diff options
| author | Sashi20 | 2021-07-16 00:20:12 +0550 |
|---|---|---|
| committer | Sashi20 | 2021-07-16 00:20:12 +0550 |
| commit | cddf1f4952e59e0b390770acad5ea0e78fccff85 (patch) | |
| tree | 2a83aaf2ae0c2087a560cff354feed6d40851a09 | |
| parent | da58f2890abb13c0fa75a9908804c01193adb217 (diff) | |
| download | DWSIM-Flowsheets-cddf1f4952e59e0b390770acad5ea0e78fccff85.tar.gz DWSIM-Flowsheets-cddf1f4952e59e0b390770acad5ea0e78fccff85.tar.bz2 DWSIM-Flowsheets-cddf1f4952e59e0b390770acad5ea0e78fccff85.zip | |
Added(A)/Deleted(D) following Flowsheet file
A Chloroform_Recovery_Process_Simulation_Based_On_Double-Effect_Distillation_Design_By_Mr_K._John_Steven_Wesley/user_defined_compound/Methacrolein.json
A Mono_Ethylene_Glycol_From_Hydration_Of_Ethylene_Oxide_By_Ms_Yutika_Naik/Abstract.pdf
A Mono_Ethylene_Glycol_From_Hydration_Of_Ethylene_Oxide_By_Ms_Yutika_Naik/Flowsheet.dwxmz
A Pressure-Swing_Reactive_Distillation_Method_For_Production_Of_N-Propyl_Acetate_By_Ms_Chandni/Abstract.pdf
A Pressure-Swing_Reactive_Distillation_Method_For_Production_Of_N-Propyl_Acetate_By_Ms_Chandni/Flowsheet.dwxmz
A Process_For_The_Production_Of_Methyl_Methacrylate_Via_Direct_Methylation_By_Ms_Shivani_Sutrave/user_defined_compound/methacrolein.dwcsd2
A Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/ABSTRACT_DWSIM.pdf
D Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/Abstract.pdf
A Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/FLOWSHEET_DWSIM.dwxmz
D Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/Finalflowchart.dwxmz
A Production_Of_Phthalic_Anhydride_From_O-Xylene_By_Ms_Yekkaluri_Snehasree_Reddy/user_defined_compound/PhthalicAnhydride.json
A Triple_Column_Pressure_Swing_Distillation_Of_Ternary_Azeotropic_Mixture_Of_Iso-Propanol,_Mek_And_Ethanol_Using_Partial_Heat_Integration_Method_By_Mr_Vineet_Kumar_Kundu/TCPSD_Abstract.pdf
A Triple_Column_Pressure_Swing_Distillation_Of_Ternary_Azeotropic_Mixture_Of_Iso-Propanol,_Mek_And_Ethanol_Using_Partial_Heat_Integration_Method_By_Mr_Vineet_Kumar_Kundu/TCPSD_Flowsheet.dwxmz
13 files changed, 9040 insertions, 0 deletions
diff --git a/Chloroform_Recovery_Process_Simulation_Based_On_Double-Effect_Distillation_Design_By_Mr_K._John_Steven_Wesley/user_defined_compound/Methacrolein.json b/Chloroform_Recovery_Process_Simulation_Based_On_Double-Effect_Distillation_Design_By_Mr_K._John_Steven_Wesley/user_defined_compound/Methacrolein.json new file mode 100644 index 0000000..5871c8d --- /dev/null +++ b/Chloroform_Recovery_Process_Simulation_Based_On_Double-Effect_Distillation_Design_By_Mr_K._John_Steven_Wesley/user_defined_compound/Methacrolein.json @@ -0,0 +1,8524 @@ +{ + "Record": { + "RecordType": "CID", + "RecordNumber": 6562, + "RecordTitle": "Methacrolein", + "Section": [ + { + "TOCHeading": "Structures", + "Description": "Structure depictions and information for 2D, 3D, and crystal related", + "Section": [ + { + "TOCHeading": "2D Structure", + "Description": "A two-dimensional representation of the compound", + "DisplayControls": { + "MoveToTop": true + }, + "Information": [ + { + "ReferenceNumber": 54, + "Value": { + "Boolean": [ + true + ] + } + } + ] + }, + { + "TOCHeading": "3D Conformer", + "Description": "A three-dimensional representation of the compound. The 3D structure is not experimentally determined, but computed by PubChem. More detailed information on this conformer model is described in the PubChem3D thematic series published in the Journal of Cheminformatics.", + "DisplayControls": { + "MoveToTop": true + }, + "Information": [ + { + "ReferenceNumber": 54, + "Description": "Methacrolein", + "Value": { + "Number": [ + 6562 + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Chemical Safety", + "Description": "Launch the Laboratory Chemical Safety Summary datasheet, and link to the safety and hazard section", + "DisplayControls": { + "HideThisSection": true, + "MoveToTop": true + }, + "Information": [ + { + "ReferenceNumber": 54, + "Name": "Chemical Safety", + "Value": { + "StringWithMarkup": [ + { + "String": " ", + "Markup": [ + { + "Start": 0, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS02.svg", + "Type": "Icon", + "Extra": "Flammable" + }, + { + "Start": 1, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS05.svg", + "Type": "Icon", + "Extra": "Corrosive" + }, + { + "Start": 2, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS06.svg", + "Type": "Icon", + "Extra": "Acute Toxic" + }, + { + "Start": 3, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS08.svg", + "Type": "Icon", + "Extra": "Health Hazard" + }, + { + "Start": 4, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS09.svg", + "Type": "Icon", + "Extra": "Environmental Hazard" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Names and Identifiers", + "Description": "Record identifiers, synonyms, chemical names, descriptors, etc.", + "Section": [ + { + "TOCHeading": "Record Description", + "Description": "Summary Information", + "DisplayControls": { + "HideThisSection": true, + "MoveToTop": true + }, + "Information": [ + { + "ReferenceNumber": 1, + "Description": "Physical Description", + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrylaldehyde appears as a colorless liquid. Less dense than water. May be toxic by ingestion, inhalation and skin absorption. Severely irritating to skin and eyes. Used to make plastics.", + "Markup": [ + { + "Start": 0, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 65, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 4, + "Name": "Record Description", + "Description": "Ontology Summary", + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrolein is an enal." + } + ] + } + } + ] + }, + { + "TOCHeading": "Computed Descriptors", + "Description": "Descriptors generated from chemical structure input", + "Section": [ + { + "TOCHeading": "IUPAC Name", + "Description": "Chemical name computed from chemical structure that uses International Union of Pure and Applied Chemistry (IUPAC) nomenclature standards.", + "URL": "http://old.iupac.org/publications/books/seriestitles/nomenclature.html", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by LexiChem 2.6.6 (PubChem release 2019.06.18)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "2-methylprop-2-enal" + } + ] + } + } + ] + }, + { + "TOCHeading": "InChI", + "Description": "International Chemical Identifier (InChI) computed from chemical structure using the International Union of Pure and Applied Chemistry (IUPAC) standard.", + "URL": "http://www.iupac.org/home/publications/e-resources/inchi.html", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by InChI 1.0.5 (PubChem release 2019.06.18)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "InChI=1S/C4H6O/c1-4(2)3-5/h3H,1H2,2H3" + } + ] + } + } + ] + }, + { + "TOCHeading": "InChI Key", + "Description": "International Chemical Identifier hash (InChIKey) computed from chemical structure using the International Union of Pure and Applied Chemistry (IUPAC) standard.", + "URL": "http://www.iupac.org/home/publications/e-resources/inchi.html", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by InChI 1.0.5 (PubChem release 2019.06.18)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "STNJBCKSHOAVAJ-UHFFFAOYSA-N" + } + ] + } + } + ] + }, + { + "TOCHeading": "Canonical SMILES", + "Description": "Simplified Molecular-Input Line-Entry System (SMILES) computed from chemical structure devoid of isotopic and stereochemical information.", + "URL": "http://www.daylight.com/dayhtml/doc/theory/theory.smiles.html", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by OEChem 2.1.5 (PubChem release 2019.06.18)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "CC(=C)C=O" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Molecular Formula", + "Description": "A chemical formula is a way of expressing information about the proportions of atoms that constitute a particular chemical compound, using a single line of chemical element symbols and numbers. PubChem uses the Hill system whereby the number of carbon atoms in a molecule is indicated first, the number of hydrogen atoms second, and then the number of all other chemical elements in alphabetical order. When the formula contains no carbon, all the elements, including hydrogen, are listed alphabetically. Sources other than PubChem may include a variant of the formula that is more structural or natural to chemists, for example \"H2SO4\" for sulfuric acid, rather than the Hill version \"H2O4S.\"", + "DisplayControls": { + "MoveToTop": true + }, + "Information": [ + { + "ReferenceNumber": 1, + "Value": { + "StringWithMarkup": [ + { + "String": "C4H6O" + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "C4H6O" + }, + { + "String": "CH2=C(CH3)CHO" + } + ] + } + }, + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem 2.1 (PubChem release 2019.06.18)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "C4H6O" + } + ] + } + } + ] + }, + { + "TOCHeading": "Other Identifiers", + "Description": "Important identifiers assigned to this chemical substance by authoritative organizations", + "Section": [ + { + "TOCHeading": "CAS", + "Description": "A proprietary registry number assigned by the Chemical Abstracts Service (CAS) division of the American Chemical Society (ACS) often used to help describe chemical ingredients.", + "URL": "http://en.wikipedia.org/wiki/CAS_Registry_Number", + "Information": [ + { + "ReferenceNumber": 1, + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + }, + { + "ReferenceNumber": 2, + "URL": "https://commonchemistry.cas.org/detail?cas_rn=78-85-3", + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + }, + { + "ReferenceNumber": 5, + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + }, + { + "ReferenceNumber": 9, + "Name": "CAS", + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + }, + { + "ReferenceNumber": 10, + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + }, + { + "ReferenceNumber": 12, + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + }, + { + "ReferenceNumber": 13, + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + }, + { + "ReferenceNumber": 15, + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + }, + { + "ReferenceNumber": 50, + "Value": { + "StringWithMarkup": [ + { + "String": "78-85-3" + } + ] + } + } + ] + }, + { + "TOCHeading": "Related CAS", + "Description": "The CAS registry number(s) in this section refer(s) to related chemicals - like parents, other salt forms, etc.", + "Information": [ + { + "ReferenceNumber": 3, + "Reference": [ + "Compound: 2-Propenal, 2-methyl-, homopolymer" + ], + "URL": "https://commonchemistry.cas.org/detail?cas_rn=25120-30-3", + "Value": { + "StringWithMarkup": [ + { + "String": "25120-30-3" + } + ] + } + } + ] + }, + { + "TOCHeading": "European Community (EC) Number", + "Description": "A seven-digit regulatory identifier currently assigned by the European Chemicals Agency (ECHA) known as a European Community (EC) number. It is sometimes referred to as an EINECS, ELINCS, or NLP number, which are subsets of an EC number.", + "URL": "http://en.wikipedia.org/wiki/European_Community_number", + "Information": [ + { + "ReferenceNumber": 15, + "URL": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.046", + "Value": { + "StringWithMarkup": [ + { + "String": "201-150-1" + } + ] + } + } + ] + }, + { + "TOCHeading": "ICSC Number", + "Description": "An identifier assigned by the International Labour Organization (ILO) known as an International Chemical Safety Card number.", + "URL": "http://www.ilo.org/safework/info/publications/WCMS_113134/lang--en/index.htm", + "Information": [ + { + "ReferenceNumber": 19, + "URL": "https://www.ilo.org/dyn/icsc/showcard.display?p_card_id=1259", + "Value": { + "StringWithMarkup": [ + { + "String": "1259" + } + ] + } + } + ] + }, + { + "TOCHeading": "NSC Number", + "Description": "The NSC number is a numeric identifier for substances submitted to the National Cancer Institute (NCI) for testing and evaluation. It is a registration number for the Developmental Therapeutics Program (DTP) repository. NSC stands for National Service Center.", + "Information": [ + { + "ReferenceNumber": 9, + "Name": "NSC Number", + "URL": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8260", + "Value": { + "StringWithMarkup": [ + { + "String": "8260" + } + ] + } + } + ] + }, + { + "TOCHeading": "RTECS Number", + "Description": "An identifier of the Registry of Toxic Effects of Chemical Substances (RTECS) database of toxicity information.", + "URL": "http://www.cdc.gov/niosh/rtecs/", + "Information": [ + { + "ReferenceNumber": 50, + "URL": "https://www.cdc.gov/niosh-rtecs/OZ280DE8.html", + "Value": { + "StringWithMarkup": [ + { + "String": "OZ2625000" + } + ] + } + } + ] + }, + { + "TOCHeading": "UN Number", + "Description": "United Nations numbers (UN numbers) are four-digit numbers assigned by the United Nations Committee of Experts on the Transport of Dangerous Goods. They are used in international commerce and transportation to identify hazardous materials and articles (such as explosives, flammable liquids, oxidizers, toxic liquids, etc.). With a few exceptions, UN numbers are usually identical to DOT (Department of Transportation) IDs [also known as NA (North America) numbers], which are issued by the United States Department of Transportation. Therefore, UN numbers are also called DOT IDs and NA numbers. To learn information to each UN/NA number, refer to the Emergency Response Guidebook (https://www.phmsa.dot.gov/hazmat/erg/emergency-response-guidebook-erg).", + "URL": "https://pubchemdocs.ncbi.nlm.nih.gov/erg/", + "Information": [ + { + "ReferenceNumber": 1, + "URL": "https://www.phmsa.dot.gov/sites/phmsa.dot.gov/files/2020-08/ERG2020-WEB.pdf", + "Value": { + "StringWithMarkup": [ + { + "String": "2396" + } + ] + } + }, + { + "ReferenceNumber": 8, + "Name": "UN Number", + "URL": "https://www.phmsa.dot.gov/sites/phmsa.dot.gov/files/2020-08/ERG2020-WEB.pdf", + "Value": { + "StringWithMarkup": [ + { + "String": "2396" + } + ] + } + }, + { + "ReferenceNumber": 19, + "URL": "https://www.phmsa.dot.gov/sites/phmsa.dot.gov/files/2020-08/ERG2020-WEB.pdf", + "Value": { + "StringWithMarkup": [ + { + "String": "2396" + } + ] + } + }, + { + "ReferenceNumber": 27, + "Name": "UN Number", + "URL": "https://www.phmsa.dot.gov/sites/phmsa.dot.gov/files/2020-08/ERG2020-WEB.pdf", + "Value": { + "StringWithMarkup": [ + { + "String": "2396" + } + ] + } + } + ] + }, + { + "TOCHeading": "UNII", + "Description": "A non-proprietary registry number assigned by the U.S. Food and Drug Administration (FDA) known as an UNique Ingredient Identifier (UNII) code.", + "URL": "http://www.fda.gov/ForIndustry/DataStandards/SubstanceRegistrationSystem-UniqueIngredientIdentifierUNII/", + "Information": [ + { + "ReferenceNumber": 16, + "Name": "UNII", + "Value": { + "StringWithMarkup": [ + { + "String": "9HRB24892H" + } + ] + } + } + ] + }, + { + "TOCHeading": "DSSTox Substance ID", + "Description": "Substance identifier at the Distributed Structure-Searchable Toxicity (DSSTox) Database.", + "URL": "https://www.epa.gov/chemical-research/distributed-structure-searchable-toxicity-dsstox-database/", + "Information": [ + { + "ReferenceNumber": 13, + "URL": "https://comptox.epa.gov/dashboard/DTXSID0052540", + "Value": { + "StringWithMarkup": [ + { + "String": "DTXSID0052540" + } + ] + } + } + ] + }, + { + "TOCHeading": "Wikipedia", + "Description": "Links to Wikipedia or wikidata for this record.", + "Information": [ + { + "ReferenceNumber": 52, + "Name": "Wikipedia", + "URL": "https://en.wikipedia.org/wiki/Methacrolein", + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrolein" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Synonyms", + "Description": "Alternative names for this PubChem Compound record. A compound can have many different names. For example, acetone (CH3C(=O)CH3) is also known as propanone, propan-2-one, or dimethyl ketone. The brand name of a product is commonly used to indicate the primary chemical ingredient(s) in the product (e.g., Tylenol, a common pain killer, is often used for acetaminophen, its active ingredient). Another example of common synonyms is record identifiers used in different data collections, such as Chemical Abstract Service (CAS) registry numbers, FDA UNII (Unique Ingredient Identifiers), and many others. All these various names and identifiers that designate this compound are organized under the Synonyms section.", + "Section": [ + { + "TOCHeading": "MeSH Entry Terms", + "Description": "Medical Subject Heading (MeSH) names or identifiers matching this PubChem Compound record. The matching between the MeSH and compound records is performed by name matching (i.e., identical common names).", + "DisplayControls": { + "ListType": "Columns" + }, + "Information": [ + { + "ReferenceNumber": 55, + "Value": { + "StringWithMarkup": [ + { + "String": "2-methylacrolein" + }, + { + "String": "methacrolein" + }, + { + "String": "methacrylaldehyde" + } + ] + } + } + ] + }, + { + "TOCHeading": "Depositor-Supplied Synonyms", + "Description": "Chemical names provided by individual data contributors. Synonyms of Substances corresponding to a PubChem Compound record are combined. Some contributed names may be considered erroneous and filtered out. The link on each synonym shows which depositors provided that particular synonym for this structure.", + "DisplayControls": { + "ListType": "Columns", + "MoveToTop": true + }, + "Information": [ + { + "ReferenceNumber": 54, + "Value": { + "StringWithMarkup": [ + { + "String": "METHACROLEIN" + }, + { + "String": "Methacrylaldehyde" + }, + { + "String": "78-85-3" + }, + { + "String": "2-Propenal, 2-methyl-" + }, + { + "String": "2-Methyl-2-propenal" + }, + { + "String": "2-Methylacrolein" + }, + { + "String": "Isobutenal" + }, + { + "String": "2-Methylpropenal" + }, + { + "String": "2-Methylprop-2-enal" + }, + { + "String": "Methylacrylaldehyde" + }, + { + "String": "2-Methylenepropanal" + }, + { + "String": "Methacrylic aldehyde" + }, + { + "String": "Acrolein, 2-methyl-" + }, + { + "String": "Methakrylaldehyd" + }, + { + "String": "HSDB 182" + }, + { + "String": "NSC 8260" + }, + { + "String": "2-methyl-propenal" + }, + { + "String": "UNII-9HRB24892H" + }, + { + "String": ".alpha.-Methacrolein" + }, + { + "String": ".alpha.-Methylacrolein" + }, + { + "String": "9HRB24892H" + }, + { + "String": "MFCD00006974" + }, + { + "String": "alpha-Methylacrolein" + }, + { + "String": "Methacrolein, 90%, stabilized" + }, + { + "String": "Methakrylaldehyd [Czech]" + }, + { + "String": "2-Methylpropenal [Czech]" + }, + { + "String": "CCRIS 1153" + }, + { + "String": "EINECS 201-150-1" + }, + { + "String": "UN2396" + }, + { + "String": "BRN 1209258" + }, + { + "String": "methacroleine" + }, + { + "String": "Methacraldehyde" + }, + { + "String": "methyl propenal" + }, + { + "String": "AI3-37779" + }, + { + "String": "2-Methylacrylaldehyde" + }, + { + "String": "Methacrolein, 95%" + }, + { + "String": "2-Methylacrylaldehyde #" + }, + { + "String": "Methacrylaldehyde, inhibited" + }, + { + "String": "2-methylprop-2-en-1-one" + }, + { + "String": "CH2=C(CH3)CHO" + }, + { + "String": "WLN: VHY1&U1" + }, + { + "String": "4-01-00-03455 (Beilstein Handbook Reference)" + }, + { + "String": "UN 2396 (Salt/Mix)" + }, + { + "String": "CHEMBL4063095" + }, + { + "String": "DTXSID0052540" + }, + { + "String": "CHEBI:88384" + }, + { + "String": "NSC8260" + }, + { + "String": "Methacrolein (stabilized with HQ)" + }, + { + "String": "AMY28760" + }, + { + "String": "NSC-8260" + }, + { + "String": "ZINC1586526" + }, + { + "String": "7213AF" + }, + { + "String": "ANW-41500" + }, + { + "String": "AKOS000119839" + }, + { + "String": "FT-0628270" + }, + { + "String": "FT-0671115" + }, + { + "String": "M0078" + }, + { + "String": "Methacrolein, 90%, stabilized, AcroSeal(R)" + }, + { + "String": "A839511" + }, + { + "String": "Q420234" + }, + { + "String": "F2191-0163" + }, + { + "String": "Methacrylaldehyde, inhibited [UN2396] [Flammable liquid]" + } + ] + } + } + ] + }, + { + "TOCHeading": "Removed Synonyms", + "Description": "Potentially erroneous chemical names and identifiers provided by PubChem Substance records for the same chemical structure that were removed by name/structure consistency filtering.", + "DisplayControls": { + "HideThisSection": true + }, + "Information": [ + { + "ReferenceNumber": 54, + "Value": { + "StringWithMarkup": [ + { + "String": "methacrylaldehyd-" + }, + { + "String": "Methacrolein-13C" + }, + { + "String": "METHACROLEIN 5ML" + }, + { + "String": "2-propenal, 2-metil-" + }, + { + "String": "C4H6O" + }, + { + "String": "METHACROLEIN 25ML" + }, + { + "String": "AC1L1MT1" + }, + { + "String": "AC1Q1J4K" + }, + { + "String": "AC1Q1J4L" + }, + { + "String": "Methacrolein =96% stabilized" + }, + { + "String": "STNJBCKSHOAVAJ-UHFFFAOYSA-N" + }, + { + "String": "CTK2H7214" + }, + { + "String": "KS-00000WKB" + }, + { + "String": "C4-H6-O" + }, + { + "String": "CID6562" + }, + { + "String": "Methacrolein, 96%, stabilized 5ml" + }, + { + "String": "NA2396" + }, + { + "String": "RTR-025165" + }, + { + "String": "TRA0047987" + }, + { + "String": "AN-42123" + }, + { + "String": "LS-89902" + }, + { + "String": "TR-025165" + }, + { + "String": "NS00022801" + }, + { + "String": "C039175" + }, + { + "String": "I04-0409" + }, + { + "String": "InChI=1/C4H6O/c1-4(2)3-5/h3H,1H2,2H" + }, + { + "String": "Methacrylaldehyde, inhibited [UN2396] [Flammable liquid]" + }, + { + "String": "Methacrolein, 88%, stabilized with 0.1% HQ - 100ML 100ml" + }, + { + "String": "Methacrolein, 97.5%, stabilized with 0.1% HQ - 100ML 100ml" + }, + { + "String": "1119514-41-8" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Create Date", + "Description": "Date the compound record was initially added to PubChem", + "DisplayControls": { + "HideThisSection": true, + "MoveToTop": true + }, + "Information": [ + { + "ReferenceNumber": 54, + "Value": { + "DateISO8601": [ + "2005-03-26" + ] + } + } + ] + }, + { + "TOCHeading": "Modify Date", + "Description": "Date this record was last updated in PubChem", + "DisplayControls": { + "HideThisSection": true, + "MoveToTop": true + }, + "Information": [ + { + "ReferenceNumber": 54, + "Value": { + "DateISO8601": [ + "2021-07-10" + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Chemical and Physical Properties", + "Description": "Chemical and physical properties such as melting point, molecular weight, etc.", + "Section": [ + { + "TOCHeading": "Computed Properties", + "Description": "Properties computed automatically from the given chemical structure", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "Subsections", + "NumberOfColumns": 3, + "ColumnHeadings": [ + "Property Name", + "Property Value", + "Reference" + ], + "ColumnContents": [ + "Name", + "Value", + "Reference" + ] + } + }, + "Section": [ + { + "TOCHeading": "Molecular Weight", + "Description": "Molecular weight or molecular mass refers to the mass of a molecule. It is calculated as the sum of the mass of each constituent atom multiplied by the number of atoms of that element in the molecular formula.", + "DisplayControls": { + "MoveToTop": true + }, + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem 2.1 (PubChem release 2021.05.07)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "70.09" + } + ], + "Unit": "g/mol" + } + } + ] + }, + { + "TOCHeading": "XLogP3", + "Description": "Computed Octanol/Water Partition Coefficient", + "Information": [ + { + "ReferenceNumber": 54, + "Name": "XLogP3-AA", + "Reference": [ + "Computed by XLogP3 3.0 (PubChem release 2019.06.18)" + ], + "Value": { + "Number": [ + 0.7 + ] + } + } + ] + }, + { + "TOCHeading": "Hydrogen Bond Donor Count", + "Description": "The number of hydrogen bond donors in the structure.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by Cactvs 3.4.6.11 (PubChem release 2019.06.18)" + ], + "Value": { + "Number": [ + 0 + ] + } + } + ] + }, + { + "TOCHeading": "Hydrogen Bond Acceptor Count", + "Description": "The number of hydrogen bond acceptors in the structure.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by Cactvs 3.4.6.11 (PubChem release 2019.06.18)" + ], + "Value": { + "Number": [ + 1 + ] + } + } + ] + }, + { + "TOCHeading": "Rotatable Bond Count", + "Description": "A rotatable bond is defined as any single-order non-ring bond, where atoms on either side of the bond are in turn bound to nonterminal heavy (i.e., non-hydrogen) atoms. That is, where rotation around the bond axis changes the overall shape of the molecule, and generates conformers which can be distinguished by standard fast spectroscopic methods.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by Cactvs 3.4.6.11 (PubChem release 2019.06.18)" + ], + "Value": { + "Number": [ + 1 + ] + } + } + ] + }, + { + "TOCHeading": "Exact Mass", + "Description": "The exact mass of an isotopic species is obtained by summing the masses of the individual isotopes of the molecule.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem 2.1 (PubChem release 2021.05.07)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "70.041864811" + } + ], + "Unit": "g/mol" + } + } + ] + }, + { + "TOCHeading": "Monoisotopic Mass", + "Description": "The monoisotopic mass is the sum of the masses of the atoms in a molecule using the unbound, ground-state, rest mass of the principal (most abundant) isotope for each element instead of the isotopic average mass.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem 2.1 (PubChem release 2021.05.07)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "70.041864811" + } + ], + "Unit": "g/mol" + } + } + ] + }, + { + "TOCHeading": "Topological Polar Surface Area", + "Description": "The topological polar surface area (TPSA) of a molecule is defined as the surface sum over all polar atoms in a molecule.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by Cactvs 3.4.6.11 (PubChem release 2019.06.18)" + ], + "Value": { + "Number": [ + 17.1 + ], + "Unit": "Ų" + } + } + ] + }, + { + "TOCHeading": "Heavy Atom Count", + "Description": "A heavy atom is defined as any atom except hydrogen in a chemical structure.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem" + ], + "Value": { + "Number": [ + 5 + ] + } + } + ] + }, + { + "TOCHeading": "Formal Charge", + "Description": "Formal charge is the difference between the number of valence electrons of each atom and the number of electrons the atom is associated with. Formal charge assumes any shared electrons are equally shared between the two bonded atoms.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem" + ], + "Value": { + "Number": [ + 0 + ] + } + } + ] + }, + { + "TOCHeading": "Complexity", + "Description": "The complexity rating of a compound is a rough estimate of how complicated a structure is, seen from both the point of view of the elements contained and the displayed structural features including symmetry. This complexity rating is computed using the Bertz/Hendrickson/Ihlenfeldt formula.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by Cactvs 3.4.6.11 (PubChem release 2019.06.18)" + ], + "Value": { + "Number": [ + 54.7 + ] + } + } + ] + }, + { + "TOCHeading": "Isotope Atom Count", + "Description": "Isotope Atom Count is the number of isotopes that are not most abundant for the corresponding chemical elements. Isotopes are variants of a chemical element which differ in neutron number. For example, among three isotopes of carbon (i.e., C-12, C-13, and C-14), the isotope atom count considers the C-13 and C-14 atoms, because C-12 is the most abundant isotope of carbon.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem" + ], + "Value": { + "Number": [ + 0 + ] + } + } + ] + }, + { + "TOCHeading": "Defined Atom Stereocenter Count", + "Description": "An atom stereocenter, also known as a chiral center, is an atom that is attached to four different types of atoms (or groups of atoms) in the tetrahedral arrangement. It can have either (R)- or (S)- configurations. Some compounds, such as racemic mixtures, have an undefined atom stereocenter, whose (R/S)-configuration is not specifically defined.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem" + ], + "Value": { + "Number": [ + 0 + ] + } + } + ] + }, + { + "TOCHeading": "Undefined Atom Stereocenter Count", + "Description": "An atom stereocenter, also known as a chiral center, is an atom that is attached to four different types of atoms (or groups of atoms) in the tetrahedral arrangement. It can have either (R)- or (S)- configurations. Some compounds, such as racemic mixtures, have an undefined atom stereocenter, whose (R/S)-configuration is not specifically defined.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem" + ], + "Value": { + "Number": [ + 0 + ] + } + } + ] + }, + { + "TOCHeading": "Defined Bond Stereocenter Count", + "Description": "A bond stereocenter is a non-rotatable bond around which two atoms can have different arrangement (as in cis- and trans-forms of butene around its double bond). Some compounds have an undefined bond stereocenter, whose stereochemistry is not specifically defined.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem" + ], + "Value": { + "Number": [ + 0 + ] + } + } + ] + }, + { + "TOCHeading": "Undefined Bond Stereocenter Count", + "Description": "A bond stereocenter is a non-rotatable bond around which two atoms can have different arrangement (as in cis- and trans-forms of butene around its double bond). Some compounds have an undefined bond stereocenter, whose stereochemistry is not specifically defined.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem" + ], + "Value": { + "Number": [ + 0 + ] + } + } + ] + }, + { + "TOCHeading": "Covalently-Bonded Unit Count", + "Description": "The number of separate chemical structures not connected by covalent bonds.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem" + ], + "Value": { + "Number": [ + 1 + ] + } + } + ] + }, + { + "TOCHeading": "Compound Is Canonicalized", + "Description": "Whether the compound has successfully passed PubChem's valence bond canonicalization procedure. Some large, complex, or highly symmetric structures may fail this process.", + "Information": [ + { + "ReferenceNumber": 54, + "Reference": [ + "Computed by PubChem (release 2019.01.04)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Yes" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Experimental Properties", + "Description": "Properties determined experimentally (See also Safety and Hazard Properties section for more information if available)", + "Section": [ + { + "TOCHeading": "Physical Description", + "Description": "Physical description refers to the appearance or features of a given chemical compound including color, odor, state, taste and more in general", + "Information": [ + { + "ReferenceNumber": 1, + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrylaldehyde appears as a colorless liquid. Less dense than water. May be toxic by ingestion, inhalation and skin absorption. Severely irritating to skin and eyes. Used to make plastics.", + "Markup": [ + { + "Start": 0, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 65, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 12, + "Value": { + "StringWithMarkup": [ + { + "String": "Liquid" + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "COLOURLESS-TO-YELLOW LIQUID WITH PUNGENT ODOUR." + } + ] + } + } + ] + }, + { + "TOCHeading": "Color/Form", + "Description": "Physical description - color", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Sax, N.I. Dangerous Properties of Industrial Materials. 5th ed. New York: Van Nostrand Rheinhold, 1979., p. 800" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "COLORLESS LIQUID" + } + ] + } + } + ] + }, + { + "TOCHeading": "Boiling Point", + "Description": "The boiling point of a substance is the temperature at which the vapor pressure of the liquid equals the pressure surrounding the liquid and the liquid changes into a vapor", + "Information": [ + { + "ReferenceNumber": 13, + "Value": { + "StringWithMarkup": [ + { + "String": "68.4 °C" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Lide, D.R. (ed.). CRC Handbook of Chemistry and Physics. 75th ed. Boca Raton, Fl: CRC Press Inc., 1994-1995., p. 3-287" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "68.4 °C" + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "68 °C" + } + ] + } + } + ] + }, + { + "TOCHeading": "Melting Point", + "Description": "This section provides the melting point and/or freezing point. The melting point is the temperature at which a substance changes state from solid to liquid at atmospheric pressure. When considered as the temperature of the reverse change, from liquid to solid, it is referred to as the freezing point.", + "Information": [ + { + "ReferenceNumber": 13, + "Value": { + "StringWithMarkup": [ + { + "String": "-81.0 °C" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Kirk-Othmer Encyclopedia of Chemical Technology. 4th ed. Volumes 1: New York, NY. John Wiley and Sons, 1991-Present., p. V16 482" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "-81 °C" + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "-81 °C" + } + ] + } + } + ] + }, + { + "TOCHeading": "Flash Point", + "Description": "The flash point (of a volatile material) is the lowest temperature at which it can vaporize to form an ignitable mixture in air", + "Information": [ + { + "ReferenceNumber": 1, + "Reference": [ + "National Fire Protection Association. 2010. Fire Protection Guide to Hazardous Materials, 14th edition, edited by Guy R. Colonna. Quincy, MA: National Fire Protection Association. Note that this information is subject to the copyright restrictions of the organization that provided the data." + ], + "Value": { + "StringWithMarkup": [ + { + "String": "35 °F (NFPA, 2010)" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "Fire Protection Guide to Hazardous Materials. 12 ed. Quincy, MA: National Fire Protection Association, 1997., p. 325-72" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "35 °F (2 °C) (OPEN CUP)" + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "-15 °C" + } + ] + } + } + ] + }, + { + "TOCHeading": "Solubility", + "Description": "The solubility of a substance is the amount of that substance that will dissolve in a given amount of solvent. The default solvent is water, if not indicated.", + "Information": [ + { + "ReferenceNumber": 13, + "Reference": [ + "COLLIN,G & HOKE,H (1985)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "0.81 M" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Lide, D.R. (ed.). CRC Handbook of Chemistry and Physics. 75th ed. Boca Raton, Fl: CRC Press Inc., 1994-1995., p. 3-287" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "MISCIBLE WITH WATER, ETHANOL, ETHER", + "Markup": [ + { + "Start": 14, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/WATER", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 21, + "Length": 7, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/ETHANOL", + "Type": "PubChem Internal Link", + "Extra": "CID-702" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Lewis, R.J., Sr (Ed.). Hawley's Condensed Chemical Dictionary. 12th ed. New York, NY: Van Nostrand Rheinhold Co., 1993, p. 749" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Water solubility = 5.9% (59,000 mg/L) at 20 °C", + "Markup": [ + { + "Start": 0, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Solubility in water, g/100ml at 20 °C: 6 (soluble)", + "Markup": [ + { + "Start": 14, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Density", + "Description": "This section provides information on the density (with unit) and specific gravity (without unit) of a compound. Density is mass of a unit volume of a compound and commonly expressed in units of kg/m3 or g/cm3. Specific gravity, also known as relative density, is a unit-less quantity, defined as the ratio of the density of a compound to that of a standard reference material (typically, water at 4 °C for liquids and air at room temperature [20 °C or 68 °F] for gases).", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Lide, D.R. (ed.). CRC Handbook of Chemistry and Physics. 75th ed. Boca Raton, Fl: CRC Press Inc., 1994-1995., p. 3-287" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "0.849 @ 25 °C/4 °C" + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Relative density (water = 1): 0.8", + "Markup": [ + { + "Start": 18, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Vapor Density", + "Description": "Vapor density is the density of a vapor in relation to that of hydrogen", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2649" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "2.4 (AIR= 1)" + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Relative vapor density (air = 1): 2.42" + } + ] + } + } + ] + }, + { + "TOCHeading": "Vapor Pressure", + "Description": "Vapor pressure is the pressure of a vapor in thermodynamic equilibrium with its condensed phases in a closed system.", + "Information": [ + { + "ReferenceNumber": 13, + "Value": { + "StringWithMarkup": [ + { + "String": "154.99 mmHg" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Yaws CL; Handbook of Vapor Pressure Vol 1, C1-C4 Compounds. Houston, TX: Gulf Publ. Co. p. 347 (1994)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "155 mm Hg @ 25 °C" + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Vapor pressure, kPa at 20 °C: 16" + } + ] + } + } + ] + }, + { + "TOCHeading": "Henrys Law Constant", + "Description": "At a constant temperature, the amount of a given gas that dissolves in a given type and volume of liquid is directly proportional to the partial pressure of that gas in equilibrium with that liquid", + "Information": [ + { + "ReferenceNumber": 13, + "Value": { + "StringWithMarkup": [ + { + "String": "2.32e-04 atm-m3/mole" + } + ] + } + } + ] + }, + { + "TOCHeading": "Atmospheric OH Rate Constant", + "Description": "The rate constant for a reaction of the molecule with OH is used to determine atmospheric behavior (stability) of compound", + "Information": [ + { + "ReferenceNumber": 13, + "Reference": [ + "ATKINSON,R (1989)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "3.35e-11 cm3/molecule*sec" + } + ] + } + } + ] + }, + { + "TOCHeading": "Autoignition Temperature", + "Description": "The lowest temperature at which the substance will spontaneously ignite in a normal atmosphere without an external source of ignition", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "295 °C" + } + ] + } + } + ] + }, + { + "TOCHeading": "Decomposition", + "Description": "The decomposition temperature of a substance is the temperature at which the substance chemically decomposes", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Sax, N.I. Dangerous Properties of Industrial Materials. 6th ed. New York, NY: Van Nostrand Reinhold, 1984., p. 1794" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "DANGEROUS; ON DECOMPOSITION, EMITS TOXIC FUMES..." + } + ] + } + } + ] + }, + { + "TOCHeading": "Viscosity", + "Description": "Viscosity is a measure of a fluid's resistance to flow. It describes the internal friction of a moving fluid.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Gerhartz, W. (exec ed.). Ullmann's Encyclopedia of Industrial Chemistry. 5th ed.Vol A1: Deerfield Beach, FL: VCH Publishers, 1985 to Present., p. VA1 150" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "0.49 mPa.s @ 20 °C" + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "0.59 mm²/s at 20 °C" + } + ] + } + } + ] + }, + { + "TOCHeading": "Heat of Combustion", + "Description": "The heat of combustion is the energy released as heat when a compound undergoes complete combustion with oxygen under standard conditions.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Gerhartz, W. (exec ed.). Ullmann's Encyclopedia of Industrial Chemistry. 5th ed.Vol A1: Deerfield Beach, FL: VCH Publishers, 1985 to Present., p. VA1 150" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "2299 kJ/mol @ 25 °C" + } + ] + } + } + ] + }, + { + "TOCHeading": "Heat of Vaporization", + "Description": "The Heat (or Enthalpy) of Vaporization is the quantity of heat that must be absorbed if a certain quantity of liquid is vaporized at a constant temperature.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Gerhartz, W. (exec ed.). Ullmann's Encyclopedia of Industrial Chemistry. 5th ed.Vol A1: Deerfield Beach, FL: VCH Publishers, 1985 to Present., p. VA1 150" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "29.0 kJ/mol @ 101.3 kPa" + } + ] + } + } + ] + }, + { + "TOCHeading": "Surface Tension", + "Description": "Surface tension is a contractive tendency of the surface of a liquid that allows it to resist an external force. It is measured as the energy required to increase the surface area of a liquid by a unit of area.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "ASTM; Physical Constants of Hydrocarbon and Non-Hydrocarbon Compounds 2nd ed; ASTM Data Series DS 4B ASTM Comm D-2 on Petroleum Products and Lubricants. Amer Petrol Inst Ref Dept Tech Data Comm, PCN: 05-004020-12. pp 180 (1988)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Surface tension of the liquid at 77 °F = 23.41 dyne/cm." + } + ] + } + } + ] + }, + { + "TOCHeading": "Refractive Index", + "Description": "Index of refraction n of a substance is a dimensionless number that describes how light, or any other radiation, propagates through that medium.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Lide, D.R. (ed.). CRC Handbook of Chemistry and Physics. 75th ed. Boca Raton, Fl: CRC Press Inc., 1994-1995., p. 3-287" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "INDEX OF REFRACTION: 1.4144 @ 20 °C/D; MAX ABSORPTION (ALCOHOL): 216 NM (LOG E= 4.04); SADTLER REF NUMBER: 8350" + } + ] + } + } + ] + }, + { + "TOCHeading": "Kovats Retention Index", + "Description": "Kovats (gas phase) retention index.", + "URL": "http://en.wikipedia.org/wiki/Kovats_retention_index", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ListType": "CommaSeparated" + }, + "Information": [ + { + "ReferenceNumber": 25, + "Name": "Standard non-polar", + "Value": { + "Number": [ + 552.7, + 553, + 556.3, + 556, + 531 + ] + } + }, + { + "ReferenceNumber": 25, + "Name": "Semi-standard non-polar", + "Value": { + "Number": [ + 568.4, + 567, + 566, + 543, + 552, + 574, + 559, + 567.4, + 577 + ] + } + }, + { + "ReferenceNumber": 25, + "Name": "Standard polar", + "Value": { + "Number": [ + 892, + 893, + 885, + 883, + 891, + 884 + ] + } + } + ] + }, + { + "TOCHeading": "Other Experimental Properties", + "Description": "Additional property information.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2649" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "CONVERSION FACTORS: 1 MG/L= 349 PPM; 1 PPM= 2.8 MG/CU M" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Daubert, T.E., R.P. Danner. Physical and Thermodynamic Properties of Pure Chemicals Data Compilation. Washington, D.C.: Taylor and Francis, 1989." + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Liquid molar volume = 0.08320 cu m/kmol" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Gerhartz, W. (exec ed.). Ullmann's Encyclopedia of Industrial Chemistry. 5th ed.Vol A1: Deerfield Beach, FL: VCH Publishers, 1985 to Present., p. VA1 150" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Heat of Formation (gas) = -70.8 kJ/mol at 25 °C" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "SpringerMaterials Properties", + "Description": "List of properties available in SpringerMaterials covering materials science, physics, chemistry and engineering.", + "DisplayControls": { + "ListType": "Columns" + }, + "Information": [ + { + "ReferenceNumber": 49, + "Value": { + "StringWithMarkup": [ + { + "String": "Coriolis coupling", + "Markup": [ + { + "Start": 0, + "Length": 17, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=Coriolis%20coupling&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Schoenflies notation", + "Markup": [ + { + "Start": 0, + "Length": 20, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=Schoenflies%20notation&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Centrifugal distortion", + "Markup": [ + { + "Start": 0, + "Length": 22, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=centrifugal%20distortion&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Chemical bond", + "Markup": [ + { + "Start": 0, + "Length": 13, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=chemical%20bond&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Density", + "Markup": [ + { + "Start": 0, + "Length": 7, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=density&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Equilibrium structure", + "Markup": [ + { + "Start": 0, + "Length": 21, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=equilibrium%20structure&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Hindering potential", + "Markup": [ + { + "Start": 0, + "Length": 19, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=hindering%20potential&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Internuclear distance", + "Markup": [ + { + "Start": 0, + "Length": 21, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=internuclear%20distance&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Molecular structure", + "Markup": [ + { + "Start": 0, + "Length": 19, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=molecular%20structure&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Moment of inertia", + "Markup": [ + { + "Start": 0, + "Length": 17, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=moment%20of%20inertia&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Nuclear quadrupole coupling", + "Markup": [ + { + "Start": 0, + "Length": 27, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=nuclear%20quadrupole%20coupling&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Nuclear quadrupole moment", + "Markup": [ + { + "Start": 0, + "Length": 25, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=nuclear%20quadrupole%20moment&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Optical coefficient", + "Markup": [ + { + "Start": 0, + "Length": 19, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=optical%20coefficient&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Point group", + "Markup": [ + { + "Start": 0, + "Length": 11, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=point%20group&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Refractive index", + "Markup": [ + { + "Start": 0, + "Length": 16, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=refractive%20index&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Rotation-vibration spectrum", + "Markup": [ + { + "Start": 0, + "Length": 27, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=rotation-vibration%20spectrum&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Rotational excitation cross section", + "Markup": [ + { + "Start": 0, + "Length": 35, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=rotational%20excitation%20cross%20section&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Sound absorption", + "Markup": [ + { + "Start": 0, + "Length": 16, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=sound%20absorption&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Sound propagation", + "Markup": [ + { + "Start": 0, + "Length": 17, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=sound%20propagation&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Sound velocity", + "Markup": [ + { + "Start": 0, + "Length": 14, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=sound%20velocity&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Thermal expansion coefficient", + "Markup": [ + { + "Start": 0, + "Length": 29, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=thermal%20expansion%20coefficient&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + }, + { + "String": "Vibrational mode frequency", + "Markup": [ + { + "Start": 0, + "Length": 26, + "URL": "https://materials.springer.com/search?searchTerm=2-methyl-2-propenal&propertyFacet=vibrational%20mode%20frequency&substanceId=smsid_qkznmnjmynrmdhof" + } + ] + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Spectral Information", + "Description": "Spectral data for chemical compounds", + "Section": [ + { + "TOCHeading": "1D NMR Spectra", + "Description": "1D NMR Spectra data or Linking.", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Weast, R.C. and M.J. Astle. CRC Handbook of Data on Organic Compounds. Volumes I and II. Boca Raton, FL: CRC Press Inc. 1985., p. V1 835" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "NMR: 152 (Varian Associates NMR Spectra Catalogue)" + } + ] + } + }, + { + "ReferenceNumber": 28, + "Name": "1D NMR Spectra", + "Value": { + "StringWithMarkup": [ + { + "String": "NMRShiftDB Link", + "Markup": [ + { + "Start": 0, + "Length": 15, + "URL": "http://nmrshiftdb.nmr.uni-koeln.de/portal/js_pane/P-Results/nmrshiftdbaction/showDetailsFromHome/molNumber/12017" + } + ] + } + ] + } + } + ], + "Section": [ + { + "TOCHeading": "13C NMR Spectra", + "Description": "Carbon-13 NMR (13C NMR or CMR) is the application of nuclear magnetic resonance (NMR) spectroscopy to carbon isotope 13.", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 32, + "Name": "Source of Sample", + "Value": { + "StringWithMarkup": [ + { + "String": "R. Rupprecht, W. Bremser BASF Ludwigshafen (1984)" + } + ] + } + }, + { + "ReferenceNumber": 32, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 1980, 1981-2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 32, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/60HlvquIH4C", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/4575697_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 35, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2016-2020 W. Robien, Inst. of Org. Chem., Univ. of Vienna. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 35, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/1IlU3XDr719", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/4575700_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 36, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2016-2020 W. Robien, Inst. of Org. Chem., Univ. of Vienna. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 36, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/27FxW7U8BBL", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/4575701_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 38, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2002-2020 Wiley-VCH Verlag GmbH & Co. KGaA. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 38, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/9UDLMxerKQ4", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685941_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 39, + "Name": "Instrument Name", + "Value": { + "StringWithMarkup": [ + { + "String": "Bruker AM-270" + } + ] + } + }, + { + "ReferenceNumber": 39, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2002-2020 Wiley-VCH Verlag GmbH & Co. KGaA. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 39, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/FkDU0VrPQ6C", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685942_1" + ], + "MimeType": "image/png" + } + } + ] + } + ] + }, + { + "TOCHeading": "Mass Spectrometry", + "Description": "Mass spectrometry (MS or mass spec) is a technique to determine molecular structure through ionization and fragmentation of the parent compound into smaller components.", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 37, + "Name": "Source of Spectrum", + "Value": { + "StringWithMarkup": [ + { + "String": "Chemical Concepts, A Wiley Division, Weinheim, Germany" + } + ] + } + }, + { + "ReferenceNumber": 37, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2002-2020 Wiley-VCH Verlag GmbH & Co. KGaA. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 37, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/1035Hs2ImSY", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685940_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 40, + "Name": "Source of Spectrum", + "Value": { + "StringWithMarkup": [ + { + "String": "AD-0-1753-0" + } + ] + } + }, + { + "ReferenceNumber": 40, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 40, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/G0Fc7LEadlY", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685943_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 41, + "Name": "Source of Spectrum", + "Value": { + "StringWithMarkup": [ + { + "String": "NW-3-0-0" + } + ] + } + }, + { + "ReferenceNumber": 41, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 41, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/AHGRTvqppmC", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685944_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 42, + "Name": "Source of Spectrum", + "Value": { + "StringWithMarkup": [ + { + "String": "PR-474-0-0" + } + ] + } + }, + { + "ReferenceNumber": 42, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 42, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/Rgg2KRGXh2", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685945_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 43, + "Name": "Source of Spectrum", + "Value": { + "StringWithMarkup": [ + { + "String": "AA-0-58-3" + } + ] + } + }, + { + "ReferenceNumber": 43, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 43, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/8NropLWgwxU", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685946_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 44, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright Â© 2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 44, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/7kaP02DwhQe", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685947_1" + ], + "MimeType": "image/png" + } + } + ], + "Section": [ + { + "TOCHeading": "GC-MS", + "Description": "Data from GC-MS experiments.", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ListType": "Columns", + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 21, + "Name": "NIST Number", + "Value": { + "Number": [ + 254 + ] + } + }, + { + "ReferenceNumber": 21, + "Name": "Library", + "Value": { + "StringWithMarkup": [ + { + "String": "Main library" + } + ] + } + }, + { + "ReferenceNumber": 21, + "Name": "Total Peaks", + "Value": { + "Number": [ + 27 + ] + } + }, + { + "ReferenceNumber": 21, + "Name": "m/z Top Peak", + "Value": { + "Number": [ + 41 + ] + } + }, + { + "ReferenceNumber": 21, + "Name": "m/z 2nd Highest", + "Value": { + "Number": [ + 70 + ] + } + }, + { + "ReferenceNumber": 21, + "Name": "m/z 3rd Highest", + "Value": { + "Number": [ + 39 + ] + } + }, + { + "ReferenceNumber": 21, + "Name": "Thumbnail", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9388_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 22, + "Name": "NIST Number", + "Value": { + "Number": [ + 19089 + ] + } + }, + { + "ReferenceNumber": 22, + "Name": "Library", + "Value": { + "StringWithMarkup": [ + { + "String": "Replicate library" + } + ] + } + }, + { + "ReferenceNumber": 22, + "Name": "Total Peaks", + "Value": { + "Number": [ + 47 + ] + } + }, + { + "ReferenceNumber": 22, + "Name": "m/z Top Peak", + "Value": { + "Number": [ + 41 + ] + } + }, + { + "ReferenceNumber": 22, + "Name": "m/z 2nd Highest", + "Value": { + "Number": [ + 39 + ] + } + }, + { + "ReferenceNumber": 22, + "Name": "m/z 3rd Highest", + "Value": { + "Number": [ + 70 + ] + } + }, + { + "ReferenceNumber": 22, + "Name": "Thumbnail", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/248502_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 23, + "Name": "NIST Number", + "Value": { + "Number": [ + 156492 + ] + } + }, + { + "ReferenceNumber": 23, + "Name": "Library", + "Value": { + "StringWithMarkup": [ + { + "String": "Replicate library" + } + ] + } + }, + { + "ReferenceNumber": 23, + "Name": "Total Peaks", + "Value": { + "Number": [ + 26 + ] + } + }, + { + "ReferenceNumber": 23, + "Name": "m/z Top Peak", + "Value": { + "Number": [ + 41 + ] + } + }, + { + "ReferenceNumber": 23, + "Name": "m/z 2nd Highest", + "Value": { + "Number": [ + 39 + ] + } + }, + { + "ReferenceNumber": 23, + "Name": "m/z 3rd Highest", + "Value": { + "Number": [ + 70 + ] + } + }, + { + "ReferenceNumber": 23, + "Name": "Thumbnail", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/248503_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 24, + "Name": "NIST Number", + "Value": { + "Number": [ + 230393 + ] + } + }, + { + "ReferenceNumber": 24, + "Name": "Library", + "Value": { + "StringWithMarkup": [ + { + "String": "Replicate library" + } + ] + } + }, + { + "ReferenceNumber": 24, + "Name": "Total Peaks", + "Value": { + "Number": [ + 38 + ] + } + }, + { + "ReferenceNumber": 24, + "Name": "m/z Top Peak", + "Value": { + "Number": [ + 70 + ] + } + }, + { + "ReferenceNumber": 24, + "Name": "m/z 2nd Highest", + "Value": { + "Number": [ + 41 + ] + } + }, + { + "ReferenceNumber": 24, + "Name": "m/z 3rd Highest", + "Value": { + "Number": [ + 39 + ] + } + }, + { + "ReferenceNumber": 24, + "Name": "Thumbnail", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/256553_1" + ], + "MimeType": "image/png" + } + } + ] + }, + { + "TOCHeading": "Other MS", + "Description": "This section provides additional MS linking information.", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Weast, R.C. and M.J. Astle. CRC Handbook of Data on Organic Compounds. Volumes I and II. Boca Raton, FL: CRC Press Inc. 1985., p. V1 835" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "MASS: 501 (Atlas of Mass Spectral Data, John Wiley & Sons, New York)" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Weast, R.C. and M.J. Astle. CRC Handbook of Data on Organic Compounds. Volumes I and II. Boca Raton, FL: CRC Press Inc. 1985., p. V1 42" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "MASS: 58 (Atlas of Mass Spectral Data, John Wiley & Sons, New York)" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "UV Spectra", + "Description": "Ultraviolet (UV) spectroscopy refers to absorption spectroscopy or reflectance spectroscopy in the ultraviolet spectral region.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Weast, R.C. and M.J. Astle. CRC Handbook of Data on Organic Compounds. Volumes I and II. Boca Raton, FL: CRC Press Inc. 1985., p. V1 42" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "UV: 4-18 (Organic Electronic Spectral Data, Phillips et al, John Wiley & Sons, New York)" + } + ] + } + } + ] + }, + { + "TOCHeading": "IR Spectra", + "Description": "Infrared spectroscopy (IR spectroscopy) is the spectroscopy that deals with the infrared region of the electromagnetic spectrum.", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Weast, R.C. and M.J. Astle. CRC Handbook of Data on Organic Compounds. Volumes I and II. Boca Raton, FL: CRC Press Inc. 1985., p. V1 835" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "IR: 8349 (Sadtler Research Laboratories Prism Collection)" + } + ] + } + } + ], + "Section": [ + { + "TOCHeading": "FTIR Spectra", + "Description": "FTIR spectral data", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 30, + "Name": "Technique", + "Value": { + "StringWithMarkup": [ + { + "String": "NEAT" + } + ] + } + }, + { + "ReferenceNumber": 30, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 1980, 1981-2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 30, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/5kxdQHddQuc", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/4575695_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 46, + "Name": "Technique", + "Value": { + "StringWithMarkup": [ + { + "String": "Neat" + } + ] + } + }, + { + "ReferenceNumber": 46, + "Name": "Source of Spectrum", + "Value": { + "StringWithMarkup": [ + { + "String": "Sigma-Aldrich Co. LLC." + } + ] + } + }, + { + "ReferenceNumber": 46, + "Name": "Source of Sample", + "Value": { + "StringWithMarkup": [ + { + "String": "Aldrich" + } + ] + } + }, + { + "ReferenceNumber": 46, + "Name": "Catalog Number", + "Value": { + "StringWithMarkup": [ + { + "String": "133035" + } + ] + } + }, + { + "ReferenceNumber": 46, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2018-2020 Sigma-Aldrich Co. LLC. - Database Compilation Copyright © 2020-2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 46, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/BfjnLGWWj5n", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685949_1" + ], + "MimeType": "image/png" + } + } + ] + }, + { + "TOCHeading": "ATR-IR Spectra", + "Description": "ATR-IR spectral data", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 34, + "Name": "Technique", + "Value": { + "StringWithMarkup": [ + { + "String": "ATR-Cylindrical Internal Reflectance (CIR)" + } + ] + } + }, + { + "ReferenceNumber": 34, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 1980, 1981-2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 34, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/BDSUT1mVNs7", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/4575699_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 45, + "Name": "Source of Sample", + "Value": { + "StringWithMarkup": [ + { + "String": "Aldrich" + } + ] + } + }, + { + "ReferenceNumber": 45, + "Name": "Catalog Number", + "Value": { + "StringWithMarkup": [ + { + "String": "133035" + } + ] + } + }, + { + "ReferenceNumber": 45, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2018-2020 Sigma-Aldrich Co. LLC. - Database Compilation Copyright © 2018-2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 45, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/K9cCitSKfLw", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685948_1" + ], + "MimeType": "image/png" + } + } + ] + }, + { + "TOCHeading": "Vapor Phase IR Spectra", + "Description": "Vapor Phase IR spectral data", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 31, + "Name": "Technique", + "Value": { + "StringWithMarkup": [ + { + "String": "Vapor Phase" + } + ] + } + }, + { + "ReferenceNumber": 31, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 1980, 1981-2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 31, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/GNzJ9qqOu3Q", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/4575696_1" + ], + "MimeType": "image/png" + } + }, + { + "ReferenceNumber": 33, + "Name": "Instrument Name", + "Value": { + "StringWithMarkup": [ + { + "String": "DIGILAB FTS-14" + } + ] + } + }, + { + "ReferenceNumber": 33, + "Name": "Technique", + "Value": { + "StringWithMarkup": [ + { + "String": "Vapor Phase" + } + ] + } + }, + { + "ReferenceNumber": 33, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 1980, 1981-2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 33, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/KLCeSsJizeB", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/4575698_1" + ], + "MimeType": "image/png" + } + } + ] + } + ] + }, + { + "TOCHeading": "Raman Spectra", + "Description": "Raman spectroscopy is a spectroscopic technique used to observe vibrational, rotational, and other low-frequency modes in a system.", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 47, + "Name": "Catalog Number", + "Value": { + "StringWithMarkup": [ + { + "String": "133035" + } + ] + } + }, + { + "ReferenceNumber": 47, + "Name": "Copyright", + "Value": { + "StringWithMarkup": [ + { + "String": "Copyright © 2017-2020 Sigma-Aldrich Co. LLC. - Database Compilation Copyright © 2017-2020 John Wiley & Sons, Inc. All Rights Reserved." + } + ] + } + }, + { + "ReferenceNumber": 47, + "Name": "Thumbnail", + "URL": "https://spectrabase.com/spectrum/CSuqFIQOOcO", + "Value": { + "ExternalDataURL": [ + "https://pubchem.ncbi.nlm.nih.gov/rest/pug_view/data/key/9685950_1" + ], + "MimeType": "image/png" + } + } + ] + } + ] + }, + { + "TOCHeading": "Related Records", + "Description": "Related compounds/substances information based on the similar structure, annotations, etc.", + "Section": [ + { + "TOCHeading": "Related Compounds with Annotation", + "Description": "The subset of compounds that are related to the one currently displayed AND that have biomedical annotations.", + "Information": [ + { + "ReferenceNumber": 54, + "Value": { + "Boolean": [ + true + ] + } + } + ] + }, + { + "TOCHeading": "Related Compounds", + "Description": "Compound records closely associated to this record.", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 1 + }, + "Information": [ + { + "ReferenceNumber": 54, + "Name": "Same Connectivity Count", + "URL": "https://www.ncbi.nlm.nih.gov/pccompound?cmd=Link&LinkName=pccompound_pccompound_sameconnectivity_pulldown&from_uid=6562", + "Value": { + "Number": [ + 3 + ] + } + }, + { + "ReferenceNumber": 54, + "Name": "Same Parent, Connectivity Count", + "URL": "https://www.ncbi.nlm.nih.gov/pccompound?cmd=Link&LinkName=pccompound_pccompound_parent_connectivity_pulldown&from_uid=6562", + "Value": { + "Number": [ + 45 + ] + } + }, + { + "ReferenceNumber": 54, + "Name": "Same Parent, Exact Count", + "URL": "https://www.ncbi.nlm.nih.gov/pccompound?cmd=Link&LinkName=pccompound_pccompound_parent_pulldown&from_uid=6562", + "Value": { + "Number": [ + 43 + ] + } + }, + { + "ReferenceNumber": 54, + "Name": "Mixtures, Components, and Neutralized Forms Count", + "URL": "https://www.ncbi.nlm.nih.gov/pccompound?cmd=Link&LinkName=pccompound_pccompound_mixture&from_uid=6562", + "Value": { + "Number": [ + 1200 + ] + } + }, + { + "ReferenceNumber": 54, + "Name": "Similar Compounds Count", + "URL": "https://www.ncbi.nlm.nih.gov/pccompound?cmd=Link&LinkName=pccompound_pccompound&from_uid=6562", + "Value": { + "Number": [ + 10 + ] + } + }, + { + "ReferenceNumber": 54, + "Name": "Similar Conformers Count", + "URL": "https://www.ncbi.nlm.nih.gov/pccompound?cmd=Link&LinkName=pccompound_pccompound_3d&from_uid=6562", + "Value": { + "Number": [ + 1921 + ] + } + } + ] + }, + { + "TOCHeading": "Substances", + "Description": "Substance records linked to this compound.", + "Section": [ + { + "TOCHeading": "Related Substances", + "Description": "Substances identical or nearly identical to this record.", + "URL": "https://pubchemdocs.ncbi.nlm.nih.gov/substances", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 1 + }, + "Information": [ + { + "ReferenceNumber": 54, + "Name": "All Count", + "URL": "https://www.ncbi.nlm.nih.gov/pcsubstance/?term=6562[CompoundID]", + "Value": { + "Number": [ + 1331 + ] + } + }, + { + "ReferenceNumber": 54, + "Name": "Same Count", + "URL": "https://www.ncbi.nlm.nih.gov/pcsubstance/?term=6562[StandardizedCID]", + "Value": { + "Number": [ + 103 + ] + } + }, + { + "ReferenceNumber": 54, + "Name": "Mixture Count", + "URL": "https://www.ncbi.nlm.nih.gov/pcsubstance/?term=6562[ComponentCID]", + "Value": { + "Number": [ + 1228 + ] + } + } + ] + }, + { + "TOCHeading": "Substances by Category", + "Description": "Substance category according to the depositors. Substance Categorization Classification - The subheaders in this section of a PubChem Compound record reflect the various categories of depositors that have submitted corresponding PubChem Substance records. This allows you to quickly find the corresponding PubChem Substance records that are likely to contain a given type of information, such as Chemical Reactions.", + "URL": "https://pubchemdocs.ncbi.nlm.nih.gov/substances", + "Information": [ + { + "ReferenceNumber": 54, + "Value": { + "StringWithMarkup": [ + { + "String": "Chemical Vendors" + }, + { + "String": "Curation Efforts" + }, + { + "String": "Governmental Organizations" + }, + { + "String": "Journal Publishers" + }, + { + "String": "Legacy Depositors" + }, + { + "String": "Research and Development" + }, + { + "String": "Subscription Services" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Entrez Crosslinks", + "Description": "Cross-references to associated records in other Entrez databases such as PubMed, Gene, Protein, etc.", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 1 + }, + "Information": [ + { + "ReferenceNumber": 54, + "Name": "PubMed Count", + "URL": "https://www.ncbi.nlm.nih.gov/sites/entrez?LinkName=pccompound_pubmed&db=pccompound&cmd=Link&from_uid=6562", + "Value": { + "Number": [ + 91 + ] + } + }, + { + "ReferenceNumber": 54, + "Name": "Taxonomy Count", + "URL": "https://www.ncbi.nlm.nih.gov/sites/entrez?LinkName=pccompound_taxonomy&db=pccompound&cmd=Link&from_uid=6562", + "Value": { + "Number": [ + 1 + ] + } + }, + { + "ReferenceNumber": 54, + "Name": "Gene Count", + "URL": "https://www.ncbi.nlm.nih.gov/sites/entrez?LinkName=pccompound_gene&db=pccompound&cmd=Link&from_uid=6562", + "Value": { + "Number": [ + 1883 + ] + } + } + ] + }, + { + "TOCHeading": "NCBI LinkOut", + "Description": "LinkOut is a service that allows one to link directly from NCBI databases to a wide range of information and services beyond NCBI systems.", + "URL": "https://www.ncbi.nlm.nih.gov/projects/linkout", + "Information": [ + { + "ReferenceNumber": 67, + "Value": { + "Boolean": [ + true + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Chemical Vendors", + "Description": "A list of chemical vendors that sell this compound. Each vendor may have multiple products containing the same chemical, but different in various aspects, such as amount and purity. For each product, the external identifier used to locate the product on the vendor's website is provided under the Purcharsable Chemical column, and clicking this identifier directs you to the vendor's website. The information on the product provided by the vendor to PubChem can be accessed at the Summary page of the corresponding PubChem Substance ID (SID). Note that the order of chemical vendors on the list is randomized, and that PubChem do not endorse any of the vendors.", + "Information": [ + { + "ReferenceNumber": 54, + "Value": { + "Boolean": [ + true + ] + } + } + ] + }, + { + "TOCHeading": "Pharmacology and Biochemistry", + "Description": "Pharmacology and biochemistry information related to this record", + "Section": [ + { + "TOCHeading": "Metabolism/Metabolites", + "Description": "Metabolism/Metabolites information related to the record", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2635" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Aldehydes are readily oxidized to organic acids, which, in turn, can serve as substrates for fatty acid oxidation pathways and the Krebs cycle. ... Oxidation of aldehydes is catalyzed by aldehyde dehydrogenase, which has been found in the brain, erythrocytes, liver, kidney, heart, and placenta. /Aldehydes/" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2637" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "... The detoxification of aldehydes can be seen to proceed basically via two routes: (1) an oxidation to yield readily metabolized acids; (2) inactivation by reaction with sulfhydryl groups, particularly glutathione. Under conditions that either deplete glutathione levels, or that result in an inhibition of aldehyde dehydrogenase (for example, Antabuse treatment), the acute and chronic effects of aldehyde toxicity might be more fully expressed. /Aldehydes/", + "Markup": [ + { + "Start": 204, + "Length": 11, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/glutathione", + "Type": "PubChem Internal Link", + "Extra": "CID-124886" + }, + { + "Start": 254, + "Length": 11, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/glutathione", + "Type": "PubChem Internal Link", + "Extra": "CID-124886" + }, + { + "Start": 346, + "Length": 8, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Antabuse", + "Type": "PubChem Internal Link", + "Extra": "CID-3117" + } + ] + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Use and Manufacturing", + "Description": "The use and manufacture of the chemical and related information", + "Section": [ + { + "TOCHeading": "Use Classification", + "Description": "This section contains use classification/category information from various sources", + "Information": [ + { + "ReferenceNumber": 27, + "Value": { + "StringWithMarkup": [ + { + "String": "Fire Hazards -> Flammable - 3rd degree, Reactive - 2nd degree" + } + ] + } + } + ] + }, + { + "TOCHeading": "Uses", + "Description": "This section presents the major uses of the chemical in the United States today. In addition, past uses of the chemical are summarized.", + "Information": [ + { + "ReferenceNumber": 11, + "Name": "EPA CPDat Chemical and Product Categories", + "Value": { + "ExternalTableName": "cpdat" + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "SRI" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "CHEMICAL INTERMEDIATE; COMONOMER IN RESIN PRODN" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Kirk-Othmer Encyclopedia of Chemical Technology. 3rd ed., Volumes 1-26. New York, NY: John Wiley and Sons, 1978-1984., p. V1 293" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Copolymers, resins." + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Kirk-Othmer Encyclopedia of Chemical Technology. 3rd ed., Volumes 1-26. New York, NY: John Wiley and Sons, 1978-1984., p. V1 293" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "As an intermediate in the production of methacrylonitrile or methacrylic acid.", + "Markup": [ + { + "Start": 40, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrylonitrile", + "Type": "PubChem Internal Link", + "Extra": "CID-31368" + }, + { + "Start": 61, + "Length": 16, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrylic%20acid", + "Type": "PubChem Internal Link", + "Extra": "CID-4093" + } + ] + } + ] + } + } + ], + "Section": [ + { + "TOCHeading": "Industry Uses", + "Description": "This section presents the information for industrial function categories", + "DisplayControls": { + "ListType": "Columns" + }, + "Information": [ + { + "ReferenceNumber": 12, + "Reference": [ + "https://www.epa.gov/chemical-data-reporting" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Intermediates" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Methods of Manufacturing", + "Description": "Methods of Manufacturing from HSDB and other sources.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "SRI" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "CATALYTIC OXIDATION OF ISOBUTYLENE", + "Markup": [ + { + "Start": 23, + "Length": 11, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/ISOBUTYLENE", + "Type": "PubChem Internal Link", + "Extra": "CID-8255" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Kirk-Othmer Encyclopedia of Chemical Technology. 3rd ed., Volumes 1-26. New York, NY: John Wiley and Sons, 1978-1984., p. V1 292" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Cross-condensation of propionaldehyde and formaldehyde or the dehydrogenation of isobutyraldehyde.", + "Markup": [ + { + "Start": 22, + "Length": 15, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/propionaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-527" + }, + { + "Start": 42, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/formaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-712" + }, + { + "Start": 81, + "Length": 16, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/isobutyraldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6561" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Formulations/Preparations", + "Description": "Formulations/Preparations from HSDB and other sources", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Lewis, R.J., Sr (Ed.). Hawley's Condensed Chemical Dictionary. 12th ed. New York, NY: Van Nostrand Rheinhold Co., 1993, p. 749" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Shipped with 0.1% hydroquinone, as polymerization inhibitor", + "Markup": [ + { + "Start": 18, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/hydroquinone", + "Type": "PubChem Internal Link", + "Extra": "CID-785" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "U.S. Production", + "Description": "U.S. Production", + "Information": [ + { + "ReferenceNumber": 12, + "Name": "Aggregated Product Volume (EPA CDR 2016)", + "Reference": [ + "https://www.epa.gov/chemical-data-reporting" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "100,000 - 500,000 lb" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "SRI" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "(1975) GREATER THAN 9.08X10+5 GRAMS (EST)" + } + ] + } + } + ] + }, + { + "TOCHeading": "General Manufacturing Information", + "Description": "General Manufacturing Information", + "DisplayControls": { + "ListType": "Columns" + }, + "Information": [ + { + "ReferenceNumber": 12, + "Name": "Industry Processing Sectors", + "Value": { + "StringWithMarkup": [ + { + "String": "Pesticide, fertilizer, and other agricultural chemical manufacturing" + }, + { + "String": "Photographic film paper, plate, and chemical manufacturing" + } + ] + } + }, + { + "ReferenceNumber": 12, + "Name": "EPA TSCA Commercial Activity Status", + "Reference": [ + "https://www.epa.gov/tsca-inventory" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "2-Propenal, 2-methyl-: ACTIVE", + "Markup": [ + { + "Start": 0, + "Length": 10, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/2-Propenal", + "Type": "PubChem Internal Link", + "Extra": "CID-7847" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Kirk-Othmer Encyclopedia of Chemical Technology. 3rd ed., Volumes 1-26. New York, NY: John Wiley and Sons, 1978-1984., p. V! 292" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Development of more productive catalysts for propylene oxidation, which were not advantages for isobutylene oxidation, and failure of growth in the commercial use of methacrolein contributed to the discontinuance of the manufacture of methacrolein.", + "Markup": [ + { + "Start": 45, + "Length": 9, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/propylene", + "Type": "PubChem Internal Link", + "Extra": "CID-8252" + }, + { + "Start": 96, + "Length": 11, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/isobutylene", + "Type": "PubChem Internal Link", + "Extra": "CID-8255" + }, + { + "Start": 166, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 235, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Safety and Hazards", + "Description": "Safety and hazards information, properties, management techniques, reactivities and incompatibilities, first aid treatments, and more. For toxicity and related information, please visit Toxicity section.", + "Section": [ + { + "TOCHeading": "Hazards Identification", + "Description": "Hazards Identification includes all hazards regarding the chemical; required label elements", + "Section": [ + { + "TOCHeading": "GHS Classification", + "Description": "GHS (Globally Harmonized System of Classification and Labelling of Chemicals) is a United Nations system to identify hazardous chemicals and to inform users about these hazards. GHS has been adopted by many countries around the world and is now also used as the basis for international and national transport regulations for dangerous goods. The GHS hazard statements, class categories, pictograms, signal words, and the precautionary statements can be found on the PubChem GHS page.", + "URL": "https://pubchem.ncbi.nlm.nih.gov/ghs/", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 1 + }, + "Information": [ + { + "ReferenceNumber": 14, + "Name": "Pictogram(s)", + "Value": { + "StringWithMarkup": [ + { + "String": " ", + "Markup": [ + { + "Start": 0, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS02.svg", + "Type": "Icon", + "Extra": "Flammable" + }, + { + "Start": 1, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS05.svg", + "Type": "Icon", + "Extra": "Corrosive" + }, + { + "Start": 2, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS06.svg", + "Type": "Icon", + "Extra": "Acute Toxic" + }, + { + "Start": 3, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS08.svg", + "Type": "Icon", + "Extra": "Health Hazard" + }, + { + "Start": 4, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS09.svg", + "Type": "Icon", + "Extra": "Environmental Hazard" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 14, + "Name": "Signal", + "Value": { + "StringWithMarkup": [ + { + "String": "Danger", + "Markup": [ + { + "Start": 0, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 14, + "Name": "GHS Hazard Statements", + "Value": { + "StringWithMarkup": [ + { + "String": "H225 (93.06%): Highly Flammable liquid and vapor [Danger Flammable liquids]", + "Markup": [ + { + "Start": 50, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H301 (93.06%): Toxic if swallowed [Danger Acute toxicity, oral]", + "Markup": [ + { + "Start": 35, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H311 (90.97%): Toxic in contact with skin [Danger Acute toxicity, dermal]", + "Markup": [ + { + "Start": 43, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H314 (90.97%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]", + "Markup": [ + { + "Start": 56, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H318 (59.72%): Causes serious eye damage [Danger Serious eye damage/eye irritation]", + "Markup": [ + { + "Start": 42, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H330 (70.14%): Fatal if inhaled [Danger Acute toxicity, inhalation]", + "Markup": [ + { + "Start": 33, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H341 (59.03%): Suspected of causing genetic defects [Warning Germ cell mutagenicity]", + "Markup": [ + { + "Start": 53, + "Length": 7, + "Type": "Color", + "Extra": "GHSWarning" + } + ] + }, + { + "String": "H400 (59.03%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard]", + "Markup": [ + { + "Start": 43, + "Length": 7, + "Type": "Color", + "Extra": "GHSWarning" + } + ] + }, + { + "String": "H410 (59.03%): Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard]", + "Markup": [ + { + "Start": 69, + "Length": 7, + "Type": "Color", + "Extra": "GHSWarning" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 14, + "Name": "Precautionary Statement Codes", + "Value": { + "StringWithMarkup": [ + { + "String": "P201, P202, P210, P233, P240, P241, P242, P243, P260, P264, P270, P271, P273, P280, P281, P284, P301+P310, P301+P330+P331, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P308+P313, P310, P312, P320, P321, P322, P330, P361, P363, P370+P378, P391, P403+P233, P403+P235, P405, and P501" + }, + { + "String": "(The corresponding statement to each P-code can be found at the GHS Classification page.)", + "Markup": [ + { + "Start": 64, + "Length": 18, + "URL": "https://pubchem.ncbi.nlm.nih.gov/ghs/#_prec" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 14, + "Name": "ECHA C&L Notifications Summary", + "Value": { + "StringWithMarkup": [ + { + "String": "Aggregated GHS information provided by 144 companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.", + "Markup": [ + { + "Start": 0, + "Length": 165, + "Type": "Italics" + } + ] + }, + { + "String": "Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown.", + "Markup": [ + { + "Start": 0, + "Length": 281, + "Type": "Italics" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 26, + "Name": "Pictogram(s)", + "Value": { + "StringWithMarkup": [ + { + "String": " ", + "Markup": [ + { + "Start": 0, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS02.svg", + "Type": "Icon", + "Extra": "Flammable" + }, + { + "Start": 1, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS05.svg", + "Type": "Icon", + "Extra": "Corrosive" + }, + { + "Start": 2, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS06.svg", + "Type": "Icon", + "Extra": "Acute Toxic" + }, + { + "Start": 3, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/images/ghs/GHS07.svg", + "Type": "Icon", + "Extra": "Irritant" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 26, + "Name": "Signal", + "Value": { + "StringWithMarkup": [ + { + "String": "Danger", + "Markup": [ + { + "Start": 0, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 26, + "Name": "GHS Hazard Statements", + "Value": { + "StringWithMarkup": [ + { + "String": "H225: Highly Flammable liquid and vapor [Danger Flammable liquids]", + "Markup": [ + { + "Start": 41, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H301: Toxic if swallowed [Danger Acute toxicity, oral]", + "Markup": [ + { + "Start": 26, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H311: Toxic in contact with skin [Danger Acute toxicity, dermal]", + "Markup": [ + { + "Start": 34, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H314: Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]", + "Markup": [ + { + "Start": 47, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H318: Causes serious eye damage [Danger Serious eye damage/eye irritation]", + "Markup": [ + { + "Start": 33, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H330: Fatal if inhaled [Danger Acute toxicity, inhalation]", + "Markup": [ + { + "Start": 24, + "Length": 6, + "Type": "Color", + "Extra": "GHSDanger" + } + ] + }, + { + "String": "H335: May cause respiratory irritation [Warning Specific target organ toxicity, single exposure; Respiratory tract irritation]", + "Markup": [ + { + "Start": 40, + "Length": 7, + "Type": "Color", + "Extra": "GHSWarning" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 26, + "Name": "Precautionary Statement Codes", + "Value": { + "StringWithMarkup": [ + { + "String": "P210, P233, P240, P241, P242, P243, P260, P261, P264, P270, P271, P280, P284, P301+P310, P301+P330+P331, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P310, P312, P320, P321, P322, P330, P361, P363, P370+P378, P403+P233, P403+P235, P405, and P501" + }, + { + "String": "(The corresponding statement to each P-code can be found at the GHS Classification page.)", + "Markup": [ + { + "Start": 64, + "Length": 18, + "URL": "https://pubchem.ncbi.nlm.nih.gov/ghs/#_prec" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Hazard Classes and Categories", + "Description": "The Hazard Classes and Categories are aligned with GHS (Globally Harmonized System of Classification and Labelling of Chemicals) hazard statement codes. More info can be found at the PubChem GHS summary page. The percentage data in the parenthesis from ECHA indicates that the hazard classes and categories information are consolidated from multiple companies, see the detailed explanation from the above GHS classification section.", + "URL": "https://pubchem.ncbi.nlm.nih.gov/ghs/", + "DisplayControls": { + "ShowAtMost": 2 + }, + "Information": [ + { + "ReferenceNumber": 14, + "Value": { + "StringWithMarkup": [ + { + "String": "Flam. Liq. 2 (93.06%)" + }, + { + "String": "Acute Tox. 3 (93.06%)" + }, + { + "String": "Acute Tox. 3 (90.97%)" + }, + { + "String": "Skin Corr. 1B (90.97%)" + }, + { + "String": "Eye Dam. 1 (59.72%)" + }, + { + "String": "Acute Tox. 2 (70.14%)" + }, + { + "String": "Muta. 2 (59.03%)" + }, + { + "String": "Aquatic Acute 1 (59.03%)" + }, + { + "String": "Aquatic Chronic 1 (59.03%)" + } + ] + } + }, + { + "ReferenceNumber": 26, + "Value": { + "StringWithMarkup": [ + { + "String": "Flammable liquids - Category 2" + }, + { + "String": "Self-reactive substances and mixtures - Type G" + }, + { + "String": "Acute toxicity (Dermal) - Category 3" + }, + { + "String": "Acute toxicity (Inhalation: Gases) - Category 3" + }, + { + "String": "Acute toxicity (Inhalation: Dusts and mists) - Category 2" + }, + { + "String": "Serious eye damage/eye irritation - Category 1" + }, + { + "String": "Respiratory sensitization - Category 1" + }, + { + "String": "Specific target organ toxicity - Repeated exposure - Category 3 (Respiratory tract irritation)" + } + ] + } + } + ] + }, + { + "TOCHeading": "NFPA Hazard Classification", + "Description": "National Fire Protection Association Hazard Classification", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 2, + "ColumnContents": [ + "Name", + "Value" + ] + }, + "ShowAtMost": 1 + }, + "Information": [ + { + "ReferenceNumber": 17, + "Name": "NFPA 704 Diamond", + "Value": { + "StringWithMarkup": [ + { + "String": " ", + "Markup": [ + { + "Start": 0, + "Length": 1, + "URL": "https://pubchem.ncbi.nlm.nih.gov/image/nfpa.cgi?code=332W", + "Type": "Icon", + "Extra": "3-3-2- ̵W̵" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Name": "NFPA Health Rating", + "Value": { + "StringWithMarkup": [ + { + "String": " 3 - Materials that, under emergency conditions, can cause serious or permanent injury." + } + ] + } + }, + { + "ReferenceNumber": 17, + "Name": "NFPA Fire Rating", + "Value": { + "StringWithMarkup": [ + { + "String": " 3 - Liquids and solids that can be ignited under almost all ambient temperature conditions. Materials produce hazardous atmospheres with air under almost all ambient temperatures or, though unaffected by ambient temperatures, are readily ignited under almost all conditions." + } + ] + } + }, + { + "ReferenceNumber": 17, + "Name": "NFPA Instability Rating", + "Value": { + "StringWithMarkup": [ + { + "String": " 2 - Materials that readily undergo violent chemical changes at elevated temperatures and pressures." + } + ] + } + }, + { + "ReferenceNumber": 17, + "Name": "NFPA Specific Notice", + "Value": { + "StringWithMarkup": [ + { + "String": "W - No water: Materials that react violently or explosively with water.", + "Markup": [ + { + "Start": 7, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 65, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Substance of Very High Concern (SVHC)", + "Description": "This section provides related information to restricted substances, highly hazardous chemicals, substance with high concerns.", + "DisplayControls": { + "ListType": "Columns" + }, + "Information": [ + { + "ReferenceNumber": 29, + "Name": "OSHA Highly Hazardous Chemicals, Toxics and Reactives", + "Value": { + "StringWithMarkup": [ + { + "String": "Chemical: Methacrylaldehyde", + "Markup": [ + { + "Start": 10, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + }, + { + "String": "Threshold: 1000 [lb]" + }, + { + "String": "Note: Methacrylaldehyde in quantities at or above above 1000lb presents a potential for a catastrophic event as a toxic or reactive highly hazardous chemical.", + "Markup": [ + { + "Start": 6, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Health Hazards", + "Description": "Description of the chemical's health hazards (such as toxicity, flammability, or corrosivity).", + "Information": [ + { + "ReferenceNumber": 1, + "Reference": [ + "U.S. Department of Transportation, Transport Canada, and Secretariat of Communications and Transport of Mexico, with collaboration from Argentina's Centro de Información QuÃmica para Emergencias. 2016 Emergency Response Guidebook. https://www.phmsa.dot.gov/hazmat/outreach-training/erg (accessed April 26, 2016)." + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Excerpt from ERG Guide 131P [Flammable Liquids - Toxic]: TOXIC; may be fatal if inhaled, ingested or absorbed through skin. Inhalation or contact with some of these materials will irritate or burn skin and eyes. Fire will produce irritating, corrosive and/or toxic gases. Vapors may cause dizziness or suffocation. Runoff from fire control or dilution water may cause pollution. (ERG, 2016)", + "Markup": [ + { + "Start": 353, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Fire Hazards", + "Description": "Description of the Fire Hazard information", + "Information": [ + { + "ReferenceNumber": 1, + "Reference": [ + "U.S. Department of Transportation, Transport Canada, and Secretariat of Communications and Transport of Mexico, with collaboration from Argentina's Centro de Información QuÃmica para Emergencias. 2016 Emergency Response Guidebook. https://www.phmsa.dot.gov/hazmat/outreach-training/erg (accessed April 26, 2016)." + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Excerpt from ERG Guide 131P [Flammable Liquids - Toxic]: HIGHLY FLAMMABLE: Will be easily ignited by heat, sparks or flames. Vapors may form explosive mixtures with air. Vapors may travel to source of ignition and flash back. Most vapors are heavier than air. They will spread along ground and collect in low or confined areas (sewers, basements, tanks). Vapor explosion and poison hazard indoors, outdoors or in sewers. Those substances designated with a (P) may polymerize explosively when heated or involved in a fire. Runoff to sewer may create fire or explosion hazard. Containers may explode when heated. Many liquids are lighter than water. (ERG, 2016)", + "Markup": [ + { + "Start": 642, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Highly flammable. Vapour/air mixtures are explosive." + } + ] + } + }, + { + "ReferenceNumber": 27, + "Value": { + "StringWithMarkup": [ + { + "String": "Flammable - 3rd degree, Reactive - 2nd degree" + } + ] + } + } + ] + }, + { + "TOCHeading": "Fire Potential", + "Description": "Fire Potential information", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Sax, N.I. Dangerous Properties of Industrial Materials. 5th ed. New York: Van Nostrand Rheinhold, 1979., p. 800" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "FIRE HAZARD: DANGEROUS, WHEN EXPOSED TO HEAT, FLAME OR OXIDIZERS. ...CAN REACT VIGOROUSLY WITH OXIDIZING MATERIALS." + } + ] + } + } + ] + }, + { + "TOCHeading": "Skin, Eye, and Respiratory Irritations", + "Description": "Symptoms of Skin, Eye, and Respiratory Irritations cause by chemical hazards", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Hawley, G.G. The Condensed Chemical Dictionary. 9th ed. New York: Van Nostrand Reinhold Co., 1977., p. 553" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "... STRONG IRRITANT" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Safety and Hazard Properties", + "Description": "Safety and Hazard Properties lists the chemical's safety and hazard characteristics", + "Section": [ + { + "TOCHeading": "Acute Exposure Guideline Levels (AEGLs)", + "Description": "Acute exposure guideline levels (AEGLs) describe the human health effects from once-in-a-lifetime, or rare, exposure to airborne chemicals.", + "URL": "https://www.epa.gov/aegl", + "Section": [ + { + "TOCHeading": "AEGLs Table", + "Description": "AEGLs values for a given compound", + "DisplayControls": { + "CreateTable": { + "FromInformationIn": "ThisSection", + "NumberOfColumns": 6, + "ColumnsFromNamedLists": { + "Name": [ + "AEGLs", + "10 min", + "30 min", + "60 min", + "4 hr", + "8 hr" + ], + "UseNamesAsColumnHeadings": true + } + } + }, + "Information": [ + { + "ReferenceNumber": 10, + "Name": "AEGLs", + "Value": { + "StringWithMarkup": [ + { + "String": "AEGL 1: Notable discomfort, irritation, or certain asymptomatic non-sensory effects. However, the effects are not disabling and are transient and reversible upon cessation of exposure (Unit: ppm)" + }, + { + "String": "AEGL 2: Irreversible or other serious, long-lasting adverse health effects or an impaired ability to escape (Unit: ppm)" + }, + { + "String": "AEGL 3: Life-threatening health effects or death (Unit: ppm)" + } + ] + } + }, + { + "ReferenceNumber": 10, + "Name": "10 min", + "Value": { + "StringWithMarkup": [ + { + "String": "0.20" + }, + { + "String": "0.33" + }, + { + "String": "4.3" + } + ] + } + }, + { + "ReferenceNumber": 10, + "Name": "30 min", + "Value": { + "StringWithMarkup": [ + { + "String": "0.20" + }, + { + "String": "0.33" + }, + { + "String": "4.3" + } + ] + } + }, + { + "ReferenceNumber": 10, + "Name": "60 min", + "Value": { + "StringWithMarkup": [ + { + "String": "0.20" + }, + { + "String": "0.33" + }, + { + "String": "3.5" + } + ] + } + }, + { + "ReferenceNumber": 10, + "Name": "4 hr", + "Value": { + "StringWithMarkup": [ + { + "String": "0.20" + }, + { + "String": "0.33" + }, + { + "String": "2.2" + } + ] + } + }, + { + "ReferenceNumber": 10, + "Name": "8 hr", + "Value": { + "StringWithMarkup": [ + { + "String": "0.20" + }, + { + "String": "0.33" + }, + { + "String": "1.4" + } + ] + } + } + ] + }, + { + "TOCHeading": "AEGLs Notes", + "Description": "Additional information for AEGL data.", + "Information": [ + { + "ReferenceNumber": 10, + "Value": { + "StringWithMarkup": [ + { + "String": "AEGLs Status: Final" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Critical Temperature & Pressure", + "Description": "The critical temperature of a substance is the temperature at and above which vapor of the substance cannot be liquefied, no matter how much pressure is applied. The critical pressure of a substance is the pressure required to liquefy a gas at its critical temperature.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Gerhartz, W. (exec ed.). Ullmann's Encyclopedia of Industrial Chemistry. 5th ed.Vol A1: Deerfield Beach, FL: VCH Publishers, 1985 to Present., p. VA1 150" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Critical temperature: 257 °C; Critical pressure: 4.36 mPa" + } + ] + } + } + ] + }, + { + "TOCHeading": "Physical Dangers", + "Description": "Physical Dangers information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "The vapour is heavier than air and may travel along the ground; distant ignition possible." + } + ] + } + } + ] + }, + { + "TOCHeading": "Explosive Limits and Potential", + "Description": "Explosive Limits and Potential information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Explosive limits , vol% in air: 2.6-?" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "First Aid Measures", + "Description": "First-aid measures includes important symptoms/ effects, acute, delayed; required treatment.", + "Section": [ + { + "TOCHeading": "First Aid", + "Description": "First Aid information", + "Information": [ + { + "ReferenceNumber": 1, + "Reference": [ + "U.S. Department of Transportation, Transport Canada, and Secretariat of Communications and Transport of Mexico, with collaboration from Argentina's Centro de Información QuÃmica para Emergencias. 2016 Emergency Response Guidebook. https://www.phmsa.dot.gov/hazmat/outreach-training/erg (accessed April 26, 2016)." + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Excerpt from ERG Guide 131P [Flammable Liquids - Toxic]: Ensure that medical personnel are aware of the material(s) involved and take precautions to protect themselves. Move victim to fresh air. Call 911 or emergency medical service. Give artificial respiration if victim is not breathing. Do not use mouth-to-mouth method if victim ingested or inhaled the substance; give artificial respiration with the aid of a pocket mask equipped with a one-way valve or other proper respiratory medical device. Administer oxygen if breathing is difficult. Remove and isolate contaminated clothing and shoes. In case of contact with substance, immediately flush skin or eyes with running water for at least 20 minutes. Wash skin with soap and water. In case of burns, immediately cool affected skin for as long as possible with cold water. Do not remove clothing if adhering to skin. Keep victim calm and warm. Effects of exposure (inhalation, ingestion or skin contact) to substance may be delayed. (ERG, 2016)", + "Markup": [ + { + "Start": 512, + "Length": 6, + "URL": "https://pubchem.ncbi.nlm.nih.gov/element/Oxygen", + "Type": "PubChem Internal Link", + "Extra": "Element-Oxygen" + }, + { + "Start": 677, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 732, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 822, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Inhalation First Aid", + "Description": "Information regarding the Inhalation First Aid", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Fresh air, rest." + } + ] + } + } + ] + }, + { + "TOCHeading": "Skin First Aid", + "Description": "Information regarding the Skin First Aid", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Remove contaminated clothes. Rinse skin with plenty of water or shower. Refer for medical attention .", + "Markup": [ + { + "Start": 55, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Eye First Aid", + "Description": "First Aid for eyes", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "First rinse with plenty of water for several minutes (remove contact lenses if easily possible), then refer for medical attention.", + "Markup": [ + { + "Start": 27, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Ingestion First Aid", + "Description": "Information regarding the Ingestion First Aid", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Rinse mouth. Refer for medical attention ." + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Fire Fighting", + "Description": "Fire Fighting information", + "Information": [ + { + "ReferenceNumber": 1, + "Reference": [ + "U.S. Department of Transportation, Transport Canada, and Secretariat of Communications and Transport of Mexico, with collaboration from Argentina's Centro de Información QuÃmica para Emergencias. 2016 Emergency Response Guidebook. https://www.phmsa.dot.gov/hazmat/outreach-training/erg (accessed April 26, 2016)." + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Excerpt from ERG Guide 131P [Flammable Liquids - Toxic]: CAUTION: All these products have a very low flash point: Use of water spray when fighting fire may be inefficient. SMALL FIRE: Dry chemical, CO2, water spray or alcohol-resistant foam. LARGE FIRE: Water spray, fog or alcohol-resistant foam. Move containers from fire area if you can do it without risk. Dike fire-control water for later disposal; do not scatter the material. Use water spray or fog; do not use straight streams. FIRE INVOLVING TANKS OR CAR/TRAILER LOADS: Fight fire from maximum distance or use unmanned hose holders or monitor nozzles. Cool containers with flooding quantities of water until well after fire is out. Withdraw immediately in case of rising sound from venting safety devices or discoloration of tank. ALWAYS stay away from tanks engulfed in fire. For massive fire, use unmanned hose holders or monitor nozzles; if this is impossible, withdraw from area and let fire burn. (ERG, 2016)", + "Markup": [ + { + "Start": 122, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 205, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 257, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 381, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 440, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 659, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Use water spray, powder, alcohol-resistant foam, carbon dioxide. In case of fire: keep drums, etc., cool by spraying with water.", + "Markup": [ + { + "Start": 4, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 49, + "Length": 14, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/carbon%20dioxide", + "Type": "PubChem Internal Link", + "Extra": "CID-280" + }, + { + "Start": 122, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ], + "Section": [ + { + "TOCHeading": "Fire Fighting Procedures", + "Description": "Fire fighting measures list suitable extinguishing techniques, equipment; chemical hazards from fire.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Sax, N.I. Dangerous Properties of Industrial Materials. 5th ed. New York: Van Nostrand Rheinhold, 1979., p. 800" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "CARBON DIOXIDE, ALC FOAM, FOAM, DRY CHEMICAL.", + "Markup": [ + { + "Start": 0, + "Length": 14, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/CARBON%20DIOXIDE", + "Type": "PubChem Internal Link", + "Extra": "CID-280" + } + ] + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Accidental Release Measures", + "Description": "Accidental release measures lists emergency procedures; protective equipment; proper methods of containment and cleanup.", + "Section": [ + { + "TOCHeading": "Isolation and Evacuation", + "Description": "Information related to isolation and evacuation", + "Information": [ + { + "ReferenceNumber": 1, + "Reference": [ + "U.S. Department of Transportation, Transport Canada, and Secretariat of Communications and Transport of Mexico, with collaboration from Argentina's Centro de Información QuÃmica para Emergencias. 2016 Emergency Response Guidebook. https://www.phmsa.dot.gov/hazmat/outreach-training/erg (accessed April 26, 2016)." + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Excerpt from ERG Guide 131P [Flammable Liquids - Toxic]: As an immediate precautionary measure, isolate spill or leak area for at least 50 meters (150 feet) in all directions. SPILL: Increase, in the downwind direction, as necessary, the isolation distance shown above. FIRE: If tank, rail car or tank truck is involved in a fire, ISOLATE for 800 meters (1/2 mile) in all directions; also, consider initial evacuation for 800 meters (1/2 mile) in all directions. (ERG, 2016)" + } + ] + } + } + ] + }, + { + "TOCHeading": "Spillage Disposal", + "Description": "Procedures for Spillage Disposal", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Consult an expert! Remove all ignition sources. Ventilation. Personal protection: complete protective clothing including self-contained breathing apparatus. Do NOT let this chemical enter the environment. Do NOT wash away into sewer. Collect leaking and spilled liquid in sealable containers as far as possible. Absorb remaining liquid in sand or inert absorbent. Wash away remainder with plenty of water. Then store and dispose of according to local regulations.", + "Markup": [ + { + "Start": 399, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Disposal Methods", + "Description": "Disposal Methods for this chemical", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Value": { + "StringWithMarkup": [ + { + "String": "SRP: At the time of review, criteria for land treatment or burial (sanitary landfill) disposal practices are subject to significant revision. Prior to implementing land disposal of waste residue (including waste sludge), consult with environmental regulatory agencies for guidance on acceptable disposal practices." + } + ] + } + } + ] + }, + { + "TOCHeading": "Preventive Measures", + "Description": "Information on Preventive Measures", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2656" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "PRECAUTIONS FOR HANDLING REACTIVE UNSATURATED ALDEHYDES SUCH AS...METHACROLEIN...SHOULD BE SAME AS THOSE FOR OTHER HIGHLY ACTIVE EYE & PULMONARY IRRITANTS...", + "Markup": [ + { + "Start": 66, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/METHACROLEIN", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Handling and Storage", + "Description": "Handling and storage lists precautions for safe handling and storage, including incompatibilities.", + "Section": [ + { + "TOCHeading": "Nonfire Spill Response", + "Description": "Information for Nonfire Spill Response", + "Information": [ + { + "ReferenceNumber": 1, + "Reference": [ + "U.S. Department of Transportation, Transport Canada, and Secretariat of Communications and Transport of Mexico, with collaboration from Argentina's Centro de Información QuÃmica para Emergencias. 2016 Emergency Response Guidebook. https://www.phmsa.dot.gov/hazmat/outreach-training/erg (accessed April 26, 2016)." + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Excerpt from ERG Guide 131P [Flammable Liquids - Toxic]: Fully encapsulating, vapor-protective clothing should be worn for spills and leaks with no fire. ELIMINATE all ignition sources (no smoking, flares, sparks or flames in immediate area). All equipment used when handling the product must be grounded. Do not touch or walk through spilled material. Stop leak if you can do it without risk. Prevent entry into waterways, sewers, basements or confined areas. A vapor-suppressing foam may be used to reduce vapors. SMALL SPILL: Absorb with earth, sand or other non-combustible material and transfer to containers for later disposal. Use clean, non-sparking tools to collect absorbed material. LARGE SPILL: Dike far ahead of liquid spill for later disposal. Water spray may reduce vapor, but may not prevent ignition in closed spaces. (ERG, 2016)", + "Markup": [ + { + "Start": 761, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Safe Storage", + "Description": "Information for Safe Storage", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Fireproof. Separated from strong oxidants, acids, bases and food and feedstuffs. Cooled. Keep in the dark. Well closed. Keep under inert gas. Store only if stabilized. Provision to contain effluent from fire extinguishing." + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Exposure Control and Personal Protection", + "Description": "Exposure controls and personal protection list OSHA's Permissible Exposure Limits (PELs); Threshold Limit Values (TLVs); appropriate engineering controls; personal protective equipment (PPE) and more.", + "Section": [ + { + "TOCHeading": "Inhalation Risk", + "Description": "Inhalation Risk information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "A harmful contamination of the air can be reached very quickly on evaporation of this substance at 20 °C." + } + ] + } + } + ] + }, + { + "TOCHeading": "Effects of Short Term Exposure", + "Description": "Effects of Short Term Exposure information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "The substance is irritating to the eyes, skin and respiratory tract." + } + ] + } + } + ] + }, + { + "TOCHeading": "Effects of Long Term Exposure", + "Description": "Effects of Long Term Exposure information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Health effects of the substance have been investigated but none have been found" + } + ] + } + } + ] + }, + { + "TOCHeading": "Personal Protective Equipment (PPE)", + "Description": "Personal Protection and related information", + "Information": [ + { + "ReferenceNumber": 1, + "Reference": [ + "U.S. Department of Transportation, Transport Canada, and Secretariat of Communications and Transport of Mexico, with collaboration from Argentina's Centro de Información QuÃmica para Emergencias. 2016 Emergency Response Guidebook. https://www.phmsa.dot.gov/hazmat/outreach-training/erg (accessed April 26, 2016)." + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Excerpt from ERG Guide 131P [Flammable Liquids - Toxic]: Wear positive pressure self-contained breathing apparatus (SCBA). Wear chemical protective clothing that is specifically recommended by the manufacturer. It may provide little or no thermal protection. Structural firefighters' protective clothing provides limited protection in fire situations ONLY; it is not effective in spill situations where direct contact with the substance is possible. (ERG, 2016)" + } + ] + } + } + ] + }, + { + "TOCHeading": "Fire Prevention", + "Description": "Fire Prevention information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "NO open flames, NO sparks and NO smoking. Closed system, ventilation, explosion-proof electrical equipment and lighting. Do NOT use compressed air for filling, discharging, or handling. Use non-sparking handtools." + } + ] + } + } + ] + }, + { + "TOCHeading": "Exposure Prevention", + "Description": "Exposure Prevention information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "PREVENT GENERATION OF MISTS!" + } + ] + } + } + ] + }, + { + "TOCHeading": "Inhalation Prevention", + "Description": "Inhalation Prevention information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Use ventilation, local exhaust or breathing protection." + } + ] + } + } + ] + }, + { + "TOCHeading": "Skin Prevention", + "Description": "Skin Prevention information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Protective gloves. Protective clothing." + } + ] + } + } + ] + }, + { + "TOCHeading": "Eye Prevention", + "Description": "Eye Prevention", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Wear safety spectacles, face shield or eye protection in combination with breathing protection." + } + ] + } + } + ] + }, + { + "TOCHeading": "Ingestion Prevention", + "Description": "Ingestion Prevention information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Do not eat, drink, or smoke during work." + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Stability and Reactivity", + "Description": "Stability and reactivity lists chemical stability and possibility of hazardous reactions. (See also Stability section under the Experimental Properties if available)", + "Section": [ + { + "TOCHeading": "Air and Water Reactions", + "Description": "Special alerts if the chemical reacts with air, water, or moisture.", + "Information": [ + { + "ReferenceNumber": 1, + "Value": { + "StringWithMarkup": [ + { + "String": "Highly flammable. Soluble in water.", + "Markup": [ + { + "Start": 29, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Reactive Group", + "Description": "List of reactive groups that the chemical is assigned to, based on its known chemistry. Reactive groups are categories of chemicals that react in similar ways because their chemical structures are similar.", + "Information": [ + { + "ReferenceNumber": 1, + "Value": { + "StringWithMarkup": [ + { + "String": "Aldehydes" + }, + { + "String": "Acrylates and Acrylic Acids" + }, + { + "String": "Polymerizable Compounds" + } + ] + } + } + ] + }, + { + "TOCHeading": "Reactivity Alerts", + "Description": "Special alerts if the chemical is especially reactive", + "Information": [ + { + "ReferenceNumber": 1, + "Value": { + "StringWithMarkup": [ + { + "String": "Highly Flammable" + }, + { + "String": "Polymerizable" + } + ] + } + } + ] + }, + { + "TOCHeading": "Reactivity Profile", + "Description": "Generic reactivity information from CAMEO.", + "Information": [ + { + "ReferenceNumber": 1, + "Value": { + "StringWithMarkup": [ + { + "String": "METHACRYLALDEHYDE is an aldehyde. Aldehydes are frequently involved in self-condensation or polymerization reactions. These reactions are exothermic; they are often catalyzed by acid. Aldehydes are readily oxidized to give carboxylic acids. Flammable and/or toxic gases are generated by the combination of aldehydes with azo, diazo compounds, dithiocarbamates, nitrides, and strong reducing agents. Aldehydes can react with air to give first peroxo acids, and ultimately carboxylic acids. These autoxidation reactions are activated by light, catalyzed by salts of transition metals, and are autocatalytic (catalyzed by the products of the reaction). The addition of stabilizers (antioxidants) to shipments of aldehydes retards autoxidation.", + "Markup": [ + { + "Start": 0, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/METHACRYLALDEHYDE", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Transport Information", + "Description": "Transport Information lists DOT requirement and related information. More information can be found in the Emergency Response Guidebook page.", + "URL": "https://pubchem.ncbi.nlm.nih.gov/erg/", + "Section": [ + { + "TOCHeading": "DOT Emergency Guidelines", + "Description": "DOT (Department of Transportation) Emergency Guidelines", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "U.S. Department of Transportation. 2004 Emergency Response Guidebook. A Guide book for First Responders During the Initial Phase of a Dangerous Goods/Hazardous Materials Incident. Washington, D.C. 2004" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "/GUIDE 131P: FLAMMABLE LIQUIDS-TOXIC/ Health: TOXIC; may be fatal if inhaled, ingested or absorbed through skin. Inhalation or contact with some of these materials will irritate or burn skin and eyes. Fire will produce irritating, corrosive and/or toxic gases. Vapors may cause dizziness or suffocation. Runoff from fire control or dilution water may cause pollution. /Methacrylaldehyde; Methacrylaldehyde, inhibited; Methacrylaldehyde, stabilized/", + "Markup": [ + { + "Start": 341, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 369, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 388, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 418, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "U.S. Department of Transportation. 2004 Emergency Response Guidebook. A Guide book for First Responders During the Initial Phase of a Dangerous Goods/Hazardous Materials Incident. Washington, D.C. 2004" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "/GUIDE 131P: FLAMMABLE LIQUIDS-TOXIC/ Fire or Explosion: HIGHLY FLAMMABLE: Will be easily ignited by heat, sparks or flames. Vapors may form explosive mixtures with air. Vapors may travel to source of ignition and flash back. Most vapors are heavier than air. They will spread along ground and collect in low or confined areas (sewers, basements, tanks). Vapor explosion and poison hazard indoors, outdoors or in sewers. Those substances designated with a \"P\" may polymerize explosively when heated or involved in a fire. Runoff to sewer may create fire or explosion hazard. Containers may explode when heated. Many liquids are lighter than water. /Methacrylaldehyde; Methacrylaldehyde, inhibited; Methacrylaldehyde, stabilized/", + "Markup": [ + { + "Start": 642, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 650, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 669, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 699, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "U.S. Department of Transportation. 2004 Emergency Response Guidebook. A Guide book for First Responders During the Initial Phase of a Dangerous Goods/Hazardous Materials Incident. Washington, D.C. 2004" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "/GUIDE 131P: FLAMMABLE LIQUIDS-TOXIC/ Public Safety: CALL Emergency Response Telephone Number ... . As an immediate precautionary measure, isolate spill or leak area for at least 50 meters (150 feet) in all directions. Keep unauthorized personnel away. Stay upwind. Keep out of low areas. Ventilate closed spaces before entering. /Methacrylaldehyde; Methacrylaldehyde, inhibited; Methacrylaldehyde, stabilized/", + "Markup": [ + { + "Start": 331, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 350, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 380, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "U.S. Department of Transportation. 2004 Emergency Response Guidebook. A Guide book for First Responders During the Initial Phase of a Dangerous Goods/Hazardous Materials Incident. Washington, D.C. 2004" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "/GUIDE 131P: FLAMMABLE LIQUIDS-TOXIC/ Protective Clothing: Wear positive pressure self-contained breathing apparatus (SCBA). Wear chemical protective clothing that is specifically recommended by the manufacturer. It may provide little or no thermal protection. Structural firefighters' protective clothing provides limited protection in fire situations ONLY; it is not effective in spill situations where direct contact with the substance is possible. /Methacrylaldehyde; Methacrylaldehyde, inhibited; Methacrylaldehyde, stabilized/", + "Markup": [ + { + "Start": 453, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 472, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 502, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Value": { + "StringWithMarkup": [ + { + "String": "For more DOT Emergency Guidelines (Complete) data for METHACROLEIN (8 total), please visit the HSDB record page.", + "Markup": [ + { + "Start": 95, + "Length": 16, + "URL": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/182#section=DOT-Emergency-Guidelines-(Complete)" + }, + { + "Start": 54, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/METHACROLEIN", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "DOT ID and Guide", + "Description": "U.S. Department of Transportation (DOT) Identification number and the corresponding Guide number. The DOT ID is also the UN/NA Number. More information about the DOT ID/UN/NA number and the guide number can be found in the Emergency Response Guidebook page.", + "URL": "https://pubchemdocs.ncbi.nlm.nih.gov/erg/", + "Information": [ + { + "ReferenceNumber": 8, + "Name": "DOT ID and Guide", + "URL": "https://www.phmsa.dot.gov/sites/phmsa.dot.gov/files/2020-08/ERG2020-WEB.pdf", + "Value": { + "StringWithMarkup": [ + { + "String": "2396 131P" + } + ] + } + } + ] + }, + { + "TOCHeading": "Shipping Name/ Number DOT/UN/NA/IMO", + "Description": "Shipping Name/ Number DOT/UN/NA/IMO", + "Information": [ + { + "ReferenceNumber": 17, + "Value": { + "StringWithMarkup": [ + { + "String": "UN 2396; Methacrylaldehyde, stabilized", + "Markup": [ + { + "Start": 9, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Value": { + "StringWithMarkup": [ + { + "String": "IMO 3.2; Methacrylaldehyde, stabilized", + "Markup": [ + { + "Start": 9, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Shipment Methods and Regulations", + "Description": "Shipment Methods and Regulations", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "49 CFR 171.2 (7/1/96)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "No person may /transport,/ offer or accept a hazardous material for transportation in commerce unless that person is registered in conformance ... and the hazardous material is properly classed, described, packaged, marked, labeled, and in condition for shipment as required or authorized by ... /the hazardous materials regulations (49 CFR 171-177)./" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "International Air Transport Association. Dangerous Goods Regulations. 47th Edition. Montreal, Quebec Canada. 2006., p. 216" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "The International Air Transport Association (IATA) Dangerous Goods Regulations are published by the IATA Dangerous Goods Board pursuant to IATA Resolutions 618 and 619 and constitute a manual of industry carrier regulations to be followed by all IATA Member airlines when transporting hazardous materials." + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "International Maritime Organization. International Maritime Dangerous Goods Code. London, UK. 2004., p. 113" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "The International Maritime Dangerous Goods Code lays down basic principles for transporting hazardous chemicals. Detailed recommendations for individual substances and a number of recommendations for good practice are included in the classes dealing with such substances. A general index of technical names has also been compiled. This index should always be consulted when attempting to locate the appropriate procedures to be used when shipping any substance or article." + } + ] + } + } + ] + }, + { + "TOCHeading": "DOT Label", + "Description": "U.S. Department of Transportation (DOT) hazard warning label for the chemical (such as flammable liquid or corrosive). This label must be displayed on shipped packages, railroad tank cars, and tank trucks according to specifications described in 49 CFR 172.", + "Information": [ + { + "ReferenceNumber": 1, + "Value": { + "StringWithMarkup": [ + { + "String": "Flammable Liquid Poison" + } + ] + } + } + ] + }, + { + "TOCHeading": "Packaging and Labelling", + "Description": "Packaging and Labelling information", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Unbreakable packaging. Put breakable packaging into closed unbreakable container. Do not transport with food and feedstuffs." + } + ] + } + } + ] + }, + { + "TOCHeading": "UN Classification", + "Description": "UN (United Nations) hazard identification system", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "UN Hazard Class: 3; UN Subsidiary Risks: 6.1; UN Pack Group: II" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Regulatory Information", + "Description": "Related Regulatory Information", + "Section": [ + { + "TOCHeading": "TSCA Requirements", + "Description": "The Toxic Substance Control Act (TSCA) gives EPA authority to issue data development regulations that require manufacturers and processors of existing chemicals to test their chemicals for health and environmental effects.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "40 CFR 712.30 (7/1/94)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Section 8(a) of TSCA requires manufacturers of this chemical substance to report preliminary assessment information concerned with production, use, and exposure to EPA as cited in the preamble in 51 FR 41329.", + "Markup": [ + { + "Start": 16, + "Length": 4, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/TSCA", + "Type": "PubChem Internal Link", + "Extra": "CID-110408" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "40 CFR 716.120 (7/1/94)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Pursuant to section 8(d) of TSCA, EPA promulgated a model Health and Safety Data Reporting Rule. The section 8(d) model rule requires manufacturers, importers, and processors of listed chemical substances and mixtures to submit to EPA copies and lists of unpublished health and safety studies. 2-methyl-2-propenal is included on this list.", + "Markup": [ + { + "Start": 28, + "Length": 4, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/TSCA", + "Type": "PubChem Internal Link", + "Extra": "CID-110408" + }, + { + "Start": 294, + "Length": 19, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/2-methyl-2-propenal", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "FIFRA Requirements", + "Description": "The Federal Insecticide, Fungicide, and Rodenticide Act (FIFRA) allows for federal control of pesticide distribution, sale and use.", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Value": { + "StringWithMarkup": [ + { + "String": "//fifr-a//" + } + ] + } + } + ] + } + ] + } + ] + }, + { + "TOCHeading": "Toxicity", + "Description": "Toxicity information related to this record, includes routes of exposure; related symptoms, acute and chronic effects; numerical measures of toxicity.", + "Section": [ + { + "TOCHeading": "Toxicological Information", + "Description": "Toxicological Information", + "Section": [ + { + "TOCHeading": "NIOSH Toxicity Data", + "Description": "Toxicity data summary from NIOSH", + "Information": [ + { + "ReferenceNumber": 50, + "Name": "NIOSH Toxicity Data", + "Value": { + "ExternalTableName": "niosh" + } + } + ] + }, + { + "TOCHeading": "Exposure Routes", + "Description": "The way people or other living organisms come into contact with a hazardous substance", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "The substance can be absorbed into the body by inhalation of its vapour, through the skin and by ingestion." + } + ] + } + } + ] + }, + { + "TOCHeading": "Inhalation Symptoms", + "Description": "Symptoms of exposure (inhalation, skin, eyes, ingestion) routes by which the chemical can be absorbed into the body", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Cough. Sore throat. Burning sensation." + } + ] + } + } + ] + }, + { + "TOCHeading": "Skin Symptoms", + "Description": "Symptoms of exposure (inhalation, skin, eyes, ingestion) routes by which the chemical can be absorbed into the body", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Redness. Pain." + } + ] + } + } + ] + }, + { + "TOCHeading": "Eye Symptoms", + "Description": "Symptoms of exposure (inhalation, skin, eyes, ingestion) routes by which the chemical can be absorbed into the body", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "Redness. Pain. Burns. Watering of the eyes." + } + ] + } + } + ] + }, + { + "TOCHeading": "Acute Effects", + "Description": "The results from acute animal tests and/or acute human studies are presented in this section. Acute animal studies consist of LD50 and LC50 tests, which present the median lethal dose (or concentration) to the animals. Acute human studies usually consist of case reports from accidental poisonings or industrial accidents. These case reports often help to define the levels at which acute toxic effects are seen in humans.", + "Information": [ + { + "ReferenceNumber": 6, + "Value": { + "ExternalTableName": "chemidplus", + "ExternalTableNumRows": 3 + } + } + ] + }, + { + "TOCHeading": "Human Toxicity Excerpts", + "Description": "Human Toxicity Excerpts", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "ARCH OTOLARYNGOL 93(5) 496 (1971)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "METHACROLEIN WAS LESS CILIOSTATIC (IRRITATING TO TRACHEAL MUCOSA) THAN ACROLEIN.", + "Markup": [ + { + "Start": 0, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/METHACROLEIN", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 71, + "Length": 8, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/ACROLEIN", + "Type": "PubChem Internal Link", + "Extra": "CID-7847" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2633" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "The low molecular weight aldehydes, the halogenated aliphatic aldehydes, and the unsaturated aldehydes are particularly irritating. The mucus membranes of the nasal and oral passages and the upper respiratory tract are affected, producing a burning sensation, an increased ventilation rate, bronchial constriction, choking, and coughing. The eyes tear, and a burning sensation is noted on the skin of the face. During low exposures, the initial discomfort may abate after 5 to 10 minutes but will recur if exposure is resumed after an interruption. /Aldehydes/" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Hawley, G.G. The Condensed Chemical Dictionary. 9th ed. New York: Van Nostrand Reinhold Co., 1977., p. 553" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "...STRONG IRRITANT." + } + ] + } + } + ] + }, + { + "TOCHeading": "Non-Human Toxicity Excerpts", + "Description": "Non-Human Toxicity Excerpts", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2651" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "DEATH OCCURRED IN 5 OUT OF 6 RATS EXPOSED FOR 4 HR TO 250 PPM. WHEN RABBITS WERE EXPOSED TO METHACROLEIN, THERE WAS SLIGHT IRRITATION OF SKIN, BUT SEVERE IRRITATION OF EYES. /FROM TABLE/", + "Markup": [ + { + "Start": 92, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/METHACROLEIN", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2651" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Inhalation toxicity: rat, 250 ppm for 4 hours; mortality 5/6. /From table/" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2651" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Irritant effects to rabbits: slight skin irritant, severe eye irritant. /From table/" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Grant, W.M. Toxicology of the Eye. 3rd ed. Springfield, IL: Charles C. Thomas Publisher, 1986., p. 1044" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "The compound was tested externally on the eyes of rabbits, and, according to the degree of injury observed after 24 hours, rated on a scale of 1 to 10. The most severely injurious substances have been rated 10. Methacrylaldehyde rated 9 on rabbit eyes.", + "Markup": [ + { + "Start": 211, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrylaldehyde", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Value": { + "StringWithMarkup": [ + { + "String": "For more Non-Human Toxicity Excerpts (Complete) data for METHACROLEIN (6 total), please visit the HSDB record page.", + "Markup": [ + { + "Start": 98, + "Length": 16, + "URL": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/182#section=Non-Human-Toxicity-Excerpts-(Complete)" + }, + { + "Start": 57, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/METHACROLEIN", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Non-Human Toxicity Values", + "Description": "Non-Human Toxicity Values", + "DisplayControls": { + "ShowAtMost": 5 + }, + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2651" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "LD50 Rat oral 0.14 g/kg /From table/" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "Clayton, G. D. and F. E. Clayton (eds.). Patty's Industrial Hygiene and Toxicology: Volume 2A, 2B, 2C: Toxicology. 3rd ed. New York: John Wiley Sons, 1981-1982., p. 2651" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "LD50 Rabbit skin 0.43 g/kg /From table/" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Ecological Information", + "Description": "This section provides eco-related toxicity information.", + "Section": [ + { + "TOCHeading": "ICSC Environmental Data", + "Description": "ICSC Environmental Data", + "Information": [ + { + "ReferenceNumber": 19, + "Value": { + "StringWithMarkup": [ + { + "String": "The substance is very toxic to aquatic organisms. It is strongly advised not to let the chemical enter into the environment." + } + ] + } + } + ] + }, + { + "TOCHeading": "Environmental Fate/Exposure Summary", + "Description": "Environmental Fate/Exposure Summary", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrolein's former production and use in copolymers, resins, and as an intermediate for the production of methacrylonitrile or methacrylic acid may have resulted in its release to the environment through various waste streams. It has been detected in the emissions from automobile exhaust, liquid floor wax, steel protective paints, and from trees. It also has been identified in urban and rural air samples, Chickpea seed, and in human adipose tissue. If released to soil, methacrolein will have very high mobility. Volatilization of methacrolein will be important from moist and dry soil surfaces. Insufficient data are available to determine the rate or importance of biodegradation of methacrolein in soil or water. If released to water, methacrolein may not adsorb to suspended solids and sediment. Methacrolein may volatilize from water surfaces with estimated half-lives for a model river and model lake of about 5 hours and 4 days, respectively. An estimated BCF value of 1.4 suggests that methacrolein will not bioconcentrate in aquatic organisms. If released to the atmosphere, methacrolein will exist in the vapor phase. Vapor-phase methacrolein is degraded in the atmosphere by reaction with photochemically produced hydroxyl radicals with an estimated half-life of about 11.5 hours. Vapor-phase methacrolein is also degraded in the atmosphere by reaction with ozone with an estimated half-life of about 10.5 days. Methacrolein reacts very quickly in air with oxygen forming peroxides and acids. Methacrolein is formed from the gas-phase reaction of ozone with isoprene. Exposure to methacrolein may occur through dermal contact and inhalation. (SRC)", + "Markup": [ + { + "Start": 0, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 109, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrylonitrile", + "Type": "PubChem Internal Link", + "Extra": "CID-31368" + }, + { + "Start": 130, + "Length": 16, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrylic%20acid", + "Type": "PubChem Internal Link", + "Extra": "CID-4093" + }, + { + "Start": 477, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 538, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 692, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 716, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 738, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 745, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 807, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 840, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 1001, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 1091, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 1147, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 1311, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 1376, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/ozone", + "Type": "PubChem Internal Link", + "Extra": "CID-24823" + }, + { + "Start": 1430, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 1475, + "Length": 6, + "URL": "https://pubchem.ncbi.nlm.nih.gov/element/Oxygen", + "Type": "PubChem Internal Link", + "Extra": "Element-Oxygen" + }, + { + "Start": 1511, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 1565, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/ozone", + "Type": "PubChem Internal Link", + "Extra": "CID-24823" + }, + { + "Start": 1576, + "Length": 8, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/isoprene", + "Type": "PubChem Internal Link", + "Extra": "CID-6557" + }, + { + "Start": 1598, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Artificial Pollution Sources", + "Description": "Artificial Sources", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "ZINN ET AL; THE SMOKE HAZARDS RESULTING FROM THE BURNING OF SHIPBOARD MATERIALS USED BY THE US NAVY; REPORT; ISS NRL-8414; (ORDER NO AD-A088091) 64 PP (1980)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "ONE OF THE COMPOUNDS IDENTIFIED IN THE SMOKE PRODUCED BY BURNING OF SHIPBOARD MATERIAL WAS METHACROLEIN.", + "Markup": [ + { + "Start": 91, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/METHACROLEIN", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "VERSCHUEREN. HDBK ENVIRON DATA ORG CHEM 1983 p.814" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Found in exhaust from API #7 gasoline in concentrations of 1.6 ppm" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "VERSCHUEREN. HDBK ENVIRON DATA ORG CHEM 1983 p.814" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Found in exhaust from API #8 gasoline in concentrations of 0.9 ppm" + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Lewis RJSr; Hawley's Condensed Chemical Dictionary. 12th ed. NY,NY: Van Nostrand Rheinhold Co pg 749 (1993) (2) Hess LG et al; Kirk-Othmer Encycl Chem Technol 3rd ed. NY,NY: John Wiley and Sons 1: 277-97 (1978)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrolein's production and use in copolymers(1), resins(1), and as an intermediate for the production of methacrylonitrile or methacrylic acid(2) may result in its release to the environment through various waste streams(SRC).", + "Markup": [ + { + "Start": 0, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 108, + "Length": 17, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrylonitrile", + "Type": "PubChem Internal Link", + "Extra": "CID-31368" + }, + { + "Start": 129, + "Length": 16, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrylic%20acid", + "Type": "PubChem Internal Link", + "Extra": "CID-4093" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Environmental Fate", + "Description": "Environmental Fate", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "(1) Swann RL et al; Res Rev 85: 23 (1983) (2) Ohara T et al; in Ullmann's Encycl Indust Chem 5th ed., Gerhartz W, ed. Deerfield Beach, FL: VCH Publ A1: 149-60 (1985) (3) Lyman WJ et al; Handbook of Chemical Property Estimation Methods. Washington DC: Amer Chem Soc pp. 4-9 (1990) (4) Yaws CL; Handbook of Vapor Pressure Vol 1, C1-C4 Compounds. Houston, TX: Gulf Publ. Co. p. 345 (1994)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "TERRESTRIAL FATE: Based on a recommended classification scheme(1), an estimated Koc value of 11.3(SRC), determined from an experimental water solubility(2) and a recommended regression-derived equation(3), indicates that methacrolein will have very high mobility in soil(SRC). Volatilization of methacrolein may be important from moist soil surfaces(SRC) given an estimated Henry's Law constant of 2.86X10-4 atm-cu m/mole, calculated from experimental values of vapor pressure(4) and water solubility(2), and from dry soil surfaces(SRC) based on an experimental vapor pressure of 155 mm Hg(4). Insufficient data are available to determine the rate or importance of biodegradation of methacrolein in soil(SRC).", + "Markup": [ + { + "Start": 136, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 221, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 295, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 484, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 683, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "(1) Swann RL et al; Res Rev 85: 23 (1983) (2) Ohara T et al; in Ullmann's Encycl Indust Chem 5th ed., Gerhartz W, ed. Deerfield Beach, FL: VCH Publ A1: 149-60 (1985) (3) Lyman WJ et al; Handbook of Chemical Property Estimation Methods. Washington DC: Amer Chem Soc pp. 4-9, 5-4, 5-10, 15-1 to 15-29 (1990) (4) Yaws CL; Handbook of Vapor Pressure Vol 1, C1-C4 Compounds. Houston, TX: Gulf Publ. Co. p. 347 (1994) (5) Franke C et al; Chemosphere 29: 1501-14 (1994)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "AQUATIC FATE: Based on a recommended classification scheme(1), an estimated Koc value of 11.3(SRC), determined from an experimental water solubility(2) and a recommended regression-derived equation(3), indicates that methacrolein may not adsorb to suspended solids and sediment(SRC) in the water. Methacrolein may volatilize from water surfaces based on an estimated Henry's Law constant of 2.86X10-4 atm-cu m/mole(SRC), calculated from experimental values of vapor pressure(4) and water solubility(2). Estimated half-lives for a model river and model lake are 5 hours and 4 days, respectively(3,SRC). An estimated BCF value of 1.4(3,SRC), from an experimental water solubility(2), suggests that methacrolein will not bioconcentrate in aquatic organisms(SRC) according to a recommended classification scheme(5). Insufficient data are available to determine the rate or importance of biodegradation of methacrolein in water(SRC).", + "Markup": [ + { + "Start": 132, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 217, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 290, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 297, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 330, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 482, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 661, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 696, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 901, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 917, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Bidleman TF; Environ Sci Technol 22: 361-367 (1988) (2) Yaws CL; Handbook of Vapor Pressure Vol 1, C1-C4 Compounds. Houston, TX: Gulf Publ. Co. p. 347 (1994) (3) Atkinson R et al; Kinetics and Mechanisms of the Gas Phase Reactions of the Hydroxyl Radicals with Organic Compounds. J Phys Chem Ref Data Monograph No 1 (1989) (4) Atkinson R et al; Atmospheric Fates of Organic Chemicals: Prediction of Ozone and Hydroxyl Radical Reaction Rates and Mechanisms: USEPA-600/3-85-063 (NTIS PB85-241-529) Riverside, CA: Statewide Air Pollut Res Ctr p 86 (1985) (5) Hess LG et al; Kirk-Othmer Encycl Chem Technol 3rd ed. NY,NY: John Wiley and Sons 1: 277-97 (1978) (6) Aschmann SM, Atkinson R; Environ Sci Technol 26: 1539-42 (1994)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "ATMOSPHERIC FATE: According to a suggested classification scheme(1), an experimental vapor pressure of 155 mm Hg at 25 °C(2) indicates that methacrolein will exist in the vapor phase in the ambient atmosphere. Vapor-phase methacrolein is degraded in the atmosphere by reaction with photochemically produced hydroxyl radicals(SRC); the half-life for this reaction in air is estimated to be about 11.5 hours(3,SRC). Vapor-phase methacrolein is also degraded in the atmosphere by reaction with ozone(SRC); the half-life for this reaction in air is estimated to be about 10.5 days(4,SRC). Methacrolein reacts very quickly in air with oxygen forming peroxides and acids(5). Methacrolein is formed from the gas-phase reaction of ozone with isoprene with a formation yield of 0.387(6).", + "Markup": [ + { + "Start": 140, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 222, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 426, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 491, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/ozone", + "Type": "PubChem Internal Link", + "Extra": "CID-24823" + }, + { + "Start": 585, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 630, + "Length": 6, + "URL": "https://pubchem.ncbi.nlm.nih.gov/element/Oxygen", + "Type": "PubChem Internal Link", + "Extra": "Element-Oxygen" + }, + { + "Start": 669, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 723, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/ozone", + "Type": "PubChem Internal Link", + "Extra": "CID-24823" + }, + { + "Start": 734, + "Length": 8, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/isoprene", + "Type": "PubChem Internal Link", + "Extra": "CID-6557" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Environmental Abiotic Degradation", + "Description": "Environmental Abiotic Degradation", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Atkinson R et al; Kinetics and Mechanisms of the Gas Phase Reactions of the Hydroxyl Radicals with Organic Compounds. Journal of Physical and Chemical Ref Data Monograph No 1 (1989) (2) Atkinson R et al; Atmospheric Fates of Organic Chemicals: Prediction of Ozone and Hydroxyl Radical Reaction Rates and Mechanisms: USEPA-600/3-85-063 (NTIS PB85-241-529) Riverside, CA: Statewide Air Pollut Res Ctr p 86 (1985) (3) Hess LG et al; Kirk-Othmer Encycl Chem Technol 3rd ed. NY,NY: John Wiley and Sons 1: 277-97 (1978) (4) Aschmann SM, Atkinson R; Environ Sci Technol 26: 1539-42 (1994)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "The rate constant for the vapor-phase reaction of methacrolein with photochemically produced hydroxyl radicals has been experimentally determined to be 3.35X10-11 cu cm/molecule-sec at 25 °C(1). This corresponds to an atmospheric half-life of about 11.5 hours at an atmospheric concentration of 5X10+5 hydroxyl radicals per cu cm(1,SRC). The rate constant for the vapor-phase reaction of methacrolein with ozone has been experimentally determined to be 1.12X10-18 cu cm/molecule-sec at 25 °C(2). This corresponds to an atmospheric half-life of about 10.2 days at an atmospheric concentration of 7X10+11 ozone molecules per cu cm(2,SRC). Methacrolein reacts very quickly in air with oxygen forming peroxides and acids(3). Methacrolein is formed from the gas-phase reaction of ozone with isoprene with a formation yield of 0.387 at 296 deg K at 740 torr total pressure(4).", + "Markup": [ + { + "Start": 50, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 388, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 406, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/ozone", + "Type": "PubChem Internal Link", + "Extra": "CID-24823" + }, + { + "Start": 603, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/ozone", + "Type": "PubChem Internal Link", + "Extra": "CID-24823" + }, + { + "Start": 637, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 682, + "Length": 6, + "URL": "https://pubchem.ncbi.nlm.nih.gov/element/Oxygen", + "Type": "PubChem Internal Link", + "Extra": "Element-Oxygen" + }, + { + "Start": 721, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 775, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/ozone", + "Type": "PubChem Internal Link", + "Extra": "CID-24823" + }, + { + "Start": 786, + "Length": 8, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/isoprene", + "Type": "PubChem Internal Link", + "Extra": "CID-6557" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Environmental Bioconcentration", + "Description": "Environmental Bioconcentration", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "(1) Ohara T et al; in Ullmann's Encycl Indust Chem 5th ed., Gerhartz W, ed. Deerfield Beach, FL: VCH Publ A1: 149-60 (1985) (2) Lyman WJ et al; Handbook of Chemical Property Estimation Methods. Washington DC: Amer Chem Soc pp. 5-4, 5-10 (1990) (3) Franke C et al; Chemosphere 29: 1501-14 (1994)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "An estimated BCF value of 1.4 was calculated for methacrolein(SRC), using an experimental water solubility of 50,000 mg/L(1) and a recommended regression-derived equation(2). According to a recommended classification scheme(3), this BCF value suggests that bioconcentration in aquatic organisms will not be an important fate process(SRC).", + "Markup": [ + { + "Start": 49, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 90, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Soil Adsorption/Mobility", + "Description": "Soil Adsorption/Mobility", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Collin G, Hoke H; in Ullmann's Encycl Indut Chem 5th ed., Gerhartz W, ed. Deerfield Beach, FL: VCH Publ A1: 149-60 (1985) (2) Lyman WJ et al; Handbook of Chemical Property Estimation Methods. Washington DC: Amer Chem Soc pp. 4-9 (1990) (3) Swann RL et al; Res Rev 85: 23 (1983)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "The Koc of methacrolein is estimated as approximately 11.3(SRC), using an experimental water solubility of 50,000 mg/L(1) and a regression-derived equation(2,SRC). According to a recommended classification scheme(3), this estimated Koc value suggests that methacrolein has very high mobility in soil(SRC).", + "Markup": [ + { + "Start": 11, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 87, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 256, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Volatilization from Water/Soil", + "Description": "Volatilization from Water/Soil", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "QC REVIEWED", + "Reference": [ + "(1) Yaws CL; Handbook of Vapor Pressure Vol 1, C1-C4 Compounds. Houston, TX: Gulf Publ. Co. p. 347 (1994) (2) Ohara T et al; in Ullmann's Encycl Indut Chem 5th ed., Gerhartz W, ed. Deerfield Beach, FL: VCH Publ A1: 149-60 (1985) (3) Lyman WJ et al; Handbook of Chemical Property Estimation Methods. Washington DC: Amer Chem Soc pp. 15-1 to 15-29 (1990)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "The Henry's Law constant for methacrolein is estimated as 1.9X10-4 atm-cu m/mole(SRC) from its experimental values for vapor pressure, 155 mm Hg(1), and water solubility, 50,000 mg/l(2). This value indicates that methacrolein will volatilize from water surfaces(3,SRC). Based on this Henry's Law constant, the volatilization half-life from a model river (1 m deep, flowing 1 m/sec, wind velocity of 3 m/sec) is estimated as approximately 5 hours(3,SRC). The volatilization half-life from a model lake (1 m deep, flowing 0.05 m/sec, wind velocity of 0.5 m/sec) is estimated as approximately 4 days(3,SRC). Methacrolein's high vapor pressure(1) and Henry's Law constant(1,2,SRC) indicate that volatilization from dry and moist soil may occur(SRC).", + "Markup": [ + { + "Start": 29, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 153, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 213, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 247, + "Length": 5, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/water", + "Type": "PubChem Internal Link", + "Extra": "CID-962" + }, + { + "Start": 605, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Effluent Concentrations", + "Description": "Effluent Concentrations", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Hampton CV et al; Environ Sci Technol 16: 287-98 (1982) (2) Hodgkin JH et al; J Macromol Sci Chem A17: 35-44 (1982) (3) Kaiser EW; Environ Sci Technol 27: 1440-7 (1993) (4) Knoppel H, Schauenburg H; Environ Intl 15: 413-8 (1989) (5) Siegel WO et al; J Air Waste Manage Ass 42: 912-20 (1992)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrolein has been reported to be released from gasoline exhaust(1). Methacrolein is formed from burning polyethylene which may occur in fire situations(2). Methacrolein emissions from a single-cylinder, production-type engine using isooctane fuel were 21 and less than 1 mole fraction with a 0.9 and 1.15 fuel-air equivalence ratio, respectively(3). Methacrolein has been detected as an emission from liquid floor wax(4). Methacrolein made up 1.6% of the total hydrocarbons released from a pulse flame combustor using methyl-t-butyl ether as fuel(5).", + "Markup": [ + { + "Start": 0, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 72, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 160, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 236, + "Length": 9, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/isooctane", + "Type": "PubChem Internal Link", + "Extra": "CID-10907" + }, + { + "Start": 354, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 426, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + }, + { + "Start": 522, + "Length": 20, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methyl-t-butyl%20ether", + "Type": "PubChem Internal Link", + "Extra": "CID-15413" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Atmospheric Concentrations", + "Description": "Atmospheric Concentrations", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Jonsson A et al; Environ Intl 11: 383-92 (1985)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "URBAN/SUBURBAN: Air samples from four urban sites in Stockholm contained methacrolein at the following average concentrations: 0.71, 0.19, 0.11, and 0.13 ppb(1).", + "Markup": [ + { + "Start": 73, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + }, + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Jonsson A et al; Environ Intl 11: 383-92 (1985)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "RURAL/REMOTE: In a rural site, 12 km outside of Stockholm, the average methacrolein concentration was 0.06 ppb(1).", + "Markup": [ + { + "Start": 71, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Food Survey Values", + "Description": "Food Survey Values", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Rembold H et al; J Agric Food Chem 37: 658-62 (1989)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrolein has been qualitatively detected as a volatile component of Chickpea (Cicer arietinum L) seed(1).", + "Markup": [ + { + "Start": 0, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Plant Concentrations", + "Description": "Plant Concentrations", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Isidorov VA et al; Atmos Environ 19: 1-8 (1985)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrolein is emitted from Bay-leaved Willow, Aspen, Balsam poplar, European oak, Scots pine, and European larch(1).", + "Markup": [ + { + "Start": 0, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Other Environmental Concentrations", + "Description": "Other Environmental Concentrations", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Henriks-Eckerman ML et al; Am Ind Hyg Assoc J 51: 241-44 (1990)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrolein is released upon thermal degradation of steel protective paints (350 °C) at the following amounts: from primers, 4, 1, and 7 mg/cu m (special, chlorinated rubber and alkyds); and finishing paints, 10 mg/cu m (alkyd)(1).", + "Markup": [ + { + "Start": 0, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Probable Routes of Human Exposure", + "Description": "Probable Routes of Human Exposure", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Hess LG et al; Kirk-Othmer Encycl Chem Technol 3rd ed. NY,NY: John Wiley and Sons 1: 277-97 (1978)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Exposure to methacrolein may occur through dermal contact and inhalation(1).", + "Markup": [ + { + "Start": 12, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "Body Burden", + "Description": "Body Burdens", + "Information": [ + { + "ReferenceNumber": 17, + "Description": "PEER REVIEWED", + "Reference": [ + "(1) Onstot JD et al; Characterization of HRGC/MS Unidentified Peaks from the Broad Scan Analysis of the FY82 NHATS Composites. MRI Project No 8823-AO1 Work Assignment No 23 Midwest Research Inst: USEPA pp 56 (1987)" + ], + "Value": { + "StringWithMarkup": [ + { + "String": "Methacrolein has been qualitatively detected in one out of 12 samples of human adipose tissue from a 0-14 age group in the Southern Region(1).", + "Markup": [ + { + "Start": 0, + "Length": 12, + "URL": "https://pubchem.ncbi.nlm.nih.gov/compound/Methacrolein", + "Type": "PubChem Internal Link", + "Extra": "CID-6562" + } + ] + } + ] + } + } + ] + } + ] + } + ] + }, + { + "TOCHeading": "Literature", + "Description": "Literature citation references mainly refers to regular publications such as journal articles, etc.", + "URL": "https://pubchemdocs.ncbi.nlm.nih.gov/literature", + "Section": [ + { + "TOCHeading": "NLM Curated PubMed Citations", + "Description": "The \"NLM Curated PubMed Citations\" section links to all PubMed records that are tagged with the same MeSH term that has been associated with a particular compound.", + "Information": [ + { + "ReferenceNumber": 54, + "URL": "https://www.ncbi.nlm.nih.gov/sites/entrez?LinkName=pccompound_pubmed_mesh&db=pccompound&cmd=Link&from_uid=6562", + "Value": { + "Boolean": [ + true + ] + } + } + ] + }, + { + "TOCHeading": "Springer Nature References", + "Description": "Literature references related to scientific contents from Springer Nature journals and books. These references have been ranked automatically by an algorithm which calculates the relevance for each substance in a Springer Nature document. It is based on: 1. the TF-IDF, adapted to chemical structures, 2. location information in the text (e.g. title, abstract, keywords), and 3. the document size. Springer Nature aims to provide only high qualitative and relevant content but references of lower relevance aren't withheld as they might contain also very useful information", + "URL": "https://group.springernature.com/gp/group/aboutus", + "Information": [ + { + "ReferenceNumber": 48, + "Name": "Springer Nature References", + "Value": { + "ExternalTableName": "springernature" + } + } + ] + }, + { + "TOCHeading": "Thieme References", + "Description": "Literature references related to scientific contents from Thieme Chemistry journals and books. The Thieme Chemistry content within this section is provided under a CC-BY-NC-ND 4.0 license (https://creativecommons.org/licenses/by-nc-nd/4.0/), unless otherwise stated.", + "URL": "https://www.thieme.de/en/thieme-chemistry/home-51399.htm", + "Information": [ + { + "ReferenceNumber": 51, + "Name": "Thieme References", + "Value": { + "ExternalTableName": "ThiemeChemistry" + } + } + ] + }, + { + "TOCHeading": "Wiley References", + "Description": "Literature references related to scientific contents from Wiley journals and books.", + "URL": "https://onlinelibrary.wiley.com/", + "Information": [ + { + "ReferenceNumber": 53, + "Value": { + "ExternalTableName": "wiley" + } + } + ] + }, + { + "TOCHeading": "Depositor Provided PubMed Citations", + "Description": "This section displays a concatenated list of all PubMed records that have been cited by the depositors of all PubChem Substance records that contain the same chemical structure as the compound.", + "Information": [ + { + "ReferenceNumber": 54, + "Name": "Depositor Provided PubMed Citations", + "URL": "https://www.ncbi.nlm.nih.gov/sites/entrez?LinkName=pccompound_pubmed&db=pccompound&cmd=Link&from_uid=6562", + "Value": { + "ExternalTableName": "collection=pubmed&pmidsrcs=xref", + "ExternalTableNumRows": 91 + } + } + ] + }, + { + "TOCHeading": "Metabolite References", + "Description": "General metabolite literature references, from the Human Metabolome Database (HMDB) or other sources", + "Information": [ + { + "ReferenceNumber": 18, + "Name": "Metabolite References", + "Value": { + "ExternalTableName": "hmdb", + "ExternalTableNumRows": 9 + } + } + ] + }, + { + "TOCHeading": "General References", + "Description": "General References", + "DisplayControls": { + "ListType": "Numbered" + }, + "Information": [ + { + "ReferenceNumber": 20, + "URL": "http://dx.doi.org/10.1038/nchem.1200", + "Value": { + "StringWithMarkup": [ + { + "String": "Aquino et al. A biomimetic polyketide-inspired approach to small-molecule ligand discovery. Nature Chemistry, doi: 10.1038/nchem.1200, published online 20 November 2011 http://www.nature.com/nchem" + } + ] + } + } + ] + }, + { + "TOCHeading": "Chemical Co-Occurrences in Literature", + "Description": "Chemical co-occurrences in literature highlight chemicals mentioned together in scientific articles. This may suggest an important relationship exists between the two. Please note that this content is not human curated. It is generated by text-mining algorithms that can be fooled such that a co-occurrence may be happenstance or a casual mention. The lists are ordered by relevancy as indicated by count of publications and other statistics, with the most relevant mentions appearing at the top.", + "URL": "https://pubchemdocs.ncbi.nlm.nih.gov/knowledge-panels", + "Information": [ + { + "ReferenceNumber": 54, + "Name": "Co-Occurrence Panel", + "Value": { + "StringWithMarkup": [ + { + "String": "ChemicalNeighbor" + }, + { + "String": "Chemical" + }, + { + "String": "ChemicalName_1" + }, + { + "String": "ChemicalName_2" + }, + { + "String": "SUMMARY_URL.cid" + }, + { + "String": "CID" + }, + { + "String": "CID" + } + ] + } + } + ] + }, + { + "TOCHeading": "Chemical-Gene Co-Occurrences in Literature", + "Description": "Chemical-gene co-occurrences in the literature highlight chemical-'gene' pairs mentioned together in scientific articles. Note that a co-occurring 'gene' entity is organism non-specific and could refer to a gene, protein, or enzyme. This may suggest an important relationship exists between the two. Please note that this content is not human curated. It is generated by text-mining algorithms that can be fooled such that a co-occurrence may be happenstance or a casual mention. The lists are ordered by relevancy as indicated by count of publications and other statistics, with the most relevant mentions appearing at the top.", + "URL": "https://pubchemdocs.ncbi.nlm.nih.gov/knowledge-panels", + "Information": [ + { + "ReferenceNumber": 54, + "Name": "Co-Occurrence Panel", + "Value": { + "StringWithMarkup": [ + { + "String": "ChemicalGeneSymbolNeighbor" + }, + { + "String": "Gene/Protein/Enzyme" + }, + { + "String": "ChemicalName" + }, + { + "String": "GeneSymbolName" + }, + { + "String": "SUMMARY_URL.genesymbol" + }, + { + "String": "CID" + }, + { + "String": "GeneSymbol" + } + ] + } + } + ] + }, + { + "TOCHeading": "Chemical-Disease Co-Occurrences in Literature", + "Description": "Chemical-disease co-occurrences in literature highlight chemical-disease pairs mentioned together in scientific articles. This may suggest an important relationship exists between the two. Please note that this content is not human curated. It is generated by text-mining algorithms that can be fooled such that a co-occurrence may be happenstance or a casual mention. The lists are ordered by relevancy as indicated by count of publications and other statistics, with the most relevant mentions appearing at the top.", + "URL": "https://pubchemdocs.ncbi.nlm.nih.gov/knowledge-panels", + "Information": [ + { + "ReferenceNumber": 54, + "Name": "Co-Occurrence Panel", + "Value": { + "StringWithMarkup": [ + { + "String": "ChemicalDiseaseNeighbor" + }, + { + "String": "Disease" + }, + { + "String": "ChemicalName" + }, + { + "String": "DiseaseName" + }, + { + "String": "https://meshb.nlm.nih.gov/record/ui?ui=" + }, + { + "String": "CID" + }, + { + "String": "MeSH" + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Patents", + "Description": "A PubChem summary page displays Patent information when available for the given molecule.", + "URL": "https://pubchemdocs.ncbi.nlm.nih.gov/patents", + "DisplayControls": { + "ListType": "Columns" + }, + "Section": [ + { + "TOCHeading": "Depositor-Supplied Patent Identifiers", + "Description": "Patent identifiers and more information provided by depositors in form of a widget.", + "Information": [ + { + "ReferenceNumber": 54, + "Value": { + "ExternalTableName": "patent" + } + }, + { + "ReferenceNumber": 54, + "Value": { + "StringWithMarkup": [ + { + "String": "Link to all deposited patent identifiers", + "Markup": [ + { + "Start": 0, + "Length": 40, + "URL": "https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/6562/xrefs/PatentID/TXT" + } + ] + } + ] + } + } + ] + }, + { + "TOCHeading": "WIPO PATENTSCOPE", + "Description": "Use the provided link to show patents associated with this chemical structure in WIPO's PATENTSCOPE system.", + "URL": "https://patentscope.wipo.int/", + "Information": [ + { + "ReferenceNumber": 66, + "Value": { + "StringWithMarkup": [ + { + "String": "Patents are available for this chemical structure:" + }, + { + "String": "https://patentscope.wipo.int/search/en/result.jsf?inchikey=STNJBCKSHOAVAJ-UHFFFAOYSA-N", + "Markup": [ + { + "Start": 0, + "Length": 86, + "URL": "https://patentscope.wipo.int/search/en/result.jsf?inchikey=STNJBCKSHOAVAJ-UHFFFAOYSA-N" + } + ] + } + ] + } + } + ] + } + ] + }, + { + "TOCHeading": "Biomolecular Interactions and Pathways", + "Description": "A PubChem summary page displays biomolecular interactions and pathways information when available for the given record.", + "Section": [ + { + "TOCHeading": "Chemical-Gene Interactions", + "Description": "Interactions between chemical and this gene", + "Section": [ + { + "TOCHeading": "CTD Chemical-Gene Interactions", + "Description": "Chemical-gene interactions provided by the Comparative Toxicogenomics Database (CTD)", + "Information": [ + { + "ReferenceNumber": 7, + "Value": { + "ExternalTableName": "ctdchemicalgene" + } + } + ] + } + ] + } + ] + }, + { + "TOCHeading": "Biological Test Results", + "Description": "A PubChem substance or compound summary page displays biological test results from the PubChem BioAssay database, if/as available, for the chemical structure currently displayed. (Note that you can embed biological test results displays within your own web pages, for a PubChem Compound or Substance of interest, by using the BioActivity Widget.)", + "URL": "https://pubchemdocs.ncbi.nlm.nih.gov/bioassays", + "Section": [ + { + "TOCHeading": "BioAssay Results", + "Description": "BioActivity information showed in tabular widget.", + "Information": [ + { + "ReferenceNumber": 54, + "Value": { + "ExternalTableName": "bioactivity" + } + } + ] + } + ] + }, + { + "TOCHeading": "Classification", + "Description": "Classification systems from MeSH, ChEBI, Kegg, etc.", + "URL": "https://pubchem.ncbi.nlm.nih.gov/classification", + "Section": [ + { + "TOCHeading": "Ontologies", + "Description": "Ontologies", + "Section": [ + { + "TOCHeading": "MeSH Tree", + "Description": "MeSH tree", + "Information": [ + { + "ReferenceNumber": 56, + "Name": "HID", + "URL": "https://pubchem.ncbi.nlm.nih.gov/classification/#hid=1", + "Value": { + "Number": [ + 1 + ] + } + } + ] + }, + { + "TOCHeading": "ChEBI Ontology", + "Description": "ChEBI Ontology tree", + "Information": [ + { + "ReferenceNumber": 57, + "Name": "HID", + "URL": "https://pubchem.ncbi.nlm.nih.gov/classification/#hid=2", + "Value": { + "Number": [ + 2 + ] + } + } + ] + }, + { + "TOCHeading": "ChemIDplus", + "Description": "ChemIDplus tree", + "Information": [ + { + "ReferenceNumber": 60, + "Name": "HID", + "URL": "https://pubchem.ncbi.nlm.nih.gov/classification/#hid=84", + "Value": { + "Number": [ + 84 + ] + } + } + ] + }, + { + "TOCHeading": "CAMEO Chemicals", + "Description": "CAMEO Chemical Reactivity Classification", + "Information": [ + { + "ReferenceNumber": 61, + "Name": "HID", + "URL": "https://pubchem.ncbi.nlm.nih.gov/classification/#hid=86", + "Value": { + "Number": [ + 86 + ] + } + } + ] + }, + { + "TOCHeading": "UN GHS Classification", + "Description": "The United Nations' Globally Harmonized System of Classification and Labelling of Chemicals (GHS) provides a harmonized basis for globally uniform physical, environmental, and health and safety information on hazardous chemical substances and mixtures.", + "Information": [ + { + "ReferenceNumber": 59, + "Name": "HID", + "URL": "https://pubchem.ncbi.nlm.nih.gov/classification/#hid=83", + "Value": { + "Number": [ + 83 + ] + } + } + ] + }, + { + "TOCHeading": "EPA CPDat Classification", + "Description": "CPDat (Chemical and Products Database) is a database containing information mapping more than 49,000 chemicals to a set of terms categorizing their usage or function in 16,000 consumer products (e.g. shampoo, soap) types based on what chemicals they contain.", + "Information": [ + { + "ReferenceNumber": 62, + "Name": "HID", + "URL": "https://pubchem.ncbi.nlm.nih.gov/classification/#hid=99", + "Value": { + "Number": [ + 99 + ] + } + } + ] + }, + { + "TOCHeading": "NORMAN Suspect List Exchange Classification", + "Description": "NORMAN Suspect List Exchange Classification", + "Information": [ + { + "ReferenceNumber": 63, + "Name": "HID", + "URL": "https://pubchem.ncbi.nlm.nih.gov/classification/#hid=101", + "Value": { + "Number": [ + 101 + ] + } + } + ] + }, + { + "TOCHeading": "EPA DSSTox Classification", + "Description": "EPA DSSTox Classification", + "Information": [ + { + "ReferenceNumber": 64, + "Name": "HID", + "URL": "https://pubchem.ncbi.nlm.nih.gov/classification/#hid=105", + "Value": { + "Number": [ + 105 + ] + } + } + ] + } + ] + } + ] + } + ], + "Reference": [ + { + "ReferenceNumber": 1, + "SourceName": "CAMEO Chemicals", + "SourceID": "3868", + "Name": "METHACRYLALDEHYDE", + "Description": "CAMEO Chemicals is a chemical database designed for people who are involved in hazardous material incident response and planning. CAMEO Chemicals contains a library with thousands of datasheets containing response-related information and recommendations for hazardous materials that are commonly transported, used, or stored in the United States. CAMEO Chemicals was developed by the National Oceanic and Atmospheric Administration's Office of Response and Restoration in partnership with the Environmental Protection Agency's Office of Emergency Management.", + "URL": "https://cameochemicals.noaa.gov/chemical/3868", + "LicenseNote": "CAMEO Chemicals and all other CAMEO products are available at no charge to those organizations and individuals (recipients) responsible for the safe handling of chemicals. However, some of the chemical data itself is subject to the copyright restrictions of the companies or organizations that provided the data.", + "LicenseURL": "https://cameochemicals.noaa.gov/help/reference/terms_and_conditions.htm?d_f=false", + "ANID": 759310 + }, + { + "ReferenceNumber": 2, + "SourceName": "CAS Common Chemistry", + "SourceID": "78-85-3", + "Name": "Methacrolein", + "Description": "CAS Common Chemistry is an open community resource for accessing chemical information. Nearly 500,000 chemical substances from CAS REGISTRY cover areas of community interest, including common and frequently regulated chemicals, and those relevant to high school and undergraduate chemistry classes. This chemical information, curated by our expert scientists, is provided in alignment with our mission as a division of the American Chemical Society.", + "URL": "https://commonchemistry.cas.org/detail?cas_rn=78-85-3", + "LicenseNote": "The data from CAS Common Chemistry is provided under a CC-BY-NC 4.0 license, unless otherwise stated.", + "LicenseURL": "https://creativecommons.org/licenses/by-nc/4.0/", + "ANID": 12680603 + }, + { + "ReferenceNumber": 5, + "SourceName": "ChemIDplus", + "SourceID": "0000078853", + "Name": "Methacrolein", + "Description": "ChemIDplus is a free, web search system that provides access to the structure and nomenclature authority files used for the identification of chemical substances cited in National Library of Medicine (NLM) databases, including the TOXNET system.", + "URL": "https://chem.nlm.nih.gov/chemidplus/sid/0000078853", + "LicenseURL": "https://www.nlm.nih.gov/copyright.html", + "IsToxnet": true, + "ANID": 763085 + }, + { + "ReferenceNumber": 9, + "SourceName": "DTP/NCI", + "SourceID": "NSC 8260", + "Name": "METHACROLEIN", + "Description": "The NCI Development Therapeutics Program (DTP) provides services and resources to the academic and private-sector research communities worldwide to facilitate the discovery and development of new cancer therapeutic agents.", + "URL": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8260", + "LicenseNote": "Unless otherwise indicated, all text within NCI products is free of copyright and may be reused without our permission. Credit the National Cancer Institute as the source.", + "LicenseURL": "https://www.cancer.gov/policies/copyright-reuse", + "ANID": 6870735 + }, + { + "ReferenceNumber": 10, + "SourceName": "EPA Acute Exposure Guideline Levels (AEGLs)", + "SourceID": "78-85-3", + "Name": "Methacrylaldehyde", + "Description": "Acute Exposure Guideline Levels (AEGLs) are used by emergency planners and responders worldwide as guidance in dealing with rare, usually accidental, releases of chemicals into the air. https://www.epa.gov/aegl", + "URL": "https://www.epa.gov/aegl/methacrylaldehyde-results-aegl-program", + "LicenseURL": "https://www.epa.gov/privacy/privacy-act-laws-policies-and-resources", + "ANID": 13097350 + }, + { + "ReferenceNumber": 12, + "SourceName": "EPA Chemicals under the TSCA", + "SourceID": "78-85-3", + "Name": "2-Propenal, 2-methyl-", + "Description": "EPA Chemicals under the Toxic Substances Control Act (TSCA) collection contains information on chemicals and their regulation under TSCA, including non-confidential content from the TSCA Chemical Substance Inventory, Acute Exposure Guideline Levels (AEGLs), and Chemical Data Reporting.", + "URL": "https://www.epa.gov/chemicals-under-tsca", + "LicenseURL": "https://www.epa.gov/privacy/privacy-act-laws-policies-and-resources", + "ANID": 7751511 + }, + { + "ReferenceNumber": 13, + "SourceName": "EPA DSSTox", + "SourceID": "DTXSID0052540", + "Name": "Methacrylaldehyde", + "Description": "DSSTox provides a high quality public chemistry resource for supporting improved predictive toxicology.", + "URL": "https://comptox.epa.gov/dashboard/DTXSID0052540", + "LicenseURL": "https://www.epa.gov/privacy/privacy-act-laws-policies-and-resources", + "ANID": 1165385 + }, + { + "ReferenceNumber": 15, + "SourceName": "European Chemicals Agency (ECHA)", + "SourceID": "201-150-1", + "Name": "Methacrylaldehyde", + "Description": "The European Chemicals Agency (ECHA) is an agency of the European Union which is the driving force among regulatory authorities in implementing the EU's groundbreaking chemicals legislation for the benefit of human health and the environment as well as for innovation and competitiveness.", + "URL": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.046", + "LicenseNote": "Use of the information, documents and data from the ECHA website is subject to the terms and conditions of this Legal Notice, and subject to other binding limitations provided for under applicable law, the information, documents and data made available on the ECHA website may be reproduced, distributed and/or used, totally or in part, for non-commercial purposes provided that ECHA is acknowledged as the source: \"Source: European Chemicals Agency, http://echa.europa.eu/\". Such acknowledgement must be included in each copy of the material. ECHA permits and encourages organisations and individuals to create links to the ECHA website under the following cumulative conditions: Links can only be made to webpages that provide a link to the Legal Notice page.", + "LicenseURL": "https://echa.europa.eu/web/guest/legal-notice", + "ANID": 1977316 + }, + { + "ReferenceNumber": 17, + "SourceName": "Hazardous Substances Data Bank (HSDB)", + "SourceID": "182", + "Name": "METHACROLEIN", + "Description": "The Hazardous Substances Data Bank (HSDB) is a toxicology database that focuses on the toxicology of potentially hazardous chemicals. It provides information on human exposure, industrial hygiene, emergency handling procedures, environmental fate, regulatory requirements, nanomaterials, and related areas. The information in HSDB has been assessed by a Scientific Review Panel.", + "URL": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/182", + "IsToxnet": true, + "ANID": 142 + }, + { + "ReferenceNumber": 19, + "SourceName": "ILO International Chemical Safety Cards (ICSC)", + "SourceID": "1259", + "Name": "METHACRYLALDEHYDE", + "Description": "International Chemical Safety Cards (ICSC) are data sheets intended to provide essential safety and health information on chemicals in a clear and concise way.", + "URL": "https://www.ilo.org/dyn/icsc/showcard.display?p_version=2&p_card_id=1259", + "LicenseNote": "The reproduction of ILO material is generally authorized for non-commercial purposes and within established limits. For non-commercial purposes of reproduction of data, any required permission is hereby granted and no further permission must be obtained from the ILO, but acknowledgement to the ILO as the original source must be made.", + "LicenseURL": "https://www.ilo.org/global/copyright/request-for-permission/lang--en/index.htm", + "ANID": 2261102 + }, + { + "ReferenceNumber": 50, + "SourceName": "The National Institute for Occupational Safety and Health (NIOSH)", + "SourceID": "OZ2625000", + "Name": "Methacrylaldehyde", + "Description": "The NIOSH Pocket Guide to Chemical Hazards (NPG) provides general industrial hygiene information for workers, employers, and occupational health professionals. It contains safety information and hazard data related to chemical substances or mixtures.", + "URL": "https://www.cdc.gov/niosh-rtecs/OZ280DE8.html", + "LicenseNote": "The information provided using CDC Web site is only intended to be general summary information to the public. It is not intended to take the place of either the written law or regulations.", + "LicenseURL": "https://www.cdc.gov/Other/disclaimer.html", + "ANID": 2268096 + }, + { + "ReferenceNumber": 8, + "SourceName": "DOT Emergency Response Guidebook", + "SourceID": "2396", + "Name": "methacrylaldehyde, stabilized", + "Description": "UN Number is also know as DOT Number. The Emergency Response Guidebook provides first responders with a go-to manual to help deal with hazmat transportation accidents during the critical first 30 minutes.", + "URL": "https://www.phmsa.dot.gov/hazmat/erg/emergency-response-guidebook-erg", + "ANID": 2134978 + }, + { + "ReferenceNumber": 27, + "SourceName": "NJDOH RTK Hazardous Substance List", + "SourceID": "1198", + "Name": "methacrylaldehyde", + "Description": "New Jersey Department of Health, Right to Know Hazardous Substance List, read more: https://www.nj.gov/health/workplacehealthandsafety/right-to-know/hazardous-substances/", + "URL": "http://nj.gov/health/eoh/rtkweb/documents/fs/1198.pdf", + "ANID": 2269903 + }, + { + "ReferenceNumber": 4, + "SourceName": "ChEBI", + "SourceID": "CHEBI:OBO:6562", + "Name": "Methacrolein", + "Description": "Chemical Entities of Biological Interest (ChEBI) is a database and ontology of molecular entities focused on 'small' chemical compounds, that is part of the Open Biomedical Ontologies effort. The term \"molecular entity\" refers to any constitutionally or isotopically distinct atom, molecule, ion, ion pair, radical, radical ion, complex, conformer, etc., identifiable as a separately distinguishable entity.", + "URL": "http://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:88384", + "ANID": 2476589 + }, + { + "ReferenceNumber": 3, + "SourceName": "CAS Common Chemistry", + "SourceID": "25120-30-3", + "Name": "2-Propenal, 2-methyl-, homopolymer", + "Description": "CAS Common Chemistry is an open community resource for accessing chemical information. Nearly 500,000 chemical substances from CAS REGISTRY cover areas of community interest, including common and frequently regulated chemicals, and those relevant to high school and undergraduate chemistry classes. This chemical information, curated by our expert scientists, is provided in alignment with our mission as a division of the American Chemical Society.", + "URL": "https://commonchemistry.cas.org/detail?cas_rn=25120-30-3", + "LicenseNote": "The data from CAS Common Chemistry is provided under a CC-BY-NC 4.0 license, unless otherwise stated.", + "LicenseURL": "https://creativecommons.org/licenses/by-nc/4.0/", + "ANID": 12683782 + }, + { + "ReferenceNumber": 6, + "SourceName": "ChemIDplus", + "SourceID": "r_6562", + "Description": "The toxicity data was from the legacy RTECS data set in ChemIDplus.", + "URL": "https://chem.nlm.nih.gov/chemidplus/sid/0000078853", + "LicenseURL": "https://www.nlm.nih.gov/copyright.html", + "IsToxnet": true, + "ANID": 3733615 + }, + { + "ReferenceNumber": 7, + "SourceName": "Comparative Toxicogenomics Database (CTD)", + "SourceID": "C039175::Compound", + "Description": "CTD is a robust, publicly available database that aims to advance understanding about how environmental exposures affect human health.", + "URL": "http://ctdbase.org/detail.go?type=chem&acc=C039175", + "LicenseNote": "It is to be used only for research and educational purposes. Any reproduction or use for commercial purpose is prohibited without the prior express written permission of the MDI Biological Laboratory and NC State University.", + "LicenseURL": "http://ctdbase.org/about/legal.jsp", + "ANID": 12499169 + }, + { + "ReferenceNumber": 11, + "SourceName": "EPA Chemical and Products Database (CPDat)", + "SourceID": "13004_DTXSID0052540", + "Name": "methacrylaldehyde", + "Description": "Chemical, products, and use category from EPA CPDat", + "URL": "https://comptox.epa.gov/dashboard/DTXSID0052540#exposure", + "LicenseURL": "https://www.epa.gov/privacy/privacy-act-laws-policies-and-resources", + "ANID": 9461761 + }, + { + "ReferenceNumber": 14, + "SourceName": "European Chemicals Agency (ECHA)", + "SourceID": "75443", + "Name": "Methacrylaldehyde", + "Description": "The information provided here is aggregated from the \"Notified classification and labelling\" from ECHA's C&L Inventory. Read more: https://echa.europa.eu/information-on-chemicals/cl-inventory-database", + "URL": "https://echa.europa.eu/information-on-chemicals/cl-inventory-database/-/discli/details/75443", + "LicenseNote": "Use of the information, documents and data from the ECHA website is subject to the terms and conditions of this Legal Notice, and subject to other binding limitations provided for under applicable law, the information, documents and data made available on the ECHA website may be reproduced, distributed and/or used, totally or in part, for non-commercial purposes provided that ECHA is acknowledged as the source: \"Source: European Chemicals Agency, http://echa.europa.eu/\". Such acknowledgement must be included in each copy of the material. ECHA permits and encourages organisations and individuals to create links to the ECHA website under the following cumulative conditions: Links can only be made to webpages that provide a link to the Legal Notice page.", + "LicenseURL": "https://echa.europa.eu/web/guest/legal-notice", + "ANID": 1873396 + }, + { + "ReferenceNumber": 26, + "SourceName": "NITE-CMC", + "SourceID": "21A3566", + "Name": "2-Methyl-2-propenal - FY2009", + "Description": "The chemical classification in this section was conducted by the Chemical Management Center (CMC) of Japan National Institute of Technology and Evaluation (NITE) in accordance with GHS Classification Guidance for the Japanese Government, and is intended to provide a reference for preparing GHS labelling and SDS for users.", + "URL": "https://www.nite.go.jp/chem/english/ghs/09-mhlw-0065e.html", + "ANID": 2264812 + }, + { + "ReferenceNumber": 16, + "SourceName": "FDA/SPL Indexing Data", + "SourceID": "9HRB24892H", + "Name": "9HRB24892H", + "Description": "The UNique Ingredient Identifier (UNII) is an alphanumeric substance identifier from the joint FDA/USP Substance Registration System (SRS).", + "URL": "https://www.fda.gov/ForIndustry/DataStandards/SubstanceRegistrationSystem-UniqueIngredientIdentifierUNII/", + "LicenseNote": "Unless otherwise noted, the contents of the FDA website (www.fda.gov), both text and graphics, are not copyrighted. They are in the public domain and may be republished, reprinted and otherwise used freely by anyone without the need to obtain permission from FDA. Credit to the U.S. Food and Drug Administration as the source is appreciated but not required.", + "LicenseURL": "https://www.fda.gov/about-fda/about-website/website-policies#linking", + "ANID": 5837319 + }, + { + "ReferenceNumber": 28, + "SourceName": "NMRShiftDB", + "SourceID": "12017", + "Description": "NMRShiftDB(2) is a NMR database (web database) for organic structures and their nuclear magnetic resonance (nmr) spectra. It allows for spectrum prediction (13C, 1H and other nuclei) as well as for searching spectra, structures and other properties. http://nmrshiftdb.nmr.uni-koeln.de/", + "URL": "https://pubchem.ncbi.nlm.nih.gov/substance/587305", + "ANID": 6426230 + }, + { + "ReferenceNumber": 18, + "SourceName": "Human Metabolome Database (HMDB)", + "SourceID": "HMDB0061874", + "Name": "Methacrolein", + "Description": "The Human Metabolome Database (HMDB) is a freely available electronic database containing detailed information about small molecule metabolites found in the human body.", + "URL": "http://www.hmdb.ca/metabolites/HMDB0061874", + "LicenseNote": "\u0009HMDB is offered to the public as a freely available resource. Use and re-distribution of the data, in whole or in part, for commercial purposes requires explicit permission of the authors and explicit acknowledgment of the source material (HMDB) and the original publication (see the HMDB citing page). We ask that users who download significant portions of the database cite the HMDB paper in any resulting publications.", + "LicenseURL": "http://www.hmdb.ca/citing", + "ANID": 2183921 + }, + { + "ReferenceNumber": 20, + "SourceName": "Nature Chemistry", + "SourceID": "nchem.1200-comp6", + "Description": "Nature Chemistry is a monthly journal dedicated to publishing high-quality papers that describe the most significant and cutting-edge research in all areas of chemistry. As well as reflecting the traditional core subjects of analytical, inorganic, organic and physical chemistry, the journal also features a broad range of chemical research including, but not limited to, catalysis, computational and theoretical chemistry, environmental chemistry, green chemistry, medicinal chemistry, nuclear chemistry, polymer chemistry, supramolecular chemistry and surface chemistry.", + "URL": "https://pubchem.ncbi.nlm.nih.gov/substance/126497363", + "ANID": 8519003 + }, + { + "ReferenceNumber": 21, + "SourceName": "NIST Mass Spectrometry Data Center", + "SourceID": "GC-MS #1 for STNJBCKSHOAVAJ-UHFFFAOYSA-N", + "Name": "Methacrolein", + "URL": "http://www.nist.gov/srd/nist1a.cfm", + "ANID": 9388 + }, + { + "ReferenceNumber": 22, + "SourceName": "NIST Mass Spectrometry Data Center", + "SourceID": "GC-MS #2 for STNJBCKSHOAVAJ-UHFFFAOYSA-N", + "Name": "Methacrolein", + "URL": "http://www.nist.gov/srd/nist1a.cfm", + "ANID": 248502 + }, + { + "ReferenceNumber": 23, + "SourceName": "NIST Mass Spectrometry Data Center", + "SourceID": "GC-MS #3 for STNJBCKSHOAVAJ-UHFFFAOYSA-N", + "Name": "Methacrolein", + "URL": "http://www.nist.gov/srd/nist1a.cfm", + "ANID": 248503 + }, + { + "ReferenceNumber": 24, + "SourceName": "NIST Mass Spectrometry Data Center", + "SourceID": "GC-MS #4 for STNJBCKSHOAVAJ-UHFFFAOYSA-N", + "Name": "Methacrolein", + "URL": "http://www.nist.gov/srd/nist1a.cfm", + "ANID": 256553 + }, + { + "ReferenceNumber": 25, + "SourceName": "NIST Mass Spectrometry Data Center", + "SourceID": "RI for STNJBCKSHOAVAJ-UHFFFAOYSA-N", + "Name": "Methacrolein", + "URL": "http://www.nist.gov/srd/nist1a.cfm", + "ANID": 307510 + }, + { + "ReferenceNumber": 29, + "SourceName": "Occupational Safety and Health Administration (OSHA)", + "SourceID": "hh904", + "Name": "Methacrylaldehyde", + "Description": "The annotation is from the OSHA 1910.119 App A - List of Highly Hazardous Chemicals, Toxics and Reactives (Mandatory).", + "URL": "https://www.osha.gov/laws-regs/regulations/standardnumber/1910/1910.119AppA", + "LicenseNote": "Materials created by the federal government are generally part of the public domain and may be used, reproduced and distributed without permission. Therefore, content on this website which is in the public domain may be used without the prior permission of the U.S. Department of Labor (DOL). Warning: Some content - including both images and text - may be the copyrighted property of others and used by the DOL under a license.", + "LicenseURL": "https://www.dol.gov/general/aboutdol/copyright", + "ANID": 8148434 + }, + { + "ReferenceNumber": 30, + "SourceName": "SpectraBase", + "SourceID": "5kxdQHddQuc", + "Name": "METHACROLEIN", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/5kxdQHddQuc", + "ANID": 4575695 + }, + { + "ReferenceNumber": 46, + "SourceName": "SpectraBase", + "SourceID": "BfjnLGWWj5n", + "Name": "Methacrolein", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/BfjnLGWWj5n", + "ANID": 9685949 + }, + { + "ReferenceNumber": 31, + "SourceName": "SpectraBase", + "SourceID": "GNzJ9qqOu3Q", + "Name": "METHACROLEIN", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/GNzJ9qqOu3Q", + "ANID": 4575696 + }, + { + "ReferenceNumber": 33, + "SourceName": "SpectraBase", + "SourceID": "KLCeSsJizeB", + "Name": "ACROLEIN, 2-METHYL-, /LIQUID/", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/KLCeSsJizeB", + "ANID": 4575698 + }, + { + "ReferenceNumber": 32, + "SourceName": "SpectraBase", + "SourceID": "60HlvquIH4C", + "Name": "METHACRYLALDEHYDE", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/60HlvquIH4C", + "ANID": 4575697 + }, + { + "ReferenceNumber": 35, + "SourceName": "SpectraBase", + "SourceID": "1IlU3XDr719", + "Name": "STNJBCKSHOAVAJ-UHFFFAOYSA-N", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/1IlU3XDr719", + "ANID": 4575700 + }, + { + "ReferenceNumber": 36, + "SourceName": "SpectraBase", + "SourceID": "27FxW7U8BBL", + "Name": "STNJBCKSHOAVAJ-UHFFFAOYSA-N", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/27FxW7U8BBL", + "ANID": 4575701 + }, + { + "ReferenceNumber": 38, + "SourceName": "SpectraBase", + "SourceID": "9UDLMxerKQ4", + "Name": "2-PROPENAL, 2-METHYL-", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/9UDLMxerKQ4", + "ANID": 9685941 + }, + { + "ReferenceNumber": 39, + "SourceName": "SpectraBase", + "SourceID": "FkDU0VrPQ6C", + "Name": "2-Methyl-2-propenal", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/FkDU0VrPQ6C", + "ANID": 9685942 + }, + { + "ReferenceNumber": 34, + "SourceName": "SpectraBase", + "SourceID": "BDSUT1mVNs7", + "Name": "Methacrolein", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/BDSUT1mVNs7", + "ANID": 4575699 + }, + { + "ReferenceNumber": 45, + "SourceName": "SpectraBase", + "SourceID": "K9cCitSKfLw", + "Name": "Methacrolein", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/K9cCitSKfLw", + "ANID": 9685948 + }, + { + "ReferenceNumber": 37, + "SourceName": "SpectraBase", + "SourceID": "1035Hs2ImSY", + "Name": "2-PROPENAL, 2-METHYL-", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/1035Hs2ImSY", + "ANID": 9685940 + }, + { + "ReferenceNumber": 40, + "SourceName": "SpectraBase", + "SourceID": "G0Fc7LEadlY", + "Name": "2-Propenal, 2-methyl-", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/G0Fc7LEadlY", + "ANID": 9685943 + }, + { + "ReferenceNumber": 41, + "SourceName": "SpectraBase", + "SourceID": "AHGRTvqppmC", + "Name": "2-Propenal, 2-methyl-", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/AHGRTvqppmC", + "ANID": 9685944 + }, + { + "ReferenceNumber": 42, + "SourceName": "SpectraBase", + "SourceID": "Rgg2KRGXh2", + "Name": "2-Propenal, 2-methyl-", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/Rgg2KRGXh2", + "ANID": 9685945 + }, + { + "ReferenceNumber": 43, + "SourceName": "SpectraBase", + "SourceID": "8NropLWgwxU", + "Name": "2-Propenal, 2-methyl-", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/8NropLWgwxU", + "ANID": 9685946 + }, + { + "ReferenceNumber": 44, + "SourceName": "SpectraBase", + "SourceID": "7kaP02DwhQe", + "Name": "2-Propenal, 2-methyl-", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/7kaP02DwhQe", + "ANID": 9685947 + }, + { + "ReferenceNumber": 47, + "SourceName": "SpectraBase", + "SourceID": "CSuqFIQOOcO", + "Name": "Methacrolein", + "Description": "Wiley Science Solutions (https://sciencesolutions.wiley.com) is a leading publisher of spectral databases and KnowItAll spectroscopy software. SpectraBase provides fast text access to hundreds of thousands of NMR, IR, Raman, UV-Vis, and mass spectra.", + "URL": "https://spectrabase.com/spectrum/CSuqFIQOOcO", + "ANID": 9685950 + }, + { + "ReferenceNumber": 48, + "SourceName": "Springer Nature", + "SourceID": "5037342-61875353", + "Description": "Literature references related to scientific contents from Springer Nature journals and books. https://link.springer.com/", + "URL": "https://pubchem.ncbi.nlm.nih.gov/substance/341139192", + "ANID": 3846171 + }, + { + "ReferenceNumber": 49, + "SourceName": "SpringerMaterials", + "SourceID": "smsid_qkznmnjmynrmdhof", + "Name": "2-methyl-2-propenal", + "Description": "Springer Nature is the leading scientific publisher in the fields of science and related areas. The company not only publishes best-in-class scientific journals and books but is also a well-known organization compiling databases for scientific applications. Amongst these databases, SpringerMaterials helps scientist to find and use property data of materials and chemical substances.", + "URL": "https://materials.springer.com/substanceprofile/docs/smsid_qkznmnjmynrmdhof", + "ANID": 8748767 + }, + { + "ReferenceNumber": 51, + "SourceName": "Thieme Chemistry", + "SourceID": "5037342-61875353", + "Description": "Literature references related to scientific contents from Thieme journals and books. Read more: http://www.thieme-chemistry.com", + "LicenseNote": "The Thieme Chemistry contribution within PubChem is provided under a CC-BY-NC-ND 4.0 license, unless otherwise stated.", + "LicenseURL": "https://creativecommons.org/licenses/by-nc-nd/4.0/", + "ANID": 3837552 + }, + { + "ReferenceNumber": 52, + "SourceName": "Wikipedia", + "SourceID": "Q420234", + "Name": "methacrolein", + "Description": "Link to the compound information in Wikipedia.", + "URL": "https://en.wikipedia.org/wiki/Methacrolein", + "ANID": 2328243 + }, + { + "ReferenceNumber": 53, + "SourceName": "Wiley", + "SourceID": "183548", + "Description": "Literature references related to scientific contents from Wiley. Read more: https://onlinelibrary.wiley.com/", + "URL": "https://pubchem.ncbi.nlm.nih.gov/substance/?source=wiley&sourceid=183548", + "ANID": 8349812 + }, + { + "ReferenceNumber": 54, + "SourceName": "PubChem", + "SourceID": "PubChem", + "Description": "Data deposited in or computed by PubChem", + "URL": "https://pubchem.ncbi.nlm.nih.gov" + }, + { + "ReferenceNumber": 55, + "SourceName": "Medical Subject Headings (MeSH)", + "SourceID": "67039175", + "Name": "methacrylaldehyde", + "URL": "https://www.ncbi.nlm.nih.gov/mesh/67039175" + }, + { + "ReferenceNumber": 56, + "SourceName": "Medical Subject Headings (MeSH)", + "SourceID": "DescTree", + "Name": "MeSH Tree", + "Description": "MeSH (Medical Subject Headings) is the NLM controlled vocabulary thesaurus used for indexing articles for PubMed.", + "URL": "http://www.nlm.nih.gov/mesh/meshhome.html" + }, + { + "ReferenceNumber": 57, + "SourceName": "ChEBI", + "SourceID": "OBO", + "Name": "ChEBI Ontology", + "Description": "The ChEBI Ontology is a structured classification of the entities contained within ChEBI.", + "URL": "http://www.ebi.ac.uk/chebi/userManualForward.do#ChEBI%20Ontology" + }, + { + "ReferenceNumber": 59, + "SourceName": "UN Globally Harmonized System of Classification and Labelling of Chemicals (GHS)", + "SourceID": "UN_GHS_tree", + "Name": "GHS Classification Tree", + "Description": "The United Nations' Globally Harmonised System of Classification and Labelling of Chemicals (GHS) provides a harmonised basis for globally uniform physical, environmental, and health and safety information on hazardous chemical substances and mixtures. It sets up criteria for the classification of chemicals for physical-chemical, health, and environmental hazards of chemical substances and mixtures and sets up standardised hazard information to facilitate global trade of chemicals.", + "URL": "http://www.unece.org/trans/danger/publi/ghs/ghs_welcome_e.html" + }, + { + "ReferenceNumber": 60, + "SourceName": "ChemIDplus", + "SourceID": "ChemIDplus_tree", + "Name": "ChemIDplus Chemical Information Classification", + "Description": "ChemIDplus is a TOXNET (TOXicology Data NETwork) databases that contain chemicals and drugs related information. It is managed by the Toxicology and Environmental Health Information Program (TEHIP) in the Division of Specialized Information Services (SIS) of the National Library of Medicine (NLM).", + "URL": "https://chem.nlm.nih.gov/chemidplus/", + "IsToxnet": true + }, + { + "ReferenceNumber": 61, + "SourceName": "CAMEO Chemicals", + "SourceID": "CameoReactivityTree", + "Name": "CAMEO Chemical Reactivity Classification", + "Description": "CAMEO Chemical Reactivity Classification was created based on the reactive groups.", + "URL": "https://cameochemicals.noaa.gov/browse/react" + }, + { + "ReferenceNumber": 62, + "SourceName": "EPA Chemical and Products Database (CPDat)", + "SourceID": "cpdat_tree", + "Name": "EPA CPDat Classification", + "Description": "CPDat (Chemical and Products Database) is a database containing information mapping more than 49,000 chemicals to a set of terms categorizing their usage or function in 16,000 consumer products. Ref: The Chemical and Products Database, a resource for exposure-relevant data on chemicals in consumer products, Scientific Data, volume 5, Article number: 180125 (2018), DOI:10.1038/sdata.2018.125", + "URL": "https://www.epa.gov/chemical-research/chemical-and-products-database-cpdat" + }, + { + "ReferenceNumber": 63, + "SourceName": "NORMAN Suspect List Exchange", + "SourceID": "norman_sle_tree", + "Name": "NORMAN Suspect List Exchange Classification", + "Description": "The <a href=\"https://www.norman-network.com/nds/SLE/\">NORMAN Suspect List Exchange</a> (NORMAN-SLE) is a central access point for NORMAN members (and others) to find suspect lists relevant for their environmental monitoring questions.", + "URL": "https://www.norman-network.com/nds/SLE/" + }, + { + "ReferenceNumber": 64, + "SourceName": "EPA DSSTox", + "SourceID": "dsstoxlist_tree", + "Name": "CompTox Chemicals Dashboard Chemical Lists", + "Description": "This classification listed the chemical categories from the EPA CompTox Chemicals Dashboard", + "URL": "https://comptox.epa.gov/dashboard/chemical_lists/" + }, + { + "ReferenceNumber": 66, + "SourceName": "PATENTSCOPE (WIPO)", + "Name": "SID 403030562", + "URL": "https://pubchem.ncbi.nlm.nih.gov/substance/403030562" + }, + { + "ReferenceNumber": 67, + "SourceName": "NCBI", + "SourceID": "LinkOut", + "Description": "LinkOut is a service that allows one to link directly from NCBI databases to a wide range of information and services beyond NCBI systems.", + "URL": "https://www.ncbi.nlm.nih.gov/projects/linkout" + } + ] + } +} diff --git a/Mono_Ethylene_Glycol_From_Hydration_Of_Ethylene_Oxide_By_Ms_Yutika_Naik/Abstract.pdf b/Mono_Ethylene_Glycol_From_Hydration_Of_Ethylene_Oxide_By_Ms_Yutika_Naik/Abstract.pdf Binary files differnew file mode 100644 index 0000000..8bd94da --- /dev/null +++ b/Mono_Ethylene_Glycol_From_Hydration_Of_Ethylene_Oxide_By_Ms_Yutika_Naik/Abstract.pdf diff --git a/Mono_Ethylene_Glycol_From_Hydration_Of_Ethylene_Oxide_By_Ms_Yutika_Naik/Flowsheet.dwxmz b/Mono_Ethylene_Glycol_From_Hydration_Of_Ethylene_Oxide_By_Ms_Yutika_Naik/Flowsheet.dwxmz Binary files differnew file mode 100644 index 0000000..3efd19e --- /dev/null +++ b/Mono_Ethylene_Glycol_From_Hydration_Of_Ethylene_Oxide_By_Ms_Yutika_Naik/Flowsheet.dwxmz diff --git a/Pressure-Swing_Reactive_Distillation_Method_For_Production_Of_N-Propyl_Acetate_By_Ms_Chandni/Abstract.pdf b/Pressure-Swing_Reactive_Distillation_Method_For_Production_Of_N-Propyl_Acetate_By_Ms_Chandni/Abstract.pdf Binary files differnew file mode 100644 index 0000000..9b83b3e --- /dev/null +++ b/Pressure-Swing_Reactive_Distillation_Method_For_Production_Of_N-Propyl_Acetate_By_Ms_Chandni/Abstract.pdf diff --git a/Pressure-Swing_Reactive_Distillation_Method_For_Production_Of_N-Propyl_Acetate_By_Ms_Chandni/Flowsheet.dwxmz b/Pressure-Swing_Reactive_Distillation_Method_For_Production_Of_N-Propyl_Acetate_By_Ms_Chandni/Flowsheet.dwxmz Binary files differnew file mode 100644 index 0000000..7f00a47 --- /dev/null +++ b/Pressure-Swing_Reactive_Distillation_Method_For_Production_Of_N-Propyl_Acetate_By_Ms_Chandni/Flowsheet.dwxmz diff --git a/Process_For_The_Production_Of_Methyl_Methacrylate_Via_Direct_Methylation_By_Ms_Shivani_Sutrave/user_defined_compound/methacrolein.dwcsd2 b/Process_For_The_Production_Of_Methyl_Methacrylate_Via_Direct_Methylation_By_Ms_Shivani_Sutrave/user_defined_compound/methacrolein.dwcsd2 new file mode 100644 index 0000000..1a5f99f --- /dev/null +++ b/Process_For_The_Production_Of_Methyl_Methacrylate_Via_Direct_Methylation_By_Ms_Shivani_Sutrave/user_defined_compound/methacrolein.dwcsd2 @@ -0,0 +1,323 @@ +{
+ "Filename": "C:\\Users\\admin\\Documents\\dw_methacrolein.json.zip",
+ "cp": {
+ "Acentric_Factor": 0.0,
+ "BO_BSW": 0.0,
+ "BO_GOR": 0.0,
+ "BO_OilVisc1": 0.0,
+ "BO_OilVisc2": 0.0,
+ "BO_OilViscTemp1": 0.0,
+ "BO_OilViscTemp2": 0.0,
+ "BO_PNA_A": 0.0,
+ "BO_PNA_N": 0.0,
+ "BO_PNA_P": 0.0,
+ "BO_SGG": 0.0,
+ "BO_SGO": 0.0,
+ "CAS_Number": "78-85-3",
+ "Chao_Seader_Acentricity": 0.0,
+ "Chao_Seader_Liquid_Molar_Volume": 0.0,
+ "Chao_Seader_Solubility_Parameter": 0.0,
+ "Charge": 0,
+ "ChemicalStructure": "",
+ "Comments": "",
+ "CompCreatorStudyFile": "C:\\Users\\admin\\Documents\\dw_methacrolein.json.zip",
+ "COSMODBName": null,
+ "Critical_Compressibility": 0.0,
+ "Critical_Pressure": 0.0,
+ "Critical_Temperature": 0.0,
+ "Critical_Volume": 0.0,
+ "CurrentDB": "User",
+ "Dipole_Moment": 0.0,
+ "Electrolyte_Cp0": 0.0,
+ "Electrolyte_DelGF": 0.0,
+ "Electrolyte_DelHF": 0.0,
+ "EnthalpyOfFusionAtTf": 0.0,
+ "Formula": "CH2=C(CH3)CHO",
+ "HVap_A": 0.0,
+ "HVap_B": 0.0,
+ "HVap_C": 0.0,
+ "HVap_D": 0.0,
+ "HVap_E": 0.0,
+ "HVap_TMAX": 0.0,
+ "HVap_TMIN": 0.0,
+ "HydrationNumber": 0.0,
+ "ID": 66983,
+ "Ideal_Gas_Heat_Capacity_Const_A": 0.0,
+ "Ideal_Gas_Heat_Capacity_Const_B": 0.0,
+ "Ideal_Gas_Heat_Capacity_Const_C": 0.0,
+ "Ideal_Gas_Heat_Capacity_Const_D": 0.0,
+ "Ideal_Gas_Heat_Capacity_Const_E": 0.0,
+ "IdealgasCpEquation": "0",
+ "IG_Enthalpy_of_Formation_25C": 0.0,
+ "IG_Entropy_of_Formation_25C": 0.0,
+ "IG_Gibbs_Energy_of_Formation_25C": 0.0,
+ "InChI": "",
+ "Ion_CpAq_a": 0.0,
+ "Ion_CpAq_b": 0.0,
+ "Ion_CpAq_c": 0.0,
+ "IsBlackOil": false,
+ "IsCOOLPROPSupported": false,
+ "IsFPROPSSupported": false,
+ "IsHydratedSalt": false,
+ "IsHYPO": 0,
+ "IsIon": false,
+ "IsModified": false,
+ "IsPF": 0,
+ "IsSalt": false,
+ "Liquid_Density_Const_A": 0.0,
+ "Liquid_Density_Const_B": 0.0,
+ "Liquid_Density_Const_C": 0.0,
+ "Liquid_Density_Const_D": 0.0,
+ "Liquid_Density_Const_E": 0.0,
+ "Liquid_Density_Tmax": 0.0,
+ "Liquid_Density_Tmin": 0.0,
+ "Liquid_Heat_Capacity_Const_A": 0.0,
+ "Liquid_Heat_Capacity_Const_B": 0.0,
+ "Liquid_Heat_Capacity_Const_C": 0.0,
+ "Liquid_Heat_Capacity_Const_D": 0.0,
+ "Liquid_Heat_Capacity_Const_E": 0.0,
+ "Liquid_Heat_Capacity_Tmax": 0.0,
+ "Liquid_Heat_Capacity_Tmin": 0.0,
+ "Liquid_Thermal_Conductivity_Const_A": 0.0,
+ "Liquid_Thermal_Conductivity_Const_B": 0.0,
+ "Liquid_Thermal_Conductivity_Const_C": 0.0,
+ "Liquid_Thermal_Conductivity_Const_D": 0.0,
+ "Liquid_Thermal_Conductivity_Const_E": 0.0,
+ "Liquid_Thermal_Conductivity_Tmax": 0.0,
+ "Liquid_Thermal_Conductivity_Tmin": 0.0,
+ "Liquid_Viscosity_Const_A": 0.0,
+ "Liquid_Viscosity_Const_B": 0.0,
+ "Liquid_Viscosity_Const_C": 0.0,
+ "Liquid_Viscosity_Const_D": 0.0,
+ "Liquid_Viscosity_Const_E": 0.0,
+ "LiquidDensityEquation": "0",
+ "LiquidHeatCapacityEquation": "0",
+ "LiquidThermalConductivityEquation": "0",
+ "LiquidViscosityEquation": "0",
+ "Molar_Weight": 70.09,
+ "MolarVolume_k1i": 0.0,
+ "MolarVolume_k2i": 0.0,
+ "MolarVolume_k3i": 0.0,
+ "MolarVolume_v2i": 0.0,
+ "MolarVolume_v3i": 0.0,
+ "Name": "methacrolein",
+ "NBP": null,
+ "NegativeIon": "",
+ "NegativeIonStoichCoeff": 0,
+ "Normal_Boiling_Point": 0.0,
+ "OriginalDB": "User",
+ "PC_SAFT_epsilon_k": 0.0,
+ "PC_SAFT_m": 0.0,
+ "PC_SAFT_sigma": 0.0,
+ "PF_MM": null,
+ "PF_SG": null,
+ "PF_Tv1": null,
+ "PF_Tv2": null,
+ "PF_v1": null,
+ "PF_v2": null,
+ "PF_vA": null,
+ "PF_vB": null,
+ "PF_Watson_K": null,
+ "PositiveIon": "",
+ "PositiveIonStoichCoeff": 0,
+ "PR_Volume_Translation_Coefficient": 0.0,
+ "SMILES": "CC(=C)C=O",
+ "Solid_Density_Const_A": 0.0,
+ "Solid_Density_Const_B": 0.0,
+ "Solid_Density_Const_C": 0.0,
+ "Solid_Density_Const_D": 0.0,
+ "Solid_Density_Const_E": 0.0,
+ "Solid_Density_Tmax": 0.0,
+ "Solid_Density_Tmin": 0.0,
+ "Solid_Heat_Capacity_Const_A": 0.0,
+ "Solid_Heat_Capacity_Const_B": 0.0,
+ "Solid_Heat_Capacity_Const_C": 0.0,
+ "Solid_Heat_Capacity_Const_D": 0.0,
+ "Solid_Heat_Capacity_Const_E": 0.0,
+ "Solid_Heat_Capacity_Tmax": 0.0,
+ "Solid_Heat_Capacity_Tmin": 0.0,
+ "SolidDensityAtTs": 0.0,
+ "SolidDensityEquation": "0",
+ "SolidHeatCapacityEquation": "0",
+ "SolidTs": 0.0,
+ "SRK_Volume_Translation_Coefficient": 0.0,
+ "StandardStateMolarVolume": 0.0,
+ "StoichSum": 0,
+ "Surface_Tension_Const_A": 0.0,
+ "Surface_Tension_Const_B": 0.0,
+ "Surface_Tension_Const_C": 0.0,
+ "Surface_Tension_Const_D": 0.0,
+ "Surface_Tension_Const_E": 0.0,
+ "Surface_Tension_Tmax": 0.0,
+ "Surface_Tension_Tmin": 0.0,
+ "SurfaceTensionEquation": "",
+ "TemperatureOfFusion": 0.0,
+ "UNIQUAC_Q": 0.0,
+ "UNIQUAC_R": 0.0,
+ "Vapor_Pressure_Constant_A": 0.0,
+ "Vapor_Pressure_Constant_B": 0.0,
+ "Vapor_Pressure_Constant_C": 0.0,
+ "Vapor_Pressure_Constant_D": 0.0,
+ "Vapor_Pressure_Constant_E": 0.0,
+ "Vapor_Pressure_TMAX": 0.0,
+ "Vapor_Pressure_TMIN": 0.0,
+ "Vapor_Thermal_Conductivity_Const_A": 0.0,
+ "Vapor_Thermal_Conductivity_Const_B": 0.0,
+ "Vapor_Thermal_Conductivity_Const_C": 0.0,
+ "Vapor_Thermal_Conductivity_Const_D": 0.0,
+ "Vapor_Thermal_Conductivity_Const_E": 0.0,
+ "Vapor_Thermal_Conductivity_Tmax": 0.0,
+ "Vapor_Thermal_Conductivity_Tmin": 0.0,
+ "Vapor_Viscosity_Const_A": 0.0,
+ "Vapor_Viscosity_Const_B": 0.0,
+ "Vapor_Viscosity_Const_C": 0.0,
+ "Vapor_Viscosity_Const_D": 0.0,
+ "Vapor_Viscosity_Const_E": 0.0,
+ "Vapor_Viscosity_Tmax": 0.0,
+ "Vapor_Viscosity_Tmin": 0.0,
+ "VaporizationEnthalpyEquation": "",
+ "VaporPressureEquation": "0",
+ "VaporThermalConductivityEquation": "",
+ "VaporViscosityEquation": "",
+ "Z_Rackett": 0.0,
+ "Elements": {},
+ "MODFACGroups": {},
+ "NISTMODFACGroups": {},
+ "UNIFACGroups": {},
+ "FullerDiffusionVolume": 0.0,
+ "LennardJonesDiameter": 0.0,
+ "LennardJonesEnergy": 0.0,
+ "Parachor": 0.0,
+ "Tag": "",
+ "ExtraProperties": {}
+ },
+ "database": "",
+ "su": {
+ "accel": "m2/s",
+ "activity": "Pa",
+ "activityCoefficient": "-",
+ "area": "m2",
+ "cakeresistance": "m/kg",
+ "cinematic_viscosity": "m2/s",
+ "compressibility": "1/Pa",
+ "compressibilityFactor": "-",
+ "deltaP": "Pa",
+ "deltaT": "K.",
+ "density": "kg/m3",
+ "diameter": "mm",
+ "distance": "m",
+ "enthalpy": "kJ/kg",
+ "entropy": "kJ/[kg.K]",
+ "excessEnthalpy": "kJ/kg",
+ "excessEntropy": "kJ/[kg.K]",
+ "force": "N",
+ "foulingfactor": "K.m2/W",
+ "fugacity": "Pa",
+ "fugacityCoefficient": "-",
+ "gor": null,
+ "head": "m",
+ "heat_transf_coeff": "W/[m2.K]",
+ "heatCapacityCp": "kJ/[kg.K]",
+ "heatCapacityCv": "kJ/[kg.K]",
+ "heatflow": "kW",
+ "idealGasHeatCapacity": "kJ/[kg.K]",
+ "jouleThomsonCoefficient": "K/Pa",
+ "kvalue": "-",
+ "logFugacityCoefficient": "-",
+ "logKvalue": "-",
+ "mass": "kg",
+ "mass_conc": "kg/m3",
+ "massflow": "kg/s",
+ "massfraction": "-",
+ "mediumresistance": "m-1",
+ "molar_conc": "mol/m3",
+ "molar_enthalpy": "kJ/kmol",
+ "molar_entropy": "kJ/[kmol.K]",
+ "molar_volume": "m3/kmol",
+ "molarflow": "mol/s",
+ "molarfraction": "-",
+ "molecularWeight": "kg/kmol",
+ "Name": "SI",
+ "pdp_boilingPointTemperature": "K",
+ "pdp_meltingTemperature": "K",
+ "pressure": "Pa",
+ "reac_rate": "mol/[m3.s]",
+ "reac_rate_heterog": "mol/[kg.s]",
+ "spec_vol": "m3/kg",
+ "speedOfSound": "m/s",
+ "surfaceTension": "N/m",
+ "temperature": "K",
+ "thermalConductivity": "W/[m.K]",
+ "thermalConductivityOfLiquid": "W/[m.K]",
+ "thermalConductivityOfVapor": "W/[m.K]",
+ "thickness": "mm",
+ "time": "s",
+ "vaporPressure": "Pa",
+ "velocity": "m/s",
+ "viscosity": "Pa.s",
+ "viscosityOfLiquid": "Pa.s",
+ "viscosityOfVapor": "Pa.s",
+ "volume": "m3",
+ "volumetricFlow": "m3/s",
+ "diffusivity": "m2/s",
+ "conductance": "[kg/s]/[Pa^0.5]"
+ },
+ "IgnoreUnsupportedGroups": false,
+ "nf": "System.Globalization.NumberFormatInfo",
+ "CalcMW": false,
+ "CalcTC": true,
+ "CalcPC": true,
+ "CalcZC": true,
+ "CalcZRA": true,
+ "CalcAF": true,
+ "CalcHF": true,
+ "CalcGF": true,
+ "CalcNBP": true,
+ "CalcCSAF": true,
+ "CalcCSSP": true,
+ "CalcCSMV": true,
+ "CalcMP": true,
+ "CalcEM": true,
+ "RegressPVAP": false,
+ "RegressCPIG": false,
+ "RegressCPLiquid": false,
+ "RegressLVISC": false,
+ "RegressLDENS": false,
+ "RegressLTC": false,
+ "RegressCpS": false,
+ "RegressRoS": false,
+ "EqPVAP": false,
+ "EqCPIG": false,
+ "EqCPLiquid": false,
+ "EqLVISC": false,
+ "EqLDENS": false,
+ "EqLTC": false,
+ "EqCpS": true,
+ "EqSDens": false,
+ "RegressOKPVAP": false,
+ "RegressOKCPIG": false,
+ "RegressOKCPLiquid": false,
+ "RegressOKLVISC": false,
+ "RegressOKLDENS": false,
+ "RegressOKLTC": false,
+ "RegressOKCpS": false,
+ "RegressOKRoS": false,
+ "ErrorMsgPVAP": "",
+ "ErrorMsgCPIG": "",
+ "ErrorMsgCPLiquid": "",
+ "ErrorMsgLVISC": "",
+ "ErrorMsgLDENS": "",
+ "ErrorMsgLTC": "",
+ "ErrorMsgCpS": "",
+ "ErrorMsgRoS": "",
+ "JobackGroups": [],
+ "DataPVAP": [],
+ "DataCPIG": [],
+ "DataCPLiquid": [],
+ "DataLVISC": [],
+ "DataLDENS": [],
+ "DataLTC": [],
+ "DataCpS": [],
+ "DataRoS": [],
+ "AdditionalAtoms": []
+}
\ No newline at end of file diff --git a/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/ABSTRACT_DWSIM.pdf b/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/ABSTRACT_DWSIM.pdf Binary files differnew file mode 100644 index 0000000..581c93b --- /dev/null +++ b/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/ABSTRACT_DWSIM.pdf diff --git a/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/Abstract.pdf b/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/Abstract.pdf Binary files differdeleted file mode 100644 index 5f9976e..0000000 --- a/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/Abstract.pdf +++ /dev/null diff --git a/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/FLOWSHEET_DWSIM.dwxmz b/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/FLOWSHEET_DWSIM.dwxmz Binary files differnew file mode 100644 index 0000000..4e65cd3 --- /dev/null +++ b/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/FLOWSHEET_DWSIM.dwxmz diff --git a/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/Finalflowchart.dwxmz b/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/Finalflowchart.dwxmz Binary files differdeleted file mode 100644 index 04838ed..0000000 --- a/Production_Of_Acrylonitrile_By_Propylene_Ammoxidation_By_Ms_Rakshitha_Gr/Finalflowchart.dwxmz +++ /dev/null diff --git a/Production_Of_Phthalic_Anhydride_From_O-Xylene_By_Ms_Yekkaluri_Snehasree_Reddy/user_defined_compound/PhthalicAnhydride.json b/Production_Of_Phthalic_Anhydride_From_O-Xylene_By_Ms_Yekkaluri_Snehasree_Reddy/user_defined_compound/PhthalicAnhydride.json new file mode 100644 index 0000000..d6be66e --- /dev/null +++ b/Production_Of_Phthalic_Anhydride_From_O-Xylene_By_Ms_Yekkaluri_Snehasree_Reddy/user_defined_compound/PhthalicAnhydride.json @@ -0,0 +1,193 @@ +{
+ "Acentric_Factor": 0.35,
+ "BO_BSW": 0.0,
+ "BO_GOR": 0.0,
+ "BO_OilVisc1": 0.0,
+ "BO_OilVisc2": 0.0,
+ "BO_OilViscTemp1": 0.0,
+ "BO_OilViscTemp2": 0.0,
+ "BO_PNA_A": 0.0,
+ "BO_PNA_N": 0.0,
+ "BO_PNA_P": 0.0,
+ "BO_SGG": 0.0,
+ "BO_SGO": 0.0,
+ "CAS_Number": "85-44-9",
+ "Chao_Seader_Acentricity": 0.0,
+ "Chao_Seader_Liquid_Molar_Volume": 0.0,
+ "Chao_Seader_Solubility_Parameter": 11781.8386142379,
+ "Charge": 0,
+ "ChemicalStructure": "",
+ "Comments": "",
+ "CompCreatorStudyFile": "",
+ "COSMODBName": null,
+ "Critical_Compressibility": 0.260096,
+ "Critical_Pressure": 4782590.0,
+ "Critical_Temperature": 850.92,
+ "Critical_Volume": 0.37,
+ "CurrentDB": "User",
+ "Dipole_Moment": 5.3,
+ "Electrolyte_Cp0": 0.0,
+ "Electrolyte_DelGF": 0.0,
+ "Electrolyte_DelHF": 0.0,
+ "EnthalpyOfFusionAtTf": 0.0,
+ "Formula": "",
+ "HVap_A": 0.0,
+ "HVap_B": 0.0,
+ "HVap_C": 0.0,
+ "HVap_D": 0.0,
+ "HVap_E": 0.0,
+ "HVap_TMAX": 0.0,
+ "HVap_TMIN": 0.0,
+ "HydrationNumber": 0.0,
+ "ID": 500992,
+ "Ideal_Gas_Heat_Capacity_Const_A": -4.455,
+ "Ideal_Gas_Heat_Capacity_Const_B": 0.654,
+ "Ideal_Gas_Heat_Capacity_Const_C": -0.0004283,
+ "Ideal_Gas_Heat_Capacity_Const_D": 1.009E-07,
+ "Ideal_Gas_Heat_Capacity_Const_E": 0.0,
+ "IdealgasCpEquation": "Cp = A + B*T + C*T^2 + D*T^3 + E*T^4\r\n where Cp in kJ/kg-mol , T in K",
+ "IG_Enthalpy_of_Formation_25C": -2009.51930866865,
+ "IG_Entropy_of_Formation_25C": 0.0,
+ "IG_Gibbs_Energy_of_Formation_25C": -969.349176343505,
+ "InChI": "1S/C8H4O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H",
+ "Ion_CpAq_a": 0.0,
+ "Ion_CpAq_b": 0.0,
+ "Ion_CpAq_c": 0.0,
+ "IsBlackOil": false,
+ "IsCOOLPROPSupported": false,
+ "IsFPROPSSupported": false,
+ "IsHydratedSalt": false,
+ "IsHYPO": 0,
+ "IsIon": false,
+ "IsModified": false,
+ "IsPF": 0,
+ "IsSalt": false,
+ "Liquid_Density_Const_A": 0.0,
+ "Liquid_Density_Const_B": 0.0,
+ "Liquid_Density_Const_C": 0.0,
+ "Liquid_Density_Const_D": 0.0,
+ "Liquid_Density_Const_E": 0.0,
+ "Liquid_Density_Tmax": 0.0,
+ "Liquid_Density_Tmin": 0.0,
+ "Liquid_Heat_Capacity_Const_A": 0.0,
+ "Liquid_Heat_Capacity_Const_B": 0.0,
+ "Liquid_Heat_Capacity_Const_C": 0.0,
+ "Liquid_Heat_Capacity_Const_D": 0.0,
+ "Liquid_Heat_Capacity_Const_E": 0.0,
+ "Liquid_Heat_Capacity_Tmax": 0.0,
+ "Liquid_Heat_Capacity_Tmin": 0.0,
+ "Liquid_Thermal_Conductivity_Const_A": 0.0,
+ "Liquid_Thermal_Conductivity_Const_B": 0.0,
+ "Liquid_Thermal_Conductivity_Const_C": 0.0,
+ "Liquid_Thermal_Conductivity_Const_D": 0.0,
+ "Liquid_Thermal_Conductivity_Const_E": 0.0,
+ "Liquid_Thermal_Conductivity_Tmax": 0.0,
+ "Liquid_Thermal_Conductivity_Tmin": 0.0,
+ "Liquid_Viscosity_Const_A": 0.0,
+ "Liquid_Viscosity_Const_B": 0.0,
+ "Liquid_Viscosity_Const_C": 0.0,
+ "Liquid_Viscosity_Const_D": 0.0,
+ "Liquid_Viscosity_Const_E": 0.0,
+ "LiquidDensityEquation": "0",
+ "LiquidHeatCapacityEquation": "0",
+ "LiquidThermalConductivityEquation": "",
+ "LiquidViscosityEquation": "0",
+ "Molar_Weight": 148.12,
+ "MolarVolume_k1i": 0.0,
+ "MolarVolume_k2i": 0.0,
+ "MolarVolume_k3i": 0.0,
+ "MolarVolume_v2i": 0.0,
+ "MolarVolume_v3i": 0.0,
+ "Name": "Phthalic Anhydride",
+ "NBP": 557.2,
+ "NegativeIon": "",
+ "NegativeIonStoichCoeff": 0,
+ "Normal_Boiling_Point": 557.2,
+ "OriginalDB": "User",
+ "PC_SAFT_epsilon_k": 0.0,
+ "PC_SAFT_m": 0.0,
+ "PC_SAFT_sigma": 0.0,
+ "PF_MM": null,
+ "PF_SG": null,
+ "PF_Tv1": null,
+ "PF_Tv2": null,
+ "PF_v1": null,
+ "PF_v2": null,
+ "PF_vA": null,
+ "PF_vB": null,
+ "PF_Watson_K": null,
+ "PositiveIon": "",
+ "PositiveIonStoichCoeff": 0,
+ "PR_Volume_Translation_Coefficient": 0.0,
+ "SMILES": "O=C1OC(=O)c2ccccc21",
+ "Solid_Density_Const_A": 0.0,
+ "Solid_Density_Const_B": 0.0,
+ "Solid_Density_Const_C": 0.0,
+ "Solid_Density_Const_D": 0.0,
+ "Solid_Density_Const_E": 0.0,
+ "Solid_Density_Tmax": 400.0,
+ "Solid_Density_Tmin": 0.0,
+ "Solid_Heat_Capacity_Const_A": 0.0,
+ "Solid_Heat_Capacity_Const_B": 0.0,
+ "Solid_Heat_Capacity_Const_C": 0.0,
+ "Solid_Heat_Capacity_Const_D": 0.0,
+ "Solid_Heat_Capacity_Const_E": 0.0,
+ "Solid_Heat_Capacity_Tmax": 400.0,
+ "Solid_Heat_Capacity_Tmin": 0.0,
+ "SolidDensityAtTs": 0.0,
+ "SolidDensityEquation": "0",
+ "SolidHeatCapacityEquation": "0",
+ "SolidTs": 0.0,
+ "SRK_Volume_Translation_Coefficient": 0.0,
+ "StandardStateMolarVolume": 0.0,
+ "StoichSum": 0,
+ "Surface_Tension_Const_A": 0.0,
+ "Surface_Tension_Const_B": 0.0,
+ "Surface_Tension_Const_C": 0.0,
+ "Surface_Tension_Const_D": 0.0,
+ "Surface_Tension_Const_E": 0.0,
+ "Surface_Tension_Tmax": 0.0,
+ "Surface_Tension_Tmin": 0.0,
+ "SurfaceTensionEquation": "",
+ "TemperatureOfFusion": 400.0,
+ "UNIQUAC_Q": 0.0,
+ "UNIQUAC_R": 0.0,
+ "Vapor_Pressure_Constant_A": -18.6099,
+ "Vapor_Pressure_Constant_B": -13372.12,
+ "Vapor_Pressure_Constant_C": 143.0441,
+ "Vapor_Pressure_Constant_D": 1.042995E-05,
+ "Vapor_Pressure_Constant_E": 0.0,
+ "Vapor_Pressure_TMAX": 791.0,
+ "Vapor_Pressure_TMIN": 404.15,
+ "Vapor_Thermal_Conductivity_Const_A": 0.0,
+ "Vapor_Thermal_Conductivity_Const_B": 0.0,
+ "Vapor_Thermal_Conductivity_Const_C": 0.0,
+ "Vapor_Thermal_Conductivity_Const_D": 0.0,
+ "Vapor_Thermal_Conductivity_Const_E": 0.0,
+ "Vapor_Thermal_Conductivity_Tmax": 0.0,
+ "Vapor_Thermal_Conductivity_Tmin": 0.0,
+ "Vapor_Viscosity_Const_A": 0.0,
+ "Vapor_Viscosity_Const_B": 0.0,
+ "Vapor_Viscosity_Const_C": 0.0,
+ "Vapor_Viscosity_Const_D": 0.0,
+ "Vapor_Viscosity_Const_E": 0.0,
+ "Vapor_Viscosity_Tmax": 0.0,
+ "Vapor_Viscosity_Tmin": 0.0,
+ "VaporizationEnthalpyEquation": "",
+ "VaporPressureEquation": "ln(Pvp) = A*ln(T) + B/T + C + D*T^2 where Pvp in kPa, T in K",
+ "VaporThermalConductivityEquation": "",
+ "VaporViscosityEquation": "",
+ "Z_Rackett": 0.0,
+ "Elements": {},
+ "MODFACGroups": {},
+ "NISTMODFACGroups": {},
+ "UNIFACGroups": {
+ "10": "4",
+ "11": "2",
+ "77": "1"
+ },
+ "FullerDiffusionVolume": 0.0,
+ "LennardJonesDiameter": 0.0,
+ "LennardJonesEnergy": 0.0,
+ "Parachor": 0.0
+}
\ No newline at end of file diff --git a/Triple_Column_Pressure_Swing_Distillation_Of_Ternary_Azeotropic_Mixture_Of_Iso-Propanol,_Mek_And_Ethanol_Using_Partial_Heat_Integration_Method_By_Mr_Vineet_Kumar_Kundu/TCPSD_Abstract.pdf b/Triple_Column_Pressure_Swing_Distillation_Of_Ternary_Azeotropic_Mixture_Of_Iso-Propanol,_Mek_And_Ethanol_Using_Partial_Heat_Integration_Method_By_Mr_Vineet_Kumar_Kundu/TCPSD_Abstract.pdf Binary files differnew file mode 100644 index 0000000..cdbfa2c --- /dev/null +++ b/Triple_Column_Pressure_Swing_Distillation_Of_Ternary_Azeotropic_Mixture_Of_Iso-Propanol,_Mek_And_Ethanol_Using_Partial_Heat_Integration_Method_By_Mr_Vineet_Kumar_Kundu/TCPSD_Abstract.pdf diff --git a/Triple_Column_Pressure_Swing_Distillation_Of_Ternary_Azeotropic_Mixture_Of_Iso-Propanol,_Mek_And_Ethanol_Using_Partial_Heat_Integration_Method_By_Mr_Vineet_Kumar_Kundu/TCPSD_Flowsheet.dwxmz b/Triple_Column_Pressure_Swing_Distillation_Of_Ternary_Azeotropic_Mixture_Of_Iso-Propanol,_Mek_And_Ethanol_Using_Partial_Heat_Integration_Method_By_Mr_Vineet_Kumar_Kundu/TCPSD_Flowsheet.dwxmz Binary files differnew file mode 100644 index 0000000..7259946 --- /dev/null +++ b/Triple_Column_Pressure_Swing_Distillation_Of_Ternary_Azeotropic_Mixture_Of_Iso-Propanol,_Mek_And_Ethanol_Using_Partial_Heat_Integration_Method_By_Mr_Vineet_Kumar_Kundu/TCPSD_Flowsheet.dwxmz |