diff options
author | Trupti Kini | 2016-01-11 23:30:05 +0600 |
---|---|---|
committer | Trupti Kini | 2016-01-11 23:30:05 +0600 |
commit | 71ecf09ac6c64cf1e9e5e4e39ce9b911acfe7d19 (patch) | |
tree | 4067b5e10abd24dab97a70d021b3cf372c373967 /Microwave_Engineering_by_G._S._Raghuvanshi/Ch4.ipynb | |
parent | 095af558738161c3d7dac4307dd97a4a3c0c0811 (diff) | |
download | Python-Textbook-Companions-71ecf09ac6c64cf1e9e5e4e39ce9b911acfe7d19.tar.gz Python-Textbook-Companions-71ecf09ac6c64cf1e9e5e4e39ce9b911acfe7d19.tar.bz2 Python-Textbook-Companions-71ecf09ac6c64cf1e9e5e4e39ce9b911acfe7d19.zip |
Added(A)/Deleted(D) following books
A Engineering_Mechanics_of_Solids_by_Popov_E_P/Chapter1.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/chapter10.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/chapter11.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/chapter12.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/chapter2.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/chapter4.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/chapter5.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/chapter6.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/chapter7.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/chapter8.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/chapter9.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/charpter_3.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/charpter_3_1.ipynb
A Engineering_Mechanics_of_Solids_by_Popov_E_P/screenshots/Untitled.png
A Engineering_Mechanics_of_Solids_by_Popov_E_P/screenshots/cap2.png
A Engineering_Mechanics_of_Solids_by_Popov_E_P/screenshots/cap3.png
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch1.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch10.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch11.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch12.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch2.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch3.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch4.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch5.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch6.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch7.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch8.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/Ch9.ipynb
A Microwave_Engineering_by_G._S._Raghuvanshi/screenshots/12refCoeff.png
A Microwave_Engineering_by_G._S._Raghuvanshi/screenshots/1RefCoeff.png
A Microwave_Engineering_by_G._S._Raghuvanshi/screenshots/6axialPhasVel.png
Diffstat (limited to 'Microwave_Engineering_by_G._S._Raghuvanshi/Ch4.ipynb')
-rw-r--r-- | Microwave_Engineering_by_G._S._Raghuvanshi/Ch4.ipynb | 1069 |
1 files changed, 1069 insertions, 0 deletions
diff --git a/Microwave_Engineering_by_G._S._Raghuvanshi/Ch4.ipynb b/Microwave_Engineering_by_G._S._Raghuvanshi/Ch4.ipynb new file mode 100644 index 00000000..080d6f6c --- /dev/null +++ b/Microwave_Engineering_by_G._S._Raghuvanshi/Ch4.ipynb @@ -0,0 +1,1069 @@ +{ + "metadata": { + "name": "", + "signature": "sha256:ffa36c37285243e82f8b7c3abbc469b9a273b2bd68fa586a9dc529ef122af349" + }, + "nbformat": 3, + "nbformat_minor": 0, + "worksheets": [ + { + "cells": [ + { + "cell_type": "heading", + "level": 1, + "metadata": {}, + "source": [ + "Ch-4: Microwave resonators & Waveguide components" + ] + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 193 Example 4.1" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + "from __future__ import division\n", + "from math import sqrt \n", + "#Given\n", + "a=5 #cm\n", + "a1=a/100 #m\n", + "b=2 #cm\n", + "b1=b/100 #m\n", + "c=15 #cm\n", + "c1=c/100 #m\n", + "\n", + "#(i) Air filled cavity\n", + "m=1 \n", + "n=0 \n", + "p=1 \n", + "c=3e8 #for air\n", + "fr=(1/2)*c*sqrt((m/a1)**2+(n/b1)**2+(p/c1)**2) #hz\n", + "print 'Resonant frequency for an air filled cavity: %0.3f'%(fr/10**9),'Ghz'\n", + "\n", + "#(ii) Dielctric filled cavity\n", + "er=2.56 \n", + "fr1=(1/2)*(c/sqrt(er))*sqrt((m/a1)**2+(n/b1)**2+(p/c1)**2) #hz\n", + "print 'Resonant frequency for dielectric cavity: %0.3f'%(fr1/10**9),'Ghz'" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Resonant frequency for an air filled cavity: 3.162 Ghz\n", + "Resonant frequency for dielectric cavity: 1.976 Ghz\n" + ] + } + ], + "prompt_number": 30 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 193 Example 4.2" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "a=0.38 #cm\n", + "a1=a/100 #m\n", + "b=0.76 #cm\n", + "b1=b/100 #m\n", + "f=50e9 \n", + "c=3e8 \n", + "\n", + "#Length for TE102\n", + "m=1 \n", + "n=0 \n", + "p=2 \n", + "l=1/sqrt((f/c)**2-(1/(4*b1**2))) #m\n", + "print 'Length c: %0.3f'%(l*100),'cm'" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Length c: 0.653 cm\n" + ] + } + ], + "prompt_number": 31 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 194 Example 4.3" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + "from math import pi \n", + "#Given\n", + "c=3e8 #m/s\n", + "a=2.286 #cm\n", + "a1=a/100 #m\n", + "b=1.024 #cm\n", + "b1=b/100 #m\n", + "f=10e9 #hz\n", + "sig=6e7 \n", + "u=4e-7*pi \n", + "w=2*pi*f \n", + "eet=377 \n", + "\n", + "#Shortest cavity length\n", + "lamc=2*a1 #m\n", + "fc=c/lamc #hz\n", + "lam=c/f #m\n", + "lamg=lam/sqrt(1-(fc/f)**2) #m\n", + "sc=lamg/2 #m\n", + "print 'Shortest cavity length: %0.3f'%(sc*100), 'cm'\n", + "\n", + "#Qw of the resonator operating in TE101 mode\n", + "rs=sqrt((w*u)/(2*sig)) #ohm\n", + "lamr=c/f \n", + "x=(((a1*b1)/(sc**2))+((sc**2+a1**2)/(2*sc*a1))+(b1*sc/a1**2)) \n", + "qw=(2*pi*eet*a1*b1*sc)/(rs*(lamr**3)*x) \n", + "print 'Qw of the resonator operating in TE101 mode %0.3f'%qw" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Shortest cavity length: 1.988 cm\n", + "Qw of the resonator operating in TE101 mode 7990.324\n" + ] + } + ], + "prompt_number": 32 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 195 Example 4.4" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "c=3e8 #m/s\n", + "a=4.8 #cm\n", + "a1=a/100 #m\n", + "b=2.2 #cm\n", + "b1=b/100 #m\n", + "f=5e9 #hz\n", + "er=2.25 \n", + "tandel=4e-4 \n", + "sig=5.813e7 \n", + "oneby=3e8 \n", + "u=4e-7*pi \n", + "w=2*pi*f \n", + "eet=377 \n", + "\n", + "#Length at p=1\n", + "m=1 \n", + "n=0 \n", + "p=1 \n", + "z=(f*2*sqrt(er))/c \n", + "cp1=p/sqrt((z**2)-((m/a1)**2)-((n/b1)**2)) \n", + "print 'Length of resonator at p=1: %0.3f'%(cp1*100), 'cm'\n", + "\n", + "#At p=2\n", + "cp2=cp1*2 \n", + "print 'Length of resonator at p=2: %0.3f'%(cp2*100), 'cm'\n", + "\n", + "#Qw\n", + "rs=sqrt((w*u)/(2*sig)) #ohm\n", + "lamr=c/(f*sqrt(er)) \n", + "x=(((a1*b1)/(cp1**2))+((cp1**2+a1**2)/(2*cp1*a1))+(b1*cp1/a1**2)) \n", + "qw=(2*pi*(eet/sqrt(er))*a1*b1*cp1)/(rs*(lamr**3)*x) \n", + "qd=1/tandel \n", + "q=(qw*qd)/(qw+qd) \n", + "print 'Q for TE101 mode: %0.3f'%q" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Length of resonator at p=1: 2.200 cm\n", + "Length of resonator at p=2: 4.400 cm\n", + "Q for TE101 mode: 1925.612\n" + ] + } + ], + "prompt_number": 33 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 196 Example 4.5" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "c=3e8 #m/s\n", + "a=2 #cm\n", + "a1=a/100 #m\n", + "b=2.5 #cm\n", + "b1=b/100 #m\n", + "\n", + "print 'TE modes' \n", + "h01=3.832 \n", + "fr=(c/(2*pi))*sqrt((h01/a1)**2+(pi/b1)**2) #hz\n", + "print 'Resonant frequency for mode TE010: %0.3f'%(fr/10**9),'Ghz'\n", + "\n", + "h11=1.841 \n", + "fr1=(c/(2*pi))*sqrt((h11/a1)**2+(pi/b1)**2) #hz\n", + "print 'Resonant frequency for mode TE111: %0.3f'%(fr1/10**9),'Ghz'\n", + "\n", + "h21=3.054 \n", + "fr2=(c/(2*pi))*sqrt((h21/a1)**2+(pi/b1)**2) #hz\n", + "print 'Resonant frequency for mode TE211: %0.3f'%(fr2/10**9),'Ghz'\n", + "\n", + "print 'TM modes:' \n", + "l1=0 \n", + "h011=2.405 \n", + "fr3=(c/(2*pi))*sqrt((h011/a1)**2+(pi*l1/b1)**2) #hz\n", + "print 'Resonant frequency for mode TM010 %0.3f'%(fr3/10**9),'Ghz'\n", + "\n", + "l2=1 \n", + "fr4=(c/(2*pi))*sqrt((h011/a1)**2+(pi*l2/b1)**2) #hz\n", + "print 'resonant frequency for mode TM011: %0.3f'%(fr4/10**9),'Ghz'\n", + "\n", + "l3=1 \n", + "h111=3.832 \n", + "fr5=(c/(2*pi))*sqrt((h111/a1)**2+(pi*l3/b1)**2) #hz\n", + "print 'Resonant frequency for mode TM111: %0.3f'%(fr5/10**9),'Ghz'" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "TE modes\n", + "Resonant frequency for mode TE010: 10.940 Ghz\n", + "Resonant frequency for mode TE111: 7.438 Ghz\n", + "Resonant frequency for mode TE211: 9.442 Ghz\n", + "TM modes:\n", + "Resonant frequency for mode TM010 5.742 Ghz\n", + "resonant frequency for mode TM011: 8.305 Ghz\n", + "Resonant frequency for mode TM111: 10.940 Ghz\n" + ] + } + ], + "prompt_number": 34 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 196 Example 4.6" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "QTM010=1.202 \n", + "QTE101=1.11 \n", + "\n", + "r=QTM010/QTE101 \n", + "print 'Ratio of Qs of cylindrical and rectangular resonators: %0.3f'%r" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Ratio of Qs of cylindrical and rectangular resonators: 1.083\n" + ] + } + ], + "prompt_number": 35 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 197 Example 4.7" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + "#Given\n", + "f=7.07e9 #hz\n", + "a=3 #cm\n", + "a1=a/100 #m\n", + "sig=5.8e7 \n", + "er=2.25 \n", + "tandel=4e-4 \n", + "ur=1 \n", + "n=377 \n", + "w=2*pi*f \n", + "u=4e-7*pi \n", + "\n", + "#Q of resonantor\n", + "rs=sqrt(w*u/(2*sig)) #ohm\n", + "qw=(0.7419*n)/(rs*sqrt(2.25)) \n", + "qd=1/tandel \n", + "q=(qw*qd)/(qw+qd) \n", + "print 'Q of resonator: %0.3f'%q" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Q of resonator: 1931.819\n" + ] + } + ], + "prompt_number": 36 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 198 Example 4.8" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "a=5 #cm\n", + "a1=a/100 #m\n", + "b=4 #cm\n", + "b1=b/100 #m\n", + "c=10 #cm\n", + "c1=c/100 #m\n", + "sig=5.8e7 \n", + "u0=4e-7*pi \n", + "er=3 \n", + "eet=377 \n", + "\n", + "ur=1 \n", + "spl=3e8 \n", + "tandel=2.5e-4 \n", + "\n", + "#TE101 mode\n", + "m=1 \n", + "n=0 \n", + "p=1 \n", + "fr=(spl/(2*sqrt(er*ur)))*sqrt((m/a1)**2+(n/b1)**2+(p/c1)**2) #hz\n", + "print 'Resonant frequency: %0.3f'%(fr/10**9), 'Ghz'\n", + "\n", + "w=2*pi*fr \n", + "rs=sqrt((w*u0)/(2*sig)) #ohm\n", + "lamr=spl/(fr*sqrt(er)) \n", + "x=(((a1*b1)/(c1**2))+((c1**2+a1**2)/(2*c1*a1))+((b1*c1)/a1**2)) \n", + "qw=(2*pi*(eet/sqrt(er))*a1*b1*c1)/(rs*(lamr**3)*x) \n", + "print 'Q for TE101 mode: %0.3f'%qw\n", + "\n", + "qd=1/tandel \n", + "q=(qw*qd)/(qw+qd) \n", + "print 'Q for lossy dielectric: %0.3f'%q\n", + "\n", + "#Value of qw is calculated wrong in book as lamr comes to be 0.08 not 0.89 m" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Resonant frequency: 1.936 Ghz\n", + "Q for TE101 mode: 10916.466\n", + "Q for lossy dielectric: 2927.360\n" + ] + } + ], + "prompt_number": 40 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 198 Example 4.9" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "c=3e8 #m/s\n", + "a=2.286 #cm\n", + "a1=a/100 #m\n", + "b=1.106 #cm\n", + "b1=b/100 #m\n", + "\n", + "#For fr1=9.3e9 \n", + "fr1=9.3e9 #hz\n", + "lamr1=c/fr1 #m\n", + "c1=(2*a1)/sqrt((((2*a1)/lamr1)**2)-1) \n", + "\n", + "#For fr2=10.2e9 \n", + "fr2=10.2e9 #hz\n", + "lamr2=c/fr2 #m\n", + "c2=(2*a1)/sqrt((((2*a1)/lamr2)**2)-1) \n", + "\n", + "r=c1-c2 \n", + "print 'Range of piston movement: %0.3f'%(r*100), 'cm'" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Range of piston movement: 0.710 cm\n" + ] + } + ], + "prompt_number": 41 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 199 Example 4.10" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "a=3 #cm\n", + "a1=a/100 #m\n", + "d=10 #cm\n", + "d1=d/100 #m\n", + "df=2.5e6 \n", + "er=2.25 \n", + "p11=1.841 \n", + "c=3e8 #m/s\n", + "\n", + "#Resonant frequency\n", + "fr=(c/2)*(sqrt((p11/a1)**2+(pi/d1)**2)) #hz\n", + "print 'Resonant frequency: %0.3f'%(fr/10**9),'Ghz'\n", + "\n", + "#Q without dielectric\n", + "q0=fr/df \n", + "print 'Q wirhout dielectric constant: %0.3f'%q0\n", + "\n", + "# Q with dielectric\n", + "fr1=fr/sqrt(er) \n", + "qd=1e3 \n", + "q=(q0*qd)/(q0+qd) \n", + "print 'Q with dielectric constant: %0.3f'%q" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Resonant frequency: 10.341 Ghz\n", + "Q wirhout dielectric constant: 4136.446\n", + "Q with dielectric constant: 805.313\n" + ] + } + ], + "prompt_number": 44 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 200 Example 4.11" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "f=9.375e9 #hz\n", + "sig=5.8e7 \n", + "eet=377 \n", + "c=3e8 #m/s\n", + "w=2*pi*f \n", + "r=1.5 \n", + "u=4e-7*pi \n", + "\n", + "#Radius\n", + "a=c/(f*2.62) #m\n", + "print 'Radius of resonantor %0.3f'%(a*100), 'cm'\n", + "\n", + "#O\n", + "rs=sqrt((w*u)/(2*sig)) #ohm\n", + "x=1.202*eet \n", + "y=rs*(1+(1/r)) \n", + "q=x/y \n", + "print 'Q of the resonator: %0.3f'%q\n", + "\n", + "#Answer for Q is calculated as 10875 in book but it is 10763.303" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Radius of resonantor 1.221 cm\n", + "Q of the resonator: 10763.303\n" + ] + } + ], + "prompt_number": 45 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 215 Example 4.12" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "f=5e9 #hz\n", + "sig=5.813e7 \n", + "er=2.25 \n", + "tandel=4e-4 \n", + "c=3e8 #m/s\n", + "h01=3.832 \n", + "u=4e-7*pi \n", + "\n", + "#Length of resonator\n", + "lamr=c/(f*sqrt(er)) \n", + "d=sqrt((((((2*3.832)**2)+(pi*pi))*(lamr*lamr))/(2*2*pi*pi)) )\n", + "print 'Length of resonator: %0.3f'%(d*100),'cm'\n", + "\n", + "#Q of resonator\n", + "n=(120*pi)/sqrt(er) \n", + "Rs=sqrt((f*u)/sig) \n", + "a=d/2 \n", + "Qw1=n*(((h01/a)**2+(pi/d)**2)**(3/2))\n", + "Qw2=2*Rs*(((h01*h01)/(a*a*a))+((2*pi*pi)/(d*d*d))) \n", + "Qw=Qw1/Qw2 \n", + "Qd=1/tandel \n", + "Q=(Qw*Qd)/(Qw+Qd) \n", + "print 'Q of resonator: %0.3f'%Q\n", + "\n", + "#Value of Qw is calculated wrong in the book, it should be 50057.91 instead of 53473.8\n", + "#Hence the value of Q also differs" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Length of resonator: 5.273 cm\n", + "Q of resonator: 2381.084\n" + ] + } + ], + "prompt_number": 46 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 215 Example 4.13" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + "#Given\n", + "p=100 #mW\n", + "#As 2 and 3 are matched terminals\n", + "x=1/2 \n", + "y=1/sqrt(2) \n", + "s=[x,-x, y, -x, 0, y, y, y, 0] \n", + "\n", + "#Power delivered\n", + "#Port 1\n", + "p1=p*(1-s[1]**2) \n", + "print 'Power at port 1:',p1, 'mW'\n", + "\n", + "#Port2\n", + "p2=p*s[2]**2 \n", + "print 'Power at port 2:',p2, 'mW'\n", + "\n", + "#Port 3\n", + "p3=p*s[3]**2 \n", + "print 'Power at port 3:' ,p3,'mW'" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Power at port 1: 75.0 mW\n", + "Power at port 2: 50.0 mW\n", + "Power at port 3: 25.0 mW\n" + ] + } + ], + "prompt_number": 14 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 216 Example 4.14" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "p=40 #mW\n", + "#Since port 3 is matched\n", + "x=sqrt(2) \n", + "s=[1, 1, x, 1, 1, -x, x, -x, 0] \n", + "r1=40 #ohm\n", + "r2=60 #ohm\n", + "w=50 #ohm\n", + "\n", + "#Reflection coefficients\n", + "T1=(w-r1)/(w+r1) \n", + "T2=(r2-w)/(r2+w) \n", + "\n", + "#As power is fed into 1 and 2 equally\n", + "pd=p/2 \n", + "\n", + "#Power delivered\n", + "#Port 1\n", + "p1=pd*(1-T1**2) \n", + "print 'Power at port 1: %0.3f'%p1,'mW'\n", + "\n", + "#Port2\n", + "p2=pd*(1-T2**2) \n", + "print 'Power at port 2: %0.3f'%p2,'mW'" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Power at port 1: 19.753 mW\n", + "Power at port 2: 19.835 mW\n" + ] + } + ], + "prompt_number": 48 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 216 Example 4.15" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + "from __future__ import division \n", + "#Given\n", + "T1=1/2 \n", + "T2=3/5 \n", + "T3=0 \n", + "T4=4/5 \n", + "p=500e-3 #W\n", + "#S matrix for magic Tee\n", + "x=1/sqrt(2) \n", + "s=[0, 0, x, x, 0, 0, x, -x, x ,x, 0, 0, x, -x, 0, 0] \n", + "#Using the input output relation\n", + "#[b]=[s]*[a]\n", + "b=[0.6565, 0.7576, 0.5536, 0.0892] \n", + "\n", + "#(i) Power transmitted through ports\n", + "#Port 1\n", + "p1=(1/2)*b[0]**2*(1-T1**2) \n", + "print 'Power at port 1: %0.3f'%p1,'W'\n", + "\n", + "#Port2\n", + "p2=(1/2)*(b[1]**2)*(1-(T2**2)) \n", + "print 'Power at port 2: %0.3f'%p2, 'W'\n", + "\n", + "#Port 4\n", + "p4=(1/2)*b[3]**2*(1-T4**2) \n", + "print 'Power at port 4: %0.3f'%p4,'W'\n", + "\n", + "#(ii) Power reflected at port 3\n", + "#Port 3\n", + "p3=p*b[2]**2 \n", + "print 'Power at port 3: %0.3f'%p3,'W'\n", + "\n", + "#(iii) Power absorbed\n", + "pabs=p-(p1+p2+p3+p4) \n", + "print 'Power absorbed: %0.3f'%pabs,'W'\n", + "\n", + "#Answer for power absorbed is calculated wrong in book" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Power at port 1: 0.162 W\n", + "Power at port 2: 0.184 W\n", + "Power at port 4: 0.001 W\n", + "Power at port 3: 0.153 W\n", + "Power absorbed: 0.000 W\n" + ] + } + ], + "prompt_number": 53 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 236 Example 4.18" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + "from numpy import mat, set_printoptions\n", + "#Given\n", + "C=10 #dB\n", + "D=30 #dB\n", + "\n", + "#Parameters\n", + "bet=10**(-C/20) \n", + "x=bet/(10**(D/20)) \n", + "a=sqrt(1-(bet*bet)) \n", + "#Scattering matrix\n", + "#Assuming symmetery\n", + "s=mat([[0, a ,x ,(bet*1J)],[ a, 0, (bet*1J), x],[ x ,(bet*1J), 0 ,a],[ (bet*1J) ,x ,a, 0] ])\n", + "set_printoptions(precision=3)\n", + "print 'Scattering matrix:\\n',s " + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Scattering matrix:\n", + "[[ 0.000+0.j 0.949+0.j 0.010+0.j 0.000+0.316j]\n", + " [ 0.949+0.j 0.000+0.j 0.000+0.316j 0.010+0.j ]\n", + " [ 0.010+0.j 0.000+0.316j 0.000+0.j 0.949+0.j ]\n", + " [ 0.000+0.316j 0.010+0.j 0.949+0.j 0.000+0.j ]]\n" + ] + } + ], + "prompt_number": 57 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 238 Example 4.20" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "vswr=2 \n", + "D1=8 #mW\n", + "D2=2 #mW\n", + "\n", + "#Reflection coefficient at arm 4\n", + "T=(vswr-1)/(vswr+1) \n", + "#Powwe delivered to D1\n", + "P=(D1*100)/(1-T**2) \n", + "P1=0.99*P \n", + "#Power reflected at D1\n", + "W1=(P/100)*T*T \n", + "#Power reflected at load\n", + "W2=D2-W1 \n", + "Tt=sqrt((W2*100)/(P1)) \n", + "pt=(1+Tt)/(1-Tt) \n", + "print 'VSWR:%0.3f'%pt\n", + "Pl=P1*(1-(Tt*Tt)) \n", + "print 'Power delivered:' ,Pl,'mW'\n", + "\n", + "#Answer for P1 should be 792 but it is given as 800" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "VSWR:2.008\n", + "Power delivered: 791.0 mW\n" + ] + } + ], + "prompt_number": 59 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 239 Example 4.21" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + "from numpy import mat, set_printoptions\n", + "#Given\n", + "I=30 #dB\n", + "Il=0.4 #dB\n", + "\n", + "S12=10**(I/-20) \n", + "S21=10**(Il/-20) \n", + "s=mat([[0, S12],[ S21, 0] ])\n", + "set_printoptions(precision=3)\n", + "print 'Scattering matrix:\\n' ,s" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Scattering matrix:\n", + "[[ 0. 0.032]\n", + " [ 0.955 0. ]]\n" + ] + } + ], + "prompt_number": 60 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 240 Example 4.22" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + "from numpy import mat, set_printoptions\n", + "#Given\n", + "I=30 #dB\n", + "Il=2 #dB\n", + "p=1.3 \n", + "\n", + "#Elelments\n", + "T=(p-1)/(p+1) \n", + "S11=T \n", + "S22=T \n", + "S33=T \n", + "S12=10**(-Il/20) \n", + "S13=10**(-I/20) \n", + "S21=S13 \n", + "S32=S13 \n", + "S23=S12 \n", + "S31=S23 \n", + "s=mat([[S11, S21, S31] ,[S12, S22, S32], [S13, S23 ,S33] ])\n", + "set_printoptions(precision=3)\n", + "print 'Scattering matrix:\\n' ,s" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Scattering matrix:\n", + "[[ 0.13 0.032 0.794]\n", + " [ 0.794 0.13 0.032]\n", + " [ 0.032 0.794 0.13 ]]\n" + ] + } + ], + "prompt_number": 61 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 249 Example 4.23" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + " \n", + "#Given\n", + "f=10e9 #Hz\n", + "u=4e-7*pi \n", + "c=3e8 #m/s\n", + "a=2.29 #cm\n", + "a1=a/100 \n", + "b=1.02 #cm\n", + "b1=b/100 \n", + "\n", + "#E/H\n", + "w=2*pi*f \n", + "EbyH=(w*u)/sqrt(((w/c)**2)+((pi/a1)**2)) \n", + "lam=c/f \n", + "lamc=2*a1 \n", + "d=(1/4)*(lam/sqrt(1-((lam/lamc)**2))) \n", + "print 'Position: %0.3f'%(d*100), 'cm'\n", + "\n", + "#Answer for positon is calculated wrong in book" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Position: 0.993 cm\n" + ] + } + ], + "prompt_number": 62 + }, + { + "cell_type": "heading", + "level": 2, + "metadata": {}, + "source": [ + "Page Number: 250 Example 4.24" + ] + }, + { + "cell_type": "code", + "collapsed": false, + "input": [ + "from numpy import mat, set_printoptions\n", + "#Given\n", + "#As it is perfectly matched\n", + "S12=1/sqrt(2) \n", + "S21=S12 \n", + "s=mat([[0 ,S12] ,[S21, 0] ])\n", + "set_printoptions(precision=3)\n", + "print 'Scattering matrix:\\n' , s" + ], + "language": "python", + "metadata": {}, + "outputs": [ + { + "output_type": "stream", + "stream": "stdout", + "text": [ + "Scattering matrix:\n", + "[[ 0. 0.707]\n", + " [ 0.707 0. ]]\n" + ] + } + ], + "prompt_number": 65 + } + ], + "metadata": {} + } + ] +}
\ No newline at end of file |