1 + "at event time, as functions of "+depp],txt2) + if txt2==[] then return,end + mac=null();deff("[]=mac()",txt2,"n") + ok1=check_mac(mac) + if ok1 then + vars=macrovar(mac) + if ~or(vars(5)=="x") then txt3=[txt3;"x=[]"];end + if ~or(vars(5)=="z") then txt3=[txt3;"z=[]"];end + break; + end + end + else + txt2=" " + end // end of x+ z+ + + //flag = 3 + if nci>0&nco>0 then + depp=strcat(dep) + + while %t do + if txt3==[] then txt3=" ",end + txt3=dialog(["Using "+depp+",you may set " + "vector of output time events t_evo (size:"+string(nco)+")" + "at event time. "],txt3) + if txt3==[] then return,end + mac=null();deff("[]=mac()",txt3,"n") + // alan.layec + ok1=check_mac(mac) + if ok1 then + vars=macrovar(mac) + if ~or(vars(5)=="t_evo") then txt3=[txt3;"t_evo=[]"];end + break; + end + end + else + txt3=" " + end + + //flag = 4 + depp=strcat(dep([2 3 6])) + t1=[] + if nx>0 then + t1=[t1;"- continuous state x (size:"+string(nx)+")"] + end + if nz>0 then + t1=[t1;"- discrete state z (size:"+string(nz)+")"] + end + if t1<>[] then + t1=["You may also reinitialize:"; + t1] + end + while %t do + if txt4==[] then txt4=" ",end + txt4=dialog(["You may do whatever needed for initialization :" + "File or graphic opening...," + t1 + "as function(s) of "+depp],txt4) + if txt4==[] then return,end + mac=null();deff("[]=mac()",txt4,"n") + ok1=check_mac(mac) + if ok1 then break,end + end + + //flag = 5 + depp=strcat(dep([2 3 6])) + t1=[] + if nx>0 then + t1=[t1;"- continuous state x (size:"+string(nx)+")"] + end + if nz>0 then + t1=[t1;"- discrete state z (size:"+string(nz)+")"] + end + if t1<>[] then + t1=["You may also change final value of:";t1] + end + while %t do + if txt5==[] then txt5=" ",end + txt5=dialog(["You may do whatever needed to finish :" + "File or graphic closing...," + t1 + "as function(s) of "+depp],txt5) + if txt5==[] then return,end + mac=null();deff("[]=mac()",txt5,"n") + ok1=check_mac(mac) + if ok1 then break,end + end + + //flag = 6 + if nx>0|nz>0|no>0 then + t1=[] + if nx>0 then + t1=[t1;"- state x (size:"+string(nx)+")"] + end + if nz>0 then + t1=[t1;"- state z (size:"+string(nz)+")"] + end + w=[] + for k=1:no + w=[w;"- output y"+string(k)+" (size : "+string(out(k))+")"] + end + t1=[t1;w] + + depp=strcat(dep([2:4,6])) + + while %t do + txt6=dialog(["You may define here functions imposing contraints"; + "on initial inputs, states and outputs"; + "Note: these functions may be called more than once"; + " "; + "Enter Scilab instructions defining:" + t1; + "as a function of "+depp],txt6) + if txt6==[] then return,end + + mac=null();deff("[]=mac()",txt6,"n") + ok1=check_mac(mac) + if ok1 then + vars=macrovar(mac) + for k=1:no + if and(vars(5)<>"y"+string(k)) then txt6=[txt6;"y"+string(k)+"=[]"],end + end + break, + end + end + else + txt6=[] + end + + ok=%t + tt=list(txt1,txt0,txt2,txt3,txt4,txt5,txt6) + + + dep_ut=[dep_u dep_t] +endfunction diff --git a/modules/scicos/macros/scicos_scicos/genfunc2.bin b/modules/scicos/macros/scicos_scicos/genfunc2.bin new file mode 100755 index 000000000..96821677a Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/genfunc2.bin differ diff --git a/modules/scicos/macros/scicos_scicos/genfunc2.sci b/modules/scicos/macros/scicos_scicos/genfunc2.sci new file mode 100755 index 000000000..9bd66fd02 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/genfunc2.sci @@ -0,0 +1,260 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [ok,tt,dep_ut]=genfunc2(tt,inp,out,nci,nco,nx,nz,nrp,type_) + // manages dialog to get definition (with scilab instruction) of a new scicos + // block + //! + ni=size(inp,1) + no=size(out,1) + + mac=[];ok=%f,dep_ut=[] + if size(tt)<>7 then + [txt1,txt0,txt2,txt3,txt4,txt5,txt6]=(" "," "," "," "," "," "," ") + else + [txt1,txt0,txt2,txt3,txt4,txt5,txt6]=tt(1:7) + end + dep_u=%f;dep_t=%f + depp="t";deqq="t"; + + u=emptystr(), + for k=1:ni,u=u+"u"+string(k)+",",end + dep=["t,","x,","z,",u,"n_evi,","rpar"] + + + + if nx==0 then dep(2)=emptystr(),end + if nz==0 then dep(3)=emptystr(),end + //if nci==0 then dep(5)=emptystr(),end + if nrp==0 then dep(6)=emptystr(),end + + + //flag = 1 + if no>0 then + depp=strcat(dep([1:5,6])) + w=[] + for k=1:no,w=[w;"y"+string(k)+" (size: "+string(out(k))+")"],end + while %t do + txt1=dialog(["Define function which computes the output"; + " " + "Enter Scilab instructions defining"; + w; + "as a functions of "+depp],txt1) + if txt1==[] then return,end + // check if txt defines y from u + mac=null();deff("[]=mac()",txt1,"n") + ok1=check_mac(mac) + if ok1 then + vars=macrovar(mac) + for k=1:ni + if or(vars(3)=="u"+string(k)) then dep_u=%t,end + end + if or(vars(3)=="t") then dep_t=%t,end + w=[];w(no)=%f; + for k=1:no,if or(vars(5)=="y"+string(k)) then w(k)=%t,end,end + if ~and(w) then + k1=find(~w) + w=[];for k=1:size(k1,"*"),w=[w;"y"+string(k)+" (size: "+string(out(k))+")"],end + messagebox("You did not define "+strcat(w,",")+" !","modal") + else + break + end + end + end + else + txt1=" " + end + + //flag = 2 + if nx>0 then + // xdot + depp=strcat(dep([1:4,6])) + while %t do + if txt0==[] then txt0=" ",end + txt0=dialog(["Define continuous states evolution"; + " " + "Enter Scilab instructions defining:"; + "derivative of continuous state xd (size:"+string(nx)+")" + "as function(s) of "+depp],txt0) + + if txt0==[] then return,end + mac=null();deff("[]=mac()",txt0,"n") + ok1=check_mac(mac) + if ok1 then + vars=macrovar(mac) + if or(vars(5)=="xd") then + break, + else + messagebox("You did not define xd !","modal") + end + end + end + else + txt0="xd=[]" + end + if (nci>0&(nx>0|nz>0))|nz>0 then // x+ z+ + depp=strcat(dep([1:5,6])) + while %t do + if txt2==[] then txt2=" ",end + t1=[] + if nx>0 then + t1=[t1;"-new continuous state x (size:"+string(nx)+")"] + end + if nz>0 then + t1=[t1;"-new discrete state z (size:"+string(nz)+")"] + end + + txt2=dialog(["You may define:"; + t1 + "at event time, as functions of "+depp],txt2) + if txt2==[] then return,end + mac=null();deff("[]=mac()",txt2,"n") + ok1=check_mac(mac) + if ok1 then + vars=macrovar(mac) + if ~or(vars(5)=="x") then txt3=[txt3;"x=[]"];end + if ~or(vars(5)=="z") then txt3=[txt3;"z=[]"];end + break; + end + end + else + txt2=" " + end // end of x+ z+ + + //flag = 3 + if nci>0&nco>0 then + depp=strcat(dep) + + while %t do + if txt3==[] then txt3=" ",end + txt3=dialog(["Using "+depp+",you may set " + "vector of output time events t_evo (size:"+string(nco)+")" + "at event time. "],txt3) + if txt3==[] then return,end + mac=null();deff("[]=mac()",txt3,"n") + ok1=check_mac(mac) + if ok1 then + vars=macrovar(mac) + if ~or(vars(5)=="t_evo") then txt3=[txt3;"t_evo=[]"];end + break; + end + end + else + txt3=" " + end + + //flag = 4 + depp=strcat(dep([2 3 6])) + t1=[] + if nx>0 then + t1=[t1;"- continuous state x (size:"+string(nx)+")"] + end + if nz>0 then + t1=[t1;"- discrete state z (size:"+string(nz)+")"] + end + if t1<>[] then + t1=["You may also reinitialize:"; + t1] + end + while %t do + if txt4==[] then txt4=" ",end + txt4=dialog(["You may do whatever needed for initialization :" + "File or graphic opening...," + t1 + "as function(s) of "+depp],txt4) + if txt4==[] then return,end + mac=null();deff("[]=mac()",txt4,"n") + ok1=check_mac(mac) + if ok1 then break,end + end + + //flag = 5 + depp=strcat(dep([2 3 6])) + t1=[] + if nx>0 then + t1=[t1;"- continuous state x (size:"+string(nx)+")"] + end + if nz>0 then + t1=[t1;"- discrete state z (size:"+string(nz)+")"] + end + if t1<>[] then + t1=["You may also change final value of:";t1] + end + while %t do + if txt5==[] then txt5=" ",end + txt5=dialog(["You may do whatever needed to finish :" + "File or graphic closing...," + t1 + "as function(s) of "+depp],txt5) + if txt5==[] then return,end + mac=null();deff("[]=mac()",txt5,"n") + ok1=check_mac(mac) + if ok1 then break,end + end + + //flag = 6 + if nx>0|nz>0|no>0 then + t1=[] + if nx>0 then + t1=[t1;"- state x (size:"+string(nx)+")"] + end + if nz>0 then + t1=[t1;"- state z (size:"+string(nz)+")"] + end + w=[] + for k=1:no + w=[w;"- output y"+string(k)+" (size : "+string(out(k))+")"] + end + t1=[t1;w] + + depp=strcat(dep([2:4,6])) + + while %t do + if txt6==[] then txt6=" ",end + txt6=dialog(["You may define here functions imposing contraints"; + "on initial inputs, states and outputs"; + "Note: these functions may be called more than once"; + " "; + "Enter Scilab instructions defining:" + t1; + "as a function of "+depp],txt6) + if txt6==[] then return,end + + mac=null();deff("[]=mac()",txt6,"n") + ok1=check_mac(mac) + if ok1 then + vars=macrovar(mac) + for k=1:no + if and(vars(5)<>"y"+string(k)) then txt6=[txt6;"y"+string(k)+"=[]"],end + end + break, + end + end + else + txt6=" " + end + + ok=%t + tt=list(txt1,txt0,txt2,txt3,txt4,txt5,txt6) + + + dep_ut=[dep_u dep_t] +endfunction diff --git a/modules/scicos/macros/scicos_scicos/genmac.bin b/modules/scicos/macros/scicos_scicos/genmac.bin new file mode 100755 index 000000000..f6a82d29c Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/genmac.bin differ diff --git a/modules/scicos/macros/scicos_scicos/genmac.sci b/modules/scicos/macros/scicos_scicos/genmac.sci new file mode 100755 index 000000000..d838c2a0a --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/genmac.sci @@ -0,0 +1,90 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function mac=genmac(tt,nin,nout) + [txt1,txt0,txt2,txt3,txt4,txt5,txt6]=tt(1:7) + mac=null() + // [y, x, z, tvec,xd]=func(flag,nevprt,t,x,z,rpar,ipar,u) + blank=" " + // if txt2_1<>' ' then + // txt2=[txt2; + // 'if n_evi<>0 then' + // blank(ones(txt2_1))+txt2_1 + // 'end'] + //end + semi=";" + + + txt1=blank(ones(txt1))+txt1+semi(ones(txt1)) + txt2=blank(ones(txt2))+txt2+semi(ones(txt2)) + txt3=blank(ones(txt3))+txt3+semi(ones(txt3)) + txt4=blank(ones(txt4))+txt4+semi(ones(txt4)) + txt5=blank(ones(txt5))+txt5+semi(ones(txt5)) + txt6=blank(ones(txt6))+txt6+semi(ones(txt6)) + + u="u" + if nin>0 then + get_u=blank+"["+strcat(u(ones(1,nin))+string(1:nin),",")+"]=u(:)" + else + get_u=[] + end + y="y" + set_y=blank+"y=list("+strcat(y(ones(1,nout))+string(1:nout),",")+")" + mac_txt=[ + get_u + "select %_flag"; + "case 0 then"; + txt0 + " t_evo=[]"; + " y=list()"; + "case 1 then"; + txt1 + " t_evo=[]"; + " xd=[]"; + set_y; + "case 2 then"; + txt2 + " y=list()"; + " t_evo=[]"; + " xd=[]"; + "case 3 then"; + txt3 + " xd=[]"; + " y=list()"; + "case 4 then"; + txt4 + " y=list()"; + " t_evo=[]"; + " xd=[]"; + "case 5 then"; + txt5 + " y=list()"; + " t_evo=[]"; + " xd=[]"; + "case 6 then"; + txt6 + " t_evo=[]"; + " xd=[]"; + set_y + "end";] + + deff("[y,x,z,t_evo,xd]=mac(%_flag,n_evi,t,x,z,rpar,ipar,u)",mac_txt) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/get2index.bin b/modules/scicos/macros/scicos_scicos/get2index.bin new file mode 100755 index 000000000..b39fc3a1e Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/get2index.bin differ diff --git a/modules/scicos/macros/scicos_scicos/get2index.sci b/modules/scicos/macros/scicos_scicos/get2index.sci new file mode 100755 index 000000000..fdaf4478b --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/get2index.sci @@ -0,0 +1,81 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [scs_m_i, cpr_i, sflag] = get2index(object, k) + // + //** scs_m_i : Object numeber (index) in the diagram (scs_m) + //** + //** cpr_i : Compiled structure index + //** + //** the code is derived from + //** + //** "Info" -> GetInfo -> do_block_info -> get_block_info -> standard_document + // + // + //pause + + sflag=[] + object_type = typeof(object) + // + if object_type=="Block" then + + scs_m_i = k ; + //disp('ici');pause + if %cpr<>list()&needcompile<>4&k<>-1 then + cor = %cpr.cor + corinv = %cpr.corinv + path = list() + for kp=1:size(super_path,"*") + path(kp) = super_path(kp) + end + path($+1) = k + ind = cor(path) + + //** if ind>0 & ind<=size(corinv) then + cpr_i = cor(path) ; //** the good one + //disp('ici');pause + if type(cpr_i)==15 then + tmp_cpr=[]; + sflag="*" + ssflag="" + for i=1:size(cpr_i) + if type(cpr_i(i))<>15 then + if cpr_i(i)<>0&cpr_i(i)<=size(corinv) then + tmp_cpr=[tmp_cpr,cpr_i(i)] + end + else //another sblock + ssflag=" *" + end + end + cpr_i="["+strcat(string(tmp_cpr)," ")+ssflag+"]"; + end + //** else + //** cpr_i= -7; //** ['Compiled structure Index : suppressed'; ' '] + //**end + else + cpr_i= -9; //** ['Compiled structure Index : Not available';' '] + end + else + scs_m_i = [] ; + cpr_i = [] ; + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/get_connected.bin b/modules/scicos/macros/scicos_scicos/get_connected.bin new file mode 100755 index 000000000..7ae848231 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/get_connected.bin differ diff --git a/modules/scicos/macros/scicos_scicos/get_connected.sci b/modules/scicos/macros/scicos_scicos/get_connected.sci new file mode 100755 index 000000000..f32b939f2 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/get_connected.sci @@ -0,0 +1,65 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function connected=get_connected(scs_m,k,typ) + //return the vector of number of link connected to a given block + // scs_m : structure of blocks and links + // k : block_number + // typ : 'in','out','clkin','clkout' + // connected : vector of connected link numbers + [lhs,rhs]=argn(0) + + connected=[] + + //disp('get_connected') + // pause + if rhs<=2 then // all connected links + graphics=scs_m.objs(k).graphics + + ip=graphics.pin + connected=[connected ip(find(ip>0))'] + + op=graphics.pout + connected=[connected op(find(op>0))'] + + cip=graphics.pein + connected=[connected cip(find(cip>0))'] + + cop=graphics.peout + connected=[connected cop(find(cop>0))'] + else + + if typ=="in" then + ip=scs_m.objs(k).graphics.pin + connected=[connected ip(find(ip>0))'], + elseif typ=="out" then + op=scs_m.objs(k).graphics.pout + connected=[connected op(find(op>0))'], + elseif typ=="clkin" then + cip=scs_m.objs(k).graphics.pein + connected=[connected cip(find(cip>0))'], + elseif typ=="clkout" then + cop=scs_m.objs(k).graphics.peout + connected=[connected cop(find(cop>0))'], + end + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.bin b/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.bin new file mode 100755 index 000000000..74313ffcf Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.bin differ diff --git a/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.sci b/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.sci new file mode 100755 index 000000000..bb16abc43 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/get_dynamic_lib_dir.sci @@ -0,0 +1,51 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function [libss,ok,cancel]=get_dynamic_lib_dir(tt,funam,flag) + // Copyright INRIA + cancel=%f + cur_wd = pwd(); + chdir(TMPDIR); + mputl(tt,funam+"."+flag); + libss=""; + label=""; + ok=%f + while ~ok then + [ok,libss,label]=scicos_getvalue("Linking the "+funam+" function","External libraries (if any)",list("str",1),label); + if ~ok then chdir(cur_wd);cancel=%t,return;end + // for multiple libraries + if strindex(libss,"''")<>[] | strindex(libss,"""")<>[] then + ierr=execstr("libss=evstr(libss)","errcatch") + if ierr<>0 then + messagebox(["Can''t solve other files to link"],"modal") + chdir(cur_wd); + ok=%f; + end + else + libss=tokens(libss,[" ",";"]) + end + for i=1:size(libss,"*") + lib_dll=libss(i) + getdynlibext(); + ifexst=fileinfo(lib_dll) + if ifexst==[] then messagebox ("the library "+lib_dll+" doesn''t exists","modal");ok=%f;end + end + end + chdir(cur_wd); +endfunction diff --git a/modules/scicos/macros/scicos_scicos/get_errorcmd.bin b/modules/scicos/macros/scicos_scicos/get_errorcmd.bin new file mode 100755 index 000000000..312248578 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/get_errorcmd.bin differ diff --git a/modules/scicos/macros/scicos_scicos/get_errorcmd.sci b/modules/scicos/macros/scicos_scicos/get_errorcmd.sci new file mode 100755 index 000000000..452935b57 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/get_errorcmd.sci @@ -0,0 +1,108 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Alan Layec +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function cmd=get_errorcmd(path,scs_m_in,title_err,mess_err) + //** get_errorcmd : return a Scicos_commands strings + //** to select/hilite and display error messages for block + //** defined by his main scs_m path. + //** If the block is included in a super block, the editor + //** will open the correspondig windows by the use of the + //** scicos global variable %diagram_path_objective and + //** %scicos_navig. + //** + //** exemple of use : + //** path=corinv(kfun); + //** global Scicos_commands; + //** Scicos_commands=get_errorcmd(path,'my Title error','error message'); + //** + //** inputs : path : the path of the object which have + //** generated an error in a scs_m + //** + //** scs_m_in : a scicos diagram data structure + //** (if any. if not scs_m is semi global) + //** + //** title_err : the title of the error box message + //** (if any) + //** + //** mess_err : the message of the error box message + //** (if any) + //** + //** nb : the string message will be formated as this : + //** str_err=[title; + //** specific message for type of block; + //** mess_err] + //** + //** output : cmd : the Scicos_commands strings + //** + //** Alan, 11/10/07 : Initial rev + //Copyright INRIA + + //** first generate an empty cmd + cmd=[] + + //** generte empty spec_err + spec_err=[] + + //** check number of rhs arg + rhs = argn(2) ; + if (rhs == 1) then + title_err=[] + mess_err=[] + elseif (rhs == 2) then + if typeof(scs_m_in)=="diagram" then + scs_m=scs_m_in + mess_err=[] + elseif typeof(scs_m_in)=="string" then + title_err=scs_m_in + mess_err=[] + end + elseif (rhs == 3) then + if typeof(scs_m_in)=="diagram" then + scs_m=scs_m_in + elseif typeof(scs_m_in)=="string" then + mess_err=title_err + title_err=scs_m_in + end + end + + //** ************** + //** modelica block + //** ************** + if type(path)==15 then + + spec_err="The modelica block returns the error :"; + //** create cmd + cmd=["messagebox([''"+title_err+"'';"+... + "''"+spec_err+"'';"+... + strcat("''"+mess_err+"''",";")+"],''modal'');"] + + //** ************************ + //** all other type of blocks + //** ************************ + else + msg = "" + title_err + ":
      "; + msg = msg + strcat(mess_err, "
      "); + msg = msg + ""; + hilite_path(path, msg); + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/get_model_name.bin b/modules/scicos/macros/scicos_scicos/get_model_name.bin new file mode 100755 index 000000000..0e7bca72e Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/get_model_name.bin differ diff --git a/modules/scicos/macros/scicos_scicos/get_model_name.sci b/modules/scicos/macros/scicos_scicos/get_model_name.sci new file mode 100755 index 000000000..0a98ce7ae --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/get_model_name.sci @@ -0,0 +1,45 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function model_name=get_model_name(mo_model,Bnames) + //Copyright INRIA + //## return an unique name for a modelica model + //## for the compiled modelica structure + //## + //## inputs : + //## mo_model : a string that gives the name of the model + //## in the modelica list (equations) of a modelica block. + //## + //## Bnames : vector of strings of already attribuate models name + //## + //## output : + //## model_name : the output string of the model name + //## + + ind = 1; + model_name = strsubst(mo_model," ","") + string(ind); + + while find(model_name==Bnames) <> [] then + ind = ind + 1; + model_name=strsubst(mo_model," ","") + string(ind); + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/get_subobj_path.bin b/modules/scicos/macros/scicos_scicos/get_subobj_path.bin new file mode 100755 index 000000000..1eed497ce Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/get_subobj_path.bin differ diff --git a/modules/scicos/macros/scicos_scicos/get_subobj_path.sci b/modules/scicos/macros/scicos_scicos/get_subobj_path.sci new file mode 100755 index 000000000..6c252422f --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/get_subobj_path.sci @@ -0,0 +1,36 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function full_path=get_subobj_path(path) + // path : vector of integer gives the path of the required block from + // top level (main diagram) to bottom level (required block). + // Each vector entry is a block index in the current level structure. + // full_path : is the path relative to scs_m of the required block + // scs_m.objs(full_path) is the data structure of the required block + + full_path=list("objs",path(1)); + for l=path(2:$), + full_path($+1)="model"; + full_path($+1)="rpar"; + full_path($+1)="objs"; + full_path($+1)=l; + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/get_tree_elt.bin b/modules/scicos/macros/scicos_scicos/get_tree_elt.bin new file mode 100755 index 000000000..51ad3a14f Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/get_tree_elt.bin differ diff --git a/modules/scicos/macros/scicos_scicos/get_tree_elt.sci b/modules/scicos/macros/scicos_scicos/get_tree_elt.sci new file mode 100755 index 000000000..6e08308db --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/get_tree_elt.sci @@ -0,0 +1,34 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function value=get_tree_elt(tree,path) + // tree : a recursive list + // path : a vector of index giving top to bottom path + // value : new value for the pointed tree element + + n=prod(size(path)) + + + for k=1:n + tree=tree(path(k)) + end + value=tree +endfunction diff --git a/modules/scicos/macros/scicos_scicos/getmodelicacpath.bin b/modules/scicos/macros/scicos_scicos/getmodelicacpath.bin new file mode 100755 index 000000000..65016a20b Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/getmodelicacpath.bin differ diff --git a/modules/scicos/macros/scicos_scicos/getmodelicacpath.sci b/modules/scicos/macros/scicos_scicos/getmodelicacpath.sci new file mode 100755 index 000000000..fbaed02f3 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/getmodelicacpath.sci @@ -0,0 +1,67 @@ +// +// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab +// Copyright (C) 2009 - DIGITEO - Vincent COUVERT +// +// This file must be used under the terms of the CeCILL. +// This source file is licensed as described in the file COPYING, which +// you should have received as part of this distribution. The terms +// are also available at +// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt +// +// +function compilerpath = getmodelicacpath() + + MODELICAC_FILENAME = "modelicac"; + + compilerpath = ""; + + if getos() == "Windows" then + // --- WINDOWS --- + MODELICAC_FILENAME = MODELICAC_FILENAME + ".exe"; + defaultPath = SCI + "/bin/"; + + if isfile(defaultPath + MODELICAC_FILENAME) then + compilerpath = defaultPath; + else + compilerpath = ""; + end + + else + // --- LINUX/MACOS --- + + // Check if source tree version + if isdir(SCI+"/modules/core/includes/") then + defaultPath = SCI + "/modules/scicos/"; + + if isfile(defaultPath + MODELICAC_FILENAME) then + compilerpath = defaultPath; + else + compilerpath = ""; + end + end + + // Check if binary version + if compilerpath=="" & isdir(SCI+"/../../include/scilab/") then + defaultPath = SCI + "/../../bin/"; + + if isfile(defaultPath + MODELICAC_FILENAME) then + compilerpath = defaultPath; + else + compilerpath = ""; + end + end + + // Check if system version + if compilerpath=="" & isdir("/usr/include/scilab/") then + defaultPath = "/usr/bin/"; + + if isfile(defaultPath + MODELICAC_FILENAME) then + compilerpath = defaultPath; + else + compilerpath = ""; + end + end + + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/global_case.bin b/modules/scicos/macros/scicos_scicos/global_case.bin new file mode 100755 index 000000000..ddc40eddf Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/global_case.bin differ diff --git a/modules/scicos/macros/scicos_scicos/global_case.sci b/modules/scicos/macros/scicos_scicos/global_case.sci new file mode 100755 index 000000000..55214c2e3 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/global_case.sci @@ -0,0 +1,48 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [links_table,sco_mat,ok]=global_case(links_table,sco_mat) + [s,k]=gsort(sco_mat(:,2)) + sco_mat=sco_mat(k,:); + index=find((sco_mat(:,2)=="1")&(sco_mat(:,4)=="3")) + if index<> [] then + for i=1:size(index,"*") + indexx=find((sco_mat(index(:),3)==sco_mat(index(i),3))&(sco_mat(index(:),5)==sco_mat(index(i),5))) + if size(indexx,"*")>1 then + messagebox(["Error In Compilation";"You cannot have multiple global GOTO with the same tag"],"modal") + ok=%f + return + end + end + for i=index + index1=find((sco_mat(:,2)=="-1")&(sco_mat(:,3)==sco_mat(i,3))&(sco_mat(:,5)==sco_mat(i,5))) + if index1<>[] then + for j=index1 + index2=find(links_table(:,1)==-evstr(sco_mat(j,1))) + if index2<>[] then + links_table(index2',1)=-evstr(sco_mat(i,1)) + end + end + sco_mat(index1,:)=[] + end + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/haltscicos.bin b/modules/scicos/macros/scicos_scicos/haltscicos.bin new file mode 100755 index 000000000..30aac9d44 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/haltscicos.bin differ diff --git a/modules/scicos/macros/scicos_scicos/haltscicos.sci b/modules/scicos/macros/scicos_scicos/haltscicos.sci new file mode 100755 index 000000000..b4c082af7 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/haltscicos.sci @@ -0,0 +1,27 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function haltscicos(menus, win_id) + //** This is just a *CLEVER* function used for the "halt" button that + //** stop the Scicos simulation + sleep(1); //** DO NOT REMOVE IT + sci_haltscicos(); +endfunction diff --git a/modules/scicos/macros/scicos_scicos/hilite_path.bin b/modules/scicos/macros/scicos_scicos/hilite_path.bin new file mode 100755 index 000000000..784538047 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/hilite_path.bin differ diff --git a/modules/scicos/macros/scicos_scicos/hilite_path.sci b/modules/scicos/macros/scicos_scicos/hilite_path.sci new file mode 100755 index 000000000..ab1320f15 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/hilite_path.sci @@ -0,0 +1,68 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function hilite_path(path,mess,with_intermediates) + //hilite a block included in a superblock hierarchy and displays a + //message. If required all the intermediate superblocs are displayed + //first entry of the path must be a bloc of currently opened diagram + + if argn(2)<2 then mess=" ",end + + // retrieve the root diagram + if isdef("scs_m_s") then + diagram = scs_m_s; + elseif isdef("scs_m") then + diagram = scs_m; + else + error("scs_m variable does not exist"); + end + + uid = []; // empty uid path + + // construct the uid path from the index path + for i = 1:length(path) + index = path(i); + if typeof(diagram.objs(index)) == "Block" then + o = diagram.objs(index); + + // masked superblock case + if isempty(o.doc) then + // we abort because blocks do not have uuid inside + // masked superblocks + break; + end + + // normal case + uid($+1) = diagram.objs(index).doc(1) + ""; + + if diagram.objs(index).model.sim == "super" then + diagram = diagram.objs(index).model.rpar; + else + break; + end + end + end + + if uid <> [] then + warnBlockByUID(uid, strcat(mess, " ")); + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/init_agenda.bin b/modules/scicos/macros/scicos_scicos/init_agenda.bin new file mode 100755 index 000000000..572faf795 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/init_agenda.bin differ diff --git a/modules/scicos/macros/scicos_scicos/init_agenda.sci b/modules/scicos/macros/scicos_scicos/init_agenda.sci new file mode 100755 index 000000000..f1f8f44f0 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/init_agenda.sci @@ -0,0 +1,53 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [tevts,evtspt,pointi]=init_agenda(initexe,clkptr) + + // order initial firing events in chronological order. + nblk=size(clkptr,1)-1 + timevec=initexe(:,3) + if timevec<>[] then + [timevec,indtime]=gsort(-timevec) + initexe=initexe(indtime,:) + else + initexe=[] + end + timevec=[] + //initialize agenda + ninit=size(initexe,1) + pointi=0 + nevts=clkptr(nblk+1)-1 //time events agenda size + tevts=0*ones(nevts,1) + if initexe<>[] then + tevts(clkptr(initexe(:,1))+initexe(:,2)-1)=initexe(:,3) + end + evtspt=-ones(nevts,1) + + if ninit>0 then + pointi=clkptr(initexe(1,1))+initexe(1,2)-1; + evtspt(pointi)=0 + end + if ninit>1 then + evtspt(clkptr(initexe(1:ninit-1,1))+initexe(1:ninit-1,2)-1)=.. + clkptr(initexe(2:ninit,1))+initexe(2:ninit,2)-1; + evtspt(clkptr(initexe(ninit,1))+initexe(ninit,2)-1)=0; + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/is_modelica_block.bin b/modules/scicos/macros/scicos_scicos/is_modelica_block.bin new file mode 100755 index 000000000..33982d45c Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/is_modelica_block.bin differ diff --git a/modules/scicos/macros/scicos_scicos/is_modelica_block.sci b/modules/scicos/macros/scicos_scicos/is_modelica_block.sci new file mode 100755 index 000000000..e221e49bd --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/is_modelica_block.sci @@ -0,0 +1,29 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function r=is_modelica_block(o) + //checks if the block o is a modelica block + if or(getfield(1,o.model)=="equations") then + r=o.model.equations<>list() + else + r=%f + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/lib b/modules/scicos/macros/scicos_scicos/lib new file mode 100755 index 000000000..2cad4137f Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/lib differ diff --git a/modules/scicos/macros/scicos_scicos/link_olibs.bin b/modules/scicos/macros/scicos_scicos/link_olibs.bin new file mode 100755 index 000000000..431b7e1f4 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/link_olibs.bin differ diff --git a/modules/scicos/macros/scicos_scicos/link_olibs.sci b/modules/scicos/macros/scicos_scicos/link_olibs.sci new file mode 100755 index 000000000..e158a9874 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/link_olibs.sci @@ -0,0 +1,104 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Alan Layec - 2007 +// - Allan CORNET - 2008 +// - Rachid Djenidi +// - Simone Mannori +// +// Copyright (C) DIGITEO - Allan CORNET - 2010 +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +//** +//------------------------------------------------------------------------ +//** link_olibs : links otherlibs in scilab +// for scicos C generated block +// +// Input : libs : a matrix of string containing path + name +// of the libraries +// +// rpat : a target directory for temporary generated files +// +// Output : ok : a boolean variable to say if job has succed +// libs : a matrix of string containing path + name +// of the libraries +// for_link : a vector of strings with link cmd +// for exec or for loader.sce +// +function [ok, libs, for_link] = link_olibs(libs,rpat) + + //** get lhs,rhs nb paramaters + [lhs,rhs] = argn(0); + + //** declare and set local variables + ok = %t; + xlibs = []; + for_link = [], + + //** get out from this function if + // there is nothing to do + if ( (libs == "") | (libs == []) ) then return, end + + for i = 1:size(libs, "*") + [_path, _name , _ext] = fileparts(libs(i)); + dynlibname = _path + _name + getdynlibext(); + if isfile(dynlibname) then + for_link = [for_link; dynlibname]; + ierr = execstr("link(for_link($))","errcatch"); + if ierr <> 0 then + messagebox(_("Cannot load dynamic library: ") + for_link($) ,"modal","error"); + libs = []; + for_link = []; + ok = %f; + return + else + if getos() == "Windows" then + xlibs = [xlibs; _path + _name + ".lib"]; + else + xlibs = [xlibs; libs(i)]; + end + end + else + messagebox([_("Can''t include ") + dynlibname; _("This file does not exist"); lasterror()], "modal", "error"); + libs = []; + for_link = []; + ok = %f; + return + end + end + + //** add double quote for include in + // Makefile + libs = xlibs; + if getos() == "Windows" then + libs = """" + libs + """"; + else + libs = "''" + libs + "''"; + end + + //** return link cmd for for_link + if (for_link <> []) then + for_link = "link(""" + for_link + """);"; + end + + //** concatenate libs for Makefile + if (size(libs,1) <> 1) then + libs = strcat(libs," "); + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/lnkptrcomp.bin b/modules/scicos/macros/scicos_scicos/lnkptrcomp.bin new file mode 100755 index 000000000..cfb81871f Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/lnkptrcomp.bin differ diff --git a/modules/scicos/macros/scicos_scicos/lnkptrcomp.sci b/modules/scicos/macros/scicos_scicos/lnkptrcomp.sci new file mode 100755 index 000000000..08fa682f3 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/lnkptrcomp.sci @@ -0,0 +1,50 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Alan Layec +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [lnksz,lnktyp]=lnkptrcomp(bllst,inpptr,outptr,inplnk,outlnk) + + lnkbsz=[];ptlnk=[];lnksz=[];lnktyp=[]; + for blkout=1:length(bllst) + for portout=1:outptr(blkout+1)-outptr(blkout) + ptlnk=outlnk(outptr(blkout)+portout-1) + lnkbsz(outlnk(outptr(blkout)+portout-1))=bllst(blkout).out(portout); + lnksz(ptlnk,1)=bllst(blkout).out(portout); + lnksz(ptlnk,2)=bllst(blkout).out2(portout); + lnktyp(ptlnk)=bllst(blkout).outtyp(portout); + end + end + + //27/09/07 Alan's patch : do test here for unconnected inputs + if inplnk<>[] | outlnk<>[] then + unco=find(inplnk>max(outlnk)) + for j=unco + m=max(find(inpptr<=j)) + n=j-inpptr(m)+1 + lnksz($+1,1)=bllst(m).in(n); + lnksz($,2)=bllst(m).in2(n); + lnktyp($+1)=bllst(m).intyp(n); + end + end + + //lnkptr=cumsum([1;lnkbsz]) +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/loadpallibs.bin b/modules/scicos/macros/scicos_scicos/loadpallibs.bin new file mode 100755 index 000000000..593acde3c Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/loadpallibs.bin differ diff --git a/modules/scicos/macros/scicos_scicos/loadpallibs.sci b/modules/scicos/macros/scicos_scicos/loadpallibs.sci new file mode 100755 index 000000000..ce92620bf --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/loadpallibs.sci @@ -0,0 +1,33 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function loadpallibs() + //to be called by exec(loadpallibs) + if ~(exists("scicos_pal_libs")) then + [modelica_libs, scicos_pal_libs, %scicos_with_grid, %scs_wgrid] = initial_scicos_tables(); + end + for d = scicos_pal_libs + execstr(["if exists(''scs"+convstr(d)+"lib'')==0 then" + " load(''SCI/modules/scicos_blocks/macros/"+d+"/lib'');" + "end"]); + end + clear d +endfunction diff --git a/modules/scicos/macros/scicos_scicos/mark_prt.bin b/modules/scicos/macros/scicos_scicos/mark_prt.bin new file mode 100755 index 000000000..d03da6347 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/mark_prt.bin differ diff --git a/modules/scicos/macros/scicos_scicos/mark_prt.sci b/modules/scicos/macros/scicos_scicos/mark_prt.sci new file mode 100755 index 000000000..833244481 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/mark_prt.sci @@ -0,0 +1,47 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function o=mark_prt(o,prt_number,inout,typ,v) + //mark a port of a block free or used + // o : block data structure + // prt_number : port number + // inout : port orientation ('in' or 'out') + // typ : port type + // 1 : standard port + // -1 : event port + // v : value to assign + // k>0 : port is connected to link #k + // 0 : port is free + + if inout=="out" then //set an output port + if typ==1 | typ==2 then //standard (regular or implicit) port + o.graphics.pout(prt_number)=v; + else //clock port + o.graphics.peout(prt_number)=v; + end + else //set an input port + if typ==1 | typ==2 then //standard (regular or implicit) port + o.graphics.pin(prt_number)=v; + else //clock port + o.graphics.pein(prt_number)=v; + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/message.bin b/modules/scicos/macros/scicos_scicos/message.bin new file mode 100755 index 000000000..0a956bf59 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/message.bin differ diff --git a/modules/scicos/macros/scicos_scicos/message.sci b/modules/scicos/macros/scicos_scicos/message.sci new file mode 100755 index 000000000..65ee509f1 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/message.sci @@ -0,0 +1,45 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function num=message(strings ,buttons, modal) + //interface to message primitive to allow simple overloading for live demo + [lhs,rhs]=argn(0) + if rhs==3 then + if modal == %t then + if buttons == "" then + num=messagebox(strings, "modal", "scilab"); + else + num=messagebox(strings, "modal", "scilab", buttons); + end + else //non modal messagebox + if buttons == "" then + num=messagebox(strings,"scilab"); + else + num=messagebox(strings, "scilab", buttons); + end + end + elseif rhs==2 then + num=messagebox(strings, "modal", "scilab", buttons); + else + num=1 + messagebox(strings, "modal", "scilab"); + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/mfrequ_clk.bin b/modules/scicos/macros/scicos_scicos/mfrequ_clk.bin new file mode 100755 index 000000000..e08a6b0c0 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/mfrequ_clk.bin differ diff --git a/modules/scicos/macros/scicos_scicos/mfrequ_clk.sci b/modules/scicos/macros/scicos_scicos/mfrequ_clk.sci new file mode 100755 index 000000000..ee372f990 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/mfrequ_clk.sci @@ -0,0 +1,104 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function [m,den,off,count,m1,fir,frequ,offset,ok]=mfrequ_clk(frequ,offset) + // copyright: INRIA + // Anthor: Fady NASSIF + // Date: 2007-2008 + m=[];den=[];off=[];count=[];m1=[];fir=[]; + v=[frequ;offset]; + v=v(find(v<>0)); + min_v=min(v);max_v=max(v); + if (max_v/min_v)>1e5 then message(["The difference between the frequencies is very large";.. + "the clocks could not be synchronized"]); + ok=%f; + return; + end + // we call this function to get the least common denominator. + [pgcd,den]=fixedpointgcd(v);//find the pgcd and the common denominator of the vector v + [m1,k]=uni(frequ,offset); // m1 is a vector of different frequencies or same frequencies with different offsets + // k is the index. + frequ=frequ(k); // delete the dupplicated frequencies. + frd1=uint32(round((frequ.*double(den)))); // this will be used to construct the counter of the simulation. + ppcm=lcm(frd1); // find the least common multiple of the frequencies. + frd1=double(frd1); + offset=offset(k); // delete the dupplicated offset. + //constructing the first element of the opar of the m_frequ block. + // the first column contains the delay. + // the second element contains the event output number to activate. + // the third column contains the time. + if size(frequ,"*")>1 then // more than one frequency + mat=[]; + for i=1:size(frequ,"*") + mat1=[offset(i)*den:frd1(i):double(ppcm)]';// for each frequency + mat=[mat;[mat1 2^(i-1)*ones(size(mat1,"*"),1)]]; // contains the frequency and the corresponding output. + end + [n,k]=gsort(mat(:,1),"g","i"); + mat=mat(k,:); // sorting the mat matrix (increasingly). + // if two outputs are called at the same time they are replaced by an other output; the intersection of the two. + if size(mat,1)>10000 then + num=messagebox(["Warning: Your system is too hard to synchronize it will take some time"; + "And the stacksize has to be increase"; + " A scilab crash may occur"; + "Do You want me to continue?"],"modal",["No","Yes"]) + if num==1 then + ok=%f; + return + end + end + vv=mat(2:$,1)-mat(1:$-1,1); + vv=[1;vv;1]; + kkk=find(vv(:)==0); + kk=find(vv); + for i=1:size(kk,2)-1 + mat(kk(i),2)=sum(mat(kk(i):kk(i+1)-1,2)); + end + mat(kkk(:),:)=[]; + + //constructing the first element of opar + m=[mat(1,1);mat(2:$,1)-mat(1:$-1,1)]; //contains the first element of the chain and the delay. + last_delay=double(ppcm)-mat($,1)+mat(1,1) // finding the last delay. + // In other world finding the delay between the last element + // and the first element of mat. So we can have a cycle. + if last_delay<>0 then // all the offset are different from 0. + m($+1)=last_delay // we add the last delay to m. + m=[m,[mat(:,2);mat(1,2)],[mat(:,1);double(ppcm)+mat(1,1)]] // the event output for the last element + // will be equal to the first one. + // the time will be the lcm+the delay of the first element + else // there is at least one offset that is equal to 0. + m=[m,mat(:,2),mat(:,1)]; // we don't have to add the last delay because in this case it will be equal to 0. + end + count=int32(m(1,1)); // we put the first element of the matrix in a variable that will initialise the counter. + m(1,:)=[]; // we delete the first row of the matrix. the delay is conserv in the variable count. + mn=(2**size(m1,"*"))-1; // find the number of event output. + fir=-ones(1,mn); // put all the element of the firing to -1 + fir(mat(1,2))=mat(1,1)/double(den);// programming the corresponding event output + // by the first element of the matrix mat.(first delay). + off=0; // the offset in this case will be equal to 0 because it is implemented in the calculation + // of the delay. + else + // case of one frequency + m=[frd1 1 frd1]; // put the delay in the matrix. the delay will be equal to the one frequency. + count=int32(0); // the counter will begin by 0. + mat=m; + off=offset; // the offset is put in the variable off. used by the simulator. + fir=off; // program the event output of the block by the corresponding offset. + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/modelica.bin b/modules/scicos/macros/scicos_scicos/modelica.bin new file mode 100755 index 000000000..4242d7b87 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/modelica.bin differ diff --git a/modules/scicos/macros/scicos_scicos/modelica.sci b/modules/scicos/macros/scicos_scicos/modelica.sci new file mode 100755 index 000000000..ac21e626e --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/modelica.sci @@ -0,0 +1,31 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function mo=modelica(v1,v2,v3,v4) + + if exists("model","local")==0 then model=[], end + if exists("inputs","local")==0 then inputs=[], end + if exists("outputs","local")==0 then outputs=[], end + if exists("parameters","local")==0 then parameters=list([],list()), end + + mo=tlist(["modelica","model","inputs","outputs","parameters"],... + model,inputs,outputs,parameters) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/modelicac.bin b/modules/scicos/macros/scicos_scicos/modelicac.bin new file mode 100755 index 000000000..355e3ed21 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/modelicac.bin differ diff --git a/modules/scicos/macros/scicos_scicos/modelicac.sci b/modules/scicos/macros/scicos_scicos/modelicac.sci new file mode 100755 index 000000000..67fd4ced5 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/modelicac.sci @@ -0,0 +1,79 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function ok = modelicac(Flat, Flat_functions, xmlfileTMP, Jacobian, Cfile, with_gui, init) + //Scilab interface with external tool modelicac + + MODELICAC_FILENAME = "modelicac"; + if getos() == "Windows" then + MODELICAC_FILENAME = MODELICAC_FILENAME + ".exe"; + end + + if argn(2) < 7 then init = %f,end + incidence = ""; + tmpdir = pathconvert(TMPDIR, %t, %t); //for error log and shell scripts + xmlfileTMP = pathconvert(xmlfileTMP, %f, %t); + Cfile = pathconvert(Cfile, %f, %t); + + if fileinfo(Flat_functions) == [] then + Flat_functions = " "; + else + Flat_functions = """" + Flat_functions + """"; + end + + if ( (with_gui) & (fileinfo(xmlfileTMP) <> []) ) then // if GUI is running + XMLfiles = " -with-init-in """ + strsubst(xmlfileTMP, "\", "/") + """ -with-init-out """ + strsubst(xmlfileTMP,"\","/") + """"; + else + XMLfiles = ""; + end + + exe = """" + pathconvert(getmodelicacpath() + MODELICAC_FILENAME, %f, %t) + """"; + + Flat = """" + Flat + """"; + out = "-o """ + Cfile + """"; + + if Jacobian then + JAC = " -jac "; + else + JAC=""; + end + + instr = strcat([exe, Flat, Flat_functions, XMLfiles, out, JAC], " "); + + if getos() == "Windows" then + if init then + mputl(instr,tmpdir+"igenm.bat"); + instr = tmpdir + "igenm.bat"; + else + mputl(instr, tmpdir + "genm2.bat"); + instr = tmpdir + "genm2.bat"; + end + end + + [rep,stat,err]=unix_g(instr); + if stat <> 0 then + messagebox(err, _("Modelica compiler"), "error", "modal"); + ok=%f; + return + end + +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/modipar.bin b/modules/scicos/macros/scicos_scicos/modipar.bin new file mode 100755 index 000000000..ed504b1e9 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/modipar.bin differ diff --git a/modules/scicos/macros/scicos_scicos/modipar.sci b/modules/scicos/macros/scicos_scicos/modipar.sci new file mode 100755 index 000000000..bbdf7d65a --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/modipar.sci @@ -0,0 +1,304 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [%state0,state,sim,ok]=modipar(newparameters,%state0,state,sim,scs_m,cor) + //store modified parameters in compiled structure state,sim + //newparameters gives modified blocks numbers in original structure scs_m + //cor is the correspondance table from original structure to compiled one + xptr=sim.xptr + zptr=sim.zptr + ozptr=sim.ozptr + rpptr=sim.rpptr + ipptr=sim.ipptr + opptr=sim.opptr + ipar=sim.ipar + rpar=sim.rpar + opar=sim.opar + ztyp=sim.ztyp + labels=sim.labels + st=state.x + dst=state.z + odst=state.oz + st0=%state0.x + dst0=%state0.z + odst0=%state0.oz + + Impl=%f + if xptr($)-1 < size(st,"*") then + std=st($/2+1:$) + st=st(1:$/2) + std0=st0($/2+1:$) + st0=st0(1:$/2) + Impl=%t + end + + nb=prod(size(rpptr))-1 + for k=newparameters + if prod(size(k))==1 then //parameter of a simple block + kc=cor(k) //index of modified block in compiled structure + o=scs_m.objs(k) + else + kc=get_tree_elt(cor,k); + o=scs_m(get_subobj_path(k)) + end + if is_modelica_block(o) then + parameters=o.model.equations.parameters + rpark=[];for p=parameters(2),rpark=[rpark;p(:)];end + ipark=ipar(ipptr(kc):ipptr(kc+1)-1) + corinvm=%cpr.corinv(kc); + J=[]; + if findinlistcmd(%cpr.corinv,size(cor),">")<>list() then ok=%f;return; end + //if %cpr.corinv(kc-1)>size(cor) then ok=%f;return;end + for jj=1:size(corinvm) + if and(corinvm(jj)==k) then J=jj;break,end + end + nek=size(rpark,"*")-(ipark(J+1)-ipark(J)) + if nek<>0 then + warning("variying number of parameter for modelica block is not yet implemented") + end + rpar(rpptr(kc)+ipark(J)-1:rpptr(kc)+ipark(J+1)-2)=rpark + else + statekd=[] + om=o.model + [fun,statek,dstatek,odstatek,rpark,ipark,opark]=... + (om.sim,om.state,om.dstate,om.odstate,om.rpar,om.ipar,om.opar); + if type(fun)==15 then + if (fun(2)==3 | fun(2)==5 | fun(2)==10005) then + if rpark<>[] then rpark=var2vec(rpark); end + if dstatek<>[] then dstatek=var2vec(dstatek),end + end + if fun(2)>10000 then + statekd=statek($/2+1:$) + statek=statek(1:$/2) + end + end + + if kc>0 then + //Change continuous state + nek=prod(size(statek))-(xptr(kc+1)-xptr(kc)) + sel=xptr(kc+1):xptr($)-1 + if nek<>0&sel<>[] then + st(nek+sel)=st(sel) + st0(nek+sel)=st0(sel) + if Impl then + std(nek+sel)=std(sel) + std0(nek+sel)=std0(sel) + end + end + + if nek<0 then + st($+nek+1:$)=[],st0($+nek+1:$)=[], + if Impl then std($+nek+1:$)=[],std0($+nek+1:$)=[],end + end + + xptr(kc+1:$)=xptr(kc+1:$)+nek + st(xptr(kc):xptr(kc+1)-1)=statek(:), + st0(xptr(kc):xptr(kc+1)-1)=statek(:), + if Impl then + if statekd==[] then statekd=0*statek,end + std(xptr(kc):xptr(kc+1)-1)=statekd(:), + std0(xptr(kc):xptr(kc+1)-1)=statekd(:), + end + + //Change discrete state + nek=prod(size(dstatek))-(zptr(kc+1)-zptr(kc)) + sel=zptr(kc+1):zptr($)-1 + if nek<>0&sel<>[] then + dst(nek+sel)=dst(sel) + dst0(nek+sel)=dst0(sel) + end + + if nek<0 then + dst($+nek+1:$)=[],dst0($+nek+1:$)=[], + end + + zptr(kc+1:$)=zptr(kc+1:$)+nek + dst(zptr(kc):zptr(kc+1)-1)=dstatek(:) + dst0(zptr(kc):zptr(kc+1)-1)=dstatek(:) + + //Change objects discrete state + if ((type(odstatek)<>15) | ... + (type(fun)<>15)) then //old sci blocks or odstatek not a list + nek=-(ozptr(kc+1)-ozptr(kc)) + elseif ((fun(2)==5) | (fun(2)==10005)) then // sciblocks type 5 | 10005 + if lstsize(odstatek)>0 then + nek=1-(ozptr(kc+1)-ozptr(kc)) //nombre d'états supplémentaires + else + nek=-(ozptr(kc+1)-ozptr(kc)) + end + elseif ((fun(2)==4) | (fun(2)==10004) | (fun(2)==2004)) then // C blocks type 4 | 10004 + nek=lstsize(odstatek)-(ozptr(kc+1)-ozptr(kc)) + else // other C and sci blocks + nek=-(ozptr(kc+1)-ozptr(kc)) + end + sel=ozptr(kc+1):ozptr($)-1 + + if nek<>0&sel<>[] then + while lstsize(odst)0 then sel=gsort(sel), end + for j=sel + odst(j+nek)=odst(j) + odst0(j+nek)=odst0(j) + end + end + ozptr(kc+1:$)=ozptr(kc+1:$)+nek; + + if ((type(odstatek)==15) & (type(fun)==15)) then + if ((fun(2)==5) | (fun(2)==10005)) then // sciblocks + if lstsize(odstatek)>0 then + odst(ozptr(kc))=odstatek; + odst0(ozptr(kc))=odstatek; + end + elseif ((fun(2)==4) | (fun(2)==10004) | (fun(2)==2004)) then // C blocks + for j=1:lstsize(odstatek) + odst(ozptr(kc)+j-1)=odstatek(j); + odst0(ozptr(kc)+j-1)=odstatek(j); + end + end + end + + //## rebuild odst list if nek < 0 + if nek < 0 then + n_odst = list(); n_odst0 = list(); + for j=1:max(ozptr)-1 + n_odst(j)=odst(j); + n_odst0(j)=odst0(j); + end + odst = n_odst; odst0 = n_odst0; + clear n_odst; clear n_odst0; + end + + //Change real parameters + nek=prod(size(rpark))-(rpptr(kc+1)-rpptr(kc)) + sel=rpptr(kc+1):rpptr($)-1 + if nek<>0&sel<>[] then + rpar(nek+sel)=rpar(sel) + end + + if nek<0 then + rpar($+nek+1:$)=[] + end + + rpptr(kc+1:$)=rpptr(kc+1:$)+nek + rpar(rpptr(kc):rpptr(kc+1)-1)=rpark(:), + + //Change integer parameters + if type(ipark)==1 then //scifunc + nek=prod(size(ipark))-(ipptr(kc+1)-ipptr(kc)) + sel=ipptr(kc+1):ipptr($)-1 + if nek<>0&sel<>[] then + ipar(nek+sel)=ipar(sel) + end + + if nek<0 then + ipar($+nek+1:$)=[] + end + + ipptr(kc+1:$)=ipptr(kc+1:$)+nek + ipar(ipptr(kc):ipptr(kc+1)-1)=ipark(:), + end + //Change objects parameters + if ((type(opark)<>15) | ... + (type(fun)<>15)) then //old sci blocks or odstatek not a list + nek=-(opptr(kc+1)-opptr(kc)) + elseif ((fun(2)==5) | (fun(2)==10005)) then // sciblocks + if lstsize(opark)>0 then + nek=1-(opptr(kc+1)-opptr(kc)) //nombre de param�tres suppl�mentaires + else + nek=-(opptr(kc+1)-opptr(kc)) + end + elseif ((fun(2)==4) | (fun(2)==10004) | (fun(2)==2004)) then //C blocks + nek=lstsize(opark)-(opptr(kc+1)-opptr(kc)) + else // other C and sci blocks + nek=-(opptr(kc+1)-opptr(kc)) + end + sel=opptr(kc+1):opptr($)-1 + if nek<>0&sel<>[] then + while lstsize(opar)0 then sel=gsort(sel), end + for j=sel, opar(j+nek)=opar(j); end + end + opptr(kc+1:$)=opptr(kc+1:$)+nek; + if ((type(opark)==15) & (type(fun)==15)) then + if ((fun(2)==5) | (fun(2)==10005)) then // sciblocks + if lstsize(opark)>0 then + opar(opptr(kc))=opark; + end + elseif ((fun(2)==4) | (fun(2)==10004) | (fun(2)==2004)) then //C blocks + for j=1:lstsize(opark), opar(opptr(kc)+j-1)=opark(j), end + end + end + //## rebuild opar list if nek < 0 + if nek < 0 then + n_opar = list(); + for j=1:max(opptr)-1 + n_opar(j)=opar(j); + end + opar = n_opar; + clear n_opar; + end + + + //Change simulation routine + if type(sim("funs")(kc))<>13 then //scifunc + sim("funs")(kc)=fun(1); + if prod(size(fun))> 1 then + sim("funtyp")(kc)=fun(2); + else + sim("funtyp")(kc)==0; + end + end + + //Change label + labels(kc)=o.model.label + end + end + end + + sim.xptr=xptr + sim.zptr=zptr + sim.ozptr=ozptr + sim.rpar=rpar + sim.rpptr=rpptr + sim.ipar=ipar + sim.ipptr=ipptr + sim.opar=opar + sim.opptr=opptr + sim.labels=labels + + if Impl then + state.x=[st;std] + else + state.x=st + end + + state.z=dst + state.oz=odst + if Impl then + %state0.x=[st0;std0] + else + %state0.x=st0 + end + %state0.z=dst0 + %state0.oz=odst0 + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/names b/modules/scicos/macros/scicos_scicos/names new file mode 100755 index 000000000..93868a63f --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/names @@ -0,0 +1,126 @@ +%Block_e +%Block_p +%b_i_graphics +%b_i_model +%c_i_block +%c_i_graphics +%c_i_model +%debug_scicos +%diagram_p +%graphics_e +%graphics_i_Block +%graphics_p +%l_i_block +%l_i_graphics +%l_i_model +%model_e +%model_i_Block +%model_p +%params_p +%s_i_block +%s_i_graphics +%s_i_model +CC4 +CFORTR +CFORTR2 +Compute_cic +FORTR +Link_modelica_C +MODCOM +adjust +adjust_in2out2 +bad_connection +build_block +build_modelica_block +buildnewblock +c_pass1 +c_pass2 +c_pass3 +check_io +check_mac +compile_init_modelica +compile_modelica +context_evstr +cos2cosf +countblocks +create_modelica +default_color +default_options +delete_unconnected +dialog +dig_bound_compound +do_compile +do_compile_superblock42 +do_delete1 +do_eval +do_purge +do_terminate +do_update +do_version +extract_implicit +findinlist +findinlistcmd +gen_modelica +genfunc +genfunc1 +genfunc2 +genmac +get2index +get_connected +get_dynamic_lib_dir +get_errorcmd +get_model_name +get_subobj_path +get_tree_elt +getmodelicacpath +global_case +haltscicos +hilite_path +init_agenda +is_modelica_block +link_olibs +lnkptrcomp +loadpallibs +mark_prt +message +mfrequ_clk +modelica +modelicac +modipar +reading_incidence +recur_scicos_block_link +sample_clk +scicos_block +scicos_block_link +scicos_cpr +scicos_diagram +scicos_flat +scicos_graphics +scicos_include_paths +scicos_link +scicos_model +scicos_params +scicos_sim +scicos_state +scicos_txtedit +script2var +scs_full_path +scs_show +scstxtedit +set_io +setvalue +shiftcors +split_lasterror +standard_define +standard_draw +standard_draw_ports +standard_draw_ports_up +standard_inputs +standard_origin +standard_outputs +translator +update_scs_m +update_version +validvar +value2modelica +xml2modelica diff --git a/modules/scicos/macros/scicos_scicos/reading_incidence.bin b/modules/scicos/macros/scicos_scicos/reading_incidence.bin new file mode 100755 index 000000000..33bc93d39 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/reading_incidence.bin differ diff --git a/modules/scicos/macros/scicos_scicos/reading_incidence.sci b/modules/scicos/macros/scicos_scicos/reading_incidence.sci new file mode 100755 index 000000000..c989429f1 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/reading_incidence.sci @@ -0,0 +1,128 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function [nipar,nrpar,nopar,nz,nx,nx_der,nx_ns,nin,nout,nm,ng,dep_u]=reading_incidence(incidence) + // this function creates the matrix dep_u given by the xml format. + // It is used for modelica compiler. + // number of lines represents the number of input, number of columns represents the number of outputs. + // Fady 02/09/08 + xmlformat=mgetl(incidence); + typ=[];input_name=[];order=[];depend=[]; + global txtline;txtline=0; + corresp_table=["""""""[] then + // dep_u=(ones(size(input_name,'*'),size(unique(depend),'*'))==zeros(size(input_name,'*'),size(unique(depend),'*'))) + // else + // dep_u=%f + // end + // ind=find(depend=='NAN') + // depend(ind(:))=[]; + // order(ind(:))=[]; + // for i=1:size(depend,'*') + // in_num=find(input_name==depend(i)); + // dep_u(in_num,order(i)+1)=%t; + // end + + nu=size(input_name,"*"); + dep_u=ones(1,nu)==zeros(1,nu); + for i=1:nu + if find(depend==input_name(i))==[] then + dep_u(1,i)=%f; + else + dep_u(1,i)=%t; + end + end + // remind taht inputs are numbered according to their position in the + // diagram and not in the Modelica block.InPutPortx.viis the x-th + // input in the whole diagram! + +endfunction + + +function t=read_new_line(txt) + global txtline + txtline=txtline+1; + t=txt(txtline) +endfunction + +function typ=get_typ(txt) + t=read_new_line(txt); + typ=tokens(t); + typ=tokens(typ(1),">"); +endfunction diff --git a/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.bin b/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.bin new file mode 100755 index 000000000..f7c2dfdfe Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.bin differ diff --git a/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.sci b/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.sci new file mode 100755 index 000000000..032d01a17 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/recur_scicos_block_link.sci @@ -0,0 +1,79 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function [model,ok]=recur_scicos_block_link(o,flag) + // Copyright INRIA + model=o.model;ok=%t; + if or(o.model.sim(1)==["super","csuper","asuper"]) then + obj=o.model.rpar; + for i=1:size(obj.objs) + o1=obj.objs(i); + if typeof(o1)=="Block" + + if (or(o1.model.sim(1)==["super","csuper","asuper"])) then + [model,ok]=recur_scicos_block_link(o1,flag) + if ~ok then return; end + elseif type(o1.model.sim)==15 + if or(int(o1.model.sim(2)/1000)==[1,2]) then + model=o1.model + funam=o1.model.sim(1) + if ~c_link(funam) then + tt=o1.graphics.exprs(2) + mputl(tt,TMPDIR+"/"+funam+".c") + ok=buildnewblock(funam,funam,"","","",TMPDIR,"","") + if ~ok then return; end + end + end + end + end + end + if o.model.sim(1)=="asuper" then + model=o.graphics.exprs(3) + funam=model.sim(1) + if ~c_link(funam) then + if size(o.graphics.exprs)==4 then + if type(o.graphics.exprs(4))==15 then + intern_funam=o.graphics.exprs(4)(2); + if ~c_link(intern_funam) then + tt=o.graphics.exprs(4)(1); + mputl(tt,TMPDIR+"/"+intern_funam+"."+flag) + ok=buildnewblock(intern_funam,intern_funam,"","","",TMPDIR,"","") + if ~ok then return; end + end + end + end + tt=o.graphics.exprs(2) + mputl(tt,TMPDIR+"/"+funam+".c") + ok=buildnewblock(funam,funam,"","","",TMPDIR,"","") + if ~ok then return; end + end + end + elseif or(int(o.model.sim(2)/1000)==[1,2]) then + model=o.model + funam=o.model.sim(1) + if ~c_link(funam) then + tt=o.graphics.exprs(2) + mputl(tt,TMPDIR+"/"+funam+".c") + ok=buildnewblock(funam,funam,"","","",TMPDIR,"","") + if ~ok then return; end + end + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/sample_clk.bin b/modules/scicos/macros/scicos_scicos/sample_clk.bin new file mode 100755 index 000000000..45144859d Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/sample_clk.bin differ diff --git a/modules/scicos/macros/scicos_scicos/sample_clk.sci b/modules/scicos/macros/scicos_scicos/sample_clk.sci new file mode 100755 index 000000000..0a7ad3c37 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/sample_clk.sci @@ -0,0 +1,295 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [Ts,bllst,corinv,indout,ok,scs_m,flgcdgen,freof]=sample_clk(MAT,Ts,bllst,corinv,scs_m,indout,flgcdgen) + + // This function takes care of the synchronize clocks. + // Two ways are used for that calculation. + // the first one uses a fast clock connected to a counter which is connected to an event select. + // This method used the two functions clock_major and update_diag. It is used for the moment in the code generation + // and it may be used in the future in the atomics blocks. + // The second method generates an event at a specific time using the multifrequency block. + // It uses the s_clk2 function. it is used in the compilation of all the diagram. + // The compilation using the second method is faster than using the first one but the first method generates periodic events. + // Fady NASSIF 2008. Copyright INRIA. + + //input: -MAT: a M*5 matrix. This matrix is the sco_mat given by the scicos_flat function. + // When the fifth column is equal to '4' then the corresponding block is the SampleCLK block. + // -Ts: the links_table given by th scicos_flat function. + // -bllst: block list.same definition as in c_pass1. + // -corinv: same definition as in c_pass1. + // -scs_m: diagram + // -indout: index used in c_pass1 to separate modelica blocks from regular blocks. + // -flgcdgen: -1 when the function is not called by the code generation + // it takes the number of event input of the superblock when it is called under the code generation. + // + // This part can be used in the next version to choose between the two methods. + // ------------ + // [num]=x_choose(['event select';'multiple frequency'],.. + // ["You have to choose a method for the sample time computation:";.. + // "The first method is a periodic synchronize system";.. + // "it uses the event select block to generate events"; "at every clock time (regular period)";.. + // "The number of outputs is equal to the least common"; "multiple of the input frequencies ";.. + // "The second method uses the multi-frequency block";.. + // "it generates an event only on the used time";.. + // "The default value is select method"]) + //num=scs_m.props.tol(8) + //the test will be done on num and not on the flgcdgen + //--------------------------------------------------------------------- + + if flgcdgen==-1 then + [Ts,bllst,corinv,indout,ok]=s_clk2(MAT,Ts,bllst,corinv,scs_m,indout) + else + [frequ,offset,freqdiv,den,flg,ok]=clock_major(MAT) + if ok then + [Ts,corinv,bllst,indout,ok,scs_m,flgcdgen,freof]=update_diag(scs_m,corinv,Ts,frequ,offset,freqdiv,bllst,den,flg,indout,flgcdgen) + end + end +endfunction + +function [frequ,offset,freqdiv,den,flg,ok]=clock_major(MAT) + + // this function calculates the frequency and the offset of the fastest clock + //modification to support double + // output parameters: -frequ: the frequency of the major clock. + // -offset: the offset of the major clock. + // -freqdiv: A vector containing the frequencies of all the SampleClk multiplied by the common denominator. + // -den: The common denominator. + // -flg: 0 if there is one frequency and one offset + // 1 else case. + // -ok: flag for error. + + ok=%t; + flg=1; + index=find(MAT(:,5)==string(4)); + if index<>[] then + freq1=evstr(MAT(index,3)); + offset1=evstr(MAT(index,4)); + end + freqdiv=unique(freq1); + if size(unique(offset1),"*")==1 then // case of one offset + if size(freqdiv,"*")==1 then flg=0;end // case of one offset and one frequency. + v=freq1; + v=v(find(v<>0)); + min_v=min(v);max_v=max(v); + if (max_v/min_v)>1e5 then messagebox(["The difference between the frequencies is very large";.. + "the clocks could not be synchronized"],"modal"); + ok=%f;Ts=[];bllst=[];corinv=list();indout=[]; + return; + end + [frequ,den]=fixedpointgcd(v); //computing the pgcd of the frequencies + offset=offset1(1); + else // case of multiple offset + v=[freq1;offset1] + v=v(find(v<>0)); + min_v=min(v);max_v=max(v); + if (max_v/min_v)>1e5 then messagebox(["The difference between the frequencies is very large";.. + "the clocks could not be synchronized"],"modal"); + ok=%f;Ts=[];bllst=[];corinv=list();indout=[]; + return; + end + [frequ,den]=fixedpointgcd(v);//computes the pgcd of the frequencies and the offsets. + offset=0; + end + freqdiv=uint32(freqdiv*double(den)); + frequ=double(frequ)/double(den); + if frequ==[] then frequ=0;end + if offset==[] then offset=0; end + if (offset > frequ) then + offset=modulo(offset,frequ) + if (offset~=0) then ok=%f; end + end +endfunction + +function [Ts,corinv,bllst,indout,ok,scs_m,flgcdgen,freof]=update_diag(scs_m,corinv,Ts,frequ,offset,freqdiv,bllst,den,flg,indout,flgcdgen) + //modification to support double + ok=%t + n=lstsize(scs_m.objs) + + // when the function is called by the code generator we add an input event to the diagram + // the major clock will be put outside the superblock. it will be explicitly drawn. + // In the other case the major clock will be implicitly used in the diagram. + + if flgcdgen<>-1 then // when the function is called by the codegeneration. + flgcdgen=flgcdgen+1 // the flgcdgen contains the number of event input. + // we incremented to be able to add the sampleclk to the diagram at the end + // Adding the event input block. + bllst($+1)=scicos_model(sim=list("bidon",0),in=[],in2=[],intyp=1,out=[],out2=[],.. + outtyp=1,evtin=[],evtout=1,state=[],dstate=[],odstate=list(),.. + rpar=[],ipar=flgcdgen,opar=list(),blocktype="d",firing=-1,.. + dep_ut=[%f,%f],label="",nzcross=0,nmode=0,equations=list()); + freof=[frequ;offset]; + // Drawing the block in the scs_m + blk=CLKINV_f("define"); + blk.gui="EVTGEN_f"; + blk.model.ipar=flgcdgen; + blk.model.sim(1)="bidon"; + blk.graphics.exprs=sci2exp(flgcdgen); + blk.graphics.sz=[20 30]; + blk.graphics.peout=20 + scs_m.objs($+1)=blk + else + bllst($+1)=scicos_model(sim=list("evtdly4",4),in=[],in2=[],intyp=1,out=[],out2=[],.. + outtyp=1,evtin=1,evtout=1,state=[],dstate=[],odstate=list(),.. + rpar=[frequ;offset],ipar=[],opar=list(),blocktype="d",firing=offset,.. + dep_ut=[%f,%f],label="",nzcross=0,nmode=0,equations=list()); + scs_m.objs(n+1)=EVTDLY_c("define"); + scs_m.objs(n+1).model.rpar=[frequ;offset]; + scs_m.objs(n+1).model.firing=offset; + freof=[frequ;offset]; + end + corinv($+1)=n+1 + nb=size(corinv) + nc=size(bllst); + // nb and nc defers in the diagrams that contains modelicas blocks. + indout($+1)=nc; + if flgcdgen==-1 then + // linking the output of the evtdly to its input. + Ts($+1:$+2,:)=[nb 1 -1 -1;.. + nb 1 1 -1] + end + if flg then //more then one frequency or offset + + nn=lcm(freqdiv); + nn=double(nn)/(frequ*(double(den)));// the number of output of the event select block + //Adding the counter to the block list. + bllst($+1)=scicos_model(sim=list("counter",4),in=[],in2=[],intyp=1,out=1,out2=1,.. + outtyp=1,evtin=1,evtout=[],state=[],dstate=0,odstate=list(),.. + rpar=[],ipar=[1;double(nn);1],opar=list(),blocktype="c",firing=[],.. + dep_ut=[%f,%f],label="",nzcross=0,nmode=0,equations=list()); + // Adding the event select to the block list. + bllst($+1)=scicos_model(sim=list("eselect",-2),in=1,in2=1,intyp=-1,out=[],out2=[],.. + outtyp=1,evtin=[],evtout=ones(nn,1),state=[],dstate=[],odstate=list(),.. + rpar=[],ipar=[],opar=list(),blocktype="l",firing=-ones(nn,1),.. + dep_ut=[%t,%f],label="",nzcross=0,nmode=0,equations=list()); + + corinv($+1)=n+2 + //we have to add the counter and the eventselect block to the scs_m + //to be compatible with the code generation + scs_m.objs(n+2)=Counter("define"); + scs_m.objs(n+2).model.ipar=[1;double(nn);1]; + corinv($+1)=n+3 + scs_m.objs(n+3)=ESELECT_f("define"); + scs_m.objs(n+3).model.evtout=ones(nn,1); + scs_m.objs(n+3).model.firing=-ones(nn,1); + nc=size(bllst) + nb=size(corinv) + indout($+1)=nc-1; + indout($+1)=nc; + // linking the event output of the evntdly or the bidon to the counter. + // and linking the regular output of the counter to the event select. + Ts($+1:$+4,:)=[nb-2 1 -1 -1;.. + nb-1,1,1,-1;.. + nb-1,1,-1,1;.. + nb,1,1,1] + // replacing the SampleClk by the output of the event select + index=find(MAT(:,5)==string(4)) + for i=index + num=-evstr(MAT(i,1)) + Ts(find(Ts(:,1)==num),1)=-num + K=0:nn-1; + M=find(modulo(int(K*frequ*den),int(evstr(MAT(i,3))*double(den)))==0)'; + ON=ones(size(M,"*"),1) + Ts($+1:2:$+2*size(M,"*"),:)=[nb*ON M+ON*(evstr(MAT(i,4))-offset)*double(den) -ON -ON] + N=[1:size(M,"*")]'; + Ts($+1-(2*size(M,"*")-2):2:$+1,:)=[-num*ON N ON -ON] + end + else + nb=size(corinv) + index=find(MAT(:,5)==string(4)) + ON=ones(size(index,"*"),1) + Ts($+1:2:$+2*size(index,"*"),:)=[nb*ON ON -ON -ON] + num=-evstr(MAT(index,1)) + // N=[1:size(index,'*')]'; + Ts($+1-(2*size(index,"*")-2):2:$+1,:)=[-num ON ON -ON] + for i=1:size(index,"*") + Ts(find(Ts(:,1)==num(i)),1)=-num(i) + end + end +endfunction + +function [Ts,bllst,corinv,indout,ok]=s_clk2(MAT,Ts,bllst,corinv,scs_m,indout) + ok=%t + index=find(MAT(:,5)==string(4)) //index of SampleCLK blocks + MAT1=MAT(index,:); + frequ=evstr(MAT1(:,3)); // frequencies of the sampleCLK + offset=evstr(MAT1(:,4)); // offsets of the SampleCLK + offset=offset(:);frequ=frequ(:); + [m,den,off,count,m1,fir,frequ,offset,ok]=mfrequ_clk(frequ,offset); + if ~ok then return;end + mn=(2**size(m1,"*"))-1;//number of event outputs. + n=lstsize(scs_m.objs); + bllst($+1)=scicos_model(sim=list("m_frequ",4),in=[],in2=[],intyp=1,out=[],out2=[],outtyp=1,.. + evtin=1,evtout=ones(mn,1),state=[],dstate=[],odstate=list(),rpar=[],ipar=[],.. + opar=list(m,double(den),off,count),blocktype="d",firing=fir,dep_ut=[%f,%f],.. + label="",nzcross=0,nmode=0,equations=list()); + corinv($+1)=n+1; + nb=size(corinv); + nc=size(bllst);// nc differs from nb if the diagram contains modelica's block + indout($+1)=nc; + k=1:mn; + //connecting all the event outputs to the event input of the M_Frequ block + Ts($+1:2:$+2*mn,:)=[nb*ones(mn,1) k' -ones(mn,2)] + Ts($+1-(2*mn-2):2:$+1,:)=[nb*ones(mn,1) ones(mn,2) -ones(mn,1)] + //replacing the SampleCLK by the outputs of the M_frequ + for i=1:size(frequ,"*") + num=evstr(MAT1(find((evstr(MAT1(:,3))==frequ(i))&(evstr(MAT1(:,4))==offset(i))),1)) + for ii=num' + Ts(find(Ts(:,1)==-ii),1)=ii; + j=2**(i-1):2**i:mn; + v=j; + for k=1:2**(i-1)-1; + v=[v,j+k] + end + v=(unique(v)) + ON=ones(size(v,"*"),1) + N=[1:size(v,"*")]'; + Ts($+1:2:$+2*size(v,"*"),:)=[nb*ON v' -ON -ON] + Ts($+1-(2*size(v,"*")-2):2:$+1,:)=[ii*ON N ON -ON] + end + end +endfunction + +function [m,k]=uni(fr,of) + k=[]; + m=[]; + ot=[]; + for i=1:size(fr,"*") + istreated=%f; + ind=find(m==fr(i)); + if ind==[] then + m=[m;fr(i)]; + ot=[ot;of(i)]; + k=[k;i]; + else + for j=ind + if of(i)==ot(j) then + istreated=%t + end + end + if ~istreated then + m=[m;fr(i)]; + ot=[ot;of(i)] + k=[k;i]; + end + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_block.bin b/modules/scicos/macros/scicos_scicos/scicos_block.bin new file mode 100755 index 000000000..453fd4d83 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_block.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_block.sci b/modules/scicos/macros/scicos_scicos/scicos_block.sci new file mode 100755 index 000000000..598e10dcc --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_block.sci @@ -0,0 +1,30 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function blk=scicos_block(v1,v2,v3,v4,v5) + //Block data structure initialization + if exists("graphics","local")==0 then graphics=scicos_graphics(),end + if exists("model","local")==0 then model=scicos_model(),end + if exists("gui","local")==0 then gui="",end + if exists("doc","local")==0 then doc=list(),end + + blk=mlist(["Block","graphics","model","gui","doc"],graphics,model,gui,doc) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_block_link.bin b/modules/scicos/macros/scicos_scicos/scicos_block_link.bin new file mode 100755 index 000000000..1e5b1d24b Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_block_link.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_block_link.sci b/modules/scicos/macros/scicos_scicos/scicos_block_link.sci new file mode 100755 index 000000000..e6231391b --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_block_link.sci @@ -0,0 +1,59 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// Copyright (C) DIGITEO - Clément DAVID +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function ok = scicos_block_link(funam, txt, flag, libs) + // Link a new funame block with txt implementation. + // + // Parameters: + // funam: the name of the function + // txt: the code + // flag: language type ('c' or 'f') + // libs: the libs to link with + + // pre-condition + if flag <> "c" & flag <> "f" then + ok = %f; + messagebox(gettext("Sorry: Only C or FORTRAN languages are supported","modal")); + return; + end + if stripblanks(funam)==emptystr() then + ok = %f; + messagebox(gettext("Sorry file name not defined in "+flag+" block","modal")); + return; + end + if ~exists("libs", "l") then + libs = ""; + end + + // put the txt to a temp file + cur_wd = pwd(); + chdir(TMPDIR); + mputl(txt, funam + "." + flag); + + // call the standard block link function + ok = buildnewblock(funam, funam + "." + flag, "", "", libs, TMPDIR, "", ""); + + // post + chdir(cur_wd); + ok = %t; +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/scicos_cpr.bin b/modules/scicos/macros/scicos_scicos/scicos_cpr.bin new file mode 100755 index 000000000..69bcc4ac6 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_cpr.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_cpr.sci b/modules/scicos/macros/scicos_scicos/scicos_cpr.sci new file mode 100755 index 000000000..9889448a1 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_cpr.sci @@ -0,0 +1,30 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function cpr=scicos_cpr(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10) + //initialisation de cpr tlist + if exists("state","local")==0 then state=scicos_state(),end + if exists("sim","local")==0 then sim=scicos_sim(),end + if exists("cor","local")==0 then cor=list(),end + if exists("corinv","local")==0 then corinv=list(),end + cpr=tlist(["cpr","state","sim","cor","corinv"],.. + state,sim,cor,corinv) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_diagram.bin b/modules/scicos/macros/scicos_scicos/scicos_diagram.bin new file mode 100755 index 000000000..b39e9c8a0 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_diagram.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_diagram.sci b/modules/scicos/macros/scicos_scicos/scicos_diagram.sci new file mode 100755 index 000000000..5ea1793aa --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_diagram.sci @@ -0,0 +1,30 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function scs_m=scicos_diagram(v1,v2,v3) + if exists("props","local")==0 then props=scicos_params(),end + if exists("objs","local")==0 then objs=list(),end + if exists("version","local")==0 then version="",end + if exists("contrib","local")==0 then contrib=list(),end + + scs_m=mlist(["diagram","props","objs","version","contrib"],... + props,objs,version,contrib) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_flat.bin b/modules/scicos/macros/scicos_scicos/scicos_flat.bin new file mode 100755 index 000000000..43d90e60a Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_flat.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_flat.sci b/modules/scicos/macros/scicos_scicos/scicos_flat.sci new file mode 100755 index 000000000..5610397fb --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_flat.sci @@ -0,0 +1,456 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Ramine Nikoukhah - 2003 +// - Serge Steer - 2003 +// - Fady Nassif - 2007 +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [cor,corinv,links_table,cur_fictitious,sco_mat,ok, IN, OUT, EIN, EOUT]=scicos_flat(scs_m,ksup,MaxBlock) + //This function takes a hierarchical Scicos diagram and computes the + //"flat" equivalent, removing "non computational" blocs like splits. + //S. Steer, R. Nikoukhah 2003. Copyright INRIA + + //NB::-------------------------------------------------------------- + // Modifying this function to take care of the GOTO FROM SampleCLK and VirtualCLK0 blocks. + // A negatif number in cor and in links_table is refer to a GOTO,FROM + // GotoTagVisibility, SampleCLK, VirtualCLK0. in other words the blocks that are virtual. + // These blocks are removed in the compilation part. + // Modification of shiftcors. It will not shift the negatives numbers. + // A sco_mat is a string matrix composed by the : + // For the blocks GOTO, FROM, VirtualCLK0 + // - the first column : the negatif of the number of the virtual block in the cor. + // - the second column: 1 if it is a GOTO; -1 if it is a FROM. + // The VirtualCLK0 is considered as a GOTO. + // - the third column : the tag value. 'scicostimeclk0' is used in the case of the VirtualCLK0 + // - the forth column : the tag visibility + // For the GOTO: + 2: scoped + // + 3: global + // For the FROM: + 1 + // For the VirtualCLK0: 2 + // - the fifth column : 1=regular 2=event 3=modelica 10=VirtualCLK0 + // For the SampleCLK: + // - the first column : the negatif of the number of the virtual block in the cor. + // - the second column: the value 1. + // - the third column : The frequency value. + // - the forth column : The offset value. + // - the fifth column : the value 4. + // Another two string matrices are used for the GOTO/FROM blocks. The loc_mat it is used when the GOTO + // block is local. The from_mat to match the local from with the local goto. + // A tag_exprs matrices is used for the GotoTagVisibility and the VirtualCLK0: + // it is composed by: + // - the first column: The tag value. 'scicostimeclk0' in the VirtualCLK0 case. + // - the second column: 1=regular 2=event 3=modelica 10=VirtualCLK0 + // The local and scoped cases are studied in this function. + // The global case is studied in the function global_case in c_pass1. + // A Modification of update_cor in c_pass1. For the negatives numbers + // the cor will be set to 0. (In this case the blocks are considered as IN_f ...) + // Fady NASSIF 2007. INRIA. + //------------------------------------------------------------------- + + if argn(2)<=1 then ksup=0;end //used for recursion + if ksup==0 then // main scheme + MaxBlock=countblocks(scs_m); + //last created fictitious block (clock split,clock sum,super_blocks, superbloc)) + cur_fictitious=MaxBlock + path=[]; // for delete_unconnected + scs_m_s=scs_m ;// for delete_unconnected + end + //-------------- suppress blocks with an unconnected regular port -------------- + scs_m=delete_unconnected(scs_m); + + //list of blocks with are not retained in the final block list + blocks_to_remove=["CLKSPLIT_f" "SPLIT_f" "IMPSPLIT_f" "CLKSOM_f" "CLKSOMV_f" "NRMSOM_f" "PAL_f" "xcos_block"] + port_blocks=["IN_f","INIMPL_f","OUT_f","OUTIMPL_f","CLKIN_f","CLKINV_f","CLKOUT_f","CLKOUTV_f"] + block_goto=["GOTO","CLKGOTO","GOTOMO"] + block_from=["FROM","CLKFROM","FROMMO"] + block_tag=["GotoTagVisibility","CLKGotoTagVisibility","GotoTagVisibilityMO"] + n=lstsize(scs_m.objs) //number of "objects" in the data structure + //-------------- initialize outputs -------------- + nb=0; + links_table=[]; // + corinv=list(); + cor=list();for k=1:n, cor(k)=0;end + + ok=%t; + IN=[];OUT=[];EIN=[];EOUT=[]; + Links=[] //to memorize links position in the data structure + mod_blk_exist=%f; + //-------------- Analyse blocks -------------- + loc_mat=[];from_mat=[];tag_exprs=[];sco_mat=[]; + for k=1:n //loop on all objects + o=scs_m.objs(k); + x=getfield(1,o); + cor(k)=0 + if x(1)=="Block" then + if or(o.gui==block_goto) then + cur_fictitious=cur_fictitious+1; + cor(k)=-cur_fictitious; + if (o.graphics.exprs(2)=="1") then + loc_mat=[loc_mat;[string(cur_fictitious),string(1),(o.graphics.exprs(1)),string(find(block_goto(:)==o.gui))]] + locomat=[]; + for i=1:size(loc_mat,1) + locomat=[locomat;strcat([loc_mat(i,3) loc_mat(i,4)])] + end + vec=unique(locomat) + if size(vec,1)<>size(loc_mat,1) then + if flgcdgen<>-1 then path=[numk path];scs_m=all_scs_m; end + if (ksup==0)|flgcdgen<>-1 then + hilite_path([path,k],"There is another local GOTO in this diagram with the same tag ''"+loc_mat($,3)+"''",%t); + else + hilite_path([path,k], "There is another local GOTO in this diagram with the same tag ''"+loc_mat($,3)+"''",%t); + end + disp(mprintf("%s: goto tag not unique", "scicos_flat")); + ok=%f;return + end + else + sco_mat=[sco_mat;[string(cur_fictitious),string(1),o.graphics.exprs(1),o.graphics.exprs(2),string(find(block_goto(:)==o.gui))]] + end + elseif or(o.gui==block_from) then + cur_fictitious=cur_fictitious+1; + cor(k)=-cur_fictitious + sco_mat=[sco_mat;[string(cur_fictitious),string(-1),o.graphics.exprs(1),string(1),string(find(block_from(:)==o.gui))]] + from_mat=[from_mat;[string(cur_fictitious),string(-1),o.graphics.exprs(1),string(find(block_from(:)==o.gui))]] + elseif or(o.gui==block_tag) then + tag_exprs=[tag_exprs;[o.graphics.exprs(1),string(find(block_tag(:)==o.gui))]] + cur_fictitious=cur_fictitious+1; + cor(k)=-cur_fictitious + elseif o.gui=="SampleCLK" then + if o.graphics.peout<>0 then + cur_fictitious=cur_fictitious+1; + cor(k)=-cur_fictitious + [Nf,Df]=rat(o.model.rpar(1),1d-9); + [No,Do]=rat(o.model.rpar(2),1d-9); + sco_mat=[sco_mat;[string(cur_fictitious),string(1),string(Nf)+"/"+string(Df),.. + string(No)+"/"+string(Do),string(4)]] + end + //Adding the VirtualCLK0. Fady 18/11/2007 + elseif o.gui=="VirtualCLK0" then + cur_fictitious=cur_fictitious+1; + cor(k)=-cur_fictitious + sco_mat=[sco_mat;[string(cur_fictitious),string(1),"scicostimeclk0",.. + string(2),string(10)]] + tag_exprs=[tag_exprs;["scicostimeclk0",string(10)]] + elseif or(o.gui==blocks_to_remove) then + cur_fictitious=cur_fictitious+1; + cor(k)=cur_fictitious + elseif o.gui=="SUM_f"|o.gui=="SOM_f" then + nb=nb+1; + corinv(nb)=k; + cor(k)=nb + //scs_m=adjust_sum(scs_m,k) + elseif or(o.gui==port_blocks) then + //here we suppose to be inside a superblock + //may be we can handle this blocks just as blocks_to_remove + if ksup==0 then + scs_m=scs_m_s + hilite_path([path,k],gettext("I/O blocks must be only used in a Super Block"),%f) + disp(mprintf("%s: Port out of hierarchy", "scicos_flat")); + ok=%f;return + end + connected=get_connected(scs_m,k) + if connected==[] then + scs_m=scs_m_s + hilite_path([path,k],gettext("This Super block input port is not connected."),%t) + disp(mprintf("%s: Not connected super block input", "scicos_flat")); + ok=%f;return + end + if or(o.gui==["IN_f","INIMPL_f"]) then + pind=Pind(1) + IN=[IN o.model.ipar] + elseif or(o.gui==["OUT_f","OUTIMPL_f"]) then + pind=Pind(2) + OUT=[OUT o.model.ipar] + elseif or(o.gui==["CLKIN_f","CLKINV_f"]) then + pind=Pind(3) + EIN=[EIN o.model.ipar] + elseif or(o.gui==["CLKOUT_f","CLKOUTV_f"]) then + pind=Pind(4) + EOUT=[EOUT o.model.ipar] + end + //connect the link to the fictitious bloc replacing the superblock + if scs_m.objs(connected).from(1)==k then + scs_m.objs(connected).from(1)=-(pind+o.model.ipar) + end + if scs_m.objs(connected).to(1)==k then + scs_m.objs(connected).to(1)=-(pind+o.model.ipar) + end + elseif o.model.sim(1)=="asuper" then + nb=nb+1 + corinv(nb)=k + cor(k)=nb + if o.graphics.exprs(3).dep_ut($)==%t then + sco_mat=[sco_mat;[string(nb) "-1" "scicostimeclk0" "1" "10"]] + end + elseif o.model.sim=="super"|o.model.sim=="csuper" then + path=[path k] //superbloc path in the hierarchy + //replace superbloc by a set of fictitious blocks (one per port) + //and reconnect links connected to the superblock to these + //ficitious blocks + Pinds=[];if exists("Pind") then Pinds=Pind,end + Pind=[] //base of ports numbering + //mprintf("entering superblock at level "+string(size(path,'*'))+"\r\n") + nb_pin=size(scs_m.objs(k).graphics("pin"),1); + nb_pein=size(scs_m.objs(k).graphics("pein"),1); + for port_type=["pin","pout","pein","peout"] + Pind=[Pind cur_fictitious] + ip=scs_m.objs(k).graphics(port_type); + ki=find(ip>0) + for kk=ki + kc=ip(kk) + //** a link is connected to the same sblock on both ends + if scs_m.objs(kc).to(1)==scs_m.objs(kc).from(1) then + //** regular input port + if port_type=="pin" then + scs_m.objs(kc).to(1)=-(cur_fictitious+scs_m.objs(kc).to(2)); + scs_m.objs(kc).to(2)=1 + + if scs_m.objs(kc).from(3)==0 then //** in connected to out + scs_m.objs(kc).from(1)=-(cur_fictitious+scs_m.objs(kc).from(2)+nb_pin); + scs_m.objs(kc).from(2)=1 + else //** in connected to in + scs_m.objs(kc).from(1)=-(cur_fictitious+scs_m.objs(kc).from(2)); + scs_m.objs(kc).from(2)=1 + end + + //** regular output port + elseif port_type=="pout" then + scs_m.objs(kc).from(1)=-(cur_fictitious+scs_m.objs(kc).from(2)); + scs_m.objs(kc).from(2)=1 + + if scs_m.objs(kc).to(3)==0 then //** out connected to out + scs_m.objs(kc).to(1)=-(cur_fictitious+scs_m.objs(kc).to(2)); + scs_m.objs(kc).to(2)=1 + end + + //** event input port + elseif port_type=="pein" then + scs_m.objs(kc).to(1)=-(cur_fictitious+scs_m.objs(kc).to(2)); + scs_m.objs(kc).to(2)=1 + + scs_m.objs(kc).from(1)=-(cur_fictitious+scs_m.objs(kc).from(2)+nb_pein); + scs_m.objs(kc).from(2)=1 + + //** peout and pein are never connected to themselves + end + + elseif scs_m.objs(kc).to(1)==k then // a link going to the superblock + scs_m.objs(kc).to(1)=-(cur_fictitious+scs_m.objs(kc).to(2)); + scs_m.objs(kc).to(2)=1 + + elseif scs_m.objs(kc).from(1)==k then // a link coming from the superblock + scs_m.objs(kc).from(1)=-(cur_fictitious+scs_m.objs(kc).from(2)); + scs_m.objs(kc).from(2)=1 + end + end + cur_fictitious=cur_fictitious+size(ip,"*") + end + + + //Analyze the superblock contents + [cors,corinvs,lt,cur_fictitious,scop_mat,ok, localIN, localOUT, localEIN, localEOUT]=scicos_flat(o.model.rpar,cur_fictitious,MaxBlock) + if ~ok then + disp(mprintf("%s: Invalid super block at %d", "scicos_flat", k)); + return + end + + // check if the ports has the right order + localIN=-gsort(-localIN); + if or(localIN<>[1:size(localIN,"*")]) then + ok=%f; + msg=gettext("Input ports are not numbered properly.") + hilite_path(path,msg,%t) + disp(mprintf("%s: Input ports are not numbered properly.", "scicos_flat")) + return + end + localOUT=-gsort(-localOUT); + if or(localOUT<>[1:size(localOUT,"*")]) then + ok=%f; + msg=gettext("Output ports are not numbered properly.") + hilite_path(path,msg,%t) + disp(mprintf("%s: Output ports are not numbered properly.", "scicos_flat")) + return + end + localEIN=-gsort(-localEIN); + if or(localEIN<>[1:size(localEIN,"*")]) then + ok=%f; + msg=gettext("Event input ports are not numbered properly.") + hilite_path(path,msg,%t) + disp(mprintf("%s: Event input ports are not numbered properly.", "scicos_flat")) + return + end + localEOUT=-gsort(-localEOUT); + if or(localEOUT<>[1:size(localEOUT,"*")]) then + ok=%f; + msg=gettext("Event output ports are not numbered properly.") + hilite_path(path,msg,%t) + disp(mprintf("%s: Event output ports are not numbered properly.", "scicos_flat")) + return + end + + //shifting the scop_mat for regular blocks. Fady 08/11/2007 + if scop_mat<>[] then + v_mat=find(eval(scop_mat(:,1))0<(:,1)<=nbs);if f<>[] then lt(f,1)=lt(f,1)+nb,end + links_table=[links_table;lt] + + for kk=1:nbs, corinv(nb+kk)=[k,corinvs(kk)];end + cors=shiftcors(cors,nb) + // cur_fictitious=cur_fictitious+nb + cor(k)=cors + nb=nb+nbs + Pind=Pinds + path($)=[] + + else //standard blocks + nb=nb+1 + corinv(nb)=k + //[model,ok]=build_block(o.model) + cor(k)=nb + //Adding the always activated blocks to the sco_mat to take care of the enabling if exists. + //Fady 18/11/2007 + if ~is_modelica_block(o) then + if o.model.dep_ut($) then + sco_mat=[sco_mat;[string(nb) "-1" "scicostimeclk0" "1" "10"]] + end + else + mod_blk_exist=%t // Flag for the existance of modelica's blocks + end + end + elseif x(1)=="Deleted"|x(1)=="Text" then + //this objects are ignored + else //links + Links=[Links k] // memorize their position for use during links analysis + end + end //end of loop on objects + + if ksup==0&nb==0 then + messagebox(msprintf(gettext("%s: Empty diagram"), "Xcos"),"modal") + ok=%f + disp(msprintf("%s: Empty diagram", "scicos_flat")); + return + end + //-------------- Analyse links -------------- + for k=Links + o=scs_m.objs(k); + f=0 + if o.from(1)<0|o.from(1)>MaxBlock then //Link coming from a superblock input port + else + o.from(1)=cor(o.from(1)); + end + if o.to(1)<0 |o.to(1)>MaxBlock then //Link going to a superblock output port + else + o.to(1)=cor(o.to(1)), + end + + if o.ct(2)==2 //implicit links + //if abs(o.from(1))==125|abs(o.to(1))==125 then pause,end + links_table=[links_table + o.from(1:3) o.ct(2) + o.to(1:3) o.ct(2) ] + else //regular or event links + links_table=[links_table + o.from(1:2) -1 o.ct(2) //outputs are tagged with -1 + o.to(1:2) 1 o.ct(2) ] //inputs are tagged with 1 + end + end + // Warning in case of modelica's blocks in an enabled diagram. + // Fady 18/11/2007 + tof=find((sco_mat(:,2)=="1")& (sco_mat(:,5)=="10")) + if tof<>[] then + if mod_blk_exist then + messagebox("Warning the enable does not consider the modelica blocks","modal") + end + end + //----------------------Goto From Analyses-------------------------- + // Local case + if loc_mat<>[] then + for i=1:size(loc_mat,1) + index1=find((from_mat(:,2)=="-1")&(from_mat(:,3)==loc_mat(i,3))&(from_mat(:,4)==loc_mat(i,4))) + for j=index1 + index2=find(links_table(:,1)==-evstr(from_mat(j,1))) + // for k=index2 + // links_table(k,1)=-evstr(loc_mat(i,1)) + // end + if index2<>[] then + links_table(index2',1)=-evstr(loc_mat(i,1)) + end + index2=find(sco_mat(:,1)==from_mat(j,1)) + sco_mat(index2',:)=[] + end + end + end + //scoped case + if tag_exprs<>[] then + //to be modified !!!!! + // vec=unique(tag_exprs) + for i=1:size(tag_exprs,1) + index=find((tag_exprs(:,1)==tag_exprs(i,1))&(tag_exprs(:,2)==tag_exprs(i,2))) + if size(index,"*") > 1 then + messagebox(["Error In Compilation. You cannot have multiple GotoTagVisibility";.. + " with the same tag value in the same scs_m"],"modal") + ok=%f; + disp(mprintf("%s: Multiple GotoTagVisibility at the same level", "scicos_flat")); + return + end + end + + for i=1:size(tag_exprs,1) + index=find((sco_mat(:,2)=="1")&(sco_mat(:,3)==tag_exprs(i,1))&(sco_mat(:,4)=="2")&(sco_mat(:,5)==tag_exprs(i,2))) + if index<>[] then + if size(index,"*")>1 then + messagebox(["Error in compilation";"Multiple GOTO are taged by the same GotoTagVisibility"],"modal") + ok=%f + disp(mprintf("%s: Shared GotoTagVisibility across GOTO", "scicos_flat")); + return + end + index1=find((sco_mat(:,2)=="-1")&(sco_mat(:,3)==tag_exprs(i,1))&(sco_mat(:,5)==tag_exprs(i,2))) + if index1<>[] then + for j=index1 + index2=find(links_table(:,1)==-evstr(sco_mat(j,1))) + if index2<>[] then + links_table(index2',1)=-evstr(sco_mat(index,1)) + end + //linking the always active blocks to the VirtualCLK0 if exists. + if sco_mat(j,5)=="10" then + links_table($+1,:)=[-evstr(sco_mat(index,1)) 1 -1 -1] + links_table($+1,:)=[evstr(sco_mat(j,1)) 0 1 -1] + end + end + end + sco_mat([index1';index'],:)=[] + //sco_mat(index,:)=[] + end + end + end + //global case + // function global_case in c_pass1 + //------------------------------------------------------------------------ +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_graphics.bin b/modules/scicos/macros/scicos_scicos/scicos_graphics.bin new file mode 100755 index 000000000..68d6fd830 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_graphics.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_graphics.sci b/modules/scicos/macros/scicos_scicos/scicos_graphics.sci new file mode 100755 index 000000000..bf385ca07 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_graphics.sci @@ -0,0 +1,61 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function graphics=scicos_graphics(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10,... + v11,v12,v13,v14,v15,v16,v17,v18,v19,v20) + //initialisation de graphics mlist + if exists("orig","local")==0 then orig=[0 0],end + if exists("sz","local")==0 then sz=[20 20],end + if exists("flip","local")==0 then flip=%t,end + if exists("theta","local")==0 then theta=0,end + if exists("exprs","local")==0 then exprs=[],end + if exists("pin","local")==0 then pin=[],end + if exists("pout","local")==0 then pout=[],end + if exists("pein","local")==0 then pein=[],end + if exists("peout","local")==0 then peout=[],end + if exists("gr_i","local")==0 then gr_i=[],end + if exists("id","local")==0 then id="",end + if exists("in_implicit","local")==0 then + I="E"; + in_implicit=I(ones(pin(:))); + end + if exists("out_implicit","local")==0 then + I="E"; + out_implicit=I(ones(pout(:))); + end + if exists("in_style","local")==0 then + in_style=emptystr(pin); + end + if exists("out_style","local")==0 then + out_style=emptystr(pout); + end + if exists("in_label","local")==0 then + in_label=emptystr(pin); + end + if exists("out_label","local")==0 then + out_label=emptystr(pout); + end + if exists("style","local")==0 then style="" + [],end + + graphics=mlist(["graphics","orig","sz","flip","theta","exprs","pin",.. + "pout","pein","peout","gr_i","id","in_implicit","out_implicit","in_style","out_style","in_label","out_label","style"],.. + orig,sz,flip,theta,exprs,pin,pout,pein,peout,gr_i,id,in_implicit,out_implicit,in_style,out_style,in_label,out_label,style) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_include_paths.bin b/modules/scicos/macros/scicos_scicos/scicos_include_paths.bin new file mode 100755 index 000000000..f9c3b9eb1 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_include_paths.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_include_paths.sci b/modules/scicos/macros/scicos_scicos/scicos_include_paths.sci new file mode 100755 index 000000000..17c0a4e92 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_include_paths.sci @@ -0,0 +1,46 @@ +// Copyright (C) INRIA - METALAU Project +// Copyright (C) DIGITEO - 2010 - Allan CORNET +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function p = scicos_include_paths(modules) + + if argn(2) < 1 then + modules = ["scicos_blocks", "dynamic_link", "scicos", "core"]; + end + + p = []; + + if getos() == "Windows" then + // Windows + p= """" + SCI + "/modules/" + modules + "/includes" + """"; + else + //Unix + if isdir(SCI+"/modules/core/includes/") then + // source version + p = SCI + "/modules/" + modules + "/includes"; + elseif isdir(SCI+"/../../include/scilab/core/") then + // binary version + p = SCI + "/../../include/scilab/" + modules; + elseif isdir("/usr/include/scilab/") then + // packaged version + p = []; + end + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_link.bin b/modules/scicos/macros/scicos_scicos/scicos_link.bin new file mode 100755 index 000000000..49785c7d3 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_link.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_link.sci b/modules/scicos/macros/scicos_scicos/scicos_link.sci new file mode 100755 index 000000000..0f42bbaa9 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_link.sci @@ -0,0 +1,34 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function lnk=scicos_link(v1,v2,v3,v4,v5,v6,v7,v8) + //initialisation de link mlist + if exists("xx","local")==0 then xx=[],end + if exists("yy","local")==0 then yy=[],end + if exists("id","local")==0 then id="",end + if exists("thick","local")==0 then thick=[0,0],end + if exists("ct","local")==0 then ct=[1,1],end + if exists("from","local")==0 then from=[],end + if exists("to","local")==0 then to=[],end + lnk=mlist(["Link","xx","yy","id","thick","ct","from","to"],.. + xx,yy,id,thick,ct,from,to) + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_model.bin b/modules/scicos/macros/scicos_scicos/scicos_model.bin new file mode 100755 index 000000000..c3024fcc2 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_model.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_model.sci b/modules/scicos/macros/scicos_scicos/scicos_model.sci new file mode 100755 index 000000000..a0c4d8757 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_model.sci @@ -0,0 +1,56 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function model=scicos_model(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10,v11,v12,v13,v14,v15,v16,... + v17,v18,v19,v20,v21,v22,v23,v24,v25,v26) + + //initialisation de model mlist + if exists("sim","local")==0 then sim="",end + if exists("in","local")==0 then in=[],end + if exists("in2","local")==0 then in2=[],end + if exists("intyp","local")==0 then intyp=1,end + if exists("out","local")==0 then out=[],end + if exists("out2","local")==0 then out2=[],end + if exists("outtyp","local")==0 then outtyp=1,end + if exists("evtin","local")==0 then evtin=[],end + if exists("evtout","local")==0 then evtout=[],end + if exists("state","local")==0 then state=[],end + if exists("dstate","local")==0 then dstate=[],end + if exists("odstate","local")==0 then odstate=list(),end + if exists("opar","local")==0 then opar=list(),end + if exists("rpar","local")==0 then rpar=[],end + if exists("ipar","local")==0 then ipar=[],end + if exists("blocktype","local")==0 then blocktype="c",end + if exists("firing","local")==0 then firing=[],end + if exists("dep_ut","local")==0 then dep_ut=[%f %f],end + if exists("label","local")==0 then label="",end + if exists("nzcross","local")==0 then nzcross=0,end + if exists("nmode","local")==0 then nmode=0,end + if exists("equations","local")==0 then equations=list(),end + if exists("uid","local")==0 then uid="",end + + model=mlist(["model","sim","in","in2","intyp","out","out2","outtyp",... + "evtin","evtout","state","dstate","odstate","rpar","ipar","opar",... + "blocktype","firing","dep_ut","label","nzcross",.. + "nmode","equations","uid"],.. + sim,in,in2,intyp,out,out2,outtyp,evtin,evtout,state,dstate,odstate,.. + rpar,ipar,opar,blocktype,firing,dep_ut,label,nzcross,nmode,equations,uid) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_params.bin b/modules/scicos/macros/scicos_scicos/scicos_params.bin new file mode 100755 index 000000000..7e9a1ca8e Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_params.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_params.sci b/modules/scicos/macros/scicos_scicos/scicos_params.sci new file mode 100755 index 000000000..9deaf8c1e --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_params.sci @@ -0,0 +1,48 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function params=scicos_params(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10) + if exists("wpar","local")==0 then wpar=[600,450,0,0,600,450],end + if exists("title","local")==0 & exists("Title","local")==0 then + titlex="Untitled" + else + if exists("title","local")==1 then + titlex=title + elseif exists("Title","local")==1 then + titlex=Title + end + end + if exists("tf","local")==0 then tf=100000,end + if exists("tol","local")==0 then tol=[1.d-6,1.d-6,1.d-10,tf+1,0,1,0],end + if exists("context","local")==0 then context=[],end + void1=[] + if exists("options","local")==0 then options=default_options(),end + void2=[] + void3=[] + if exists("doc","local")==0 then doc=list(),end + + params=tlist(["params","wpar","title","tol","tf","context",.. + "void1","options","void2","void3","doc"],.. + wpar,titlex,tol,tf,context,void1,options,void2,.. + void3,doc) + +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/scicos_sim.bin b/modules/scicos/macros/scicos_scicos/scicos_sim.bin new file mode 100755 index 000000000..8f12b04b0 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_sim.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_sim.sci b/modules/scicos/macros/scicos_scicos/scicos_sim.sci new file mode 100755 index 000000000..3a32c7211 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_sim.sci @@ -0,0 +1,75 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function sim=scicos_sim(v1,v2,v3,v4,v5,.. + v6,v7,v8,v9,v10,.. + v11,v12,v13,v14,v15,.. + v16,v17,v18,v19,v20,.. + v21,v22,v23,v24,v25,.. + v26,v27,v28,v29,v30,.. + v31,v32,v33,v34,v35,.. + v36,v37,v38,v39,v40) + if exists("funs","local")==0 then funs=[],end + if exists("xptr","local")==0 then xptr=[],end + if exists("zptr","local")==0 then zptr=[],end + if exists("ozptr","local")==0 then ozptr=[],end + if exists("zcptr","local")==0 then zcptr=[],end + if exists("inpptr","local")==0 then inpptr=[],end + if exists("outptr","local")==0 then outptr=[],end + if exists("inplnk","local")==0 then inplnk=[],end + if exists("outlnk","local")==0 then outlnk=[],end + if exists("rpar","local")==0 then rpar=[],end + if exists("rpptr","local")==0 then rpptr=[],end + if exists("ipar","local")==0 then ipar=[],end + if exists("ipptr","local")==0 then ipptr=[],end + if exists("opar","local")==0 then opar=list(),end + if exists("opptr","local")==0 then opptr=[],end + if exists("clkptr","local")==0 then clkptr=[],end + if exists("ordptr","local")==0 then ordptr=[],end + if exists("execlk","local")==0 then execlk=[],end + if exists("ordclk","local")==0 then ordclk=[],end + if exists("cord","local")==0 then cord=[],end + if exists("oord","local")==0 then oord=[],end + if exists("zord","local")==0 then zord=[],end + if exists("critev","local")==0 then critev=[],end + if exists("nb","local")==0 then nb=[],end + if exists("ztyp","local")==0 then ztyp=[],end + if exists("nblk","local")==0 then nblk=[],end + if exists("ndcblk","local")==0 then ndcblk=[],end + if exists("subscr","local")==0 then subscr=[],end + if exists("funtyp","local")==0 then funtyp=[],end + if exists("iord","local")==0 then iord=[],end + if exists("labels","local")==0 then labels=[],end + if exists("modptr","local")==0 then modptr=[],end + if exists("uids","local")==0 then uids=[],end + sim=tlist(["scs","funs","xptr","zptr","ozptr",.. + "zcptr","inpptr","outptr","inplnk","outlnk","rpar",.. + "rpptr","ipar","ipptr","opar","opptr",.. + "clkptr","ordptr","execlk","ordclk","cord","oord","zord",.. + "critev","nb","ztyp","nblk","ndcblk","subscr","funtyp",.. + "iord","labels","modptr","uids"],.. + funs,xptr,zptr,ozptr,zcptr,inpptr,.. + outptr,inplnk,outlnk,rpar,rpptr,ipar,ipptr,.. + opar,opptr,clkptr,ordptr,.. + execlk,ordclk,cord,oord,zord,.. + critev,nb,ztyp,nblk,ndcblk,.. + subscr,funtyp,iord,labels,modptr,uids) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_state.bin b/modules/scicos/macros/scicos_scicos/scicos_state.bin new file mode 100755 index 000000000..4e367e025 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_state.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_state.sci b/modules/scicos/macros/scicos_scicos/scicos_state.sci new file mode 100755 index 000000000..06d2b731f --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_state.sci @@ -0,0 +1,34 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function state=scicos_state(v1,v2,v3,v4,v5,v6,v7,v8,v9,v10,v11) + //initialisation de state mlist + if exists("x","local")==0 then x=[],end + if exists("z","local")==0 then z=[],end + if exists("oz","local")==0 then oz=list,end + if exists("iz","local")==0 then iz=[],end + if exists("tevts","local")==0 then tevts=[],end + if exists("evtspt","local")==0 then evtspt=[],end + if exists("pointi","local")==0 then pointi=1,end + if exists("outtb","local")==0 then outtb=list(),end + state=tlist(["xcs","x","z","oz","iz","tevts","evtspt","pointi","outtb"],.. + x,z,iz,tevts,evtspt,pointi,outtb) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scicos_txtedit.bin b/modules/scicos/macros/scicos_scicos/scicos_txtedit.bin new file mode 100755 index 000000000..24cb0fd12 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scicos_txtedit.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scicos_txtedit.sci b/modules/scicos/macros/scicos_scicos/scicos_txtedit.sci new file mode 100755 index 000000000..a7155b304 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scicos_txtedit.sci @@ -0,0 +1,30 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function param=scicos_txtedit(v1,v2,v3,v4,v5) + // Copyright INRIA + // Scicos text editor param structure + if exists("typ","local")==0 then typ="", end + if exists("ttitle","local")==0 then ttitle="", end + if exists("head","local")==0 then head=[], end + if exists("clos","local")==0 then clos=0, end + + param=mlist(["TxtEdit","typ","title","head","clos"],typ,ttitle,head,clos) +endfunction diff --git a/modules/scicos/macros/scicos_scicos/script2var.bin b/modules/scicos/macros/scicos_scicos/script2var.bin new file mode 100755 index 000000000..b1e8e3ff1 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/script2var.bin differ diff --git a/modules/scicos/macros/scicos_scicos/script2var.sci b/modules/scicos/macros/scicos_scicos/script2var.sci new file mode 100755 index 000000000..635ffbeb8 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/script2var.sci @@ -0,0 +1,89 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// Copyright (C) 2011 - INRIA - Serge Steer + +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [%ll,%ierr] = script2var(%txt, %ll) + //** [%scicos_context, ierr] = script2var(context, %scicos_context) + //** context is the scs_m.props.context (string array) associated with the current level + //** %scicos_context is a struct containing the values defined by the + // calling contexts + //** + //** 10 Jan 2006 + //local variable names are prefixed with a % to limit conflicts with + //variables defined in %txt instructions + %ierr = 0 ; //** init + + //next lines checks if variable defined in %ll struct can be evaluated + //why ??? + %mm = fieldnames(%ll)'; + for %mi=%mm + if execstr(%mi+"=%ll(%mi)","errcatch")<>0 then + mprintf("%s\n",lasterror()) + %ierr=1 + return + end + end + [%ll,%ierr] = getvardef(%txt,%ll) + if %ierr<>0 then return, end +endfunction + +//**-------------------------------------------------------------------------- +function [%ll,%ierr]=getvardef(%txt,%ll) + //extend and modify the %scicos_context variable (%ll) with the variable + //defined in the current level scs_m.props.context (%txt) instructions + + //local variable names are prefixed with a % to limit conflicts with + //variables defined in %txt instructions + + %nww="";%ierr=0; // to make sure %nww and %ierr does not enter the difference + if isempty(%txt) then return,end + %nww=size(who("get"),"*") + + %ierr=execstr(%txt,"errcatch") + if %ierr<>0 then mprintf("%s\n",lasterror()), return,end + + %mm=who("get") + %mm=%mm(1:size(%mm,"*")-%nww) + //%mm contains the list of the variables defined by execstr(%txt,'errcatch') + for %mi=%mm(:)' + if %mi=="scs_m" then + mprintf(_("The variable name %s cannot be used as block parameter: ignored"),"scs_m"); + continue + elseif %mi=="ans" then + continue + end + + clear %v + %v=evstr(%mi); + + if typeof(%v)=="scs_m" then + mprintf(_("The variable name %s cannot be used as block parameter: ignored"),"scs_m") + continue + elseif or(type(%v)==[11 13 14]) then + continue + end + + %ll(%mi)=%v; + clear %v + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/scs_full_path.bin b/modules/scicos/macros/scicos_scicos/scs_full_path.bin new file mode 100755 index 000000000..5897dde40 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scs_full_path.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scs_full_path.sci b/modules/scicos/macros/scicos_scicos/scs_full_path.sci new file mode 100755 index 000000000..4986982b2 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scs_full_path.sci @@ -0,0 +1,31 @@ +// Scicos +// +// Copyright (C) INRIA - Serge Steer +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function path=scs_full_path(P) + // Given a path in the superclock hierachy, this function returns a path + // in the scs_m data structure + // P is a vector of numbers. All but the last entries are Superblocks index + // path is a list such as scs_m(path) is the required object + + path=list("objs"); + for l=P(1:$-1),path($+1)=l;path($+1)="model";path($+1)= "rpar";path($+1)="objs";end + path($+1)=P($); +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scs_show.bin b/modules/scicos/macros/scicos_scicos/scs_show.bin new file mode 100755 index 000000000..34d6a5fe5 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scs_show.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scs_show.sci b/modules/scicos/macros/scicos_scicos/scs_show.sci new file mode 100755 index 000000000..61aea6699 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scs_show.sci @@ -0,0 +1,47 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function scs_show(scs_m, win) + //** + //** 24 Nov 2006: Super simplified version + //** + + if %scicos_debug_gr then + disp(_("scs_show active...")) + end + + gh_curwin = scf(win) ; + + if ~set_cmap(scs_m.props.options("Cmap")) then // add colors if required + scs_m.props.options("3D")(1)=%f //disable 3D block shape + end + + options = scs_m.props.options ; //** not used + + set_background(gh_curwin) ; + pwindow_set_size(gh_curwin) ; + window_set_size(gh_curwin) ; + + scs_m.props.title(1) = msprintf(_("Scilab Graphics of %s"),scs_m.props.title(1)) + + drawobjs(scs_m, gh_curwin) + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/scstxtedit.bin b/modules/scicos/macros/scicos_scicos/scstxtedit.bin new file mode 100755 index 000000000..f2b31006e Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/scstxtedit.bin differ diff --git a/modules/scicos/macros/scicos_scicos/scstxtedit.sci b/modules/scicos/macros/scicos_scicos/scstxtedit.sci new file mode 100755 index 000000000..0d60cbbbe --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/scstxtedit.sci @@ -0,0 +1,62 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +//## scstxtedit : Input function of the text editor +//## We exit from that function if Quit or use +//## the commit button. +//## +//## Inputs : str_in : the input text to edit +//## clos : a flag to close the window +//## 0 : No +//## 1 : close +//## +//## str_out : the edited output text +//## can be [] if abort +//## Quit : a flag to say if the buffer has been +//## closed +//## 0 : No +//## 1 : Quit +//## +function [str_out,Quit] = scstxtedit(str_in,ptxtedit) + //** check lhs/rhs arg + [lhs,rhs]=argn(0) + + //## param from ptxtedit + clos = ptxtedit.clos + typ = ptxtedit.typ + head = ptxtedit.head + + if clos<>1 then + if head==[] then + str_out = dialog(["DIALOG"], str_in) ; + else + str_out = dialog([head], str_in) ; + end + else + str_out=[]; + end + + if str_out == [] then + Quit = 1 + else + Quit = 0 + end + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/set_io.bin b/modules/scicos/macros/scicos_scicos/set_io.bin new file mode 100755 index 000000000..867dae496 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/set_io.bin differ diff --git a/modules/scicos/macros/scicos_scicos/set_io.sci b/modules/scicos/macros/scicos_scicos/set_io.sci new file mode 100755 index 000000000..429854bf4 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/set_io.sci @@ -0,0 +1,284 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [model,... + graphics,... + ok]=set_io(model,... + graphics,... + in#,... + out#,... + clkin,... + clkout,... + in_implicit,... + out_implicit) + // CHECK + if argn(2)<=6 then + in_implicit=[] + out_implicit=[], end + deff("[str__err]=str__err(err__,"+... + "str__#)",... + ["str__err=''ERROR''" + "select err__" + "case 1 then" + "str__err=str__#+... + ''put port "+... + "must be "+... + " list''" + "case 2 then" + "str__err=str__#+... + ''put list "+... + "must have "+... + "a size "+... + "of 2''" + "case 3 then" + "str__err=''First entry of ''+... + str__#+... + ''put list "+... + " must be "+... + "double "+... + "or integer''" + "case 4 then" + "str__err=''Second entry of ''+... + str__#+... + ''put list "+... + "must be "+... + "double "+... + "or integer''" + "case 10 then" + "str__err=str__#+... + ''put port "+... + "sizes "+... + "must have "+... + "a dimension "+... + "of nx2''" + "case 11 then" + "str__err=str__#+... + ''put port "+... + "sizes and ''+... + str__#+... + ''put port "+... + "type "+... + "must have "+... + "the same number "+... + "of rows''" + "case 100 then" + "str__err=str__#+... + ''put port "+... + "type must "+... + "be <=8''" + "end"]) + deff("[var,"+... + "vart,"+... + "ierr,"+... + "ko]=extract__(var#)",... + ["ko=%f" + "ierr=0" + "var=[]" + "vart=1" + "if type(var#)<>15 then" + "ierr=1," + "resume, end" + "if var#<>list() then" + "if lstsize(var#)<>2 then" + "ierr=2," + "resume, end" + "for i=1:2" + "if ~(type(var#(i))==1|"+... + "type(var#(i))==8) then" + "ierr=2+i," + "resume, end" + "end" + "if var#(1)<>[] then" + "if size(var#(1),2)<>2 then" + "ierr=10," + "resume, end" + "if size(var#(1),1)<>"+... + "size(var#(2)(:),1) then" + "ierr=11," + "resume, end" + "if max(var#(2))>8 then" + "ierr=100," + "resume, end" + "var=int(var#(1))" + "vart=int(var#(2)(:))" + "end" + "end" + "ko=%t"]) + [in,... + in_t,... + err__,... + ko]=extract__(in#) + if ~ko then + messagebox("set_io : "+ str__err(err__,"in") , "modal") + ok=%f + return, end + [out,.. + out_t,... + err__,... + ko]=extract__(out#) + if ~ko then + messagebox("set_io : "+ str__err(err__, "out") ,"modal") + ok=%f + return, end + + clkin=int(clkin(:)) + nclkin=size(clkin,1) + if nclkin>0 then + if min(clkin)<1 then + messagebox("set_io : " + "Event input ports sizes must be positive","modal") + ok=%f + return, end + end + clkout=int(clkout(:)) + nclkout=size(clkout,1) + if nclkout>0 then + if min(clkout)<1 then + messagebox("set_io : "+ "Event output ports sizes must be positive","modal") + ok=%f + return, end + end + + // set_io first check if given numbe + // of ports agree with block connection + [label,... + ip1,... + op1,... + cip1,... + cop1]=(graphics.exprs,... + graphics.pin,... + graphics.pout,... + graphics.pein,... + graphics.peout) + [in1,... + in2,... + intyp,... + out1,... + out2,... + outtyp,... + clkin1,... + clkout1]=(model.in,... + model.in2,... + model.intyp,... + model.out,... + model.out2,... + model.outtyp,... + model.evtin,... + model.evtout) + + n1=size(in1(:,1),"*") //current number of input port of model + n=size(in(:,1),"*") //given number of input port + if n1>n then + // if or(ip1(n+1:$)>0) then + // messagebox('set_io : '+'Connected ports cannot be suppressed','modal') + // ok=%f + // return, end + ip1=ip1(1:n) + else + ip1=[ip1;zeros(n-n1,1)] + end + n1=size(out1(:,1),"*") + n=size(out(:,1),"*") + if n1>n then + // if or(op1(n+1:$)>0) then + // messagebox('set_io : '+... + // 'Connected ports cannot be suppressed', 'modal') + // ok=%f + // return, end + op1=op1(1:n) + else + op1=[op1;zeros(n-n1,1)] + end + + n1=size(clkin1,"*") + n=size(clkin,"*") + if n1>n then + // if or(cip1(n+1:$)>0) then + // messagebox('set_io : '+... + // 'Connected ports cannot be suppressed','modal') + // ok=%f + // return, end + cip1=cip1(1:n) + else + cip1=[cip1;zeros(n-n1,1)] + end + n1=size(clkout1,"*") + n=size(clkout,"*") + if n1>n then + // if or(cop1(n+1:$)>0) then + // messagebox('set_io : '+... + // 'Connected ports cannot be suppressed','modal') + // ok=%f + // return, end + cop1=cop1(1:n) + else + cop1=[cop1;zeros(n-n1,1)] + end + + I="E" + + if ip1<>[] then + in_impl=I(ones(ip1)) + in_impl(in_implicit)="I" + // kk=size(graphics.in_implicit,'*') + // k=find(ip1<>0) //connected links + // k=k(find(k<=kk)) + // if or(graphics.in_implicit(k)<>in_impl(k)) then + // messagebox('set_io : '+... + // 'Connected ports types cannot be changed','modal') + // ok=%f + // return, end + else + in_impl=[] + end + if op1<>[] then + out_impl=I(ones(op1)) + out_impl(out_implicit)="I" + // kk=size(graphics.out_implicit,'*') + // k=find(op1<>0) //connected links + // k=k(find(k<=kk)) + // if or(graphics.out_implicit(k)<>out_impl(k)) then + // messagebox('set_io : '+... + // 'Connected ports types cannot be changed','modal') + // ok=%f + // return, end + else + out_impl=[] + end + + // SET + ok=%t + graphics.pin=ip1 + graphics.pout=op1 + graphics.pein=cip1 + graphics.peout=cop1 + graphics.in_implicit=in_impl + graphics.out_implicit=out_impl + model.in=in(:,1) + model.in2=in(:,2) + model.intyp=in_t + model.out=out(:,1) + model.out2=out(:,2) + model.outtyp=out_t + model.evtin=clkin + model.evtout=clkout + +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/setvalue.bin b/modules/scicos/macros/scicos_scicos/setvalue.bin new file mode 100755 index 000000000..0d1ad7bfd Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/setvalue.bin differ diff --git a/modules/scicos/macros/scicos_scicos/setvalue.sci b/modules/scicos/macros/scicos_scicos/setvalue.sci new file mode 100755 index 000000000..742c1aac3 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/setvalue.sci @@ -0,0 +1,282 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// - Alan Layec +// Copyright (C) 2010 - DIGITEO - Clément DAVID +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [%ok,%1,%2,%3,%4,%5,... + %6,%7,%8,%9,%10,... + %11,%12,%13,%14,%15,... + %16,%17,%18,%19,%20,... + %21,%22,%23,%24,%25,... + %26,%27,%28,%29,%30]=setvalue(%desc,%lables,%typ,%ini) + + // To avoid infinite loops in set section of blocks during eval + if %scicos_prob==%t then + %ok=%f + [%1,%2,%3,%4,%5,... + %6,%7,%8,%9,%10,... + %11,%12,%13,%14,%15,... + %16,%17,%18,%19,%20,... + %21,%22,%23,%24,%25,... + %26,%27,%28,%29,%30]=(0,0,0,0,0,... + 0,0,0,0,0,... + 0,0,0,0,0,... + 0,0,0,0,0,... + 0,0,0,0,0,... + 0,0,0,0,0) + return;end + // setvalues - data acquisition, getvalue equivalent without dialog + //%Syntax + // [%ok,x1,..,x18]=setvalue(desc,labels,typ,ini) + //%Parameters + // desc : column vector of strings, dialog general comment + // labels : n column vector of strings, labels(i) is the label of + // the ith required value + // typ : list(typ1,dim1,..,typn,dimn) + // typi : defines the type of the ith required value + // if may have the following values: + // 'mat' : stands for matrix of scalars + // 'col' : stands for column vector of scalars + // 'row' : stands for row vector of scalars + // 'vec' : stands for vector of scalars + // 'str' : stands for string + // 'lis' : stands for list + // 'pol' : stands for polynomials + // 'r' : stands for rational + // dimi : defines the size of the ith required value + // it must be + // - an integer or a 2-vector of integers (-1 stands for + // arbitrary dimension) + // - an evaluatable character string + // ini : n column vector of strings, ini(i) gives the suggested + // response for the ith required value + // %ok : boolean ,%t if %ok button pressed, %f if cancel button pressed + // xi : contains the ith required value if %ok==%t + //%Description + // getvalues function uses ini strings to evaluate required args + // with error checking, + //%Remarks + // All correct scilab syntax may be used as responses, for matrices + // and vectors getvalues automatically adds [ ] around the given response + // before numerical evaluation + //%Example + // labels=['magnitude';'frequency';'phase ']; + // [ampl,freq,ph]=setvalue('define sine signal',labels,.. + // list('vec',1,'vec',1,'vec',1),['0.85';'10^2';'%pi/3']) + // + //%See also + // x_mdialog, dialog + //! + // 17/01/07 -Alan- - %scicos_context behavior reviewed in accordance to context_evstr macro + // - pass int in field of type vec/mat/row/col (F. Nassif's Work) + // + // 05/02/07 -Alan- : update to %20 rhs parameters + // + // Copyright INRIA + [%lhs,%rhs]=argn(0) + + %nn=prod(size(%lables)) + if %lhs<>%nn+2&%lhs<>%nn+1 then error(41),end + if size(%typ)<>2*%nn then + error("typ : list(''type'',[sizes],...)") + end + %1=[];%2=[];%3=[];%4=[];%5=[]; + %6=[];%7=[];%8=[];%9=[];%10=[]; + %11=[];%12=[];%13=[];%14=[],%15=[]; + %16=[];%17=[];%18=[];%19=[],%20=[]; + %21=[];%22=[];%23=[];%24=[],%25=[]; + %26=[];%27=[];%28=[];%29=[],%30=[]; + + if %rhs==3 then %ini=emptystr(%nn,1),end + %ok=%t + while %t do + %str=%ini; + if %str==[] then %ok=%f,break,end + for %kk=1:%nn + %cod=ascii(%str(%kk)) + %spe=find(%cod==10) + if %spe<>[] then + %semi=ascii(";") + %cod(%spe)=%semi*ones(%spe') + %str(%kk)=ascii(%cod) + end + end + + [%vv_list,%ierr_vec]=context_evstr(%str,%scicos_context,%typ); + + %noooo=0 + for %kk=1:%nn + %vv=%vv_list(%kk) + %ierr=%ierr_vec(%kk) + select part(%typ(2*%kk-1),1:6) + case "mat " + if %ierr<>0 then + %noooo=-%kk,break, + end + //29/12/06 + //the type of %vv is accepted if it is constant or integer + if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + [%mmmm,%nnnnn]=size(%vv) + %ssss=string(%sz(1))+"-by-"+string(%sz(2)) + " matrix" + if %mmmm*%nnnnn==0 then + if %sz(1)>=0&%sz(2)>=0&%sz(1)*%sz(2)<>0 then %noooo=%kk,break,end + else + if %sz(1)>=0 then if %mmmm<>%sz(1) then %noooo=%kk,break,end,end + if %sz(2)>=0 then if %nnnnn<>%sz(2) then %noooo=%kk,break,end,end + end + case "vec " + if %ierr<>0 then + %noooo=-%kk,break, + end + //17/01/07 + //the type of %vv is accepted if it is constant or integer + if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + %ssss=string(%sz(1)) + %nnnnn=prod(size(%vv)) + if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end + case "intvec" + if %ierr<>0 then + %noooo=-%kk,break, + end + //the type of %vv is accepted if it is constant or integer + if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + %ssss=string(%sz(1)) + %nnnnn=prod(size(%vv)) + if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end + case "pol " + if %ierr<>0 then + %noooo=-%kk,break, + end + if %ierr<>0 then %noooo=-%kk;break,end + if (type(%vv)>2 & type(%vv)<>8) then %noooo=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + %ssss=string(%sz(1)) + %nnnnn=prod(size(%vv)) + if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end + case "row " + if %ierr<>0 then + %noooo=-%kk,break, + end + //17/01/07 + //the type of %vv is accepted if it is constant or integer + if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + if %sz(1)<0 then + %ssss="1-by-n matrix" + else + %ssss="1-by-"+string(%sz(1))+" matrix" + end + [%mmmm,%nnnnn]=size(%vv) + if %mmmm<>1 then %noooo=%kk,break,end, + if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end + case "col " + if %ierr<>0 then + %noooo=-%kk,break, + end + //17/01/07 + //the type of %vv is accepted if it is constant or integer + if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + if %sz(1)<0 then + %ssss="m-by-1 matrix" + else + %ssss=string(%sz(1))+"-by-1 matrix" + end + [%mmmm,%nnnnn]=size(%vv) + if %nnnnn<>1 then %noooo=%kk,break,end, + if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end + case "str " + clear %vv + %vv=%str(%kk) + if type(%vv)<>10 then %noooo=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + %ssss=string(%sz(1)) + %nnnnn=prod(size(%vv)) + if %sz(1)>=0 then if %nnnnn<>1 then %noooo=%kk,break,end,end + case "lis " + if %ierr<>0 then + %noooo=-%kk,break, + end + if type(%vv)<>15& type(%vv)<>16& type(%vv)<>17 then %noooo=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + %ssss=string(%sz(1)) + %nnnnn=size(%vv) + if %sz(1)>=0 then if %nnnnn<>%sz(1) then %noooo=%kk,break,end,end + case "r " + if %ierr<>0 then + %noooo=-%kk,break, + end + if type(%vv)<>16 then %noooo=-%kk,break,end + if typeof(%vv)<>"rational" then %noooo=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + [%mmmm,%nnnnn]=size(%vv(2)) + %ssss=string(%sz(1))+"-by-"+string(%sz(2)) + if %mmmm*%nnnnn==0 then + if %sz(1)>=0&%sz(2)>=0&%sz(1)*%sz(2)<>0 then %noooo=%kk,break,end + else + if %sz(1)>=0 then if %mmmm<>%sz(1) then %noooo=%kk,break,end,end + if %sz(2)>=0 then if %nnnnn<>%sz(2) then %noooo=%kk,break,end,end + end + case "gen " + //accept all + else + str = gettext("%s: Type %s is not implemented.\n"); + mess = msprintf(str, arg1.gui + "(''set'')", %typ(2*%kk-1)); + if length(arg1.doc) > 0 then + warnBlockByUID(arg1.doc(1), mess); // arg1 is from the block interface function + else + error(mess); + end + end + execstr("%"+string(%kk)+"=%vv") + clear %vv + end + if %noooo>0 then + str = gettext("%s: Wrong size for block parameter ''%s'': %s expected, getting %s"); + mess = msprintf(str, arg1.gui + "(''set'')", %lables(%noooo), %ssss, %ini(%noooo)); + if length(arg1.doc) > 0 then + warnBlockByUID(arg1.doc(1), mess); // arg1 is from the block interface function + else + disp(mess); + end + %ini=%str + %ok=%f;break + elseif %noooo<0 then + str = gettext("%s: Wrong type for block parameter ''%s'': %s(%s) expected, getting %s"); + mess = msprintf(str, arg1.gui + "(''set'')", %lables(-%noooo), %typ(-2*%noooo-1), strcat(string(%typ(-2*%noooo))," by "), %ini(-%noooo)); + if length(arg1.doc) > 0 then + warnBlockByUID(arg1.doc(1), mess); // arg1 is from the block interface function + else + disp(mess); + end + %ini=%str + %ok=%f;break + else + break + end + end + if %lhs==%nn+2 then + execstr("%"+string(%lhs-1)+"=%str") + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/shiftcors.bin b/modules/scicos/macros/scicos_scicos/shiftcors.bin new file mode 100755 index 000000000..c3827b83e Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/shiftcors.bin differ diff --git a/modules/scicos/macros/scicos_scicos/shiftcors.sci b/modules/scicos/macros/scicos_scicos/shiftcors.sci new file mode 100755 index 000000000..c96b11d71 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/shiftcors.sci @@ -0,0 +1,32 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function cors=shiftcors(cors,ns) + n=size(cors) + for k=1:n + if type(cors(k))==15 then + cors(k)=shiftcors(cors(k),ns) + else + if cors(k)<0 then cors(k)=cors(k); + elseif cors(k)<>0 then cors(k)=cors(k)+ns,end + end + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/split_lasterror.bin b/modules/scicos/macros/scicos_scicos/split_lasterror.bin new file mode 100755 index 000000000..473217102 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/split_lasterror.bin differ diff --git a/modules/scicos/macros/scicos_scicos/split_lasterror.sci b/modules/scicos/macros/scicos_scicos/split_lasterror.sci new file mode 100755 index 000000000..5ee5d1aa1 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/split_lasterror.sci @@ -0,0 +1,47 @@ +// Scicos +// +// Copyright (C) INRIA - Alan Layec +// Copyright (C) 2012-2012 - Scilab Enterprises - Bruno JOFRET +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function str_out=split_lasterror(str_in) + //** Fix the unreadable error messages + //** returned by the simulator. + //** Alan, 11/10/07 : Initial rev + str_out = []; + for nLine = 1:size(str_in, "r") + ind_bl=strindex(str_in(nLine)," "); + + // Find some room in a line with more than 50 characters. + if find(ind_bl > 50) <> [] then + ind_bl2 = ind_bl; + nind = []; + for i = 1:size(ind_bl,2) + if ind_bl2(i) > 50 then + nind = [nind ; ind_bl(i)]; + ind_bl2 = ind_bl2 - ind_bl2(i); + end + end + str_out = [str_out ; strsplit(str_in(nLine),nind)] + else + str_out = [str_out ; str_in(nLine)]; + end + + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/standard_define.bin b/modules/scicos/macros/scicos_scicos/standard_define.bin new file mode 100755 index 000000000..dbe5283a1 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/standard_define.bin differ diff --git a/modules/scicos/macros/scicos_scicos/standard_define.sci b/modules/scicos/macros/scicos_scicos/standard_define.sci new file mode 100755 index 000000000..f0d390cea --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/standard_define.sci @@ -0,0 +1,52 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function o=standard_define(sz,model,label,gr_i) + //initialize graphic part of the block data structure + + if argn(2)<4 then gr_i=[],end + + nin=size(model.in,1); + if nin>0 then pin(nin,1)=0,else pin=[],end + + nout=size(model.out,1); + if nout>0 then pout(nout,1)=0,else pout=[],end + + ncin=size(model.evtin,1); + if ncin>0 then pein(ncin,1)=0,else pein=[],end + + ncout=size(model.evtout,1); + if ncout>0 then peout(ncout,1)=0,else peout=[],end + + if type(gr_i)<>15 then gr_i=list(gr_i,8),end + if gr_i(2)==[] then gr_i(2)=8,end + if gr_i(2)==0 then gr_i(2)=[],end + + graphics=scicos_graphics(sz=sz,pin=pin,pout=pout,pein=pein,peout=peout, ... + gr_i=gr_i,exprs=label) + + // if model.sim(1)=='super' then + // o=scicos_block(graphics=graphics,model=model,gui='SUPER_f') + // else + [ln,mc]=where() + o=scicos_block(graphics=graphics,model=model,gui=mc(2)) + // end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/standard_draw.bin b/modules/scicos/macros/scicos_scicos/standard_draw.bin new file mode 100755 index 000000000..3041e473d Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/standard_draw.bin differ diff --git a/modules/scicos/macros/scicos_scicos/standard_draw.sci b/modules/scicos/macros/scicos_scicos/standard_draw.sci new file mode 100755 index 000000000..569358f36 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/standard_draw.sci @@ -0,0 +1,251 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function standard_draw (o, frame, draw_ports, up) + // + // + //** This function is used to draw the object from the most of (but NOT all) the interface functions + //** + //** 21 Nov 2006 : some save/restore patch moved to upper level "drawobj.sci" + //** 22 Jun 2009 (Serge Steer INRIA) + // - gh_curwin.children use replaced by gh_axes to get the + // axes children because uimenu are now children of the figure + // - use gh_blk for argument of dig_bound_compound + // - use of gh_text to set text properties of the indentifier (instead + // of modifying the correponding axes properties + + xf = 60 ; yf = 40 ; + + [lhs,rhs] = argn(0) + + if rhs==1 then + frame=%t + end + + if rhs<3 then + draw_ports = standard_draw_ports //** left right ports + //** the function 'standard_draw_ports' it's copied in 'draw_ports' + elseif rhs==4 then //** otherwise + draw_ports = standard_draw_ports_up //** up / down ports + end //** the function 'standard_draw_ports_up' it's copied in 'draw_ports' + + nin = size(o.model.in,1); + nout = size(o.model.out,1); + clkin = size(o.model.evtin,1); + clkout= size(o.model.evtout,1); + [orig,sz,orient] = (o.graphics.orig,o.graphics.sz,o.graphics.flip) + + //** Default values ------------------- + thick = 1 ; //** patch Simone + e = 4 ; + With3D = options("3D")(1) + //** ---------------------------------- + + gr_i = o.graphics.gr_i + + if type(gr_i) == 15 then + [gr_i,coli] = gr_i(1:2) ; + else + coli = [] ; + end + + //** --------------------------------------- draw box ------------------------------------------------ + if frame then + if With3D then //** this is the code relative to the block's "window dressing" + //**---------- 3D Mode ON ----------------------------------------------------------------------- + #Color3D = options("3D")(2) + // xpoly([orig(1)+e;orig(1)+sz(1);orig(1)+sz(1)],[orig(2)+sz(2);orig(2)+sz(2);orig(2)+e],'lines') + xrect( orig(1)+e, orig(2)+sz(2), sz(1)-e, sz(2)-e) ; + gh_e = gce(); //** new graphics :) + gh_e.thickness = 0 ; + gh_e.foreground = #Color3D ; + + if coli<>[] then + gh_e.fill_mode = "on" ; + gh_e.background = coli ; + end + + xx = [ orig(1) , orig(1) + orig(1) , orig(1)+sz(1)-e + orig(1)+e , orig(1)+sz(1) + orig(1)+e , orig(1)+e] ; + + yy = [orig(2) , orig(2) + orig(2)+sz(2)-e , orig(2) + orig(2)+sz(2) , orig(2)+e + orig(2)+e , orig(2)+e]; + + xfpolys(xx,yy,-[1,1]*#Color3D); //** fill a set of polygons + gh_e = gce() ; + gh_c = gh_e.children(1:2) ; + gh_c.foreground = default_color(0) ; + gh_c.thickness = 2 ; + + else //** not in 3D mode + //**----------3D Mode OFF ------------------------------------------------------------------------- + e = 0 ; + xrect(orig(1),orig(2)+sz(2),sz(1),sz(2)) ; + gh_e = gce() ; + gh_e.thickness = 2 ; + + if coli<>[] then + gh_e.fill_mode = "on" ; + gh_e.background = coli ; + end + + end //** of 3D mode ON/OFF + end //** of the frame mode + draw_ports(o) ; //** 'standard_draw_ports' or 'standard_draw_ports_up' + //** -------------------------------------------------------------------------------------------------------------- + + //** ---- scs_m , %cpr Indexes Show including information on internal superblocks --------------------------------- + if exists("%scicos_with_grid") then + if %scicos_with_grid then + scs_m_i=[]; cpr_i=[] ; sflag=[] ; + win_id = gh_current_window.figure_id + + kc = find(win_id==windows(:,2)) + + pal = windows(kc,1); + + if pal > 0 then + if ~exists("scs_m_index") then scs_m_index=-1, end + [scs_m_i, cpr_i, sflag] = get2index(o, scs_m_index); + + txt_index = []; + if scs_m_i<>[] & cpr_i<>[] then + if sflag<>[] then + txt_index = string(scs_m_i)+"s, "+cpr_i+"c"; + else + txt_index = string(scs_m_i)+"s, "+string(cpr_i)+"c"; + end + end + + gh_axes = gca(); //** get the Axes proprieties + + // draw indexes + if txt_index<>[] then + + //@@ compute bbox + rect = stringbox(txt_index, orig(1), orig(2), 0,... + options.ID(1)(1), options.ID(1)(2)); + + w = (rect(1,3)-rect(1,2)) * %zoom; + w = max(w, sz(1)); + h = (rect(2,2)-rect(2,4)) * 1.3 * %zoom/1.4; + + //@@ fill txt_index in a box + xstringb(orig(1) + sz(1) / 2 - w / 2, orig(2) + sz(2), txt_index , w, h,"fill") ; + gh_txt = gce(); + gh_txt.font_style = options.ID(1)(1) ; + gh_txt.font_size = options.ID(1)(2) ; + + end + end + end + end //** of on/off control + //** -------------------------------------------------------------------------------------------------------------- + + //** --------------------------------- draw gr_i --------------------------------- + o_size=size(gh_axes.children) + deff("c=scs_color(c)"," ") ; //** on line function definition + gr_i = [gr_i]; //** simple but not simpler :) + model = o.model + if With3D & frame then + orig = orig + e ; + sz = sz - e ; + end + //@@ Alan,28/11/08 : protect variables of standard_draw + deff("ierr=exec_gr_i(gr_i)","ierr=execstr(gr_i,''errcatch'',''n'');") ; //** on line function definition + //** Check of the graphics object has generated any error + if exec_gr_i(gr_i)<>0 then + messagebox(["Error in Icon defintion"; lasterror()],"modal") + end + //** ----------------------------------------------------------------------------- + + //** -------------------------------- Identification -------------------------------------------------------------- + + ident = o.graphics.id + + // draw Identification + if ident<>[] & ident<>"" then + + + //@@ compute bbox of gr object + + p_size=size(gh_axes.children); + if p_size(1)-o_size(1)<>0 then + gh_blk=glue(gh_axes.children(1:(p_size(1)-o_size(1)))); + rect=dig_bound_compound(gh_blk) + //@@ Alan,28/11/08 : I redraw all here because glue/unglue op change + //@@ some properties of objects in the compound + //unglue(gh_blk) + delete(gh_blk) + exec_gr_i(gr_i) //@@ no test here : this have been done previously + else + rect=[orig(1) orig(2) orig(1)+sz(1) orig(2)+sz(2)] + end + if With3D & frame then + rect(1,1)=rect(1,1)-e + rect(1,2)=rect(1,2)-e + orig = orig - e ; + sz = sz + e ; + end + //rect(1,1)=min(rect(1,1),orig(1)) + rect(1,2)=min(rect(1,2),orig(2)) + //rect(1,3)=max(rect(1,3),orig(1)+sz(1)) + rect(1,4)=max(rect(1,4),orig(2)+sz(2)) + + //@@ compute bbox + rectstr = stringbox(ident, rect(1,1), rect(1,2), 0,... + options.ID(1)(1), options.ID(1)(2)); + w=(rectstr(1,3)-rectstr(1,2)) * %zoom; + h=(rectstr(2,2)-rectstr(2,4)) * %zoom; + + //@@ fill ident in a box + xstringb(orig(1) + sz(1) / 2 - w / 2, rect(1,2) - (h*1.1) , ident , ... + w, h,"fill") ; + //@@ Serge 22 Jun 2009 + gh_text=gce(); + gh_text.font_style = options.ID(1)(1) ; + gh_text.font_size = options.ID(1)(2) ; + gh_text.font_foreground = options.ID(1)(3) ; //@@ + + //@@ set visible + if gh_axes.children(1).type == "Text" then + if options.ID(1)(4)==0 then + gh_axes.children(1).visible="off" + else + gh_axes.children(1).visible="on" + end + else //@@compound + for i=1:size(gh_axes.children(1).children,1) + if options.ID(1)(4)==0 then + gh_axes.children(1).children(i).visible="off" + else + gh_axes.children(1).children(i).visible="on" + end + end + end + end + //** --------------------------- Identification End -------------------------------------------------------------- + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/standard_draw_ports.bin b/modules/scicos/macros/scicos_scicos/standard_draw_ports.bin new file mode 100755 index 000000000..69330a7f8 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/standard_draw_ports.bin differ diff --git a/modules/scicos/macros/scicos_scicos/standard_draw_ports.sci b/modules/scicos/macros/scicos_scicos/standard_draw_ports.sci new file mode 100755 index 000000000..f5045b0c5 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/standard_draw_ports.sci @@ -0,0 +1,211 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function standard_draw_ports(o) + + nin = size(o.model.in,1); + nout= size(o.model.out,1); + inporttype = o.graphics.in_implicit + outporttype = o.graphics.out_implicit + clkin = size(o.model.evtin,1); + clkout = size(o.model.evtout,1); + + [orig,sz,orient]=(o.graphics.orig,o.graphics.sz,o.graphics.flip) + + // xset('pattern',default_color(0)); + // xset('thickness',1) + // draw input/output ports + //------------------------ + + //** --------- For the implict mode only ---------- + //if o.model.sim=='inimpl' then pause, end + //** ----------------------------------------------- + + + if orient then //standard orientation + // set port shape + out1=[ 0 -1 + 1 0 + 0 1 + 0 -1]*diag([xf/7,yf/14]) + + in1= [-1 -1 + 0 0 + -1 1 + -1 -1]*diag([xf/7,yf/14]) + + out2=[ 0 -1 + 1 -1 + 1 1 + 0 1]*diag([xf/7,yf/14]) + + in2= [-1 -1 + 0 -1 + 0 1 + -1 1]*diag([xf/7,yf/14]) + dy=sz(2)/(nout+1) + + //** xset('pattern',default_color(1)) + + for k=1:nout + + if outporttype==[] then + xfpoly( out1(:,1)+ones(4,1)*(orig(1)+sz(1)), out1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k), 1) + else + if outporttype(k)=="E" then + xfpoly(out1(:,1)+ones(4,1)*(orig(1)+sz(1)),out1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1) + elseif outporttype(k)=="I" then + xpoly(out2(:,1)+ones(4,1)*(orig(1)+sz(1)), out2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),"lines",1) + end + end + + // gh_e = gce(); + // gh_e.thickness = 1 ; + // gh_e.foreground = default_color(1) + + + end //** end of for + + dy=sz(2)/(nin+1) + + for k=1:nin + + if inporttype==[] then + xfpoly(in1(:,1)+ones(4,1)*orig(1), in1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1) + else + if inporttype(k)=="E" then + xfpoly(in1(:,1)+ones(4,1)*orig(1), in1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1) + elseif inporttype(k)=="I" then + xfpoly(in2(:,1)+ones(4,1)*orig(1), in2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1) + end + end + + // gh_e = gce(); + // gh_e.thickness = 1 ; + // gh_e.foreground = default_color(1) + + + end //** end of for + + else //tilded orientation + out1=[0 -1 + -1 0 + 0 1 + 0 -1]*diag([xf/7,yf/14]) + + in1= [1 -1 + 0 0 + 1 1 + 1 -1]*diag([xf/7,yf/14]) + + out2=[0 -1 + -1 -1 + -1 1 + 0 1]*diag([xf/7,yf/14]) + + in2= [1 -1 + 0 -1 + 0 1 + 1 1]*diag([xf/7,yf/14]) + + + dy=sz(2)/(nout+1) + + // xset('pattern',default_color(1)) + for k=1:nout + + if outporttype==[] then + xfpoly(out1(:,1)+ones(4,1)*orig(1)-1, out1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1) + else + if outporttype(k)=="E" then + xfpoly(out1(:,1)+ones(4,1)*orig(1)-1, out1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1) + elseif outporttype(k)=="I" then + xpoly(out2(:,1)+ones(4,1)*orig(1)-1, out2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),"lines",1) + end + end + + //gh_e = gce(); + //gh_e.thickness = 1 ; + // gh_e.foreground = default_color(1) + + end //** end of for + + dy=sz(2)/(nin+1) + for k=1:nin + if inporttype==[] then + xfpoly(in1(:,1)+ones(4,1)*(orig(1)+sz(1))+1, in1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1) + else + if inporttype(k)=="E" then + xfpoly(in1(:,1)+ones(4,1)*(orig(1)+sz(1))+1, in1(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1) + elseif inporttype(k)=="I" then + xfpoly(in2(:,1)+ones(4,1)*(orig(1)+sz(1))+1, in2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*k),1) + end + end + + end //** end of for + + // gh_e = gce(); + // gh_e.thickness = 1 ; + // gh_e.foreground = default_color(1) + + end + + //**---------------------------------------------------------------------------------------------------- + // draw input/output clock ports + //------------------------ + // set port shape + + out= [-1 0 + 0 -1 + 1 0 + -1 0]*diag([xf/14,yf/7]) + + + in= [-1 1 + 0 0 + 1 1 + -1 1]*diag([xf/14,yf/7]) + + + dx=sz(1)/(clkout+1) + //** xset('pattern',default_color(-1)) + + for k=1:clkout + xfpoly(out(:,1)+ones(4,1)*(orig(1)+k*dx), out(:,2)+ones(4,1)*orig(2),1) + gh_e = gce(); + // gh_e.thickness = 1 ; + gh_e.foreground = default_color(-1); //** non so perche' ... + gh_e.background = default_color(-1); //** ... ma funziona :) + // pause + end + + dx=sz(1)/(clkin+1) + for k=1:clkin + xfpoly(in(:,1)+ones(4,1)*(orig(1)+k*dx), in(:,2)+ones(4,1)*(orig(2)+sz(2)),1); + gh_e = gce(); + // gh_e.thickness = 1 ; + gh_e.foreground = default_color(-1); + gh_e.background = default_color(-1); + end + + //** xset('pattern',default_color(0)) + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.bin b/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.bin new file mode 100755 index 000000000..d31c1564f Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.bin differ diff --git a/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.sci b/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.sci new file mode 100755 index 000000000..e01d882e3 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/standard_draw_ports_up.sci @@ -0,0 +1,56 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function standard_draw_ports_up(o) + + nin=size(o.model.in,1); + + inporttype=o.graphics.in_implicit + nout=size(o.model.out,1); + outporttype=o.graphics.out_implicit + [orig,sz,orient]=(o.graphics.orig,o.graphics.sz,o.graphics.flip) + xset("pattern",default_color(0)); + + // set port shape + + out2=[0 -1 + -1 -1 + -1 1 + 0 1]*diag([xf/7,yf/14]) + + in2= [1 -1 + 0 -1 + 0 1 + 1 1]*diag([xf/7,yf/14]) + + + dy=sz(2)/3 + xset("pattern",default_color(1)) + xpoly(out2(:,1)+ones(4,1)*orig(1)-1,.. + out2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*2),"lines",1) + xpoly(in2(:,1)+ones(4,1)*(orig(1)+sz(1))+1,.. + in2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy*2),"lines",1) + xfpoly(out2(:,1)+ones(4,1)*orig(1)-1,.. + out2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy),1) + xfpoly(in2(:,1)+ones(4,1)*(orig(1)+sz(1))+1,.. + in2(:,2)+ones(4,1)*(orig(2)+sz(2)-dy),1) + +endfunction diff --git a/modules/scicos/macros/scicos_scicos/standard_inputs.bin b/modules/scicos/macros/scicos_scicos/standard_inputs.bin new file mode 100755 index 000000000..92307a1da Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/standard_inputs.bin differ diff --git a/modules/scicos/macros/scicos_scicos/standard_inputs.sci b/modules/scicos/macros/scicos_scicos/standard_inputs.sci new file mode 100755 index 000000000..6bd490a4e --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/standard_inputs.sci @@ -0,0 +1,76 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [x,y,typ]=standard_inputs(o) + //get position of inputs ports and clock inputs port for a standard block + // the input ports are located on the left (or rigth if tilded) vertical + // side of the block, regularly located from top to bottom + // the clock input ports are located on the top horizontal side + // side of the block, regularly located from left to right + xf=60 + yf=40 + graphics=o.graphics + model=o.model + orig=graphics.orig;sz=graphics.sz;orient=graphics.flip; + inp=size(model.in,1);clkinp=size(model.evtin,1); + if orient then + xo=orig(1) + dx=-xf/7 + else + xo=orig(1)+sz(1) + dx=yf/7 + end + + typ=[]; + + //if o.model.sim=='valve' then pause,end + if inp==0 then + x=[];y=[]; + else + y=orig(2)+sz(2)-(sz(2)/(inp+1))*(1:inp) + x=(xo+dx)*ones(y) + for k=1:inp + if o.graphics.in_implicit==[] then + typ=ones(x) + else + if o.graphics.in_implicit(k)=="E" then + typ=[typ ones(x(k))] + elseif o.graphics.in_implicit(k)=="I" then + typ=[typ 2*ones(x(k))] + end + end + end + end + + if clkinp<>0 then + x=[x,orig(1)+(sz(1)/(clkinp+1))*(1:clkinp)] + y=[y,(orig(2)+yf/7+sz(2))*ones(1,clkinp)] + typ=[typ,-ones(1,clkinp)] + end +endfunction + + + + + + + + diff --git a/modules/scicos/macros/scicos_scicos/standard_origin.bin b/modules/scicos/macros/scicos_scicos/standard_origin.bin new file mode 100755 index 000000000..c1c889283 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/standard_origin.bin differ diff --git a/modules/scicos/macros/scicos_scicos/standard_origin.sci b/modules/scicos/macros/scicos_scicos/standard_origin.sci new file mode 100755 index 000000000..ff0b54119 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/standard_origin.sci @@ -0,0 +1,26 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [x,y]=standard_origin(o) + //orig=o(2)(1) + orig=o.graphics.orig + x=orig(1);y=orig(2); +endfunction diff --git a/modules/scicos/macros/scicos_scicos/standard_outputs.bin b/modules/scicos/macros/scicos_scicos/standard_outputs.bin new file mode 100755 index 000000000..9ca50ec11 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/standard_outputs.bin differ diff --git a/modules/scicos/macros/scicos_scicos/standard_outputs.sci b/modules/scicos/macros/scicos_scicos/standard_outputs.sci new file mode 100755 index 000000000..a2d1ad9b3 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/standard_outputs.sci @@ -0,0 +1,75 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function [x,y,typ]=standard_outputs(o) + //get position of inputs ports and clock inputs port for a standard block + // the output ports are located on the right (or left if tilded) vertical + // side of the block, regularly located from bottom to top + // the clock output ports are located on the bottom horizontal side + // of the block, regularly located from left to right + //! + xf=60 + yf=40 + + graphics=o.graphics + model=o.model + orig=graphics.orig;sz=graphics.sz;orient=graphics.flip; + + out=size(model.out,1);clkout=size(model.evtout,1); + + if orient then + xo=orig(1)+sz(1) + dx=xf/7 + else + xo=orig(1) + dx=-xf/7 + end + + typ=[]; + + // output port location + if out==0 then + x=[];y=[]; + else + y=orig(2)+sz(2)-(sz(2)/(out+1))*(1:out) + x=(xo+dx)*ones(y) + for k=1:out + if o.graphics.out_implicit==[] then + typ=ones(x) + else + if o.graphics.out_implicit(k)=="E" then + typ=[typ ones(x(k))] + elseif o.graphics.out_implicit(k)=="I" then + typ=[typ 2*ones(x(k))] + end + end + end + end + + + // clock output port location + if clkout<>0 then + x=[x,orig(1)+(sz(1)/(clkout+1))*(1:clkout)] + y=[y,(orig(2)-yf/7)*ones(1,clkout)] + typ=[typ,-ones(1,clkout)] + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/translator.bin b/modules/scicos/macros/scicos_scicos/translator.bin new file mode 100755 index 000000000..5ccd5e60b Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/translator.bin differ diff --git a/modules/scicos/macros/scicos_scicos/translator.sci b/modules/scicos/macros/scicos_scicos/translator.sci new file mode 100755 index 000000000..2c03c0952 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/translator.sci @@ -0,0 +1,113 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function [ok]=translator(filemo,Mblocks,_Modelica_libs,Flat) + //Generate the flat model of the Modelica model given in the filemo file + //and the Modelica libraries. Interface to the external tool + //translator. + // if is the basename of filemo this function produces + // - the flat Modelica model file in outpath+name+'f.mo' + // - the flat xml representation file in outpath+name+'f_init.xml' + // - the flat xml file in outpath+name+'f_relations.xml' + + // TO DO : rename filename too generic + TRANSLATOR_FILENAME = "modelicat"; + if getos() == "Windows" then + TRANSLATOR_FILENAME = TRANSLATOR_FILENAME + ".exe"; + end + + mlibs = pathconvert(_Modelica_libs,%f,%t); + filemo = pathconvert(filemo,%f,%t); + Flat = pathconvert(Flat,%f,%t); + + name = basename(filemo); + namef = name + "f"; + + [modelica_libs,modelica_directory] = getModelicaPath(); + + molibs = []; + + for k = 1:size(Mblocks,"r") + funam = stripblanks(Mblocks(k)); + [dirF, nameF, extF] = fileparts(funam); + if (extF == ".mo") then + molibs = [molibs; """" + funam + """"]; + else + molibs = [molibs; """" + modelica_directory + funam + ".mo" + """"] + end + end + + // directories for translator libraries + for k = 1:size(mlibs,"*") + modelica_directories = mlibs(k); + if modelica_directories<> [] then + molibs = [molibs; """" + modelica_directories + """"]; + end + end + + translator_libs = strcat(" -lib "+ molibs); + + // build the sequence of -lib arguments for translator + if getos() == "Windows" then, Limit=1000;else, Limit=3500;end + if (length(translator_libs)>Limit) then + // OS limitation may restrict the length of shell command line + // arguments. If there are too many .mo file we catenate them into a + // single MYMOPACKAGE.mo file + messagebox(msprintf(_("There are too many Modelica files.\n" + .. + "it would be better to define several \n" + .. + "Modelica programs in a single file.")),"warning","modal"); + mymopac = pathconvert(outpath+"MYMOPACKAGE.mo",%f,%t); + txt = []; + for k = 1:size(molibs,"*") + [pathx,fnamex,extensionx] = fileparts(molibs(k)); + if (fnamex <> "MYMOPACKAGE") then + txt = [txt; mgetl(evstr(molibs(k)))]; + end + end + mputl(txt, mymopac); + translator_libs= " -lib """+mymopac+""""; + end + translator_libs = translator_libs + " -lib """ + filemo + """" + + //Build the shell instruction for calling the translator + + exe = getmodelicacpath() + TRANSLATOR_FILENAME + exe = """" + pathconvert(getmodelicacpath() + TRANSLATOR_FILENAME,%f,%t) + """ "; + + out =" -o """+Flat+"""" //flat modelica + Errfile = outpath + "S_translator.err"""; + + // with the with-init option + instr = exe + translator_libs + out + " -with-init -command """ + name + " " + namef + ";"" >""" + Errfile + + if getos() == "Windows" then + mputl(instr,outpath+"/gent.bat") + instr = outpath + "/gent.bat"; + end + + if execstr("unix_s(instr)","errcatch") <> 0 then + messagebox([_("-------Modelica translator error message:-----"); + mgetl(outpath + "S_translator.err")], "error", "modal"); + ok = %f, + else + ok = %t + end +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/update_scs_m.bin b/modules/scicos/macros/scicos_scicos/update_scs_m.bin new file mode 100755 index 000000000..dd3b02f5e Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/update_scs_m.bin differ diff --git a/modules/scicos/macros/scicos_scicos/update_scs_m.sci b/modules/scicos/macros/scicos_scicos/update_scs_m.sci new file mode 100755 index 000000000..710e4ab3a --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/update_scs_m.sci @@ -0,0 +1,242 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function scs_m_new = update_scs_m(scs_m,version) + // update_scs_m : function to do certification of + // main data structure of + // a scicos diagram (scs_m) + // for current version of scicos + // + // certification is done through initial value of fields in : + // scicos_diagram() + // scicos_params() + // scicos_block() + // scicos_graphics() + // scicos_model() + // scicos_link() + // + // Initial rev 12/05/07 : Alan + // Copyright INRIA + rhs = argn(2) + if rhs<2 then + version=get_scicos_version(); + end + + scs_m_new = scicos_diagram(); + + F = getfield(1,scs_m); + + for i=2:size(F,2) + + select F(i) + + //******************* props *******************// + case "props" then + + sprops = scs_m.props; + T = getfield(1,scs_m.props); + T_txt = []; + for j=2:size(T,2) + T_txt = T_txt + strsubst(T(1,j),"title","Title") + ... + "=" + "sprops." + T(1,j); + if j<>size(T,2) then + T_txt = T_txt + ","; + end + end + T_txt = "sprops=scicos_params(" + T_txt + ")"; + execstr(T_txt) + scs_m_new.props = sprops; + //*********************************************// + + //******************** objs *******************// + case "objs" then + + for j=1:lstsize(scs_m.objs) //loop on objects + + o=scs_m.objs(j); + + select typeof(o) + + //************** Block ***************// + case "Block" then + + o_new=scicos_block(); + T = getfield(1,o); + + for k=2:size(T,2) + select T(k) + //*********** graphics **********// + case "graphics" then + ogra = o.graphics; + G = getfield(1,ogra); + G_txt = []; + for l=2:size(G,2) + G_txt = G_txt + G(1,l) + ... + "=" + "ogra." + G(1,l); + if l<>size(G,2) then + G_txt = G_txt + ","; + end + end + G_txt = "ogra=scicos_graphics(" + G_txt + ")"; + execstr(G_txt) + o_new.graphics = ogra; + //*******************************// + + //************* model ***********// + case "model" then + omod = o.model; + M = getfield(1,o.model); + M_txt = []; + for l=2:size(M,2) + M_txt = M_txt + M(1,l) + ... + "=" + "omod." + M(1,l); + if l<>size(M,2) then + M_txt = M_txt + ","; + end + end + M_txt = "omod=scicos_model(" + M_txt + ")"; + execstr(M_txt) + //******** super block case ********// + if omod.sim=="super"|omod.sim=="csuper" then + rpar=update_scs_m(omod.rpar,version) + omod.rpar=rpar + end + o_new.model = omod; + //*******************************// + + //************* doc ***********// + case "doc" then + o_new.doc = list(); + //*******************************// + + //************* other ***********// + else + T_txt = "o."+T(k); + T_txt = "o_new." + T(k) + "=" + T_txt; + execstr(T_txt) + //*******************************// + + end //end of select T(k) + end //end of for k= + scs_m_new.objs(j) = o_new; + //************************************// + + //************** Link ****************// + case "Link" then + + T = getfield(1,o); + T_txt = []; + for k=2:size(T,2) + T_txt = T_txt + T(1,k) + ... + "=" + "o." + T(1,k); + if k<>size(T,2) then + T_txt = T_txt + ","; + end + end + T_txt = "o_new=scicos_link(" + T_txt + ")"; + execstr(T_txt) + scs_m_new.objs(j) = o_new; + //************************************// + + //************** Text ****************// + case "Text" then + o_new = mlist(["Text","graphics","model","void","gui"],... + scicos_graphics(),scicos_model()," ","TEXT_f") + + T = getfield(1,o); + T_txt = []; + for k=2:size(T,2) + select T(k) + //*********** graphics **********// + case "graphics" then + ogra = o.graphics; + G = getfield(1,ogra); + G_txt = []; + for l=2:size(G,2) + G_txt = G_txt + G(1,l) + ... + "=" + "ogra." + G(1,l); + if l<>size(G,2) then + G_txt = G_txt + ","; + end + end + G_txt = "ogra=scicos_graphics(" + G_txt + ")"; + execstr(G_txt) + o_new.graphics = ogra; + //*******************************// + + //************* model ***********// + case "model" then + omod = o.model; + M = getfield(1,o.model); + M_txt = []; + for l=2:size(M,2) + M_txt = M_txt + M(1,l) + ... + "=" + "omod." + M(1,l); + if l<>size(M,2) then + M_txt = M_txt + ","; + end + end + M_txt = "omod=scicos_model(" + M_txt + ")"; + execstr(M_txt) + //******** super block case ********// + if omod.sim=="super"|omod.sim=="csuper" then + rpar=update_scs_m(omod.rpar,version) + omod.rpar=rpar + end + o_new.model = omod; + //*******************************// + + //************* other ***********// + else + T_txt = "o."+T(k); + T_txt = "o_new." + T(k) + "=" + T_txt; + execstr(T_txt) + //*******************************// + + end //end of select T(k) + end //end of for k= + scs_m_new.objs(j) = o_new; + //************************************// + + //************* other ***********// + else // JESAISPASIYADAUTRESOBJS + // QUEDESBLOCKSDESLINKETDUTEXTESDANSSCICOS + // ALORSICIJEFAISRIEN + scs_m_new.objs(j) = o; + //************************************// + + end //end of select typeof(o) + + end //end of for j= + //*********************************************// + + //** version **// + case "version" then + //do nothing here + //this should be done later + + end //end of select F(i) + + end //end of for i= + + //**update version **// + scs_m_new.version = version; +endfunction + diff --git a/modules/scicos/macros/scicos_scicos/update_version.bin b/modules/scicos/macros/scicos_scicos/update_version.bin new file mode 100755 index 000000000..97ef9933f Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/update_version.bin differ diff --git a/modules/scicos/macros/scicos_scicos/update_version.sci b/modules/scicos/macros/scicos_scicos/update_version.sci new file mode 100755 index 000000000..a1d5d3edd --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/update_version.sci @@ -0,0 +1,40 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function [ierr,scicos_ver,scs_m_out]=update_version(scs_m_in) + + //## contrib update + + //## scicos update + current_version = get_scicos_version() + scicos_ver = find_scicos_version(scs_m_in) + + if scicos_ver<>current_version then + txt_to_run = "scs_m_out=do_version(scs_m_in,scicos_ver)" + ierr=execstr(txt_to_run,"errcatch") + if ierr<>0 then + scs_m_out=scs_m_in + end + else + scs_m_out=scs_m_in + ierr=0 + end + +endfunction \ No newline at end of file diff --git a/modules/scicos/macros/scicos_scicos/validvar.bin b/modules/scicos/macros/scicos_scicos/validvar.bin new file mode 100755 index 000000000..912eec051 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/validvar.bin differ diff --git a/modules/scicos/macros/scicos_scicos/validvar.sci b/modules/scicos/macros/scicos_scicos/validvar.sci new file mode 100755 index 000000000..6301dff37 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/validvar.sci @@ -0,0 +1,48 @@ +// Scicos +// +// Copyright (C) INRIA - Serge Steer +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function r=validvar(s) + //Serge Steer, 08/10/2007 + //Alan restricted validvar for operation, 29/03/08 + + //check if the string s is a valid identifier + s=stripblanks(s) + r=%f + if size(s,"*")<>1 then return, end + if s=="" then return, end + + //create a function with s as single statement + if execstr("deff(''foo'',s)","errcatch") then return, end + t=macr2tree(foo) //syntax tree + instr=t.statements(2) //ignore leading and trailing EOL + + //lhs should be "ans" + if size(instr.lhs)<>1 then return,end + if instr.lhs(1).name<>"ans" then return,end + + //expression should be just a reference to s + if typeof(instr.expression)<>"operation" then return, end + if instr.expression.operator<>"ext" then return,end + if size(instr.expression.operands)<>1 then return,end + if instr.expression.operands(1).name<>s then return,end + + r=%t +endfunction diff --git a/modules/scicos/macros/scicos_scicos/value2modelica.bin b/modules/scicos/macros/scicos_scicos/value2modelica.bin new file mode 100755 index 000000000..e53818cc5 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/value2modelica.bin differ diff --git a/modules/scicos/macros/scicos_scicos/value2modelica.sci b/modules/scicos/macros/scicos_scicos/value2modelica.sci new file mode 100755 index 000000000..a85aeb247 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/value2modelica.sci @@ -0,0 +1,49 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// + +function txt=value2modelica(v) + [m,n]=size(v) + if m==1&n==1 then + txt=stripblanks(sci2exp(v)) + kdot=strindex(txt,".") + if kdot==[] then return,end + if kdot==1 then + txt="0"+txt + else + if or(part(txt,kdot-1)==["+","-"]) then + txt=part(txt,1:kdot-1)+"0"+part(txt,kdot:length(txt)) + end + end + else //matrix case + txt=stripblanks(sci2exp(v,0)) + kdot=strindex(txt,".") + if kdot==[] then return,end + k=strindex(part(txt,kdot-1),["+","-",",",";","["]) + if k==[] then return,end + t=txt;txt="";k0=1; + for i=k + ki=kdot(i); + txt=txt+part(t,k0:ki-1)+"0"; + k0=ki; + end + txt=txt+part(t,k0:length(t)) + end +endfunction diff --git a/modules/scicos/macros/scicos_scicos/xml2modelica.bin b/modules/scicos/macros/scicos_scicos/xml2modelica.bin new file mode 100755 index 000000000..7a26b4e09 Binary files /dev/null and b/modules/scicos/macros/scicos_scicos/xml2modelica.bin differ diff --git a/modules/scicos/macros/scicos_scicos/xml2modelica.sci b/modules/scicos/macros/scicos_scicos/xml2modelica.sci new file mode 100755 index 000000000..ff79a1888 --- /dev/null +++ b/modules/scicos/macros/scicos_scicos/xml2modelica.sci @@ -0,0 +1,60 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ../license.txt +// +function ok=xml2modelica(xmlfile,Flati) + // Generate the Modelica model file Flati with + // the xml file given by the initialization interface. + // Interface to the external tool xml2modelica.exe + // if is the basename of filemo this function produces + // - the flat Modelica model file in outpath+name+'fi.mo' + + //Scilab interface with external tool xml2modelica + + XML2MODELICA_FILENAME = "XML2Modelica"; + if getos() == "Windows" then + XML2MODELICA_FILENAME = XML2MODELICA_FILENAME + ".exe"; + end + + tmpdir = pathconvert(TMPDIR, %t, %t); //for error log and shell scripts + xmlfile = pathconvert(xmlfile, %f, %t); + Flati = pathconvert(Flati, %f, %t); + + exe = """" + pathconvert(XML2MODELICA_FILENAME, %f, %t) + """ "; + in = """" + xmlfile + """"; + out = "-o """ + Flati + """"; + option = "-init"; // generates a flat modelica file for the initialization + instr = strcat([exe in option out], " "); + + if getos() == "Windows" then, + mputl(instr, tmpdir + "igenx.bat"); + instr = tmpdir + "igenx.bat"; + end + + [rep,stat,err]=unix_g(instr); + if stat == 0 then + mprintf("%s\n", " xml->Modelica : " + Flati); + ok = %t; + else + messagebox(err, _("XML to Modelica"), "error", "modal"); + ok = %f; + return + end +endfunction + diff --git a/modules/scicos/macros/scicos_utils/block_parameter_error.bin b/modules/scicos/macros/scicos_utils/block_parameter_error.bin new file mode 100755 index 000000000..74bb203f7 Binary files /dev/null and b/modules/scicos/macros/scicos_utils/block_parameter_error.bin differ diff --git a/modules/scicos/macros/scicos_utils/block_parameter_error.sci b/modules/scicos/macros/scicos_utils/block_parameter_error.sci new file mode 100755 index 000000000..c02fdf16f --- /dev/null +++ b/modules/scicos/macros/scicos_utils/block_parameter_error.sci @@ -0,0 +1,32 @@ +// +// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab +// Copyright (C) 2011 - Bernard DUJARDIN +// +// This file must be used under the terms of the CeCILL. +// This source file is licensed as described in the file COPYING, which +// you should have received as part of this distribution. The terms +// are also available at +// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt +// +// + +function block_parameter_error(inform, expected) + // Displays a parameter input error box for an Xcos block + // Parameters + // inform: a string, type of the error + // expected: a string, expected value + + rhs=argn(2) + if rhs <> 2 then + error(msprintf(gettext("%s: Wrong number of input arguments: %d expected.\n"), "block_parameter_error", 2)) + end + if typeof(inform) <> "string" then + error(msprintf(gettext("%s: Wrong type for input argument #%d: String array expected.\n"), "block_parameter_error", 1 )) + end + if typeof(expected) <> "string" + error(msprintf(gettext("%s: Wrong type for input argument #%d: String array expected.\n"),"block_parameter_error", 2)); + end + + boxmsg = [" "; inform; " "; expected]; + messagebox(boxmsg, gettext("Xcos block parameter error"), "error","modal"); +endfunction diff --git a/modules/scicos/macros/scicos_utils/buildmacros.sce b/modules/scicos/macros/scicos_utils/buildmacros.sce new file mode 100755 index 000000000..383855a59 --- /dev/null +++ b/modules/scicos/macros/scicos_utils/buildmacros.sce @@ -0,0 +1,16 @@ + +// Scilab ( http://www.scilab.org/ ) - This file is part of Scilab +// Copyright (C) 2007-2008 - INRIA - Allan CORNET +// +// This file must be used under the terms of the CeCILL. +// This source file is licensed as described in the file COPYING, which +// you should have received as part of this distribution. The terms +// are also available at +// http://www.cecill.info/licences/Licence_CeCILL_V2.1-en.txt + +if (isdef("genlib") == %f) then + exec(SCI+"/modules/functions/scripts/buildmacros/loadgenlib.sce"); +end +//------------------------------------ +genlib("scicos_utilslib","SCI/modules/scicos/macros/scicos_utils",%f,%t); +//------------------------------------ diff --git a/modules/scicos/macros/scicos_utils/find_scicos_version.bin b/modules/scicos/macros/scicos_utils/find_scicos_version.bin new file mode 100755 index 000000000..373c13184 Binary files /dev/null and b/modules/scicos/macros/scicos_utils/find_scicos_version.bin differ diff --git a/modules/scicos/macros/scicos_utils/find_scicos_version.sci b/modules/scicos/macros/scicos_utils/find_scicos_version.sci new file mode 100755 index 000000000..3b143c85f --- /dev/null +++ b/modules/scicos/macros/scicos_utils/find_scicos_version.sci @@ -0,0 +1,78 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ./license.txt +// + +function [scicos_ver]=find_scicos_version(scs_m) + //** + //** find_scicos_version try to retrieve a version of a + //** scs_m + //** + //** 21/08/07: Alan, inital revision + //** + + if ~exists("scicos_ver") then + scicos_ver = "scicos2.2"; + else + scicos_ver = scicos_ver; + end + + if type(scs_m)==17 then + //case for diagrams >= 4.2 + if find(getfield(1,scs_m)=="version")<>[] then + if scs_m.version<>"" then + scicos_ver=scs_m.version + else + n=size(scs_m.objs); + for j=1:n //loop on objects + o=scs_m.objs(j); + if typeof(o)=="Block" then + if find(getfield(1,o.model)=="equations")<>[] then + scicos_ver = "scicos2.7.3" + break; + else + //** the last version supported here is scicos2.7 + //** other tests can be done + scicos_ver = "scicos2.7" + break; + end + end + end //** end for + end + //case for diagrams < 4.2 + else + n=size(scs_m.objs); + for j=1:n //loop on objects + o=scs_m.objs(j); + if typeof(o)=="Block" then + if find(getfield(1,o.model)=="equations")<>[] then + scicos_ver = "scicos2.7.3" + break; + else + //** the last version supported here is scicos2.7 + //** other tests can be done + scicos_ver = "scicos2.7" + break; + end + end + end //** end for + end + end + +endfunction diff --git a/modules/scicos/macros/scicos_utils/fixedpointgcd.bin b/modules/scicos/macros/scicos_utils/fixedpointgcd.bin new file mode 100755 index 000000000..50056875b Binary files /dev/null and b/modules/scicos/macros/scicos_utils/fixedpointgcd.bin differ diff --git a/modules/scicos/macros/scicos_utils/fixedpointgcd.sci b/modules/scicos/macros/scicos_utils/fixedpointgcd.sci new file mode 100755 index 000000000..e6c9248dd --- /dev/null +++ b/modules/scicos/macros/scicos_utils/fixedpointgcd.sci @@ -0,0 +1,13 @@ +function [value,denom_com]=fixedpointgcd(v) + // This function computes the PGCD of a double vector. + x=log10(v); + f=round((min(x)+max(x))/2); + v=v./10^(f); + [N,D]=rat(v,1d-9); + denom_com=lcm(uint32(D)); + N=uint32(N)*denom_com./uint32(D); + value=gcd(N); + if f>0 then value=value*10^f; + else denom_com=double(denom_com)*10^(-f); + end +endfunction diff --git a/modules/scicos/macros/scicos_utils/get_scicos_version.bin b/modules/scicos/macros/scicos_utils/get_scicos_version.bin new file mode 100755 index 000000000..a7d664def Binary files /dev/null and b/modules/scicos/macros/scicos_utils/get_scicos_version.bin differ diff --git a/modules/scicos/macros/scicos_utils/get_scicos_version.sci b/modules/scicos/macros/scicos_utils/get_scicos_version.sci new file mode 100755 index 000000000..7ef336c02 --- /dev/null +++ b/modules/scicos/macros/scicos_utils/get_scicos_version.sci @@ -0,0 +1,25 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ./license.txt +// + +function [scicos_ver]=get_scicos_version() + //INRIA + scicos_ver = "scicos4.3"; +endfunction diff --git a/modules/scicos/macros/scicos_utils/initial_scicos_tables.bin b/modules/scicos/macros/scicos_utils/initial_scicos_tables.bin new file mode 100755 index 000000000..28d0b5297 Binary files /dev/null and b/modules/scicos/macros/scicos_utils/initial_scicos_tables.bin differ diff --git a/modules/scicos/macros/scicos_utils/initial_scicos_tables.sci b/modules/scicos/macros/scicos_utils/initial_scicos_tables.sci new file mode 100755 index 000000000..3d0192d0a --- /dev/null +++ b/modules/scicos/macros/scicos_utils/initial_scicos_tables.sci @@ -0,0 +1,20 @@ + +function [modelica_libs, scicos_pal_libs, .. + %scicos_with_grid, %scs_wgrid] = initial_scicos_tables() + + //** This function is called from "scicos" "scicos_simulate" "lincos" "steadycos" + + + %scicos_with_grid = %f;//** define grid + %scs_wgrid = [10;10;12];//**define aspect of grid + + + //Scicos palettes libs list ======================================================== + scicos_pal_libs = ["Branching","Events","Misc","Sinks","Threshold","Linear","MatrixOp","NonLinear","Sources","Electrical","Hydraulics","PDE","IntegerOp"]; + + //Scicos Modelica librabry path definitions======================================== + modelica_libs = getModelicaPath(); + + //** This is the END, the END my friend". By The Doors, Apocalypse Now. +endfunction + diff --git a/modules/scicos/macros/scicos_utils/lib b/modules/scicos/macros/scicos_utils/lib new file mode 100755 index 000000000..3c03be8a2 Binary files /dev/null and b/modules/scicos/macros/scicos_utils/lib differ diff --git a/modules/scicos/macros/scicos_utils/names b/modules/scicos/macros/scicos_utils/names new file mode 100755 index 000000000..c91bf1217 --- /dev/null +++ b/modules/scicos/macros/scicos_utils/names @@ -0,0 +1,9 @@ +block_parameter_error +find_scicos_version +fixedpointgcd +get_scicos_version +initial_scicos_tables +returntoscilab +scicos_getvalue +scicos_workspace_init +with_modelica_compiler diff --git a/modules/scicos/macros/scicos_utils/returntoscilab.bin b/modules/scicos/macros/scicos_utils/returntoscilab.bin new file mode 100755 index 000000000..a6dc26362 Binary files /dev/null and b/modules/scicos/macros/scicos_utils/returntoscilab.bin differ diff --git a/modules/scicos/macros/scicos_utils/returntoscilab.sci b/modules/scicos/macros/scicos_utils/returntoscilab.sci new file mode 100755 index 000000000..df3acfbbf --- /dev/null +++ b/modules/scicos/macros/scicos_utils/returntoscilab.sci @@ -0,0 +1,39 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ./license.txt +// + +function [txt,files]=returntoscilab() + files= listfiles(TMPDIR+"/Workspace") + n=size(files,1) + if n==0 then + txt=[], + return, + else + txtg="["+files(1) + txtd="resume("+files(1) + for i=2:n + txtg=txtg+","+files(i) + txtd=txtd+","+files(i) + end + txtg=txtg+"]" + txtd=txtd+")" + txt=txtg+"="+txtd + end +endfunction diff --git a/modules/scicos/macros/scicos_utils/scicos_getvalue.bin b/modules/scicos/macros/scicos_utils/scicos_getvalue.bin new file mode 100755 index 000000000..4092be6fa Binary files /dev/null and b/modules/scicos/macros/scicos_utils/scicos_getvalue.bin differ diff --git a/modules/scicos/macros/scicos_utils/scicos_getvalue.sci b/modules/scicos/macros/scicos_utils/scicos_getvalue.sci new file mode 100755 index 000000000..37bafdda3 --- /dev/null +++ b/modules/scicos/macros/scicos_utils/scicos_getvalue.sci @@ -0,0 +1,311 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// Copyright (C) 2010 - DIGITEO - Clément DAVID +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ./license.txt +// + +function [%ok,%1,%2,%3,%4,%5,... + %6,%7,%8,%9,%10,... + %11,%12,%13,%14,%15,... + %16,%17,%18,%19,%20,... + %21,%22,%23,%24,%25,... + %26,%27,%28,%29,%30]=scicos_getvalue(%desc,%labels,%typ,%ini) + // getvalues - %window dialog for data acquisition + //%Synta% + // [%ok,%1,..,%30]=getvalue(desc,labels,typ,ini) + //%Parameters + // desc : column vector of strings, dialog general comment + // labels : n column vector of strings, labels(i) is the label of + // the ith required value + // typ : list(typ1,dim1,..,typn,dimn) + // typi : defines the type of the ith required value + // if may have the following values: + // 'mat' : stands for matrix of scalars + // 'col' : stands for column vector of scalars + // 'row' : stands for row vector of scalars + // 'vec' : stands for vector of scalars + // 'intvec' : stands for vector of integers i.e int(x) == x + // 'str' : stands for vector of strings + // 'lis' : stands for list + // 'pol' : stands for polynomials + // 'r' : stands for rational + // dimi : defines the size of the ith required value + // it must be + // - an integer or a 2-vector of integers (-1 stands for + // arbitrary dimension) + // - an evaluatable character string + // ini : n column vector of strings, ini(i) gives the suggested + // response for the ith required value + // %ok : boolean ,%t if %ok button pressed, %f if cancel button pressed + // xi : contains the ith required value if %ok==%t + //%Description + // getvalues macro encapsulate x_mdialog function with error checking, + // evaluation of numerical response, ... + //%Remarks + // All correct scilab syntax may be used as responses, for matrices + // and vectors getvalues automatically adds [ ] around the given response + // before numerical evaluation + //%Example + // labels=['magnitude';'frequency';'phase ']; + // [ampl,freq,ph]=getvalue('define sine signal',labels,.. + // list('vec',1,'vec',1,'vec',1),['0.85';'10^2';'%pi/3']) + // + //%See also + // x_mdialog, x_dialog + + //! + // 01/09/10 Clément DAVID: update to %30 rhs parameters + // 17/01/07 -Alan- This version of getvalue is different of scilab 4.1 : + // - %scicos_context behavior reviewed in accordance to context_evstr macro + // - (u)int(8/16/32) allowed in field of type vec/mat/row/col (F. Nassif's Work) + // + // 05/02/07 -Alan- : update to %20 rhs parameters + // + // 12/02/07 -Alan- : fix (variable evaluation of %scicos_context) + // + // Copyright INRIA + [%lhs,%rhs]=argn(0) + + %nn=prod(size(%labels)) + if %lhs<>%nn+2&%lhs<>%nn+1 then error(41),end + if size(%typ)<>2*%nn then + error("%typ : list(''type'',[sizes],...)") + end + %1=[];%2=[];%3=[];%4=[];%5=[]; + %6=[];%7=[];%8=[];%9=[];%10=[]; + %11=[];%12=[];%13=[];%14=[];%15=[]; + %16=[];%17=[];%18=[];%19=[];%20=[]; + %21=[];%22=[];%23=[];%24=[];%25=[]; + %26=[];%27=[];%28=[];%29=[];%30=[]; + + if %rhs==3 then %ini=emptystr(%nn,1),end + + // Transform a list of strings into a vector of strings + // Has no effect if %ini is already a vector of strings + // An empty item in the source list is converted to an empty string in the + // destination vector + // %ini = cat(1,%ini(:)) + if typeof(%ini) <> "string" + %new_ini = [] + for k = 1:length(%ini) + if isempty(%ini(k)) + %new_ini(k) = "" + else + %new_ini(k) = %ini(k) + end + end + %ini = %new_ini + end + + %ok=%t + while %t do + %ini=matrix(%ini, size(%labels)); + %str=x_mdialog(%desc,%labels,%ini) + if %str==[] then %ok=%f,%str=[];break,end + for %kk=1:%nn + %cod=ascii(%str(%kk)) + %spe=find(%cod==10) + if %spe<>[] then + %semi=ascii(";") + %cod(%spe)=%semi*ones(%spe') + %str(%kk)=ascii(%cod) + end + end + + if exists("%scicos_context") + %mm=getfield(1,%scicos_context) + for %mi=%mm(3:$) + if execstr(%mi+"=%scicos_context(%mi)","errcatch")<>0 then + disp(lasterror()) + %ok=%f + return + end + end + end + + %nok=0 + for %kk=1:%nn + select part(%typ(2*%kk-1),1:6) + case "mat " + if exists("%scicos_context") then + [%vv,%ierr]=evstr(%str(%kk)) + else + %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch"); + end + if %ierr<>0 then %nok=-%kk;break,end + //29/12/06 + //the type of %vv is accepted if it is constant or integer + if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + [%mv,%nv]=size(%vv) + %ssz=string(%sz(1))+" x "+string(%sz(2)) + if %mv*%nv==0 then + if %sz(1)>=0&%sz(2)>=0&%sz(1)*%sz(2)<>0 then %nok=%kk,break,end + else + if %sz(1)>=0 then if %mv<>%sz(1) then %nok=%kk,break,end,end + if %sz(2)>=0 then if %nv<>%sz(2) then %nok=%kk,break,end,end + end + case "vec " + if exists("%scicos_context") then + [%vv,%ierr]=evstr(%str(%kk)) + else + %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch") + end + if %ierr<>0 then %nok=-%kk;break,end + //17/01/07 + //the type of %vv is accepted if it is constant or integer + if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + %ssz=string(%sz(1)) + %nv=prod(size(%vv)) + if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end + case "intvec" + if exists("%scicos_context") then + [%vv,%ierr]=evstr(%str(%kk)) + else + %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch") + end + if %ierr<>0 then %nok=-%kk;break,end + //17/01/07 + //the type of %vv is accepted if it is constant or integer + if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + if and(int(%vv) == %vv) == %f then + %nok=-%kk; + break; + end + %ssz=string(%sz(1)) + %nv=prod(size(%vv)) + if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end + case "pol " + if exists("%scicos_context") then + [%vv,%ierr]=evstr(%str(%kk)) + else + %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch"); + end + if %ierr<>0 then %nok=-%kk;break,end + if type(%vv)>2 then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + %ssz=string(%sz(1)) + %nv=prod(size(%vv)) + if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end + case "row " + if exists("%scicos_context") then + [%vv,%ierr]=evstr(%str(%kk)) + else + %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch"); + end + if %ierr<>0 then %nok=-%kk;break,end + //17/01/07 + //the type of %vv is accepted if it is constant or integer + if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + if %sz(1)<0 then + %ssz="1 x *" + else + %ssz="1 x "+string(%sz(1)) + end + [%mv,%nv]=size(%vv) + if %mv<>1 then %nok=%kk,break,end, + if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end + case "col " + if exists("%scicos_context") then + [%vv,%ierr]=evstr(%str(%kk)) + else + %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch"); + end + if %ierr<>0 then %nok=-%kk;break,end + //17/01/07 + //the type of %vv is accepted if it is constant or integer + if and(type(%vv)<>[1 8]) then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + if %sz(1)<0 then + %ssz="* x 1" + else + %ssz=string(%sz(1))+" x 1" + end + [%mv,%nv]=size(%vv) + if %nv<>1 then %nok=%kk,break,end, + if %sz(1)>=0 then if %mv<>%sz(1) then %nok=%kk,break,end,end + case "str " + %sde=%str(%kk) + %spe=find(ascii(%str(%kk))==10) + %spe($+1)=length(%sde)+1 + %vv=[];%kk1=1 + for %kkk=1:size(%spe,"*") + %vv(%kkk,1)=part(%sde,%kk1:%spe(%kkk)-1) + %kk1=%spe(%kkk)+1 + end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + %ssz=string(%sz(1)) + %nv=prod(size(%vv)) + if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end + case "lis " + if exists("%scicos_context") then + [%vv,%ierr]=evstr(%str(%kk)) + else + %ierr=execstr("%vv="+%str(%kk),"errcatch"); + end + if %ierr<>0 then %nok=-%kk;break,end + if type(%vv)<>15& type(%vv)<>16& type(%vv)<>17 then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + %ssz=string(%sz(1)) + %nv=size(%vv) + if %sz(1)>=0 then if %nv<>%sz(1) then %nok=%kk,break,end,end + case "r " + if exists("%scicos_context") then + [%vv,%ierr]=evstr(%str(%kk)) + else + %ierr=execstr("%vv=["+%str(%kk)+"]","errcatch"); + end + if %ierr<>0 then %nok=-%kk;break,end + if type(%vv)<>16 then %nok=-%kk,break,end + if typeof(%vv)<>"rational" then %nok=-%kk,break,end + %sz=%typ(2*%kk);if type(%sz)==10 then %sz=evstr(%sz),end + [%mv,%nv]=size(%vv(2)) + %ssz=string(%sz(1))+" x "+string(%sz(2)) + if %mv*%nv==0 then + if %sz(1)>=0&%sz(2)>=0&%sz(1)*%sz(2)<>0 then %nok=%kk,break,end + else + if %sz(1)>=0 then if %mv<>%sz(1) then %nok=%kk,break,end,end + if %sz(2)>=0 then if %nv<>%sz(2) then %nok=%kk,break,end,end + end + else + error(msprintf(_("%s: Type %s is not implemented.\n"),"getvalue", %typ(2*%kk-1))) + end + execstr("%"+string(%kk)+"=%vv") + end + if %nok>0 then + messagebox(msprintf(_("Answer given for %s \n has invalid dimension: \n waiting for dimension %s.\n"), %labels(%nok), %ssz), "modal"); + %ini=%str + elseif %nok<0 then + if %ierr==0 then + messagebox(msprintf(_("Answer given for %s \n has incorrect type %s.\n"), %labels(-%nok), %typ(-2*%nok-1)), "modal"); + else + messagebox(msprintf(_("Answer given for %s \n is incorrect: %s.\n"), %labels(-%nok), lasterror()), "modal"); + end + %ini=%str + else + break + end + end + if %lhs==%nn+2 then + execstr("%"+string(%lhs-1)+"=%str") + end +endfunction diff --git a/modules/scicos/macros/scicos_utils/scicos_workspace_init.bin b/modules/scicos/macros/scicos_utils/scicos_workspace_init.bin new file mode 100755 index 000000000..d1500c5a2 Binary files /dev/null and b/modules/scicos/macros/scicos_utils/scicos_workspace_init.bin differ diff --git a/modules/scicos/macros/scicos_utils/scicos_workspace_init.sci b/modules/scicos/macros/scicos_utils/scicos_workspace_init.sci new file mode 100755 index 000000000..e3b7008d7 --- /dev/null +++ b/modules/scicos/macros/scicos_utils/scicos_workspace_init.sci @@ -0,0 +1,56 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ./license.txt +// +// +function scicos_workspace_init() + //preserve all variables of type struct having a "time" and a "value" + //field in temporary binary files + path=TMPDIR+"/Workspace/" + mkdir(path); + + + //prepare the fromworkspace stuff We need to store all variables of + //type struct which have 2 fields "values" and "time". these variables + //are stored into Scilab binary files whose name are the variable names + //and which contain 2 variables "x" and "t" + // + prt=funcprot(),funcprot(0) + varnames = who("get") ; + varnames = varnames(1:$-predef()+1); //** exclude protected variables + varnames(varnames=="ans")=[]; + for var=varnames' + v=evstr(var); + if typeof(v)=="st" then + fn=fieldnames(v) + if and(fn==["values";"time"] | fn==["time";"values"]) then + if execstr("x=v.values","errcatch")==0 then + if execstr("t=v.time","errcatch") ==0 then + // remove deprecation warning on save, this will be reimplemented on 6.x + warnMode = warning("query"); + warning("off"); + execstr("save("""+path+var+""",x,t)") + warning(warnMode); + end + end + end + end + end + funcprot(prt) +endfunction diff --git a/modules/scicos/macros/scicos_utils/with_modelica_compiler.bin b/modules/scicos/macros/scicos_utils/with_modelica_compiler.bin new file mode 100755 index 000000000..a51850bd9 Binary files /dev/null and b/modules/scicos/macros/scicos_utils/with_modelica_compiler.bin differ diff --git a/modules/scicos/macros/scicos_utils/with_modelica_compiler.sci b/modules/scicos/macros/scicos_utils/with_modelica_compiler.sci new file mode 100755 index 000000000..bce2d1b95 --- /dev/null +++ b/modules/scicos/macros/scicos_utils/with_modelica_compiler.sci @@ -0,0 +1,33 @@ +// Scicos +// +// Copyright (C) INRIA - METALAU Project +// Copyright (C) INRIA - 2008 - Allan CORNET +// +// This program is free software; you can redistribute it and/or modify +// it under the terms of the GNU General Public License as published by +// the Free Software Foundation; either version 2 of the License, or +// (at your option) any later version. +// +// This program is distributed in the hope that it will be useful, +// but WITHOUT ANY WARRANTY; without even the implied warranty of +// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +// GNU General Public License for more details. +// +// You should have received a copy of the GNU General Public License +// along with this program; if not, write to the Free Software +// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +// +// See the file ./license.txt +// + +function r = with_modelica_compiler() + + if exists("scicos_scicoslib") == 0 then + load("SCI/modules/scicos/macros/scicos_scicos/lib") ; + end + + // check if modelica compiler exists in current $PATH + r = ~isempty(getmodelicacpath()); + +endfunction + -- cgit