diff options
author | kinitrupti | 2017-05-12 18:53:46 +0530 |
---|---|---|
committer | kinitrupti | 2017-05-12 18:53:46 +0530 |
commit | 6279fa19ac6e2a4087df2e6fe985430ecc2c2d5d (patch) | |
tree | 22789c9dbe468dae6697dcd12d8e97de4bcf94a2 /Fundamental_of_Electronics_Devices_by_JB_Gupta | |
parent | d36fc3b8f88cc3108ffff6151e376b619b9abb01 (diff) | |
download | Python-Textbook-Companions-6279fa19ac6e2a4087df2e6fe985430ecc2c2d5d.tar.gz Python-Textbook-Companions-6279fa19ac6e2a4087df2e6fe985430ecc2c2d5d.tar.bz2 Python-Textbook-Companions-6279fa19ac6e2a4087df2e6fe985430ecc2c2d5d.zip |
Removed duplicates
Diffstat (limited to 'Fundamental_of_Electronics_Devices_by_JB_Gupta')
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch1.ipynb | 329 | ||||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch2.ipynb | 1366 | ||||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch3.ipynb | 341 | ||||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch4.ipynb | 1026 | ||||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch5.ipynb | 148 | ||||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch6.ipynb | 672 | ||||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch7.ipynb | 427 | ||||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch8.ipynb | 219 | ||||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/README.txt | 10 | ||||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/energybands.png | bin | 0 -> 54573 bytes | |||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/steadystatephoto.png | bin | 0 -> 47996 bytes | |||
-rwxr-xr-x | Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/transfercharateristics.png | bin | 0 -> 8684 bytes |
12 files changed, 4538 insertions, 0 deletions
diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch1.ipynb b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch1.ipynb new file mode 100755 index 00000000..78c644f7 --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch1.ipynb @@ -0,0 +1,329 @@ +{
+ "metadata": {
+ "name": ""
+ },
+ "nbformat": 3,
+ "nbformat_minor": 0,
+ "worksheets": [
+ {
+ "cells": [
+ {
+ "cell_type": "heading",
+ "level": 1,
+ "metadata": {},
+ "source": [
+ "Chapter 1:Semiconductor Marerials and Crystal Properties"
+ ]
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 1.1 Page No.23"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "l1=2.0\n",
+ "l2=3.0\n",
+ "l3=2.0\n",
+ "\n",
+ "r1=1/l1\n",
+ "r2=1/l2\n",
+ "r3=1/l3\n",
+ "m1=6*r1\n",
+ "m2=6*r2\n",
+ "m3=6*r3\n",
+ "\n",
+ "print\"Miller indices of the given plane are\",m1,m2,m3\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Miller indices of the given plane are 3.0 2.0 3.0\n"
+ ]
+ }
+ ],
+ "prompt_number": 2
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 1.2 Page No.24"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "l1=1.0\n",
+ "l2=2.0\n",
+ "l3=0\n",
+ "\n",
+ "r1=1/l1\n",
+ "r2=1/l2\n",
+ "r3=0\n",
+ "m1=2*r1\n",
+ "m2=2*r2\n",
+ "m3=2*r3\n",
+ "\n",
+ "print\"Miller indices of the given plane are\",m1,m2,m3\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Miller indices of the given plane are 2.0 1.0 0\n"
+ ]
+ }
+ ],
+ "prompt_number": 6
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 1.3 Page No.24"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "V=3*(10**22) #kg/m**3, density of SCC lattice\n",
+ "p=(1/3.0)*10**-22\n",
+ "\n",
+ "n=1 #no. of lattice point \n",
+ "a=(n*p)**(1/3.0) #lattice constant\n",
+ "r=(a*10**8/2)\n",
+ "\n",
+ "print\"Lattice constant is\",round(a*10**8,2),\"A\"\n",
+ "print\"radius of simple lattice is\",round(r,2),\"A\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Lattice constant is 3.22 A\n",
+ "radius of simple lattice is 1.61 A\n"
+ ]
+ }
+ ],
+ "prompt_number": 17
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 1.4 Page no.25"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "import math\n",
+ "r=1.278 #in Angstrum\n",
+ "AtomicWeight=63.5 #constant\n",
+ "AvogadroNo=6.023*10**23 #constant\n",
+ "\n",
+ "a=4*r*10**-10/math.sqrt(2) #in meter\n",
+ "V=a**3 #in meter**3\n",
+ "m=AtomicWeight/AvogadroNo #in gm\n",
+ "m=m/1000 #in Kg\n",
+ "n=4 # no. of atoms per unit cell for FCC structure\n",
+ "rho=m*n/V #in Kg/m**3\n",
+ "\n",
+ "print \"Density of crystal is\",round(rho,2),\"Kg/m**3\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Density of crystal is 8928.8 Kg/m**3\n"
+ ]
+ }
+ ],
+ "prompt_number": 18
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 1.5 Page no.26"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "n=4 # no. of atoms per unit cell of silicon\n",
+ "AtomicWeight=28 #constant\n",
+ "AvogadroNo=6.021*10**23 #constant\n",
+ "\n",
+ "m=AtomicWeight/AvogadroNo #in gm\n",
+ "m=m/1000 #in Kg\n",
+ "a=5.3 #lattice constant in Angstrum\n",
+ "a=a*10**-10 #in meter\n",
+ "V=a**3 #in meter**3\n",
+ "rho=m*n/V #in Kg/m**3\n",
+ "\n",
+ "print\"Density of silicon crystal is\",round(rho,0),\"Kg/m**3\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Density of silicon crystal is 1249.0 Kg/m**3\n"
+ ]
+ }
+ ],
+ "prompt_number": 19
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 1.6 Page no.26"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "a=4.75 #lattice constant in Angstrum\n",
+ "a=a*10**-10 #in meter\n",
+ "\n",
+ "dp=2.31/a**2 #in atom/m**2\n",
+ "dp=dp/10**6 #in atom/mm**2\n",
+ "\n",
+ "print \"Surface density in FCC on (111)Plane is %.e\",dp,\"atoms/mm**2\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Surface density in FCC on (111)Plane is %.e 1.02382271468e+13 atoms/mm**2\n"
+ ]
+ }
+ ],
+ "prompt_number": 2
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 1.7 Page no. 28"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "import math\n",
+ "l=1.539 #in Angstrum\n",
+ "theta=22.5 #in degree\n",
+ "n=1 #order unitless\n",
+ "\n",
+ "d=n*l/(2*math.sin(theta*math.pi/180)) #in Angstrum\n",
+ "\n",
+ "print \"Interpolar distance in Angstrum \",round(d,2),\"A\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Interpolar distance in Angstrum 2.01 A\n"
+ ]
+ }
+ ],
+ "prompt_number": 28
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 1.8 Page no. 28"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "import math\n",
+ "\n",
+ "theta=16.8/2.0 #in degree\n",
+ "n=2.0 #order unitless\n",
+ "d=0.4 #in nm\n",
+ "\n",
+ "l=(2*d*10**-9*sin(theta*math.pi/180.0))/n #in Angstrum\n",
+ "\n",
+ "print \"wavelength of X-rays in Angstrum \",round(l*10**10,3),\"A\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "wavelength of X-rays in Angstrum 0.584 A\n"
+ ]
+ }
+ ],
+ "prompt_number": 4
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [],
+ "language": "python",
+ "metadata": {},
+ "outputs": []
+ }
+ ],
+ "metadata": {}
+ }
+ ]
+}
\ No newline at end of file diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch2.ipynb b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch2.ipynb new file mode 100755 index 00000000..b52ed808 --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch2.ipynb @@ -0,0 +1,1366 @@ +{
+ "metadata": {
+ "name": ""
+ },
+ "nbformat": 3,
+ "nbformat_minor": 0,
+ "worksheets": [
+ {
+ "cells": [
+ {
+ "cell_type": "heading",
+ "level": 1,
+ "metadata": {},
+ "source": [
+ "Chapter2 : Energy Bands and Charge Carriers in semiconductor"
+ ]
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.1 Page No.58"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "dE1=0.1 #eV\n",
+ "dE2=-0.1 #eV\n",
+ "k=8.61*10**-5 #Boltzman constant\n",
+ "T=300 #K\n",
+ "\n",
+ "import math\n",
+ "FE1=1/(1+math.exp(dE1/(k*T)))\n",
+ "FE2=1/(1+math.exp(dE2/(k*T)))\n",
+ "\n",
+ "print\"Probability when the energy of the state is above 0.1 eV\",round(FE1,2)\n",
+ "print\"Probability when the energy of the state is below 0.1 eV\",round(FE2,2)"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Probability when the energy of the state is above 0.1 eV 0.02\n",
+ "Probability when the energy of the state is below 0.1 eV 0.98\n"
+ ]
+ }
+ ],
+ "prompt_number": 9
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.2 Page No. 58"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "Ef=6.25 #EV fermi energy level\n",
+ "dE=-0.30 #eV\n",
+ "k=8.61*10**-5 #Boltzman constant\n",
+ "fE=0.99\n",
+ "\n",
+ "T=(dE)/(k*math.log(1/fE-1))\n",
+ "\n",
+ "print\"The Temprature is\",round(T,1),\"K\" "
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The Temprature is 758.3 K\n"
+ ]
+ }
+ ],
+ "prompt_number": 2
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.3 Page No. 64"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "Eg=0.72 #eV\n",
+ "Ef=0.5*Eg\n",
+ "dE=Eg-Ef #eV\n",
+ "k=8.61*10**-5 #Boltzman constant\n",
+ "T=300 #K\n",
+ "\n",
+ "import math\n",
+ "N=1/(1+math.exp(dE/(k*T)))\n",
+ "\n",
+ "\n",
+ "print\"the fraction of total no. of electron is \",round(N,9)"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "the fraction of total no. of electron is 8.85e-07\n"
+ ]
+ }
+ ],
+ "prompt_number": 1
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.4 Page No. 64"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "E=300*1.602*10**-19 #eV Energy\n",
+ "m=9.108*10**-31 #kg, mass of electron\n",
+ "h=6.626*10**-34 #Planck constant\n",
+ "\n",
+ "v=math.sqrt(2*E/m)\n",
+ "lam=h*v/E\n",
+ "\n",
+ "print\"The wavwlength is\",round(lam*10**10,3),\"A\"\n",
+ "\n",
+ "\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The wavwlength is 1.416 A\n"
+ ]
+ }
+ ],
+ "prompt_number": 22
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.5 Page No. 70"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "ni=1.4*10**18\t\t\t#in atoms/m**3\n",
+ "Nd=1.4*10**24\t\t\t#in atoms/m**3\n",
+ "n=Nd\t\t\t\t#in atoms/m**3\n",
+ "\n",
+ "p=ni**2/n\t\t\t#in atoms/m**3\n",
+ "ratio=n/p\t\t\t#unitless\n",
+ "\n",
+ "print\"Ratio of electron to hole concentration : \",round(ratio,2)"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Ratio of electron to hole concentration : 1e+12\n"
+ ]
+ }
+ ],
+ "prompt_number": 25
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.7 Page no 74"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "n=10**24 #Electron density\n",
+ "e=1.6*10**-19 #Electron charge\n",
+ "v=0.015 #m/s drift velocity\n",
+ "A=10**-4 #m**2 area\n",
+ "\n",
+ "I=n*e*v/A\n",
+ "\n",
+ "print\"The magnitude of current is\",round(I/10**8,2),\"A\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The magnitude of current is 0.24 A\n"
+ ]
+ }
+ ],
+ "prompt_number": 35
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.8 Page No. 74"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "Ef=5.5\t\t\t#in eV\n",
+ "MUe=7.04*10**-3\t\t#in m**2/V-s\n",
+ "n=5.8*10**28\t\t#in m**-3\n",
+ "e=1.6*10**-19\t\t#constant\n",
+ "m=9.1*10**-31\t\t#in Kg\n",
+ "\n",
+ "import math\n",
+ "tau=MUe*m/e\t\t#in sec\n",
+ "rho=1/(n*e*MUe)\t\t#in ohm-m\n",
+ "vF=math.sqrt(2*Ef*1.6*10**-19/m)\n",
+ "\n",
+ "print\"Relaxation time in sec : \",tau,\"s\"\n",
+ "print\"Resistivity of conductor in ohm-m : \",round(rho,11),\"ohm m\"\n",
+ "print\"velocity of electron with fermi energy is \",round(vF,0),\"m/s\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Relaxation time in sec : 4.004e-14 s\n",
+ "Resistivity of conductor in ohm-m : 1.531e-08 ohm m\n",
+ "velocity of electron with fermi energy is 1390707.0 m/s\n"
+ ]
+ }
+ ],
+ "prompt_number": 32
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.9 Page No. 75"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "rho=1.73*10**-8 #resistivity\n",
+ "Tav=2.42*10**-14 #Average Time\n",
+ "e=1.6*10**-19\t\t#constant\n",
+ "m=9.1*10**-31\t\t#in Kg\n",
+ "\n",
+ "n=m/(e**2*Tav*rho)\n",
+ "mu=(e*Tav)/m\n",
+ "\n",
+ "print\"NO. of free electrons are\",round(n,-26)\n",
+ "print\"mobility of electrons is\",round(mu,3),\"m**2/Vs\"\n",
+ "\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "NO. of free electrons are 8.49e+28\n",
+ "mobility of electrons is 0.004 m**2/Vs\n"
+ ]
+ }
+ ],
+ "prompt_number": 51
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.10 page No. 75"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "Ef=100\t\t\t#in V/m Applied electric field\n",
+ "n=6*10**28\t\t#in m**-3\n",
+ "e=1.6*10**-19\t\t#constant electronic charge\n",
+ "m=9.1*10**-31\t\t#in Kg mass of electron\n",
+ "rho=1.5*10**-8 #Density\n",
+ "\n",
+ "import math\n",
+ "tau=m/(n*e**2*rho)\t\t#in sec\n",
+ "vF=e*Ef*tau/m\n",
+ "\n",
+ "print\"Relaxation time in sec : \",round(tau,16),\"s\"\n",
+ "print\"velocity of electron with fermi energy is \",round(vF,1),\"m/s\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Relaxation time in sec : 3.95e-14 s\n",
+ "velocity of electron with fermi energy is 0.7 m/s\n"
+ ]
+ }
+ ],
+ "prompt_number": 57
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.11 Page No.75"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "d=0.002 #m, diameter of pipe\n",
+ "s=5.8*10**7 #Conductivity S/m\n",
+ "mu=0.0032 #m**2/Vs, Electron mobility\n",
+ "e=1.6*10**-19\t\t#constant electronic charge\n",
+ "m=9.1*10**-31\t\t#in Kg mass of electron\n",
+ "E=0.02 #V/m Electric field\n",
+ "\n",
+ "import math\n",
+ "n=s/(e*mu)\n",
+ "J=s*E\n",
+ "I=J*(math.pi*d**2/4.0)\n",
+ "v=mu*E\n",
+ "\n",
+ "print\"Charge density is\",round(n,-26),\"m**-3\"\n",
+ "print\"current density is\",round(J,6),\"A/m**2\"\n",
+ "print\"curret flowing is\",round(I,3),\"A\"\n",
+ "print\"electron drift velocityis\",round(v,6),\"m/s\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Charge density is 1.133e+29 m**-3\n",
+ "current density is 1160000.0 A/m**2\n",
+ "curret flowing is 3.644 A\n",
+ "electron drift velocityis 6.4e-05 m/s\n"
+ ]
+ }
+ ],
+ "prompt_number": 69
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.12 page no 76"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "rho=0.5 #ohm-m Resistivity\n",
+ "J=100 #A/m**2 Current density\n",
+ "mue=0.4 #m**2/Vs Electron mobility\n",
+ "d=10*10**-6 #m distance\n",
+ "\n",
+ "Ve=mue*J*rho\n",
+ "t=d/Ve\n",
+ "\n",
+ "print\"The drift velocity is \",Ve,\"m/s\"\n",
+ "print\"Time taken by the electron is\",round(t,8),\"s\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The drift velocity is 20.0 m/s\n",
+ "Time taken by the electron is 5e-07 s\n"
+ ]
+ }
+ ],
+ "prompt_number": 156
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.13 Page No.76"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "e=1.6*10**-19\t\t#constant electronic charge\n",
+ "m=9.1*10**-31\t\t#in Kg mass of electron\n",
+ "rho=0.039 #ohm-cm resistivity\n",
+ "mu=3600 #cm**2/Vs Carrier mobility\n",
+ "ni=2.5*10**13\n",
+ "\n",
+ "Nd=(1/(rho*e*mu))\n",
+ "n=Nd\n",
+ "p=(ni**2/n)\n",
+ "\n",
+ "print\"Concentration of electron is\",round(n,-14),\"/cm**3\"\n",
+ "print\"Concentration of holes is\",round(p,0),\"/cm**3\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Concentration of electron is 4.45e+16 /cm**3\n",
+ "Concentration of holes is 14040000000.0 /cm**3\n"
+ ]
+ }
+ ],
+ "prompt_number": 76
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.14 page No 76"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "rho=5.32 #kg/m**3, density\n",
+ "Aw=72.6 #kg/K kmol atomic weight\n",
+ "ni=2.5*10**13\n",
+ "di=10**8 #Donor impurity\n",
+ "e=1.6*10**-19 #Electronic charge\n",
+ "mue=0.38 #m**/Vs\n",
+ "muh=0.18 #m**/Vs\n",
+ "\n",
+ "N=6.023*10**23*rho/Aw #No 0f germanium atoms per cm**3\n",
+ "Nd=N/di\n",
+ "n=Nd\n",
+ "p=(ni**2/n)\n",
+ "s=n*e*mue*10**4\n",
+ "\n",
+ "print\"Concentration of electrons is\",round(n,-12),\"atoms/cm**3\"\n",
+ "print\"Concentration of holes is\",round(p,-10),\"atoms/cm**3\"\n",
+ "\n",
+ "if n > p:\n",
+ " \n",
+ " print\"Conductivity of N-type germanium\",round(s*100,1),\"/ohm-m\" \n",
+ "else:\n",
+ " print \"Calculate p-type germanium conductivity\"\n",
+ "\n",
+ "\n",
+ "\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Concentration of electrons is 4.41e+14 atoms/cm**3\n",
+ "Concentration of holes is 1.42e+12 atoms/cm**3\n",
+ "Conductivity of N-type germanium 26.8 /ohm-m\n"
+ ]
+ }
+ ],
+ "prompt_number": 4
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.15 Page no.79"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "e=1.6*10**-19 #Electronic charge\n",
+ "mue=0.39 #m**/Vs\n",
+ "muh=0.19 #m**/Vs\n",
+ "rhoi=0.47 #ohm-m, intrinsic resistivity\n",
+ "E=10**4 #Electric field\n",
+ "\n",
+ "sigmai=1/rhoi\n",
+ "ni=sigmai/(e*(mue+muh))\n",
+ "Vn=mue*E\n",
+ "Vh=muh*E\n",
+ "\n",
+ "print\"Density of electrons is\",round(ni,-17),\"/m**3\"\n",
+ "print\"Drift velocity for electrons\",round(Vn,0),\"m/s\"\n",
+ "print\"Drift velocity for holes\",round(Vh,0),\"m/s\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Density of electrons is 2.29e+19 /m**3\n",
+ "Drift velocity for electrons 3900.0 m/s\n",
+ "Drift velocity for holes 1900.0 m/s\n"
+ ]
+ }
+ ],
+ "prompt_number": 5
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.16 page No.80"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "i=10**7 #IMpurity in Ge atom\n",
+ "ni=2.5*10**13 #/cm**3\n",
+ "N=4.4*10**22 #No. of atoms of Ge\n",
+ "mue=3800 #cm**2/Vs\n",
+ "muh=1800 #cm**2/Vs\n",
+ "e=1.6*10**-19 #Electronic charge\n",
+ "E=400 #Electric field\n",
+ "\n",
+ "sigmai=ni*e*(mue+muh)\n",
+ "Nd=N/i\n",
+ "n=Nd\n",
+ "p=ni**2/(Nd)\n",
+ "sigman=e*Nd*mue\n",
+ "\n",
+ "print\"Intrinsic conductivity of Ge is \",sigmai,\"ohm-cm**-1\"\n",
+ "print\"Conductivity of N type Ge semiconductor is\",round(sigman,2),\"ohm-cm**-1\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Intrinsic conductivity of Ge is 0.0224 ohm-cm**-1\n",
+ "Conductivity of N type Ge semiconductor is 2.68 ohm-cm**-1\n"
+ ]
+ }
+ ],
+ "prompt_number": 10
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.17 Page No. 80"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "V=10 #Volt\n",
+ "l=0.025 #m, length\n",
+ "w=0.004 #m width\n",
+ "t=0.0015 #m thickness\n",
+ "\n",
+ "ni=2.5*10**19 #/cm**3\n",
+ "mue=0.38 #m**2/Vs\n",
+ "muh=0.18 #m**2/Vs\n",
+ "e=1.6*10**-19 #Electronic charge\n",
+ "E=400 #Electric field\n",
+ "\n",
+ "E=V/l\n",
+ "Ve=mue*E\n",
+ "Vh=muh*E\n",
+ "sigmai=ni*e*(mue+muh)\n",
+ "I=sigmai*E*w*t\n",
+ "\n",
+ "print\"(i)Electron drift velocity is \",Ve,\"m/s\"\n",
+ "print\" hole drift velocity is \",Vh,\"m/s\"\n",
+ "print\"(ii)Intrinsic Conductivity of Ge is\",sigmai,\"ohm-m**-1\"\n",
+ "print\"(iii)The total current is \",I*1000,\"mA\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "(i)Electron drift velocity is 152.0 m/s\n",
+ " hole drift velocity is 72.0 m/s\n",
+ "(ii)Intrinsic Conductivity of Ge is 2.24 ohm-m**-1\n",
+ "(iii)The total current is 5.376 mA\n"
+ ]
+ }
+ ],
+ "prompt_number": 8
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.18 page no.80"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "Ie=3/4.0 #Current due to electron\n",
+ "Ih=1-Ie #Current due to holes\n",
+ "Vh=1 #Hole velocity\n",
+ "Ve=3 #Electron velocity 3 times the hole velocity\n",
+ "\n",
+ "R=(Ie*Vh/(Ih*Ve))\n",
+ "\n",
+ "print\"The ratio of electrons to holes drift velocity is \",R"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The ratio of electrons to holes drift velocity is 1.0\n"
+ ]
+ }
+ ],
+ "prompt_number": 11
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.19 Page No.81"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "e=1.6*10**-19\t\t\t#in coulamb\n",
+ "T=300\t\t\t\t#in Kelvin\n",
+ "MUh=0.025\t\t\t#in m**2/V-s\n",
+ "MUe=0.17\t\t\t#in m**2/V-s\n",
+ "k=1.38*10**-23\t\t\t#in J/K\n",
+ "De=MUe*k*T/e\t\t\t#in cm**2/s\n",
+ "Dh=MUh*k*T/e\t\t\t#in cm**2/s\n",
+ "\n",
+ "print\"Diffusion constant of electron is \",round(De*10000,2),\"(in cm**2/s)\"\n",
+ "print\"Diffusion constant of hole is \",round(Dh*10000,2),\"(in cm**2/s)\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Diffusion constant of electron is 43.99 (in cm**2/s)\n",
+ "Diffusion constant of hole is 6.47 (in cm**2/s)\n"
+ ]
+ }
+ ],
+ "prompt_number": 17
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.20 Page no. 81 "
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "N=3*10**25 #No of atoms\n",
+ "e=1.6*10**-19\n",
+ "Eg=1.1*e #eV\n",
+ "k=1.38*10**-23 #j/k boltzman's constant\n",
+ "T=300 #K\n",
+ "mue=0.14\n",
+ "muh=0.05\n",
+ "\n",
+ "ni=N*math.exp(-Eg/(2*k*T))\n",
+ "sigma=ni*e*(mue+muh)\n",
+ "\n",
+ "print\"The intrinsic carries concentration is \",round(ni,-14),\"/m**3\"\n",
+ "print\"The conductivity of Si is \",round(sigma,5),\"S/m\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The intrinsic carries concentration is 1.76e+16 /m**3\n",
+ "The conductivity of Si is 0.00054 S/m\n"
+ ]
+ }
+ ],
+ "prompt_number": 40
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.21 Page No.84"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "a=1.5 #a=me/mo\n",
+ "T=300 #K\n",
+ "\n",
+ "Nc=4.82*10**21*(a)**(1.5)*T**(1.5)\n",
+ "\n",
+ "print\"The effective density is\",round(Nc,-23),\"/m**3\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The effective density is 4.6e+25 /m**3\n"
+ ]
+ }
+ ],
+ "prompt_number": 44
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.22 page no. 84"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "a=0.07 #a=me/mo\n",
+ "b=0.4 #b=mh/mo\n",
+ "T=300 #K\n",
+ "Eg=0.7 #eV\n",
+ "k=8.62*10**-5 # Boltzman constant\n",
+ "\n",
+ "import math\n",
+ "ni=math.sqrt(2.33*10**43*(a*b)**(1.5)*T**3*math.exp(-Eg/(k*T)))\n",
+ "\n",
+ "print\"The intrinsic concentration of charge carrier is\",round(ni,-16),\"/m**3\"\n",
+ "\n",
+ "\n",
+ "\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The intrinsic concentration of charge carrier is 2.27e+18 /m**3\n"
+ ]
+ }
+ ],
+ "prompt_number": 55
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.23 Page no. 85"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "C=5*10**28 #atom/m**3, concentration of Si atoms\n",
+ "DL=2*10**8 #Doping level \n",
+ "m=1\n",
+ "me=m\n",
+ "Nd=C/DL\n",
+ "nc=Nd\n",
+ "T=((nc/(4.82*10**21))*(m/me)**(1.5))**(2/3.0)\n",
+ "\n",
+ "print\"The absolute temprature is\",round(T,2),\"K\"\n",
+ "\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The absolute temprature is 0.14 K\n"
+ ]
+ }
+ ],
+ "prompt_number": 61
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.24 Page No. 85"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "T1=300.0 #K temprature\n",
+ "T2=400.0\n",
+ "k=1.38*10**-23 #J/k\n",
+ "m=1.25*9.107*10**-31\n",
+ "h=6.625*10**-34\n",
+ "dE=0.3 #eV\n",
+ "k_=8.62*10**-5\n",
+ "\n",
+ "import math\n",
+ "nc1=2*(2*math.pi*m*k*T1/(h**2))**(1.5)\n",
+ "n1=nc1*math.exp(-(0.3/(k_*T1)))\n",
+ "\n",
+ "nc2=2*(2*math.pi*m*k*T2/(h**2))**(1.5)\n",
+ "n2=nc2*math.exp(-(0.3/(k_*T2)))\n",
+ "\n",
+ "print\"The effective density at temprature 300 K is\",round(n1,-19),\"/m**3\"\n",
+ "print\"The effective density at temprature 400 K is\",round(n2,-19),\"/m**3\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The effective density at temprature 300 K is 3.2e+20 /m**3\n",
+ "The effective density at temprature 400 K is 8.98e+21 /m**3\n"
+ ]
+ }
+ ],
+ "prompt_number": 110
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.25 Page no.86"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "T=300.0\n",
+ "k=8.62*10**-5 #J/k\n",
+ "m=9.107*10**-31\n",
+ "me=0.6*m\n",
+ "mh=0.4*m\n",
+ "\n",
+ "\n",
+ "dE=-3*k*T*math.log((me/mh)**(1))/4.0 #dE=Ef-Emidgap\n",
+ "\n",
+ "print\"The position of fermi level is\",round(dE,4),\"eV\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The position of fermi level is -0.0079 eV\n"
+ ]
+ }
+ ],
+ "prompt_number": 116
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.26 Page no 86"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "T=300.0\n",
+ "Eg=0.72 #eV Energy gap\n",
+ "k=8.62*10**-5 #J/k\n",
+ "me=1\n",
+ "mh=5.0\n",
+ "\n",
+ "import math\n",
+ "dE=(Eg/2.0)-3*k*T*math.log(me/mh)/4.0 #dE=Ef-Emidgap\n",
+ "\n",
+ "print\"The position of fermi level is\",round(dE,4),\"eV\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The position of fermi level is 0.3912 eV\n"
+ ]
+ }
+ ],
+ "prompt_number": 131
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.27 Page no 87"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "T1=300.0\n",
+ "T2=350\n",
+ "Eg=0.24 #eV Energy gap\n",
+ "\n",
+ "import math\n",
+ "dE=(T2/T1)*Eg\n",
+ "\n",
+ "print\"The position of fermi level is\",round(dE,4),\"eV\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The position of fermi level is 0.28 eV\n"
+ ]
+ }
+ ],
+ "prompt_number": 134
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.28 Page no.88"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "T1=300.0\n",
+ "T2=400\n",
+ "Eg=0.27 #eV Energy gap\n",
+ "\n",
+ "import math\n",
+ "dE=(T2/T1)*Eg\n",
+ "\n",
+ "print\"The position of fermi level is\",round(dE,4),\"eV\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The position of fermi level is 0.36 eV\n"
+ ]
+ }
+ ],
+ "prompt_number": 133
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.29 page no.88"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "dE1=0.3 #eV Energy gap\n",
+ "kT=0.026 #eV\n",
+ "\n",
+ "import math\n",
+ "x=math.exp(-dE1/kT) #x=Nd/nc\n",
+ "y=5 #y=Nd2/Nd1\n",
+ "dE2=-math.log(y)*kT+dE1\n",
+ "\n",
+ "print\"The position of fermi level is\",round(dE2,3),\"eV\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The position of fermi level is 0.258 eV\n"
+ ]
+ }
+ ],
+ "prompt_number": 137
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.30 Page no.89"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "dE1=0.39 #eV Energy gap\n",
+ "kT=0.026 #eV\n",
+ "\n",
+ "import math\n",
+ "x=math.exp(-dE1/kT) #x=NA1/nV\n",
+ "y=3 #y=NA2/NA1\n",
+ "dE2=((dE1/kT)-math.log(y))*kT\n",
+ "\n",
+ "\n",
+ "print\"The position of fermi level is\",round(dE2,2),\"eV\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The position of fermi level is 0.36 eV\n"
+ ]
+ }
+ ],
+ "prompt_number": 143
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.31 Page no.91"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "rho=1 #ohm-m Resistivity\n",
+ "Rh=100.0 #cm**3/coulomb\n",
+ "e=1.6*10**-19\n",
+ "\n",
+ "con=1/rho #Conductivity\n",
+ "R=1/Rh #Charge density\n",
+ "ED=R*10**6/e\n",
+ "mu=con/(R*10**6)\n",
+ "\n",
+ "print\"The electron density is\",ED,\"/m**3\"\n",
+ "print\"The mobility is %.e\"%mu,\"/m**3\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The electron density is 6.25e+22 /m**3\n",
+ "The mobility is 1e-04 /m**3\n"
+ ]
+ }
+ ],
+ "prompt_number": 9
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.32 Page no. 92"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "w=0.1 #m width\n",
+ "t=0.01 #m thickness\n",
+ "F=0.6 #T, field\n",
+ "Rh=3.8*10**-4 #Hall Coefficient\n",
+ "I=10 #mA\n",
+ "\n",
+ "Vh=(Rh*F*I/w)\n",
+ "\n",
+ "print\"Hall Voltage is\",Vh*1000,\"micro V\"\n",
+ "\n",
+ "\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Hall Voltage is 22.8 micro V\n"
+ ]
+ }
+ ],
+ "prompt_number": 146
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.33 Page No. 92"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "e=1.6*10**-19\t\t\t#in coulamb\n",
+ "ND=10**17\t\t\t#in cm**-3\n",
+ "Bz=0.1\t\t\t\t#in Wb/m**2\n",
+ "w=4\t\t\t\t#in mm\n",
+ "d=4\t\t\t\t#in mm\n",
+ "Ex=5\t\t\t\t#in V/cm\n",
+ "MUe=3800\t\t\t#in cm**2/V-s\n",
+ "\n",
+ "v=MUe*Ex\t\t\t#in cm/s\n",
+ "v=v*10**-2\t\t\t#in m/s\n",
+ "VH=Bz*v*d\t\t\t#in mV\n",
+ "\n",
+ "print\"Magnitude of hall voltage is\",VH,\"mV\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Magnitude of hall voltage is 76.0 mV\n"
+ ]
+ }
+ ],
+ "prompt_number": 19
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.34 Page No.92"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "e=1.6*10**-19\t\t\t#in coulamb\n",
+ "ND=10**21\t\t\t#in m**-3\n",
+ "Bz=0.2\t\t\t\t#in T\n",
+ "d=4\t\t\t\t#in mm\n",
+ "d=d*10**-3\t\t\t#in meter\n",
+ "J=600\t\t\t\t#in A/m**2\n",
+ "n=ND\t\t\t\t#in m**-3\n",
+ "\n",
+ "VH=Bz*J*d/(n*e)\t\t\t#in V\n",
+ "\n",
+ "print\"Magnitude of hall voltage is \",VH*10**3,\"mV\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Magnitude of hall voltage is 3.0 mV\n"
+ ]
+ }
+ ],
+ "prompt_number": 22
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 2.35 Page No."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "e=1.6*10**-19\t\t\t#in coulamb\n",
+ "rho=0.00912\t\t\t#in ohm-m\n",
+ "B=0.48\t\t\t\t#in Wb/m**2\n",
+ "RH=3.55*10**-4\t\t\t#in m**3-coulamb**-1\n",
+ "SIGMA=1/rho\t\t\t#in (ohm=m)**-1\n",
+ "\n",
+ "import math\n",
+ "THETAh=math.atan(SIGMA*B*RH)\t#in Degree\n",
+ "\n",
+ "print\"Hall angle is\",round(THETAh*180/3.14,4),\"degree\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Hall angle is 1.0709 degree\n"
+ ]
+ }
+ ],
+ "prompt_number": 169
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [],
+ "language": "python",
+ "metadata": {},
+ "outputs": []
+ }
+ ],
+ "metadata": {}
+ }
+ ]
+}
\ No newline at end of file diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch3.ipynb b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch3.ipynb new file mode 100755 index 00000000..19b5eab1 --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch3.ipynb @@ -0,0 +1,341 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Chapter3 : Excess Carriers in Semiconductor" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Example 3.2 Page No 111" + ] + }, + { + "cell_type": "code", + "execution_count": 3, + "metadata": { + "collapsed": false + }, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Minimum required energy is 2.06 eV \n" + ] + } + ], + "source": [ + "#Example 3.2\n", + "#What is Minimum required energy \n", + "\n", + "#given data\n", + "l=6000 #in Angstrum\n", + "h=6.6*10**(-34) #Planks constant\n", + "c=3*10**8 #speed of light in m/s\n", + "e=1.602*10**(-19) #Constant\n", + "\n", + "#calculation\n", + "phi=c*h/(e*l*10**(-10))\n", + "\n", + "#result\n", + "print\"Minimum required energy is\",round(phi,2),\"eV \"\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Example 3.3 Page No 112" + ] + }, + { + "cell_type": "code", + "execution_count": 6, + "metadata": { + "collapsed": false + }, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Work function of the cathode material is 2.39 eV\n" + ] + } + ], + "source": [ + "#Exa 3.3\n", + "#calculate Work function of the cathode material\n", + "\n", + "#given data\n", + "Emax=2.5 #maximum energy of emitted electrons in eV \n", + "l=2537.0 #in Angstrum\n", + "\n", + "#Calculation\n", + "EeV=12400.0/l #in eV\n", + "phi=EeV-Emax #in eV\n", + "\n", + "#result\n", + "print \"Work function of the cathode material is \",round(phi,2),\"eV\"" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Example 3.4 Page No 115" + ] + }, + { + "cell_type": "code", + "execution_count": 1, + "metadata": { + "collapsed": false + }, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "(i)Thus power absorbed is 0.009 J/s\n", + "(ii)Energy converted into heat is 0.0026 J/s\n", + "(iii)Number of photons per second given off from recombination events 2.81e+16\n" + ] + } + ], + "source": [ + "#Example 3.4\n", + "#Find (i)The fraction of each photon energy unit which is converted into heat\",f\n", + "#(ii)Energy converted into heat in ,((2-1.43)/2)*0.009,\"J/s\"\n", + "#(iii)Number of photons per second given off from recombination events \",0.009/(e*2)\n", + "\n", + "#given data\n", + "t=0.46*10**-4 #in centi meters\n", + "hf1=2 #in ev\n", + "hf2=1.43\n", + "Pin=10 #in mW\n", + "alpha=50000 # in per cm\n", + "e=1.6*10**-19 #constant\n", + "Io=0.01 #in mW\n", + "\n", + "import math\n", + "\n", + "#Calculation\n", + "It=Io*math.exp(-alpha*t) #in mW\n", + "Iabs=Io-It\n", + "f=(hf1-hf2)/hf1\n", + "E=f*Iabs\n", + "N=Iabs/(e*hf1)\n", + "\n", + "#result\n", + "print\"(i)Thus power absorbed is \",round(Iabs,3),\"J/s\"\n", + "print\"(ii)Energy converted into heat is\",round(E,4),\"J/s\"\n", + "print\"(iii)Number of photons per second given off from recombination events \",round(N,-14)\n", + "#In book there is calculation mistake in Number of photons." + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Example 3.5 Page No 123" + ] + }, + { + "cell_type": "code", + "execution_count": 29, + "metadata": { + "collapsed": false + }, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Electron transit time in sec is 6.4e-09 s\n", + "Photoconductor gain is 216.0\n" + ] + } + ], + "source": [ + "#Example 3.5\n", + "#What is Photoconductor gain \n", + "#Electron transit time.\n", + "\n", + "#given data\n", + "L=100 #in uM\n", + "A=10&-7 #in cm**2\n", + "th=10**-6 #in sec\n", + "V=12 #in Volts\n", + "ue=0.13 #in m**2/V-s\n", + "uh=0.05 #in m**2/V-s\n", + "\n", + "#Calculation\n", + "E=V/(L*10**-6) #in V/m\n", + "tn=(L*10**-6)/(ue*E)\n", + "Gain=(1+uh/ue)*(th/tn)\n", + "\n", + "#result\n", + "print\"Electron transit time in sec is \",round(tn,10),\"s\"\n", + "print\"Photoconductor gain is \",Gain" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Example 3.6 Page No128" + ] + }, + { + "cell_type": "code", + "execution_count": 30, + "metadata": { + "collapsed": false + }, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Current flowing through diode is 15.0 micra A\n" + ] + } + ], + "source": [ + "#Example3.6\n", + "#Calculate Current flowing through diode .\n", + "\n", + "#given datex\n", + "import math\n", + "Io=0.15 #in uA\n", + "V=0.12 #in mVolt\n", + "Vt=26 #in mVolt\n", + "\n", + "#calculation\n", + "I=Io*10**-6*(math.exp(V/(Vt*10**-3))-1) #in A\n", + "\n", + "#result\n", + "print\"Current flowing through diode is \",round(I*10**6,2),\"micra A\"" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Example 3.7 Page No 128" + ] + }, + { + "cell_type": "code", + "execution_count": 31, + "metadata": { + "collapsed": false + }, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Forward voltage is 0.43 V\n" + ] + } + ], + "source": [ + "#Exa 3.7\n", + "#Determine the Forward voltage \n", + "\n", + "#given data\n", + "import math\n", + "Io=2.5 #in uA\n", + "I=10 #in mA\n", + "Vt=26 #in mVolt\n", + "n=2 #for silicon\n", + "\n", + "#Calculation\n", + "V=n*Vt*10**-3*math.log((I*10**-3)/(Io*10**-6))\n", + "\n", + "#Result\n", + "print \"Forward voltage is \",round(V,2),\"V\"" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Example 3.8 Page No 128" + ] + }, + { + "cell_type": "code", + "execution_count": 33, + "metadata": { + "collapsed": false + }, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Reverse saturation current density is 0.16 uA \n" + ] + } + ], + "source": [ + "#Example 3.8\n", + "#What is Reverse saturation current density \n", + "\n", + "#given data\n", + "ND=10**21 #in m**-3\n", + "NA=10**22 #in m**-3\n", + "De=3.4*10**-3 #in m**2-s**-1\n", + "Dh=1.2*10**-3 #in m**2-s**-1\n", + "Le=7.1*10**-4 #in meters\n", + "Lh=3.5*10**-4 #in meters\n", + "ni=1.6*10**16 #in m**-3\n", + "e=1.602*10**-19 #constant\n", + "\n", + "#calculation\n", + "IoA=e*ni**2*(Dh/(Lh*ND)+De/(Le*NA))\n", + "\n", + "#Result\n", + "print\"Reverse saturation current density is \",round(IoA*10**6,2),\"uA \"" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": { + "collapsed": false + }, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 2", + "language": "python", + "name": "python2" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 2 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython2", + "version": "2.7.3" + } + }, + "nbformat": 4, + "nbformat_minor": 0 +} diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch4.ipynb b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch4.ipynb new file mode 100755 index 00000000..47f532e6 --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch4.ipynb @@ -0,0 +1,1026 @@ +{ + "metadata": { + "name": "", + "signature": "sha256:606a5c9e48de665a7bdbd2fe9ec84d0a776a619019e1e88b4d21b1affe9620a0" + }, + "nbformat": 3, + "nbformat_minor": 0, + "worksheets": [ + { + "cells": [ + { + "cell_type": "heading", + "level": 1, + "metadata": {}, + "source": [ + "Chapter 4: Junction Properties" + ] + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.1 page No. 146" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#given data\n", + "import math\n", + "T=300\t\t\t #in Kelvin\n", + "ND=5*10**13\t\t #in cm**-3\n", + "NA=0\t\t\t #in cm**-3\n", + "ni=2.4*10**13\t\t#in cm**-3\n", + "\n", + "#Calculation\n", + "no=ND/2.0+math.sqrt((ND/2.0)**2+ni**2)\t#in cm**-3\n", + "po=ni**2/no\t\t#in cm**-3\n", + "\n", + "#Result\n", + "print\"Majority carrier electron concentration is \",round(no,-11),\"cm**-3\"\n", + "print\"Minority carrier hole concentration is \",round(po,-11),\" cm**-3\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Majority carrier electron concentration is 5.97e+13 cm**-3\n", + "Minority carrier hole concentration is 9.7e+12 cm**-3\n" + ] + } + ], + "prompt_number": 14 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.2 Page No.146" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#given data\n", + "import math\n", + "T=300\t\t\t#in Kelvin\n", + "ND=10**16\t\t#in cm**-3\n", + "NA=0\t\t\t #in cm**-3\n", + "ni=1.5*10**10\t\t#in cm**-3\n", + "\n", + "#Calculation\n", + "no=ND/2.0+math.sqrt((ND/2.0)**2+ni**2)\t#in cm**-3\n", + "po=ni**2/no\t\t#in cm**-3\n", + "\n", + "#result\n", + "print\"Majority carrier electron concentration is \",no,\"cm**-3\"\n", + "print\"Minority carrier hole concentration is \",round(po,0),\" cm**-3\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Majority carrier electron concentration is 1e+16 cm**-3\n", + "Minority carrier hole concentration is 22500.0 cm**-3\n" + ] + } + ], + "prompt_number": 16 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.3 Page No. 147" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#given data\n", + "import math\n", + "T=300\t\t\t#in Kelvin\n", + "ND=3*10**15\t\t#in cm**-3\n", + "NA=10**16\t\t#in cm**-3\n", + "ni=1.6*10**10\t\t#in cm**-3\n", + "\n", + "#Calculation\n", + "po=(NA-ND)/2+math.sqrt(((NA-ND)/2.0)**2+ni**2.0)\t#in cm**-3\n", + "no=ni**2/po\t\t#in cm**-3\n", + "\n", + "#Result\n", + "print\"Majority carrier hole concentration is\",round(po,-8),\" cm**-3\"\n", + "print\"Minority carrier electron concentration is \",round(no,0),\" cm**-3\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Majority carrier hole concentration is 7e+15 cm**-3\n", + "Minority carrier electron concentration is 36571.0 cm**-3\n" + ] + } + ], + "prompt_number": 19 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.4 Page No. 147" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given \n", + "import math\n", + "ND=3*10**15\t\t#in cm**-3\n", + "Eg=1.12 #eV\n", + "k=8.62*10**-5 #eV/k\n", + "Nc=2.8*10**19\n", + "Nv=1.04*10**19\n", + "\n", + "#Calculation\n", + "import math\n", + "# from the equation po=(NA-ND)/2+math.sqrt(((NA-ND)/2.0)**2+ni**2.0)\t#in cm**-3\n", + "No=1.05*ND\n", + "ni=math.sqrt((No-ND/2.0)**2-0.25*ND**2)\n", + "#From ni**2=Nc*Nv*exp(-Eg/(k*t))\n", + "T=Eg/(-math.log(ni**2/(Nc*Nv))*k)\n", + "\n", + "#Result\n", + "print \"The maximum Temprature is \",round(T,1),\"K\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "The maximum Temprature is 642.0 K\n" + ] + } + ], + "prompt_number": 45 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.5 Page No. 151" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + " \n", + "#given data\n", + "import math\n", + "T=300\t\t#in Kelvin\n", + "ND=10**15\t#in cm**-3\n", + "NA=10**18\t#in cm**-3\n", + "ni=1.5*10**10\t#in cm**-3\n", + "VT=T/11600.0\t#in Volts\n", + "\n", + "#Calculation\n", + "Vbi=VT*math.log(NA*ND/ni**2)\t#in Volts\n", + "\n", + "#result\n", + "print\"Built in potential barrier is\",round(Vbi,4),\"V\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Built in potential barrier is 0.7532 V\n" + ] + } + ], + "prompt_number": 47 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.6 Page No.151" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "T=300\t\t #in Kelvin\n", + "ND=10**21\t #in m**-3\n", + "NA=10**21\t #in m**-3\n", + "ni=1.5*10**16 #in m**-3\n", + "VT=T/11600.0\t#in Volts\n", + "\n", + "#Calculation\n", + "import math\n", + "Vo=VT*math.log(NA*ND/ni**2)\t#in Volts\n", + "\n", + "#result\n", + "print\"Contact potential is\",round(Vo,4),\"V\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Contact potential is 0.5745 V\n" + ] + } + ], + "prompt_number": 52 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.7 Page No. 154" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#given data\n", + "import math\n", + "T=300\t\t\t#in Kelvin\n", + "ND=10**15\t\t#in cm**-3\n", + "NA=10**16\t\t#in cm**-3\n", + "ni=1.5*10**10\t\t#in cm**-3\n", + "VT=T/11600.0\t\t#in Volts\n", + "e=1.6*10**-19\t #in Coulamb\n", + "\n", + "#calculation\n", + "epsilon=11.7*8.854*10**-14\t #constant\n", + "Vbi=VT*math.log(NA*ND/ni**2)\t\t#in Volts\n", + "SCW=math.sqrt((2*epsilon*Vbi/e)*(NA+ND)/(NA*ND))#in cm\n", + "SCW=SCW*10**4 #in uMeter\n", + "xn=0.864\t\t#in uM\n", + "xp=0.086\t\t#in uM\n", + "Emax=-e*ND*xn/epsilon\t#in V/cm\n", + "\n", + "#result\n", + "print\"Space charge width is\",round(SCW,2),\"micro meter\"\n", + "print\"At metallurgical junction, i.e for x=0 the electric field is \",round(Emax/10000,0),\"V\"#Note : Ans in the book is wrong" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Space charge width is 0.95 micro meter\n", + "At metallurgical junction, i.e for x=0 the electric field is -13345.0 V\n" + ] + } + ], + "prompt_number": 2 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.8 Page No.160" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#given data\n", + "import math\n", + "Ecf=0.3 #in Volts\n", + "T=27.0+273.0 #in Kelvin\n", + "delT=55 #in degree centigrade\n", + "\n", + "#calculation\n", + "#formula : Ecf=Ec-Ef=K*T*math.log(nc/ND)\n", + "#let K*math.log(nc/ND)=y\n", + "#Ecf=Ec-Ef=T*y\n", + "y=Ecf/T #assumed\n", + "Tnew=273+55 #in Kelvin\n", + "EcfNEW=y*Tnew #in Volts\n", + "\n", + "#result\n", + "print\"New position of fermi level is \",round(EcfNEW,4),\"V\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "New position of fermi level is 0.328 V\n" + ] + } + ], + "prompt_number": 9 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.9 Page No. 161" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + " \n", + "#given data\n", + "import math\n", + "T=300\t\t\t#in Kelvin\n", + "ND=8*10**14\t\t#in cm**-3\n", + "NA=8*10**14\t\t#in cm**-3\n", + "ni=2*10**13\t\t#in cm**-3\n", + "k=8.61*10**-5\t\t#in eV/K\n", + "\n", + "#calculation\n", + "Vo=k*T*math.log(NA*ND/ni**2)\t#in Volts\n", + "\n", + "#Result\n", + "print\"Contact potential is \",round(Vo,2),\"V\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Contact potential is 0.19 V\n" + ] + } + ], + "prompt_number": 7 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.10 page No.161" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#given data\n", + "ND=2*10**16 #in cm**-3\n", + "NA=5*10**15 #in cm**-3\n", + "Ao=4.83*10**21 \t#constant\n", + "T=300.0\t\t\t #in Kelvin\n", + "EG=1.1\t \t \t #in eV\n", + "kT=0.026 \t\t#in eV\n", + "\n", + "#Calculation\n", + "ni=Ao*T**(1.5)*math.exp(-EG/(2*kT))\t\t#in m**-3\n", + "p=(ni/10**6)**2/ND\t\t\t#in cm**-3\n", + "n=((ni/10**6)**2)/NA\t\t\t#in cm**-3\n", + "\n", + "#Result\n", + "\n", + "print\"Hole concentration in cm**-3 : %.1e\"%round(p,0),\"/cm**3\"\n", + "print\"electron concentration in cm**-3 :%.1e\"%round(n,0),\"/cm**3\"\n", + "print\"\\nNOTE:\\nSlight Variation in answer due to wrong value of ni in book as 1.6*10**16 instead of\",ni\n", + "if n < e:\n", + " \n", + " print\"\\n\\nthe given Si is of P-type\" \n", + "else:\n", + " print \"\\nThe given Si is of N-type\"\n", + " " + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Hole concentration in cm**-3 : 1.3e+04 /cm**3\n", + "electron concentration in cm**-3 :5.3e+04 /cm**3\n", + "\n", + "NOTE:\n", + "Slight Variation in answer due to wrong value of ni in book as 1.6*10**16 instead of 1.63166259315e+16\n", + "\n", + "The given Si is of N-type\n" + ] + } + ], + "prompt_number": 42 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.11 Page No. 168" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "V=5\t\t #in volts\n", + "Vo=0.7\t #in Volts\n", + "R=100\t\t#in Kohm\n", + "\n", + "#Calculation\n", + "I=(V-Vo)/R\t#in Ampere\n", + "\n", + "#result\n", + "print\"Current flowing through the circuit is\",round(I*1000,0),\"mA\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Current flowing through the circuit is 43.0 mA\n" + ] + } + ], + "prompt_number": 6 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.12 Page No. 168" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "V=15\t\t\t #in volts\n", + "Vo=0.7\t\t\t#in Volts\n", + "R=7\t \t \t#in Kohm\n", + "\n", + "#Calculation\n", + "I=(V-2*Vo)/R\n", + "I=(V-2*Vo)/R\t\t#in mAmpere\n", + "VA=I*R\t \t\t#in Volts\n", + "\n", + "#result\n", + "print\"Voltagee VA is \",VA,\"V\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Voltagee VA is 13.6 V\n" + ] + } + ], + "prompt_number": 20 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.13 Page No.169" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "V=15 #V, voltage\n", + "Vb=0.3 #V, Barrier Potential #When supply is switched on\n", + "\n", + "#Calculation\n", + "VA=V-Vb\n", + "\n", + "#Result\n", + "print\"The Voltage VA is \",VA,\"V\"\n", + "\n" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "The Voltage VA is 14.7 V\n" + ] + } + ], + "prompt_number": 23 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.14 Page No.172" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#given data\n", + "Vz=5\t\t\t#in volts\n", + "to=25\t\t\t#in degree centigrade\n", + "t=100\t\t\t#in degree centigrade\n", + "Vdrop=4.8\t\t#in Volts\n", + "\n", + "#calculation\n", + "delVz=Vdrop-Vz\t\t#in Volts\n", + "delt=t-to\t\t#in degree centigrade\n", + "TempCoeff=delVz*100/(Vz*delt)\n", + "\n", + "#result\n", + "print\"Temperature coefficient f zener diode is \",round(TempCoeff,3),\"percent\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Temperature coefficient f zener diode is -0.053 percent\n" + ] + } + ], + "prompt_number": 22 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.15 Page No. 174" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "Vz=8.0\t\t\t#in volts\n", + "VS=12.0\t\t\t#in volts\n", + "RL=10.0\t\t\t#in Kohm\n", + "Rs=5.0\t\t\t#in Kohm\n", + "\n", + "#part (a)\n", + "Vout=Vz\t\t\t#in volts\n", + "\n", + "#part (b)\n", + "Vrs=VS-Vout\t\t#in volts\n", + "IL=Vout/RL \t\t#in mAmpere\n", + "Is=(VS-Vout)/Rs\t#in mAmpere\n", + "\n", + "#part c\n", + "Iz=Is-IL\t \t#in mAmpere\n", + "\n", + "#result\n", + "print\"(a)Output voltage will be equal to Vout=\",Vout,\" Volts\"\n", + "print\"(b)Voltage across Rs is Rs=\",Vrs,\"V\"\n", + "print\"(c)Current through zener diode is Iz=\",round(Iz,1),\"mA\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "(a)Output voltage will be equal to Vout= 8.0 Volts\n", + "(b)Voltage across Rs is Rs= 4.0 V\n", + "(c)Current through zener diode is Iz= 0.0 mA\n" + ] + } + ], + "prompt_number": 47 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.16 Page No. 175" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#given data\n", + "Vz=50.\t\t\t#in volts\n", + "VSmax=120.0\t\t#in volts\n", + "VSmin=80.0\t\t#in volts\n", + "RL=10.0\t\t\t#in Kohm\n", + "Rs=5.0\t\t\t#in Kohm\n", + "\n", + "#Calculation\n", + "Vout=Vz\t\t\t#in Volts\n", + "IL=Vout/RL\t\t#in mAmpere\n", + "\n", + "ISmax=(VSmax-Vout)/Rs\t#in mAmpere\n", + "Izmax=ISmax-IL\t\t#in mA\n", + "Ismin=(VSmin-Vout)/Rs#in mAmpere\n", + "Izmin=Ismin-IL#in mA\n", + "\n", + "#Result\n", + "print\"Maximum zener diode current is \",Izmax,\"mA\"\n", + "print\"Minimum zener diode current is \",Izmin,\"mA\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Maximum zener diode current is 9.0 mA\n", + "Minimum zener diode current is 1.0 mA\n" + ] + } + ], + "prompt_number": 32 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.17 Page No. 175" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "Vz=15\t\t#in volts\n", + "Izk=6.0\t\t#in mA\n", + "Vout=15\t\t#in Volts\n", + "Vs=20\t\t#in Volts\n", + "ILmin=10.0\t#in mA\n", + "ILmax=20.0\t#in mA\n", + "RS=(Vs-Vz)*1000/(ILmax+Izk)\t#in ohm\n", + "\n", + "#result\n", + "print\"sereis Resistance is \",round(RS,1),\"ohm\"\n", + "print\"The zener current will be minimum i.e. Izk = 6mA when load current is maximum i.e. ILmax = 20mA\"\n", + "print\"when the load current will decrease and become 10 mA, the zener current will increase and become 6+10 i.e. 16 mA. \\nThus the current through series resistance Rs will remain unchanged at 6+20 i.e. 26 mA. \\nThus voltage drop in series resistance Rs will remain constant. Consequently, the output voltage will also remain constant. \"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "sereis Resistance is 192.3 ohm\n", + "The zener current will be minimum i.e. Izk = 6mA when load current is maximum i.e. ILmax = 20mA\n", + "when the load current will decrease and become 10 mA, the zener current will increase and become 6+10 i.e. 16 mA. \n", + "Thus the current through series resistance Rs will remain unchanged at 6+20 i.e. 26 mA. \n", + "Thus voltage drop in series resistance Rs will remain constant. Consequently, the output voltage will also remain constant. \n" + ] + } + ], + "prompt_number": 48 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.18 Page No. 175" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "Vs=16.0\t\t #in volts\n", + "RL=1.2\t\t\t#in Kohm\n", + "Rs=1.0\t\t\t#in Kohm\n", + "\n", + "#calculation\n", + "#If zener open circuited\n", + "VL=Vs*RL/(Rs+RL)\t#in Volts\n", + "Iz=0\t\t\t#in mA\n", + "Pz=VL*Iz\t\t#in watts\n", + "\n", + "#result\n", + "print\"When zener open circuited Voltage across load is \",round(VL,2),\"V\"\n", + "print\"Zener current is \",Iz,\"mA\"\n", + "print\"Power is\",Pz,\"watt\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "When zener open circuited Voltage across load is 8.73 V\n", + "Zener current is 0 mA\n", + "Power is 0.0 watt\n" + ] + } + ], + "prompt_number": 52 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.19 Page No. 126" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "Vin=20\t\t\t#in volts\n", + "Rs=220.0\t\t\t#in Kohm\n", + "Vz=10\t\t \t#in volts\n", + "RL2=50.0\t\t\t#in Kohm\n", + "RL1=200\t\t\t#in Kohm\n", + "\n", + "#calculation\n", + "# part (i) RL=50\t#in Kohm\n", + "VL1=Vin*RL1/(RL+Rs)\n", + "IR=Vin/(Rs+RL)\t#in mA\n", + "IL=IR\t\t \t#in mA\n", + "IZ=0\t\t\t #in mA\n", + "\n", + "if VL1< Vz:\n", + " \n", + " print\"Zener diode will not conduct and VL=\",round(VL1,1),\"V\" \n", + "else:\n", + " print \"Zener diode will conduct\"\n", + "\n", + " \n", + "#Result\n", + "print\"When RL=200 ohm\"\n", + "print\"IL is\",round(IL*1000,2),\"mA\"\n", + "print\"IR is\",round(IR*10**3,2),\"mA\"\n", + "print\"Iz in mA: \",round(IZ,0),\"mA\"\n", + "\n", + "# part (ii) RL=200#in Kohm\n", + "RL=200\t\t\t#in Kohm\n", + "VL2=Vin*RL2/(RL2+Rs)\n", + "IR=Vin/(Rs+RL2)\t\t#in mA\n", + "IL=IR\t\t\t#in mA\n", + "IZ=0\t\t\t#in mA\n", + "\n", + "#result\n", + "if VL2< Vz:\n", + " \n", + " print\"Zener diode will not conduct and VL=\",round(VL2,1),\"V\" \n", + "else:\n", + " print \"Zener diode will conduct\"\n", + "\n", + "print\"When RL=50 ohm\"\n", + "print\"IL is\",round(IL*1000,2),\"mA\"\n", + "print\"IR is\",round(IR*10**3,2),\"mA\"\n", + "print\"Iz in mA: \",IZ,\"mA\"\n" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Zener diode will not conduct and VL= 9.5 V\n", + "When RL=200 ohm\n", + "IL is 47.62 mA\n", + "IR is 47.62 mA\n", + "Iz in mA: 0.0 mA\n", + "Zener diode will not conduct and VL= 3.7 V\n", + "When RL=50 ohm\n", + "IL is 74.07 mA\n", + "IR is 74.07 mA\n", + "Iz in mA: 0 mA\n" + ] + } + ], + "prompt_number": 64 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.20 Page No. 176" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "RL=10.0\t\t\t #in Kohm\n", + "Rs=5.0 #in Kohm\n", + "Vin=100\t\t\t #in Volts\n", + "\n", + "#Calculation\n", + "V=Vin*RL/(RL+Rs)\t#in Volt\n", + "VZ=50\t\t\t#in Volts\n", + "VL=VZ\t\t\t#in volts\n", + "#Apply KVL\n", + "VR=100-50\t\t#in Volts\n", + "VR=50\t\t\t#in Volts\n", + "\n", + "if V< VZ:\n", + " \n", + " print\"Zener diode is OFF state\" \n", + "else:\n", + " print \"zener diode is ON state\"\n", + "\n", + "print\"Hence the voltage dropp across the 5 Kohm resistor in Volts is \",VR,\"V\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "zener diode is ON state\n", + "Hence the voltage dropp across the 5 Kohm resistor in Volts is 50 V\n" + ] + } + ], + "prompt_number": 67 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.21 Page No. 176" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "RL=120.0\t\t\t#in ohm, load resistance\n", + "Izmin=20\t\t#in mA min. diode current\n", + "Izmax=200\t\t#in mA max. diode current\n", + "VL=12\t\t\t#in Volts\n", + "VDCmin=15\t\t#in Volts\n", + "VDCmax=19.5\t\t#in Volts\n", + "Vz=12\t\t\t#in Volts\n", + "IL=VL/RL\t\t#in Ampere\n", + "IL=IL*1000\t\t#in mAmpere\n", + "\n", + "#calculation\n", + "#For VDCmin = 15 volts\n", + "VSmin=VDCmin-Vz\t\t#in Volts\n", + "#For VDCmax = 19.5 volts\n", + "VSmax=VDCmax-Vz\t\t#in Volts\n", + "ISmin=Izmin+IL\t\t#in mA\n", + "Ri=VSmin/ISmin\t\t#in Kohm\n", + "Ri=Ri*10**3\t\t#in ohm\n", + "\n", + "#result\n", + "print\"The resistance Ri is \",Ri,\"ohm\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "The resistance Ri is 25.0 ohm\n" + ] + } + ], + "prompt_number": 72 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 4.22 Page No. 177" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "VRL=10\t\t\t#in Volts Diode resistance\n", + "Vi=50\t\t\t#in Volts\n", + "R=1.0\t\t\t#in Kohm Resistance\n", + "Vz=10\t\t\t#in Volts\n", + "VL=Vz\t\t\t#in Volts\n", + "Izm=32\t\t\t#in mA\n", + "IR=(Vi-VL)/R\t\t#in mA\n", + "\n", + "Izmin=0\t\t\t #in mA\n", + "ILmax=IR-Izmin\t\t#in mA\n", + "RLmin=VL/ILmax\t\t#in Ohm\n", + "Izmax=32\t\t #in mA\n", + "ILmin=IR-Izmax\t\t#in mA\n", + "VL=Vz\t\t\t #in Volts\n", + "RLmax=VL/ILmin\t\t#in Ohm\n", + "\n", + "#Result\n", + "print\"Range of RL in Kohm : From \",RLmin*1000,\"ohm to \",RLmax,\"kohm\"\n", + "print\"Range of IL in mA : From \",ILmin,\"mA to \",ILmax,\"mA\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Range of RL in Kohm : From 250.0 ohm to 1.25 kohm\n", + "Range of IL in mA : From 8.0 mA to 40.0 mA\n" + ] + } + ], + "prompt_number": 71 + }, + { + "cell_type": "code", + "collapsed": false, + "input": [], + "language": "python", + "metadata": {}, + "outputs": [] + } + ], + "metadata": {} + } + ] +}
\ No newline at end of file diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch5.ipynb b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch5.ipynb new file mode 100755 index 00000000..bcf84c6b --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch5.ipynb @@ -0,0 +1,148 @@ +{
+ "metadata": {
+ "name": "El5"
+ },
+ "nbformat": 3,
+ "nbformat_minor": 0,
+ "worksheets": [
+ {
+ "cells": [
+ {
+ "cell_type": "heading",
+ "level": 1,
+ "metadata": {},
+ "source": [
+ "Chapter 5: Junction Properties (Continued)"
+ ]
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 5.1 Page No 191"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "import math\n",
+ "ND=10**17 #in atoms/cm**3\n",
+ "NA=0.5*10**16 #in atoms/cm**3\n",
+ "Vo=0.7 #in Volts\n",
+ "V=-10.0 #in Volts\n",
+ "ND=ND*10**6 #in atoms/m**3\n",
+ "NA=NA*10**6 #in atoms/m**3\n",
+ "epsilon=8.85*10**-11 #in F/m\n",
+ "e=1.6*10**-19 #coulamb\n",
+ "\n",
+ "VB=0.7 #in Volts\n",
+ "W1=math.sqrt(2*epsilon*VB*(1/NA+1/ND)/e) #in m\n",
+ "\n",
+ "VB=Vo-V #in Volts\n",
+ "W2=math.sqrt(2*epsilon*VB*(1/NA+1/ND)/e) #in m\n",
+ "\n",
+ "print \"When no external voltage is applied, Junction width is \",round(W1,8),\"m\"\n",
+ "print\"When external voltage of -10 Volt is applied, Junction width is \",round(W2,7),\"m\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "When no external voltage is applied, Junction width is 3.9e-07 m\n",
+ "When external voltage of -10 Volt is applied, Junction width is 1.5e-06 m\n"
+ ]
+ }
+ ],
+ "prompt_number": 11
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 5.3 Page No 195"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "CTzero=50 #in pF\n",
+ "VR=8 #in Volt\n",
+ "VK=0.7 #in Volt\n",
+ "n=1/3.0 #for Si\n",
+ "\n",
+ "CT=CTzero/((1+VR/VK)**n) #in pF\n",
+ "\n",
+ "print\"Junction capacitance is\",round(CT,2),\"pF\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Junction capacitance is 21.59 pF\n"
+ ]
+ }
+ ],
+ "prompt_number": 17
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 5.4 Page No.196"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "L=12.5*10**-3 #mH inductance\n",
+ "C1=4.0 #pF Capacitance\n",
+ "C2=40.0 #pF Capacitance\n",
+ "\n",
+ "Ctmin=(C1*C1)/(C1+C1) #Min value of total Capacitance\n",
+ "Ctmax=(C2*C2)/(C2+C2) #Max value of total Capacitance\n",
+ "Fmax=1/(2*math.pi*math.sqrt(L*Ctmin*10**-12))\n",
+ "Fmin=1/(2*math.pi*math.sqrt(L*Ctmax*10**-12))\n",
+ "\n",
+ "print\"The tuning range of circuit lies between\",round(Fmin/1000,2),\"khz and\",round(Fmax/1000,0),\"Mhz\"\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "The tuning range of circuit lies between 318.31 khz and 1007.0 Mhz\n"
+ ]
+ }
+ ],
+ "prompt_number": 22
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [],
+ "language": "python",
+ "metadata": {},
+ "outputs": []
+ }
+ ],
+ "metadata": {}
+ }
+ ]
+}
\ No newline at end of file diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch6.ipynb b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch6.ipynb new file mode 100755 index 00000000..ae8389eb --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch6.ipynb @@ -0,0 +1,672 @@ +{
+ "metadata": {
+ "name": ""
+ },
+ "nbformat": 3,
+ "nbformat_minor": 0,
+ "worksheets": [
+ {
+ "cells": [
+ {
+ "cell_type": "heading",
+ "level": 1,
+ "metadata": {},
+ "source": [
+ "Chapter 6: Bipolar junction Transistors (BJTs)"
+ ]
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.1 page No.215"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "Ic=9.95\t\t\t#in mA\n",
+ "Ie=10 \t\t#in mA\n",
+ "\n",
+ "Ib=Ie-Ic\t\t#in mA\n",
+ "\n",
+ "print\"Emitter current is \",Ib,\"mA\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Emitter current is 0.05 mA\n"
+ ]
+ }
+ ],
+ "prompt_number": 2
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.2 page No. 216"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "IC=0.98\t\t\t#in mA\n",
+ "IB=20.0\t\t\t#in uA\n",
+ "IB=IB*10**-3\t\t#in mA\n",
+ "\n",
+ "IE=IB+IC\t\t#in mA\n",
+ "\n",
+ "alpha=IC/IE\t\t#unitless\n",
+ "Beta=IC/IB\t\t#unitless\n",
+ "\n",
+ "print\"Emitter current is\",IE,\"mA\"\n",
+ "print\"Current amplification factor is \",alpha\n",
+ "print\"Current gain factor is \",Beta"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Emitter current is 1.0 mA\n",
+ "Current amplification factor is 0.98\n",
+ "Current gain factor is 49.0\n"
+ ]
+ }
+ ],
+ "prompt_number": 13
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.3 page No.216"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "alfaDC=0.98\t\t\t#unitless\n",
+ "ICBO=4\t\t\t\t#in uA\n",
+ "ICBO=ICBO*10**-3\t\t#in mA\n",
+ "IB=50\t\t\t\t#in uA\n",
+ "IB=IB*10**-3\t\t\t#in mA\n",
+ "\n",
+ "IC=alfaDC*IB/(1-alfaDC)+ICBO/(1-alfaDC)\t#in mA\n",
+ "IE=IC+IB\t\t\t#in mA\n",
+ "\n",
+ "print\"Emitter current is \",IE,\"mA\"\n",
+ "print\"Collector current is \",IC,\"mA\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Emitter current is 2.7 mA\n",
+ "Collector current is 2.65 mA\n"
+ ]
+ }
+ ],
+ "prompt_number": 16
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.4 page No. 216"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "IB=10\t\t\t#in uA\n",
+ "IB=IB*10**-3\t\t#in mA\n",
+ "Beta=99\t\t\t#Unitless\n",
+ "ICO=1\t\t\t#in uA\n",
+ "ICO=ICO*10**-3\t\t#in mA\n",
+ "\n",
+ "IC=Beta*IB+(1+Beta)*ICO\t#in mA\n",
+ "\n",
+ "print\"Collector current in mA : \",IC,\"mA\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Collector current in mA : 1.09 mA\n"
+ ]
+ }
+ ],
+ "prompt_number": 17
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.5 Page No.216"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "Ic=5*10**-3 #mA collector current\n",
+ "Ic_=10*10**-3 #mA collector current\n",
+ "Ib=50*10**-6 #mA, Base current\n",
+ "Icbo=1*10**-6 #micro A, Current to base open current\n",
+ "\n",
+ "beta=(Ic-Icbo)/(Ib+Icbo)\n",
+ "alpha=(beta/(1+beta))\n",
+ "Ie=Ib+Ic\n",
+ "\n",
+ "Ib=(Ic_-(beta+1)*Icbo)/(beta)\n",
+ "\n",
+ "print\"(i) Current gain factor is\",round(beta,0)\n",
+ "print\" Current amplification factor is\",round(alpha,2)\n",
+ "print\" Emitter Current is\",Ie*1000,\"mA\"\n",
+ "print\"(ii)New level of Ib is\",round(Ib*10**6,0),\"micro A\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "(i) Current gain factor is 98.0\n",
+ " Current amplification factor is 0.99\n",
+ " Emitter Current is 5.05 mA\n",
+ "(ii)New level of Ib is 101.0 micro A\n"
+ ]
+ }
+ ],
+ "prompt_number": 6
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.6 page No. 222"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "delVEB=200\t\t\t#in Volts\n",
+ "delIE=5\t\t\t\t#in mA\n",
+ "\n",
+ "rin=delVEB/delIE\t\t#in ohm\n",
+ "\n",
+ "print\"Dynamic input resistance is \",rin,\"mohm\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Dynamic input resistance is 40 mohm\n"
+ ]
+ }
+ ],
+ "prompt_number": 18
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.7 page No. 222"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "\n",
+ "ICBO=12.5 \t\t\t#in uA\n",
+ "ICBO=ICBO*10**-3 \t\t#in mA\n",
+ "IE=2 \t\t\t\t#in mA\n",
+ "IC=1.97 \t\t\t#in mA\n",
+ "\n",
+ "alfa=(IC-ICBO)/IE \t\t#unitless\n",
+ "IB=IE-IC \t\t\t#in mA\n",
+ "\n",
+ "print\"Current gain : \",round(alfa,3)\n",
+ "print\"Base current is \",IB,\"mA\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Current gain : 0.979\n",
+ "Base current is 0.03 mA\n"
+ ]
+ }
+ ],
+ "prompt_number": 32
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.8 page No. 222"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "RL=4.0 \t\t\t#in Kohm\n",
+ "VL=3.0\t\t\t#in volt\n",
+ "alfa=0.96 \t\t#unitless\n",
+ "IC=VL/RL \t\t#in mA\n",
+ "\n",
+ "IE=IC/alfa \t\t#in mA\n",
+ "IB=IE-IC \t\t#in mA\n",
+ "\n",
+ "print\"Base current ia\",round(IB,2),\"mA\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Base current ia 0.03 mA\n"
+ ]
+ }
+ ],
+ "prompt_number": 37
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.9 page No.227"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "VCC=10\t\t\t #in volt\n",
+ "RL=800\t\t\t #in ohm\n",
+ "VL=0.8\t\t\t #in volt\n",
+ "alfa=0.96\t\t #unitless\n",
+ "\n",
+ "VCE=VCC-VL \t\t#in Volt\n",
+ "IC=VL*1000/RL \t\t#in mA\n",
+ "Beta=alfa/(1-alfa) \t#unitless\n",
+ "IB=IC/Beta \t\t#in mA\n",
+ "\n",
+ "print\"Collector-emitter Voltage is \",VCE,\"V\"\n",
+ "print\"Base current in uA : \",round(IB*1000,2),\"microA\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Collector-emitter Voltage is 9.2 V\n",
+ "Base current in uA : 41.67 microA\n"
+ ]
+ }
+ ],
+ "prompt_number": 41
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.10 page No. 227"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "alfao=0.98 \t\t#unitless\n",
+ "ICO=10 \t\t\t#in uA\n",
+ "ICO=ICO*10**-3 \t\t#in mA\n",
+ "IB=0.22 \t\t#in mA\n",
+ "\n",
+ "IC=(alfao*IB+ICO)/(1-alfao) \t#in mA\n",
+ "\n",
+ "print\"Collector current is\",IC,\"mA\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Collector current is 11.28 mA\n"
+ ]
+ }
+ ],
+ "prompt_number": 45
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.11 page No. 228"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "delVEB=250 \t\t#in mVolts\n",
+ "delIE=1 \t\t#in mA\n",
+ "\n",
+ "rin=delVEB/delIE \t#in ohm\n",
+ "\n",
+ "print\"Dynamic input resistance is\",rin,\"ohm\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Dynamic input resistance is 250 ohm\n"
+ ]
+ }
+ ],
+ "prompt_number": 47
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.12 page No. 228"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "delVCE=10-5 \t\t#in Volts\n",
+ "delIC=5.8-5\t \t#in mA\n",
+ "\n",
+ "rin=delVCE/delIC \t#in Kohm\n",
+ "\n",
+ "print\"Dynamic output resistance is \",rin,\"kohm\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Dynamic output resistance is 6.25 kohm\n"
+ ]
+ }
+ ],
+ "prompt_number": 49
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.13 page No.232"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "%matplotlib inline"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": []
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "VCC=10 \t\t\t#in volt\n",
+ "RC=8 \t\t\t#in Kohm\n",
+ "Beta=40 \t\t#unitless\n",
+ "IB=15 \t\t\t#in uA\n",
+ "IB=IB*10**-3 \t\t#in mA\n",
+ "\n",
+ "IC=VCC/RC \t\t#in mA\n",
+ "IC=Beta*IB \t\t#in mA\n",
+ "VCE=VCC-IC*RC \t\t#in Volts\n",
+ "\n",
+ "print\"Operating point Q is (\",VCE,\"V,\",IC,\"mA)\"\n",
+ "\n",
+ "import matplotlib.pyplot as plt\n",
+ "fig = plt.figure()\n",
+ "ax = fig.add_subplot(111)\n",
+ "\n",
+ "Vce=[0,10]\n",
+ "Ic=[1.25,0]\n",
+ "plt.xlabel('Vce,V')\n",
+ "plt.ylabel('Ic,mA')\n",
+ "ax.plot([5.2], [0.6], 'o')\n",
+ "ax.annotate('(5.2V,0.6 mA)', xy=(5.4,0.7))\n",
+ "\n",
+ "a=plot(Vce,Ic)\n",
+ "show(a)"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Operating point Q is ( 5.2 V, 0.6 mA)\n"
+ ]
+ },
+ {
+ "metadata": {},
+ "output_type": "display_data",
+ "png": "iVBORw0KGgoAAAANSUhEUgAAAYQAAAEPCAYAAABCyrPIAAAABHNCSVQICAgIfAhkiAAAAAlwSFlz\nAAALEgAACxIB0t1+/AAAIABJREFUeJzt3X1YVGXeB/DvwJBiGhgqioA4IjK8Q6BhmlO8CBTUEhXa\nauILiIAS1uNDWxe6u1qkayKQmaGb6SI+a74VjAYr6FqiBgIiKBqkkMuGwSqpIDPn+UN3isB4keEM\n8P1cV9fFDPc582Uum9/cv3POfSSCIAggIqIBT0/sAEREpBtYEIiICAALAhER3cOCQEREAFgQiIjo\nHhYEIiICoOWCMH/+fJiamsLR0fE3x506dQpSqRSfffaZNuMQEdFv0GpBCAsLg1Kp/M0xKpUKK1as\ngJ+fH3hJBBGReLRaEKZPn47hw4f/5pjk5GSEhIRg5MiR2oxCREQdEPUYQk1NDfbv34/IyEgAgEQi\nETMOEdGAJmpBiI2NxbvvvguJRAJBENgyIiISkVTMF//mm28QGhoKAKirq0NWVhYMDAwQFBTUapy1\ntTUuXbokRkQioj5rwoQJuHjxYuc3ELSssrJScHBw6HDcvHnzhD179rT7u16I2WckJCSIHUFn8L34\nGd+Ln/G9+FlXPzu1OkOYNWsW8vLyUFdXBwsLC6xatQp37twBAERERGjzpYmIqIu0WhDS09M7PXbb\ntm1aTEJERB3hlcp9jEKhEDuCzuB78TO+Fz/je9F9knt9Jp3237OQiIio87r62ckZAhERAWBBICKi\ne1gQiIgIAAsCERHdw4JAREQAWBCIiOgeFgQiIgLAgkBERPewIBAREQAWBCIiuocFgYiIALAgEBHR\nPSwIREQEgAWBiIjuYUEgIiIALAhERHQPCwIREQHoQwWh9N+lYkcgIurX+kxBUHyiwPJDy3G96brY\nUYiI+qU+UxBKl5Si4XYDbFNs8WnRp7zHMhFRD5MIfeCT9Zc3is6vzkdUZhQGSwcjJSAFLqNdRE5H\nRKSbfvnZ2RlanSHMnz8fpqamcHR0bPf3O3fuhLOzM5ycnPDEE0+guLi4w31OMZ+C/IX5mOs8FzN3\nzER0ZjTqb9X3dHQiogFHqwUhLCwMSqXyvr+XyWQ4evQoiouL8fbbbyM8PLxT+9XX00f4Y+E4t+Qc\nVGoV5KlypBWkQS2oeyo6EdGAo/WWUVVVFQIDA1FSUvKb4+rr6+Ho6Ijq6uo2v+to2lNwtQBRmVFQ\nC2qkBqTC3cz9gXMTEfV1OtUy6oq0tDQEBAR0a1u3MW44Pv84It0jEZgeiPCD4ai7WdfDCYmI+jep\n2AEA4MiRI9i6dSuOHz9+3zErV67U/KxQKKBQKFr9Xk+ih3ku8/C87fNIOJIAu1Q7rFKsQvhj4dDX\n09dSciIi3ZGbm4vc3Nxuby96y6i4uBjBwcFQKpWwtrZuP2QXpz0AUFxbjOjMaDQ2NyI1IBWeFp5d\nzk5E1Jf1qZbR5cuXERwcjB07dty3GHSXk6kT8ubl4fWpryPk/0Iwb9881DbW9uhrEBH1J1qdIcya\nNQt5eXmoq6uDqakpVq1ahTt37gAAIiIisHDhQuzduxeWlpYAAAMDA5w8ebJtyG7MEH7pRtMN/Ono\nn7DtzDa8Nf0tRE2OglRPJ7plRERa09XPzj53YdqDKPuhDDFZMaj9qRYp/imYYTWjB9IREekmFoQO\nCIKAPWV7EHcoDtMsp2Gd7zqYDTPrkX0TEemSPnUMQQwSiQQhdiEoiyqDbLgMTpucsPb4WjSrmsWO\nRkQkqgE3Q/i1imsVWKZchsqGSmz02wifCT5aeR0iot7GllE3CIKAgxcOIlYZC7cxblg/cz0sjSy1\n9npERL2BLaNukEgkCJoUhNIlpXAc5QjXza5YfXQ1brfcFjsaEVGv4QyhHZX1lYg7HIeS2hIk+SXh\nGZtneu21iYh6CltGPUh5UYmlWUthO8IWG/w2QDZc1usZiIi6iy2jHuRn7YeSyBJ4mnvCY4sHEo4k\n4Oadm2LHIiLSChaEDgySDkL89HiciTiD8mvlsP/AHvvK9/EWnkTU77Bl1EU53+YgJisGlkaW2Oi/\nETYmNmJHIiJqF1tGWuYl80LR4iL4TvDF1LSpiM+OR2Nzo9ixiIgeGAtCNxjoGyDOMw4lkSWovlEN\neaocu0t368wshoioO9gy6gHHvjuG6KxomBiaINk/Gfaj7MWORETElpEYpo+bjm/Cv0GwPBiKTxRY\nfmg5rjddFzsWEVGXsCD0EKmeFNGTo1G6pBQNtxsgT5VjR/EOnZ7ZEBH9EltGWpJfnY+ozCgYGhgi\n2T8ZLqNdxI5ERAMMW0Y6Yor5FOQvzMccpzmYuWMmojOjUX+rXuxYRET3xYKgRfp6+gh/LBznlpyD\nSq2CPFWOtII0qAW12NGIiNpgy6gXFVwtQFRmFNSCGqkBqXA3cxc7EhH1Y1zcTsepBTW2F21HfE48\nAm0CscZrDUYMGSF2LCLqh3gMQcfpSfQwz2UeyqLKYCg1hF2qHTad2gSVWiV2NCIa4DhDEFlxbTGi\nM6PR2NyI1IBUeFp4ih2JiPoJtoz6IEEQkH42HW98+QZ8ZD5I9E6E6VBTsWMRUR+nUy2j+fPnw9TU\nFI6Ojvcds3TpUkycOBHOzs4oLCzUZhydJZFIMNtxNsqjyjHq4VFw2OSApBNJaFG3iB2NiAYQrRaE\nsLAwKJXK+/4+MzMTFy9eREVFBT766CNERkZqM47OGzZoGN7zeQ9H5x3FwQsH4brZFXlVeWLHIqIB\nQqsFYfr06Rg+fPh9f3/gwAG8+uqrAIApU6agoaEBtbW12ozUJ8hHyvHlnC+RMCMBc/bOwew9s/H9\nje/FjkVE/ZyoZxnV1NTAwsJC89jc3BzV1dUiJtIdEokEIXYhKIsqg2y4DE6bnLD2+Fo0q5rFjkZE\n/ZRU7AC/PuAhkUjaHbdy5UrNzwqFAgqFQoupdMfDDz2MPz/9Z7zq/CqWKZdh65mtSPZPhrfMW+xo\nRKRjcnNzkZub2+3ttX6WUVVVFQIDA1FSUtLmd4sXL4ZCoUBoaCgAwNbWFnl5eTA1bX2GTX8/y6iz\nBEHAwQsHEauMhdsYN6yfuR6WRpZixyIiHaVTZxl1JCgoCNu3bwcAnDhxAsbGxm2KAf1MIpEgaFIQ\nSpeUwnGUI1w3u2L10dW43XJb7GhE1A9odYYwa9Ys5OXloa6uDqampli1ahXu3LkDAIiIiAAAREdH\nQ6lU4uGHH8a2bdvg5ubWNiRnCO2qrK9E3OE4lNSWIMkvCc/YPCN2JCLSIbwwbQBSXlRiadZS2I6w\nxQa/DZANl4kdiYh0QJ9qGVHP8LP2Q0lkCTzNPeGxxQMJRxJw885NsWMRUR/DgtBPDJIOQvz0eJyJ\nOIPya+Ww/8Ae+8r3cWZFRJ3GllE/lfNtDmKyYmBpZImN/hthY2IjdiQi6mVsGREAwEvmhaLFRfCd\n4IupaVMRnx2PxuZGsWMRkQ5jQejHDPQNEOcZh5LIElTfqIY8VY7dpbs52yKidrFlNIAc++4YorOi\nYWJogmT/ZNiPshc7EhFpEVtGdF/Tx03HN+HfIFgeDMUnCiw/tBzXm66LHYuIdAQLwgAj1ZMienI0\nSpeUouF2A+Spcuwo3sEZGBGxZTTQ5VfnIyozCoYGhkjxT4HzaGexIxFRD2HLiLpkivkU5C/Mxxyn\nOfDd4YuYzBjU36oXOxYRiYAFgaCvp4/wx8Jxbsk5tKhbIE+VI60gDWpBLXY0IupFbBlRGwVXCxCV\nGQW1oEZqQCrczdzFjkRE3cDF7ahHqAU1thdtR3xOPAJtArHGaw1GDBkhdiwi6gIeQ6AeoSfRwzyX\neSiLKoOh1BB2qXbYdGoTVGqV2NGISEs4Q6BOKa4tRnRmNBqbG5EakApPC0+xIxFRB9gyIq0RBAHp\nZ9PxxpdvwEfmg0TvRJgO5R3uiHQVW0akNRKJBLMdZ6M8qhwjh4yEwyYHJJ1IQou6RexoRNQDOEOg\nbiv7oQwxWTGo/akWKf4pmGE1Q+xIRPQLbBlRrxIEAXvK9iDuUBymWU7DOt91MBtmJnYsIgJbRtTL\nJBIJQuxCUBZVBtlwGZw2OWHt8bVoVjWLHY2IuogzBOpRFdcqsEy5DJUNlUj2T4a3zFvsSEQDFltG\nJDpBEHDwwkHEKmPhNsYN62euh6WRpdixiAYctoxIdBKJBEGTglC6pBSOoxzhttkNq4+uxu2W22JH\nI6LfoNWCoFQqYWtri4kTJyIxMbHN7+vq6uDn5wcXFxc4ODjgr3/9qzbjUC8zNDBEgiIBpxadwumr\np+HwgQO+uPCF2LGI6D601jJSqVSYNGkSsrOzMXbsWHh4eCA9PR1yuVwzZuXKlWhqasI777yDuro6\nTJo0CbW1tZBKpa1DsmXULygvKrE0aylsR9hig98GyIbLxI5E1K/pTMvo5MmTsLa2hpWVFQwMDBAa\nGor9+/e3GjNmzBhcv373Fo7Xr1+HiYlJm2JA/YeftR9KIkvgae4Jjy0eSDiSgJt3boodi4ju0VpB\nqKmpgYWFheaxubk5ampqWo1ZtGgRSktLYWZmBmdnZyQlJWkrDumIQdJBiJ8ejzMRZ1B+rRz2H9hj\nX/k+zgCJdIDWvo5LJJIOx6xZswYuLi7Izc3FpUuX4OPjg6KiIgwbNqzN2JUrV2p+VigUUCgUPZiW\nepuFkQUyQjKQ820OYrJi8OHpD7HRfyNsTGzEjkbUZ+Xm5iI3N7fb22utIIwdOxZXrlzRPL5y5QrM\nzc1bjfnqq6/whz/8AQAwYcIEjB8/HufPn4e7e9sbsvyyIFD/4SXzQtHiIiSfTMbUtKlY5LYIf3jy\nDxj60FCxoxH1Ob/+srxq1aouba+1lpG7uzsqKipQVVWF5uZmZGRkICgoqNUYW1tbZGdnAwBqa2tx\n/vx5yGQ80DjQGOgbIM4zDiWRJai+UQ15qhy7S3ezjUTUy7R6YVpWVhZiY2OhUqmwYMECxMfHY/Pm\nzQCAiIgI1NXVISwsDJcvX4ZarUZ8fDxmz57dNiTPMhpQjn13DNFZ0TAxNEGyfzLsR9mLHYmoT9Lq\nlcqNjY3Yu3cvdu3ahS++6L3zyVkQBp4WdQs+PP0hVuWtwlynuUhQJOCRQY+IHYuoT+nx006bmprw\n2Wef4cUXX4SZmRlycnKwePHiBwpJ1BGpnhTRk6NRuqQUDbcbIE+VY0fxDn4xINKi+84QDh06hPT0\ndPzjH/+AQqHAiy++iJiYGFRVVfVyRM4QCMivzkdUZhQMDQyR4p8C59HOYkci0nk91jLS09PDs88+\niw8//BBmZnfXtx8/fjwqKyt7JmkXsCAQAKjUKqQVpuHtI2/jJbuX8Men/ojhhsPFjkWks3qsZVRQ\nUAC5XI4ZM2bAz88PaWlpUKlUPRKSqDv09fQR/lg4zi05hxZ1C+SpcqQVpEEtqMWORtQv3LcguLi4\nIDExERcuXMDbb7+NwsJC3LlzB35+fvjoo496MyNRKyZDTLDp2U3IfCUTHxd+DM80T5z+/rTYsbqs\nqakJM2bM0HyD09fXh6urK1xdXfH888+3u8369ethb28PZ2dneHt74/LlywDuXsdz4cKFVmNjY2Px\n3nvvtdnHJ598AhsbG9jY2GD79u33zbd7927Y29vDwcEBr7zySnf/TI3nn38enp6erZ7buHEjPv30\n0wfeN/UQoQtaWlqEQ4cOCWFhYV3Z7IF1MSYNICq1SthWuE0YvW60sOjAIuGHn34QO1KnpaWlCe+9\n957m8dChQzvc5siRI8KtW7cEQRCETZs2CS+//LIgCILw5ptvCqtWrdKMU6lUgrm5uXD58uVW21+7\ndk2QyWRCfX29UF9fr/n51y5cuCC4uroKDQ0NgiAIwg8/PNj7Wl9fL0yYMEFwc3MTvv32W83z169f\nFzw8PB5o33R/Xf3s7NSFaUVFRThw4AD279+PGzdu4JlnntFulSLqJD2JHua5zENZVBkMpYawS7XD\nplOboFLrfnszPT0dzz33XJe2USgUGDx4MABgypQpqK6uBgDMmjULGRkZmnFHjx7FuHHjWq0nBtw9\nWcTX1xfGxsYwNjaGj48PlEplm9fZsmULoqOjYWRkBAAYMWJEmzFVVVWwtbVFWFgYJk2ahFdeeQWH\nDx/GE088ARsbG5w6dUoz9rPPPkNgYCBefPFF7Nq1S/P8sGHDYGJigtLS0i69D6QdHRaEsLAwLFiw\nAHv27MHBgwfx+eef4/PPP++NbESdZjzYGEn+Sciem430s+nw2OKBr698LXas+1KpVDh79ixsbH5e\nu+n27dt47LHH4Onp2WZl4PakpaUhICAAAODg4AA9PT0UFxcDAHbt2tXuRZ7ff/99qyVk2lt0EgAq\nKipw/vx5TJs2DZ6enjh06FC7GS5duoTXX38d5eXlOH/+PDIyMnD8+HGsW7cOa9as0YzbtWsXXn75\nZbz00ktIT09vtY/Jkyfj6NGjHf69pH0drmWUn5+P0tLSTi1WRyQ2J1Mn5M3LQ/rZdIT8Xwh8ZD5I\n9E6E6VBTsaO1UldX12YRx8uXL2PMmDGorKzE008/DUdHx/su5bJjxw4UFBTg/fff1zw3a9Ys7Nq1\nC/b29ti/fz/+9Kc/dTtfS0sLLl68iLy8PFy5cgVPPvkkSkpKNDOG/xo/fjzs7e9eSW5vbw9v77v3\n0HZwcNCcol5bW4uLFy/i8ccfBwA89NBDKC0t1WxnZmaGb7/9tttZqed0OEPw8PDAuXPneiMLUY+Q\nSCSY7Tgb5VHlGDlkJBw2OSDpRBJa1C1iR2tF+NXpgGPGjAFw90NWoVCgsLCw3e2ys7OxZs0aHDhw\nAAYGBprnQ0NDsXv3bmRnZ8PJyQkjR45ss21nFp0E7s4cAgMDoa+vDysrK9jY2ODixYttxg0aNEjz\ns56eHh566CHNzy0td9/v3bt348cff8T48eMxfvx4VFVVtZolCILAL5w6olMtI09PT9jY2MDR0RGO\njo5wcnLqjWxED2TYoGFY67sWR+cdxcELB+G62RV5VXlixwJwtyff2NioedzQ0ICmpiYAd2cPx48f\n13yD/qXCwkIsXrwYBw8ebNPXl8lkGDFiBP73f/+3VbuopqZG883d19cXhw8fRkNDA+rr6/Hll19i\n5syZbV7n+eef1yyjXFdXhwsXLnR74cn09HQcOnQIlZWVqKysxOnTp1sdR7h69SqsrKy6tW/qWR22\njBYsWIAdO3ZoepREfY18pBxfzvkSe8r2YM7eOZhmOQ3rfNfBbJiZaJn09fXh4OCA8+fPY9KkSSgr\nK0NERAT09PQ0Cz3a2toCABISEuDh4YFnn30W//M//4OffvoJISEhAIBx48Zh3759mv3OmjUL8fHx\nCA4O1jx39epVzZ0IH330Ubz99tvw8PDQ7NvY2Fjzs7u7OwIDAzFz5kwcPnwY9vb20NfXx7p16zB8\neNuLAH/9zf6XjyUSCb777jtcuXIFU6ZM0TxvZWUFIyMjnDp1Ch4eHjh58iTWrVv3QO8n9YwOF7fz\n9PTE11+Le3COVypTT/mp+Se888938OHpD7HiiRVY9vgyPKT/kChZ/vrXv6K2thYrVqzQ6uukpqZi\n3LhxePbZZ7X6Ot1x/fp1eHl5tTojiXpOj692umTJEjQ0NCAwMFDTH5RIJK2+gWgbCwL1tIprFVim\nXIbKhkok+yfDW+bd6xmam5vh7e2NvLy8AdtD37hxIx599FH8/ve/FztKv9TjBWHevHnt/mPdtm1b\n19N1EwsCaYMgCDh44SBilbFwG+OG9TPXw9LIUuxYRD1Gq/dDEAsLAmnTrTu38N7x95B8MhmvPf4a\nXp/6OgZJB3W8IZGO03pBSE1NxYgRI/DCCy9oDlRpGwsC9YbK+krEHY7D2X+fRZJfEgImBogdieiB\n9PgNcn5NEAQcO3YMv/vd77q6KZFOGz98PPa+vBfJ/smIVcYiKD0I39bzgikaONgyImpHU0sT1n+9\nHuu+Xodoj2ismLYCQwyGiB2LqEt6fIYQHx+P+vp6zeP6+nq89dZb3UtH1EcMkg5C/PR4nIk4g/Jr\n5bD/wB77yvfxiwn1ax3OEFxcXHDmzJlWz7m6ut73snpt4AyBxJbzbQ5ismJgaWSJjf4bYWNi0/FG\nRCLr8RmCWq3G7du3NY9v3bqF5ubm7qUj6qO8ZF4oWlwE3wm+mJo2FfHZ8Whsbux4Q6I+pMOC8Mor\nr8DLywtpaWn4+OOP4e3tjblz5/ZGNiKdYqBvgDjPOJRElqD6RjXkqXLsLt3N2Sv1G506qJyVlYXs\n7GxIJBL4+Pi0uxhWe5RKJWJjY6FSqbBw4cJ2L9HPzc3Fa6+9hjt37mDEiBGaBbVahWTLiHTQse+O\nITorGiaGJkj2T4b9qLaL0RGJSWcuTFOpVJg0aRKys7MxduxYeHh4ID09HXK5XDOmoaEBTzzxBA4d\nOgRzc3PU1dW1e2cmFgTSVS3qFnx4+kOsyluFuU5zkaBIwLHsM9i48TCamqQYNKgFS5f64plnnhQ7\nKg1AXf3svO+VZUOHDr3v+ioSiQTXr1//zR2fPHkS1tbWmmVtQ0NDsX///lYF4W9/+xteeOEFzXrs\n7RUDIl0m1ZMienI0XrJ/CfHZ8Rj/lwmQHpmKf2fvA3D3/59Ll/4AACwKpPPuewyhsbERN27caPe/\njooBcHcN9l/ez7W9W/VVVFTgxx9/xFNPPQV3d3d8+umnD/CnEIln1MOjkPZcGqy/eRb/ltUAYU8C\npkUAgEuXViM5+UuRExJ1TGtrT3Rm9cY7d+6goKAAOTk5uHnzJjw9PfH4449j4sSJbcauXLlS87NC\noYBCoejBtEQ9w/DaOGDvx4BbGjDHFyh9CTjyR9y+rS92NBoAcnNz2z0O21laKwiduVWfhYUFRowY\nAUNDQxgaGuLJJ59EUVFRhwWBSFcNGtQCCPrAN+HAuReAp98CouWo+5cH1IIaehLeZIq059dfllet\nWtWl7bX2r9Pd3R0VFRWoqqpCc3MzMjIyEBQU1GrMc889h3/+859QqVS4efMm8vPzYWdnp61IRFq3\ndKkvJky4e8wAt0yALzbBPC8ALc7fwjPNE6e/Py1uQKLfoLUZglQqRUpKCmbOnAmVSoUFCxZALpdj\n8+bNAICIiAjY2trCz88PTk5O0NPTw6JFi1gQqE/774Hj5OS3cfu2PgYPViEmZh78Az7G9qLtCEwP\nRKBNINZ4rcGIITyJgnQLF7cj6kUNtxuQcCQB6WfTsUqxCuGPhUNfj8cXSDt05jqEnsSCQP1NcW0x\nojOj0djciNSAVHhaeIodifohFgSiPkIQBKSfTccbX74BH5kPEr0TYTrUVOxY1I9o/QY5RNQzJBIJ\nZjvORnlUOUYOGQmHTQ5IOpGEFnWL2NFogOIMgUhHlP1QhpisGNT+VIsU/xTMsJohdiTq49gyIurD\nBEHAnrI9iDsUh2mW07DOdx3MhpmJHYv6KLaMiPowiUSCELsQlEWVQTZcBqdNTlh7fC2aVbwHCWkf\nZwhEOqziWgWWKZehsqESyf7J8JZ5ix2J+hC2jIj6GUEQcPDCQcQqY+E2xg3rZ66HpZGl2LGoD2DL\niKifkUgkCJoUhNIlpXAc5Qi3zW5YfXQ1mlqaxI5G/QxnCER9TGV9JeIOx+Hsv88iyS8JARMDxI5E\nOootI6IBQnlRiaVZS2E7whYb/DZANlwmdiTSMWwZEQ0QftZ+KIksgae5Jzy2eCDhSAJu3rkpdizq\nw1gQiPqwQdJBiJ8ejzMRZ1B+rRz2H9hjX/k+zqipW9gyIupHcr7NQUxWDCyNLLHRfyNsTGzEjkQi\nYsuIaADzknmhaHERfGQ+mJo2FfHZ8WhsbhQ7FvURLAhE/YyBvgGWT12OksgSVN+ohjxVjt2luznL\npg6xZUTUzx377hiis6JhYmiCZP9k2I+yFzsS9RK2jIiolenjpuOb8G8QLA+G4hMFlh9ajutN18WO\nRTqIBYFoAJDqSRE9ORqlS0rRcLsB8lQ5dhTv4MybWmHLiGgAyq/OR1RmFAwNDJHinwLn0c5iRyIt\nYMuIiDo0xXwK8hfmY47THPju8EVMZgzqb9WLHYtExoJANEDp6+kj/LFwnFtyDi3qFshT5dhauBVq\nQS12NBIJW0ZEBAAouFqAqMwoqAU1UgNS4W7mLnYkekA61TJSKpWwtbXFxIkTkZiYeN9xp06dglQq\nxWeffabNOET0G9zGuOH4/OOIdI9EYHogIg5GoO5mndixqBdprSCoVCpER0dDqVTi3LlzSE9PR1lZ\nWbvjVqxYAT8/P84CiESmJ9HDPJd5KIsqw2DpYNil2mHTqU1QqVViR6NeoLWCcPLkSVhbW8PKygoG\nBgYIDQ3F/v3724xLTk5GSEgIRo4cqa0oRNRFxoONkeSfhOy52Ug/mw6PLR74+srXYsciLdNaQaip\nqYGFhYXmsbm5OWpqatqM2b9/PyIjIwHc7XcRke5wMnVC3rw8vD71dYT8Xwjm7ZuH2sZasWORlki1\ntePOfLjHxsbi3Xff1Rz4+K2W0cqVKzU/KxQKKBSKHkhJRB2RSCSY7TgbgTaB+GPeH+GwyQFvTX8L\nUZOjINXT2kcIdUNubi5yc3O7vb3WzjI6ceIEVq5cCaVSCQB45513oKenhxUrVmjGyGQyTRGoq6vD\nkCFDsGXLFgQFBbUOybOMiHRG2Q9liMmKQe1PtUjxT8EMqxliR6L70JlbaLa0tGDSpEnIycmBmZkZ\nJk+ejPT0dMjl8nbHh4WFITAwEMHBwW1DsiAQ6RRBELCnbA/iDsVhmuU0rPNdB7NhZmLHol/RmdNO\npVIpUlJSMHPmTNjZ2eHll1+GXC7H5s2bsXnzZm29LBH1AolEghC7EJRFlUE2XAanTU5Ye3wtmlXN\nYkejB8AL04jogVVcq8Ay5TJUNlQi2T8Z3jJvsSMRdKhl1JNYEIh0nyAIOHjhIGKVsXAb44b1M9fD\n0shS7FgDms60jIhoYJFIJAiaFITSJaVwHOUIt81uWH10NZpamsSORp3EGQIRaUVlfSXiDsfh7L/P\nIskvCQETA8SONOCwZUREOkV5UYmlWUthO8IWG/w2QDZcJnakAYMtIyLSKX7WfiiJLIGnuScmb5mM\nhCMJuHkg4f34AAAPJElEQVTnptixqB0sCESkdYOkgxA/PR6FEYUov1YO+w/ssa98H2f+OoYtIyLq\ndTnf5iAmKwaWRpbY6L8RNiY2Ykfql9gyIiKd5yXzQtHiIvjIfDA1bSris+PR2NwodqwBjwWBiERh\noG+A5VOXoySyBNU3qiFPlWN36W52A0TElhER6YRj3x1DdFY0TAxNkOyfDPtR9mJH6vPYMiKiPmn6\nuOn4JvwbBMuDofhEgeWHluN603WxYw0oLAhEpDOkelJET45G6ZJSNNxugDxVjh3FO9gh6CVsGRGR\nzsqvzkdUZhQMDQyR4p8C59HOYkfqU9gyIqJ+Y4r5FOQvzMccpznw3eGLmMwY1N+qFztWv8WCQEQ6\nTV9PH+GPhePcknNoUbdAnirH1sKtUAtqsaP1O2wZEVGfUnC1AFGZUVALaqQGpMLdzF3sSDqLi9sR\nUb+nFtTYXrQd8TnxCLIJwmqv1RgxZITYsXQOjyEQUb+nJ9HDPJd5KIsqw2DpYNil2uHD0x9CpVaJ\nHa1P4wyBiPq84tpiRGdGo7G5EakBqfC08BQ7kk5gy4iIBiRBEJB+Nh1vfPkGfGQ+SPROhOlQU7Fj\niYotIyIakCQSCWY7zkZZVBlGDhkJh00OSDqRhBZ1i9jR+gzOEIioXyr7oQwxWTGo/akWKf4pmGE1\nQ+xIvY4tIyKiewRBwJ6yPYg7FIdpltOwzncdzIaZiR2r1+hcy0ipVMLW1hYTJ05EYmJim9/v3LkT\nzs7OcHJywhNPPIHi4mJtRyKiAUIikSDELgRlUWWQDZfBaZMT1h5fi2ZVs9jRdJJWZwgqlQqTJk1C\ndnY2xo4dCw8PD6Snp0Mul2vGfP3117Czs4ORkRGUSiVWrlyJEydOtA7JGQIR9YCKaxVYplyGyoZK\nJPsnw1vmLXYkrdKpGcLJkydhbW0NKysrGBgYIDQ0FPv37281xtPTE0ZGRgCAKVOmoLq6WpuRiGgA\nm2gyEV/M/gKJ3okIPxiOkN0huPyfy2LH0hlaLQg1NTWwsLDQPDY3N0dNTc19x6elpSEgIECbkYho\ngJNIJAiaFITSJaVwHOUIt81uWH10NZpamsSOJjqpNncukUg6PfbIkSPYunUrjh8/3u7vV65cqflZ\noVBAoVA8YDoiGsgMDQyRoEjAXOe5iDscd/c0Vb8kBEzsu19Kc3NzkZub2+3ttXoM4cSJE1i5ciWU\nSiUA4J133oGenh5WrFjRalxxcTGCg4OhVCphbW3dNiSPIRCRlikvKrE0aylsR9hig98GyIbLxI70\nwHTqGIK7uzsqKipQVVWF5uZmZGRkICgoqNWYy5cvIzg4GDt27Gi3GBAR9QY/az+URJbA09wTk7dM\nRsKRBNy6c0vsWL1K69chZGVlITY2FiqVCgsWLEB8fDw2b94MAIiIiMDChQuxd+9eWFpaAgAMDAxw\n8uTJ1iE5QyCiXnTlP1fw+pev42TNSbw/8308N+m5LrXAdQUvTCMi6iE53+YgJisGlkaW2Oi/ETYm\nNmJH6hKdahkREfVlXjIvFC0ugo/MB1PTpiI+Ox6NzY1ix9IaFgQiot9goG+A5VOXoySyBNU3qiFP\nlWN36e5+2bVgy4iIqAuOfXcM0VnRMDE0QbJ/MuxH2Ysd6b7YMiIi0qLp46bjm/BvECwPhuITBZYf\nWo7rTdfFjtUjWBCIiLpIqidF9ORolC4pRcPtBshT5dhRvKPPdzLYMiIiekD51fmIyoyCoYEhUvxT\n4DzaWexIANgyIiLqdVPMpyB/YT7mOM2B7w5fxGTGoP5WvdixuowFgYioB+jr6SP8sXCcW3IOLeoW\nyFPl2Fq4FWpBLXa0TmPLiIhICwquFiAqMwpqQY3UgFS4m7n3egZeqUxEpCPUghrbi7YjPiceQTZB\nWO21GiOGjOi11+cxBCIiHaEn0cM8l3koiyrDYOlg2KXa4cPTH0KlVokdrV2cIRAR9ZLi2mJEZ0aj\nsbkRqQGp8LTw1OrrsWVERKTDBEFA+tl0vPHlG/CR+SDROxGmQ0218lpsGRER6TCJRILZjrNRFlWG\nkUNG3r1T24kktKhbxI7GGQIRkZjKfihDTFYMan+qRYp/CmZYzeixfbNlRETUxwiCgD1lexB3KA7T\nLKdhne86mA0ze+D9smVERNTHSCQShNiFoCyqDLLhMjhtcsLa42vRrGru3RycIRAR6ZaKaxVYplyG\nyoZKJPsnw1vm3a39sGVERNQPCIKAgxcOIlYZC7cxblg/cz0sjSy7tA+2jIiI+gGJRIKgSUEoXVIK\nx1GOcNvshtVHV6OppUl7r8kZAhGR7qusr0Tc4Tic/fdZJPklIWBiQIfbsGVERNSPKS8qsTRrKWxH\n2GKD3wbIhsvuO1anWkZKpRK2traYOHEiEhMT2x2zdOlSTJw4Ec7OzigsLNRmHCKiPs/P2g8lkSXw\nNPfE5C2TkXAkAbfu3OqRfWutIKhUKkRHR0OpVOLcuXNIT09HWVlZqzGZmZm4ePEiKioq8NFHHyEy\nMlJbcfqN3NxcsSPoDL4XP+N78bOB8F4Mkg5C/PR4FEYUovxaOew+sMO+8n0P3EnRWkE4efIkrK2t\nYWVlBQMDA4SGhmL//v2txhw4cACvvvoqAGDKlCloaGhAbW2ttiL1CwPhH3tn8b34Gd+Lnw2k98LC\nyAIZIRn4OPBjvJnzJgL+FoAL1y50e39aKwg1NTWwsLDQPDY3N0dNTU2HY6qrq7UViYioX/KSeaFo\ncRG8x3tjatpUxGfHo7G5scv70VpBkEgknRr36ylOZ7cjIqKfGegbYPnU5SiJLEH1jWrIU+Vd3odU\nC7kAAGPHjsWVK1c0j69cuQJzc/PfHFNdXY2xY8e22deECRNYKH5h1apVYkfQGXwvfsb34md8L+6a\nMGFCl8ZrrSC4u7ujoqICVVVVMDMzQ0ZGBtLT01uNCQoKQkpKCkJDQ3HixAkYGxvD1LTtuuAXL17U\nVkwiIrpHawVBKpUiJSUFM2fOhEqlwoIFCyCXy7F582YAQEREBAICApCZmQlra2s8/PDD2LZtm7bi\nEBFRB/rEhWlERKR9Or2WUWcubBsorly5gqeeegr29vZwcHDAxo0bxY4kKpVKBVdXVwQGBoodRVQN\nDQ0ICQmBXC6HnZ0dTpw4IXYk0bzzzjuwt7eHo6MjZs+ejaYm7a35o2vmz58PU1NTODo6ap778ccf\n4ePjAxsbG/j6+qKhoaHD/ehsQejMhW0DiYGBAd5//32UlpbixIkTSE1NHdDvR1JSEuzs7Ab8yQbL\nli1DQEAAysrKUFxcDLm862eW9AdVVVXYsmULCgoKUFJSApVKhV27dokdq9eEhYVBqVS2eu7dd9+F\nj48PLly4AC8vL7z77rsd7kdnC0JnLmwbSEaPHg0XFxcAwNChQyGXy/H999+LnEoc1dXVyMzMxMKF\nCwf0Glf/+c9/cOzYMcyfPx/A3eN2RkZGIqcSxyOPPAIDAwPcvHkTLS0tuHnzZrtnLPZX06dPx/Dh\nw1s998sLf1999VXs27evw/3obEHozIVtA1VVVRUKCwsxZcoUsaOI4rXXXsPatWuhp6ez/3x7RWVl\nJUaOHImwsDC4ublh0aJFuHnzptixRPHoo49i+fLlsLS0hJmZGYyNjeHt3b2byvQXtbW1mrM2TU1N\nO7UKhM7+HzXQWwH309jYiJCQECQlJWHo0KFix+l1n3/+OUaNGgVXV9cBPTsAgJaWFhQUFGDJkiUo\nKCjAww8/3Km2QH906dIlbNiwAVVVVfj+++/R2NiInTt3ih1LZ0gkkk59pupsQejMhW0DzZ07d/DC\nCy/g97//PZ5//nmx44jiq6++woEDBzB+/HjMmjUL//jHPzB37lyxY4nC3Nwc5ubm8PDwAACEhISg\noKBA5FTiOH36NKZOnQoTExNIpVIEBwfjq6++EjuWqExNTfGvf/0LAHD16lWMGjWqw210tiD88sK2\n5uZmZGRkICgoSOxYohEEAQsWLICdnR1iY2PFjiOaNWvW4MqVK6isrMSuXbvw9NNPY/v27WLHEsXo\n0aNhYWGBCxfuLmaWnZ0Ne3t7kVOJw9bWFidOnMCtW7cgCAKys7NhZ2cndixRBQUF4ZNPPgEAfPLJ\nJ537EinosMzMTMHGxkaYMGGCsGbNGrHjiOrYsWOCRCIRnJ2dBRcXF8HFxUXIysoSO5aocnNzhcDA\nQLFjiOrMmTOCu7u74OTkJPzud78TGhoaxI4kmsTERMHOzk5wcHAQ5s6dKzQ3N4sdqdeEhoYKY8aM\nEQwMDARzc3Nh69atwrVr1wQvLy9h4sSJgo+Pj1BfX9/hfnhhGhERAdDhlhEREfUuFgQiIgLAgkBE\nRPewIBAREQAWBCIiuocFgYiIALAgEAEAnn76aRw+fLjVcxs2bMCSJUu6tb+qqqpWa3H9l4uLC06d\nOtWtfRJpGwsCEYBZs2a1WS45IyMDs2fP7tb+rKysYGlpiaNHj2qeKy8vR2Njo2apCSJdw4JABOCF\nF17AF198gZaWFgDQLJI2bdo0JCYmwsnJCS4uLoiPjwdwdzE1f39/uLu748knn8T58+fb7PPXRWbX\nrl2YNWtW7/xBRN3AK5WJ7gkMDMSiRYsQFBSEd999Fz/++COeeuop/PnPf0ZOTg4GDx6MhoYGGBsb\nw8vLC5s3b4a1tTXy8/Px5ptvIicnp9X+amtr4erqiurqaujp6cHOzg5///vfB/waO6S7pGIHINIV\n//1GHxQUhIyMDGzduhU7d+7E/PnzMXjwYACAsbExGhsb8fXXX+PFF1/UbNvc3Nxmf6ampnBwcEB2\ndjZGjRoFqVTKYkA6jQWB6J6goCC89tprKCwsxM2bN+Hq6oqdO3e2ue+CWq2GsbExCgsLO9znf4uM\nqalpt49HEPUWHkMgumfo0KF46qmnEBYWpvnw9vHxwbZt23Dr1i0AQH19PR555BGMHz8ef//73wHc\nXZq8uLgYALB37168+eabmn0GBwfjiy++QEZGBkJDQ3v5LyLqGhYEol+YNWsWSkpKNAd/Z86ciaCg\nILi7u8PV1RV/+ctfAAA7d+5EWloaXFxc4ODggAMHDgC4e7D5l/c1NjIywtSpUzF69GhYWVn1+t9D\n1BU8qEzUg+bMmYMNGzbAxMRE7ChEXcaCQEREANgyIiKie1gQiIgIAAsCERHdw4JAREQAWBCIiOge\nFgQiIgLAgkBERPf8PzB3vekNwU7EAAAAAElFTkSuQmCC\n",
+ "text": [
+ "<matplotlib.figure.Figure at 0x7a67da0>"
+ ]
+ }
+ ],
+ "prompt_number": 17
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.14 page No. 232"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "Vcc=12 \t\t#in Volt collector supply voltage\n",
+ "Ic=1.2 #A, collector current\n",
+ "Rl=5 #kohm load resistance\n",
+ "\n",
+ "Vce=Vcc-Ic*Rl #Collector emitter voltage\n",
+ "Rl1=7.5\n",
+ "Vce1=Vcc-Ic*Rl1\n",
+ "\n",
+ "print\"Operating point at load resistance 5 kohm is (\",Vce,\"V,\",Ic,\"mA)\"\n",
+ "print\"Operating point at load resistance 7.5 kohm is (\",Vce1,\"V,\",Ic,\"mA)\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Operating point at load resistance 5 kohm is ( 6.0 V, 1.2 mA)\n",
+ "Operating point at load resistance 7.5 kohm is ( 3.0 V, 1.2 mA)\n"
+ ]
+ }
+ ],
+ "prompt_number": 65
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.15 Page No.233"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "Vcc=20 # V, collector voltage\n",
+ "Rc=3.3*10**3\n",
+ "\n",
+ "Ic=0 #for cut off point\n",
+ "Vce=Vcc\n",
+ "Ic=Vcc/Rc\n",
+ "print \"Collector to emitter voltage is (Vce)\",Vce,\"V\"\n",
+ "print \"Collector current at saturation point is (Ic)\",round(Ic*1000,0),\"mA\"\n",
+ "\n",
+ "import matplotlib.pyplot as plt\n",
+ "fig = plt.figure()\n",
+ "ax = fig.add_subplot(111)\n",
+ "\n",
+ "Vce=[0,20]\n",
+ "Ic=[6,0]\n",
+ "xlabel(\"Vce (V)\") \n",
+ "ylabel(\"Ic (mA)\") \n",
+ "plt.xlim((0,25))\n",
+ "plt.ylim((0,8))\n",
+ "ax.plot([0], [6], 'o')\n",
+ "ax.annotate('(0,6mA)', xy=(0,6))\n",
+ "\n",
+ "ax.plot([20], [0], 'o')\n",
+ "ax.annotate('(20V,0)', xy=(20,0))\n",
+ "a=plot(Vce,Ic)\n",
+ "show(a)\n",
+ "\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Collector to emitter voltage is (Vce) 20 V\n",
+ "Collector current at saturation point is (Ic) 6.0 mA\n"
+ ]
+ },
+ {
+ "output_type": "display_data",
+ "png": "iVBORw0KGgoAAAANSUhEUgAAAXsAAAEMCAYAAAAlGRZyAAAABHNCSVQICAgIfAhkiAAAAAlwSFlz\nAAALEgAACxIB0t1+/AAAHwFJREFUeJzt3XtUVXX+//HnUYz5Nl4wL4iiYiYJgoA30sk8pmaWIt4K\nbbLEpoZZzWjfGs2mXzGXb5PLLqPW1Hcab2kLdaaJLJG81EmLHELJNEvNoEHDvmkYEgkC+/cHcQRB\n7vvc9uux1lkD52z2+3P22vPu4/u9P3vbDMMwEBERn9bG3QMQERHzKdmLiFiAkr2IiAUo2YuIWICS\nvYiIBSjZi4hYgKnJ/s9//jODBg0iMjKSOXPmUFJSYmY4ERG5DNOSfW5uLi+99BL79+/n4MGDlJeX\ns3HjRrPCiYhIPfzM2nHHjh1p164dxcXFtG3bluLiYnr16mVWOBERqYdpM/urrrqKBx98kD59+tCz\nZ08CAgIYP368WeFERKQ+hkk+//xzIywszDh9+rRx4cIFIz4+3tiwYUONbQC99NJLL72a8Woq02b2\nWVlZjBo1ii5duuDn58f06dPJyMiotZ1hGHoZBo8//rjbx+ApLx0LHQsdi/pfzWFash84cCB79+7l\nhx9+wDAMdu7cSXh4uFnhRESkHqYl+6ioKObOncuwYcMYPHgwAPfee69Z4UREpB6mXY0DsGjRIhYt\nWmRmCJ9ht9vdPQSPoWNxkY7FRToWLWMzmlsAao3gNluz608iIlbVnNyp2yWIiFiAkr2IiAUo2YuI\nWICSvYiIBSjZi4hYgJK9iIgFKNmLiFiAkr2IiAUo2YuIWICSvYiIBSjZi4hYgJK9iIgFKNmLiFiA\nkr2IiAUo2YuIWICSvYiIBSjZi4hYgJK9iIgFmJrsjxw5QkxMjPPVqVMnVqxYYWZIERGpg8ueQVtR\nUUGvXr3IzMykd+/elcH1DFoRkSbz6GfQ7ty5k/79+zsTvYiIuI7Lkv3GjRuZM2eOq8KJiEg1fq4I\nUlpayhtvvMHSpUtrfZacnOz82W63Y7fbXTEkERGv4XA4cDgcLdqHS2r2r7/+Oi+88ALp6ek1g6tm\nLyLSZB5bs09JSWH27NmuCCUiInUwfWb//fff07dvX3JycujQoUPN4JrZi4g0WXNyp8suvawzuJK9\niEiTeWwZR0RE3EvJXkTEApTsRUQsQMleRMQClOxFRCxAyV5ExAKU7EVELEDJXkTEApTsRUQsQMle\nRMQClOxFRCxAyV5ExAKU7EVELEDJXkTEApTsRUQswO3JvqSkhDFjxlBRUcG6desIDQ0lNDSUl19+\n+bJ/s3LlSsLCwoiIiGDx4sVNjllWVka3bt1YsmRJjfdvu+02cnJymrw/ERFP5/aHl6xatYozZ84w\nf/58hg8fzr59+wAYOnQo+/btIyAgoMbfvPPOOzzxxBOkpaXRrl07vvnmG7p169akuNu2bWP58uV8\n8cUXHD161Pn+jh07eOONN1ixYkXLv5yIiEm88uElKSkpTJ06lbfeeoubbrqJgIAAAgICmDBhQq0H\nlAO88MILLFmyhHbt2gE4E/3atWuJj4/npptuol+/fjz33HM89dRTDBkyhJEjR1JQUODcx8aNG0lK\nSuLqq6/mgw8+cL5vt9tJS0sz+RuLiLie25P9oUOHCA0N5eTJkwQHBzvfDw4O5uTJk7W2P3bsGLt3\n7+a6667DbreTlZXl/OyTTz7htdde48MPP+R3v/sdHTt2ZP/+/YwcOdJZFjp//jxvv/02kyZN4rbb\nbiMlJcX59+3ataNXr158+umnJn5jERHXMzXZnz17lpkzZxIWFkZ4eDh79+6ttU1hYSlbt+7GZrM1\nap9lZWUUFBSwd+9eli1bxm233eb8bOzYsfz0pz+la9euBAQEMGXKFAAiIyPJzc0F4M0338Rut3PF\nFVcQHx9PampqjX8O9ezZ07mtiIivMDXZL1iwgFtuuYVPP/2Ujz/+mLCwsFrbFBdfxYIFb/F//1dI\nXl6e8/28vLwaM/0qwcHBTJ8+HYDhw4fTpk0bTp8+jc1mw9/f37ldmzZtnL+3adOGsrIyoLJstGPH\nDvr168fQoUP59ttv2bVrl/PvDMOgTRu3/4NHRKRVmZbVvvvuO/bs2UNiYiIAfn5+dOrUqY4tizh+\n/H/Iyvqe7du3c/bsWQoKCtixYwcTJ04EYMmSJaSmpgIQHx/P22+/DcDRo0e5cOECXbt2rbdZUfVZ\nYWEh7733Hnl5eeTk5JCTk8Nzzz1Xo5STn59P3759W+MQiIh4DD+zdpyTk0O3bt2YN28eBw4cYOjQ\noSxfvpwrr7yyxnZdKKaQ+zh+/Ai33z6L4cOHA/D44487r8Q5dOgQ8fHxACQmJpKYmEhkZCRXXHEF\n69atAyq709VLQXX9nJqayrhx45zNXYC4uDgWLVrEhQsXADhx4gQDBw5s7cMhItJsDocDh8PRon2Y\ndullVlYWI0eOJCMjg+HDh7Nw4UI6duzIH/7wh4vBbTYSuZ7ufMxPoifyePbmOvd1880313llTmvb\nvn07W7duZfny5abHEhFpLo+69DI4OJjg4GDnTH3mzJns37+/1nar2cWqK/z572/2Qnw8VKvbV3FF\nogf4+9//zgMPPOCSWCIirmRasu/Rowe9e/d2LlrauXMngwYNqrXdxIl/ZM2//kmH48dgyBCIiYG/\n/AV+bKi60ubNmwkJCXF5XBERs5m6gvbAgQPcc889lJaW0r9/f9asWVOjSVvnP0WOHoVf/hK++w7+\n9jcYOtSs4YmIeKXmlHHcfruEOsMbBqxfD4sWQUIC/PGP0KGD6wcoIuKBPKpm3yI2G8ydC4cOQWEh\nhIfDj5deiohI03nmzP5SDkdlaWfgQFi5Enr3Nn1sIiKeyndm9pey2+HAAbc3cEVEvJV3zOyrUwNX\nRCzOd2f21YWGwq5dsGAB3HorLFwI5865e1QiIh7N+5I9qIErItJE3lfGqYsauCJiIdYo49RFDVwR\nkXr5xsy+OjVwRcTHWXdmX50auCIitfhesgc1cEVELuF7ZZy6qIErIj5EZZzLUQNXRCzOGjP76tTA\nFREvp5l9Y6iBKyIWZL1kD2rgiojlWK+MUxc1cEXEi6iM01xq4IqIj9PM/lJq4IqIh/PIZ9CGhITQ\nsWNH2rZtS7t27cjMzLwY3BOTPegZuCLi0TyyjGOz2XA4HGRnZ9dI9B5NDVwR8TEuqdl75Oy9Mbp2\nhdWrK2f5Dz8M8fGQl+fuUYmINJmf2QFsNhvjx4+nbdu23HffffziF7+o8XlycrLzZ7vdjt1uN3tI\nTVfVwF26tLKB++ijcP/94Gf64RMRweFw4HA4WrQP02v2+fn5BAUF8c033zBhwgRWrlzJ6NGjK4N7\nas2+PmrgioibeWTNPigoCIBu3boxbdo076nbX45W4IqIFzI12RcXF3Pux0T4/fffs337diIjI80M\n6Rpq4IqIlzG1jJOTk8O0adMAKCsr44477mDJkiUXg3tjGacuWoErIi7kkdfZ1xvcV5I9QElJZQN3\nxQo1cEXEVEr2nkANXBExmUc2aC1HDVwR8UBK9mZQA1dEPIzKOK6gBq6ItCJTyzjnz5+npKSkyYMS\ndAtlEXG7y87sKyoqSE1NJSUlhYyMDCoqKjAMg7Zt2zJy5EjuuOMO4uPjsdlszQ9ulZl9dWrgikgL\nterVODfccAOjR48mLi6O6Oho/P39ASgpKSE7O5stW7bw3nvvsXv3bpcO2CfoFsoi0gKtmuxLSkqc\nCf5yGrNNvcGtmuyrnD5dmfB37Kis5cfHu3tEIuIFWrVmX1cSLyoqYv369dx6662X3UaaQLdQFhEX\nabBBW1JSwr/+9S9mzZpFz5492bVrF7/85S9dMTbrUANXREx22TLOW2+9RUpKCm+//TZ2u51Zs2bx\n61//mtzc3NYLbvUyTl3UwBWRBrRqzb5NmzZMnjyZF198kZ49ewLQr18/cnJyWj7SquBK9nVTA1dE\n6tGqNfv9+/cTFhbGmDFjuPnmm1m1ahXl5eUtHqQ0glbgikgra3AFrWEYZGRkkJKSwquvvkpUVBTT\np0/n3nvvbXlwzewbRytwRaQa0+96WV5ezq5du9i4cSOrV69u8gBrBVeybzzdQllEfmRasj9w4ABf\nfvklZWVlzgAzZsxo3iirB1eybzo1cEUsz5RkP2/ePA4ePMigQYNo0+ZiiX/NmjXNG2X14Er2zaMG\nroilmZLsw8PD+eSTT1p0D5zLBleybxmtwBWxJFPuejl8+HAOHz7c7EGJibQCV0QaqcFkP2/ePEaO\nHEloaCiRkZFERkYyePDgRgcoLy8nJiaGKVOmtGigUg+twBWRBjRYxunfvz/PPvssERERNWr2ISEh\njQrwzDPPsG/fPs6dO8eWLVtqBlcZp/WpgSvi80wp43Tv3p24uDiuvvpqQkJCnK/GOHHiBGlpadxz\nzz1K6q6iZ+CKSB0avFA7JiaGOXPmMGXKFK644gqg8r8q06dPb3DnDzzwAMuWLaOwsPCy2yQnJzt/\nttvt2O32hkct9atagXvLLZUN3PBwNXBFvJjD4cDhcLRoHw2Wce6+++46r8Rp6NLLN998k23btvH8\n88/jcDh4+umneeONN2oGVxnHNd59F+67TytwRXyE6Stom+KRRx5h/fr1+Pn5cf78eQoLC5kxYwYv\nv/zyxeBK9q6jFbgiPqNVk31ycjJJSUkEBgbW+Yf5+fm8+OKL/P73v28wyLvvvstTTz2lmb0nUANX\nxOs1J3dedmo3bNgwEhISKC0tZciQIQQFBWEYBqdOnWL//v34+/vz0EMPNWlw4gGqGrjr11c2cLUC\nV8QSGizj5OXl8f777/Of//wHgL59+/Kzn/2M4ODglgfXzN69tAJXxCt5VM2+UcGV7D2DGrgiXsWU\n6+zFAsaM0QpcER+nmb3UpAauiMfTzF5aTitwRXySkr3UpmfgivgclXGkYWrgingUlXHEHGrgini9\nBpP9kiVLKCgocP5eUFDAo48+auqgxAP5+8Njj0FGBmzZArGxsG+fu0clIo3UYLLftm0bnTt3dv7e\nuXNntm7dauqgxIOpgSvilRpM9hUVFZw/f975+w8//EBpaampgxIPpwauiNdp8LaHd9xxB+PGjSMx\nMRHDMFizZg1z5851xdjE01U9A7eqgbt2rRq4Ih6qUVfjbNu2jZ07d2Kz2ZgwYQITJ05sneC6Gsd3\n6BbKIi6je+OI+2kFrojpWjXZt2/f/rK3JbbZbPU+arDRwZXsfZNhVN5CedEi3UJZxASa2Ytn0S2U\nRUyhZC+eSStwRVqVVtCKZ9IKXBG308xeXEsNXJEW08xePJ9W4Iq4hanJ/vz588TGxhIdHU14eDhL\nliwxM5x4C63AFXE508s4xcXFXHnllZSVlXH99dfz1FNPcf3111cGVxlHQA1ckSbyyDLOlVdeCUBp\naSnl5eVcddVVZocUb6MGrojpTF/PXlFRwZAhQzh+/DhJSUmEh4fX+Dw5Odn5s91ux263mz0k8URV\nt1BOSKhs4K5frwauyI8cDgcOh6NF+3DZ1TjfffcdEydO5Mknn3QmdJVxpE5agStSL48s41Tp1KkT\nt956K1lZWa4KKd5KDVyRVmdqsj99+jRnz54FKu+Dv2PHDmJiYswMKb6k6hbKGzbAww9X3m4hL8/d\noxLxSqYm+/z8fG688Uaio6OJjY1lypQpjBs3zsyQ4ovUwBVpMa2gFe+iFbginl2zF2kVWoEr0ixK\n9uJ91MAVaTKVccT7aQWuWIzKOGJNauCKNEgze/EtauCKBWhmL6IGrkidlOzF96iBK1KLyjji+9TA\nFR+jMo5IXdTAFdHMXixGDVzxAZrZizREDVyxKCV7sR41cMWCVMYRUQNXvIzKOCLNoQauWIBm9iLV\nVW/g/u//wrBh7h6RSC2a2Yu0VPUG7uTJlf+rBq74ACV7kUtVb+CeO6cGrvgElXFEGqIGrngYlXFE\nzKAGrvgAU5N9Xl4eY8eOZdCgQURERLBixQozw4mYx98fHnsMMjJgyxaIjYWsLHePSqTRTC3jnDp1\nilOnThEdHU1RURFDhw4lNTWVsLCwyuAq44g3MgxYvx4WLYLbb4c//Qk6dHD3qMRCPK6M06NHD6Kj\nowFo3749YWFhfPXVV2aGFDGfGrjihfxcFSg3N5fs7GxiY2NrvJ+cnOz82W63Y7fbXTUkkZbp2hVW\nr77YwF27Vg1cMYXD4cDhcLRoHy65GqeoqAi73c6jjz5KfHz8xeAq44ivKCmBpUthxQp49FG4/37w\nc9lcSiymObnT9GR/4cIFJk+ezKRJk1i4cGHN4Er24muOHoWkJDh7VitwxTQel+wNw+Cuu+6iS5cu\nPPvss7WDK9mLL1IDV0zmcQ3a999/nw0bNvDOO+8QExNDTEwM6enpZoYUcT81cMUDaQWtiNm0Alda\nmcfN7EUErcAVj6CZvYgrqYErrUAzexFPFxoKO3fqFsrickr2Iq6mBq64gco4Iu6mBq40kco4It5I\nDVxxAc3sRTyJGrjSCJrZi3g7NXDFJEr2Ip5GDVwxgco4Ip5ODVy5hMo4Ir5IDVxpBZrZi3gTNXAF\nzexFfJ8auNJMSvYi3kYNXGkGlXFEvJ0auJajMo6IFamBK42gmb2IL1ED1xI0sxexOjVw5TJMTfaJ\niYkEBgYSGRlpZhgRqU4NXKmDqWWcPXv20L59e+bOncvBgwdrB1cZR8R8VQ3ca6+tbOD26ePuEUkL\neVwZZ/To0XTu3NnMECLSkKoG7tChlU3cZ59VA9eCVLMXsQJ/f3jsMcjIgDffhNhYyMpy96jEhfzc\nPYDk5GTnz3a7Hbvd7raxiPi8qgbu+vWVDdzbb4c//Qk6dHD3yKQeDocDh8PRon2Yfullbm4uU6ZM\nUc1exNOcPg2LFsGOHZW1/Ph4d49IGsnjavYi4sG6doXVq2HDBnj4YZg6Ff7zH3ePSkxiarKfPXs2\no0aN4ujRo/Tu3Zs1a9aYGU5EmkMNXEvQCloRuUgrcL2Cyjgi0jJageuzlOxFpCatwPVJKuOISP20\nAtfjqIwjIq1PDVyfoJm9iDSeGrgeQTN7ETGXGrheS8leRJpGDVyvpDKOiLSMGrgupzKOiLieGrhe\nQTN7EWk9auC6hGb2IuJeauB6LCV7EWldauB6JJVxRMRcauC2OpVxRMTzqIHrETSzFxHXUQO3VWhm\nLyKerYUN3JKSEsaMGcP+/fsZOXIkERERREVFsXnzZuc2OTk5xMbGMmDAABISErhw4QK5ubn07t27\n1v6io6P58MMPa73/m9/8hgEDBhAVFUV2drYz9g033EBFRUUzvrj7KdmLiGu1oIH7yiuvMHnyZDp0\n6MCGDRs4dOgQ6enpLFy4kMLCQgAWL17Mgw8+yLFjx+jcuTOrVq0iJCSEPn36sHv3bue+PvvsM4qK\nihg+fHiNGGlpaXz++eccO3aMv/3tbyQlJQHg7+/P6NGjSfXSZrOSvYi4RzOegZuSksLUqVMZMGAA\n/fv3ByAoKIju3bvzzTffYBgG77zzDjNnzgTgrrvucibn2bNns3HjRue+Nm7cyOzZs2vF2LJlC3fd\ndRcAsbGxnD17lq+//hqAuLg4UlJSWv7d3UDJXkTcq5EN3PLycg4dOkRoaGiN9zMzMyktLaV///6c\nOXOGgIAA2rSpTG29evXi5MmTAMyaNYvU1FRnGWbz5s11JvuTJ0/WKPkEBwdz4sQJoLLsk5GR0Trf\n28VMTfbp6ekMHDiQAQMGsHTpUjNDeT2Hw+HuIXgMHYuLLHMs/P3hsccgIwPefBNiYyErq8Ymr7/+\nOh06dKjxXn5+PnPnzmXt2rUNhggMDCQiIoKdO3fy0Ucf4efnR3h4eJ3bXtr8tNlsPw7Tn4qKCs6f\nP9+EL+cZTEv25eXl3H///aSnp3P48GFSUlL49NNPzQrn9Szzf+pG0LG4yHLHoo4Gbvrr/2DivIks\n+H8LOHnqJFt3bAWgsLCQyZMn88QTTzBixAgAunTpwtmzZ52z9xMnTtCrVy/n7qtKOZs2bWLOnDl1\nDqFXr17k5eU5f790H4ZhOJO/NzEt2WdmZnLNNdcQEhJCu3btSEhI4PXXXzcrnIj4imoN3Lwjh4lK\nmM1/nd/OiW4nKDaKWfD8AlLTUpk2bRpz585l+vTp1f7UxtixY/nHP/4BwLp164iPj3d+Pn36dLZu\n3cqmTZtISEhwvv/aa6/xyCOPAJV1+ZdffhmAvXv3EhAQQGBgIFB5RU7btm3x9/c3/TC0NtOSfV11\nr6ramYhIg7p25Z6gNiQklPPnnTDzMNAdjvc+zmNLH2PPnj2sXbuWmJgYYmJi+PjjjwFYunQpzzzz\nDAMGDKCgoID58+c7d9mpUydGjRpFjx49CAkJcb5//PhxOnXqBMAtt9zC1VdfzTXXXMN9993HX//6\nV+d22dnZjBw50iVfv7WZtqjq1VdfJT09nZdeegmADRs28O9//5uVK1deDO6F/xQSEfEETU3dfiaN\no1bdKy8vj+Dg4BrbaPWsiDRFaWkp48eP591333X5ZLGkpIQJEya4JXZrMG1mX1ZWxrXXXsuuXbvo\n2bMnI0aMICUlhbCwMDPCiYhIPUyb2fv5+fHcc88xceJEysvLmT9/vhK9iIibmHqd/aRJkzhy5Aif\nf/45S5YsqfGZrsG/KCQkhMGDBxMTE+O8hMwqEhMTCQwMJDIy0vnet99+y4QJEwgNDeWmm27i7Nmz\nbhyh69R1LJKTkwkODnY2IdPT0904QtfJy8tj7NixDBo0iIiICFasWAFY89y43LFo8rlhuEFZWZnR\nv39/IycnxygtLTWioqKMw4cPu2MoHiEkJMQ4c+aMu4fhFrt37zb2799vREREON/77W9/ayxdutQw\nDMN48sknjcWLF7treC5V17FITk42nn76aTeOyj3y8/ON7OxswzAM49y5c0ZoaKhx+PBhS54blzsW\nTT033HK7BF2DX5th0Wb16NGj6dy5c433qt+bpPq9TXxdXccCrHlu9OjRg+joaADat29PWFgYJ0+e\ntOS5cbljAU07N9yS7HUNfk02m43x48czbNgw56WqVvb11187F7EEBgY6b0JlVStXriQqKor58+db\nomxxqdzcXLKzs4mNjbX8uVF1LK677jqgaeeGW5K9N162ZKb333+f7Oxstm3bxvPPP8+ePXvcPSSP\nYbPZLH2+JCUlkZOTw0cffURQUBAPPvigu4fkUkVFRcyYMYPly5fXui+O1c6NoqIiZs6cyfLly2nf\nvn2Tzw23JPvGXINvJUFBQQB069aNadOmkZmZ6eYRuVdgYCCnTp0CKm901b17dzePyH26d+/uTGr3\n3HOPpc6NCxcuMGPGDO68807nLQ+sem5UHYuf//znzmPR1HPDLcl+2LBhHDt2jNzcXEpLS9m0aRNx\ncXHuGIrbFRcXc+7HJ/V8//33bN++vcbVGFYUFxfHunXrgNr3NrGa/Px858+vvfaaZc4NwzCYP38+\n4eHhLFy40Pm+Fc+Nyx2LJp8bJjSPGyUtLc0IDQ01+vfvbzzxxBPuGobbffHFF0ZUVJQRFRVlDBo0\nyHLHIiEhwQgKCjLatWtnBAcHG6tXrzbOnDljjBs3zhgwYIAxYcIEo6CgwN3DdIlLj8WqVauMO++8\n04iMjDQGDx5sTJ061Th16pS7h+kSe/bsMWw2mxEVFWVER0cb0dHRxrZt2yx5btR1LNLS0pp8brj1\ngeMiIuIaelKViIgFKNmLiFiAkr2IiAUo2YuIWICSvfiUG2+8ke3bt9d47y9/+Qu/+tWvWjXOwYMH\nSUxM5Msvv6yxGrxKdHQ0mZmZrFixgvXr17dqbJHmULIXn1L1QOnq6nu4dHMtW7aMpKQk+vbtS58+\nfdi9e7fzs88++4yioiJGjBjBvHnzajydTcRdlOzFp8yYMYOtW7dSVlYGVN5L5KuvvuL6668HKp9P\nOnjwYKKjo5233T5+/DiTJk1i2LBh3HDDDRw5cqTeGCUlJezdu5fhw4cDtf8Ds3HjRmbPng1Ahw4d\n6NKlC5988kmrf1eRplCyF59y1VVXMWLECNLS0oDKxHv77bcDsG3bNrZs2UJmZiYfffQRixcvBuDe\ne+9l5cqVZGVlsWzZsgZLPtnZ2Vx77bXO32fNmkVqaioVFRUAbN682ZnsAUaMGFFj5i/iDqY9qUrE\nXapm2nFxcWzatInVq1cDsGvXLhITE/nJT34CQEBAAEVFRXzwwQfMmjXL+felpaX17v/LL7903s8I\nKu/XEhERwc6dO+nevTt+fn6Eh4c7P+/ZsydffPFFa35FkSZTshefExcXxwMPPEB2djbFxcXExMQ4\nP7t0wXhFRQUBAQFkZ2c3ev82m63Wfqr+AxMYGFirP2AYhqXuziieSWUc8Tnt27dn7NixzJs3r0bi\nnTBhAmvWrOGHH34AoKCggI4dO9KvXz/++c9/ApWJ+eOPP653/3379nXeebHK9OnT2bp1K5s2bSIh\nIaHGZ/n5+YSEhLTCNxNpPiV78UmzZ8/m4MGDNWrnEydOJC4ujmHDhhETE8PTTz8NwCuvvMKqVauI\njo4mIiKCLVu21LvvqKioWk3cTp06MWrUKHr06FErsWdmZjJ69OjW+WIizaQboYk0w913301SUhKx\nsbH1bldYWMi4ceP48MMPXTQykbppZi/SDA899BAvvvhig9utXbuWBQsWuGBEIvXTzF5ExAI0sxcR\nsQAlexERC1CyFxGxACV7ERELULIXEbEAJXsREQv4/4w+NkMIq9efAAAAAElFTkSuQmCC\n"
+ }
+ ],
+ "prompt_number": 1
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 6.16 page No. 233"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "Beta=45 \t\t\t#Unitless\n",
+ "VBE=0.7 \t\t\t#in Volt\n",
+ "VCC=0 \t\t\t\t#in Volt\n",
+ "RB=10**5 \t\t\t#in ohm\n",
+ "RC=1.2*10**3 \t\t\t#in ohm\n",
+ "VEE=-9 \t\t\t\t#in Volt\n",
+ "\n",
+ "IB=-(VBE+VEE)/RB \t\t#in mA\n",
+ "IC=Beta*IB \t\t\t#in mA\n",
+ "VC=VCC-IC*RC \t\t\t#in Volts\n",
+ "VB=VBE+VEE \t\t\t#in Volts\n",
+ "\n",
+ "print\"collector voltage is \",round(VC,1),\"V\"\n",
+ "print\"Base voltage is \",VB,\"V\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "collector voltage is -4.5 V\n",
+ "Base voltage is -8.3 V\n"
+ ]
+ }
+ ],
+ "prompt_number": 60
+ }
+ ],
+ "metadata": {}
+ }
+ ]
+}
\ No newline at end of file diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch7.ipynb b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch7.ipynb new file mode 100755 index 00000000..990f60e7 --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch7.ipynb @@ -0,0 +1,427 @@ +{
+ "metadata": {
+ "name": ""
+ },
+ "nbformat": 3,
+ "nbformat_minor": 0,
+ "worksheets": [
+ {
+ "cells": [
+ {
+ "cell_type": "heading",
+ "level": 1,
+ "metadata": {},
+ "source": [
+ "Chapter 7: Field effect Transistors"
+ ]
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 7.1 page no. 262"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "VGS=10\t\t\t#in Volt\n",
+ "IG=0.001\t\t#in uA\n",
+ "IG=IG*10**-6\t\t#in A\n",
+ "\n",
+ "RGS=VGS/IG\t\t#in ohm\n",
+ "\n",
+ "print\"Resistance between gate and source is \",RGS/10**6,\"ohm\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Resistance between gate and source is 10000.0 ohm\n"
+ ]
+ }
+ ],
+ "prompt_number": 1
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 7.2 page no.262"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "delVDS=1.5\t\t\t#in Volt\n",
+ "delID=120\t\t\t#in uA\n",
+ "delID=120*10**-6\t\t#in A\n",
+ "\n",
+ "rd=delVDS/delID\t\t\t#in Ohm\n",
+ "\n",
+ "print\"AC drain resistance of JFET in Kohm \",rd*10**-3,\"kohm\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "AC drain resistance of JFET in Kohm 12.5 kohm\n"
+ ]
+ }
+ ],
+ "prompt_number": 2
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 7.3 page no. 262"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "VP=-4.5\t\t\t#in Volt\n",
+ "IDSS=10.0\t\t\t#in mA\n",
+ "IDS=2.5\t\t\t#in mA\n",
+ "\n",
+ "VGS=VP*(1-math.sqrt(IDS/IDSS))\t\t#in Volt\n",
+ "gm=(-2*IDSS/VP)*(1-VGS/VP)\t\t#in mA/Volt\n",
+ "\n",
+ "print\"Transconductance is\",round(gm,2),\"mA/v\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Transconductance is 2.22 mA/v\n"
+ ]
+ }
+ ],
+ "prompt_number": 4
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 7.4 page no. 262"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "gm=10\t\t\t#in mS\n",
+ "IDSS=10\t\t\t#in uA\n",
+ "IDSS=IDSS-10**-6\t#in Ampere\n",
+ "\n",
+ "VGS_OFF=-2*IDSS/gm\n",
+ "\n",
+ "print\"VGS(OFF) is =\",round(VGS_OFF),\"mV\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "VGS(OFF) is = -2.0 mV\n"
+ ]
+ }
+ ],
+ "prompt_number": 6
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 7.5 page no. 262"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "VP=-4.0\t\t\t #in Volt\n",
+ "IDSS=10.0\t\t\t #in mA\n",
+ "IDSS=IDSS*10**-3\t#in Ampere\n",
+ "VGS=-2.0 #in Volt\n",
+ "\n",
+ "ID=IDSS*(1.0-VGS/VP)**2\t#in mA\n",
+ "\n",
+ "print \"Drain current=\",ID*1000,\"mA\"\n",
+ "print\"VDS(min) is : \",VP,\"V\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Drain current= 2.5 mA\n",
+ "VDS(min) is : -4.0 V\n"
+ ]
+ }
+ ],
+ "prompt_number": 6
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 7.6 page no. 263"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "VP=-3.0\t\t\t#in Volt\n",
+ "IDSS=8.7\t\t#in mA\n",
+ "IDSS=IDSS*10**-3\t#in mA\n",
+ "VGS=-1\t\t\t#in Volt\n",
+ "\n",
+ "ID=IDSS*(1-VGS/VP)**2\t#in Ampere\n",
+ "gmo=-2*IDSS/VP\t\t#in mS\n",
+ "gm=gmo*(1-VGS/VP)\t#in mS\n",
+ "\n",
+ "print\"ID is \",round(ID*1000,1),\"mA\"\n",
+ "print\"gmo is\",round(gmo*1000,1),\"mS\"\n",
+ "print\"gm is \",round(gm*1000,1),\"mS\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "ID is 3.9 mA\n",
+ "gmo is 5.8 mS\n",
+ "gm is 3.9 mS\n"
+ ]
+ }
+ ],
+ "prompt_number": 13
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 7.7 page no.263"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "VP=-3.0 \t\t#in Volt\n",
+ "IDSS=8.4 \t#in mA\n",
+ "VGS=-1.5 \t#in Volt\n",
+ "\n",
+ "ID=IDSS*(1-VGS/VP)**2 \t\t#in mA\n",
+ "gmo=-2*IDSS/VP \t\t\t#in mS\n",
+ "gm=gmo*(1-VGS/VP) \t\t#in mS\n",
+ "\n",
+ "print\"Drain current=\",ID,\"mA\"\n",
+ "print\"Transconductance is \",gm,\"mS\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Drain current= 2.1 mA\n",
+ "Transconductance is 2.8 mS\n"
+ ]
+ }
+ ],
+ "prompt_number": 9
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 7.8 page no.263"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "VP=-4.5 \t\t #in Volt\n",
+ "IDSS=9 \t\t\t#in mA\n",
+ "IDSS=IDSS*10**-3 #in Ampere\n",
+ "IDS=3 \t\t\t #in mA\n",
+ "IDS=IDS*10**-3 \t\t#in Ampere\n",
+ "\n",
+ "import math\n",
+ "VGS=VP*(1-math.sqrt(IDS/IDSS)) \t#in Volt\n",
+ "gm=(-2*IDSS/VP)*(1-VGS/VP) \t\t#in mS\n",
+ "\n",
+ "print\"IDS = 3 mA when gm is \",round(gm*1000,2),\"mS\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "IDS = 3 mA when gm is 2.31 mS\n"
+ ]
+ }
+ ],
+ "prompt_number": 17
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 7.9 page no.271"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "Vp=-4.0 \t\t\t #in Volt\n",
+ "IDSS=10.0 \t\t #in mA\n",
+ "Vgs1=0\n",
+ "Id1=IDSS # mA, at Vgs=0\n",
+ "Vgs2=1\n",
+ "Id2=Id1*(1-Vgs2/Vp)**2 #mA, at Vgs=1\n",
+ "Vgs3=-1\n",
+ "Id3=Id1*(1-Vgs3/Vp)**2 #mA, at Vgs=1\n",
+ "Vgs4=-2\n",
+ "Id4=Id1*(1-Vgs4/Vp)**2 #mA, at Vgs=-2\n",
+ "Vgs5=-4\n",
+ "Id5=Id1*(1-Vgs5/Vp)**2 #mA, at Vgs=-4\n",
+ "\n",
+ "print \"Transfer Characteristics are in mA \",Id1,Id2,Id3,Id4,Id5\n",
+ "\n",
+ "import matplotlib.pyplot as plt\n",
+ "fig = plt.figure()\n",
+ "ax = fig.add_subplot(111)\n",
+ "\n",
+ "Vgs=[-4,-2,-1,0,1]\n",
+ "Id=[0,2.5,5.625,10,15.625]\n",
+ "xlabel(\"Vgs (V)\") \n",
+ "ylabel(\"Id (mA)\") \n",
+ "plt.xlim((-4,2))\n",
+ "plt.ylim((0,18))\n",
+ "ax.plot([0], [10], 'o')\n",
+ "ax.annotate('(Idss)', xy=(0,10))\n",
+ "\n",
+ "a=plot(Vgs,Id)\n",
+ "\n",
+ "print \"Transfer Characteristics for N channel MOSFET Type\"\n",
+ "show(a)\n"
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "Transfer Characteristics are in mA 10.0 15.625 5.625 2.5 0.0\n",
+ "Transfer Characteristics for N channel MOSFET Type"
+ ]
+ },
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "\n"
+ ]
+ },
+ {
+ "output_type": "display_data",
+ "png": "iVBORw0KGgoAAAANSUhEUgAAAX0AAAEMCAYAAAAoB2Y1AAAABHNCSVQICAgIfAhkiAAAAAlwSFlz\nAAALEgAACxIB0t1+/AAAIABJREFUeJzt3Xlczfn+B/DXyRaTJeFYImRpL0s1Y2SOJWWJJkwyZCrj\nDnMN416zXNwbxjAjjO3O/HApZiQjki0iJ0yaojRZRjMU0WIbyVaq7+8PM2cm2p3v+Z7l9fyrjnPO\n9/V9cF/zud/3d5EJgiCAiIgMgpHUAYiISHNY+kREBoSlT0RkQFj6REQGhKVPRGRAWPpERAZEtNIP\nDAyEXC6Hvb296rWkpCS4uLigV69ecHZ2RnJyslibJyKiCohW+gEBAYiJiSn32kcffYRFixYhNTUV\nCxcuxEcffSTW5omIqAKilb6bmxtMTU3LvdauXTsUFBQAAO7du4cOHTqItXkiIqqATMwrcrOysuDl\n5YX09HQAwNWrV9G/f3/IZDKUlZXh1KlT6Nixo1ibJyKi59TX5MaCgoKwevVqvPnmm/j+++8RGBiI\n2NjYF94nk8k0GYuISG9Uu44XRJSZmSnY2dmpfm/atKnq57KyMqFZs2YVfk7kWJL7z3/+I3UEUXH/\ndJc+75sg6P/+1aQ7NXrKZrdu3RAfHw8AiIuLQ48ePTS5eSIigyfa4R0/Pz/Ex8fj9u3b6NixIxYu\nXIj169fj/fffR1FRERo3boz169eLtXkiIqqAaKUfHh5e4es//vijWJvUGQqFQuoIouL+6S593jdA\n//evJkQ9e6euZDJZ9cMIIiIqpybdydswEBEZEJY+EZEBYekTERkQlj4RkQFh6RMRGRCWPhGRAWHp\nExEZEJY+EZEBYekTERkQlj4RkQFh6RMRGRCWPhGRAWHpExEZEJY+EZEBYekTERkQ0Uo/MDAQcrkc\n9vb25V5fs2YNrK2tYWdnh48//liszRMRUQVEe3JWQEAAZsyYAX9/f9Vrx44dQ3R0NH766Sc0aNAA\nt27dEmvzRERUAdFW+m5ubjA1NS332tdff41PP/0UDRo0AAC0bt1arM0TEVEFRFvpV+SXX37B8ePH\n8a9//QvGxsYICQlB3759K3xvcHCw6meFQsFnWxIRPUepVEKpVNbqM6I+IzcrKwteXl5IT08HANjb\n22PQoEFYtWoVkpOT4evriytXrrwYis/IJSKqNa17Rq65uTl8fHwAAM7OzjAyMsKdO3c0GYGIyKBp\ntPS9vb0RFxcHAMjIyEBxcTHMzMw0GYGIyKCJVvp+fn7o168fMjIy0LFjR2zevBmBgYG4cuUK7O3t\n4efnhy1btoi1eSKicnIKc7Dj/A6pY0hO1GP6dcVj+kSkTkUlRVCEKTCy+0jMHTBX6jiiqUl3svSJ\nSK8JgoCp+6bi7uO72DluJ2QymdSRRFOT7tToKZtERJq2/sx6JGQnIDEoUa8Lv6ZY+kSkt3649gPm\nH5uPHwJ/QNNGTaWOoxV4wzUi0ks5hTl4a+dbCPUORXez7lLH0RosfSLSO0UlRRizYwym952O4d2H\nSx1Hq3CQS0R6xZAGt8/jIJeIDA4Ht1Vj6ROR3uDgtno8pk9EeoGD25ph6RORzuPgtuY4yCUinWbI\ng9vncZBLRHqPg9vaYekTkc7i4Lb2eEyfiHQSB7d1w9InIp3DwW3dcZBLRDqFg9vKSfqM3MDAQMjl\nctjb27/wZ8uXL4eRkRHu3r0r1uaJSE/9MbgNHR3Kwq8D0Uo/ICAAMTExL7yenZ2N2NhYWFhYiLVp\nItJTfwxuo3yjOLitI9FK383NDaampi+8Pnv2bHz55ZdibZaI9BQHt+qh0VM29+zZA3Nzczg4OFT7\n3uDgYNXPCoUCCoVCvGBEpNU4uK2YUqmEUqms1WdEHeRmZWXBy8sL6enpePToEQYOHIjY2Fg0a9YM\nXbp0wenTp2FmZvZiKA5yieh3HNzWnKSD3OddvnwZWVlZcHR0RJcuXXD9+nX06dMHN2/e1FQEItJB\nHNyql8YO79jb2yM/P1/1e5cuXXDmzBm0bNlSUxGISMfwilv1E22l7+fnh379+iEjIwMdO3bE5s2b\ny/05/4tNRFXh4FYcvDiLiLROUUkRFGEKjOw+EnMHzJU6js6oSXey9IlIq3BwW3e8tTIR6RzeKllc\nLH0i0hoc3IqPd9kkIq3Awa1msPSJSHK84lZzOMglIklxcKs+HOQSkdbj4FazWPpEJBkObjWPx/SJ\nSBIc3EqDpU9EGsfBrXQ4yCUijeLgVjwc5BKR1uHgVlosfSLSGA5upcdj+kSkERzcageWPhGJjoNb\n7cFBLhGJioNbzZH8GbmBgYGQy+Wwt7dXvTZnzhxYW1vD0dERPj4+KCgoEDMCEUmMz7jVLqKWfkBA\nAGJiYsq9NnToUJw/fx5paWno0aMHlixZImYEIpLQH4PbKN8oDm61hKil7+bmBlNT03Kvubu7w8jo\n2WZdXV1x/fp1MSMQkUQ4uNVOkp6yuWnTJvj5+VX4Z8HBwaqfFQoFFAqFZkIR0Uvj4FYzlEollEpl\nrT4j+iA3KysLXl5eSE9PL/f64sWLkZKSgsjIyBdDcZBLpLM4uJWO1l6RGxoaigMHDuDo0aNSbJ6I\nRMQrbrWbxks/JiYGy5YtQ3x8PIyNjTW9eSISEa+41X6iHt7x8/NDfHw8bt++DblcjgULFmDJkiUo\nLi5Gy5YtAQCvvfYa/vvf/5YPxcM7RDonpzAHzhucscFrA4/jS6Qm3cmLs4jopRWVFEERpsDI7iMx\nd8BcqeMYLJY+EYmOg1vtobWDXCLSHxzc6haWPhHVGQe3uod32SSiOuEVt7qJpU9EtcYrbnUXB7lE\nVCsc3GovDnKJSO04uNVtLH0iqjEObnUfj+kTUY1wcKsfWPpEVC0ObvUHB7lEVCUObnWH5M/IJSLd\nU1RUhDfeeANXrlyBvb19hc+4VSgUOHPmTK2+Nzo6GosWLRIjMtUCS5+Iyvnuu+8wcuRI1KtXD4+e\nPqrwGbcymazWK34vLy9ERkbi6dOn6o5MtVBl6aekpGDOnDlwdXWFXC5H27Zt4erqijlz5iA1NVVT\nGYlIg8LDwzF69GjkFebhWsE1hHqHwryJOcaPHw8bGxv4+Pjg8ePHAICysjK88847sLe3h4ODA1at\nWgUAWL16NWxtbeHo6Kh6JKpMJsNrr72Gw4cPS7ZvVMUpm8OHD4epqSlGjRqF6dOno127dhAEAbm5\nuUhKSkJISAju3buH/fv3azIvEYmotLQU586dg0VXC4xfPh5mjc0wvPtwrFixAiYmJrhw4QLS09PR\nu3dvAEBqaipycnJUj0O9f/8+AOCLL75AVlYWGjRooHoNAFxcXHD8+HGMGDFC8ztHAKoo/c2bN0Mu\nl7/weteuXdG1a1eMHz8eN2/erPSLAwMDsX//frRp00b1D+Lu3bvw9fXF1atX0blzZ+zYsQMtWrRQ\nw24QkTrcvn0bTZs2xd8P/h1tXmmDp688OxRz4sQJzJw5EwBUq3oAsLS0xJUrV/DBBx9gxIgRGDp0\nKADAwcEBEyZMgLe3N7y9vVXf3759e8TExGh4r+ivKj28U1HhA8/+8t9//30AQJs2bSr94oCAgBf+\ncpcuXQp3d3dkZGRg8ODBWLp0aV0yE5Ga7d9/HB4e8/Dmm8uQlXcDhy8cQcjQkHLvqeiskBYtWiAt\nLQ0KhQLffPMNpkyZ8vv37cf777+PlJQUODs7o6ysDMCzw0E8+0daNRrk/nFs38LCAvPnz4eVlVW1\nn3Fzc4OpqWm516KjozF58mQAwOTJkxEVFVWHyESkTvv3H8fMmYdw+PBnOJU9Ck/LnkDY7omkk+dV\n7xkwYAC2bdsGADh37hx++uknAMCdO3dQWloKHx8fLFq0CCkpKRAEAdeuXYNCocDSpUtRUFCABw8e\nAAByc3NhYWGh+Z0klUoP71y6dAnh4eGIiIhA69atMW7cOAiCAKVSWeeN5efnq/4fhFwuR35+fp2/\ni4jUY/Xqw7h8eTFgehl4yw/42gHZZ2chLGytalU+bdo0BAQEwMbGBtbW1ujbty8A4MaNGwgICFCt\n5JcuXYrS0lJMmjQJBQUFEAQBM2fORLNmzQAASUlJ8PLykmZHCUAVpW9tbY2RI0fi0KFD6NSpEwBg\nxYoVattwdad8BQcHq35WKBRQKBRq2zYR/amoqD5gdgnwHwLE/xt43AhAFGQyM9WK3tjYGOHh4RV+\nvqLz9U+cOPHCa2VlZUhMTMTatWvVmt+QKZXKWi/EKy39Xbt2ITw8HAMGDICnp6dqpf8y5HI58vLy\n0LZtW+Tm5lY5E/hr6ROReJ62yAUmDwLiPgPOBgAoBjAEjRoNUOt29u3bh7Fjx6J+fd7nUV2eXxAv\nWLCg2s9Uekzf29sbEREROHfuHNzc3LBy5UrcunUL06ZNq/N5tqNGjUJYWBgAICwsrNxUn4g0Ly0v\nDRdddqLNT31/L3wAaAhLy/744IOhat3WqFGjMG/ePLV+J9Vere69c/fuXezcuRPbt29HXFxcle/1\n8/NDfHw8bt++DblcjoULF2L06NF46623cO3atSpP2eS9d4jEdzrnNEZsG4G1w9aiSZYca9bE4smT\nejA2LsWMGe4YMUK9K30SX026s0al/9tvvyE7OxslJSWqL+zTp496UlYUiqVPJKrE64kYFT4KG7w2\nYLTVaKnjkJqo5clZ8+fPR2hoKLp27Qojoz+PBh07duzlExKRxp24egI+O3wQ5h3G2yQboGpX+j16\n9MC5c+fQsGFDTWXiSp9IJHGZcfDd6YttPtvgbukudRxSM7XcWtnW1ha//fab2kIRkTQO/XoIvjt9\nsXPcTha+Aat2pZ+cnIzRo0fDzs4OjRo1evYhmQzR0dHiheJKn0it9l7ai6DoIOz23Y3XO70udRwS\niVqO6fv7++OTTz6BnZ2d6pg+751BpDt2XdyFafunYd+EfXDp4CJ1HJJYtSt9Z2dnJCcnayoPAK70\nidRl+7ntmBUzCwffPohe7XpJHYdEppZTNmfPno1GjRph1KhRqsM7AFT30xYDS5/o5YWdDcOnRz/F\noYmHYC+3lzoOaYBaSl+hUFR4OEfMUzZZ+kQvZ2PKRgQrgxE7KRbWra2ljkMaoraLszSNpU9Ud+uS\n1uHLhC9xZNIRdDfrLnUc0qCXOmUzNDQUJSUllX6wuLgYmzdvrns6IlK7FadWIORUCJSTlSx8qlCl\nZ+88ePAAzs7OsLKyQt++fVXPyM3Ly8Pp06fx888/491339VkViKqwpITS7Dp7CbEvxOPTs07SR2H\ntFSVh3cEQcAPP/yAkydP4tq1awAACwsL9O/fH/369RPt1E0e3iGqOUEQsCB+ASLOR+Co/1G0b9pe\n6kgkER7TJ9JzgiDgX3H/wr6MfTgy6QjkJhU/25oMg1ouziIi7SQIAv5x+B84lnUMxyYfQ6smraSO\nRDqApU+kg8qEMsw4OAPJN5Jx1P8oWjZuKXUk0hEsfSIdUyaU4W/7/oYLty4gdlIsmhs3lzoS6ZBq\n77IphiVLlsDW1hb29vaYMGECioqKpIhBpHNKy0oRsCcAGXcyEPN2DAufak3jpZ+VlYUNGzYgJSUF\n6enpKC0txfbt2zUdg0jnPC19iom7JyKnMAcH3z6Ipo2aSh2JdJDGD+80a9YMDRo0wKNHj1CvXj08\nevQIHTp00HQMIp1SXFoMv0g/PH76GHv99sK4vrHUkUhHVVr6kZGRqtN/Kjof38fHp04bbNmyJf7x\nj3+gU6dOaNy4MTw8PDBkyJA6fReRIXhS8gTjvh+HerJ62O27G43qN6r+Q0SVqLT09+7dC5lMhps3\nbyIhIQGDBg0C8OxGa/369atz6V++fBlfffUVsrKy0Lx5c4wbNw7fffcd3n777XLvCw4OVv2sUCig\nUCjqtD0iXfb46WN4R3ijeaPm+M7nOzSo10DqSKRFlEollEplrT5T7cVZ7u7u2LJlC9q1awcAyM3N\nxeTJk3H48OE6hYyIiEBsbCw2btwIANi6dSsSExOxbt26P0Px4iwiPCx+CK9wL7Rv2h6h3qGob8ST\n7ahqanlGbnZ2Ntq2bav6XS6Xq27JUBdWVlZITEzE48ePIQgCjhw5Ahsbmzp/H5E+ul90H57fecKi\nhQXCvMNY+KQ21f5LGjJkCDw8PDBhwgQIgoCIiAi4u9f9ocqOjo7w9/dH3759YWRkhN69e2Pq1Kl1\n/j4ifXPvyT14fusJp7ZO+O+I/8JIJsmZ1aSnqj28IwgCdu/ejePHj0Mmk2HAgAF48803xQ3Fwztk\noO48uoOh3w5F/0798ZXHV3weNdUKb7hGpENuPrwJ963u8LD0wBdDvmDhU6291A3XTExMKv1HJ5PJ\ncP/+/ZdLR0QquYW5GLJ1CHysfbBQsZCFT6LhSp9IYtfvX8fgLYMxyWES5g2YJ3Uc0mG8tTKRlrt6\n7yoGbRmE9/q8hzmvz5E6DhkAlj6RRC7fvYzBWwbjw1c/xMxXZ0odhwwES59IApduX8KQrUMw120u\n3uv7ntRxyICw9Ik07PzN8xj67VB8NvAzBPQKkDoOGRiWPpEGpeWlwfM7TyxzX4aJDhOljkMGiKVP\npCFncs5gxLYRWDNsDcbZjpM6Dhkolj6RBiReT8To7aOxfuR6jLYaLXUcMmAsfSKRnbh6Aj47fBDm\nHYbh3YdLHYcMHEufSERxmXHw3emLbT7b4G5Z9xsVEqkLS59IJId+PYSJuydi57ideKPzG1LHIQLA\n0icSxd5LexEUHYQo3yi83ul1qeMQqbD0idRs18VdmLZ/GvZN2AeXDi5SxyEqh6VPpEbbz23HrJhZ\niHk7Br3a9ZI6DtELJHkkz7179zB27FhYW1vDxsYGiYmJUsQgUquws2GYfWg2YifFsvBJa0my0p85\ncyaGDx+OnTt3oqSkBA8fPpQiBpHabEzZiGBlMI76H4V1a2up4xBVSuP30y8oKECvXr1w5cqVSt/D\n++mTLlmXtA5fJnyJI5OOoLtZd6njkAHTyvvpZ2ZmonXr1ggICEBaWhr69OmDVatWoUmTJuXeFxwc\nrPpZoVBAoVBoNihRDaw8tRJrktZAOVmJLqZdpI5DBkapVEKpVNbqMxpf6Z8+fRqvvfYaEhIS4Ozs\njFmzZqFZs2ZYuHDhn6G40icdsOTEEmw6uwlH/Y+iU/NOUschqlF3anyQa25uDnNzczg7OwMAxo4d\ni5SUFE3HIKozQRCwQLkAW37agvh34ln4pFM0Xvpt27ZFx44dkZGRAQA4cuQIbG1tNR2DqE4EQcDc\nuLnYeXEnlJOVaN+0vdSRiGpFkgejp6WlYcqUKSguLoalpSU2b96M5s2b/xmKh3dIC5WUleCfh/+J\n+KvxiJ0Ui1ZNWkkdiaicmnSnJKVfHZY+aZuMOxnw3+2PZo2aYfvY7WjZuKXUkYheoJXH9Il0iSAI\n+Dr5a/T7Xz9MdJiImIkxLHzSabwNA1ElcgtzERQdhFuPbuFk4ElYtbKSOhLRS+NKn6gCkRci0ev/\nesG5gzMSAhNY+KQ3uNIn+ouCJwWYcXAGTl0/hajxUXjV/FWpIxGpFVf6RL9TZinh8I0DXmn4Cs7+\n7SwLn/QSV/pk8J6UPMG8uHkIPxeODV4b+Bxb0mssfTJoZ/POYtLuSehp1hNp76Xx3HvSeyx9Mkil\nZaUISQhByKkQrBi6AhMdJkImk0kdi0h0LH0yOJm/ZcI/yh/1ZPVw+t3TsGhhIXUkIo3hIJcMhiAI\n2JS6CS4bXeDd0xtxk+NY+GRwuNIng3Dz4U1M3TsVmfcyEecfB3u5vdSRiCTBlT7pvb2X9sLpGydY\ntbJC0pQkFj4ZNK70SW8VFhVi9uHZOHLlCCLGRsDNwk3qSESS40qf9FJCdgKc/s8JZUIZ0t5LY+ET\n/Y4rfdIrxaXFWBC/AP9L+R++GfkNvK28pY5EpFVY+qQ3Lty6gIm7JqJDsw5Iey8NchO51JGItI5k\nh3dKS0vRq1cveHl5SRWB9ESZUIavEr/CG6FvYLrzdESPj2bhE1VCspX+qlWrYGNjg8LCQqkikB7I\nLsjGO3veweOnj5EYlAjLlpZSRyLSapKs9K9fv44DBw5gypQpfCwi1YkgCNiWvg191vfB4C6DcTzg\nOAufqAYkWel/+OGHWLZsGe7fv1/pe4KDg1U/KxQKKBQK8YORTrj7+C6m7Z+G9Px0xEyMQe92vaWO\nRCQJpVIJpVJZq89o/MHo+/btw8GDB7Fu3ToolUosX74ce/fuLR+KD0anShz69RCCooMwznYcPh/0\nORo3aCx1JCKtUZPu1PhKPyEhAdHR0Thw4ACePHmC+/fvw9/fH1u2bNF0FNIhj54+wsdHPsaen/cg\nzDsMg7sOljoSkU7S+Er/r+Lj4xESEsKVPlUp+UYyJu2ehD7t+2DtsLUwbWwqdSQiraSVK/3n8R7m\nVJmSshJ8fuJzrEteh9Weq+Fr5yt1JCKdJ+lKvzJc6VPGnQxM2j0JzRs1x+bRm9GhWQepIxFpvZp0\nJ++9Q1pFEAR8nfw1+v2vHyY5TELMxBgWPpEaSX54h+gPuYW5CIoOwq1Ht3Ay8CSsWllJHYlI73Cl\nT1oh8kIknP7PCc4dnJEQmMDCJxIJV/okqYInBZhxcAZOXT+FPeP34FXzV6WORKTXuNInySizlHD4\nxgEmDU1w9m9nWfhEGsCVPmnck5InmBc3D+HnwrHRayOGdR8mdSQig8HSJ406m3cWk3ZPQk+znkh7\nLw2tmrSSOhKRQWHpk0aUlpUiJCEEIadCsGLoCkx0mMgL84gkwNIn0WX+lgn/KH/Uk9XD6XdPw6KF\nhdSRiAwWB7kkGkEQsCl1E1w2usC7pzfiJsex8IkkxpU+ieLmw5uYuncqMu9lIs4/DvZye6kjERG4\n0icR7L20F47fOMKqlRWSpiSx8Im0CFf6pBb5D/Jx+PJhRF2KQkpuCnaM3QE3CzepYxHRc3iXTaqT\n4tJiJGQn4NDlQ4j5NQaZv2ViUJdB8LD0gJ+9H5o1aiZ1RCKDU5PuZOlTjf1691cc+vUQDl0+hPir\n8ehp1hMe3TzgYekB1w6uaFCvgdQRiQwaS59eSmFRIeIy43Do8rOif/z0MYZaDoWHpQfcLd15YRWR\nltHa0s/Ozoa/vz9u3rwJmUyGqVOn4oMPPvgzFEtfEmVCGc7mnVWt5s/knoFrB1d4WHrAo5sH7NvY\n84IqIi2mtaWfl5eHvLw8ODk54cGDB+jTpw+ioqJgbW39LBRLX2P+GMAeunwIsVdiYWpsqjpk84bF\nG3il4StSRySiGtLaZ+S2bdsWbdu2BQCYmJjA2toaOTk5qtIn8VQ1gP1s0Gfo3KKz1BGJSESSn7KZ\nlZWF1NRUuLq6lns9ODhY9bNCoYBCodBsMD1S2QB2zbA1HMAS6TClUgmlUlmrz0g6yH3w4AEUCgXm\nzZsHb2/vP0Px8M5L4QCWyDBp7TF9AHj69ClGjhyJYcOGYdasWeVDsfRrhQNYIgK0uPQFQcDkyZNh\nZmaGlStXvhiKpV8tDmCJ6HlaW/onT57EgAED4ODgoFqBLlmyBJ6ens9CsfRfUNUA1qObBwewRKS9\npV8dlv4zvAKWiGqDpa9jOIAlopfB0tdyHMASkTqx9LUQB7BEJBaWvhbgAJaINIWlLxEOYIlICix9\nDeEAloi0AUtfJBzAEpE2Yumr0fMD2BbGLeDZzZMDWCLSGiz9l8ABLBHpGpZ+LXEAS0S6jKVfDQ5g\niUifsPSfwwEsEekzlj44gCUiw2GQpc8BLBEZKoMpfQ5giYhq1p1GGspSTkxMDKysrNC9e3d88cUX\ntf58YVEh9vy8B9P3T4flaksM2DwAyTnJ8LPzw+UPLiPp3SQsGrgI/Tv118rCr+2DjHUN90936fO+\nAfq/fzWh8dIvLS3F3//+d8TExODChQsIDw/HxYsXq/xMmVCGlNwULDmxBIpQBdqvaI81SWvQpUUX\n7PbdjRuzbyDUOxR+9n46ccaNvv/D4/7pLn3eN0D/968m6mt6g0lJSejWrRs6d+4MABg/fjz27NkD\na2vrcu+rbAD70esfcQBLRFRHGi/9GzduoGPHjqrfzc3N8eOPP77wvp5re6oGsJ8N+owDWCIiNdD4\nIDcyMhIxMTHYsGEDAODbb7/Fjz/+iDVr1vwZiufKExHVSXWVrvGVfocOHZCdna36PTs7G+bm5uXe\no4UnFBER6QWND3L79u2LX375BVlZWSguLkZERARGjRql6RhERAZJ4yv9+vXrY+3atfDw8EBpaSmC\ngoJeGOISEZE4JDlPf9iwYbh06RJ+/fVXfPrpp1W+d/ny5TAyMsLdu3c1lE4z5s+fD0dHRzg5OWHw\n4MHlDnnpujlz5sDa2hqOjo7w8fFBQUGB1JHU6vvvv4etrS3q1auHlJQUqeOozcteP6PNAgMDIZfL\nYW9vL3UUUWRnZ2PgwIGwtbWFnZ0dVq9eXfmbBS127do1wcPDQ+jcubNw584dqeOo1f3791U/r169\nWggKCpIwjXodPnxYKC0tFQRBED7++GPh448/ljiRel28eFG4dOmSoFAohDNnzkgdRy1KSkoES0tL\nITMzUyguLhYcHR2FCxcuSB1LbY4fPy6kpKQIdnZ2UkcRRW5urpCamioIgiAUFhYKPXr0qPTvT5KV\nfk3Nnj0bX375pdQxRNG0aVPVzw8ePECrVtp/UVlNubu7w8jo2T8tV1dXXL9+XeJE6mVlZYUePXpI\nHUOt/nr9TIMGDVTXz+gLNzc3mJqaSh1DNG3btoWTkxMAwMTEBNbW1sjJyanwvRo/pl9Te/bsgbm5\nORwcHKSOIpq5c+di69ataNKkCRITE6WOI4pNmzbBz89P6hhUjZpeP0PaLysrC6mpqXB1da3wzyUt\nfXd3d+Tl5b3w+uLFi7FkyRIcPnxY9Zqgg6dxVrZ/n3/+Oby8vLB48WIsXrwYS5cuxYcffojNmzdL\nkLJuqts34NnfY8OGDTFhwgRNx3tpNdk/fcJrY/TDgwcPMHbsWKxatQomJiYVvkfS0o+Nja3w9XPn\nziEzMxOOjo4AgOvXr6NPnz5ISkpCmzZtNBnxpVS2f8+bMGEChg8fLnIa9apu30JDQ3HgwAEcPXpU\nQ4nUq6ZuTZ1KAAAEWElEQVR/d/qiJtfPkHZ7+vQpxowZg4kTJ8Lb27vS92nl4R07Ozvk5+erfu/S\npQvOnDmDli1bSphKvX755Rd0794dwLNDWb169ZI4kfrExMRg2bJliI+Ph7GxsdRxRKWL/w+0In+9\nfqZ9+/aIiIhAeHi41LGohgRBQFBQEGxsbDBr1qxq36z1unTpondn74wZM0aws7MTHB0dBR8fHyE/\nP1/qSGrTrVs3oVOnToKTk5Pg5OQkTJs2TepIarVr1y7B3NxcMDY2FuRyueDp6Sl1JLU4cOCA0KNH\nD8HS0lL4/PPPpY6jVuPHjxfatWsnNGzYUDA3Nxc2bdokdSS1OnHihCCTyQRHR0fV/+4OHjxY4Xu1\n8iEqREQkDq0+ZZOIiNSLpU9EZEBY+kREBoSlT0RkQFj6pPcGDRpU7kI/APjqq68wffp0tW4nPT0d\ngYGBuHr1armrW//g5OSEpKQkrF69Glu3blXrtolqiqVPes/Pzw/bt28v91pERITarxRetmwZpk2b\nBgsLC3Tq1AnHjx9X/dnPP/+MBw8ewMXFBQEBAeWeFEekSSx90ntjxozB/v37UVJSAuDZvUlycnLQ\nv39/lJWVYfr06bC2tsbQoUMxYsQIREZGAgA++eQT2NrawtHREXPmzKlyG0VFRUhMTISzszOAF/9D\ns337dtU9iJo2bQozMzOcP39ejN0lqhJLn/Rey5Yt4eLiggMHDgB4VsC+vr4AgF27duHq1au4ePEi\ntm7dilOnTkEmk+HOnTuIiorC+fPnkZaWhvnz51e5jdTUVPTs2VP1+7hx4xAVFYWysjIAwI4dO8rd\neM7FxaXc/xMg0hSWPhmEv668IyIiVAX8ww8/4K233gIAyOVyDBw4EADQokULGBsbIygoCLt370bj\nxo2r/P6rV6+iXbt2qt/lcjns7Oxw5MgRnD17FvXr14eNjY3qz9u3b4+srCx17iJRjbD0ySCMGjUK\nR48eRWpqKh49elTuXkcVXZRer149JCUlYezYsdi3bx88PT2r/H6ZTPbC9/zxH5qK5geCIPDOliQJ\nlj4ZBBMTEwwcOBABAQHlCvj1119HZGQkBEFAfn4+lEolAODhw4e4d+8ehg0bhhUrViAtLa3K77ew\nsHjhVsw+Pj7Yv38/IiIiMH78+HJ/lpubi86dO6tl34hqQyvvskkkBj8/P/j4+GDHjh2q18aMGYOj\nR4/CxsYGHTt2RO/evdG8eXMUFhZi9OjRePLkCQRBwMqVK6v8bkdHR1y6dKnca82bN0e/fv2Qn5//\nQsEnJSUhJCREbftGVFO84RoZvIcPH+KVV17BnTt34OrqioSEhDo9t+Gdd97BtGnTKn1i0R/u37+P\nwYMHIzk5ua6RieqMK30yeCNHjsS9e/dQXFyMf//733V+UM8///lPLF++vNrSDw0NxcyZM+u0DaKX\nxZU+EZEB4SCXiMiAsPSJiAwIS5+IyICw9ImIDAhLn4jIgLD0iYgMyP8Dr4y+N/dLTzoAAAAASUVO\nRK5CYII=\n"
+ }
+ ],
+ "prompt_number": 27
+ },
+ {
+ "cell_type": "heading",
+ "level": 3,
+ "metadata": {},
+ "source": [
+ "Example 7.10 page no.275"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [
+ "\n",
+ "ID_on=5 \t\t#in mA\n",
+ "VGS=6 \t\t\t#in Volt\n",
+ "VGS_on=8.0 \t\t#in Volt\n",
+ "VGST=4 \t\t\t#in Volt\n",
+ "\n",
+ "K=ID_on/(VGS_on-VGST)**2 \t\t#in mA/V**2\n",
+ "ID=K*(VGS-VGST)**2 \t\t\t#in mA\n",
+ "\n",
+ "print\"When VGS=6V the drain current is \",ID,\"mA\""
+ ],
+ "language": "python",
+ "metadata": {},
+ "outputs": [
+ {
+ "output_type": "stream",
+ "stream": "stdout",
+ "text": [
+ "When VGS=6V the drain current is 1.25 mA\n"
+ ]
+ }
+ ],
+ "prompt_number": 20
+ },
+ {
+ "cell_type": "code",
+ "collapsed": false,
+ "input": [],
+ "language": "python",
+ "metadata": {},
+ "outputs": []
+ }
+ ],
+ "metadata": {}
+ }
+ ]
+}
\ No newline at end of file diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch8.ipynb b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch8.ipynb new file mode 100755 index 00000000..aa872860 --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/Ch8.ipynb @@ -0,0 +1,219 @@ +{ + "metadata": { + "name": "", + "signature": "sha256:10bc56ed65806cbbee507a717cc3074e0bb64182283ec8c23086b1c40de0014f" + }, + "nbformat": 3, + "nbformat_minor": 0, + "worksheets": [ + { + "cells": [ + { + "cell_type": "heading", + "level": 1, + "metadata": {}, + "source": [ + "Chapter 8: Photonic Devices" + ] + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 8.1 Page no 293" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#given data \n", + "NA=10**22 #in atoms/m**3\n", + "ND=10**22 #in atoms/m**3\n", + "De=25*10**-4 \t#in m**2/s\n", + "Dh=10**-3\t\t#in m**2/s\n", + "TAUeo=500\t\t#in ns\n", + "TAUho=100\t\t#in ns\n", + "ni=1.5*10**16\t\t#in atoms/m**3\n", + "VR=-10\t\t\t#in Volt\n", + "epsilon=11.6*8.854*10**-12\t#in F/m\n", + "e=1.6*10**-19\t\t\t#in Coulamb\n", + "VT=26\t\t\t\t#in mV\n", + "GL=10**27\t\t\t#in m**-3 s**-1\n", + "\n", + "\n", + "#calculation\n", + "import math\n", + "Le=math.sqrt(De*TAUeo*10**-9)\t#in um\n", + "Le=Le*10**6\t\t\t#in um\n", + "Lh=math.sqrt(Dh*TAUho*10**-9)\t#in um\n", + "Lh=Lh*10**6\t\t\t#in um\n", + "Vbi=VT*10**-3*math.log(NA*ND/ni**2)\t#in Volt\n", + "Vo=Vbi\t\t\t\t#in Volt\n", + "VB=Vo-VR\t\t\t#in Volt\n", + "W=math.sqrt((2*epsilon*VB/e)*(1/NA+1/ND))\t#in um\n", + "W=W*10**6\t\t\t#in um\n", + "JL=e*(W+Le+Lh)*10**-6*GL\t#in A/cm**2\n", + "\n", + "#Result\n", + "print \"Steady state photocurrent density is \",round(JL/10**4,3),\"A/cm**2\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Steady state photocurrent density is 0.726 A/cm**2\n" + ] + } + ], + "prompt_number": 3 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 8.2 Page no 295" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "import math\n", + "W=25\t\t\t#in um\n", + "PhotonFlux=10**21\t#in m**2s**-1\n", + "alfa=10**5\t\t#in m**-1\n", + "e=1.6*10**-19\t\t#in Coulambs\n", + "\n", + "#calculation\n", + "GL1=alfa*PhotonFlux\t#in m**-3s**-1\n", + "GL2=alfa*PhotonFlux*math.exp(-alfa*W*10**-6)\t#in m**-3s**-1\n", + "JL=e*PhotonFlux*(1-math.exp(-alfa*W*10**-6))\t#in mA/cm**2\n", + "\n", + "#Result\n", + "print\"Steady state photocurrent density is \",round(JL/10,2),\"mA/cm**2\"" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Steady state photocurrent density is 14.69 mA/cm**2\n" + ] + } + ], + "prompt_number": 5 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 8.3 Page no 304" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "NA=7.5*10**24\t\t#in atoms/m**3\n", + "ND=1.5*10**22\t\t#in atoms/m**3\n", + "De=25.0*10**-4\t\t#in m**2/s\n", + "Dh=10.0**-3\t\t#in m**2/s\n", + "TAUeo=500.0\t\t#in ns\n", + "TAUho=100.0\t\t#in ns\n", + "ni=1.5*10**16\t\t#in atoms/m**3\n", + "VR=-10.0\t\t\t#in Volt\n", + "epsilon=11.6*8.854*10**-12\t#in F/m\n", + "e=1.6*10**-19\t\t#in Coulamb\n", + "VT=26.0\t\t\t#in mV\n", + "GL=10.0**27\t\t#in m**-3 s**-1\n", + "\n", + "#Calculation\n", + "import math\n", + "Le=math.sqrt(De*TAUeo*10**-9)\t#in m\n", + "Le=Le*10**6\t\t\t#in um\n", + "Lh=math.sqrt(Dh*TAUho*10**-9)\t#in m\n", + "Lh=Lh*10**6\t\t\t#in um\n", + "JS=e*(ni**2)*(De/(Le*10**-6*NA)+Dh/(Lh*10**-6*ND))\t#in A/cm**2\n", + "JL=12.5\t\t\t\t#in mA/cm**2\n", + "VOC=VT*math.log(1.0+((JL*10**-3)/(JS*10**-4)))\t\t#in Volt\n", + "\n", + "#Result\n", + "print\"Open circuit voltage is\",round(VOC/1000,3),\"V\"\n" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Open circuit voltage is 0.522 V\n" + ] + } + ], + "prompt_number": 15 + }, + { + "cell_type": "heading", + "level": 3, + "metadata": {}, + "source": [ + "Example 8.4 Page no 304" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "Vout=28\t\t\t#in Volts\n", + "Vcell=0.45\t\t#in Volt\n", + "n=Vout/Vcell\t\t#Unitless\n", + "Iout=1\t\t\t#in A\n", + "Icell=50\t\t#in mA\n", + "\n", + "#Calculation\n", + "m=Iout/(Icell*10**-3)\t#unitless\n", + "\n", + "#Result\n", + "print\"The total no. of cells required : \",round(m*n)\n", + "#Note : Answer in the book is wrong." + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "The total no. of cells required : 1244.0\n" + ] + } + ], + "prompt_number": 9 + }, + { + "cell_type": "code", + "collapsed": false, + "input": [], + "language": "python", + "metadata": {}, + "outputs": [] + } + ], + "metadata": {} + } + ] +}
\ No newline at end of file diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/README.txt b/Fundamental_of_Electronics_Devices_by_JB_Gupta/README.txt new file mode 100755 index 00000000..da7bc292 --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/README.txt @@ -0,0 +1,10 @@ +Contributed By: Rahul Garg +Course: btech +College/Institute/Organization: Gurgaon College of Engineering, MDU Rohtak +Department/Designation: Electronics Engineering +Book Title: Fundamental of Electronics Devices +Author: JB Gupta +Publisher: Katariya & Sons, New Delhi +Year of publication: 2010 +Isbn: 9380027745, 9789380027746 +Edition: 2
\ No newline at end of file diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/energybands.png b/Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/energybands.png Binary files differnew file mode 100755 index 00000000..26f3a730 --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/energybands.png diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/steadystatephoto.png b/Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/steadystatephoto.png Binary files differnew file mode 100755 index 00000000..5f0c6810 --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/steadystatephoto.png diff --git a/Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/transfercharateristics.png b/Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/transfercharateristics.png Binary files differnew file mode 100755 index 00000000..85c6b507 --- /dev/null +++ b/Fundamental_of_Electronics_Devices_by_JB_Gupta/screenshots/transfercharateristics.png |