diff options
666 files changed, 24444 insertions, 0 deletions
diff --git a/.idea/Chemical-Simulator-GUI.iml b/.idea/Chemical-Simulator-GUI.iml new file mode 100644 index 0000000..6017e7a --- /dev/null +++ b/.idea/Chemical-Simulator-GUI.iml @@ -0,0 +1,12 @@ +<?xml version="1.0" encoding="UTF-8"?> +<module type="PYTHON_MODULE" version="4"> + <component name="NewModuleRootManager"> + <content url="file://$MODULE_DIR$" /> + <orderEntry type="inheritedJdk" /> + <orderEntry type="sourceFolder" forTests="false" /> + <orderEntry type="module" module-name="uniqacLLE" /> + </component> + <component name="TestRunnerService"> + <option name="PROJECT_TEST_RUNNER" value="Unittests" /> + </component> +</module>
\ No newline at end of file diff --git a/.idea/misc.xml b/.idea/misc.xml new file mode 100644 index 0000000..65531ca --- /dev/null +++ b/.idea/misc.xml @@ -0,0 +1,4 @@ +<?xml version="1.0" encoding="UTF-8"?> +<project version="4"> + <component name="ProjectRootManager" version="2" project-jdk-name="Python 3.6" project-jdk-type="Python SDK" /> +</project>
\ No newline at end of file diff --git a/.idea/modules.xml b/.idea/modules.xml new file mode 100644 index 0000000..4e1f420 --- /dev/null +++ b/.idea/modules.xml @@ -0,0 +1,9 @@ +<?xml version="1.0" encoding="UTF-8"?> +<project version="4"> + <component name="ProjectModuleManager"> + <modules> + <module fileurl="file://$PROJECT_DIR$/.idea/Chemical-Simulator-GUI.iml" filepath="$PROJECT_DIR$/.idea/Chemical-Simulator-GUI.iml" /> + <module fileurl="file://$USER_HOME$/PycharmProjects/uniqacLLE/.idea/uniqacLLE.iml" filepath="$USER_HOME$/PycharmProjects/uniqacLLE/.idea/uniqacLLE.iml" /> + </modules> + </component> +</project>
\ No newline at end of file diff --git a/.idea/vcs.xml b/.idea/vcs.xml new file mode 100644 index 0000000..94a25f7 --- /dev/null +++ b/.idea/vcs.xml @@ -0,0 +1,6 @@ +<?xml version="1.0" encoding="UTF-8"?> +<project version="4"> + <component name="VcsDirectoryMappings"> + <mapping directory="$PROJECT_DIR$" vcs="Git" /> + </component> +</project>
\ No newline at end of file diff --git a/.idea/workspace.xml b/.idea/workspace.xml new file mode 100644 index 0000000..290fb6d --- /dev/null +++ b/.idea/workspace.xml @@ -0,0 +1,496 @@ +<?xml version="1.0" encoding="UTF-8"?> +<project version="4"> + <component name="ChangeListManager"> + <list default="true" id="87cd4531-42bb-4ffe-8646-a7b8907e1856" name="Default" comment="" /> + <option name="EXCLUDED_CONVERTED_TO_IGNORED" value="true" /> + <option name="SHOW_DIALOG" value="false" /> + <option name="HIGHLIGHT_CONFLICTS" value="true" /> + <option name="HIGHLIGHT_NON_ACTIVE_CHANGELIST" value="false" /> + <option name="LAST_RESOLUTION" value="IGNORE" /> + </component> + <component name="CoverageDataManager"> + <SUITE FILE_PATH="coverage/OMChemSimGUI$mainApp.coverage" NAME="mainApp Coverage Results" MODIFIED="1560968263522" SOURCE_PROVIDER="com.intellij.coverage.DefaultCoverageFileProvider" RUNNER="coverage.py" COVERAGE_BY_TEST_ENABLED="true" COVERAGE_TRACING_ENABLED="false" WORKING_DIRECTORY="$PROJECT_DIR$" /> + </component> + <component name="FUSProjectUsageTrigger"> + <session id="450873294"> + <usages-collector id="statistics.lifecycle.project"> + <counts> + <entry key="project.closed" value="1" /> + <entry key="project.open.time.19" value="1" /> + <entry key="project.open.time.39" value="1" /> + <entry key="project.opened" value="2" /> + </counts> + </usages-collector> + <usages-collector id="statistics.file.extensions.open"> + <counts> + <entry key="py" value="4" /> + </counts> + </usages-collector> + <usages-collector id="statistics.file.types.open"> + <counts> + <entry key="Python" value="4" /> + </counts> + </usages-collector> + </session> + <session id="1459816095"> + <usages-collector id="statistics.lifecycle.project"> + <counts> + <entry key="project.open.time.2" value="1" /> + <entry key="project.opened" value="1" /> + </counts> + </usages-collector> + <usages-collector id="statistics.file.extensions.open"> + <counts> + <entry key="py" value="2" /> + </counts> + </usages-collector> + <usages-collector id="statistics.file.types.open"> + <counts> + <entry key="Python" value="2" /> + </counts> + </usages-collector> + <usages-collector id="statistics.file.extensions.edit"> + <counts> + <entry key="py" value="3" /> + </counts> + </usages-collector> + <usages-collector id="statistics.file.types.edit"> + <counts> + <entry key="Python" value="3" /> + </counts> + </usages-collector> + </session> + </component> + <component name="FileEditorManager"> + <leaf SIDE_TABS_SIZE_LIMIT_KEY="300"> + <file pinned="false" current-in-tab="false"> + <entry file="file://$PROJECT_DIR$/mainApp.py"> + <provider selected="true" editor-type-id="text-editor"> + <state> + <folding> + <element signature="e#0#29#0" expanded="true" /> + </folding> + </state> + </provider> + </entry> + </file> + <file pinned="false" current-in-tab="false"> + <entry file="file://$PROJECT_DIR$/container.py"> + <provider selected="true" editor-type-id="text-editor"> + <state> + <folding> + <element signature="e#0#38#0" expanded="true" /> + </folding> + </state> + </provider> + </entry> + </file> + <file pinned="false" current-in-tab="false"> + <entry file="file://$PROJECT_DIR$/OMChem/Flowsheet.py"> + <provider selected="true" editor-type-id="text-editor"> + <state relative-caret-position="1785"> + <caret line="109" column="57" selection-start-line="109" selection-start-column="57" selection-end-line="109" selection-end-column="57" /> + </state> + </provider> + </entry> + </file> + <file pinned="false" current-in-tab="false"> + <entry file="file://$PROJECT_DIR$/OMChem/ConvReactor.py"> + <provider selected="true" editor-type-id="text-editor"> + <state> + <folding> + <element signature="e#0#11#0" expanded="true" /> + </folding> + </state> + </provider> + </entry> + </file> + <file pinned="false" current-in-tab="false"> + <entry file="file://$USER_HOME$/PycharmProjects/uniqacLLE/uniquaclle.py"> + <provider selected="true" editor-type-id="text-editor"> + <state relative-caret-position="-829"> + <folding> + <element signature="e#0#18#0" expanded="true" /> + </folding> + </state> + </provider> + </entry> + </file> + <file pinned="false" current-in-tab="true"> + <entry file="file://$USER_HOME$/PycharmProjects/uniqacLLE/Test_LLE.py"> + <provider selected="true" editor-type-id="text-editor"> + <state relative-caret-position="1241"> + <caret line="73" column="28" selection-start-line="73" selection-start-column="28" selection-end-line="73" selection-end-column="28" /> + <folding> + <element signature="e#0#18#0" expanded="true" /> + </folding> + </state> + </provider> + </entry> + </file> + </leaf> + </component> + <component name="Git.Settings"> + <option name="RECENT_GIT_ROOT_PATH" value="$PROJECT_DIR$" /> + </component> + <component name="IdeDocumentHistory"> + <option name="CHANGED_PATHS"> + <list> + <option value="$USER_HOME$/PycharmProjects/uniqacLLE/Test_LLE.py" /> + </list> + </option> + </component> + <component name="JsBuildToolGruntFileManager" detection-done="true" sorting="DEFINITION_ORDER" /> + <component name="JsBuildToolPackageJson" detection-done="true" sorting="DEFINITION_ORDER" /> + <component name="JsGulpfileManager"> + <detection-done>true</detection-done> + <sorting>DEFINITION_ORDER</sorting> + </component> + <component name="ProjectFrameBounds"> + <option name="x" value="-8" /> + <option name="y" value="-8" /> + <option name="width" value="1382" /> + <option name="height" value="744" /> + </component> + <component name="ProjectLevelVcsManager" settingsEditedManually="true"> + <ConfirmationsSetting value="1" id="Add" /> + </component> + <component name="ProjectView"> + <navigator proportions="" version="1"> + <foldersAlwaysOnTop value="true" /> + </navigator> + <panes> + <pane id="Scope" /> + <pane id="ProjectPane"> + <subPane> + <expand> + <path> + <item name="Chemical-Simulator-GUI" type="b2602c69:ProjectViewProjectNode" /> + <item name="uniqacLLE" type="462c0819:PsiDirectoryNode" /> + </path> + </expand> + <select /> + </subPane> + </pane> + </panes> + </component> + <component name="PropertiesComponent"> + <property name="WebServerToolWindowFactoryState" value="false" /> + <property name="last_opened_file_path" value="$USER_HOME$/PycharmProjects/uniqacLLE" /> + <property name="settings.editor.selected.configurable" value="com.jetbrains.python.configuration.PyActiveSdkModuleConfigurable" /> + </component> + <component name="RunDashboard"> + <option name="ruleStates"> + <list> + <RuleState> + <option name="name" value="ConfigurationTypeDashboardGroupingRule" /> + </RuleState> + <RuleState> + <option name="name" value="StatusDashboardGroupingRule" /> + </RuleState> + </list> + </option> + </component> + <component name="RunManager" selected="Python.Test_LLE"> + <configuration default="true" type="DjangoTestsConfigurationType" factoryName="Django tests"> + <option name="INTERPRETER_OPTIONS" value="" /> + <option name="PARENT_ENVS" value="true" /> + <envs> + <env name="PYTHONUNBUFFERED" value="1" /> + </envs> + <option name="SDK_HOME" value="" /> + <option name="WORKING_DIRECTORY" value="" /> + <option name="IS_MODULE_SDK" value="false" /> + <option name="ADD_CONTENT_ROOTS" value="true" /> + <option name="ADD_SOURCE_ROOTS" value="true" /> + <module name="chapter06" /> + <EXTENSION ID="PythonCoverageRunConfigurationExtension" enabled="false" sample_coverage="true" runner="coverage.py" /> + <option name="TARGET" value="" /> + <option name="SETTINGS_FILE" value="" /> + <option name="CUSTOM_SETTINGS" value="false" /> + <option name="USE_OPTIONS" value="false" /> + <option name="OPTIONS" value="" /> + <method /> + </configuration> + <configuration default="true" type="JavaScriptTestRunnerJest" factoryName="Jest"> + <node-interpreter value="project" /> + <working-dir value="" /> + <envs /> + <scope-kind value="ALL" /> + <method /> + </configuration> + <configuration default="true" type="JavaScriptTestRunnerProtractor" factoryName="Protractor"> + <config-file value="" /> + <node-interpreter value="project" /> + <envs /> + <method /> + </configuration> + <configuration default="true" type="JavascriptDebugType" factoryName="JavaScript Debug"> + <method /> + </configuration> + <configuration default="true" type="PyBehaveRunConfigurationType" factoryName="Behave"> + <option name="INTERPRETER_OPTIONS" value="" /> + <option name="PARENT_ENVS" value="true" /> + <envs /> + <option name="SDK_HOME" value="" /> + <option name="WORKING_DIRECTORY" value="" /> + <option name="IS_MODULE_SDK" value="false" /> + <option name="ADD_CONTENT_ROOTS" value="true" /> + <option name="ADD_SOURCE_ROOTS" value="true" /> + <module name="chapter06" /> + <EXTENSION ID="PythonCoverageRunConfigurationExtension" enabled="false" sample_coverage="true" runner="coverage.py" /> + <option name="ADDITIONAL_ARGS" value="" /> + <method /> + </configuration> + <configuration default="true" type="PyLettuceRunConfigurationType" factoryName="Lettuce"> + <option name="INTERPRETER_OPTIONS" value="" /> + <option name="PARENT_ENVS" value="true" /> + <envs /> + <option name="SDK_HOME" value="" /> + <option name="WORKING_DIRECTORY" value="" /> + <option name="IS_MODULE_SDK" value="false" /> + <option name="ADD_CONTENT_ROOTS" value="true" /> + <option name="ADD_SOURCE_ROOTS" value="true" /> + <module name="chapter06" /> + <EXTENSION ID="PythonCoverageRunConfigurationExtension" enabled="false" sample_coverage="true" runner="coverage.py" /> + <option name="ADDITIONAL_ARGS" value="" /> + <method /> + </configuration> + <configuration default="true" type="js.build_tools.gulp" factoryName="Gulp.js"> + <method /> + </configuration> + <configuration default="true" type="js.build_tools.npm" factoryName="npm"> + <command value="run" /> + <scripts /> + <node-interpreter value="project" /> + <envs /> + <method /> + </configuration> + <configuration name="Test_LLE" type="PythonConfigurationType" factoryName="Python" temporary="true"> + <module name="uniqacLLE" /> + <option name="INTERPRETER_OPTIONS" value="" /> + <option name="PARENT_ENVS" value="true" /> + <envs> + <env name="PYTHONUNBUFFERED" value="1" /> + </envs> + <option name="SDK_HOME" value="C:\Python36\python.exe" /> + <option name="WORKING_DIRECTORY" value="$USER_HOME$/PycharmProjects/uniqacLLE" /> + <option name="IS_MODULE_SDK" value="false" /> + <option name="ADD_CONTENT_ROOTS" value="true" /> + <option name="ADD_SOURCE_ROOTS" value="true" /> + <EXTENSION ID="PythonCoverageRunConfigurationExtension" enabled="false" sample_coverage="true" runner="coverage.py" /> + <option name="SCRIPT_NAME" value="$USER_HOME$/PycharmProjects/uniqacLLE/Test_LLE.py" /> + <option name="PARAMETERS" value="" /> + <option name="SHOW_COMMAND_LINE" value="false" /> + <option name="EMULATE_TERMINAL" value="false" /> + <option name="MODULE_MODE" value="false" /> + <option name="REDIRECT_INPUT" value="false" /> + <option name="INPUT_FILE" value="" /> + <method v="2" /> + </configuration> + <configuration default="true" type="PythonConfigurationType" factoryName="Python"> + <module name="chapter06" /> + <option name="INTERPRETER_OPTIONS" value="" /> + <option name="PARENT_ENVS" value="true" /> + <envs> + <env name="PYTHONUNBUFFERED" value="1" /> + </envs> + <option name="SDK_HOME" value="" /> + <option name="WORKING_DIRECTORY" value="" /> + <option name="IS_MODULE_SDK" value="false" /> + <option name="ADD_CONTENT_ROOTS" value="true" /> + <option name="ADD_SOURCE_ROOTS" value="true" /> + <EXTENSION ID="PythonCoverageRunConfigurationExtension" enabled="false" sample_coverage="true" runner="coverage.py" /> + <option name="SCRIPT_NAME" value="" /> + <option name="PARAMETERS" value="" /> + <option name="SHOW_COMMAND_LINE" value="false" /> + <option name="EMULATE_TERMINAL" value="false" /> + <option name="MODULE_MODE" value="false" /> + <option name="REDIRECT_INPUT" value="false" /> + <option name="INPUT_FILE" value="" /> + <method v="2" /> + </configuration> + <configuration name="mainApp" type="PythonConfigurationType" factoryName="Python" temporary="true"> + <module name="OMChemSimGUI-master" /> + <option name="INTERPRETER_OPTIONS" value="" /> + <option name="PARENT_ENVS" value="true" /> + <envs> + <env name="PYTHONUNBUFFERED" value="1" /> + </envs> + <option name="SDK_HOME" value="C:\Python36\python.exe" /> + <option name="WORKING_DIRECTORY" value="$PROJECT_DIR$" /> + <option name="IS_MODULE_SDK" value="false" /> + <option name="ADD_CONTENT_ROOTS" value="true" /> + <option name="ADD_SOURCE_ROOTS" value="true" /> + <EXTENSION ID="PythonCoverageRunConfigurationExtension" enabled="false" sample_coverage="true" runner="coverage.py" /> + <option name="SCRIPT_NAME" value="$PROJECT_DIR$/mainApp.py" /> + <option name="PARAMETERS" value="" /> + <option name="SHOW_COMMAND_LINE" value="false" /> + <option name="EMULATE_TERMINAL" value="false" /> + <option name="MODULE_MODE" value="false" /> + <option name="REDIRECT_INPUT" value="false" /> + <option name="INPUT_FILE" value="" /> + <method v="2" /> + </configuration> + <configuration default="true" type="Tox" factoryName="Tox"> + <module name="chapter06" /> + <option name="INTERPRETER_OPTIONS" value="" /> + <option name="PARENT_ENVS" value="true" /> + <option name="SDK_HOME" value="" /> + <option name="WORKING_DIRECTORY" value="" /> + <option name="IS_MODULE_SDK" value="false" /> + <option name="ADD_CONTENT_ROOTS" value="true" /> + <option name="ADD_SOURCE_ROOTS" value="true" /> + <EXTENSION ID="PythonCoverageRunConfigurationExtension" enabled="false" sample_coverage="true" runner="coverage.py" /> + <method v="2" /> + </configuration> + <configuration default="true" type="tests" factoryName="Doctests"> + <module name="chapter06" /> + <option name="INTERPRETER_OPTIONS" value="" /> + <option name="PARENT_ENVS" value="true" /> + <option name="SDK_HOME" value="" /> + <option name="WORKING_DIRECTORY" value="" /> + <option name="IS_MODULE_SDK" value="false" /> + <option name="ADD_CONTENT_ROOTS" value="true" /> + <option name="ADD_SOURCE_ROOTS" value="true" /> + <EXTENSION ID="PythonCoverageRunConfigurationExtension" enabled="false" sample_coverage="true" runner="coverage.py" /> + <option name="SCRIPT_NAME" value="" /> + <option name="CLASS_NAME" value="" /> + <option name="METHOD_NAME" value="" /> + <option name="FOLDER_NAME" value="" /> + <option name="TEST_TYPE" value="TEST_SCRIPT" /> + <option name="PATTERN" value="" /> + <option name="USE_PATTERN" value="false" /> + <method v="2" /> + </configuration> + <configuration default="true" type="tests" factoryName="Nosetests"> + <module name="chapter06" /> + <option name="INTERPRETER_OPTIONS" value="" /> + <option name="PARENT_ENVS" value="true" /> + <option name="SDK_HOME" value="" /> + <option name="WORKING_DIRECTORY" value="" /> + <option name="IS_MODULE_SDK" value="false" /> + <option name="ADD_CONTENT_ROOTS" value="true" /> + <option name="ADD_SOURCE_ROOTS" value="true" /> + <EXTENSION ID="PythonCoverageRunConfigurationExtension" enabled="false" sample_coverage="true" runner="coverage.py" /> + <option name="_new_regexPattern" value="""" /> + <option name="_new_additionalArguments" value="""" /> + <option name="_new_target" value=""."" /> + <option name="_new_targetType" value=""PATH"" /> + <method v="2" /> + </configuration> + <list> + <item itemvalue="Python.mainApp" /> + <item itemvalue="Python.Test_LLE" /> + </list> + <recent_temporary> + <list> + <item itemvalue="Python.Test_LLE" /> + <item itemvalue="Python.mainApp" /> + </list> + </recent_temporary> + </component> + <component name="SvnConfiguration"> + <configuration /> + </component> + <component name="TaskManager"> + <task active="true" id="Default" summary="Default task"> + <changelist id="87cd4531-42bb-4ffe-8646-a7b8907e1856" name="Default" comment="" /> + <created>1560965064356</created> + <option name="number" value="Default" /> + <option name="presentableId" value="Default" /> + <updated>1560965064356</updated> + </task> + <servers /> + </component> + <component name="ToolWindowManager"> + <frame x="-8" y="-8" width="1382" height="744" extended-state="0" /> + <editor active="true" /> + <layout> + <window_info content_ui="combo" id="Project" order="0" visible="true" weight="0.24925596" /> + <window_info id="Structure" order="1" weight="0.25" /> + <window_info id="Favorites" order="2" side_tool="true" /> + <window_info anchor="bottom" id="Message" order="0" /> + <window_info anchor="bottom" id="Find" order="1" /> + <window_info active="true" anchor="bottom" id="Run" order="2" visible="true" weight="0.3295082" /> + <window_info anchor="bottom" id="Debug" order="3" weight="0.4" /> + <window_info anchor="bottom" id="Cvs" order="4" weight="0.25" /> + <window_info anchor="bottom" id="Inspection" order="5" weight="0.4" /> + <window_info anchor="bottom" id="TODO" order="6" /> + <window_info anchor="bottom" id="Version Control" order="7" /> + <window_info anchor="bottom" id="Terminal" order="8" /> + <window_info anchor="bottom" id="Python Console" order="9" /> + <window_info anchor="bottom" id="Event Log" order="10" side_tool="true" /> + <window_info anchor="right" id="Commander" order="0" weight="0.4" /> + <window_info anchor="right" id="Ant Build" order="1" weight="0.25" /> + <window_info anchor="right" content_ui="combo" id="Hierarchy" order="2" weight="0.25" /> + <window_info anchor="right" id="Data View" order="3" /> + <window_info anchor="right" id="Database" order="4" /> + </layout> + </component> + <component name="TypeScriptGeneratedFilesManager"> + <option name="processedProjectFiles" value="true" /> + </component> + <component name="VcsContentAnnotationSettings"> + <option name="myLimit" value="2678400000" /> + </component> + <component name="editorHistoryManager"> + <entry file="file://C:/ProgramData/Anaconda3/Lib/site-packages/pandas/core/api.py" /> + <entry file="file://$PROJECT_DIR$/mainApp.py"> + <provider selected="true" editor-type-id="text-editor"> + <state> + <folding> + <element signature="e#0#29#0" expanded="true" /> + </folding> + </state> + </provider> + </entry> + <entry file="file://$PROJECT_DIR$/container.py"> + <provider selected="true" editor-type-id="text-editor"> + <state> + <folding> + <element signature="e#0#38#0" expanded="true" /> + </folding> + </state> + </provider> + </entry> + <entry file="file://$PROJECT_DIR$/OMChem/Flowsheet.py"> + <provider selected="true" editor-type-id="text-editor"> + <state relative-caret-position="1785"> + <caret line="109" column="57" selection-start-line="109" selection-start-column="57" selection-end-line="109" selection-end-column="57" /> + </state> + </provider> + </entry> + <entry file="file://$USER_HOME$/PycharmProjects/uniqacLLE/functions.py"> + <provider selected="true" editor-type-id="text-editor" /> + </entry> + <entry file="file://$PROJECT_DIR$/OMChem/ConvReactor.py"> + <provider selected="true" editor-type-id="text-editor"> + <state> + <folding> + <element signature="e#0#11#0" expanded="true" /> + </folding> + </state> + </provider> + </entry> + <entry file="file://$USER_HOME$/PycharmProjects/uniqacLLE/uniquaclle.py"> + <provider selected="true" editor-type-id="text-editor"> + <state relative-caret-position="-829"> + <folding> + <element signature="e#0#18#0" expanded="true" /> + </folding> + </state> + </provider> + </entry> + <entry file="file://$USER_HOME$/PycharmProjects/uniqacLLE/Test_LLE.py"> + <provider selected="true" editor-type-id="text-editor"> + <state relative-caret-position="1241"> + <caret line="73" column="28" selection-start-line="73" selection-start-column="28" selection-end-line="73" selection-end-column="28" /> + <folding> + <element signature="e#0#18#0" expanded="true" /> + </folding> + </state> + </provider> + </entry> + </component> +</project>
\ No newline at end of file diff --git a/OMChem/CompSep.py b/OMChem/CompSep.py new file mode 100644 index 0000000..54b6415 --- /dev/null +++ b/OMChem/CompSep.py @@ -0,0 +1,63 @@ +from OMChem.EngStm import EngStm +import json +class CompSep(): + def __init__(self,CompNames = [],name='compoundseparator',SepFact=['Molar_Flow','Mass_Flow'],SepStrm=1,SepFactValue=[]): + self.SepFact = json.dumps(SepFact).replace('[','{').replace(']','}') + self.SepStrm = str(SepStrm) + self.SepFactValue = json.dumps(SepFactValue).replace('[','{').replace(']','}') + self.name = name + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = [] + self.OutputStms = [] + self.type = 'CompSep' + self.EngStms = EngStm(name='EngStm') + + def modesList(self): + return [] + def paramgetter(self,mode=None): + dict = {"SepStrm":None,"SepFactValue":None,"SepFact":None} + return dict + + def paramsetter(self,dict): + self.SepStrm = dict['SepStrm'] + self.SepFactValue = dict['SepFactValue'] + self.SepFact = dict['SepFact'] + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStms.name+';\n' + self.OM_data_init = self.OM_data_init + ( + "Simulator.Unit_Operations.Compound_Separator " + self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("},") + self.OM_data_init = self.OM_data_init + ("sepFact = "+self.SepFact+",sepStrm = " + self.SepStrm + ", sepFactVal = " + self.SepFactValue + ");\n") + + return self.OM_data_init + + def connect(self,InputStms = None,OutputStms = []): + self.InputStms = InputStms + self.OutputStms = OutputStms + + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + comp_count = len(addedcomp) + strcount = 1 + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.InputStms[0].name + '.outlet,' + self.name + '.inlet' + ');\n') + + for strm in self.OutputStms: + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + strm.name + '.inlet,' + self.name + '.outlet'+str(strcount)+');\n') + strcount += 1 + + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.EngStms.name + '.outlet,' + self.name + '.energy);\n') + sepFac = str(self.SepFactValue).strip('[').strip(']') + + self.OM_data_eqn = self.OM_data_eqn + (self.name+'.sepFactVal= {'+ sepFac + '};\n') + + + return self.OM_data_eqn + diff --git a/OMChem/ConvReactor.py b/OMChem/ConvReactor.py new file mode 100644 index 0000000..b9958a9 --- /dev/null +++ b/OMChem/ConvReactor.py @@ -0,0 +1,80 @@ +import json +from OMChem.EngStm import EngStm +class ConvReactor(): + def __init__(self,name='',Nr=None,b=None,X=None,Z=None,a=[],operation=None,Tdef=None): + self.Nr = str(Nr) + self.b = str(b) + self.X = str(X) + self.Z = str(Z) + self.a = json.dumps(a).replace('[','{').replace(']','}') + self.operation = str(operation) + self.Tdef = str(Tdef) + self.name = name + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = [] + self.OutputStms = [] + self.type = 'ConvReactor' + self.EngStms = EngStms(name="EngStm") + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStms.name+';\n' + self.OM_data_init = self.OM_data_init + ( "Simulator.Unit_Operations.ConversionReactor " + self.name + "(Nr = " + self.Nr + ',b = ' + self.b + ',X = ' + self.X + ',Z = ' + self.Z + ',a = ' + self.a + ',operation = ' + self.operation + ',Tdef = ' + self.Tdef + ');\n') + return self.OM_data_init + + def connect(self,InputStms = None,OutputStms = None): + self.InputStms = InputStms + self.OutputStms = OutputStms + + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + comp_count = len(addedcomp) + strcount = 1 + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.InputStms[0].name + '.outlet,' + self.name + '.inlet' + ');\n') + + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.OutputStms[0].name + '.inlet,' + self.name + '.outlet);\n') + + + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.EngStms.name + '.inlet,' + self.name + '.EnergyStream);\n') + + return self.OM_data_eqn + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/OMChem/Cooler.py b/OMChem/Cooler.py new file mode 100644 index 0000000..577b181 --- /dev/null +++ b/OMChem/Cooler.py @@ -0,0 +1,66 @@ +from OMChem.EngStm import EngStm +class Cooler(): + def __init__(self,name='cooler',PressureDrop = None, eff = None): + self.PressureDrop = PressureDrop + self.eff = eff + self.name = name + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = None + self.OutputStms = None + #self.heatRem = heatRem + self.EngStms = EngStm(name='EngStm') + self.type = 'Cooler' + self.mode = None + self.modeVal = None + + self.Prop = { + 'pressDrop':None, + 'eff':None, + 'outT':None, + 'tempDrop':None, + 'heatRem':None, + } + def connect(self,InputStms = None,OutputStms = None): + self.InputStms = InputStms + self.OutputStms = OutputStms + + def modesList(self): + return ["heatRem","outT","outVapPhasMolFrac","tempDrop","enFlo"] + + def paramgetter(self,mode="heatRem"): + self.mode = mode + dict = {"PressureDrop":None,"eff":None,self.mode:None} + return dict + + def paramsetter(self,dict): + + self.PressureDrop = dict['PressureDrop'] + self.eff = dict['eff'] + self.modeVal = dict[self.mode] + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStms.name+';\n' + self.OM_data_init = self.OM_data_init + ( + "Simulator.Unit_Operations.Cooler " + self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("},") + self.OM_data_init = self.OM_data_init + 'pressDrop = ' + str(self.PressureDrop) + ',' + self.OM_data_init = self.OM_data_init + 'eff = ' + str(self.eff) + ');\n' + return self.OM_data_init + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + # self.OM_data_eqn = self.name + '.pressDrop = ' + str(self.PressDrop) + ';\n' + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.InputStms[0].name + '.outlet,' + self.name + '.inlet' + ');\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.outlet,' + self.OutputStms[0].name + '.inlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.EngStms.name + '.outlet,'+ self.name + '.energy);\n') + if(self.mode =="enFlo"): + self.OM_data_eqn = self.OM_data_eqn + (self.EngStms.name+'.'+self.mode+'='+ self.modeVal + ';\n') + else: + self.OM_data_eqn = self.OM_data_eqn + (self.name+'.'+self.mode+'='+ self.modeVal + ';\n') + return self.OM_data_eqn
\ No newline at end of file diff --git a/OMChem/DistCol.py b/OMChem/DistCol.py new file mode 100644 index 0000000..35054da --- /dev/null +++ b/OMChem/DistCol.py @@ -0,0 +1,95 @@ +from OMChem.EngStm import EngStm +class DistCol(): + def __init__(self,name=('DistCol',1), numStage = None,numFeeds = None,feedStages = None): + self.numStage = numStage + self.numFeeds=numFeeds + self.feedStages=feedStages + self.name = name[0] + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = None + self.OutputStms = None + self.EngStm1 = EngStm(name='EngStm1'+self.name) + self.EngStm2 = EngStm(name='EngStm2'+self.name) + self.count = name[1] + self.thermoPackage='Raoults_Law' + self.type = 'DistCol' + self.mode = None + self.condType='' + self.modeVal = None + self.condP=None + self.rebP=None + + def connect(self,InputStms = None,OutputStms = None): + self.InputStms = InputStms + self.OutputStms = OutputStms + + def modesList(self): + return ["refluxRatio","sideDrawMolFlo","T"] + + def paramgetter(self,mode="refluxRatio"): + self.mode=mode + dict = { "numStage" : None,"numFeeds" :None,"feedStages" :None,"thermoPackage":None,"condType":None,self.mode:None,"condensor.P":None,"reboiler.P":None} + return dict + + def paramsetter(self,dict): + self.numStage = dict["numStage"] + self.numFeeds = dict["numFeeds"] + self.feedStages = dict["feedStages"].split(",") + self.modeVal=dict[self.mode] + self.condP=dict["condensor.P"] + self.rebP=dict["reboiler.P"] + self.condType=dict["condType"] + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + self.OM_data_init = self.OM_data_init + 'model Condensor\n' + self.OM_data_init = self.OM_data_init + 'extends Simulator.Unit_Operations.Distillation_Column.Cond;\n' + self.OM_data_init = self.OM_data_init + 'extends Simulator.Files.Thermodynamic_Packages.'+self.thermoPackage+';\n' + self.OM_data_init = self.OM_data_init + 'end Condensor;\n' + self.OM_data_init = self.OM_data_init + 'model Tray\n' + self.OM_data_init = self.OM_data_init + 'extends Simulator.Unit_Operations.Distillation_Column.DistTray;\n' + self.OM_data_init = self.OM_data_init + 'extends Simulator.Files.Thermodynamic_Packages.'+self.thermoPackage+';\n' + self.OM_data_init = self.OM_data_init + 'end Tray;\n' + self.OM_data_init = self.OM_data_init + 'model Reboiler\n' + self.OM_data_init = self.OM_data_init + 'extends Simulator.Unit_Operations.Distillation_Column.Reb;\n' + self.OM_data_init = self.OM_data_init + 'extends Simulator.Files.Thermodynamic_Packages.'+self.thermoPackage+';\n' + self.OM_data_init = self.OM_data_init + 'end Reboiler;\n' + self.OM_data_init = self.OM_data_init + ("model distCol"+str(self.count)+"\n") + self.OM_data_init = self.OM_data_init + ("extends Simulator.Unit_Operations.Distillation_Column.DistCol;\n" ) + self.OM_data_init = self.OM_data_init + ("Condensor condensor(NOC = NOC, comp = comp, condType =condType, boolFeed = boolFeed[1], T(start = 300));\n" ) + self.OM_data_init = self.OM_data_init + ("Reboiler reboiler(NOC = NOC, comp = comp, boolFeed = boolFeed[noOfStages]);\n" ) + self.OM_data_init = self.OM_data_init + ("Tray tray[noOfStages - 2](each NOC = NOC, each comp = comp, boolFeed = boolFeed[2:noOfStages -1]);\n" ) + self.OM_data_init = self.OM_data_init + ("end distCol"+str(self.count)+";\n") + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + ( + "distCol"+str(self.count)+" "+ self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.feedStages=str(self.feedStages).strip('[').strip(']') + self.feedStages = self.feedStages.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("},")+("noOfStages="+self.numStage+","+"noOfFeeds="+self.numFeeds+",feedStages="+"{"+self.feedStages+"}"+",condensor.condType="+"\""+self.condType+"\""+");\n") + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStm1.name+';\n' + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStm2.name+';\n' + return self.OM_data_init + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + # self.OM_data_eqn = self.name + '.pressDrop = ' + str(self.PressDrop) + ';\n' + self.OM_data_eqn = self.OM_data_eqn + ('connect('+self.name+'.'+'condensor_duty'+','+ self.EngStm1.name+'.inlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect('+self.name+'.reboiler_duty'+', '+self.EngStm2.name+'.inlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect('+self.name+'.distillate'+", "+self.OutputStms[0].name+'.inlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect('+self.name+'.bottoms'+", "+self.OutputStms[1].name+'.inlet);\n') + for i in range(len(self.InputStms)): + self.OM_data_eqn = self.OM_data_eqn + ('connect('+self.InputStms[i].name+'.outlet'+", "+self.name+'.feed['+str(i+1)+']);\n') + self.OM_data_eqn = self.OM_data_eqn + (self.OutputStms[1].name+'.'+'totMolFlow[1] = '+str(self.OutputStms[1].Prop['totMolFlo[1]'])+';\n') + if self.mode=="refluxRatio": + self.OM_data_eqn = self.OM_data_eqn + (self.name+'.'+str(self.mode)+'='+ str(self.modeVal) + ';\n') + else: + self.OM_data_eqn = self.OM_data_eqn + (self.name+'.condensor.'+self.mode+'='+ str(self.modeVal) + ';\n') + + self.OM_data_eqn = self.OM_data_eqn + self.name +'.reboiler.P='+self.rebP+';\n' + self.OM_data_eqn = self.OM_data_eqn + self.name +'.condensor.P='+self.condP+';\n' + return self.OM_data_eqn + diff --git a/OMChem/EngStm.py b/OMChem/EngStm.py new file mode 100644 index 0000000..cf938ad --- /dev/null +++ b/OMChem/EngStm.py @@ -0,0 +1,18 @@ + +class EngStm(): + + def __init__(self,name = 'Engstm'): + self.name = name + self.type = 'EngStm' + self.OM_data_init = '' + self.OM_data_eqn = '' + + + def OM_Flowsheet_Init(self,addedcomp): + self.OM_data_init = '' + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.name+';\n' + return self.OM_data_init + + def OM_Flowsheet_Eqn(self,addedcomp): + self.OM_data_eqn = '' + return self.OM_data_eqn diff --git a/OMChem/Flash.py b/OMChem/Flash.py new file mode 100644 index 0000000..22335a5 --- /dev/null +++ b/OMChem/Flash.py @@ -0,0 +1,45 @@ +class Flash(): + def __init__(self,name=("flash",1)): + self.name = name[0] + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = None + self.OutputStms = None + self.type = 'flash' + self.count = name[1] + self.thermoPackage =None + def connect(self,InputStms = None,OutputStms = None): + self.InputStms = InputStms + self.OutputStms = OutputStms + + def modesList(self): + return [] + + def paramgetter(self,mode=None): + dict = {"thermoPackage":None} + return dict + def paramsetter(self,dict): + self.thermoPackage = dict['thermoPackage'] + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + self.OM_data_init = self.OM_data_init + ("model fls"+str(self.count)+"\n") + self.OM_data_init = self.OM_data_init + ("extends Simulator.Unit_Operations.Flash;\n" ) + self.OM_data_init = self.OM_data_init + ("extends Simulator.Files.Thermodynamic_Packages."+self.thermoPackage+";\n") + self.OM_data_init = self.OM_data_init + ("end fls"+str(self.count)+";\n") + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + ( + "fls"+str(self.count)+" "+ self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("});\n") + return self.OM_data_init + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + comp_count = len(addedcomp) + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.InputStms[0].name + '.outlet,' + self.name + '.feed' + ');\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.vapor,' + self.OutputStms[0].name + '.inlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.liquid,' + self.OutputStms[1].name + '.inlet);\n') + return self.OM_data_eqn
\ No newline at end of file diff --git a/OMChem/Flowsheet.py b/OMChem/Flowsheet.py new file mode 100644 index 0000000..35c6d0a --- /dev/null +++ b/OMChem/Flowsheet.py @@ -0,0 +1,467 @@ +# from OMPython import OMCSession +import os +import csv +from subprocess import Popen, PIPE +#import subprocess +import pandas as pd + +class Flowsheet(): + def __init__(self): + self.sim_name = 'Simulator' + self.sim_method = '' + self.UnitOpn = [] + self.data = [] + self.compounds = [] + self.interface = '' + self.omc_path = None + self.curr_path = os.getcwd() + self.sim_dir_path = os.path.join(self.curr_path, self.sim_name) + self.Flomo_path = os.path.join(self.sim_dir_path,'Flowsheet.mo') + self.eqn_mos_path = os.path.join(self.sim_dir_path,'simulateEQN.mos') + self.sm_mos_path = os.path.join(self.sim_dir_path,'simulateSM.mos') + self.resdata = [] + self.stdout=None + self.stderr=None + + + def get_omc_path(self): + try: + self.omhome = os.environ.get('OPENMODELICAHOME') + if self.omhome is None: + self.omhome = os.path.split(os.path.split(os.path.realpath(spawn.find_executable("omc")))[0])[0] + elif os.path.exists('/opt/local/bin/omc'): + self.omhome = '/opt/local' + return os.path.join(self.omhome, 'bin', 'omc') + except BaseException: + print("The OpenModelica compiler is missing in the System path please install it" ) + raise + + def add_UnitOpn(self,unitop,flag): + f=(unitop,flag) + self.UnitOpn.append(f) + def remove_UnitOpn(self,unitop): + self.UnitOpn.remove(unitop) + + def add_comp_list(self,comp): + self.compounds = comp + + + def send_for_simulationEqn(self): + self.resdata = [] + self.omc_path = self.get_omc_path() + print(self.omc_path) + + if self.sim_method == 'Eqn': + simpath = self.eqn_mos_path + os.chdir(self.sim_dir_path) + + process = Popen([self.omc_path, '-s',simpath], stdout=PIPE, stderr=PIPE) + self.stdout, self.stderr = process.communicate() + #s = subprocess.check_output([self.omc_path, '-s',simpath]) + #print(s) + #print("############### StdOut ################") + print(self.stdout) + os.chdir(self.curr_path) + #os.system(self.omc_path + ' -s ' + simpath) + print("Hello") + if self.sim_method == 'Eqn': + print("hhhh") + csvpath = os.path.join(self.sim_dir_path,'Flowsheet_res.csv') + print("csvPath",csvpath) + with open (csvpath,'r') as resultFile: + self.resdata = [] + print("opened") + csvreader = csv.reader(resultFile,delimiter=',') + for row in csvreader: + print("124125") + self.resdata.append(row) + #self.ExtData() + + + def send_for_simulationSM(self,unitop): + + self.resdata = [] + self.omc_path = self.get_omc_path() + os.chdir(self.sim_dir_path) + #os.system(self.omc_path + ' -s ' + unitop.name+'.mos') + process = Popen([self.omc_path, '-s',unitop.name,'.mos'], stdout=PIPE, stderr=PIPE) + stdout, stderr = process.communicate() + #s = subprocess.check_output([self.omc_path, '-s',simpath]) + #print(s) + print("############### StdOut ################") + print(stdout) + self.resdata = [] + print('Simulating '+unitop.name+'...') + csvpath = os.path.join(self.sim_dir_path,unitop.name+'_res.csv') + with open(csvpath,'r') as resultFile: + csvreader = csv.reader(resultFile,delimiter=',') + for row in csvreader: + self.resdata.append(row) + self.ExtData() + + + + + + # if self.sim_method == 'SM': + # for unitop in self.UnitOpn: + # self.resdata = [] + # if unitop.type != 'MatStm': + # print 'Simulating '+unitop.name+'...' + # csvpath = os.path.join(self.sim_dir_path,unitop.name+'_res.csv') + # with open(csvpath,'r') as resultFile: + # csvreader = csv.reader(resultFile,delimiter=',') + # for row in csvreader: + # self.resdata.append(row) + # self.ExtData() + + + + + + # if self.interface == 'OMPython': + # omc = OMCSession() + # omc.sendExpression("loadModel(Modelica)") + # omc.sendExpression("loadFile(\"Simulator.mo\")") + # omc.sendExpression("loadFile(\"Flowsheet.mo\")") + # execsim = omc.sendExpression("simulate(Flowsheet, outputFormat=\"csv\", stopTime=1.0, numberOfIntervals=1)") + + # else: + # os.system(self.omc_path + ' -s ') + + def ExtData(self): + for unit in self.UnitOpn: + if unit[0].type == 'MatStm': +# + for key, value in unit[0].Prop.items(): + + + propertyname = unit[0].name + '.' + key + if propertyname in self.resdata[0]: + ind = self.resdata[0].index(propertyname) + resultval = str(self.resdata[-1][ind]) + #resultval = str(omc.sendExpression("val("+unit.name+ "." + value + ", 0.5)")) + print(resultval) + unit[0].Prop[key] = resultval + #print(unit[0].Prop) + # else: + # for v in value: + # propertyname = unit.name + '.' + v + # if propertyname in self.resdata[0]: + # ind = self.resdata[0].index(propertyname) + # resultval = str(self.resdata[-1][ind]) + # # resultval = str(omc.sendExpression("val("+unit.name+ "." + v + ", 0.5)")) + # unit.Prop[key][i] = resultval + # i = i + 1 + + # for key, value in unit.OMVapProp.iteritems(): + # i = 0 + + # if type(value) is str: + # propertyname = unit.name + '.' + value + # if propertyname in self.resdata[0]: + # ind = self.resdata[0].index(propertyname) + # resultval = str(self.resdata[-1][ind]) + # # resultval = str(omc.sendExpression("val("+unit.name+ "." + value + ", 0.5)")) + # unit.VapProp[key] = resultval + # else: + # for v in value: + # propertyname = unit.name + '.' + v + # if propertyname in self.resdata[0]: + # ind = self.resdata[0].index(propertyname) + # resultval = str(self.resdata[-1][ind]) + # # resultval = str(omc.sendExpression("val("+unit.name+ "." + v + ", 0.5)")) + # unit.VapProp[key][i] = resultval + # i = i + 1 + + + # for key, value in unit.OMLiqProp.iteritems(): + # i = 0 + + # if type(value) is str: + # propertyname = unit.name + '.' + value + # if propertyname in self.resdata[0]: + # ind = self.resdata[0].index(propertyname) + # resultval = str(self.resdata[-1][ind]) + # # resultval = str(omc.sendExpression("val("+unit.name+ "." + value + ", 0.5)")) + # unit.LiqProp[key] = resultval + # else: + # for v in value: + # propertyname = unit.name + '.' + v + # if propertyname in self.resdata[0]: + # ind = self.resdata[0].index(propertyname) + # resultval = str(self.resdata[-1][ind]) + # # resultval = str(omc.sendExpression("val("+unit.name+ "." + v + ", 0.5)")) + # unit.LiqProp[key][i] = resultval + # i = i + 1 + # for key, value in unit.OMVapProp.iteritems(): + # i = 0 + + # if type(value) is str: + # resultval = str(omc.sendExpression("val("+unit.name+ "." + value + ", 0.5)")) + # unit.VapProp[key] = resultval + # else: + # for v in value: + # resultval = str(omc.sendExpression("val("+unit.name+ "." + v + ", 0.5)")) + # unit.VapProp[key][i] = resultval + # i = i + 1 + + + # for key, value in unit.OMLiqProp.iteritems(): + # i = 0 + + # if type(value) is str: + # resultval = str(omc.sendExpression("val("+unit.name+ "." + value + ", 0.5)")) + # unit.LiqProp[key] = resultval + # else: + # for v in value: + # resultval = str(omc.sendExpression("val("+unit.name+ "." + v + ", 0.5)")) + # unit.LiqProp[key][i] = resultval + # i = i + 1 + + + + def simulateEQN(self): + self.data = [] + print("##################################################") + print("##################################################") + self.sim_method = 'Eqn' + self.data.append("model Flowsheet\n") + + for c in self.compounds: + ucase = c.title() + lcase = c.lower() + self.data.append("parameter Simulator.Files.Chemsep_Database." + ucase +' '+ ucase + "; \n") + + for unitop in self.UnitOpn: + self.data.append(unitop[0].OM_Flowsheet_Init(self.compounds)) + + self.data.append("equation\n") + + for unitop in self.UnitOpn: + if unitop[1]==0: + + if unitop[0].type == 'MatStm': + self.data.append(unitop[0].OM_Flowsheet_Eqn(self.compounds,'Eqn')) + else: + self.data.append(unitop[0].OM_Flowsheet_Eqn(self.compounds)) + else: + pass + with open(self.Flomo_path, 'w') as txtfile: + for d in self.data: + txtfile.write(d) + txtfile.write('end Flowsheet;\n') + + with open(self.eqn_mos_path, 'w') as mosFile: + mosFile.write('loadModel(Modelica);\n') + mosFile.write("loadFile(\"Simulator\package.mo\");\n") + mosFile.write("loadFile(\"Flowsheet.mo\");\n") + mosFile.write("simulate(Flowsheet, outputFormat=\"csv\", stopTime=1.0, numberOfIntervals=1);\n") + + print('Initiating Simulation in Equation Oriented Mode') + + self.send_for_simulationEqn() + + + + + def simulateSM(self,ip,op): + self.sim_method = 'SM' + self.data = [] + self.resdata = [] + self.unit = [] + self.csvlist = [] + print("op list",op) + print("ip list",ip) + for i in ip: + common = ip[i] + print("common #############3",common) + print("*********** i *********",i) + for k,v in op.items(): + print("Print K",k) + if(set(v) & set(common)): + print("*****************common matstm***************") + if((i in self.unit) and (k in self.unit)): + print("both exist") + pass + elif(i in self.unit): + print("output exist") + self.unit.insert(self.unit.index(i),k) + elif(k in self.unit): + print("input exists") + self.unit.append(i) + else: + print("nothing exists") + self.unit.append(k) + self.unit.append(i) + print("##############################33") + print(self.unit) + print("################################11") + + for unitop in self.unit: + os.chdir(self.curr_path) + self.data = [] + if unitop.type not in ['MatStm','EngStm']: + inpstms = unitop.InputStms + outstms = unitop.OutputStms + + try: + engstms = unitop.EngStms + except: + engstms = None + + self.data.append("model "+unitop.name.lower()+'\n') + + for c in self.compounds: + ucase = c.title() + lcase = c.lower() + self.data.append("parameter Simulator.Files.Chemsep_Database." + ucase +' '+ ucase + "; \n") + + print("##############compounds added") + self.data.append(unitop.OM_Flowsheet_Init(self.compounds)) + + if type(outstms) is list: + for stm in outstms: + self.data.append(stm.OM_Flowsheet_Init(self.compounds)) + else: + self.data.append(outstms.OM_Flowsheet_Init(self.compounds)) + + + if engstms: + self.data.append(engstms.OM_Flowsheet_Init(self.compounds)) + + if type(inpstms) is list: + for stm in inpstms: + self.data.append(stm.OM_Flowsheet_Init(self.compounds)) + else: + self.data.append(inpstms.OM_Flowsheet_Init(self.compounds)) + + self.data.append('equation\n') + print("##################equation") + self.data.append(unitop.OM_Flowsheet_Eqn(self.compounds)) + ''' + if type(outstms) is list: + for stm in outstms: + #stm.GetEquationValues() + self.data.append(stm.OM_Flowsheet_Eqn(self.compounds,'SM')) + else: + #outstms.GetEquationValues() + self.data.append(outstms.OM_Flowsheet_Eqn(self.compounds,'SM')) +''' + if type(inpstms) is list: + for stm in inpstms: + #stm.GetEquationValues() + self.data.append(stm.OM_Flowsheet_Eqn(self.compounds,'SM')) + else: + #inpstms.GetEquationValues() + self.data.append(inpstms.OM_Flowsheet_Eqn(self.compounds,'SM')) + + # os.chdir(self.sim_dir_path) + unitmofile = os.path.join(self.sim_dir_path,unitop.name.lower()+'.mo') + + with open(unitmofile,'w') as unitFile: + for d in self.data: + unitFile.write(d) + unitFile.write('end '+unitop.name.lower()+';\n') + + unitmosfile = os.path.join(self.sim_dir_path,unitop.name.lower()+'.mos') + with open(unitmosfile, 'w') as mosFile: + mosFile.write('loadModel(Modelica);\n') + mosFile.write("loadFile(\"Simulator\package.mo\");\n") + + mosFile.write("loadFile(\""+unitop.name.lower()+".mo\");\n") + mosFile.write("simulate("+unitop.name.lower()+", outputFormat=\"csv\", stopTime=1.0, numberOfIntervals=1);\n") + + print("Initiating simulation in Sequential Modular Mode") + #self.resdata = [] + self.omc_path = self.get_omc_path() + os.chdir(self.sim_dir_path) + #os.system(self.omc_path + ' -s ' + unitop[0].name.lower()+"SEQ"+'.mos') + print("SIM directory Path 1 ###",self.sim_dir_path) + sim = os.path.join(self.sim_dir_path,unitop.name.lower()+'.mos') + process = Popen([self.omc_path, '-s',sim], stdout=PIPE, stderr=PIPE) + self.stdout, self.stderr = process.communicate() + os.chdir(self.curr_path) + #s = subprocess.check_output([self.omc_path, '-s',simpath]) + #print(s) + print("############### StdOut ################") + print(self.stdout) + print("############### StdErr ################") + print(self.stderr) + print('Simulating '+unitop.name.lower()+'...') + csvpath = os.path.join(self.sim_dir_path,unitop.name.lower()+'_res.csv') + + self.csvlist.append(csvpath) + + with open(csvpath,'r') as resultFile: + csvreader = csv.reader(resultFile,delimiter=',') + for row in csvreader: + self.resdata.append(row) + + os.chdir(self.curr_path) + if type(inpstms) is list: + for stm in inpstms: + for key, value in stm.Prop.items(): + propertyname = stm.name + '.' + key + if propertyname in self.resdata[0]: + ind = self.resdata[0].index(propertyname) + resultval = str(self.resdata[-1][ind]) + stm.Prop[key] = resultval + + #print("input",stm.Prop[key]) + + + else: + for key, value in inpstms.Prop.items(): + propertyname = inpstms.name + '.' + key + if propertyname in self.resdata[0]: + ind = self.resdata[0].index(propertyname) + resultval = str(self.resdata[-1][ind]) + inpstms.Prop[key] = resultval + #print("input",inpstms.Prop[key]) + + if type(outstms) is list: + for stm in outstms: + for key, value in stm.Prop.items(): + propertyname = stm.name + '.' + key + if propertyname in self.resdata[0]: + ind = self.resdata[0].index(propertyname) + resultval = str(self.resdata[-1][ind]) + stm.Prop[key] = resultval + print("output key:",key,"value:",stm.Prop[key]) + else: + for key, value in outstms.Prop.items(): + propertyname = outstms.name + '.' + key + if propertyname in self.resdata[0]: + ind = self.resdata[0].index(propertyname) + resultval = str(self.resdata[-1][ind]) + outstms.Prop[key] = resultval + print("output key:",key,"value:",outstms.Prop[key]) + + + self.dataframes = [pd.read_csv(i) for i in self.csvlist] + os.chdir(self.sim_dir_path) + dffinal = pd.concat(self.dataframes,axis=1) + dffinal.to_csv('FlowsheetSEQ.csv',index=False) + self.resdata.clear() + with open(os.path.join(self.sim_dir_path+'/FlowsheetSEQ.csv'),'r') as resultFile: + csvreader = csv.reader(resultFile,delimiter=',') + for row in csvreader: + self.resdata.append(row) + + + + + + + + + + + + + + + + + diff --git a/OMChem/Heater.py b/OMChem/Heater.py new file mode 100644 index 0000000..c0d8d95 --- /dev/null +++ b/OMChem/Heater.py @@ -0,0 +1,69 @@ +from OMChem.EngStm import EngStm +class Heater(): + def __init__(self,name='Heater',PressureDrop = None, eff = None): + self.PressureDrop = PressureDrop + self.eff = eff + self.name = name + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = None + #self.heatAdd=heatAdd + #self.outT = outT + self.OutputStms = None + self.EngStms = EngStm(name='EngStm'+name) + self.type = 'Heater' + self.mode = None + self.modeVal = None + + self.Prop = { + 'pressDrop':None, + 'eff':None, + 'outT':None, + 'tempInc':None, + 'heatAdd':None, + } + + def connect(self,InputStms = None,OutputStms = None): + self.InputStms = InputStms + self.OutputStms = OutputStms + + def modesList(self): + return ["heatAdd","outT","outVapPhasMolFrac","tempInc","enFlo"] + + def paramgetter(self,mode="heatAdd"): + self.mode = mode + dict = {"PressureDrop":None,"eff":None,self.mode:None} + return dict + + def paramsetter(self,dict): + + self.PressureDrop = dict['PressureDrop'] + self.eff = dict['eff'] + self.modeVal = dict[self.mode] + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStms.name+';\n' + self.OM_data_init = self.OM_data_init + ( + "Simulator.Unit_Operations.Heater " + self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("},") + self.OM_data_init = self.OM_data_init + 'pressDrop = ' + str(self.PressureDrop) +',' + self.OM_data_init = self.OM_data_init + 'eff = ' + str(self.eff) + ');\n' + return self.OM_data_init + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + # self.OM_data_eqn = self.name + '.pressDrop = ' + str(self.PressDrop) + ';\n' + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.InputStms[0].name + '.outlet,' + self.name + '.inlet' + ');\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.outlet,' + self.OutputStms[0].name + '.inlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.EngStms.name + '.outlet,' + self.name + '.energy);\n') + + if(self.mode =="enFlo"): + self.OM_data_eqn = self.OM_data_eqn + (self.EngStms.name+'.'+self.mode+'='+ self.modeVal + ';\n') + else: + self.OM_data_eqn = self.OM_data_eqn + (self.name+'.'+self.mode+'='+ self.modeVal + ';\n') + return self.OM_data_eqn diff --git a/OMChem/MatStm.py b/OMChem/MatStm.py new file mode 100644 index 0000000..6a3d814 --- /dev/null +++ b/OMChem/MatStm.py @@ -0,0 +1,500 @@ +from OMPython import OMCSession +import json +import sys +from collections import defaultdict + +class MatStm(): + def __init__(self,name =None,CompNames = [],Temperature=300,Pressure=101325,VapPhasMolFrac=None,VapPhasMasFrac=None,LiqPhasMolFrac=None,LiqPhasMasFrac=None,CompMolFrac = [1.0], CompMasFrac = [], MolFlow=100, MasFlow=None,**kwargs): + self.name = name[0] + self.type = 'MatStm' + self.T = Temperature + self.P = Pressure + self.VapPhasMolFrac = VapPhasMolFrac + self.VapPhasMasFrac = VapPhasMasFrac + self.LiqPhasMolFrac = LiqPhasMolFrac + self.LiqPhasMasFrac = LiqPhasMasFrac + self.CompNames = CompNames + self.CompMolFrac = CompMolFrac + self.CompMasFrac = CompMasFrac + self.MolFlow = MolFlow + self.MasFlow = MasFlow + self.OM_data_init = '' + self.OM_data_eqn = '' + self.count = name[1] + self.thermoPackage ="Raoults_Law" + self.mode1 = "P" + self.mode1val = "" + self.mode2 = "T" + self.mode2val = "" + + # self.ValEntList = {"T":T," P":P," VapPhasMolFrac":vapPhasMolFrac," CompNames":CompNames," CompMolFrac[1]":CompMolFrac," CompMasFrac":CompMasFrac," MolFlow[1]":MolFlow," MasFlow[1]":MasFlow} + + + # self.OMProp = { + # 'Pressure': self.mode1, + # 'Temperature': self.mode2, + # 'Liquid Phase Mole Fraction': 'liqPhasMolFrac', + # 'Liquid Phase Mas Fraction': 'liqPhasMasFrac', + # 'Vapour Phase Mole Fraction': 'vapPhasMolFrac', + # 'Vapour Phase Mas Fraction': 'vapPhasMasFrac', + # 'Total Molar Flow': 'totMolFlo[1]', + # 'Total Mas Flow': 'totMasFlo[1]', + # 'Av. Molecular Weight': 'MW[1]', + # 'Comp Mole Fraction': ['compMolFrac[1,1]','compMolFrac[1,2]','compMolFrac[1,3]'], + # 'Comp Mas Fraction': ['compMasFrac[1,1]','compMasFrac[1,2]','compMasFrac[1,3]'], + # 'Comp Molar Flow': ['compMolFlo[1,1]','compMolFlo[1,2]','compMolFlo[1,3]'], + # 'Comp Mas Flow': ['compMasFlo[1,1]','compMasFlo[1,2]','compMasFlo[1,3]'], + # 'Molar Specific Heat': 'phasMolSpHeat[1]', + # 'Molar Enthalpy': 'phasMolEnth[1]', + # 'Molar Entropy': 'phasMolEntr[1]' + # } + self.startDict = {} + self.eqnDict = {} + + + self.Prop = { + + self.mode1:self.mode1val, + self.mode2:self.mode2val, + 'liqPhasMolFrac':LiqPhasMolFrac, + 'liqPhasMasFrac':LiqPhasMasFrac, + 'vapPhasMolFrac':VapPhasMolFrac, + 'vapPhasMasFrac':VapPhasMasFrac, + 'totMolFlo[1]':MolFlow, + 'totMasFlo[1]':MasFlow, + 'MW[1]':None, + 'MW[2]':None, + 'MW[3]':None, + 'phasMolSpHeat[1]':None, + 'phasMolEnth[1]':None, + '[1]':None, + 'phasMolSpHeat[2]':None, + 'phasMolEnth[2]':None, + 'phasMolEntr[2]':None, + 'phasMolSpHeat[3]':None, + 'phasMolEnth[3]':None, + 'phasMolEntr[3]':None, + 'totMolFlo[2]':None, + 'totMasFlo[2]':None, + 'totMolFlo[3]':None, + 'totMasFlo[3]':None + + } + + self.Prop1 = { + self.mode1:self.mode1val, + self.mode2:self.mode2val, + 'liqPhasMolFrac':LiqPhasMolFrac, + 'liqPhasMasFrac':LiqPhasMasFrac, + 'vapPhasMolFrac':VapPhasMolFrac, + 'vapPhasMasFrac':VapPhasMasFrac, + 'totMolFlo[1]':MolFlow, + 'totMasFlo[1]':MasFlow, + 'MW[1]':None, + 'MW[2]':None, + 'MW[3]':None, + 'phasMolSpHeat[1]':None, + 'phasMolEnth[1]':None, + 'phasMolEntr[1]':None, + 'phasMolSpHeat[2]':None, + 'phasMolEnth[2]':None, + 'phasMolEntr[2]':None, + 'phasMolSpHeat[3]':None, + 'phasMolEnth[3]':None, + 'phasMolEntr[3]':None, + 'totMolFlo[2]':None, + 'totMasFlo[2]':None, + 'totMolFlo[3]':None, + 'totMasFlo[3]':None + + } + + def modesList(self): + return ["PT","PH","PVF","TVF","PS"] + def paramgetter(self,mode): + dict = {} + if(mode=="PT"): + self.mode1 = 'P' + self.mode2 = 'T' + dict = {self.mode2:None,self.mode1:None,"CompMolFrac":None,"MolFlow":None,"thermoPackage":None} + elif(mode=="PH"): + self.mode1 = 'P' + self.mode2 = 'phasMolEnth[1]' + dict = {self.mode1:None,self.mode2:None,"CompMolFrac":None,"MolFlow":None,"thermoPackage":None} + elif(mode=="PVF"): + self.mode1 = 'P' + self.mode2 = 'vapPhasMolFrac' + dict = {self.mode1:None,self.mode2:None,"CompMolFrac":None,"MolFlow":None,"thermoPackage":None} + elif(mode=="TVF"): + self.mode1 = 'T' + self.mode2 = 'vapPhasMolFrac' + dict = {self.mode1:None,self.mode2:None,"CompMolFrac":None,"MolFlow":None,"thermoPackage":None} + elif(mode=="PS"): + self.mode1 = 'P' + self.mode2 = 'phasMolEntr[1]' + dict = {self.mode1:None,self.mode2:None,"CompMolFrac":None,"MolFlow":None,"thermoPackage":None} + + return dict + def paramsetter(self,dict): + self.mode1val = dict[self.mode1] + self.mode2val = dict[self.mode2] + self.MolFlow = dict['MolFlow'] + self.CompMolFrac = dict['CompMolFrac'].split(",") + self.thermoPackage = dict['thermoPackage'] + self.Prop['totMolFlo[1]'] = self.MolFlow + self.Prop[self.mode2] = dict[self.mode2] + self.Prop[self.mode1] = dict[self.mode1] + for i in range(len(self.CompNames)): + print('####### compmolfrac #########\n',self.CompMolFrac[i]) + if self.CompMolFrac: + self.Prop['compMolFrac[1,'+str(i+1)+']'] = self.CompMolFrac[i] + else: + self.Prop['compMolFrac[1,'+str(i+1)+']'] = None + + if self.CompMasFrac: + self.Prop['compMasFrac[1,'+str(i+1)+']'] = self.CompMasFrac[i] + else: + self.Prop['compMasFrac[1,'+str(i+1)+']'] = None + self.Prop['compMolFlo[1,'+str(i+1)+']'] = None + self.Prop['compMasFlo[1,'+str(i+1)+']'] = None + for i in range(0,len(self.CompNames)): + self.Prop['compMolFrac[2,'+str(i+1)+']'] = None + self.Prop['compMasFrac[2,'+str(i+1)+']'] = None + self.Prop['compMolFlo[2,'+str(i+1)+']'] = None + self.Prop['compMasFlo[2,'+str(i+1)+']'] = None + self.Prop['compMolFrac[3,'+str(i+1)+']'] = None + self.Prop['compMasFrac[3,'+str(i+1)+']'] = None + self.Prop['compMolFlo[3,'+str(i+1)+']'] = None + self.Prop['compMasFlo[3,'+str(i+1)+']'] = None + + def GetMinEqnValues(self): + compmolfraclist = [] + for i in range(0,len(self.CompNames)): + print(self.Prop['compMolFrac[1,'+str(i+1)+']']) + compmolfraclist.append(self.Prop['compMolFrac[1,'+str(i+1)+']']) + print(compmolfraclist) + #compmolfraclist = list(self.Prop(compMolFrac[1,1)]) + compmolfrac = json.dumps(compmolfraclist) + print(compmolfrac) + compmolfrac = compmolfrac.replace('[','{') + compmolfrac = compmolfrac.replace(']','}') + compmolfrac = compmolfrac.replace('"','') + ''' + compmolfracstr = json.dumps(self.CompMolFrac) + compmolfracstr = compmolfracstr.replace('[','{') + compmolfracstr = compmolfracstr.replace(']','}') + compmolfracstr = compmolfracstr.replace('"','') + ''' + if self.Prop[self.mode1]: + self.eqnDict[self.mode1] = self.Prop[self.mode1] + if self.Prop[self.mode2]: + self.eqnDict[self.mode2] = self.Prop[self.mode2] + if self.CompMolFrac: + self.eqnDict['compMolFrac[1,:]'] = compmolfrac + if self.MolFlow: + self.eqnDict['totMolFlo[1]'] = self.Prop['totMolFlo[1]']#self.MolFlow + + print("##############$GetMinVEqnValuesStart$##################") + print("P:",self.Prop[self.mode1]) + print("T:",self.Prop[self.mode2]) + print("CompMolFrac",compmolfrac) + print("totMolFlo",self.Prop['totMolFlo[1]']) + print("##############$GetMinVEqnValuesEnd$##################") + + def GetEquationValues(self): + if self.Prop[self.mode1]: + self.eqnDict[self.mode1] = self.Prop[self.mode1] + + if self.Prop[self.mode2]: + self.eqnDict[self.mode2] = self.Prop[self.mode2] + + if self.Prop['compMolFrac[1,1]']: + cfa = [] + for i in range(1,len(self.CompNames)+1): + cfa.append(self.Prop['compMolFrac[1,'+str(i)+']']) + cmpMolFracstr = json.dumps(cfa) + cmpMolFracstr = cmpMolFracstr.replace('[','{') + cmpMolFracstr = cmpMolFracstr.replace(']','}') + cmpMolFracstr = cmpMolFracstr.replace('"','') + self.eqnDict['compMolFrac[1,:]'] = cmpMolFracstr + + if self.Prop['totMolFlo[1]']: + self.eqnDict['totMolFlo[1]'] = self.Prop['totMolFlo[1]'] + + + def GetStartValues(self): + try: + if self.Prop[self.mode1]: + self.startDict[self.mode1] = self.Prop[self.mode1] + + if self.Prop[self.mode2]: + self.startDict[self.mode2] = self.Prop[self.mode2] + + + if self.Prop['compMolFrac[2,1]'] != None: + compMolFracarr = [] + for i in range(1,4): + cmf = [] + for j in range(1,len(self.CompNames)+1): + cmf.append(str(self.Prop['compMolFrac['+str(i)+','+str(j)+']'])) + compMolFracarr.append(cmf) + compMolFracstr = json.dumps(compMolFracarr) + compMolFracstr = compMolFracstr.replace('[','{') + compMolFracstr = compMolFracstr.replace(']','}') + compMolFracstr = compMolFracstr.replace('"','') + self.startDict['compMolFrac'] = compMolFracstr + + if self.Prop['compMasFrac[2,1]'] != None: + compMasFracarr = [] + for i in range(1,4): + cmf = [] + for j in range(1,len(self.CompNames)+1): + cmf.append(str(self.Prop['compMasFrac['+str(i)+','+str(j)+']'])) + compMasFracarr.append(cmf) + compMasFracstr = json.dumps(compMolFracarr) + compMasFracstr = compMasFracstr.replace('[','{') + compMasFracstr = compMasFracstr.replace(']','}') + compMasFracstr = compMasFracstr.replace('"','') + self.startDict['compMasFrac'] = compMasFracstr + + if self.Prop['compMasFlo[2,1]'] != None: + compMasFloarr = [] + for i in range(1,4): + cmf = [] + for j in range(1,len(self.CompNames)+1): + cmf.append(str(self.Prop['compMasFlo['+str(i)+','+str(j)+']'])) + compMasFloarr.append(cmf) + compMasFlostr = json.dumps(compMolFracarr) + compMasFlostr = compMasFlostr.replace('[','{') + compMasFlostr = compMasFlostr.replace(']','}') + compMasFlostr = compMasFlostr.replace('"','') + self.startDict['compMasFlo'] = compMasFlostr + + if self.Prop['compMolFlo[2,1]'] != None: + compMolFloarr = [] + for i in range(1,4): + cmf = [] + for j in range(1,len(self.CompNames)+1): + cmf.append(str(self.Prop['compMolFlo['+str(i)+','+str(j)+']'])) + compMolFloarr.append(cmf) + compMolFlostr = json.dumps(compMolFloarr) + compMolFlostr = compMolFlostr.replace('[','{') + compMolFlostr = compMolFlostr.replace(']','}') + compMolFlostr = compMolFlostr.replace('"','') + self.startDict['compMolFlo'] = compMolFlostr + + if self.Prop['MW[2]'] != None: + MWArr = [] + for i in range(1,4): + MWArr.append(self.Prop['MW['+str(i)+']']) + MWStr = json.dumps(MWArr) + MWStr = MWStr.replace('[','{') + MWStr = MWStr.replace(']','}') + MWStr = MWStr.replace('"','') + self.startDict['MW'] = MWStr + + if self.Prop['totMolFlo[2]'] != None: + totMolFloArr = [] + for i in range(1,4): + totMolFloArr.append(self.Prop['totMolFlo['+str(i)+']']) + totMolFloStr = json.dumps(totMolFloArr) + totMolFloStr = totMolFloStr.replace('[','{') + totMolFloStr = totMolFloStr.replace(']','}') + totMolFloStr = totMolFloStr.replace('"','') + self.startDict['totMolFlo'] = totMolFloStr + + if self.Prop['phasMolSpHeat[2]'] != None: + phasMolSpHeatArr = [] + for i in range(1,4): + phasMolSpHeatArr.append(self.Prop['phasMolSpHeat['+str(i)+']']) + phasMolSpHeatStr = json.dumps(phasMolSpHeatArr) + phasMolSpHeatStr = phasMolSpHeatStr.replace('[','{') + phasMolSpHeatStr = phasMolSpHeatStr.replace(']','}') + phasMolSpHeatStr = phasMolSpHeatStr.replace('"','') + self.startDict['phasMolSpHeat'] = phasMolSpHeatStr + + if self.Prop['phasMolEnth[2]'] != None: + phasMolEnthArr = [] + for i in range(1,4): + phasMolEnthArr.append(self.Prop['phasMolEnth['+str(i)+']']) + phasMolEnthStr = json.dumps(phasMolEnthArr) + phasMolEnthStr = phasMolEnthStr.replace('[','{') + phasMolEnthStr = phasMolEnthStr.replace(']','}') + phasMolEnthStr = phasMolEnthStr.replace('"','') + self.startDict['phasMolEnth'] = phasMolEnthStr + + + if self.Prop['phasMolEntr[2]'] != None: + phasMolEntrArr = [] + for i in range(1,4): + phasMolEntrArr.append(self.Prop['phasMolEntr['+str(i)+']']) + phasMolEntrStr = json.dumps(phasMolEntrArr) + phasMolEntrStr = phasMolEntrStr.replace('[','{') + phasMolEntrStr = phasMolEntrStr.replace(']','}') + phasMolEntrStr = phasMolEntrStr.replace('"','') + self.startDict['phasMolEntr'] = phasMolEntrStr + + if self.Prop['totMasFlo[2]'] != None: + totMasFloArr = [] + for i in range(1,4): + totMasFloArr.append(self.Prop['totMasFlo['+str(i)+']']) + totMasFloStr = json.dumps(totMasFloArr) + totMasFloStr = totMasFloStr.replace('[','{') + totMasFloStr = totMasFloStr.replace(']','}') + totMasFloStr = totMasFloStr.replace('"','') + self.startDict['totMasFlo'] = totMasFloStr + + except Exception as e: + exc_type, exc_obj, exc_tb = sys.exc_info() + print(exc_type,exc_tb.tb_lineno) + print(e) + print('error') + + # self.OMVapProp = { + # 'Pressure': self.mode1, + # 'Temperature': self.mode2, + # 'Total Molar Flow': 'totMolFlo[3]', + # 'Total Mas Flow': 'totMasFlo[3]', + # 'Comp Mole Fraction': ['compMolFrac[3,1]','compMolFrac[3,2]','compMolFrac[3,3]'], + # 'Comp Mas Fraction': ['compMasFrac[3,1]','compMasFrac[3,2]','compMasFrac[3,3]'], + # 'Comp Molar Flow': ['compMolFlo[3,1]','compMolFlo[3,2]','compMolFlo[3,3]'], + # 'Comp Mas Flow': ['compMasFlo[3,1]','compMasFlo[3,2]','compMasFlo[3,3]'], + # 'Av. Molecular Weight': 'phasMolEnth[3]', + # 'Molar Specific Heat': 'phasMolSpHeat[3]', + # 'Molar Enthalpy': 'phasMolEnth[3]', + # 'Molar Entropy': 'phasMolEntr[3]'} + + + + # self.VapProp = { + # self.mode1:None, + # self.mode2:None, + # 'liqPhasMolFrac':None, + # 'liqPhasMasFrac':None, + # 'vapPhasMolFrac':None, + # 'vapPhasMasFrac':None, + # 'totMolFlo[3]':None, + # 'totMasFlo[3]':None, + # 'MW[1]':None, + # 'compMolFrac[3,1]':None, + # 'compMolFrac[3,2]':None, + # 'compMolFrac[3,3]':None, + # 'compMasFrac[3,1]':None, + # 'compMasFrac[3,2]':None, + # 'compMasFrac[3,3]'None, + # 'compMolFlo[3,1]':None, + # 'compMolFlo[3,2]':None, + # 'compMolFlo[3,3]':None, + # 'compMasFlo[3,1]':None, + # 'compMasFlo[3,2]':None, + # 'compMasFlo[3,3]':None, + # 'phasMolSpHeat[3]':None, + # 'phasMolEnth[3]':None, + # 'phasMolEntr[3]':None + # } + + + # self.OMLiqProp = { + # 'Pressure': self.mode1, + # 'Temperature': self.mode2, + # 'Total Molar Flow': 'totMolFlo[2]', + # 'Total Mas Flow': 'totMasFlo[2]', + # 'Comp Mole Fraction': ['compMolFrac[2,1]','compMolFrac[2,2]','compMolFrac[2,3]'], + # 'Comp Mas Fraction': ['compMasFrac[2,1]','compMasFrac[2,2]','compMasFrac[2,3]'], + # 'Comp Molar Flow': ['compMolFlo[2,1]','compMolFlo[2,2]','compMolFlo[2,3]'], + # 'Comp Mas Flow': ['compMasFlo[2,1]','compMasFlo[2,2]','compMasFlo[2,3]'], + # 'Av. Molecular Weight': 'MW[2]', + # 'Molar Specific Heat': 'phasMolSpHeat[2]', + # 'Molar Enthalpy': 'phasMolEnth[2]', + # 'Molar Entropy': 'phasMolEntr[2]'} + + + # self.LiqProp = { + # self.mode1:P, + # self.mode2:None, + # 'liqPhasMolFrac':None, + # 'liqPhasMasFrac':None, + # 'vapPhasMolFrac':None, + # 'vapPhasMasFrac':None, + # 'totMolFlo[2]':None, + # 'totMasFlo[2]':None, + # 'MW[1]':None, + # 'compMolFrac[2,1]':None, + # 'compMolFrac[2,2]':None, + # 'compMolFrac[2,3]':None, + # 'compMasFrac[2,1]':None, + # 'compMasFrac[2,2]':None, + # 'compMasFrac[2,3]'None, + # 'compMolFlo[2,1]':None, + # 'compMolFlo[2,2]':None, + # 'compMolFlo[2,3]':None, + # 'compMasFlo[2,1]':None, + # 'compMasFlo[2,2]':None, + # 'compMasFlo[2,3]':None, + # 'phasMolSpHeat[2]':None, + # 'phasMolEnth[2]':None, + # 'phasMolEntr[2]':None + # } + + def OM_Flowsheet_Init(self,addedcomp): + self.OM_data_init = '' + self.OM_data_init = self.OM_data_init + ("model ms"+str(self.count)+"\n") + self.OM_data_init = self.OM_data_init + ("extends Simulator.Streams.Material_Stream;\n" ) + self.OM_data_init = self.OM_data_init + ("extends Simulator.Files.Thermodynamic_Packages."+self.thermoPackage+";\n") + self.OM_data_init = self.OM_data_init + ("end ms"+str(self.count)+";\n") + comp_count = len(addedcomp) + self.GetStartValues() + + #self.OM_data_init = "Simulator.Streams.Mat_Stm_RL " + self.name +"(NOC = " + str(comp_count) + self.OM_data_init = self.OM_data_init + "ms"+str(self.count) +" " + self.name +"(NOC = " + str(comp_count) + self.OM_data_init = self.OM_data_init + ",comp = {" + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'","") + self.OM_data_init = self.OM_data_init + comp + "}," + #for key, value in self.startDict.items(): + # self.OM_data_init = self.OM_data_init + key + '(start = ' + str(value) + '),' + self.OM_data_init = self.OM_data_init[:-1] + self.OM_data_init = self.OM_data_init + ');\n' + return self.OM_data_init + + + def OM_Flowsheet_Eqn(self,addedcomp,method): + self.OM_data_eqn = '' + self.comp_count = len(addedcomp) + if method == 'Eqn': + self.eqnDict = {} + self.GetMinEqnValues() + if method == 'SM': + self.eqnDict = {} + self.GetMinEqnValues() + #self.GetEquationValues() + #self.GetEquationValues() + + for key,value in self.eqnDict.items(): + self.OM_data_eqn = self.OM_data_eqn + self.name + '.'+ key + ' = ' + str(value) + ';\n' + return self.OM_data_eqn + + + # if self.P: + # self.OM_data_eqn = self.OM_data_eqn + (self.name + '.P=' + str(self.P) + ';\n') + # if self.T: + # self.OM_data_eqn = self.OM_data_eqn + (self.name + '.T=' + str(self.T) + ';\n') + # if self.VapPhasMolFrac: + # self.OM_data_eqn = self.OM_data_eqn + (self.name + '.vapPhasMolFrac=' + str(self.VapPhasMolFrac) + ';\n') + + + # if self.CompMolFrac != []: + # self.OM_data_eqn = self.OM_data_eqn + (self.name + ".compMolFrac[1,:] = {") + # mf = str(self.CompMolFrac).strip('[').strip(']') + # self.OM_data_eqn = self.OM_data_eqn + mf + ('};\n') + # if self.CompMasFrac != []: + # self.OM_data_eqn = self.OM_data_eqn + (self.name + ".compMasFrac[1,:] = {") + # Mf = str(self.CompMasFrac).strip('[').strip(']') + # self.OM_data_eqn = self.OM_data_eqn + Mf + ('};\n') + + # if self.MolFlow: + # self.OM_data_eqn = self.OM_data_eqn + (self.name + ".totMolFlo[1] = " + str(self.MolFlow) + ";\n") + # if self.MasFlow: + # self.OM_data_eqn = self.OM_data_eqn + (self.name + ".totMasFlo[1] = " + str(self.MasFlow) + ";\n") + + # return self.OM_data_eqn
\ No newline at end of file diff --git a/OMChem/Mixer.py b/OMChem/Mixer.py new file mode 100644 index 0000000..9419de1 --- /dev/null +++ b/OMChem/Mixer.py @@ -0,0 +1,49 @@ +class Mixer(): + def __init__(self,name='mixer',NOI=5,Pcal = 'Inlet_Average'): + self.NOI = NOI + self.Pcal = Pcal + self.name = name + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = [] + self.OutputStms = None + self.type = 'Mixer' + + def modesList(self): + return [] + + def paramgetter(self,mode=None): + dict = {} + return dict + def paramsetter(self,dict): + self.NOI = dict["NOI"] + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + comp_count = len(addedcomp) + + self.OM_data_init = self.OM_data_init + ( + "Simulator.Unit_Operations.Mixer " + self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("},") + self.OM_data_init = self.OM_data_init + ("outPress = \""+self.Pcal+"\",NI=" + str(self.NOI) + ");\n") + return self.OM_data_init + + def connect(self,InputStms = [],OutputStms = None): + self.NOI=len(InputStms) + self.InputStms = InputStms + self.OutputStms = OutputStms + + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + comp_count = len(addedcomp) + strcount = 1 + for strm in self.InputStms: + self.OM_data_eqn = self.OM_data_eqn + ( + 'connect(' + strm.name + '.outlet,' + self.name + '.inlet[' + str(strcount) + ']);\n') + strcount += 1 + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.outlet,' + self.OutputStms[0].name + '.inlet);\n') + return self.OM_data_eqn + diff --git a/OMChem/Pump.py b/OMChem/Pump.py new file mode 100644 index 0000000..04c8425 --- /dev/null +++ b/OMChem/Pump.py @@ -0,0 +1,58 @@ +from OMChem.EngStm import EngStm +class Pump(): + def __init__(self,name='Pump',eff = None): + self.eff = eff + self.name = name + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = None + #self.heatAdd=heatAdd + #self.outT = outT + self.OutputStms = None + self.EngStms = EngStm(name='EngStm'+name) + self.type = 'Pump' + self.mode = None + self.modeVal = None + + def connect(self,InputStms = None,OutputStms = None): + self.InputStms = InputStms + self.OutputStms = OutputStms + + def modesList(self): + return ["pressInc","outP","reqPow","enFlo"] + + def paramgetter(self,mode="pressInc"): + self.mode = mode + dict = {"eff":None,self.mode:None} + return dict + + def paramsetter(self,dict): + + self.eff = dict['eff'] + self.modeVal = dict[self.mode] + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStms.name+';\n' + self.OM_data_init = self.OM_data_init + ( + "Simulator.Unit_Operations.Centrifugal_Pump " + self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("},") + self.OM_data_init = self.OM_data_init + 'eff = ' + str(self.eff) + ');\n' + return self.OM_data_init + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + # self.OM_data_eqn = self.name + '.pressDrop = ' + str(self.PressDrop) + ';\n' + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.InputStms[0].name + '.outlet,' + self.name + '.inlet' + ');\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.outlet,' + self.OutputStms[0].name + '.inlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.EngStms.name + '.outlet,' + self.name + '.energy);\n') + + if(self.mode =="enFlo"): + self.OM_data_eqn = self.OM_data_eqn + (self.EngStms.name+'.'+self.mode+'='+ self.modeVal + ';\n') + else: + self.OM_data_eqn = self.OM_data_eqn + (self.name+'.'+self.mode+'='+ self.modeVal + ';\n') + return self.OM_data_eqn diff --git a/OMChem/ShortcutColumn.py b/OMChem/ShortcutColumn.py new file mode 100644 index 0000000..13cffea --- /dev/null +++ b/OMChem/ShortcutColumn.py @@ -0,0 +1,76 @@ +from OMChem.EngStm import EngStm +class ShortcutColumn(): + def __init__(self,name=("ShortcutCol",1),condP = None, rebP = None, LKey = None, HKey = None): + self.condP = condP + self.rebP = rebP + self.LKey = LKey + self.HKey = HKey + self.LKeyMolFrac = None + self.HKeyMolFrac = None + self.name = name[0] + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = None + self.OutputStms = None + self.EngStm1 = EngStm(name='EngStm1'+self.name) + self.EngStm2 = EngStm(name='EngStm2'+self.name) + self.count = name[1] + self.condType='' + self.actR = None + self.thermoPackage='Raoults_Law' + self.type = 'ShortCol' + + def modesList(self): + return [] + + def paramgetter(self,mode=None): + dict = { "HKey" : None,"LKey" :None,"HKeyMolFrac":None,"LKeyMolFrac":None,"condType":None,"thermoPackage":None,"condP":None,"rebP":None,"actR":None} + return dict + + def paramsetter(self,dict): + self.HKey = dict["HKey"] + self.LKey = dict["LKey"] + self.HKeyMolFrac = dict["HKeyMolFrac"] + self.LKeyMolFrac=dict["LKeyMolFrac"] + self.condP=dict["condP"] + self.rebP=dict["rebP"] + self.actR=dict["actR"] + self.condType=dict["condType"] + self.thermoPackage=dict["thermoPackage"] + def connect(self,InputStms = None,OutputStms = None): + self.InputStms = InputStms + self.OutputStms = OutputStms + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + self.OM_data_init = self.OM_data_init + ("model sc"+str(self.count)+"\n") + self.OM_data_init = self.OM_data_init + ("extends Simulator.Unit_Operations.Shortcut_Column;\n" ) + self.OM_data_init = self.OM_data_init + ("extends Simulator.Files.Thermodynamic_Packages."+self.thermoPackage+";\n") + self.OM_data_init = self.OM_data_init + ("end sc"+str(self.count)+";\n") + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + "sc"+str(self.count)+ " " + self.name + "(NOC = " + str(comp_count) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("},") + self.OM_data_init = self.OM_data_init + 'condType = ' + "\""+self.condType+"\""+',' + self.OM_data_init = self.OM_data_init + 'HKey = ' + str(self.HKey) +',' + self.OM_data_init = self.OM_data_init + 'LKey = ' + str(self.LKey) + ');\n' + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStm1.name+';\n' + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStm2.name+';\n' + return self.OM_data_init + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.reboiler_duty,' +self.EngStm1.name +'.outlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.EngStm2.name+'.inlet,' + self.name + '.condenser_duty);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.distillate,' + self.OutputStms[0].name + '.inlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.bottoms,' + self.OutputStms[1].name + '.inlet);\n') + + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.InputStms[0].name + '.outlet,' + self.name + '.feed);\n') + self.OM_data_eqn = self.OM_data_eqn + self.name +'.rebP = ' + self.rebP + ';\n' + self.OM_data_eqn = self.OM_data_eqn + self.name +'.condP = ' + self.condP + ';\n' + self.OM_data_eqn = self.OM_data_eqn + self.name +'.mixMolFrac[2,'+self.name+'.LKey]='+self.LKeyMolFrac+ ';\n' + self.OM_data_eqn = self.OM_data_eqn + self.name +'.mixMolFrac[3,'+self.name+'.HKey]='+self.HKeyMolFrac+ ';\n' + self.OM_data_eqn = self.OM_data_eqn + self.name +'.actR=' + self.actR + ';\n' + return self.OM_data_eqn
\ No newline at end of file diff --git a/OMChem/Splitter.py b/OMChem/Splitter.py new file mode 100644 index 0000000..a055851 --- /dev/null +++ b/OMChem/Splitter.py @@ -0,0 +1,52 @@ + +import json +class Splitter(): + def __init__(self,name='splitter',NOO=5,calcType = 'Molar_Flow',specval = [50,50]): + self.NOO = NOO + self.calcType = calcType + self.name = name + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = None + self.OutputStms = [] + self.type = 'Splitter' + self.specval = json.dumps(specval).replace('[','{').replace(']','}') + + def modesList(self): + return [] + def paramgetter(self,mode=None): + dict = {"NOO":None} + return dict + def paramsetter(self,dict): + self.NOI = dict["NOO"] + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + ( + "Simulator.Unit_Operations.Splitter " + self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("},") + self.OM_data_init = self.OM_data_init + ("calcType = \""+self.calcType+"\",NO=" + str(self.NOO) + ");\n") + return self.OM_data_init + + def connect(self,InputStms = None,OutputStms = []): + self.NOO=len(OutputStms) + self.InputStms = InputStms + self.OutputStms = OutputStms + + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + comp_count = len(addedcomp) + strcount = 1 + print("Output#########",self.OutputStms) + for strm in self.OutputStms: + self.OM_data_eqn = self.OM_data_eqn + ( + 'connect(' + strm.name + '.inlet,' + self.name + '.outlet[' + str(strcount) + ']);\n') + strcount += 1 + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.inlet,' + self.InputStms[0].name + '.outlet);\n') + self.OM_data_eqn = self.OM_data_eqn + self.name +'.' +'specVal =' + self.specval +';\n' + return self.OM_data_eqn diff --git a/OMChem/Valve.py b/OMChem/Valve.py new file mode 100644 index 0000000..f8f61b6 --- /dev/null +++ b/OMChem/Valve.py @@ -0,0 +1,52 @@ +class Valve(): + def __init__(self,name='valve'): + #self.PressDrop = PressureDrop + self.mode = None + self.modeVal = None + self.name = name + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = None + self.OutputStms = None + self.type = 'Valve' + + self.Prop = { + 'pressDrop':None, + 'outP':None + } + + def modesList(self): + return ["pressDrop","outP"] + + def paramgetter(self,mode="pressDrop"): + self.mode = mode + dict = {self.mode:None} + return dict + + def paramsetter(self,dict): + + self.modeVal = dict[self.mode] + + def connect(self,InputStms = None,OutputStms = None): + self.InputStms = InputStms + self.OutputStms = OutputStms + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + ( + "Simulator.Unit_Operations.Valve " + self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("});\n") + return self.OM_data_init + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.InputStms[0].name + '.outlet,' + self.name + '.inlet' + ');\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.outlet,' + self.OutputStms[0].name + '.inlet);\n') + print("asdfvfdasdsqdfdedfdfv12345678987654321234567898765") + self.OM_data_eqn = self.OM_data_eqn + (self.name+'.'+self.mode+'='+ self.modeVal + ';\n') + return self.OM_data_eqn
\ No newline at end of file diff --git a/OMChem/__pycache__/CompSep.cpython-36.pyc b/OMChem/__pycache__/CompSep.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..dc4410b --- /dev/null +++ b/OMChem/__pycache__/CompSep.cpython-36.pyc diff --git a/OMChem/__pycache__/Cooler.cpython-36.pyc b/OMChem/__pycache__/Cooler.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..be8d9fe --- /dev/null +++ b/OMChem/__pycache__/Cooler.cpython-36.pyc diff --git a/OMChem/__pycache__/DistCol.cpython-36.pyc b/OMChem/__pycache__/DistCol.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..518410e --- /dev/null +++ b/OMChem/__pycache__/DistCol.cpython-36.pyc diff --git a/OMChem/__pycache__/EngStm.cpython-36.pyc b/OMChem/__pycache__/EngStm.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..8799e46 --- /dev/null +++ b/OMChem/__pycache__/EngStm.cpython-36.pyc diff --git a/OMChem/__pycache__/Flash.cpython-36.pyc b/OMChem/__pycache__/Flash.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..3c55d7e --- /dev/null +++ b/OMChem/__pycache__/Flash.cpython-36.pyc diff --git a/OMChem/__pycache__/Flowsheet.cpython-36.pyc b/OMChem/__pycache__/Flowsheet.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..dd8f589 --- /dev/null +++ b/OMChem/__pycache__/Flowsheet.cpython-36.pyc diff --git a/OMChem/__pycache__/Heater.cpython-36.pyc b/OMChem/__pycache__/Heater.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..1139a24 --- /dev/null +++ b/OMChem/__pycache__/Heater.cpython-36.pyc diff --git a/OMChem/__pycache__/MatStm.cpython-36.pyc b/OMChem/__pycache__/MatStm.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..9b5b187 --- /dev/null +++ b/OMChem/__pycache__/MatStm.cpython-36.pyc diff --git a/OMChem/__pycache__/Mixer.cpython-36.pyc b/OMChem/__pycache__/Mixer.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..c75307b --- /dev/null +++ b/OMChem/__pycache__/Mixer.cpython-36.pyc diff --git a/OMChem/__pycache__/Pump.cpython-36.pyc b/OMChem/__pycache__/Pump.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..c351aba --- /dev/null +++ b/OMChem/__pycache__/Pump.cpython-36.pyc diff --git a/OMChem/__pycache__/ShortcutColumn.cpython-36.pyc b/OMChem/__pycache__/ShortcutColumn.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..1ea4727 --- /dev/null +++ b/OMChem/__pycache__/ShortcutColumn.cpython-36.pyc diff --git a/OMChem/__pycache__/Splitter.cpython-36.pyc b/OMChem/__pycache__/Splitter.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..2830093 --- /dev/null +++ b/OMChem/__pycache__/Splitter.cpython-36.pyc diff --git a/OMChem/__pycache__/Valve.cpython-36.pyc b/OMChem/__pycache__/Valve.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..aba6ad1 --- /dev/null +++ b/OMChem/__pycache__/Valve.cpython-36.pyc diff --git a/OMChem/__pycache__/adiabatic_comp.cpython-36.pyc b/OMChem/__pycache__/adiabatic_comp.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..c5e8b65 --- /dev/null +++ b/OMChem/__pycache__/adiabatic_comp.cpython-36.pyc diff --git a/OMChem/__pycache__/adiabatic_exp.cpython-36.pyc b/OMChem/__pycache__/adiabatic_exp.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..1138bdc --- /dev/null +++ b/OMChem/__pycache__/adiabatic_exp.cpython-36.pyc diff --git a/OMChem/adiabatic_comp.py b/OMChem/adiabatic_comp.py new file mode 100644 index 0000000..b8849fd --- /dev/null +++ b/OMChem/adiabatic_comp.py @@ -0,0 +1,59 @@ +from OMChem.EngStm import EngStm +class AdiaComp(): + def __init__(self,name=('AdiaComp',1), eff = None): + self.eff = eff + self.name = name[0] + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = None + self.OutputStms = None + self.EngStms = EngStm(name='EngStm'+self.name) + self.count = name[1] + self.type = 'AdiaComp' + self.thermoPackage ="Raoults_Law" + self.mode = None + self.modeVal = None + + def connect(self,InputStms = None,OutputStms = None): + self.InputStms = InputStms + self.OutputStms = OutputStms + + def modesList(self): + return ["pressInc","outP","reqPow"] + + def paramgetter(self,mode="pressInc"): + self.mode = mode + dict = {"eff":None,self.mode:None,"thermoPackage":None} + return dict + + def paramsetter(self,dict): + self.eff = dict['eff'] + self.modeVal = dict[self.mode] + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStms.name+';\n' + self.OM_data_init = self.OM_data_init + ("model adiaComp"+str(self.count)+"\n") + self.OM_data_init = self.OM_data_init + ("extends Simulator.Unit_Operations.Adiabatic_Compressor;\n" ) + self.OM_data_init = self.OM_data_init + ("extends Simulator.Files.Thermodynamic_Packages."+self.thermoPackage+";\n") + self.OM_data_init = self.OM_data_init + ("end adiaComp"+str(self.count)+";\n") + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + ( + "adiaComp"+str(self.count)+" "+ self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("},")+("eff="+self.eff+");\n") + return self.OM_data_init + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + # self.OM_data_eqn = self.name + '.pressDrop = ' + str(self.PressDrop) + ';\n' + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.InputStms[0].name + '.outlet,' + self.name + '.inlet' + ');\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.outlet,' + self.OutputStms[0].name + '.inlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.EngStms.name + '.outlet,' + self.name + '.energy);\n') + + self.OM_data_eqn = self.OM_data_eqn + (self.name+'.'+self.mode+'='+ self.modeVal + ';\n') + + return self.OM_data_eqn + diff --git a/OMChem/adiabatic_exp.py b/OMChem/adiabatic_exp.py new file mode 100644 index 0000000..102596d --- /dev/null +++ b/OMChem/adiabatic_exp.py @@ -0,0 +1,59 @@ +from OMChem.EngStm import EngStm +class AdiaExp(): + def __init__(self,name=('AdiaExp',1), eff = None): + self.eff = eff + self.name = name[0] + self.OM_data_eqn = '' + self.OM_data_init = '' + self.InputStms = None + self.OutputStms = None + self.EngStms = EngStm(name='EngStm'+self.name) + self.count = name[1] + self.type = 'AdiaExp' + self.thermoPackage ="Raoults_Law" + self.mode = None + self.modeVal = None + + def connect(self,InputStms = None,OutputStms = None): + self.InputStms = InputStms + self.OutputStms = OutputStms + + def modesList(self): + return ["pressDrop","outP","genPow"] + + def paramgetter(self,mode="pressDrop"): + self.mode = mode + dict = {"eff":None,self.mode:None,"thermoPackage":None} + return dict + + def paramsetter(self,dict): + self.eff = dict['eff'] + self.modeVal = dict[self.mode] + + def OM_Flowsheet_Init(self, addedcomp): + self.OM_data_init = '' + self.OM_data_init = self.OM_data_init + 'Simulator.Streams.Energy_Stream '+self.EngStms.name+';\n' + self.OM_data_init = self.OM_data_init + ("model adiaComp"+str(self.count)+"\n") + self.OM_data_init = self.OM_data_init + ("extends Simulator.Unit_Operations.Adiabatic_Expander;\n" ) + self.OM_data_init = self.OM_data_init + ("extends Simulator.Files.Thermodynamic_Packages."+self.thermoPackage+";\n") + self.OM_data_init = self.OM_data_init + ("end adiaComp"+str(self.count)+";\n") + comp_count = len(addedcomp) + self.OM_data_init = self.OM_data_init + ( + "adiaComp"+str(self.count)+" "+ self.name + "(NOC = " + str(comp_count)) + self.OM_data_init = self.OM_data_init + (",comp = {") + comp = str(addedcomp).strip('[').strip(']') + comp = comp.replace("'", "") + self.OM_data_init = self.OM_data_init + comp + ("},")+("eff="+self.eff+");\n") + return self.OM_data_init + + def OM_Flowsheet_Eqn(self, addedcomp): + self.OM_data_eqn = '' + # self.OM_data_eqn = self.name + '.pressDrop = ' + str(self.PressDrop) + ';\n' + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.InputStms[0].name + '.outlet,' + self.name + '.inlet' + ');\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.name + '.outlet,' + self.OutputStms[0].name + '.inlet);\n') + self.OM_data_eqn = self.OM_data_eqn + ('connect(' + self.EngStms.name + '.outlet,' + self.name + '.energy);\n') + + self.OM_data_eqn = self.OM_data_eqn + (self.name+'.'+self.mode+'='+ self.modeVal + ';\n') + + return self.OM_data_eqn + diff --git a/OMChem/setup.py b/OMChem/setup.py new file mode 100644 index 0000000..765aa04 --- /dev/null +++ b/OMChem/setup.py @@ -0,0 +1,54 @@ +try: + from setuptools import setup +except ImportError: + from distutils.core import setup + +from subprocess import call +import sys +import os +# Python 3.3 offers shutil.which() +from distutils import spawn + +def warningOrError(errorOnFailure, msg): + if errorOnFailure: + raise Exception(msg) + else: + print(msg) + +def generateIDL(): + errorOnFailure = not os.path.exists(os.path.join(os.path.dirname(__file__), 'OMPythonIDL', '__init__.py')) + try: + omhome = os.path.split(os.path.split(os.path.realpath(spawn.find_executable("omc")))[0])[0] + except: + omhome = None + omhome = omhome or os.environ.get('OPENMODELICAHOME') + + if omhome is None: + warningOrError(errorOnFailure, "Failed to find OPENMODELICAHOME (searched for environment variable as well as the omc executable)") + return + idl = os.path.join(omhome,"share","omc","omc_communication.idl") + if not os.path.exists(idl): + warningOrError(errorOnFailure, "Path not found: %s" % idl) + return + + if 0<>call(["omniidl","-bpython","-Wbglobal=_OMCIDL","-Wbpackage=OMPythonIDL",idl]): + warningOrError(errorOnFailure, "omniidl command failed") + return + print("Generated OMPythonIDL files") +generateIDL() + +setup(name='OMPython', + version='2.0.7', + description='OpenModelica-Python API Interface', + author='Anand Kalaiarasi Ganeson', + author_email='ganan642@student.liu.se', + maintainer='Adeel Asghar', + maintainer_email='adeel.asghar@liu.se', + license="BSD, OSMC-PL 1.2, GPL (user's choice)", + url='http://openmodelica.org/', + packages=['OMPython', 'OMPython.OMParser', 'OMPythonIDL', 'OMPythonIDL._OMCIDL', 'OMPythonIDL._OMCIDL__POA'], + install_requires=[ + # 'omniORB', # Required, but not part of pypi + 'pyparsing' + ] +) diff --git a/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_NRTL.mo b/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_NRTL.mo new file mode 100644 index 0000000..73df01e --- /dev/null +++ b/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_NRTL.mo @@ -0,0 +1,93 @@ +within Simulator.Binary_Phase_Envelope; + +package Binary_Phase_Envelope_NRTL + model NRTL_model + import Simulator.Files.Thermodynamic_Functions.*; + gammaNRTL_model Gamma(NOC = NOC, comp = comp, molFrac = x[:], T = T); + Real density[NOC], BIPS[NOC, NOC, 2]; + equation + gamma = Gamma.gamma; + BIPS = Gamma.BIPS; + for i in 1:NOC loop + density[i] = Dens(comp[i].LiqDen, comp[i].Tc, T, P); + end for; + for i in 1:NOC loop + K[i] = gamma[i] * Psat(comp[i].VP, T) / P; + end for; + end NRTL_model; + + model gammaNRTL_model + parameter Integer NOC; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + Real molFrac[NOC], T; + Real gamma[NOC]; + Real tau[NOC, NOC], G[NOC, NOC], alpha[NOC, NOC], A[NOC, NOC], BIPS[NOC, NOC, 2]; + Real sum1[NOC], sum2[NOC]; + constant Real R = 1.98721; + equation + A = BIPS[:, :, 1]; + alpha = BIPS[:, :, 2]; + tau = A ./ (R * T); + for i in 1:NOC loop + for j in 1:NOC loop + G[i, j] = exp(-alpha[i, j] * tau[i, j]); + end for; + end for; + for i in 1:NOC loop + sum1[i] = sum(molFrac[:] .* G[:, i]); + sum2[i] = sum(molFrac[:] .* tau[:, i] .* G[:, i]); + end for; + for i in 1:NOC loop + log(gamma[i]) = sum(molFrac[:] .* tau[:, i] .* G[:, i]) / sum(molFrac[:] .* G[:, i]) + sum(molFrac[:] .* G[i, :] ./ sum1[:] .* (tau[i, :] .- sum2[:] ./ sum1[:])); + end for; + end gammaNRTL_model; + + model base + import data = Simulator.Files.Chemsep_Database; + parameter Integer NOC; + parameter Real BIP[NOC, NOC, 2]; + parameter data.General_Properties comp[NOC]; + extends NRTL_model(BIPS = BIP); + Real P, T(start = 300), gamma[NOC], K[NOC], x[NOC](each start = 0.5), y[NOC]; + equation + y[:] = K[:] .* x[:]; + sum(x[:]) = 1; + sum(y[:]) = 1; + end base; + + model Onehexene_Acetone_Txy + import data = Simulator.Files.Chemsep_Database; + parameter data.Onehexene ohex; + parameter data.Acetone acet; + parameter Integer NOC = 2; + parameter Real BIP[NOC, NOC, 2] = Simulator.Files.Thermodynamic_Functions.BIPNRTL(NOC, comp.CAS); + parameter data.General_Properties comp[NOC] = {ohex, acet}; + base points[41](each P = 1013250, each NOC = NOC, each comp = comp, each BIP = BIP); + Real x[41, NOC], y[41, NOC], T[41]; + equation + points[:].x = x; + points[:].y = y; + points[:].T = T; + for i in 1:41 loop + x[i, 1] = 0 + (i - 1) * 0.025; + end for; + end Onehexene_Acetone_Txy; + + model Onehexene_Acetone_Pxy + import data = Simulator.Files.Chemsep_Database; + parameter data.Onehexene ohex; + parameter data.Acetone acet; + parameter Integer NOC = 2; + parameter Real BIP[NOC, NOC, 2] = Simulator.Files.Thermodynamic_Functions.BIPNRTL(NOC, comp.CAS); + parameter data.General_Properties comp[NOC] = {ohex, acet}; + base points[41](each T = 424, each NOC = NOC, each comp = comp, each BIP = BIP); + Real x[41, NOC], y[41, NOC], P[41]; + equation + points[:].x = x; + points[:].y = y; + points[:].P = P; + for i in 1:41 loop + x[i, 1] = 0 + (i - 1) * 0.025; + end for; + end Onehexene_Acetone_Pxy; +end Binary_Phase_Envelope_NRTL; diff --git a/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_PR.mo b/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_PR.mo new file mode 100644 index 0000000..9c54588 --- /dev/null +++ b/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_PR.mo @@ -0,0 +1,166 @@ +within Simulator.Binary_Phase_Envelope; + +package Binary_Phase_Envelope_PR + function Compresseblity_Factor + input Real b[NOC]; + input Real aij[NOC, NOC]; + input Real P; + input Real T; + input Integer NOC; + input Real m[NOC]; + output Real am; + output Real bm; + output Real A; + output Real B; + output Real Z[3]; + protected + Real R = 8.314; + Real C[4]; + Real ZR[3, 2]; + algorithm + am := sum({{m[i] * m[j] * aij[i, j] for i in 1:NOC} for j in 1:NOC}); + bm := sum(b .* m); + A := am * P / (R * T) ^ 2; + B := bm * P / (R * T); + C[1] := 1; + C[2] := B - 1; + C[3] := A - 3 * B ^ 2 - 2 * B; + C[4] := B ^ 3 + B ^ 2 - A * B; + ZR := Modelica.Math.Vectors.Utilities.roots(C); + Z := {ZR[i, 1] for i in 1:3}; + end Compresseblity_Factor; + + model PR + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + parameter Integer NOC; + parameter Real R = 8.314; + parameter Real kij[NOC, NOC] = Simulator.Files.Thermodynamic_Functions.BIP_PR(NOC, comp.name); + Real Tr[NOC]; + Real b[NOC]; + Real m[NOC]; + Real q[NOC]; + Real a[NOC]; + Real aij[NOC, NOC]; + Real amL, bmL; + Real AL, BL, Z_L[3]; + Real ZL; + Real sum_xa[NOC]; + Real liqfugcoeff[NOC]; + Real amV, bmV; + Real AV, BV, Z_V[3]; + Real ZV; + Real sum_ya[NOC]; + Real vapfugcoeff[NOC]; + Real P; + Real T(start = 273); + Real Psat[NOC]; + //Bubble and Dew Point Calculation + Real Tr_bubl[NOC]; + Real a_bubl[NOC]; + Real aij_bubl[NOC, NOC]; + Real Psat_bubl[NOC]; + Real amL_bubl, bmL_bubl; + Real AL_bubl, BL_bubl, Z_L_bubl[3]; + Real ZL_bubl; + Real sum_xa_bubl[NOC]; + Real liqfugcoeff_bubl[NOC]; + Real gammaBubl[NOC]; + Real Tbubl(start = 273); + equation + for i in 1:NOC loop + Psat_bubl[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, Tbubl); + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + end for; +//Bubble Point and Dew Point Calculation Routine + Tr_bubl = Tbubl ./ comp.Tc; + a_bubl = q .* (1 .+ m .* (1 .- sqrt(Tr_bubl))) .^ 2; + aij_bubl = {{(1 - kij[i, j]) * sqrt(a_bubl[i] * a_bubl[j]) for i in 1:NOC} for j in 1:NOC}; + (amL_bubl, bmL_bubl, AL_bubl, BL_bubl, Z_L_bubl) = Compresseblity_Factor(b, aij_bubl, P, Tbubl, NOC, x[:]); + ZL_bubl = min({Z_L_bubl}); + sum_xa_bubl = {sum({x[j] * aij_bubl[i, j] for j in 1:NOC}) for i in 1:NOC}; + liqfugcoeff_bubl = exp(AL_bubl / (BL_bubl * sqrt(8)) * log((ZL_bubl + 2.4142135 * BL_bubl) / (ZL_bubl - 0.414213 * BL_bubl)) .* (b / bmL_bubl .- 2 * sum_xa_bubl / amL_bubl) .+ (ZL_bubl - 1) * (b / bmL_bubl) .- log(ZL_bubl - BL_bubl)); + liqfugcoeff_bubl[:] = gammaBubl[:] .* P ./ Psat_bubl[:]; + P = sum(gammaBubl[:] .* x[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / Tbubl + comp[:].VP[4] * log(Tbubl) + comp[:].VP[5] .* Tbubl .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Calculation of Temperatures at different compositions + Tr = T ./ comp.Tc; + b = 0.0778 * R * comp.Tc ./ comp.Pc; + m = 0.37464 .+ 1.54226 * comp.AF .- 0.26992 * comp.AF .^ 2; + q = 0.45724 * R ^ 2 * comp.Tc .^ 2 ./ comp.Pc; + a = q .* (1 .+ m .* (1 .- sqrt(Tr))) .^ 2; + aij = {{(1 - kij[i, j]) * sqrt(a[i] * a[j]) for i in 1:NOC} for j in 1:NOC}; +//Liquid Phase Calculation Routine + (amL, bmL, AL, BL, Z_L) = Compresseblity_Factor(b, aij, P, T, NOC, x[:]); + ZL = min({Z_L}); + sum_xa = {sum({x[j] * aij[i, j] for j in 1:NOC}) for i in 1:NOC}; + liqfugcoeff = exp(AL / (BL * sqrt(8)) * log((ZL + 2.4142135 * BL) / (ZL - 0.414213 * BL)) .* (b / bmL .- 2 * sum_xa / amL) .+ (ZL - 1) * (b / bmL) .- log(ZL - BL)); +//Vapour Phase Calculation Routine + (amV, bmV, AV, BV, Z_V) = Compresseblity_Factor(b, aij, P, T, NOC, y[:]); + ZV = max({Z_V}); + sum_ya = {sum({y[j] * aij[i, j] for j in 1:NOC}) for i in 1:NOC}; + vapfugcoeff = exp(AV / (BV * sqrt(8)) * log((ZV + 2.4142135 * BV) / (ZV - 0.414213 * BV)) .* (b / bmV .- 2 * sum_ya / amV) .+ (ZV - 1) * (b / bmV) .- log(ZV - BV)); + end PR; + + model Phase_Equilibria + import data = Simulator.Files.Chemsep_Database; + parameter data.Ethane eth; + parameter data.Propane prop; + extends PR(NOC = 2, comp = {eth, prop}); + Real P, T(start = 273), K[NOC], x[NOC](each start = 0.5), y[NOC], Tbubl(start = 273); + equation + K[:] = liqfugcoeff[:] ./ vapfugcoeff[:]; + y[:] = K[:] .* x[:]; + sum(x[:]) = 1; + sum(y[:]) = 1; + end Phase_Equilibria; + + model Peng_Robinson_Pxy + import data = Simulator.Files.Chemsep_Database; + parameter data.Ethane eth; + parameter data.Propane prop; + parameter Integer NOC = 2; + parameter Integer N = 2; + parameter data.General_Properties comp[NOC] = {eth, prop}; + Phase_Equilibria points[N](each T = 210, each NOC = NOC, each comp = comp, each T(start = 273), each Tbubl(start = 273), each x(each start = 0.5), each y(each start = 0.5)); + Real x1[N], y1[N], x2[N], y2[N], P[N](each start = 101325), Tbubl[N], Temp[N]; + equation +//Generation of Points to compute Bubble Temperature + points[:].x[1] = x1[:]; + points[:].y[1] = y1[:]; + points[:].x[2] = x2[:]; + points[:].y[2] = y2[:]; + points[:].P = P; + points[:].Tbubl = Tbubl; + Temp[1] = Tbubl[1]; + Temp[N] = Tbubl[N]; + for i in 2:N - 1 loop + Temp[i] = points[i].T; + end for; + for i in 1:N loop + x1[i] = 0.5 + (i - 1) * 0.025; + end for; + end Peng_Robinson_Pxy; + + model Peng_Robinson_Txy + import data = Simulator.Files.Chemsep_Database; + parameter data.Ethane eth; + parameter data.Propane prop; + parameter Integer NOC = 2; + parameter Integer N = 1; + parameter data.General_Properties comp[NOC] = {eth, prop}; + Phase_Equilibria points[N](each P = 101325, each NOC = NOC, each comp = comp, each T(start = 273), each Tbubl(start = 273), each x(each start = 0.5), each y(each start = 0.5)); + Real x[N, NOC], y[N, NOC], T[N], Tbubl[N], T_PR[N]; + equation + points[:].x = x; + points[:].y = y; + points[:].T = T; + points[:].Tbubl = Tbubl; + T_PR[1] = Tbubl[1]; + T_PR[N] = Tbubl[N]; + for i in 2:N - 1 loop + T_PR[i] = T[i]; + end for; + for i in 1:N loop + x[i, 1] = 0 + (i - 1) * 0.025; + end for; + end Peng_Robinson_Txy; +end Binary_Phase_Envelope_PR; diff --git a/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_UNIFAC.mo b/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_UNIFAC.mo new file mode 100644 index 0000000..86c0d72 --- /dev/null +++ b/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_UNIFAC.mo @@ -0,0 +1,264 @@ +within Simulator.Binary_Phase_Envelope; + +package Binary_Phase_Envelope_UNIFAC + model P_x_y_UNIFAC + //Libraries + import Simulator.*; + //Extension of Chemsep Database + Simulator.Files.Chemsep_Database data; + //Parameter Section + //Selection of compounds + parameter data.Methylethylketone meth; + parameter data.Aceticacid eth; + //Instantiation of selected compounds + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] = {meth, eth}; + parameter Integer NOC = 2 "Number of components"; + parameter Integer Choice = 1 "System choice of Txy or Pxy"; + parameter Real T(unit = "K") = 375 "System Temperature"; + parameter Integer N = 40 "Number of points of data generation"; + parameter Integer m = 4 "Interaction parameter index"; + parameter Integer k = 4 "Number of Functional groups present in the compound"; + parameter Real a[m, k] = {{0, 0, 476.4, 663.5}, {0, 0, 476.4, 663.5}, {26.76, 26.76, 0, 669.4}, {315.3, 315.3, -297.8, 0}} "Binary intraction parameter"; + parameter Real V[NOC, k] = {{1, 1, 1, 0}, {1, 0, 0, 1}} "Number of group of kind k in molecule "; + parameter Real R[NOC, k] = {{0.9011, 0.6744, 1.6724, 0.0}, {0.9011, 0, 0, 1.3013}} "Group volume of group k "; + parameter Real Q[NOC, k] = {{0.848, 0.540, 1.448, 0}, {0.848, 0, 0, 1.224}} "Group surface area of group k"; + //Gas constant + parameter Real R_gas = 1.98721; + //Variable Section + Real delta "Increment step"; + Real e[k, NOC]; + Real B[NOC, k]; + Real q[NOC] "Van der waal molecular surface area"; + Real r[NOC] "Van der waal molecular volume"; + Real tow[m, k] "Empherical Parameter (tow) at the system temperature"; + //Mole Fractions (x-axis) of the P-x-y plot + Real z1[N + 1], z2[N + 1]; + //Intermediate parameters used to calculate the Combinatorial contribution" + Real J1_bubl[N + 1], J2_bubl[N + 1]; + Real L1_bubl[N + 1], L2_bubl[N + 1]; + Real gammac1_bubl[N + 1], gammac2_bubl[N + 1]; + //Intermediate parameters used to calculate the Residual contribution" + Real teta1_bubl[N + 1, k]; + Real S1_bubl[N + 1, k]; + Real sum1_bubl[N + 1, k], sum2_bubl[N + 1, k]; + Real sum_bubl[N + 1], summ_bubl[N + 1]; + Real gammar1_bubl[N + 1], gammar2_bubl[N + 1]; + //Activity coefficients at different Pressures + Real gammaBubl1[N + 1](each start = 0.5), gammaBubl2[N + 1]; + //Bubble Pressure + Real P[N + 1](each unit = "Pa", each start = 117018); + //Distribution coefficient + Real K1[N + 1]; + //Vapour Phase Mole Fraction + Real y1[N + 1](each start = 0.5), y2[N + 1](each start = 0.5); + //Vapour Pressure at the chosen temperature + Real Psat[NOC](each unit = "Pa") "Vapour Pressure"; + //=========================================================================================== + //Equation Section + equation +//Calculation of Vapour Pressure at the input temperature +//Thermodynamic Function Psat is instantiated from Simulator Package + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + end for; +//Calculation of increment step for the total number of points + delta = 1 / N; +//Calculation of Unifac parameter R and Q for the induvidual compounds + for i in 1:NOC loop + for j in 1:k loop + B[i, j] = sum(e[:, i] .* tow[:, j]); + end for; + end for; + for i in 1:NOC loop + r[i] = sum(V[i, :] .* R[i, :]); + q[i] = sum(V[i, :] .* Q[i, :]); + e[:, i] = V[i, :] .* Q[i, :] / q[i]; + end for; +//Calculation of Empherical parameter (tow) at the system temperature + for i in 1:m loop + tow[i, :] = exp((-a[i, :]) / T); + end for; +//Generation of mole fraction from 0 to 1 in steps of "delta" + z1[1] = 0; + for i in 2:N + 1 loop + z1[i] = z1[i - 1] + delta; + end for; + for i in 1:N + 1 loop + z2[i] = 1 - z1[i]; + end for; +//Calculation of combinatorial contribution parameter used to compute activity coefficient at the corresponding compositions + for i in 1:N + 1 loop + J1_bubl[i] = r[1] / (r[1] * z1[i] + r[2] * z2[i]); + J2_bubl[i] = r[2] / (r[1] * z1[i] + r[2] * z2[i]); + L1_bubl[i] = q[1] / (q[1] * z1[i] + q[2] * z2[i]); + L2_bubl[i] = q[2] / (q[1] * z1[i] + q[2] * z2[i]); + gammac1_bubl[i] = exp(1 - J1_bubl[i] + log(J1_bubl[i]) + (-5 * q[1] * (1 - J1_bubl[i] / L1_bubl[i] + log(J1_bubl[i] / L1_bubl[i])))); + gammac2_bubl[i] = exp(1 - J2_bubl[i] + log(J2_bubl[i]) + (-5 * q[2] * (1 - J2_bubl[i] / L2_bubl[i] + log(J2_bubl[i] / L2_bubl[i])))); + end for; +//Calculation of residual contribution parameter used to compute activity coefficient at the corresponding compositions + for i in 1:N + 1 loop + teta1_bubl[i, :] = (z1[i] * q[1] .* e[:, 1] + z2[i] * q[2] .* e[:, 2]) / (z1[i] * q[1] + z2[i] * q[2]); + end for; + for i in 1:N + 1 loop + for j in 1:k loop + S1_bubl[i, j] = sum(teta1_bubl[i, :] .* tow[:, j]); + sum1_bubl[i, j] = teta1_bubl[i, j] * B[1, j] / S1_bubl[i, j] - e[j, 1] * log(B[1, j] / S1_bubl[i, j]); + sum2_bubl[i, j] = teta1_bubl[i, j] * B[2, j] / S1_bubl[i, j] - e[j, 2] * log(B[2, j] / S1_bubl[i, j]); + end for; + end for; + for i in 1:N + 1 loop + gammar1_bubl[i] = exp(q[1] * (1 - sum_bubl[i])); + gammar2_bubl[i] = exp(q[2] * (1 - summ_bubl[i])); + sum_bubl[i] = sum(sum1_bubl[i, :]); + summ_bubl[i] = sum(sum2_bubl[i, :]); + gammaBubl1[i] = exp(log(gammac1_bubl[i]) + log(gammar1_bubl[i])); + gammaBubl2[i] = exp(log(gammac2_bubl[i]) + log(gammar2_bubl[i])); + end for; +//Bubble point calculation + for i in 1:N + 1 loop + P[i] = gammaBubl1[i] * z1[i] * exp(comp[1].VP[2] + comp[1].VP[3] / T + comp[1].VP[4] * log(T) + comp[1].VP[5] * T ^ comp[1].VP[6]) + gammaBubl2[i] * z2[i] * exp(comp[2].VP[2] + comp[2].VP[3] / T + comp[2].VP[4] * log(T) + comp[2].VP[5] * T ^ comp[2].VP[6]); + end for; +//Phase Equilibria + for i in 1:N + 1 loop + K1[i] = gammaBubl1[i] * (Psat[1] / P[i]); + y1[i] = K1[i] * z1[i]; + y2[i] = 1 - y1[i]; + end for; + end P_x_y_UNIFAC; + + //==================================================================================================== + + model T_x_y_UNIFAC + //Libraries + import Simulator.*; + //Extension of Chemsep Database + Simulator.Files.Chemsep_Database data; + //Parameter Section + //Selection of compounds + parameter data.Methylethylketone meth; + parameter data.Aceticacid eth; + //Instantiation of selected compounds + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] = {meth, eth}; + parameter Real Z = 10 "Compressiblity Factor"; + parameter Integer Choice = 2 "System choice of Txy or Pxy"; + parameter Integer NOC = 2 "Number of components"; + parameter Real P(unit = "Pa") = 101325 "System Pressure"; + parameter Integer N = 40 "Number of points of data generation"; + parameter Integer m = 4 "Interaction parameter index", k = 4 "Number of Functional groups present in the compound"; + parameter Real a[m, k] = {{0, 0, 476.4, 663.5}, {0, 0, 476.4, 663.5}, {26.76, 26.76, 0, 669.4}, {315.3, 315.3, -297.8, 0}} "Binary intraction parameter"; + parameter Real V[NOC, k] = {{1, 1, 1, 0}, {1, 0, 0, 1}} "number of group of kind k in molecule "; + parameter Real R[NOC, k] = {{0.9011, 0.6744, 1.6724, 0.0}, {0.9011, 0, 0, 1.3013}} "group volume of group k "; + parameter Real Q[NOC, k] = {{0.848, 0.540, 1.448, 0}, {0.848, 0, 0, 1.224}} "group surface area of group k"; + //Gas constant + parameter Real R_gas = 1.98721; + //Variable Section + Real delta "Increment step"; + Real e[k, NOC]; + Real B[N + 1, NOC, k]; + Real q[NOC] "van der walls molecular surface area"; + Real r[NOC] "van der walls molecular volume"; + //Empherical parameter (tow) at different temperatures + Real tow[N + 1, m, k]; + //Intermediate parameters used to calculate the Combinatorial contribution" + Real J1_bubl[N + 1], J2_bubl[N + 1]; + Real L1_bubl[N + 1], L2_bubl[N + 1]; + Real gammac1_bubl[N + 1], gammac2_bubl[N + 1]; + //Intermediate parameters used to calculate the Residual contribution" + Real teta1_bubl[N + 1, k]; + Real S1_bubl[N + 1, k]; + Real sum1_bubl[N + 1, k], sum2_bubl[N + 1, k]; + Real sum_bubl[N + 1], summ_bubl[N + 1]; + Real gammar1_bubl[N + 1], gammar2_bubl[N + 1]; + //Activity coefficients at different Temperatures + Real gammaBubl1[N + 1](each start = 0.5), gammaBubl2[N + 1]; + //Mole Fractions (x-axis) of the T-x-y plot + Real z1[N + 1], z2[N + 1]; + //Bubble Temperature + Real T[N + 1](unit = "K", each start = 300); + //Distribution coefficient + Real K1[N + 1]; + //Vapour Phase Mole Fraction + Real y1[N + 1](each start = 0.5), y2[N + 1](each start = 0.5); + //Vapour Pressure at the chosen temperature range + Real Psat[N + 1, 1]; + //====================================================================================================== + equation +//Calculation of increment step for the total number of points + delta = 1 / N; +//Calculation of vapour pressures at different temperatures + for i in 1:N + 1 loop + Psat[i, 1] = Simulator.Files.Thermodynamic_Functions.Psat(comp[1].VP, T[i]); + end for; +//Generation of mole fraction from 0 to 1 in steps of "delta" + z1[1] = 0; + for i in 2:N + 1 loop + z1[i] = z1[i - 1] + delta; + end for; + for i in 1:N + 1 loop + z2[i] = 1 - z1[i]; + end for; +//Calculation of r and q for compounds + for l in 1:N + 1 loop + for i in 1:NOC loop + for j in 1:k loop + B[l, i, j] = sum(e[:, i] .* tow[l, :, j]); + end for; + end for; + end for; + for i in 1:NOC loop + r[i] = sum(V[i, :] .* R[i, :]); + q[i] = sum(V[i, :] .* Q[i, :]); + e[:, i] = V[i, :] .* Q[i, :] / q[i]; + end for; +//Empherical parameter (towk) is calculated at different temperatures in the T-x-y mode of operation + for j in 1:N + 1 loop + for i in 1:m loop + tow[j, i, :] = exp((-a[i, :]) / T[j]); + end for; + end for; +//Calculation of combinatorial contribution parameter used to compute activity coefficient at the corresponding compositions + for i in 1:N + 1 loop + J1_bubl[i] = r[1] / (r[1] * z1[i] + r[2] * z2[i]); + J2_bubl[i] = r[2] / (r[1] * z1[i] + r[2] * z2[i]); + L1_bubl[i] = q[1] / (q[1] * z1[i] + q[2] * z2[i]); + L2_bubl[i] = q[2] / (q[1] * z1[i] + q[2] * z2[i]); + gammac1_bubl[i] = exp(1 - J1_bubl[i] + log(J1_bubl[i]) + (-5 * q[1] * (1 - J1_bubl[i] / L1_bubl[i] + log(J1_bubl[i] / L1_bubl[i])))); + gammac2_bubl[i] = exp(1 - J2_bubl[i] + log(J2_bubl[i]) + (-5 * q[2] * (1 - J2_bubl[i] / L2_bubl[i] + log(J2_bubl[i] / L2_bubl[i])))); + end for; +//Calculation of residual contribution parameter used to compute activity coefficient at the corresponding compositions + for i in 1:N + 1 loop + teta1_bubl[i, :] = (z1[i] * q[1] .* e[:, 1] + z2[i] * q[2] .* e[:, 2]) / (z1[i] * q[1] + z2[i] * q[2]); + end for; + for i in 1:N + 1 loop + for j in 1:k loop + S1_bubl[i, j] = sum(teta1_bubl[i, :] .* tow[i, :, j]); + end for; + end for; + for i in 1:N + 1 loop + for j in 1:k loop + sum1_bubl[i, j] = teta1_bubl[i, j] * B[i, 1, j] / S1_bubl[i, j] - e[j, 1] * log(B[i, 1, j] / S1_bubl[i, j]); + sum2_bubl[i, j] = teta1_bubl[i, j] * B[i, 2, j] / S1_bubl[i, j] - e[j, 2] * log(B[i, 2, j] / S1_bubl[i, j]); + end for; + end for; + for i in 1:N + 1 loop + gammar1_bubl[i] = exp(q[1] * (1 - sum_bubl[i])); + gammar2_bubl[i] = exp(q[2] * (1 - summ_bubl[i])); + sum_bubl[i] = sum(sum1_bubl[i, :]); + summ_bubl[i] = sum(sum2_bubl[i, :]); + gammaBubl1[i] = exp(log(gammac1_bubl[i]) + log(gammar1_bubl[i])); + gammaBubl2[i] = exp(log(gammac2_bubl[i]) + log(gammar2_bubl[i])); + end for; +//Bubble point calculation + for i in 1:N + 1 loop + P = gammaBubl1[i] * z1[i] * exp(comp[1].VP[2] + comp[1].VP[3] / T[i] + comp[1].VP[4] * log(T[i]) + comp[1].VP[5] * T[i] ^ comp[1].VP[6]) + gammaBubl2[i] * z2[i] * exp(comp[2].VP[2] + comp[2].VP[3] / T[i] + comp[2].VP[4] * log(T[i]) + comp[2].VP[5] * T[i] ^ comp[2].VP[6]); + end for; +//Phase Equlibria + for i in 1:N + 1 loop + K1[i] = gammaBubl1[i] * (Psat[i, 1] / P); + y1[i] = K1[i] * z1[i]; + y2[i] = 1 - y1[i]; + end for; + end T_x_y_UNIFAC; + + //================================================================================================================ +end Binary_Phase_Envelope_UNIFAC; diff --git a/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_UNIQUAC.mo b/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_UNIQUAC.mo new file mode 100644 index 0000000..74533dd --- /dev/null +++ b/Simulator/Simulator/Binary_Phase_Envelope/Binary_Phase_Envelope_UNIQUAC.mo @@ -0,0 +1,254 @@ +within Simulator.Binary_Phase_Envelope; + +package Binary_Phase_Envelope_UNIQUAC + //============================================================================================================== + + function Gamma_UNIQUAC + input Integer Choice "Enter if choice of VLE curve is Pxy or Txy"; + //Note : Choice = 1 = P-x-y-Envelope + // Choice = 2 = T-x-y-Envelope + input Integer N "Number of data points", NOC "Total number of components"; + input Real z1[N + 1], z2[N + 1]; + input Real R[NOC], Q[NOC]; + input Real tow[NOC, NOC]; + input Real towk[N + 1, NOC, NOC]; + parameter Real Z = 10 "Compresseblity Factor"; + parameter Real R_gas = 1.98721 "Gas Constant"; + //Activity coefficients + output Real gammaBubl1[N + 1], gammaBubl2[N + 1]; + protected + //Intermediate parameters used to calculate the Combinatorial and Residual contribution" + Real r_bubl[N + 1], q_bubl[N + 1]; + Real teta1_bubl[N + 1], teta2_bubl[N + 1]; + Real S1_bubl[N + 1], S2_bubl[N + 1]; + Real sum1_bubl[N + 1], sum2_bubl[N + 1]; + //Residual contribution term of Activity coefficient + Real gammar1_bubl[N + 1], gammar2_bubl[N + 1]; + //Cobinatorial contribution term of Activity coefficient + Real gammac1_bubl[N + 1], gammac2_bubl[N + 1]; + //Empherical Parameter at different temperatures + Real toww[N, NOC, NOC]; + //========================================================================================= + algorithm + for i in 1:N + 1 loop + r_bubl[i] := z1[i] * R[1] + z2[i] * R[2]; + q_bubl[i] := z1[i] * Q[1] + z2[i] * Q[2]; + end for; + if Choice == 1 then + for i in 1:N + 1 loop + teta1_bubl[i] := z1[i] * Q[1] * (1 / q_bubl[i]); + teta2_bubl[i] := z2[i] * Q[2] * (1 / q_bubl[i]); + S1_bubl[i] := teta1_bubl[i] * tow[1, 1] + teta2_bubl[i] * tow[1, 2]; + S2_bubl[i] := teta1_bubl[i] * tow[2, 1] + teta2_bubl[i] * tow[2, 2]; + sum1_bubl[i] := teta1_bubl[i] * (tow[1, 1] / S1_bubl[i]) + teta2_bubl[i] * (tow[1, 2] / S2_bubl[i]); + sum2_bubl[i] := teta1_bubl[i] * (tow[2, 1] / S1_bubl[i]) + teta2_bubl[i] * (tow[2, 2] / S2_bubl[i]); + gammar1_bubl[i] := exp(Q[1] * (1 - log(S1_bubl[i]) - sum1_bubl[i])); + gammar2_bubl[i] := exp(Q[2] * (1 - log(S2_bubl[i]) - sum2_bubl[i])); + gammac1_bubl[i] := exp(1 - R[1] / r_bubl[i] + log(R[1] / r_bubl[i]) + (-Z / 2 * Q[1] * (1 - R[1] / r_bubl[i] / (Q[1] / q_bubl[i]) + log(R[1] / r_bubl[i] / (Q[1] / q_bubl[i]))))); + gammac2_bubl[i] := exp(1 - R[2] / r_bubl[i] + log(R[2] / r_bubl[i]) + (-Z / 2 * Q[2] * (1 - R[2] / r_bubl[i] / (Q[2] / q_bubl[i]) + log(R[2] / r_bubl[i] / (Q[2] / q_bubl[i]))))); + gammaBubl1[i] := exp(log(gammac1_bubl[i]) + log(gammar1_bubl[i])); + gammaBubl2[i] := exp(log(gammac2_bubl[i]) + log(gammar2_bubl[i])); + end for; + else + for i in 1:N + 1 loop + teta1_bubl[i] := z1[i] * Q[1] * (1 / q_bubl[i]); + teta2_bubl[i] := z2[i] * Q[2] * (1 / q_bubl[i]); + S1_bubl[i] := teta1_bubl[i] * towk[i, 1, 1] + teta2_bubl[i] * towk[i, 1, 2]; + S2_bubl[i] := teta1_bubl[i] * towk[i, 2, 1] + teta2_bubl[i] * towk[i, 2, 2]; + sum1_bubl[i] := teta1_bubl[i] * (towk[i, 1, 1] / S1_bubl[i]) + teta2_bubl[i] * (towk[i, 1, 2] / S2_bubl[i]); + sum2_bubl[i] := teta1_bubl[i] * (towk[i, 2, 1] / S1_bubl[i]) + teta2_bubl[i] * (towk[i, 2, 2] / S2_bubl[i]); + gammar1_bubl[i] := exp(Q[1] * (1 - log(S1_bubl[i]) - sum1_bubl[i])); + gammar2_bubl[i] := exp(Q[2] * (1 - log(S2_bubl[i]) - sum2_bubl[i])); + gammac1_bubl[i] := exp(1 - R[1] / r_bubl[i] + log(R[1] / r_bubl[i]) + (-Z / 2 * Q[1] * (1 - R[1] / r_bubl[i] / (Q[1] / q_bubl[i]) + log(R[1] / r_bubl[i] / (Q[1] / q_bubl[i]))))); + gammac2_bubl[i] := exp(1 - R[2] / r_bubl[i] + log(R[2] / r_bubl[i]) + (-Z / 2 * Q[2] * (1 - R[2] / r_bubl[i] / (Q[2] / q_bubl[i]) + log(R[2] / r_bubl[i] / (Q[2] / q_bubl[i]))))); + gammaBubl1[i] := exp(log(gammac1_bubl[i]) + log(gammar1_bubl[i])); + gammaBubl2[i] := exp(log(gammac2_bubl[i]) + log(gammar2_bubl[i])); + end for; + end if; +//Calculation of Activity coefficients at different pressures( P-x-y calculation routine) +//Calculation of residual contribution term of activity coefficient +//Calculation of combinatorial term of activity coefficient +//Calculation of activity coefficients at different temperatures (T-x-y calculation routine) +//Calculation of residual contribution term of activity coefficient +//Calculation of combinatorial term of activity coefficient + end Gamma_UNIQUAC; + + //================================================================================================ + //Binary Phase Envelope + //Envelope Type : P-x-y + //Thermodynamic-Model : UNIQUAC + //Nature of System : Azeotropic System + //======================================================================================== + + model P_x_y_UNIQUAC + //Libraries + import Simulator.*; + //Extension of Chemsep Database + Simulator.Files.Chemsep_Database data; + //Parameter Section + //Selection of compounds + parameter data.Water wat; + parameter data.Ethanol eth; + //Instantiation of selected compounds + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] = {wat, eth}; + parameter Integer NOC = 2 "Number of components"; + parameter Integer Choice = 1 "System choice of Txy or Pxy"; + parameter Real T(unit = "K") = 315 "System Temperature"; + //Empherical parameter (towk) at different temperatures + //Note : The below value will be active only in the T-x-y phase envelope routine + Real towk[N + 1, NOC, NOC]; + parameter Integer N = 40 "Number of points of data generation"; + Real delta "Increment step"; + parameter Real a[NOC, NOC] = Simulator.Files.Thermodynamic_Functions.BIP_UNIQUAC(NOC, comp.name) "Interaction Parameters"; + //UNIQUAC parameters instantiated from Chemsep Database + parameter Real R[NOC] = comp.UniquacR; + parameter Real Q[NOC] = comp.UniquacQ; + //Variable Section + //Empherical Parameter (tow) at the system temperature + Real tow[NOC, NOC]; + //Mole Fractions (x-axis) of the P-x-y plot + Real z1[N + 1], z2[N + 1]; + //Activity coefficients at different Pressures + Real gammaBubl1[N + 1], gammaBubl2[N + 1]; + //Bubble Pressure + Real P[N + 1](each unit = "Pa", each start = 776454); + //Distribution coefficient + Real K1[N + 1]; + //Vapour Phase Mole Fraction + Real y1[N + 1](each start = 0.5), y2[N + 1](each start = 0.5); + //Vapour Pressure at the chosen temperature + Real Psat[NOC](unit = "Pa") "Vapour Pressure"; + //========================================================================================= + //Equation Section + equation +//Calculation of Vapour Pressure at the input temperature +//Thermodynamic Function Psat is instantiated from Simulator Package + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + end for; +//Calculation of increment step for the total number of points + delta = 1 / N; +//Empherical parameter (towk) is assigned to 1 for P-x-y mode of operation + for k in 1:N + 1 loop + for i in 1:NOC loop + for j in 1:NOC loop + towk[k, i, j] = 1; + end for; + end for; + end for; +//Calculation of Empherical parameter (tow) at the system temperature + tow = Simulator.Files.Thermodynamic_Functions.Tow_UNIQUAC(NOC, a, T); +//Generation of mole fraction from 0 to 1 in steps of "delta" + z1[1] = 0; + for i in 2:N + 1 loop + z1[i] = z1[i - 1] + delta; + end for; + for i in 1:N + 1 loop + z2[i] = 1 - z1[i]; + end for; +//Calculation of Activity coefficients at different conditions using the function "Gamma_UNIQUAC" + (gammaBubl1, gammaBubl2) = Binary_Phase_Envelope_UNIQUAC.Gamma_UNIQUAC(Choice, N, NOC, z1, z2, R, Q, tow, towk); +//Bubble point calculation + for i in 1:N + 1 loop + P[i] = gammaBubl1[i] * z1[i] * exp(comp[1].VP[2] + comp[1].VP[3] / T + comp[1].VP[4] * log(T) + comp[1].VP[5] * T ^ comp[1].VP[6]) + gammaBubl2[i] * z2[i] * exp(comp[2].VP[2] + comp[2].VP[3] / T + comp[2].VP[4] * log(T) + comp[2].VP[5] * T ^ comp[2].VP[6]); + end for; +//Phase Equlibria + for i in 1:N + 1 loop + K1[i] = gammaBubl1[i] * (Psat[1] / P[i]); + y1[i] = K1[i] * z1[i]; + y2[i] = 1 - y1[i]; + end for; + end P_x_y_UNIQUAC; + + //===================================================================================================== + + model T_x_y_UNIQUAC + //Libraries + import Simulator.*; + //Extension of Chemsep database + Simulator.Files.Chemsep_Database data; + //Parameter Section + //Selection of compounds + parameter data.Water wat; + parameter data.Ethanol eth; + //Instantiation of selected compounds + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] = {wat, eth}; + parameter Integer Choice = 2 "System choice of Txy or Pxy"; + parameter Integer NOC = 2 "Number of components"; + parameter Real P(unit = "Pa") = 101325 "System Pressure"; + parameter Integer N = 40 "Number of points of data generation"; + //UNIQUAC Parameters + parameter Real R[NOC] = comp.UniquacR; + parameter Real Q[NOC] = comp.UniquacQ; + parameter Real a[NOC, NOC] = Simulator.Files.Thermodynamic_Functions.BIP_UNIQUAC(NOC, comp.name) "Interaction temperatures"; + //Variable Section + Real delta "Increment step"; + //Empherical parameter (towk) at different temperatures + //Note : The below value will be active only in the T-x-y phase envelope routine + Real towk[N + 1, NOC, NOC]; + //Empherical Parameter (tow) at the system temperature + //Note : The below value will be active only in the P-x-y phase envelope routine + Real tow[NOC, NOC]; + //Mole Fractions (x-axis) of the T-x-y plot + Real z1[N + 1], z2[N + 1]; + //Bubble Temperature + Real T[N + 1](each unit = "K", each start = 300); + //Distribution coefficient + Real K1[N + 1]; + //Vapour Phase Mole Fraction + Real y1[N + 1](each start = 0.5), y2[N + 1](each start = 0.5); + //Vapour Pressure at the chosen temperature range + Real Psat[N + 1, 1](each unit = "Pa"); + //Activity coefficients at different Temperatures + Real gammaBubl1[N + 1], gammaBubl2[N + 1]; + //Gas constant + parameter Real R_gas = 1.98721; + //======================================================================================================= + //Equation Section + equation +//Calculation of increment step for the total number of points + delta = 1 / N; +//Empherical parameter (towk) is calculated at different temperatures in the T-x-y mode of operation + for k in 1:N + 1 loop + for i in 1:NOC loop + for j in 1:NOC loop + towk[k, i, j] = exp(-a[i, j] / (R_gas * T[k])); + end for; + end for; + end for; +//Empherical parameter (tow) is assigned to 1 for T-x-y mode of operation + for i in 1:NOC loop + for j in 1:NOC loop + tow[i, j] = 1; + end for; + end for; +//Generation of mole fraction from 0 to 1 in steps of "delta" + z1[1] = 0; + for i in 2:N + 1 loop + z1[i] = z1[i - 1] + delta; + end for; + for i in 1:N + 1 loop + z2[i] = 1 - z1[i]; + end for; +//Calculation of Activity coefficients at different conditions using the function "Gamma_UNIQUAC" + (gammaBubl1, gammaBubl2) = Binary_Phase_Envelope_UNIQUAC.Gamma_UNIQUAC(Choice, N, NOC, z1, z2, R, Q, tow, towk); +//Bubble point calculation + for i in 1:N + 1 loop + P = gammaBubl1[i] * z1[i] * exp(comp[1].VP[2] + comp[1].VP[3] / T[i] + comp[1].VP[4] * log(T[i]) + comp[1].VP[5] * T[i] ^ comp[1].VP[6]) + gammaBubl2[i] * z2[i] * exp(comp[2].VP[2] + comp[2].VP[3] / T[i] + comp[2].VP[4] * log(T[i]) + comp[2].VP[5] * T[i] ^ comp[2].VP[6]); + end for; +//Phase Equilibria + for i in 1:N + 1 loop + K1[i] = gammaBubl1[i] * (Psat[i, 1] / P); + y1[i] = K1[i] * z1[i]; + y2[i] = 1 - y1[i]; + end for; +//Calculation of vapour pressures at different temperatures + for i in 1:N + 1 loop + Psat[i, 1] = Simulator.Files.Thermodynamic_Functions.Psat(comp[1].VP, T[i]); + end for; + end T_x_y_UNIQUAC; + + //================================================================================================ + //============================================================================================================== + //================================================================================================================ +end Binary_Phase_Envelope_UNIQUAC; diff --git a/Simulator/Simulator/Binary_Phase_Envelope/package.mo b/Simulator/Simulator/Binary_Phase_Envelope/package.mo new file mode 100644 index 0000000..6d958ff --- /dev/null +++ b/Simulator/Simulator/Binary_Phase_Envelope/package.mo @@ -0,0 +1,4 @@ +within Simulator; +package Binary_Phase_Envelope + +end Binary_Phase_Envelope; diff --git a/Simulator/Simulator/Binary_Phase_Envelope/package.order b/Simulator/Simulator/Binary_Phase_Envelope/package.order new file mode 100644 index 0000000..1ec8e59 --- /dev/null +++ b/Simulator/Simulator/Binary_Phase_Envelope/package.order @@ -0,0 +1,4 @@ +Binary_Phase_Envelope_UNIQUAC +Binary_Phase_Envelope_UNIFAC +Binary_Phase_Envelope_PR +Binary_Phase_Envelope_NRTL diff --git a/Simulator/Simulator/Files/Chemsep_Database/Acenaphthene.mo b/Simulator/Simulator/Files/Chemsep_Database/Acenaphthene.mo new file mode 100644 index 0000000..8ff846d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Acenaphthene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Acenaphthene + extends General_Properties(SN = 177, name = "Acenaphthene", CAS = "83-32-9", Tc = 803.15, Pc = 3100000, Vc = 0.553, Cc = 0.257, Tb = 550.54, Tm = 366.56, TT = 366.56, TP = 199.997, MW = 154.208, LVB = 0.149792, AF = 0.381147, SP = 19480, DM = 8.5E-31, SH = -168070000.0, IGHF = 1.55E+08, GEF = 2.602E+08, AS = 368900, HFMP = 2.1462E+07, HOC = -6.0014E+09, LiqDen = {105, 0.39942, 0.22066, 803.15, 0.24043, 0}, VP = {101, 73.737, -9735.5, -7.1321, 0.0000016079, 2}, LiqCp = {16, 173930, 379.65, 5.6292, 0.017939, -0.000013551}, HOV = {106, 3.785978E+08, 10.14483, -25.41937, 26.03775, -9.982155}, VapCp = {16, 60762, -515.4, 13.307, -0.000026823, -1.013E-08}, LiqVis = {101, -8.2073, 1373.2, -0.25871, -0.0000036859, 2}, VapVis = {102, 0.0000015547, 0.4064, 630.11, 26.274, 0}, LiqK = {16, 0.059552, -91.592, -1.7169, -0.0019056, 1.2951E-07}, VapK = {102, 0.000078027, 1.0286, 593.39, 37622, 0}, Racketparam = 0.257114, UniquacR = 5.997356, UniquacQ = 3.96, ChaoSeadAF = 0.382, ChaoSeadSP = 19480.5, ChaoSeadLV = 0.149792); +end Acenaphthene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Acetaldehyde.mo b/Simulator/Simulator/Files/Chemsep_Database/Acetaldehyde.mo new file mode 100644 index 0000000..f33b926 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Acetaldehyde.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Acetaldehyde + extends General_Properties(SN = 46, name = "Acetaldehyde", CAS = "75-07-0", Tc = 466, Pc = 5550000, Vc = 0.154, Cc = 0.221, Tb = 294, Tm = 150.15, TT = 150.15, TP = 0.323203, MW = 44.0526, LVB = 0.0568878, AF = 0.290734, SP = 20110, DM = 8.97E-30, SH = -166400000.0, IGHF = -1.664E+08, GEF = -1.333E+08, AS = 264200, HFMP = 3220000, HOC = -1.1045E+09, LiqDen = {105, 1.2346, 0.22392, 466, 0.25025, 0}, VP = {101, 132.6058, -7086.883, -17.42481, 0.0000237457, 2}, LiqCp = {16, 72077, 1068.4, -6.4275, 0.06878, -0.000079154}, HOV = {106, 1.4565E+07, -6.1925, 18.559, -20.707, 8.5605}, VapCp = {16, 42578, -730.39, 11.883, 0.000033485, -3.0296E-08}, LiqVis = {101, -4.0316, 623.05, -1.1589, 8.4583E-07, 2}, VapVis = {102, 1.1933E-07, 0.78879, 65.293, 1023.3, 0}, LiqK = {16, 0.014392, -40.45, -0.67323, -0.0036191, 0.0000011083}, VapK = {102, 3.2627E-07, 1.8293, -23.073, 3397.7, 0}, Racketparam = 0, UniquacR = 1.9, UniquacQ = 1.8, ChaoSeadAF = 0.316685, ChaoSeadSP = 19818.5, ChaoSeadLV = 0.0564965); +end Acetaldehyde; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Aceticacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Aceticacid.mo new file mode 100644 index 0000000..0724f28 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Aceticacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Aceticacid + extends General_Properties(SN = 48, name = "Aceticacid", CAS = "64-19-7", Tc = 594.45, Pc = 5790000, Vc = 0.171, Cc = 0.2, Tb = 391.04, Tm = 289.81, TT = 289.81, TP = 1280, MW = 60.053, LVB = 0.05753, AF = 0.46, SP = 19060, DM = 5.8E-30, SH = -52630000.0, IGHF = -4.328E+08, GEF = -3.745E+08, AS = 282500, HFMP = 1.173E+07, HOC = -7.866E+08, LiqDen = {105, 1.0627, 0.22174, 594.76, 0.22566, 0}, VP = {101, 87.50607, -7603.906, -9.655308, 7.168835E-06, 2}, LiqCp = {16, 49034, 1051.1, 0.77564, 0.031667, -0.000028344}, HOV = {106, 6.6203E+07, 6.7121, -17.45, 17.2, -6.0038}, VapCp = {16, 40110, -588.24, 12.017, 0.00016249, -8.6918E-08}, LiqVis = {101, -58.528, 2990.9, 7.4911, -0.000011028, 2}, VapVis = {102, 4.3395E-09, 1.24, -175.09, 25013, 0}, LiqK = {16, 0.11159, -531.13, 1.6359, -0.009369, -7.1996E-07}, VapK = {102, 0.34137, -0.80579, -824.3, 175840, 0}, Racketparam = 0, UniquacR = 2.23, UniquacQ = 2.04, ChaoSeadAF = 0.4566, ChaoSeadSP = 18501.7, ChaoSeadLV = 0.0575804); +end Aceticacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Aceticanhydride.mo b/Simulator/Simulator/Files/Chemsep_Database/Aceticanhydride.mo new file mode 100644 index 0000000..dc5221a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Aceticanhydride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Aceticanhydride + extends General_Properties(SN = 404, name = "Aceticanhydride", CAS = "108-24-7", Tc = 569.15, Pc = 4280000, Vc = 0.29, Cc = 0.23, Tb = 413.15, Tm = 200.15, TT = 200.15, TP = 0.0219995, MW = 102.089, LVB = 0.0949602, AF = 0.809524, SP = 22010, DM = 9.3E-30, SH = -22600000.0, IGHF = -5.735E+08, GEF = -4.767E+08, AS = 389900, HFMP = 1.05E+07, HOC = -1.675E+09, LiqDen = {105, 1.3543, 0.3062, 584.65, 0.43334, 0}, VP = {101, 94.79499, -8627.117, -10.49847, 0.0000051448, 2}, LiqCp = {16, -76055, 674.26, 4.7415, 0.026829, -0.000028167}, HOV = {106, 4.787557E+07, -0.639261, 1.651354, -0.778133, -0.0411955}, VapCp = {16, 63862, -716.36, 13.016, -0.00041944, 1.1702E-07}, LiqVis = {101, -13.196, 1321.3, 0.29135, 3.1938E-07, 2}, VapVis = {102, 1.3132E-07, 0.7781, 96.036, 3593.8, 0}, LiqK = {16, 0.0017236, -11.978, -1.3413, -0.0012823, -6.1388E-07}, VapK = {102, 0.0003967, 0.81349, 426.6, 140300, 0}, Racketparam = 0.23, UniquacR = 3.586025, UniquacQ = 3.224, ChaoSeadAF = 0.453, ChaoSeadSP = 22010, ChaoSeadLV = 0.0949602); +end Aceticanhydride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Acetone.mo b/Simulator/Simulator/Files/Chemsep_Database/Acetone.mo new file mode 100644 index 0000000..9d81a60 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Acetone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Acetone + extends General_Properties(SN = 62, name = "Acetone", CAS = "67-64-1", Tc = 508.1, Pc = 4700000, Vc = 0.209, Cc = 0.233, Tb = 329.22, Tm = 178.45, TT = 178.45, TP = 2.78509, MW = 58.08, LVB = 0.07394, AF = 0.307, SP = 19730, DM = 9.61E-30, SH = 20230000.0, IGHF = -2.157E+08, GEF = -1.513E+08, AS = 295400, HFMP = 5774000, HOC = -1.659E+09, LiqDen = {105, 1.1051, 0.24556, 508.21, 0.27409, 0}, VP = {101, 72.77713, -5752.936, -7.680083, 6.83076E-06, 2}, LiqCp = {16, 107130, 725.57, 0.95296, 0.025981, -0.00001439}, HOV = {106, 6.6943E+07, 3.4736, -8.9271, 10.062, -4.1656}, VapCp = {16, 52915, -669.27, 12.201, 0.00012839, -5.8844E-08}, LiqVis = {101, -14.064, 1000.7, 0.45349, 3.9456E-07, 2}, VapVis = {102, 3.1012E-08, 0.97616, 23.042, 14.834, 0}, LiqK = {16, 0.01013, -95.32, -0.21151, -0.0052616, 0.0000023043}, VapK = {102, -26.882, 0.9036, -1.2095E+08, -6.0879E+08, 0}, Racketparam = 0, UniquacR = 2.5735, UniquacQ = 2.336, ChaoSeadAF = 0.3099, ChaoSeadSP = 19729.7, ChaoSeadLV = 0.0738386); +end Acetone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Acetonitrile.mo b/Simulator/Simulator/Files/Chemsep_Database/Acetonitrile.mo new file mode 100644 index 0000000..dbe6dcb --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Acetonitrile.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Acetonitrile + extends General_Properties(SN = 42, name = "Acetonitrile", CAS = "75-05-8", Tc = 545.5, Pc = 4830000, Vc = 0.173, Cc = 0.184, Tb = 354.75, Tm = 229.32, TT = 229.32, TP = 186.945, MW = 41.0519, LVB = 0.0528577, AF = 0.337886, SP = 24050, DM = 1.31E-29, SH = 28450000.0, IGHF = 7.404E+07, GEF = 9.1868E+07, AS = 243290, HFMP = 8167000, HOC = -1.19043E+09, LiqDen = {105, 1.3064, 0.22597, 545.5, 0.28678, 0}, VP = {101, 63.90188, -5635.018, -6.338065, 5.801644E-06, 2}, LiqCp = {16, 78687, 635.92, 1.7473, 0.02389, -0.000017421}, HOV = {106, 4.416703E+07, 0.0989791, 1.817987, -3.443548, 1.854664}, VapCp = {16, 41003, -679.99, 11.578, 0.00010104, -4.1014E-08}, LiqVis = {101, -31.531, 1522.1, 3.3306, -0.0000059061, 2}, VapVis = {102, 5.1905E-08, 0.88581, 38.325, 87.034, 0}, LiqK = {16, 0.18265, 8401.9, -103.1, 0.40559, -0.00056286}, VapK = {102, 4.7622E-08, 2.1156, 30.88, -14671, 0}, Racketparam = 0.260911, UniquacR = 1.87, UniquacQ = 1.72, ChaoSeadAF = 0.338174, ChaoSeadSP = 24093.5, ChaoSeadLV = 0.0526772); +end Acetonitrile; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Acetylchloride.mo b/Simulator/Simulator/Files/Chemsep_Database/Acetylchloride.mo new file mode 100644 index 0000000..658dfca --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Acetylchloride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Acetylchloride + extends General_Properties(SN = 40, name = "Acetylchloride", CAS = "75-36-5", Tc = 508, Pc = 5740000, Vc = 0.196, Cc = 0.266, Tb = 323.9, Tm = 160.3, TT = 160.3, TP = 0.0945737, MW = 78.4976, LVB = 0.0713449, AF = 0.334018, SP = 19730, DM = 9.07E-30, SH = 28450000.0, IGHF = -2.4351E+08, GEF = -2.058E+08, AS = 295000, HFMP = 2.75307E+08, HOC = -8.7599E+08, LiqDen = {105, 1.4254, 0.27938, 508, 0.26304, 0}, VP = {101, 99.17638, -7177.914, -11.22425, -0.0000057394, 2}, LiqCp = {16, 42690, 1356.4, -2.0032, 0.038796, -0.000032805}, HOV = {106, 4.0E+07, 0.3, 0, 0, 0}, VapCp = {16, 55490, -733.46, 11.97, -0.00022853, 6.1958E-08}, LiqVis = {101, 4.4371, 130.26, -2.2299, -8.5166E-07, 2}, VapVis = {102, 5.0377E-08, 0.94052, 79.768, -9041.6, 0}, LiqK = {16, 0.11965, 1957.5, -32.911, 0.1548, -0.00027429}, VapK = {102, -27944, 0.34599, -4.878E+09, -7.8546E+10, 0}, Racketparam = 0.26125, UniquacR = 2.438365, UniquacQ = 2.208, ChaoSeadAF = 0.334018, ChaoSeadSP = 20189.2, ChaoSeadLV = 0.0712327); +end Acetylchloride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Acetylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Acetylene.mo new file mode 100644 index 0000000..0447be7 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Acetylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Acetylene + extends General_Properties(SN = 37, name = "Acetylene", CAS = "74-86-2", Tc = 308.3, Pc = 6114000, Vc = 0.1122, Cc = 0.268, Tb = 188.4, Tm = 192.4, TT = 192.4, TP = 127445, MW = 26.038, LVB = 0.04347, AF = 0.189, SP = 7921, DM = 0, SH = 228200000.0, IGHF = 2.282E+08, GEF = 2.1068E+08, AS = 200810, HFMP = 3770000, HOC = -1.257E+09, LiqDen = {105, 2.8265, 0.29316, 308.3, 0.31711, 0}, VP = {101, 82.22155, -3603.253, -10.0271, 0.0000269397, 2}, LiqCp = {16, 79227, 3177.2, -44.249, 0.23814, -0.00030171}, HOV = {106, 3.8817E+07, 1.497, -1.0261, 0.037348, -0.024401}, VapCp = {16, 28271.69, -404.2493, 11.05572, -0.000229636, 1.424209E-07}, LiqVis = {101, -10.822, 283.23, 0.22007, -0.0000091126, 2}, VapVis = {102, 0.0000010997, 0.50414, 259.72, 2787.3, 0}, LiqK = {16, -0.060328, -110.3, 0.44567, -0.0073832, 0.0000024581}, VapK = {102, 0.000078096, 1.0286, -36.515, 33144, 0}, Racketparam = 0.2712, UniquacR = 1.52, UniquacQ = 1.39, ChaoSeadAF = 0.1841, ChaoSeadSP = 18813, ChaoSeadLV = 0.0421382); +end Acetylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Acrylicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Acrylicacid.mo new file mode 100644 index 0000000..3e84792 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Acrylicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Acrylicacid + extends General_Properties(SN = 394, name = "Acrylicacid", CAS = "79-10-7", Tc = 654.15, Pc = 5664070, Vc = 0.210712, Cc = 0.23, Tb = 414.15, Tm = 286.15, TT = 286.15, TP = 257.117, MW = 72.0627, LVB = 0.068927, AF = 0.220736, SP = 19230, DM = 4.87E-30, SH = -22600000.0, IGHF = -3.371E+08, GEF = -2.861E+08, AS = 315000, HFMP = 1.117E+07, HOC = -1.28022E+09, LiqDen = {105, 0.11535, 0.078693, 654.15, 0.16945, 0}, VP = {101, 55.86645, -7062.889, -4.564151, 1.238643E-06, 2}, LiqCp = {16, 142250, 1837.1, -38.373, 0.21763, -0.00027035}, HOV = {106, 6.9258E+07, 1.9796, 2.7587, -12.283, 8.2823}, VapCp = {16, 49916, -589.6, 12.259, -0.00013536, 3.0855E-08}, LiqVis = {101, -113.67, 5526.6, 15.75, -0.000015983, 2}, VapVis = {102, 2.4666E-07, 0.69704, 207.66, -6104.4, 0}, LiqK = {16, -0.40695, 33.472, -0.79449, 0.00078306, -0.0000013868}, VapK = {102, 0.00092475, 0.70367, 626.1, 112700, 0}, Racketparam = 0.23, UniquacR = 2.6467, UniquacQ = 2.4, ChaoSeadAF = 0.538324, ChaoSeadSP = 19230, ChaoSeadLV = 0.068927); +end Acrylicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Acrylonitrile.mo b/Simulator/Simulator/Files/Chemsep_Database/Acrylonitrile.mo new file mode 100644 index 0000000..d32af58 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Acrylonitrile.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Acrylonitrile + extends General_Properties(SN = 58, name = "Acrylonitrile", CAS = "107-13-1", Tc = 535, Pc = 4480000, Vc = 0.212, Cc = 0.214, Tb = 350.5, Tm = 189.63, TT = 189.63, TP = 3.68289, MW = 53.0626, LVB = 0.0662367, AF = 0.349801, SP = 21560, DM = 1.29E-29, SH = -47150000.0, IGHF = 1.837E+08, GEF = 1.937E+08, AS = 275300, HFMP = 6230000, HOC = -1.69E+09, LiqDen = {105, 1.0816, 0.2293, 535, 0.28939, 0}, VP = {101, 74.54771, -6259.727, -7.785577, 4.08032E-06, 2}, LiqCp = {16, 83847, 240.59, 6.8887, 0.0095277, -0.0000046046}, HOV = {106, 5.224752E+07, 0.877802, -0.432396, -0.672186, 0.607598}, VapCp = {16, 42651, -533.04, 11.728, 0.00013096, -6.2176E-08}, LiqVis = {101, -0.5429, 318.29, -1.481, -8.3759E-07, 2}, VapVis = {102, 4.616E-08, 0.90278, 67.424, -1672.6, 0}, LiqK = {16, -0.15669, 19.22, -1.0721, 0.00025871, -0.0000022582}, VapK = {102, 0.0012317, 1.2472, 60863, -1968600, 0}, Racketparam = 0.259865, UniquacR = 2.31, UniquacQ = 2.05, ChaoSeadAF = 0.349801, ChaoSeadSP = 21555.4, ChaoSeadLV = 0.0662367); +end Acrylonitrile; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Adipicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Adipicacid.mo new file mode 100644 index 0000000..724b3d2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Adipicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Adipicacid + extends General_Properties(SN = 400, name = "Adipicacid", CAS = "124-04-9", Tc = 809, Pc = 3530000, Vc = 0.4, Cc = 0.21, Tb = 611, Tm = 426.15, TT = 425.5, TP = 78.0827, MW = 146.141, LVB = 0.133942, AF = 1.05065, SP = 25370, DM = 7.74E-30, SH = -22600000.0, IGHF = -8.65E+08, GEF = -6.82E+08, AS = 482000, HFMP = 1.67E+07, HOC = -2.58E+09, LiqDen = {105, 0.64797, 0.25918, 809, 0.28198, 0}, VP = {101, 255.2237, -23233.92, -32.83085, 0.000013435, 2}, LiqCp = {16, 235940, -32.997, 10.809, 0.0032672, -0.0000019456}, HOV = {106, 1.949255E+08, 0.823008, 2.518159, -5.646327, 2.784565}, VapCp = {16, 85474, -423.41, 12.745, 0.00026178, -1.1462E-07}, LiqVis = {101, -8.4738, 3093.2, -0.68319, 4.5668E-07, 2}, VapVis = {102, 8.6397E-08, 0.79699, 129.04, -83.45, 0}, LiqK = {16, -0.15138, 31.723, -1.1417, 0.000072402, -7.2467E-07}, VapK = {102, 0.00019846, 0.87712, 520.45, 62013, 0}, Racketparam = 0.21, UniquacR = 5.3002, UniquacQ = 4.608, ChaoSeadAF = 1.05065, ChaoSeadSP = 25370, ChaoSeadLV = 0.133942); +end Adipicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Air.mo b/Simulator/Simulator/Files/Chemsep_Database/Air.mo new file mode 100644 index 0000000..047969d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Air.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Air + extends General_Properties(SN = 1, name = "Air", CAS = "132259-10-0", Tc = 132.45, Pc = 3774000, Vc = 0.09147, Cc = 0.313, Tb = 78.67, Tm = 59.15, TT = 59.15, TP = 5642.15, MW = 28.96, LVB = 0.0329147, AF = 0, SP = 12750, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 199000, HFMP = 0, HOC = 0, LiqDen = {105, 2.6731, 0.25637, 132.51, 0.26788, 0}, VP = {101, 14.794, -599.85, 1.0009, -3.9938E-07, 2}, LiqCp = {16, 53628, 4511.1, -143.29, 1.582, -0.0051332}, HOV = {106, 7385651, 0.276676, 0.211253, -0.836764, 0.722737}, VapCp = {100, 29562.29, -7.164949, 0.0216294, -0.0000139748, 2.89195E-09}, LiqVis = {101, -72.336, 813.48, 12.687, -0.00033062, 2}, VapVis = {102, 0.000001592, 0.48975, 123.45, -829.58, 0}, LiqK = {16, -0.21199, -16.311, -0.23057, -0.0076197, 0.0000025018}, VapK = {102, 0.0003511, 0.76492, 16.071, 1084.4, 0}, Racketparam = 0.29056, UniquacR = 0, UniquacQ = 0, ChaoSeadAF = -0.00787976, ChaoSeadSP = 12749.8, ChaoSeadLV = 0.0329147); +end Air; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ammonia.mo b/Simulator/Simulator/Files/Chemsep_Database/Ammonia.mo new file mode 100644 index 0000000..0f489c9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ammonia.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ammonia + extends General_Properties(SN = 16, name = "Ammonia", CAS = "7664-41-7", Tc = 405.4, Pc = 1.1353E+07, Vc = 0.07247, Cc = 0.255, Tb = 239.82, Tm = 195.41, TT = 195.41, TP = 6111.09, MW = 17.031, LVB = 0.02496, AF = 0.256, SP = 24790, DM = 4.9E-30, SH = -45898000.0, IGHF = -4.5898E+07, GEF = -1.64E+07, AS = 192660, HFMP = 5657000, HOC = -3.1683E+08, LiqDen = {105, 4.0518, 0.27129, 405.4, 0.31349, 0}, VP = {101, 62.8849, -4136.862, -6.320663, 9.203947E-06, 2}, LiqCp = {16, 77659, -45330, 445.74, -1.4197, 0.0015508}, HOV = {106, 2.4542E+07, -1.3178, 4.7194, -5.4808, 2.4196}, VapCp = {16, 33239, -913.64, 10.802, 0.00021047, -4.1739E-08}, LiqVis = {101, -39.742, 1486.5, 4.7749, -0.000015796, 2}, VapVis = {102, 0.0000000459, 0.96936, 48.366, -2671.4, 0}, LiqK = {16, -0.95309, 14.684, 0.56768, -0.00028968, -0.0000019238}, VapK = {102, 0.000016165, 1.3146, 75.168, -8202.1, 0}, Racketparam = 0, UniquacR = 0.9097, UniquacQ = 0.98, ChaoSeadAF = 0.2517, ChaoSeadSP = 29224.9, ChaoSeadLV = 0.0249801); +end Ammonia; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Aniline.mo b/Simulator/Simulator/Files/Chemsep_Database/Aniline.mo new file mode 100644 index 0000000..4818df2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Aniline.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Aniline + extends General_Properties(SN = 127, name = "Aniline", CAS = "62-53-3", Tc = 699, Pc = 5310000, Vc = 0.2739, Cc = 0.256, Tb = 457.17, Tm = 267.13, TT = 267.13, TP = 7.13219, MW = 93.128, LVB = 0.09152, AF = 0.38, SP = 24120, DM = 5.1E-30, SH = -168070000.0, IGHF = 8.71E+07, GEF = 1.668E+08, AS = 319800, HFMP = 1.054E+07, HOC = -3.239E+09, LiqDen = {105, 1.0034, 0.27828, 699.16, 0.26553, 0}, VP = {101, 51.415, -7256.776, -3.968851, 1.89237E-06, 1.941839}, LiqCp = {16, 113560, -229.45, 12.348, -0.001777, 0.0000025731}, HOV = {106, 6.518054E+07, -0.829815, 5.221579, -7.587726, 3.672676}, VapCp = {16, 53776, -561.43, 12.878, -0.00018357, 4.6595E-08}, LiqVis = {101, -411.9909, 17880.72, 61.83069, -0.0000659764, 2}, VapVis = {102, 1.8398E-07, 0.71832, 209.33, -5579.1, 0}, LiqK = {16, 0.065783, -186.09, -0.85045, -0.0016475, -0.0000028261}, VapK = {102, 0.00025341, 0.90822, 897.01, -19862, 0}, Racketparam = 0, UniquacR = 3.72, UniquacQ = 2.82, ChaoSeadAF = 0.404143, ChaoSeadSP = 24125.7, ChaoSeadLV = 0.0916034); +end Aniline; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Anisole.mo b/Simulator/Simulator/Files/Chemsep_Database/Anisole.mo new file mode 100644 index 0000000..ce4533c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Anisole.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Anisole + extends General_Properties(SN = 334, name = "Anisole", CAS = "100-66-3", Tc = 642.15, Pc = 4180000, Vc = 0.337, Cc = 0.267, Tb = 426.95, Tm = 235.85, TT = 235.65, TP = 2.44662, MW = 108.138, LVB = 0.109167, AF = 0.350169, SP = 20110, DM = 4.54E-30, SH = -216400000.0, IGHF = -6.8E+07, GEF = 2.27E+07, AS = 361000, HFMP = 9600000, HOC = -3.6018E+09, LiqDen = {105, 0.67524, 0.24431, 645.61, 0.26239, 0}, VP = {101, 117.0581, -9318.991, -14.12565, 9.850515E-06, 2}, LiqCp = {16, 128070, -77.615, 10.002, 0.0059631, -0.0000043683}, HOV = {106, 6.1782E+07, 0.29654, 0.81637, -1.3762, 0.64684}, VapCp = {16, -116340, -170.41, 12.829, 0.00034368, -1.0767E-07}, LiqVis = {101, -16.864, 1572.6, 0.82898, -2.2828E-07, 2}, VapVis = {102, 1.7587E-07, 0.71998, 171.18, 1705.8, 0}, LiqK = {16, -0.15959, 21.142, -1.1373, -0.0000023738, -0.0000009757}, VapK = {102, 0.00055356, 0.7624, 342.48, 235670, 0}, Racketparam = 0.267, UniquacR = 4.1667, UniquacQ = 3.208, ChaoSeadAF = 0.350169, ChaoSeadSP = 20110, ChaoSeadLV = 0.109167); +end Anisole; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Argon.mo b/Simulator/Simulator/Files/Chemsep_Database/Argon.mo new file mode 100644 index 0000000..1fd528d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Argon.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Argon + extends General_Properties(SN = 2, name = "Argon", CAS = "7440-37-1", Tc = 150.86, Pc = 4898000, Vc = 0.07457, Cc = 0.291, Tb = 87.27, Tm = 83.8039, TT = 83.8, TP = 68906.1, MW = 39.948, LVB = 0.0291, AF = -0.002, SP = 14138.3, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 154732, HFMP = 1184900, HOC = 0, LiqDen = {105, 3.803, 0.286, 150.86, 0.2984, 0}, VP = {101, 44.369, -1126.1, -4.5688, 0.000062339, 2}, LiqCp = {16, 46085, -1304.5, 21.195, -0.015382, 0.000033063}, HOV = {106, 7981000, 0.099752, 0.32009, -0.11898, 0.031141}, VapCp = {16, 20786, 0, 0, 0, 0}, LiqVis = {101, -99.903, 1347.5, 17.615, -0.00032893, 2}, VapVis = {102, 0.0000010023, 0.5922, 85.563, 238.26, 0}, LiqK = {16, -0.30397, -0.82999, -0.71462, -0.00039294, -0.000012209}, VapK = {102, 0.00013095, 0.81923, -122.33, 13993, 0}, Racketparam = 0, UniquacR = 1.1074, UniquacQ = 1.068, ChaoSeadAF = -0.002, ChaoSeadSP = 14138.3, ChaoSeadLV = 0.0285865); +end Argon; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Benzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Benzene.mo new file mode 100644 index 0000000..f4c68b5 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Benzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Benzene + extends General_Properties(SN = 125, name = "Benzene", CAS = "71-43-2", Tc = 562.05, Pc = 4895000, Vc = 0.256, Cc = 0.268, Tb = 353.24, Tm = 278.68, TT = 278.68, TP = 4764.22, MW = 78.114, LVB = 0.08941, AF = 0.209, SP = 18700, DM = 0, SH = -168070000.0, IGHF = 8.288E+07, GEF = 1.296E+08, AS = 269300, HFMP = 9866000, HOC = -3.136E+09, LiqDen = {105, 0.99938, 0.26348, 562.05, 0.27856, 0}, VP = {101, 88.368, -6712.9, -10.022, 0.000007694, 2}, LiqCp = {16, 111460, -1854.3, 22.399, -0.028936, 0.000028991}, HOV = {106, 4.881E+07, 0.61066, -0.25882, 0.032238, 0.022475}, VapCp = {16, 34010.24, -588.0978, 12.81777, -0.000197306, 5.142899E-08}, LiqVis = {101, -24.61, 1576.5, 2.1698, -0.0000051366, 2}, VapVis = {102, 3.1366E-08, 0.9675, 8.0285, -35.629, 0}, LiqK = {16, 0.049539, -177.97, 0.19475, -0.0073805, 0.0000027938}, VapK = {102, 0.0000049549, 1.4519, 154.14, 26202, 0}, Racketparam = 0.2696, UniquacR = 3.1878, UniquacQ = 2.4, ChaoSeadAF = 0.213, ChaoSeadSP = 18736.78, ChaoSeadLV = 0.0894); +end Benzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Benzoicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Benzoicacid.mo new file mode 100644 index 0000000..2284bc6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Benzoicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Benzoicacid + extends General_Properties(SN = 396, name = "Benzoicacid", CAS = "65-85-0", Tc = 751, Pc = 4470000, Vc = 0.344, Cc = 0.246, Tb = 523.15, Tm = 395.55, TT = 395.45, TP = 795.501, MW = 122.121, LVB = 0.112442, AF = 0.602794, SP = 24590, DM = 3.34E-30, SH = -22600000.0, IGHF = -2.902E+08, GEF = -2.142E+08, AS = 369000, HFMP = 1.807E+07, HOC = -3.0951E+09, LiqDen = {105, 0.7147, 0.24811, 751, 0.28445, 0}, VP = {101, 444.4847, -30166.81, -61.25117, 0.000029739, 2}, LiqCp = {16, 78008, 1056.8, 2.5621, 0.02421, -0.000017579}, HOV = {106, 6.7437E+07, 0.13946, -2.3071, 5.0416, -2.5138}, VapCp = {16, 71253, -905.31, 13.682, -0.00087786, 2.5351E-07}, LiqVis = {101, -204.19, 11713, 28.642, -0.000020228, 2}, VapVis = {102, 7.426E-08, 0.8289, 91.171, 5.6616, 0}, LiqK = {16, -0.26694, 24.352, -0.89204, 0.00010336, -5.9141E-07}, VapK = {102, 0.000021559, 1.1593, 126.16, 64371, 0}, Racketparam = 0.246, UniquacR = 4.323, UniquacQ = 3.344, ChaoSeadAF = 0.602794, ChaoSeadSP = 24590, ChaoSeadLV = 0.112442); +end Benzoicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Biphenyl.mo b/Simulator/Simulator/Files/Chemsep_Database/Biphenyl.mo new file mode 100644 index 0000000..df2a30a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Biphenyl.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Biphenyl + extends General_Properties(SN = 178, name = "Biphenyl", CAS = "92-52-4", Tc = 789.26, Pc = 3847270, Vc = 0.491118, Cc = 0.294, Tb = 528.15, Tm = 342.35, TT = 342.372, TP = 84.2725, MW = 154.211, LVB = 0.155536, AF = 0.3643, SP = 19383, DM = 0, SH = -168070000.0, IGHF = 1.82088E+08, GEF = 2.80077E+08, AS = 392668, HFMP = 1.85769E+07, HOC = -6.0317E+09, LiqDen = {105, 0.50803, 0.25417, 789.26, 0.2795, 0}, VP = {101, 154.3401, -13555.42, -19.05582, 8.30386E-06, 2}, LiqCp = {16, 24132, -12.395, 11.585, 0.0029407, -0.0000014331}, HOV = {106, 8.680865E+07, 0.473092, 1.061004, -2.226343, 1.156876}, VapCp = {16, 79583, -635.84, 13.574, -0.00034935, 9.291E-08}, LiqVis = {101, -10.998, 1574.4, -0.022671, -3.4058E-07, 2}, VapVis = {102, 1.7776E-07, 0.70632, 118.6, 61798, 0}, LiqK = {16, 0.086277, -343.48, 0.36261, -0.00791, 0.0000032504}, VapK = {102, 0.000031971, 1.1528, 215.14, 115000, 0}, Racketparam = 0, UniquacR = 6.0434, UniquacQ = 4.24, ChaoSeadAF = 0.3643, ChaoSeadSP = 19383, ChaoSeadLV = 0.155536); +end Biphenyl; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Bromine.mo b/Simulator/Simulator/Files/Chemsep_Database/Bromine.mo new file mode 100644 index 0000000..0ce9c6b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Bromine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Bromine + extends General_Properties(SN = 3, name = "Bromine", CAS = "7726-95-6", Tc = 584.15, Pc = 1.03E+07, Vc = 0.135, Cc = 0.286, Tb = 331.9, Tm = 265.9, TT = 265.85, TP = 5853.37, MW = 159.808, LVB = 0.0514795, AF = 0.128997, SP = 23590, DM = 0, SH = 0.0, IGHF = 3.091E+07, GEF = 3140000, AS = 245350, HFMP = 1.057E+07, HOC = 0, LiqDen = {105, 2.0603, 0.28982, 584.15, 0.28948, 0}, VP = {101, 63.657, -5321.6, -6.3199, 0.0000054412, 2}, LiqCp = {16, 75351, -4.87E+07, 54033, 102.73, 0.43775}, HOV = {106, 3.8419E+07, -0.26282, 2.1808, -2.7529, 1.1823}, VapCp = {16, 35000, -410, 8.5, -0.00016, -0.00000001}, LiqVis = {101, -5.9813, 410.55, -0.30036, -0.000006936, 2}, VapVis = {102, 1.1438E-07, 0.88111, 59.595, -6723.3, 0}, LiqK = {16, -0.69183, 27.775, -0.38966, 0.00057103, -8.8462E-07}, VapK = {102, 0.0000065648, 1.4785, 4505.6, -870500, 0}, Racketparam = 0.279241, UniquacR = 1.8985, UniquacQ = 1.672, ChaoSeadAF = 0.108, ChaoSeadSP = 23591.8, ChaoSeadLV = 0.0514795); +end Bromine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Bromobenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Bromobenzene.mo new file mode 100644 index 0000000..13de707 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Bromobenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Bromobenzene + extends General_Properties(SN = 121, name = "Bromobenzene", CAS = "108-86-1", Tc = 670.15, Pc = 4519100, Vc = 0.324, Cc = 0.263, Tb = 429.236, Tm = 242.43, TT = 242.43, TP = 7.8364, MW = 157.008, LVB = 0.105567, AF = 0.250575, SP = 19940, DM = 5.67059E-30, SH = -168070000.0, IGHF = 1.05018E+08, GEF = 1.38532E+08, AS = 324386, HFMP = 1.06274E+07, HOC = -3.01917E+09, LiqDen = {105, 0.8226, 0.26632, 670.15, 0.2821, 0}, VP = {101, 146.6319, -10375.07, -18.74897, 0.0000147083, 2}, LiqCp = {16, 97487, 953.8, 2.1839, 0.023716, -0.000017458}, HOV = {106, 5.656362E+07, 0.347537, 0.135082, 0.0123621, -0.140849}, VapCp = {16, 65656, -767.67, 13.165, -0.00063667, 1.8215E-07}, LiqVis = {101, -54.93, 2754.4, 6.973, -0.000009784, 2}, VapVis = {102, 2.2327E-07, 0.71456, 185.02, -22.393, 0}, LiqK = {16, 0.032562, -180.04, -0.56464, -0.0046562, 1.7973E-07}, VapK = {102, 0.00025787, 0.79923, 269.79, 163730, 0}, Racketparam = 0, UniquacR = 3.9709, UniquacQ = 2.952, ChaoSeadAF = 0.250575, ChaoSeadSP = 19944.7, ChaoSeadLV = 0.105567); +end Bromobenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Butanal.mo b/Simulator/Simulator/Files/Chemsep_Database/Butanal.mo new file mode 100644 index 0000000..815c14e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Butanal.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Butanal + extends General_Properties(SN = 319, name = "Butanal", CAS = "123-72-8", Tc = 521.15, Pc = 4000000, Vc = 0.263, Cc = 0.25, Tb = 347.95, Tm = 176.75, TT = 176.75, TP = 0.316993, MW = 72.1057, LVB = 0.0904328, AF = 0.277417, SP = 18660, DM = 9.07E-30, SH = -1209000000.0, IGHF = -2.07E+08, GEF = -1.1539E+08, AS = 344900, HFMP = 1.109E+07, HOC = -2.3035E+09, LiqDen = {105, 1.0715, 0.2723, 521.3, 0.27225, 0}, VP = {101, 99.51827, -7112.269, -11.7407, 9.521179E-06, 2}, LiqCp = {16, 146790, -6569.4, 41.653, -0.01116, -0.000075065}, HOV = {106, 4.118197E+07, -1.36073, 5.949252, -7.213209, 2.926745}, VapCp = {16, 84791, -954.83, 13.167, -0.00050103, 1.5222E-07}, LiqVis = {101, -14.207, 1014.9, 0.55992, -0.0000018129, 2}, VapVis = {102, 9.4037E-07, 0.50713, 464.89, -11049, 0}, LiqK = {16, 0.054171, 0.30189, -1.9042, -0.00054405, -0.0000037387}, VapK = {102, 784.27, 0.98392, 6.406E+09, -1.3461E+11, 0}, Racketparam = 0.25, UniquacR = 3.2479, UniquacQ = 2.876, ChaoSeadAF = 0.277417, ChaoSeadSP = 18660, ChaoSeadLV = 0.0904328); +end Butanal; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Butylvinylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Butylvinylether.mo new file mode 100644 index 0000000..26d4cd3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Butylvinylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Butylvinylether + extends General_Properties(SN = 333, name = "Butylvinylether", CAS = "111-34-2", Tc = 540.5, Pc = 3200000, Vc = 0.38362, Cc = 0.273, Tb = 367.131, Tm = 181.15, TT = 181.15, TP = 0.134811, MW = 100.163, LVB = 0.130251, AF = 0.358, SP = 16460, DM = 4.16955E-30, SH = -216400000.0, IGHF = -1.83E+08, GEF = -3.61974E+07, AS = 428000, HFMP = 1.38E+07, HOC = -3.59144E+09, LiqDen = {105, 0.51202, 0.22443, 540.5, 0.25269, 0}, VP = {101, 80.48089, -6835.53, -8.641032, 5.192611E-06, 2}, LiqCp = {16, 179060, 294.15, 4.464, 0.023293, -0.000021892}, HOV = {106, 5.9857E+07, 1.4054, -2.9112, 3.3585, -1.4378}, VapCp = {16, 70271, -440.11, 12.531, 0.00054467, -2.1666E-07}, LiqVis = {101, -13.973, 1139.1, 0.44727, -0.0000011861, 2}, VapVis = {102, 9.4315E-08, 0.78571, 41.584, 9100.4, 0}, LiqK = {16, -0.13174, 16.987, -1.2513, -0.000050242, -0.000001447}, VapK = {102, 0.00002407, 1.1842, 65.04, 40153, 0}, Racketparam = 0.273, UniquacR = 4.7403, UniquacQ = 4.192, ChaoSeadAF = 0.358, ChaoSeadSP = 16460, ChaoSeadLV = 0.130251); +end Butylvinylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Carbondioxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Carbondioxide.mo new file mode 100644 index 0000000..0c81a31 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Carbondioxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Carbondioxide + extends General_Properties(SN = 6, name = "Carbondioxide", CAS = "124-38-9", Tc = 304.21, Pc = 7383000, Vc = 0.094, Cc = 0.274, Tb = 0, Tm = 216.58, TT = 216.58, TP = 518672, MW = 44.0095, LVB = 0.0616782, AF = 0.223621, SP = 14560, DM = 0, SH = -393510000.0, IGHF = -3.9351E+08, GEF = -3.9437E+08, AS = 213677, HFMP = 9019000, HOC = 0, LiqDen = {105, 2.768, 0.26212, 304.21, 0.2908, 0}, VP = {101, 95.478, -4070, -12.07, 0.000029505, 2}, LiqCp = {16, 80592, 108.83, -6.9126, 0.059647, 0.0000069922}, HOV = {106, 2.1092E+07, 0.35366, -0.46134, 0.43554, 0.037671}, VapCp = {16, 28933, -494.28, 10.658, -0.000027375, 3.3268E-09}, LiqVis = {101, -7.7022, -166.34, 0.38094, -0.00004018, 2}, VapVis = {102, 0.0000022464, 0.45495, 292.64, 1669.1, 0}, LiqK = {16, -0.24975, -55.106, 0.41735, -0.0051067, 0.0000020157}, VapK = {102, 5.804, -0.44522, 794.13, 2139600, 0}, Racketparam = 0.270937, UniquacR = 1.2986, UniquacQ = 1.292, ChaoSeadAF = 0.231, ChaoSeadSP = 14563.8, ChaoSeadLV = 0.0372744); +end Carbondioxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Carbondisulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Carbondisulfide.mo new file mode 100644 index 0000000..ce31ae9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Carbondisulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Carbondisulfide + extends General_Properties(SN = 7, name = "Carbondisulfide", CAS = "75-15-0", Tc = 552, Pc = 7900000, Vc = 0.16, Cc = 0.275, Tb = 319.375, Tm = 161.58, TT = 161.11, TP = 1.4944, MW = 76.1407, LVB = 0.0606387, AF = 0.110697, SP = 20400, DM = 0, SH = -393510000.0, IGHF = 1.169E+08, GEF = 6.68E+07, AS = 237900, HFMP = 4393000, HOC = -1.0769E+09, LiqDen = {105, 1.7976, 0.28757, 552, 0.32269, 0}, VP = {101, 52.62041, -4546.02, -4.744246, 4.881551E-06, 2}, LiqCp = {16, 69032, 671.75, 2.3423, 0.015972, -0.0000043479}, HOV = {106, 3.9758E+07, 0.68679, 0.18227, -1.7985, 1.3658}, VapCp = {16, 26779, -222.87, 10.557, 0.00011062, -5.3772E-08}, LiqVis = {101, -9.8702, 691.26, -0.072299, 1.6489E-07, 2}, VapVis = {102, 5.9681E-08, 0.92304, 48.01, -162.47, 0}, LiqK = {16, 0.12378, -150.01, -0.453, -0.0078739, -0.0000032002}, VapK = {102, 0.00033762, 0.73827, 483.3, -4769.2, 0}, Racketparam = 0, UniquacR = 2.057, UniquacQ = 1.65, ChaoSeadAF = 0.107865, ChaoSeadSP = 20410.7, ChaoSeadLV = 0.0606387); +end Carbondisulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Carbonmonoxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Carbonmonoxide.mo new file mode 100644 index 0000000..4e03365 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Carbonmonoxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Carbonmonoxide + extends General_Properties(SN = 5, name = "Carbonmonoxide", CAS = "630-08-0", Tc = 132.85, Pc = 3494000, Vc = 0.0931, Cc = 0.292, Tb = 81.66, Tm = 68.15, TT = 68.15, TP = 15400, MW = 28.01, LVB = 0.03488, AF = 0.045, SP = 6402, DM = 3.74E-31, SH = -110530000.0, IGHF = -1.1053E+08, GEF = -1.3715E+08, AS = 197556, HFMP = 840984, HOC = -2.83E+08, LiqDen = {105, 2.2423, 0.2437, 132.93, 0.24196, 0}, VP = {101, 42.283, -1035.1, -4.2012, 0.000062546, 2}, LiqCp = {16, 63364, -10524, 359.6, -3.9494, 0.014624}, HOV = {106, 8585000, 0.4921, -0.326, 0.2231, 0}, VapCp = {16, 29100, -1979.753, 10.58274, -0.0000790406, -1.99685E-07}, LiqVis = {101, -82.158, 1037.8, 14.229, -0.00028204, 2}, VapVis = {102, 0.0000012713, 0.51494, 105.97, -231.11, 0}, LiqK = {16, -0.23621, -3.5251, -0.55788, -0.0039362, -0.0000082725}, VapK = {102, 0.00061581, 0.6828, 61.287, 221.32, 0}, Racketparam = 0.2918, UniquacR = 1.0679, UniquacQ = 1.112, ChaoSeadAF = 0.093, ChaoSeadSP = 6402.36, ChaoSeadLV = 0.0354426); +end Carbonmonoxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Carbontetrachloride.mo b/Simulator/Simulator/Files/Chemsep_Database/Carbontetrachloride.mo new file mode 100644 index 0000000..753eee3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Carbontetrachloride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Carbontetrachloride + extends General_Properties(SN = 4, name = "Carbontetrachloride", CAS = "56-23-5", Tc = 556.3, Pc = 4557000, Vc = 0.276, Cc = 0.271, Tb = 349.79, Tm = 250.33, TT = 250.33, TP = 1122.46, MW = 153.822, LVB = 0.09707, AF = 0.187, SP = 17550, DM = 0, SH = 0.0, IGHF = -9.581E+07, GEF = -5.354E+07, AS = 309910, HFMP = 2535000, HOC = -2.653E+08, LiqDen = {105, 1.0721, 0.28328, 556.3, 0.30092, 0}, VP = {101, 82.671, -6304.2, -9.2247, 0.0000074352, 2}, LiqCp = {16, 129390, 1959.2, -18.833, 0.080834, -0.000047491}, HOV = {106, 3.1764E+07, -1.5729, 5.2158, -5.5259, 2.1931}, VapCp = {16, 37588.04, -242.5309, 11.66726, -0.000446049, 1.391101E-07}, LiqVis = {101, -22.297, 1645, 1.7588, -0.0000028163, 2}, VapVis = {102, 0.0000029947, 0.37756, 454.35, 5708.3, 0}, LiqK = {16, 0.034432, -227.95, -0.38117, -0.0048371, -0.0000011782}, VapK = {102, 0.0001208, 0.98541, 1411.1, -36584, 0}, Racketparam = 0, UniquacR = 3.33, UniquacQ = 2.82, ChaoSeadAF = 1.695, ChaoSeadSP = 17546.4, ChaoSeadLV = 0.0971395); +end Carbontetrachloride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Carbonylsulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Carbonylsulfide.mo new file mode 100644 index 0000000..300b266 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Carbonylsulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Carbonylsulfide + extends General_Properties(SN = 202, name = "Carbonylsulfide", CAS = "463-58-1", Tc = 375.15, Pc = 6349000, Vc = 0.14, Cc = 0.272, Tb = 223.15, Tm = 134.35, TT = 134.3, TP = 101.325, MW = 60.0751, LVB = 0.0510474, AF = 0.137779, SP = 14270, DM = 2.37E-30, SH = -138410000.0, IGHF = -1.3841E+08, GEF = -1.692E+08, AS = 231470, HFMP = 4725000, HOC = -5.4827E+08, LiqDen = {105, 1.8896, 0.27226, 378.81, 0.25315, 0}, VP = {101, 74.34266, -3813.497, -8.620386, 0.0000180431, 2}, LiqCp = {16, 71808, -8528.4, 73.159, -0.16854, 0.00016953}, HOV = {106, 3.0555E+07, 0.84937, -0.32129, -0.52716, 0.40226}, VapCp = {16, 28351, -363.89, 10.752, -0.00019902, 7.0945E-08}, LiqVis = {101, -9.091, 494.42, -0.20653, -6.4588E-07, 2}, VapVis = {102, 0.000010184, 0.2938, 1012.7, -12250, 0}, LiqK = {16, 0.032218, -41.011, -0.83624, -0.0051268, 0.0000012154}, VapK = {102, 0.0012701, 0.60437, 545.23, 3627.6, 0}, Racketparam = 0.272, UniquacR = 1.707317, UniquacQ = 1.620988, ChaoSeadAF = 0.096, ChaoSeadSP = 14270, ChaoSeadLV = 0.0510474); +end Carbonylsulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Chlorine.mo b/Simulator/Simulator/Files/Chemsep_Database/Chlorine.mo new file mode 100644 index 0000000..0669652 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Chlorine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Chlorine + extends General_Properties(SN = 11, name = "Chlorine", CAS = "7782-50-5", Tc = 417, Pc = 7700000, Vc = 0.124, Cc = 0.275, Tb = 239.12, Tm = 172.12, TT = 172.12, TP = 1366.04, MW = 70.905, LVB = 0.04536, AF = 0.073, SP = 17360, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 222972, HFMP = 6406000, HOC = 0, LiqDen = {105, 1.8293, 0.25, 417.16, 0.26753, 0}, VP = {101, 45.776, -3292.7, -3.7926, 0.0000049863, 2}, LiqCp = {16, 66547, 12488, -246.3, -2.7266, -0.021518}, HOV = {106, 2.9601E+07, 0.77334, -1.0279, 0.93368, -0.2926}, VapCp = {16, 28958, -398.03, 10.125, -0.0010681, 3.8414E-07}, LiqVis = {101, -11.351, 502.6, 0.30506, -9.5237E-07, 2}, VapVis = {102, 2.5899E-07, 0.74273, 97.463, -22.488, 0}, LiqK = {16, -0.48743, 13.229, -0.49371, 0.00052989, -0.0000020491}, VapK = {102, 0.00096588, 0.54995, 434.26, 3605.9, 0}, Racketparam = 0, UniquacR = 1.5887, UniquacQ = 1.524, ChaoSeadAF = 0.0547, ChaoSeadSP = 20120, ChaoSeadLV = 0.0455063); +end Chlorine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Chloroform.mo b/Simulator/Simulator/Files/Chemsep_Database/Chloroform.mo new file mode 100644 index 0000000..0d971a1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Chloroform.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Chloroform + extends General_Properties(SN = 26, name = "Chloroform", CAS = "67-66-3", Tc = 536.5, Pc = 5500000, Vc = 0.24, Cc = 0.296, Tb = 334.33, Tm = 209.63, TT = 209.63, TP = 68.1479, MW = 119.377, LVB = 0.08068, AF = 0.226, SP = 18920, DM = 3.37E-30, SH = -296840000.0, IGHF = -1.029E+08, GEF = -7.01E+07, AS = 295600, HFMP = 9540000, HOC = -3.8E+08, LiqDen = {105, 0.53556, 0.18404, 536.5, 0.18541, 0}, VP = {101, 99.91512, -6781.559, -11.93873, 0.0000115883, 2}, LiqCp = {16, 93132, 645.44, 2.3739, 0.024457, -0.000021097}, HOV = {106, 5.1382E+07, 0.7027, 0.36748, -1.351, 0.69236}, VapCp = {16, 36659, -308.1, 11.299, 0.00003137, -3.3538E-08}, LiqVis = {101, -20.923, 1248.9, 1.655, -0.0000024787, 2}, VapVis = {102, 1.8024E-07, 0.76204, 109.36, -1373.9, 0}, LiqK = {16, 0.061417, -66.692, -1.6802, -0.001962, -0.0000044192}, VapK = {102, 0.00041167, 0.84476, 1870.6, -7829.5, 0}, Racketparam = 0, UniquacR = 2.7, UniquacQ = 2.34, ChaoSeadAF = 0.2059, ChaoSeadSP = 18919.5, ChaoSeadLV = 0.0805048); +end Chloroform; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Chrysene.mo b/Simulator/Simulator/Files/Chemsep_Database/Chrysene.mo new file mode 100644 index 0000000..6bb1546 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Chrysene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Chrysene + extends General_Properties(SN = 189, name = "Chrysene", CAS = "218-01-9", Tc = 979, Pc = 2390000, Vc = 0.749, Cc = 0.22, Tb = 714.15, Tm = 531.15, TT = 531.15, TP = 1028.09, MW = 228.288, LVB = 0.223221, AF = 0.603008, SP = 18920, DM = 2.33E-30, SH = -168070000.0, IGHF = 2.698E+08, GEF = 4.03E+08, AS = 440000, HFMP = 2.62E+07, HOC = -8.6796E+09, LiqDen = {105, 0.30846, 0.21991, 979, 0.32162, 0}, VP = {101, 171.0845, -19845.5, -20.41887, 4.689312E-06, 2}, LiqCp = {16, 314190, 239.97, 9.0147, 0.0068894, -0.0000035685}, HOV = {106, 1.2779E+08, 0.96651, -1.3609, 1.2985, -0.49651}, VapCp = {16, 124010, -668.94, 14.001, -0.0004632, 1.3177E-07}, LiqVis = {101, -12.612, 2823.3, -0.058693, 2.8981E-08, 2}, VapVis = {102, 3.4146E-07, 0.54263, 230.08, -3.8758, 0}, LiqK = {16, 0.032525, -322.45, -0.056163, -0.0034819, 4.4935E-07}, VapK = {102, 0.0001111, 0.947, 689.64, 45041, 0}, Racketparam = 0.237646, UniquacR = 8.250494, UniquacQ = 5.304, ChaoSeadAF = 0.603954, ChaoSeadSP = 19486.9, ChaoSeadLV = 0.210334); +end Chrysene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/CisOneFourdimethylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/CisOneFourdimethylcyclohexane.mo new file mode 100644 index 0000000..a1b2793 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/CisOneFourdimethylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model CisOneFourdimethylcyclohexane + extends General_Properties(SN = 279, name = "CisOneFourdimethylcyclohexane", CAS = "624-29-3", Tc = 598.15, Pc = 2938430, Vc = 0.46, Cc = 0.272, Tb = 397.48, Tm = 185.744, TT = 185.72, TP = 0.0704204, MW = 112.213, LVB = 0.144106, AF = 0.2348, SP = 15980, DM = 0, SH = -1209000000.0, IGHF = -1.76648E+08, GEF = 3.79489E+07, AS = 370451, HFMP = 9307730, HOC = -4.86704E+09, LiqDen = {105, 0.53336, 0.24533, 598.15, 0.2771, 0}, VP = {101, 79.163, -7004.6, -8.4779, 0.0000046053, 2}, LiqCp = {16, 110770, 140.07, 8.7617, 0.0091373, -0.0000048302}, HOV = {106, 7.1514E+07, 2.3724, -5.2021, 5.4751, -2.1521}, VapCp = {16, 101700, -844.25, 13.931, -0.00056374, 1.5762E-07}, LiqVis = {101, -20.704, 1391.4, 1.6378, -0.0000047953, 2}, VapVis = {102, 0.0000024207, 0.36412, 666.44, 4231, 0}, LiqK = {16, -0.063527, 3.3026, -1.4941, -0.0004362, -0.0000011663}, VapK = {102, 0.016747, 0.34072, -1.7965, 898230, 0}, Racketparam = 0.272, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2348, ChaoSeadSP = 15980, ChaoSeadLV = 0.144106); +end CisOneFourdimethylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/CisOneThreedimethylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/CisOneThreedimethylcyclohexane.mo new file mode 100644 index 0000000..29e44d3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/CisOneThreedimethylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model CisOneThreedimethylcyclohexane + extends General_Properties(SN = 277, name = "CisOneThreedimethylcyclohexane", CAS = "638-04-0", Tc = 591.15, Pc = 2938430, Vc = 0.45, Cc = 0.269, Tb = 393.24, Tm = 197.61, TT = 197.58, TP = 0.562747, MW = 112.213, LVB = 0.147281, AF = 0.2414, SP = 15640, DM = 0, SH = -1209000000.0, IGHF = -1.84765E+08, GEF = 2.98319E+07, AS = 370451, HFMP = 1.08211E+07, HOC = -4.85972E+09, LiqDen = {105, 0.56146, 0.25431, 591.15, 0.28196, 0}, VP = {101, 80.304, -6952.9, -8.6838, 0.000005071, 2}, LiqCp = {16, 91638, 67.51, 9.6813, 0.0069535, -0.0000034278}, HOV = {106, 6.8345E+07, 2.0984, -4.3187, 4.4054, -1.7047}, VapCp = {16, 100690, -836.69, 13.908, -0.00051206, 1.3582E-07}, LiqVis = {101, -19.068, 1358.3, 1.3526, -0.0000038202, 2}, VapVis = {102, 0.0000012434, 0.44274, 472.75, 75.213, 0}, LiqK = {16, -0.04198, -3.8682, -1.5284, -0.00074068, -0.0000011056}, VapK = {102, 0.015195, 0.35206, -46.167, 870770, 0}, Racketparam = 0.269, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2414, ChaoSeadSP = 15640, ChaoSeadLV = 0.147281); +end CisOneThreedimethylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/CisOneThreedimethylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/CisOneThreedimethylcyclopentane.mo new file mode 100644 index 0000000..951876f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/CisOneThreedimethylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model CisOneThreedimethylcyclopentane + extends General_Properties(SN = 269, name = "CisOneThreedimethylcyclopentane", CAS = "2532-58-3", Tc = 551, Pc = 3400000, Vc = 0.3633, Cc = 0.277, Tb = 364.71, Tm = 139.45, TT = 139.45, TP = 0.000172698, MW = 98.188, LVB = 0.13191, AF = 0.276, SP = 15490, DM = 0, SH = -1209000000.0, IGHF = -1.3585E+08, GEF = 3.9204E+07, AS = 366810, HFMP = 7397000, HOC = -4.2771E+09, LiqDen = {105, 0.77224, 0.27858, 551, 0.31293, 0}, VP = {101, 59.262, -5561.3, -5.5932, 0.0000039124, 2}, LiqCp = {16, 65786, -81.345, 11.138, 0.0032931, -0.0000013405}, HOV = {106, 5.964754E+07, 1.992198, -3.906039, 3.442342, -1.064932}, VapCp = {16, 86318, -831.43, 13.758, -0.00059782, 1.8276E-07}, LiqVis = {101, -11.311, 1000.6, 0.063555, -2.0388E-07, 2}, VapVis = {102, 4.8359E-07, 0.57388, 271.6, -5017.7, 0}, LiqK = {16, -0.041732, 3.5995, -1.581, -0.00048911, -0.0000016476}, VapK = {102, 0.0021721, 0.62882, 203.61, 446440, 0}, Racketparam = 0.277, UniquacR = 4.7192, UniquacQ = 3.772, ChaoSeadAF = 0.276, ChaoSeadSP = 15490, ChaoSeadLV = 0.13191); +end CisOneThreedimethylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/CisOneTwodimethylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/CisOneTwodimethylcyclohexane.mo new file mode 100644 index 0000000..891e9b0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/CisOneTwodimethylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model CisOneTwodimethylcyclohexane + extends General_Properties(SN = 275, name = "CisOneTwodimethylcyclohexane", CAS = "2207-01-4", Tc = 606.15, Pc = 2938430, Vc = 0.46, Cc = 0.268, Tb = 402.94, Tm = 223.16, TT = 223.16, TP = 6.41394, MW = 112.213, LVB = 0.141645, AF = 0.2363, SP = 16250, DM = 0, SH = -1209000000.0, IGHF = -1.72172E+08, GEF = 4.12124E+07, AS = 374510, HFMP = 1645150, HOC = -4.87084E+09, LiqDen = {105, 0.52003, 0.24148, 606.15, 0.2655, 0}, VP = {101, 79.675, -7110.6, -8.5422, 0.0000045741, 2}, LiqCp = {16, 111710, 52.625, 9.3729, 0.0077553, -0.0000040932}, HOV = {106, 6.6247E+07, 1.824, -3.744, 3.9502, -1.5633}, VapCp = {16, 99210, -835.35, 13.925, -0.00054754, 1.5043E-07}, LiqVis = {101, -12.312, 1465.3, 0.097955, -4.4792E-07, 2}, VapVis = {102, 8.4568E-07, 0.48702, 397.94, 11.816, 0}, LiqK = {16, -0.013234, -31.366, -1.3892, -0.0016087, -0.0000006162}, VapK = {102, 0.015824, 0.34516, -25.388, 892770, 0}, Racketparam = 0.268, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2363, ChaoSeadSP = 16250, ChaoSeadLV = 0.141645); +end CisOneTwodimethylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/CisOneTwodimethylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/CisOneTwodimethylcyclopentane.mo new file mode 100644 index 0000000..3ba14e6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/CisOneTwodimethylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model CisOneTwodimethylcyclopentane + extends General_Properties(SN = 267, name = "CisOneTwodimethylcyclopentane", CAS = "1192-18-3", Tc = 565.15, Pc = 3445050, Vc = 0.37, Cc = 0.271, Tb = 372.68, Tm = 219.26, TT = 219.26, TP = 24.1041, MW = 98.1861, LVB = 0.127822, AF = 0.2692, SP = 16160, DM = 0, SH = -1209000000.0, IGHF = -1.29453E+08, GEF = 4.58148E+07, AS = 366142, HFMP = 1657280, HOC = -4.28203E+09, LiqDen = {105, 0.72465, 0.26829, 565.15, 0.28378, 0}, VP = {101, 88.755, -6920, -10.09, 0.0000077797, 2}, LiqCp = {16, 91966, 30.661, 9.7483, 0.0064492, -0.0000032985}, HOV = {106, 5.8904E+07, 1.2615, -1.6517, 1.1747, -0.3566}, VapCp = {16, 85421, -827.36, 13.75, -0.00058187, 1.7604E-07}, LiqVis = {101, -30.744, 1578.9, 3.2397, -0.0000069313, 2}, VapVis = {102, 5.0794E-07, 0.561, 243.58, 7280.5, 0}, LiqK = {16, -0.014002, -51.607, -1.1286, -0.0024368, 4.2617E-08}, VapK = {102, 0.011269, 0.40836, 151.71, 760020, 0}, Racketparam = 0.271, UniquacR = 4.7192, UniquacQ = 3.772, ChaoSeadAF = 0.2692, ChaoSeadSP = 16160, ChaoSeadLV = 0.127822); +end CisOneTwodimethylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/CisTwobutene.mo b/Simulator/Simulator/Files/Chemsep_Database/CisTwobutene.mo new file mode 100644 index 0000000..055b488 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/CisTwobutene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model CisTwobutene + extends General_Properties(SN = 79, name = "CisTwobutene", CAS = "590-18-1", Tc = 435.5, Pc = 4210000, Vc = 0.2338, Cc = 0.269, Tb = 276.87, Tm = 134.26, TT = 134.26, TP = 0.272, MW = 56.108, LVB = 0.09101, AF = 0.203, SP = 14720, DM = 1.0E-30, SH = -7400000.0, IGHF = -7400000, GEF = 6.536E+07, AS = 301200, HFMP = 7309400, HOC = -2.5339E+09, LiqDen = {105, 1.1591, 0.27085, 435.5, 0.28116, 0}, VP = {101, 82.92441, -5022.628, -9.652369, 0.0000133961, 2}, LiqCp = {16, 79532, 110.96, 9.7654, -0.0036798, 0.000019578}, HOV = {106, 3.4358E+07, 0.38004, 0, 0, 0}, VapCp = {16, 53149, -719.47, 12.619, -0.000047815, 4.5198E-10}, LiqVis = {101, -17.96838, 892.0637, 1.159883, -2.883463E-06, 2}, VapVis = {102, 4.0697E-08, 0.91942, -12.143, 1343.2, 0}, LiqK = {16, -0.032373, 19.125, -1.716, 0.00030408, -0.0000042934}, VapK = {102, 0.000075196, 1.0578, -53.701, 131760, 0}, Racketparam = 0.2705, UniquacR = 2.9189, UniquacQ = 2.563, ChaoSeadAF = 0.2575, ChaoSeadSP = 13827.58, ChaoSeadLV = 0.0912); +end CisTwobutene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/CisTwohexene.mo b/Simulator/Simulator/Files/Chemsep_Database/CisTwohexene.mo new file mode 100644 index 0000000..5dc4e45 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/CisTwohexene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model CisTwohexene + extends General_Properties(SN = 257, name = "CisTwohexene", CAS = "7688-21-3", Tc = 511.4, Pc = 3160000, Vc = 0.345, Cc = 0.256, Tb = 342.03, Tm = 132, TT = 132.03, TP = 0.000232, MW = 84.1595, LVB = 0.1234, AF = 0.287374, SP = 15360, DM = 1.015E-30, SH = -1209000000.0, IGHF = -4.856E+07, GEF = 8.025E+07, AS = 386500, HFMP = 8857530, HOC = -3.728E+09, LiqDen = {105, 0.77464, 0.2672, 511.4, 0.28571, 0}, VP = {101, 104.3995, -6791.221, -12.84602, 0.0000165576, 2}, LiqCp = {16, 135610, 570.7, 1.6392, 0.033591, -0.000032605}, HOV = {106, 4.9E+07, 1.281, -2.4971, 2.499, -0.86824}, VapCp = {16, 88576, -789.82, 13.286, -0.00034537, 1.0091E-07}, LiqVis = {101, -10.864, 787.8, 0.0025561, -7.6676E-08, 2}, VapVis = {102, 3.6061E-08, 0.91362, -8.4415, 1515.2, 0}, LiqK = {16, -0.038625, 3.4165, -1.4421, -0.00078927, -0.0000017176}, VapK = {102, 0.000053674, 1.0887, -86.934, 155330, 0}, Racketparam = 0.256, UniquacR = 4.2677, UniquacQ = 3.643, ChaoSeadAF = 0.287374, ChaoSeadSP = 15360, ChaoSeadLV = 0.1234); +end CisTwohexene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/CisTwopentene.mo b/Simulator/Simulator/Files/Chemsep_Database/CisTwopentene.mo new file mode 100644 index 0000000..a1a5ed6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/CisTwopentene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model CisTwopentene + extends General_Properties(SN = 109, name = "CisTwopentene", CAS = "627-20-3", Tc = 475, Pc = 3690000, Vc = 0.3021, Cc = 0.273, Tb = 310.07, Tm = 121.75, TT = 121.75, TP = 0.000554, MW = 70.134, LVB = 0.10785, AF = 0.253, SP = 15060, DM = 1.008E-30, SH = -27600000.0, IGHF = -2.63E+07, GEF = 7.37E+07, AS = 346300, HFMP = 7112000, HOC = -3.123E+09, LiqDen = {105, 0.90921, 0.26313, 475, 0.30422, 0}, VP = {101, 87.54937, -5782.462, -10.18969, 0.00001126, 2}, LiqCp = {16, 132080, -10569, 112.64, -0.34846, 0.00041161}, HOV = {106, 3.808893E+07, 0.541071, -0.876512, 1.300916, -0.612383}, VapCp = {16, 68358, -741.07, 12.923, -0.00013529, 3.1324E-08}, LiqVis = {101, -10.01, 644.41, -0.11124, 1.3682E-07, 2}, VapVis = {102, 7.0321E-08, 0.83123, 33.115, -394.35, 0}, LiqK = {16, -0.06994, -6.3331, -1.1883, -0.0013351, -7.8623E-07}, VapK = {102, 0.00017973, 0.95148, 124.65, 170420, 0}, Racketparam = 0, UniquacR = 3.5933, UniquacQ = 3.103, ChaoSeadAF = 0.206, ChaoSeadSP = 14420.78, ChaoSeadLV = 0.1078); +end CisTwopentene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Cisdecahydronaphthalene.mo b/Simulator/Simulator/Files/Chemsep_Database/Cisdecahydronaphthalene.mo new file mode 100644 index 0000000..2b77b89 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Cisdecahydronaphthalene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Cisdecahydronaphthalene + extends General_Properties(SN = 190, name = "Cisdecahydronaphthalene", CAS = "493-01-6", Tc = 702.25, Pc = 3242400, Vc = 0.48, Cc = 0.267, Tb = 468.965, Tm = 230.17, TT = 230.2, TP = 0.157166, MW = 138.253, LVB = 0.154615, AF = 0.294204, SP = 17625.3, DM = 0, SH = -168070000.0, IGHF = -1.6924E+08, GEF = 8.552E+07, AS = 377730, HFMP = 9489000, HOC = -5.89213E+09, LiqDen = {105, 0.5563, 0.26613, 702.25, 0.2872, 0}, VP = {101, 133.51, -10671, -16.446, 0.0000090618, 2}, LiqCp = {16, 22875, 183.22, 9.7191, 0.0080113, -0.0000053261}, HOV = {106, 7.893812E+07, 1.120046, -0.590284, -0.648808, 0.601197}, VapCp = {16, 90923, -788.66, 14.021, -0.00046171, 0.0000001235}, LiqVis = {101, -102.87, 5387.9, 14.086, -0.000014127, 2}, VapVis = {102, 7.2745E-07, 0.51364, 404.18, 49.274, 0}, LiqK = {16, 0.087597, -101, -1.0253, -0.0090174, 0.0000045064}, VapK = {102, 0.0000017593, 1.7742, 317.62, 37605, 0}, Racketparam = 0.264744, UniquacR = 6.289, UniquacQ = 4.776, ChaoSeadAF = 0.294204, ChaoSeadSP = 17625.3, ChaoSeadLV = 0.154615); +end Cisdecahydronaphthalene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Cumene.mo b/Simulator/Simulator/Files/Chemsep_Database/Cumene.mo new file mode 100644 index 0000000..b3e837f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Cumene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Cumene + extends General_Properties(SN = 163, name = "Cumene", CAS = "98-82-8", Tc = 631, Pc = 3209000, Vc = 0.4347, Cc = 0.261, Tb = 425.52, Tm = 177.14, TT = 177.14, TP = 0.000471313, MW = 120.194, LVB = 0.14017, AF = 0.326, SP = 17420, DM = 1.3E-30, SH = -168070000.0, IGHF = 4000000, GEF = 1.379E+08, AS = 386000, HFMP = 7326000, HOC = -4.951E+09, LiqDen = {105, 0.50221, 0.23722, 631.11, 0.26133, 0}, VP = {101, 118.1491, -9251.635, -14.30054, 9.196883E-06, 2}, LiqCp = {16, 41467, -297.98, 13.905, -0.0047724, 0.0000064694}, HOV = {106, 5.766E+07, 0.38939, 0, 0, 0}, VapCp = {16, 86134, -649.19, 13.375, -0.00027067, 7.9617E-08}, LiqVis = {101, -16.711, 1557.8, 0.70915, 0.000002636, 2}, VapVis = {102, 3.9385E-07, 0.59572, 281.33, -806.82, 0}, LiqK = {16, 0.085857, 481.58, -8.587, 0.025021, -0.000042138}, VapK = {102, 1.6743E-07, 1.8369, -449.46, 112760, 0}, Racketparam = 0.2617, UniquacR = 5.2708, UniquacQ = 4.044, ChaoSeadAF = 0.3353, ChaoSeadSP = 17436.2, ChaoSeadLV = 0.139854); +end Cumene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Cumenehydroperoxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Cumenehydroperoxide.mo new file mode 100644 index 0000000..f69fd23 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Cumenehydroperoxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Cumenehydroperoxide + extends General_Properties(SN = 410, name = "Cumenehydroperoxide", CAS = "80-15-9", Tc = 605, Pc = 3340000, Vc = 0.463, Cc = 0.278, Tb = 442.7, Tm = 264.26, TT = 264.26, TP = 0.00236574, MW = 152.19, LVB = 0.145892, AF = 0.995, SP = 21500, DM = 5.95412E-30, SH = -61100000.0, IGHF = -7.84E+07, GEF = 9.6E+07, AS = 455000, HFMP = 0, HOC = -4.8444E+09, LiqDen = {105, 0.6643, 0.27801, 605, 0.28637, 0}, VP = {101, 156.523, -16668.56, -17.98221, 0.0000113017, 2}, LiqCp = {16, 83403, -35.074, 9.3262, 0.010979, -0.00001071}, HOV = {106, 7.2836E+07, 0.18056, -0.22381, -0.21673, 0.35898}, VapCp = {16, 70090, -408.89, 12.927, 0.00036839, -1.5886E-07}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {102, 1.9678E-07, 0.71936, 203.36, -7639, 0}, LiqK = {16, -0.022189, -77.144, -1.2225, -0.0023354, 4.0588E-08}, VapK = {102, 0.00018194, 0.94296, 592.69, 22533, 0}, Racketparam = 0.278, UniquacR = 5.817402, UniquacQ = 4.648, ChaoSeadAF = 0.995, ChaoSeadSP = 21500, ChaoSeadLV = 0.145892); +end Cumenehydroperoxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Cyclobutane.mo b/Simulator/Simulator/Files/Chemsep_Database/Cyclobutane.mo new file mode 100644 index 0000000..f4d76a8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Cyclobutane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Cyclobutane + extends General_Properties(SN = 427, name = "Cyclobutane", CAS = "287-23-0", Tc = 459.93, Pc = 4980000, Vc = 0.21, Cc = 0.273, Tb = 285.66, Tm = 182.48, TT = 182.48, TP = 180.101, MW = 56.1063, LVB = 0.0814243, AF = 0.18474, SP = 16020, DM = 0, SH = 28500000.0, IGHF = 2.85E+07, GEF = 1.122E+08, AS = 265400, HFMP = 1088000, HOC = -2.5678E+09, LiqDen = {105, 1.407691, 0.295395, 459.93, 0.248729, 0}, VP = {101, 60.70694, -4389.85, -6.086364, 7.387074E-06, 2}, LiqCp = {16, -3355.973, 25.71519, 11.14976, -0.0000199586, 4.55626E-06}, HOV = {106, 3.344974E+07, 0.35995, -0.0547115, 0.0583309, -0.0233634}, VapCp = {16, 37380.05, -673.6637, 12.72112, -0.000063263, 1.539025E-09}, LiqVis = {16, 0.0000263799, 486.4199, -9.034853, -0.00420404, 4.708051E-07}, VapVis = {16, 2.344771E-06, -353.1514, -11.15186, 0.000996526, -0.0000002755}, LiqK = {16, 0.0169674, 14.7154, -1.831383, -0.000155026, -0.0000048849}, VapK = {16, 0.00541541, -765.5803, -2.581507, 0.00174448, -3.307726E-07}, Racketparam = 0, UniquacR = 0, UniquacQ = 0, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); +end Cyclobutane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Cyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/Cyclohexane.mo new file mode 100644 index 0000000..8138cbb --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Cyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Cyclohexane + extends General_Properties(SN = 129, name = "Cyclohexane", CAS = "110-82-7", Tc = 553.5, Pc = 4073000, Vc = 0.308, Cc = 0.273, Tb = 353.93, Tm = 279.69, TT = 279.69, TP = 5362.51, MW = 84.161, LVB = 0.10875, AF = 0.211, SP = 16740, DM = 0, SH = -168070000.0, IGHF = -1.233E+08, GEF = 3.191E+07, AS = 297276, HFMP = 2740000, HOC = -3.656E+09, LiqDen = {105, 0.93459, 0.28022, 553.5, 0.29409, 0}, VP = {101, 79.82965, -6246.688, -8.778766, 6.933726E-06, 2}, LiqCp = {16, 116110, 127.67, 6.7654, 0.01311, -0.0000060013}, HOV = {106, 4.4856E+07, 0.35691, 0.26181, -0.47647, 0.25741}, VapCp = {16, 42569, -588.9, 12.962, 0.00028376, -1.4009E-07}, LiqVis = {101, -132.2852, 5905.41, 18.88092, -0.000023942, 2}, VapVis = {102, 6.7726E-08, 0.83665, 36.786, -20.301, 0}, LiqK = {16, 0.073881, -301.5, 0.30119, -0.0068406, -0.0000028646}, VapK = {102, 8.5865E-07, 1.771, 243.16, -9.1779, 0}, Racketparam = 0.2729, UniquacR = 4.0464, UniquacQ = 3.24, ChaoSeadAF = 0.2032, ChaoSeadSP = 16773.1, ChaoSeadLV = 0.1087); +end Cyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Cyclohexanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Cyclohexanol.mo new file mode 100644 index 0000000..3e8fc00 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Cyclohexanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Cyclohexanol + extends General_Properties(SN = 132, name = "Cyclohexanol", CAS = "108-93-0", Tc = 650.1, Pc = 4260000, Vc = 0.322, Cc = 0.254, Tb = 434, Tm = 296.6, TT = 296.6, TP = 76.4997, MW = 100.159, LVB = 0.105751, AF = 0.369047, SP = 23730, DM = 6.2E-30, SH = -168070000.0, IGHF = -2.862E+08, GEF = -1.095E+08, AS = 327700, HFMP = 1783000, HOC = -3.4639E+09, LiqDen = {105, 0.90826, 0.27716, 650.1, 0.30685, 0}, VP = {101, -31.63718, -3989.985, 9.013268, -0.0000126698, 2}, LiqCp = {16, -69485, 774.7, 4.4167, 0.025384, -0.000022994}, HOV = {106, 7.128838E+07, 0.392061, -2.168338, 5.552036, -3.376933}, VapCp = {16, 82477, -807.95, 13.526, -0.00028702, 2.5016E-08}, LiqVis = {101, -437.51, 22529, 63.787, -0.000049001, 2}, VapVis = {102, 8.1528E-08, 0.83387, 90.96, 4936.6, 0}, LiqK = {16, 0.075187, -249.81, -0.16784, -0.0068233, 0.0000026882}, VapK = {102, 0.0030349, 0.6097, 669.35, 478820, 0}, Racketparam = 0.24, UniquacR = 4.27, UniquacQ = 3.51, ChaoSeadAF = 0.514148, ChaoSeadSP = 23672.2, ChaoSeadLV = 0.104294); +end Cyclohexanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Cyclohexanone.mo b/Simulator/Simulator/Files/Chemsep_Database/Cyclohexanone.mo new file mode 100644 index 0000000..4556254 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Cyclohexanone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Cyclohexanone + extends General_Properties(SN = 128, name = "Cyclohexanone", CAS = "108-94-1", Tc = 653, Pc = 4000000, Vc = 0.311, Cc = 0.229, Tb = 428.58, Tm = 242, TT = 242, TP = 6.80118, MW = 98.143, LVB = 0.104111, AF = 0.299006, SP = 20250, DM = 1.03E-29, SH = -168070000.0, IGHF = -2.261E+08, GEF = -9.028E+07, AS = 334260, HFMP = 1190000, HOC = -3.299E+09, LiqDen = {105, 0.8601, 0.26829, 653, 0.29808, 0}, VP = {101, 69.93885, -7280.529, -6.943105, 3.624646E-06, 2}, LiqCp = {16, 17987, -72.539, 10.794, 0.0063056, -0.0000049607}, HOV = {106, 6.763E+07, 1.0666, -1.0647, 0.39633, 0.019258}, VapCp = {16, 63931, -772.15, 13.468, -0.00038098, 7.7306E-08}, LiqVis = {101, -37.877, 3012.8, 3.7501, 0.0000021994, 2}, VapVis = {102, 5.3484E-08, 0.89115, 65.345, -657.26, 0}, LiqK = {16, 0.11507, -853.65, 4.7946, -0.021722, 0.0000091954}, VapK = {102, -1104.9, -0.018396, 479160, -8.1392E+09, 0}, Racketparam = 0.23, UniquacR = 4.07, UniquacQ = 3.11, ChaoSeadAF = 0.445, ChaoSeadSP = 20139.4, ChaoSeadLV = 0.104167); +end Cyclohexanone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Cyclohexene.mo b/Simulator/Simulator/Files/Chemsep_Database/Cyclohexene.mo new file mode 100644 index 0000000..2f61298 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Cyclohexene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Cyclohexene + extends General_Properties(SN = 265, name = "Cyclohexene", CAS = "110-83-8", Tc = 560.42, Pc = 4350000, Vc = 0.291, Cc = 0.272, Tb = 356.12, Tm = 169.67, TT = 169.67, TP = 0.103772, MW = 82.1436, LVB = 0.101877, AF = 0.212302, SP = 17420, DM = 1.83E-30, SH = -1209000000.0, IGHF = -4520000, GEF = 1.077E+08, AS = 310750, HFMP = 3290000, HOC = -3.532E+09, LiqDen = {105, 0.807, 0.25253, 560.42, 0.26738, 0}, VP = {101, 82.052, -6388.7, -9.1035, 0.0000071317, 2}, LiqCp = {16, 97738, 2.3363, 7.7626, 0.013772, -0.000011653}, HOV = {106, 5.794402E+07, 1.587579, -2.225474, 1.109627, 0.041589}, VapCp = {16, 48919, -644.33, 13.16, -0.0002758, 9.0717E-08}, LiqVis = {101, -11.901, 1159.3, 0.11228, -1.9651E-07, 2}, VapVis = {102, 0.0000013322, 0.45371, 444.45, 117.38, 0}, LiqK = {16, 0.11174, 816.81, -14.373, 0.055987, -0.00010104}, VapK = {102, 0.000094336, 1.0783, 568.3, 34471, 0}, Racketparam = 0.272, UniquacR = 3.8143, UniquacQ = 3.027, ChaoSeadAF = 0.212302, ChaoSeadSP = 17420, ChaoSeadLV = 0.101877); +end Cyclohexene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Cyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Cyclopentane.mo new file mode 100644 index 0000000..2c146f6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Cyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Cyclopentane + extends General_Properties(SN = 104, name = "Cyclopentane", CAS = "287-92-3", Tc = 511.6, Pc = 4508000, Vc = 0.26, Cc = 0.276, Tb = 322.38, Tm = 179.311, TT = 179.28, TP = 9.07217, MW = 70.134, LVB = 0.09473, AF = 0.194, SP = 16550, DM = 0, SH = -134990000.0, IGHF = -7.703E+07, GEF = 3.885E+07, AS = 292900, HFMP = 608800, HOC = -3.0709E+09, LiqDen = {105, 0.92461, 0.26305, 511.77, 0.22002, 0}, VP = {101, -74.77148, -401.0576, 15.6271, -0.0000260872, 2}, LiqCp = {16, 84725, 368.5, 3.0559, 0.030633, -0.000031124}, HOV = {106, 4.513618E+07, 1.248318, -2.311302, 2.401073, -0.943348}, VapCp = {16, 39785, -704.2, 13.082, -0.00014913, 2.4491E-08}, LiqVis = {101, -5.1843, 670.87, -0.84082, -7.0656E-07, 2}, VapVis = {102, 2.1433E-07, 0.68815, 135.42, -1597.6, 0}, LiqK = {16, 0.10961, -598.59, 3.5098, -0.016258, -0.0000091635}, VapK = {102, 0.0000098408, 1.4611, 639.53, 7396.1, 0}, Racketparam = 0.2687, UniquacR = 3.3, UniquacQ = 2.47, ChaoSeadAF = 0.2051, ChaoSeadSP = 16589.01, ChaoSeadLV = 0.0947); +end Cyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/DiButylCarbonate.mo b/Simulator/Simulator/Files/Chemsep_Database/DiButylCarbonate.mo new file mode 100644 index 0000000..438b0ae --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/DiButylCarbonate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model DiButylCarbonate + extends General_Properties(SN = 431, name = "DiButylCarbonate", CAS = "542-52-9", Tc = 577.9457, Pc = 2554740, Vc = 0.48029, Cc = 0.255346, Tb = 480.6, Tm = 0, TT = 0, TP = 0, MW = 174.2374, LVB = 0.16285, AF = 0.380499, SP = 14896.02, DM = 0, SH = 28500000.0, IGHF = -3.824176E+07, GEF = 1.508667E+07, AS = 1355409, HFMP = 0, HOC = -5.683778E+09, LiqDen = {0, 0, 0, 0, 0, 0}, VP = {10, 22.02883, 4492.482, -50.81, 0, 0}, LiqCp = {0, 0, 0, 0, 0, 0}, HOV = {0, 0, 0, 0, 0, 0}, VapCp = {0, 0, 0, 0, 0, 0}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {0, 0, 0, 0, 0, 0}, LiqK = {100, 0, 0, 0, 0, 0}, VapK = {0, 0, 0, 0, 0, 0}, Racketparam = 0, UniquacR = 0, UniquacQ = 0, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); +end DiButylCarbonate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/DiEthylCarbonate.mo b/Simulator/Simulator/Files/Chemsep_Database/DiEthylCarbonate.mo new file mode 100644 index 0000000..e9e0b73 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/DiEthylCarbonate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model DiEthylCarbonate + extends General_Properties(SN = 413, name = "DiEthylCarbonate", CAS = "105-58-8", Tc = 577, Pc = 3420000, Vc = 0.35725, Cc = 0.254676, Tb = 399.95, Tm = 230.15, TT = 0, TP = 0, MW = 118.1322, LVB = 0.12721, AF = 0.3544, SP = 18727.86, DM = 0, SH = -61100000.0, IGHF = 4.443408E+07, GEF = -1.919535, AS = 1202641, HFMP = 0, HOC = -3.223334, LiqDen = {0, 0, 0, 0, 0, 0}, VP = {10, 20.45386, 2817.834, -84.304, 0, 0}, LiqCp = {0, 0, 0, 0, 0, 0}, HOV = {106, 2.9807E+07, 0.38, 0, 0, 0}, VapCp = {4, -748.0008, 383.84, -0.1938, 0.0000364, 0}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {0, 0, 0, 0, 0, 0}, LiqK = {16, 0, 0, 0, 0, 0}, VapK = {0, 0, 0, 0, 0, 0}, Racketparam = 0.254676, UniquacR = 4.731, UniquacQ = 4.166, ChaoSeadAF = 0.3544, ChaoSeadSP = 0, ChaoSeadLV = 0.12721); +end DiEthylCarbonate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/DiPhenylCarbonate.mo b/Simulator/Simulator/Files/Chemsep_Database/DiPhenylCarbonate.mo new file mode 100644 index 0000000..5aa598d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/DiPhenylCarbonate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model DiPhenylCarbonate + extends General_Properties(SN = 417, name = "DiPhenylCarbonate", CAS = "102-09-0", Tc = 799.32, Pc = 2796500, Vc = 0.59685, Cc = 0.251145, Tb = 572.99, Tm = 352.15, TT = 0, TP = 0, MW = 214.2202, LVB = 0.18261, AF = 0.55805, SP = 18788.28, DM = 0, SH = -61100000.0, IGHF = 1.832592E+08, GEF = 2.719642E+08, AS = 737371.8, HFMP = 0, HOC = -6.512399E+09, LiqDen = {0, 0, 0, 0, 0, 0}, VP = {10, 23.41177, 6810.358, 0, 0, 0}, LiqCp = {3, -164882.8, 994.6407, -0.464037, 0, 0}, HOV = {106, 7.141145E+07, 0.38, 0, 0, 0}, VapCp = {4, -72586.55, 927.9609, -0.573626, 0.000147143, 0}, LiqVis = {101, -49.44655, 15931.93, 0, 0, 0}, VapVis = {0, 0, 0, 0, 0, 0}, LiqK = {3, 0.101839, 0.000518198, -1.230409E-06, 0, 0}, VapK = {3, -0.0506874, 0.00020251, -1.156856E-07, 0, 0}, Racketparam = 0.251145, UniquacR = 7.6234, UniquacQ = 5.63, ChaoSeadAF = 0.55805, ChaoSeadSP = 0, ChaoSeadLV = 0.18261); +end DiPhenylCarbonate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dichloroacetaldehyde.mo b/Simulator/Simulator/Files/Chemsep_Database/Dichloroacetaldehyde.mo new file mode 100644 index 0000000..f051e70 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dichloroacetaldehyde.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dichloroacetaldehyde + extends General_Properties(SN = 38, name = "Dichloroacetaldehyde", CAS = "79-02-7", Tc = 555, Pc = 4950000, Vc = 0.239, Cc = 0.256, Tb = 362, Tm = 223, TT = 223, TP = 30.4712, MW = 112.943, LVB = 0.0800261, AF = 0.343679, SP = 21090, DM = 7.87E-30, SH = 228200000.0, IGHF = -1.8E+08, GEF = -1.387E+08, AS = 329000, HFMP = 1.4E+07, HOC = -8.11E+08, LiqDen = {105, 1.0695, 0.25535, 555, 0.28663, 0}, VP = {101, 90.61988, -7239.82, -10.19237, 7.278159E-06, 2}, LiqCp = {16, 79819, -93.388, 10.443, 0.0030492, -0.0000015371}, HOV = {106, 5.4311E+07, 0.74287, -0.97767, 1.092, -0.46681}, VapCp = {16, 68025, -873.5, 12.537, -0.00086712, 2.2298E-07}, LiqVis = {101, -19.012, 2548.4, 0.73092, -0.0000016452, 2}, VapVis = {102, 3.0229E-07, 0.67781, 216.84, -7478.9, 0}, LiqK = {16, -0.006509, -45.732, -1.1121, -0.0023494, -2.6574E-07}, VapK = {102, 0.00042346, 0.72759, 609.27, 10645, 0}, Racketparam = 0.260402, UniquacR = 3.058668, UniquacQ = 2.632, ChaoSeadAF = 0.343679, ChaoSeadSP = 21250.9, ChaoSeadLV = 0.0788193); +end Dichloroacetaldehyde; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dichloroacetylchloride.mo b/Simulator/Simulator/Files/Chemsep_Database/Dichloroacetylchloride.mo new file mode 100644 index 0000000..8ac9eac --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dichloroacetylchloride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dichloroacetylchloride + extends General_Properties(SN = 35, name = "Dichloroacetylchloride", CAS = "79-36-7", Tc = 585, Pc = 4610000, Vc = 0.283, Cc = 0.268, Tb = 380.45, Tm = 230, TT = 230, TP = 27.15, MW = 147.388, LVB = 0.0969971, AF = 0.308927, SP = 19510, DM = 5.27E-30, SH = -22970000.0, IGHF = -2.4033E+08, GEF = -1.915E+08, AS = 350000, HFMP = 0, HOC = -6.2647E+08, LiqDen = {105, 0.94766, 0.26857, 585, 0.28586, 0}, VP = {101, 74.72886, -6808.875, -7.735182, 4.475716E-06, 2}, LiqCp = {16, 140380, -122.15, 7.1438, 0.0089927, -3.0698E-07}, HOV = {106, 1.182114E+08, 5.662305, -14.25375, 15.19267, -6.032208}, VapCp = {16, 54272, -346.01, 11.744, -0.00014147, 6.1056E-08}, LiqVis = {101, -11.762, 1691.3, -0.020172, 2.8483E-09, 2}, VapVis = {102, 1.4668E-07, 0.7617, 110.57, -0.0060267, 0}, LiqK = {16, 0.045516, -168.82, -0.6335, -0.0052944, 0.0000014358}, VapK = {102, 0.00049754, 0.6638, 622.43, -0.0085753, 0}, Racketparam = 0, UniquacR = 3.597891, UniquacQ = 3.044, ChaoSeadAF = 0.370509, ChaoSeadSP = 19942.4, ChaoSeadLV = 0.097018); +end Dichloroacetylchloride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dicyclopentadiene.mo b/Simulator/Simulator/Files/Chemsep_Database/Dicyclopentadiene.mo new file mode 100644 index 0000000..3ecf73c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dicyclopentadiene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dicyclopentadiene + extends General_Properties(SN = 170, name = "Dicyclopentadiene", CAS = "77-73-6", Tc = 660, Pc = 3060000, Vc = 0.445, Cc = 0.248, Tb = 443, Tm = 305.15, TT = 305.15, TP = 566.19, MW = 132.202, LVB = 0.134736, AF = 0.288011, SP = 17800, DM = 0, SH = -168070000.0, IGHF = 1.961E+08, GEF = 3.75E+08, AS = 240000, HFMP = 2090000, HOC = -5.535E+09, LiqDen = {105, 0.41899, 0.20539, 660, 0.34053, 0}, VP = {101, 72.31496, -7292.827, -7.388294, 3.746895E-06, 2}, LiqCp = {16, 83937, -392.22, 13.886, -0.0031138, 0.000003368}, HOV = {106, 7.0543E+07, 1.9867, -4.6545, 5.1772, -2.0831}, VapCp = {16, 38735, -535.99, 13.553, -0.00031277, 0.0000001075}, LiqVis = {101, -11.633, 1272.8, 0.067676, -1.2999E-07, 2}, VapVis = {102, 0.0000004337, 0.561, 232.6, -0.00081701, 0}, LiqK = {16, 0.029848, 47.178, -2.5363, 0.0023572, -0.0000058893}, VapK = {102, 0.00025878, 0.8604, 51.14, 244020, 0}, Racketparam = 0, UniquacR = 5.8156, UniquacQ = 4.548, ChaoSeadAF = 0.285111, ChaoSeadSP = 17445.1, ChaoSeadLV = 0.138585); +end Dicyclopentadiene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diethanolamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Diethanolamine.mo new file mode 100644 index 0000000..bce8cf3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diethanolamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diethanolamine + extends General_Properties(SN = 368, name = "Diethanolamine", CAS = "111-42-2", Tc = 736.6, Pc = 4720000, Vc = 0.349, Cc = 0.243, Tb = 542, Tm = 301.15, TT = 301.15, TP = 0.102031, MW = 105.136, LVB = 0.096244, AF = 0.991515, SP = 29260, DM = 2.84E-30, SH = -22600000.0, IGHF = -3.73E+08, GEF = -2.2574E+08, AS = 429000, HFMP = 2.5104E+07, HOC = -2.4439E+09, LiqDen = {105, 0.5251, 0.20924, 736.61, 0.18363, 0}, VP = {10, 23.735, 5441.7, -95.519, 0, 0}, LiqCp = {4, 88234.68, 483.2566, 0.294569, -0.000214761, 0}, HOV = {106, 7.90134E+07, -1.865152, 6.820965, -7.963053, 3.251551}, VapCp = {16, 92216, -624.1, 12.938, -0.00014779, 6.6337E-08}, LiqVis = {101, -0.28702, 6080.5, -3.8708, 0.00001517, 2}, VapVis = {102, 4.7852E-08, 0.89857, 99.058, -7265.2, 0}, LiqK = {16, -0.91328, 16.824, -0.15997, 0.0011516, -0.0000013756}, VapK = {102, -10221, 0.42596, -2.5172E+09, -7.9932E+10, 0}, Racketparam = 0.243, UniquacR = 5.2302, UniquacQ = 4.956, ChaoSeadAF = 0.952882, ChaoSeadSP = 29260, ChaoSeadLV = 0.096244); +end Diethanolamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diethylamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Diethylamine.mo new file mode 100644 index 0000000..5b75c40 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diethylamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diethylamine + extends General_Properties(SN = 100, name = "Diethylamine", CAS = "109-89-7", Tc = 496.6, Pc = 3710000, Vc = 0.301, Cc = 0.27, Tb = 328.6, Tm = 223.35, TT = 223.35, TP = 374.108, MW = 73.138, LVB = 0.10424, AF = 0.303856, SP = 16610, DM = 3.07E-30, SH = -134990000.0, IGHF = -7.142E+07, GEF = 7.308E+07, AS = 352200, HFMP = 1.14E+07, HOC = -2.8003E+09, LiqDen = {105, 0.73036, 0.23814, 496.66, 0.24991, 0}, VP = {101, 64.68388, -5484.939, -6.37255, 4.185124E-06, 2}, LiqCp = {16, 107090, 694.46, 2.8508, 0.027204, -0.000024864}, HOV = {106, 3.911798E+07, 0.292165, -0.28266, 0.355094, 0.0257197}, VapCp = {16, 85298, -793.64, 13.085, -0.00026826, 6.6572E-08}, LiqVis = {101, -21.138, 1492, 1.4401, -0.0000012994, 2}, VapVis = {102, 4.3797E-07, 0.60244, 253.34, -614.36, 0}, LiqK = {16, 0.066644, -97.786, -0.73312, -0.0054502, -7.5663E-08}, VapK = {102, 0.000016939, 1.2488, -114.17, 77881, 0}, Racketparam = 0.27, UniquacR = 3.68, UniquacQ = 3.17, ChaoSeadAF = 0.303733, ChaoSeadSP = 16543.3, ChaoSeadLV = 0.104234); +end Diethylamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diethyldisulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Diethyldisulfide.mo new file mode 100644 index 0000000..86b9e87 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diethyldisulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diethyldisulfide + extends General_Properties(SN = 360, name = "Diethyldisulfide", CAS = "110-81-6", Tc = 642, Pc = 3870000, Vc = 0.358, Cc = 0.26, Tb = 427.15, Tm = 171.65, TT = 171.64, TP = 0.000220562, MW = 122.252, LVB = 0.12376, AF = 0.346925, SP = 18630, DM = 6.54E-30, SH = -22600000.0, IGHF = -7.47E+07, GEF = 2.301E+07, AS = 414000, HFMP = 9406000, HOC = -3.257E+09, LiqDen = {105, 0.77633, 0.27774, 642, 0.3008, 0}, VP = {101, 177.1651, -11358.16, -23.65597, 0.0000232121, 2}, LiqCp = {16, 184820, 1402.4, -9.485, 0.072797, -0.00007939}, HOV = {106, 5.898575E+07, 0.279736, 0.523521, -0.500907, 0.0214669}, VapCp = {16, 100900, -621.21, 12.713, -0.0000050655, -1.705E-08}, LiqVis = {101, -12.559, 1373.4, 0.15118, -3.7692E-07, 2}, VapVis = {102, 6.5143E-08, 0.87157, 110.73, -9132.4, 0}, LiqK = {16, -0.047803, 3.9799, -1.4697, -0.00042308, -0.0000011998}, VapK = {102, 0.00017171, 0.93356, 610.03, 20030, 0}, Racketparam = 0.26, UniquacR = 4.5748, UniquacQ = 3.816, ChaoSeadAF = 0.346925, ChaoSeadSP = 18630, ChaoSeadLV = 0.12376); +end Diethyldisulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diethyleneglycol.mo b/Simulator/Simulator/Files/Chemsep_Database/Diethyleneglycol.mo new file mode 100644 index 0000000..f8e73d7 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diethyleneglycol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diethyleneglycol + extends General_Properties(SN = 99, name = "Diethyleneglycol", CAS = "111-46-6", Tc = 744.6, Pc = 4600000, Vc = 0.312, Cc = 0.232, Tb = 517.95, Tm = 262.7, TT = 262.7, TP = 0.00319709, MW = 106.12, LVB = 0.0952681, AF = 0.622105, SP = 28920, DM = 8.41E-30, SH = -134990000.0, IGHF = -5.464E+08, GEF = -3.84E+08, AS = 440000, HFMP = 1.3481E+07, HOC = -2.155E+09, LiqDen = {105, 0.81894, 0.25823, 744.6, 0.23979, 0}, VP = {101, 46.26595, -10205.15, -2.102723, -7.036466E-06, 2}, LiqCp = {16, 188290, 227.63, 5.7157, 0.020545, -0.000018798}, HOV = {106, 1.0853E+08, -0.00876655, 1.770951, -1.359893, -0.0210292}, VapCp = {16, 82107, -687.16, 13.353, -0.00070647, 2.4155E-07}, LiqVis = {101, -374.29, 18192, 55.132, -0.000049166, 2}, VapVis = {102, 6.4523E-08, 0.8468, 24.322, 7352.9, 0}, LiqK = {16, -0.11579, 8.2246, -1.6466, 0.002673, -0.0000035412}, VapK = {102, 500.16, 1.0276, 7.9617E+09, -7.5258E+11, 0}, Racketparam = 0, UniquacR = 4.9415, UniquacQ = 4.8, ChaoSeadAF = 0.621104, ChaoSeadSP = 27775.2, ChaoSeadLV = 0.0952681); +end Diethyleneglycol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diethylenetriamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Diethylenetriamine.mo new file mode 100644 index 0000000..4932ccf --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diethylenetriamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diethylenetriamine + extends General_Properties(SN = 373, name = "Diethylenetriamine", CAS = "111-40-0", Tc = 676, Pc = 4220000, Vc = 0.426, Cc = 0.257, Tb = 480, Tm = 234, TT = 234.15, TP = 0.0524649, MW = 103.166, LVB = 0.108088, AF = 0.70022, SP = 22210, DM = 0, SH = -22600000.0, IGHF = -5860000, GEF = 2.07293E+08, AS = 444000, HFMP = 1.97E+07, HOC = -3.08E+09, LiqDen = {105, 0.75082, 0.25686, 676, 0.285, 0}, VP = {101, 100.1854, -10608.36, -10.96201, 4.74905E-06, 2}, LiqCp = {16, 42291, -130.86, 11.696, 0.0024243, -0.0000011576}, HOV = {106, 6.200873E+07, -0.521717, 2.922507, -3.785965, 1.591946}, VapCp = {16, 73737, -451.7, 12.705, 0.00030197, -1.0181E-07}, LiqVis = {101, -10.117, 2075.7, -0.40711, 6.9322E-07, 2}, VapVis = {102, 5.7285E-08, 0.85783, 72.519, -3817.5, 0}, LiqK = {16, -0.078667, 1.4114, -1.3167, -0.00041656, -8.7844E-07}, VapK = {102, 0.00017737, 0.94914, 591.08, 27011, 0}, Racketparam = 0.257, UniquacR = 4.6198, UniquacQ = 3.948, ChaoSeadAF = 0.70022, ChaoSeadSP = 22210, ChaoSeadLV = 0.108088); +end Diethylenetriamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diethylethanolamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Diethylethanolamine.mo new file mode 100644 index 0000000..47a47c6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diethylethanolamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diethylethanolamine + extends General_Properties(SN = 425, name = "Diethylethanolamine", CAS = "100-37-8", Tc = 616, Pc = 2650000, Vc = 0.4231, Cc = 0.218914, Tb = 434.15, Tm = 235.15, TT = 253, TP = 4.85244, MW = 117.189, LVB = 0.132864, AF = 0.781757, SP = 19100, DM = 8.11E-30, SH = -61100000.0, IGHF = -2.575E+08, GEF = -3.323E+07, AS = 459800, HFMP = 1.84E+07, HOC = -4.03338E+09, LiqDen = {105, 0.63795, 0.25988, 592, 0.27186, 0}, VP = {101, 442.3122, -22650.03, -64.35227, 0.0000641088, 2}, LiqCp = {4, 28933.37, 738.1104, -0.669126, 0.000593149, 0}, HOV = {106, 6.442525E+07, -0.590881, 4.028331, -5.586056, 2.388691}, VapCp = {16, 91061, -562.7, 13.172, -0.000023606, 6.7111E-09}, LiqVis = {101, -83.307, 6061.8, 10.089, -1.4583E-07, 2}, VapVis = {102, 1.3335E-07, 0.7599, 186.08, -6648.4, 0}, LiqK = {16, -0.0045149, -46.605, -1.1875, -0.0019723, -5.2781E-08}, VapK = {102, 0.00013877, 0.99774, 582.26, 23748, 0}, Racketparam = 0.259, UniquacR = 5.315095, UniquacQ = 4.532, ChaoSeadAF = 0.781757, ChaoSeadSP = 19100, ChaoSeadLV = 0.132864); +end Diethylethanolamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diethylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Diethylether.mo new file mode 100644 index 0000000..100c722 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diethylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diethylether + extends General_Properties(SN = 98, name = "Diethylether", CAS = "60-29-7", Tc = 466.7, Pc = 3640000, Vc = 0.28, Cc = 0.263, Tb = 307.59, Tm = 156.85, TT = 156.85, TP = 0.395447, MW = 74.123, LVB = 0.10475, AF = 0.281, SP = 15420, DM = 3.84E-30, SH = -134990000.0, IGHF = -2.521E+08, GEF = -1.221E+08, AS = 342300, HFMP = 7190000, HOC = -2.5035E+09, LiqDen = {105, 0.97479, 0.27114, 466.7, 0.28433, 0}, VP = {101, 75.39748, -5436.852, -8.193869, 7.812562E-06, 2}, LiqCp = {16, 145290, -2.8208, 5.9722, 0.017041, -0.0000078238}, HOV = {106, 5.331574E+07, 0.876213, 0.475413, -1.944676, 1.061631}, VapCp = {16, 81727, -660.7, 12.61, 0.00016979, -7.4028E-08}, LiqVis = {101, 10.139, -61.707, -3.2168, -9.5022E-09, 2}, VapVis = {102, 0.0000019481, 0.40997, 495.46, 85.073, 0}, LiqK = {16, -0.14221, 30.008, -1.3139, 0.00048013, -0.0000026572}, VapK = {102, -0.0044909, 0.61494, -3258.3, 85.806, 0}, Racketparam = 0, UniquacR = 3.39, UniquacQ = 3.02, ChaoSeadAF = 0.284607, ChaoSeadSP = 15530.3, ChaoSeadLV = 0.104692); +end Diethylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diethylsulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Diethylsulfide.mo new file mode 100644 index 0000000..8705852 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diethylsulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diethylsulfide + extends General_Properties(SN = 359, name = "Diethylsulfide", CAS = "352-93-2", Tc = 557, Pc = 3960000, Vc = 0.318, Cc = 0.269, Tb = 365.25, Tm = 169.22, TT = 169.2, TP = 0.099321, MW = 90.189, LVB = 0.10851, AF = 0.295, SP = 17490, DM = 5.14E-30, SH = -22600000.0, IGHF = -8.347E+07, GEF = 1.778E+07, AS = 368000, HFMP = 1.19035E+07, HOC = -2.9607E+09, LiqDen = {105, 0.71845, 0.24674, 557.16, 0.25292, 0}, VP = {101, 70.99138, -6108.92, -7.37143, 5.835752E-06, 2}, LiqCp = {16, 145900, 1485.7, -9.9348, 0.077005, -0.000088463}, HOV = {106, 4.6317E+07, 0.40563, -0.17525, 0.12561, 0.018959}, VapCp = {16, 84916, -751.54, 12.969, -0.00026179, 6.4336E-08}, LiqVis = {101, -2.9987, 606.92, -1.2077, 8.2651E-07, 2}, VapVis = {102, 6.8477E-08, 0.85168, 55.152, 236.99, 0}, LiqK = {16, -0.07619, 7.9978, -1.3835, -0.00020735, -0.0000016592}, VapK = {102, 0.0017352, 0.67658, 1116.5, 181260, 0}, Racketparam = 0.269, UniquacR = 3.8629, UniquacQ = 3.296, ChaoSeadAF = 0.295, ChaoSeadSP = 17490, ChaoSeadLV = 0.10851); +end Diethylsulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diisobutylketone.mo b/Simulator/Simulator/Files/Chemsep_Database/Diisobutylketone.mo new file mode 100644 index 0000000..a36426d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diisobutylketone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diisobutylketone + extends General_Properties(SN = 316, name = "Diisobutylketone", CAS = "108-83-8", Tc = 620, Pc = 2530000, Vc = 0.522, Cc = 0.253, Tb = 441.4, Tm = 227, TT = 227.17, TP = 0.249815, MW = 142.239, LVB = 0.177418, AF = 0.511608, SP = 16450, DM = 8.87E-30, SH = -1209000000.0, IGHF = -3.576E+08, GEF = -1.13E+08, AS = 509000, HFMP = 0, HOC = -5.31E+09, LiqDen = {105, 0.3783, 0.23231, 620, 0.24664, 0}, VP = {101, 122.1783, -10064.3, -14.70184, 8.652147E-06, 2}, LiqCp = {16, 85834, -102.6, 11.702, 0.0033978, -0.0000021321}, HOV = {106, 4.9161E+07, -1.6509, 5.8937, -6.6307, 2.7354}, VapCp = {16, 118320, -505.35, 13.11, 0.00028036, -1.0389E-07}, LiqVis = {101, -74.692, 4018.6, 9.6018, -0.0000061216, 2}, VapVis = {102, 1.3916E-07, 0.72063, 190.96, -7816.5, 0}, LiqK = {16, -0.12088, 22.25, -1.2974, 0.0000088903, -0.0000012079}, VapK = {102, -380230, 0.02484, 1.3363E+08, -3.9523E+12, 0}, Racketparam = 0.253, UniquacR = 6.6183, UniquacQ = 5.568, ChaoSeadAF = 0.511608, ChaoSeadSP = 16450, ChaoSeadLV = 0.177418); +end Diisobutylketone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diisopropanolamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Diisopropanolamine.mo new file mode 100644 index 0000000..f2654a6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diisopropanolamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diisopropanolamine + extends General_Properties(SN = 426, name = "Diisopropanolamine", CAS = "110-97-4", Tc = 672, Pc = 3600000, Vc = 0.454, Cc = 0.293, Tb = 521.9, Tm = 315, TT = 318.15, TP = 0.217912, MW = 133.189, LVB = 0.134763, AF = 1.38914, SP = 26610, DM = 0, SH = -61100000.0, IGHF = -4.54E+08, GEF = -2.15E+08, AS = 513000, HFMP = 2.636E+07, HOC = -3.82E+09, LiqDen = {105, 0.54022, 0.24621, 672, 0.22052, 0}, VP = {101, 339.329, -25910.98, -45.42461, 0.0000223088, 2}, LiqCp = {4, 119382.9, 778.3072, -0.00245385, -1.190941E-06, -0.0000013464}, HOV = {106, 1.4113E+08, 0.38119, 1.0156, -1.8242, 0.83437}, VapCp = {16, 104010, -559.93, 13.272, -0.00018865, 9.0295E-08}, LiqVis = {101, -158.9768, 13684.82, 19.79212, 0.0000178855, 1.442815}, VapVis = {102, 1.7289E-07, 0.71286, 205.1, -6089.6, 0}, LiqK = {16, -0.070378, -101.18, -0.46641, -0.0021528, 2.0992E-07}, VapK = {102, 0.0002313, 0.90558, 651.81, 18136, 0}, Racketparam = 0.293, UniquacR = 6.5774, UniquacQ = 6.028, ChaoSeadAF = 1.38914, ChaoSeadSP = 26610, ChaoSeadLV = 0.134763); +end Diisopropanolamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diisopropylamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Diisopropylamine.mo new file mode 100644 index 0000000..e52e85c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diisopropylamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diisopropylamine + extends General_Properties(SN = 371, name = "Diisopropylamine", CAS = "108-18-9", Tc = 522.15, Pc = 3200000, Vc = 0.031, Cc = 0.308, Tb = 357.05, Tm = 176.85, TT = 176.85, TP = 0.00447237, MW = 101.19, LVB = 0.141919, AF = 0.388315, SP = 15060, DM = 0, SH = -22600000.0, IGHF = -1.5E+08, GEF = 6.42E+07, AS = 412000, HFMP = 6530000, HOC = -3.99E+09, LiqDen = {105, 0.72754, 0.27918, 522.15, 0.29458, 0}, VP = {101, 237.36, -12403, -33.276, 0.000035165, 2}, LiqCp = {16, 150380, 276.56, 5.7411, 0.021881, -0.000021998}, HOV = {106, 8.537039E+07, -2.459337, 14.73933, -19.70849, 7.844199}, VapCp = {16, 61641, -432.93, 12.839, 0.00037342, -1.4329E-07}, LiqVis = {101, -7.0105, 766.59, -0.57101, -0.0000016173, 2}, VapVis = {102, 5.4462E-07, 0.56686, 334.62, -4787.5, 0}, LiqK = {16, 0.046488, -113.84, -0.63846, -0.0065631, 0.0000029442}, VapK = {102, 0.00048482, 0.81453, 349.64, 151910, 0}, Racketparam = 0.308, UniquacR = 5.0308, UniquacQ = 4.244, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); +end Diisopropylamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diisopropylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Diisopropylether.mo new file mode 100644 index 0000000..ef737a9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diisopropylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diisopropylether + extends General_Properties(SN = 323, name = "Diisopropylether", CAS = "108-20-3", Tc = 500.05, Pc = 2880000, Vc = 0.386, Cc = 0.267, Tb = 341.45, Tm = 187.65, TT = 187.65, TP = 6.8582, MW = 102.175, LVB = 0.141775, AF = 0.338683, SP = 14450, DM = 3.77E-30, SH = -1209000000.0, IGHF = -3.18988E+08, GEF = -1.248E+08, AS = 382000, HFMP = 1.103E+07, HOC = -3.70234E+09, LiqDen = {105, 0.72527, 0.27594, 500.05, 0.29413, 0}, VP = {101, 109.5333, -7120.297, -13.51365, 0.0000143778, 2}, LiqCp = {16, 161880, -2.8879, 7.7638, 0.014551, -0.000013251}, HOV = {106, 5.8041E+07, 2.3385, -5.2086, 5.0367, -1.6926}, VapCp = {16, 69454, -410.18, 12.642, 0.00044085, -1.3595E-07}, LiqVis = {101, -9.064, 932.47, -0.38815, 0.0000010323, 2}, VapVis = {102, 4.0782E-07, 0.58517, 121.4, 19303, 0}, LiqK = {16, 0.067752, -462.02, 2.3997, -0.014453, 0.0000029856}, VapK = {102, 0.00010149, 1.0246, 180.97, 93179, 0}, Racketparam = 0.267, UniquacR = 4.7421, UniquacQ = 4.088, ChaoSeadAF = 0.338683, ChaoSeadSP = 14450, ChaoSeadLV = 0.141775); +end Diisopropylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diisopropylketone.mo b/Simulator/Simulator/Files/Chemsep_Database/Diisopropylketone.mo new file mode 100644 index 0000000..12529c3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diisopropylketone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diisopropylketone + extends General_Properties(SN = 317, name = "Diisopropylketone", CAS = "565-80-0", Tc = 582, Pc = 3380000, Vc = 0.416, Cc = 0.262, Tb = 397.5, Tm = 204, TT = 204.81, TP = 0.820585, MW = 114.185, LVB = 0.142561, AF = 0.404427, SP = 16330, DM = 9.11E-30, SH = -1209000000.0, IGHF = -3.16E+08, GEF = -1.237E+08, AS = 427000, HFMP = 1.118E+07, HOC = -4.095E+09, LiqDen = {105, 0.013793, 0.039842, 582, 0.095675, 0}, VP = {101, 107.12, -8385.7, -12.681, 0.0000089823, 2}, LiqCp = {16, 180230, -51.129, 8.6687, 0.010407, -0.0000076786}, HOV = {106, 8.205456E+07, 3.802881, -9.83224, 10.38407, -3.829124}, VapCp = {16, 60064, -502.12, 13.055, 0.00012498, -3.7343E-08}, LiqVis = {101, -5.6405, 1129.7, -1.0122, 0.0000027665, 2}, VapVis = {102, 1.7015E-07, 0.70572, 193.2, -7481.9, 0}, LiqK = {16, -0.11955, 20.681, -1.3034, 0.0000051067, -0.0000013764}, VapK = {102, -9.5076, -0.0072136, 2380.8, -7.251E+07, 0}, Racketparam = 0.262, UniquacR = 5.0493, UniquacQ = 4.568, ChaoSeadAF = 0.404427, ChaoSeadSP = 16330, ChaoSeadLV = 0.142561); +end Diisopropylketone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dimethylacetylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Dimethylacetylene.mo new file mode 100644 index 0000000..20af9c0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dimethylacetylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dimethylacetylene + extends General_Properties(SN = 74, name = "Dimethylacetylene", CAS = "503-17-3", Tc = 473.2, Pc = 4870000, Vc = 0.221, Cc = 0.274, Tb = 300.13, Tm = 240.91, TT = 240.91, TP = 6121.21, MW = 54.0904, LVB = 0.0788997, AF = 0.238542, SP = 17480, DM = 1.32E-29, SH = 304600000.0, IGHF = 1.457E+08, GEF = 1.849E+08, AS = 283300, HFMP = 9234000, HOC = -2.4189E+09, LiqDen = {105, 1.1717, 0.25895, 473.2, 0.27289, 0}, VP = {101, 66.56107, -4998.053, -6.834282, 6.682052E-06, 2}, LiqCp = {16, 116500, 35.116, 5.8634, 0.0049877, 0.000013087}, HOV = {106, 4761730, -11.5565, 30.6629, -31.89366, 12.67797}, VapCp = {16, 62226, -826.04, 12.513, -0.0002013, 4.9424E-08}, LiqVis = {101, -0.045622, 305.04, -1.6582, -4.749E-08, 2}, VapVis = {102, 0.0000021802, 0.39407, 508.41, 3758, 0}, LiqK = {16, 0.0074431, -154.13, -0.25098, -0.0046292, -7.3662E-08}, VapK = {102, 0.00021497, 0.91998, 214.54, 130500, 0}, Racketparam = 0, UniquacR = 2.8635, UniquacQ = 2.48, ChaoSeadAF = 0.1301, ChaoSeadSP = 17463.7, ChaoSeadLV = 0.0789036); +end Dimethylacetylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dimethylcarbonate.mo b/Simulator/Simulator/Files/Chemsep_Database/Dimethylcarbonate.mo new file mode 100644 index 0000000..a3bd161 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dimethylcarbonate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dimethylcarbonate + extends General_Properties(SN = 412, name = "Dimethylcarbonate", CAS = "616-38-6", Tc = 557, Pc = 4800000, Vc = 0.25163, Cc = 0.261, Tb = 363.24, Tm = 276.15, TT = 273.15, TP = 1825.53, MW = 90.084, LVB = 0.084825, AF = 0.337, SP = 20240, DM = 3.0E-30, SH = -61100000.0, IGHF = -5.701E+08, GEF = -4.524E+08, AS = 321600, HFMP = 1.2E+07, HOC = -1.295E+09, LiqDen = {105, 0.0073625, 0.022214, 557, 0.083013, 0}, VP = {101, 127.2975, -8353.984, -16.14514, 0.0000181933, 2}, LiqCp = {16, 170430, -2560.3, -9.9628, -0.012169, 0.000014736}, HOV = {106, 5.291764E+07, 1.146922, -2.489366, 2.898325, -1.182726}, VapCp = {16, 62577, -594.2, 12.53, -0.000022352, -2.2803E-08}, LiqVis = {101, -235.18, 9633.9, 34.904, -0.000038795, 2}, VapVis = {102, 3.5376E-07, 0.64846, 244.72, -7103.7, 0}, LiqK = {16, 0.011223, -183.44, 0.22279, -0.0056614, 0.0000021056}, VapK = {102, 0.00023689, 0.89541, 568.87, 19356, 0}, Racketparam = 0.261, UniquacR = 3.3822, UniquacQ = 3.086, ChaoSeadAF = 0.337, ChaoSeadSP = 20240, ChaoSeadLV = 0.084825); +end Dimethylcarbonate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dimethyldisulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Dimethyldisulfide.mo new file mode 100644 index 0000000..5873338 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dimethyldisulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dimethyldisulfide + extends General_Properties(SN = 361, name = "Dimethyldisulfide", CAS = "624-92-0", Tc = 606, Pc = 5360000, Vc = 0.252, Cc = 0.264, Tb = 382.9, Tm = 188.44, TT = 188.44, TP = 0.207156, MW = 94.199, LVB = 0.0890926, AF = 0.266353, SP = 20060, DM = 6.57E-30, SH = -22600000.0, IGHF = -2.35978E+07, GEF = 1.53553E+07, AS = 336686, HFMP = 9192000, HOC = -2.04376E+09, LiqDen = {105, 1.0289, 0.26919, 615.01, 0.29771, 0}, VP = {101, 81.238, -6951.5, -8.8055, 0.0000055663, 2}, LiqCp = {16, 143050, -21950, 190.58, -0.51509, 0.00050194}, HOV = {106, 5.473869E+07, 0.511523, 0.456682, -1.152343, 0.579651}, VapCp = {16, 74603, -691.43, 12.21, -0.0000028522, -1.9217E-08}, LiqVis = {101, -11.014, 1197, -0.085106, 2.8649E-07, 2}, VapVis = {102, 7.8221E-08, 0.86272, 109.17, -8364.4, 0}, LiqK = {16, -0.035195, -0.25311, -1.4287, -0.00064815, -0.0000012773}, VapK = {102, 0.00022814, 0.8901, 687.63, 4695.8, 0}, Racketparam = 0.264, UniquacR = 3.226, UniquacQ = 2.736, ChaoSeadAF = 0.205916, ChaoSeadSP = 20060, ChaoSeadLV = 0.0890926); +end Dimethyldisulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dimethylethanolamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Dimethylethanolamine.mo new file mode 100644 index 0000000..ea775a8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dimethylethanolamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dimethylethanolamine + extends General_Properties(SN = 378, name = "Dimethylethanolamine", CAS = "108-01-0", Tc = 571.82, Pc = 4140000, Vc = 0.331, Cc = 0.261, Tb = 404.15, Tm = 214.15, TT = 214.15, TP = 0.0376223, MW = 89.1362, LVB = 0.101094, AF = 0.710963, SP = 22790, DM = 7.37E-30, SH = -22600000.0, IGHF = -2.02E+08, GEF = -3.64E+07, AS = 384000, HFMP = 0, HOC = -2.65E+09, LiqDen = {105, 0.87166, 0.26133, 571.82, 0.28585, 0}, VP = {101, 121.6094, -10451.37, -14.23754, 0.000006927, 2}, LiqCp = {16, 66692, -55.489, 10.897, 0.0047237, -0.0000030382}, HOV = {106, 7.9011E+07, 0.56455, -0.031757, -0.28621, 0.17191}, VapCp = {16, 71203, -582.55, 12.891, -0.000082299, 3.2172E-08}, LiqVis = {101, -15.376, 3350.8, -0.34232, 9.4723E-07, 2}, VapVis = {102, 1.2904E-07, 0.77955, 165.36, -6888.3, 0}, LiqK = {16, -0.083559, -10.945, -0.99458, -0.00097463, -8.1342E-07}, VapK = {102, 0.00023136, 0.92757, 412.5, 95357, 0}, Racketparam = 0.261, UniquacR = 4.4363, UniquacQ = 4.068, ChaoSeadAF = 0.710963, ChaoSeadSP = 22790, ChaoSeadLV = 0.101094); +end Dimethylethanolamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dimethylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Dimethylether.mo new file mode 100644 index 0000000..cb6f983 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dimethylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dimethylether + extends General_Properties(SN = 53, name = "Dimethylether", CAS = "115-10-6", Tc = 400.1, Pc = 5400000, Vc = 0.17, Cc = 0.276, Tb = 248.31, Tm = 131.66, TT = 131.65, TP = 3.04959, MW = 46.069, LVB = 0.06907, AF = 0.191, SP = 15120, DM = 4.34E-30, SH = -184100000.0, IGHF = -1.841E+08, GEF = -1.128E+08, AS = 266700, HFMP = 4937000, HOC = -1.3284E+09, LiqDen = {105, 1.4889, 0.26123, 400.1, 0.27948, 0}, VP = {101, 50.32175, -3631.453, -4.444735, 5.290757E-06, 2}, LiqCp = {16, 97754, 353.35, -1.896, 0.040999, -0.000017816}, HOV = {106, 3.8521E+07, 2.2845, -5.7518, 6.5695, -2.6976}, VapCp = {16, 37573.94, -346.059, 11.12596, 0.00118434, -4.086847E-07}, LiqVis = {101, -10.661, 449.83, 0.0072727, -3.6906E-08, 2}, VapVis = {102, 0.0000027281, 0.3952, 534.12, 2319, 0}, LiqK = {16, -0.15344, -11.847, -0.56462, -0.0022104, 5.6048E-07}, VapK = {102, 0.059968, 0.26671, 1018.3, 1098900, 0}, Racketparam = 0, UniquacR = 2.0461, UniquacQ = 1.936, ChaoSeadAF = 0.2, ChaoSeadSP = 15212.1, ChaoSeadLV = 0.0703107); +end Dimethylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dimethylsulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Dimethylsulfide.mo new file mode 100644 index 0000000..58680cf --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dimethylsulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dimethylsulfide + extends General_Properties(SN = 55, name = "Dimethylsulfide", CAS = "75-18-3", Tc = 503, Pc = 5530000, Vc = 0.201, Cc = 0.266, Tb = 310.48, Tm = 174.88, TT = 174.88, TP = 7.86415, MW = 62.136, LVB = 0.07377, AF = 0.19, SP = 18530, DM = 5.0E-30, SH = -184100000.0, IGHF = -3.724E+07, GEF = 7302000, AS = 285850, HFMP = 7984700, HOC = -1.7443E+09, LiqDen = {105, 1.1867, 0.25844, 503.06, 0.24773, 0}, VP = {101, 14.07567, -3435.088, 1.598135, -0.0000069451, 2}, LiqCp = {16, 112410, -20036, 201.07, -0.63397, 0.0007177}, HOV = {106, 5.490637E+07, 1.721854, -2.161256, 0.932609, -0.0179494}, VapCp = {16, 56893, -682.39, 12.01, 0.00013748, -5.7442E-08}, LiqVis = {101, -15.044, 992.97, 0.60378, 0.0000010306, 2}, VapVis = {102, 4.8631E-07, 0.62748, 355.22, -11800, 0}, LiqK = {16, 0.10006, -155.98, -0.57159, -0.0045066, -0.0000087305}, VapK = {102, 0.00026184, 0.91507, 780.75, -32167, 0}, Racketparam = 0.273888, UniquacR = 2.5141, UniquacQ = 2.216, ChaoSeadAF = 0.189279, ChaoSeadSP = 18513.3, ChaoSeadLV = 0.0730914); +end Dimethylsulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dimethylsulfoxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Dimethylsulfoxide.mo new file mode 100644 index 0000000..ca6534f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dimethylsulfoxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dimethylsulfoxide + extends General_Properties(SN = 204, name = "Dimethylsulfoxide", CAS = "67-68-5", Tc = 729, Pc = 5650000, Vc = 0.227, Cc = 0.212, Tb = 462.15, Tm = 291.67, TT = 291.67, TP = 50.2288, MW = 78.1334, LVB = 0.071277, AF = 0.280551, SP = 26750, DM = 1.32E-29, SH = -1209000000.0, IGHF = -2.092E+08, GEF = -1.157E+08, AS = 306300, HFMP = 1.393E+07, HOC = -1.6054E+09, LiqDen = {105, 1.1064, 0.25156, 729, 0.33043, 0}, VP = {101, 87.24911, -9095.583, -9.246359, 3.215062E-06, 2}, LiqCp = {16, 148920, 274.35, 2.2127, 0.017296, -0.000001184}, HOV = {106, 4.1934E+08, 12.701, -33.974, 36.922, -14.839}, VapCp = {16, 61635, -582.63, 12.205, -0.000053872, 2.2232E-08}, LiqVis = {101, 33.492, 223.29, -7.3227, 0.000014294, 2}, VapVis = {102, 8.6219E-08, 0.83436, 168.37, -97.445, 0}, LiqK = {16, 0.081843, -215.42, 0.15922, -0.0051305, 0.0000011114}, VapK = {102, 0.0006441, 0.77214, 1010.2, 82198, 0}, Racketparam = 0.212, UniquacR = 2.8266, UniquacQ = 2.472, ChaoSeadAF = 0.280551, ChaoSeadSP = 26750, ChaoSeadLV = 0.071277); +end Dimethylsulfoxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dimethylterephthalate.mo b/Simulator/Simulator/Files/Chemsep_Database/Dimethylterephthalate.mo new file mode 100644 index 0000000..bdf0c11 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dimethylterephthalate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dimethylterephthalate + extends General_Properties(SN = 408, name = "Dimethylterephthalate", CAS = "120-61-6", Tc = 772, Pc = 2780000, Vc = 0.529, Cc = 0.229, Tb = 555.15, Tm = 413.8, TT = 413.8, TP = 1257.73, MW = 194.184, LVB = 0.180564, AF = 0.637086, SP = 17710, DM = 7.3E-30, SH = -61100000.0, IGHF = -6.37E+08, GEF = -4.74E+08, AS = 550000, HFMP = 3.09E+07, HOC = -4.4115E+09, LiqDen = {105, 0.50864, 0.26895, 772, 0.26133, 0}, VP = {101, 87.35202, -11061.82, -8.88269, 1.566691E-07, 2}, LiqCp = {16, 306140, 1151.8, 1.8179, 0.019226, -0.0000087371}, HOV = {106, 4.927268E+07, -0.826644, 0.840569, 0.547723, -0.373819}, VapCp = {16, 95546, -944.26, 15.059, -0.0027373, 0.0000012901}, LiqVis = {101, -9.6027, 1845.8, -0.28991, 2.7867E-07, 2}, VapVis = {102, 1.5497E-10, 1.62, -527.6, 101960, 0}, LiqK = {16, -0.015206, -275.63, 0.058569, -0.0035078, 7.3745E-07}, VapK = {102, -21938, 0.32202, -4.3275E+09, -1.5265E+11, 0}, Racketparam = 0.229, UniquacR = 6.6618, UniquacQ = 5.296, ChaoSeadAF = 0.637086, ChaoSeadSP = 17710, ChaoSeadLV = 0.180564); +end Dimethylterephthalate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dinbutylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Dinbutylether.mo new file mode 100644 index 0000000..c3baa0d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dinbutylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dinbutylether + extends General_Properties(SN = 324, name = "Dinbutylether", CAS = "142-96-1", Tc = 580.15, Pc = 2380000, Vc = 0.511, Cc = 0.247, Tb = 415.35, Tm = 177.95, TT = 175.3, TP = 0.000714135, MW = 130.228, LVB = 0.17041, AF = 0.447646, SP = 15830, DM = 3.9E-30, SH = -1209000000.0, IGHF = -3.339E+08, GEF = -8.827E+07, AS = 481200, HFMP = 1.63E+07, HOC = -4.94716E+09, LiqDen = {105, 0.22926, 0.17412, 584.11, 0.21764, 0}, VP = {101, 95.7043, -8294.241, -10.81822, 6.127187E-06, 2}, LiqCp = {16, 198760, 65.432, 9.8123, 0.0039694, 8.4178E-07}, HOV = {106, 6.4859E+07, 0.77992, -0.72383, 0.38094, -0.025388}, VapCp = {16, 152990, -805.71, 13.605, -0.00024656, 5.3497E-08}, LiqVis = {101, 20.743, -83.003, -4.9404, 0.000004096, 2}, VapVis = {102, 0.0000002113, 0.66224, 141.56, 6932, 0}, LiqK = {16, -0.067128, 2.4703, -1.3291, -0.0010011, -2.5742E-07}, VapK = {102, 0.0036064, 0.57918, 1401.9, 287150, 0}, Racketparam = 0.247, UniquacR = 6.0925, UniquacQ = 5.176, ChaoSeadAF = 0.447646, ChaoSeadSP = 15830, ChaoSeadLV = 0.17041); +end Dinbutylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dinpropyldisulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Dinpropyldisulfide.mo new file mode 100644 index 0000000..4ff0e48 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dinpropyldisulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dinpropyldisulfide + extends General_Properties(SN = 362, name = "Dinpropyldisulfide", CAS = "629-19-6", Tc = 727.15, Pc = 3009350, Vc = 0.518, Cc = 0.25, Tb = 466.65, Tm = 187.15, TT = 187.66, TP = 0.000767693, MW = 150.305, LVB = 0.157229, AF = 0.142024, SP = 17950, DM = 6.6E-30, SH = -22600000.0, IGHF = -1.173E+08, GEF = 3.849E+07, AS = 490000, HFMP = 1.381E+07, HOC = -4.53027E+09, LiqDen = {105, 0.0083051, 0.032244, 727.15, 0.12866, 0}, VP = {101, 37.30305, -7362.883, -1.323142, -8.891834E-06, 2}, LiqCp = {16, 195280, 206.99, 8.2539, 0.0083402, -0.0000036311}, HOV = {106, 5.27924E+07, -0.627848, 2.812662, -3.633008, 1.997715}, VapCp = {16, 135200, -728.45, 13.4, -0.00037376, 9.4294E-08}, LiqVis = {101, -9.576, 1437.8, -0.35065, 0.0000011166, 2}, VapVis = {102, 6.2944E-08, 0.86495, 121.54, -9663.6, 0}, LiqK = {16, -0.066065, 4.827, -1.4132, -0.00039942, -9.1868E-07}, VapK = {102, 0.00015595, 0.95139, 651.61, 14665, 0}, Racketparam = 0.25, UniquacR = 5.9236, UniquacQ = 4.896, ChaoSeadAF = 0.436981, ChaoSeadSP = 17950, ChaoSeadLV = 0.157229); +end Dinpropyldisulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Dinpropylsulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Dinpropylsulfide.mo new file mode 100644 index 0000000..6b55393 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Dinpropylsulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Dinpropylsulfide + extends General_Properties(SN = 358, name = "Dinpropylsulfide", CAS = "111-47-7", Tc = 608, Pc = 3080000, Vc = 0.412, Cc = 0.251, Tb = 415.978, Tm = 170.55, TT = 170.44, TP = 0.000440358, MW = 118.24, LVB = 0.141918, AF = 0.374042, SP = 17110, DM = 5.5E-30, SH = -22600000.0, IGHF = -1.254E+08, GEF = 2.15E+07, AS = 447000, HFMP = 1.214E+07, HOC = -4.1801E+09, LiqDen = {105, 0.66296, 0.27313, 608, 0.29224, 0}, VP = {101, 149.6373, -10251.56, -19.3067, 0.0000171365, 2}, LiqCp = {16, 165300, 330.45, 6.4516, 0.01426, -0.000009041}, HOV = {106, 5.7575E+07, 0.38334, 0.098397, -0.17233, 0.065159}, VapCp = {16, 105470, -659.93, 13.199, -0.00015, 2.3041E-08}, LiqVis = {101, -10.285, 1150.9, -0.17064, 6.2281E-07, 2}, VapVis = {102, 7.5739E-08, 0.838, 116.99, -6475.6, 0}, LiqK = {16, -0.078109, 7.1733, -1.4231, -0.000097639, -0.0000015465}, VapK = {102, 0.0086151, 0.48706, 1648.6, 489220, 0}, Racketparam = 0.251, UniquacR = 5.2117, UniquacQ = 4.376, ChaoSeadAF = 0.374042, ChaoSeadSP = 17110, ChaoSeadLV = 0.141918); +end Dinpropylsulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Diphenyldisulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Diphenyldisulfide.mo new file mode 100644 index 0000000..fdf9fe3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Diphenyldisulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Diphenyldisulfide + extends General_Properties(SN = 366, name = "Diphenyldisulfide", CAS = "882-33-7", Tc = 829.8, Pc = 3569000, Vc = 0.584, Cc = 0.302, Tb = 583.15, Tm = 333.5, TT = 333.5, TP = 0.49, MW = 218.338, LVB = 0.2076, AF = 0.569717, SP = 20480, DM = 5.97E-30, SH = -22600000.0, IGHF = 2.628E+08, GEF = 3.518E+08, AS = 489300, HFMP = 1.93E+07, HOC = -6.676E+09, LiqDen = {105, 0.5173, 0.302, 829.8, 0.28571, 0}, VP = {101, 927.5541, -59320.23, -131.1073, 0.000060625, 2}, LiqCp = {100, 267470, 28.884, 0.54728, 0, 0}, HOV = {106, 1.1805E+08, 0.46278, 0.25764, -0.22402, -0.0012437}, VapCp = {16, 50433, -472.23, 13.469, -0.00011605, 2.3877E-08}, LiqVis = {101, -10.832, 1659.3, -0.039017, -1.1543E-07, 2}, VapVis = {102, 5.542E-08, 0.87669, 123.7, -14104, 0}, LiqK = {16, -0.040762, -52.269, -1.2013, -0.001172, -1.6247E-07}, VapK = {102, 0.0000021936, 1.4453, -128.48, 46604, 0}, Racketparam = 0.302, UniquacR = 7.6308, UniquacQ = 5.496, ChaoSeadAF = 0.569717, ChaoSeadSP = 20480, ChaoSeadLV = 0.2076); +end Diphenyldisulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Disecbutylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Disecbutylether.mo new file mode 100644 index 0000000..04f8b57 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Disecbutylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Disecbutylether + extends General_Properties(SN = 325, name = "Disecbutylether", CAS = "6863-58-7", Tc = 562, Pc = 2556000, Vc = 0.487, Cc = 0.269, Tb = 394.2, Tm = 173.15, TT = 173.15, TP = 0.0027863, MW = 130.228, LVB = 0.171577, AF = 0.329, SP = 14950, DM = 0, SH = -1209000000.0, IGHF = -3.609E+08, GEF = -1.157E+08, AS = 501000, HFMP = 0, HOC = -4.9233E+09, LiqDen = {105, 0.038135, 0.072155, 562, 0.11862, 0}, VP = {101, 102.5292, -8146.755, -11.97808, 8.058954E-06, 2}, LiqCp = {16, 102180, -37.551, 10.606, 0.0064949, -0.0000048029}, HOV = {106, 5.5999E+07, 0.34375, 0.18962, -0.14755, -0.0040987}, VapCp = {16, 94528, -497.39, 13.241, 0.000057744, -1.2606E-09}, LiqVis = {101, -10.318, 1230.4, -0.20919, 4.9411E-07, 2}, VapVis = {102, 1.1864E-07, 0.74861, 137.78, -4500.8, 0}, LiqK = {16, 0.027499, 27.604, -2.2754, 0.00032105, -0.0000044406}, VapK = {102, 0.00016749, 0.96101, 656.84, -691.7, 0}, Racketparam = 0.269, UniquacR = 6.0909, UniquacQ = 5.168, ChaoSeadAF = 0.329, ChaoSeadSP = 14950, ChaoSeadLV = 0.171577); +end Disecbutylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ditertbutyldisulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Ditertbutyldisulfide.mo new file mode 100644 index 0000000..229486e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ditertbutyldisulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ditertbutyldisulfide + extends General_Properties(SN = 363, name = "Ditertbutyldisulfide", CAS = "110-06-5", Tc = 689.7, Pc = 3159000, Vc = 0.518, Cc = 0.285, Tb = 473.6, Tm = 268.2, TT = 268.2, TP = 9.12, MW = 178.359, LVB = 0.1947, AF = 0.402005, SP = 15680, DM = 6.2E-30, SH = -22600000.0, IGHF = -1.998E+08, GEF = 3.427E+07, AS = 500100, HFMP = 1.31E+07, HOC = -5.665E+09, LiqDen = {105, 0.60778, 0.31522, 689.7, 0.2884, 0}, VP = {101, 113.63, -10180, -13.332, 0.0000068178, 2}, LiqCp = {16, 273850, -799.3, 13.794, -0.001521, 0.0000014598}, HOV = {106, 5.0039E+07, -1.4285, 5.5884, -6.8503, 3.0089}, VapCp = {16, 171300, -806, 13.98, -0.00069575, 1.6372E-07}, LiqVis = {101, -10.435, 1172.7, 0, 0, 0}, VapVis = {102, 0.0000001005, 0.79652, 148.51, -7648.2, 0}, LiqK = {16, -0.019283, -53.989, -1.1745, -0.0017696, -1.3435E-07}, VapK = {102, 0.00018425, 0.91582, 448.35, 58650, 0}, Racketparam = 0.285, UniquacR = 5.9221, UniquacQ = 4.972, ChaoSeadAF = 0.402005, ChaoSeadSP = 15680, ChaoSeadLV = 0.1947); +end Ditertbutyldisulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethane.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethane.mo new file mode 100644 index 0000000..77ecbc8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethane + extends General_Properties(SN = 51, name = "Ethane", CAS = "74-84-0", Tc = 305.32, Pc = 4872000, Vc = 0.1455, Cc = 0.279, Tb = 184.55, Tm = 90.352, TT = 90.352, TP = 1.13, MW = 30.07, LVB = 0.04615, AF = 0.099, SP = 12400, DM = 0, SH = -83820000.0, IGHF = -8.382E+07, GEF = -3.192E+07, AS = 229120, HFMP = 2859000, HOC = -1.42864E+09, LiqDen = {105, 1.3749, 0.23949, 305.43, 0.22875, 0}, VP = {101, 61.43744, -2814.319, -6.778053, 0.0000210827, 2}, LiqCp = {16, 68726, -1953.6, 31.772, -0.10571, 0.00019673}, HOV = {106, 2.3996E+07, 1.4625, -2.8991, 2.8421, -0.99532}, VapCp = {16, 35666.22, -616.5198, 11.69914, 0.000444525, -1.541942E-07}, LiqVis = {101, -33.92204, 743.404, 4.302492, -0.0000364469, 2}, VapVis = {102, 5.2452E-07, 0.58906, 188.8, -2953.8, 0}, LiqK = {16, -0.073876, -9.6787, -0.67405, -0.003407, -0.0000022023}, VapK = {102, 0.000074549, 1.168, 506.4, -881.74, 0}, Racketparam = 0.2793, UniquacR = 1.8022, UniquacQ = 1.696, ChaoSeadAF = 0.0908, ChaoSeadSP = 12375.2, ChaoSeadLV = 0.0551979); +end Ethane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethanol.mo new file mode 100644 index 0000000..4575553 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethanol + extends General_Properties(SN = 52, name = "Ethanol", CAS = "64-17-5", Tc = 513.92, Pc = 6148000, Vc = 0.167, Cc = 0.24, Tb = 351.8, Tm = 159.05, TT = 159.05, TP = 0.000495642, MW = 46.069, LVB = 0.05868, AF = 0.649, SP = 26140, DM = 5.64E-30, SH = -83820000.0, IGHF = -2.3495E+08, GEF = -1.6785E+08, AS = 280640, HFMP = 4931000, HOC = -1.235E+09, LiqDen = {105, 1.3539, 0.24957, 515.66, 0.22099, 0}, VP = {101, 88.0754, -7652.06, -9.471507, 5.928087E-06, 2}, LiqCp = {16, 76684, 675.72, -0.093875, 0.037153, -0.000031214}, HOV = {106, 6.3899E+07, 1.2782, -2.673, 2.7973, -1.0209}, VapCp = {16, 44530, -660.89, 12.153, 0.000019532, -1.5636E-08}, LiqVis = {101, 8.061, 774.76, -3.0701, -4.3408E-09, 2}, VapVis = {102, 1.2467E-07, 0.7862, 76.034, -2017.3, 0}, LiqK = {16, 0.10247, -120.39, -0.48487, -0.0071706, 0.000003461}, VapK = {102, -0.01001, 0.64925, -7360.5, -255250, 0}, Racketparam = 0, UniquacR = 2.11, UniquacQ = 1.97, ChaoSeadAF = 0.634, ChaoSeadSP = 26133.3, ChaoSeadLV = 0.0586177); +end Ethanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/EthylPhenylCarbonate.mo b/Simulator/Simulator/Files/Chemsep_Database/EthylPhenylCarbonate.mo new file mode 100644 index 0000000..ddce6e5 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/EthylPhenylCarbonate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model EthylPhenylCarbonate + extends General_Properties(SN = 416, name = "EthylPhenylCarbonate", CAS = "3878-46-4", Tc = 729.29, Pc = 2529800, Vc = 0.55209, Cc = 0.230336, Tb = 522.67, Tm = 0, TT = 0, TP = 0, MW = 166.1762, LVB = 0.18105, AF = 0.54406, SP = 18670.52, DM = 0, SH = -61100000.0, IGHF = 1.138466E+08, GEF = 1.263844E+08, AS = 970006.4, HFMP = 0, HOC = -4.867867, LiqDen = {0, 0, 0, 0, 0, 0}, VP = {10, 22.88975, 5939.5, 0, 0, 0}, LiqCp = {0, 0, 0, 0, 0, 0}, HOV = {106, 5.2005E+07, 0.38, 0, 0, 0}, VapCp = {4, -38289, 684.92, -0.4426, 0.0001095, 0}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {0, 0, 0, 0, 0, 0}, LiqK = {16, 0, 0, 0, 0, 0}, VapK = {0, 0, 0, 0, 0, 0}, Racketparam = 0.230336, UniquacR = 6.1772, UniquacQ = 4.898, ChaoSeadAF = 0.54406, ChaoSeadSP = 0, ChaoSeadLV = 0.18105); +end EthylPhenylCarbonate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylacetate.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylacetate.mo new file mode 100644 index 0000000..9bf3872 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylacetate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylacetate + extends General_Properties(SN = 87, name = "Ethylacetate", CAS = "141-78-6", Tc = 523.2, Pc = 3830000, Vc = 0.286, Cc = 0.252, Tb = 350.21, Tm = 189.6, TT = 189.6, TP = 1.43179, MW = 88.106, LVB = 0.09855, AF = 0.361, SP = 18350, DM = 5.94E-30, SH = -17100000.0, IGHF = -4.445E+08, GEF = -3.28E+08, AS = 359700, HFMP = 1.048E+07, HOC = -2.061E+09, LiqDen = {105, 0.78926, 0.24295, 523.26, 0.25762, 0}, VP = {101, 93.16862, -7073.291, -10.65983, 8.16528E-06, 2}, LiqCp = {16, 129430, 961.92, -0.12694, 0.034745, -0.000031346}, HOV = {106, 4.9527E+07, 0.37029, 0.072685, -0.077493, 0.017381}, VapCp = {16, 97183, -1121.4, 13.827, -0.0012343, 3.6158E-07}, LiqVis = {101, 16.428, -219.29, -4.124, 6.0568E-07, 2}, VapVis = {102, 0.0000034514, 0.35236, 732.29, -3982.4, 0}, LiqK = {16, 0.040771, -127.25, -0.26995, -0.0055753, 9.9363E-07}, VapK = {102, 2.3264E-07, 1.902, 102.58, -17015, 0}, Racketparam = 0, UniquacR = 3.48, UniquacQ = 3.12, ChaoSeadAF = 0.362, ChaoSeadSP = 18345.6, ChaoSeadLV = 0.0985939); +end Ethylacetate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylacetylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylacetylene.mo new file mode 100644 index 0000000..041dcc1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylacetylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylacetylene + extends General_Properties(SN = 75, name = "Ethylacetylene", CAS = "107-00-6", Tc = 440, Pc = 4600000, Vc = 0.208, Cc = 0.262, Tb = 281.21, Tm = 147.429, TT = 147.43, TP = 1.17966, MW = 54.092, LVB = 0.08322, AF = 0.245, SP = 15950, DM = 2.7E-30, SH = 165200000.0, IGHF = 1.652E+08, GEF = 2.0225E+08, AS = 290390, HFMP = 6029270, HOC = -2.4647E+09, LiqDen = {105, 1.3447, 0.27928, 440, 0.29778, 0}, VP = {101, 76.044, -5031.59, -8.40406, 9.681824E-06, 2}, LiqCp = {16, 109820, 1148.7, -9.607, 0.084548, -0.00010384}, HOV = {106, 3.604722E+07, 0.546439, -0.26185, 0, 0}, VapCp = {16, 44709, -441.89, 11.889, 0.00039371, -1.2645E-07}, LiqVis = {101, -4.3451, 354.46, -0.92921, -0.0000006027, 2}, VapVis = {102, 0.0000027867, 0.37696, 663.32, 30.832, 0}, LiqK = {16, -0.032845, 13.956, -1.5811, -0.00025138, -0.0000029965}, VapK = {102, 0.000036868, 1.1429, -57.854, 83816, 0}, Racketparam = 0, UniquacR = 2.8675, UniquacQ = 2.476, ChaoSeadAF = 0.246864, ChaoSeadSP = 16554, ChaoSeadLV = 0.0809511); +end Ethylacetylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylamine.mo new file mode 100644 index 0000000..ce1c454 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylamine + extends General_Properties(SN = 57, name = "Ethylamine", CAS = "75-04-7", Tc = 456.4, Pc = 5630000, Vc = 0.1818, Cc = 0.267, Tb = 289.75, Tm = 192.15, TT = 192.15, TP = 151.827, MW = 45.084, LVB = 0.06659, AF = 0.276, SP = 19100, DM = 4.07E-30, SH = -47150000.0, IGHF = -4.715E+07, GEF = 3.616E+07, AS = 284800, HFMP = 9350000, HOC = -1.5874E+09, LiqDen = {105, 1.3663, 0.25297, 456.4, 0.27948, 0}, VP = {101, 115.5255, -6764.221, -14.43912, 0.0000155603, 2}, LiqCp = {16, 129790, -12366, -31.003, 0.53709, -0.00091494}, HOV = {106, 4.2765E+07, 0.58718, -0.33502, 0.17251, -0.0015134}, VapCp = {16, 55762, -832.71, 12.632, -0.00036845, 1.1147E-07}, LiqVis = {101, -41.853, 1619.5, 5.3649, -0.000030563, 2}, VapVis = {102, 5.0871E-07, 0.59417, 255.23, -186.42, 0}, LiqK = {16, 0.17744, 585.82, -11.165, 0.043182, -0.000095024}, VapK = {102, 0.40679, 0.005162, 1280.6, 1721800, 0}, Racketparam = 0, UniquacR = 2.2703, UniquacQ = 2.084, ChaoSeadAF = 0.285061, ChaoSeadSP = 19493.4, ChaoSeadLV = 0.0656335); +end Ethylamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylbenzene.mo new file mode 100644 index 0000000..24ae38f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylbenzene + extends General_Properties(SN = 149, name = "Ethylbenzene", CAS = "100-41-4", Tc = 617.15, Pc = 3609000, Vc = 0.374, Cc = 0.263, Tb = 409.36, Tm = 178.2, TT = 178.2, TP = 0.00390778, MW = 106.167, LVB = 0.12308, AF = 0.304, SP = 17980, DM = 2.0E-30, SH = -168070000.0, IGHF = 2.992E+07, GEF = 1.3073E+08, AS = 360630, HFMP = 9180300, HOC = -4.3448E+09, LiqDen = {105, 0.66155, 0.25394, 617.21, 0.27883, 0}, VP = {101, 137.5088, -9745.069, -17.34457, 0.0000127987, 2}, LiqCp = {16, 131820, -90.983, 10.031, 0.0026504, 0.0000033965}, HOV = {106, 5.990732E+07, 0.380483, 1.094304, -2.185536, 1.1369}, VapCp = {16, 65434, -619.34, 13.166, -0.00016412, 4.1529E-08}, LiqVis = {101, -14.506, 1237.2, 0.52859, -9.1363E-08, 2}, VapVis = {102, 0.0000016833, 0.39831, 366.45, 23750, 0}, LiqK = {16, -0.026087, 13.301, -1.6623, -0.00027844, -0.0000018214}, VapK = {102, 0.000015932, 1.3226, 486.47, 14367, 0}, Racketparam = 0, UniquacR = 4.6, UniquacQ = 3.51, ChaoSeadAF = 0.2936, ChaoSeadSP = 17979.95, ChaoSeadLV = 0.1231); +end Ethylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylchloride.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylchloride.mo new file mode 100644 index 0000000..9a99a54 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylchloride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylchloride + extends General_Properties(SN = 50, name = "Ethylchloride", CAS = "75-00-3", Tc = 460.3, Pc = 5300000, Vc = 0.199, Cc = 0.276, Tb = 285.42, Tm = 136.75, TT = 134.8, TP = 0.1249, MW = 64.514, LVB = 0.07258, AF = 0.194, SP = 17250, DM = 6.84E-30, SH = -112260000.0, IGHF = -1.1226E+08, GEF = -6.0499E+07, AS = 275780, HFMP = 4451800, HOC = -1.2849E+09, LiqDen = {105, 1.3553, 0.26895, 460.36, 0.24994, 0}, VP = {101, 51.28342, -4206.393, -4.478839, 3.812824E-06, 2}, LiqCp = {16, 95946, -7247, 67.469, -0.16696, 0.00017795}, HOV = {106, 3.61548E+07, 0.981924, -2.026046, 2.205811, -0.774155}, VapCp = {16, 12765.96, -117.0948, 11.04141, 0.00111696, -3.565557E-07}, LiqVis = {101, -10.065, 698.32, -0.097691, 8.0018E-08, 2}, VapVis = {102, 3.2572E-07, 0.66869, 165.43, -2726.9, 0}, LiqK = {16, 0.062544, 150.84, -4.3182, 0.012599, -0.000031799}, VapK = {102, -19.83, 0.20145, -728060, -2.7917E+08, 0}, Racketparam = 0, UniquacR = 2.3665, UniquacQ = 2.112, ChaoSeadAF = 0.190636, ChaoSeadSP = 17772.6, ChaoSeadLV = 0.0708426); +end Ethylchloride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylcyclohexane.mo new file mode 100644 index 0000000..9d8df68 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylcyclohexane + extends General_Properties(SN = 153, name = "Ethylcyclohexane", CAS = "1678-91-7", Tc = 609.15, Pc = 3040000, Vc = 0.43, Cc = 0.258, Tb = 404.945, Tm = 161.839, TT = 161.839, TP = 0.000357389, MW = 112.213, LVB = 0.143036, AF = 0.245525, SP = 16340, DM = 0, SH = -168070000.0, IGHF = -1.715E+08, GEF = 3.955E+07, AS = 382600, HFMP = 8334100, HOC = -4.87051E+09, LiqDen = {105, 0.61774, 0.26525, 609.15, 0.28064, 0}, VP = {101, 80.60435, -7221.846, -8.661516, 4.619539E-06, 2}, LiqCp = {16, 106540, 50.724, 9.3758, 0.0085193, -0.0000058679}, HOV = {106, 6.1066E+07, 1.1095, -1.6401, 1.5232, -0.54256}, VapCp = {16, 99579, -799.66, 13.811, -0.00043634, 1.1487E-07}, LiqVis = {101, -22.531, 1686, 1.7093, -0.0000001282, 2}, VapVis = {102, 4.2871E-07, 0.57053, 258.88, -2237.2, 0}, LiqK = {16, -0.040212, 3.9673, -1.6044, -0.00049691, -0.0000012623}, VapK = {102, 0.000062751, 1.1219, 488.85, 45648, 0}, Racketparam = 0, UniquacR = 5.3944, UniquacQ = 4.316, ChaoSeadAF = 0.2426, ChaoSeadSP = 16360, ChaoSeadLV = 0.143117); +end Ethylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylcyclopentane.mo new file mode 100644 index 0000000..2585134 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylcyclopentane + extends General_Properties(SN = 145, name = "Ethylcyclopentane", CAS = "1640-89-7", Tc = 569.5, Pc = 3397000, Vc = 0.375, Cc = 0.269, Tb = 376.59, Tm = 134.71, TT = 134.71, TP = 3.71437E-06, MW = 98.188, LVB = 0.12883, AF = 0.27, SP = 16250, DM = 0, SH = -168070000.0, IGHF = -1.269E+08, GEF = 4.48E+07, AS = 378300, HFMP = 6869700, HOC = -4.2839E+09, LiqDen = {105, 0.72259, 0.26996, 569.5, 0.2784, 0}, VP = {101, 95.769, -7366.4, -11.099, 0.0000081014, 2}, LiqCp = {16, 128880, 403.43, 3.1567, 0.031507, -0.000033176}, HOV = {106, 5.78221E+07, 0.856257, -0.338119, -0.391894, 0.299953}, VapCp = {16, 61352, -623.48, 13.275, -0.000068613, 9.3089E-09}, LiqVis = {101, -3.6105, 709.69, -1.12, 8.8328E-07, 2}, VapVis = {102, 0.0000021783, 0.38064, 577.64, 269.9, 0}, LiqK = {16, -0.019932, 6.51, -1.7114, -0.0004148, -0.0000019629}, VapK = {102, 0.0047981, 0.52948, 335.74, 590020, 0}, Racketparam = 0, UniquacR = 4.72, UniquacQ = 3.776, ChaoSeadAF = 0.271548, ChaoSeadSP = 16339.4, ChaoSeadLV = 0.128749); +end Ethylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylene.mo new file mode 100644 index 0000000..d77c16d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylene + extends General_Properties(SN = 43, name = "Ethylene", CAS = "74-85-1", Tc = 282.34, Pc = 5041000, Vc = 0.1311, Cc = 0.282, Tb = 169.42, Tm = 104, TT = 104, TP = 125.988, MW = 28.054, LVB = 0.05107, AF = 0.087, SP = 12440, DM = 0, SH = 52510000.0, IGHF = 5.251E+07, GEF = 6.844E+07, AS = 219200, HFMP = 3351000, HOC = -1.323E+09, LiqDen = {105, 2.3782, 0.29542, 282.36, 0.32456, 0}, VP = {101, 54.53229, -2458.42, -5.660037, 0.0000194185, 2}, LiqCp = {16, 68016, -22414, 286.75, -1.1802, 0.0017304}, HOV = {106, 2.1658E+07, 1.2164, -2.1538, 2.0768, -0.73096}, VapCp = {16, 33071.93, -860.0281, 12.22807, -0.000509703, 1.628387E-07}, LiqVis = {101, -8.9556, 288.21, -0.21985, -0.000010831, 2}, VapVis = {102, 0.0000021134, 0.41436, 359.51, -2291.7, 0}, LiqK = {16, -0.19499, -11.178, -0.31182, -0.0034844, 3.5873E-07}, VapK = {102, 0.0000093247, 1.4607, 410.48, -44405, 0}, Racketparam = 0.281, UniquacR = 1.57, UniquacQ = 1.49, ChaoSeadAF = 0.0949, ChaoSeadSP = 12436.64, ChaoSeadLV = 0.061); +end Ethylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylenecarbonate.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylenecarbonate.mo new file mode 100644 index 0000000..29f5d27 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylenecarbonate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylenecarbonate + extends General_Properties(SN = 418, name = "Ethylenecarbonate", CAS = "96-49-1", Tc = 806, Pc = 6770000, Vc = 0.193, Cc = 0.195, Tb = 521.15, Tm = 309.15, TT = 309.55, TP = 8.01004, MW = 88.0621, LVB = 0.0664942, AF = 0.442272, SP = 29660, DM = 1.5E-29, SH = -61100000.0, IGHF = -5.069E+08, GEF = -4.1E+08, AS = 260000, HFMP = 1.0E+07, HOC = -1.083E+09, LiqDen = {105, 1.5442, 0.2959, 806, 0.28857, 0}, VP = {101, 132.44, -12293, -15.875, 0.0000073572, 2}, LiqCp = {16, -57259, -17.021, 11.366, 0.0033817, -0.0000020646}, HOV = {106, 8.7297E+07, -0.075043, 3.7018, -6.1954, 2.9631}, VapCp = {16, 50075, -516.61, 12.288, 0.000013893, -2.689E-08}, LiqVis = {101, -8.7402, 1424.5, -0.45708, 0.0000005934, 2}, VapVis = {102, 8.5517E-08, 0.85448, 116.16, -3914.9, 0}, LiqK = {16, 0.00091342, -110.82, -0.51748, -0.0023793, 3.9376E-07}, VapK = {102, 0.030823, 0.34958, 3003.2, 830800, 0}, Racketparam = 0.195, UniquacR = 2.9288, UniquacQ = 2.47, ChaoSeadAF = 0.442272, ChaoSeadSP = 29660, ChaoSeadLV = 0.0664942); +end Ethylenecarbonate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylenediamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylenediamine.mo new file mode 100644 index 0000000..1c3cbf5 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylenediamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylenediamine + extends General_Properties(SN = 370, name = "Ethylenediamine", CAS = "107-15-3", Tc = 592.95, Pc = 6290000, Vc = 0.206, Cc = 0.337, Tb = 390.15, Tm = 281.65, TT = 284.29, TP = 677.511, MW = 60.0983, LVB = 0.0672757, AF = 0.472367, SP = 25200, DM = 6.34E-30, SH = -22600000.0, IGHF = -1.78E+07, GEF = 1.032E+08, AS = 321833, HFMP = 109700, HOC = -1.691E+09, LiqDen = {105, 0.77469, 0.20588, 592.95, 0.20098, 0}, VP = {101, 133.543, -9787.615, -16.57909, 0.0000129717, 2}, LiqCp = {16, 143860, 434.68, 4.2425, 0.021662, -0.000021123}, HOV = {106, 7.5708E+07, 1.0826, -0.65481, -0.27019, 0.25065}, VapCp = {16, 58340, -554.75, 12.205, 0.00022368, -7.8562E-08}, LiqVis = {101, -9.2076, 2247.2, -0.93509, 0.0000071501, 2}, VapVis = {102, 2.0005E-07, 0.70929, 192.67, -6383.4, 0}, LiqK = {16, 0.020715, -158.25, 0.1953, -0.004385, 0.0000010035}, VapK = {102, 0.16528, 0.18013, 3835.1, 1598900, 0}, Racketparam = 0.337, UniquacR = 2.7384, UniquacQ = 2.472, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); +end Ethylenediamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethyleneglycol.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethyleneglycol.mo new file mode 100644 index 0000000..1ffbeb1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethyleneglycol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethyleneglycol + extends General_Properties(SN = 54, name = "Ethyleneglycol", CAS = "107-21-1", Tc = 719, Pc = 8200000, Vc = 0.191, Cc = 0.262, Tb = 470.45, Tm = 260.15, TT = 260.15, TP = 0.21922, MW = 62.0678, LVB = 0.055908, AF = 0.506776, SP = 33840, DM = 8.04E-30, SH = -184100000.0, IGHF = -3.922E+08, GEF = -3.018E+08, AS = 304891, HFMP = 9958000, HOC = -1.0527E+09, LiqDen = {105, 1.3106, 0.25084, 720, 0.21838, 0}, VP = {101, 68.11797, -9617.267, -5.83171, -1.13705E-06, 2}, LiqCp = {16, 86990, -72.326, 9.7466, 0.0065456, -0.0000047}, HOV = {106, 7.414E+07, 0.16807, -0.19694, 1.0417, -0.61488}, VapCp = {16, 52948, -604.61, 12.115, 0.00010607, -4.9352E-08}, LiqVis = {101, -309.38, 14928, 45.49, -0.000044405, 2}, VapVis = {102, 1.2284E-07, 0.79557, 132.87, -5540.3, 0}, LiqK = {16, 0.1684, -313.75, -1.072, -0.000058054, -0.0000032443}, VapK = {102, -8962900, -0.31257, 2.5313E+09, -1.2955E+13, 0}, Racketparam = 0, UniquacR = 2.41, UniquacQ = 2.25, ChaoSeadAF = 0.48683, ChaoSeadSP = 33703.3, ChaoSeadLV = 0.0559089); +end Ethyleneglycol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethyleneoxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethyleneoxide.mo new file mode 100644 index 0000000..bb847b5 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethyleneoxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethyleneoxide + extends General_Properties(SN = 47, name = "Ethyleneoxide", CAS = "75-21-8", Tc = 469.15, Pc = 7190000, Vc = 0.140296, Cc = 0.25876, Tb = 283.6, Tm = 160.65, TT = 160.65, TP = 7.78791, MW = 44.0526, LVB = 0.0508328, AF = 0.197447, SP = 21050, DM = 6.3E-30, SH = -52630000.0, IGHF = -5.263E+07, GEF = -1.323E+07, AS = 242990, HFMP = 5171400, HOC = -1.218E+09, LiqDen = {105, 0.99773, 0.19368, 469.15, 0.19965, 0}, VP = {101, 69.60869, -4890.744, -7.346771, 8.198478E-06, 2}, LiqCp = {16, 81911, -50003, 534.49, -1.8654, 0.00223}, HOV = {106, 5.9285E+07, 3.2175, -7.404, 7.8553, -3.1858}, VapCp = {16, 31884.09, -715.0886, 12.13937, -0.0000867837, -5.187264E-09}, LiqVis = {101, -8.5785, 634.7, -0.32031, -8.1095E-08, 2}, VapVis = {102, 0.0000010777, 0.52994, 452.12, -16957, 0}, LiqK = {16, -0.2748, 8.1093, -0.70065, -0.00041054, -6.2588E-07}, VapK = {102, -0.00032904, 1.1711, -7027.1, 89001, 0}, Racketparam = 0, UniquacR = 1.5927, UniquacQ = 1.32, ChaoSeadAF = 0.202, ChaoSeadSP = 21584, ChaoSeadLV = 0.0497046); +end Ethyleneoxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylformate.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylformate.mo new file mode 100644 index 0000000..bc5ae69 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylformate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylformate + extends General_Properties(SN = 63, name = "Ethylformate", CAS = "109-94-4", Tc = 508.5, Pc = 4740000, Vc = 0.229, Cc = 0.257, Tb = 327.47, Tm = 193.55, TT = 193.55, TP = 18.1186, MW = 74.079, LVB = 0.08093, AF = 0.282, SP = 19070, DM = 6.44E-30, SH = 20230000.0, IGHF = -3.883E+08, GEF = -3.031E+08, AS = 328200, HFMP = 9204800, HOC = -1.50696E+09, LiqDen = {105, 0.85568, 0.22882, 508.5, 0.23792, 0}, VP = {101, 69.04518, -5678.642, -7.031396, 0.0000050057, 2}, LiqCp = {16, 115910, 228.3, 4.0783, 0.027366, -0.000029781}, HOV = {106, 5.9813E+07, 2.1931, -4.6587, 4.7089, -1.7696}, VapCp = {16, 52378, -459.08, 11.875, 0.00065506, -2.4832E-07}, LiqVis = {101, -8.9483, 848.56, -0.31567, 2.8582E-07, 2}, VapVis = {102, 6.0691E-07, 0.60378, 450.04, -20466, 0}, LiqK = {16, -0.030927, 19.999, -1.4911, -0.000052048, -0.0000024111}, VapK = {102, 381.39, 0.9159, 1.8E+09, -1.1462E+10, 0}, Racketparam = 0, UniquacR = 2.8175, UniquacQ = 2.576, ChaoSeadAF = 0.285, ChaoSeadSP = 18938.7, ChaoSeadLV = 0.0808277); +end Ethylformate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylmercaptan.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylmercaptan.mo new file mode 100644 index 0000000..5315046 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylmercaptan.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylmercaptan + extends General_Properties(SN = 56, name = "Ethylmercaptan", CAS = "75-08-1", Tc = 499, Pc = 5490000, Vc = 0.207, Cc = 0.274, Tb = 308.15, Tm = 125.26, TT = 125.26, TP = 0.00113837, MW = 62.136, LVB = 0.07458, AF = 0.189, SP = 18250, DM = 5.27E-30, SH = -184100000.0, IGHF = -4.63E+07, GEF = -4814000, AS = 296100, HFMP = 4975000, HOC = -1.7366E+09, LiqDen = {105, 1.203, 0.25909, 499.16, 0.26567, 0}, VP = {101, 65.4773, -5020.82, -6.678317, 6.449817E-06, 2}, LiqCp = {16, 112430, -35384, 348.44, -1.1065, 0.0012231}, HOV = {106, 4.1777E+07, 0.6898, -0.36317, -0.097723, 0.16958}, VapCp = {16, 39403.72, -328.0582, 11.29594, 0.000950986, -3.249647E-07}, LiqVis = {101, -10.854, 753.55, 0.040849, -7.5884E-07, 2}, VapVis = {102, 0.0000001695, 0.75553, 151.56, -5377.8, 0}, LiqK = {16, -0.021257, 2.7237, -1.42, -0.0008779, -0.0000018277}, VapK = {102, 0.0014607, 0.7033, 1243.2, 53588, 0}, Racketparam = 0, UniquacR = 2.551747, UniquacQ = 2.3, ChaoSeadAF = 0.192074, ChaoSeadSP = 18270.4, ChaoSeadLV = 0.0746133); +end Ethylmercaptan; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylmethyldisulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylmethyldisulfide.mo new file mode 100644 index 0000000..1ce364a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylmethyldisulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylmethyldisulfide + extends General_Properties(SN = 364, name = "Ethylmethyldisulfide", CAS = "20333-39-5", Tc = 628.9, Pc = 4615000, Vc = 0.312, Cc = 0.275, Tb = 407.15, Tm = 183.22, TT = 183.22, TP = 0.0416, MW = 108.226, LVB = 0.1066, AF = 0.301, SP = 18730, DM = 8.25E-30, SH = -22600000.0, IGHF = -4.94E+07, GEF = 1.709E+07, AS = 381100, HFMP = 9210000, HOC = -2.65E+09, LiqDen = {105, 0.88258, 0.27523, 628.9, 0.28571, 0}, VP = {101, 96.027, -8038.4, -10.972, 0.0000070895, 2}, LiqCp = {100, 187520, -208.62, 0.55295, 0, 0}, HOV = {106, 4.8216E+07, 0.48633, -0.6279, 0.476, 0}, VapCp = {16, 84149, -628.71, 12.564, -0.0001652, 8.9754E-08}, LiqVis = {101, -74.45287, 3204.964, 10.10529, -0.0000144504, 2}, VapVis = {102, 7.0201E-08, 0.85571, 90.077, -7385.7, 0}, LiqK = {16, -0.21083, 11.426, -1.0307, 0.00012249, -0.0000010671}, VapK = {102, 0.00027958, 0.86411, 843.3, 7471.1, 0}, Racketparam = 0.275, UniquacR = 3.9004, UniquacQ = 3.276, ChaoSeadAF = 0.301, ChaoSeadSP = 18730, ChaoSeadLV = 0.1066); +end Ethylmethyldisulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethylpropyldisulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethylpropyldisulfide.mo new file mode 100644 index 0000000..74ada5e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethylpropyldisulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethylpropyldisulfide + extends General_Properties(SN = 365, name = "Ethylpropyldisulfide", CAS = "30453-31-7", Tc = 660, Pc = 3612000, Vc = 0.417, Cc = 0.274, Tb = 446.85, Tm = 165, TT = 165, TP = 0.00002, MW = 136.279, LVB = 0.1405, AF = 0.391, SP = 17840, DM = 7.69E-30, SH = -22600000.0, IGHF = -9.625E+07, GEF = 2.796E+07, AS = 460300, HFMP = 1.08E+07, HOC = -3.866E+09, LiqDen = {105, 0.65822, 0.27459, 660, 0.28571, 0}, VP = {101, 110.6, -9574.8, -12.96, 0.0000072115, 2}, LiqCp = {100, 223630, -139.83, 0.57232, 0, 0}, HOV = {106, 5.9782E+07, 0.63427, -0.74757, 0.47275, 0}, VapCp = {16, 105720, -573.79, 12.857, 0.000058344, 8.0803E-09}, LiqVis = {101, -37.87, 2334.8, 4.1564, -0.0000036099, 2}, VapVis = {102, 6.9027E-08, 0.8462, 109.98, -9618.4, 0}, LiqK = {16, -0.20064, 12.059, -1.0757, 0.00011826, -0.000000977}, VapK = {102, 0.00000124, 1.5526, -137.7, 30422, 0}, Racketparam = 0.274, UniquacR = 5.2492, UniquacQ = 4.356, ChaoSeadAF = 0.391, ChaoSeadSP = 17840, ChaoSeadLV = 0.1405); +end Ethylpropyldisulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ethyltertpentylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Ethyltertpentylether.mo new file mode 100644 index 0000000..a9d6ba0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ethyltertpentylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ethyltertpentylether + extends General_Properties(SN = 332, name = "Ethyltertpentylether", CAS = "919-94-8", Tc = 544, Pc = 2740000, Vc = 0.435, Cc = 0.273, Tb = 374.15, Tm = 190, TT = 190, TP = 0.729523, MW = 116.201, LVB = 0.152635, AF = 0.338192, SP = 14970, DM = 5.14E-30, SH = -216400000.0, IGHF = -3.324E+08, GEF = -1.094E+08, AS = 439200, HFMP = 1.2E+07, HOC = -4.32E+09, LiqDen = {105, 0.65888, 0.27797, 544, 0.29227, 0}, VP = {101, 47.12433, -5006.625, -3.892102, 0.0000058438, 2}, LiqCp = {16, -79604, -398.25, 15.392, -0.0067505, 0.0000071337}, HOV = {106, 6.448049E+07, 2.475757, -5.830862, 5.958177, -2.135539}, VapCp = {16, 119820, -647.93, 13.251, -0.00004893, 2.8951E-09}, LiqVis = {101, -11.435, 1134.3, -0.0102, 2.552E-08, 2}, VapVis = {102, 1.2029E-07, 0.7552, 122.76, -2833.2, 0}, LiqK = {16, -0.13805, 13.252, -1.2618, -0.00018101, -0.0000010967}, VapK = {102, 0.00013295, 0.98504, 431.52, 34060, 0}, Racketparam = 0.273, UniquacR = 5.4166, UniquacQ = 4.712, ChaoSeadAF = 0.338192, ChaoSeadSP = 14970, ChaoSeadLV = 0.152635); +end Ethyltertpentylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/FivemethylTwohexanone.mo b/Simulator/Simulator/Files/Chemsep_Database/FivemethylTwohexanone.mo new file mode 100644 index 0000000..5648c1b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/FivemethylTwohexanone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model FivemethylTwohexanone + extends General_Properties(SN = 314, name = "FivemethylTwohexanone", CAS = "110-12-3", Tc = 601, Pc = 2970000, Vc = 0.421, Cc = 0.25, Tb = 417.95, Tm = 199.25, TT = 199.25, TP = 0.0241997, MW = 114.185, LVB = 0.141298, AF = 0.434398, SP = 17740, DM = 0, SH = -1209000000.0, IGHF = -3.04E+08, GEF = -1.22E+08, AS = 446000, HFMP = 0, HOC = -4.1E+09, LiqDen = {105, 0.59436, 0.2568, 601, 0.28571, 0}, VP = {101, 114.12, -9180, -13.613, 0.0000087656, 2}, LiqCp = {16, 125240, 163.14, 9.1111, 0.0074883, -0.0000035144}, HOV = {106, 8.005371E+07, 1.17745, -0.708374, -0.221424, 0.184955}, VapCp = {16, 96832, -530.6, 12.878, 0.00028483, -1.1552E-07}, LiqVis = {101, -15.292, 1388.7, 0.61336, -0.0000015372, 2}, VapVis = {102, 3.5504E-07, 0.6089, 292.03, -90.104, 0}, LiqK = {16, -0.18233, 17.124, -1.0595, -0.000040298, -9.9547E-07}, VapK = {102, 1467.4, 1.0438, 1.713E+10, -1.5385E+11, 0}, Racketparam = 0.25, UniquacR = 5.2703, UniquacQ = 4.492, ChaoSeadAF = 0.434398, ChaoSeadSP = 17740, ChaoSeadLV = 0.141298); +end FivemethylTwohexanone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Fivemethylnonane.mo b/Simulator/Simulator/Files/Chemsep_Database/Fivemethylnonane.mo new file mode 100644 index 0000000..4544ad3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Fivemethylnonane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Fivemethylnonane + extends General_Properties(SN = 256, name = "Fivemethylnonane", CAS = "15869-85-9", Tc = 609.6, Pc = 2140000, Vc = 0.5904, Cc = 0.248, Tb = 438.25, Tm = 186, TT = 185.45, TP = 0.000438465, MW = 142.282, LVB = 0.195298, AF = 0.456177, SP = 15440, DM = 0, SH = -1209000000.0, IGHF = -2.5472E+08, GEF = 3.06E+07, AS = 536500, HFMP = 1.66E+07, HOC = -6.291E+09, LiqDen = {105, 0.41463, 0.2529, 610.01, 0.28051, 0}, VP = {101, 215.6392, -13712.31, -29.15861, 0.0000236309, 2}, LiqCp = {16, 230160, -61.977, 9.1603, 0.0096645, -0.0000061376}, HOV = {106, 6.5588E+07, 0.029762, 1.6061, -2.0417, 0.80324}, VapCp = {16, 131700, -594.98, 13.529, -0.000014234, -5.0987E-09}, LiqVis = {101, -13.838, 1303.8, 0.41828, -8.7942E-07, 2}, VapVis = {102, 5.7631E-07, 0.50736, 283.05, -1279.5, 0}, LiqK = {16, -0.183, 10.49, -1.0698, -0.00021616, -6.8913E-07}, VapK = {102, 0.00003614, 1.1239, -159.13, 172680, 0}, Racketparam = 0.248, UniquacR = 7.196599, UniquacQ = 6.012, ChaoSeadAF = 0.456177, ChaoSeadSP = 15440, ChaoSeadLV = 0.195298); +end Fivemethylnonane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Fluoranthene.mo b/Simulator/Simulator/Files/Chemsep_Database/Fluoranthene.mo new file mode 100644 index 0000000..98d2efc --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Fluoranthene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Fluoranthene + extends General_Properties(SN = 185, name = "Fluoranthene", CAS = "206-44-0", Tc = 905, Pc = 2610000, Vc = 0.655, Cc = 0.227, Tb = 655.95, Tm = 383.33, TT = 383.33, TP = 15.7016, MW = 202.251, LVB = 0.184362, AF = 0.587526, SP = 19290, DM = 7.6E-31, SH = -168070000.0, IGHF = 2.889E+08, GEF = 3.862E+08, AS = 418500, HFMP = 1.873E+07, HOC = -7.695E+09, LiqDen = {105, 0.34656, 0.22699, 905, 0.28508, 0}, VP = {101, 96.11781, -12362.08, -10.3511, 0.0000032319, 2}, LiqCp = {16, 241580, 1296.9, 0.78013, 0.023496, -0.000011773}, HOV = {106, 1.442678E+08, 2.403711, -3.376173, 1.404001, 0.0327511}, VapCp = {16, 59938, -461.32, 13.513, -0.00005781, -5.6701E-09}, LiqVis = {101, -68.502, 5208.9, 8.4007, -0.0000042979, 2}, VapVis = {102, 0.0000010875, 0.41309, 444.51, -25.424, 0}, LiqK = {16, -0.045864, -83.397, -0.96049, -0.0013219, -5.1355E-10}, VapK = {102, 0.00011776, 0.94788, 660.84, 38292, 0}, Racketparam = 0.239005, UniquacR = 7.187871, UniquacQ = 4.504, ChaoSeadAF = 0.5, ChaoSeadSP = 19277.2, ChaoSeadLV = 0.184693); +end Fluoranthene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Fluorene.mo b/Simulator/Simulator/Files/Chemsep_Database/Fluorene.mo new file mode 100644 index 0000000..1a9590b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Fluorene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Fluorene + extends General_Properties(SN = 180, name = "Fluorene", CAS = "86-73-7", Tc = 826, Pc = 3000000, Vc = 0.524, Cc = 0.229, Tb = 570.44, Tm = 387.94, TT = 387.94, TP = 281.665, MW = 166.219, LVB = 0.15327, AF = 0.404163, SP = 19820, DM = 8.3E-31, SH = -168070000.0, IGHF = 1.869E+08, GEF = 2.901E+08, AS = 381500, HFMP = 1.9578E+07, HOC = -6.4251E+09, LiqDen = {105, 0.43683, 0.229, 826, 0.28571, 0}, VP = {101, 141.8746, -13833.84, -17.04805, 0.0000063782, 2}, LiqCp = {16, 172320, 813.11, 3.2969, 0.023275, -0.000018014}, HOV = {106, 9.581E+07, 1.317, -1.4739, -0.0034969, 0.61586}, VapCp = {16, 57825, -560.42, 13.575, -0.00027161, 7.5804E-08}, LiqVis = {101, -33.053, 2454.9, 3.4575, -0.0000042581, 2}, VapVis = {102, 5.7084E-07, 0.56204, 373.69, -49.196, 0}, LiqK = {16, -0.013258, -130.68, -0.68476, -0.0022566, 3.0043E-07}, VapK = {102, 0.00017437, 0.9152, 500.25, 62613, 0}, Racketparam = 0, UniquacR = 6.174687, UniquacQ = 4.076, ChaoSeadAF = 0.349259, ChaoSeadSP = 21645.7, ChaoSeadLV = 0.128237); +end Fluorene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Fluorine.mo b/Simulator/Simulator/Files/Chemsep_Database/Fluorine.mo new file mode 100644 index 0000000..9e1f65e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Fluorine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Fluorine + extends General_Properties(SN = 198, name = "Fluorine", CAS = "7782-41-4", Tc = 144.3, Pc = 5215000, Vc = 0.0662, Cc = 0.288, Tb = 84.95, Tm = 53.53, TT = 53.48, TP = 252, MW = 37.997, LVB = 0.02516, AF = 0.051, SP = 15210, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 202690, HFMP = 510360, HOC = 0, LiqDen = {105, 2.7003, 0.23171, 144.42, 0.21541, 0}, VP = {101, 19.18299, -840.6862, 0.560464, -0.0000352006, 2}, LiqCp = {16, 56031, -8382.1, 267.49, -2.7228, 0.0096889}, HOV = {106, 2.7497E+07, 7.2112, -17.699, 17.895, -6.7781}, VapCp = {16, 29021.05, -721.5995, 10.44015, -0.00105401, 3.331903E-07}, LiqVis = {101, 9.2895, -86.903, -3.7445, 0.0000058477, 2}, VapVis = {102, 7.0875E-07, 0.64956, 73.747, -637.02, 0}, LiqK = {16, -0.15422, 9.0003, -1.0608, -0.0018487, -0.00001682}, VapK = {102, 0.00012664, 0.93229, 1.6645, 205.53, 0}, Racketparam = 0.288, UniquacR = 0.75, UniquacQ = 0.88, ChaoSeadAF = 0.051, ChaoSeadSP = 15210, ChaoSeadLV = 0.02516); +end Fluorine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Formaldehyde.mo b/Simulator/Simulator/Files/Chemsep_Database/Formaldehyde.mo new file mode 100644 index 0000000..f2b4dc9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Formaldehyde.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Formaldehyde + extends General_Properties(SN = 28, name = "Formaldehyde", CAS = "50-00-0", Tc = 408, Pc = 6590000, Vc = 0.115, Cc = 0.223, Tb = 254.05, Tm = 181.15, TT = 181.15, TP = 887, MW = 30.026, LVB = 0.04097, AF = 0.281846, SP = 21190, DM = 7.77E-30, SH = -108600000.0, IGHF = -1.086E+08, GEF = -1.026E+08, AS = 218660, HFMP = 7050000, HOC = -5.268E+08, LiqDen = {105, 1.9413, 0.22308, 408, 0.28569, 0}, VP = {101, 62.07923, -4207.675, -6.202287, 5.521233E-06, 2}, LiqCp = {16, 62716, -69.453, 3.2871, 0.047782, -0.0001008}, HOV = {106, 3.0902E+07, 0.29722, -0.051281, 0.13234, -0.080686}, VapCp = {16, 33216.06, -1212.62, 11.96032, -0.000635943, 1.549232E-07}, LiqVis = {101, -11.303, 753.06, -0.013733, -4.6837E-08, 2}, VapVis = {102, 8.1997E-07, 0.57256, 258.17, -5091, 0}, LiqK = {16, 0.10999, -161.62, 0.83463, -0.01142, 0.0000060772}, VapK = {102, 44.841, -0.71285, -3466.2, 5262100, 0}, Racketparam = 0, UniquacR = 0.9183, UniquacQ = 0.78, ChaoSeadAF = 0.253, ChaoSeadSP = 23824.8, ChaoSeadLV = 0.0369129); +end Formaldehyde; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Fourethylmxylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Fourethylmxylene.mo new file mode 100644 index 0000000..464eb08 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Fourethylmxylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Fourethylmxylene + extends General_Properties(SN = 302, name = "Fourethylmxylene", CAS = "874-41-9", Tc = 665, Pc = 2850000, Vc = 0.456, Cc = 0.251, Tb = 461.59, Tm = 210, TT = 210.27, TP = 0.0181496, MW = 134.218, LVB = 0.153864, AF = 0.409, SP = 17650, DM = 0, SH = -1209000000.0, IGHF = -3.08E+07, GEF = 1.286E+08, AS = 436600, HFMP = 1.293E+07, HOC = -5.544E+09, LiqDen = {105, 0.53184, 0.25635, 665, 0.29535, 0}, VP = {101, 109.6, -9849.7, -12.73, 0.0000063582, 2}, LiqCp = {16, 95699, -84.431, 11.066, 0.0051032, -0.0000041785}, HOV = {106, 6.586476E+07, 0.958711, -1.952194, 2.240006, -0.865941}, VapCp = {16, 90693, -533.27, 13.139, 0.00014143, -6.0863E-08}, LiqVis = {101, -12.665, 1419.5, 0.18354, -0.0000003451, 2}, VapVis = {102, 0.0000037216, 0.29591, 752.65, -7.7443, 0}, LiqK = {16, -0.081171, 5.0587, -1.4195, -0.00031748, -9.1756E-07}, VapK = {102, 0.000083547, 1.0482, 520.64, 45100, 0}, Racketparam = 0.251, UniquacR = 6.0672, UniquacQ = 4.644, ChaoSeadAF = 0.409, ChaoSeadSP = 17650, ChaoSeadLV = 0.153864); +end Fourethylmxylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Fourethyloxylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Fourethyloxylene.mo new file mode 100644 index 0000000..bf59ffc --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Fourethyloxylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Fourethyloxylene + extends General_Properties(SN = 303, name = "Fourethyloxylene", CAS = "934-80-5", Tc = 666, Pc = 2890000, Vc = 0.452, Cc = 0.254, Tb = 462.93, Tm = 206, TT = 206.22, TP = 0.00343448, MW = 134.218, LVB = 0.154172, AF = 0.42, SP = 17990, DM = 0, SH = -1209000000.0, IGHF = -3.209E+07, GEF = 1.274E+08, AS = 436600, HFMP = 1.205E+07, HOC = -5.542E+09, LiqDen = {105, 0.54664, 0.26088, 666, 0.29186, 0}, VP = {101, 96.694, -9142.9, -10.852, 0.0000055519, 2}, LiqCp = {16, 89767, -77.889, 11.113, 0.0049399, -0.0000039958}, HOV = {106, 4.3714E+07, -2.7554, 9.4578, -11.023, 4.6307}, VapCp = {16, 90693, -533.27, 13.139, 0.00014143, -6.0863E-08}, LiqVis = {101, -9.1159, 1410.6, -0.43411, 7.8135E-07, 2}, VapVis = {102, 5.8567E-07, 0.52279, 312.52, -1851, 0}, LiqK = {16, -0.061613, 4.0176, -1.4936, -0.00037218, -9.9721E-07}, VapK = {102, 0.000083697, 1.0475, 520.73, 45665, 0}, Racketparam = 0.254, UniquacR = 6.0672, UniquacQ = 4.644, ChaoSeadAF = 0.42, ChaoSeadSP = 17990, ChaoSeadLV = 0.154172); +end Fourethyloxylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Fourheptanone.mo b/Simulator/Simulator/Files/Chemsep_Database/Fourheptanone.mo new file mode 100644 index 0000000..13597a9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Fourheptanone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Fourheptanone + extends General_Properties(SN = 309, name = "Fourheptanone", CAS = "123-19-3", Tc = 595, Pc = 2920000, Vc = 0.421, Cc = 0.253, Tb = 417.15, Tm = 240.65, TT = 240.65, TP = 7.95766, MW = 114.185, LVB = 0.140625, AF = 0.471409, SP = 17410, DM = 8.34E-30, SH = -1209000000.0, IGHF = -3.01E+08, GEF = -1.196E+08, AS = 448600, HFMP = 1.86E+07, HOC = -4.09E+09, LiqDen = {105, 0.78297, 0.29215, 595, 0.33209, 0}, VP = {101, 121.5579, -9310.284, -14.85267, 0.000010781, 2}, LiqCp = {16, 209750, 222.65, 6.403, 0.014092, -0.0000084677}, HOV = {106, 6.630562E+07, 0.51436, 0.600897, -1.414428, 0.688564}, VapCp = {16, 121670, -659.01, 13.093, 0.000016432, -4.1637E-08}, LiqVis = {101, -29.013, 1989.1, 2.6786, -0.0000019943, 2}, VapVis = {102, 1.5516E-07, 0.71327, 190.48, -6907.5, 0}, LiqK = {16, -0.084176, -5.3333, -1.1753, -0.00094427, -3.0728E-07}, VapK = {102, 2007.9, 1.0403, 2.325E+10, -1.556E+11, 0}, Racketparam = 0.253, UniquacR = 5.2711, UniquacQ = 4.496, ChaoSeadAF = 0.411976, ChaoSeadSP = 17410, ChaoSeadLV = 0.140625); +end Fourheptanone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/FourmethylcisTwopentene.mo b/Simulator/Simulator/Files/Chemsep_Database/FourmethylcisTwopentene.mo new file mode 100644 index 0000000..ba6b521 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/FourmethylcisTwopentene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model FourmethylcisTwopentene + extends General_Properties(SN = 263, name = "FourmethylcisTwopentene", CAS = "691-38-3", Tc = 499, Pc = 3220000, Vc = 0.346, Cc = 0.269, Tb = 329.53, Tm = 138.72, TT = 138.3, TP = 0.00215772, MW = 84.1595, LVB = 0.126648, AF = 0.244178, SP = 14610, DM = 7.18E-31, SH = -1209000000.0, IGHF = -5.03335E+07, GEF = 7.69856E+07, AS = 373338, HFMP = 7363840, HOC = -3.72502E+09, LiqDen = {105, 0.77793, 0.27017, 499, 0.2861, 0}, VP = {101, 83.573, -5993.9, -9.4501, 0.0000085686, 2}, LiqCp = {16, -59803, -16.203, 11.773, 0.0034333, -0.0000037581}, HOV = {106, 5.4227E+07, 1.5628, -2.6171, 2.4298, -0.92758}, VapCp = {16, 101130, -861.95, 13.463, -0.00060529, 2.0212E-07}, LiqVis = {101, -11.752, 820.42, 0.14056, -7.3435E-07, 2}, VapVis = {102, 6.3021E-07, 0.52941, 268.94, 16.597, 0}, LiqK = {16, -0.050868, 4.0553, -1.554, -0.00045968, -0.000001981}, VapK = {102, 0.000052516, 1.0978, -60.883, 128130, 0}, Racketparam = 0.269, UniquacR = 4.2669, UniquacQ = 3.639, ChaoSeadAF = 0.244178, ChaoSeadSP = 14610, ChaoSeadLV = 0.126648); +end FourmethylcisTwopentene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Fourmethylheptane.mo b/Simulator/Simulator/Files/Chemsep_Database/Fourmethylheptane.mo new file mode 100644 index 0000000..6484cd9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Fourmethylheptane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Fourmethylheptane + extends General_Properties(SN = 228, name = "Fourmethylheptane", CAS = "589-53-7", Tc = 561.7, Pc = 2540000, Vc = 0.476, Cc = 0.259, Tb = 390.86, Tm = 152.19, TT = 152.2, TP = 0.0000457034, MW = 114.231, LVB = 0.16306, AF = 0.371, SP = 15140, DM = 0, SH = -1209000000.0, IGHF = -2.1196E+08, GEF = 1.571E+07, AS = 457390, HFMP = 1.08E+07, HOC = -5.07282E+09, LiqDen = {105, 0.41247, 0.23007, 561.76, 0.23229, 0}, VP = {101, 97.33843, -7742.706, -11.25952, 7.843366E-06, 2}, LiqCp = {16, 123600, -18.717, 11.067, 0.0020327, 0.0000016218}, HOV = {106, 6.797167E+07, 1.151616, -0.835173, -0.171743, 0.314726}, VapCp = {16, 100250, -569.74, 13.266, 0.000060406, -2.5661E-08}, LiqVis = {101, -11.11, 1066.3, -0.039384, 1.7455E-07, 2}, VapVis = {102, 0.0000043616, 0.27023, 695.06, -2959.1, 0}, LiqK = {16, -0.096483, 12.321, -1.3603, -0.00031289, -0.0000012186}, VapK = {102, 0.000040274, 1.1204, -164.18, 166050, 0}, Racketparam = 0.259, UniquacR = 5.8478, UniquacQ = 4.932, ChaoSeadAF = 0.371, ChaoSeadSP = 15140, ChaoSeadLV = 0.16306); +end Fourmethylheptane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Fourmethylnonane.mo b/Simulator/Simulator/Files/Chemsep_Database/Fourmethylnonane.mo new file mode 100644 index 0000000..a3f94c7 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Fourmethylnonane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Fourmethylnonane + extends General_Properties(SN = 255, name = "Fourmethylnonane", CAS = "17301-94-9", Tc = 613.7, Pc = 2140000, Vc = 0.5904, Cc = 0.248, Tb = 438.85, Tm = 174.45, TT = 174.45, TP = 0.000108068, MW = 142.282, LVB = 0.195426, AF = 0.465073, SP = 15500, DM = 0, SH = -1209000000.0, IGHF = -2.547E+08, GEF = 2.89E+07, AS = 541900, HFMP = 1.52E+07, HOC = -6.291E+09, LiqDen = {105, 0.046753, 0.085687, 613.7, 0.13909, 0}, VP = {101, 143.6866, -10632.15, -18.17547, 0.0000137486, 2}, LiqCp = {16, 41953, 56.5, 11.484, 0.0029861, -0.0000006055}, HOV = {106, 6.2873E+07, 0.39496, -0.054115, 0.081779, -0.040701}, VapCp = {16, 130820, -589.61, 13.519, -0.0000013811, -1.0182E-08}, LiqVis = {101, -8.7174, 1148.5, -0.42278, 0.000000818, 2}, VapVis = {102, 5.0899E-07, 0.5228, 260.59, -971.93, 0}, LiqK = {16, -0.16198, 12.531, -1.1439, -0.00019006, -7.9079E-07}, VapK = {102, 0.000039332, 1.1131, -152.11, 174490, 0}, Racketparam = 0.248, UniquacR = 7.196599, UniquacQ = 6.012, ChaoSeadAF = 0.465073, ChaoSeadSP = 15500, ChaoSeadLV = 0.195426); +end Fourmethylnonane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Fourmethyloctane.mo b/Simulator/Simulator/Files/Chemsep_Database/Fourmethyloctane.mo new file mode 100644 index 0000000..1cea483 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Fourmethyloctane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Fourmethyloctane + extends General_Properties(SN = 248, name = "Fourmethyloctane", CAS = "2216-34-4", Tc = 587.65, Pc = 2340000, Vc = 0.523, Cc = 0.25, Tb = 415.59, Tm = 159.95, TT = 159.95, TP = 0.0000317697, MW = 128.255, LVB = 0.179037, AF = 0.412925, SP = 15300, DM = 0, SH = -1209000000.0, IGHF = -2.336E+08, GEF = 2.17E+07, AS = 501660, HFMP = 1.6E+07, HOC = -5.68166E+09, LiqDen = {105, 0.51336, 0.26824, 587.65, 0.29075, 0}, VP = {101, 168.4912, -11138.63, -22.13486, 0.0000188399, 2}, LiqCp = {16, 71582, 100.57, 10.612, 0.0050783, -0.0000024905}, HOV = {106, 6.2916E+07, 0.7446, -0.80882, 0.80228, -0.33895}, VapCp = {16, 116790, -588.34, 13.412, 0.000015201, -1.4561E-08}, LiqVis = {101, -11.837, 1162, 0.077237, -2.6336E-07, 2}, VapVis = {102, 3.2706E-07, 0.5848, 183.92, 0.068678, 0}, LiqK = {16, -0.1663, 9.2848, -1.1068, -0.00028405, -0.0000007408}, VapK = {102, 0.000038784, 1.117, -185.06, 177130, 0}, Racketparam = 0.25, UniquacR = 6.5222, UniquacQ = 5.472, ChaoSeadAF = 0.412925, ChaoSeadSP = 15300, ChaoSeadLV = 0.179037); +end Fourmethyloctane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/FourmethyltransTwopentene.mo b/Simulator/Simulator/Files/Chemsep_Database/FourmethyltransTwopentene.mo new file mode 100644 index 0000000..26ae0fa --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/FourmethyltransTwopentene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model FourmethyltransTwopentene + extends General_Properties(SN = 264, name = "FourmethyltransTwopentene", CAS = "674-76-0", Tc = 501, Pc = 3220000, Vc = 0.346, Cc = 0.267, Tb = 331.76, Tm = 132.36, TT = 132.35, TP = 0.000344783, MW = 84.1595, LVB = 0.126739, AF = 0.255237, SP = 14730, DM = 3.63E-31, SH = -1209000000.0, IGHF = -5.43501E+07, GEF = 7.43497E+07, AS = 368390, HFMP = 7154640, HOC = -3.7205E+09, LiqDen = {105, 0.77321, 0.26966, 501, 0.28578, 0}, VP = {101, 81.691, -5972.8, -9.1408, 0.0000081285, 2}, LiqCp = {16, 22279, 6.5061, 10.859, 0.0058182, -0.000006387}, HOV = {106, 5.3985E+07, 1.4966, -2.4784, 2.2857, -0.85991}, VapCp = {16, 95377, -622.83, 12.814, 0.000074545, -3.6318E-08}, LiqVis = {101, -11.038, 805.55, 0.01464, -7.2359E-08, 2}, VapVis = {102, 7.4971E-07, 0.50587, 292.11, 780.77, 0}, LiqK = {16, -0.02241, 4.5423, -1.7038, -0.00048445, -0.0000024834}, VapK = {102, 0.000062348, 1.0772, -17.479, 116240, 0}, Racketparam = 0.267, UniquacR = 4.2669, UniquacQ = 3.639, ChaoSeadAF = 0.255237, ChaoSeadSP = 14730, ChaoSeadLV = 0.126739); +end FourmethyltransTwopentene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Furfural.mo b/Simulator/Simulator/Files/Chemsep_Database/Furfural.mo new file mode 100644 index 0000000..2332f1e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Furfural.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Furfural + extends General_Properties(SN = 101, name = "Furfural", CAS = "98-01-1", Tc = 670.15, Pc = 5660000, Vc = 0.252, Cc = 0.256, Tb = 434.85, Tm = 236.65, TT = 236.65, TP = 1.54565, MW = 96.0841, LVB = 0.0832248, AF = 0.367784, SP = 23610, DM = 1.2E-29, SH = -134990000.0, IGHF = -1.51E+08, GEF = -1.028E+08, AS = 333300, HFMP = 1.44E+07, HOC = -2.2564E+09, LiqDen = {105, 1.0614, 0.26706, 670.15, 0.30028, 0}, VP = {101, 25.656, -5514, -0.19573, -0.0000013402, 2}, LiqCp = {16, 122630, 404.51, 3.0587, 0.029945, -0.000031496}, HOV = {106, 6.3009E+07, 0.4784, 0.066802, -0.59102, 0.42453}, VapCp = {16, 45855, -497.61, 12.549, -0.000033724, -2.8785E-08}, LiqVis = {101, 2.6487, 910.16, -2.1754, 0.0000028413, 2}, VapVis = {102, 5.1928E-08, 0.91224, 70.285, -5476.4, 0}, LiqK = {16, 0.13228, 19058, -182.25, 0.56426, -0.00059782}, VapK = {102, 0.00022183, 0.91119, 617.18, 55137, 0}, Racketparam = 0.258287, UniquacR = 3.168, UniquacQ = 2.484, ChaoSeadAF = 0.383, ChaoSeadSP = 23643.5, ChaoSeadLV = 0.0831649); +end Furfural; diff --git a/Simulator/Simulator/Files/Chemsep_Database/General_Properties.mo b/Simulator/Simulator/Files/Chemsep_Database/General_Properties.mo new file mode 100644 index 0000000..48fc7cd --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/General_Properties.mo @@ -0,0 +1,41 @@ +within Simulator.Files.Chemsep_Database; + +model General_Properties + parameter Integer SN; + parameter String name; + parameter String CAS; + parameter Real Tc; + parameter Real Pc; + parameter Real Vc; + parameter Real Cc; + parameter Real Tb; + parameter Real Tm; + parameter Real TT; + parameter Real TP; + parameter Real MW; + parameter Real LVB; + parameter Real AF; + parameter Real SP; + parameter Real DM; + parameter Real SH; + parameter Real IGHF; + parameter Real GEF; + parameter Real AS; + parameter Real HFMP; + parameter Real HOC; + parameter Real UniquacR; + parameter Real UniquacQ; + parameter Real LiqDen[6]; + parameter Real VP[6]; + parameter Real LiqCp[6]; + parameter Real HOV[6]; + parameter Real VapCp[6]; + parameter Real LiqVis[6]; + parameter Real VapVis[6]; + parameter Real LiqK[6]; + parameter Real VapK[6]; + parameter Real Racketparam; + parameter Real ChaoSeadAF; + parameter Real ChaoSeadSP; + parameter Real ChaoSeadLV; +end General_Properties; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Glycerol.mo b/Simulator/Simulator/Files/Chemsep_Database/Glycerol.mo new file mode 100644 index 0000000..ffc1a41 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Glycerol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Glycerol + extends General_Properties(SN = 429, name = "Glycerol", CAS = "56-81-5", Tc = 725.15, Pc = 6660000, Vc = 0.264, Cc = 0.28, Tb = 563.15, Tm = 291.15, TT = 291.33, TP = 0.00952225, MW = 92.0938, LVB = 0.0732027, AF = 1.544133, SP = 34540, DM = 1.4E-29, SH = 28500000.0, IGHF = -5.828E+08, GEF = -4.471E+08, AS = 396000, HFMP = 1.831E+07, HOC = -1.477E+09, LiqDen = {105, 0.933664, 0.246209, 850, 0.220672, 0}, VP = {101, 99.57469, -13673.87, -10.09699, 1.227718E-11, 2}, LiqCp = {16, 115.6361, -33.33621, 11.80006, 0.00238285, -0.0000010098}, HOV = {106, 1.1E+08, 1, -2.5, 3.4, -1.65}, VapCp = {16, 31366.31, -311.2541, 12.31511, 0.000195602, 1.752076E-09}, LiqVis = {10, -27, -10000, 70, 0, 0}, VapVis = {16, 1.418624E-06, -375.5227, -11.1197, 0.000710923, 4.531819E-08}, LiqK = {16, 0.00821317, -13.47096, -1.285018, 0.000197192, 1.226656E-07}, VapK = {16, -0.00880104, -445.7976, -2.857337, 0.000677005, 8.722756E-08}, Racketparam = 0, UniquacR = 3.385629, UniquacQ = 3.06, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); +end Glycerol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/HeliumFour.mo b/Simulator/Simulator/Files/Chemsep_Database/HeliumFour.mo new file mode 100644 index 0000000..10e0778 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/HeliumFour.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model HeliumFour + extends General_Properties(SN = 197, name = "HeliumFour", CAS = "7440-59-7", Tc = 5.19, Pc = 227000, Vc = 0.0573, Cc = 0.301, Tb = 4.3, Tm = 1.763, TT = 1.763, TP = 1478.21, MW = 4.003, LVB = 0.03254, AF = -0.39, SP = 1222, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 126044, HFMP = 50000, HOC = 0, LiqDen = {105, 0.31844, 0.089499, 5.21, 0.063807, 0}, VP = {101, 8.8804, -4.8932, 2.5648, 0.0062779, 2}, LiqCp = {16, -72432, 14.864, 0.90909, 1.9106, -0.057997}, HOV = {106, 191120, 4.6881, -12.652, 12.947, -4.5859}, VapCp = {1, 20786, 0, 0, 0, 0}, LiqVis = {101, -21.436, 10.949, 5.7389, -0.11646, 2}, VapVis = {102, 3.3098E-07, 0.71183, -10.485, 126.3, 0}, LiqK = {16, -0.19278, -0.8853, -0.83633, -0.19115, 0.016867}, VapK = {102, 0.00226, 0.7305, -18.63, 440, 0}, Racketparam = 0.301, UniquacR = 0.456163, UniquacQ = 0.592, ChaoSeadAF = -0.39, ChaoSeadSP = 1222, ChaoSeadLV = 0.03254); +end HeliumFour; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Heptanal.mo b/Simulator/Simulator/Files/Chemsep_Database/Heptanal.mo new file mode 100644 index 0000000..21d0721 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Heptanal.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Heptanal + extends General_Properties(SN = 322, name = "Heptanal", CAS = "111-71-7", Tc = 603, Pc = 2800000, Vc = 0.421, Cc = 0.267, Tb = 425.95, Tm = 230.15, TT = 229.8, TP = 1.44979, MW = 114.185, LVB = 0.140287, AF = 0.488466, SP = 17780, DM = 8.6E-30, SH = -1209000000.0, IGHF = -2.6401E+08, GEF = -8.653E+07, AS = 461380, HFMP = 2.359E+07, HOC = -4.136E+09, LiqDen = {105, 0.53646, 0.24452, 616.81, 0.26981, 0}, VP = {101, 108.36, -9179.6, -12.655, 0.0000073363, 2}, LiqCp = {16, 200220, 128.23, 7.474, 0.012008, -0.0000080423}, HOV = {106, 6.244116E+07, 0.224744, 0.949788, -1.500319, 0.675167}, VapCp = {16, 131660, -858.87, 13.596, -0.00041213, 8.8955E-08}, LiqVis = {101, 8.4077, 475.87, -3.0758, 0.0000053404, 2}, VapVis = {102, 1.4563E-07, 0.72362, 184.89, -7288.6, 0}, LiqK = {16, 0.02754, -55.074, -1.243, -0.0022084, -0.0000010637}, VapK = {102, 1569.2, 1.0102, 1.4874E+10, 2.7536E+11, 0}, Racketparam = 0.267, UniquacR = 5.2711, UniquacQ = 4.496, ChaoSeadAF = 0.42794, ChaoSeadSP = 17780, ChaoSeadLV = 0.140287); +end Heptanal; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Hexanal.mo b/Simulator/Simulator/Files/Chemsep_Database/Hexanal.mo new file mode 100644 index 0000000..ec5fd68 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Hexanal.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Hexanal + extends General_Properties(SN = 321, name = "Hexanal", CAS = "66-25-1", Tc = 579, Pc = 3110000, Vc = 0.369, Cc = 0.26, Tb = 401.45, Tm = 217.15, TT = 217.15, TP = 1.24729, MW = 100.159, LVB = 0.123708, AF = 0.439121, SP = 18150, DM = 8.6E-30, SH = -1209000000.0, IGHF = -2.4732E+08, GEF = -9.882E+07, AS = 422140, HFMP = 1.89E+07, HOC = -3.52E+09, LiqDen = {105, 1.3196, 0.35571, 579, 0.38551, 0}, VP = {101, 209.3738, -12430.59, -28.59364, 0.0000281667, 2}, LiqCp = {16, 175480, 98.975, 6.7267, 0.013876, -0.0000081365}, HOV = {106, 5.570251E+07, -0.000821879, 0.788181, -0.0470431, -0.460389}, VapCp = {16, 115820, -867.39, 13.422, -0.00036658, 7.4569E-08}, LiqVis = {101, -11.85, 1055.4, 0.17945, -3.4838E-07, 2}, VapVis = {102, 1.6626E-07, 0.71206, 185.2, -6483.1, 0}, LiqK = {16, 0.0039289, -19.957, -1.3588, -0.0017925, -6.0508E-07}, VapK = {102, -5919900, -0.017833, 2.2842E+09, -4.7916E+13, 0}, Racketparam = 0.26, UniquacR = 4.5967, UniquacQ = 3.956, ChaoSeadAF = 0.387184, ChaoSeadSP = 18150, ChaoSeadLV = 0.123708); +end Hexanal; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Hydrogen.mo b/Simulator/Simulator/Files/Chemsep_Database/Hydrogen.mo new file mode 100644 index 0000000..0e92f9e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Hydrogen.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Hydrogen + extends General_Properties(SN = 13, name = "Hydrogen", CAS = "1333-74-0", Tc = 33.19, Pc = 1313000, Vc = 0.064147, Cc = 0.305, Tb = 20.39, Tm = 13.95, TT = 13.95, TP = 7220, MW = 2.01588, LVB = 0.0285681, AF = -0.215993, SP = 6648, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 130571, HFMP = 117100, HOC = -2.4182E+08, LiqDen = {105, 2.9613, 0.25981, 33.19, 0.19104, 0}, VP = {101, 13.05, -97.534, 1.0355, 0.00031816, 2}, LiqCp = {16, 14510, -1191.1, 156.51, -6.1773, 0.087907}, HOV = {106, 1534700, 3.214, -8.4567, 8.4646, -2.8057}, VapCp = {16, 3994.325, -48.69006, 10.36209, -0.000340144, 1.960333E-07}, LiqVis = {101, -32.531, 97.304, 5.9178, -0.0031563, 2}, VapVis = {102, 1.7916E-07, 0.68557, -0.51413, 132.61, 0}, LiqK = {16, -0.34238, -4.3002, -0.53814, 0.0011639, -0.00021792}, VapK = {102, 0.0026851, 0.74366, 13.289, -31.305, 0}, Racketparam = 0.3139, UniquacR = 0.4092, UniquacQ = 0.5516, ChaoSeadAF = 0, ChaoSeadSP = 6647.875, ChaoSeadLV = 0.031); +end Hydrogen; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Hydrogenchloride.mo b/Simulator/Simulator/Files/Chemsep_Database/Hydrogenchloride.mo new file mode 100644 index 0000000..b1220fd --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Hydrogenchloride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Hydrogenchloride + extends General_Properties(SN = 10, name = "Hydrogenchloride", CAS = "7647-01-0", Tc = 324.69, Pc = 8310000, Vc = 0.081, Cc = 0.249, Tb = 188.15, Tm = 158.97, TT = 158.97, TP = 13521.9, MW = 36.461, LVB = 0.03028, AF = 0.126, SP = 12190, DM = 3.6E-30, SH = -92310000.0, IGHF = -9.231E+07, GEF = -9.53E+07, AS = 186786, HFMP = 2000000, HOC = -2.86E+07, LiqDen = {105, 2.3619, 0.23301, 324.69, 0.25076, 0}, VP = {101, 138.2562, -4825.245, -19.73669, 0.0000650759, 2}, LiqCp = {16, -53340, 265.92, 4.243, 0.058092, -0.00013923}, HOV = {106, 1.9563E+07, -0.79988, 3.8907, -4.9768, 2.2266}, VapCp = {16, 29096.99, -1271.123, 6.610209, 0.00378635, -0.0000013094}, LiqVis = {101, -196.43, 5474.4, 31.068, -0.000094243, 2}, VapVis = {102, 5.1969E-07, 0.66444, 177.83, -3965.9, 0}, LiqK = {16, -0.4993, -113.3, 0.99185, -0.0023549, -0.0000033612}, VapK = {102, 0.0017816, 0.5013, 331.03, 3750.8, 0}, Racketparam = 0, UniquacR = 1.056032, UniquacQ = 1.1, ChaoSeadAF = 0.121, ChaoSeadSP = 22003.8, ChaoSeadLV = 0.030563); +end Hydrogenchloride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Hydrogencyanide.mo b/Simulator/Simulator/Files/Chemsep_Database/Hydrogencyanide.mo new file mode 100644 index 0000000..3c8ab0c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Hydrogencyanide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Hydrogencyanide + extends General_Properties(SN = 27, name = "Hydrogencyanide", CAS = "74-90-8", Tc = 456.65, Pc = 5390000, Vc = 0.139, Cc = 0.197, Tb = 298.85, Tm = 259.91, TT = 259.833, TP = 18625, MW = 27.0253, LVB = 0.0397695, AF = 0.409913, SP = 24810, DM = 9.94E-30, SH = -296840000.0, IGHF = 1.35143E+08, GEF = 1.24725E+08, AS = 201719, HFMP = 8405700, HOC = -6.2329E+08, LiqDen = {105, 1.3163, 0.18425, 456.65, 0.2794, 0}, VP = {101, 42.70101, -4001.496, -3.208729, 5.620619E-06, 2}, LiqCp = {16, 70227, -10279, 42.028, 0.069085, -0.00024154}, HOV = {106, 4.5225E+07, 2.0549, -4.7432, 4.7996, -1.8366}, VapCp = {16, 29289, -482.84, 10.404, -0.000041659, 6.8553E-08}, LiqVis = {101, -12.545, 843.5, 0.21344, -0.0000012673, 2}, VapVis = {102, 1.2749E-08, 1.0633, 338.59, 155.3, 0}, LiqK = {16, 0.06901, -183.38, 0.87895, -0.0078031, 0.000002353}, VapK = {102, 0.000015837, 1.2055, -98.566, 53091, 0}, Racketparam = 0, UniquacR = 1.1951, UniquacQ = 1.2098, ChaoSeadAF = 0.409913, ChaoSeadSP = 24806, ChaoSeadLV = 0.0397695); +end Hydrogencyanide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Hydrogeniodide.mo b/Simulator/Simulator/Files/Chemsep_Database/Hydrogeniodide.mo new file mode 100644 index 0000000..568f1cc --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Hydrogeniodide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Hydrogeniodide + extends General_Properties(SN = 12, name = "Hydrogeniodide", CAS = "10034-85-2", Tc = 423.85, Pc = 8310000, Vc = 0.1219, Cc = 0.287, Tb = 237.55, Tm = 222.38, TT = 222.38, TP = 49326.4, MW = 127.912, LVB = 0.0507575, AF = 0.0380703, SP = 17120, DM = 1.5E-30, SH = 26500000.0, IGHF = 2.65E+07, GEF = 1716000, AS = 206481, HFMP = 2872100, HOC = -1.162E+08, LiqDen = {105, 0.29008, 0.10272, 423.85, 0.12802, 0}, VP = {101, 48.208, -3309.5, -4.2202, 0.0000058868, 2}, LiqCp = {16, 47228, 657.18, 2.2493, 0.031778, -0.000056365}, HOV = {106, 4.5057E+07, 2.4036, -3.4166, 1.5877, -0.0027034}, VapCp = {16, 29070.86, -1600.955, 9.445762, 0.000914155, -4.506661E-07}, LiqVis = {101, -20.449, -959.41, 4.2445, -0.000095025, 2}, VapVis = {102, 1.6146E-07, 0.8587, 45.387, -1595.3, 0}, LiqK = {16, -0.2841, 21.17, -1.299, 0.00096857, -0.0000020056}, VapK = {102, 0.000042343, 0.89806, 44.783, -39.662, 0}, Racketparam = 0, UniquacR = 1.6724, UniquacQ = 1.5928, ChaoSeadAF = 0.0380703, ChaoSeadSP = 19866.7, ChaoSeadLV = 0.0457176); +end Hydrogeniodide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Hydrogensulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Hydrogensulfide.mo new file mode 100644 index 0000000..84ce036 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Hydrogensulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Hydrogensulfide + extends General_Properties(SN = 15, name = "Hydrogensulfide", CAS = "7783-06-4", Tc = 373.53, Pc = 8962910, Vc = 0.0985, Cc = 0.284, Tb = 212.8, Tm = 187.68, TT = 187.68, TP = 23200, MW = 34.0809, LVB = 0.0438045, AF = 0.0941677, SP = 18000, DM = 3.23E-30, SH = -20630000.0, IGHF = -2.063E+07, GEF = -3.344E+07, AS = 205600, HFMP = 2376500, HOC = -5.18E+08, LiqDen = {105, 2.3565, 0.25354, 373.53, 0.26514, 0}, VP = {101, 48.34868, -3078.428, -4.229632, 6.844234E-06, 2}, LiqCp = {16, 68743, -100800, 1016.4, -3.3645, 0.0037533}, HOV = {106, 2.7198E+07, 0.69517, -0.69951, 0.51422, -0.11694}, VapCp = {16, 33121.9, -869.6079, 9.605736, 0.00110059, -3.859399E-07}, LiqVis = {101, 7.527, 261.77, -3.1833, 0.0000078743, 2}, VapVis = {102, 3.4328E-08, 1.0455, 58.912, -13329, 0}, LiqK = {16, -0.078369, -33.634, -0.24641, -0.0025463, -0.0000049089}, VapK = {102, 1.0611E-07, 1.8773, -355.78, 45782, 0}, Racketparam = 0.285, UniquacR = 1.234, UniquacQ = 1.241, ChaoSeadAF = 0.0941677, ChaoSeadSP = 18000.2, ChaoSeadLV = 0.0358604); +end Hydrogensulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Indane.mo b/Simulator/Simulator/Files/Chemsep_Database/Indane.mo new file mode 100644 index 0000000..1c33907 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Indane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Indane + extends General_Properties(SN = 162, name = "Indane", CAS = "496-11-7", Tc = 684.9, Pc = 3950000, Vc = 0.393, Cc = 0.273, Tb = 451, Tm = 221.74, TT = 221.74, TP = 0.152927, MW = 118.178, LVB = 0.12315, AF = 0.309213, SP = 19420, DM = 1.8E-30, SH = -168070000.0, IGHF = 6.07E+07, GEF = 1.668E+08, AS = 348910, HFMP = 8598000, HOC = -4.7626E+09, LiqDen = {105, 0.63627, 0.25179, 684.9, 0.29165, 0}, VP = {101, 97.02207, -8795.05, -11.00248, 6.105132E-06, 2}, LiqCp = {16, 136380, -29.478, 8.0608, 0.01305, -0.000010993}, HOV = {106, 6.2067E+07, -0.0045874, 2.0817, -3.2476, 1.6013}, VapCp = {16, 60321, -643.06, 13.337, -0.00018807, 3.6677E-08}, LiqVis = {101, -151.95, 6810.2, 21.863, -0.00002342, 2}, VapVis = {102, 0.0000002842, 0.64259, 225.95, -643.44, 0}, LiqK = {16, -0.041318, 5.7098, -1.5369, -0.00043639, -0.0000010195}, VapK = {102, 0.0089527, 0.43447, 617.91, 764370, 0}, Racketparam = 0.263427, UniquacR = 4.66381, UniquacQ = 3.108, ChaoSeadAF = 0.305, ChaoSeadSP = 19405.1, ChaoSeadLV = 0.123128); +end Indane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Indene.mo b/Simulator/Simulator/Files/Chemsep_Database/Indene.mo new file mode 100644 index 0000000..027c1ff --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Indene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Indene + extends General_Properties(SN = 161, name = "Indene", CAS = "95-13-6", Tc = 687, Pc = 3820000, Vc = 0.368, Cc = 0.246, Tb = 455.77, Tm = 271.7, TT = 271.7, TP = 17.0209, MW = 116.16, LVB = 0.116856, AF = 0.333766, SP = 20310, DM = 2.23E-30, SH = -168070000.0, IGHF = 1.6328E+08, GEF = 2.3396E+08, AS = 336870, HFMP = 1.02E+07, HOC = -4.61948E+09, LiqDen = {105, 0.68574, 0.25341, 687, 0.30914, 0}, VP = {101, 198.3126, -13212.05, -26.47637, 0.0000206314, 2}, LiqCp = {16, 87661, -18.633, 10.258, 0.0056195, -0.0000040934}, HOV = {106, 1.127174E+08, 2.195635, -2.278889, 0.782692, -0.231351}, VapCp = {16, 54598, -572.63, 13.077, -0.000062304, -1.4084E-09}, LiqVis = {101, -136.89, 6165.4, 19.669, -0.000025488, 2}, VapVis = {102, 8.1278E-07, 0.4938, 370.54, -3708.9, 0}, LiqK = {16, -0.0034145, -80.459, -0.91571, -0.0024408, 2.3991E-07}, VapK = {102, 0.000075165, 1.055, 558.89, 35355, 0}, Racketparam = 0.261272, UniquacR = 4.431773, UniquacQ = 2.892, ChaoSeadAF = 0.262, ChaoSeadSP = 20467.4, ChaoSeadLV = 0.116856); +end Indene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Iodobenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Iodobenzene.mo new file mode 100644 index 0000000..6f28ed3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Iodobenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Iodobenzene + extends General_Properties(SN = 123, name = "Iodobenzene", CAS = "591-50-4", Tc = 721.15, Pc = 4519100, Vc = 0.351, Cc = 0.265, Tb = 461.6, Tm = 241.83, TT = 241.83, TP = 1.17521, MW = 204.008, LVB = 0.111976, AF = 0.246574, SP = 20450, DM = 5.67E-30, SH = -168070000.0, IGHF = 1.649E+08, GEF = 1.902E+08, AS = 334100, HFMP = 9749000, HOC = -3.05E+09, LiqDen = {105, 0.7521, 0.26381, 721.15, 0.2895, 0}, VP = {101, 79.186, -8185.3, -8.2636, 0.0000035963, 2}, LiqCp = {16, 139830, 578.69, 1.6453, 0.031278, -0.000034279}, HOV = {106, 6.148821E+07, 0.433906, -0.0102943, -0.0130647, -0.0329532}, VapCp = {16, 63442, -692.72, 13.003, -0.00048297, 1.3499E-07}, LiqVis = {101, -57.177, 3157.8, 7.1529, -0.0000070913, 2}, VapVis = {102, 2.1908E-07, 0.74366, 231.22, -43.688, 0}, LiqK = {16, 0.077923, 1284.8, -17.082, 0.050362, -0.00006779}, VapK = {102, 0.00026878, 0.78911, 373.97, 187720, 0}, Racketparam = 0, UniquacR = 4.2857, UniquacQ = 3.112, ChaoSeadAF = 0.246574, ChaoSeadSP = 20367.4, ChaoSeadLV = 0.111976); +end Iodobenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isobutane.mo b/Simulator/Simulator/Files/Chemsep_Database/Isobutane.mo new file mode 100644 index 0000000..7981797 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isobutane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isobutane + extends General_Properties(SN = 93, name = "Isobutane", CAS = "75-28-5", Tc = 407.85, Pc = 3640000, Vc = 0.2627, Cc = 0.278, Tb = 261.34, Tm = 113.54, TT = 113.54, TP = 0.0120622, MW = 58.123, LVB = 0.10436, AF = 0.186, SP = 12560, DM = 4.4E-31, SH = -134990000.0, IGHF = -1.3499E+08, GEF = -2.144E+07, AS = 295500, HFMP = 4540000, HOC = -2.64812E+09, LiqDen = {105, 0.89934, 0.25371, 407.85, 0.25125, 0}, VP = {101, 70.58866, -4298.161, -7.798635, 0.0000116, 2}, LiqCp = {16, 89466, -323.61, 12.827, -0.010476, 0.000025037}, HOV = {106, 3.4869E+07, 0.64449, -0.15424, -0.28822, 0.20982}, VapCp = {16, 39746.03, -371.573, 12.02593, 0.000755039, -2.59608E-07}, LiqVis = {101, -39.10125, 1315.145, 4.876982, -0.0000203993, 2}, VapVis = {102, 3.951E-08, 0.90975, -52.076, 8625.4, 0}, LiqK = {16, 0.029586, 56.323, -2.8746, 0.0051627, -0.000017826}, VapK = {102, 0.091178, 0.18264, 626.56, 1124600, 0}, Racketparam = 0.275, UniquacR = 3.1502, UniquacQ = 2.772, ChaoSeadAF = 0.1825, ChaoSeadSP = 13766.21, ChaoSeadLV = 0.1055); +end Isobutane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isobutene.mo b/Simulator/Simulator/Files/Chemsep_Database/Isobutene.mo new file mode 100644 index 0000000..165ed73 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isobutene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isobutene + extends General_Properties(SN = 81, name = "Isobutene", CAS = "115-11-7", Tc = 417.9, Pc = 4000000, Vc = 0.2388, Cc = 0.275, Tb = 266.24, Tm = 132.81, TT = 132.81, TP = 0.644929, MW = 56.108, LVB = 0.09524, AF = 0.2, SP = 13660, DM = 1.67E-30, SH = -17100000.0, IGHF = -1.71E+07, GEF = 5.808E+07, AS = 293090, HFMP = 5931200, HOC = -2.5242E+09, LiqDen = {105, 1.01, 0.25611, 417.9, 0.2642, 0}, VP = {101, 47.13879, -3682.162, -3.952514, 4.044185E-06, 2}, LiqCp = {16, 95317, -68.58, 9.3268, 0.0023434, 0.0000076824}, HOV = {106, 3.916E+07, 1.1638, -1.4033, 0.81203, -0.13521}, VapCp = {16, 49784, -472.84, 12.012, 0.00052863, -1.7772E-07}, LiqVis = {101, -12.717, 644.93, 0.3696, -0.0000023983, 2}, VapVis = {102, 0.0000028839, 0.33897, 365.04, 17752, 0}, LiqK = {16, 0.061493, 33.335, -2.4686, 0.0041425, -0.000023609}, VapK = {102, -418.21, 0.91306, -1.5105E+09, 3.1789E+10, 0}, Racketparam = 0.2727, UniquacR = 2.9195, UniquacQ = 2.684, ChaoSeadAF = 0.1951, ChaoSeadSP = 13659.3, ChaoSeadLV = 0.0953727); +end Isobutene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isobutylacetate.mo b/Simulator/Simulator/Files/Chemsep_Database/Isobutylacetate.mo new file mode 100644 index 0000000..ef5c668 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isobutylacetate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isobutylacetate + extends General_Properties(SN = 337, name = "Isobutylacetate", CAS = "110-19-0", Tc = 561, Pc = 3160000, Vc = 0.413, Cc = 0.266, Tb = 389.72, Tm = 174.3, TT = 174.3, TP = 0.00622415, MW = 116.16, LVB = 0.13387, AF = 0.456, SP = 17050, DM = 6.24E-30, SH = -216400000.0, IGHF = -4.93E+08, GEF = -3.222E+08, AS = 441000, HFMP = 1.24E+07, HOC = -3.319E+09, LiqDen = {105, 0.40843, 0.20784, 561, 0.21394, 0}, VP = {101, 28.45261, -5051.537, -0.615949, -1.95606E-06, 2}, LiqCp = {16, 161610, 660.76, 3.3098, 0.024476, -0.000019195}, HOV = {106, 6.408651E+07, 1.313221, -1.992233, 1.203843, -0.0654865}, VapCp = {16, 100140, -654.65, 13.176, -0.00017464, 3.2068E-08}, LiqVis = {101, -7.1351, 566.94, -0.24427, -0.0000078548, 2}, VapVis = {102, 1.0879E-07, 0.78101, 111.13, 1059.5, 0}, LiqK = {16, 0.070874, 405.28, -7.1892, 0.020474, -0.000033831}, VapK = {102, -0.0010112, 0.95292, -6813.9, 270410, 0}, Racketparam = 0.266, UniquacR = 4.8266, UniquacQ = 4.192, ChaoSeadAF = 0.456, ChaoSeadSP = 17050, ChaoSeadLV = 0.13387); +end Isobutylacetate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isobutylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Isobutylbenzene.mo new file mode 100644 index 0000000..22c528f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isobutylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isobutylbenzene + extends General_Properties(SN = 288, name = "Isobutylbenzene", CAS = "538-93-2", Tc = 650, Pc = 3050000, Vc = 0.48, Cc = 0.271, Tb = 445.9, Tm = 221.7, TT = 221.7, TP = 0.289087, MW = 134.221, LVB = 0.15808, AF = 0.383, SP = 16860, DM = 1.5E-30, SH = -1209000000.0, IGHF = -2.054E+07, GEF = 1.388E+08, AS = 439700, HFMP = 1.25E+07, HOC = -5.56974E+09, LiqDen = {105, 0.54967, 0.26271, 650, 0.30807, 0}, VP = {101, 97.24209, -8752.864, -11.04244, 6.424651E-06, 2}, LiqCp = {16, 116150, -36.608, 10.189, 0.0074074, -0.0000060747}, HOV = {106, 6.0838E+07, 0.30052, 0.25612, -0.19969, -0.0011249}, VapCp = {16, 83364, -556.41, 13.277, 0.000016037, -2.0047E-08}, LiqVis = {101, -12.546, 1392.5, 0.17362, -2.3672E-07, 2}, VapVis = {102, 3.8764E-07, 0.58977, 249.51, 1034.4, 0}, LiqK = {16, -0.033263, -23.962, -1.3695, -0.001338, -2.5251E-07}, VapK = {102, 0.000022162, 1.2141, 174.06, 50162, 0}, Racketparam = 0.271, UniquacR = 5.9452, UniquacQ = 4.584, ChaoSeadAF = 0.383, ChaoSeadSP = 16860, ChaoSeadLV = 0.15808); +end Isobutylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isobutylmercaptan.mo b/Simulator/Simulator/Files/Chemsep_Database/Isobutylmercaptan.mo new file mode 100644 index 0000000..64bbfbc --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isobutylmercaptan.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isobutylmercaptan + extends General_Properties(SN = 351, name = "Isobutylmercaptan", CAS = "513-44-0", Tc = 557, Pc = 3900000, Vc = 0.307, Cc = 0.268, Tb = 361.64, Tm = 128.31, TT = 128.3, TP = 4.75023E-06, MW = 90.1872, LVB = 0.108751, AF = 0.25, SP = 17240, DM = 5.1E-30, SH = -22600000.0, IGHF = -9.694E+07, GEF = 6100000, AS = 362840, HFMP = 4982300, HOC = -2.949E+09, LiqDen = {105, 0.97433, 0.28543, 557, 0.30684, 0}, VP = {101, 94.36165, -7005.04, -10.97315, 8.971409E-06, 2}, LiqCp = {16, 113680, 117.72, 9.1822, 0.0046628, 2.8876E-09}, HOV = {106, 4.696233E+07, 0.280539, 0.393074, -0.340509, 0.0160184}, VapCp = {16, 83649, -694.35, 12.849, -0.00014111, 3.1023E-08}, LiqVis = {101, -10.885, 935.58, 0.015703, -1.4837E-10, 2}, VapVis = {102, 8.5691E-08, 0.8336, 119.56, -8012, 0}, LiqK = {16, -0.03575, 3.5477, -1.4952, -0.00050318, -0.0000017356}, VapK = {102, 0.00014532, 0.98673, 557.5, 22542, 0}, Racketparam = 0.268, UniquacR = 3.9001, UniquacQ = 3.292, ChaoSeadAF = 0.25, ChaoSeadSP = 17240, ChaoSeadLV = 0.108751); +end Isobutylmercaptan; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Isopentane.mo new file mode 100644 index 0000000..51f467c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isopentane + extends General_Properties(SN = 114, name = "Isopentane", CAS = "78-78-4", Tc = 460.39, Pc = 3381000, Vc = 0.3083, Cc = 0.272, Tb = 300.99, Tm = 113.25, TT = 113.25, TP = 0.00012144, MW = 72.15, LVB = 0.11646, AF = 0.229, SP = 13870, DM = 4.34E-31, SH = -27600000.0, IGHF = -1.537E+08, GEF = -1.405E+07, AS = 343740, HFMP = 5150000, HOC = -3.23954E+09, LiqDen = {105, 0.73194, 0.24835, 460.99, 0.25733, 0}, VP = {101, 71.04288, -4967.235, -7.674379, 8.659929E-06, 2}, LiqCp = {16, 112460, -54.259, 8.8747, 0.0083911, -0.0000034773}, HOV = {106, 4.14248E+07, 0.799342, -0.581969, 0.0834724, 0.117826}, VapCp = {16, 59843, -493.27, 12.516, 0.00046099, -1.5305E-07}, LiqVis = {101, -12.596, 889.14, 0.20472, 4.0592E-09, 2}, VapVis = {102, 6.6346E-08, 0.82828, -68.082, 25303, 0}, LiqK = {16, 0.061061, 89.857, -3.522, 0.0075154, -0.000023032}, VapK = {102, 0.00090019, 0.7738, 456.82, 231390, 0}, Racketparam = 0.2716, UniquacR = 3.82, UniquacQ = 3.31, ChaoSeadAF = 0.2104, ChaoSeadSP = 14359.41, ChaoSeadLV = 0.1174); +end Isopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isoprene.mo b/Simulator/Simulator/Files/Chemsep_Database/Isoprene.mo new file mode 100644 index 0000000..15920b7 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isoprene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isoprene + extends General_Properties(SN = 103, name = "Isoprene", CAS = "78-79-5", Tc = 484, Pc = 3850030, Vc = 0.276, Cc = 0.264, Tb = 307.205, Tm = 127.27, TT = 127.27, TP = 0.00247682, MW = 68.117, LVB = 0.100775, AF = 0.158323, SP = 15330, DM = 8.3391E-31, SH = -134990000.0, IGHF = 7.57304E+07, GEF = 1.45896E+08, AS = 315641, HFMP = 4924570, HOC = -2.98424E+09, LiqDen = {105, 0.95762, 0.265, 484, 0.28587, 0}, VP = {101, 59.64382, -4808.579, -5.723014, 3.325462E-06, 2}, LiqCp = {16, 111430, 579.88, 0.11179, 0.042713, -0.000046991}, HOV = {106, 4.7482E+07, 1.7472, -3.7153, 4.0508, -1.6134}, VapCp = {16, 46067, -400.72, 12.189, 0.00043981, -1.4681E-07}, LiqVis = {101, -8.3004, 457.06, -0.22583, -0.0000048674, 2}, VapVis = {102, 5.2484E-07, 0.58768, 291.05, -6176.5, 0}, LiqK = {16, -0.0093138, -47.475, -0.82654, -0.0037828, 8.2245E-07}, VapK = {102, 0.0010775, 0.73105, 657.17, 112780, 0}, Racketparam = 0, UniquacR = 3.36, UniquacQ = 3.01, ChaoSeadAF = 0.1642, ChaoSeadSP = 15333.3, ChaoSeadLV = 0.100775); +end Isoprene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isopropanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Isopropanol.mo new file mode 100644 index 0000000..5cb0753 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isopropanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isopropanol + extends General_Properties(SN = 68, name = "Isopropanol", CAS = "67-63-0", Tc = 508.3, Pc = 4762000, Vc = 0.22, Cc = 0.248, Tb = 355.39, Tm = 185.28, TT = 185.28, TP = 0.0363946, MW = 60.096, LVB = 0.07692, AF = 0.665, SP = 23420, DM = 5.54E-30, SH = -104680000.0, IGHF = -2.727E+08, GEF = -1.7347E+08, AS = 309200, HFMP = 5410000, HOC = -1.83E+09, LiqDen = {105, 1.1898, 0.26648, 508.3, 0.23986, 0}, VP = {101, 77.70856, -7630.115, -7.63517, 9.965114E-07, 2}, LiqCp = {16, -188260, 277.99, 9.4459, 0.010702, -0.0000091964}, HOV = {106, 1.100995E+08, 4.1961, -10.70959, 11.69444, -4.625499}, VapCp = {16, 52738, -555.28, 12.347, 0.000094247, -4.5945E-08}, LiqVis = {101, -7.4407, 2259.7, -1.1149, 0.0000002963, 2}, VapVis = {102, 1.9931E-07, 0.72329, 178.01, -15.318, 0}, LiqK = {16, -0.15761, 49.41, -1.6579, 0.0019566, -0.0000034939}, VapK = {102, 0.0028843, 0.91609, 11082, -222500, 0}, Racketparam = 0.2493, UniquacR = 2.78, UniquacQ = 2.51, ChaoSeadAF = 0.7238, ChaoSeadSP = 23408.3, ChaoSeadLV = 0.0768988); +end Isopropanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isopropylacetate.mo b/Simulator/Simulator/Files/Chemsep_Database/Isopropylacetate.mo new file mode 100644 index 0000000..b0327fe --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isopropylacetate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isopropylacetate + extends General_Properties(SN = 335, name = "Isopropylacetate", CAS = "108-21-4", Tc = 516.15, Pc = 3495640, Vc = 0.343881, Cc = 0.25, Tb = 361.65, Tm = 199.75, TT = 199.75, TP = 3.8692, MW = 102.132, LVB = 0.117579, AF = 0.542817, SP = 17150, DM = 5.84E-30, SH = -216400000.0, IGHF = -4.817E+08, GEF = -3.337E+08, AS = 390200, HFMP = 8880000, HOC = -2.658E+09, LiqDen = {105, 1.7447, 0.38746, 516.15, 0.46246, 0}, VP = {101, 53.596, -5675.5, -4.5065, 0.0000012831, 2}, LiqCp = {16, 131390, -46.486, 8.1047, 0.013597, -0.000010999}, HOV = {106, 4.852874E+07, 0.139799, 0.87492, -1.379465, 0.721356}, VapCp = {16, 49388, -461.23, 12.886, -0.00010674, 6.959E-08}, LiqVis = {101, -10.895, 1115.7, -0.084451, 4.8399E-07, 2}, VapVis = {102, 3.7177E-07, 0.62086, 249.31, -266.55, 0}, LiqK = {16, -0.09612, 7.576, -1.2028, -0.00070085, -9.2097E-07}, VapK = {102, -5913400, -0.12076, 3.6992E+09, -2.5996E+13, 0}, Racketparam = 0.25, UniquacR = 4.1522, UniquacQ = 3.652, ChaoSeadAF = 0.367774, ChaoSeadSP = 17150, ChaoSeadLV = 0.117579); +end Isopropylacetate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isopropylbutylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Isopropylbutylether.mo new file mode 100644 index 0000000..64b1737 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isopropylbutylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isopropylbutylether + extends General_Properties(SN = 328, name = "Isopropylbutylether", CAS = "1860-27-1", Tc = 549, Pc = 2740000, Vc = 0.435, Cc = 0.261, Tb = 378.15, Tm = 180, TT = 180, TP = 0.0337504, MW = 116.201, LVB = 0.155791, AF = 0.403229, SP = 15260, DM = 4.24E-30, SH = -216400000.0, IGHF = -3.269E+08, GEF = -1.071E+08, AS = 450200, HFMP = 1.22E+07, HOC = -4.324E+09, LiqDen = {105, 0.62258, 0.27082, 549, 0.30735, 0}, VP = {101, 85.99635, -7315.405, -9.426402, 5.236755E-06, 2}, LiqCp = {16, 200760, -0.77126, 8.116, 0.0093067, -0.00000176}, HOV = {106, 5.2177E+07, 0.38027, 0, 0, 0}, VapCp = {16, 76973, -443.41, 12.925, 0.00032949, -1.1644E-07}, LiqVis = {101, -11.496, 1171.6, 0.0066892, -1.6659E-08, 2}, VapVis = {102, 0.000000176, 0.70157, 181.76, -5946.4, 0}, LiqK = {16, -0.10095, 17.355, -1.4146, -0.000082157, -0.0000014735}, VapK = {102, 0.00016013, 0.96562, 574.46, 18419, 0}, Racketparam = 0.261, UniquacR = 5.4173, UniquacQ = 4.632, ChaoSeadAF = 0.403229, ChaoSeadSP = 15260, ChaoSeadLV = 0.155791); +end Isopropylbutylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isopropylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Isopropylcyclopentane.mo new file mode 100644 index 0000000..20dff8a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isopropylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isopropylcyclopentane + extends General_Properties(SN = 271, name = "Isopropylcyclopentane", CAS = "3875-51-2", Tc = 601, Pc = 3000000, Vc = 0.422, Cc = 0.259, Tb = 399.58, Tm = 161.79, TT = 161.79, TP = 0.000981869, MW = 112.213, LVB = 0.14527, AF = 0.302996, SP = 15940, DM = 0, SH = -1209000000.0, IGHF = -1.5071E+08, GEF = 5.305E+07, AS = 407080, HFMP = 1.041E+07, HOC = -4.8944E+09, LiqDen = {105, 0.01997, 0.048466, 601, 0.10484, 0}, VP = {101, 70.74905, -6671.509, -7.204875, 3.983606E-06, 2}, LiqCp = {16, 77318, -174.75, 11.36, 0.00375, -0.0000015189}, HOV = {106, 5.807013E+07, 1.420456, -3.256998, 3.923183, -1.686337}, VapCp = {16, 31291, -392.29, 12.88, 0.0005799, -2.3026E-07}, LiqVis = {101, -11.637, 1116.2, 0.10394, -3.9216E-07, 2}, VapVis = {102, 6.3283E-08, 0.84204, 92.528, -7299.5, 0}, LiqK = {16, -0.057129, 3.4704, -1.5201, -0.00050193, -0.0000011418}, VapK = {102, 0.10336, 0.072913, -474.32, 1330800, 0}, Racketparam = 0.259, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.302996, ChaoSeadSP = 15940, ChaoSeadLV = 0.14527); +end Isopropylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Isopropylmercaptan.mo b/Simulator/Simulator/Files/Chemsep_Database/Isopropylmercaptan.mo new file mode 100644 index 0000000..06e16ce --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Isopropylmercaptan.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Isopropylmercaptan + extends General_Properties(SN = 428, name = "Isopropylmercaptan", CAS = "75-33-2", Tc = 517.3, Pc = 4750000, Vc = 0.254, Cc = 0.281, Tb = 325.75, Tm = 142.61, TT = 142.64, TP = 0.00973089, MW = 76.1606, LVB = 0.0941865, AF = 0.21381, SP = 16970, DM = 5.47E-30, SH = 28500000.0, IGHF = -7.59E+07, GEF = -2180000, AS = 324300, HFMP = 5736000, HOC = -2.3684E+09, LiqDen = {105, 1.093001, 0.27762, 517, 0.29781, 0}, VP = {101, 52.49398, -5018.813, -4.414151, 1.969036E-13, 2}, LiqCp = {16, -4182.09, 11.57821, 11.69322, 0.0000133303, 0.0000020152}, HOV = {106, 4.07186E+07, 0.189905, 0.420769, -0.0231137, -0.258009}, VapCp = {16, 68588.92, -673.2911, 12.50044, 1.486465E-06, -1.964897E-08}, LiqVis = {16, 0.0000158085, 630.9957, -8.670452, -0.006493, 5.676279E-06}, VapVis = {16, 2.562672E-06, -300.3637, -11.49051, 0.00155043, -4.080467E-07}, LiqK = {16, 0.019346, 8.361977, -1.76982, -0.000539416, -3.287583E-06}, VapK = {102, 0.00018367, 0.9627, 646.01, 0, 0}, Racketparam = 0, UniquacR = 3.225445, UniquacQ = 2.84, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); +end Isopropylmercaptan; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ketene.mo b/Simulator/Simulator/Files/Chemsep_Database/Ketene.mo new file mode 100644 index 0000000..1f82f4d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ketene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ketene + extends General_Properties(SN = 406, name = "Ketene", CAS = "463-51-4", Tc = 370, Pc = 5810000, Vc = 0.144, Cc = 0.272, Tb = 217.15, Tm = 122.15, TT = 122, TP = 7.19493, MW = 42.0367, LVB = 0.06374, AF = 0.125656, SP = 13820, DM = 4.74E-30, SH = -61100000.0, IGHF = -6.11E+07, GEF = -6.02914E+07, AS = 241800, HFMP = 0, HOC = -9.67759E+08, LiqDen = {105, 1.8886, 0.272, 370, 0.28571, 0}, VP = {101, 58.628, -3467, -5.9337, 0.000010248, 2}, LiqCp = {16, 41971, 267.01, 4.7755, 0.029953, -0.000037749}, HOV = {106, 4.6158E+07, 4.5264, -12.408, 14.257, -5.881}, VapCp = {16, 33110, -414.32, 10.968, 0.00041237, -1.3222E-07}, LiqVis = {101, -18.659, 731.69, 1.5497, -0.000011288, 2}, VapVis = {102, 0.000001285, 0.50552, 367.45, -2188.3, 0}, LiqK = {16, -0.007072, -11.763, -0.74777, -0.0024777, -0.0000018714}, VapK = {102, 0.000028519, 1.1477, -97.436, 37387, 0}, Racketparam = 0.272, UniquacR = 1.694792, UniquacQ = 1.610932, ChaoSeadAF = 0.125656, ChaoSeadSP = 13820, ChaoSeadLV = 0.06374); +end Ketene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Krypton.mo b/Simulator/Simulator/Files/Chemsep_Database/Krypton.mo new file mode 100644 index 0000000..d763ad1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Krypton.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Krypton + extends General_Properties(SN = 199, name = "Krypton", CAS = "7439-90-9", Tc = 209.4, Pc = 5500000, Vc = 0.0912, Cc = 0.288, Tb = 119.74, Tm = 115.77, TT = 115.78, TP = 73149.9, MW = 83.8, LVB = 0.03463, AF = 0.005, SP = 15280, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 163975, HFMP = 1640130, HOC = 0, LiqDen = {105, 2.5742, 0.26395, 209.4, 0.25018, 0}, VP = {101, 48.208, -1609, -4.9593, 0.0000342, 2}, LiqCp = {16, 36193, 105.13, 3.9876, 0.048456, -0.0001134}, HOV = {106, 1.7515E+07, 2.6595, -6.0031, 6.068, -2.2776}, VapCp = {16, 20754, 0, 0, 0, 0}, LiqVis = {101, -7.7422, -0.3975, -0.00054036, -9.2221E-08, 2}, VapVis = {102, 0.0000018282, 0.5384, 165.83, -1432.5, 0}, LiqK = {16, -0.22624, -10.133, -0.77044, -0.0023081, -0.0000013009}, VapK = {102, 0.00075369, 0.52925, 198.58, -4150.2, 0}, Racketparam = 0.288, UniquacR = 1.12, UniquacQ = 1.12, ChaoSeadAF = 0.005, ChaoSeadSP = 15280, ChaoSeadLV = 0.03463); +end Krypton; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Maleicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Maleicacid.mo new file mode 100644 index 0000000..82cb1b0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Maleicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Maleicacid + extends General_Properties(SN = 402, name = "Maleicacid", CAS = "110-16-7", Tc = 773, Pc = 4990000, Vc = 0.297, Cc = 0.231, Tb = 411, Tm = 403.45, TT = 403.8, TP = 98.6734, MW = 116.072, LVB = 0.090835, AF = 0.997587, SP = 30550, DM = 1.06E-29, SH = -22600000.0, IGHF = -6.794E+08, GEF = -5.96E+08, AS = 416000, HFMP = 3.47E+07, HOC = -1.2684E+09, LiqDen = {105, 0.77641, 0.231, 773, 0.28571, 0}, VP = {101, 187.4602, -19104.39, -22.78106, 6.967225E-06, 2}, LiqCp = {16, 148240, 706.52, 4.046, 0.018422, -0.000011933}, HOV = {106, 1.16446E+08, 0.325842, -0.000233021, 0.00216992, 0.484323}, VapCp = {16, 60872, -493.34, 12.58, -0.00028606, 0.0000001493}, LiqVis = {101, -11.993, 2508.3, 0.079857, -1.8766E-08, 2}, VapVis = {102, 9.0189E-08, 0.80995, 111.91, -70.22, 0}, LiqK = {16, -0.061944, -160.86, -0.25643, -0.0021458, 2.3954E-07}, VapK = {102, 0.0000021963, 1.4191, -285.03, 84199, 0}, Racketparam = 0.231, UniquacR = 3.7193, UniquacQ = 3.315, ChaoSeadAF = 0.997587, ChaoSeadSP = 30550, ChaoSeadLV = 0.090835); +end Maleicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Maleicanhydride.mo b/Simulator/Simulator/Files/Chemsep_Database/Maleicanhydride.mo new file mode 100644 index 0000000..46f57ab --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Maleicanhydride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Maleicanhydride + extends General_Properties(SN = 405, name = "Maleicanhydride", CAS = "108-31-6", Tc = 721, Pc = 7280000, Vc = 0.219, Cc = 0.266, Tb = 473.15, Tm = 325.927, TT = 325.72, TP = 289.837, MW = 98.0569, LVB = 0.0741215, AF = 0.54629, SP = 25870, DM = 1.31E-29, SH = -22600000.0, IGHF = -4.167E+08, GEF = -3.55E+08, AS = 317000, HFMP = 1.15E+07, HOC = -1.38E+09, LiqDen = {105, 1.1934, 0.26153, 721, 0.35499, 0}, VP = {101, 181.7423, -13070.32, -23.83155, 0.0000182982, 2}, LiqCp = {16, 7374.3, 412.68, 8.4647, 0.0086559, -0.0000060424}, HOV = {106, 5.7421E+07, 0.064434, 0.35394, -0.39596, 0.19018}, VapCp = {16, -39596, -169.57, 12.496, 6.0181E-08, 4.1214E-08}, LiqVis = {101, 93.459, -2744.1, -16.078, 0.000015825, 2}, VapVis = {102, 7.5282E-08, 0.87275, 168.46, -10784, 0}, LiqK = {16, 0.0050361, -137.05, -0.46443, -0.0029116, 3.9472E-07}, VapK = {102, 0.00030053, 0.85542, 634.55, 21624, 0}, Racketparam = 0.266, UniquacR = 2.903098, UniquacQ = 2.384, ChaoSeadAF = 0.54629, ChaoSeadSP = 25870, ChaoSeadLV = 0.0741215); +end Maleicanhydride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Mcresol.mo b/Simulator/Simulator/Files/Chemsep_Database/Mcresol.mo new file mode 100644 index 0000000..8550b37 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Mcresol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Mcresol + extends General_Properties(SN = 141, name = "Mcresol", CAS = "108-39-4", Tc = 705.7, Pc = 4560000, Vc = 0.312, Cc = 0.241, Tb = 475.38, Tm = 285.39, TT = 285.39, TP = 5.86242, MW = 108.14, LVB = 0.10499, AF = 0.452, SP = 23900, DM = 5.3E-30, SH = -168070000.0, IGHF = -1.323E+08, GEF = -4.019E+07, AS = 356040, HFMP = 1.0707E+07, HOC = -3.52783E+09, LiqDen = {105, 0.76595, 0.25907, 705.86, 0.2605, 0}, VP = {101, 143.16, -12586, -17.327, 0.0000073113, 2}, LiqCp = {16, 62676, -205.39, 12.221, 0.0027125, -0.0000038975}, HOV = {106, 9.4557E+07, 0.36419, 1.602, -2.5634, 1.0947}, VapCp = {16, 58129, -537.86, 12.936, -0.000090368, 1.797E-08}, LiqVis = {101, -1098.989, 45628.63, 168.1502, -0.000185183, 2}, VapVis = {102, 1.4432E-07, 0.74376, 166.32, -45.138, 0}, LiqK = {16, 0.10478, -476.78, 0.8844, -0.0090128, 0.0000031516}, VapK = {102, 0.00016795, 0.9362, 585.89, 24552, 0}, Racketparam = 0.241, UniquacR = 4.7567, UniquacQ = 3.888, ChaoSeadAF = 0.45, ChaoSeadSP = 24080.3, ChaoSeadLV = 0.104996); +end Mcresol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Mcymene.mo b/Simulator/Simulator/Files/Chemsep_Database/Mcymene.mo new file mode 100644 index 0000000..c1fb933 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Mcymene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Mcymene + extends General_Properties(SN = 292, name = "Mcymene", CAS = "535-77-3", Tc = 666.25, Pc = 2810000, Vc = 0.478, Cc = 0.257, Tb = 448.23, Tm = 209.44, TT = 209.44, TP = 0.0405569, MW = 134.218, LVB = 0.156604, AF = 0.342, SP = 17110, DM = 1.2E-30, SH = -1209000000.0, IGHF = -2.79909E+07, GEF = 1.301E+08, AS = 432200, HFMP = 1.37E+07, HOC = -5.55802E+09, LiqDen = {105, 0.17699, 0.14976, 666.25, 0.19922, 0}, VP = {101, 72.132, -7676.5, -7.2263, 0.0000031742, 2}, LiqCp = {16, 129560, -114.64, 10.436, 0.006807, -0.0000055776}, HOV = {106, 1.132017E+08, 4.402749, -10.71693, 11.0294, -4.113621}, VapCp = {16, 118290, -808.58, 13.818, -0.00057669, 1.7291E-07}, LiqVis = {101, -8.2582, 1048.3, -0.41448, -1.0836E-07, 2}, VapVis = {102, 0.0000018208, 0.39157, 589.66, 3771.8, 0}, LiqK = {16, -0.042558, -18.046, -1.3081, -0.0015377, 2.6414E-07}, VapK = {102, 0.0000098162, 1.3084, 45.918, 51418, 0}, Racketparam = 0.257, UniquacR = 6.0058, UniquacQ = 4.612, ChaoSeadAF = 0.342, ChaoSeadSP = 17110, ChaoSeadLV = 0.156604); +end Mcymene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Mdichlorobenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Mdichlorobenzene.mo new file mode 100644 index 0000000..2c8ac79 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Mdichlorobenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Mdichlorobenzene + extends General_Properties(SN = 118, name = "Mdichlorobenzene", CAS = "541-73-1", Tc = 683.95, Pc = 4070000, Vc = 0.351, Cc = 0.251, Tb = 446.23, Tm = 248.39, TT = 248.39, TP = 6.40787, MW = 147.002, LVB = 0.114533, AF = 0.27898, SP = 19570, DM = 5.74E-30, SH = -168070000.0, IGHF = 2.57E+07, GEF = 7.79E+07, AS = 343530, HFMP = 1.259E+07, HOC = -2.825E+09, LiqDen = {105, 0.74132, 0.26094, 683.95, 0.31392, 0}, VP = {101, 100.37, -9087, -11.404, 0.0000055122, 2}, LiqCp = {16, 89111, 785.31, 3.6098, 0.022491, -0.00001896}, HOV = {106, 5.2076E+07, 0.15554, -0.20298, 0.94291, -0.55524}, VapCp = {16, 56066, -490.93, 12.649, -0.00012726, 2.3703E-08}, LiqVis = {101, -114.79, 4907.5, 16.374, -0.000020623, 2}, VapVis = {102, 2.3524E-07, 0.71383, 257.29, 1880.2, 0}, LiqK = {16, 0.042347, -224.09, -0.2096, -0.006185, 0.0000024486}, VapK = {102, -1552.3, 0.68852, -2.6293E+09, -1.7751E+11, 0}, Racketparam = 0, UniquacR = 4.4376, UniquacQ = 3.288, ChaoSeadAF = 0.215834, ChaoSeadSP = 19575.7, ChaoSeadLV = 0.114641); +end Mdichlorobenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Mdiethylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Mdiethylbenzene.mo new file mode 100644 index 0000000..fb8a0f7 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Mdiethylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Mdiethylbenzene + extends General_Properties(SN = 295, name = "Mdiethylbenzene", CAS = "141-93-5", Tc = 663, Pc = 2880000, Vc = 0.488, Cc = 0.255, Tb = 454.252, Tm = 189.23, TT = 189.259, TP = 0.000664991, MW = 134.2182, LVB = 0.156083, AF = 0.354019, SP = 17460, DM = 1.2E-30, SH = -1209000000.0, IGHF = -2.18E+07, GEF = 1.367E+08, AS = 439500, HFMP = 1.097E+07, HOC = -5.5546E+09, LiqDen = {105, 0.52578, 0.25663, 663, 0.2955, 0}, VP = {101, 153.5552, -11090.88, -19.79091, 0.000016846, 2}, LiqCp = {16, -15019, 20.098, 11.35, 0.0044704, -0.0000034473}, HOV = {106, 6.460804E+07, 0.433681, -0.0244308, 0.0154888, -0.0245419}, VapCp = {16, 115660, -734.22, 13.598, -0.00034186, 8.9326E-08}, LiqVis = {101, -11.504, 1313.6, 0.03353, -9.5074E-08, 2}, VapVis = {102, 0.0000018496, 0.38185, 552.33, 63.517, 0}, LiqK = {16, -0.056303, 5.6194, -1.5408, -0.00033118, -0.0000010873}, VapK = {102, 0.25407, -0.039016, -216.19, 1832400, 0}, Racketparam = 0.255, UniquacR = 6.0066, UniquacQ = 4.616, ChaoSeadAF = 0.354019, ChaoSeadSP = 17460, ChaoSeadLV = 0.156083); +end Mdiethylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Mesitylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Mesitylene.mo new file mode 100644 index 0000000..48d5d75 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Mesitylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Mesitylene + extends General_Properties(SN = 287, name = "Mesitylene", CAS = "108-67-8", Tc = 637.3, Pc = 3127000, Vc = 0.43, Cc = 0.252, Tb = 437.9, Tm = 228.46, TT = 228.42, TP = 0.742135, MW = 120.194, LVB = 0.14299, AF = 0.399, SP = 17940, DM = 0, SH = -1209000000.0, IGHF = -1.605E+07, GEF = 1.181E+08, AS = 385410, HFMP = 9514000, HOC = -4.92904E+09, LiqDen = {105, 0.59019, 0.25742, 637.3, 0.27724, 0}, VP = {101, 118.5616, -9560.276, -14.30644, 9.375247E-06, 2}, LiqCp = {16, 152130, 279.49, 4.8304, 0.024632, -0.000024309}, HOV = {106, 6.9292E+07, 1.0706, -1.5094, 1.269, -0.42864}, VapCp = {16, 76799, -561.49, 13.016, 0.00018488, -8.0041E-08}, LiqVis = {101, -11.283, 1439.3, -0.15787, 0.0000019934, 2}, VapVis = {102, 3.4877E-07, 0.61399, 342.31, -16742, 0}, LiqK = {16, -0.012521, 77.398, -2.4912, 0.0027181, -0.0000053908}, VapK = {102, 0.3225, -0.079944, -464.54, 1938200, 0}, Racketparam = 0.252, UniquacR = 5.3928, UniquacQ = 4.104, ChaoSeadAF = 0.399, ChaoSeadSP = 17940, ChaoSeadLV = 0.14299); +end Mesitylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methacrylicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Methacrylicacid.mo new file mode 100644 index 0000000..1160d57 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methacrylicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methacrylicacid + extends General_Properties(SN = 395, name = "Methacrylicacid", CAS = "79-41-4", Tc = 643, Pc = 4700000, Vc = 0.27, Cc = 0.244, Tb = 433.65, Tm = 288.15, TT = 288.15, TP = 58.5615, MW = 86.0892, LVB = 0.0852843, AF = 0.331817, SP = 21000, DM = 5.5E-30, SH = -22600000.0, IGHF = -3.68E+08, GEF = -2.88E+08, AS = 350000, HFMP = 0, HOC = -1.93E+09, LiqDen = {105, 2.1083, 0.37321, 643, 0.47743, 0}, VP = {101, 9.843112, -6238.161, 2.965581, -0.0000105952, 2}, LiqCp = {16, 130480, 265.42, 3.971, 0.026507, -0.000026858}, HOV = {106, 7009500, -12.334, 36.335, -42.263, 18.248}, VapCp = {16, 48894, -560.59, 12.692, -0.00031458, 1.4407E-07}, LiqVis = {101, 0.054722, 968.88, -1.7788, 0.0000031087, 2}, VapVis = {102, 9.4671E-08, 0.81582, 92.397, 383.72, 0}, LiqK = {16, -0.067603, 29.398, -1.512, 0.00016774, -0.0000015769}, VapK = {102, 0.000065218, 1.0555, 299.46, 29315, 0}, Racketparam = 0.244, UniquacR = 3.3197, UniquacQ = 3.06, ChaoSeadAF = 0.331817, ChaoSeadSP = 21000, ChaoSeadLV = 0.0852843); +end Methacrylicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methacrylonitrile.mo b/Simulator/Simulator/Files/Chemsep_Database/Methacrylonitrile.mo new file mode 100644 index 0000000..f4db099 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methacrylonitrile.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methacrylonitrile + extends General_Properties(SN = 73, name = "Methacrylonitrile", CAS = "126-98-7", Tc = 554, Pc = 3880000, Vc = 0.265, Cc = 0.223, Tb = 363.45, Tm = 237.35, TT = 237.35, TP = 268.868, MW = 67.0892, LVB = 0.0844058, AF = 0.301271, SP = 19090, DM = 1.23E-29, SH = 304600000.0, IGHF = 9.803E+07, GEF = 1.64E+08, AS = 223800, HFMP = 0, HOC = -2.243E+09, LiqDen = {105, 0.89537, 0.23729, 554, 0.29629, 0}, VP = {101, 56.07917, -5342.951, -5.152858, 4.011012E-06, 2}, LiqCp = {16, 125060, 169.88, 6.1441, 0.015707, -0.000014502}, HOV = {106, 4.4103E+07, 0.56334, -0.51577, 0.31852, -0.072403}, VapCp = {16, 68640, -664.02, 12.252, 0.000039427, -4.9098E-08}, LiqVis = {101, -14.973, 1174.5, 0.57272, -0.0000017357, 2}, VapVis = {102, 3.3003E-07, 0.64938, 329.57, -240, 0}, LiqK = {16, 0.095479, 1984.5, -23.334, 0.076497, -0.000098215}, VapK = {102, 0.0010085, 1.2282, 49915, 0.89214, 0}, Racketparam = 0, UniquacR = 2.987475, UniquacQ = 2.712, ChaoSeadAF = 0.301271, ChaoSeadSP = 19094, ChaoSeadLV = 0.0844058); +end Methacrylonitrile; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methane.mo b/Simulator/Simulator/Files/Chemsep_Database/Methane.mo new file mode 100644 index 0000000..6d51b6c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methane + extends General_Properties(SN = 31, name = "Methane", CAS = "74-82-8", Tc = 190.56, Pc = 4599000, Vc = 0.0986, Cc = 0.286, Tb = 111.66, Tm = 90.694, TT = 90.694, TP = 11696, MW = 16.043, LVB = 0.03554, AF = 0.011, SP = 11600, DM = 0, SH = -74520000.0, IGHF = -7.452E+07, GEF = -5.049E+07, AS = 186270, HFMP = 941400, HOC = -8.0262E+08, LiqDen = {105, 1.894, 0.23603, 191.05, 0.21974, 0}, VP = {101, 39.98844, -1337.308, -3.580049, 0.0000320698, 2}, LiqCp = {16, 61157, 5034.1, -48.913, -0.22998, 0.0022243}, HOV = {106, 1.4418E+07, 2.3055, -5.4199, 5.658, -2.1286}, VapCp = {16, 33151.9, -1220.001, 12.0907, -0.000384791, 9.896403E-08}, LiqVis = {101, -45.328, 724.39, 6.5917, -0.00010373, 2}, VapVis = {102, 5.3432E-07, 0.58831, 114.58, -1338.5, 0}, LiqK = {16, 0.011567, -46.041, 0.10435, -0.012133, -0.0000051716}, VapK = {102, 0.0000074705, 1.4432, -57.569, 587.82, 0}, Racketparam = 0.2876, UniquacR = 1.1239, UniquacQ = 1.152, ChaoSeadAF = 0, ChaoSeadSP = 11618.44, ChaoSeadLV = 0.0378392); +end Methane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Methanol.mo new file mode 100644 index 0000000..93cd89d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methanol + extends General_Properties(SN = 32, name = "Methanol", CAS = "67-56-1", Tc = 512.64, Pc = 8097000, Vc = 0.118, Cc = 0.224, Tb = 337.69, Tm = 175.47, TT = 175.47, TP = 0.111264, MW = 32.042, LVB = 0.04073, AF = 0.565, SP = 29440, DM = 5.67E-30, SH = -74520000.0, IGHF = -2.0094E+08, GEF = -1.6232E+08, AS = 239880, HFMP = 3215000, HOC = -6.382E+08, LiqDen = {105, 1.7918, 0.23929, 512.64, 0.21078, 0}, VP = {101, 73.40342, -6548.076, -7.409987, 5.72492E-06, 2}, LiqCp = {16, 62799, 1254.2, -5.9906, 0.052937, -0.00004711}, HOV = {106, 5.8058E+07, 0.87168, -0.81501, 0.1695, 0.17846}, VapCp = {16, 36313.16, -680.4577, 11.10203, 0.000756766, -2.902645E-07}, LiqVis = {101, -32.996, 1981.4, 3.3666, -0.0000039246, 2}, VapVis = {102, 3.0654E-07, 0.69658, 204.87, 24.304, 0}, LiqK = {16, -0.056817, 13.156, -1.2214, -0.00028282, -0.0000010129}, VapK = {102, 7.8368E-07, 1.7569, 108.12, -21101, 0}, Racketparam = 0, UniquacR = 1.43, UniquacQ = 1.43, ChaoSeadAF = 0.5589, ChaoSeadSP = 29546.4, ChaoSeadLV = 0.0407027); +end Methanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/MethylDiEthanolAmine.mo b/Simulator/Simulator/Files/Chemsep_Database/MethylDiEthanolAmine.mo new file mode 100644 index 0000000..0b5ed8d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/MethylDiEthanolAmine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model MethylDiEthanolAmine + extends General_Properties(SN = 424, name = "MethylDiEthanolAmine", CAS = "105-59-9", Tc = 741.9, Pc = 4160000, Vc = 0.365, Cc = 0.246154, Tb = 520.15, Tm = 252.15, TT = 252.15, TP = 0.00203612, MW = 119.162, LVB = 0.115302, AF = 1.1649, SP = 28140, DM = 9.53993E-30, SH = -61100000.0, IGHF = -3.8E+08, GEF = -1.69E+08, AS = 469000, HFMP = 0, HOC = -3.06E+09, LiqDen = {105, 0.69135, 0.25418, 675, 0.2857, 0}, VP = {101, -0.352098, -4812.65, 3.121045, 6.605463E-06, 2}, LiqCp = {4, 181326, 26.21689, 0.880838, 0, -0.00001581}, HOV = {106, 1.40201E+08, 0.632751, 0.350924, -0.633597, 0.0584955}, VapCp = {16, 89777, -550.24, 13.01, 0.000045139, -3.2024E-08}, LiqVis = {101, -162.0804, 9995.149, 22.49076, -0.0000361184, 1.932506}, VapVis = {102, 7.7364E-08, 0.84268, 140.24, -9063.1, 0}, LiqK = {16, -0.869, 15, 0, 0, 0}, VapK = {102, 0.00016443, 0.97072, 595.54, 41960, 0}, Racketparam = 0.254, UniquacR = 5.8841, UniquacQ = 5.5, ChaoSeadAF = 1.1649, ChaoSeadSP = 28140, ChaoSeadLV = 0.115302); +end MethylDiEthanolAmine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/MethylEthylCarbonate.mo b/Simulator/Simulator/Files/Chemsep_Database/MethylEthylCarbonate.mo new file mode 100644 index 0000000..b5ff494 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/MethylEthylCarbonate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model MethylEthylCarbonate + extends General_Properties(SN = 414, name = "MethylEthylCarbonate", CAS = "623-53-0", Tc = 565.93, Pc = 3828600, Vc = 0.30149, Cc = 0.24531, Tb = 385.68, Tm = 258.65, TT = 0, TP = 0, MW = 104.1054, LVB = 0.1108, AF = 0.31086, SP = 20328.39, DM = 0, SH = -61100000.0, IGHF = 6.510304E+07, GEF = -2.776586, AS = 1164449, HFMP = 0, HOC = -2.608223, LiqDen = {0, 0, 0, 0, 0, 0}, VP = {10, 21.71522, 3376.596, -49.461, 0, 0}, LiqCp = {0, 0, 0, 0, 0, 0}, HOV = {106, 2.0559E+07, 0.38, 0, 0, 0}, VapCp = {4, 160.9996, 288.84, -0.1394, 0.0000245, 0}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {0, 0, 0, 0, 0, 0}, LiqK = {16, 0, 0, 0, 0, 0}, VapK = {0, 0, 0, 0, 0, 0}, Racketparam = 0.24531, UniquacR = 4.0566, UniquacQ = 3.626, ChaoSeadAF = 0.31086, ChaoSeadSP = 0, ChaoSeadLV = 0.1108); +end MethylEthylCarbonate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/MethylPhenylCarbonate.mo b/Simulator/Simulator/Files/Chemsep_Database/MethylPhenylCarbonate.mo new file mode 100644 index 0000000..bbb6c89 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/MethylPhenylCarbonate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model MethylPhenylCarbonate + extends General_Properties(SN = 415, name = "MethylPhenylCarbonate", CAS = "13509-27-8", Tc = 711.76, Pc = 3441000, Vc = 0.42129, Cc = 0.244961, Tb = 491.76, Tm = 0, TT = 0, TP = 0, MW = 152.1494, LVB = 0.1385, AF = 0.41299, SP = 19646.23, DM = 0, SH = -61100000.0, IGHF = 1.345156E+08, GEF = 1.178139E+08, AS = 931814.4, HFMP = 0, HOC = -4.252756, LiqDen = {0, 0, 0, 0, 0, 0}, VP = {10, 23.07041, 5677.005, 0, 0, 0}, LiqCp = {0, 0, 0, 0, 0, 0}, HOV = {106, 4.6776E+07, 0.38, 0, 0, 0}, VapCp = {4, -37380, 589.92, -0.3882, 0.0000976, 0}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {0, 0, 0, 0, 0, 0}, LiqK = {16, 0, 0, 0, 0, 0}, VapK = {0, 0, 0, 0, 0, 0}, Racketparam = 0.244961, UniquacR = 5.5028, UniquacQ = 4.358, ChaoSeadAF = 0.41299, ChaoSeadSP = 0, ChaoSeadLV = 0.1385); +end MethylPhenylCarbonate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylacetate.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylacetate.mo new file mode 100644 index 0000000..7ca3eef --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylacetate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylacetate + extends General_Properties(SN = 64, name = "Methylacetate", CAS = "79-20-9", Tc = 506.8, Pc = 4690000, Vc = 0.228, Cc = 0.254, Tb = 330.09, Tm = 175.15, TT = 175.15, TP = 1.01703, MW = 74.079, LVB = 0.07989, AF = 0.323, SP = 19350, DM = 5.6E-30, SH = 20230000.0, IGHF = -4.119E+08, GEF = -3.242E+08, AS = 319800, HFMP = 7970000, HOC = -1.461E+09, LiqDen = {105, 0.98331, 0.2428, 506.86, 0.2549, 0}, VP = {101, 83.01817, -6288.581, -9.185862, 7.595367E-06, 2}, LiqCp = {16, 6314.4, 680.3, 4.1767, 0.026148, -0.000027341}, HOV = {106, 4.9929E+07, 0.79197, -0.73136, 0.37429, -0.019974}, VapCp = {16, 62235, -685.05, 12.348, 0.00012363, -8.5641E-08}, LiqVis = {101, 11.12, -100.13, -3.2745, -5.3051E-07, 2}, VapVis = {102, 0.0000013226, 0.48849, 504.21, 4.2341, 0}, LiqK = {16, -0.28416, 27.186, -0.94457, 0.00083974, -0.0000024412}, VapK = {102, -23257, -0.1738, 1.0287E+07, -6.9243E+10, 0}, Racketparam = 0, UniquacR = 2.8, UniquacQ = 2.58, ChaoSeadAF = 0.326, ChaoSeadSP = 19435.1, ChaoSeadLV = 0.0798903); +end Methylacetate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylacetylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylacetylene.mo new file mode 100644 index 0000000..9cad78e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylacetylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylacetylene + extends General_Properties(SN = 59, name = "Methylacetylene", CAS = "74-99-7", Tc = 402.4, Pc = 5630000, Vc = 0.1635, Cc = 0.275, Tb = 250.12, Tm = 170.45, TT = 170.45, TP = 414.934, MW = 40.065, LVB = 0.06231, AF = 0.214, SP = 15870, DM = 2.61E-30, SH = 184900000.0, IGHF = 1.849E+08, GEF = 1.9384E+08, AS = 248360, HFMP = 5350000, HOC = -1.8487E+09, LiqDen = {105, 1.5983, 0.26361, 402.4, 0.27835, 0}, VP = {101, 68.97649, -4285.953, -7.418705, 0.000010515, 2}, LiqCp = {16, 85291, 38.538, 6.7428, 0.016885, -0.000022161}, HOV = {106, 3.4954E+07, 0.52948, 0.26449, -0.89434, 0.5174}, VapCp = {16, 34169.26, -350.7621, 11.18743, 0.000684714, -2.185041E-07}, LiqVis = {101, -0.91891, 242.44, -1.5439, 5.0147E-07, 2}, VapVis = {102, 0.0000010586, 0.48791, 277.58, 3995.6, 0}, LiqK = {16, 0.065025, -121.87, -0.025752, -0.0097723, 0.0000047452}, VapK = {102, 0.00029245, 0.88088, 248.57, 78809, 0}, Racketparam = 0.2703, UniquacR = 2.1931, UniquacQ = 1.936, ChaoSeadAF = 0.2176, ChaoSeadSP = 18393.2, ChaoSeadLV = 0.0596157); +end Methylacetylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylal.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylal.mo new file mode 100644 index 0000000..b1491b0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylal.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylal + extends General_Properties(SN = 423, name = "Methylal", CAS = "109-87-5", Tc = 480.6, Pc = 3950000, Vc = 0.213, Cc = 0.211, Tb = 315, Tm = 168, TT = 168.35, TP = 1.13284, MW = 76.0944, LVB = 0.0891275, AF = 0.285565, SP = 17430, DM = 2.47E-30, SH = -61100000.0, IGHF = -3.482E+08, GEF = -2.263E+08, AS = 335700, HFMP = 8330000, HOC = -1.7998E+09, LiqDen = {105, 1.4351, 0.30572, 480.6, 0.31739, 0}, VP = {101, 62.15058, -5217.94, -5.982976, 3.491239E-06, 2}, LiqCp = {16, 134330, 575.02, 0.73414, 0.035906, -0.00003541}, HOV = {106, 4.956236E+07, 0.517705, 0.708214, -1.530256, 0.744705}, VapCp = {16, 73387, -1249, 14.774, -0.0029552, 0.0000012399}, LiqVis = {101, -8.4058, 722.36, -0.36572, 2.4819E-07, 2}, VapVis = {102, 4.8512E-07, 0.60235, 248.43, -1208.9, 0}, LiqK = {16, 0.11543, -776.65, 7.882, -0.041206, 0.000038121}, VapK = {102, 0.0014869, 0.65846, 470.64, 206460, 0}, Racketparam = 0.211, UniquacR = 2.964403, UniquacQ = 2.716, ChaoSeadAF = 0.285565, ChaoSeadSP = 17430, ChaoSeadLV = 0.0891275); +end Methylal; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylamine.mo new file mode 100644 index 0000000..d74438f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylamine + extends General_Properties(SN = 33, name = "Methylamine", CAS = "74-89-5", Tc = 430, Pc = 7420000, Vc = 0.125, Cc = 0.259, Tb = 266.82, Tm = 179.69, TT = 179.69, TP = 176.712, MW = 31.057, LVB = 0.04734, AF = 0.284, SP = 21270, DM = 4.37E-30, SH = -22970000.0, IGHF = -2.297E+07, GEF = 3.207E+07, AS = 243300, HFMP = 6134000, HOC = -9.7508E+08, LiqDen = {105, 1.39, 0.21405, 430.05, 0.2275, 0}, VP = {101, 74.79969, -5067.174, -8.028002, 7.988835E-06, 2}, LiqCp = {16, 90815, 374.96, 2.7431, 0.031527, -0.000044978}, HOV = {106, 4.6499E+07, 1.6058, -3.2311, 3.4082, -1.3345}, VapCp = {16, 40540, -902.15, 12.495, -0.00072761, 0.0000002382}, LiqVis = {101, 9.645, 448.12, -3.737, 0.000017508, 2}, VapVis = {102, 5.4475E-07, 0.58715, 230.63, -2982.2, 0}, LiqK = {16, 0.19876, 9592, -137.2, 0.62482, -0.00097954}, VapK = {102, -51.979, 1.0721, -4.4966E+08, 4.2697E+09, 0}, Racketparam = 0, UniquacR = 1.5959, UniquacQ = 1.544, ChaoSeadAF = 0.281272, ChaoSeadSP = 23116, ChaoSeadLV = 0.0447131); +end Methylamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylchloride.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylchloride.mo new file mode 100644 index 0000000..4b3d47f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylchloride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylchloride + extends General_Properties(SN = 29, name = "Methylchloride", CAS = "74-87-3", Tc = 416.2, Pc = 6680000, Vc = 0.143, Cc = 0.276, Tb = 248.95, Tm = 175.45, TT = 175.43, TP = 867.6, MW = 50.488, LVB = 0.05059, AF = 0.151, SP = 17320, DM = 6.24E-30, SH = -81960000.0, IGHF = -8.196E+07, GEF = -5.844E+07, AS = 234180, HFMP = 6548000, HOC = -6.7538E+08, LiqDen = {105, 1.6672, 0.24865, 416.26, 0.26843, 0}, VP = {101, 73.95113, -4332.347, -8.308415, 0.0000132119, 2}, LiqCp = {16, 72914, 778.6, -9.5627, 0.081286, -0.000092921}, HOV = {106, 3.0406E+07, 0.41721, -0.045158, -0.067629, 0.055437}, VapCp = {16, 32790.34, -743.4513, 11.51178, -0.0000302967, 1.138778E-09}, LiqVis = {101, -60.189, 2252.1, 8.022, -0.000019477, 2}, VapVis = {102, 8.5916E-08, 0.87071, 35.619, 35.603, 0}, LiqK = {16, -0.22503, 12.649, -0.64685, -0.0003032, -0.0000029812}, VapK = {102, -22144, 0.7661, -4.8548E+10, -3.7839E+10, 0}, Racketparam = 0, UniquacR = 1.667106, UniquacQ = 1.568, ChaoSeadAF = 0.153068, ChaoSeadSP = 19719.7, ChaoSeadLV = 0.0501264); +end Methylchloride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylcyclohexane.mo new file mode 100644 index 0000000..24499ec --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylcyclohexane + extends General_Properties(SN = 144, name = "Methylcyclohexane", CAS = "108-87-2", Tc = 572.19, Pc = 3471000, Vc = 0.368, Cc = 0.268, Tb = 374.09, Tm = 146.58, TT = 146.58, TP = 0.000152251, MW = 98.188, LVB = 0.12835, AF = 0.235, SP = 16060, DM = 0, SH = -168070000.0, IGHF = -1.548E+08, GEF = 2.733E+07, AS = 343300, HFMP = 6751000, HOC = -4.25714E+09, LiqDen = {105, 0.54994, 0.23476, 572.19, 0.25237, 0}, VP = {101, 84.02524, -6720.084, -9.367446, 6.892527E-06, 2}, LiqCp = {16, 121540, -7.0302, 8.197, 0.012761, -0.000010388}, HOV = {106, 5.3741E+07, 0.65698, 0.0050875, -0.53082, 0.29149}, VapCp = {16, 82902, -804.58, 13.697, -0.00042977, 1.1051E-07}, LiqVis = {101, -11.411, 1214.3, 0.0090457, -0.0000000327, 2}, VapVis = {102, 6.5256E-07, 0.52942, 310.39, 23.825, 0}, LiqK = {16, 0.035771, -249.64, 0.10904, -0.0066567, 0.0000013937}, VapK = {102, 0.000074754, 1.119, 613.15, 22882, 0}, Racketparam = 0.2699, UniquacR = 4.72, UniquacQ = 3.776, ChaoSeadAF = 0.2421, ChaoSeadSP = 16016.26, ChaoSeadLV = 0.1283); +end Methylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylcyclopentane.mo new file mode 100644 index 0000000..f7b3ffb --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylcyclopentane + extends General_Properties(SN = 131, name = "Methylcyclopentane", CAS = "96-37-7", Tc = 532.79, Pc = 3784000, Vc = 0.319, Cc = 0.272, Tb = 344.98, Tm = 130.73, TT = 130.73, TP = 0.000224525, MW = 84.161, LVB = 0.11313, AF = 0.227, SP = 16100, DM = 0, SH = -168070000.0, IGHF = -1.062E+08, GEF = 3.63E+07, AS = 339900, HFMP = 6929000, HOC = -3.6741E+09, LiqDen = {105, 0.63455, 0.23477, 532.79, 0.24394, 0}, VP = {101, 63.18203, -5470.368, -6.215132, 4.384737E-06, 2}, LiqCp = {16, 102830, 317.53, 4.999, 0.022368, -0.000020298}, HOV = {106, 4.986429E+07, 0.75425, -0.186227, -0.50621, 0.35999}, VapCp = {16, 55624, -676.34, 13.207, -0.0001363, 2.6321E-08}, LiqVis = {101, -9.2288, 846.65, -0.18612, -0.0000022383, 2}, VapVis = {102, 0.0000009078, 0.495, 355.78, 10.622, 0}, LiqK = {16, -0.040815, 4.4808, -1.5434, -0.00050494, -0.0000017671}, VapK = {102, 0.0076653, 0.48521, 479.72, 658190, 0}, Racketparam = 0, UniquacR = 3.97, UniquacQ = 3.01, ChaoSeadAF = 0.2346, ChaoSeadSP = 16057.17, ChaoSeadLV = 0.1131); +end Methylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylethanolamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylethanolamine.mo new file mode 100644 index 0000000..768126b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylethanolamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylethanolamine + extends General_Properties(SN = 377, name = "Methylethanolamine", CAS = "109-83-1", Tc = 630, Pc = 5300000, Vc = 0.25901, Cc = 0.262, Tb = 432.388, Tm = 268.65, TT = 268.65, TP = 11.1091, MW = 75.112, LVB = 0.082206, AF = 0.604, SP = 25930, DM = 7.2E-30, SH = -22600000.0, IGHF = -1.98E+08, GEF = -6.11E+07, AS = 344000, HFMP = 8760000, HOC = -2.01E+09, LiqDen = {105, 0.982868, 0.255663, 630, 0.231239, 0}, VP = {101, 101.1268, -9896.461, -11.12231, 4.333878E-06, 2}, LiqCp = {4, 65879.9, 415.0007, 0.00004583, 2.109E-09, -0.0000030816}, HOV = {106, 8.3715E+07, 1.1304, -1.7736, 1.7333, -0.66961}, VapCp = {16, 50351, -464.92, 12.353, 0.00032078, -1.1521E-07}, LiqVis = {101, -8.8113, 2947, -0.99316, 4.0603E-07, 2}, VapVis = {102, 2.1919E-07, 0.70935, 211, -8775.4, 0}, LiqK = {16, -0.011378, -96.849, -0.47605, -0.0029428, 4.7129E-07}, VapK = {102, 0.00021463, 0.94857, 622.07, 15372, 0}, Racketparam = 0.262, UniquacR = 3.7825, UniquacQ = 3.524, ChaoSeadAF = 0.604, ChaoSeadSP = 25930, ChaoSeadLV = 0.082206); +end Methylethanolamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylethylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylethylether.mo new file mode 100644 index 0000000..ca2b041 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylethylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylethylether + extends General_Properties(SN = 326, name = "Methylethylether", CAS = "540-67-0", Tc = 437.8, Pc = 4400000, Vc = 0.221, Cc = 0.267, Tb = 280.5, Tm = 160, TT = 160, TP = 7.85121, MW = 60.096, LVB = 0.08585, AF = 0.236, SP = 15370, DM = 4.1E-30, SH = -216400000.0, IGHF = -2.164E+08, GEF = -1.177E+08, AS = 308810, HFMP = 7980000, HOC = -1.9314E+09, LiqDen = {105, 1.1195, 0.26367, 437.86, 0.25231, 0}, VP = {101, 63.84, -4659.2, -6.4137, 0.0000057727, 2}, LiqCp = {16, 109050, -31.645, 7.7783, 0.0084684, 0.0000041202}, HOV = {106, 1.3679E+08, 9.4948, -25.655, 28.424, -11.603}, VapCp = {16, 60571, -557.18, 12.079, 0.00048084, -1.7581E-07}, LiqVis = {101, -11.138, 628.05, 0.042345, -2.0281E-08, 2}, VapVis = {102, 2.9661E-07, 0.6716, 174.02, -2778.1, 0}, LiqK = {16, 0.029003, 34.124, -1.9356, 0.0010295, -0.0000079939}, VapK = {102, 0.00021058, 0.94472, 515.36, 8108.3, 0}, Racketparam = 0.267, UniquacR = 2.7205, UniquacQ = 2.476, ChaoSeadAF = 0.236, ChaoSeadSP = 15370, ChaoSeadLV = 0.08585); +end Methylethylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylethylketone.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylethylketone.mo new file mode 100644 index 0000000..6b751b0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylethylketone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylethylketone + extends General_Properties(SN = 83, name = "Methylethylketone", CAS = "78-93-3", Tc = 536.8, Pc = 4210000, Vc = 0.267, Cc = 0.252, Tb = 352.71, Tm = 186.48, TT = 186.48, TP = 1.3904, MW = 72.107, LVB = 0.09013, AF = 0.322, SP = 18880, DM = 9.21E-30, SH = -17100000.0, IGHF = -2.39E+08, GEF = -1.47E+08, AS = 339400, HFMP = 8385000, HOC = -2.268E+09, LiqDen = {105, 0.16518, 0.10716, 536.8, 0.15066, 0}, VP = {101, 84.00012, -6498.964, -9.389584, 8.32043E-06, 2}, LiqCp = {16, 137210, 245.98, 6.3249, 0.009404, 3.3143E-07}, HOV = {106, 4.7221E+07, 0.30759, 0.48591, -0.8645, 0.45018}, VapCp = {16, 69404, -545.04, 12.139, 0.00045578, -1.6351E-07}, LiqVis = {101, -0.60519, 503.02, -1.5659, 5.5782E-08, 2}, VapVis = {102, 2.8817E-08, 0.96765, -28.58, 7703, 0}, LiqK = {16, -0.17871, 4.3086, -1.0343, 0.00010801, -0.0000015411}, VapK = {102, -4970700, -0.23106, 2.2577E+09, -1.0834E+13, 0}, Racketparam = 0, UniquacR = 3.25, UniquacQ = 2.88, ChaoSeadAF = 0.3241, ChaoSeadSP = 18878.7, ChaoSeadLV = 0.0901936); +end Methylethylketone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylethylsulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylethylsulfide.mo new file mode 100644 index 0000000..9b61edc --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylethylsulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylethylsulfide + extends General_Properties(SN = 354, name = "Methylethylsulfide", CAS = "624-89-5", Tc = 533, Pc = 4260000, Vc = 0.26, Cc = 0.25, Tb = 339.8, Tm = 167.24, TT = 167.23, TP = 0.224563, MW = 76.163, LVB = 0.09102, AF = 0.208, SP = 18010, DM = 5.34E-30, SH = -22600000.0, IGHF = -5.93E+07, GEF = 1.19E+07, AS = 332100, HFMP = 9761000, HOC = -2.3531E+09, LiqDen = {105, 1.067, 0.27102, 533, 0.29364, 0}, VP = {101, 84.44792, -6287.173, -9.497514, 8.101952E-06, 2}, LiqCp = {16, 128430, 1340.2, -7.9347, 0.062009, -0.00006022}, HOV = {106, 5.1014E+07, 1.045, -1.3834, 1.1914, -0.41055}, VapCp = {16, 65018, -602.45, 12.269, 0.00023938, -9.0299E-08}, LiqVis = {101, -11.137, 871.68, 0.048227, -1.2198E-07, 2}, VapVis = {102, 1.5396E-07, 0.76205, 156.76, -5273.3, 0}, LiqK = {16, -0.050172, -1.1207, -1.3208, -0.00082247, -0.0000013076}, VapK = {102, 0.0034168, 0.62158, 1811.6, 162180, 0}, Racketparam = 0.25, UniquacR = 3.1885, UniquacQ = 2.756, ChaoSeadAF = 0.208, ChaoSeadSP = 18010, ChaoSeadLV = 0.09102); +end Methylethylsulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylformate.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylformate.mo new file mode 100644 index 0000000..8e189c6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylformate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylformate + extends General_Properties(SN = 49, name = "Methylformate", CAS = "107-31-3", Tc = 487.2, Pc = 6000000, Vc = 0.172, Cc = 0.255, Tb = 304.9, Tm = 174.15, TT = 174.15, TP = 6.88085, MW = 60.053, LVB = 0.06214, AF = 0.253, SP = 20500, DM = 5.9E-30, SH = -52630000.0, IGHF = -3.524E+08, GEF = -2.95E+08, AS = 285200, HFMP = 7531000, HOC = -8.924E+08, LiqDen = {105, 1.213, 0.23619, 487.2, 0.24621, 0}, VP = {101, 70.6458, -5401.751, -7.334787, 5.934343E-06, 2}, LiqCp = {16, 97064, 3377.4, -42.373, 0.22648, -0.00029763}, HOV = {106, 7.0578E+07, 3.7855, -9.0874, 9.6043, -3.7868}, VapCp = {16, 41319, -570.15, 12.038, -0.000034216, -2.7109E-11}, LiqVis = {101, -9.949, 1214.4, -0.53562, 0.000010346, 2}, VapVis = {102, 0.0000069776, 0.31537, 1034.6, 13.293, 0}, LiqK = {16, 0.0090363, 23.594, -1.5627, 0.00089283, -0.0000058101}, VapK = {102, -817050, -0.23016, 2.5314E+08, -1.5205E+12, 0}, Racketparam = 0, UniquacR = 2.1431, UniquacQ = 2.036, ChaoSeadAF = 0.257, ChaoSeadSP = 20503.4, ChaoSeadLV = 0.0620841); +end Methylformate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methyliodide.mo b/Simulator/Simulator/Files/Chemsep_Database/Methyliodide.mo new file mode 100644 index 0000000..c0377d6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methyliodide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methyliodide + extends General_Properties(SN = 30, name = "Methyliodide", CAS = "74-88-4", Tc = 528, Pc = 7370000, Vc = 0.185, Cc = 0.311, Tb = 315.58, Tm = 206.7, TT = 206.7, TP = 254.555, MW = 141.939, LVB = 0.062667, AF = 0.19716, SP = 20180, DM = 5.4E-30, SH = -81960000.0, IGHF = 1.3E+07, GEF = 1.47E+07, AS = 254000, HFMP = 0, HOC = -7.096E+08, LiqDen = {105, 1.3975, 0.25854, 528, 0.2679, 0}, VP = {101, 56.57754, -4804.529, -5.238128, 3.097144E-06, 2}, LiqCp = {16, 81227, -510450, 4831.2, -15.234, 0.016088}, HOV = {106, 3.3737E+07, -0.25822, 1.7219, -2.0034, 0.83642}, VapCp = {16, 33243, -588.89, 11.23, 0.00016737, -5.0885E-08}, LiqVis = {101, -8.0691, 650.82, -0.30881, -1.1201E-07, 2}, VapVis = {102, 7.1469E-07, 0.6322, 292.39, -1664.7, 0}, LiqK = {16, 0.025022, -2.7147, -2.1673, -0.0005511, -0.000004231}, VapK = {102, 0.15913, 0.010769, 1577.4, 2109400, 0}, Racketparam = 0, UniquacR = 2.1651, UniquacQ = 1.84, ChaoSeadAF = 0.192721, ChaoSeadSP = 20172.3, ChaoSeadLV = 0.062667); +end Methyliodide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylisobutylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylisobutylether.mo new file mode 100644 index 0000000..f4eeb76 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylisobutylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylisobutylether + extends General_Properties(SN = 329, name = "Methylisobutylether", CAS = "625-44-5", Tc = 497, Pc = 3410000, Vc = 0.329, Cc = 0.272, Tb = 331.7, Tm = 0, TT = 0, TP = 0, MW = 88.1482, LVB = 0.121242, AF = 0.307786, SP = 15100, DM = 4.7E-30, SH = -216400000.0, IGHF = -2.66E+08, GEF = -1.07E+08, AS = 381000, HFMP = 0, HOC = -3.122E+09, LiqDen = {105, 0.83514, 0.27544, 497, 0.27525, 0}, VP = {101, 67.83965, -5584.772, -6.90156, 5.177794E-06, 2}, LiqCp = {16, 156890, 481.87, 3.1798, 0.023292, -0.000015219}, HOV = {106, 4.281E+07, 0.34436, 0.050812, -0.029168, 0.014527}, VapCp = {16, 84480, -573.48, 12.645, 0.00036001, -1.6026E-07}, LiqVis = {101, -6.5049, 776.05, -0.79051, 0.0000029469, 2}, VapVis = {102, 2.7344E-07, 0.65828, 203.42, -5560.1, 0}, LiqK = {16, -0.1664, 6.1773, -1.0308, -0.0004394, -9.9213E-07}, VapK = {102, 0.00016088, 0.97231, 471.48, 30281, 0}, Racketparam = 0.272, UniquacR = 4.0685, UniquacQ = 3.552, ChaoSeadAF = 0.307786, ChaoSeadSP = 15100, ChaoSeadLV = 0.121242); +end Methylisobutylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylisobutylketone.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylisobutylketone.mo new file mode 100644 index 0000000..4cedc2f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylisobutylketone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylisobutylketone + extends General_Properties(SN = 307, name = "Methylisobutylketone", CAS = "108-10-1", Tc = 574.6, Pc = 3270000, Vc = 0.3406, Cc = 0.256, Tb = 389.15, Tm = 189.15, TT = 189.15, TP = 0.0698742, MW = 100.161, LVB = 0.12581, AF = 0.352, SP = 17420, DM = 9.0E-30, SH = -1209000000.0, IGHF = -2.88E+08, GEF = -1.351E+08, AS = 407000, HFMP = 9710000, HOC = -3.49E+09, LiqDen = {105, 0.70438, 0.26215, 574.6, 0.2872, 0}, VP = {101, 151.9969, -9958.63, -19.68914, 0.0000167819, 2}, LiqCp = {16, 93433, -8.9197, 10.885, 0.0029916, -6.6769E-07}, HOV = {106, 2.7929E+07, -4.5647, 14.372, -16.097, 6.5387}, VapCp = {16, 97540, -634.68, 12.939, 0.000018497, -1.9665E-08}, LiqVis = {101, -9.5441, 1138.8, -0.34128, 0.0000016581, 2}, VapVis = {102, 2.9033E-07, 0.63516, 190.41, 3013.2, 0}, LiqK = {16, 0.05085, -96.32, -0.95078, -0.0031661, -0.0000020547}, VapK = {102, -874190, 0.020464, 1.7911E+07, -8.1274E+12, 0}, Racketparam = 0.256, UniquacR = 4.5959, UniquacQ = 3.952, ChaoSeadAF = 0.352, ChaoSeadSP = 17420, ChaoSeadLV = 0.12581); +end Methylisobutylketone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylisopropylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylisopropylether.mo new file mode 100644 index 0000000..c961655 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylisopropylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylisopropylether + extends General_Properties(SN = 330, name = "Methylisopropylether", CAS = "598-53-8", Tc = 464.48, Pc = 3762000, Vc = 0.276, Cc = 0.269, Tb = 303.92, Tm = 127.93, TT = 127.93, TP = 0.00332352, MW = 74.1216, LVB = 0.1046, AF = 0.26555, SP = 15160, DM = 4.16E-30, SH = -216400000.0, IGHF = -2.52E+08, GEF = -1.209E+08, AS = 338300, HFMP = 5850000, HOC = -2.5311E+09, LiqDen = {105, 0.82094, 0.24798, 464.48, 0.26184, 0}, VP = {101, 61.57822, -4874.158, -6.034163, 5.097159E-06, 2}, LiqCp = {16, 123760, 190.2, 5.9878, 0.016259, -0.000010176}, HOV = {106, 4.2811E+07, 1.2196, -2.6572, 3.1706, -1.3477}, VapCp = {16, 84263, -798.1, 12.945, -0.00018216, 3.6316E-08}, LiqVis = {101, -10.884, 730.8, -0.038881, 2.6764E-07, 2}, VapVis = {102, 1.9275E-07, 0.70897, 109.56, -107.54, 0}, LiqK = {16, -0.21567, 5.2547, -0.85956, -0.00045627, -9.7493E-07}, VapK = {102, 1.3675, -0.14071, 1446.2, 3030500, 0}, Racketparam = 0.269, UniquacR = 3.3941, UniquacQ = 3.012, ChaoSeadAF = 0.26555, ChaoSeadSP = 15160, ChaoSeadLV = 0.1046); +end Methylisopropylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylisopropylketone.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylisopropylketone.mo new file mode 100644 index 0000000..cc32bfd --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylisopropylketone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylisopropylketone + extends General_Properties(SN = 112, name = "Methylisopropylketone", CAS = "563-80-4", Tc = 567.7, Pc = 3620000, Vc = 0.31, Cc = 0.238, Tb = 367.55, Tm = 180.15, TT = 180.15, TP = 0.295357, MW = 86.134, LVB = 0.10791, AF = 0.216, SP = 17710, DM = 9.21E-30, SH = -27600000.0, IGHF = -2.626E+08, GEF = -1.393E+08, AS = 369900, HFMP = 9343000, HOC = -2.877E+09, LiqDen = {105, 0.22922, 0.13849, 567.7, 0.18207, 0}, VP = {101, 57.033, -5794.3, -5.09, 0.0000023975, 2}, LiqCp = {16, 142840, 463.87, 4.1439, 0.020347, -0.000013989}, HOV = {106, 1.3282E+07, -7.596951, 21.963, -24.77369, 10.66731}, VapCp = {16, 65899, -628.39, 12.858, 0.000023331, -5.0246E-08}, LiqVis = {101, -11.042, 1043.1, -0.038423, 1.1535E-07, 2}, VapVis = {102, 1.5484E-07, 0.72865, 149.15, -3826.1, 0}, LiqK = {16, -0.11038, 18.412, -1.2824, -0.000057222, -0.000001541}, VapK = {102, -6058400, -0.090573, 3.176E+09, -2.84E+13, 0}, Racketparam = 0.259, UniquacR = 3.9215, UniquacQ = 3.412, ChaoSeadAF = 0.350039, ChaoSeadSP = 18253.3, ChaoSeadLV = 0.106975); +end Methylisopropylketone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylmercaptan.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylmercaptan.mo new file mode 100644 index 0000000..da714d8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylmercaptan.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylmercaptan + extends General_Properties(SN = 348, name = "Methylmercaptan", CAS = "74-93-1", Tc = 470, Pc = 7230000, Vc = 0.145, Cc = 0.268, Tb = 279.11, Tm = 150.18, TT = 150.18, TP = 3.14785, MW = 48.109, LVB = 0.05552, AF = 0.15, SP = 19470, DM = 5.07E-30, SH = -22600000.0, IGHF = -2.26E+07, GEF = -9920000, AS = 255000, HFMP = 5904000, HOC = -1.1517E+09, LiqDen = {105, 1.954, 0.28171, 470, 0.28737, 0}, VP = {101, 115.1598, -6300.053, -14.66478, 0.0000195265, 2}, LiqCp = {16, 87318, -59222, 550.29, -1.6599, 0.001702}, HOV = {106, 3.221375E+07, -0.00310105, 0.657759, -0.0249162, -0.340052}, VapCp = {16, 38535, -588.35, 11.232, 0.00044782, -1.6363E-07}, LiqVis = {101, -8.947, 607.01, -0.26447, 0.0000011807, 2}, VapVis = {102, 1.9969E-07, 0.74097, 130.67, -839.04, 0}, LiqK = {16, -0.011242, -11.424, -1.1701, -0.0017729, -0.0000012043}, VapK = {102, 0.000024689, 1.1702, 4.7184, 35466, 0}, Racketparam = 0.268, UniquacR = 1.877, UniquacQ = 1.676, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); +end Methylmercaptan; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylmethacrylate.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylmethacrylate.mo new file mode 100644 index 0000000..a8107b1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylmethacrylate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylmethacrylate + extends General_Properties(SN = 407, name = "Methylmethacrylate", CAS = "80-62-6", Tc = 563.15, Pc = 3670000, Vc = 0.324, Cc = 0.253, Tb = 374.15, Tm = 225.15, TT = 225.6, TP = 19.0855, MW = 100.116, LVB = 0.106736, AF = 0.280233, SP = 18530, DM = 6.57E-30, SH = -61100000.0, IGHF = -3.6E+08, GEF = -2.54E+08, AS = 401000, HFMP = 1.44348E+07, HOC = -2.54E+09, LiqDen = {105, 0.91648, 0.27205, 563.15, 0.3201, 0}, VP = {101, 129.5007, -8907.818, -16.17497, 0.000012098, 2}, LiqCp = {16, 45251, 733.56, 4.0201, 0.024183, -0.000020347}, HOV = {106, 5.397285E+07, -0.0862845, 1.857786, -2.127696, 0.775243}, VapCp = {16, 40862.92, -408.0793, 12.53452, 0.000265188, -1.105927E-07}, LiqVis = {101, -8.2342, 780.75, -0.30393, -0.0000019127, 2}, VapVis = {102, 4.0508E-07, 0.64362, 435.99, -25064, 0}, LiqK = {16, 0.093744, -51.297, -0.18289, -0.0078351, -0.0000030405}, VapK = {102, 0.0023506, 0.61168, 848.43, 252520, 0}, Racketparam = 0.253, UniquacR = 3.9215, UniquacQ = 3.564, ChaoSeadAF = 0.280233, ChaoSeadSP = 18530, ChaoSeadLV = 0.106736); +end Methylmethacrylate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylnpropylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylnpropylether.mo new file mode 100644 index 0000000..d8a045a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylnpropylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylnpropylether + extends General_Properties(SN = 327, name = "Methylnpropylether", CAS = "557-17-5", Tc = 472, Pc = 3801000, Vc = 0.274, Cc = 0.265, Tb = 312.29, Tm = 123.15, TT = 133.97, TP = 0.00289599, MW = 74.1216, LVB = 0.1032, AF = 0.276999, SP = 15730, DM = 4.14E-30, SH = -216400000.0, IGHF = -2.379E+08, GEF = -1.108E+08, AS = 352000, HFMP = 7670000, HOC = -2.517E+09, LiqDen = {105, 1.1427, 0.28927, 472, 0.3185, 0}, VP = {101, 59.81269, -4968.626, -5.703041, 3.962175E-06, 2}, LiqCp = {16, 136920, 43.97, 5.0864, 0.024992, -0.000027384}, HOV = {106, 4.425282E+07, 0.586164, -0.378014, 0.582618, -0.440041}, VapCp = {16, 93668, -926.82, 13.189, -0.0004818, 0.000000144}, LiqVis = {101, -11.301, 802.09, 0.054938, -4.1844E-07, 2}, VapVis = {102, 1.0896E-07, 0.78578, 98.829, -6562.3, 0}, LiqK = {16, -0.0079788, 3.9001, -1.4224, -0.0010693, -0.0000025315}, VapK = {102, 0.010718, 0.485, 2083.9, 283110, 0}, Racketparam = 0.265, UniquacR = 3.3949, UniquacQ = 3.016, ChaoSeadAF = 0.276999, ChaoSeadSP = 15730, ChaoSeadLV = 0.1032); +end Methylnpropylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylnpropylsulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylnpropylsulfide.mo new file mode 100644 index 0000000..a122990 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylnpropylsulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylnpropylsulfide + extends General_Properties(SN = 355, name = "Methylnpropylsulfide", CAS = "3877-15-4", Tc = 552, Pc = 3800000, Vc = 0.322, Cc = 0.259, Tb = 368.69, Tm = 160.17, TT = 160.17, TP = 0.00425588, MW = 90.1872, LVB = 0.107699, AF = 0.356915, SP = 17710, DM = 5.5E-30, SH = -22600000.0, IGHF = -8.19E+07, GEF = 1.793E+07, AS = 371700, HFMP = 9912000, HOC = -2.962E+09, LiqDen = {105, 1.528, 0.35328, 552, 0.39953, 0}, VP = {101, 83.78969, -6786.538, -9.267875, 6.742312E-06, 2}, LiqCp = {16, 140680, 477.81, 3.8109, 0.020949, -0.000014877}, HOV = {106, 5.460643E+07, 0.610381, 0.183873, -0.864255, 0.448129}, VapCp = {16, 76201, -575.5, 12.472, 0.00030373, -1.0224E-07}, LiqVis = {101, -11.683, 983.43, 0.11996, -4.1262E-07, 2}, VapVis = {102, 5.4928E-08, 0.89154, 78.07, -5628.6, 0}, LiqK = {16, -0.062059, 3.0814, -1.3629, -0.00055214, -0.0000012783}, VapK = {102, 0.0023304, 0.67586, 1803.3, 153300, 0}, Racketparam = 0.259, UniquacR = 3.8629, UniquacQ = 3.296, ChaoSeadAF = 0.273669, ChaoSeadSP = 17710, ChaoSeadLV = 0.107699); +end Methylnpropylsulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methylpropionate.mo b/Simulator/Simulator/Files/Chemsep_Database/Methylpropionate.mo new file mode 100644 index 0000000..5774e55 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methylpropionate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methylpropionate + extends General_Properties(SN = 88, name = "Methylpropionate", CAS = "554-12-1", Tc = 530.6, Pc = 4000000, Vc = 0.282, Cc = 0.256, Tb = 352.6, Tm = 185.65, TT = 185.65, TP = 0.634091, MW = 88.106, LVB = 0.09693, AF = 0.349, SP = 18630, DM = 5.681E-30, SH = -17100000.0, IGHF = -4.275E+08, GEF = -3.11E+08, AS = 359600, HFMP = 1.01E+07, HOC = -2.078E+09, LiqDen = {105, 0.72945, 0.23284, 530.6, 0.24422, 0}, VP = {101, 91.97365, -7071.987, -10.4626, 7.767427E-06, 2}, LiqCp = {16, 140380, 1173.7, 0.81056, 0.020863, -0.000005642}, HOV = {106, 7.6303E+07, 2.9196, -6.5593, 6.8235, -2.6926}, VapCp = {16, 11365, -258.45, 12.315, 0.00033508, -7.4281E-08}, LiqVis = {101, -8.2868, 807.93, -0.36444, -0.0000010038, 2}, VapVis = {102, 3.2912E-07, 0.63237, 126.55, 15669, 0}, LiqK = {16, 0.034599, 27.577, -2.1207, 0.00098891, -0.0000051703}, VapK = {102, -197.62, -0.13413, 101740, -8.2156E+08, 0}, Racketparam = 0, UniquacR = 3.4786, UniquacQ = 3.116, ChaoSeadAF = 0.391, ChaoSeadSP = 18626.5, ChaoSeadLV = 0.0969396); +end Methylpropionate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methyltbutylsulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Methyltbutylsulfide.mo new file mode 100644 index 0000000..bb02242 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methyltbutylsulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methyltbutylsulfide + extends General_Properties(SN = 356, name = "Methyltbutylsulfide", CAS = "6163-64-0", Tc = 585, Pc = 3400000, Vc = 0.37, Cc = 0.269, Tb = 372.048, Tm = 190.84, TT = 190.84, TP = 0.818336, MW = 104.214, LVB = 0.12697, AF = 0.107514, SP = 16230, DM = 5.2E-30, SH = -22600000.0, IGHF = -1.209E+08, GEF = 7400000, AS = 414300, HFMP = 8414000, HOC = -3.558E+09, LiqDen = {105, 0.0025324, 0.015967, 585, 0.080614, 0}, VP = {101, 84.46516, -6786.586, -9.396892, 6.668285E-06, 2}, LiqCp = {16, 141210, 178.65, 7.6994, 0.011393, -0.0000080501}, HOV = {106, 6.776086E+07, 2.156989, -4.009149, 3.630339, -1.236406}, VapCp = {16, 87862, -573.15, 12.832, 0.000097962, -4.8038E-08}, LiqVis = {101, -10.768, 996.37, 0.0046964, -1.0865E-08, 2}, VapVis = {102, 1.4934E-07, 0.74231, 170.99, -8263.5, 0}, LiqK = {16, -0.049324, -5.479, -1.3559, -0.00091706, -9.5073E-07}, VapK = {102, 0.00016838, 0.95767, 599.31, 12993, 0}, Racketparam = 0.269, UniquacR = 4.5358, UniquacQ = 3.912, ChaoSeadAF = 0.233365, ChaoSeadSP = 16230, ChaoSeadLV = 0.12697); +end Methyltbutylsulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methyltertbutylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Methyltertbutylether.mo new file mode 100644 index 0000000..ff877c1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methyltertbutylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methyltertbutylether + extends General_Properties(SN = 192, name = "Methyltertbutylether", CAS = "1634-04-4", Tc = 497.1, Pc = 3430000, Vc = 0.329, Cc = 0.273, Tb = 328.35, Tm = 164.55, TT = 164.55, TP = 0.535656, MW = 88.1482, LVB = 0.119887, AF = 0.266059, SP = 15070, DM = 4.54E-30, SH = -168070000.0, IGHF = -2.835E+08, GEF = -1.175E+08, AS = 357800, HFMP = 7600000, HOC = -3.1049E+09, LiqDen = {105, 1.013, 0.29119, 513.95, 0.39929, 0}, VP = {101, 63.31041, -5322.676, -6.212745, 3.951136E-06, 2}, LiqCp = {16, 135550, -54.229, 8.6558, 0.010329, -0.0000078206}, HOV = {106, 7.685222E+07, 4.561833, -12.06881, 13.61234, -5.569118}, VapCp = {16, 89729, -682.14, 12.912, 0.000021441, -2.0192E-08}, LiqVis = {101, -7.136, 821.59, -0.64419, 4.8322E-07, 2}, VapVis = {102, 1.6185E-07, 0.73614, 130.03, -727.78, 0}, LiqK = {16, 0.073008, 306.73, -6.3111, 0.019235, -0.000037933}, VapK = {102, 0.00023034, 0.92128, 391.6, 80274, 0}, Racketparam = 0.267213, UniquacR = 4.0678, UniquacQ = 3.632, ChaoSeadAF = 0.266059, ChaoSeadSP = 15070, ChaoSeadLV = 0.119887); +end Methyltertbutylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methyltertpentylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Methyltertpentylether.mo new file mode 100644 index 0000000..f29beb0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methyltertpentylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methyltertpentylether + extends General_Properties(SN = 193, name = "Methyltertpentylether", CAS = "994-05-8", Tc = 534, Pc = 3040000, Vc = 0.386, Cc = 0.264, Tb = 359.51, Tm = 0, TT = 0, TP = 0, MW = 102.175, LVB = 0.133437, AF = 0.298071, SP = 15480, DM = 4.90339E-30, SH = -168070000.0, IGHF = -3.054E+08, GEF = -1.137E+08, AS = 408000, HFMP = 0, HOC = -3.71229E+09, LiqDen = {105, 0.68843, 0.26574, 534, 0.27067, 0}, VP = {101, 127.09, -8433.7, -15.94, 0.000013112, 2}, LiqCp = {16, 96936, -844.6, 17.426, -0.01423, 0.000014683}, HOV = {106, 6.112039E+07, 2.144847, -4.987322, 5.569725, -2.294462}, VapCp = {16, 86134, -503.3, 12.828, 0.00026316, -9.3404E-08}, LiqVis = {101, -11.271, 991.37, -0.019082, -2.1664E-08, 2}, VapVis = {102, 6.9893E-08, 0.83491, 61.227, -3034.8, 0}, LiqK = {16, -0.10613, 12.391, -1.3082, -0.00026248, -0.0000013654}, VapK = {102, 0.12493, 0.14978, 1706.4, 1349200, 0}, Racketparam = 0.264404, UniquacR = 4.7422, UniquacQ = 4.172, ChaoSeadAF = 0.298071, ChaoSeadSP = 15480, ChaoSeadLV = 0.133437); +end Methyltertpentylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methyltoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/Methyltoluene.mo new file mode 100644 index 0000000..b2bf801 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methyltoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methyltoluene + extends General_Properties(SN = 283, name = "Methyltoluene", CAS = "620-14-4", Tc = 637.15, Pc = 2840000, Vc = 0.49, Cc = 0.254, Tb = 434.48, Tm = 177.61, TT = 177.61, TP = 0.000664959, MW = 120.192, LVB = 0.139685, AF = 0.3232, SP = 17630, DM = 1.1E-30, SH = -1209000000.0, IGHF = -1920000, GEF = 1.2643E+08, AS = 404280, HFMP = 7610000, HOC = -4.94377E+09, LiqDen = {105, 0.61007, 0.26045, 637.15, 0.2946, 0}, VP = {101, 59.906, -6895.5, -5.4176, 0.00000211, 2}, LiqCp = {16, 136340, -1484.6, 20.724, -0.020829, 0.000018949}, HOV = {106, 6.562712E+07, 1.251642, -2.311984, 2.123485, -0.635116}, VapCp = {16, 77831, -586.35, 13.16, 0.0000010287, -1.3417E-08}, LiqVis = {101, -10.732, 1285.7, -0.12931, 2.7444E-07, 2}, VapVis = {102, 4.7246E-07, 0.55389, 274.11, -5848.6, 0}, LiqK = {16, -0.048117, 4.2831, -1.5331, -0.00039971, -0.0000012216}, VapK = {102, 0.000091259, 1.0513, 653.39, 40428, 0}, Racketparam = 0.254, UniquacR = 5.3322, UniquacQ = 4.076, ChaoSeadAF = 0.3232, ChaoSeadSP = 17630, ChaoSeadLV = 0.139685); +end Methyltoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Methyltpentylsulfide.mo b/Simulator/Simulator/Files/Chemsep_Database/Methyltpentylsulfide.mo new file mode 100644 index 0000000..ad1f526 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Methyltpentylsulfide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Methyltpentylsulfide + extends General_Properties(SN = 357, name = "Methyltpentylsulfide", CAS = "13286-92-5", Tc = 632, Pc = 3130000, Vc = 0.412, Cc = 0.259, Tb = 401.15, Tm = 195, TT = 195, TP = 0.0547032, MW = 118.24, LVB = 0.141236, AF = 0.283554, SP = 16850, DM = 5.2E-30, SH = -22600000.0, IGHF = -1.374E+08, GEF = 2.884E+07, AS = 422900, HFMP = 8320000, HOC = -4.171E+09, LiqDen = {105, 0.59566, 0.25918, 632, 0.28571, 0}, VP = {101, 71.41151, -7073.516, -7.244729, 3.628693E-06, 2}, LiqCp = {16, 181970, 283.58, 5.3016, 0.020294, -0.000016827}, HOV = {106, 5.4045E+07, 0.37325, 0, 0, 0}, VapCp = {16, 109660, -656.23, 13.164, -0.000084618, -5.7336E-09}, LiqVis = {101, -11.248, 1169.1, -0.00088104, 1.198E-09, 2}, VapVis = {102, 8.9322E-08, 0.79515, 142.11, -9151.1, 0}, LiqK = {16, -0.059845, -0.6973, -1.3681, -0.00062696, -0.0000008708}, VapK = {102, 0.00014528, 0.96627, 637.8, 13351, 0}, Racketparam = 0.259, UniquacR = 5.2102, UniquacQ = 4.452, ChaoSeadAF = 0.283554, ChaoSeadSP = 16850, ChaoSeadLV = 0.141236); +end Methyltpentylsulfide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Mnitrotoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/Mnitrotoluene.mo new file mode 100644 index 0000000..d471c21 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Mnitrotoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Mnitrotoluene + extends General_Properties(SN = 386, name = "Mnitrotoluene", CAS = "99-08-1", Tc = 734, Pc = 3800000, Vc = 0.441, Cc = 0.275, Tb = 504, Tm = 288.65, TT = 289.2, TP = 6.84272, MW = 137.136, LVB = 0.118913, AF = 0.491987, SP = 21470, DM = 1.41E-29, SH = -22600000.0, IGHF = 2.58E+07, GEF = 1.502E+08, AS = 380800, HFMP = 1.406E+07, HOC = -3.5696E+09, LiqDen = {105, 0.50673, 0.22353, 734, 0.25642, 0}, VP = {101, 174.0974, -13266.49, -22.50751, 0.0000146534, 2}, LiqCp = {16, 165480, 678.6, 2.6976, 0.024579, -0.000018568}, HOV = {106, 1.23147E+08, 2.991682, -5.10633, 3.432299, -0.844633}, VapCp = {16, 126830, -1053.5, 13.982, -0.0011308, 3.2272E-07}, LiqVis = {101, -219.04, 9323.8, 32.506, -0.000040609, 2}, VapVis = {102, 3.6657E-08, 0.9283, 56.912, -1935.8, 0}, LiqK = {16, -0.16653, 2.5129, -1.0577, -0.0003596, -3.0249E-07}, VapK = {102, 0.00013182, 0.95336, 611.68, 32295, 0}, Racketparam = 0.275, UniquacR = 4.2801, UniquacQ = 3.272, ChaoSeadAF = 0.491987, ChaoSeadSP = 21470, ChaoSeadLV = 0.118913); +end Mnitrotoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Monochlorobenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Monochlorobenzene.mo new file mode 100644 index 0000000..8485370 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Monochlorobenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Monochlorobenzene + extends General_Properties(SN = 122, name = "Monochlorobenzene", CAS = "108-90-7", Tc = 632.4, Pc = 4520000, Vc = 0.308, Cc = 0.265, Tb = 404.91, Tm = 227.95, TT = 227.95, TP = 8.4456, MW = 112.558, LVB = 0.10222, AF = 0.251, SP = 19350, DM = 5.64E-30, SH = -168070000.0, IGHF = 5.109E+07, GEF = 9.829E+07, AS = 314030, HFMP = 9556000, HOC = -2.976E+09, LiqDen = {105, 0.78287, 0.25464, 632.4, 0.26342, 0}, VP = {101, 51.41334, -6020.539, -4.204143, 1.293848E-06, 2}, LiqCp = {16, 139150, -333.42, 10.906, -0.018036, 0.000054846}, HOV = {106, 4.9039E+07, 0.24473, -0.048652, 0.40537, -0.25012}, VapCp = {16, 74680, -1001.5, 13.827, -0.0014014, 4.6413E-07}, LiqVis = {101, 0.029483, 556.49, -1.5963, 1.2171E-07, 2}, VapVis = {102, 1.1217E-07, 0.79382, 109.37, 1134.4, 0}, LiqK = {16, 0.083427, -157.94, -0.89724, -0.0049259, -0.0000027589}, VapK = {102, 0.0004167, 0.92033, 1902.9, 123750, 0}, Racketparam = 0, UniquacR = 3.79, UniquacQ = 2.84, ChaoSeadAF = 0.2459, ChaoSeadSP = 19345.3, ChaoSeadLV = 0.10229); +end Monochlorobenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Monoethanolamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Monoethanolamine.mo new file mode 100644 index 0000000..3cb29bd --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Monoethanolamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Monoethanolamine + extends General_Properties(SN = 367, name = "Monoethanolamine", CAS = "141-43-5", Tc = 671.4, Pc = 8030000, Vc = 0.225, Cc = 0.284, Tb = 444.15, Tm = 283.65, TT = 283.65, TP = 13.3683, MW = 61.0831, LVB = 0.0603415, AF = 0.550815, SP = 31830, DM = 2.59E-30, SH = -22600000.0, IGHF = -1.96E+08, GEF = -1.033E+08, AS = 320000, HFMP = 2.0496E+07, HOC = -1.363E+09, LiqDen = {105, 0.648, 0.18183, 678.21, 0.17947, 0}, VP = {10, 23.09274, 4319.625, -69.95024, 0, 0}, LiqCp = {4, 78653.42, 311.4162, -0.0607137, -2.713217E-06, -0.000017988}, HOV = {106, 1.012031E+08, 1.976961, -4.399887, 4.906054, -1.945886}, VapCp = {16, 50668, -516.86, 12.167, 0.00008641, 2.8656E-10}, LiqVis = {101, -370.3, 17780, 54.624, -0.000051065, 2}, VapVis = {102, 5.78881E-08, 0.876532, 75.00276, 628.0161, 0}, LiqK = {16, -0.37218, 78.8, -1.5916, 0.0043895, -0.0000053291}, VapK = {102, -9539.9, 0.39852, -1.7433E+09, -6.3715E+10, 0}, Racketparam = 0.284, UniquacR = 3.0436, UniquacQ = 2.976, ChaoSeadAF = 0.446737, ChaoSeadSP = 31830, ChaoSeadLV = 0.0603415); +end Monoethanolamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Mxylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Mxylene.mo new file mode 100644 index 0000000..6a614ec --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Mxylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Mxylene + extends General_Properties(SN = 150, name = "Mxylene", CAS = "108-38-3", Tc = 617, Pc = 3541000, Vc = 0.375, Cc = 0.259, Tb = 412.34, Tm = 225.3, TT = 225.3, TP = 3.18019, MW = 106.167, LVB = 0.12347, AF = 0.327, SP = 18050, DM = 1.0E-30, SH = -168070000.0, IGHF = 1.732E+07, GEF = 1.1876E+08, AS = 358540, HFMP = 1.157E+07, HOC = -4.3318E+09, LiqDen = {105, 0.68902, 0.26086, 617, 0.27479, 0}, VP = {101, 97.968, -8164.7, -11.269, 0.0000072101, 2}, LiqCp = {16, 127090, -62.999, 9.3762, 0.0068549, -0.0000032778}, HOV = {106, 5.9562E+07, 0.67841, -0.38938, 0.0061115, 0.10219}, VapCp = {16, 62092, -572.21, 12.975, 0.000062577, -3.7811E-08}, LiqVis = {101, -13.362, 1141.4, 0.37182, -3.9423E-07, 2}, VapVis = {102, 7.2954E-08, 0.8097, 14.386, 8844.3, 0}, LiqK = {16, -0.021158, -27.324, -1.2663, -0.0016664, -3.6744E-07}, VapK = {102, 2.8001E-09, 2.4298, -575.12, 122260, 0}, Racketparam = 0.2593, UniquacR = 4.66, UniquacQ = 3.54, ChaoSeadAF = 0.3045, ChaoSeadSP = 18041.31, ChaoSeadLV = 0.1235); +end Mxylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Naminoethylethanolamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Naminoethylethanolamine.mo new file mode 100644 index 0000000..87d8f76 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Naminoethylethanolamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Naminoethylethanolamine + extends General_Properties(SN = 374, name = "Naminoethylethanolamine", CAS = "111-41-1", Tc = 698, Pc = 4460000, Vc = 0.387, Cc = 0.252, Tb = 517, Tm = 0, TT = 0, TP = 0, MW = 104.151, LVB = 0.101519, AF = 1.04726, SP = 29230, DM = 0, SH = -22600000.0, IGHF = -1.91E+08, GEF = 3810000, AS = 447000, HFMP = 0, HOC = -2.74E+09, LiqDen = {105, 0.76828, 0.25238, 698, 0.28565, 0}, VP = {101, 214.43, -18769, -27.15, 0.00001141, 2}, LiqCp = {16, 65604, -121.74, 11.802, 0.0023485, -7.9478E-07}, HOV = {106, 1.2005E+08, 0.3465, 0.971, -1.7132, 0.81091}, VapCp = {16, 75533, -495.37, 12.77, 0.00015714, -4.9852E-08}, LiqVis = {101, -27.66295, 5326.5, 1.362383, -1.706454E-06, 2}, VapVis = {102, 1.2606E-07, 0.76222, 173.4, -8594.2, 0}, LiqK = {16, -0.1257, -10.607, -0.88928, -0.00060102, -5.9478E-07}, VapK = {102, 0.00019261, 0.93731, 615.43, 23918, 0}, Racketparam = 0.252, UniquacR = 4.925, UniquacQ = 4.452, ChaoSeadAF = 1.04726, ChaoSeadSP = 29230, ChaoSeadLV = 0.101519); +end Naminoethylethanolamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Naminoethylpiperazine.mo b/Simulator/Simulator/Files/Chemsep_Database/Naminoethylpiperazine.mo new file mode 100644 index 0000000..b33570d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Naminoethylpiperazine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Naminoethylpiperazine + extends General_Properties(SN = 372, name = "Naminoethylpiperazine", CAS = "140-31-8", Tc = 708, Pc = 3850000, Vc = 0.475, Cc = 0.266, Tb = 495.15, Tm = 254.15, TT = 254.15, TP = 0.0694812, MW = 129.203, LVB = 0.132257, AF = 0.557243, SP = 21520, DM = 0, SH = -22600000.0, IGHF = 2.51E+07, GEF = 2.79E+08, AS = 451000, HFMP = 0, HOC = -4.135E+09, LiqDen = {105, 0.66681, 0.27137, 708, 0.27214, 0}, VP = {101, 127.7429, -12067.23, -15.04915, 6.424073E-06, 2}, LiqCp = {16, 259220, 331.04, 3.608, 0.023605, -0.000018248}, HOV = {106, 9.785579E+07, 0.814708, 0.0237006, -0.690218, 0.260899}, VapCp = {16, 70888, -450.73, 13.066, 0.00018285, -6.5268E-08}, LiqVis = {101, -497.9054, 22666.52, 74.36022, -0.0000702789, 2}, VapVis = {102, 7.7705E-08, 0.8233, 132.06, -8963.7, 0}, LiqK = {16, -0.089882, -7.0061, -1.0711, -0.00065668, -0.0000005629}, VapK = {102, 0.00012973, 0.99814, 630.8, 21962, 0}, Racketparam = 0.266, UniquacR = 5.5591, UniquacQ = 4.424, ChaoSeadAF = 0.557243, ChaoSeadSP = 21520, ChaoSeadLV = 0.132257); +end Naminoethylpiperazine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Naphthalene.mo b/Simulator/Simulator/Files/Chemsep_Database/Naphthalene.mo new file mode 100644 index 0000000..698a9e4 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Naphthalene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Naphthalene + extends General_Properties(SN = 167, name = "Naphthalene", CAS = "91-20-3", Tc = 748.4, Pc = 4050000, Vc = 0.407, Cc = 0.265, Tb = 491.16, Tm = 353.434, TT = 353.43, TP = 991.297, MW = 128.174, LVB = 0.12913, AF = 0.304, SP = 19490, DM = 0, SH = -168070000.0, IGHF = 1.5058E+08, GEF = 2.2408E+08, AS = 333150, HFMP = 1.898E+07, HOC = -4.9809E+09, LiqDen = {105, 0.45282, 0.21953, 748.4, 0.23236, 0}, VP = {101, 93.15947, -9448.063, -10.23844, 4.335455E-06, 2}, LiqCp = {16, 149170, 579.65, 3.8152, 0.021624, -0.000015657}, HOV = {106, 7.732822E+07, 1.116621, -1.313575, 0.672121, -0.00584514}, VapCp = {16, 49831, -547.92, 13.201, -0.00013999, 2.8208E-08}, LiqVis = {101, -8.2151, 1338.2, -0.46592, 0.00000135, 2}, VapVis = {102, 1.2323E-08, 1.0475, -162.06, 35144, 0}, LiqK = {16, 0.033214, -361.89, -0.012818, -0.0040236, 0.0000012782}, VapK = {102, 0.000017754, 1.2123, 69.759, 78517, 0}, Racketparam = 0.261, UniquacR = 4.920237, UniquacQ = 3.368, ChaoSeadAF = 0.302, ChaoSeadSP = 19187.5, ChaoSeadLV = 0.130825); +end Naphthalene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nbutane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nbutane.mo new file mode 100644 index 0000000..5731f3d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nbutane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nbutane + extends General_Properties(SN = 92, name = "Nbutane", CAS = "106-97-8", Tc = 425.12, Pc = 3796000, Vc = 0.255, Cc = 0.274, Tb = 272.66, Tm = 134.86, TT = 134.86, TP = 0.67358, MW = 58.123, LVB = 0.10048, AF = 0.199, SP = 13510, DM = 0, SH = -125790000.0, IGHF = -1.2579E+08, GEF = -1.67E+07, AS = 309910, HFMP = 4661000, HOC = -2.65732E+09, LiqDen = {105, 1.0023, 0.26457, 425.17, 0.27138, 0}, VP = {101, 68.5773, -4444.916, -7.395837, 9.857432E-06, 2}, LiqCp = {16, 115150, -3564.7, 41.067, -0.098803, 0.0001183}, HOV = {106, 3.6258E+07, 0.83741, -0.83676, 0.41526, -0.007606}, VapCp = {16, 44749.95, -338.1412, 11.81452, 0.00097744, -3.359129E-07}, LiqVis = {101, -46.56549, 1439.945, 6.168131, -0.000023917, 2}, VapVis = {102, 2.7078E-08, 0.97147, -51.16, 6431, 0}, LiqK = {16, 0.00024966, -43.155, -0.78129, -0.0043776, -4.136E-08}, VapK = {102, 0.042635, 0.45147, 4234, 1756600, 0}, Racketparam = 0.2728, UniquacR = 3.151, UniquacQ = 2.776, ChaoSeadAF = 0.1953, ChaoSeadSP = 13766.21, ChaoSeadLV = 0.1014); +end Nbutane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nbutylacetate.mo b/Simulator/Simulator/Files/Chemsep_Database/Nbutylacetate.mo new file mode 100644 index 0000000..1a616d5 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nbutylacetate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nbutylacetate + extends General_Properties(SN = 336, name = "Nbutylacetate", CAS = "123-86-4", Tc = 579, Pc = 3090000, Vc = 0.4128, Cc = 0.253, Tb = 399.12, Tm = 199.65, TT = 199.65, TP = 0.0816516, MW = 116.16, LVB = 0.13251, AF = 0.407, SP = 17670, DM = 6.14E-30, SH = -216400000.0, IGHF = -4.856E+08, GEF = -3.123E+08, AS = 442500, HFMP = 1.44E+07, HOC = -3.283E+09, LiqDen = {105, 0.13588, 0.1193, 579, 0.16305, 0}, VP = {101, 90.42793, -7625.342, -10.22284, 8.987208E-06, 2}, LiqCp = {16, 201710, -19.025, 8.0191, 0.0068889, 0.0000021505}, HOV = {106, 8.192574E+07, 1.151594, 0.0889674, -1.859865, 1.113952}, VapCp = {16, 92876, -666.17, 13.432, -0.00066148, 3.0678E-07}, LiqVis = {101, -17.008, 1461.1, 0.8424, 1.1193E-07, 2}, VapVis = {102, 1.0488E-07, 0.76809, 52.337, 8271.1, 0}, LiqK = {16, 0.04366, -125.65, -0.40686, -0.0059305, 0.0000024167}, VapK = {102, 5.9364E-09, 2.3739, -402.22, 69606, 0}, Racketparam = 0.253, UniquacR = 4.8274, UniquacQ = 4.196, ChaoSeadAF = 0.407, ChaoSeadSP = 17670, ChaoSeadLV = 0.13251); +end Nbutylacetate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nbutylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Nbutylbenzene.mo new file mode 100644 index 0000000..fb1500c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nbutylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nbutylbenzene + extends General_Properties(SN = 171, name = "Nbutylbenzene", CAS = "104-51-8", Tc = 660.5, Pc = 2890000, Vc = 0.497, Cc = 0.262, Tb = 456.42, Tm = 185.3, TT = 185.3, TP = 0.000154386, MW = 134.221, LVB = 0.15678, AF = 0.393, SP = 17510, DM = 1.23E-30, SH = -168070000.0, IGHF = -1.314E+07, GEF = 1.454E+08, AS = 439490, HFMP = 1.122E+07, HOC = -5.5644E+09, LiqDen = {105, 0.50648, 0.25203, 660.5, 0.29203, 0}, VP = {101, 100.11, -9186.6, -11.379, 0.0000058585, 2}, LiqCp = {16, 173590, 115.14, 7.4501, 0.014631, -0.000011875}, HOV = {106, 6.5698E+07, 0.30842, 0.67062, -1.1135, 0.53276}, VapCp = {16, 97423, -619.62, 13.35, -0.000032816, -9.3502E-09}, LiqVis = {101, -18.829, 1737.7, 1.0385, 0.0000015468, 2}, VapVis = {102, 3.4687E-07, 0.59512, 233.67, 177.63, 0}, LiqK = {16, 0.081204, 245.71, -5.5946, 0.01322, -0.00002506}, VapK = {102, 0.19225, -0.0011093, -156.74, 1712400, 0}, Racketparam = 0, UniquacR = 5.946, UniquacQ = 4.588, ChaoSeadAF = 0.3923, ChaoSeadSP = 17450.9, ChaoSeadLV = 0.156494); +end Nbutylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nbutylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nbutylcyclohexane.mo new file mode 100644 index 0000000..d848e5b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nbutylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nbutylcyclohexane + extends General_Properties(SN = 172, name = "Nbutylcyclohexane", CAS = "1678-93-9", Tc = 667, Pc = 2570000, Vc = 0.534, Cc = 0.247, Tb = 454.131, Tm = 198.42, TT = 198.42, TP = 0.00365804, MW = 140.266, LVB = 0.176266, AF = 0.274326, SP = 16400, DM = 0, SH = -168070000.0, IGHF = -2.1317E+08, GEF = 5.654E+07, AS = 458480, HFMP = 1.416E+07, HOC = -6.0902E+09, LiqDen = {105, 0.49786, 0.26572, 667, 0.30254, 0}, VP = {101, 82.702, -8417.7, -8.6968, 0.0000027713, 2}, LiqCp = {16, 117850, 44.861, 10.356, 0.0053947, -0.0000020204}, HOV = {106, 7.7656E+07, 1.637, -3.3269, 3.6698, -1.48}, VapCp = {16, 145450, -890.37, 14.241, -0.0007098, 2.1101E-07}, LiqVis = {101, -66.15115, 3536.438, 8.46644, -7.612217E-06, 2}, VapVis = {102, 5.6992E-07, 0.52089, 326.29, -3328.7, 0}, LiqK = {16, -0.040753, 3.9448, -1.6588, -0.00045987, -0.0000010215}, VapK = {102, 0.000063509, 1.1032, 470.22, 42922, 0}, Racketparam = 0, UniquacR = 6.7432, UniquacQ = 5.396, ChaoSeadAF = 0.3618, ChaoSeadSP = 16411.2, ChaoSeadLV = 0.176266); +end Nbutylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nbutylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nbutylcyclopentane.mo new file mode 100644 index 0000000..583c767 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nbutylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nbutylcyclopentane + extends General_Properties(SN = 273, name = "Nbutylcyclopentane", CAS = "2040-95-1", Tc = 621, Pc = 2710000, Vc = 0.482, Cc = 0.254, Tb = 429.75, Tm = 165.165, TT = 165.18, TP = 0.0000370087, MW = 126.239, LVB = 0.161572, AF = 0.37188, SP = 16390, DM = 0, SH = -1209000000.0, IGHF = -1.683E+08, GEF = 6.217E+07, AS = 453800, HFMP = 1.131E+07, HOC = -5.5037E+09, LiqDen = {105, 0.55321, 0.26684, 621, 0.28873, 0}, VP = {101, 59.57026, -7247.203, -5.051393, -2.973642E-06, 2}, LiqCp = {16, 165400, 317.8, 5.7051, 0.0202, -0.000017103}, HOV = {106, 5.633912E+07, -0.222347, 2.054738, -2.396364, 0.924309}, VapCp = {16, 82154, -554.7, 13.299, 0.00015408, -5.7536E-08}, LiqVis = {101, -10.446, 1200.4, -0.12541, 4.6316E-07, 2}, VapVis = {102, 0.0000029081, 0.33269, 700.46, -5220.4, 0}, LiqK = {16, -0.059329, 3.6894, -1.5397, -0.00046539, -0.0000010217}, VapK = {102, 0.001615, 0.65033, 212.05, 447790, 0}, Racketparam = 0.254, UniquacR = 6.068799, UniquacQ = 4.856, ChaoSeadAF = 0.37188, ChaoSeadSP = 16390, ChaoSeadLV = 0.161572); +end Nbutylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nbutyricacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Nbutyricacid.mo new file mode 100644 index 0000000..ccd7563 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nbutyricacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nbutyricacid + extends General_Properties(SN = 86, name = "Nbutyricacid", CAS = "107-92-6", Tc = 624, Pc = 4030000, Vc = 0.292, Cc = 0.227, Tb = 436.87, Tm = 267.95, TT = 267.95, TP = 10.3, MW = 88.106, LVB = 0.09246, AF = 0.72, SP = 20180, DM = 5.5E-30, SH = -17100000.0, IGHF = -4.758E+08, GEF = -3.6E+08, AS = 360100, HFMP = 1.159E+07, HOC = -2.008E+09, LiqDen = {105, 0.702, 0.22902, 628.16, 0.24275, 0}, VP = {101, 54.31047, -7692.649, -4.148708, 2.624319E-07, 2}, LiqCp = {16, 135560, 664.7, 1.9592, 0.027685, -0.000020111}, HOV = {106, 5.1387E+07, 1.1517, -2.7656, 2.6617, -0.66983}, VapCp = {16, 75565, -613.25, 12.671, -0.000058773, -2.4845E-08}, LiqVis = {101, 14.241, 534.99, -4.0411, 0.0000053437, 2}, VapVis = {102, 2.2745E-08, 1.0055, 13.097, 182.58, 0}, LiqK = {16, -0.043955, 57.698, -1.8847, 0.00050649, -0.0000013441}, VapK = {102, 0.00010747, 1.3444, 19634, -7296600, 0}, Racketparam = 0, UniquacR = 3.5512, UniquacQ = 3.152, ChaoSeadAF = 0.683, ChaoSeadSP = 20262.7, ChaoSeadLV = 0.0924567); +end Nbutyricacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ndecane.mo b/Simulator/Simulator/Files/Chemsep_Database/Ndecane.mo new file mode 100644 index 0000000..75a62d7 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ndecane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ndecane + extends General_Properties(SN = 173, name = "Ndecane", CAS = "124-18-5", Tc = 617.7, Pc = 2110000, Vc = 0.624, Cc = 0.256, Tb = 447.3, Tm = 243.51, TT = 243.51, TP = 1.39297, MW = 142.285, LVB = 0.19595, AF = 0.491, SP = 15720, DM = 0, SH = -168070000.0, IGHF = -2.4946E+08, GEF = 3.318E+07, AS = 545700, HFMP = 2.871E+07, HOC = -6.29422E+09, LiqDen = {105, 0.37424, 0.2405, 617.7, 0.27182, 0}, VP = {101, 6.023802, -5713.196, 3.410225, -0.000012633, 2}, LiqCp = {16, 160660, 291.43, 8.5687, 0.0098408, -0.0000060811}, HOV = {106, 5.7689E+07, -1.1412, 5.1463, -6.2946, 2.6623}, VapCp = {16, 152020, -697.29, 13.714, -0.00021747, 4.9426E-08}, LiqVis = {101, -102.98, 4517.9, 14.495, -0.00002056, 2}, VapVis = {102, 2.3638E-08, 0.95886, 24.698, 7541.9, 0}, LiqK = {16, 0.071684, -217.03, -0.47424, -0.0039028, -0.0000049442}, VapK = {102, -668.49, 0.93224, -4.0687E+09, -1.0176E+09, 0}, Racketparam = 0.2503, UniquacR = 7.2, UniquacQ = 6.02, ChaoSeadAF = 0.4869, ChaoSeadSP = 15791.26, ChaoSeadLV = 0.196); +end Ndecane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ndocosane.mo b/Simulator/Simulator/Files/Chemsep_Database/Ndocosane.mo new file mode 100644 index 0000000..b060c80 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ndocosane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ndocosane + extends General_Properties(SN = 209, name = "Ndocosane", CAS = "629-97-0", Tc = 808.83, Pc = 1339000, Vc = 1.252, Cc = 0.209, Tb = 641.75, Tm = 318.25, TT = 317.15, TP = 0.00359575, MW = 310.601, LVB = 0.393226, AF = 0.973, SP = 15800, DM = 0, SH = -1209000000.0, IGHF = -4.985E+08, GEF = 1.307E+08, AS = 1019000, HFMP = 4.8953E+07, HOC = -1.357E+10, LiqDen = {105, 0.00088994, 0.017172, 808.83, 0.094179, 0}, VP = {101, 270.663, -22731.61, -35.81794, 0.0000193308, 2}, LiqCp = {16, 94846, -114.81, 13.466, 0.000531, 3.3532E-07}, HOV = {106, 1.5383E+08, 1.0955, -1.2067, 1.3977, -0.85529}, VapCp = {16, 291820, -567.43, 14.157, 0.00012912, -4.9166E-08}, LiqVis = {101, -27.314, 2728.1, 2.3358, -0.0000013135, 2}, VapVis = {102, 2.8858E-07, 0.62154, 714.54, 4582.3, 0}, LiqK = {16, -0.148, -22.716, -0.91136, -0.00059496, -3.4759E-07}, VapK = {102, -270.77, 1.0546, -5.8977E+09, -1.0935E+11, 0}, Racketparam = 0.209, UniquacR = 15.2902, UniquacQ = 12.496, ChaoSeadAF = 0.973, ChaoSeadSP = 15800, ChaoSeadLV = 0.393226); +end Ndocosane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ndodecane.mo b/Simulator/Simulator/Files/Chemsep_Database/Ndodecane.mo new file mode 100644 index 0000000..da8ff4b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ndodecane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ndodecane + extends General_Properties(SN = 179, name = "Ndodecane", CAS = "112-40-3", Tc = 658, Pc = 1820000, Vc = 0.754, Cc = 0.251, Tb = 489.48, Tm = 263.568, TT = 263.568, TP = 0.615203, MW = 170.338, LVB = 0.22859, AF = 0.571, SP = 15930, DM = 0, SH = -168070000.0, IGHF = -2.9072E+08, GEF = 4.981E+07, AS = 624150, HFMP = 3.684E+07, HOC = -7.51368E+09, LiqDen = {105, 0.30334, 0.23617, 658, 0.2706, 0}, VP = {101, 127.8877, -11582.12, -15.22541, 6.680034E-06, 2}, LiqCp = {16, 203950, 627.31, 6.2796, 0.014676, -0.0000079758}, HOV = {106, 9.812979E+07, 0.939672, -0.0412509, -0.949322, 0.501567}, VapCp = {16, 193680, -732.61, 13.902, -0.00022284, 6.2257E-08}, LiqVis = {101, -83.21108, 4238.311, 11.14639, -0.0000124656, 2}, VapVis = {102, 5.4481E-08, 0.85223, 245.71, -11928, 0}, LiqK = {16, 0.029364, -108.04, -0.7007, -0.0040791, 6.1377E-07}, VapK = {102, 0.0000055504, 1.4726, 558.15, 3563.6, 0}, Racketparam = 0.2466, UniquacR = 8.5462, UniquacQ = 7.096, ChaoSeadAF = 0.561, ChaoSeadSP = 16036.72, ChaoSeadLV = 0.2286); +end Ndodecane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Neicosane.mo b/Simulator/Simulator/Files/Chemsep_Database/Neicosane.mo new file mode 100644 index 0000000..f0ca0c6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Neicosane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Neicosane + extends General_Properties(SN = 430, name = "Neicosane", CAS = "112-95-8", Tc = 767, Pc = 1160000, Vc = 1.19, Cc = 0.213, Tb = 616.95, Tm = 309.58, TT = 309.58, TP = 0.00925737, MW = 282.547, LVB = 0.360385, AF = 0.9065, SP = 16000, DM = 0, SH = 28500000.0, IGHF = -4.5576E+08, GEF = 1.157E+08, AS = 934120, HFMP = 7.03E+07, HOC = -1.239199E+10, LiqDen = {105, 0.18166, 0.23351, 768, 0.28571, 0}, VP = {101, 164.6909, -17503.89, -19.74205, 5.399206E-06, 2}, LiqCp = {100, 352720, 807.32, 0.2122, 0, 0}, HOV = {106, 1.286E+08, 0.50351, 0.32986, -0.42184, 0}, VapCp = {107, 324810, 1109000, 1636, 745000, 726.27}, LiqVis = {101, -10.5557, 1830.385, -0.148602, -7.471032E-06, -7.49069E-06}, VapVis = {102, 2.9236E-07, 0.62458, 702.84, 0, 0}, LiqK = {100, 0.2178, -0.0002233, 0, 0, 0}, VapK = {102, -375.32, 1.0708, -8.7836E+09, 0, 0}, Racketparam = 0, UniquacR = 13.9414, UniquacQ = 11.416, ChaoSeadAF = 0.9065, ChaoSeadSP = 16000, ChaoSeadLV = 0.360385); +end Neicosane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Neon.mo b/Simulator/Simulator/Files/Chemsep_Database/Neon.mo new file mode 100644 index 0000000..d975616 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Neon.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Neon + extends General_Properties(SN = 17, name = "Neon", CAS = "7440-01-9", Tc = 44.4, Pc = 2653000, Vc = 0.0417, Cc = 0.3, Tb = 27.09, Tm = 24.55, TT = 24.56, TP = 43300, MW = 20.1797, LVB = 0.0167622, AF = -0.0395988, SP = 9440, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 146219, HFMP = 328100, HOC = 0, LiqDen = {105, 7.3718, 0.3067, 44.4, 0.2786, 0}, VP = {101, 29.459, -269.41, -2.5349, 0.00051726, 2}, LiqCp = {16, 29948, -243.96, 32.083, -0.79445, 0.01023}, HOV = {106, 1420900, -0.63029, -0.0022325, 1.6268, -0.7611}, VapCp = {16, 20786, -1728.5, -21.855, 0.0020512, 2.1139E-07}, LiqVis = {101, -83.002, 434.94, 18.35, -0.0034996, 2}, VapVis = {102, 7.6731E-07, 0.65634, 5.8941, 175.84, 0}, LiqK = {16, -0.49811, -1.8025, -0.49257, 0.0090166, -0.00024023}, VapK = {102, 0.0011717, 0.66099, 12.109, -70.155, 0}, Racketparam = 0, UniquacR = 0.680949, UniquacQ = 0.776, ChaoSeadAF = -0.0413762, ChaoSeadSP = 9417.34, ChaoSeadLV = 0.0167622); +end Neon; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Neopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Neopentane.mo new file mode 100644 index 0000000..ed75851 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Neopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Neopentane + extends General_Properties(SN = 116, name = "Neopentane", CAS = "463-82-1", Tc = 433.75, Pc = 3199000, Vc = 0.3032, Cc = 0.269, Tb = 282.65, Tm = 256.6, TT = 256.6, TP = 35745.2, MW = 72.15, LVB = 0.12216, AF = 0.197, SP = 12510, DM = 0, SH = -168070000.0, IGHF = -1.6807E+08, GEF = -1.714E+07, AS = 305890, HFMP = 3146000, HOC = -3.25039E+09, LiqDen = {105, 0.90246, 0.2775, 433.8, 0.29085, 0}, VP = {101, 85.887, -5169, -10.119, 0.000013061, 2}, LiqCp = {16, 116590, 146.32, 1.9197, 0.044936, -0.000054657}, HOV = {106, 3.3957E+07, 0.38208, 0, 0, 0}, VapCp = {16, 31525, -309.56, 12.21, 0.00085791, -2.6395E-07}, LiqVis = {101, -36.861, 2459.5, 3.4416, 0.0000070474, 2}, VapVis = {102, 8.1019E-07, 0.5294, 468.47, -22580, 0}, LiqK = {16, 0.027667, -243.53, 0.83395, -0.010754, 0.0000058849}, VapK = {102, 0.0000044729, 1.4644, -142.95, 66180, 0}, Racketparam = 0.2762, UniquacR = 3.8239, UniquacQ = 3.392, ChaoSeadAF = 0.195, ChaoSeadSP = 14359.41, ChaoSeadLV = 0.1233); +end Neopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nheneicosane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nheneicosane.mo new file mode 100644 index 0000000..d83ae0a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nheneicosane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nheneicosane + extends General_Properties(SN = 208, name = "Nheneicosane", CAS = "629-94-7", Tc = 798.64, Pc = 1391000, Vc = 1.197, Cc = 0.211, Tb = 629.65, Tm = 313.65, TT = 313.35, TP = 0.00621532, MW = 296.574, LVB = 0.376581, AF = 0.942004, SP = 15900, DM = 0, SH = -1209000000.0, IGHF = -4.778E+08, GEF = 1.229E+08, AS = 985000, HFMP = 4.7698E+07, HOC = -1.296E+10, LiqDen = {105, 0.0010945, 0.018629, 798.64, 0.095543, 0}, VP = {101, 107.2451, -14833.82, -11.21418, 3.606473E-07, 2}, LiqCp = {16, 268470, 50.971, 11.858, 0.0031331, -0.0000010628}, HOV = {106, 2.0592E+08, 3.1557, -6.6833, 7.1267, -3.099}, VapCp = {16, 253120, -507.31, 13.984, 0.00027572, -9.6316E-08}, LiqVis = {101, -25.108, 2540.9, 2.0324, -0.0000013549, 2}, VapVis = {102, 2.9575E-07, 0.62136, 718.74, 3255.3, 0}, LiqK = {16, -0.22263, 31.196, -1.0701, 0.0001617, -7.0064E-07}, VapK = {102, -237.86, 1.0527, -4.9708E+09, -8.9521E+10, 0}, Racketparam = 0.211, UniquacR = 14.6158, UniquacQ = 11.956, ChaoSeadAF = 0.942004, ChaoSeadSP = 15900, ChaoSeadLV = 0.376581); +end Nheneicosane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nheptacosane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nheptacosane.mo new file mode 100644 index 0000000..b0490bc --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nheptacosane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nheptacosane + extends General_Properties(SN = 214, name = "Nheptacosane", CAS = "593-49-7", Tc = 826, Pc = 883000, Vc = 1.58, Cc = 0.203, Tb = 695.25, Tm = 332.65, TT = 332.15, TP = 0.000283125, MW = 380.734, LVB = 0.48815, AF = 1.21357, SP = 15810, DM = 0, SH = -1209000000.0, IGHF = -6.021E+08, GEF = 1.716E+08, AS = 1216000, HFMP = 6.0417E+07, HOC = -1.66E+10, LiqDen = {105, 0.13373, 0.23061, 826, 0.29272, 0}, VP = {101, 254.28, -25266, -32.268, 0.0000098574, 2}, LiqCp = {16, 287690, -499.88, 15.238, -0.0020847, 0.000001614}, HOV = {106, 1.738E+08, 0.55455, 0.6619, -1.1864, 0.39235}, VapCp = {16, 324210, -507.11, 14.235, 0.00027032, -9.4813E-08}, LiqVis = {101, -11.337, 2071.7, -0.014083, 1.056E-08, 2}, VapVis = {102, 2.7943E-07, 0.60493, 599.04, 42458, 0}, LiqK = {16, -0.12846, 8.4662, -1.1232, -0.00036291, -3.8993E-07}, VapK = {102, -177.26, 1.0676, -4.7446E+09, -7.2852E+10, 0}, Racketparam = 0.203, UniquacR = 18.6622, UniquacQ = 15.196, ChaoSeadAF = 1.21357, ChaoSeadSP = 15810, ChaoSeadLV = 0.48815); +end Nheptacosane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nheptadecane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nheptadecane.mo new file mode 100644 index 0000000..5954351 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nheptadecane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nheptadecane + extends General_Properties(SN = 205, name = "Nheptadecane", CAS = "629-78-7", Tc = 736, Pc = 1340000, Vc = 1.103, Cc = 0.242, Tb = 574.56, Tm = 295.127, TT = 295.134, TP = 0.0465559, MW = 240.473, LVB = 0.31045, AF = 0.762, SP = 16100, DM = 0, SH = -1209000000.0, IGHF = -3.939E+08, GEF = 9.083E+07, AS = 820230, HFMP = 4.0459E+07, HOC = -1.05618E+10, LiqDen = {105, 0.1972, 0.22446, 736, 0.27261, 0}, VP = {101, 230.4768, -19512.15, -29.73776, 0.0000119109, 2}, LiqCp = {16, 341660, -48.077, 11.234, 0.0041437, -0.0000017269}, HOV = {106, 1.1837E+08, 0.45937, 1.0501, -1.8353, 0.77357}, VapCp = {16, 247870, -663.74, 14.166, -0.00017722, 5.7891E-08}, LiqVis = {101, -77.193, 4597, 9.9892, -0.0000084702, 2}, VapVis = {102, 3.2694E-07, 0.5961, 448.22, 45523, 0}, LiqK = {16, -0.015537, -239.33, 0.042685, -0.0038367, 8.6547E-07}, VapK = {102, -115.33, 1.0524, -2.1515E+09, -1.3137E+10, 0}, Racketparam = 0.242, UniquacR = 11.9182, UniquacQ = 9.796, ChaoSeadAF = 0.762, ChaoSeadSP = 16100, ChaoSeadLV = 0.31045); +end Nheptadecane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nheptane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nheptane.mo new file mode 100644 index 0000000..9825617 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nheptane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nheptane + extends General_Properties(SN = 147, name = "Nheptane", CAS = "142-82-5", Tc = 540.2, Pc = 2740000, Vc = 0.428, Cc = 0.261, Tb = 371.57, Tm = 182.57, TT = 182.57, TP = 0.182694, MW = 100.204, LVB = 0.14747, AF = 0.35, SP = 15240, DM = 0, SH = -168070000.0, IGHF = -1.8765E+08, GEF = 8165000, AS = 427980, HFMP = 1.405E+07, HOC = -4.46473E+09, LiqDen = {105, 0.57043, 0.25304, 540.2, 0.27335, 0}, VP = {101, 89.80457, -7084.845, -10.17918, 7.441708E-06, 2}, LiqCp = {16, 134750, 14.937, 10.603, 0.001438, 0.0000036711}, HOV = {106, 4.275764E+07, -1.051245, 4.601706, -5.558946, 2.369496}, VapCp = {16, 109310, -704.2, 13.352, -0.00017922, 4.6992E-08}, LiqVis = {101, -61.08861, 2532.297, 8.091665, -0.0000152585, 2}, VapVis = {102, 2.6134E-08, 0.948, -37.497, 9005.3, 0}, LiqK = {16, 0.083657, 49.111, -3.4536, 0.0077989, -0.000025112}, VapK = {102, -0.076333, 0.38025, -7539.9, -2646800, 0}, Racketparam = 0.2611, UniquacR = 5.1742, UniquacQ = 4.396, ChaoSeadAF = 0.3403, ChaoSeadSP = 15230, ChaoSeadLV = 0.1475); +end Nheptane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nhexacosane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nhexacosane.mo new file mode 100644 index 0000000..0d47a21 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nhexacosane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nhexacosane + extends General_Properties(SN = 213, name = "Nhexacosane", CAS = "630-01-3", Tc = 844.7, Pc = 1162000, Vc = 1.473, Cc = 0.203, Tb = 685.35, Tm = 329.55, TT = 329.25, TP = 0.000515816, MW = 366.707, LVB = 0.4561, AF = 1.15444, SP = 15800, DM = 0, SH = -1209000000.0, IGHF = -5.814E+08, GEF = 1.636E+08, AS = 1176000, HFMP = 5.9496E+07, HOC = -1.6E+10, LiqDen = {105, 0.0012458, 0.021983, 844.7, 0.10464, 0}, VP = {101, -181.3952, -2296.288, 31.90668, -0.0000256231, 2}, LiqCp = {16, 657670, -651.68, 14.164, -0.00036454, 7.7672E-07}, HOV = {106, 2.0502E+08, 2.0708, -3.8957, 4.3419, -2.0579}, VapCp = {16, 342560, -564.25, 14.318, 0.00013185, -5.001E-08}, LiqVis = {101, -92.13292, 5845.982, 12.08985, -8.198834E-06, 2}, VapVis = {102, 2.7977E-07, 0.616, 732.48, 6359.2, 0}, LiqK = {16, 0.020148, -211.96, -0.39294, -0.0031327, 1.9698E-07}, VapK = {102, -164.53, 1.0626, -4.163E+09, -7.6944E+10, 0}, Racketparam = 0.203, UniquacR = 17.9878, UniquacQ = 14.656, ChaoSeadAF = 1.15444, ChaoSeadSP = 15800, ChaoSeadLV = 0.4561); +end Nhexacosane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nhexadecane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nhexadecane.mo new file mode 100644 index 0000000..38c17d0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nhexadecane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nhexadecane + extends General_Properties(SN = 188, name = "Nhexadecane", CAS = "544-76-3", Tc = 723, Pc = 1400000, Vc = 1.034, Cc = 0.241, Tb = 559.98, Tm = 291.308, TT = 291.308, TP = 0.0922432, MW = 226.446, LVB = 0.29411, AF = 0.726, SP = 16190, DM = 0, SH = -168070000.0, IGHF = -3.7417E+08, GEF = 8.216E+07, AS = 781020, HFMP = 5.3358E+07, HOC = -9.95145E+09, LiqDen = {105, 0.23237, 0.23642, 723, 0.28403, 0}, VP = {101, 138.0173, -14151.1, -16.24379, 5.027608E-06, 2}, LiqCp = {16, 387360, -123.61, 10.738, 0.005, -0.0000019617}, HOV = {106, 1.2775E+08, 0.92612, 0.52583, -2.1415, 1.2039}, VapCp = {16, 232700, -655.34, 14.079, -0.0001451, 4.6597E-08}, LiqVis = {101, -84.70059, 4841.907, 11.15158, -9.617336E-06, 2}, VapVis = {102, 1.3203E-07, 0.72722, 424.3, 4562.7, 0}, LiqK = {16, 0.006807, -152.97, -0.44096, -0.0038892, 0.0000012245}, VapK = {102, 0.0000035961, 1.5118, 510.88, 23814, 0}, Racketparam = 0.226854, UniquacR = 11.24, UniquacQ = 9.26, ChaoSeadAF = 0.7078, ChaoSeadSP = 16343.54, ChaoSeadLV = 0.2941); +end Nhexadecane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nhexane.mo new file mode 100644 index 0000000..90daecc --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nhexane + extends General_Properties(SN = 135, name = "Nhexane", CAS = "110-54-3", Tc = 507.6, Pc = 3025000, Vc = 0.368, Cc = 0.264, Tb = 341.88, Tm = 177.83, TT = 177.83, TP = 0.901695, MW = 86.177, LVB = 0.13159, AF = 0.297, SP = 14870, DM = 0, SH = -168070000.0, IGHF = -1.6694E+08, GEF = -66340, AS = 388740, HFMP = 1.308E+07, HOC = -3.8551E+09, LiqDen = {105, 0.55661, 0.23506, 507.6, 0.24183, 0}, VP = {101, 71.56625, -5848.968, -7.46028, 0.0000050823, 2}, LiqCp = {16, 155690, 5.9137, 7.3123, 0.013809, -0.0000093814}, HOV = {106, 4.086241E+07, -1.014854, 4.97802, -6.266175, 2.685532}, VapCp = {16, 94649, -698.41, 13.164, -0.00011992, 2.9719E-08}, LiqVis = {101, -62.582, 2308.7, 8.5085, -0.000019741, 2}, VapVis = {102, 3.3843E-07, 0.62082, 239.17, -260.6, 0}, LiqK = {16, -0.12682, -1.5015, -1.0467, -0.00088709, -9.3679E-07}, VapK = {102, -569.52, 0.7943, -1.1379E+09, -8.2055E+09, 0}, Racketparam = 0.2635, UniquacR = 4.4998, UniquacQ = 3.856, ChaoSeadAF = 0.2927, ChaoSeadSP = 14870.79, ChaoSeadLV = 0.1316); +end Nhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nhexylacetate.mo b/Simulator/Simulator/Files/Chemsep_Database/Nhexylacetate.mo new file mode 100644 index 0000000..e6e218f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nhexylacetate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nhexylacetate + extends General_Properties(SN = 340, name = "Nhexylacetate", CAS = "142-92-7", Tc = 623.5, Pc = 2410000, Vc = 0.519, Cc = 0.244, Tb = 444.65, Tm = 192.25, TT = 192.25, TP = 0.000851561, MW = 144.211, LVB = 0.166008, AF = 0.461433, SP = 17200, DM = 6.2E-30, SH = -216400000.0, IGHF = -5.263E+08, GEF = -2.954E+08, AS = 520900, HFMP = 1.69E+07, HOC = -4.505E+09, LiqDen = {105, 0.39801, 0.22828, 623.5, 0.26879, 0}, VP = {101, 135.2, -10778, -16.633, 0.000010146, 2}, LiqCp = {16, 152410, 849.23, 3.575, 0.024024, -0.000019964}, HOV = {106, 7.6365E+07, 1.3535, -2.7266, 3.0189, -1.2516}, VapCp = {16, 74275, -423.1, 13.088, 0.00020721, -5.6794E-08}, LiqVis = {101, -11.853, 1437.9, 0.03568, -1.5887E-07, 2}, VapVis = {102, 0.0000001052, 0.76244, 141.7, -5217.3, 0}, LiqK = {16, 0.076217, 432.06, -6.6217, 0.014354, -0.00002134}, VapK = {102, -96.991, -0.0010535, 51726, -1.0193E+09, 0}, Racketparam = 0.244, UniquacR = 6.1762, UniquacQ = 5.276, ChaoSeadAF = 0.539588, ChaoSeadSP = 17200, ChaoSeadLV = 0.166008); +end Nhexylacetate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nhexylmercaptan.mo b/Simulator/Simulator/Files/Chemsep_Database/Nhexylmercaptan.mo new file mode 100644 index 0000000..e75bda0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nhexylmercaptan.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nhexylmercaptan + extends General_Properties(SN = 353, name = "Nhexylmercaptan", CAS = "111-31-9", Tc = 622, Pc = 3025000, Vc = 0.412, Cc = 0.245, Tb = 424.15, Tm = 192.15, TT = 192.62, TP = 0.0130959, MW = 118.24, LVB = 0.141006, AF = 0.369, SP = 17450, DM = 5.17E-30, SH = -22600000.0, IGHF = -1.292E+08, GEF = 2.77E+07, AS = 454600, HFMP = 1.801E+07, HOC = -4.176E+09, LiqDen = {105, 0.60827, 0.26212, 623.01, 0.27785, 0}, VP = {101, 102.0208, -8530.272, -11.91139, 8.521739E-06, 2}, LiqCp = {16, 168110, 243.92, 7.741, 0.0099925, -0.0000054522}, HOV = {106, 6.053718E+07, 0.532372, -0.222059, 0.0696209, -0.00101028}, VapCp = {16, 116170, -711.75, 13.18, -0.000044297, 1.0562E-09}, LiqVis = {101, -35.723, 1823.3, 4.0853, -0.0000098564, 2}, VapVis = {102, 6.7616E-08, 0.85134, 101.57, -4277.1, 0}, LiqK = {16, -0.076932, 5.5076, -1.3601, -0.00033003, -0.000001155}, VapK = {102, 0.090806, 0.27994, 4707, 1982000, 0}, Racketparam = 0.245, UniquacR = 5.2497, UniquacQ = 4.376, ChaoSeadAF = 0.369, ChaoSeadSP = 17450, ChaoSeadLV = 0.141006); +end Nhexylmercaptan; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nitricacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Nitricacid.mo new file mode 100644 index 0000000..a3dd66b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nitricacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nitricacid + extends General_Properties(SN = 18, name = "Nitricacid", CAS = "7697-37-2", Tc = 520, Pc = 6890100, Vc = 0.145, Cc = 0.231, Tb = 356.15, Tm = 231.55, TT = 231.55, TP = 60.7682, MW = 63.0128, LVB = 0.041734, AF = 0.714406, SP = 29610, DM = 7.24E-30, SH = 0.0, IGHF = -1.343E+08, GEF = -7.401E+07, AS = 266370, HFMP = 1.047E+07, HOC = 1.34E+07, LiqDen = {105, 6.9293, 0.47274, 520, 0.49837, 0}, VP = {101, 26.654, -5017.1, -0.036699, -0.0000064771, 2}, LiqCp = {16, 111110, -611.57, -2.7202, 0.014286, -0.000033905}, HOV = {106, 7.01E+07, 0.68707, -0.0019914, 0.0028792, -0.0014403}, VapCp = {16, 32639, -463.06, 11.547, -0.00011018, 4.1801E-09}, LiqVis = {101, 264.29, -7985, -44.099, 0.000074947, 2}, VapVis = {102, 2.2234E-07, 0.72283, 140.72, -0.0025913, 0}, LiqK = {16, 0.15591, -186.43, -2.2714, 0.0033214, -0.0000018932}, VapK = {102, 0.00063365, 0.72057, 645.24, 0.005306, 0}, Racketparam = 0, UniquacR = 1.638761, UniquacQ = 1.564, ChaoSeadAF = 0.714406, ChaoSeadSP = 29605.6, ChaoSeadLV = 0.041734); +end Nitricacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nitricoxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Nitricoxide.mo new file mode 100644 index 0000000..cc0053d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nitricoxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nitricoxide + extends General_Properties(SN = 19, name = "Nitricoxide", CAS = "10102-43-9", Tc = 180, Pc = 6480000, Vc = 0.058, Cc = 0.251, Tb = 121.38, Tm = 112.15, TT = 109.5, TP = 21890, MW = 30.006, LVB = 0.02344, AF = 0.582, SP = 23120, DM = 5.1E-31, SH = 90250000.0, IGHF = 9.025E+07, GEF = 8.657E+07, AS = 210600, HFMP = 2301000, HOC = -9.02489E+07, LiqDen = {105, 2.1354, 0.19686, 180.16, 0.15443, 0}, VP = {101, 98.67523, -3011.477, -13.21121, 0.000072078, 2}, LiqCp = {16, 38756, -323.94, 15.685, -0.060412, 0.00033434}, HOV = {106, 2.4721E+07, 2.2365, -5.8672, 6.8169, -2.7529}, VapCp = {16, 29831.89, -2622.96, 12.94433, -0.00260975, 6.261468E-07}, LiqVis = {101, -50.098, 734.63, 8.0267, -0.00017996, 2}, VapVis = {102, 0.0000010289, 0.55954, 89.353, 515.43, 0}, LiqK = {16, -0.85384, 4.7868, -0.010049, 0.0010454, -0.0000086044}, VapK = {102, 0.00046657, 0.73353, 58.917, -625.75, 0}, Racketparam = 0, UniquacR = 0.9163, UniquacQ = 0.9859, ChaoSeadAF = 0.582944, ChaoSeadSP = 23117.6, ChaoSeadLV = 0.0234267); +end Nitricoxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nitrobenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Nitrobenzene.mo new file mode 100644 index 0000000..7a7ebfe --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nitrobenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nitrobenzene + extends General_Properties(SN = 124, name = "Nitrobenzene", CAS = "98-95-3", Tc = 719, Pc = 4400000, Vc = 0.349, Cc = 0.257, Tb = 483.95, Tm = 278.91, TT = 278.87, TP = 6.69814, MW = 123.109, LVB = 0.102717, AF = 0.449158, SP = 22610, DM = 1.41E-29, SH = -168070000.0, IGHF = 6.75E+07, GEF = 1.63E+08, AS = 342100, HFMP = 1.16E+07, HOC = -2.9782E+09, LiqDen = {105, 0.69124, 0.24124, 719, 0.28137, 0}, VP = {101, 112.2302, -10538.91, -12.95686, 5.116363E-06, 2}, LiqCp = {16, 146460, 1160.6, 0.44135, 0.024575, -0.000013049}, HOV = {106, 4.9884E+07, -2.0813, 7.5215, -8.8126, 3.6947}, VapCp = {16, 112710, -1114.3, 13.93, -0.0013044, 3.7699E-07}, LiqVis = {101, -78.652, 4202, 10.37, -0.0000091095, 2}, VapVis = {102, 1.1361E-07, 0.80626, 193.03, -46.762, 0}, LiqK = {16, 0.11293, -401.92, 1.2826, -0.013207, 0.0000075932}, VapK = {102, 0.00014373, 0.9615, 718, -0.0027852, 0}, Racketparam = 0.251146, UniquacR = 4.13, UniquacQ = 3.14, ChaoSeadAF = 0.447966, ChaoSeadSP = 22612.4, ChaoSeadLV = 0.102717); +end Nitrobenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nitroethane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nitroethane.mo new file mode 100644 index 0000000..2c07ca2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nitroethane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nitroethane + extends General_Properties(SN = 380, name = "Nitroethane", CAS = "79-24-3", Tc = 557.15, Pc = 5160000, Vc = 0.236, Cc = 0.247, Tb = 387.22, Tm = 183.63, TT = 183.63, TP = 0.0317711, MW = 75.0666, LVB = 0.0720005, AF = 0.672348, SP = 23090, DM = 1.22E-29, SH = -22600000.0, IGHF = -1.022E+08, GEF = -4900000, AS = 315400, HFMP = 9853000, HOC = -1.25E+09, LiqDen = {105, 0.90007, 0.22451, 593.01, 0.26359, 0}, VP = {101, 81.03385, -7188.308, -8.680357, 0.0000053196, 2}, LiqCp = {16, 67990, 798.52, 2.4874, 0.02816, -0.000027001}, HOV = {106, 5.428692E+07, 0.314015, -0.225443, 1.068645, -0.953684}, VapCp = {16, 48198, -581.79, 12.283, 0.000023838, -2.2739E-08}, LiqVis = {101, 15.403, 194.75, -4.2217, 0.0000078126, 2}, VapVis = {102, 2.4631E-07, 0.70062, 285.76, -1030.8, 0}, LiqK = {16, -0.1486, 6.324, -1.0708, 0.00009663, -0.0000015981}, VapK = {102, 0.0011064, 0.69186, 675.03, 236860, 0}, Racketparam = 0.247, UniquacR = 2.6829, UniquacQ = 2.408, ChaoSeadAF = 0.380324, ChaoSeadSP = 23090, ChaoSeadLV = 0.0720005); +end Nitroethane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nitrogen.mo b/Simulator/Simulator/Files/Chemsep_Database/Nitrogen.mo new file mode 100644 index 0000000..9f51daa --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nitrogen.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nitrogen + extends General_Properties(SN = 21, name = "Nitrogen", CAS = "7727-37-9", Tc = 126.2, Pc = 3398000, Vc = 0.0901, Cc = 0.289, Tb = 77.35, Tm = 63.149, TT = 63.149, TP = 12520, MW = 28.014, LVB = 0.03484, AF = 0.037, SP = 9082, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 191500, HFMP = 720000, HOC = 0, LiqDen = {105, 2.435, 0.25137, 126.27, 0.249, 0}, VP = {101, 42.32946, -965.9771, -4.321774, 0.0000797271, 2}, LiqCp = {16, 55135, 217.45, -0.9071, 0.05327, 0.00024166}, HOV = {106, 2.7284E+07, 7.8021, -19.125, 19.518, -7.5428}, VapCp = {16, 29103.63, -2305.946, 11.31935, -0.00100557, 1.706099E-07}, LiqVis = {101, 3.4358, -24.706, -2.6748, -0.000041603, 2}, VapVis = {102, 4.6051E-07, 0.65049, 5.8019, 2822.7, 0}, LiqK = {16, -0.21743, 10.383, -1.0631, 0.00036245, -0.000023265}, VapK = {102, 0.0003395, 0.76921, 19.592, 293.93, 0}, Racketparam = 0.2906, UniquacR = 1.0415, UniquacQ = 1.088, ChaoSeadAF = 0.045, ChaoSeadSP = 9081.94, ChaoSeadLV = 0.0346723); +end Nitrogen; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nitrogendioxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Nitrogendioxide.mo new file mode 100644 index 0000000..c116354 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nitrogendioxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nitrogendioxide + extends General_Properties(SN = 20, name = "Nitrogendioxide", CAS = "10102-44-0", Tc = 431.15, Pc = 1.01325E+07, Vc = 0.08249, Cc = 0.233, Tb = 294.15, Tm = 261.9, TT = 261.9, TP = 18728.3, MW = 46.0055, LVB = 0.031997, AF = 0.851088, SP = 33390, DM = 1.05E-30, SH = 33180000.0, IGHF = 3.318E+07, GEF = 5.1328E+07, AS = 239920, HFMP = 1.465E+07, HOC = -3.30954E+07, LiqDen = {105, 2.2179, 0.22994, 431.38, 0.19006, 0}, VP = {101, 18.404, -3508.6, 0.81255, 0.0000049983, 2}, LiqCp = {16, 77435, 432.69, 5.3737, 0.020804, -0.000021695}, HOV = {106, 5.37E+07, 0.3, 0, 0, 0}, VapCp = {16, 32962.96, -578.7755, 10.44921, 0.0000793322, -5.181036E-08}, LiqVis = {101, -311.49, 10041, 49.027, -0.00010518, 2}, VapVis = {102, 1.2078E-08, 1.1399, -382.56, 78187, 0}, LiqK = {16, 0.11611, 127610, -1409.1, 5.1777, -0.0063738}, VapK = {102, 0.070851, -0.2143, -1258, 429500, 0}, Racketparam = 0, UniquacR = 1.053395, UniquacQ = 1.1308, ChaoSeadAF = 0.851088, ChaoSeadSP = 33494.8, ChaoSeadLV = 0.0317854); +end Nitrogendioxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nitrogentetroxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Nitrogentetroxide.mo new file mode 100644 index 0000000..8def3a2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nitrogentetroxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nitrogentetroxide + extends General_Properties(SN = 196, name = "Nitrogentetroxide", CAS = "10544-72-6", Tc = 431.15, Pc = 1.00312E+07, Vc = 0.08249, Cc = 0.233, Tb = 294.3, Tm = 263.01, TT = 261.9, TP = 18558.7, MW = 92.011, LVB = 0.06407, AF = 0.853274, SP = 24123.32, DM = 0, SH = 9162960.0, IGHF = 9162960, GEF = 9.785E+07, AS = 304320, HFMP = 1.465E+07, HOC = 1983170, LiqDen = {105, 2.117, 0.32671, 431.15, 0.20832, 0}, VP = {101, 72.419, -5432, -7.7259, 0.00001711, 2}, LiqCp = {16, 112080, 15.081, 5.5387, 0.025083, -0.000030338}, HOV = {106, 3.0678E+07, 0.17744, -0.16521, -0.11792, 0.13193}, VapCp = {16, 39950.82, -260.1236, 11.41281, 0.000224817, -1.049284E-07}, LiqVis = {101, -340.1, 10957, 53.641, -0.00011365, 2}, VapVis = {102, 0.0000080298, 0.2905, 212.56, 117290, 0}, LiqK = {16, 0.11499, 26916, -297.75, 1.089, -0.0013592}, VapK = {102, 0.000019664, 1.1277, 265.48, -210280, 0}, Racketparam = 0.233, UniquacR = 1.982861, UniquacQ = 1.984, ChaoSeadAF = 0.853274, ChaoSeadSP = 24123.32, ChaoSeadLV = 0.06407); +end Nitrogentetroxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nitrogentrioxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Nitrogentrioxide.mo new file mode 100644 index 0000000..9045ada --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nitrogentrioxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nitrogentrioxide + extends General_Properties(SN = 195, name = "Nitrogentrioxide", CAS = "10544-73-7", Tc = 451, Pc = 6990000, Vc = 0.195, Cc = 0.386, Tb = 276.65, Tm = 171.15, TT = 172.45, TP = 15.1767, MW = 76.0116, LVB = 0.0531885, AF = 0.431227, SP = 32600, DM = 7.078E-30, SH = 82843000.0, IGHF = 8.2843E+07, GEF = 1.39727E+08, AS = 308450, HFMP = 0, HOC = -8.2843E+07, LiqDen = {105, 2.7664, 0.37489, 451, 0.040027, 0}, VP = {101, 137.96, -7584.5, -17.9, 0.000022014, 2}, LiqCp = {0, 0, 0, 0, 0, 0}, HOV = {106, 6.1243E+07, 0.17457, -0.20195, -0.16172, 0.24757}, VapCp = {16, 37365, -232.94, 10.977, 0.00031169, -1.1931E-07}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {0, 0, 0, 0, 0, 0}, LiqK = {16, 0, 0, 0, 0, 0}, VapK = {0, 0, 0, 0, 0, 0}, Racketparam = 0.386, UniquacR = 1.738827, UniquacQ = 1.7628, ChaoSeadAF = 0.431227, ChaoSeadSP = 32600, ChaoSeadLV = 0.0531885); +end Nitrogentrioxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nitromethane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nitromethane.mo new file mode 100644 index 0000000..e636c46 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nitromethane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nitromethane + extends General_Properties(SN = 379, name = "Nitromethane", CAS = "75-52-5", Tc = 588, Pc = 5870000, Vc = 0.173, Cc = 0.208, Tb = 374.35, Tm = 244.6, TT = 244.6, TP = 146.529, MW = 61.04, LVB = 0.05396, AF = 0.348026, SP = 25700, DM = 1.15E-29, SH = -22600000.0, IGHF = -7.48E+07, GEF = -6940000, AS = 275000, HFMP = 9703000, HOC = -6.432E+08, LiqDen = {105, 1.2195, 0.22476, 588.16, 0.2787, 0}, VP = {101, 93.27, -7345.1, -10.689, 0.0000086998, 2}, LiqCp = {16, 80588, 345.48, 6.7575, 0.0084794, -0.0000031326}, HOV = {106, 4.160998E+07, -0.662124, 2.67118, -2.702805, 0.931262}, VapCp = {16, 38681, -615.84, 11.895, 0.000023118, -2.9677E-08}, LiqVis = {101, -10.411, 1047.6, -0.095445, 6.9198E-07, 2}, VapVis = {102, 4.2141E-07, 0.64539, 383.4, -1344.5, 0}, LiqK = {16, 0.050889, -150.55, -0.2952, -0.0028403, -0.0000022109}, VapK = {102, 0.000031393, 1.1117, -91.903, 128140, 0}, Racketparam = 0.208, UniquacR = 2.0086, UniquacQ = 1.868, ChaoSeadAF = 0.348026, ChaoSeadSP = 257, ChaoSeadLV = 0); +end Nitromethane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nitrousoxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Nitrousoxide.mo new file mode 100644 index 0000000..05b74c1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nitrousoxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nitrousoxide + extends General_Properties(SN = 22, name = "Nitrousoxide", CAS = "10024-97-2", Tc = 309.6, Pc = 7255000, Vc = 0.097, Cc = 0.273, Tb = 184.67, Tm = 182.33, TT = 182.3, TP = 87850, MW = 44.013, LVB = 0.0359, AF = 0.162, SP = 8275, DM = 5.57E-31, SH = 82050000.0, IGHF = 8.205E+07, GEF = 1.0416E+08, AS = 219850, HFMP = 6539000, HOC = -8.20482E+07, LiqDen = {105, 2.0978, 0.2338, 309.6, 0.25899, 0}, VP = {101, 50.69662, -2836.473, -4.609937, 7.237315E-06, 2}, LiqCp = {16, 72525, 232.93, 2.2666, 0.037329, -0.000055304}, HOV = {106, 2.585559E+07, 0.982629, -2.292314, 3.369827, -1.65657}, VapCp = {16, 28650, -400.03, 10.5, 0.00014292, -6.728E-08}, LiqVis = {101, -10.876, 472.99, 0.14659, -0.000013815, 2}, VapVis = {102, 0.0000020512, 0.47044, 305.02, -521.81, 0}, LiqK = {16, 0.10112, -5274.1, 16.778, -0.037729, -0.000048678}, VapK = {102, 0.001121, 0.66298, 524.68, 7332.7, 0}, Racketparam = 0, UniquacR = 1.238, UniquacQ = 1.2442, ChaoSeadAF = 0.140894, ChaoSeadSP = 20308, ChaoSeadLV = 0.036002); +end Nitrousoxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nndimethylacetamide.mo b/Simulator/Simulator/Files/Chemsep_Database/Nndimethylacetamide.mo new file mode 100644 index 0000000..d84800e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nndimethylacetamide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nndimethylacetamide + extends General_Properties(SN = 91, name = "Nndimethylacetamide", CAS = "127-19-5", Tc = 658, Pc = 4030000, Vc = 0.321, Cc = 0.236, Tb = 439.25, Tm = 253.15, TT = 253.15, TP = 7.64072, MW = 87.1204, LVB = 0.0930285, AF = 0.363509, SP = 22350, DM = 1.27088E-29, SH = -17100000.0, IGHF = -2.25E+08, GEF = -8.85E+07, AS = 351000, HFMP = 1.04182E+07, HOC = -2.38E+09, LiqDen = {105, 0.72553, 0.2328, 658, 0.27034, 0}, VP = {101, 67.333, -7592.9, -6.3978, 0.0000021543, 2}, LiqCp = {16, 175450, 252.77, 11.249, -0.052983, 0.00011812}, HOV = {106, 5.8939E+07, 0.34564, -0.28415, 0.52832, -0.2171}, VapCp = {16, 41899, -423.52, 12.444, 0.00039958, -1.2339E-07}, LiqVis = {101, 16.727, -219.71, -4.0135, -0.0000013942, 2}, VapVis = {102, 3.4592E-07, 0.64442, 412.29, -8784, 0}, LiqK = {16, 0.06447, -206.75, -0.7204, 0.00031649, -0.000010441}, VapK = {102, 0.0011762, 0.72055, 943.06, 275760, 0}, Racketparam = 0.258662, UniquacR = 3.760053, UniquacQ = 3.276, ChaoSeadAF = 0.363509, ChaoSeadSP = 22352.7, ChaoSeadLV = 0.0930285); +end Nndimethylacetamide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nndimethylformamide.mo b/Simulator/Simulator/Files/Chemsep_Database/Nndimethylformamide.mo new file mode 100644 index 0000000..ea4401e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nndimethylformamide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nndimethylformamide + extends General_Properties(SN = 66, name = "Nndimethylformamide", CAS = "68-12-2", Tc = 649.6, Pc = 4420000, Vc = 0.26199, Cc = 0.214, Tb = 425.15, Tm = 212.72, TT = 212.72, TP = 0.195325, MW = 73.0938, LVB = 0.0773903, AF = 0.31771, SP = 23960, DM = 1.27E-29, SH = 20230000.0, IGHF = -1.917E+08, GEF = -8.84E+07, AS = 326000, HFMP = 1.615E+07, HOC = -1.78871E+09, LiqDen = {105, 0.65216, 0.20032, 649.6, 0.24418, 0}, VP = {101, 68.99879, -7311.388, -6.749791, 3.063845E-06, 2}, LiqCp = {16, 141440, 162.91, 4.0696, 0.019381, -0.000013063}, HOV = {106, 5.7496E+07, 0.2466, 0.21619, -0.11587, 0.026126}, VapCp = {16, 68728, -846.07, 13.139, -0.00064688, 1.6133E-07}, LiqVis = {101, -9.089031, 826.091, -0.0843389, -3.479212E-06, 2}, VapVis = {102, 0.0000034602, 0.37991, 1156.9, 8715.8, 0}, LiqK = {16, 0.14084, -2496, 20.244, -0.064914, 0.000049356}, VapK = {102, 0.015205, 0.35461, 594.92, 741220, 0}, Racketparam = 0, UniquacR = 3.0856, UniquacQ = 2.736, ChaoSeadAF = 0.375516, ChaoSeadSP = 23964.9, ChaoSeadLV = 0.0773743); +end Nndimethylformamide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nnonacosane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nnonacosane.mo new file mode 100644 index 0000000..8611cb2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nnonacosane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nnonacosane + extends General_Properties(SN = 216, name = "Nnonacosane", CAS = "630-03-5", Tc = 838, Pc = 826000, Vc = 1.69, Cc = 0.2, Tb = 713.95, Tm = 339.15, TT = 336.85, TP = 0.0000684619, MW = 408.787, LVB = 0.523824, AF = 1.26531, SP = 15500, DM = 0, SH = -1209000000.0, IGHF = -6.435E+08, GEF = 1.879E+08, AS = 1295000, HFMP = 6.6107E+07, HOC = -1.782E+10, LiqDen = {105, 0.12857, 0.23366, 838, 0.30121, 0}, VP = {101, -4.241455, -11668.64, 5.534214, -8.103778E-06, 2}, LiqCp = {16, -89782, -199.31, 14.448, -0.00027681, 5.1812E-07}, HOV = {106, 1.9213E+08, 0.53282, 0.78359, -0.96953, 0.062608}, VapCp = {16, 383900, -568.27, 14.435, 0.00012081, -4.6695E-08}, LiqVis = {101, -11.543, 2141.6, 0.0076776, -5.4408E-09, 2}, VapVis = {102, 2.7904E-07, 0.59854, 575.23, 50800, 0}, LiqK = {16, -0.1272, 8.851, -1.1267, -0.00035068, -3.6961E-07}, VapK = {102, -257.69, 1.0697, -7.2501E+09, -1.1593E+11, 0}, Racketparam = 0.2, UniquacR = 20.011, UniquacQ = 16.276, ChaoSeadAF = 1.26531, ChaoSeadSP = 15500, ChaoSeadLV = 0.523824); +end Nnonacosane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nnonadecane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nnonadecane.mo new file mode 100644 index 0000000..5b61e73 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nnonadecane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nnonadecane + extends General_Properties(SN = 207, name = "Nnonadecane", CAS = "629-92-5", Tc = 760, Pc = 1230000, Vc = 1.1, Cc = 0.215, Tb = 603.75, Tm = 305.05, TT = 305.04, TP = 0.0159089, MW = 268.521, LVB = 0.343701, AF = 0.8271, SP = 16200, DM = 0, SH = -1209000000.0, IGHF = -4.3514E+08, GEF = 1.075E+08, AS = 898930, HFMP = 5.02E+07, HOC = -1.17812E+10, LiqDen = {105, 0.20149, 0.23831, 760, 0.29903, 0}, VP = {101, 182.4003, -17843.62, -22.48728, 7.349606E-06, 2}, LiqCp = {16, 244790, 42.54, 11.446, 0.0046334, -0.0000026668}, HOV = {106, 1.5404E+08, 1.2215, -0.32899, -1.0541, 0.6821}, VapCp = {16, 274480, -648.39, 14.221, -0.00011095, 3.3607E-08}, LiqVis = {101, -84.761, 5101, 11.082, -0.0000087239, 2}, VapVis = {102, 3.0651E-07, 0.58942, 341.93, 67425, 0}, LiqK = {16, -0.057019, 73.111, -2.1518, 0.0021618, -0.0000035171}, VapK = {102, 0.000043333, 1.271, 2799.6, 138170, 0}, Racketparam = 0.215, UniquacR = 13.267, UniquacQ = 10.876, ChaoSeadAF = 0.8271, ChaoSeadSP = 16200, ChaoSeadLV = 0.343701); +end Nnonadecane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nnonane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nnonane.mo new file mode 100644 index 0000000..0b00deb --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nnonane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nnonane + extends General_Properties(SN = 166, name = "Nnonane", CAS = "111-84-2", Tc = 594.6, Pc = 2290000, Vc = 0.555, Cc = 0.257, Tb = 423.97, Tm = 219.66, TT = 219.66, TP = 0.430583, MW = 128.258, LVB = 0.1797, AF = 0.443, SP = 15630, DM = 0, SH = -168070000.0, IGHF = -2.2874E+08, GEF = 2.498E+07, AS = 506400, HFMP = 1.547E+07, HOC = -5.68455E+09, LiqDen = {105, 0.46379, 0.25569, 594.6, 0.27961, 0}, VP = {101, 34.38252, -6235.412, -1.153933, -6.408486E-06, 2}, LiqCp = {16, 263370, -14466, 134.04, -0.36823, 0.00038456}, HOV = {106, 8.427482E+07, 1.573752, -1.785921, 0.692082, 0.00268541}, VapCp = {16, 137710, -699.52, 13.613, -0.00021735, 5.3695E-08}, LiqVis = {101, -75.488, 3420.7, 10.183, -0.000014836, 2}, VapVis = {102, 1.0363E-07, 0.77284, 221.39, -190.1, 0}, LiqK = {16, 0.022998, -23.224, -1.6475, -0.000633, -0.0000035211}, VapK = {102, -0.065472, 0.27739, -3569.2, -1629700, 0}, Racketparam = 0.251687, UniquacR = 6.523, UniquacQ = 5.476, ChaoSeadAF = 0.4439, ChaoSeadSP = 15648.08, ChaoSeadLV = 0.1796); +end Nnonane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Noctacosane.mo b/Simulator/Simulator/Files/Chemsep_Database/Noctacosane.mo new file mode 100644 index 0000000..14fb607 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Noctacosane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Noctacosane + extends General_Properties(SN = 215, name = "Noctacosane", CAS = "630-02-4", Tc = 843, Pc = 888000, Vc = 1.58, Cc = 0.2, Tb = 704.75, Tm = 334.55, TT = 334.35, TP = 0.000104457, MW = 394.76, LVB = 0.492645, AF = 1.23752, SP = 15700, DM = 0, SH = -1209000000.0, IGHF = -6.228E+08, GEF = 1.799E+08, AS = 1255000, HFMP = 6.4643E+07, HOC = -1.722E+10, LiqDen = {105, 0.0073167, 0.055448, 843, 0.13236, 0}, VP = {101, 196.5874, -22285.21, -23.91336, 7.155924E-06, 2}, LiqCp = {16, 494250, -131.76, 12.406, 0.0033619, -0.0000018387}, HOV = {106, 2.0593E+08, 0.90796, 0.4061, -1.298, 0.44283}, VapCp = {16, 335140, -505.51, 14.268, 0.00027376, -9.6008E-08}, LiqVis = {101, -110.67, 6750.2, 14.886, -0.000010312, 2}, VapVis = {102, 0.0000003028, 0.58316, 487.28, 64252, 0}, LiqK = {16, -0.0095167, -82.828, -0.8204, -0.0023614, 5.0131E-07}, VapK = {102, -190.77, 1.0711, -5.355E+09, -7.036E+10, 0}, Racketparam = 0.2, UniquacR = 19.3366, UniquacQ = 15.736, ChaoSeadAF = 1.23752, ChaoSeadSP = 15700, ChaoSeadLV = 0.492645); +end Noctacosane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Noctadecane.mo b/Simulator/Simulator/Files/Chemsep_Database/Noctadecane.mo new file mode 100644 index 0000000..eb2e345 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Noctadecane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Noctadecane + extends General_Properties(SN = 206, name = "Noctadecane", CAS = "593-45-3", Tc = 747, Pc = 1290000, Vc = 1.189, Cc = 0.247, Tb = 588.3, Tm = 301.33, TT = 301.33, TP = 0.0339091, MW = 254.5, LVB = 0.32666, AF = 0.808, SP = 16100, DM = 0, SH = -1209000000.0, IGHF = -4.1457E+08, GEF = 9.921E+07, AS = 859450, HFMP = 6.1986E+07, HOC = -1.11726E+10, LiqDen = {105, 0.21099, 0.23901, 748.16, 0.28153, 0}, VP = {101, 156.4726, -16120.27, -18.72498, 5.38655E-06, 2}, LiqCp = {16, 332820, -15.176, 11.369, 0.0039066, -0.0000015738}, HOV = {106, 1.214E+08, 0.36333, 1.283, -2.0514, 0.85175}, VapCp = {16, 258960, -641.43, 14.136, -0.000068602, 1.814E-08}, LiqVis = {101, -83.956, 4978.7, 10.99, -0.0000089834, 2}, VapVis = {102, 3.2955E-07, 0.58255, 343.75, 67974, 0}, LiqK = {16, -0.046627, -130.56, -0.64842, -0.0017182, -4.6995E-07}, VapK = {102, -198.99, 1.1011, -5.9685E+09, 5.2419E+11, 0}, Racketparam = 0.247, UniquacR = 12.5926, UniquacQ = 10.336, ChaoSeadAF = 0.808, ChaoSeadSP = 16100, ChaoSeadLV = 0.32666); +end Noctadecane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Noctane.mo b/Simulator/Simulator/Files/Chemsep_Database/Noctane.mo new file mode 100644 index 0000000..47bf787 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Noctane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Noctane + extends General_Properties(SN = 155, name = "Noctane", CAS = "111-65-9", Tc = 568.7, Pc = 2490000, Vc = 0.492, Cc = 0.259, Tb = 398.82, Tm = 216.38, TT = 216.38, TP = 2.1083, MW = 114.231, LVB = 0.16353, AF = 0.397, SP = 15490, DM = 0, SH = -168070000.0, IGHF = -2.0875E+08, GEF = 1.6E+07, AS = 467230, HFMP = 2.074E+07, HOC = -5.07415E+09, LiqDen = {105, 0.4436, 0.23818, 568.77, 0.25171, 0}, VP = {101, 87.46069, -7578.199, -9.657211, 5.664818E-06, 2}, LiqCp = {16, 184080, 362.58, 6.1268, 0.015908, -0.000010697}, HOV = {106, 6.509104E+07, 0.906328, -0.61829, 0.0251605, 0.114898}, VapCp = {16, 123360, -700.1, 13.486, -0.00019118, 4.5401E-08}, LiqVis = {101, -67.06275, 2937.699, 8.939458, -0.0000146474, 2}, VapVis = {102, 7.2215E-09, 1.1166, -127.08, 17623, 0}, LiqK = {16, -0.03316, 17.841, -1.6367, -0.000047737, -0.0000026501}, VapK = {102, -8968.5, 0.84408, -2.7564E+10, -6.5097E+10, 0}, Racketparam = 0.2567, UniquacR = 5.8486, UniquacQ = 4.936, ChaoSeadAF = 0.3992, ChaoSeadSP = 15445.57, ChaoSeadLV = 0.163455); +end Noctane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Npentacosane.mo b/Simulator/Simulator/Files/Chemsep_Database/Npentacosane.mo new file mode 100644 index 0000000..11f9ee8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Npentacosane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Npentacosane + extends General_Properties(SN = 212, name = "Npentacosane", CAS = "629-99-2", Tc = 836.31, Pc = 1202000, Vc = 1.418, Cc = 0.205, Tb = 675.05, Tm = 327.9, TT = 326.65, TP = 0.00079876, MW = 352.68, LVB = 0.442767, AF = 1.10526, SP = 15800, DM = 0, SH = -1209000000.0, IGHF = -5.607E+08, GEF = 1.553E+08, AS = 1143000, HFMP = 5.7739E+07, HOC = -1.539E+10, LiqDen = {105, 0.00063401, 0.015388, 836.31, 0.093752, 0}, VP = {101, -203.2504, -1095.063, 35.1974, -0.0000282197, 2}, LiqCp = {16, 528340, -126.87, 12.075, 0.002955, -9.8642E-07}, HOV = {106, 1.9288E+08, 1.8937, -3.4712, 3.9636, -1.9344}, VapCp = {16, 330530, -566.25, 14.283, 0.00012874, -4.9096E-08}, LiqVis = {101, -9.804, 1971.8, -0.26998, 3.9914E-07, 2}, VapVis = {102, 2.8769E-07, 0.61575, 746.72, 4040.4, 0}, LiqK = {16, 0.0058343, -203.86, -0.37432, -0.0029792, 2.4773E-07}, VapK = {102, -266.99, 1.0606, -6.4961E+09, -1.2167E+11, 0}, Racketparam = 0.205, UniquacR = 17.3134, UniquacQ = 14.116, ChaoSeadAF = 1.10526, ChaoSeadSP = 15800, ChaoSeadLV = 0.442767); +end Npentacosane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Npentadecane.mo b/Simulator/Simulator/Files/Chemsep_Database/Npentadecane.mo new file mode 100644 index 0000000..20d4403 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Npentadecane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Npentadecane + extends General_Properties(SN = 184, name = "Npentadecane", CAS = "629-62-9", Tc = 708, Pc = 1480000, Vc = 0.966, Cc = 0.243, Tb = 543.83, Tm = 283.072, TT = 283.072, TP = 0.128872, MW = 212.419, LVB = 0.27771, AF = 0.685, SP = 16210, DM = 0, SH = -168070000.0, IGHF = -3.5311E+08, GEF = 7.426E+07, AS = 741810, HFMP = 3.459E+07, HOC = -9.34237E+09, LiqDen = {105, 0.26611, 0.24483, 708, 0.29579, 0}, VP = {101, 105.7905, -12176.19, -11.51031, 2.157424E-06, 2}, LiqCp = {16, 44888, 73.977, 11.979, 0.0027483, -9.4622E-07}, HOV = {106, 1.334182E+08, 1.382258, -0.345375, -1.508041, 0.995233}, VapCp = {16, 218790, -655.87, 14.013, -0.00013811, 4.3573E-08}, LiqVis = {101, -91.37005, 4965.801, 12.24551, -0.0000115231, 2}, VapVis = {102, 3.2252E-08, 0.90575, 168.22, 3233.4, 0}, LiqK = {16, 0.010742, -152.75, -0.43594, -0.0040245, 0.0000012373}, VapK = {102, 0.0000047787, 1.4851, 642.9, 182.7, 0}, Racketparam = 0.245, UniquacR = 10.5694, UniquacQ = 8.716001, ChaoSeadAF = 0.6743, ChaoSeadSP = 16282.18, ChaoSeadLV = 0.2778); +end Npentadecane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Npentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Npentane.mo new file mode 100644 index 0000000..9eeed6a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Npentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Npentane + extends General_Properties(SN = 115, name = "Npentane", CAS = "109-66-0", Tc = 469.7, Pc = 3370000, Vc = 0.311, Cc = 0.268, Tb = 309.22, Tm = 143.42, TT = 143.42, TP = 0.0686418, MW = 72.15, LVB = 0.11522, AF = 0.251, SP = 14380, DM = 0, SH = -27600000.0, IGHF = -1.4676E+08, GEF = -8813000, AS = 349450, HFMP = 8401500, HOC = -3.24494E+09, LiqDen = {105, 0.77386, 0.25574, 469.7, 0.26319, 0}, VP = {101, 72.14242, -5265.589, -7.720709, 7.151866E-06, 2}, LiqCp = {16, 122980, 401.5, 3.9651, 0.024056, -0.000020161}, HOV = {106, 4.0854E+07, 0.25483, 0.96045, -1.5349, 0.72504}, VapCp = {16, 81062, -706.86, 12.962, -0.000049298, 2.8357E-09}, LiqVis = {101, -28.93847, 1176.355, 3.050544, -9.721368E-06, 2}, VapVis = {102, 5.9173E-08, 0.85109, 8.4138, 3723.2, 0}, LiqK = {16, 0.023649, -75.089, -0.64229, -0.005078, -2.7196E-07}, VapK = {102, -603.2, 0.74698, -8.1823E+08, -8.7865E+09, 0}, Racketparam = 0.2685, UniquacR = 3.8254, UniquacQ = 3.316, ChaoSeadAF = 0.2387, ChaoSeadSP = 14359.41, ChaoSeadLV = 0.1161); +end Npentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Npentylacetate.mo b/Simulator/Simulator/Files/Chemsep_Database/Npentylacetate.mo new file mode 100644 index 0000000..ee41ec6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Npentylacetate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Npentylacetate + extends General_Properties(SN = 338, name = "Npentylacetate", CAS = "628-63-7", Tc = 605.15, Pc = 2800000, Vc = 0.442, Cc = 0.245, Tb = 422.15, Tm = 202.35, TT = 202.35, TP = 0.0185761, MW = 130.185, LVB = 0.149382, AF = 0.413866, SP = 17360, DM = 6.44E-30, SH = -216400000.0, IGHF = -5.055E+08, GEF = -3.035E+08, AS = 481800, HFMP = 1.65E+07, HOC = -3.89405E+09, LiqDen = {105, 0.12608, 0.12252, 605.15, 0.16886, 0}, VP = {101, 168.7214, -11229.65, -22.11732, 0.0000177213, 2}, LiqCp = {16, 162580, 80.092, 8.5511, 0.011513, -0.0000095523}, HOV = {106, 7.883914E+07, 0.946213, -0.171734, -0.730153, 0.419139}, VapCp = {16, 47433, -339.24, 12.756, 0.0005476, -2.1862E-07}, LiqVis = {101, -24.376, 1661.3, 2.1378, -0.0000051198, 2}, VapVis = {102, 4.6095E-07, 0.57889, 337.64, -259.28, 0}, LiqK = {16, -0.08346, 4.4855, -1.2866, -0.00064282, -6.6262E-07}, VapK = {102, -0.014827, 0.47704, -3337.4, -1003300, 0}, Racketparam = 0.245, UniquacR = 5.5018, UniquacQ = 4.736, ChaoSeadAF = 0.447773, ChaoSeadSP = 17360, ChaoSeadLV = 0.149382); +end Npentylacetate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Npropylacetate.mo b/Simulator/Simulator/Files/Chemsep_Database/Npropylacetate.mo new file mode 100644 index 0000000..85b3619 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Npropylacetate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Npropylacetate + extends General_Properties(SN = 113, name = "Npropylacetate", CAS = "109-60-4", Tc = 549.4, Pc = 3330000, Vc = 0.345, Cc = 0.252, Tb = 374.65, Tm = 178.15, TT = 178.15, TP = 0.0171129, MW = 102.133, LVB = 0.11572, AF = 0.389, SP = 17890, DM = 5.97E-30, SH = -27600000.0, IGHF = -4.648E+08, GEF = -3.204E+08, AS = 402300, HFMP = 1.12E+07, HOC = -2.672E+09, LiqDen = {105, 0.57751, 0.2255, 549.4, 0.25884, 0}, VP = {101, 106.6613, -8095.022, -12.62161, 8.999471E-06, 2}, LiqCp = {16, 124410, 36.932, 8.3883, 0.012662, -0.000012028}, HOV = {106, 8.047503E+07, 1.798019, -2.259874, 1.293466, -0.333711}, VapCp = {16, 108820, -937.38, 13.511, -0.00062962, 1.4249E-07}, LiqVis = {101, 15.453, -157.9, -3.9304, -3.2102E-07, 2}, VapVis = {102, 1.9633E-07, 0.69295, 104.27, 10438, 0}, LiqK = {16, 0.045513, -31.328, -1.5572, -0.00066538, -0.0000053334}, VapK = {102, 1128.5, 1.014, 1.1605E+10, -1.2869E+11, 0}, Racketparam = 0, UniquacR = 4.153, UniquacQ = 3.656, ChaoSeadAF = 0.391, ChaoSeadSP = 18004.7, ChaoSeadLV = 0.115712); +end Npropylacetate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Npropylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Npropylbenzene.mo new file mode 100644 index 0000000..a392e16 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Npropylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Npropylbenzene + extends General_Properties(SN = 164, name = "Npropylbenzene", CAS = "103-65-1", Tc = 638.35, Pc = 3200000, Vc = 0.44, Cc = 0.265, Tb = 432.35, Tm = 173.55, TT = 173.55, TP = 0.000181372, MW = 120.194, LVB = 0.1402, AF = 0.345, SP = 17670, DM = 1.23E-30, SH = -168070000.0, IGHF = 7900000, GEF = 1.376E+08, AS = 400140, HFMP = 9268000, HOC = -4.95415E+09, LiqDen = {105, 0.56872, 0.25108, 638.35, 0.29337, 0}, VP = {101, 90.904, -8254.5, -10.105, 0.0000055769, 2}, LiqCp = {16, 44429, 65.841, 10.897, 0.0032658, -5.4402E-07}, HOV = {106, 7.1312E+07, 1.0445, -0.61076, -0.59569, 0.63332}, VapCp = {16, 82370, -622.6, 13.289, -0.00014307, 2.6658E-08}, LiqVis = {101, -15.601, 1467.9, 0.61045, 8.0442E-07, 2}, VapVis = {102, 4.6834E-07, 0.55936, 217.09, 10253, 0}, LiqK = {16, -0.081391, 2.87, -1.3455, -0.00061835, -5.1664E-07}, VapK = {102, 0.025018, 0.26728, 100.66, 971170, 0}, Racketparam = 0.2599, UniquacR = 5.2716, UniquacQ = 4.048, ChaoSeadAF = 0.3444, ChaoSeadSP = 17805.4, ChaoSeadLV = 0.139831); +end Npropylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Npropylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/Npropylcyclohexane.mo new file mode 100644 index 0000000..fe1e467 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Npropylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Npropylcyclohexane + extends General_Properties(SN = 165, name = "Npropylcyclohexane", CAS = "1678-92-8", Tc = 639.15, Pc = 2807000, Vc = 0.477, Cc = 0.252, Tb = 429.897, Tm = 178.25, TT = 178.25, TP = 0.000859078, MW = 126.239, LVB = 0.159758, AF = 0.259535, SP = 16350, DM = 0, SH = -168070000.0, IGHF = -1.933E+08, GEF = 4.738E+07, AS = 419530, HFMP = 1.037E+07, HOC = -5.47966E+09, LiqDen = {105, 0.55532, 0.26594, 639.15, 0.29886, 0}, VP = {101, 82.958, -7871.7, -8.8759, 0.0000037842, 2}, LiqCp = {16, 47569, 39.903, 11.009, 0.0038436, -0.0000012583}, HOV = {106, 6.8086E+07, 1.2548, -2.1193, 2.1809, -0.84474}, VapCp = {16, 123230, -835.51, 14.003, -0.00055451, 1.5912E-07}, LiqVis = {101, -18.964, 1768.3, 1.0133, 0.0000031666, 2}, VapVis = {102, 0.0000010206, 0.44533, 352.16, 7219.8, 0}, LiqK = {16, -0.049742, 3.3035, -1.5814, -0.00048571, -0.000001015}, VapK = {102, 0.000001205, 1.6222, -42.945, 15739, 0}, Racketparam = 0, UniquacR = 6.068799, UniquacQ = 4.856, ChaoSeadAF = 0.2577, ChaoSeadSP = 16377.1, ChaoSeadLV = 0.159758); +end Npropylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Npropylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Npropylcyclopentane.mo new file mode 100644 index 0000000..289cd4b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Npropylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Npropylcyclopentane + extends General_Properties(SN = 154, name = "Npropylcyclopentane", CAS = "2040-96-2", Tc = 596, Pc = 3020000, Vc = 0.428, Cc = 0.261, Tb = 404.11, Tm = 155.81, TT = 155.81, TP = 0.0000458874, MW = 112.213, LVB = 0.145193, AF = 0.326642, SP = 16360, DM = 0, SH = -168070000.0, IGHF = -1.481E+08, GEF = 5.344E+07, AS = 414500, HFMP = 1.003E+07, HOC = -4.89356E+09, LiqDen = {105, 0.63061, 0.26934, 596, 0.28169, 0}, VP = {101, 95.39512, -7846.538, -10.93845, 7.332031E-06, 2}, LiqCp = {16, 121270, 281.76, 6.7151, 0.017545, -0.000016082}, HOV = {106, 7.088104E+07, 1.477689, -1.919309, 1.219865, -0.332624}, VapCp = {16, 82387, -676.01, 13.514, -0.00019546, 4.9854E-08}, LiqVis = {101, -22.725, 1601.8, 1.7512, 2.3108E-07, 2}, VapVis = {102, 0.0000028167, 0.32978, 562.31, 4948.1, 0}, LiqK = {16, -0.033741, 2.5308, -1.6237, -0.00058186, -0.0000013118}, VapK = {102, 0.000098309, 1.0636, 611.41, 33175, 0}, Racketparam = 0, UniquacR = 5.3944, UniquacQ = 4.316, ChaoSeadAF = 0.27189, ChaoSeadSP = 16393.5, ChaoSeadLV = 0.145193); +end Npropylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Npropylformate.mo b/Simulator/Simulator/Files/Chemsep_Database/Npropylformate.mo new file mode 100644 index 0000000..49e2a20 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Npropylformate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Npropylformate + extends General_Properties(SN = 89, name = "Npropylformate", CAS = "110-74-7", Tc = 538, Pc = 4060000, Vc = 0.285, Cc = 0.259, Tb = 354.69, Tm = 180.25, TT = 180.25, TP = 0.211011, MW = 88.106, LVB = 0.09794, AF = 0.32, SP = 18470, DM = 6.37E-30, SH = -17100000.0, IGHF = -4.076E+08, GEF = -2.936E+08, AS = 367800, HFMP = 1.32E+07, HOC = -2.041E+09, LiqDen = {105, 0.915, 0.26134, 538, 0.28, 0}, VP = {101, 71.35267, -6244.56, -7.280094, 4.220422E-06, 2}, LiqCp = {16, 76453, -41.853, 10.797, 0.0021776, 0.0000016375}, HOV = {106, 5.414398E+07, 0.597341, -0.589234, 1.004533, -0.602007}, VapCp = {16, 48655, -455.54, 12.53, 0.000075917, -4.246E-09}, LiqVis = {101, -51.649, 2317.7, 6.5556, -0.000012396, 2}, VapVis = {102, 6.0899E-07, 0.58607, 368.57, -171.06, 0}, LiqK = {16, 0.017242, -22.474, -1.4478, -0.0011278, -0.0000020716}, VapK = {102, 661.08, 0.99232, 5.8449E+09, -9.0597E+10, 0}, Racketparam = 0, UniquacR = 3.4919, UniquacQ = 3.116, ChaoSeadAF = 0.314, ChaoSeadSP = 18339.9, ChaoSeadLV = 0.0979424); +end Npropylformate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Npropylmercaptan.mo b/Simulator/Simulator/Files/Chemsep_Database/Npropylmercaptan.mo new file mode 100644 index 0000000..b77e520 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Npropylmercaptan.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Npropylmercaptan + extends General_Properties(SN = 349, name = "Npropylmercaptan", CAS = "107-03-9", Tc = 536, Pc = 4520000, Vc = 0.254, Cc = 0.264, Tb = 340.65, Tm = 159.85, TT = 160, TP = 0.0651025, MW = 76.1606, LVB = 0.0911676, AF = 0.225, SP = 18020, DM = 5.17E-30, SH = -22600000.0, IGHF = -6.75E+07, GEF = 2700000, AS = 336400, HFMP = 5477000, HOC = -2.345E+09, LiqDen = {105, 0.98491, 0.2613, 536.61, 0.28105, 0}, VP = {101, 81.44938, -6196.556, -9.018418, 0.0000073391, 2}, LiqCp = {16, 104970, 204.83, 8.2793, 0.0048108, 0.0000020317}, HOV = {106, 4.183879E+07, -0.0306824, 1.010385, -0.640892, -0.0194755}, VapCp = {16, 69258, -718.05, 12.587, -0.000090812, 1.349E-08}, LiqVis = {101, -8.6328, 806.3, -0.3609, 0.0000011977, 2}, VapVis = {102, 2.0609E-07, 0.72623, 217.41, -10810, 0}, LiqK = {16, -0.061115, 3.3836, -1.3478, -0.00049487, -0.0000016211}, VapK = {102, 0.0088953, 0.51444, 2337.9, 345110, 0}, Racketparam = 0.264, UniquacR = 3.2265, UniquacQ = 2.756, ChaoSeadAF = 0.225, ChaoSeadSP = 18020, ChaoSeadLV = 0.0911676); +end Npropylmercaptan; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ntetracosane.mo b/Simulator/Simulator/Files/Chemsep_Database/Ntetracosane.mo new file mode 100644 index 0000000..1d7f40c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ntetracosane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ntetracosane + extends General_Properties(SN = 211, name = "Ntetracosane", CAS = "646-31-1", Tc = 810, Pc = 1020000, Vc = 1.36, Cc = 0.207, Tb = 664.45, Tm = 324.05, TT = 323.75, TP = 0.00138507, MW = 338.654, LVB = 0.426088, AF = 1.07102, SP = 15800, DM = 0, SH = -1209000000.0, IGHF = -5.4E+08, GEF = 1.472E+08, AS = 1097000, HFMP = 5.4894E+07, HOC = -1.479E+10, LiqDen = {105, 0.013821, 0.07087, 810, 0.13885, 0}, VP = {101, 118.4643, -17014.83, -12.51446, 1.109888E-07, 2}, LiqCp = {16, 397960, -97.814, 12.108, 0.0038156, -0.0000022229}, HOV = {106, 1.5462E+08, 0.24892, 1.8808, -2.829, 1.1319}, VapCp = {16, 318880, -569.39, 14.249, 0.00012213, -4.6983E-08}, LiqVis = {101, -64.748, 4433, 8.0272, -0.0000059771, 2}, VapVis = {102, 2.9788E-07, 0.59708, 514.64, 49388, 0}, LiqK = {16, 0.046069, -245.01, -0.62562, -0.0019192, -0.0000023135}, VapK = {102, -232.02, 1.063, -5.6529E+09, -8.4042E+10, 0}, Racketparam = 0.207, UniquacR = 16.639, UniquacQ = 13.576, ChaoSeadAF = 1.07102, ChaoSeadSP = 15800, ChaoSeadLV = 0.426088); +end Ntetracosane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ntetradecane.mo b/Simulator/Simulator/Files/Chemsep_Database/Ntetradecane.mo new file mode 100644 index 0000000..475a4be --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ntetradecane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ntetradecane + extends General_Properties(SN = 183, name = "Ntetradecane", CAS = "629-59-4", Tc = 693, Pc = 1570000, Vc = 0.894, Cc = 0.244, Tb = 526.76, Tm = 279.01, TT = 279.01, TP = 0.252685, MW = 198.392, LVB = 0.26132, AF = 0.644, SP = 16140, DM = 0, SH = -168070000.0, IGHF = -3.3244E+08, GEF = 6.599E+07, AS = 702590, HFMP = 4.507E+07, HOC = -8.73282E+09, LiqDen = {105, 0.26297, 0.23695, 693, 0.26861, 0}, VP = {101, 141.7696, -13265.67, -17.07041, 6.905252E-06, 2}, LiqCp = {16, 84257, 110.32, 11.507, 0.0033723, -0.0000011739}, HOV = {106, 1.216371E+08, 1.28014, -0.352636, -1.241735, 0.826459}, VapCp = {16, 204940, -657.01, 13.943, -0.00013248, 4.0902E-08}, LiqVis = {101, -84.61448, 4567.43, 11.25434, -0.0000111579, 2}, VapVis = {102, 3.4874E-09, 1.2039, -69.467, 11809, 0}, LiqK = {16, 0.039135, -208.63, -0.066493, -0.005844, 0.0000021711}, VapK = {102, -122.4, 0.86814, -5.5021E+08, -2.1347E+10, 0}, Racketparam = 0.234049, UniquacR = 9.895, UniquacQ = 8.176001, ChaoSeadAF = 0.6399, ChaoSeadSP = 16200.36, ChaoSeadLV = 0.2613); +end Ntetradecane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ntricosane.mo b/Simulator/Simulator/Files/Chemsep_Database/Ntricosane.mo new file mode 100644 index 0000000..c03891c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ntricosane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ntricosane + extends General_Properties(SN = 210, name = "Ntricosane", CAS = "638-67-5", Tc = 818.25, Pc = 1290000, Vc = 1.307, Cc = 0.208, Tb = 653.15, Tm = 320.95, TT = 320.65, TP = 0.00186855, MW = 324.627, LVB = 0.4074, AF = 1.02617, SP = 15800, DM = 0, SH = -1209000000.0, IGHF = -5.192E+08, GEF = 1.39E+08, AS = 1064000, HFMP = 5.3974E+07, HOC = -1.417E+10, LiqDen = {105, 0.048866, 0.12922, 818.25, 0.20531, 0}, VP = {101, -22.08031, -9534.111, 8.274049, -0.0000125255, 2}, LiqCp = {16, -58655, -99.845, 13.754, 0.00030768, 3.7705E-07}, HOV = {106, 1.6434E+08, 1.0068, -0.55169, 0.31454, -0.3244}, VapCp = {16, 304710, -567.01, 14.201, 0.00012862, -4.8999E-08}, LiqVis = {101, -8.8394, 1949.8, -0.47088, 0.0000010446, 2}, VapVis = {102, 2.8518E-07, 0.61933, 704.01, 6598.3, 0}, LiqK = {16, -0.18218, 0.19147, -0.94906, -0.00035642, -3.5025E-07}, VapK = {102, -232.83, 1.0566, -5.2747E+09, -9.8604E+10, 0}, Racketparam = 0.208, UniquacR = 15.9646, UniquacQ = 13.036, ChaoSeadAF = 1.02617, ChaoSeadSP = 15800, ChaoSeadLV = 0.4074); +end Ntricosane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ntridecane.mo b/Simulator/Simulator/Files/Chemsep_Database/Ntridecane.mo new file mode 100644 index 0000000..2498650 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ntridecane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ntridecane + extends General_Properties(SN = 181, name = "Ntridecane", CAS = "629-50-5", Tc = 675, Pc = 1680000, Vc = 0.823, Cc = 0.246, Tb = 508.63, Tm = 267.76, TT = 267.76, TP = 0.250959, MW = 184.365, LVB = 0.24494, AF = 0.61, SP = 16060, DM = 0, SH = -168070000.0, IGHF = -3.1177E+08, GEF = 5.771E+07, AS = 663370, HFMP = 2.85E+07, HOC = -8.1229E+09, LiqDen = {105, 0.29787, 0.24164, 675, 0.29254, 0}, VP = {101, 143.3256, -12766.72, -17.45421, 7.99709E-06, 2}, LiqCp = {16, 37167, 123.48, 11.52, 0.0033147, -0.0000011194}, HOV = {106, 9.732822E+07, 0.667983, 0.462399, -1.329972, 0.649193}, VapCp = {16, 191240, -657.52, 13.861, -0.00011498, 3.3409E-08}, LiqVis = {101, -81.45907, 4309.552, 10.81921, -0.000011395, 2}, VapVis = {102, 3.0146E-08, 0.91936, 136.12, 2279.8, 0}, LiqK = {16, 0.037294, -193.16, -0.1108, -0.0058295, 0.0000022551}, VapK = {102, 0.0000050471, 1.4806, 553.99, 7554.4, 0}, Racketparam = 0.2465, UniquacR = 9.2206, UniquacQ = 7.636, ChaoSeadAF = 0.6002, ChaoSeadSP = 16139, ChaoSeadLV = 0.2449); +end Ntridecane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Nundecane.mo b/Simulator/Simulator/Files/Chemsep_Database/Nundecane.mo new file mode 100644 index 0000000..9ca5765 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Nundecane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Nundecane + extends General_Properties(SN = 176, name = "Nundecane", CAS = "1120-21-4", Tc = 639, Pc = 1980000, Vc = 0.689, Cc = 0.257, Tb = 469.08, Tm = 247.571, TT = 247.571, TP = 0.408414, MW = 156.312, LVB = 0.21224, AF = 0.538, SP = 15880, DM = 0, SH = -168070000.0, IGHF = -2.7043E+08, GEF = 4.116E+07, AS = 584930, HFMP = 2.218E+07, HOC = -6.9036E+09, LiqDen = {105, 0.36785, 0.24938, 639, 0.28395, 0}, VP = {101, 128.8551, -11029.21, -15.54009, 8.030888E-06, 2}, LiqCp = {16, 208030, 521.1, 6.1551, 0.017086, -0.000013175}, HOV = {106, 8.9735E+07, 0.81788, 0.31647, -1.4781, 0.80673}, VapCp = {16, 177700, -730.83, 13.81, -0.00021088, 5.7776E-08}, LiqVis = {101, -92.575, 4408.9, 12.698, -0.000015556, 2}, VapVis = {102, 2.9213E-08, 0.9335, 118.62, -4363.8, 0}, LiqK = {16, 0.015185, -212.29, -0.044539, -0.0049614, 0.0000013629}, VapK = {102, 0.037608, 0.6852, 33443, 9124600, 0}, Racketparam = 0.243351, UniquacR = 7.871799, UniquacQ = 6.556, ChaoSeadAF = 0.521, ChaoSeadSP = 15934.45, ChaoSeadLV = 0.2122); +end Nundecane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ocresol.mo b/Simulator/Simulator/Files/Chemsep_Database/Ocresol.mo new file mode 100644 index 0000000..aef9f1c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ocresol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ocresol + extends General_Properties(SN = 142, name = "Ocresol", CAS = "95-48-7", Tc = 697.6, Pc = 5000000, Vc = 0.282, Cc = 0.243, Tb = 464.17, Tm = 304.19, TT = 304.19, TP = 65.3261, MW = 108.14, LVB = 0.10364, AF = 0.435, SP = 22870, DM = 4.84E-30, SH = -168070000.0, IGHF = -1.2857E+08, GEF = -3.543E+07, AS = 352590, HFMP = 1.582E+07, HOC = -3.528E+09, LiqDen = {105, 1.1115, 0.30952, 697.6, 0.31161, 0}, VP = {101, 140.51, -11819, -17.163, 0.0000087043, 2}, LiqCp = {16, 146600, -116.23, 11.009, 0.0034596, -0.0000033446}, HOV = {106, 9.9721E+07, 1.0333, 0.08043, -1.2193, 0.58124}, VapCp = {16, 64367, -535.92, 12.871, -0.000033383, -2.2759E-09}, LiqVis = {101, -455.0775, 20670.83, 67.87773, -0.0000660983, 2}, VapVis = {102, 8.7371E-08, 0.80775, 98.538, -0.0034513, 0}, LiqK = {16, 0.065471, 92.351, -2.8415, 0.0012245, -0.0000029956}, VapK = {102, 0.00018648, 0.9302, 709.37, -0.0036596, 0}, Racketparam = 0, UniquacR = 4.7567, UniquacQ = 3.888, ChaoSeadAF = 0.433455, ChaoSeadSP = 23397.9, ChaoSeadLV = 0.104368); +end Ocresol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ocymene.mo b/Simulator/Simulator/Files/Chemsep_Database/Ocymene.mo new file mode 100644 index 0000000..1982fe2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ocymene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ocymene + extends General_Properties(SN = 291, name = "Ocymene", CAS = "527-84-4", Tc = 670.15, Pc = 2895870, Vc = 0.478, Cc = 0.26, Tb = 451.33, Tm = 201.64, TT = 201.64, TP = 0.0177118, MW = 134.218, LVB = 0.153824, AF = 0.2769, SP = 17160, DM = 2.0E-30, SH = -1209000000.0, IGHF = -2.56061E+07, GEF = 1.37359E+08, AS = 425500, HFMP = 1.0E+07, HOC = -5.56053E+09, LiqDen = {105, 0.017298, 0.046645, 670.15, 0.11526, 0}, VP = {101, 47.323, -6536.6, -3.5074, 6.0254E-07, 2}, LiqCp = {16, 130330, -123.14, 10.583, 0.0062464, -0.0000049954}, HOV = {106, 8.44827E+07, 3.205721, -8.334975, 9.055186, -3.399515}, VapCp = {16, 105060, -664.9, 13.437, -0.00013826, 2.1794E-08}, LiqVis = {101, -8.1679, 885.64, -0.29176, -7.7161E-07, 2}, VapVis = {102, 0.0000020745, 0.37852, 642.92, 259.27, 0}, LiqK = {16, 0.06145, -173.56, -0.23519, -0.0077758, 0.0000038715}, VapK = {102, 0.000020459, 1.2217, 183.94, 51167, 0}, Racketparam = 0.26, UniquacR = 6.0058, UniquacQ = 4.612, ChaoSeadAF = 0.2769, ChaoSeadSP = 17160, ChaoSeadLV = 0.153824); +end Ocymene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Odichlorobenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Odichlorobenzene.mo new file mode 100644 index 0000000..d1feeab --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Odichlorobenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Odichlorobenzene + extends General_Properties(SN = 119, name = "Odichlorobenzene", CAS = "95-50-1", Tc = 705, Pc = 4070000, Vc = 0.351, Cc = 0.244, Tb = 453.57, Tm = 256.15, TT = 256.15, TP = 6.48939, MW = 147.002, LVB = 0.112969, AF = 0.219189, SP = 20310, DM = 8.34E-30, SH = -168070000.0, IGHF = 3.02E+07, GEF = 8.29E+07, AS = 341850, HFMP = 1.266E+07, HOC = -2.826E+09, LiqDen = {105, 0.74261, 0.26108, 705, 0.30655, 0}, VP = {101, 75.75983, -8226.762, -7.552754, 6.191298E-07, 2}, LiqCp = {16, 127840, -59.156, 8.3728, 0.0093569, -0.0000051714}, HOV = {106, 8.774E+07, 2.8227, -6.8433, 7.6547, -3.1275}, VapCp = {16, 55560, -490.51, 12.648, -0.00012186, 2.1792E-08}, LiqVis = {101, -37.699, 2377, 4.0848, -0.0000020768, 2}, VapVis = {102, 1.6041E-07, 0.76289, 205.1, -39.728, 0}, LiqK = {16, 0.06919, -379.09, 0.89948, -0.0099037, 0.0000041677}, VapK = {102, -1200.2, 0.7235, -2.8422E+09, -8.8684E+10, 0}, Racketparam = 0.271326, UniquacR = 4.4376, UniquacQ = 3.288, ChaoSeadAF = 0.214215, ChaoSeadSP = 20271.3, ChaoSeadLV = 0.11318); +end Odichlorobenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Odiethylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Odiethylbenzene.mo new file mode 100644 index 0000000..2172bf8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Odiethylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Odiethylbenzene + extends General_Properties(SN = 294, name = "Odiethylbenzene", CAS = "135-01-3", Tc = 668, Pc = 2880000, Vc = 0.502, Cc = 0.26, Tb = 456.573, Tm = 241.91, TT = 241.929, TP = 1.04119, MW = 134.2182, LVB = 0.15328, AF = 0.3879, SP = 17760, DM = 1.96803E-30, SH = -1209000000.0, IGHF = -1.89535E+07, GEF = 1.41084E+08, AS = 434800, HFMP = 1.67778E+07, HOC = -5.5596E+09, LiqDen = {105, 0.52086, 0.25389, 668, 0.28666, 0}, VP = {101, 136.1844, -10760.78, -16.88233, 0.0000109939, 2}, LiqCp = {16, 13731, 7.9227, 11.237, 0.004718, -0.0000037106}, HOV = {106, 4.4827E+07, -1.9073, 6.1295, -6.3772, 2.4857}, VapCp = {16, 122330, -723.39, 13.531, -0.00028953, 7.2562E-08}, LiqVis = {101, -13.971, 1608.7, 0.32395, -5.0533E-07, 2}, VapVis = {102, 4.8451E-08, 0.84013, -72.915, 24855, 0}, LiqK = {16, -0.047218, -11.073, -1.4189, -0.00077787, -7.5252E-07}, VapK = {102, 0.000087851, 1.0397, 505.4, 47466, 0}, Racketparam = 0.26, UniquacR = 6.0066, UniquacQ = 4.616, ChaoSeadAF = 0.3879, ChaoSeadSP = 17760, ChaoSeadLV = 0.15328); +end Odiethylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Oethyltoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/Oethyltoluene.mo new file mode 100644 index 0000000..ba8eb36 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Oethyltoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Oethyltoluene + extends General_Properties(SN = 282, name = "Oethyltoluene", CAS = "611-14-3", Tc = 651.15, Pc = 3040000, Vc = 0.46, Cc = 0.26, Tb = 438.33, Tm = 192.35, TT = 192.35, TP = 0.00376669, MW = 120.192, LVB = 0.136967, AF = 0.2941, SP = 18090, DM = 1.87E-30, SH = -1209000000.0, IGHF = 1213360, GEF = 1.31055E+08, AS = 399350, HFMP = 9962100, HOC = -4.94607E+09, LiqDen = {105, 0.37928, 0.20513, 651.15, 0.23356, 0}, VP = {101, 96.1971, -8650.261, -10.86209, 5.918239E-06, 2}, LiqCp = {16, -102370, -26.419, 12.162, 0.0026059, -0.000002126}, HOV = {106, 8.227273E+07, 1.968046, -3.535916, 3.107317, -1.061436}, VapCp = {16, 85432, -569.61, 13.054, 0.000095945, -4.3717E-08}, LiqVis = {101, -10.303, 1378.1, -0.24629, 5.1436E-07, 2}, VapVis = {102, 4.4089E-07, 0.56719, 270.1, -4560.2, 0}, LiqK = {16, -0.059289, 4.2071, -1.4739, -0.00039236, -0.0000010623}, VapK = {102, 0.000092842, 1.0422, 544.16, 63099, 0}, Racketparam = 0.26, UniquacR = 5.3322, UniquacQ = 4.076, ChaoSeadAF = 0.2941, ChaoSeadSP = 18090, ChaoSeadLV = 0.136967); +end Oethyltoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneFourbutanediol.mo b/Simulator/Simulator/Files/Chemsep_Database/OneFourbutanediol.mo new file mode 100644 index 0000000..9289195 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneFourbutanediol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneFourbutanediol + extends General_Properties(SN = 347, name = "OneFourbutanediol", CAS = "110-63-4", Tc = 667, Pc = 4880000, Vc = 0.297, Cc = 0.261, Tb = 501.15, Tm = 293.05, TT = 293.05, TP = 0.437872, MW = 90.121, LVB = 0.0888513, AF = 1.17696, SP = 28850, DM = 1.31E-29, SH = -216400000.0, IGHF = -4.267E+08, GEF = -2.78E+08, AS = 381000, HFMP = 1.63E+07, HOC = -2.2801E+09, LiqDen = {105, 0.87669, 0.26038, 667, 0.18382, 0}, VP = {101, 273.87, -20688, -36.39, 0.000020662, 2}, LiqCp = {16, -147300, -151.29, 13.013, 0.00082927, -4.8483E-07}, HOV = {106, 8.835E+07, 0.2441, 0, 0, 0}, VapCp = {16, 78857, -613.48, 12.793, -0.00013274, 6.7309E-08}, LiqVis = {101, -135.2818, 9167.078, 18.06409, -0.0000115446, 2}, VapVis = {102, 1.0592E-07, 0.79673, 195.38, -19182, 0}, LiqK = {16, 0.17847, -272.57, -0.42428, -0.0080796, 0.0000034419}, VapK = {102, -0.69878, 0.86746, -2810400, -7.1005E+07, 0}, Racketparam = 0.261, UniquacR = 4.6976, UniquacQ = 4.56, ChaoSeadAF = 1.17696, ChaoSeadSP = 28850, ChaoSeadLV = 0.0888513); +end OneFourbutanediol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneFourdioxane.mo b/Simulator/Simulator/Files/Chemsep_Database/OneFourdioxane.mo new file mode 100644 index 0000000..1336bad --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneFourdioxane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneFourdioxane + extends General_Properties(SN = 85, name = "OneFourdioxane", CAS = "123-91-1", Tc = 587, Pc = 5170000, Vc = 0.238, Cc = 0.255, Tb = 374.5, Tm = 284.95, TT = 284.95, TP = 2532.46, MW = 88.106, LVB = 0.08529, AF = 0.279262, SP = 20540, DM = 0, SH = -17100000.0, IGHF = -3.158E+08, GEF = -1.816E+08, AS = 300120, HFMP = 1.284E+07, HOC = -2.1863E+09, LiqDen = {105, 1.0039, 0.25926, 587, 0.28278, 0}, VP = {101, 50.11504, -5577.21, -4.046854, 2.080567E-06, 2}, LiqCp = {16, 151550, -65314, 519.35, -1.3402, 0.0011989}, HOV = {106, 2.1367E+08, 9.1812, -22.992, 23.854, -9.34}, VapCp = {16, 46250, -613.41, 12.822, 0.000004782, -2.2238E-08}, LiqVis = {101, -79.28, 4198.4, 10.393, -0.0000085568, 2}, VapVis = {102, 2.7334E-07, 0.7393, 129.93, -0.0004206, 0}, LiqK = {16, 0.089834, 46.421, -1.1898, -0.0037338, -0.0000061358}, VapK = {102, 2.3873E-07, 1.8505, -94.575, 7804.2, 0}, Racketparam = 0.254, UniquacR = 3.07, UniquacQ = 2.28, ChaoSeadAF = 0.280373, ChaoSeadSP = 20163.3, ChaoSeadLV = 0.0856635); +end OneFourdioxane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneOneTwotrichloroethane.mo b/Simulator/Simulator/Files/Chemsep_Database/OneOneTwotrichloroethane.mo new file mode 100644 index 0000000..b7fc684 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneOneTwotrichloroethane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneOneTwotrichloroethane + extends General_Properties(SN = 41, name = "OneOneTwotrichloroethane", CAS = "79-00-5", Tc = 602, Pc = 4480000, Vc = 0.281, Cc = 0.252, Tb = 387, Tm = 236.5, TT = 236.5, TP = 44.7475, MW = 133.404, LVB = 0.0929898, AF = 0.259135, SP = 19890, DM = 4.17E-30, SH = 28450000.0, IGHF = -1.42E+08, GEF = -8.097E+07, AS = 337100, HFMP = 1.13E+07, HOC = -9.685E+08, LiqDen = {105, 0.9055, 0.25465, 602, 0.30987, 0}, VP = {101, 66.05096, -6428.165, -6.44717, 3.27127E-06, 2}, LiqCp = {16, 121000, 433.16, 2.2235, 0.034423, -0.000040901}, HOV = {106, 5.0503E+07, 0.64021, -1.1382, 1.5379, -0.66031}, VapCp = {16, 56506, -535.36, 12.166, -0.00021958, 4.8605E-08}, LiqVis = {101, -26.218, 1571.3, 2.5992, -0.0000081378, 2}, VapVis = {102, 2.8974E-07, 0.68713, 200.47, -854.38, 0}, LiqK = {16, -0.027258, -78.724, -0.73941, -0.0030401, 8.8565E-07}, VapK = {102, 0.000095455, 1.0427, 1258.3, -2960.2, 0}, Racketparam = 0.267821, UniquacR = 3.526, UniquacQ = 2.948, ChaoSeadAF = 0.259768, ChaoSeadSP = 19818.9, ChaoSeadLV = 0.0929898); +end OneOneTwotrichloroethane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneOnedichloroethane.mo b/Simulator/Simulator/Files/Chemsep_Database/OneOnedichloroethane.mo new file mode 100644 index 0000000..6125036 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneOnedichloroethane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneOnedichloroethane + extends General_Properties(SN = 44, name = "OneOnedichloroethane", CAS = "75-34-3", Tc = 523, Pc = 5100000, Vc = 0.236, Cc = 0.277, Tb = 330.45, Tm = 176.19, TT = 176.19, TP = 2.21455, MW = 98.959, LVB = 0.08473, AF = 0.244, SP = 18300, DM = 6.87E-30, SH = 52510000.0, IGHF = -1.2941E+08, GEF = -7.259E+07, AS = 305010, HFMP = 7870000, HOC = -1.1104E+09, LiqDen = {105, 1.1057, 0.26536, 523, 0.28703, 0}, VP = {101, 66.53401, -5492.415, -6.715993, 5.298782E-06, 2}, LiqCp = {16, 115470, 479.34, 1.2009, 0.029511, -0.000025794}, HOV = {106, 4.458773E+07, 0.555838, 0.0209485, -0.722234, 0.56963}, VapCp = {16, 45661, -449.92, 11.802, 0.00015496, -5.3829E-08}, LiqVis = {101, -9.7803, 891.16, -0.14866, -3.5884E-07, 2}, VapVis = {102, 0.0000001814, 0.74706, 93.461, 1513.7, 0}, LiqK = {16, 0.011357, -64.086, -0.98127, -0.0039469, 6.6106E-07}, VapK = {102, 0.00013381, 1.01, 1042.5, -2442, 0}, Racketparam = 0, UniquacR = 2.9617, UniquacQ = 2.532, ChaoSeadAF = 0.244612, ChaoSeadSP = 18299.2, ChaoSeadLV = 0.0847207); +end OneOnedichloroethane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneOnedimethylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/OneOnedimethylcyclohexane.mo new file mode 100644 index 0000000..49983f2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneOnedimethylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneOnedimethylcyclohexane + extends General_Properties(SN = 274, name = "OneOnedimethylcyclohexane", CAS = "590-66-9", Tc = 591.15, Pc = 2938430, Vc = 0.45, Cc = 0.269, Tb = 392.69, Tm = 239.66, TT = 239.66, TP = 60.5841, MW = 112.213, LVB = 0.144469, AF = 0.2376, SP = 15670, DM = 0, SH = -1209000000.0, IGHF = -1.81E+08, GEF = 3.52293E+07, AS = 365012, HFMP = 2020870, HOC = -4.8639E+09, LiqDen = {105, 0.55073, 0.24971, 591.15, 0.27534, 0}, VP = {101, 81.518, -6942.5, -8.9, 0.0000054941, 2}, LiqCp = {16, 108760, -1.4419, 9.7271, 0.0071596, -0.0000038148}, HOV = {106, 7.5815E+07, 2.7664, -6.0218, 6.1598, -2.4093}, VapCp = {16, 97627, -847.07, 13.952, -0.00053736, 1.4024E-07}, LiqVis = {101, -7.7034, 1042.4, -0.53177, 8.3765E-07, 2}, VapVis = {102, 7.8141E-07, 0.4995, 371.04, 124.2, 0}, LiqK = {16, -0.0057011, -80.549, -0.98212, -0.0030094, 4.8733E-07}, VapK = {102, 0.01079, 0.39433, -74.36, 805370, 0}, Racketparam = 0.269, UniquacR = 5.3937, UniquacQ = 4.396, ChaoSeadAF = 0.2376, ChaoSeadSP = 15670, ChaoSeadLV = 0.144469); +end OneOnedimethylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneOnedimethylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/OneOnedimethylcyclopentane.mo new file mode 100644 index 0000000..df823d6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneOnedimethylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneOnedimethylcyclopentane + extends General_Properties(SN = 266, name = "OneOnedimethylcyclopentane", CAS = "1638-26-2", Tc = 547, Pc = 3445000, Vc = 0.36, Cc = 0.273, Tb = 361, Tm = 203.36, TT = 203.68, TP = 9.04909, MW = 98.1861, LVB = 0.130925, AF = 0.272354, SP = 15460, DM = 0, SH = -1209000000.0, IGHF = -1.3828E+08, GEF = 3.9037E+07, AS = 359280, HFMP = 1080000, HOC = -4.2752E+09, LiqDen = {105, 0.77031, 0.27731, 547, 0.30161, 0}, VP = {101, 80.69439, -6444.768, -8.840923, 5.777915E-06, 2}, LiqCp = {16, 63403, -76.912, 11.112, 0.0033685, -0.0000013786}, HOV = {106, 6.4753E+07, 1.835, -2.4221, 1.0097, 0.083052}, VapCp = {16, 84040, -831.97, 13.78, -0.00060484, 0.0000001825}, LiqVis = {101, -7.8132, 901.76, -0.51373, 0.0000011607, 2}, VapVis = {102, 0.0000055348, 0.28035, 888.45, 60.9, 0}, LiqK = {16, -0.012548, -26.729, -1.3811, -0.0017046, -8.8213E-07}, VapK = {102, 0.0025566, 0.60638, 165.73, 477660, 0}, Racketparam = 0.273, UniquacR = 4.7193, UniquacQ = 3.856, ChaoSeadAF = 0.272354, ChaoSeadSP = 15460, ChaoSeadLV = 0.130925); +end OneOnedimethylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneThreebutadiene.mo b/Simulator/Simulator/Files/Chemsep_Database/OneThreebutadiene.mo new file mode 100644 index 0000000..0d337e8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneThreebutadiene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneThreebutadiene + extends General_Properties(SN = 77, name = "OneThreebutadiene", CAS = "106-99-0", Tc = 425, Pc = 4320000, Vc = 0.221, Cc = 0.27, Tb = 268.62, Tm = 164.25, TT = 164.25, TP = 69.1989, MW = 54.092, LVB = 0.08804, AF = 0.195, SP = 14460, DM = 0, SH = 109240000.0, IGHF = 1.0924E+08, GEF = 1.4972E+08, AS = 278890, HFMP = 7984000, HOC = -2.409E+09, LiqDen = {105, 1.3314, 0.28213, 425, 0.30137, 0}, VP = {101, 64.81816, -4314.788, -6.766483, 8.589719E-06, 2}, LiqCp = {16, 88166, 583.44, 1.8231, 0.030118, -0.000025695}, HOV = {106, 3.4211E+07, 0.45981, 0.016247, -0.15407, 0.054476}, VapCp = {16, 38238.49, -511.235, 12.39338, -0.000121482, 4.39211E-08}, LiqVis = {101, 12.653, -139.12, -3.6735, -0.0000014093, 2}, VapVis = {102, 3.4426E-07, 0.6407, 174.17, -2393.4, 0}, LiqK = {16, -0.096853, 19.016, -1.4201, 0.00020099, -0.0000029536}, VapK = {102, -18588, 0.94195, -7.31E+10, -9.6975E+11, 0}, Racketparam = 0.2713, UniquacR = 2.6908, UniquacQ = 2.352, ChaoSeadAF = 0.2028, ChaoSeadSP = 14195.77, ChaoSeadLV = 0.088); +end OneThreebutadiene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneTwoFourFivetetramethylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/OneTwoFourFivetetramethylbenzene.mo new file mode 100644 index 0000000..e0e4922 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneTwoFourFivetetramethylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneTwoFourFivetetramethylbenzene + extends General_Properties(SN = 299, name = "OneTwoFourFivetetramethylbenzene", CAS = "95-93-2", Tc = 676, Pc = 2900000, Vc = 0.482, Cc = 0.249, Tb = 470, Tm = 352.384, TT = 352.384, TP = 1784.79, MW = 134.221, LVB = 0.15228, AF = 0.423, SP = 17140, DM = 0, SH = -1209000000.0, IGHF = -4.527E+07, GEF = 1.177E+08, AS = 418500, HFMP = 2.1E+07, HOC = -5.507E+09, LiqDen = {105, 0.65779, 0.28461, 677.16, 0.31429, 0}, VP = {101, 96.028, -9355.7, -10.676, 0.0000049509, 2}, LiqCp = {16, 139940, 1169.1, 1.2977, 0.02859, -0.000023286}, HOV = {106, 1.607707E+08, 4.915197, -10.37671, 9.303886, -3.220797}, VapCp = {16, 110940, -562.53, 13.019, 0.00027207, -1.0669E-07}, LiqVis = {101, -9.4175, 1452.8, -0.39341, 2.9469E-07, 2}, VapVis = {102, 7.2635E-07, 0.49106, 324.48, 3435.1, 0}, LiqK = {16, 0.023024, -350.01, 0.1946, -0.0044419, 6.7822E-07}, VapK = {102, 0.000066062, 1.0649, 306.1, 93850, 0}, Racketparam = 0.249, UniquacR = 6.1278, UniquacQ = 4.672, ChaoSeadAF = 0.423, ChaoSeadSP = 17140, ChaoSeadLV = 0.15228); +end OneTwoFourFivetetramethylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneTwoFourtrichlorobenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/OneTwoFourtrichlorobenzene.mo new file mode 100644 index 0000000..2803f5c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneTwoFourtrichlorobenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneTwoFourtrichlorobenzene + extends General_Properties(SN = 117, name = "OneTwoFourtrichlorobenzene", CAS = "120-82-1", Tc = 725, Pc = 3720000, Vc = 0.395, Cc = 0.244, Tb = 486.15, Tm = 290.15, TT = 290.15, TP = 33.0937, MW = 181.447, LVB = 0.12525, AF = 0.358106, SP = 20620, DM = 4.20291E-30, SH = -168070000.0, IGHF = -1.1757E+07, GEF = 4.30523E+07, AS = 380911, HFMP = 1.55647E+07, HOC = -2.65632E+09, LiqDen = {105, 0.61713, 0.2524, 725, 0.2857, 0}, VP = {101, 47.20405, -7460.647, -3.164866, -3.316432E-06, 2}, LiqCp = {16, 145370, 234.69, 6.2789, 0.017012, -0.000015675}, HOV = {106, 6.897E+07, 0.4026, 0, 0, 0}, VapCp = {16, 63130, -426.63, 12.569, -0.000095696, 1.4713E-08}, LiqVis = {101, -241, 9893.2, 36.115, -0.000047458, 2}, VapVis = {102, 9.2097E-08, 0.80621, 99.511, 1477.5, 0}, LiqK = {16, 0.070105, -290.72, -0.20366, -0.0074415, 0.0000024779}, VapK = {102, -743.07, 0.74159, -2.1746E+09, -6.4502E+10, 0}, Racketparam = 0.259136, UniquacR = 5.0625, UniquacQ = 3.732, ChaoSeadAF = 0.358106, ChaoSeadSP = 20618.1, ChaoSeadLV = 0.12525); +end OneTwoFourtrichlorobenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneTwoFourtrimethylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/OneTwoFourtrimethylbenzene.mo new file mode 100644 index 0000000..192ec7c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneTwoFourtrimethylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneTwoFourtrimethylbenzene + extends General_Properties(SN = 286, name = "OneTwoFourtrimethylbenzene", CAS = "95-63-6", Tc = 649.1, Pc = 3232000, Vc = 0.435, Cc = 0.256, Tb = 442.49, Tm = 229.38, TT = 229.33, TP = 0.69347, MW = 120.194, LVB = 0.136, AF = 0.377, SP = 18090, DM = 1.0E-30, SH = -1209000000.0, IGHF = -1.392E+07, GEF = 1.17E+08, AS = 395870, HFMP = 1.319E+07, HOC = -4.93067E+09, LiqDen = {105, 0.61782, 0.26243, 649.1, 0.28053, 0}, VP = {101, 60.23044, -7113.208, -5.408973, 1.637451E-06, 2}, LiqCp = {16, 159260, 100.48, 7.176, 0.015511, -0.000013842}, HOV = {106, 6.6212E+07, 0.612793, 0.157992, -1.024462, 0.66352}, VapCp = {16, 86220, -588.22, 13.049, 0.00013217, -6.3042E-08}, LiqVis = {101, -22.655, 1676.9, 1.8204, -0.0000040799, 2}, VapVis = {102, 9.0311E-07, 0.47728, 388.95, -1321.5, 0}, LiqK = {16, -0.097311, -7.9329, -1.1933, -0.00075728, -4.2291E-07}, VapK = {102, 0.000071734, 1.0715, 503.12, 48355, 0}, Racketparam = 0.256, UniquacR = 5.3928, UniquacQ = 4.104, ChaoSeadAF = 0.377, ChaoSeadSP = 18090, ChaoSeadLV = 0.136); +end OneTwoFourtrimethylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneTwoThreeFivetetramethylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/OneTwoThreeFivetetramethylbenzene.mo new file mode 100644 index 0000000..6bf2a40 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneTwoThreeFivetetramethylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneTwoThreeFivetetramethylbenzene + extends General_Properties(SN = 298, name = "OneTwoThreeFivetetramethylbenzene", CAS = "527-53-7", Tc = 679, Pc = 3220000, Vc = 0.436, Cc = 0.254, Tb = 471.15, Tm = 249.46, TT = 249.46, TP = 0.886139, MW = 134.218, LVB = 0.151385, AF = 0.459061, SP = 18330, DM = 0, SH = -1209000000.0, IGHF = -4.054E+07, GEF = 1.231E+08, AS = 422500, HFMP = 1.072E+07, HOC = -5.532E+09, LiqDen = {105, 0.5261, 0.25428, 679, 0.28565, 0}, VP = {101, 108.28, -9936.6, -12.519, 0.0000062754, 2}, LiqCp = {16, 180380, -63.604, 9.2496, 0.0072443, -0.0000031051}, HOV = {106, 6.6549E+07, 0.31372, 0.25924, -0.3264, 0.12301}, VapCp = {16, 109230, -579.21, 13.116, 0.00014705, -5.951E-08}, LiqVis = {101, -14.031, 1747.6, 0.263, -3.7653E-07, 2}, VapVis = {102, 6.7114E-07, 0.50662, 335.88, -402.07, 0}, LiqK = {16, -0.064932, -8.9077, -1.3593, -0.00066705, -6.8372E-07}, VapK = {102, 0.000082384, 1.0555, 595.15, 34335, 0}, Racketparam = 0.254, UniquacR = 6.1278, UniquacQ = 4.672, ChaoSeadAF = 0.426, ChaoSeadSP = 18330, ChaoSeadLV = 0.151385); +end OneTwoThreeFivetetramethylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneTwoThreeFourtetramethylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/OneTwoThreeFourtetramethylbenzene.mo new file mode 100644 index 0000000..0f931d2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneTwoThreeFourtetramethylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneTwoThreeFourtetramethylbenzene + extends General_Properties(SN = 297, name = "OneTwoThreeFourtetramethylbenzene", CAS = "488-23-3", Tc = 690, Pc = 2860000, Vc = 0.482, Cc = 0.256, Tb = 478.19, Tm = 266.9, TT = 266.9, TP = 2.9878, MW = 134.218, LVB = 0.149073, AF = 0.417172, SP = 18860, DM = 1.66E-30, SH = -1209000000.0, IGHF = -3.305E+07, GEF = 1.324E+08, AS = 416500, HFMP = 1.123E+07, HOC = -5.5376E+09, LiqDen = {105, 0.62671, 0.276, 690, 0.30501, 0}, VP = {101, 103.3938, -9866.6, -11.74655, 5.432648E-06, 2}, LiqCp = {16, 191090, -1527.7, 20.231, -0.019977, 0.000019333}, HOV = {106, 6.827737E+07, 0.20659, 0.354625, 0.156354, -0.400825}, VapCp = {16, 108680, -536.06, 13.006, 0.00026578, -1.0197E-07}, LiqVis = {101, -12.555, 1810.8, 0.0032112, -3.0199E-09, 2}, VapVis = {102, 8.0975E-08, 0.80432, 144.14, -8326.5, 0}, LiqK = {16, -0.046705, -31.572, -1.2356, -0.0012463, -2.6103E-07}, VapK = {102, 0.0001001, 1.0331, 653.92, 21466, 0}, Racketparam = 0.256, UniquacR = 6.1278, UniquacQ = 4.672, ChaoSeadAF = 0.417172, ChaoSeadSP = 18860, ChaoSeadLV = 0.149073); +end OneTwoThreeFourtetramethylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneTwoThreetrimethylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/OneTwoThreetrimethylbenzene.mo new file mode 100644 index 0000000..f7d7c24 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneTwoThreetrimethylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneTwoThreetrimethylbenzene + extends General_Properties(SN = 285, name = "OneTwoThreetrimethylbenzene", CAS = "526-73-8", Tc = 664.5, Pc = 3454000, Vc = 0.435, Cc = 0.267, Tb = 449.23, Tm = 247.79, TT = 247.79, TP = 3.70834, MW = 120.194, LVB = 0.13322, AF = 0.367, SP = 18480, DM = 1.87E-30, SH = -1209000000.0, IGHF = -9568810, GEF = 1.244E+08, AS = 380500, HFMP = 8170000, HOC = -4.93394E+09, LiqDen = {105, 0.47081, 0.22935, 664.5, 0.22914, 0}, VP = {101, 103.4032, -9139.734, -11.94112, 6.875135E-06, 2}, LiqCp = {16, 158190, -110.87, 9.7005, 0.0066246, -0.000003875}, HOV = {106, 5.897E+07, 0.31296, 0.11034, -0.18707, 0.12203}, VapCp = {16, 97344, -642.53, 13.123, 0.000061931, -4.6438E-08}, LiqVis = {101, -13.622, 1547.6, 0.25604, -4.4218E-07, 2}, VapVis = {102, 7.8569E-07, 0.49843, 362.98, -102.15, 0}, LiqK = {16, 0.066267, 303.46, -5.2163, 0.0092731, -0.000014825}, VapK = {102, 0.000093303, 1.0419, 539.24, 56545, 0}, Racketparam = 0.267, UniquacR = 5.3928, UniquacQ = 4.104, ChaoSeadAF = 0.367, ChaoSeadSP = 18480, ChaoSeadLV = 0.13322); +end OneTwoThreetrimethylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneTwobutadiene.mo b/Simulator/Simulator/Files/Chemsep_Database/OneTwobutadiene.mo new file mode 100644 index 0000000..92caa4a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneTwobutadiene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneTwobutadiene + extends General_Properties(SN = 76, name = "OneTwobutadiene", CAS = "590-19-2", Tc = 452, Pc = 4360000, Vc = 0.22, Cc = 0.255, Tb = 284, Tm = 136.95, TT = 136.95, TP = 0.4472, MW = 54.0904, LVB = 0.0838169, AF = 0.165877, SP = 15650, DM = 1.34E-30, SH = 162300000.0, IGHF = 1.623E+08, GEF = 1.986E+08, AS = 293000, HFMP = 6962000, HOC = -2.4617E+09, LiqDen = {105, 0.86492, 0.22148, 452, 0.28373, 0}, VP = {101, 53.27585, -4559.624, -4.46417, -6.771964E-06, 2}, LiqCp = {16, 109750, -2425.1, 12.655, 0.059068, -0.00014415}, HOV = {106, 3.715905E+07, 0.824251, 0.000387028, -2.253417, 2.024613}, VapCp = {16, 39504.04, -354.1475, 11.62099, 0.00074321, -2.513775E-07}, LiqVis = {101, -9.9134, 468.65, -0.069814, 2.8031E-07, 2}, VapVis = {102, 6.4328E-07, 0.52378, 170.73, 9690.7, 0}, LiqK = {16, -0.29344, 3.1314, -0.70701, -0.00052702, -3.6665E-07}, VapK = {102, 0.000085434, 1.0359, 127.53, 78342, 0}, Racketparam = 0, UniquacR = 2.466, UniquacQ = 2.024, ChaoSeadAF = 0.3394, ChaoSeadSP = 16360.6, ChaoSeadLV = 0.0816506); +end OneTwobutadiene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneTwodichloroethane.mo b/Simulator/Simulator/Files/Chemsep_Database/OneTwodichloroethane.mo new file mode 100644 index 0000000..43a2dc3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneTwodichloroethane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneTwodichloroethane + extends General_Properties(SN = 45, name = "OneTwodichloroethane", CAS = "107-06-2", Tc = 561, Pc = 5400000, Vc = 0.22, Cc = 0.255, Tb = 356.66, Tm = 237.49, TT = 237.49, TP = 237.127, MW = 98.959, LVB = 0.07945, AF = 0.286, SP = 20260, DM = 4.8E-30, SH = 52510000.0, IGHF = -1.2979E+08, GEF = -7.3945E+07, AS = 308280, HFMP = 8830000, HOC = -1.105E+09, LiqDen = {105, 1.1942, 0.27053, 561.61, 0.29157, 0}, VP = {101, 81.47902, -6503.169, -8.960273, 7.32894E-06, 2}, LiqCp = {16, 92757, 224.15, 8.5223, 0.0025656, 0.000005106}, HOV = {106, 5.072427E+07, 0.517321, 0.205828, -0.637156, 0.265499}, VapCp = {16, 62073, -758.84, 12.345, -0.0004196, 0.0000001146}, LiqVis = {101, 25.747, -385.45, -5.5912, 0.0000027937, 2}, VapVis = {102, 1.1983E-07, 0.79504, 20.791, 14003, 0}, LiqK = {16, 0.015945, -110.67, -0.74013, -0.0032664, -5.0786E-07}, VapK = {102, 0.00023592, 0.93945, 1368.6, 23794, 0}, Racketparam = 0, UniquacR = 2.88, UniquacQ = 2.52, ChaoSeadAF = 0.2876, ChaoSeadSP = 20249.5, ChaoSeadLV = 0.0794424); +end OneTwodichloroethane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OneTwopropyleneoxide.mo b/Simulator/Simulator/Files/Chemsep_Database/OneTwopropyleneoxide.mo new file mode 100644 index 0000000..52eab94 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OneTwopropyleneoxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OneTwopropyleneoxide + extends General_Properties(SN = 409, name = "OneTwopropyleneoxide", CAS = "75-56-9", Tc = 482.25, Pc = 4920000, Vc = 0.186, Cc = 0.228, Tb = 307.05, Tm = 161.22, TT = 161.22, TP = 0.965624, MW = 58.0791, LVB = 0.0705481, AF = 0.268304, SP = 19050, DM = 6.7E-30, SH = -61100000.0, IGHF = -9.372E+07, GEF = -2.58E+07, AS = 286700, HFMP = 6531000, HOC = -1.79E+09, LiqDen = {105, 1.5769, 0.28598, 482.25, 0.29139, 0}, VP = {101, 83.693, -5715.8, -9.522, 0.00001033, 2}, LiqCp = {16, 78704, 274.26, 7.2963, 0.0088641, -0.0000023407}, HOV = {106, 5.241305E+07, 1.339985, -1.496096, 0.72766, -0.151947}, VapCp = {16, 42195, -578.73, 12.252, 0.00010777, -4.7082E-08}, LiqVis = {101, 20.905, 283.5, -5.5156, 0.000016261, 2}, VapVis = {102, 1.1059E-07, 0.81831, 109.91, -5863.4, 0}, LiqK = {16, 0.10066, 294.75, -5.9561, 0.019433, -0.000039547}, VapK = {102, 0.00022671, 0.95467, 579.31, 32798, 0}, Racketparam = 0.228, UniquacR = 2.2663, UniquacQ = 1.856, ChaoSeadAF = 0.268304, ChaoSeadSP = 19050, ChaoSeadLV = 0.0705481); +end OneTwopropyleneoxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onebutanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Onebutanol.mo new file mode 100644 index 0000000..1c34e4d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onebutanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onebutanol + extends General_Properties(SN = 94, name = "Onebutanol", CAS = "71-36-3", Tc = 563.05, Pc = 4423000, Vc = 0.275, Cc = 0.26, Tb = 390.88, Tm = 183.85, TT = 184.51, TP = 0.000320123, MW = 74.123, LVB = 0.09196, AF = 0.591, SP = 23510, DM = 5.83737E-30, SH = -134990000.0, IGHF = -2.746E+08, GEF = -1.503E+08, AS = 361480, HFMP = 9372000, HOC = -2.45601E+09, LiqDen = {105, 0.7931, 0.24201, 563.05, 0.22263, 0}, VP = {101, 94.3424, -9140.942, -10.0038, 1.706963E-06, 2}, LiqCp = {16, 118540, 928.1, -3.4067, 0.053827, -0.000053611}, HOV = {106, 1.03317E+08, 2.061287, -3.612692, 3.240107, -1.125287}, VapCp = {16, 63521, -568.25, 12.587, 0.0001566, -5.9966E-08}, LiqVis = {101, -44.688, 3409.1, 4.8758, -0.0000057302, 2}, VapVis = {102, 0.0000014735, 0.46162, 554.37, 6760.2, 0}, LiqK = {16, 0.019408, -19.063, -1.4625, -0.0014843, -4.7683E-07}, VapK = {102, 0.00022746, 1.1142, 3597.3, -411420, 0}, Racketparam = 0.2538, UniquacR = 3.4543, UniquacQ = 3.052, ChaoSeadAF = 0.593, ChaoSeadSP = 23289.2, ChaoSeadLV = 0.0919432); +end Onebutanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onebutene.mo b/Simulator/Simulator/Files/Chemsep_Database/Onebutene.mo new file mode 100644 index 0000000..349fc04 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onebutene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onebutene + extends General_Properties(SN = 78, name = "Onebutene", CAS = "106-98-9", Tc = 419.5, Pc = 4020000, Vc = 0.2408, Cc = 0.278, Tb = 266.92, Tm = 87.8, TT = 87.8, TP = 0.000000694, MW = 56.108, LVB = 0.09534, AF = 0.194, SP = 13630, DM = 1.13E-30, SH = -500000.0, IGHF = -500000, GEF = 7.041E+07, AS = 307400, HFMP = 3848000, HOC = -2.5408E+09, LiqDen = {105, 0.98, 0.25169, 419.54, 0.26645, 0}, VP = {101, 41.66588, -3605.004, -2.983562, 6.665773E-07, 2}, LiqCp = {16, 100270, 86.345, 7.7333, 0.00096546, 0.000020281}, HOV = {106, 3.5338E+07, 0.68186, -0.28099, -0.25369, 0.26017}, VapCp = {16, 53529, -619.26, 12.431, 0.000096632, -3.9013E-08}, LiqVis = {101, -10.764, 591.51, -0.0017307, 2.5723E-08, 2}, VapVis = {102, 7.0347E-07, 0.54535, 308.83, -232.73, 0}, LiqK = {16, 0.071267, 99.471, -4.2011, 0.014325, -0.000041157}, VapK = {102, 0.000092115, 1.1181, 717.19, 13037, 0}, Racketparam = 0.2736, UniquacR = 2.92, UniquacQ = 2.56, ChaoSeadAF = 0.2085, ChaoSeadSP = 13827.58, ChaoSeadLV = 0.0953); +end Onebutene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Oneheptanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Oneheptanol.mo new file mode 100644 index 0000000..f9a4f82 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Oneheptanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Oneheptanol + extends General_Properties(SN = 346, name = "Oneheptanol", CAS = "111-70-6", Tc = 631.9, Pc = 3150000, Vc = 0.435, Cc = 0.261, Tb = 449.81, Tm = 239.15, TT = 239.15, TP = 0.0117728, MW = 116.203, LVB = 0.14195, AF = 0.582, SP = 21540, DM = 5.57E-30, SH = -216400000.0, IGHF = -3.32E+08, GEF = -1.253E+08, AS = 480000, HFMP = 1.322E+07, HOC = -4.2887E+09, LiqDen = {105, 0.53584, 0.24833, 632.61, 0.25556, 0}, VP = {101, 251.8216, -17683.63, -33.48375, 0.000017626, 2}, LiqCp = {16, -85727, 742.02, 4.7157, 0.026441, -0.000025674}, HOV = {106, 1.173181E+08, 1.489028, -2.632241, 3.547284, -1.892409}, VapCp = {16, 106760, -598.85, 13.165, 0.000054117, -4.1018E-08}, LiqVis = {101, -78.864, 5896.7, 9.4721, -3.3466E-07, 2}, VapVis = {102, 2.5718E-07, 0.65021, 248.54, 12.534, 0}, LiqK = {16, 0.090359, 1107.5, -13.417, 0.037115, -0.000045589}, VapK = {102, -0.060066, 0.28898, -3437.9, -1686200, 0}, Racketparam = 0.261, UniquacR = 5.2731, UniquacQ = 4.748, ChaoSeadAF = 0.582, ChaoSeadSP = 21540, ChaoSeadLV = 0.14195); +end Oneheptanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Oneheptene.mo b/Simulator/Simulator/Files/Chemsep_Database/Oneheptene.mo new file mode 100644 index 0000000..57ea623 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Oneheptene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Oneheptene + extends General_Properties(SN = 146, name = "Oneheptene", CAS = "592-76-7", Tc = 537.3, Pc = 2920000, Vc = 0.409, Cc = 0.267, Tb = 366.79, Tm = 154.12, TT = 154.12, TP = 0.00186, MW = 98.188, LVB = 0.14177, AF = 0.343, SP = 15310, DM = 2.1E-30, SH = -168070000.0, IGHF = -6.289E+07, GEF = 9.482E+07, AS = 425200, HFMP = 1.264E+07, HOC = -4.3499E+09, LiqDen = {105, 0.26107, 0.16952, 537.3, 0.1874, 0}, VP = {101, 109.9184, -7605.67, -13.43227, 0.0000123163, 2}, LiqCp = {16, 58419, 89.259, 10.549, 0.0039271, -8.6181E-07}, HOV = {106, 5.631368E+07, 1.145386, -1.731438, 1.615943, -0.650835}, VapCp = {16, 94067, -609.56, 13.043, 0.000046316, -2.1105E-08}, LiqVis = {101, -10.29, 827.04, -0.087144, 0.0000001052, 2}, VapVis = {102, 7.4687E-08, 0.81173, 52.725, 1460.7, 0}, LiqK = {16, -0.038053, -34.158, -1.0057, -0.0023353, -3.7702E-08}, VapK = {102, 0.000013676, 1.341, 365.19, 6251.8, 0}, Racketparam = 0.260462, UniquacR = 4.9441, UniquacQ = 4.184, ChaoSeadAF = 0.358, ChaoSeadSP = 15313.2, ChaoSeadLV = 0.141709); +end Oneheptene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onehexanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Onehexanol.mo new file mode 100644 index 0000000..ea45bdb --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onehexanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onehexanol + extends General_Properties(SN = 345, name = "Onehexanol", CAS = "111-27-3", Tc = 611.4, Pc = 3510000, Vc = 0.381, Cc = 0.263, Tb = 430.44, Tm = 228.55, TT = 228.55, TP = 0.0295499, MW = 102.177, LVB = 0.12519, AF = 0.58, SP = 21830, DM = 5.5E-30, SH = -216400000.0, IGHF = -3.18E+08, GEF = -1.344E+08, AS = 440000, HFMP = 1.54E+07, HOC = -3.67439E+09, LiqDen = {105, 0.12172, 0.11263, 611.4, 0.13194, 0}, VP = {101, 140.4065, -11996.05, -16.8497, 6.25688E-06, 2}, LiqCp = {16, -13352, 695.57, 4.4864, 0.026504, -0.000025444}, HOV = {106, 9.9912E+07, 1.0345, -0.71214, 0.038869, 0.22103}, VapCp = {16, 93733, -618.92, 13.098, -0.000028541, -8.6478E-09}, LiqVis = {101, -78.019, 5186.5, 9.8395, -0.0000094042, 2}, VapVis = {102, 2.3121E-07, 0.66402, 127.06, 17987, 0}, LiqK = {16, 0.09203, 1297.6, -15.712, 0.045447, -0.000056017}, VapK = {102, -2143900, -0.092957, 1.682E+08, -1.0339E+13, 0}, Racketparam = 0.263, UniquacR = 5.2731, UniquacQ = 4.748, ChaoSeadAF = 0.58, ChaoSeadSP = 21830, ChaoSeadLV = 0.12519); +end Onehexanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onehexene.mo b/Simulator/Simulator/Files/Chemsep_Database/Onehexene.mo new file mode 100644 index 0000000..f89fcdd --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onehexene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onehexene + extends General_Properties(SN = 130, name = "Onehexene", CAS = "592-41-6", Tc = 504, Pc = 3143000, Vc = 0.3551, Cc = 0.266, Tb = 336.63, Tm = 133.39, TT = 133.39, TP = 0.000516, MW = 84.161, LVB = 0.1259, AF = 0.281, SP = 15130, DM = 1.5E-30, SH = -168070000.0, IGHF = -4.167E+07, GEF = 8.7E+07, AS = 386300, HFMP = 9347000, HOC = -3.7397E+09, LiqDen = {105, 0.42588, 0.20073, 504, 0.21659, 0}, VP = {101, 61.18966, -5302.032, -5.914346, 4.387106E-06, 2}, LiqCp = {16, 120740, 197.35, 7.4671, 0.012038, -0.0000076352}, HOV = {106, 4.3654E+07, 0.036065, 1.7176, -2.6805, 1.3349}, VapCp = {16, 79063, -588.63, 12.822, 0.00010837, -3.9549E-08}, LiqVis = {101, -10.027, 774.41, -0.14562, -2.993E-08, 2}, VapVis = {102, 7.708E-08, 0.81478, 53.202, 774.03, 0}, LiqK = {16, 0.049094, 18.334, -2.2175, 0.0015607, -0.000010695}, VapK = {102, 0.000064257, 1.1355, 445.14, 64830, 0}, Racketparam = 0, UniquacR = 4.27, UniquacQ = 3.64, ChaoSeadAF = 0.2463, ChaoSeadSP = 15136.7, ChaoSeadLV = 0.1258); +end Onehexene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OnemethylFournpropylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/OnemethylFournpropylbenzene.mo new file mode 100644 index 0000000..ce49cd0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OnemethylFournpropylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OnemethylFournpropylbenzene + extends General_Properties(SN = 305, name = "OnemethylFournpropylbenzene", CAS = "1074-55-1", Tc = 658, Pc = 2860000, Vc = 0.482, Cc = 0.248, Tb = 456.53, Tm = 209.455, TT = 209.55, TP = 0.0171898, MW = 134.218, LVB = 0.157097, AF = 0.413441, SP = 17460, DM = 0, SH = -1209000000.0, IGHF = -2.314E+07, GEF = 1.382E+08, AS = 430400, HFMP = 1.151E+07, HOC = -5.5528E+09, LiqDen = {105, 0.48219, 0.24259, 658, 0.32531, 0}, VP = {101, 103.2332, -9321.423, -11.85346, 6.228128E-06, 2}, LiqCp = {16, 128960, -102.23, 11.269, 0.0022913, 5.0742E-07}, HOV = {106, 5.9632E+07, -0.13089, 1.5769, -1.8325, 0.74608}, VapCp = {16, 97127, -599.11, 13.273, 0.000011665, -1.9003E-08}, LiqVis = {101, -65.00531, 3273.06, 8.413079, -0.0000101347, 2}, VapVis = {102, 7.8653E-08, 0.80621, 137.95, -9253.2, 0}, LiqK = {16, -0.081049, 3.2759, -1.4026, -0.00043634, -7.9035E-07}, VapK = {102, 0.000083347, 1.0517, 573.97, 33136, 0}, Racketparam = 0.248, UniquacR = 6.0066, UniquacQ = 4.616, ChaoSeadAF = 0.413441, ChaoSeadSP = 17460, ChaoSeadLV = 0.157097); +end OnemethylFournpropylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OnemethylOneethylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/OnemethylOneethylcyclopentane.mo new file mode 100644 index 0000000..86bcaf8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OnemethylOneethylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OnemethylOneethylcyclopentane + extends General_Properties(SN = 272, name = "OnemethylOneethylcyclopentane", CAS = "16747-50-5", Tc = 582, Pc = 3020000, Vc = 0.428, Cc = 0.267, Tb = 394.672, Tm = 129.35, TT = 129.35, TP = 2.16711E-07, MW = 112.213, LVB = 0.144502, AF = 0.329811, SP = 15840, DM = 0, SH = -1209000000.0, IGHF = -1.549E+08, GEF = 5.067E+07, AS = 401000, HFMP = 0, HOC = -4.88921E+09, LiqDen = {105, 0.62398, 0.26553, 582, 0.28568, 0}, VP = {101, 70.30095, -6628.265, -7.112201, 3.497931E-06, 2}, LiqCp = {16, 96111, -59.039, 10.164, 0.0078449, -0.0000067267}, HOV = {106, 5.14848E+07, 0.288357, 0.487845, -0.669561, 0.236062}, VapCp = {16, 80936, -652.6, 13.464, -0.00013102, 2.6661E-08}, LiqVis = {101, -10.773, 1099.9, -0.048343, 1.7107E-07, 2}, VapVis = {102, 4.5602E-07, 0.57042, 274.82, -5055.3, 0}, LiqK = {16, -0.0033033, 9.4359, -1.8646, -0.00027, -0.0000024258}, VapK = {102, 0.0026462, 0.59802, 270.85, 473470, 0}, Racketparam = 0.267, UniquacR = 5.3937, UniquacQ = 4.396, ChaoSeadAF = 0.329811, ChaoSeadSP = 15840, ChaoSeadLV = 0.144502); +end OnemethylOneethylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/OnemethylThreenpropylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/OnemethylThreenpropylbenzene.mo new file mode 100644 index 0000000..54e7f9f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/OnemethylThreenpropylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model OnemethylThreenpropylbenzene + extends General_Properties(SN = 304, name = "OnemethylThreenpropylbenzene", CAS = "1074-43-7", Tc = 656, Pc = 2860000, Vc = 0.482, Cc = 0.249, Tb = 455.13, Tm = 190.57, TT = 190.57, TP = 0.000721452, MW = 134.218, LVB = 0.156623, AF = 0.412785, SP = 17510, DM = 4.07E-31, SH = -1209000000.0, IGHF = -2.414E+07, GEF = 1.352E+08, AS = 436800, HFMP = 1.06E+07, HOC = -5.5516E+09, LiqDen = {105, 0.18222, 0.15152, 656, 0.20178, 0}, VP = {101, 107.4588, -9508.773, -12.48918, 6.776919E-06, 2}, LiqCp = {16, 156110, -38.093, 10.159, 0.0050313, -0.0000015247}, HOV = {106, 6.194565E+07, 0.0524158, 1.088831, -1.22236, 0.439479}, VapCp = {16, 97127, -599.11, 13.273, 0.000011665, -1.9003E-08}, LiqVis = {101, -17.301, 1601.4, 0.91018, -0.0000014707, 2}, VapVis = {102, 7.3681E-08, 0.81524, 130.94, -9552, 0}, LiqK = {16, -0.074198, 4.023, -1.4364, -0.00042252, -0.0000008562}, VapK = {102, 0.000083513, 1.0517, 570.8, 33790, 0}, Racketparam = 0.249, UniquacR = 6.0066, UniquacQ = 4.616, ChaoSeadAF = 0.412785, ChaoSeadSP = 17510, ChaoSeadLV = 0.156623); +end OnemethylThreenpropylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onemethylindene.mo b/Simulator/Simulator/Files/Chemsep_Database/Onemethylindene.mo new file mode 100644 index 0000000..92685f3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onemethylindene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onemethylindene + extends General_Properties(SN = 168, name = "Onemethylindene", CAS = "767-59-9", Tc = 703, Pc = 3460000, Vc = 0.436, Cc = 0.258, Tb = 471.65, Tm = 0, TT = 0, TP = 0, MW = 130.186, LVB = 0.134643, AF = 0.334861, SP = 19120, DM = 0, SH = -168070000.0, IGHF = 1.912E+08, GEF = 2.97E+08, AS = 354000, HFMP = 0, HOC = -5.28E+09, LiqDen = {105, 0.61191, 0.25938, 703, 0.29267, 0}, VP = {101, 86.18824, -8859.756, -9.212247, 3.741568E-06, 2}, LiqCp = {16, 152820, -189.88, 10.81, 0.00256, -0.0000011085}, HOV = {106, 8.0901E+07, 1.9933, -4.5733, 5.098, -2.0923}, VapCp = {16, -133130, -213.74, 13.196, 0.00017372, -4.8074E-08}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {102, 0.0000033072, 0.32792, 786.18, 680.97, 0}, LiqK = {16, -0.018671, -66.592, -0.99313, -0.0021306, 2.0941E-07}, VapK = {102, 0.000091267, 1.0385, 720.72, -19410, 0}, Racketparam = 0.261176, UniquacR = 5.105471, UniquacQ = 3.424, ChaoSeadAF = 0.33569, ChaoSeadSP = 18312.4, ChaoSeadLV = 0.134207); +end Onemethylindene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onemethylnaphthalene.mo b/Simulator/Simulator/Files/Chemsep_Database/Onemethylnaphthalene.mo new file mode 100644 index 0000000..db0f1f4 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onemethylnaphthalene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onemethylnaphthalene + extends General_Properties(SN = 174, name = "Onemethylnaphthalene", CAS = "90-12-0", Tc = 772, Pc = 3600000, Vc = 0.462, Cc = 0.259, Tb = 517.84, Tm = 242.67, TT = 242.67, TP = 0.043382, MW = 142.2, LVB = 0.13937, AF = 0.348, SP = 19890, DM = 1.7E-30, SH = -168070000.0, IGHF = 1.169E+08, GEF = 2.179E+08, AS = 377400, HFMP = 6945000, HOC = -5.5958E+09, LiqDen = {105, 0.59739, 0.26468, 772, 0.2918, 0}, VP = {101, 73.89852, -9115.529, -7.252019, 2.094885E-06, 2}, LiqCp = {16, 134210, 116.27, 8.3119, 0.012175, -0.000010378}, HOV = {106, 7.0001E+07, 0.3382, 0.060354, -0.021035, -0.0086978}, VapCp = {16, 67134, -530.75, 13.222, -0.000033319, -3.2916E-09}, LiqVis = {101, 8.170859, 1169.912, -3.261889, 6.874562E-06, 2}, VapVis = {102, 2.4606E-07, 0.6456, 239.2, -8656.8, 0}, LiqK = {16, -0.049867, 2.2749, -1.45, -0.00045282, -7.0729E-07}, VapK = {102, 1.5229, -0.35024, -1389.7, 2465100, 0}, Racketparam = 0, UniquacR = 5.610415, UniquacQ = 3.936, ChaoSeadAF = 0.3337, ChaoSeadSP = 20129.2, ChaoSeadLV = 0.1398); +end Onemethylnaphthalene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onenitrobutane.mo b/Simulator/Simulator/Files/Chemsep_Database/Onenitrobutane.mo new file mode 100644 index 0000000..1ce35d6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onenitrobutane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onenitrobutane + extends General_Properties(SN = 383, name = "Onenitrobutane", CAS = "627-05-4", Tc = 623, Pc = 3600000, Vc = 0.338, Cc = 0.248, Tb = 425.92, Tm = 191.82, TT = 191.82, TP = 0.00329301, MW = 103.12, LVB = 0.106476, AF = 0.454584, SP = 20780, DM = 1.13E-29, SH = -22600000.0, IGHF = -1.439E+08, GEF = 1.5E+07, AS = 379100, HFMP = 1.27E+07, HOC = -2.46965E+09, LiqDen = {105, 0.709, 0.24401, 623, 0.28339, 0}, VP = {101, 275.2044, -15483.84, -38.70231, 0.0000386, 2}, LiqCp = {16, 56152, 6.6387, 10.762, 0.003942, -0.0000013791}, HOV = {106, 5.525605E+07, -1.025854, 4.47262, -4.675607, 1.466497}, VapCp = {16, 69545, -548.77, 12.729, 0.0001233, -6.7656E-08}, LiqVis = {101, -8.4776, 1274.9, -0.51437, 0.0000019485, 2}, VapVis = {102, 9.0308E-08, 0.82266, 144.36, -9193.7, 0}, LiqK = {16, -0.088752, 4.014, -1.2388, -0.00043694, -0.0000009691}, VapK = {102, 0.00013665, 0.98745, 630.3, 15608, 0}, Racketparam = 0.248, UniquacR = 4.0317, UniquacQ = 3.488, ChaoSeadAF = 0.454584, ChaoSeadSP = 20780, ChaoSeadLV = 0.106476); +end Onenitrobutane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onenitropropane.mo b/Simulator/Simulator/Files/Chemsep_Database/Onenitropropane.mo new file mode 100644 index 0000000..232ef3c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onenitropropane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onenitropropane + extends General_Properties(SN = 381, name = "Onenitropropane", CAS = "108-03-2", Tc = 605, Pc = 4350000, Vc = 0.288, Cc = 0.249, Tb = 404.33, Tm = 169.16, TT = 169.16, TP = 0.000688982, MW = 89.0932, LVB = 0.0894679, AF = 0.412773, SP = 21290, DM = 1.22E-29, SH = -22600000.0, IGHF = -1.24E+08, GEF = 335000, AS = 355600, HFMP = 9220000, HOC = -1.859E+09, LiqDen = {105, 0.85075, 0.24483, 605, 0.27413, 0}, VP = {101, 38.65807, -5750.644, -2.115655, -1.225423E-06, 2}, LiqCp = {16, -8835.6, 176.43, 9.53, 0.0096176, -0.0000099253}, HOV = {106, 5.6307E+07, 0.47767, -0.18338, 0.057255, -0.028311}, VapCp = {16, 57745, -538.37, 12.483, 0.00011202, -5.1502E-08}, LiqVis = {101, -19.997, 1653, 1.2605, 0.0000015194, 2}, VapVis = {102, 1.7108E-07, 0.7401, 220.03, -15.073, 0}, LiqK = {16, -0.068381, 13.221, -1.3628, -0.00024357, -0.0000012535}, VapK = {102, 0.0022117, 0.61538, 875.34, 312410, 0}, Racketparam = 0.249, UniquacR = 3.3573, UniquacQ = 2.948, ChaoSeadAF = 0.412773, ChaoSeadSP = 21290, ChaoSeadLV = 0.0894679); +end Onenitropropane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onenonene.mo b/Simulator/Simulator/Files/Chemsep_Database/Onenonene.mo new file mode 100644 index 0000000..e27f6f2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onenonene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onenonene + extends General_Properties(SN = 260, name = "Onenonene", CAS = "124-11-8", Tc = 594, Pc = 2330000, Vc = 0.526, Cc = 0.248, Tb = 420.03, Tm = 191.91, TT = 191.91, TP = 0.0204, MW = 126.242, LVB = 0.17405, AF = 0.411, SP = 15500, DM = 2.0E-30, SH = -1209000000.0, IGHF = -1.035E+08, GEF = 1.123E+08, AS = 504100, HFMP = 1.9359E+07, HOC = -5.5716E+09, LiqDen = {105, 0.18062, 0.15802, 594, 0.18969, 0}, VP = {101, 120.37, -9418.7, -14.583, 0.0000094863, 2}, LiqCp = {16, 58309, 119.15, 10.75, 0.0042025, -0.0000015805}, HOV = {106, 5.0729E+07, -0.72017, 3.2276, -3.6347, 1.4659}, VapCp = {16, 122350, -622.4, 13.352, -0.000015236, -2.3169E-10}, LiqVis = {101, -10.296, 1057.3, -0.12431, 2.0281E-07, 2}, VapVis = {102, 7.2319E-08, 0.81707, 155.31, -12572, 0}, LiqK = {16, 0.024602, -118.29, -0.40946, -0.0056136, 0.0000021909}, VapK = {102, 0.000019761, 1.2983, 563.96, 24829, 0}, Racketparam = 0.248, UniquacR = 6.2929, UniquacQ = 5.264, ChaoSeadAF = 0.411, ChaoSeadSP = 15500, ChaoSeadLV = 0.17405); +end Onenonene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Oneoctene.mo b/Simulator/Simulator/Files/Chemsep_Database/Oneoctene.mo new file mode 100644 index 0000000..d43c171 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Oneoctene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Oneoctene + extends General_Properties(SN = 259, name = "Oneoctene", CAS = "111-66-0", Tc = 567, Pc = 2680000, Vc = 0.468, Cc = 0.266, Tb = 394.44, Tm = 171.45, TT = 171.45, TP = 0.00298, MW = 112.215, LVB = 0.15785, AF = 0.393, SP = 15540, DM = 1.4E-30, SH = -1209000000.0, IGHF = -8.194E+07, GEF = 1.057E+08, AS = 463700, HFMP = 1.531E+07, HOC = -4.961E+09, LiqDen = {105, 0.44684, 0.23463, 567, 0.24846, 0}, VP = {101, 177.7155, -11137.29, -23.58923, 0.000019592, 2}, LiqCp = {16, -24253, 87.834, 11.35, 0.0032002, -0.0000012467}, HOV = {106, 5.7062E+07, 0.3453, 0.41628, -0.36125, -0.059539}, VapCp = {16, 106430, -593.77, 13.154, 0.00006689, -2.6274E-08}, LiqVis = {101, -5.8042, 945.32, -0.93827, 0.0000032767, 2}, VapVis = {102, 0.000047664, 0.084052, 3514.6, 21127, 0}, LiqK = {16, 0.035226, 40.754, -2.2668, 0.00092297, -0.0000060301}, VapK = {102, 0.000014109, 1.354, 610.51, -30915, 0}, Racketparam = 0.266, UniquacR = 5.6185, UniquacQ = 4.724, ChaoSeadAF = 0.393, ChaoSeadSP = 15540, ChaoSeadLV = 0.15785); +end Oneoctene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onepentanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Onepentanol.mo new file mode 100644 index 0000000..97943b3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onepentanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onepentanol + extends General_Properties(SN = 341, name = "Onepentanol", CAS = "71-41-0", Tc = 588.15, Pc = 3909000, Vc = 0.326, Cc = 0.262, Tb = 411.16, Tm = 194.95, TT = 195.56, TP = 0.000345245, MW = 88.15, LVB = 0.10863, AF = 0.579, SP = 22520, DM = 5.67059E-30, SH = -216400000.0, IGHF = -3.0016E+08, GEF = -1.46022E+08, AS = 402501, HFMP = 9790560, HOC = -3.06051E+09, LiqDen = {105, 0.54137, 0.21848, 588.15, 0.20812, 0}, VP = {101, 150.9933, -11938.85, -18.59103, 8.735585E-06, 2}, LiqCp = {16, 151460, 721.52, -3.5691, 0.059604, -0.000063767}, HOV = {106, 1.1853E+08, 1.9668, -2.5741, 1.6268, -0.41037}, VapCp = {16, 78144, -573.83, 12.781, 0.00015431, -6.6745E-08}, LiqVis = {101, -29.696, 3126.2, 2.4167, -0.0000024327, 2}, VapVis = {102, 1.9935E-07, 0.70293, 200.97, -2040.7, 0}, LiqK = {16, 0.14679, 201570, -2097.5, 7.255, -0.0083973}, VapK = {102, 1221.5, 0.95117, 8.0014E+09, -2.8255E+11, 0}, Racketparam = 0.262, UniquacR = 4.5987, UniquacQ = 4.208, ChaoSeadAF = 0.579, ChaoSeadSP = 22520, ChaoSeadLV = 0.10863); +end Onepentanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onepentene.mo b/Simulator/Simulator/Files/Chemsep_Database/Onepentene.mo new file mode 100644 index 0000000..063580b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onepentene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onepentene + extends General_Properties(SN = 108, name = "Onepentene", CAS = "109-67-1", Tc = 464.8, Pc = 3560000, Vc = 0.2984, Cc = 0.275, Tb = 303.11, Tm = 108.016, TT = 108.016, TP = 0.000037, MW = 70.134, LVB = 0.1104, AF = 0.237, SP = 14410, DM = 1.7E-30, SH = -27600000.0, IGHF = -2.162E+07, GEF = 7.837E+07, AS = 346200, HFMP = 5937400, HOC = -3.13037E+09, LiqDen = {105, 0.44335, 0.18566, 473.43, 0.23587, 0}, VP = {101, 39.52954, -3893.399, -2.686504, 1.952359E-06, 2}, LiqCp = {16, 92753, 117.21, 8.6537, 0.007447, -0.0000026759}, HOV = {106, 3.077277E+07, -0.570706, 2.243398, -2.258065, 0.928488}, VapCp = {16, 66520, -609.44, 12.683, 0.000062395, -2.5354E-08}, LiqVis = {101, -10.79591, 682.8004, 0.00564316, -9.176806E-07, 2}, VapVis = {102, 0.0000017549, 0.42295, 561.21, -17046, 0}, LiqK = {16, -0.010825, -30.065, -1.1172, -0.0023327, -0.0000015541}, VapK = {102, 0.0000026412, 1.549, -2.5891, 24389, 0}, Racketparam = 0.2944, UniquacR = 3.5953, UniquacQ = 3.104, ChaoSeadAF = 0.2198, ChaoSeadSP = 14420.78, ChaoSeadLV = 0.1104); +end Onepentene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onephenylnaphthalene.mo b/Simulator/Simulator/Files/Chemsep_Database/Onephenylnaphthalene.mo new file mode 100644 index 0000000..3ef89da --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onephenylnaphthalene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onephenylnaphthalene + extends General_Properties(SN = 187, name = "Onephenylnaphthalene", CAS = "605-02-7", Tc = 849, Pc = 2630000, Vc = 0.656, Cc = 0.244, Tb = 607.15, Tm = 318.15, TT = 318.15, TP = 0.282425, MW = 204.266, LVB = 0.189925, AF = 0.530878, SP = 19910, DM = 0, SH = -168070000.0, IGHF = 2.47E+08, GEF = 3.71108E+08, AS = 459000, HFMP = 0, HOC = -7.92E+09, LiqDen = {105, 0.36822, 0.24155, 849, 0.29048, 0}, VP = {101, 136.2471, -14614.66, -16.02104, 5.425361E-06, 2}, LiqCp = {16, 180260, -2.5213, 10.037, 0.0072742, -0.0000049656}, HOV = {106, 1.0967E+08, 1.3201, -2.3901, 2.4598, -0.96728}, VapCp = {16, 77509, -521.03, 13.602, -0.000094316, 9.2363E-09}, LiqVis = {101, -6.144, 1205.6, -0.56682, -0.0000005706, 2}, VapVis = {102, 0.0000030793, 0.30949, 742.15, 16342, 0}, LiqK = {16, -0.052282, -21.251, -1.3126, -0.00073663, -3.6032E-07}, VapK = {102, 0.000092251, 0.99676, 619.05, 42835, 0}, Racketparam = 0, UniquacR = 7.679631, UniquacQ = 5.184, ChaoSeadAF = 0.530878, ChaoSeadSP = 19911.7, ChaoSeadLV = 0.189925); +end Onephenylnaphthalene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onepropanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Onepropanol.mo new file mode 100644 index 0000000..e16191e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onepropanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onepropanol + extends General_Properties(SN = 69, name = "Onepropanol", CAS = "71-23-8", Tc = 536.78, Pc = 5175000, Vc = 0.219, Cc = 0.254, Tb = 370.93, Tm = 146.95, TT = 146.95, TP = 3.69121E-07, MW = 60.096, LVB = 0.07514, AF = 0.629, SP = 24450, DM = 5.6E-30, SH = -104680000.0, IGHF = -2.552E+08, GEF = -1.599E+08, AS = 322470, HFMP = 5372000, HOC = -1.84381E+09, LiqDen = {105, 1.1537, 0.26188, 536.78, 0.23549, 0}, VP = {101, 141.3971, -10434.27, -17.45829, 0.0000113246, 2}, LiqCp = {16, 100520, 125.3, 4.7194, 0.024513, -0.000019669}, HOV = {106, 8.36461E+07, 3.338812, -9.831137, 11.8901, -4.905709}, VapCp = {16, 56681, -627.22, 12.379, 0.00012228, -5.0293E-08}, LiqVis = {101, -98.08798, 4904.749, 13.57131, -0.0000219968, 2}, VapVis = {102, 7.9322E-07, 0.54936, 416.77, -100.81, 0}, LiqK = {16, 0.076645, -189.91, -0.13475, -0.0069283, 0.0000033645}, VapK = {102, -453.4, 0.64532, -2.843E+08, -2.8865E+10, 0}, Racketparam = 0.2451, UniquacR = 2.78, UniquacQ = 2.51, ChaoSeadAF = 0.623, ChaoSeadSP = 24557.3, ChaoSeadLV = 0.0749393); +end Onepropanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Oneundecene.mo b/Simulator/Simulator/Files/Chemsep_Database/Oneundecene.mo new file mode 100644 index 0000000..e80a450 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Oneundecene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Oneundecene + extends General_Properties(SN = 261, name = "Oneundecene", CAS = "821-95-4", Tc = 637.8, Pc = 2044000, Vc = 0.657, Cc = 0.253, Tb = 465.82, Tm = 223.99, TT = 223.99, TP = 0.0473, MW = 154.292, LVB = 0.2065, AF = 0.522466, SP = 15680, DM = 1.8E-30, SH = -1209000000.0, IGHF = -1.449E+08, GEF = 1.283E+08, AS = 582180, HFMP = 1.699E+07, HOC = -6.7878E+09, LiqDen = {105, 0.38001, 0.24991, 637.8, 0.28571, 0}, VP = {101, 93.64799, -9306.494, -10.26144, 4.149832E-06, 2}, LiqCp = {16, 99868, 144.48, 10.69, 0.0042614, -0.0000010791}, HOV = {106, 2.3696E+07, -6.3933, 18.084, -19.033, 7.4719}, VapCp = {16, 138670, -549.63, 13.4, 0.00014861, -5.2026E-08}, LiqVis = {101, -49.01257, 2643.166, 5.957949, -8.451873E-06, 2}, VapVis = {102, 5.0406E-08, 0.85093, 112.38, -8900.1, 0}, LiqK = {16, 0.067847, -250.41, 0.40201, -0.0082828, 0.0000014058}, VapK = {102, 0.000018335, 1.3031, 709.58, -2804.6, 0}, Racketparam = 0.253, UniquacR = 7.6417, UniquacQ = 6.344, ChaoSeadAF = 0.522466, ChaoSeadSP = 15680, ChaoSeadLV = 0.2065); +end Oneundecene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Onitrotoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/Onitrotoluene.mo new file mode 100644 index 0000000..b01e54b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Onitrotoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Onitrotoluene + extends General_Properties(SN = 384, name = "Onitrotoluene", CAS = "88-72-2", Tc = 720, Pc = 3800000, Vc = 0.441, Cc = 0.28, Tb = 494.85, Tm = 269.65, TT = 269.98, TP = 1.72928, MW = 137.136, LVB = 0.118442, AF = 0.487824, SP = 21420, DM = 1.25E-29, SH = -22600000.0, IGHF = 4.71E+07, GEF = 1.715E+08, AS = 380800, HFMP = 1.148E+07, HOC = -3.5914E+09, LiqDen = {105, 0.49527, 0.21852, 720, 0.27202, 0}, VP = {101, 110.496, -10356.21, -12.86215, 7.080827E-06, 2}, LiqCp = {16, 167320, 675.67, 2.8482, 0.023742, -0.00001748}, HOV = {106, 7.853006E+07, 0.959622, -1.263212, 1.073123, -0.436452}, VapCp = {16, 126830, -1053.5, 13.982, -0.0011308, 3.2272E-07}, LiqVis = {101, -227.78, 9560.6, 33.954, -0.00004379, 2}, VapVis = {102, 3.9111E-08, 0.92063, 61.279, -2619.3, 0}, LiqK = {16, -0.28005, 20.455, -0.90478, 0.000049377, -4.8022E-07}, VapK = {102, 0.00013501, 0.95252, 632.43, 27080, 0}, Racketparam = 0.28, UniquacR = 4.2801, UniquacQ = 3.272, ChaoSeadAF = 0.487824, ChaoSeadSP = 21420, ChaoSeadLV = 0.118442); +end Onitrotoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Otoluicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Otoluicacid.mo new file mode 100644 index 0000000..9528dff --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Otoluicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Otoluicacid + extends General_Properties(SN = 397, name = "Otoluicacid", CAS = "118-90-1", Tc = 751, Pc = 3860000, Vc = 0.397, Cc = 0.245, Tb = 532, Tm = 376.85, TT = 376.85, TP = 237.832, MW = 136.148, LVB = 0.126888, AF = 0.657237, SP = 22920, DM = 5.67059E-30, SH = -22600000.0, IGHF = -3.22796E+08, GEF = -2.13346E+08, AS = 406141, HFMP = 2.01774E+07, HOC = -3.69902E+09, LiqDen = {105, 0.61816, 0.24687, 751, 0.2856, 0}, VP = {101, 133.1988, -13740.37, -15.5105, 5.245068E-06, 2}, LiqCp = {16, 129490, 18.011, 10.105, 0.0057419, -0.000003975}, HOV = {106, 9.9956E+07, 0.80217, -0.93427, 0.8805, -0.3406}, VapCp = {16, 85949, -929.05, 14.065, -0.0013145, 5.0858E-07}, LiqVis = {101, -8.7015, 1473.1, -0.25079, 0.0000003109, 2}, VapVis = {102, 1.2379E-07, 0.7551, 177.89, -5611.1, 0}, LiqK = {16, -0.13162, 29.195, -1.2663, 0.000070644, -8.4448E-07}, VapK = {102, 0.000027427, 1.1315, 204.73, 55122, 0}, Racketparam = 0.245, UniquacR = 5.058, UniquacQ = 3.912, ChaoSeadAF = 0.657237, ChaoSeadSP = 22920, ChaoSeadLV = 0.126888); +end Otoluicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Oxalicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Oxalicacid.mo new file mode 100644 index 0000000..e7672a4 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Oxalicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Oxalicacid + extends General_Properties(SN = 393, name = "Oxalicacid", CAS = "144-62-7", Tc = 804, Pc = 7020000, Vc = 0.205, Cc = 0.215, Tb = 569, Tm = 462.65, TT = 462.65, TP = 2152.34, MW = 90.0349, LVB = 0.0614585, AF = 0.917597, SP = 35980, DM = 8.77E-30, SH = -22600000.0, IGHF = -7.338E+08, GEF = -6.614E+08, AS = 343300, HFMP = 0, HOC = -2.01E+08, LiqDen = {105, 1.0501, 0.215, 804, 0.28571, 0}, VP = {101, 216.92, -20979, -27.004, 0.0000086326, 2}, LiqCp = {16, 81965, -1.9623, 9.0826, 0.0038828, 2.1663E-07}, HOV = {106, 1.2079E+08, 0.30321, 0.62049, -0.9257, 0.38682}, VapCp = {16, 25231, -1473.6, 15.259, -0.0058042, 0.0000026122}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {102, 1.3016E-07, 0.7814, 154.56, -3949.8, 0}, LiqK = {16, -0.088775, -213.56, 0.1118, -0.0022725, 3.5301E-07}, VapK = {102, 0.084868, 0.23486, 15441, 507600, 0}, Racketparam = 0.215, UniquacR = 2.6026, UniquacQ = 2.448, ChaoSeadAF = 0.917597, ChaoSeadSP = 35980, ChaoSeadLV = 0.0614585); +end Oxalicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Oxygen.mo b/Simulator/Simulator/Files/Chemsep_Database/Oxygen.mo new file mode 100644 index 0000000..8e3e639 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Oxygen.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Oxygen + extends General_Properties(SN = 23, name = "Oxygen", CAS = "7782-44-7", Tc = 154.58, Pc = 5043000, Vc = 0.07337, Cc = 0.288, Tb = 90.17, Tm = 54.361, TT = 54.361, TP = 150, MW = 31.999, LVB = 0.02785, AF = 0.022, SP = 8182, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 205043, HFMP = 444000, HOC = 0, LiqDen = {105, 2.6097, 0.23614, 154.78, 0.23695, 0}, VP = {101, 40.55487, -1120.543, -3.776114, 0.0000485344, 2}, LiqCp = {16, 53393, -1966.4, 48.21, -0.31631, 0.0010466}, HOV = {106, 1.0672E+07, 1.5661, -3.4356, 3.5416, -1.2718}, VapCp = {16, 29061.62, -1470.897, 11.10778, -0.00128484, 3.183122E-07}, LiqVis = {101, -5.2319, 116.13, -1.0315, 0.0000034376, 2}, VapVis = {102, 8.0134E-07, 0.60321, 56.09, 1584.9, 0}, LiqK = {16, -0.19654, -10.535, -0.46717, -0.0052064, -3.3418E-07}, VapK = {102, 0.0004508, 0.74544, 58.278, -562.62, 0}, Racketparam = 0.2908, UniquacR = 0.857, UniquacQ = 0.94, ChaoSeadAF = 0.019, ChaoSeadSP = 8181.93, ChaoSeadLV = 0.0280225); +end Oxygen; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Oxylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Oxylene.mo new file mode 100644 index 0000000..50c5e20 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Oxylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Oxylene + extends General_Properties(SN = 151, name = "Oxylene", CAS = "95-47-6", Tc = 630.3, Pc = 3732000, Vc = 0.37, Cc = 0.263, Tb = 417.59, Tm = 247.98, TT = 247.98, TP = 21.842, MW = 106.167, LVB = 0.12125, AF = 0.312, SP = 18390, DM = 2.1E-30, SH = -168070000.0, IGHF = 1.908E+07, GEF = 1.22E+08, AS = 353830, HFMP = 1.36E+07, HOC = -4.333E+09, LiqDen = {105, 0.69962, 0.26143, 630.3, 0.27365, 0}, VP = {101, 88.08217, -7844.793, -9.738423, 5.713756E-06, 2}, LiqCp = {16, 134490, -170.61, 10.247, 0.0049096, -0.0000031727}, HOV = {106, 6.6979E+07, 1.259, -1.849, 1.5198, -0.50455}, VapCp = {16, 73986, -589.13, 12.936, 0.000080122, -4.5074E-08}, LiqVis = {101, -11.059, 1251.7, -0.076438, 0.000001254, 2}, VapVis = {102, 6.783E-08, 0.82039, -1.2715, 13072, 0}, LiqK = {16, -0.018751, -22.77, -1.3391, -0.0014281, -6.1692E-07}, VapK = {102, 0.0000059387, 1.356, -206, 65058, 0}, Racketparam = 0.2633, UniquacR = 4.66, UniquacQ = 3.54, ChaoSeadAF = 0.2904, ChaoSeadSP = 18389.04, ChaoSeadLV = 0.1212); +end Oxylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ozone.mo b/Simulator/Simulator/Files/Chemsep_Database/Ozone.mo new file mode 100644 index 0000000..e1fe2f1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ozone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ozone + extends General_Properties(SN = 201, name = "Ozone", CAS = "10028-15-6", Tc = 261.05, Pc = 5570000, Vc = 0.0894, Cc = 0.229, Tb = 161.8, Tm = 22.1499, TT = 80.15, TP = 0.734621, MW = 47.998, LVB = 0.0354, AF = 0.224, SP = 18740, DM = 1.8E-30, SH = 143100000.0, IGHF = 1.431E+08, GEF = 1.63164E+08, AS = 238823, HFMP = 2000000, HOC = -1.42671E+08, LiqDen = {105, 2.6432, 0.26544, 261.05, 0.25239, 0}, VP = {101, 33.80011, -2066.264, -1.865143, 3.696996E-08, 2}, LiqCp = {16, 64500, -60.205, 9.9787, 0.0080434, -0.000010929}, HOV = {106, 1.6254E+07, -0.073447, 0.14823, 0.62225, -0.43277}, VapCp = {16, 32859.57, -604.7407, 10.91207, -0.000287995, 2.632407E-08}, LiqVis = {101, -37.036, 815.78, 4.8971, -0.000047646, 2}, VapVis = {102, 0.0000001896, 0.78539, 36.908, -2041.9, 0}, LiqK = {16, 0.23255, -678.09, -6.5705, -0.074977, 0.00025391}, VapK = {102, 0.0043907, 0.47832, 709.48, 233.72, 0}, Racketparam = 0.229, UniquacR = 1.1, UniquacQ = 1.27, ChaoSeadAF = 0.224, ChaoSeadSP = 18740, ChaoSeadLV = 0.0354); +end Ozone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pcresol.mo b/Simulator/Simulator/Files/Chemsep_Database/Pcresol.mo new file mode 100644 index 0000000..aa3fa92 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pcresol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pcresol + extends General_Properties(SN = 143, name = "Pcresol", CAS = "106-44-5", Tc = 704.5, Pc = 5150000, Vc = 0.277, Cc = 0.244, Tb = 475.12, Tm = 307.93, TT = 307.93, TP = 34.4658, MW = 108.14, LVB = 0.105, AF = 0.51, SP = 24030, DM = 5.2E-30, SH = -168070000.0, IGHF = -1.2535E+08, GEF = -3.166E+07, AS = 350750, HFMP = 1.2707E+07, HOC = -3.52256E+09, LiqDen = {105, 0.94818, 0.2877, 704.66, 0.2873, 0}, VP = {101, 236.9207, -17215.31, -31.28645, 0.0000163766, 2}, LiqCp = {16, 142400, 625.27, 3.2944, 0.02818, -0.000027958}, HOV = {106, 1.3617E+08, 1.404, 0.8091, -3.6055, 2.0268}, VapCp = {16, 58748, -529.02, 12.887, -0.0000351, -1.6131E-09}, LiqVis = {101, -820.7853, 35522.87, 124.3969, -0.000127538, 2}, VapVis = {102, 1.4308E-07, 0.74508, 159.9, -24.834, 0}, LiqK = {16, 0.061771, -123.88, -1.1823, -0.0033339, 0.0000010151}, VapK = {102, 0.00016735, 0.93839, 592.49, 25704, 0}, Racketparam = 0, UniquacR = 4.7567, UniquacQ = 3.888, ChaoSeadAF = 0.508, ChaoSeadSP = 23827.4, ChaoSeadLV = 0.104957); +end Pcresol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pcymene.mo b/Simulator/Simulator/Files/Chemsep_Database/Pcymene.mo new file mode 100644 index 0000000..678a956 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pcymene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pcymene + extends General_Properties(SN = 293, name = "Pcymene", CAS = "99-87-6", Tc = 652, Pc = 2800000, Vc = 0.497, Cc = 0.248, Tb = 450.26, Tm = 205.25, TT = 205.25, TP = 0.010391, MW = 134.221, LVB = 0.15749, AF = 0.376, SP = 17290, DM = 0, SH = -1209000000.0, IGHF = -2.799E+07, GEF = 1.3352E+08, AS = 426400, HFMP = 9661000, HOC = -5.558E+09, LiqDen = {105, 0.44838, 0.23842, 653.16, 0.26866, 0}, VP = {101, 130.8986, -10357.88, -16.09943, 9.850105E-06, 2}, LiqCp = {16, 99148, 48.442, 10.281, 0.006034, -0.0000045515}, HOV = {106, 8.966039E+07, 1.950064, -3.032433, 2.16162, -0.588861}, VapCp = {16, 119360, -822.32, 13.841, -0.00060036, 1.8085E-07}, LiqVis = {101, -29.824, 1974.9, 2.8359, -0.0000010565, 2}, VapVis = {102, 0.0000032148, 0.32014, 730.34, 10237, 0}, LiqK = {16, 0.018679, -10.656, -1.722, -0.0015047, -7.6885E-07}, VapK = {102, 0.00010761, 1.0275, 670.75, 67288, 0}, Racketparam = 0.248, UniquacR = 6.0058, UniquacQ = 4.612, ChaoSeadAF = 0.376, ChaoSeadSP = 17290, ChaoSeadLV = 0.15749); +end Pcymene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pdichlorobenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Pdichlorobenzene.mo new file mode 100644 index 0000000..cd2a994 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pdichlorobenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pdichlorobenzene + extends General_Properties(SN = 120, name = "Pdichlorobenzene", CAS = "106-46-7", Tc = 684.75, Pc = 4070000, Vc = 0.351, Cc = 0.251, Tb = 447.21, Tm = 326.14, TT = 326.14, TP = 1225.03, MW = 147.002, LVB = 0.117406, AF = 0.284638, SP = 19330, DM = 0, SH = -168070000.0, IGHF = 2.25E+07, GEF = 7.67E+07, AS = 336740, HFMP = 1.82E+07, HOC = -2.802E+09, LiqDen = {105, 0.74861, 0.26271, 684.75, 0.30815, 0}, VP = {101, 40.63688, -6607.72, -2.221184, -3.90747E-06, 2}, LiqCp = {16, 155200, 855.07, 0.88585, 0.024843, -0.000014582}, HOV = {106, 6.112633E+07, 0.426201, -0.0366365, 0.00811781, -0.00754654}, VapCp = {16, 55695, -489.46, 12.649, -0.00012524, 2.3115E-08}, LiqVis = {101, -131.86, 5312.8, 19.284, -0.000029085, 2}, VapVis = {102, 1.5946E-07, 0.76369, 193.94, -148.97, 0}, LiqK = {16, 0.02927, -28.287, -2.0319, 0.000077764, -0.0000037797}, VapK = {102, -2269.7, 0.68598, -3.774E+09, -2.6655E+11, 0}, Racketparam = 0.265583, UniquacR = 4.4376, UniquacQ = 3.288, ChaoSeadAF = 0.234279, ChaoSeadSP = 19187.2, ChaoSeadLV = 0.117341); +end Pdichlorobenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pdiethylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Pdiethylbenzene.mo new file mode 100644 index 0000000..b066b4a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pdiethylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pdiethylbenzene + extends General_Properties(SN = 296, name = "Pdiethylbenzene", CAS = "105-05-5", Tc = 657.9, Pc = 2803000, Vc = 0.4805, Cc = 0.247, Tb = 456.9, Tm = 230.3, TT = 230.325, TP = 0.21291, MW = 134.2182, LVB = 0.15645, AF = 0.403, SP = 17660, DM = 0, SH = -1209000000.0, IGHF = -2.23E+07, GEF = 1.385E+08, AS = 433100, HFMP = 1.06E+07, HOC = -5.5553E+09, LiqDen = {105, 0.50239, 0.25108, 657.9, 0.28806, 0}, VP = {101, 108.74, -9636.7, -12.656, 0.000006664, 2}, LiqCp = {16, 42717, -14.138, 11.106, 0.0050234, -0.0000039715}, HOV = {106, 5.468714E+07, -1.551219, 6.621841, -8.199596, 3.486311}, VapCp = {16, 117030, -755.24, 13.637, -0.00037709, 9.9721E-08}, LiqVis = {101, -11.766, 1322.3, 0.075076, -1.4518E-07, 2}, VapVis = {102, 7.2136E-07, 0.49617, 343.97, -290.07, 0}, LiqK = {16, -0.054323, -5.9143, -1.4413, -0.00065059, -8.3255E-07}, VapK = {102, 0.000023956, 1.1969, 213.51, 48127, 0}, Racketparam = 0.247, UniquacR = 6.0066, UniquacQ = 4.616, ChaoSeadAF = 0.403, ChaoSeadSP = 17660, ChaoSeadLV = 0.15645); +end Pdiethylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pdiisopropylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Pdiisopropylbenzene.mo new file mode 100644 index 0000000..9e5a79d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pdiisopropylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pdiisopropylbenzene + extends General_Properties(SN = 306, name = "Pdiisopropylbenzene", CAS = "100-18-5", Tc = 675, Pc = 2360000, Vc = 0.584, Cc = 0.256, Tb = 483.52, Tm = 256.08, TT = 256.08, TP = 0.697953, MW = 162.271, LVB = 0.190236, AF = 0.476415, SP = 16930, DM = 0, SH = -1209000000.0, IGHF = -7.76E+07, GEF = 1.47804E+08, AS = 488000, HFMP = 0, HOC = -6.77E+09, LiqDen = {105, 0.77801, 0.34547, 675, 0.38736, 0}, VP = {101, 121.6259, -10711.76, -14.56272, 8.944308E-06, 2}, LiqCp = {16, -70570, 94.476, 11.349, 0.0048258, -0.0000034771}, HOV = {106, 9.572101E+07, 2.166143, -4.616074, 4.777254, -1.852374}, VapCp = {16, 100830, -531.56, 13.456, 0.000043333, -2.4118E-08}, LiqVis = {101, -8.9912, 1148.7, -0.35833, 4.6037E-07, 2}, VapVis = {102, 8.0354E-07, 0.48062, 391.1, 176.97, 0}, LiqK = {16, -0.043466, -14.777, -1.4776, -0.00080068, -0.0000006904}, VapK = {102, 0.31596, -0.074042, -318.59, 1928600, 0}, Racketparam = 0.256, UniquacR = 7.3538, UniquacQ = 5.688, ChaoSeadAF = 0.390023, ChaoSeadSP = 16930, ChaoSeadLV = 0.190236); +end Pdiisopropylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pentanal.mo b/Simulator/Simulator/Files/Chemsep_Database/Pentanal.mo new file mode 100644 index 0000000..9649cb3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pentanal.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pentanal + extends General_Properties(SN = 320, name = "Pentanal", CAS = "110-62-3", Tc = 554, Pc = 3500000, Vc = 0.316, Cc = 0.264, Tb = 376.15, Tm = 190.15, TT = 182, TP = 0.0522823, MW = 86.1323, LVB = 0.107035, AF = 0.390803, SP = 18440, DM = 8.57E-30, SH = -1209000000.0, IGHF = -2.2669E+08, GEF = -1.0711E+08, AS = 382890, HFMP = 1.5E+07, HOC = -2.91E+09, LiqDen = {105, 0.76227, 0.25072, 566.11, 0.27912, 0}, VP = {101, 92.63614, -7428.499, -10.51804, 7.160109E-06, 2}, LiqCp = {16, 156770, 199.89, 4.2571, 0.024547, -0.000022679}, HOV = {106, 6.99504E+07, 0.991037, 0.252443, -1.761713, 0.936026}, VapCp = {16, 101560, -929.74, 13.391, -0.0005525, 1.6606E-07}, LiqVis = {101, -10.884, 982.07, -0.00046989, 2.2767E-08, 2}, VapVis = {102, 2.2718E-07, 0.67661, 192.16, -86.47, 0}, LiqK = {16, 0.010965, -0.28239, -1.5585, -0.0012856, -0.0000013221}, VapK = {102, -3901000, -0.05461, 1.6551E+09, -2.4357E+13, 0}, Racketparam = 0.264, UniquacR = 3.9223, UniquacQ = 3.416, ChaoSeadAF = 0.347159, ChaoSeadSP = 18440, ChaoSeadLV = 0.107035); +end Pentanal; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pethyltoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/Pethyltoluene.mo new file mode 100644 index 0000000..4c99a10 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pethyltoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pethyltoluene + extends General_Properties(SN = 284, name = "Pethyltoluene", CAS = "622-96-8", Tc = 640.2, Pc = 3230000, Vc = 0.44, Cc = 0.259, Tb = 435.13, Tm = 210.83, TT = 210.83, TP = 0.0782406, MW = 120.194, LVB = 0.1396, AF = 0.364, SP = 17710, DM = 0, SH = -1209000000.0, IGHF = -3260000, GEF = 1.268E+08, AS = 398900, HFMP = 1.336E+07, HOC = -4.94268E+09, LiqDen = {105, 0.60155, 0.25704, 640.2, 0.31664, 0}, VP = {101, 21.19382, -5103.792, 0.409026, -2.319216E-06, 2}, LiqCp = {16, 30748, -85.511, 11.539, 0.0037389, -0.0000030029}, HOV = {106, 7.1677E+07, 1.0708, -1.1055, 0.62044, -0.16372}, VapCp = {16, 75636, -568.13, 13.103, 0.000082441, -4.4902E-08}, LiqVis = {101, -23.973, 1681.2, 1.9315, 6.328E-08, 2}, VapVis = {102, 5.7075E-07, 0.5347, 318.96, -7211.9, 0}, LiqK = {16, -0.065655, 1.2156, -1.4285, -0.00047761, -9.6417E-07}, VapK = {102, 0.000095782, 1.0471, 660.61, 40132, 0}, Racketparam = 0.259, UniquacR = 5.3322, UniquacQ = 4.076, ChaoSeadAF = 0.364, ChaoSeadSP = 17710, ChaoSeadLV = 0.1396); +end Pethyltoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Phenanthrene.mo b/Simulator/Simulator/Files/Chemsep_Database/Phenanthrene.mo new file mode 100644 index 0000000..8e34b4c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Phenanthrene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Phenanthrene + extends General_Properties(SN = 182, name = "Phenanthrene", CAS = "85-01-8", Tc = 869, Pc = 2900000, Vc = 0.554, Cc = 0.222, Tb = 610.03, Tm = 372.38, TT = 372.38, TP = 29.2781, MW = 178.229, LVB = 0.167077, AF = 0.470716, SP = 19910, DM = 0, SH = -168070000.0, IGHF = 2.012E+08, GEF = 3.0219E+08, AS = 394500, HFMP = 1.6463E+07, HOC = -6.8282E+09, LiqDen = {105, 0.4558, 0.25237, 869, 0.24848, 0}, VP = {101, 275.0593, -20918.1, -36.87097, 0.0000193212, 2}, LiqCp = {16, 115950, -43.82, 10.979, 0.0042773, -0.0000023928}, HOV = {106, 9.2455E+07, 0.28979, 1.1393, -1.9946, 0.92537}, VapCp = {16, 66200, -509.49, 13.435, -0.000075274, 6.0366E-09}, LiqVis = {101, -22.439, 2565.4, 1.5699, 3.8655E-09, 2}, VapVis = {102, 0.0000004717, 0.52643, 268.46, 10947, 0}, LiqK = {16, 0.11683, -580.68, -0.62222, -0.006256, 4.1638E-07}, VapK = {102, 0.000092871, 0.99317, 671.87, 29972, 0}, Racketparam = 0.249255, UniquacR = 6.562953, UniquacQ = 4.336, ChaoSeadAF = 0.54, ChaoSeadSP = 20142.5, ChaoSeadLV = 0.167078); +end Phenanthrene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Phenol.mo b/Simulator/Simulator/Files/Chemsep_Database/Phenol.mo new file mode 100644 index 0000000..9ce1e5e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Phenol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Phenol + extends General_Properties(SN = 126, name = "Phenol", CAS = "108-95-2", Tc = 694.25, Pc = 6130000, Vc = 0.229, Cc = 0.243, Tb = 455.04, Tm = 314.06, TT = 314.06, TP = 187.979, MW = 94.113, LVB = 0.08787, AF = 0.442, SP = 24630, DM = 4.84E-30, SH = -168070000.0, IGHF = -9.6399E+07, GEF = -3.2637E+07, AS = 314810, HFMP = 1.151E+07, HOC = -2.921E+09, LiqDen = {105, 1.4937, 0.32883, 694.25, 0.34018, 0}, VP = {101, 300.97, -20269, -40.743, 0.000021631, 2}, LiqCp = {16, 86710, -628.11, 15.735, -0.0091743, 0.0000081827}, HOV = {106, 7.270282E+07, -0.265673, 2.248545, -2.018709, 0.353169}, VapCp = {16, 39758, -470.56, 12.627, 0.000068347, -4.9708E-08}, LiqVis = {101, -203.001, 10884.21, 28.73615, -0.0000224564, 2}, VapVis = {102, 1.0771E-07, 0.79384, 145.89, -11364, 0}, LiqK = {16, 0.14109, -966.5, 10.659, -0.049095, 0.000038703}, VapK = {102, 0.03495, 0.27845, 1585.2, 862070, 0}, Racketparam = 0, UniquacR = 3.5517, UniquacQ = 2.68, ChaoSeadAF = 0.442, ChaoSeadSP = 24632.6, ChaoSeadLV = 0.0889403); +end Phenol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Phosgene.mo b/Simulator/Simulator/Files/Chemsep_Database/Phosgene.mo new file mode 100644 index 0000000..1f963db --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Phosgene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Phosgene + extends General_Properties(SN = 8, name = "Phosgene", CAS = "75-44-5", Tc = 455, Pc = 5674200, Vc = 0.19, Cc = 0.285, Tb = 280.71, Tm = 145.37, TT = 145.37, TP = 0.920651, MW = 98.9161, LVB = 0.0597955, AF = 0.201309, SP = 17140, DM = 3.9E-30, SH = -218900000.0, IGHF = -2.189E+08, GEF = -2.0479E+08, AS = 283740, HFMP = 5738400, HOC = -1.746E+08, LiqDen = {105, 1.4691, 0.2768, 455, 0.27965, 0}, VP = {101, 81.03568, -5112.106, -9.267047, 0.0000119936, 2}, LiqCp = {16, 101240, -202030, 196.31, 2.1704, -0.0015512}, HOV = {106, 4.367252E+07, 1.081822, -0.773774, -0.1937, 0.317951}, VapCp = {16, 32506, -282.16, 11.124, -0.00017636, 4.5651E-08}, LiqVis = {101, -789.51, 22474, 129.1, -0.00032789, 2}, VapVis = {102, 6.2229E-07, 0.58405, 277.35, -6111.6, 0}, LiqK = {16, 0.0025061, 3.5674, -1.6592, -0.0007952, -0.0000018088}, VapK = {102, 0.000024368, 1.1423, 246.56, 4296.5, 0}, Racketparam = 0, UniquacR = 2.300593, UniquacQ = 2.08, ChaoSeadAF = 0.1918, ChaoSeadSP = 17837.2, ChaoSeadLV = 0.0705389); +end Phosgene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Phthalicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Phthalicacid.mo new file mode 100644 index 0000000..8c1786f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Phthalicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Phthalicacid + extends General_Properties(SN = 401, name = "Phthalicacid", CAS = "88-99-3", Tc = 943.0648, Pc = 4492234, Vc = 0.4235, Cc = 0.242627, Tb = 651.424, Tm = 483.15, TT = 0, TP = 0, MW = 166.131, LVB = 0.115821, AF = 1.16031, SP = 29038.44, DM = 8.67E-30, SH = -22600000.0, IGHF = -6.63E+08, GEF = -5.42E+08, AS = 442000, HFMP = 0, HOC = -3.0915E+09, LiqDen = {105, 0.59385, 0.252, 800, 0.28571, 0}, VP = {101, 214.6186, -21678.73, -26.54136, 7.94063E-06, 2}, LiqCp = {16, 126080, 73.955, 9.4222, 0.0070682, -0.0000039598}, HOV = {106, 1.16446E+08, 0.325842, -0.000233021, 0.00216992, 0.484323}, VapCp = {16, 78972, -814.12, 13.621, -0.00057909, 1.2469E-07}, LiqVis = {101, -20.315, 4089.4, 0.87699, -5.3713E-07, 2}, VapVis = {102, 5.1978E-08, 0.86126, 68.544, -136.86, 0}, LiqK = {16, -0.13007, 40.261, -1.3314, 0.00027982, -9.4309E-07}, VapK = {102, 0.00011576, 0.91053, 351.24, 130660, 0}, Racketparam = 0.242627, UniquacR = 5.456, UniquacQ = 4.288, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); +end Phthalicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Piperazine.mo b/Simulator/Simulator/Files/Chemsep_Database/Piperazine.mo new file mode 100644 index 0000000..f882faa --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Piperazine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Piperazine + extends General_Properties(SN = 376, name = "Piperazine", CAS = "110-85-0", Tc = 656.3, Pc = 5420000, Vc = 0.267, Cc = 0.2652, Tb = 419.15, Tm = 379.15, TT = 379.15, TP = 26372.2, MW = 86.1356, LVB = 0.129371, AF = 0.269668, SP = 17960, DM = 4.90339E-30, SH = -22600000.0, IGHF = 2.26E+07, GEF = 1.7E+08, AS = 321000, HFMP = 1.17E+07, HOC = -2.76E+09, LiqDen = {105, 1.4074, 0.323, 638, 0.28571, 0}, VP = {101, 143.27, -11245, -17.657, 0.0000096236, 2}, LiqCp = {4, 32886.27, 346.6189, 0.473406, -0.000434168, 0}, HOV = {106, 6.6945E+07, 0.99602, -2.0069, 2.4018, -0.97129}, VapCp = {16, 68463, -744.16, 13.556, -0.00073698, 1.7652E-07}, LiqVis = {101, 24.341, 105.42, -5.6537, 0.0000060109, 2}, VapVis = {102, 0.0000022951, 0.42453, 937.27, -18307, 0}, LiqK = {16, 0.029211, -334.85, 0.86034, -0.0073343, 0.0000029317}, VapK = {102, 0.0014866, 0.6319, -11.551, 345800, 0}, Racketparam = 0.323, UniquacR = 3.7628, UniquacQ = 2.952, ChaoSeadAF = 0.41376, ChaoSeadSP = 17960, ChaoSeadLV = 0.129371); +end Piperazine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pnitrotoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/Pnitrotoluene.mo new file mode 100644 index 0000000..c35090e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pnitrotoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pnitrotoluene + extends General_Properties(SN = 385, name = "Pnitrotoluene", CAS = "99-99-0", Tc = 736, Pc = 3800000, Vc = 0.441, Cc = 0.229, Tb = 511.15, Tm = 325.05, TT = 324.75, TP = 40.4829, MW = 137.136, LVB = 0.121894, AF = 0.542405, SP = 21110, DM = 1.48E-29, SH = -22600000.0, IGHF = 3.1E+07, GEF = 1.554E+08, AS = 380800, HFMP = 1.6676E+07, HOC = -3.553E+09, LiqDen = {105, 0.76802, 0.27463, 736, 0.3126, 0}, VP = {101, 115.4618, -11239.6, -13.3636, 5.387653E-06, 2}, LiqCp = {16, 90280, 945.96, 3.9359, 0.019415, -0.000013352}, HOV = {106, 1.550237E+08, 1.89329, -1.014085, -0.0168324, -0.442436}, VapCp = {16, 126830, -1053.5, 13.982, -0.0011308, 3.2272E-07}, LiqVis = {101, -164.01, 7455.2, 23.73, -0.000026464, 2}, VapVis = {102, 4.1207E-08, 0.91154, 64.997, -92.66, 0}, LiqK = {16, -0.1404, 23.385, -1.2743, -0.000067534, -5.8708E-07}, VapK = {102, 0.000064675, 1.0353, 391.41, 37904, 0}, Racketparam = 0.229, UniquacR = 4.2801, UniquacQ = 3.272, ChaoSeadAF = 0.425222, ChaoSeadSP = 21110, ChaoSeadLV = 0.121894); +end Pnitrotoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pphenylenediamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Pphenylenediamine.mo new file mode 100644 index 0000000..617214b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pphenylenediamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pphenylenediamine + extends General_Properties(SN = 375, name = "Pphenylenediamine", CAS = "106-50-3", Tc = 796, Pc = 5180000, Vc = 0.377, Cc = 0.248, Tb = 540, Tm = 419, TT = 413, TP = 1388.21, MW = 108.141, LVB = 0.102198, AF = 0.53864, SP = 24810, DM = 5.1E-30, SH = -22600000.0, IGHF = 9.12E+07, GEF = 2.1E+08, AS = 349000, HFMP = 2.68E+07, HOC = -3.33E+09, LiqDen = {105, 0.78274, 0.24798, 796, 0.28573, 0}, VP = {101, 120.7365, -13060.28, -13.71648, 4.333592E-06, 2}, LiqCp = {16, 199750, 494.23, 5.1045, 0.015817, -0.000010858}, HOV = {106, 1.0783E+08, 1.6408, -3.3392, 3.5461, -1.4179}, VapCp = {16, 58132, -482.33, 12.882, -0.000085339, 9.0492E-09}, LiqVis = {101, -8.9816, 2291, -0.53494, 2.8717E-07, 2}, VapVis = {102, 1.4679E-07, 0.74191, 224.79, -11478, 0}, LiqK = {16, 0.0030572, -268.6, 0.38244, -0.0036549, 8.2114E-07}, VapK = {102, 0.000070276, 1.0203, 189.91, 62690, 0}, Racketparam = 0.248, UniquacR = 4.2452, UniquacQ = 3.232, ChaoSeadAF = 0.53864, ChaoSeadSP = 24810, ChaoSeadLV = 0); +end Pphenylenediamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Propadiene.mo b/Simulator/Simulator/Files/Chemsep_Database/Propadiene.mo new file mode 100644 index 0000000..8f03831 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Propadiene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Propadiene + extends General_Properties(SN = 60, name = "Propadiene", CAS = "463-49-0", Tc = 394, Pc = 5250000, Vc = 0.1739, Cc = 0.279, Tb = 238.77, Tm = 136.87, TT = 136.87, TP = 18.2497, MW = 40.065, LVB = 0.06095, AF = 0.122, SP = 14010, DM = 0, SH = 190500000.0, IGHF = 1.905E+08, GEF = 2.008E+08, AS = 243900, HFMP = 4400000, HOC = -1.8563E+09, LiqDen = {105, 0.86549, 0.19732, 394, 0.21029, 0}, VP = {101, 59.80183, -3745.303, -6.036523, 8.205156E-06, 2}, LiqCp = {16, 78665, -12422, 151.08, -0.53356, 0.00065986}, HOV = {106, 1.54657E+07, -3.722436, 11.45729, -12.9266, 5.522823}, VapCp = {16, 34671.52, -447.4983, 11.46556, 0.000444481, -1.470826E-07}, LiqVis = {101, -9.5153, 310.76, -0.034725, -0.0000021543, 2}, VapVis = {102, 6.3119E-07, 0.52792, 129.92, 8459.5, 0}, LiqK = {16, 0.06063, 169.42, -4.6941, 0.014436, -0.000036249}, VapK = {102, 0.000059663, 1.0782, 9.0271, 65666, 0}, Racketparam = 0, UniquacR = 1.7917, UniquacQ = 1.528, ChaoSeadAF = 0.3125, ChaoSeadSP = 17551, ChaoSeadLV = 0.0604292); +end Propadiene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Propanal.mo b/Simulator/Simulator/Files/Chemsep_Database/Propanal.mo new file mode 100644 index 0000000..920ddca --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Propanal.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Propanal + extends General_Properties(SN = 318, name = "Propanal", CAS = "123-38-6", Tc = 493.15, Pc = 4650000, Vc = 0.223, Cc = 0.239, Tb = 321.15, Tm = 193.15, TT = 170, TP = 1.31328, MW = 58.0791, LVB = 0.0734076, AF = 0.330077, SP = 19320, DM = 8.41E-30, SH = -1209000000.0, IGHF = -1.874E+08, GEF = -1.244E+08, AS = 304700, HFMP = 8580000, HOC = -1.6857E+09, LiqDen = {105, 0.81482, 0.2126, 493.15, 0.21277, 0}, VP = {101, 110.8631, -6856.828, -13.8218, 0.0000173391, 2}, LiqCp = {16, 116710, 75.622, 5.752, 0.010877, 0.0000042986}, HOV = {106, 6.196909E+07, 1.837694, -1.953499, -0.000443949, 0.620394}, VapCp = {16, -181030, 9.3832, 12.233, 0.00079415, -2.4738E-07}, LiqVis = {101, -10.033, 843.41, -0.14954, 3.8846E-08, 2}, VapVis = {102, 1.9173E-07, 0.71905, 111.91, 4618.1, 0}, LiqK = {16, 0.020248, -83.587, -0.55331, -0.0042681, 0.0000015626}, VapK = {102, 776.87, 0.94095, 4.8356E+09, -1.3358E+11, 0}, Racketparam = 0.239, UniquacR = 2.5735, UniquacQ = 2.336, ChaoSeadAF = 0.255909, ChaoSeadSP = 19320, ChaoSeadLV = 0.0734076); +end Propanal; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Propane.mo b/Simulator/Simulator/Files/Chemsep_Database/Propane.mo new file mode 100644 index 0000000..9d92eb8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Propane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Propane + extends General_Properties(SN = 67, name = "Propane", CAS = "74-98-6", Tc = 369.83, Pc = 4248000, Vc = 0.2, Cc = 0.276, Tb = 231.02, Tm = 85.47, TT = 85.47, TP = 0.0001685, MW = 44.097, LVB = 0.07487, AF = 0.152, SP = 13100, DM = 0, SH = -104680000.0, IGHF = -1.0468E+08, GEF = -2.439E+07, AS = 270200, HFMP = 3524000, HOC = -2.04311E+09, LiqDen = {105, 1.3186, 0.27005, 369.86, 0.27852, 0}, VP = {101, 55.2725, -3396.946, -5.423393, 8.953731E-06, 2}, LiqCp = {16, 87486, -13371, 156.92, -0.5459, 0.00068504}, HOV = {106, 3.0459E+07, 1.2001, -2.1107, 1.9732, -0.65316}, VapCp = {16, 37840.4, -445.5789, 11.83871, 0.000653764, -2.200137E-07}, LiqVis = {101, -35.23159, 966.1472, 4.395026, -0.0000255079, 2}, VapVis = {102, 4.7422E-08, 0.90416, -4.7484, 478.57, 0}, LiqK = {16, 0.02937, -16.323, -1.3313, -0.0012596, -0.000011206}, VapK = {102, -1.139, 0.10904, -9898.6, -7669600, 0}, Racketparam = 0.2763, UniquacR = 2.4766, UniquacQ = 2.236, ChaoSeadAF = 0.1538, ChaoSeadSP = 13091.2, ChaoSeadLV = 0.084); +end Propane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Propionicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Propionicacid.mo new file mode 100644 index 0000000..dbf135c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Propionicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Propionicacid + extends General_Properties(SN = 65, name = "Propionicacid", CAS = "79-09-4", Tc = 604, Pc = 4530000, Vc = 0.233, Cc = 0.207, Tb = 414.31, Tm = 252.45, TT = 252.45, TP = 13.1, MW = 74.079, LVB = 0.07497, AF = 0.544, SP = 19490, DM = 5.84E-30, SH = 20230000.0, IGHF = -4.535E+08, GEF = -3.568E+08, AS = 294900, HFMP = 1.066E+07, HOC = -1.395E+09, LiqDen = {105, 0.88103, 0.22848, 612.66, 0.25898, 0}, VP = {101, 58.42, -7261.2, -4.9024, 0.0000010406, 2}, LiqCp = {16, 120710, 704.7, 1.1886, 0.028883, -0.000020278}, HOV = {106, 4.8878E+07, 3.7167, -10.822, 11.498, -4.1176}, VapCp = {16, 47961, -474.81, 12.167, 0.00020648, -6.6213E-08}, LiqVis = {101, -53.41646, 2724.985, 6.7143, -9.670276E-06, 2}, VapVis = {102, 1.6155E-08, 1.0459, -115.32, 27680, 0}, LiqK = {16, 0.067757, -235.87, -0.022659, -0.0065033, 0.0000026666}, VapK = {102, 0.004145, 0.70902, 13255, -4962900, 0}, Racketparam = 0, UniquacR = 2.9, UniquacQ = 2.58, ChaoSeadAF = 0.52, ChaoSeadSP = 19130.1, ChaoSeadLV = 0.0749523); +end Propionicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Propionitrile.mo b/Simulator/Simulator/Files/Chemsep_Database/Propionitrile.mo new file mode 100644 index 0000000..c25bb67 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Propionitrile.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Propionitrile + extends General_Properties(SN = 411, name = "Propionitrile", CAS = "107-12-0", Tc = 564.4, Pc = 4180000, Vc = 0.229, Cc = 0.204, Tb = 370.5, Tm = 180.26, TT = 180.26, TP = 0.169356, MW = 55.0785, LVB = 0.0708565, AF = 0.324267, SP = 21760, DM = 1.34E-29, SH = -61100000.0, IGHF = 5.15E+07, GEF = 9.74949E+07, AS = 286600, HFMP = 5029170, HOC = -1.8007E+09, LiqDen = {105, 0.90359, 0.2211, 564.4, 0.26246, 0}, VP = {101, 81.601, -6646.8, -8.9882, 0.0000074443, 2}, LiqCp = {16, 105770, 154.89, 4.5843, 0.018329, -0.000011984}, HOV = {106, 3.633259E+07, -2.107222, 8.013128, -9.747514, 4.114254}, VapCp = {16, 47947, -544.83, 11.91, 0.00026005, -9.1233E-08}, LiqVis = {101, -8.0958, 775.57, -0.393, -7.9624E-07, 2}, VapVis = {102, 9.8851E-08, 0.79377, 155.28, -11568, 0}, LiqK = {16, 0.13846, 2645.2, -37.177, 0.15078, -0.00022598}, VapK = {102, 0.00048871, 1.327, 43042, -3226700, 0}, Racketparam = 0.204, UniquacR = 2.5445, UniquacQ = 2.264, ChaoSeadAF = 0.324267, ChaoSeadSP = 21760, ChaoSeadLV = 0.0708565); +end Propionitrile; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Propylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Propylene.mo new file mode 100644 index 0000000..37b5d48 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Propylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Propylene + extends General_Properties(SN = 61, name = "Propylene", CAS = "115-07-1", Tc = 364.85, Pc = 4600000, Vc = 0.185, Cc = 0.281, Tb = 225.45, Tm = 87.9, TT = 87.89, TP = 0.00117, MW = 42.0797, LVB = 0.0832412, AF = 0.137588, SP = 11890, DM = 1.22E-30, SH = 20230000.0, IGHF = 2.023E+07, GEF = 6.264E+07, AS = 267000, HFMP = 2936000, HOC = -1.9262E+09, LiqDen = {105, 0.98129, 0.22226, 365.58, 0.24039, 0}, VP = {101, 55.10362, -3330.452, -5.40588, 0.0000093641, 2}, LiqCp = {16, 79790, 300.8, 5.1342, 0.0095615, 0.000012777}, HOV = {106, 2.7525E+07, 0.61217, -0.41646, 0.083772, 0.12092}, VapCp = {16, 38965.36, -516.3838, 11.75322, 0.000509119, -1.771348E-07}, LiqVis = {101, -54.05485, 1437.773, 7.536247, -0.0000342733, 2}, VapVis = {102, 7.3873E-07, 0.54213, 262.33, -108.51, 0}, LiqK = {16, -0.044587, 22.061, -1.744, 0.0015214, -0.0000078162}, VapK = {102, 0.000045373, 1.2, 415.83, 2757.2, 0}, Racketparam = 0.2785, UniquacR = 2.25, UniquacQ = 2.02, ChaoSeadAF = 0.1477, ChaoSeadSP = 13152.4, ChaoSeadLV = 0.068956); +end Propylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Propylenecarbonate.mo b/Simulator/Simulator/Files/Chemsep_Database/Propylenecarbonate.mo new file mode 100644 index 0000000..cae2f1e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Propylenecarbonate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Propylenecarbonate + extends General_Properties(SN = 419, name = "Propylenecarbonate", CAS = "108-32-7", Tc = 778, Pc = 5410000, Vc = 0.246, Cc = 0.206, Tb = 514.9, Tm = 218.62, TT = 224.85, TP = 0.00116652, MW = 102.089, LVB = 0.0852768, AF = 0.449764, SP = 27300, DM = 1.65E-29, SH = -61100000.0, IGHF = -6.0116E+08, GEF = -4.555E+08, AS = 296300, HFMP = 9617000, HOC = -1.6678E+09, LiqDen = {105, 1.122, 0.27599, 778, 0.40344, 0}, VP = {101, 102.32, -10530, -11.489, 0.0000052921, 2}, LiqCp = {16, 121750, 105.89, 6.5083, 0.016964, -0.000014577}, HOV = {106, 3.145898E+08, 9.998207, -26.2884, 28.38292, -11.49051}, VapCp = {16, 51696, -502.59, 12.655, -0.000076494, 1.3781E-08}, LiqVis = {101, -818.33, 28057, 129.62, -0.00022812, 2}, VapVis = {102, 4.7119E-08, 0.92676, 86.628, -9783.8, 0}, LiqK = {16, -0.096241, 6.7832, -1.0385, -0.00032841, -6.9782E-07}, VapK = {102, 0.00017416, 0.94857, 659.28, 16364, 0}, Racketparam = 0.206, UniquacR = 3.6024, UniquacQ = 3.006, ChaoSeadAF = 0.449764, ChaoSeadSP = 27300, ChaoSeadLV = 0.0852768); +end Propylenecarbonate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Ptoluicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Ptoluicacid.mo new file mode 100644 index 0000000..0b73183 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Ptoluicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Ptoluicacid + extends General_Properties(SN = 398, name = "Ptoluicacid", CAS = "99-94-5", Tc = 773, Pc = 3860000, Vc = 0.397, Cc = 0.238, Tb = 548.15, Tm = 452.75, TT = 452.75, TP = 5208.62, MW = 136.148, LVB = 0.129817, AF = 0.661017, SP = 22040, DM = 0, SH = -22600000.0, IGHF = -3.22796E+08, GEF = -2.13346E+08, AS = 406141, HFMP = 2.2737E+07, HOC = -3.69222E+09, LiqDen = {105, 0.60059, 0.238, 773, 0.28571, 0}, VP = {101, 180.79, -16901, -22.327, 0.0000079041, 2}, LiqCp = {16, 204240, 558.58, 5.081, 0.015699, -0.000010465}, HOV = {106, 1.0299E+08, 0.94653, -1.474, 1.5504, -0.62044}, VapCp = {16, 85949, -929.05, 14.065, -0.0013145, 5.0858E-07}, LiqVis = {101, -16.393, 2717.5, 0.51437, -3.3608E-07, 2}, VapVis = {102, 8.0828E-08, 0.81038, 114.97, -489.3, 0}, LiqK = {16, -0.14095, 29.118, -1.2124, 0.000049104, -7.6374E-07}, VapK = {102, 0.00002977, 1.1214, 206.56, 62002, 0}, Racketparam = 0.238, UniquacR = 5.058, UniquacQ = 3.912, ChaoSeadAF = 0.661017, ChaoSeadSP = 22040, ChaoSeadLV = 0.129817); +end Ptoluicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pxylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Pxylene.mo new file mode 100644 index 0000000..9df2b0c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pxylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pxylene + extends General_Properties(SN = 152, name = "Pxylene", CAS = "106-42-3", Tc = 616.2, Pc = 3511000, Vc = 0.378, Cc = 0.259, Tb = 411.53, Tm = 286.41, TT = 286.41, TP = 575.533, MW = 106.167, LVB = 0.12393, AF = 0.322, SP = 17910, DM = 0, SH = -168070000.0, IGHF = 1.803E+07, GEF = 1.214E+08, AS = 352165, HFMP = 1.711E+07, HOC = -4.333E+09, LiqDen = {105, 0.67752, 0.25887, 616.2, 0.27596, 0}, VP = {101, 97.352, -8082.1, -11.197, 0.0000072605, 2}, LiqCp = {16, 63084, -343.38, 13.438, -0.0033851, 0.0000045592}, HOV = {106, 5.6332E+07, 0.37965, 0.42395, -0.85683, 0.43704}, VapCp = {16, 62397, -585.6, 13.025, 0.0000037921, -1.7044E-08}, LiqVis = {101, -23.916, 1499.8, 2.0719, -0.0000037065, 2}, VapVis = {102, 2.4281E-08, 0.95421, -91.329, 17547, 0}, LiqK = {16, 0.00066881, -122.94, -0.60875, -0.0037322, 9.7446E-07}, VapK = {102, 0.0000001261, 1.8916, -453.43, 111720, 0}, Racketparam = 0.2589, UniquacR = 4.66, UniquacQ = 3.54, ChaoSeadAF = 0.2969, ChaoSeadSP = 17939.04, ChaoSeadLV = 0.124); +end Pxylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pyrene.mo b/Simulator/Simulator/Files/Chemsep_Database/Pyrene.mo new file mode 100644 index 0000000..ce13645 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pyrene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pyrene + extends General_Properties(SN = 186, name = "Pyrene", CAS = "129-00-0", Tc = 936, Pc = 2610000, Vc = 0.66, Cc = 0.221, Tb = 667.95, Tm = 423.81, TT = 423.81, TP = 70.0313, MW = 202.251, LVB = 0.184923, AF = 0.507416, SP = 19670, DM = 0, SH = -168070000.0, IGHF = 2.25E+08, GEF = 3.272E+08, AS = 402000, HFMP = 1.736E+07, HOC = -7.63094E+09, LiqDen = {105, 0.54272, 0.27165, 936, 0.41522, 0}, VP = {101, 68.91405, -11628.85, -6.184331, 6.420723E-07, 2}, LiqCp = {16, 149400, -94.468, 11.128, 0.0038746, -0.0000019128}, HOV = {106, 9.198843E+07, -0.224752, 1.989996, -2.139885, 0.666532}, VapCp = {16, 117680, -754.3, 14.068, -0.00069165, 2.0484E-07}, LiqVis = {101, -131.9, 8597.1, 17.746, -0.000010523, 2}, VapVis = {102, 4.4284E-07, 0.52754, 289.9, 15025, 0}, LiqK = {16, 0.10165, -731.42, 0.75712, -0.0079846, 0.0000028317}, VapK = {102, 0.000092503, 0.97453, 647.35, 45503, 0}, Racketparam = 0.246034, UniquacR = 7.187871, UniquacQ = 4.504, ChaoSeadAF = 0.344, ChaoSeadSP = 20762.5, ChaoSeadLV = 0.17368); +end Pyrene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Pyridine.mo b/Simulator/Simulator/Files/Chemsep_Database/Pyridine.mo new file mode 100644 index 0000000..8722de2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Pyridine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Pyridine + extends General_Properties(SN = 102, name = "Pyridine", CAS = "110-86-1", Tc = 620, Pc = 5670000, Vc = 0.254, Cc = 0.267, Tb = 388.37, Tm = 231.53, TT = 231.51, TP = 20.5354, MW = 79.101, LVB = 0.08088, AF = 0.242, SP = 21570, DM = 7.31E-30, SH = -134990000.0, IGHF = 1.4037E+08, GEF = 1.9049E+08, AS = 282780, HFMP = 8280000, HOC = -2.6721E+09, LiqDen = {105, 0.67102, 0.2057, 620, 0.26001, 0}, VP = {101, 82.05373, -7269.578, -8.810082, 4.816564E-06, 2}, LiqCp = {16, 101830, 209.77, 5.3544, 0.019802, -0.000018129}, HOV = {106, 8.4421E+07, 2.7457, -5.3078, 4.8654, -1.7952}, VapCp = {16, 36223, -620.9, 12.812, -0.00029215, 7.7524E-08}, LiqVis = {101, -82.798, 4102.8, 11.028, -0.0000093419, 2}, VapVis = {102, 5.339E-08, 0.90066, 85.55, -5060.2, 0}, LiqK = {16, 0.018788, -54.761, -1.2916, -0.00062226, -0.0000029942}, VapK = {102, -7052.4, 0.17223, -5.768E+07, -1.624E+11, 0}, Racketparam = 0.269325, UniquacR = 3, UniquacQ = 2.16, ChaoSeadAF = 0.238898, ChaoSeadSP = 21804.1, ChaoSeadLV = 0.0808341); +end Pyridine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Salicylicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Salicylicacid.mo new file mode 100644 index 0000000..4fdea7e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Salicylicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Salicylicacid + extends General_Properties(SN = 399, name = "Salicylicacid", CAS = "69-72-7", Tc = 739, Pc = 5180000, Vc = 0.364, Cc = 0.275, Tb = 529, Tm = 431.75, TT = 431.75, TP = 2802.65, MW = 138.121, LVB = 0.119591, AF = 0.851182, SP = 24210, DM = 8.84E-30, SH = -22600000.0, IGHF = -4.948E+08, GEF = -3.954E+08, AS = 399800, HFMP = 1.959E+07, HOC = -2.8901E+09, LiqDen = {105, 0.8432, 0.27522, 739, 0.28574, 0}, VP = {101, 252.5417, -21148.9, -32.63925, 0.0000130693, 2}, LiqCp = {16, 129500, 160.82, 8.5105, 0.0092921, -0.0000057493}, HOV = {106, 1.3325E+08, -0.11849, 3.6062, -5.1635, 2.13}, VapCp = {16, 83388, -879.57, 13.917, -0.0013499, 0.0000005122}, LiqVis = {101, -50.743, 5203.6, 5.2837, 2.047E-08, 2}, VapVis = {102, 1.0029E-07, 0.78423, 131.87, -154.53, 0}, LiqK = {16, 0.0043799, -391.31, 0.63544, -0.0048323, 0.0000010995}, VapK = {102, 0.000028337, 1.1043, 106.43, 67783, 0}, Racketparam = 0.275, UniquacR = 4.6869, UniquacQ = 3.624, ChaoSeadAF = 0.851182, ChaoSeadSP = 24210, ChaoSeadLV = 0.119591); +end Salicylicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Secbutylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Secbutylbenzene.mo new file mode 100644 index 0000000..4939092 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Secbutylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Secbutylbenzene + extends General_Properties(SN = 289, name = "Secbutylbenzene", CAS = "135-98-8", Tc = 664.54, Pc = 2930000, Vc = 0.478, Cc = 0.265, Tb = 446.48, Tm = 197.717, TT = 197.717, TP = 0.00180534, MW = 134.218, LVB = 0.156497, AF = 0.279149, SP = 17050, DM = 1.3E-30, SH = -1209000000.0, IGHF = -1.73E+07, GEF = 1.4523E+08, AS = 439600, HFMP = 9830000, HOC = -5.563E+09, LiqDen = {105, 0.51273, 0.25494, 664.54, 0.28096, 0}, VP = {101, 222.2329, -13854.88, -30.30702, 0.0000262583, 2}, LiqCp = {16, 163140, -1794.7, 23.385, -0.029199, 0.000028}, HOV = {106, 3.1793E+07, -4.1563, 12.591, -13.449, 5.2588}, VapCp = {16, 118430, -784.79, 13.745, -0.00050199, 1.4393E-07}, LiqVis = {10, -9.695648, -444.5934, -129.1082, 0, 0}, VapVis = {102, 0.000001223, 0.44278, 495.81, 151.45, 0}, LiqK = {16, -0.042864, 5.3464, -1.6033, -0.00035754, -0.0000011781}, VapK = {102, 0.000022, 1.2101, 186.5, 49434, 0}, Racketparam = 0.265, UniquacR = 5.9452, UniquacQ = 4.584, ChaoSeadAF = 0.279149, ChaoSeadSP = 17050, ChaoSeadLV = 0.156497); +end Secbutylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Secbutylmercaptan.mo b/Simulator/Simulator/Files/Chemsep_Database/Secbutylmercaptan.mo new file mode 100644 index 0000000..075deeb --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Secbutylmercaptan.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Secbutylmercaptan + extends General_Properties(SN = 352, name = "Secbutylmercaptan", CAS = "513-53-1", Tc = 551, Pc = 3970000, Vc = 0.307, Cc = 0.271, Tb = 358.13, Tm = 133.01, TT = 133.01, TP = 0.0000339902, MW = 90.1872, LVB = 0.10943, AF = 0.25, SP = 17000, DM = 5.17E-30, SH = -22600000.0, IGHF = -9.66E+07, GEF = 5200000, AS = 366730, HFMP = 6477000, HOC = -2.95E+09, LiqDen = {105, 0.81743, 0.26237, 554.01, 0.28149, 0}, VP = {101, 85.20348, -6580.804, -9.568603, 0.0000075683, 2}, LiqCp = {16, 132220, 286.96, 6.629, 0.011753, -0.0000059086}, HOV = {106, 4.567571E+07, 0.16352, 0.885588, -1.131485, 0.438377}, VapCp = {16, 85634, -697.09, 12.792, -0.00003836, -5.0229E-09}, LiqVis = {101, -11.718, 953.76, 0.15985, -4.5581E-07, 2}, VapVis = {102, 8.4539E-08, 0.83594, 117.21, -7872.1, 0}, LiqK = {16, -0.032852, 4.221, -1.5207, -0.0004702, -0.0000018598}, VapK = {102, 0.97519, -0.11286, 1130.7, 3149700, 0}, Racketparam = 0.271, UniquacR = 4.1276, UniquacQ = 3.604, ChaoSeadAF = 0.25, ChaoSeadSP = 17000, ChaoSeadLV = 0.10943); +end Secbutylmercaptan; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Squalane.mo b/Simulator/Simulator/Files/Chemsep_Database/Squalane.mo new file mode 100644 index 0000000..8376c04 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Squalane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Squalane + extends General_Properties(SN = 217, name = "Squalane", CAS = "111-01-3", Tc = 863, Pc = 868000, Vc = 1.64, Cc = 0.198, Tb = 623.15, Tm = 235.15, TT = 235.15, TP = 1.70072E-12, MW = 422.813, LVB = 0.526135, AF = 0.915303, SP = 14490, DM = 0, SH = -1209000000.0, IGHF = -6.896E+08, GEF = 1.868E+08, AS = 1272000, HFMP = 4.7E+07, HOC = -1.85E+10, LiqDen = {105, 0.15996, 0.26223, 863, 0.38604, 0}, VP = {101, 518.45, -40342, -70.491, 0.00002486, 2}, LiqCp = {16, -38276, -113.46, 13.728, 0.001186, -3.7363E-07}, HOV = {106, 1.3274E+08, 0.38, 0, 0, 0}, VapCp = {16, 369830, -553.39, 14.489, 0.00010319, -3.8186E-08}, LiqVis = {118, -347.8968, 71874.9, 53.72611, -0.0000616157, 1.3}, VapVis = {102, 2.2128E-07, 0.5436, 144.2, 25.787, 0}, LiqK = {16, -0.045427, 7.6198, -1.8982, -0.00026051, -5.9557E-07}, VapK = {102, 0.000056714, 1.0625, 551.79, 75579, 0}, Racketparam = 0.198, UniquacR = 20.6854, UniquacQ = 16.816, ChaoSeadAF = 0.915303, ChaoSeadSP = 14490, ChaoSeadLV = 0.526135); +end Squalane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Styrene.mo b/Simulator/Simulator/Files/Chemsep_Database/Styrene.mo new file mode 100644 index 0000000..86c3a1f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Styrene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Styrene + extends General_Properties(SN = 148, name = "Styrene", CAS = "100-42-5", Tc = 636, Pc = 3840000, Vc = 0.352, Cc = 0.256, Tb = 418.31, Tm = 242.54, TT = 242.54, TP = 10.6132, MW = 104.149, LVB = 0.115667, AF = 0.297097, SP = 19020, DM = 4.33E-31, SH = -168070000.0, IGHF = 1.474E+08, GEF = 2.139E+08, AS = 345100, HFMP = 1.095E+07, HOC = -4.219E+09, LiqDen = {105, 0.57789, 0.23139, 640.77, 0.26351, 0}, VP = {101, 399.8489, -19017.34, -58.96286, 0.0000747957, 2}, LiqCp = {16, 134310, -99.916, 9.4935, 0.0058294, -0.0000013972}, HOV = {106, 1.110621E+08, 3.429275, -6.061051, 4.605581, -1.408226}, VapCp = {16, 57806.72, -550.4249, 12.95376, -0.0000950882, 2.294759E-08}, LiqVis = {101, -24.717, 1824, 1.9977, -4.7933E-07, 2}, VapVis = {102, 3.6968E-08, 0.90482, -32.023, 10027, 0}, LiqK = {16, -0.071817, -30.013, -1.0262, -0.0015623, 2.7674E-07}, VapK = {102, 0.010229, 0.40085, 535.56, 704200, 0}, Racketparam = 0, UniquacR = 4.37, UniquacQ = 3.3, ChaoSeadAF = 0.2302, ChaoSeadSP = 19015.9, ChaoSeadLV = 0.115667); +end Styrene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Sulfolane.mo b/Simulator/Simulator/Files/Chemsep_Database/Sulfolane.mo new file mode 100644 index 0000000..5b95b00 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Sulfolane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Sulfolane + extends General_Properties(SN = 90, name = "Sulfolane", CAS = "126-33-0", Tc = 855, Pc = 7290000, Vc = 0.3365, Cc = 0.345074, Tb = 560.45, Tm = 300.55, TT = 300.55, TP = 0.704459, MW = 120.17, LVB = 0.0952677, AF = 0.5234, SP = 26110, DM = 1.56E-29, SH = -17100000.0, IGHF = -3.727E+08, GEF = -2.431E+08, AS = 347500, HFMP = 1373000, HOC = -2.397E+09, LiqDen = {105, 0.89997, 0.26972, 853, 0.30746, 0}, VP = {101, 112.0995, -12237.47, -12.64533, 4.157394E-06, 2}, LiqCp = {16, 122690, -336.31, 11.614, 0.0017011, -5.0866E-07}, HOV = {106, 1.605659E+08, 3.828131, -7.67047, 6.739132, -2.353929}, VapCp = {16, 92921, -999.97, 13.757, -0.00093192, 0.0000002258}, LiqVis = {101, -56.251, 4046.1, 6.7894, -0.0000052803, 2}, VapVis = {102, 2.9074E-08, 0.97453, 81.209, -9361.1, 0}, LiqK = {16, 0.079581, -84.501, -1.1134, -0.0025206, 2.9748E-07}, VapK = {102, 0.000077821, 1.0313, 528.38, 54551, 0}, Racketparam = 0.257009, UniquacR = 4.0357, UniquacQ = 3.2, ChaoSeadAF = 0.377998, ChaoSeadSP = 26335.8, ChaoSeadLV = 0.0952677); +end Sulfolane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Sulfurdioxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Sulfurdioxide.mo new file mode 100644 index 0000000..0c053bb --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Sulfurdioxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Sulfurdioxide + extends General_Properties(SN = 24, name = "Sulfurdioxide", CAS = "7446-09-5", Tc = 430.75, Pc = 7884100, Vc = 0.122, Cc = 0.269, Tb = 263.13, Tm = 200, TT = 197.67, TP = 1674.39, MW = 64.0638, LVB = 0.04688, AF = 0.245381, SP = 12270, DM = 5.44E-30, SH = -296840000.0, IGHF = -2.9684E+08, GEF = -3.0012E+08, AS = 248100, HFMP = 7401000, HOC = 0, LiqDen = {105, 1.8477, 0.24254, 430.75, 0.27051, 0}, VP = {101, 53.52766, -4260.124, -4.670429, 0.0000030272, 2}, LiqCp = {16, 86911, 53691, -599.94, 2.2025, -0.0025885}, HOV = {106, 4.8914E+07, 1.8091, -2.9053, 2.2271, -0.64793}, VapCp = {16, 33406, -516.38, 10.524, 0.000013143, -6.1535E-08}, LiqVis = {101, 50.887, -1574, -9.4517, 1.5898E-07, 2}, VapVis = {102, 0.0000012144, 0.53923, 315.41, -2659.7, 0}, LiqK = {16, -0.21664, -2.2484, -0.50659, -0.0009424, -0.0000010218}, VapK = {102, 23.316, -0.95324, -1567.4, 1330100, 0}, Racketparam = 0, UniquacR = 1.6961, UniquacQ = 1.612, ChaoSeadAF = 0.2462, ChaoSeadSP = 12272.9, ChaoSeadLV = 0.0438228); +end Sulfurdioxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Sulfurhexafluoride.mo b/Simulator/Simulator/Files/Chemsep_Database/Sulfurhexafluoride.mo new file mode 100644 index 0000000..da40927 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Sulfurhexafluoride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Sulfurhexafluoride + extends General_Properties(SN = 203, name = "Sulfurhexafluoride", CAS = "2551-62-4", Tc = 318.72, Pc = 3760000, Vc = 0.1984, Cc = 0.282, Tb = 209.25, Tm = 222.65, TT = 223.15, TP = 232670, MW = 146.056, LVB = 0.07981, AF = 0.208, SP = 7681, DM = 0, SH = -1209000000.0, IGHF = -1.209E+09, GEF = -1.1053E+09, AS = 291710, HFMP = 5024200, HOC = 9.24E+08, LiqDen = {105, 1.0016, 0.23435, 318.74, 0.24027, 0}, VP = {101, -17.60907, -1028.369, 6.556299, -0.0000178874, 2}, LiqCp = {16, 119500, -2040, -9.5251, 0.005216, -0.000044691}, HOV = {106, 5.0769E+07, 8.5605, -25.709, 29.437, -11.774}, VapCp = {16, 32322, -368.1, 12.478, -0.00063326, 1.9169E-07}, LiqVis = {101, 20.959, -457.46, -4.9486, 0.0000065105, 2}, VapVis = {102, 5.9343E-07, 0.62415, 62.573, 13289, 0}, LiqK = {16, -0.064331, -179.32, 0.36969, -0.0050683, -0.0000040693}, VapK = {102, 0.0013269, 0.52727, 30.264, 73930, 0}, Racketparam = 0.282, UniquacR = 3.085036, UniquacQ = 3.28, ChaoSeadAF = 0.208, ChaoSeadSP = 7681, ChaoSeadLV = 0.07981); +end Sulfurhexafluoride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Sulfurtrioxide.mo b/Simulator/Simulator/Files/Chemsep_Database/Sulfurtrioxide.mo new file mode 100644 index 0000000..dd7789f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Sulfurtrioxide.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Sulfurtrioxide + extends General_Properties(SN = 25, name = "Sulfurtrioxide", CAS = "7446-11-9", Tc = 490.85, Pc = 8210000, Vc = 0.127, Cc = 0.255, Tb = 317.9, Tm = 289.95, TT = 289.95, TP = 21130, MW = 80.0632, LVB = 0.0420954, AF = 0.42396, SP = 31130, DM = 0, SH = -296840000.0, IGHF = -3.9572E+08, GEF = -3.7095E+08, AS = 256510, HFMP = 7532000, HOC = 1.422E+08, LiqDen = {105, 1.6186, 0.20129, 490.85, 0.42123, 0}, VP = {101, 351.6001, -18247.39, -49.77065, 0.0000409297, 2}, LiqCp = {16, 258090, -3271.8, -8.4929, 0.0035868, -0.000028801}, HOV = {106, 8.1339E+07, 0.77728, -0.42427, 0.68287, -0.4608}, VapCp = {16, 32986, -404.97, 11.171, -0.000087925, -8.9809E-09}, LiqVis = {101, -260.71, 11505, 38.839, -0.000061621, 2}, VapVis = {102, 0.0000010033, 0.54515, 135.63, 19402, 0}, LiqK = {16, 0.021077, 585.52, -5.8227, 0.016099, -0.000027318}, VapK = {102, 1.1717, -0.2465, 2002.7, 1327100, 0}, Racketparam = 0, UniquacR = 2.145023, UniquacQ = 1.972376, ChaoSeadAF = 0.42396, ChaoSeadSP = 31130, ChaoSeadLV = 0.0420954); +end Sulfurtrioxide; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Terephthalicacid.mo b/Simulator/Simulator/Files/Chemsep_Database/Terephthalicacid.mo new file mode 100644 index 0000000..6321183 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Terephthalicacid.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Terephthalicacid + extends General_Properties(SN = 403, name = "Terephthalicacid", CAS = "100-21-0", Tc = 943.0648, Pc = 4492234, Vc = 0.4235, Cc = 0.242627, Tb = 665.55, Tm = 573.15, TT = 0, TP = 0, MW = 166.131, LVB = 0.115821, AF = 1.16031, SP = 29038.44, DM = 0, SH = -22600000.0, IGHF = -7.179E+08, GEF = -5.99E+08, AS = 448000, HFMP = 0, HOC = -3.0576E+09, LiqDen = {105, 0.42685, 0.181, 1113, 0.28571, 0}, VP = {101, 215.8574, -29586.64, -25.50026, 3.863371E-06, 2}, LiqCp = {0, 0, 0, 0, 0, 0}, HOV = {106, 8.9802E+07, 0.189, -0.50305, -1.1074, 4.311}, VapCp = {16, 83070, -852.74, 13.689, -0.000643, 1.4167E-07}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {102, 2.4248E-08, 0.96894, 40.456, -14256, 0}, LiqK = {16, 0, 0, 0, 0, 0}, VapK = {102, 0.00016184, 0.88608, 624.29, 90960, 0}, Racketparam = 0.242627, UniquacR = 5.456, UniquacQ = 4.288, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); +end Terephthalicacid; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Tertbutylbenzene.mo b/Simulator/Simulator/Files/Chemsep_Database/Tertbutylbenzene.mo new file mode 100644 index 0000000..2253108 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Tertbutylbenzene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Tertbutylbenzene + extends General_Properties(SN = 290, name = "Tertbutylbenzene", CAS = "98-06-6", Tc = 660, Pc = 2970000, Vc = 0.46, Cc = 0.266, Tb = 442.3, Tm = 215.27, TT = 215.27, TP = 0.0910321, MW = 134.218, LVB = 0.155605, AF = 0.267406, SP = 17130, DM = 2.33E-30, SH = -1209000000.0, IGHF = -2.26E+07, GEF = 1.4995E+08, AS = 401400, HFMP = 8393000, HOC = -5.5547E+09, LiqDen = {105, 0.50957, 0.25071, 660, 0.30584, 0}, VP = {101, 87.574, -8352.2, -9.5118, 0.0000039953, 2}, LiqCp = {16, 164930, 701.24, 1.184, 0.037122, -0.000038006}, HOV = {106, 6.3167E+07, 0.45262, 0, 0, 0}, VapCp = {16, 113750, -776.86, 13.825, -0.0005797, 1.6467E-07}, LiqVis = {101, -11.7, 1364.1, 0.038741, -3.8013E-08, 2}, VapVis = {102, 7.2957E-07, 0.50871, 384.51, -23.513, 0}, LiqK = {16, 0.052023, -143.3, -0.69673, -0.0057333, 0.0000022627}, VapK = {102, 0.000018955, 1.2291, 130.74, 53349, 0}, Racketparam = 0.266, UniquacR = 5.9452, UniquacQ = 4.584, ChaoSeadAF = 0.267406, ChaoSeadSP = 17130, ChaoSeadLV = 0.155605); +end Tertbutylbenzene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Tertbutylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/Tertbutylcyclohexane.mo new file mode 100644 index 0000000..ec21b15 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Tertbutylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Tertbutylcyclohexane + extends General_Properties(SN = 281, name = "Tertbutylcyclohexane", CAS = "3178-22-1", Tc = 652, Pc = 2660000, Vc = 0.51, Cc = 0.25, Tb = 444.65, Tm = 231.98, TT = 231.98, TP = 1.2, MW = 140.266, LVB = 0.1734, AF = 0.299134, SP = 16040, DM = 0, SH = -1209000000.0, IGHF = -2.169E+08, GEF = 5.695E+07, AS = 445700, HFMP = 1.12E+07, HOC = -6.091E+09, LiqDen = {105, 0.52388, 0.26705, 652, 0.32913, 0}, VP = {101, 123.1664, -9675.557, -15.08186, 0.0000105041, 2}, LiqCp = {16, 40996, -122.74, 11.846, 0.0032488, -0.0000015611}, HOV = {106, 6.9454E+07, 0.40915, 1.6494, -3.4494, 1.9573}, VapCp = {16, 95339, -601.24, 13.623, -0.000018521, -1.574E-08}, LiqVis = {101, -11.549, 1445.9, 0, 0, 0}, VapVis = {102, 4.6046E-08, 0.87493, 72.873, -5600.2, 0}, LiqK = {16, 0.054405, -203.55, -0.50495, -0.0065818, 0.0000029095}, VapK = {102, 0.077607, 0.14004, -91.94, 1372500, 0}, Racketparam = 0.25, UniquacR = 6.7417, UniquacQ = 5.472, ChaoSeadAF = 0.299134, ChaoSeadSP = 16040, ChaoSeadLV = 0.1734); +end Tertbutylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Tertbutylethylether.mo b/Simulator/Simulator/Files/Chemsep_Database/Tertbutylethylether.mo new file mode 100644 index 0000000..5bf46e8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Tertbutylethylether.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Tertbutylethylether + extends General_Properties(SN = 331, name = "Tertbutylethylether", CAS = "637-92-3", Tc = 512, Pc = 3149000, Vc = 0.382, Cc = 0.272, Tb = 345.65, Tm = 176.15, TT = 179.15, TP = 0.880264, MW = 102.175, LVB = 0.138991, AF = 0.295672, SP = 14800, DM = 4.07E-30, SH = -216400000.0, IGHF = -3.165E+08, GEF = -1.217E+08, AS = 397500, HFMP = 9530000, HOC = -3.684E+09, LiqDen = {105, 0.74373, 0.27619, 512, 0.30602, 0}, VP = {101, 59.92213, -5564.171, -5.601322, 3.389291E-06, 2}, LiqCp = {16, 135520, 9.8807, 8.6914, 0.01077, -0.0000076034}, HOV = {106, 4.5825E+07, 0.349787, 0.137025, -0.301886, 0.219717}, VapCp = {16, 78915, -487.03, 12.843, 0.00025385, -8.879E-08}, LiqVis = {101, -12.011, 1089.8, 0.081011, -2.1688E-07, 2}, VapVis = {102, 1.9715E-07, 0.697, 171.3, -4885.5, 0}, LiqK = {16, -0.1316, 11.716, -1.2478, -0.00024672, -0.0000012519}, VapK = {102, 0.000058788, 1.0907, 235.7, 33150, 0}, Racketparam = 0.272, UniquacR = 4.7422, UniquacQ = 4.172, ChaoSeadAF = 0.295672, ChaoSeadSP = 14800, ChaoSeadLV = 0.138991); +end Tertbutylethylether; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Tertbutylmercaptan.mo b/Simulator/Simulator/Files/Chemsep_Database/Tertbutylmercaptan.mo new file mode 100644 index 0000000..60b8fca --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Tertbutylmercaptan.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Tertbutylmercaptan + extends General_Properties(SN = 350, name = "Tertbutylmercaptan", CAS = "75-66-1", Tc = 530, Pc = 4060000, Vc = 0.307, Cc = 0.283, Tb = 337.37, Tm = 274.26, TT = 274.42, TP = 7907.71, MW = 90.1872, LVB = 0.113524, AF = 0.191395, SP = 15790, DM = 5.3E-30, SH = -22600000.0, IGHF = -1.096E+08, GEF = 1006000, AS = 338000, HFMP = 2482000, HOC = -2.9396E+09, LiqDen = {105, 0.89711, 0.27544, 530, 0.31359, 0}, VP = {101, 107.5154, -7030.549, -13.1586, 0.0000127338, 2}, LiqCp = {16, 154160, 506.03, 1.848, 0.027991, -0.000021961}, HOV = {106, 5.3137E+07, 1.4502, -2.4713, 2.4297, -0.95458}, VapCp = {16, 81989, -677.66, 12.907, -0.00021031, 4.8543E-08}, LiqVis = {101, -8.3337, 1214.8, -0.59208, 0.0000022318, 2}, VapVis = {102, 3.9123E-07, 0.6395, 316.74, -8533.3, 0}, LiqK = {16, 0.031454, -260.91, 0.599, -0.0079027, 0.0000031638}, VapK = {102, 0.032499, 0.31482, 1562.3, 775320, 0}, Racketparam = 0.283, UniquacR = 4.3543, UniquacQ = 3.912, ChaoSeadAF = 0.191395, ChaoSeadSP = 15790, ChaoSeadLV = 0.113524); +end Tertbutylmercaptan; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Tetraethyleneglycol.mo b/Simulator/Simulator/Files/Chemsep_Database/Tetraethyleneglycol.mo new file mode 100644 index 0000000..f1b0bbf --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Tetraethyleneglycol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Tetraethyleneglycol + extends General_Properties(SN = 160, name = "Tetraethyleneglycol", CAS = "112-60-7", Tc = 795, Pc = 2590000, Vc = 0.564, Cc = 0.221, Tb = 602.7, Tm = 268.15, TT = 268.15, TP = 0.0000138348, MW = 194.226, LVB = 0.172862, AF = 0.917442, SP = 23690, DM = 1.08E-29, SH = -168070000.0, IGHF = -8.83E+08, GEF = -5.599E+08, AS = 650100, HFMP = 3.66E+07, HOC = -4.3431E+09, LiqDen = {105, 0.46229, 0.26105, 795, 0.27055, 0}, VP = {101, 106.7938, -15323.17, -10.86107, -5.284752E-07, 2}, LiqCp = {16, 180650, -180.95, 12.547, 0.0020505, -0.0000018444}, HOV = {106, 1.282157E+08, 0.159236, 1.504015, -1.941373, 0.658104}, VapCp = {16, 122630, -416.14, 13.02, 0.00050957, -2.1012E-07}, LiqVis = {101, -702.8128, 30403.47, 106.7279, -0.000116388, 2}, VapVis = {102, 7.6872E-08, 0.801, 119.91, 0.29361, 0}, LiqK = {16, -0.11138, -134.47, -0.46393, -0.00084854, -4.1141E-07}, VapK = {102, 0.00016749, 0.91863, 699.93, 16777, 0}, Racketparam = 0, UniquacR = 8.1269, UniquacQ = 7.440001, ChaoSeadAF = 0.930639, ChaoSeadSP = 23571.8, ChaoSeadLV = 0.173363); +end Tetraethyleneglycol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Tetrahydrofuran.mo b/Simulator/Simulator/Files/Chemsep_Database/Tetrahydrofuran.mo new file mode 100644 index 0000000..635ba15 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Tetrahydrofuran.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Tetrahydrofuran + extends General_Properties(SN = 84, name = "Tetrahydrofuran", CAS = "109-99-9", Tc = 540.2, Pc = 5190000, Vc = 0.224, Cc = 0.259, Tb = 339.12, Tm = 164.65, TT = 164.65, TP = 0.195542, MW = 72.107, LVB = 0.08171, AF = 0.225, SP = 18970, DM = 5.44E-30, SH = -17100000.0, IGHF = -1.8418E+08, GEF = -7.969E+07, AS = 297290, HFMP = 8540000, HOC = -2.325E+09, LiqDen = {105, 1.054, 0.25754, 540.2, 0.26776, 0}, VP = {101, 82.74347, -6236.553, -9.221137, 0.0000078089, 2}, LiqCp = {16, 83351, 774.14, 0.38273, 0.036255, -0.00003559}, HOV = {106, 4.770629E+07, 0.8303, -0.617577, -0.253996, 0.501899}, VapCp = {16, 41616, -744.85, 13.048, -0.00029616, 7.4486E-08}, LiqVis = {101, -10.047, 896.61, -0.11864, 2.5625E-07, 2}, VapVis = {102, 3.3286E-07, 0.67758, 342.35, -15667, 0}, LiqK = {16, -0.22085, 9.5971, -0.99496, -0.00017415, -6.4958E-07}, VapK = {102, 0.000010439, 1.4482, 729.36, -9829.3, 0}, Racketparam = 0.259, UniquacR = 2.94, UniquacQ = 2.4, ChaoSeadAF = 0.225, ChaoSeadSP = 19042.3, ChaoSeadLV = 0.0819417); +end Tetrahydrofuran; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Thiophene.mo b/Simulator/Simulator/Files/Chemsep_Database/Thiophene.mo new file mode 100644 index 0000000..1157969 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Thiophene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Thiophene + extends General_Properties(SN = 72, name = "Thiophene", CAS = "110-02-1", Tc = 580, Pc = 5660000, Vc = 0.219, Cc = 0.252, Tb = 357.31, Tm = 234.94, TT = 234.94, TP = 185.638, MW = 84.142, LVB = 0.07947, AF = 0.186, SP = 20120, DM = 1.8E-30, SH = 304600000.0, IGHF = 1.1544E+08, GEF = 1.267E+08, AS = 278400, HFMP = 5085600, HOC = -2.4352E+09, LiqDen = {105, 0.73395, 0.21494, 580, 0.2288, 0}, VP = {101, 88.26733, -6809.188, -9.975872, 0.0000074967, 2}, LiqCp = {16, 84631, -77.085, 9.4174, 0.0060386, -0.0000042543}, HOV = {106, 4.87E+07, 0.35468, 0.57965, -0.92941, 0.39593}, VapCp = {16, 31580, -546.03, 12.548, -0.00032144, 9.6227E-08}, LiqVis = {101, -15.561, 1306.6, 0.66009, 3.2071E-07, 2}, VapVis = {102, 0.0000010722, 0.54275, 557.27, 2874.5, 0}, LiqK = {16, 0.024119, -20.319, -1.5338, -0.0014869, -6.6677E-07}, VapK = {102, 0.00013168, 0.98328, 649.4, -5290.1, 0}, Racketparam = 0.274238, UniquacR = 2.8569, UniquacQ = 2.14, ChaoSeadAF = 0.192846, ChaoSeadSP = 20219.8, ChaoSeadLV = 0.0794773); +end Thiophene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/ThreeFivedinitrotoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/ThreeFivedinitrotoluene.mo new file mode 100644 index 0000000..10acdb9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/ThreeFivedinitrotoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model ThreeFivedinitrotoluene + extends General_Properties(SN = 391, name = "ThreeFivedinitrotoluene", CAS = "618-85-9", Tc = 800, Pc = 2150000, Vc = 0.487, Cc = 0.238, Tb = 588, Tm = 366.15, TT = 365.65, TP = 35.4684, MW = 182.134, LVB = 0.140577, AF = 0.702302, SP = 21440, DM = 1.44E-29, SH = -22600000.0, IGHF = 2.71E+07, GEF = 2.34E+08, AS = 414000, HFMP = 2.29E+07, HOC = -3.437E+09, LiqDen = {105, 0.45727, 0.227, 814.01, 0.27155, 0}, VP = {101, 63.61855, -10355.64, -5.423477, 2.374318E-07, 2}, LiqCp = {16, 211860, -5.3058, 8.1208, 0.009225, -0.0000034389}, HOV = {106, 5.989509E+07, -0.991558, 3.414071, -4.448985, 2.238465}, VapCp = {16, 94512, -582.56, 13.27, -0.00026587, 5.3735E-08}, LiqVis = {101, -0.25652, 2097.7, -2.0147, 0.0000014987, 2}, VapVis = {102, 4.7633E-08, 0.90246, 116.57, -8469.6, 0}, LiqK = {16, -0.029795, -134.57, -0.63203, -0.0021751, 3.0388E-07}, VapK = {102, 0.00014433, 0.92815, 684.42, 24021, 0}, Racketparam = 0.238, UniquacR = 5.7, UniquacQ = 4.376, ChaoSeadAF = 0.702302, ChaoSeadSP = 21440, ChaoSeadLV = 0.140577); +end ThreeFivedinitrotoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/ThreeFourdimethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/ThreeFourdimethylhexane.mo new file mode 100644 index 0000000..fc8fc63 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/ThreeFourdimethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model ThreeFourdimethylhexane + extends General_Properties(SN = 235, name = "ThreeFourdimethylhexane", CAS = "583-48-2", Tc = 568.8, Pc = 2690000, Vc = 0.4588, Cc = 0.265, Tb = 390.88, Tm = 0, TT = 0, TP = 0, MW = 114.231, LVB = 0.15973, AF = 0.338, SP = 15140, DM = 0, SH = -1209000000.0, IGHF = -2.13007E+08, GEF = 1.674E+07, AS = 451580, HFMP = 0, HOC = -5.07251E+09, LiqDen = {105, 0.45439, 0.24011, 568.8, 0.23618, 0}, VP = {101, 93.68625, -7521.509, -10.73445, 7.52569E-06, 2}, LiqCp = {16, -327870, 47.226, 12.229, 0.0041484, -0.000004128}, HOV = {106, 5.4702E+07, 0.45918, 0.1856, -0.51513, 0.26338}, VapCp = {16, 34075, -331.34, 12.881, 0.00054108, -1.7153E-07}, LiqVis = {101, -41.742, 2125.1, 4.8163, -0.0000056466, 2}, VapVis = {102, 6.4152E-07, 0.51789, 310.46, 157.69, 0}, LiqK = {16, -0.0004002, -144.47, -0.57247, -0.0042745, 0.0000010836}, VapK = {102, 0.000020807, 1.2133, -200.76, 152640, 0}, Racketparam = 0.265, UniquacR = 5.847, UniquacQ = 4.928, ChaoSeadAF = 0.338, ChaoSeadSP = 15140, ChaoSeadLV = 0.15973); +end ThreeFourdimethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/ThreeFourdinitrotoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/ThreeFourdinitrotoluene.mo new file mode 100644 index 0000000..6a321b0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/ThreeFourdinitrotoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model ThreeFourdinitrotoluene + extends General_Properties(SN = 389, name = "ThreeFourdinitrotoluene", CAS = "610-39-9", Tc = 842, Pc = 3400000, Vc = 0.487, Cc = 0.237, Tb = 610, Tm = 331.45, TT = 331.45, TP = 2.66366, MW = 182.134, LVB = 0.139231, AF = 0.709209, SP = 21410, DM = 2.13E-29, SH = -22600000.0, IGHF = 3.58E+07, GEF = 2.59E+08, AS = 414000, HFMP = 2.08E+07, HOC = -3.466E+09, LiqDen = {105, 0.48567, 0.23619, 842, 0.28583, 0}, VP = {101, 62.33838, -11025.98, -5.109566, 1.997931E-07, 2}, LiqCp = {16, 144440, 677.88, 6.2554, 0.011911, -0.000005235}, HOV = {106, 6.888359E+07, -1.153409, 5.750305, -8.495374, 4.124815}, VapCp = {16, 94512, -582.56, 13.27, -0.00026587, 5.3735E-08}, LiqVis = {101, -13.817, 2734.2, 0.029663, -2.4471E-08, 2}, VapVis = {102, 2.8655E-08, 0.96106, 104.06, -10189, 0}, LiqK = {16, -0.082395, -25.284, -1.0996, -0.00075328, -2.6136E-07}, VapK = {102, 0.0001043, 0.96342, 702.61, 22699, 0}, Racketparam = 0.237, UniquacR = 5.7, UniquacQ = 4.376, ChaoSeadAF = 0.709209, ChaoSeadSP = 21410, ChaoSeadLV = 0.139231); +end ThreeFourdinitrotoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/ThreeThreeFivetrimethylheptane.mo b/Simulator/Simulator/Files/Chemsep_Database/ThreeThreeFivetrimethylheptane.mo new file mode 100644 index 0000000..33c327d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/ThreeThreeFivetrimethylheptane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model ThreeThreeFivetrimethylheptane + extends General_Properties(SN = 251, name = "ThreeThreeFivetrimethylheptane", CAS = "7154-80-5", Tc = 609.6, Pc = 2320000, Vc = 0.564, Cc = 0.258, Tb = 428.83, Tm = 165, TT = 165, TP = 0.0000151957, MW = 142.285, LVB = 0.19248, AF = 0.383, SP = 15010, DM = 0, SH = -1209000000.0, IGHF = -2.588E+08, GEF = 3.23E+07, AS = 513420, HFMP = 1.4E+07, HOC = -6.2911E+09, LiqDen = {105, 0.32798, 0.22465, 609.6, 0.2413, 0}, VP = {101, 165.0702, -10873.83, -21.67781, 0.0000174271, 2}, LiqCp = {16, 181900, 88.778, 8.7398, 0.011239, -0.0000078705}, HOV = {106, 5.692041E+07, -0.369689, 2.788348, -3.430471, 1.37842}, VapCp = {16, 93450, -461.09, 13.294, 0.00031582, -1.0309E-07}, LiqVis = {101, -7.8795, 1294.8, -0.60549, -4.2086E-07, 2}, VapVis = {102, 5.7085E-07, 0.52829, 329.98, -4470.2, 0}, LiqK = {16, 0.0037809, -39.052, -1.5072, -0.0019367, -8.6862E-07}, VapK = {102, 0.000042493, 1.1211, -89.298, 167970, 0}, Racketparam = 0.258, UniquacR = 7.1951, UniquacQ = 6.088, ChaoSeadAF = 0.383, ChaoSeadSP = 15010, ChaoSeadLV = 0.19248); +end ThreeThreeFivetrimethylheptane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/ThreeThreediethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/ThreeThreediethylpentane.mo new file mode 100644 index 0000000..e9e2cb1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/ThreeThreediethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model ThreeThreediethylpentane + extends General_Properties(SN = 241, name = "ThreeThreediethylpentane", CAS = "1067-20-5", Tc = 610.05, Pc = 2674980, Vc = 0.473, Cc = 0.249, Tb = 419.34, Tm = 240.12, TT = 240.12, TP = 13.7918, MW = 128.255, LVB = 0.171012, AF = 0.3379, SP = 15220, DM = 0, SH = -1209000000.0, IGHF = -2.31835E+08, GEF = 4.17E+07, AS = 436500, HFMP = 9800000, HOC = -5.68438E+09, LiqDen = {105, 0.61216, 0.28967, 610.05, 0.29325, 0}, VP = {101, 143.8917, -9842.666, -18.51396, 0.000016514, 2}, LiqCp = {16, 167890, 37.678, 8.6605, 0.012988, -0.000011813}, HOV = {106, 5.0222E+07, -0.028455, 0.90984, -0.78409, 0.24027}, VapCp = {16, 120540, -563.25, 13.32, 0.00012473, -3.6626E-08}, LiqVis = {101, -12.975, 1131.8, 0.25767, -3.4761E-07, 2}, VapVis = {102, 3.6575E-07, 0.57536, 184.44, 2017.7, 0}, LiqK = {16, -0.021495, -29.993, -1.4603, -0.0013716, -7.6272E-07}, VapK = {102, 0.000069723, 1.0959, 342.29, 74930, 0}, Racketparam = 0.249, UniquacR = 6.5215, UniquacQ = 5.552, ChaoSeadAF = 0.3379, ChaoSeadSP = 15220, ChaoSeadLV = 0.171012); +end ThreeThreediethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/ThreeThreedimethylTwobutanone.mo b/Simulator/Simulator/Files/Chemsep_Database/ThreeThreedimethylTwobutanone.mo new file mode 100644 index 0000000..90144f2 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/ThreeThreedimethylTwobutanone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model ThreeThreedimethylTwobutanone + extends General_Properties(SN = 315, name = "ThreeThreedimethylTwobutanone", CAS = "75-97-8", Tc = 567, Pc = 3470000, Vc = 0.368, Cc = 0.261, Tb = 379.45, Tm = 221.15, TT = 221.15, TP = 14.4334, MW = 100.159, LVB = 0.124869, AF = 0.327309, SP = 16920, DM = 9.37E-30, SH = -1209000000.0, IGHF = -2.905E+08, GEF = -1.307E+08, AS = 384400, HFMP = 1.133E+07, HOC = -3.4837E+09, LiqDen = {105, 0.050005, 0.070782, 567, 0.11676, 0}, VP = {101, 93.48771, -7385.263, -10.71444, 7.878115E-06, 2}, LiqCp = {16, 154180, 195.77, 7.7152, 0.0092036, -0.0000029177}, HOV = {106, 5.0163E+07, 0.36416, -0.10654, 0.27936, -0.16414}, VapCp = {16, 104260, -866.95, 13.572, -0.00063607, 2.0716E-07}, LiqVis = {101, -19.254, 1373.2, 1.3346, -0.0000032641, 2}, VapVis = {102, 1.8869E-07, 0.70026, 190.78, -6542.3, 0}, LiqK = {16, -0.15399, 9.8963, -1.0886, -0.00030883, -9.2007E-07}, VapK = {102, 1744.4, 1.0305, 1.6872E+10, -1.3896E+11, 0}, Racketparam = 0.261, UniquacR = 4.5952, UniquacQ = 4.032, ChaoSeadAF = 0.327309, ChaoSeadSP = 16920, ChaoSeadLV = 0.124869); +end ThreeThreedimethylTwobutanone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/ThreeThreedimethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/ThreeThreedimethylhexane.mo new file mode 100644 index 0000000..d1a67fc --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/ThreeThreedimethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model ThreeThreedimethylhexane + extends General_Properties(SN = 234, name = "ThreeThreedimethylhexane", CAS = "563-16-6", Tc = 562, Pc = 2650000, Vc = 0.4428, Cc = 0.251, Tb = 385.12, Tm = 147.05, TT = 147.05, TP = 0.0000473645, MW = 114.231, LVB = 0.16181, AF = 0.32, SP = 14880, DM = 0, SH = -1209000000.0, IGHF = -2.2012E+08, GEF = 1.32633E+07, AS = 438230, HFMP = 7112800, HOC = -5.06682E+09, LiqDen = {105, 0.45959, 0.24567, 562, 0.21162, 0}, VP = {101, 109.95, -8119.3, -13.232, 0.0000097251, 2}, LiqCp = {16, 130950, -54.41, 9.7102, 0.0098373, -0.0000089507}, HOV = {106, 5.8755E+07, 0.81257, -0.27217, -0.51422, 0.40803}, VapCp = {16, 73854, -426.62, 12.974, 0.00044554, -1.4645E-07}, LiqVis = {101, -7.0202, 924.42, -0.69061, 0.0000021821, 2}, VapVis = {102, 1.9286E-07, 0.65784, 75.166, 8686.9, 0}, LiqK = {16, -0.074777, 3.6654, -1.4953, -0.00045709, -0.000001113}, VapK = {102, 0.000028072, 1.1786, -168.43, 151580, 0}, Racketparam = 0.251, UniquacR = 5.8471, UniquacQ = 5.012, ChaoSeadAF = 0.32, ChaoSeadSP = 14880, ChaoSeadLV = 0.16181); +end ThreeThreedimethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/ThreeThreedimethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/ThreeThreedimethylpentane.mo new file mode 100644 index 0000000..898ec24 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/ThreeThreedimethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model ThreeThreedimethylpentane + extends General_Properties(SN = 224, name = "ThreeThreedimethylpentane", CAS = "562-49-2", Tc = 536.3, Pc = 2950000, Vc = 0.4141, Cc = 0.274, Tb = 359.19, Tm = 138.7, TT = 138.7, TP = 0.000229687, MW = 100.204, LVB = 0.1454, AF = 0.269, SP = 14530, DM = 0, SH = -1209000000.0, IGHF = -2.0146E+08, GEF = 2719600, AS = 398150, HFMP = 7066780, HOC = -4.45458E+09, LiqDen = {105, 0.57981, 0.25238, 536.41, 0.28345, 0}, VP = {101, 74.58125, -6059.883, -7.986446, 6.250113E-06, 2}, LiqCp = {16, 122500, 86.779, 8.7861, 0.0099608, -0.0000069264}, HOV = {106, 5.254E+07, 1.1834, -1.8011, 1.5275, -0.48856}, VapCp = {16, 67595, -428.94, 12.79, 0.00052141, -1.6453E-07}, LiqVis = {101, -7.1051, 998.94, -0.73694, 0.0000026961, 2}, VapVis = {102, 9.3561E-07, 0.48169, 385.32, 9.0702, 0}, LiqK = {16, -0.050708, 3.465, -1.5874, -0.00046821, -0.000001622}, VapK = {102, 0.000069501, 1.0643, -68.32, 160740, 0}, Racketparam = 0.274, UniquacR = 5.1727, UniquacQ = 4.472, ChaoSeadAF = 0.269, ChaoSeadSP = 14530, ChaoSeadLV = 0.1454); +end ThreeThreedimethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threeethylheptane.mo b/Simulator/Simulator/Files/Chemsep_Database/Threeethylheptane.mo new file mode 100644 index 0000000..28f58b9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threeethylheptane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threeethylheptane + extends General_Properties(SN = 249, name = "Threeethylheptane", CAS = "15869-80-4", Tc = 594.3, Pc = 2430000, Vc = 0.5213, Cc = 0.257, Tb = 416.35, Tm = 158.25, TT = 158.25, TP = 0.0000277743, MW = 128.255, LVB = 0.177515, AF = 0.407991, SP = 15300, DM = 0, SH = -1209000000.0, IGHF = -2.3146E+08, GEF = 2.494E+07, AS = 497400, HFMP = 1.6E+07, HOC = -5.6838E+09, LiqDen = {105, 0.38578, 0.23273, 594.3, 0.25158, 0}, VP = {101, 103.6653, -8269.445, -12.32292, 0.000012256, 2}, LiqCp = {16, 29546, -3.2521, 11.386, 0.0045932, -0.0000035582}, HOV = {106, 6.3311E+07, 1.0505, -1.9581, 2.2955, -0.98973}, VapCp = {16, 137360, -689.88, 13.586, -0.00018791, 5.2355E-08}, LiqVis = {101, -11.279, 1149.8, -0.019903, 1.7111E-07, 2}, VapVis = {102, 0.0000007497, 0.48637, 340.94, -2876.9, 0}, LiqK = {16, -0.038271, 3.4169, -1.6847, -0.00052626, -0.0000013295}, VapK = {102, 0.000030963, 1.1527, -150.17, 156710, 0}, Racketparam = 0.257, UniquacR = 6.5222, UniquacQ = 5.472, ChaoSeadAF = 0.407991, ChaoSeadSP = 15300, ChaoSeadLV = 0.177515); +end Threeethylheptane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threeethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/Threeethylhexane.mo new file mode 100644 index 0000000..27caeae --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threeethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threeethylhexane + extends General_Properties(SN = 229, name = "Threeethylhexane", CAS = "619-99-8", Tc = 565.4, Pc = 2610000, Vc = 0.4605, Cc = 0.253, Tb = 391.69, Tm = 0, TT = 0, TP = 0, MW = 114.231, LVB = 0.16101, AF = 0.362, SP = 15210, DM = 0, SH = -1209000000.0, IGHF = -2.10874E+08, GEF = 1.68615E+07, AS = 457860, HFMP = 0, HOC = -5.07398E+09, LiqDen = {105, 0.46206, 0.24436, 565.51, 0.22747, 0}, VP = {101, 97.09596, -7733.566, -11.22583, 7.810756E-06, 2}, LiqCp = {16, 80628, -64.909, 11.186, 0.0048319, -0.0000040172}, HOV = {106, 5.4799E+07, 0.26737, 0.81877, -1.2904, 0.59915}, VapCp = {16, 115160, -618.28, 13.279, 0.0000464, -2.6202E-08}, LiqVis = {101, -7.8742, 897.68, -0.5066, 2.0784E-08, 2}, VapVis = {102, 3.7627E-07, 0.57415, 196.9, -172.94, 0}, LiqK = {16, -0.001637, -138.28, -0.62782, -0.0040963, 8.9774E-07}, VapK = {102, 0.000056588, 1.0789, -123.05, 173090, 0}, Racketparam = 0.253, UniquacR = 5.8478, UniquacQ = 4.932, ChaoSeadAF = 0.362, ChaoSeadSP = 15210, ChaoSeadLV = 0.16101); +end Threeethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threeethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Threeethylpentane.mo new file mode 100644 index 0000000..e2dc5cd --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threeethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threeethylpentane + extends General_Properties(SN = 220, name = "Threeethylpentane", CAS = "617-78-7", Tc = 540.5, Pc = 2890000, Vc = 0.4158, Cc = 0.267, Tb = 366.63, Tm = 154.55, TT = 154.55, TP = 0.00170947, MW = 100.204, LVB = 0.1444, AF = 0.311, SP = 15040, DM = 0, SH = -1209000000.0, IGHF = -1.89661E+08, GEF = 1.09202E+07, AS = 411540, HFMP = 9547890, HOC = -4.4642E+09, LiqDen = {105, 0.56112, 0.24813, 540.61, 0.27074, 0}, VP = {101, 89.99315, -6915.896, -10.27777, 8.039283E-06, 2}, LiqCp = {16, 152590, 204.56, 5.9318, 0.021701, -0.000022224}, HOV = {106, 5.3257E+07, 1.2647, -2.6729, 3.1124, -1.3109}, VapCp = {16, 102980, -630.04, 13.15, 0.000058616, -2.6799E-08}, LiqVis = {101, -11.885, 1001.1, 0.10351, -0.0000003544, 2}, VapVis = {102, 6.1521E-07, 0.52741, 287.77, 1840.5, 0}, LiqK = {16, -0.055574, 4.7874, -1.5746, -0.0003945, -0.0000016303}, VapK = {102, 0.000065519, 1.0691, -74.423, 161360, 0}, Racketparam = 0.267, UniquacR = 5.1734, UniquacQ = 4.392, ChaoSeadAF = 0.311, ChaoSeadSP = 15040, ChaoSeadLV = 0.1444); +end Threeethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threeheptanone.mo b/Simulator/Simulator/Files/Chemsep_Database/Threeheptanone.mo new file mode 100644 index 0000000..d607954 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threeheptanone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threeheptanone + extends General_Properties(SN = 308, name = "Threeheptanone", CAS = "106-35-4", Tc = 605, Pc = 3010000, Vc = 0.421, Cc = 0.251, Tb = 420.55, Tm = 234.15, TT = 234.15, TP = 2.29921, MW = 114.185, LVB = 0.140257, AF = 0.407565, SP = 17940, DM = 9.37E-30, SH = -1209000000.0, IGHF = -3.01E+08, GEF = -1.196E+08, AS = 448500, HFMP = 1.81E+07, HOC = -4.098E+09, LiqDen = {105, 0.65544, 0.26958, 605, 0.29059, 0}, VP = {101, 59.93996, -7156.968, -5.201278, 1.288938E-07, 2}, LiqCp = {16, 215140, 447.78, 3.9106, 0.020539, -0.000013511}, HOV = {106, 6.726896E+07, 0.830475, -1.256385, 1.592723, -0.756362}, VapCp = {16, 122140, -668.77, 13.117, -0.0000064986, -3.4969E-08}, LiqVis = {101, -11.982, 1284.2, 0.095491, -8.1894E-07, 2}, VapVis = {102, 1.4757E-07, 0.71999, 184.44, -6805, 0}, LiqK = {16, -0.025728, -61.893, -0.97852, -0.0021604, 1.2683E-07}, VapK = {102, 1201.8, 1.0398, 1.4113E+10, -9.6162E+10, 0}, Racketparam = 0.251, UniquacR = 5.2711, UniquacQ = 4.496, ChaoSeadAF = 0.407565, ChaoSeadSP = 17940, ChaoSeadLV = 0.140257); +end Threeheptanone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threehexanone.mo b/Simulator/Simulator/Files/Chemsep_Database/Threehexanone.mo new file mode 100644 index 0000000..07a5b08 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threehexanone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threehexanone + extends General_Properties(SN = 310, name = "Threehexanone", CAS = "589-38-8", Tc = 582.8, Pc = 3320000, Vc = 0.378, Cc = 0.256, Tb = 396.65, Tm = 215, TT = 217.5, TP = 2.22016, MW = 100.161, LVB = 0.12343, AF = 0.38, SP = 17930, DM = 9.57E-30, SH = -1209000000.0, IGHF = -2.777E+08, GEF = -1.253E+08, AS = 409200, HFMP = 1.11E+07, HOC = -3.492E+09, LiqDen = {105, 0.60844, 0.24303, 582.83, 0.26177, 0}, VP = {101, 109.4591, -8520.55, -13.01531, 9.019631E-06, 2}, LiqCp = {16, 185400, 578.77, 3.0261, 0.02276, -0.000015777}, HOV = {106, 5.134266E+07, -0.294625, 1.94188, -1.96318, 0.653572}, VapCp = {16, 108160, -675.23, 12.973, -0.000036372, -1.5789E-08}, LiqVis = {101, -3.119, 957.18, -1.3764, 0.0000033013, 2}, VapVis = {102, 1.7969E-07, 0.70065, 200.48, -7668.6, 0}, LiqK = {16, 0.0083801, 80.808, -2.2377, 0.00083175, -0.0000033028}, VapK = {102, -0.24291, 0.11759, -2306.6, -3681900, 0}, Racketparam = 0.256, UniquacR = 4.5967, UniquacQ = 3.956, ChaoSeadAF = 0.38, ChaoSeadSP = 17930, ChaoSeadLV = 0.12343); +end Threehexanone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/ThreemethylOnebutene.mo b/Simulator/Simulator/Files/Chemsep_Database/ThreemethylOnebutene.mo new file mode 100644 index 0000000..2ceecea --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/ThreemethylOnebutene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model ThreemethylOnebutene + extends General_Properties(SN = 106, name = "ThreemethylOnebutene", CAS = "563-45-1", Tc = 452.7, Pc = 3550000, Vc = 0.3049, Cc = 0.288, Tb = 293.21, Tm = 104.66, TT = 104.66, TP = 0.0000144678, MW = 70.134, LVB = 0.11277, AF = 0.211, SP = 13780, DM = 1.07E-30, SH = -27600000.0, IGHF = -2.76E+07, GEF = 7.605E+07, AS = 333900, HFMP = 5359700, HOC = -3.1253E+09, LiqDen = {105, 0.85968, 0.26229, 452.7, 0.27579, 0}, VP = {101, 74.66163, -4956.256, -8.290047, 0.0000100425, 2}, LiqCp = {16, 94996, 92.422, 8.4061, 0.009093, -0.0000045826}, HOV = {106, 3.9174E+07, 0.58094, 0.12579, -0.78785, 0.49354}, VapCp = {16, 82557, -671.08, 12.784, -0.00012458, 4.234E-08}, LiqVis = {101, -11.214, 821.55, -0.010133, 9.4673E-08, 2}, VapVis = {102, 0.0000016555, 0.42535, 455.3, 876.91, 0}, LiqK = {16, -0.017622, 5.9209, -1.694, -0.00045405, -0.0000033564}, VapK = {102, 0.00014816, 0.97375, 75.281, 116540, 0}, Racketparam = 0.272045, UniquacR = 3.5945, UniquacQ = 3.1, ChaoSeadAF = 0.2285, ChaoSeadSP = 14010.2, ChaoSeadLV = 0.111819); +end ThreemethylOnebutene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/ThreemethylThreeethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/ThreemethylThreeethylpentane.mo new file mode 100644 index 0000000..fd32182 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/ThreemethylThreeethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model ThreemethylThreeethylpentane + extends General_Properties(SN = 237, name = "ThreemethylThreeethylpentane", CAS = "1067-08-9", Tc = 576.5, Pc = 2810000, Vc = 0.4551, Cc = 0.267, Tb = 391.42, Tm = 182.28, TT = 182.28, TP = 0.0625263, MW = 114.231, LVB = 0.15788, AF = 0.305, SP = 15060, DM = 0, SH = -1209000000.0, IGHF = -2.1485E+08, GEF = 2.288E+07, AS = 432960, HFMP = 1.08E+07, HOC = -5.0716E+09, LiqDen = {105, 0.59884, 0.27253, 576.5, 0.28169, 0}, VP = {101, 85.77668, -7097.92, -9.572218, 6.70781E-06, 2}, LiqCp = {16, 77769, 172.95, 9.182, 0.01021, -0.0000086615}, HOV = {106, 6.3775E+07, 1.5194, -2.4569, 2.0687, -0.69375}, VapCp = {16, 89715, -509.11, 13.135, 0.00024858, -7.767E-08}, LiqVis = {101, -18.59, 1270.3, 1.2467, -0.0000036226, 2}, VapVis = {102, 7.5822E-07, 0.50218, 361.22, -3635.6, 0}, LiqK = {16, -0.037427, 7.7785, -1.7161, -0.00028317, -0.0000017728}, VapK = {102, 0.000021773, 1.2197, -136.64, 138470, 0}, Racketparam = 0.267, UniquacR = 5.8471, UniquacQ = 5.012, ChaoSeadAF = 0.305, ChaoSeadSP = 15060, ChaoSeadLV = 0.15788); +end ThreemethylThreeethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threemethylheptane.mo b/Simulator/Simulator/Files/Chemsep_Database/Threemethylheptane.mo new file mode 100644 index 0000000..1fd2c5a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threemethylheptane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threemethylheptane + extends General_Properties(SN = 227, name = "Threemethylheptane", CAS = "589-81-1", Tc = 563.6, Pc = 2550000, Vc = 0.4711, Cc = 0.253, Tb = 392.08, Tm = 152.65, TT = 152.6, TP = 0.0000523002, MW = 114.231, LVB = 0.16278, AF = 0.371, SP = 15180, DM = 0, SH = -1209000000.0, IGHF = -2.1251E+08, GEF = 1.275E+07, AS = 465510, HFMP = 1.163E+07, HOC = -5.0721E+09, LiqDen = {105, 0.48768, 0.25064, 563.66, 0.24544, 0}, VP = {101, 94.76732, -7652.539, -10.86325, 7.450521E-06, 2}, LiqCp = {16, 137930, 50.329, 9.9028, 0.0059467, -0.0000024618}, HOV = {106, 6.899021E+07, 1.39863, -1.771662, 1.093723, -0.270846}, VapCp = {16, 103080, -583.42, 13.271, 0.000052348, -2.126E-08}, LiqVis = {101, -7.3817, 976.23, -0.66335, 0.0000021183, 2}, VapVis = {102, 0.0000069865, 0.21161, 854.03, -2592.5, 0}, LiqK = {16, -0.043161, 22.706, -1.6829, -0.000063735, -0.0000020484}, VapK = {102, 0.000042535, 1.1138, -151.71, 168420, 0}, Racketparam = 0.253, UniquacR = 5.8478, UniquacQ = 4.932, ChaoSeadAF = 0.371, ChaoSeadSP = 15180, ChaoSeadLV = 0.16278); +end Threemethylheptane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threemethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/Threemethylhexane.mo new file mode 100644 index 0000000..c29d2e9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threemethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threemethylhexane + extends General_Properties(SN = 219, name = "Threemethylhexane", CAS = "589-34-4", Tc = 535.2, Pc = 2810000, Vc = 0.404, Cc = 0.255, Tb = 365, Tm = 153.75, TT = 153.75, TP = 0.00321303, MW = 100.204, LVB = 0.14674, AF = 0.323, SP = 14950, DM = 0, SH = -1209000000.0, IGHF = -1.9133E+08, GEF = 5080000, AS = 425930, HFMP = 9460000, HOC = -4.46177E+09, LiqDen = {105, 0.53784, 0.24926, 535.2, 0.22945, 0}, VP = {101, 86.76736, -6773.074, -9.77749, 7.535909E-06, 2}, LiqCp = {16, 151720, 437.07, 3.0907, 0.032504, -0.000034822}, HOV = {106, 5.817768E+07, 1.085699, -1.05321, 0.37877, 0.0254378}, VapCp = {16, 80171, -511.41, 12.979, 0.00025345, -8.5984E-08}, LiqVis = {101, -11.794, 999.53, 0.086997, -2.3727E-07, 2}, VapVis = {102, 4.5226E-07, 0.55481, 210.53, 14.061, 0}, LiqK = {16, -0.14432, 11.474, -1.2132, -0.00022172, -0.0000010949}, VapK = {102, 0.000041038, 1.1288, -121.44, 150080, 0}, Racketparam = 0.255, UniquacR = 5.1734, UniquacQ = 4.392, ChaoSeadAF = 0.323, ChaoSeadSP = 14950, ChaoSeadLV = 0.14674); +end Threemethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threemethylnonane.mo b/Simulator/Simulator/Files/Chemsep_Database/Threemethylnonane.mo new file mode 100644 index 0000000..5fb1415 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threemethylnonane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threemethylnonane + extends General_Properties(SN = 253, name = "Threemethylnonane", CAS = "5911-04-6", Tc = 613.7, Pc = 2140000, Vc = 0.5904, Cc = 0.247, Tb = 440.95, Tm = 188.35, TT = 188.35, TP = 0.000565366, MW = 142.282, LVB = 0.195076, AF = 0.464925, SP = 15470, DM = 0, SH = -1209000000.0, IGHF = -2.544E+08, GEF = 2.88E+07, AS = 543900, HFMP = 1.88E+07, HOC = -6.291E+09, LiqDen = {105, 0.19012, 0.17319, 613.7, 0.19349, 0}, VP = {101, 90.738, -8476.8, -10.023, 0.0000053448, 2}, LiqCp = {16, 78506, 74.892, 11.023, 0.0040568, -0.0000015927}, HOV = {106, 8.354164E+07, 1.024481, -0.0908156, -1.228122, 0.762381}, VapCp = {16, 133050, -599.42, 13.53, -0.000017353, -3.363E-09}, LiqVis = {101, -12.922, 1267.3, 0.28159, -8.3807E-07, 2}, VapVis = {102, 6.1879E-07, 0.49638, 289.26, -877.62, 0}, LiqK = {16, -0.1781, 10.557, -1.078, -0.00023148, -6.8221E-07}, VapK = {102, 0.000033407, 1.1338, -162.76, 171650, 0}, Racketparam = 0.247, UniquacR = 7.196599, UniquacQ = 6.012, ChaoSeadAF = 0.464925, ChaoSeadSP = 15470, ChaoSeadLV = 0.195076); +end Threemethylnonane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threemethyloctane.mo b/Simulator/Simulator/Files/Chemsep_Database/Threemethyloctane.mo new file mode 100644 index 0000000..341e7d1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threemethyloctane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threemethyloctane + extends General_Properties(SN = 247, name = "Threemethyloctane", CAS = "2216-33-3", Tc = 590.15, Pc = 2340000, Vc = 0.529, Cc = 0.252, Tb = 417.38, Tm = 165.55, TT = 165.55, TP = 0.0000898613, MW = 128.255, LVB = 0.178944, AF = 0.412346, SP = 15380, DM = 0, SH = -1209000000.0, IGHF = -2.336E+08, GEF = 2.17E+07, AS = 501660, HFMP = 1.7E+07, HOC = -5.68128E+09, LiqDen = {105, 0.4999, 0.26438, 590.15, 0.29155, 0}, VP = {101, 169.345, -11170.36, -22.26865, 0.0000190112, 2}, LiqCp = {16, 39163, 25.328, 11.626, 0.0021572, 2.6369E-07}, HOV = {106, 6.3378E+07, 0.67667, -0.53996, 0.45608, -0.18958}, VapCp = {16, 118620, -596.81, 13.418, 0.0000088283, -1.2271E-08}, LiqVis = {101, -11.252, 1147.6, -0.021999, 4.3706E-08, 2}, VapVis = {102, 4.9482E-07, 0.53152, 245.99, 4.1109, 0}, LiqK = {16, -0.1642, 10.91, -1.1265, -0.00023366, -7.9637E-07}, VapK = {102, 0.000040968, 1.1096, -178.72, 180220, 0}, Racketparam = 0.252, UniquacR = 6.5222, UniquacQ = 5.472, ChaoSeadAF = 0.412346, ChaoSeadSP = 15380, ChaoSeadLV = 0.178944); +end Threemethyloctane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threemethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Threemethylpentane.mo new file mode 100644 index 0000000..06919e6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threemethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threemethylpentane + extends General_Properties(SN = 137, name = "Threemethylpentane", CAS = "96-14-0", Tc = 504.4, Pc = 3120000, Vc = 0.3667, Cc = 0.273, Tb = 336.4, Tm = 110.251, TT = 110.25, TP = 4.13745E-07, MW = 86.177, LVB = 0.13062, AF = 0.273, SP = 14680, DM = 0, SH = -168070000.0, IGHF = -1.72E+08, GEF = -3420000, AS = 383000, HFMP = 5303200, HOC = -3.85137E+09, LiqDen = {105, 0.64191, 0.2518, 504.61, 0.25114, 0}, VP = {101, 103.3869, -6792.289, -12.56583, 0.0000127267, 2}, LiqCp = {16, 124870, 37.47, 8.4986, 0.010489, -0.0000074005}, HOV = {106, 5.261039E+07, 1.021512, -0.656827, -0.222599, 0.294618}, VapCp = {16, 66323, -479.35, 12.713, 0.00041058, -1.3725E-07}, LiqVis = {101, -4.4466, 561.39, -0.97496, -4.1525E-07, 2}, VapVis = {102, 0.0000014857, 0.42502, 455.77, 119.73, 0}, LiqK = {16, 0.013685, 32.912, -2.24, 0.00097964, -0.0000056292}, VapK = {102, 0.000050178, 1.1143, -67.556, 138050, 0}, Racketparam = 0.2575, UniquacR = 4.499, UniquacQ = 3.852, ChaoSeadAF = 0.275, ChaoSeadSP = 14871.5, ChaoSeadLV = 0.130633); +end Threemethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Threepentanone.mo b/Simulator/Simulator/Files/Chemsep_Database/Threepentanone.mo new file mode 100644 index 0000000..a11ef5d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Threepentanone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Threepentanone + extends General_Properties(SN = 111, name = "Threepentanone", CAS = "96-22-0", Tc = 561.5, Pc = 3730000, Vc = 0.336, Cc = 0.268, Tb = 375.14, Tm = 234.18, TT = 234.18, TP = 73.4224, MW = 86.134, LVB = 0.10641, AF = 0.342, SP = 18410, DM = 9.41E-30, SH = -27600000.0, IGHF = -2.579E+08, GEF = -1.344E+08, AS = 370000, HFMP = 1.159E+07, HOC = -2.8804E+09, LiqDen = {105, 0.68664, 0.23603, 561.5, 0.27471, 0}, VP = {101, 58.885, -6044.5, -5.3259, 0.0000023057, 2}, LiqCp = {16, 169130, 405.25, 3.0239, 0.024087, -0.000018434}, HOV = {106, 5.083729E+07, 0.764461, -0.828447, -0.00277131, 0.530942}, VapCp = {16, 93124, -637.87, 12.577, 0.00022827, -1.0612E-07}, LiqVis = {101, -1.367, 550.49, -1.4469, 4.9148E-07, 2}, VapVis = {102, 0.0000002611, 0.65778, 216.39, -3537.8, 0}, LiqK = {16, 0.0080662, 16.294, -1.6509, -0.0010676, -9.5001E-07}, VapK = {102, 22.162, 1.0028, 1.8597E+08, 9.2842E+08, 0}, Racketparam = 0, UniquacR = 3.9223, UniquacQ = 3.416, ChaoSeadAF = 0.344, ChaoSeadSP = 18259.5, ChaoSeadLV = 0.106401); +end Threepentanone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Toluene.mo b/Simulator/Simulator/Files/Chemsep_Database/Toluene.mo new file mode 100644 index 0000000..05982a6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Toluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Toluene + extends General_Properties(SN = 140, name = "Toluene", CAS = "108-88-3", Tc = 591.75, Pc = 4108000, Vc = 0.316, Cc = 0.264, Tb = 383.79, Tm = 178.18, TT = 178.18, TP = 0.0475285, MW = 92.141, LVB = 0.10687, AF = 0.264, SP = 18250, DM = 1.2E-30, SH = -168070000.0, IGHF = 5.017E+07, GEF = 1.222E+08, AS = 320990, HFMP = 6636000, HOC = -3.734E+09, LiqDen = {105, 0.89799, 0.27359, 591.75, 0.30006, 0}, VP = {101, 32.89891, -5013.81, -1.348918, -1.869928E-06, 2}, LiqCp = {16, 28291, 48.171, 10.912, 0.0020542, 8.7875E-07}, HOV = {106, 5.3752E+07, 0.50341, 0.24755, -0.72898, 0.37794}, VapCp = {16, 47225, -565.85, 12.856, 0.000005535, -1.998E-08}, LiqVis = {101, -152.84, 5644.6, 22.826, -0.000040987, 2}, VapVis = {102, 8.5581E-07, 0.49514, 307.82, 1891.6, 0}, LiqK = {16, -0.072922, -23.153, -1.0277, -0.0017074, 3.6787E-07}, VapK = {102, 0.000006541, 1.4227, 190.97, 21890, 0}, Racketparam = 0.2646, UniquacR = 3.9228, UniquacQ = 2.968, ChaoSeadAF = 0.2591, ChaoSeadSP = 18245.86, ChaoSeadLV = 0.1068); +end Toluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TransOneFourdimethylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/TransOneFourdimethylcyclohexane.mo new file mode 100644 index 0000000..1e5e4d0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TransOneFourdimethylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TransOneFourdimethylcyclohexane + extends General_Properties(SN = 280, name = "TransOneFourdimethylcyclohexane", CAS = "2207-04-7", Tc = 590.15, Pc = 2940000, Vc = 0.45, Cc = 0.271, Tb = 392.51, Tm = 236.21, TT = 236.21, TP = 44.9802, MW = 112.213, LVB = 0.147921, AF = 0.2429, SP = 15490, DM = 0, SH = -1209000000.0, IGHF = -1.84598E+08, GEF = 3.17147E+07, AS = 364803, HFMP = 1.2332E+07, HOC = -4.86026E+09, LiqDen = {105, 0.064652, 0.087885, 590.15, 0.13093, 0}, VP = {101, 85.56244, -7078.051, -9.547047, 6.602527E-06, 2}, LiqCp = {16, 119770, 186.95, 7.9604, 0.011554, -0.0000069633}, HOV = {106, 5.5648E+07, 0.9536, -1.3747, 1.3927, -0.55606}, VapCp = {16, 97979, -830.68, 13.935, -0.00055238, 1.5056E-07}, LiqVis = {101, -8.7946, 1113.8, -0.41314, 9.8767E-07, 2}, VapVis = {102, 6.6365E-07, 0.52158, 345.67, -1560.6, 0}, LiqK = {16, -0.0015458, -71.843, -1.1073, -0.0027831, 1.5512E-07}, VapK = {102, 0.012496, 0.37939, -0.8405, 811480, 0}, Racketparam = 0.271, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2429, ChaoSeadSP = 15490, ChaoSeadLV = 0.147921); +end TransOneFourdimethylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TransOneThreedimethylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/TransOneThreedimethylcyclohexane.mo new file mode 100644 index 0000000..bba8efd --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TransOneThreedimethylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TransOneThreedimethylcyclohexane + extends General_Properties(SN = 278, name = "TransOneThreedimethylcyclohexane", CAS = "2207-03-6", Tc = 598.15, Pc = 2938430, Vc = 0.46, Cc = 0.272, Tb = 397.61, Tm = 183.07, TT = 183.05, TP = 0.0422148, MW = 112.213, LVB = 0.143768, AF = 0.2356, SP = 16040, DM = 0, SH = -1209000000.0, IGHF = -1.76565E+08, GEF = 3.63171E+07, AS = 376225, HFMP = 9865870, HOC = -4.86695E+09, LiqDen = {105, 0.51304, 0.23992, 598.15, 0.27441, 0}, VP = {101, 80.341, -7070.2, -8.6503, 0.0000047054, 2}, LiqCp = {16, 121960, 76.643, 8.8176, 0.0095602, -0.0000057205}, HOV = {106, 6.9382E+07, 2.1184, -4.4766, 4.6776, -1.8318}, VapCp = {16, 101700, -844.25, 13.931, -0.00056374, 1.5762E-07}, LiqVis = {101, -10.854, 1074.4, -0.03203, 4.561E-08, 2}, VapVis = {102, 0.0000023976, 0.3653, 664.66, 3836.7, 0}, LiqK = {16, -0.046977, 2.8897, -1.5646, -0.00046419, -0.0000013304}, VapK = {102, 0.016485, 0.34326, 5.6687, 894520, 0}, Racketparam = 0.272, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2356, ChaoSeadSP = 16040, ChaoSeadLV = 0.143768); +end TransOneThreedimethylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TransOneThreedimethylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TransOneThreedimethylcyclopentane.mo new file mode 100644 index 0000000..8628c58 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TransOneThreedimethylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TransOneThreedimethylcyclopentane + extends General_Properties(SN = 270, name = "TransOneThreedimethylcyclopentane", CAS = "1759-58-6", Tc = 553, Pc = 3400000, Vc = 0.3633, Cc = 0.276, Tb = 363.9, Tm = 139.18, TT = 139.18, TP = 0.0000437759, MW = 98.188, LVB = 0.13264, AF = 0.253, SP = 15660, DM = 0, SH = -1209000000.0, IGHF = -1.336E+08, GEF = 4.1463E+07, AS = 366810, HFMP = 7398000, HOC = -4.279E+09, LiqDen = {105, 0.77915, 0.2805, 553, 0.30466, 0}, VP = {101, 72.714, -6038.9, -7.709, 0.0000063511, 2}, LiqCp = {16, 128140, 215.87, 5.2004, 0.02446, -0.000024789}, HOV = {106, 6.568557E+07, 1.547069, -1.429715, -0.00159084, 0.362451}, VapCp = {16, 86318, -831.43, 13.758, -0.00059782, 1.8276E-07}, LiqVis = {101, -11.152, 996.91, 0.036374, -1.1545E-07, 2}, VapVis = {102, 0.0000007023, 0.52532, 331.02, -5427.4, 0}, LiqK = {16, -0.034026, 3.551, -1.6156, -0.00049883, -0.0000017475}, VapK = {102, 0.0021472, 0.63073, 213.01, 445470, 0}, Racketparam = 0.276, UniquacR = 4.7192, UniquacQ = 3.772, ChaoSeadAF = 0.253, ChaoSeadSP = 15660, ChaoSeadLV = 0.13264); +end TransOneThreedimethylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TransOneTwodimethylcyclohexane.mo b/Simulator/Simulator/Files/Chemsep_Database/TransOneTwodimethylcyclohexane.mo new file mode 100644 index 0000000..74e1622 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TransOneTwodimethylcyclohexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TransOneTwodimethylcyclohexane + extends General_Properties(SN = 276, name = "TransOneTwodimethylcyclohexane", CAS = "6876-23-9", Tc = 596.15, Pc = 2938430, Vc = 0.46, Cc = 0.273, Tb = 396.58, Tm = 184.99, TT = 184.99, TP = 0.0803872, MW = 112.213, LVB = 0.145347, AF = 0.2416, SP = 15780, DM = 0, SH = -1209000000.0, IGHF = -1.79996E+08, GEF = 3.44761E+07, AS = 370912, HFMP = 1.04223E+07, HOC = -4.86436E+09, LiqDen = {105, 0.54418, 0.25029, 596.15, 0.26582, 0}, VP = {101, 78.951, -6905.8, -8.4915, 0.0000050406, 2}, LiqCp = {16, 107760, 95.278, 8.9456, 0.0091345, -0.000005166}, HOV = {106, 6.3964E+07, 1.6946, -3.2086, 3.1663, -1.1947}, VapCp = {16, 97739, -799.79, 13.856, -0.00049041, 1.3436E-07}, LiqVis = {101, -9.8695, 1124.4, -0.19468, 4.6083E-07, 2}, VapVis = {102, 0.0000004616, 0.56409, 251.76, 9969.9, 0}, LiqK = {16, -0.096966, -4.6856, -1.2678, -0.00075424, -4.7962E-07}, VapK = {102, 0.014659, 0.3596, 28.311, 846250, 0}, Racketparam = 0.273, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2416, ChaoSeadSP = 15780, ChaoSeadLV = 0.145347); +end TransOneTwodimethylcyclohexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TransOneTwodimethylcyclopentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TransOneTwodimethylcyclopentane.mo new file mode 100644 index 0000000..81a0665 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TransOneTwodimethylcyclopentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TransOneTwodimethylcyclopentane + extends General_Properties(SN = 268, name = "TransOneTwodimethylcyclopentane", CAS = "822-50-4", Tc = 553.15, Pc = 3445050, Vc = 0.36, Cc = 0.27, Tb = 365.02, Tm = 155.58, TT = 155.58, TP = 0.00329595, MW = 98.1861, LVB = 0.131474, AF = 0.2692, SP = 15760, DM = 0, SH = -1209000000.0, IGHF = -1.36566E+08, GEF = 3.84928E+07, AS = 366811, HFMP = 7167190, HOC = -4.27609E+09, LiqDen = {105, 0.77149, 0.27784, 553.15, 0.30964, 0}, VP = {101, 89.97, -6815.6, -10.323, 0.000008493, 2}, LiqCp = {16, -27570, -6.4733, 11.325, 0.0043522, -0.0000035776}, HOV = {106, 5.4143E+07, 0.72069, 0.072069, -0.93971, 0.57146}, VapCp = {16, 86316, -831.39, 13.757, -0.0005975, 1.8263E-07}, LiqVis = {101, -10.501, 979.94, -0.073247, 2.6464E-07, 2}, VapVis = {102, 0.0000015301, 0.42849, 479.07, 3.9541, 0}, LiqK = {16, -0.028286, 5.044, -1.6594, -0.00043322, -0.000001941}, VapK = {102, 0.0087025, 0.4463, 190.1, 689820, 0}, Racketparam = 0.27, UniquacR = 4.7192, UniquacQ = 3.772, ChaoSeadAF = 0.2692, ChaoSeadSP = 15760, ChaoSeadLV = 0.131474); +end TransOneTwodimethylcyclopentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TransTwobutene.mo b/Simulator/Simulator/Files/Chemsep_Database/TransTwobutene.mo new file mode 100644 index 0000000..b61edfa --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TransTwobutene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TransTwobutene + extends General_Properties(SN = 80, name = "TransTwobutene", CAS = "624-64-6", Tc = 428.6, Pc = 4100000, Vc = 0.2377, Cc = 0.276, Tb = 274.03, Tm = 167.62, TT = 167.62, TP = 74.5, MW = 56.108, LVB = 0.09365, AF = 0.218, SP = 14210, DM = 0, SH = -11000000.0, IGHF = -1.1E+07, GEF = 6.32E+07, AS = 296500, HFMP = 9757500, HOC = -2.53E+09, LiqDen = {105, 1.1523, 0.27235, 428.6, 0.28543, 0}, VP = {101, 56.602, -4026.7, -5.5178, 0.0000079176, 2}, LiqCp = {16, 98730, 549.96, 0.83133, 0.038607, -0.000044392}, HOV = {106, 3.3476E+07, 0.31355, 0.41478, -0.75555, 0.40695}, VapCp = {16, 60006, -649.72, 12.368, 0.00014661, -5.1566E-08}, LiqVis = {101, -16.05639, 833.2986, 0.849646, -2.292227E-06, 2}, VapVis = {102, 0.0000010493, 0.48674, 358.01, 137.53, 0}, LiqK = {16, 0.060004, 368.81, -7.3737, 0.025078, -0.000049526}, VapK = {102, 0.000078563, 1.0565, 14.753, 105810, 0}, Racketparam = 0.2721, UniquacR = 2.9189, UniquacQ = 2.563, ChaoSeadAF = 0.2138, ChaoSeadSP = 14207.7, ChaoSeadLV = 0.0893483); +end TransTwobutene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TransTwohexene.mo b/Simulator/Simulator/Files/Chemsep_Database/TransTwohexene.mo new file mode 100644 index 0000000..8cc4dd8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TransTwohexene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TransTwohexene + extends General_Properties(SN = 258, name = "TransTwohexene", CAS = "4050-45-7", Tc = 509.8, Pc = 3168000, Vc = 0.345, Cc = 0.258, Tb = 341.02, Tm = 140.17, TT = 140.17, TP = 0.00179, MW = 84.1595, LVB = 0.125, AF = 0.288635, SP = 15250, DM = 0, SH = -1209000000.0, IGHF = -5.381E+07, GEF = 7.675E+07, AS = 380600, HFMP = 8255030, HOC = -3.72648E+09, LiqDen = {105, 0.7854, 0.271, 509.8, 0.28571, 0}, VP = {101, 102.7613, -6858.249, -12.46469, 0.0000134849, 2}, LiqCp = {16, 145330, 591.61, 0.45085, 0.040176, -0.000043449}, HOV = {106, 4.402196E+07, 0.563356, -0.497314, 0.306975, 0.0161359}, VapCp = {16, 96839, -758.81, 13.112, -0.00018911, 4.7057E-08}, LiqVis = {101, -11.296, 798.85, 0.074688, -2.5765E-07, 2}, VapVis = {102, 3.5985E-08, 0.91455, -9.2013, 1687.6, 0}, LiqK = {16, -0.091076, -0.14352, -1.1963, -0.00093801, -0.0000007123}, VapK = {102, 0.000094853, 1.0175, 2.8366, 154410, 0}, Racketparam = 0.258, UniquacR = 4.2677, UniquacQ = 3.643, ChaoSeadAF = 0.288635, ChaoSeadSP = 15250, ChaoSeadLV = 0.125); +end TransTwohexene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TransTwopentene.mo b/Simulator/Simulator/Files/Chemsep_Database/TransTwopentene.mo new file mode 100644 index 0000000..bdb87f9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TransTwopentene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TransTwopentene + extends General_Properties(SN = 110, name = "TransTwopentene", CAS = "646-04-8", Tc = 474.2, Pc = 3660000, Vc = 0.293, Cc = 0.272, Tb = 309.49, Tm = 132.89, TT = 132.89, TP = 0.00574, MW = 70.1329, LVB = 0.1091, AF = 0.248372, SP = 14970, DM = 0, SH = -27600000.0, IGHF = -3.11E+07, GEF = 6.98E+07, AS = 343100, HFMP = 8351700, HOC = -3.119E+09, LiqDen = {105, 0.9122, 0.26869, 474.2, 0.28253, 0}, VP = {101, 77.717, -5422.6, -8.6403, 0.0000092035, 2}, LiqCp = {16, 117170, 204.39, 5.1039, 0.022516, -0.00002152}, HOV = {106, 4.3712E+07, 0.84137, -0.81266, 0.47134, -0.094225}, VapCp = {16, 79715, -780.23, 12.979, -0.00024552, 0.0000000696}, LiqVis = {101, -10.52, 657.15, -0.02693, 1.6882E-07, 2}, VapVis = {102, 1.2614E-07, 0.75299, 74.21, 1685.7, 0}, LiqK = {16, -0.074338, -10.004, -1.1218, -0.0016085, -2.2796E-07}, VapK = {102, 0.000026669, 1.1894, -123.11, 111540, 0}, Racketparam = 0.268765, UniquacR = 3.5933, UniquacQ = 3.103, ChaoSeadAF = 0.209, ChaoSeadSP = 14420.78, ChaoSeadLV = 0.109); +end TransTwopentene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Transdecahydronaphthalene.mo b/Simulator/Simulator/Files/Chemsep_Database/Transdecahydronaphthalene.mo new file mode 100644 index 0000000..ae104d0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Transdecahydronaphthalene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Transdecahydronaphthalene + extends General_Properties(SN = 191, name = "Transdecahydronaphthalene", CAS = "493-02-7", Tc = 687.05, Pc = 2837100, Vc = 0.48, Cc = 0.238, Tb = 460.46, Tm = 242.77, TT = 242.79, TP = 1.14983, MW = 138.253, LVB = 0.159325, AF = 0.253611, SP = 17042.7, DM = 0, SH = -168070000.0, IGHF = -1.8217E+08, GEF = 7.355E+07, AS = 374550, HFMP = 1.441E+07, HOC = -5.88088E+09, LiqDen = {105, 0.5599, 0.26991, 687.05, 0.2952, 0}, VP = {101, 112.0059, -9619.314, -13.21808, 6.974439E-06, 2}, LiqCp = {16, 110470, -81.629, 10.313, 0.0068781, -0.0000045952}, HOV = {106, 7.646155E+07, 0.918445, 0.395142, -2.202434, 1.398354}, VapCp = {16, 81351, -707.34, 13.793, -0.00018944, 2.0365E-08}, LiqVis = {101, -47.21, 3037.9, 5.4682, -0.0000042842, 2}, VapVis = {102, 2.7061E-07, 0.60485, 153.09, 81.09, 0}, LiqK = {16, 0.087771, 45.415, -2.1613, -0.0061939, 0.0000022159}, VapK = {102, -13.928, 0.65448, -2837300, -2.043E+09, 0}, Racketparam = 0.268306, UniquacR = 6.289, UniquacQ = 4.776, ChaoSeadAF = 0.253611, ChaoSeadSP = 17042.7, ChaoSeadLV = 0.159325); +end Transdecahydronaphthalene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Trichloroacetaldehyde.mo b/Simulator/Simulator/Files/Chemsep_Database/Trichloroacetaldehyde.mo new file mode 100644 index 0000000..9c7a3e1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Trichloroacetaldehyde.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Trichloroacetaldehyde + extends General_Properties(SN = 36, name = "Trichloroacetaldehyde", CAS = "75-87-6", Tc = 565, Pc = 4410000, Vc = 0.288, Cc = 0.27, Tb = 370.85, Tm = 216, TT = 216, TP = 10.133, MW = 147.388, LVB = 0.0983111, AF = 0.332334, SP = 19150, DM = 6.54E-30, SH = -22970000.0, IGHF = -1.97E+08, GEF = -1.48E+08, AS = 348000, HFMP = 0, HOC = -6.72E+08, LiqDen = {105, 0.92352, 0.2658, 565, 0.27915, 0}, VP = {101, 104.1738, -7649.009, -12.42192, 0.0000106892, 2}, LiqCp = {16, 141170, -5.956, 6.555, 0.014383, -0.000012896}, HOV = {106, 6.2611E+07, 1.7765, -3.981, 4.442, -1.8138}, VapCp = {16, 75534, -497.17, 11.711, -0.00021306, 5.7567E-08}, LiqVis = {101, -15.452, 1500.4, 0.62119, 1.0267E-07, 2}, VapVis = {102, 1.9624E-07, 0.76217, 181.59, -7289.4, 0}, LiqK = {16, -0.0058147, -49.103, -1.1431, -0.0024848, -2.7456E-08}, VapK = {102, 0.00037396, 0.73494, 540.31, 2896.6, 0}, Racketparam = 0.261398, UniquacR = 3.638102, UniquacQ = 3.132, ChaoSeadAF = 0.332283, ChaoSeadSP = 19153.3, ChaoSeadLV = 0.0983111); +end Trichloroacetaldehyde; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Trichloroacetylchloride.mo b/Simulator/Simulator/Files/Chemsep_Database/Trichloroacetylchloride.mo new file mode 100644 index 0000000..8336257 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Trichloroacetylchloride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Trichloroacetylchloride + extends General_Properties(SN = 9, name = "Trichloroacetylchloride", CAS = "76-02-8", Tc = 604, Pc = 4320000, Vc = 0.3408, Cc = 0.293, Tb = 391.15, Tm = 216.2, TT = 216.2, TP = 5.18177, MW = 181.833, LVB = 0.112961, AF = 0.282386, SP = 18010, DM = 4.0E-30, SH = -218900000.0, IGHF = -2.398E+08, GEF = -1.8E+08, AS = 360000, HFMP = 9040000, HOC = -5.062E+08, LiqDen = {105, 0.76674, 0.26122, 604, 0.28678, 0}, VP = {101, 174.9617, -10592.68, -23.45621, 0.0000238342, 2}, LiqCp = {16, 177260, -1933.8, 48.92, -0.20004, 0.00024097}, HOV = {106, 1.449329E+08, 7.45895, -20.20511, 23.04844, -9.793955}, VapCp = {16, 91870, -696.64, 12.555, -0.0015691, 6.1156E-07}, LiqVis = {101, -12.095, 1867, -0.00010079, 1.1286E-09, 2}, VapVis = {102, 0.0000001265, 0.7796, 98.46, 0.0024692, 0}, LiqK = {16, 0.043702, -153.3, -0.62199, -0.0058162, 0.0000023649}, VapK = {102, 0.0006898, 0.5929, 623.5, 0.0039481, 0}, Racketparam = 0, UniquacR = 4.177323, UniquacQ = 3.544, ChaoSeadAF = 0.347734, ChaoSeadSP = 18501.6, ChaoSeadLV = 0.112737); +end Trichloroacetylchloride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Trichloroethylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Trichloroethylene.mo new file mode 100644 index 0000000..67c7f9a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Trichloroethylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Trichloroethylene + extends General_Properties(SN = 34, name = "Trichloroethylene", CAS = "79-01-6", Tc = 571, Pc = 4910000, Vc = 0.256, Cc = 0.265, Tb = 360.1, Tm = 188.4, TT = 188.4, TP = 1.97868, MW = 131.388, LVB = 0.0901371, AF = 0.21662, SP = 18800, DM = 2.57E-30, SH = -22970000.0, IGHF = -9620000, GEF = 1.606E+07, AS = 325090, HFMP = 0, HOC = -8.6411E+08, LiqDen = {105, 1.0632, 0.27217, 571, 0.2986, 0}, VP = {101, 46.56173, -5021.974, -3.675161, 4.330407E-06, 2}, LiqCp = {16, 111110, 1042.6, -3.1013, 0.043029, -0.000040867}, HOV = {106, 4.571591E+07, 0.581727, -0.122707, -0.842037, 0.831632}, VapCp = {16, 56305, -500.68, 11.893, -0.00053611, 1.6998E-07}, LiqVis = {101, -16.947, 1157.4, 0.95533, 0.0000012051, 2}, VapVis = {102, 1.5903E-07, 0.76088, 56.852, 7589.2, 0}, LiqK = {16, 0.079767, 522.46, -9.4979, 0.032021, -0.00005769}, VapK = {102, 0.00050539, 0.6741, 584.61, 3177.4, 0}, Racketparam = 0, UniquacR = 3.31, UniquacQ = 2.86, ChaoSeadAF = 0.2456, ChaoSeadSP = 18796.4, ChaoSeadLV = 0.0901371); +end Trichloroethylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Triethanolamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Triethanolamine.mo new file mode 100644 index 0000000..e81824a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Triethanolamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Triethanolamine + extends General_Properties(SN = 369, name = "Triethanolamine", CAS = "102-71-6", Tc = 787, Pc = 3590000, Vc = 0.472, Cc = 0.202, Tb = 613, Tm = 294.35, TT = 294.35, TP = 0.000287009, MW = 149.188, LVB = 0.132992, AF = 1.28411, SP = 27430, DM = 3.6E-30, SH = -22600000.0, IGHF = -5.54E+08, GEF = -2.994E+08, AS = 538000, HFMP = 2.7191E+07, HOC = -3.5025E+09, LiqDen = {105, 0.028938, 0.058014, 787, 0.099632, 0}, VP = {101, 283.76, -24672, -37.048, 0.000015689, 2}, LiqCp = {16, 285560, 313.35, 6.351, 0.016374, -0.000012842}, HOV = {106, 1.354875E+08, 0.343894, 0.961738, -1.466285, 0.442687}, VapCp = {16, 114870, -616.04, 13.509, -0.00048074, 2.2464E-07}, LiqVis = {101, 33.605, 4399.7, -8.9203, 0.000021038, 2}, VapVis = {102, 3.0013E-08, 0.95199, 45.139, -3355.9, 0}, LiqK = {16, -0.76863, 26.11, -0.3374, 0.0010847, -0.0000011937}, VapK = {102, 0.043843, 0.38395, 6681.4, 1202500, 0}, Racketparam = 0.202, UniquacR = 7.3317, UniquacQ = 6.932, ChaoSeadAF = 1.28411, ChaoSeadSP = 27430, ChaoSeadLV = 0.132992); +end Triethanolamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Triethylamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Triethylamine.mo new file mode 100644 index 0000000..8f8ac0d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Triethylamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Triethylamine + extends General_Properties(SN = 139, name = "Triethylamine", CAS = "121-44-8", Tc = 535, Pc = 3000000, Vc = 0.39, Cc = 0.263, Tb = 362.9, Tm = 158.45, TT = 158.45, TP = 0.0106462, MW = 101.192, LVB = 0.13996, AF = 0.316193, SP = 15170, DM = 2.2E-30, SH = -168070000.0, IGHF = -9.58E+07, GEF = 1.141E+08, AS = 405400, HFMP = 8520000, HOC = -4.0405E+09, LiqDen = {105, 0.74443, 0.28147, 535, 0.29639, 0}, VP = {101, 109.5632, -7670.939, -13.23524, 8.526035E-06, 2}, LiqCp = {16, -68176, -83.963, 12.887, -0.00053012, 0.0000014554}, HOV = {106, 5.6361E+07, 1.8179, -4.3508, 5.0206, -2.0828}, VapCp = {16, 118700, -798.83, 13.439, -0.00026576, 5.0253E-08}, LiqVis = {101, -8.1405, 722.62, -0.37234, -0.0000014417, 2}, VapVis = {102, 3.6298E-07, 0.63337, 296.37, -2057.9, 0}, LiqK = {16, -0.073124, -11.318, -1.1721, -0.001404, -1.7908E-07}, VapK = {102, 0.00013191, 0.98598, 87.622, 150050, 0}, Racketparam = 0.262814, UniquacR = 5.01, UniquacQ = 4.26, ChaoSeadAF = 0.316157, ChaoSeadSP = 15176.2, ChaoSeadLV = 0.139672); +end Triethylamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Triethyleneglycol.mo b/Simulator/Simulator/Files/Chemsep_Database/Triethyleneglycol.mo new file mode 100644 index 0000000..cb3c91a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Triethyleneglycol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Triethyleneglycol + extends General_Properties(SN = 138, name = "Triethyleneglycol", CAS = "112-27-6", Tc = 769.5, Pc = 3320000, Vc = 0.443, Cc = 0.23, Tb = 561.5, Tm = 265.95, TT = 265.95, TP = 0.000327262, MW = 150.173, LVB = 0.134127, AF = 0.755952, SP = 25710, DM = 9.97E-30, SH = -168070000.0, IGHF = -7.251E+08, GEF = -4.86E+08, AS = 556500, HFMP = 1.82E+07, HOC = -3.2498E+09, LiqDen = {105, 0.60697, 0.26444, 769.5, 0.24805, 0}, VP = {101, -148.0973, -1446.895, 26.95817, -0.0000266538, 2}, LiqCp = {16, 234210, -89.741, 10.328, 0.0058089, -0.0000030565}, HOV = {106, 1.392895E+08, 1.422819, -1.625802, 1.207667, -0.563316}, VapCp = {16, 88442, -417.2, 12.845, 0.00037163, -1.3999E-07}, LiqVis = {101, -354.9911, 16471.68, 54.55389, -0.0481353, 1}, VapVis = {102, 8.2508E-08, 0.8077, 134.01, -6653.4, 0}, LiqK = {16, -0.089806, 0.43077, -1.6802, 0.0024003, -0.0000033612}, VapK = {102, 0.0000048035, 1.4025, 164.43, 15114, 0}, Racketparam = 0.224225, UniquacR = 6.5342, UniquacQ = 6.12, ChaoSeadAF = 0.758714, ChaoSeadSP = 23437.3, ChaoSeadLV = 0.134187); +end Triethyleneglycol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Trimethylamine.mo b/Simulator/Simulator/Files/Chemsep_Database/Trimethylamine.mo new file mode 100644 index 0000000..f8e911a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Trimethylamine.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Trimethylamine + extends General_Properties(SN = 70, name = "Trimethylamine", CAS = "75-50-3", Tc = 433.3, Pc = 4075000, Vc = 0.254, Cc = 0.266, Tb = 276.02, Tm = 156.08, TT = 156.08, TP = 9.92058, MW = 59.111, LVB = 0.09428, AF = 0.206243, SP = 14360, DM = 2.04E-30, SH = -24310000.0, IGHF = -2.431E+07, GEF = 9.899E+07, AS = 287000, HFMP = 6544000, HOC = -2.2449E+09, LiqDen = {105, 0.67928, 0.21649, 433.3, 0.20925, 0}, VP = {101, 110.254, -5770.536, -14.1719, 0.0000238614, 2}, LiqCp = {16, 112140, 1253.3, -12.905, 0.10424, -0.00013798}, HOV = {106, 4.743116E+07, 0.966273, 0.752593, -2.762744, 1.513109}, VapCp = {16, 65203, -794.87, 12.953, -0.00031634, 6.4426E-08}, LiqVis = {101, 9.9961, -126.46, -3.1956, -6.7828E-08, 2}, VapVis = {102, 0.000001161, 0.48519, 364.43, 10928, 0}, LiqK = {16, -0.0043132, -14.875, -1.2529, -0.0019969, -0.0000017575}, VapK = {102, 0.00027205, 0.90104, 140.75, 139110, 0}, Racketparam = 0, UniquacR = 2.99, UniquacQ = 2.64, ChaoSeadAF = 0.205, ChaoSeadSP = 15311.1, ChaoSeadLV = 0.0902163); +end Trimethylamine; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Two6dinitrotoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/Two6dinitrotoluene.mo new file mode 100644 index 0000000..6fff2db --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Two6dinitrotoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Two6dinitrotoluene + extends General_Properties(SN = 388, name = "Two6dinitrotoluene", CAS = "606-20-2", Tc = 780, Pc = 3400000, Vc = 0.487, Cc = 0.242, Tb = 553, Tm = 339, TT = 337.85, TP = 24.9565, MW = 182.134, LVB = 0.136568, AF = 0.714206, SP = 20760, DM = 9.37E-30, SH = -22600000.0, IGHF = 2.86E+07, GEF = 2.32E+08, AS = 414000, HFMP = 2.12E+07, HOC = -3.429E+09, LiqDen = {105, 0.27332, 0.17415, 780, 0.22386, 0}, VP = {101, 115.7657, -12082.2, -13.31782, 5.09858E-06, 2}, LiqCp = {16, 163490, 785.69, 5.0684, 0.014589, -0.0000070833}, HOV = {106, 1.041715E+08, 1.247529, 0.0309575, -2.851863, 1.938855}, VapCp = {16, 94512, -582.56, 13.27, -0.00026587, 5.3735E-08}, LiqVis = {101, -70.386, 5310.9, 8.6262, -0.0000081126, 2}, VapVis = {102, 5.9592E-08, 0.88167, 135.78, -11605, 0}, LiqK = {16, -0.039901, -99.466, -0.76681, -0.0019329, 1.8512E-07}, VapK = {102, 0.00015932, 0.92355, 690.15, 19720, 0}, Racketparam = 0.242, UniquacR = 5.7, UniquacQ = 4.376, ChaoSeadAF = 0.714206, ChaoSeadSP = 20760, ChaoSeadLV = 0.136568); +end Two6dinitrotoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoFivedimethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoFivedimethylhexane.mo new file mode 100644 index 0000000..5f43da0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoFivedimethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoFivedimethylhexane + extends General_Properties(SN = 233, name = "TwoFivedimethylhexane", CAS = "592-13-2", Tc = 550, Pc = 2490000, Vc = 0.482, Cc = 0.262, Tb = 382.26, Tm = 182, TT = 182, TP = 0.0683715, MW = 114.231, LVB = 0.1657, AF = 0.357, SP = 14740, DM = 0, SH = -1209000000.0, IGHF = -2.22631E+08, GEF = 1.046E+07, AS = 442330, HFMP = 1.29537E+07, HOC = -5.06398E+09, LiqDen = {105, 0.49779, 0.2525, 550, 0.26429, 0}, VP = {101, 87.65473, -7122.285, -9.843559, 7.04047E-06, 2}, LiqCp = {16, -51796, -110.09, 12.759, 0.00089408, -0.0000004354}, HOV = {106, 6.2389E+07, 1.0017, -0.72582, -0.024698, 0.19155}, VapCp = {16, 66542, -399.08, 12.9, 0.00049831, -1.6255E-07}, LiqVis = {101, -2.9399, 836.45, -1.3966, 0.00000447, 2}, VapVis = {102, 8.3872E-07, 0.47833, 344.26, 27.957, 0}, LiqK = {16, -0.074336, 3.6543, -1.5091, -0.00039812, -0.0000013255}, VapK = {102, 0.000029331, 1.1695, -138.07, 145330, 0}, Racketparam = 0.262, UniquacR = 5.847, UniquacQ = 4.928, ChaoSeadAF = 0.357, ChaoSeadSP = 14740, ChaoSeadLV = 0.1657); +end TwoFivedimethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoFivedinitrotoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoFivedinitrotoluene.mo new file mode 100644 index 0000000..b44a31b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoFivedinitrotoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoFivedinitrotoluene + extends General_Properties(SN = 390, name = "TwoFivedinitrotoluene", CAS = "619-15-8", Tc = 814, Pc = 3400000, Vc = 0.487, Cc = 0.237, Tb = 590, Tm = 325.65, TT = 323.48, TP = 3.04164, MW = 182.134, LVB = 0.135666, AF = 0.712285, SP = 21390, DM = 1.93E-30, SH = -22600000.0, IGHF = 2.71E+07, GEF = 2.36E+08, AS = 414000, HFMP = 2.03E+07, HOC = -3.446E+09, LiqDen = {105, 0.50237, 0.23693, 814, 0.28571, 0}, VP = {101, 90.89499, -12036.13, -9.395524, 2.853055E-06, 2}, LiqCp = {16, 152220, 711.2, 5.8598, 0.012789, -0.0000058246}, HOV = {106, 5.5817E+07, -1.8578, 6.6656, -8.4526, 3.8136}, VapCp = {16, 94512, -582.56, 13.27, -0.00026587, 5.3735E-08}, LiqVis = {101, -10.391, 2604.7, -0.5024, 5.1688E-07, 2}, VapVis = {102, 3.8924E-08, 0.93015, 82.835, -8099.3, 0}, LiqK = {16, -0.078898, -29.065, -1.0796, -0.00084649, -2.5074E-07}, VapK = {102, 0.0001568, 0.92031, 704.11, 20197, 0}, Racketparam = 0.237, UniquacR = 5.7, UniquacQ = 4.376, ChaoSeadAF = 0.712285, ChaoSeadSP = 21390, ChaoSeadLV = 0.135666); +end TwoFivedinitrotoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoFour6trinitrotoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoFour6trinitrotoluene.mo new file mode 100644 index 0000000..746793a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoFour6trinitrotoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoFour6trinitrotoluene + extends General_Properties(SN = 392, name = "TwoFour6trinitrotoluene", CAS = "118-96-7", Tc = 795, Pc = 3040000, Vc = 0.48, Cc = 0.253, Tb = 573, Tm = 355, TT = 354, TP = 0.936248, MW = 227.131, LVB = 0.154989, AF = 0.897249, SP = 23070, DM = 3.87E-30, SH = -22600000.0, IGHF = 1.64E+07, GEF = 2.844E+08, AS = 460700, HFMP = 2.12E+07, HOC = -3.2919E+09, LiqDen = {105, 0.99663, 0.34261, 803.06, 0.50647, 0}, VP = {101, 245.81, -20425, -32.225, 0.00001503, 2}, LiqCp = {16, 188750, 750.94, 4.5661, 0.019107, -0.00001348}, HOV = {106, 2.111008E+07, -12.33056, 37.27643, -41.67226, 16.622}, VapCp = {16, 209680, -1410.9, 14.902, -0.0017672, 4.5403E-07}, LiqVis = {101, 92.002, -1238.6, -16.127, 0.000013297, 2}, VapVis = {102, 5.1205E-08, 0.89283, 134.66, -13583, 0}, LiqK = {16, -0.10196, -488.31, 0.35873, -0.0039133, 0.0000039064}, VapK = {102, 0.00015986, 0.89621, 647.63, 36973, 0}, Racketparam = 0.253, UniquacR = 6.5886, UniquacQ = 5.08, ChaoSeadAF = 0.897249, ChaoSeadSP = 23070, ChaoSeadLV = 0.154989); +end TwoFour6trinitrotoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoFourFourtrimethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoFourFourtrimethylhexane.mo new file mode 100644 index 0000000..aec7db7 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoFourFourtrimethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoFourFourtrimethylhexane + extends General_Properties(SN = 240, name = "TwoFourFourtrimethylhexane", CAS = "16747-30-1", Tc = 583, Pc = 2500000, Vc = 0.509, Cc = 0.26, Tb = 403.81, Tm = 159.78, TT = 159.78, TP = 0.000306827, MW = 128.255, LVB = 0.178125, AF = 0.352203, SP = 14590, DM = 0, SH = -1209000000.0, IGHF = -2.403E+08, GEF = 2.5E+07, AS = 468400, HFMP = 1.13E+07, HOC = -5.68E+09, LiqDen = {105, 0.098546, 0.11862, 583, 0.15161, 0}, VP = {101, 143.1127, -9541.532, -18.4559, 0.0000171318, 2}, LiqCp = {16, 36795, -79.414, 11.689, 0.0041098, -0.0000031494}, HOV = {106, 5.5551E+07, 0.63316, -0.60532, 0.59593, -0.24062}, VapCp = {16, 84170, -452.22, 13.167, 0.00035197, -1.1076E-07}, LiqVis = {101, -6.9748, 1194.1, -0.75025, -2.9452E-08, 2}, VapVis = {102, 0.0000003308, 0.60466, 252.52, -7535.6, 0}, LiqK = {16, -0.061213, 3.6115, -1.5687, -0.00048198, -0.000001134}, VapK = {102, 0.000028131, 1.1825, -103.57, 142450, 0}, Racketparam = 0.26, UniquacR = 6.5207, UniquacQ = 5.548, ChaoSeadAF = 0.352203, ChaoSeadSP = 14590, ChaoSeadLV = 0.178125); +end TwoFourFourtrimethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoFourdimethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoFourdimethylhexane.mo new file mode 100644 index 0000000..354dc45 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoFourdimethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoFourdimethylhexane + extends General_Properties(SN = 232, name = "TwoFourdimethylhexane", CAS = "589-43-5", Tc = 553.5, Pc = 2560000, Vc = 0.472, Cc = 0.263, Tb = 382.58, Tm = 0, TT = 0, TP = 0, MW = 114.231, LVB = 0.16408, AF = 0.344, SP = 14650, DM = 0, SH = -1209000000.0, IGHF = -2.19409E+08, GEF = 1.17152E+07, AS = 447600, HFMP = 0, HOC = -5.06733E+09, LiqDen = {105, 0.49412, 0.25086, 553.5, 0.26728, 0}, VP = {101, 110.28, -8135.7, -13.268, 0.0000097316, 2}, LiqCp = {16, -373730, 38.479, 12.478, 0.0035274, -0.0000034858}, HOV = {106, 5.4006E+07, 0.43973, 0.30966, -0.70429, 0.35515}, VapCp = {16, 68028, -390.94, 12.9, 0.00049032, -1.6117E-07}, LiqVis = {101, -12.459, 1208.2, 0.16649, -2.1296E-07, 2}, VapVis = {102, 0.0000013835, 0.41886, 453.95, -1216.3, 0}, LiqK = {16, -0.012272, -146.3, -0.49024, -0.0043592, 0.0000013669}, VapK = {102, 0.000028277, 1.1747, -150.01, 140960, 0}, Racketparam = 0.263, UniquacR = 5.847, UniquacQ = 4.928, ChaoSeadAF = 0.344, ChaoSeadSP = 14650, ChaoSeadLV = 0.16408); +end TwoFourdimethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoFourdimethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoFourdimethylpentane.mo new file mode 100644 index 0000000..1ebbe85 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoFourdimethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoFourdimethylpentane + extends General_Properties(SN = 223, name = "TwoFourdimethylpentane", CAS = "108-08-7", Tc = 519.7, Pc = 2740000, Vc = 0.4175, Cc = 0.265, Tb = 353.62, Tm = 153.908, TT = 153.912, TP = 0.0066994, MW = 100.204, LVB = 0.14995, AF = 0.304, SP = 14290, DM = 0, SH = -1209000000.0, IGHF = -2.0167E+08, GEF = 3310000, AS = 397000, HFMP = 6845000, HOC = -4.454E+09, LiqDen = {105, 0.49944, 0.24101, 519.81, 0.23086, 0}, VP = {101, 86.23433, -6498.287, -9.772628, 8.133363E-06, 2}, LiqCp = {16, 90283, 22.117, 10.293, 0.0058192, -0.0000033296}, HOV = {106, 5.636917E+07, 1.083678, -0.919235, 0.1428, 0.13605}, VapCp = {16, 66100, -427.67, 12.876, 0.00036594, -1.1245E-07}, LiqVis = {101, -15.849, 1204.5, 0.70216, -0.0000021284, 2}, VapVis = {102, 1.8633E-07, 0.67603, 100.62, -68.047, 0}, LiqK = {16, -0.10048, 3.798, -1.3824, -0.00040413, -0.0000011783}, VapK = {102, 0.0002569, 0.9033, 147.33, 182490, 0}, Racketparam = 0.265, UniquacR = 5.1726, UniquacQ = 4.388, ChaoSeadAF = 0.304, ChaoSeadSP = 14290, ChaoSeadLV = 0.14995); +end TwoFourdimethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoFourdinitrotoluene.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoFourdinitrotoluene.mo new file mode 100644 index 0000000..3a27d19 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoFourdinitrotoluene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoFourdinitrotoluene + extends General_Properties(SN = 387, name = "TwoFourdinitrotoluene", CAS = "121-14-2", Tc = 814, Pc = 3400000, Vc = 0.487, Cc = 0.245, Tb = 553, Tm = 333, TT = 342.65, TP = 7.8719, MW = 182.134, LVB = 0.137448, AF = 0.712571, SP = 21470, DM = 1.44E-29, SH = -22600000.0, IGHF = 3.36E+07, GEF = 2.18E+08, AS = 414000, HFMP = 2.0126E+07, HOC = -3.416E+09, LiqDen = {105, 0.5108, 0.24037, 814, 0.26806, 0}, VP = {101, 128.9329, -13393.44, -15.15736, 5.597038E-06, 2}, LiqCp = {16, 88958, 1324.4, 2.7528, 0.019721, -0.000011079}, HOV = {106, 1.2919E+08, 1.3248, 1.0872, -4.8737, 2.858}, VapCp = {16, 94512, -582.56, 13.27, -0.00026587, 5.3735E-08}, LiqVis = {101, -41.408, 3947.7, 4.2203, -0.0000035178, 2}, VapVis = {102, 1.9809E-08, 1.0159, 22.316, -3670.3, 0}, LiqK = {16, -0.057001, -67.01, -0.90194, -0.0013614, -3.0209E-08}, VapK = {102, 0.00011852, 0.95914, 734.05, 13896, 0}, Racketparam = 0.245, UniquacR = 5.7, UniquacQ = 4.376, ChaoSeadAF = 0.712571, ChaoSeadSP = 21470, ChaoSeadLV = 0.137448); +end TwoFourdinitrotoluene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoMethoxyTwoMethylHeptane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoMethoxyTwoMethylHeptane.mo new file mode 100644 index 0000000..af6f1c1 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoMethoxyTwoMethylHeptane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoMethoxyTwoMethylHeptane + extends General_Properties(SN = 421, name = "TwoMethoxyTwoMethylHeptane", CAS = "76589-16-7", Tc = 618.2025, Pc = 2357849, Vc = 0.53093, Cc = 0.24355, Tb = 446.7301, Tm = 0, TT = 0, TP = 0, MW = 144.2564, LVB = 0.18511, AF = 0.433286, SP = 14871.82, DM = 0, SH = -61100000.0, IGHF = -9790565, GEF = -6.029269, AS = 1629362, HFMP = 0, HOC = -5.95423E+09, LiqDen = {0, 0, 0, 0, 0, 0}, VP = {200, -8.2705, 2.1937, -3.6992, -3.7256, 2357800}, LiqCp = {0, 0, 0, 0, 0, 0}, HOV = {106, 6.6655E+07, 0.38, 0, 0, 0}, VapCp = {4, -4265.999, 921.48, -0.5266, 0.000113, 0}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {0, 0, 0, 0, 0, 0}, LiqK = {16, 0, 0, 0, 0, 0}, VapK = {0, 0, 0, 0, 0, 0}, Racketparam = 0.24355, UniquacR = 6.7654, UniquacQ = 5.792, ChaoSeadAF = 0.433286, ChaoSeadSP = 14871.82, ChaoSeadLV = 0.18511); +end TwoMethoxyTwoMethylHeptane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoMethylTwoHeptanol.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoMethylTwoHeptanol.mo new file mode 100644 index 0000000..5f98e43 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoMethylTwoHeptanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoMethylTwoHeptanol + extends General_Properties(SN = 422, name = "TwoMethylTwoHeptanol", CAS = "625-25-2", Tc = 636.6534, Pc = 2716180, Vc = 0.48244, Cc = 0.247551, Tb = 467.6976, Tm = 0, TT = 0, TP = 0, MW = 130.2296, LVB = 0.15788, AF = 0.723562, SP = 17397.3, DM = 0, SH = -61100000.0, IGHF = -1.238045, GEF = -1.233886, AS = 1322185, HFMP = 0, HOC = -5.204435, LiqDen = {0, 0, 0, 0, 0, 0}, VP = {200, -10.016, 3.415, -6.8543, -4.7824, 2716200}, LiqCp = {0, 0, 0, 0, 0, 0}, HOV = {106, 7.9114E+07, 0.38, 0, 0, 0}, VapCp = {4, -23566, 923.66, -0.6136, 0.0001657, 0}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {0, 0, 0, 0, 0, 0}, LiqK = {16, 0, 0, 0, 0, 0}, VapK = {0, 0, 0, 0, 0, 0}, Racketparam = 0.247551, UniquacR = 6.6204, UniquacQ = 5.904, ChaoSeadAF = 0.723562, ChaoSeadSP = 17397.3, ChaoSeadLV = 0.15788); +end TwoMethylTwoHeptanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoThreeFourtrimethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoThreeFourtrimethylpentane.mo new file mode 100644 index 0000000..3c7e778 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoThreeFourtrimethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoThreeFourtrimethylpentane + extends General_Properties(SN = 159, name = "TwoThreeFourtrimethylpentane", CAS = "565-75-3", Tc = 566.3, Pc = 2730000, Vc = 0.4562, Cc = 0.267, Tb = 386.62, Tm = 163.95, TT = 163.95, TP = 0.00303425, MW = 114.231, LVB = 0.15974, AF = 0.316, SP = 14940, DM = 0, SH = -168070000.0, IGHF = -2.1732E+08, GEF = 1.9E+07, AS = 428400, HFMP = 9267560, HOC = -5.06943E+09, LiqDen = {105, 0.44061, 0.23657, 566.41, 0.23009, 0}, VP = {101, 83.41936, -6957.084, -9.207327, 0.0000063783, 2}, LiqCp = {16, 108880, -13.14, 10.55, 0.00536, -0.0000028819}, HOV = {106, 5.6943E+07, 0.86512, -0.77048, 0.30586, 0.021601}, VapCp = {16, 26624, -291.65, 12.829, 0.00059553, -0.0000001821}, LiqVis = {101, -6.3467, 935.74, -0.76144, 7.5545E-07, 2}, VapVis = {102, 6.7868E-07, 0.51422, 325.4, 22.347, 0}, LiqK = {16, -0.048086, 3.7835, -1.6094, -0.00050636, -0.0000013704}, VapK = {102, 0.000017892, 1.241, -169.67, 132780, 0}, Racketparam = 0, UniquacR = 5.85, UniquacQ = 4.94, ChaoSeadAF = 0.316137, ChaoSeadSP = 14934.3, ChaoSeadLV = 0.159513); +end TwoThreeFourtrimethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoThreeThreeFourtetramethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoThreeThreeFourtetramethylpentane.mo new file mode 100644 index 0000000..cbb6325 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoThreeThreeFourtetramethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoThreeThreeFourtetramethylpentane + extends General_Properties(SN = 245, name = "TwoThreeThreeFourtetramethylpentane", CAS = "16747-38-9", Tc = 607.1, Pc = 2670000, Vc = 0.493, Cc = 0.261, Tb = 414.71, Tm = 171.05, TT = 171.03, TP = 0.00089642, MW = 128.258, LVB = 0.17076, AF = 0.313, SP = 15110, DM = 0, SH = -1209000000.0, IGHF = -2.361E+08, GEF = 3.8E+07, AS = 436900, HFMP = 9000000, HOC = -5.6822E+09, LiqDen = {105, 0.49299, 0.25927, 607.51, 0.27003, 0}, VP = {101, 79.047, -7201.2, -8.4677, 0.0000051332, 2}, LiqCp = {16, 61477, 20.611, 11.082, 0.0041652, -0.0000014763}, HOV = {106, 5.5207E+07, 0.63465, -0.82041, 1.0175, -0.45604}, VapCp = {16, 50811, -338.13, 12.991, 0.00056259, -1.7284E-07}, LiqVis = {101, -7.4098, 1217, -0.67198, -2.7904E-07, 2}, VapVis = {102, 3.7299E-07, 0.59636, 289.93, -9056.4, 0}, LiqK = {16, -0.058699, 3.5637, -1.5648, -0.000479, -0.0000010469}, VapK = {102, 0.000035577, 1.1602, -50.424, 142790, 0}, Racketparam = 0.261, UniquacR = 6.5199, UniquacQ = 5.544, ChaoSeadAF = 0.313, ChaoSeadSP = 15110, ChaoSeadLV = 0.17076); +end TwoThreeThreeFourtetramethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoThreeThreetrimethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoThreeThreetrimethylpentane.mo new file mode 100644 index 0000000..f759dbb --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoThreeThreetrimethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoThreeThreetrimethylpentane + extends General_Properties(SN = 158, name = "TwoThreeThreetrimethylpentane", CAS = "560-21-4", Tc = 573.5, Pc = 2820000, Vc = 0.4551, Cc = 0.269, Tb = 387.92, Tm = 172.22, TT = 172.22, TP = 0.0168197, MW = 114.231, LVB = 0.15815, AF = 0.291, SP = 14920, DM = 0, SH = -168070000.0, IGHF = -2.1845E+08, GEF = 1.828E+07, AS = 427020, HFMP = 857720, HOC = -5.06876E+09, LiqDen = {105, 0.56592, 0.26622, 573.5, 0.26429, 0}, VP = {101, 82.87517, -6894.749, -9.15013, 6.430758E-06, 2}, LiqCp = {16, 217000, 82.075, 1.8853, 0.036678, -0.000031911}, HOV = {106, 5.838161E+07, 1.059379, -1.234692, 0.816701, -0.225175}, VapCp = {16, 48585, -365.95, 12.926, 0.00051631, -1.5846E-07}, LiqVis = {101, -10.941, 1191.2, -0.045562, -0.0000023087, 2}, VapVis = {102, 8.2493E-07, 0.49302, 371.93, -89.774, 0}, LiqK = {16, -0.040193, 3.6823, -1.645, -0.00052834, -0.0000014091}, VapK = {102, 0.000018829, 1.2378, -181.1, 146480, 0}, Racketparam = 0, UniquacR = 5.85, UniquacQ = 4.94, ChaoSeadAF = 0.2903, ChaoSeadSP = 14919.5, ChaoSeadLV = 0.158155); +end TwoThreeThreetrimethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoThreedimethylbutane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoThreedimethylbutane.mo new file mode 100644 index 0000000..b78d36d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoThreedimethylbutane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoThreedimethylbutane + extends General_Properties(SN = 134, name = "TwoThreedimethylbutane", CAS = "79-29-8", Tc = 499.9, Pc = 3130000, Vc = 0.3576, Cc = 0.269, Tb = 331.12, Tm = 145.19, TT = 145.19, TP = 0.0152127, MW = 86.177, LVB = 0.13117, AF = 0.248, SP = 14300, DM = 0, SH = -168070000.0, IGHF = -1.768E+08, GEF = -3125000, AS = 365920, HFMP = 799100, HOC = -3.84761E+09, LiqDen = {105, 0.67999, 0.25932, 500.01, 0.25836, 0}, VP = {101, 76.80058, -5679.218, -8.443302, 7.93783E-06, 2}, LiqCp = {16, 126350, -53.429, 8.8794, 0.010279, -0.0000080841}, HOV = {106, 4.7443E+07, 0.91932, -0.91329, 0.50392, -0.089442}, VapCp = {16, 46722, -391.59, 12.599, 0.00056088, -1.7583E-07}, LiqVis = {101, 6.9204, 231.1, -2.7393, -1.3079E-07, 2}, VapVis = {102, 6.8449E-07, 0.52371, 291.92, -3199.1, 0}, LiqK = {16, -0.05308, -5.5491, -1.4118, -0.0011735, -7.4229E-07}, VapK = {102, 0.000032078, 1.1749, -107.52, 129270, 0}, Racketparam = 0.2694, UniquacR = 4.4982, UniquacQ = 3.848, ChaoSeadAF = 0.24754, ChaoSeadSP = 14352.8, ChaoSeadLV = 0.13105); +end TwoThreedimethylbutane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoThreedimethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoThreedimethylhexane.mo new file mode 100644 index 0000000..62ae6a5 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoThreedimethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoThreedimethylhexane + extends General_Properties(SN = 231, name = "TwoThreedimethylhexane", CAS = "584-94-1", Tc = 563.4, Pc = 2630000, Vc = 0.4682, Cc = 0.263, Tb = 388.76, Tm = 0, TT = 0, TP = 0, MW = 114.231, LVB = 0.16131, AF = 0.347, SP = 15020, DM = 0, SH = -1209000000.0, IGHF = -2.13886E+08, GEF = 1.50206E+07, AS = 451960, HFMP = 0, HOC = -5.07176E+09, LiqDen = {105, 0.48655, 0.24924, 563.43, 0.24533, 0}, VP = {101, 106.31, -8083.9, -12.636, 0.000008991, 2}, LiqCp = {16, -256410, 53.354, 11.988, 0.00458, -0.0000045457}, HOV = {106, 5.5877E+07, 0.44475, 0.4503, -0.98905, 0.49662}, VapCp = {16, 55247, -379.2, 12.913, 0.00048944, -1.5722E-07}, LiqVis = {101, 8.0389, 480.9, -3.1555, 0.0000074225, 2}, VapVis = {102, 4.4497E-07, 0.56168, 244.71, 41.585, 0}, LiqK = {16, -0.0041864, -133.36, -0.65326, -0.003975, 8.3867E-07}, VapK = {102, 0.000025619, 1.1862, -177.9, 153600, 0}, Racketparam = 0.263, UniquacR = 5.847, UniquacQ = 4.928, ChaoSeadAF = 0.347, ChaoSeadSP = 15020, ChaoSeadLV = 0.16131); +end TwoThreedimethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoThreedimethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoThreedimethylpentane.mo new file mode 100644 index 0000000..fb46c9c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoThreedimethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoThreedimethylpentane + extends General_Properties(SN = 222, name = "TwoThreedimethylpentane", CAS = "565-59-3", Tc = 537.3, Pc = 2910000, Vc = 0.393, Cc = 0.256, Tb = 362.91, Tm = 0, TT = 0, TP = 0, MW = 100.204, LVB = 0.14505, AF = 0.297, SP = 14820, DM = 0, SH = -1209000000.0, IGHF = -1.941E+08, GEF = 5610000, AS = 414550, HFMP = 0, HOC = -4.45567E+09, LiqDen = {105, 0.60743, 0.26317, 537.3, 0.2444, 0}, VP = {101, 81.051, -6444.3, -8.9383, 0.0000069583, 2}, LiqCp = {16, 144370, -45.964, 9.0642, 0.010184, -0.0000082901}, HOV = {106, 5.686611E+07, 1.319959, -1.914129, 1.410201, -0.377243}, VapCp = {16, 33579, -324.43, 12.683, 0.00063287, -2.0243E-07}, LiqVis = {101, -16.952, 1255.2, 0.89405, -0.0000015964, 2}, VapVis = {102, 0.0000005037, 0.54462, 227.41, 8.0354, 0}, LiqK = {16, -0.054333, 2.0859, -1.4922, -0.00079317, -0.0000012037}, VapK = {102, 0.000019733, 1.2301, -158.93, 129950, 0}, Racketparam = 0.256, UniquacR = 5.1726, UniquacQ = 4.388, ChaoSeadAF = 0.297, ChaoSeadSP = 14820, ChaoSeadLV = 0.14505); +end TwoThreedimethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwoFivetrimethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoFivetrimethylhexane.mo new file mode 100644 index 0000000..6aa103b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoFivetrimethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwoFivetrimethylhexane + extends General_Properties(SN = 239, name = "TwoTwoFivetrimethylhexane", CAS = "3522-94-9", Tc = 568.05, Pc = 2330000, Vc = 0.519, Cc = 0.255, Tb = 397.24, Tm = 167.39, TT = 167.39, TP = 0.000968629, MW = 128.255, LVB = 0.18225, AF = 0.3571, SP = 14380, DM = 0, SH = -1209000000.0, IGHF = -2.533E+08, GEF = 1.38E+07, AS = 461700, HFMP = 6200000, HOC = -5.66643E+09, LiqDen = {105, 0.45081, 0.25256, 569.81, 0.27357, 0}, VP = {101, 133.84, -9023.578, -17.08913, 0.0000169305, 2}, LiqCp = {16, 84566, 233.86, 8.46, 0.013452, -0.000012421}, HOV = {106, 8.039801E+07, 1.702411, -1.574913, 0.0056916, 0.373292}, VapCp = {16, 102010, -531.68, 13.312, 0.00017105, -4.7837E-08}, LiqVis = {101, -12.084, 1011.7, 0.13186, -0.000000312, 2}, VapVis = {102, 6.7588E-07, 0.49876, 301.49, -1437, 0}, LiqK = {16, -0.13721, 56.65, -1.9542, 0.0024543, -0.0000043702}, VapK = {102, 0.000030176, 1.1642, -156.95, 161470, 0}, Racketparam = 0.255, UniquacR = 6.5207, UniquacQ = 5.548, ChaoSeadAF = 0.3571, ChaoSeadSP = 14380, ChaoSeadLV = 0.18225); +end TwoTwoFivetrimethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwoFourFourtetramethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoFourFourtetramethylpentane.mo new file mode 100644 index 0000000..0c36c55 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoFourFourtetramethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwoFourFourtetramethylpentane + extends General_Properties(SN = 244, name = "TwoTwoFourFourtetramethylpentane", CAS = "1070-87-7", Tc = 571.35, Pc = 2360870, Vc = 0.504, Cc = 0.263, Tb = 395.44, Tm = 206.95, TT = 206.95, TP = 1.83952, MW = 128.255, LVB = 0.17923, AF = 0.313609, SP = 14150, DM = 0, SH = -1209000000.0, IGHF = -2.41375E+08, GEF = 3.40159E+07, AS = 431496, HFMP = 9700000, HOC = -5.67978E+09, LiqDen = {105, 0.47711, 0.25904, 574.61, 0.26647, 0}, VP = {101, 136.5701, -9035.55, -17.5287, 0.0000167892, 2}, LiqCp = {16, 119280, 88.665, 9.3063, 0.010453, -0.0000091934}, HOV = {106, 5.75823E+07, 1.154086, -2.055247, 2.209851, -0.923166}, VapCp = {16, 122670, -599.26, 13.402, 0.000099085, -1.741E-08}, LiqVis = {101, -10.148, 1468.8, -0.33327, -0.0000013179, 2}, VapVis = {102, 5.8808E-07, 0.52306, 289.62, -2721.1, 0}, LiqK = {16, -0.038909, -2.6455, -1.623, -0.0006558, -0.0000013711}, VapK = {102, 0.000015165, 1.2696, -148.49, 133700, 0}, Racketparam = 0.263, UniquacR = 6.52, UniquacQ = 5.628, ChaoSeadAF = 0.313609, ChaoSeadSP = 14150, ChaoSeadLV = 0.17923); +end TwoTwoFourFourtetramethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwoFourtrimethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoFourtrimethylpentane.mo new file mode 100644 index 0000000..dcec2ac --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoFourtrimethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwoFourtrimethylpentane + extends General_Properties(SN = 157, name = "TwoTwoFourtrimethylpentane", CAS = "540-84-1", Tc = 543.9, Pc = 2570000, Vc = 0.4697, Cc = 0.266, Tb = 372.39, Tm = 165.777, TT = 165.777, TP = 0.0170695, MW = 114.231, LVB = 0.16607, AF = 0.304, SP = 14080, DM = 0, SH = -168070000.0, IGHF = -2.2401E+08, GEF = 1.394E+07, AS = 422960, HFMP = 9196000, HOC = -5.06528E+09, LiqDen = {105, 0.48523, 0.24924, 543.9, 0.25602, 0}, VP = {101, 83.71044, -6701.601, -9.312194, 6.808451E-06, 2}, LiqCp = {16, 159470, -380.54, 12.372, -0.00044236, 0.0000034887}, HOV = {106, 4.633E+07, 0.37451, -0.066775, -0.010135, 0.080832}, VapCp = {16, 84635, -470.35, 13.011, 0.00041124, -1.2926E-07}, LiqVis = {101, -22.241, 1365.6, 1.8379, -0.0000051189, 2}, VapVis = {102, 1.9933E-07, 0.67222, 163.02, -5306.3, 0}, LiqK = {16, 0.044744, -42.414, -1.7361, -0.0023225, -0.0000040597}, VapK = {102, 0.000011401, 1.3632, 286.23, 6065.2, 0}, Racketparam = 0, UniquacR = 5.85, UniquacQ = 4.94, ChaoSeadAF = 0.3033, ChaoSeadSP = 14050.5, ChaoSeadLV = 0.165452); +end TwoTwoFourtrimethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreeFourtetramethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreeFourtetramethylpentane.mo new file mode 100644 index 0000000..37886ab --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreeFourtetramethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwoThreeFourtetramethylpentane + extends General_Properties(SN = 243, name = "TwoTwoThreeFourtetramethylpentane", CAS = "1186-53-4", Tc = 592.7, Pc = 2530000, Vc = 0.49, Cc = 0.258, Tb = 406.18, Tm = 152.06, TT = 152.06, TP = 0.000053591, MW = 128.258, LVB = 0.179229, AF = 0.301, SP = 14730, DM = 0, SH = -1209000000.0, IGHF = -2.37358E+08, GEF = 3.26352E+07, AS = 452834, HFMP = 500000, HOC = -5.68208E+09, LiqDen = {105, 0.42889, 0.24425, 592.7, 0.24983, 0}, VP = {101, 137.07, -9700.5, -17.255, 0.000012062, 2}, LiqCp = {16, 177720, -50.337, 8.3416, 0.015008, -0.000013849}, HOV = {106, 5.771831E+07, 1.016576, -1.835135, 2.12911, -0.921819}, VapCp = {16, 83946, -465.16, 13.193, 0.000328, -9.6189E-08}, LiqVis = {101, -8.182, 1248.5, -0.55988, -2.1902E-07, 2}, VapVis = {102, 3.9083E-07, 0.57522, 220.52, -776.34, 0}, LiqK = {16, -0.045924, 4.3553, -1.6529, -0.00040588, -0.000001389}, VapK = {102, 0.000019408, 1.2262, -198.62, 159810, 0}, Racketparam = 0.258, UniquacR = 6.5199, UniquacQ = 5.544, ChaoSeadAF = 0.301, ChaoSeadSP = 14730, ChaoSeadLV = 0.179229); +end TwoTwoThreeFourtetramethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreeThreetetramethylbutane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreeThreetetramethylbutane.mo new file mode 100644 index 0000000..d7bfc09 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreeThreetetramethylbutane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwoThreeThreetetramethylbutane + extends General_Properties(SN = 238, name = "TwoTwoThreeThreetetramethylbutane", CAS = "594-82-1", Tc = 567.8, Pc = 2870000, Vc = 0.482, Cc = 0.28, Tb = 379.44, Tm = 373.84, TT = 373.96, TP = 86930.2, MW = 114.231, LVB = 0.13902, AF = 0.248, SP = 12790, DM = 0, SH = -1209000000.0, IGHF = -2.256E+08, GEF = 2.223E+07, AS = 389360, HFMP = 7540000, HOC = -5.0558E+09, LiqDen = {105, 0.61397, 0.27674, 567.8, 0.28198, 0}, VP = {101, 120.66, -8500.6, -14.863, 0.000010649, 2}, LiqCp = {16, 239620, 55.905, 3.1054, 0.027363, -0.000020376}, HOV = {106, 5.3062E+07, 0.30484, 0.85323, -1.2161, 0.48282}, VapCp = {16, 73914, -415.76, 12.897, 0.00056384, -1.6707E-07}, LiqVis = {101, -17.538, 1603.5, 0.8804, -0.0000034564, 2}, VapVis = {102, 7.9099E-07, 0.51128, 412.18, -5389.1, 0}, LiqK = {16, -0.0058143, -354.88, 0.79351, -0.0067293, 0.0000023134}, VapK = {102, 0.000012508, 1.3068, -132.52, 121650, 0}, Racketparam = 0.28, UniquacR = 5.8456, UniquacQ = 5.088, ChaoSeadAF = 0.248, ChaoSeadSP = 12790, ChaoSeadLV = 0.13902); +end TwoTwoThreeThreetetramethylbutane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreeThreetetramethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreeThreetetramethylpentane.mo new file mode 100644 index 0000000..4c02815 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreeThreetetramethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwoThreeThreetetramethylpentane + extends General_Properties(SN = 242, name = "TwoTwoThreeThreetetramethylpentane", CAS = "7154-79-2", Tc = 607.6, Pc = 2740000, Vc = 0.478, Cc = 0.269, Tb = 413.44, Tm = 263.26, TT = 263.26, TP = 133.839, MW = 128.258, LVB = 0.17034, AF = 0.304, SP = 15060, DM = 0, SH = -1209000000.0, IGHF = -2.36856E+08, GEF = 3.74E+07, AS = 436600, HFMP = 2300000, HOC = -5.68149E+09, LiqDen = {105, 0.58952, 0.28267, 607.6, 0.29572, 0}, VP = {101, 139.0487, -9535.451, -17.78617, 0.0000157521, 2}, LiqCp = {16, 116740, -86.104, 11.13, 0.0046308, -0.000003068}, HOV = {106, 5.3713E+07, 0.39899, -0.032998, 0.06374, -0.0535}, VapCp = {16, 55048, -357.31, 13.013, 0.00055209, -1.6211E-07}, LiqVis = {101, -9.7597, 1441.2, -0.37772, -0.000001226, 2}, VapVis = {102, 8.1934E-07, 0.48521, 356.82, -1384.3, 0}, LiqK = {16, -0.0045701, -120.11, -0.775, -0.0036256, 9.650699E-07}, VapK = {102, 0.000014917, 1.2661, -211.67, 155870, 0}, Racketparam = 0.269, UniquacR = 6.52, UniquacQ = 5.628, ChaoSeadAF = 0.304, ChaoSeadSP = 15060, ChaoSeadLV = 0.17034); +end TwoTwoThreeThreetetramethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreetrimethylbutane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreetrimethylbutane.mo new file mode 100644 index 0000000..5753cf6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreetrimethylbutane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwoThreetrimethylbutane + extends General_Properties(SN = 225, name = "TwoTwoThreetrimethylbutane", CAS = "464-06-2", Tc = 531.1, Pc = 2950000, Vc = 0.3976, Cc = 0.266, Tb = 354.01, Tm = 248.253, TT = 248.57, TP = 914.054, MW = 100.204, LVB = 0.14615, AF = 0.25, SP = 14250, DM = 0, SH = -1209000000.0, IGHF = -2.04765E+08, GEF = 4600000, AS = 383340, HFMP = 2261030, HOC = -4.45223E+09, LiqDen = {105, 0.36152, 0.20413, 531.16, 0.1958, 0}, VP = {101, 68.92285, -5729.492, -7.139255, 5.482993E-06, 2}, LiqCp = {16, 95157, -51.889, 10.538, 0.0057229, -0.0000043706}, HOV = {106, 4.4282E+07, 0.37696, 0.13995, -0.28638, 0.1473}, VapCp = {16, 64561, -425.21, 12.779, 0.00055174, -1.7221E-07}, LiqVis = {101, 15.143, 240.01, -4.2433, 0.0000080652, 2}, VapVis = {102, 8.5825E-08, 0.78963, 152.98, -29510, 0}, LiqK = {16, 0.044619, -214.12, 0.30167, -0.0096656, 0.0000053979}, VapK = {102, 0.000030164, 1.1874, -102.65, 141040, 0}, Racketparam = 0.266, UniquacR = 5.1719, UniquacQ = 4.468, ChaoSeadAF = 0.25, ChaoSeadSP = 14250, ChaoSeadLV = 0.14615); +end TwoTwoThreetrimethylbutane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreetrimethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreetrimethylpentane.mo new file mode 100644 index 0000000..3c2123c --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwoThreetrimethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwoThreetrimethylpentane + extends General_Properties(SN = 156, name = "TwoTwoThreetrimethylpentane", CAS = "564-02-3", Tc = 563.4, Pc = 2730000, Vc = 0.436, Cc = 0.254, Tb = 382.99, Tm = 160.89, TT = 160.89, TP = 0.0021759, MW = 114.231, LVB = 0.16043, AF = 0.298, SP = 14690, DM = 0, SH = -168070000.0, IGHF = -2.1995E+08, GEF = 1.7726E+07, AS = 423880, HFMP = 8619000, HOC = -5.06754E+09, LiqDen = {105, 0.53892, 0.263, 563.51, 0.24185, 0}, VP = {101, 87.50671, -7031.238, -9.863302, 7.128886E-06, 2}, LiqCp = {16, 170570, -194.18, 8.4382, 0.017272, -0.000019404}, HOV = {106, 6.030131E+07, 1.053957, -0.826185, 0.00124096, 0.214352}, VapCp = {16, 45546, -344.09, 12.853, 0.00059243, -1.8071E-07}, LiqVis = {101, -8.9806, 1118.5, -0.42179, 0.000001606, 2}, VapVis = {102, 4.6777E-07, 0.5509, 223.7, 10.797, 0}, LiqK = {16, -0.050146, 3.605, -1.5994, -0.00051269, -0.0000013443}, VapK = {102, 0.000016836, 1.25, -167.06, 132290, 0}, Racketparam = 0, UniquacR = 5.85, UniquacQ = 4.94, ChaoSeadAF = 0.2975, ChaoSeadSP = 14768.5, ChaoSeadLV = 0.160344); +end TwoTwoThreetrimethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylOnepropanol.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylOnepropanol.mo new file mode 100644 index 0000000..c0e6610 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylOnepropanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwodimethylOnepropanol + extends General_Properties(SN = 344, name = "TwoTwodimethylOnepropanol", CAS = "75-84-3", Tc = 552.7, Pc = 4078000, Vc = 0.327, Cc = 0.29, Tb = 386.25, Tm = 328.15, TT = 328.15, TP = 8050, MW = 88.1482, LVB = 0.1255, AF = 0.595013, SP = 19040, DM = 5.47E-30, SH = -216400000.0, IGHF = -3.021E+08, GEF = -1.4E+08, AS = 370000, HFMP = 3500000, HOC = -3.061E+09, LiqDen = {105, 0.88741, 0.29, 552.7, 0.28571, 0}, VP = {101, 192.4683, -12413.62, -25.59931, 0.0000246643, 2}, LiqCp = {16, 124850, 368.96, 4.9094, 0.027472, -0.00002893}, HOV = {106, 4.5224E+07, -1.2435, 2.138, 0.13988, -0.73989}, VapCp = {16, 72294.67, -550.0374, 12.86817, 0.000039202, -1.255351E-08}, LiqVis = {101, -12.693, 3446.8, -0.71456, 0.0000011322, 2}, VapVis = {102, 0.000021696, 0.15612, 1926.2, 5137.4, 0}, LiqK = {16, -0.11602, 10.416, -1.227, -0.00033355, -0.00000113}, VapK = {102, 1.2842E-07, 1.9773, -61.933, 2946, 0}, Racketparam = 0.29, UniquacR = 4.5972, UniquacQ = 4.284, ChaoSeadAF = 0.595013, ChaoSeadSP = 19040, ChaoSeadLV = 0.1255); +end TwoTwodimethylOnepropanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylbutane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylbutane.mo new file mode 100644 index 0000000..4cc35d9 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylbutane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwodimethylbutane + extends General_Properties(SN = 133, name = "TwoTwodimethylbutane", CAS = "75-83-2", Tc = 488.7, Pc = 3080000, Vc = 0.3591, Cc = 0.272, Tb = 322.87, Tm = 174.28, TT = 174.28, TP = 4.0748, MW = 86.177, LVB = 0.13373, AF = 0.233, SP = 13770, DM = 0, SH = -168070000.0, IGHF = -1.8468E+08, GEF = -8745000, AS = 358340, HFMP = 579100, HOC = -3.8411E+09, LiqDen = {105, 0.68727, 0.26184, 489.01, 0.26217, 0}, VP = {101, 94.2252, -6117.857, -11.25759, 0.0000123761, 2}, LiqCp = {16, 117360, -28.344, 9.2143, 0.0086854, -0.00000596}, HOV = {106, 5.850808E+07, 1.595989, -1.437803, 0.0287957, 0.293443}, VapCp = {16, 73375, -521.55, 12.775, 0.00038975, -1.1854E-07}, LiqVis = {101, 22.562, -455.85, -5.0804, -5.7101E-07, 2}, VapVis = {102, 1.9362E-07, 0.68259, 102.35, -10.082, 0}, LiqK = {16, -0.038291, 4.8824, -1.6311, -0.00047294, -0.0000023877}, VapK = {102, 0.00018521, 0.9549, 83.825, 174320, 0}, Racketparam = 0, UniquacR = 4.4983, UniquacQ = 3.932, ChaoSeadAF = 0.23385, ChaoSeadSP = 13771.5, ChaoSeadLV = 0.133712); +end TwoTwodimethylbutane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylheptane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylheptane.mo new file mode 100644 index 0000000..1a493f3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylheptane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwodimethylheptane + extends General_Properties(SN = 250, name = "TwoTwodimethylheptane", CAS = "1071-26-7", Tc = 577.8, Pc = 2350000, Vc = 0.525, Cc = 0.257, Tb = 405.97, Tm = 160.15, TT = 160.15, TP = 0.000152983, MW = 128.258, LVB = 0.18151, AF = 0.383, SP = 14720, DM = 0, SH = -1209000000.0, IGHF = -2.461E+08, GEF = 1.79E+07, AS = 471800, HFMP = 8900000, HOC = -5.672E+09, LiqDen = {105, 0.19929, 0.16944, 577.8, 0.19098, 0}, VP = {101, 173.1768, -10891.65, -23.04354, 0.0000217483, 2}, LiqCp = {16, 188490, -126.2, 10.161, 0.0065361, -0.0000033154}, HOV = {106, 5.677584E+07, 0.420266, 0.0606766, -0.058971, -0.0565229}, VapCp = {16, 119340, -582.53, 13.386, 0.000067675, -2.1229E-08}, LiqVis = {101, -11.654, 1250.4, 0.03445, -6.0618E-08, 2}, VapVis = {102, 8.0205E-07, 0.4765, 340.6, -3260.3, 0}, LiqK = {16, -0.04961, 4.5364, -1.657, -0.00038774, -0.0000014465}, VapK = {102, 0.000023582, 1.1966, -148.34, 144910, 0}, Racketparam = 0.257, UniquacR = 6.5215, UniquacQ = 5.552, ChaoSeadAF = 0.383, ChaoSeadSP = 14720, ChaoSeadLV = 0.18151); +end TwoTwodimethylheptane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylhexane.mo new file mode 100644 index 0000000..883903d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwodimethylhexane + extends General_Properties(SN = 230, name = "TwoTwodimethylhexane", CAS = "590-73-8", Tc = 549.8, Pc = 2530000, Vc = 0.478, Cc = 0.265, Tb = 379.99, Tm = 151.97, TT = 151.97, TP = 0.000215228, MW = 114.231, LVB = 0.16529, AF = 0.339, SP = 14580, DM = 0, SH = -1209000000.0, IGHF = -2.24723E+08, GEF = 1.0711E+07, AS = 432710, HFMP = 6778080, HOC = -5.06247E+09, LiqDen = {105, 0.54681, 0.26386, 549.8, 0.27774, 0}, VP = {101, 94.06922, -7328.821, -10.84298, 7.99047E-06, 2}, LiqCp = {16, 125360, 373.89, 5.844, 0.022419, -0.00002308}, HOV = {106, 6.211522E+07, 1.000418, -0.588989, -0.277913, 0.313577}, VapCp = {16, 97647, -528.4, 13.112, 0.00027844, -9.0187E-08}, LiqVis = {101, -11.328, 1166.6, -0.039718, 2.6889E-07, 2}, VapVis = {102, 0.0000018535, 0.38476, 528.24, 78.686, 0}, LiqK = {16, -0.03878, 5.2314, -1.6985, -0.00038448, -0.000001806}, VapK = {102, 0.000045965, 1.1142, -113.91, 162780, 0}, Racketparam = 0.265, UniquacR = 5.8471, UniquacQ = 5.012, ChaoSeadAF = 0.339, ChaoSeadSP = 14580, ChaoSeadLV = 0.16529); +end TwoTwodimethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethyloctane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethyloctane.mo new file mode 100644 index 0000000..4099faf --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethyloctane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwodimethyloctane + extends General_Properties(SN = 252, name = "TwoTwodimethyloctane", CAS = "15869-87-1", Tc = 602.4, Pc = 2110000, Vc = 0.5897, Cc = 0.248, Tb = 430.05, Tm = 0, TT = 0, TP = 0, MW = 142.282, LVB = 0.197405, AF = 0.428759, SP = 14870, DM = 0, SH = -1209000000.0, IGHF = -2.67E+08, GEF = 2.6E+07, AS = 511000, HFMP = 1.7E+07, HOC = -6.281E+09, LiqDen = {105, 0.27519, 0.20873, 602.4, 0.22241, 0}, VP = {101, 128.2162, -9736.787, -15.87938, 0.0000121145, 2}, LiqCp = {16, 130180, 214, 8.9638, 0.010626, -0.0000085091}, HOV = {106, 6.2139E+07, 0.81955, -1.4728, 1.7846, -0.74179}, VapCp = {16, 133300, -582.81, 13.49, 0.000049115, -1.5637E-08}, LiqVis = {101, -12.132, 1337.2, 0.10372, -1.6576E-07, 2}, VapVis = {102, 6.6483E-07, 0.48953, 292.37, 276.07, 0}, LiqK = {16, -0.054905, -9.2849, -1.513, -0.00077582, -8.6839E-07}, VapK = {102, 0.000023992, 1.186, -157.89, 154490, 0}, Racketparam = 0.248, UniquacR = 7.1959, UniquacQ = 6.092, ChaoSeadAF = 0.428759, ChaoSeadSP = 14870, ChaoSeadLV = 0.197405); +end TwoTwodimethyloctane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylpentane.mo new file mode 100644 index 0000000..58a99ef --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwoTwodimethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwoTwodimethylpentane + extends General_Properties(SN = 221, name = "TwoTwodimethylpentane", CAS = "590-35-2", Tc = 520.4, Pc = 2770000, Vc = 0.4158, Cc = 0.266, Tb = 352.32, Tm = 149.34, TT = 149.34, TP = 0.00317517, MW = 100.204, LVB = 0.14967, AF = 0.287, SP = 14260, DM = 0, SH = -1209000000.0, IGHF = -2.06146E+08, GEF = 550000, AS = 392580, HFMP = 5824000, HOC = -4.45048E+09, LiqDen = {105, 0.5639, 0.25328, 520.51, 0.25578, 0}, VP = {101, 85.15112, -6377.959, -9.646055, 8.426861E-06, 2}, LiqCp = {16, 129920, -35.818, 9.4637, 0.0091865, -0.0000074351}, HOV = {106, 5.34663E+07, 0.794603, -0.00994342, -0.969824, 0.623819}, VapCp = {16, 80553, -507.91, 12.99, 0.00027095, -7.6982E-08}, LiqVis = {101, -24.348, 1370.4, 2.2619, -0.0000092505, 2}, VapVis = {102, 3.1425E-07, 0.61072, 160.83, 5436.3, 0}, LiqK = {16, -0.052706, 3.783, -1.5822, -0.00046167, -0.0000017248}, VapK = {102, 0.000010009, 1.3247, -199.43, 115550, 0}, Racketparam = 0.266, UniquacR = 5.1727, UniquacQ = 4.472, ChaoSeadAF = 0.287, ChaoSeadSP = 14260, ChaoSeadLV = 0.14967); +end TwoTwodimethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twobutanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Twobutanol.mo new file mode 100644 index 0000000..bde5092 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twobutanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twobutanol + extends General_Properties(SN = 96, name = "Twobutanol", CAS = "78-92-2", Tc = 536.05, Pc = 4179000, Vc = 0.269, Cc = 0.252, Tb = 372.66, Tm = 158.45, TT = 158.45, TP = 3.16526E-06, MW = 74.123, LVB = 0.09235, AF = 0.574, SP = 22620, DM = 5.54E-30, SH = -134990000.0, IGHF = -2.929E+08, GEF = -1.696E+08, AS = 364690, HFMP = 5971000, HOC = -2.4408E+09, LiqDen = {105, 0.65041, 0.21558, 536.05, 0.22084, 0}, VP = {101, 145.55, -10811, -17.957, 0.0000094132, 2}, LiqCp = {16, 68513, 631.42, 2.7425, 0.03164, -0.000028572}, HOV = {106, 9.123771E+07, 1.779726, -3.389854, 3.546493, -1.385264}, VapCp = {16, 70319, -564.51, 12.517, 0.00018661, -6.3166E-08}, LiqVis = {101, 19.329, 3026.9, -6.6532, 0.000029986, 2}, VapVis = {102, 1.3231E-07, 0.76798, 139.73, -4888.6, 0}, LiqK = {16, 0.031711, -158.34, -0.24491, -0.0057475, 0.000002591}, VapK = {102, 0.0000011661, 1.7056, 340.33, -60553, 0}, Racketparam = 0, UniquacR = 3.4535, UniquacQ = 3.048, ChaoSeadAF = 0.571133, ChaoSeadSP = 22629.5, ChaoSeadLV = 0.0921178); +end Twobutanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twoethylmxylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Twoethylmxylene.mo new file mode 100644 index 0000000..e3653f7 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twoethylmxylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twoethylmxylene + extends General_Properties(SN = 300, name = "Twoethylmxylene", CAS = "2870-04-4", Tc = 670, Pc = 2960000, Vc = 0.446, Cc = 0.261, Tb = 463.19, Tm = 257, TT = 256.89, TP = 2.81505, MW = 134.218, LVB = 0.151424, AF = 0.405, SP = 18140, DM = 0, SH = -1209000000.0, IGHF = -2.623E+07, GEF = 1.379E+08, AS = 421000, HFMP = 1.471E+07, HOC = -5.548E+09, LiqDen = {105, 0.55372, 0.25979, 670, 0.29804, 0}, VP = {101, 101.54, -9425, -11.552, 0.0000057989, 2}, LiqCp = {16, 77646, -101.26, 11.392, 0.0045401, -0.0000038677}, HOV = {106, 8.2672E+07, 1.1027, -0.68529, -0.33367, 0.36103}, VapCp = {16, 80902, -471.57, 13.059, 0.00022749, -9.0171E-08}, LiqVis = {101, -15.587, 1737.4, 0.54173, -0.0000007502, 2}, VapVis = {102, 0.0000044354, 0.29008, 895.67, 100.88, 0}, LiqK = {16, -0.038284, -32.06, -1.2755, -0.0012699, -0.0000004068}, VapK = {102, 0.000097738, 1.031, 536.66, 42862, 0}, Racketparam = 0.261, UniquacR = 6.0672, UniquacQ = 4.644, ChaoSeadAF = 0.405, ChaoSeadSP = 18140, ChaoSeadLV = 0.151424); +end Twoethylmxylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twoethylpxylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Twoethylpxylene.mo new file mode 100644 index 0000000..4f413c0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twoethylpxylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twoethylpxylene + extends General_Properties(SN = 301, name = "Twoethylpxylene", CAS = "1758-88-9", Tc = 680, Pc = 3380000, Vc = 0.461, Cc = 0.252, Tb = 460.09, Tm = 219, TT = 219.52, TP = 0.0748611, MW = 134.218, LVB = 0.153715, AF = 0.36, SP = 17610, DM = 0, SH = -1209000000.0, IGHF = -3.218E+07, GEF = 1.273E+08, AS = 436600, HFMP = 1.519E+07, HOC = -5.543E+09, LiqDen = {105, 0.15639, 0.13957, 680, 0.19566, 0}, VP = {101, 51.35796, -7093.865, -3.98884, 0.0000002143, 2}, LiqCp = {16, 115180, -69.179, 10.574, 0.0065199, -0.0000055164}, HOV = {106, 8.269938E+07, 2.580922, -6.4761, 7.125795, -2.740318}, VapCp = {16, 90693, -533.27, 13.139, 0.00014143, -6.0863E-08}, LiqVis = {101, -12.139, 1509, 0.050995, -2.3531E-08, 2}, VapVis = {102, 0.0000010483, 0.4491, 412.22, -1561.4, 0}, LiqK = {16, -0.080449, 4.7926, -1.4191, -0.00032019, -9.3368E-07}, VapK = {102, 0.000085732, 1.0445, 516.18, 46622, 0}, Racketparam = 0.252, UniquacR = 6.0672, UniquacQ = 4.644, ChaoSeadAF = 0.36, ChaoSeadSP = 17610, ChaoSeadLV = 0.153715); +end Twoethylpxylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twoheptanone.mo b/Simulator/Simulator/Files/Chemsep_Database/Twoheptanone.mo new file mode 100644 index 0000000..250a4e0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twoheptanone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twoheptanone + extends General_Properties(SN = 313, name = "Twoheptanone", CAS = "110-43-0", Tc = 611.55, Pc = 2920000, Vc = 0.421, Cc = 0.251, Tb = 424.05, Tm = 238.15, TT = 238.15, TP = 3.54477, MW = 114.185, LVB = 0.140675, AF = 0.418982, SP = 17400, DM = 8.71E-30, SH = -1209000000.0, IGHF = -3.00453E+08, GEF = -1.21796E+08, AS = 456893, HFMP = 1.84E+07, HOC = -4.09952E+09, LiqDen = {105, 0.42296, 0.21673, 611.55, 0.2517, 0}, VP = {101, 104.1321, -8934.299, -12.02629, 6.758209E-06, 2}, LiqCp = {16, 168580, 759.37, 3.3604, 0.023088, -0.000017848}, HOV = {106, 6.522658E+07, 0.472207, 0.238382, -0.54369, 0.222217}, VapCp = {16, 119760, -702.71, 13.229, -0.000074262, -4.5595E-08}, LiqVis = {101, -9.5709, 1186.6, -0.30187, 0.0000013185, 2}, VapVis = {102, 1.5766E-07, 0.71212, 201.61, -8396.4, 0}, LiqK = {16, 0.061916, -162.99, -0.59984, -0.0044095, -0.0000013415}, VapK = {102, 2047.3, 1.0324, 2.297E+10, 7.8096E+08, 0}, Racketparam = 0.251, UniquacR = 5.2711, UniquacQ = 4.496, ChaoSeadAF = 0.418982, ChaoSeadSP = 17400, ChaoSeadLV = 0.140675); +end Twoheptanone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twohexanone.mo b/Simulator/Simulator/Files/Chemsep_Database/Twohexanone.mo new file mode 100644 index 0000000..e13c831 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twohexanone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twohexanone + extends General_Properties(SN = 312, name = "Twohexanone", CAS = "591-78-6", Tc = 587, Pc = 3320000, Vc = 0.378, Cc = 0.254, Tb = 400.7, Tm = 217.35, TT = 217.35, TP = 1.44559, MW = 100.161, LVB = 0.1241, AF = 0.393, SP = 17600, DM = 8.94E-30, SH = -1209000000.0, IGHF = -2.79826E+08, GEF = -1.30081E+08, AS = 417856, HFMP = 1.49E+07, HOC = -3.49E+09, LiqDen = {105, 0.58528, 0.23872, 587.62, 0.26191, 0}, VP = {101, 81.22606, -7467.987, -8.650385, 4.736711E-06, 2}, LiqCp = {16, 171430, 304.46, 6.7554, 0.010928, -0.0000044198}, HOV = {106, 8.140665E+07, 1.724728, -1.991428, 0.65901, 0.10235}, VapCp = {16, 101950, -647, 12.874, 0.00017699, -1.3836E-07}, LiqVis = {101, -9.5407, 1129.1, -0.30673, 6.1273E-07, 2}, VapVis = {102, 1.7562E-07, 0.7037, 196.23, -7085.8, 0}, LiqK = {16, -0.0056603, -27.398, -1.2811, -0.0017572, -3.9285E-07}, VapK = {102, -0.96934, 0.03859, -1883.3, -1.1142E+07, 0}, Racketparam = 0.254, UniquacR = 4.5967, UniquacQ = 3.956, ChaoSeadAF = 0.393, ChaoSeadSP = 17600, ChaoSeadLV = 0.1241); +end Twohexanone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnebutanol.mo b/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnebutanol.mo new file mode 100644 index 0000000..6369880 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnebutanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwomethylOnebutanol + extends General_Properties(SN = 343, name = "TwomethylOnebutanol", CAS = "137-32-6", Tc = 575.4, Pc = 3940000, Vc = 0.329, Cc = 0.271, Tb = 401.85, Tm = 195, TT = 195, TP = 0.000803, MW = 88.148, LVB = 0.1083, AF = 0.587733, SP = 22080, DM = 6.27E-30, SH = -216400000.0, IGHF = -3.0209E+08, GEF = -1.41E+08, AS = 386900, HFMP = 7430000, HOC = -3.062E+09, LiqDen = {105, 0.88123, 0.27569, 576.16, 0.26459, 0}, VP = {101, 169.4054, -12535.91, -21.44821, 0.000011664, 2}, LiqCp = {16, 64512, -115.41, 11.54, 0.0018322, 0.0000027168}, HOV = {106, 1.7446E+08, 5.4789, -13.886, 15.653, -6.6531}, VapCp = {16, 76232, -567.6, 12.811, 0.000074113, -1.3012E-08}, LiqVis = {101, 0.00893998, 2796.534, -2.732303, 0.0000087109, 2}, VapVis = {102, 0.000000189, 0.70643, 185.92, -6046.6, 0}, LiqK = {16, 0.080313, -215.29, -0.17577, -0.0076457, 0.000003672}, VapK = {102, 1262.3, 0.94565, 7.7547E+09, -2.8418E+11, 0}, Racketparam = 0.271, UniquacR = 4.5979, UniquacQ = 4.204, ChaoSeadAF = 0.587733, ChaoSeadSP = 22080, ChaoSeadLV = 0.1083); +end TwomethylOnebutanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnebutene.mo b/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnebutene.mo new file mode 100644 index 0000000..b11683f --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnebutene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwomethylOnebutene + extends General_Properties(SN = 105, name = "TwomethylOnebutene", CAS = "563-46-2", Tc = 465, Pc = 3447000, Vc = 0.292, Cc = 0.26, Tb = 304.305, Tm = 135.578, TT = 135.578, TP = 0.0205382, MW = 70.1329, LVB = 0.10872, AF = 0.234056, SP = 14700, DM = 1.7E-30, SH = -134990000.0, IGHF = -3.53E+07, GEF = 6.668E+07, AS = 339500, HFMP = 7910700, HOC = -3.1159E+09, LiqDen = {105, 0.91622, 0.26752, 465, 0.28165, 0}, VP = {101, 77.29304, -5304.146, -8.607604, 9.513458E-06, 2}, LiqCp = {16, 121560, 527.31, 1.2291, 0.036295, -0.000037525}, HOV = {106, 4.6374E+07, 1.4214, -2.5789, 2.5516, -0.95454}, VapCp = {16, 81218, -803.24, 13.077, -0.00034159, 9.7536E-08}, LiqVis = {101, -10.065, 690.04, -0.13044, 0.0000004745, 2}, VapVis = {102, 5.0873E-07, 0.55006, 197.77, -68.455, 0}, LiqK = {16, -0.024046, 2.4654, -1.5931, -0.00074325, -0.0000024745}, VapK = {102, 0.00018088, 0.94101, 77.857, 153680, 0}, Racketparam = 0.270022, UniquacR = 3.5939, UniquacQ = 3.224, ChaoSeadAF = 0.228663, ChaoSeadSP = 14695.4, ChaoSeadLV = 0.10868); +end TwomethylOnebutene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwomethylOneheptene.mo b/Simulator/Simulator/Files/Chemsep_Database/TwomethylOneheptene.mo new file mode 100644 index 0000000..18b1c6a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwomethylOneheptene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwomethylOneheptene + extends General_Properties(SN = 420, name = "TwomethylOneheptene", CAS = "15870-10-7", Tc = 564, Pc = 2400000, Vc = 0.497, Cc = 0.25, Tb = 392.37, Tm = 185.78, TT = 185.77, TP = 0.113498, MW = 112.213, LVB = 0.156655, AF = 0.35513, SP = 15180, DM = 0, SH = -61100000.0, IGHF = -9.699E+07, GEF = 9.32E+07, AS = 457800, HFMP = 1.44E+07, HOC = -4.948E+09, LiqDen = {105, 0.53765, 0.25476, 567.01, 0.28376, 0}, VP = {101, 108.46, -8257.2, -12.941, 0.0000091062, 2}, LiqCp = {16, 88257, 855.11, 3.1929, 0.026245, -0.000022451}, HOV = {106, 5.8021E+07, 1.4711, -3.336, 3.8018, -1.5579}, VapCp = {16, 92500, -450.54, 12.712, 0.00068864, -3.0334E-07}, LiqVis = {101, -34.674, 1655.3, 3.8693, -0.0000085602, 2}, VapVis = {102, 5.7686E-07, 0.51551, 255.32, -429.98, 0}, LiqK = {16, -0.0714, 1.7767, -1.4729, -0.00055517, -0.0000010492}, VapK = {102, 0.00085233, 0.71803, 81.386, 330930, 0}, Racketparam = 0.25, UniquacR = 5.6171, UniquacQ = 4.844, ChaoSeadAF = 0.35513, ChaoSeadSP = 15180, ChaoSeadLV = 0.156655); +end TwomethylOneheptene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnepentene.mo b/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnepentene.mo new file mode 100644 index 0000000..c58ca70 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnepentene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwomethylOnepentene + extends General_Properties(SN = 262, name = "TwomethylOnepentene", CAS = "763-29-1", Tc = 507, Pc = 3160000, Vc = 0.359, Cc = 0.261, Tb = 335.26, Tm = 137.43, TT = 137.42, TP = 0.000805463, MW = 84.1595, LVB = 0.124649, AF = 0.261138, SP = 15070, DM = 1.89E-30, SH = -1209000000.0, IGHF = -5.22581E+07, GEF = 7.2969E+07, AS = 374000, HFMP = 7029120, HOC = -3.72209E+09, LiqDen = {105, 0.13372, 0.11276, 507, 0.1472, 0}, VP = {101, 85.161, -6171.1, -9.6632, 0.0000085639, 2}, LiqCp = {16, 173630, -41311, 386.78, -1.1602, 0.0012063}, HOV = {106, 5.397303E+07, 1.23932, -1.433928, 0.797889, -0.142823}, VapCp = {16, 92049, -683.66, 13.009, -0.000089454, 1.0969E-08}, LiqVis = {101, -11.406, 797.71, 0.099228, -5.3373E-07, 2}, VapVis = {102, 6.3076E-07, 0.52447, 272.22, -3046.8, 0}, LiqK = {16, -0.026056, 4.3913, -1.6749, -0.00048682, -0.0000023385}, VapK = {102, 0.000074858, 1.0485, -32.169, 140340, 0}, Racketparam = 0.261, UniquacR = 4.2689, UniquacQ = 3.64, ChaoSeadAF = 0.261138, ChaoSeadSP = 15070, ChaoSeadLV = 0.124649); +end TwomethylOnepentene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnepropanol.mo b/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnepropanol.mo new file mode 100644 index 0000000..a35ab0e --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwomethylOnepropanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwomethylOnepropanol + extends General_Properties(SN = 95, name = "TwomethylOnepropanol", CAS = "78-83-1", Tc = 547.78, Pc = 4300000, Vc = 0.273, Cc = 0.258, Tb = 381.04, Tm = 165.15, TT = 165.15, TP = 2.46096E-06, MW = 74.123, LVB = 0.09291, AF = 0.59, SP = 22900, DM = 5.47E-30, SH = -134990000.0, IGHF = -2.832E+08, GEF = -1.549E+08, AS = 348000, HFMP = 6322000, HOC = -2.449E+09, LiqDen = {105, 0.80194, 0.24515, 547.81, 0.21175, 0}, VP = {101, 174.0368, -12288.81, -22.23928, 0.0000131856, 2}, LiqCp = {16, 114500, 844.65, -3.6753, 0.058766, -0.000062464}, HOV = {106, 6.1411E+07, -0.67703, 2.6884, -2.3416, 0.75942}, VapCp = {16, 20857, -275.26, 12.137, 0.00070478, -0.0000002462}, LiqVis = {101, -107.9662, 6199.736, 14.5721, -0.000017552, 2}, VapVis = {102, 7.9881E-07, 0.52424, 295.54, 17281, 0}, LiqK = {16, -0.27685, 36.722, -1.0689, 0.00066056, -0.0000014048}, VapK = {102, 2189.9, 0.91222, 1.1244E+10, -5.1003E+11, 0}, Racketparam = 0, UniquacR = 3.4535, UniquacQ = 3.048, ChaoSeadAF = 0.592, ChaoSeadSP = 23750.6, ChaoSeadLV = 0.0930277); +end TwomethylOnepropanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwomethylThreeethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/TwomethylThreeethylpentane.mo new file mode 100644 index 0000000..07a109b --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwomethylThreeethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwomethylThreeethylpentane + extends General_Properties(SN = 236, name = "TwomethylThreeethylpentane", CAS = "609-26-7", Tc = 567, Pc = 2700000, Vc = 0.4453, Cc = 0.254, Tb = 388.81, Tm = 158.2, TT = 158.2, TP = 0.000447428, MW = 114.231, LVB = 0.15972, AF = 0.331, SP = 15140, DM = 0, SH = -1209000000.0, IGHF = -2.11208E+08, GEF = 1.87861E+07, AS = 443760, HFMP = 1.13386E+07, HOC = -5.07477E+09, LiqDen = {105, 0.54567, 0.26412, 567.03, 0.24308, 0}, VP = {101, 92.12933, -7403.468, -10.51119, 7.396006E-06, 2}, LiqCp = {16, 11076, -131.1, 12.479, 0.0013888, -7.3844E-07}, HOV = {106, 5.9697E+07, 0.73134, 0.033175, -0.91459, 0.58962}, VapCp = {16, 86476, -441, 12.894, 0.00051253, -1.9205E-07}, LiqVis = {101, -10.931, 1059.8, -0.066598, 1.3283E-07, 2}, VapVis = {102, 5.6587E-07, 0.52506, 255.1, -76.481, 0}, LiqK = {16, -0.069311, 4.0311, -1.5221, -0.00039448, -0.0000012799}, VapK = {102, 0.000026967, 1.1845, -133.92, 140280, 0}, Racketparam = 0.254, UniquacR = 5.847, UniquacQ = 4.928, ChaoSeadAF = 0.331, ChaoSeadSP = 15140, ChaoSeadLV = 0.15972); +end TwomethylThreeethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwomethylTwobutanol.mo b/Simulator/Simulator/Files/Chemsep_Database/TwomethylTwobutanol.mo new file mode 100644 index 0000000..64864ef --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwomethylTwobutanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwomethylTwobutanol + extends General_Properties(SN = 194, name = "TwomethylTwobutanol", CAS = "75-85-4", Tc = 545, Pc = 3790000, Vc = 0.323, Cc = 0.27, Tb = 375.15, Tm = 264.35, TT = 264.35, TP = 161.196, MW = 88.15, LVB = 0.1095, AF = 0.478, SP = 20840, DM = 5.67E-30, SH = -168070000.0, IGHF = -3.297E+08, GEF = -1.652E+08, AS = 362800, HFMP = 4456000, HOC = -3.0391E+09, LiqDen = {105, 0.71131, 0.24603, 545, 0.25077, 0}, VP = {101, 111.96, -9620.4, -12.673, 0.0000022964, 2}, LiqCp = {16, 145240, -80.948, 10.283, 0.0042992, 0.0000021924}, HOV = {106, 1.022286E+08, 1.245977, -0.515176, -0.350588, 0.262112}, VapCp = {16, 74328, -529.61, 12.79, 0.000073612, -9.0525E-09}, LiqVis = {101, -783.84, 31606, 120.39, -0.00015466, 2}, VapVis = {102, 1.8945E-07, 0.71394, 173.97, -1855.4, 0}, LiqK = {16, 0.052544, -120.78, -0.20746, -0.0081579, 0.0000039201}, VapK = {102, 1156.2, 0.93842, 5.9829E+09, -1.5337E+11, 0}, Racketparam = 0.248616, UniquacR = 4.5972, UniquacQ = 4.284, ChaoSeadAF = 0.478, ChaoSeadSP = 20840, ChaoSeadLV = 0.1095); +end TwomethylTwobutanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwomethylTwobutene.mo b/Simulator/Simulator/Files/Chemsep_Database/TwomethylTwobutene.mo new file mode 100644 index 0000000..c392ab8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwomethylTwobutene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwomethylTwobutene + extends General_Properties(SN = 107, name = "TwomethylTwobutene", CAS = "513-35-9", Tc = 470, Pc = 3860000, Vc = 0.292, Cc = 0.288, Tb = 311.7, Tm = 139.39, TT = 139.39, TP = 0.01937, MW = 70.134, LVB = 0.10757, AF = 0.339, SP = 15210, DM = 1.13E-30, SH = -27600000.0, IGHF = -4.18E+07, GEF = 6.045E+07, AS = 338600, HFMP = 7597700, HOC = -3.1088E+09, LiqDen = {105, 0.93623, 0.2731, 470, 0.25849, 0}, VP = {101, 82.2327, -5590.502, -9.366663, 0.0000104545, 2}, LiqCp = {16, 127040, 1071.7, -7.883, 0.075072, -0.000089164}, HOV = {106, 4.3456E+07, 0.64226, -0.070051, -0.5395, 0.35656}, VapCp = {16, 75343, -774.17, 12.975, -0.00022009, 6.0763E-08}, LiqVis = {101, -11.234, 703.42, 0.094871, -0.0000017625, 2}, VapVis = {102, 8.6256E-07, 0.47637, 263.56, -2475.7, 0}, LiqK = {16, -0.050847, 3.0532, -1.4724, -0.00063704, -0.0000020121}, VapK = {102, 0.00020806, 0.92265, 107.34, 175680, 0}, Racketparam = 0.260813, UniquacR = 3.5919, UniquacQ = 3.22, ChaoSeadAF = 0.27667, ChaoSeadSP = 15247.2, ChaoSeadLV = 0.106707); +end TwomethylTwobutene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/TwomethylTwopropanol.mo b/Simulator/Simulator/Files/Chemsep_Database/TwomethylTwopropanol.mo new file mode 100644 index 0000000..9ce488a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/TwomethylTwopropanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model TwomethylTwopropanol + extends General_Properties(SN = 97, name = "TwomethylTwopropanol", CAS = "75-65-0", Tc = 506.21, Pc = 3973000, Vc = 0.275, Cc = 0.26, Tb = 355.49, Tm = 298.97, TT = 298.97, TP = 5884.28, MW = 74.123, LVB = 0.09488, AF = 0.613, SP = 21620, DM = 5.57E-30, SH = -134990000.0, IGHF = -3.124E+08, GEF = -1.776E+08, AS = 326300, HFMP = 6703000, HOC = -2.4239E+09, LiqDen = {105, 0.40838, 0.17034, 508.88, 0.1974, 0}, VP = {101, 196.8976, -12439.78, -26.03107, 0.0000198743, 2}, LiqCp = {16, -158220, -166.8, 13.168, 0.0013959, -0.0000019876}, HOV = {106, 9.49928E+07, 1.077392, -0.185452, -0.822732, 0.535399}, VapCp = {16, 65560, -540.88, 12.558, 0.00014695, -5.2324E-08}, LiqVis = {101, -933.24, 39184, 142.25, -0.0001583, 2}, VapVis = {102, 2.5934E-07, 0.64853, 136.6, 9124.5, 0}, LiqK = {16, 0.0056947, 358.71, -5.5774, 0.012913, -0.000018273}, VapK = {102, 4.2365E-07, 1.7929, -130.93, 17989, 0}, Racketparam = 0, UniquacR = 3.4528, UniquacQ = 3.128, ChaoSeadAF = 0.612, ChaoSeadSP = 21491.8, ChaoSeadLV = 0.0948614); +end TwomethylTwopropanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twomethylheptane.mo b/Simulator/Simulator/Files/Chemsep_Database/Twomethylheptane.mo new file mode 100644 index 0000000..06ed32d --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twomethylheptane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twomethylheptane + extends General_Properties(SN = 226, name = "Twomethylheptane", CAS = "592-27-8", Tc = 559.6, Pc = 2480000, Vc = 0.4882, Cc = 0.26, Tb = 390.8, Tm = 164.16, TT = 164.16, TP = 0.0010587, MW = 114.231, LVB = 0.16463, AF = 0.378, SP = 15050, DM = 0, SH = -1209000000.0, IGHF = -2.154E+08, GEF = 1.18E+07, AS = 459570, HFMP = 1.1878E+07, HOC = -5.06933E+09, LiqDen = {105, 0.40246, 0.22797, 559.66, 0.23428, 0}, VP = {101, 97.9971, -7746.664, -11.37588, 8.143433E-06, 2}, LiqCp = {16, 66821, 33.207, 11.285, 0.0021902, 8.6142E-07}, HOV = {106, 6.657838E+07, 1.352117, -1.871983, 1.354613, -0.391149}, VapCp = {16, 108850, -612.4, 13.327, -0.0000091854, -2.9587E-09}, LiqVis = {101, -7.3762, 968.16, -0.65227, 0.0000018143, 2}, VapVis = {102, 4.5347E-07, 0.55194, 231.19, -1256.6, 0}, LiqK = {16, -0.00038221, 38.981, -2.075, 0.00062625, -0.0000038423}, VapK = {102, 0.000048089, 1.0964, -142.76, 170130, 0}, Racketparam = 0.26, UniquacR = 5.8478, UniquacQ = 4.932, ChaoSeadAF = 0.378, ChaoSeadSP = 15050, ChaoSeadLV = 0.16463); +end Twomethylheptane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twomethylhexane.mo b/Simulator/Simulator/Files/Chemsep_Database/Twomethylhexane.mo new file mode 100644 index 0000000..9b3d4b7 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twomethylhexane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twomethylhexane + extends General_Properties(SN = 218, name = "Twomethylhexane", CAS = "591-76-4", Tc = 530.1, Pc = 2730000, Vc = 0.421, Cc = 0.261, Tb = 363.18, Tm = 154.9, TT = 154.9, TP = 0.00429886, MW = 100.204, LVB = 0.1486, AF = 0.331, SP = 14730, DM = 0, SH = -1209000000.0, IGHF = -1.9472E+08, GEF = 3470000, AS = 420410, HFMP = 9184000, HOC = -4.45935E+09, LiqDen = {105, 0.4821, 0.23526, 530.41, 0.23824, 0}, VP = {101, 90.20617, -6876.202, -10.31895, 8.219062E-06, 2}, LiqCp = {16, 142210, 82.605, 8.5784, 0.010085, -0.000006336}, HOV = {106, 4.861947E+07, 0.640142, -0.832218, 0.945728, -0.370956}, VapCp = {16, 88324, -552.27, 13.044, 0.00017909, -6.2753E-08}, LiqVis = {101, -10.237, 971.42, -0.18335, 0.0000010057, 2}, VapVis = {102, 0.0000041509, 0.28637, 700.76, 14523, 0}, LiqK = {16, 0.060786, 305.44, -6.3461, 0.018265, -0.000033419}, VapK = {102, 0.000062491, 1.0749, -62.587, 153720, 0}, Racketparam = 0.261, UniquacR = 5.1734, UniquacQ = 4.392, ChaoSeadAF = 0.331, ChaoSeadSP = 14730, ChaoSeadLV = 0.1486); +end Twomethylhexane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twomethylindene.mo b/Simulator/Simulator/Files/Chemsep_Database/Twomethylindene.mo new file mode 100644 index 0000000..9c274b0 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twomethylindene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twomethylindene + extends General_Properties(SN = 169, name = "Twomethylindene", CAS = "2177-47-1", Tc = 711, Pc = 3460000, Vc = 0.436, Cc = 0.255, Tb = 479.45, Tm = 353.15, TT = 353.15, TP = 3020.69, MW = 130.186, LVB = 0.13407, AF = 0.350814, SP = 19650, DM = 0, SH = -168070000.0, IGHF = 1.15E+08, GEF = 2.19E+08, AS = 361000, HFMP = 0, HOC = -5.21E+09, LiqDen = {105, 0.58652, 0.25339, 711, 0.28941, 0}, VP = {101, 92.273, -9299.2, -10.097, 0.0000042786, 2}, LiqCp = {16, 156160, -200.07, 10.512, 0.0025015, -0.0000010635}, HOV = {106, 7.303067E+07, 0.433923, 0.764504, -1.615634, 0.843055}, VapCp = {16, -154380, -193.88, 13.203, 0.00019348, -5.2535E-08}, LiqVis = {0, 0, 0, 0, 0, 0}, VapVis = {102, 9.6835E-07, 0.47111, 397.83, 9327.5, 0}, LiqK = {16, 0.057046, -181.52, -0.63312, -0.0038758, -8.2839E-07}, VapK = {102, 0.00009568, 1.0268, 701.49, -31051, 0}, Racketparam = 0.259776, UniquacR = 5.104812, UniquacQ = 3.552, ChaoSeadAF = 0.32769, ChaoSeadSP = 17790.3, ChaoSeadLV = 0.133656); +end Twomethylindene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twomethylnaphthalene.mo b/Simulator/Simulator/Files/Chemsep_Database/Twomethylnaphthalene.mo new file mode 100644 index 0000000..f835cc5 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twomethylnaphthalene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twomethylnaphthalene + extends General_Properties(SN = 175, name = "Twomethylnaphthalene", CAS = "91-57-6", Tc = 761, Pc = 3540000, Vc = 0.462, Cc = 0.258, Tb = 514.2, Tm = 307.73, TT = 307.73, TP = 18.6897, MW = 142.2, LVB = 0.14577, AF = 0.374, SP = 19680, DM = 1.4E-30, SH = -168070000.0, IGHF = 1.161E+08, GEF = 2.163E+08, AS = 380000, HFMP = 1.212E+07, HOC = -5.58286E+09, LiqDen = {105, 0.53405, 0.25024, 761.16, 0.28587, 0}, VP = {101, 98.05854, -10275.56, -10.82814, 3.919145E-06, 2}, LiqCp = {16, 74335, -307.25, 13.46, -0.0028051, 0.000003645}, HOV = {106, 9.0724E+07, 1.2004, -1.1581, 0.47852, -0.081108}, VapCp = {16, 69292, -534.4, 13.21, -0.00001663, -8.8386E-09}, LiqVis = {101, -88.346, 4977.8, 11.629, -0.0000078261, 2}, VapVis = {102, 0.0000029847, 0.34183, 891.22, -28677, 0}, LiqK = {16, 0.0084839, -307.37, 0.18174, -0.0046509, 0.0000016652}, VapK = {102, 0.000098384, 1.0234, 722.6, 42453, 0}, Racketparam = 0, UniquacR = 5.610415, UniquacQ = 3.936, ChaoSeadAF = 0.3815, ChaoSeadSP = 19870.3, ChaoSeadLV = 0.143396); +end Twomethylnaphthalene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twomethylnonane.mo b/Simulator/Simulator/Files/Chemsep_Database/Twomethylnonane.mo new file mode 100644 index 0000000..b9c3ca8 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twomethylnonane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twomethylnonane + extends General_Properties(SN = 254, name = "Twomethylnonane", CAS = "871-83-0", Tc = 621, Pc = 2050000, Vc = 0.601, Cc = 0.244, Tb = 440.15, Tm = 198.5, TT = 198.5, TP = 0.00248675, MW = 142.282, LVB = 0.196826, AF = 0.472342, SP = 15380, DM = 0, SH = -1209000000.0, IGHF = -2.5652E+08, GEF = 2.841E+07, AS = 538020, HFMP = 1.75E+07, HOC = -6.2888E+09, LiqDen = {105, 0.2243, 0.18661, 621, 0.23259, 0}, VP = {101, 133.13, -10462, -16.388, 0.0000099287, 2}, LiqCp = {16, -52606, 80.981, 11.786, 0.0026831, -6.0448E-07}, HOV = {106, 7.023987E+07, -0.879246, 6.371272, -9.404583, 4.418702}, VapCp = {16, 137030, -599.28, 13.509, 0.0000018563, -1.0781E-08}, LiqVis = {101, -3.1519, 949.54, -1.2725, 0.0000012986, 2}, VapVis = {102, 9.2127E-07, 0.44292, 352.44, -1163.9, 0}, LiqK = {16, -0.16513, 15.121, -1.1582, -0.00011252, -0.0000008534}, VapK = {102, 0.000030641, 1.1437, -171.78, 168770, 0}, Racketparam = 0.244, UniquacR = 7.196599, UniquacQ = 6.012, ChaoSeadAF = 0.472342, ChaoSeadSP = 15380, ChaoSeadLV = 0.196826); +end Twomethylnonane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twomethyloctane.mo b/Simulator/Simulator/Files/Chemsep_Database/Twomethyloctane.mo new file mode 100644 index 0000000..effbdf6 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twomethyloctane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twomethyloctane + extends General_Properties(SN = 246, name = "Twomethyloctane", CAS = "3221-61-2", Tc = 587, Pc = 2310000, Vc = 0.529, Cc = 0.25, Tb = 416.44, Tm = 193.05, TT = 193.05, TP = 0.0206, MW = 128.258, LVB = 0.18075, AF = 0.423, SP = 15310, DM = 0, SH = -1209000000.0, IGHF = -2.348E+08, GEF = 2.21E+07, AS = 496800, HFMP = 1.8E+07, HOC = -5.6791E+09, LiqDen = {105, 0.048725, 0.083928, 587, 0.13299, 0}, VP = {101, 117.6637, -9065.067, -14.28093, 0.0000101806, 2}, LiqCp = {16, 69326, 112.91, 10.449, 0.0058606, -0.0000035224}, HOV = {106, 6.8687E+07, 1.3406, -2.5809, 2.7985, -1.1501}, VapCp = {16, 145390, -732.92, 13.658, -0.00027343, 8.6186E-08}, LiqVis = {101, -14.31, 1234.5, 0.50422, -0.0000012054, 2}, VapVis = {102, 0.0000005318, 0.52649, 272.37, -710.16, 0}, LiqK = {16, -0.15278, 14.586, -1.1974, -0.00013887, -9.4417E-07}, VapK = {102, 0.00002892, 1.1595, -163.72, 160440, 0}, Racketparam = 0.25, UniquacR = 6.5222, UniquacQ = 5.472, ChaoSeadAF = 0.423, ChaoSeadSP = 15310, ChaoSeadLV = 0.18075); +end Twomethyloctane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twomethylpentane.mo b/Simulator/Simulator/Files/Chemsep_Database/Twomethylpentane.mo new file mode 100644 index 0000000..80f4ae7 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twomethylpentane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twomethylpentane + extends General_Properties(SN = 136, name = "Twomethylpentane", CAS = "107-83-5", Tc = 497.5, Pc = 3010000, Vc = 0.3667, Cc = 0.267, Tb = 333.4, Tm = 119.55, TT = 119.55, TP = 0.0000206558, MW = 86.177, LVB = 0.13289, AF = 0.278, SP = 14400, DM = 0, SH = -168070000.0, IGHF = -1.7455E+08, GEF = -5338000, AS = 380890, HFMP = 6268000, HOC = -3.84915E+09, LiqDen = {105, 0.657, 0.25467, 497.71, 0.26808, 0}, VP = {101, 77.6873, -5802.911, -8.543267, 7.871718E-06, 2}, LiqCp = {16, 137510, -55.266, 8.2006, 0.013273, -0.00001165}, HOV = {106, 4.724E+07, 0.784961, -0.571271, 0.114935, 0.0796185}, VapCp = {16, 70761, -504.8, 12.795, 0.00029839, -9.4564E-08}, LiqVis = {101, -12.416, 938.41, 0.18259, 4.2586E-07, 2}, VapVis = {102, 0.0000020458, 0.38326, 542.64, -1147.6, 0}, LiqK = {16, -0.099248, 3.6931, -1.2881, -0.00063949, -0.0000011122}, VapK = {102, 0.000056887, 1.0953, -66.761, 139530, 0}, Racketparam = 0.2581, UniquacR = 4.499, UniquacQ = 3.852, ChaoSeadAF = 0.2791, ChaoSeadSP = 14417.6, ChaoSeadLV = 0.132931); +end Twomethylpentane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twomethylpropanal.mo b/Simulator/Simulator/Files/Chemsep_Database/Twomethylpropanal.mo new file mode 100644 index 0000000..5dba387 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twomethylpropanal.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twomethylpropanal + extends General_Properties(SN = 82, name = "Twomethylpropanal", CAS = "78-84-2", Tc = 507, Pc = 4100000, Vc = 0.263, Cc = 0.256, Tb = 337.25, Tm = 208.15, TT = 208.15, TP = 34.8247, MW = 72.1057, LVB = 0.0920264, AF = 0.36218, SP = 18450, DM = 9.0E-30, SH = -17100000.0, IGHF = -2.158E+08, GEF = -1.214E+08, AS = 331200, HFMP = 1.2E+07, HOC = -2.2913E+09, LiqDen = {105, 0.97266, 0.25698, 507, 0.28571, 0}, VP = {101, 102.1731, -7116.016, -12.16592, 0.0000111612, 2}, LiqCp = {16, 143330, 110.87, 5.2999, 0.018869, -0.000016131}, HOV = {106, 4.95108E+07, 0.263532, 1.209662, -2.271572, 1.223299}, VapCp = {16, 68500, -741.45, 12.977, -0.00061649, 3.0243E-07}, LiqVis = {101, -10.535, 970.52, -0.049339, 1.1673E-08, 2}, VapVis = {102, 1.9586E-07, 0.71384, 159.71, -212.67, 0}, LiqK = {16, 0.10024, -223.61, -0.25771, -0.00474, -0.000011884}, VapK = {102, -2151.4, -0.21039, 974960, -5.0943E+09, 0}, Racketparam = 0, UniquacR = 3.2471, UniquacQ = 2.872, ChaoSeadAF = 0.37009, ChaoSeadSP = 18234.6, ChaoSeadLV = 0.0920137); +end Twomethylpropanal; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twonitropropane.mo b/Simulator/Simulator/Files/Chemsep_Database/Twonitropropane.mo new file mode 100644 index 0000000..9d183db --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twonitropropane.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twonitropropane + extends General_Properties(SN = 382, name = "Twonitropropane", CAS = "79-46-9", Tc = 595, Pc = 4450000, Vc = 0.288, Cc = 0.26, Tb = 393.4, Tm = 181.83, TT = 181.83, TP = 0.021584, MW = 89.0932, LVB = 0.0905535, AF = 0.383568, SP = 20530, DM = 1.24E-29, SH = -22600000.0, IGHF = -1.39E+08, GEF = -1.2803E+07, AS = 347700, HFMP = 7790000, HOC = -1.846E+09, LiqDen = {105, 0.27031, 0.13967, 595, 0.17588, 0}, VP = {101, 57.04038, -6262.318, -4.993807, 1.61213E-06, 2}, LiqCp = {16, 67863, 138.63, 8.8679, 0.01051, -0.00001051}, HOV = {106, 5.543435E+07, 0.377393, 0.18894, -0.0391329, -0.243258}, VapCp = {16, 58543, -558.36, 12.559, 0.000040137, -3.1383E-08}, LiqVis = {101, -26.48, 1441.6, 2.6439, -0.0000074647, 2}, VapVis = {102, 0.000005644, 0.32789, 1291.7, 6279.8, 0}, LiqK = {16, 0.085284, -50.915, -1.467, -0.0035856, -0.000001687}, VapK = {102, 0.0042281, 0.52696, 790.25, 431610, 0}, Racketparam = 0.26, UniquacR = 3.3573, UniquacQ = 2.948, ChaoSeadAF = 0.383568, ChaoSeadSP = 20530, ChaoSeadLV = 0.0905535); +end Twonitropropane; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twopentanol.mo b/Simulator/Simulator/Files/Chemsep_Database/Twopentanol.mo new file mode 100644 index 0000000..22aaff3 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twopentanol.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twopentanol + extends General_Properties(SN = 342, name = "Twopentanol", CAS = "6032-29-7", Tc = 552, Pc = 3880000, Vc = 0.327, Cc = 0.26, Tb = 392.15, Tm = 200, TT = 200, TP = 0.00596587, MW = 88.1482, LVB = 0.109448, AF = 0.674371, SP = 21700, DM = 5.39E-30, SH = -216400000.0, IGHF = -3.138E+08, GEF = -1.593E+08, AS = 396400, HFMP = 8480000, HOC = -3.0515E+09, LiqDen = {105, 1.319, 0.3371, 552, 0.32218, 0}, VP = {101, 156.6278, -11701.22, -19.61134, 0.0000119964, 2}, LiqCp = {16, 223900, 2827.9, -24.806, 0.11426, -0.00010479}, HOV = {106, 8.4515E+07, 0.5603, 0.52669, -1.3675, 0.83639}, VapCp = {16, 81533, -562.17, 12.749, 0.00015514, -6.2807E-08}, LiqVis = {101, -161.5575, 9388.477, 22.02304, -0.0000121894, 2}, VapVis = {102, 3.2586E-07, 0.63457, 242.49, -572.84, 0}, LiqK = {16, -0.29342, 50.682, -1.2923, 0.0017888, -0.0000028966}, VapK = {102, 1300.2, 0.95377, 8.1158E+09, -2.9211E+11, 0}, Racketparam = 0.26, UniquacR = 4.5979, UniquacQ = 4.204, ChaoSeadAF = 0.558707, ChaoSeadSP = 21700, ChaoSeadLV = 0.109448); +end Twopentanol; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Twopentanone.mo b/Simulator/Simulator/Files/Chemsep_Database/Twopentanone.mo new file mode 100644 index 0000000..e4de861 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Twopentanone.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Twopentanone + extends General_Properties(SN = 311, name = "Twopentanone", CAS = "107-87-9", Tc = 561.1, Pc = 3690000, Vc = 0.301, Cc = 0.238, Tb = 375.39, Tm = 196.29, TT = 196.29, TP = 0.752347, MW = 86.134, LVB = 0.10733, AF = 0.346, SP = 18290, DM = 9.07E-30, SH = -1209000000.0, IGHF = -2.592E+08, GEF = -1.384E+08, AS = 378600, HFMP = 1.062E+07, HOC = -2.88E+09, LiqDen = {105, 0.8193, 0.25958, 561.1, 0.28941, 0}, VP = {101, 92.01772, -7341.876, -10.45756, 7.61086E-06, 2}, LiqCp = {16, 119520, 155.09, 9.2758, 0.0038398, 0.0000015236}, HOV = {106, 6.074187E+07, 1.097819, -1.350154, 0.926065, -0.25017}, VapCp = {16, 86927, -727.52, 12.986, -0.00023161, 6.926E-08}, LiqVis = {101, -8.4812, 921.84, -0.40943, 6.8984E-07, 2}, VapVis = {102, 2.4641E-07, 0.66525, 208.96, -62.76, 0}, LiqK = {16, 0.010889, -36.658, -1.2206, -0.0022413, -2.5211E-07}, VapK = {102, -0.017912, 0.4825, -3887.7, -1296300, 0}, Racketparam = 0.238, UniquacR = 3.9223, UniquacQ = 3.416, ChaoSeadAF = 0.346, ChaoSeadSP = 18290, ChaoSeadLV = 0.10733); +end Twopentanone; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Vinylacetate.mo b/Simulator/Simulator/Files/Chemsep_Database/Vinylacetate.mo new file mode 100644 index 0000000..06b1986 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Vinylacetate.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Vinylacetate + extends General_Properties(SN = 339, name = "Vinylacetate", CAS = "108-05-4", Tc = 501.45, Pc = 4150000, Vc = 0.266, Cc = 0.248, Tb = 345.65, Tm = 180.35, TT = 180.35, TP = 0.70586, MW = 86.0892, LVB = 0.0929486, AF = 0.529352, SP = 18580, DM = 5.97E-30, SH = -216400000.0, IGHF = -3.157E+08, GEF = -2.287E+08, AS = 334400, HFMP = 5370000, HOC = -1.95E+09, LiqDen = {105, 0.80837, 0.2388, 524.34, 0.25151, 0}, VP = {101, -28.90631, -2451.071, 8.43748, -0.000014969, 2}, LiqCp = {16, 104670, 68.241, 7.8309, 0.01301, -0.00001011}, HOV = {106, 5.178411E+07, 1.329393, -3.127105, 3.542901, -1.384803}, VapCp = {16, 50651, -432.89, 12.118, 0.00048734, -1.8964E-07}, LiqVis = {101, -20.187, 1398, 1.3362, 8.2076E-07, 2}, VapVis = {102, 1.4727E-07, 0.76076, 119.27, 67.359, 0}, LiqK = {16, -0.068153, 28.848, -1.5016, 0.00051317, -0.0000030057}, VapK = {102, -5281900, -0.16154, 2.8419E+09, -1.7045E+13, 0}, Racketparam = 0.248, UniquacR = 3.2485, UniquacQ = 2.904, ChaoSeadAF = 0.351307, ChaoSeadSP = 18580, ChaoSeadLV = 0.0929486); +end Vinylacetate; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Vinylacetylene.mo b/Simulator/Simulator/Files/Chemsep_Database/Vinylacetylene.mo new file mode 100644 index 0000000..298b3e5 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Vinylacetylene.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Vinylacetylene + extends General_Properties(SN = 71, name = "Vinylacetylene", CAS = "689-97-4", Tc = 454, Pc = 4860000, Vc = 0.205, Cc = 0.264, Tb = 278.25, Tm = 0, TT = 0, TP = 0, MW = 52.0746, LVB = 0.0769826, AF = 0.106852, SP = 16360, DM = 1.3E-30, SH = 304600000.0, IGHF = 3.046E+08, GEF = 3.06E+08, AS = 279400, HFMP = 0, HOC = -2.362E+09, LiqDen = {105, 1.2594, 0.25931, 454, 0.29553, 0}, VP = {101, 79.0442, -5001.865, -8.984128, 0.0000129415, 2}, LiqCp = {16, 68382, -63.514, 9.912, 0.0031404, -1.0307E-07}, HOV = {106, 3.313507E+07, -0.0105563, 0.71867, -0.291074, 0.0215152}, VapCp = {16, 49981, -581.7, 12.052, -0.00010825, 3.173E-08}, LiqVis = {101, -2.2453, 320.68, -1.2895, -5.6512E-09, 2}, VapVis = {102, 6.7484E-07, 0.5304, 230.17, -0.0024795, 0}, LiqK = {16, -0.05887, -27.718, -0.92317, -0.0023581, 1.5773E-07}, VapK = {102, 0.000054197, 1.0632, -70.589, 90617, 0}, Racketparam = 0.281184, UniquacR = 3.526, UniquacQ = 2.94, ChaoSeadAF = 0.11815, ChaoSeadSP = 17035, ChaoSeadLV = 0.0740148); +end Vinylacetylene; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Vinylchloride.mo b/Simulator/Simulator/Files/Chemsep_Database/Vinylchloride.mo new file mode 100644 index 0000000..cafa6a5 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Vinylchloride.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Vinylchloride + extends General_Properties(SN = 39, name = "Vinylchloride", CAS = "75-01-4", Tc = 432, Pc = 5670000, Vc = 0.179, Cc = 0.283, Tb = 259.25, Tm = 119.36, TT = 119.36, TP = 0.0191781, MW = 62.4982, LVB = 0.0692236, AF = 0.100107, SP = 15960, DM = 4.84E-30, SH = 28450000.0, IGHF = 2.845E+07, GEF = 4.195E+07, AS = 273540, HFMP = 4744000, HOC = -1.178E+09, LiqDen = {105, 1.4882, 0.26866, 432, 0.2693, 0}, VP = {101, 30.50309, -3204.111, -1.15716, -3.151817E-06, 2}, LiqCp = {16, 29928, 167.46, 5.6386, 0.023319, -0.000024747}, HOV = {106, 2.6581E+07, -2.1189, 8.303, -9.8551, 4.0685}, VapCp = {16, 39013, -667.91, 11.935, -0.00030895, 9.1245E-08}, LiqVis = {101, -3.586, 386.19, -1.1014, -9.1164E-07, 2}, VapVis = {102, 4.1288E-07, 0.63726, 118.97, 5390.5, 0}, LiqK = {16, 0.060341, 155.36, -4.6785, 0.015523, -0.000038165}, VapK = {102, -260.51, 0.58623, -1.7838E+08, -1.6691E+09, 0}, Racketparam = 0.281776, UniquacR = 1.9124, UniquacQ = 1.492, ChaoSeadAF = 0.100107, ChaoSeadSP = 17766.2, ChaoSeadLV = 0.0646597); +end Vinylchloride; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Water.mo b/Simulator/Simulator/Files/Chemsep_Database/Water.mo new file mode 100644 index 0000000..e34214a --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Water.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Water + extends General_Properties(SN = 14, name = "Water", CAS = "7732-18-5", Tc = 647.14, Pc = 2.2064E+07, Vc = 0.05595, Cc = 0.229, Tb = 373.15, Tm = 273.15, TT = 273.16, TP = 611.73, MW = 18.015, LVB = 0.01807, AF = 0.344, SP = 47860, DM = 6.17E-30, SH = 0.0, IGHF = -2.41814E+08, GEF = -2.2859E+08, AS = 188724, HFMP = 6001740, HOC = 0, LiqDen = {106, 32.51621, -3.213004, 7.92411, -7.359898, 2.703522}, VP = {101, 74.55502, -7295.586, -7.442448, 0.0000042881, 2}, LiqCp = {16, 75539, -22297, 136.02, -0.25622, 0.00018273}, HOV = {106, 5.964E+07, 0.86515, -1.1134, 0.67764, -0.026925}, VapCp = {16, 33200, -878.9001, 8.436956, 0.00207627, -6.467085E-07}, LiqVis = {101, -133.7, 6785.7, 18.47, -0.000014736, 2}, VapVis = {102, 7.002327E-08, 0.934576, 195.6338, -13045.99, 0}, LiqK = {16, -1.5697, -55.141, 0.7832, 0.0011484, -0.0000018151}, VapK = {102, 0.0000065986, 1.3947, 59.478, -15484, 0}, Racketparam = 0.2338, UniquacR = 0.92, UniquacQ = 1.4, ChaoSeadAF = 0.328, ChaoSeadSP = 47812.7, ChaoSeadLV = 0.0180674); +end Water; diff --git a/Simulator/Simulator/Files/Chemsep_Database/Xenon.mo b/Simulator/Simulator/Files/Chemsep_Database/Xenon.mo new file mode 100644 index 0000000..9297559 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/Xenon.mo @@ -0,0 +1,5 @@ +within Simulator.Files.Chemsep_Database; + +model Xenon + extends General_Properties(SN = 200, name = "Xenon", CAS = "7440-63-3", Tc = 289.74, Pc = 5840000, Vc = 0.118, Cc = 0.286, Tb = 165.01, Tm = 161.25, TT = 161.25, TP = 81667.9, MW = 131.29, LVB = 0.04291, AF = 0.006, SP = 15910, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 169578, HFMP = 2294950, HOC = 0, LiqDen = {105, 2.4063, 0.28552, 289.74, 0.28967, 0}, VP = {101, 31.497, -1758.9, -1.8727, 0.0000091652, 2}, LiqCp = {16, 44610, -221, 1.0811, 0.026515, -0.000013257}, HOV = {106, 1.740633E+07, -0.233725, 3.148357, -4.995262, 2.477111}, VapCp = {16, 20786, 0, 0, 0, 0}, LiqVis = {101, -7.7421, -0.53776, -0.00050184, -5.2934E-08, 2}, VapVis = {102, 0.0000014055, 0.57778, 188.46, -312.26, 0}, LiqK = {16, -0.012175, 143.58, -4.2655, 0.011041, -0.000032937}, VapK = {102, 0.00026719, 0.62046, 215.6, -8144.4, 0}, Racketparam = 0.286, UniquacR = 1.13, UniquacQ = 1.13, ChaoSeadAF = 0.006, ChaoSeadSP = 15910, ChaoSeadLV = 0.04291); +end Xenon; diff --git a/Simulator/Simulator/Files/Chemsep_Database/package.mo b/Simulator/Simulator/Files/Chemsep_Database/package.mo new file mode 100644 index 0000000..7e86701 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/package.mo @@ -0,0 +1,2198 @@ +within Simulator.Files; + +package Chemsep_Database + model General_Properties + parameter Integer SN; + parameter String name; + parameter String CAS; + parameter Real Tc; + parameter Real Pc; + parameter Real Vc; + parameter Real Cc; + parameter Real Tb; + parameter Real Tm; + parameter Real TT; + parameter Real TP; + parameter Real MW; + parameter Real LVB; + parameter Real AF; + parameter Real SP; + parameter Real DM; + parameter Real SH; + parameter Real IGHF; + parameter Real GEF; + parameter Real AS; + parameter Real HFMP; + parameter Real HOC; + parameter Real UniquacR; + parameter Real UniquacQ; + parameter Real LiqDen[6]; + parameter Real VP[6]; + parameter Real LiqCp[6]; + parameter Real HOV[6]; + parameter Real VapCp[6]; + parameter Real LiqVis[6]; + parameter Real VapVis[6]; + parameter Real LiqK[6]; + parameter Real VapK[6]; + parameter Real Racketparam; + parameter Real ChaoSeadAF; + parameter Real ChaoSeadSP; + parameter Real ChaoSeadLV; + end General_Properties; + + model Air + extends General_Properties( + SN = 1, name = "Air", CAS = "132259-10-0", Tc = 132.45, Pc = 3774000, Vc = 0.09147, Cc = 0.313, Tb = 78.67, Tm = 59.15, TT = 59.15, TP = 5642.15, MW = 28.96, LVB = 0.0329147, AF = 0, SP = 12750, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 199000, HFMP = 0, HOC = 0, LiqDen = {105,2.6731,0.25637,132.51,0.26788,0}, VP = {101,14.794,-599.85,1.0009,-3.9938E-07,2}, LiqCp = {16,53628,4511.1,-143.29,1.582,-0.0051332}, HOV = {106,7385651,0.276676,0.211253,-0.836764,0.722737}, VapCp = {100,29562.29,-7.164949,0.0216294,-0.0000139748,2.89195E-09}, LiqVis = {101,-72.336,813.48,12.687,-0.00033062,2}, VapVis = {102,0.000001592,0.48975,123.45,-829.58,0}, LiqK = {16,-0.21199,-16.311,-0.23057,-0.0076197,0.0000025018}, VapK = {102,0.0003511,0.76492,16.071,1084.4,0}, Racketparam = 0.29056, UniquacR = 0, UniquacQ = 0, ChaoSeadAF = -0.00787976, ChaoSeadSP = 12749.8, ChaoSeadLV = 0.0329147); + end Air; + + model Argon + extends General_Properties( + SN = 2, name = "Argon", CAS = "7440-37-1", Tc = 150.86, Pc = 4898000, Vc = 0.07457, Cc = 0.291, Tb = 87.27, Tm = 83.8039, TT = 83.8, TP = 68906.1, MW = 39.948, LVB = 0.0291, AF = -0.002, SP = 14138.3, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 154732, HFMP = 1184900, HOC = 0, LiqDen = {105,3.803,0.286,150.86,0.2984,0}, VP = {101,44.369,-1126.1,-4.5688,0.000062339,2}, LiqCp = {16,46085,-1304.5,21.195,-0.015382,0.000033063}, HOV = {106,7981000,0.099752,0.32009,-0.11898,0.031141}, VapCp = {16,20786,0,0,0,0}, LiqVis = {101,-99.903,1347.5,17.615,-0.00032893,2}, VapVis = {102,0.0000010023,0.5922,85.563,238.26,0}, LiqK = {16,-0.30397,-0.82999,-0.71462,-0.00039294,-0.000012209}, VapK = {102,0.00013095,0.81923,-122.33,13993,0}, Racketparam = 0, UniquacR = 1.1074, UniquacQ = 1.068, ChaoSeadAF = -0.002, ChaoSeadSP = 14138.3, ChaoSeadLV = 0.0285865); + end Argon; + + model Bromine + extends General_Properties( + SN = 3, name = "Bromine", CAS = "7726-95-6", Tc = 584.15, Pc = 1.03E+07, Vc = 0.135, Cc = 0.286, Tb = 331.9, Tm = 265.9, TT = 265.85, TP = 5853.37, MW = 159.808, LVB = 0.0514795, AF = 0.128997, SP = 23590, DM = 0, SH = 0.0, IGHF = 3.091E+07, GEF = 3140000, AS = 245350, HFMP = 1.057E+07, HOC = 0, LiqDen = {105,2.0603,0.28982,584.15,0.28948,0}, VP = {101,63.657,-5321.6,-6.3199,0.0000054412,2}, LiqCp = {16,75351,-4.87E+07,54033,102.73,0.43775}, HOV = {106,3.8419E+07,-0.26282,2.1808,-2.7529,1.1823}, VapCp = {16,35000,-410,8.5,-0.00016,-0.00000001}, LiqVis = {101,-5.9813,410.55,-0.30036,-0.000006936,2}, VapVis = {102,1.1438E-07,0.88111,59.595,-6723.3,0}, LiqK = {16,-0.69183,27.775,-0.38966,0.00057103,-8.8462E-07}, VapK = {102,0.0000065648,1.4785,4505.6,-870500,0}, Racketparam = 0.279241, UniquacR = 1.8985, UniquacQ = 1.672, ChaoSeadAF = 0.108, ChaoSeadSP = 23591.8, ChaoSeadLV = 0.0514795); + end Bromine; + + model Carbontetrachloride + extends General_Properties( + SN = 4, name = "Carbontetrachloride", CAS = "56-23-5", Tc = 556.3, Pc = 4557000, Vc = 0.276, Cc = 0.271, Tb = 349.79, Tm = 250.33, TT = 250.33, TP = 1122.46, MW = 153.822, LVB = 0.09707, AF = 0.187, SP = 17550, DM = 0, SH = 0.0, IGHF = -9.581E+07, GEF = -5.354E+07, AS = 309910, HFMP = 2535000, HOC = -2.653E+08, LiqDen = {105,1.0721,0.28328,556.3,0.30092,0}, VP = {101,82.671,-6304.2,-9.2247,0.0000074352,2}, LiqCp = {16,129390,1959.2,-18.833,0.080834,-0.000047491}, HOV = {106,3.1764E+07,-1.5729,5.2158,-5.5259,2.1931}, VapCp = {16,37588.04,-242.5309,11.66726,-0.000446049,1.391101E-07}, LiqVis = {101,-22.297,1645,1.7588,-0.0000028163,2}, VapVis = {102,0.0000029947,0.37756,454.35,5708.3,0}, LiqK = {16,0.034432,-227.95,-0.38117,-0.0048371,-0.0000011782}, VapK = {102,0.0001208,0.98541,1411.1,-36584,0}, Racketparam = 0, UniquacR = 3.33, UniquacQ = 2.82, ChaoSeadAF = 1.695, ChaoSeadSP = 17546.4, ChaoSeadLV = 0.0971395); + end Carbontetrachloride; + + model Carbonmonoxide + extends General_Properties( + SN = 5, name = "Carbonmonoxide", CAS = "630-08-0", Tc = 132.85, Pc = 3494000, Vc = 0.0931, Cc = 0.292, Tb = 81.66, Tm = 68.15, TT = 68.15, TP = 15400, MW = 28.01, LVB = 0.03488, AF = 0.045, SP = 6402, DM = 3.74E-31, SH = -110530000.0, IGHF = -1.1053E+08, GEF = -1.3715E+08, AS = 197556, HFMP = 840984, HOC = -2.83E+08, LiqDen = {105,2.2423,0.2437,132.93,0.24196,0}, VP = {101,42.283,-1035.1,-4.2012,0.000062546,2}, LiqCp = {16,63364,-10524,359.6,-3.9494,0.014624}, HOV = {106,8585000,0.4921,-0.326,0.2231,0}, VapCp = {16,29100,-1979.753,10.58274,-0.0000790406,-1.99685E-07}, LiqVis = {101,-82.158,1037.8,14.229,-0.00028204,2}, VapVis = {102,0.0000012713,0.51494,105.97,-231.11,0}, LiqK = {16,-0.23621,-3.5251,-0.55788,-0.0039362,-0.0000082725}, VapK = {102,0.00061581,0.6828,61.287,221.32,0}, Racketparam = 0.2918, UniquacR = 1.0679, UniquacQ = 1.112, ChaoSeadAF = 0.093, ChaoSeadSP = 6402.36, ChaoSeadLV = 0.0354426); + end Carbonmonoxide; + + model Carbondioxide + extends General_Properties( + SN = 6, name = "Carbondioxide", CAS = "124-38-9", Tc = 304.21, Pc = 7383000, Vc = 0.094, Cc = 0.274, Tb = 0, Tm = 216.58, TT = 216.58, TP = 518672, MW = 44.0095, LVB = 0.0616782, AF = 0.223621, SP = 14560, DM = 0, SH = -393510000.0, IGHF = -3.9351E+08, GEF = -3.9437E+08, AS = 213677, HFMP = 9019000, HOC = 0, LiqDen = {105,2.768,0.26212,304.21,0.2908,0}, VP = {101,95.478,-4070,-12.07,0.000029505,2}, LiqCp = {16,80592,108.83,-6.9126,0.059647,0.0000069922}, HOV = {106,2.1092E+07,0.35366,-0.46134,0.43554,0.037671}, VapCp = {16,28933,-494.28,10.658,-0.000027375,3.3268E-09}, LiqVis = {101,-7.7022,-166.34,0.38094,-0.00004018,2}, VapVis = {102,0.0000022464,0.45495,292.64,1669.1,0}, LiqK = {16,-0.24975,-55.106,0.41735,-0.0051067,0.0000020157}, VapK = {102,5.804,-0.44522,794.13,2139600,0}, Racketparam = 0.270937, UniquacR = 1.2986, UniquacQ = 1.292, ChaoSeadAF = 0.231, ChaoSeadSP = 14563.8, ChaoSeadLV = 0.0372744); + end Carbondioxide; + + model Carbondisulfide + extends General_Properties( + SN = 7, name = "Carbondisulfide", CAS = "75-15-0", Tc = 552, Pc = 7900000, Vc = 0.16, Cc = 0.275, Tb = 319.375, Tm = 161.58, TT = 161.11, TP = 1.4944, MW = 76.1407, LVB = 0.0606387, AF = 0.110697, SP = 20400, DM = 0, SH = -393510000.0, IGHF = 1.169E+08, GEF = 6.68E+07, AS = 237900, HFMP = 4393000, HOC = -1.0769E+09, LiqDen = {105,1.7976,0.28757,552,0.32269,0}, VP = {101,52.62041,-4546.02,-4.744246,4.881551E-06,2}, LiqCp = {16,69032,671.75,2.3423,0.015972,-0.0000043479}, HOV = {106,3.9758E+07,0.68679,0.18227,-1.7985,1.3658}, VapCp = {16,26779,-222.87,10.557,0.00011062,-5.3772E-08}, LiqVis = {101,-9.8702,691.26,-0.072299,1.6489E-07,2}, VapVis = {102,5.9681E-08,0.92304,48.01,-162.47,0}, LiqK = {16,0.12378,-150.01,-0.453,-0.0078739,-0.0000032002}, VapK = {102,0.00033762,0.73827,483.3,-4769.2,0}, Racketparam = 0, UniquacR = 2.057, UniquacQ = 1.65, ChaoSeadAF = 0.107865, ChaoSeadSP = 20410.7, ChaoSeadLV = 0.0606387); + end Carbondisulfide; + + model Phosgene + extends General_Properties( + SN = 8, name = "Phosgene", CAS = "75-44-5", Tc = 455, Pc = 5674200, Vc = 0.19, Cc = 0.285, Tb = 280.71, Tm = 145.37, TT = 145.37, TP = 0.920651, MW = 98.9161, LVB = 0.0597955, AF = 0.201309, SP = 17140, DM = 3.9E-30, SH = -218900000.0, IGHF = -2.189E+08, GEF = -2.0479E+08, AS = 283740, HFMP = 5738400, HOC = -1.746E+08, LiqDen = {105,1.4691,0.2768,455,0.27965,0}, VP = {101,81.03568,-5112.106,-9.267047,0.0000119936,2}, LiqCp = {16,101240,-202030,196.31,2.1704,-0.0015512}, HOV = {106,4.367252E+07,1.081822,-0.773774,-0.1937,0.317951}, VapCp = {16,32506,-282.16,11.124,-0.00017636,4.5651E-08}, LiqVis = {101,-789.51,22474,129.1,-0.00032789,2}, VapVis = {102,6.2229E-07,0.58405,277.35,-6111.6,0}, LiqK = {16,0.0025061,3.5674,-1.6592,-0.0007952,-0.0000018088}, VapK = {102,0.000024368,1.1423,246.56,4296.5,0}, Racketparam = 0, UniquacR = 2.300593, UniquacQ = 2.08, ChaoSeadAF = 0.1918, ChaoSeadSP = 17837.2, ChaoSeadLV = 0.0705389); + end Phosgene; + + model Trichloroacetylchloride + extends General_Properties( + SN = 9, name = "Trichloroacetylchloride", CAS = "76-02-8", Tc = 604, Pc = 4320000, Vc = 0.3408, Cc = 0.293, Tb = 391.15, Tm = 216.2, TT = 216.2, TP = 5.18177, MW = 181.833, LVB = 0.112961, AF = 0.282386, SP = 18010, DM = 4.0E-30, SH = -218900000.0, IGHF = -2.398E+08, GEF = -1.8E+08, AS = 360000, HFMP = 9040000, HOC = -5.062E+08, LiqDen = {105,0.76674,0.26122,604,0.28678,0}, VP = {101,174.9617,-10592.68,-23.45621,0.0000238342,2}, LiqCp = {16,177260,-1933.8,48.92,-0.20004,0.00024097}, HOV = {106,1.449329E+08,7.45895,-20.20511,23.04844,-9.793955}, VapCp = {16,91870,-696.64,12.555,-0.0015691,6.1156E-07}, LiqVis = {101,-12.095,1867,-0.00010079,1.1286E-09,2}, VapVis = {102,0.0000001265,0.7796,98.46,0.0024692,0}, LiqK = {16,0.043702,-153.3,-0.62199,-0.0058162,0.0000023649}, VapK = {102,0.0006898,0.5929,623.5,0.0039481,0}, Racketparam = 0, UniquacR = 4.177323, UniquacQ = 3.544, ChaoSeadAF = 0.347734, ChaoSeadSP = 18501.6, ChaoSeadLV = 0.112737); + end Trichloroacetylchloride; + + model Hydrogenchloride + extends General_Properties( + SN = 10, name = "Hydrogenchloride", CAS = "7647-01-0", Tc = 324.69, Pc = 8310000, Vc = 0.081, Cc = 0.249, Tb = 188.15, Tm = 158.97, TT = 158.97, TP = 13521.9, MW = 36.461, LVB = 0.03028, AF = 0.126, SP = 12190, DM = 3.6E-30, SH = -92310000.0, IGHF = -9.231E+07, GEF = -9.53E+07, AS = 186786, HFMP = 2000000, HOC = -2.86E+07, LiqDen = {105,2.3619,0.23301,324.69,0.25076,0}, VP = {101,138.2562,-4825.245,-19.73669,0.0000650759,2}, LiqCp = {16,-53340,265.92,4.243,0.058092,-0.00013923}, HOV = {106,1.9563E+07,-0.79988,3.8907,-4.9768,2.2266}, VapCp = {16,29096.99,-1271.123,6.610209,0.00378635,-0.0000013094}, LiqVis = {101,-196.43,5474.4,31.068,-0.000094243,2}, VapVis = {102,5.1969E-07,0.66444,177.83,-3965.9,0}, LiqK = {16,-0.4993,-113.3,0.99185,-0.0023549,-0.0000033612}, VapK = {102,0.0017816,0.5013,331.03,3750.8,0}, Racketparam = 0, UniquacR = 1.056032, UniquacQ = 1.1, ChaoSeadAF = 0.121, ChaoSeadSP = 22003.8, ChaoSeadLV = 0.030563); + end Hydrogenchloride; + + model Chlorine + extends General_Properties( + SN = 11, name = "Chlorine", CAS = "7782-50-5", Tc = 417, Pc = 7700000, Vc = 0.124, Cc = 0.275, Tb = 239.12, Tm = 172.12, TT = 172.12, TP = 1366.04, MW = 70.905, LVB = 0.04536, AF = 0.073, SP = 17360, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 222972, HFMP = 6406000, HOC = 0, LiqDen = {105,1.8293,0.25,417.16,0.26753,0}, VP = {101,45.776,-3292.7,-3.7926,0.0000049863,2}, LiqCp = {16,66547,12488,-246.3,-2.7266,-0.021518}, HOV = {106,2.9601E+07,0.77334,-1.0279,0.93368,-0.2926}, VapCp = {16,28958,-398.03,10.125,-0.0010681,3.8414E-07}, LiqVis = {101,-11.351,502.6,0.30506,-9.5237E-07,2}, VapVis = {102,2.5899E-07,0.74273,97.463,-22.488,0}, LiqK = {16,-0.48743,13.229,-0.49371,0.00052989,-0.0000020491}, VapK = {102,0.00096588,0.54995,434.26,3605.9,0}, Racketparam = 0, UniquacR = 1.5887, UniquacQ = 1.524, ChaoSeadAF = 0.0547, ChaoSeadSP = 20120, ChaoSeadLV = 0.0455063); + end Chlorine; + + model Hydrogeniodide + extends General_Properties( + SN = 12, name = "Hydrogeniodide", CAS = "10034-85-2", Tc = 423.85, Pc = 8310000, Vc = 0.1219, Cc = 0.287, Tb = 237.55, Tm = 222.38, TT = 222.38, TP = 49326.4, MW = 127.912, LVB = 0.0507575, AF = 0.0380703, SP = 17120, DM = 1.5E-30, SH = 26500000.0, IGHF = 2.65E+07, GEF = 1716000, AS = 206481, HFMP = 2872100, HOC = -1.162E+08, LiqDen = {105,0.29008,0.10272,423.85,0.12802,0}, VP = {101,48.208,-3309.5,-4.2202,0.0000058868,2}, LiqCp = {16,47228,657.18,2.2493,0.031778,-0.000056365}, HOV = {106,4.5057E+07,2.4036,-3.4166,1.5877,-0.0027034}, VapCp = {16,29070.86,-1600.955,9.445762,0.000914155,-4.506661E-07}, LiqVis = {101,-20.449,-959.41,4.2445,-0.000095025,2}, VapVis = {102,1.6146E-07,0.8587,45.387,-1595.3,0}, LiqK = {16,-0.2841,21.17,-1.299,0.00096857,-0.0000020056}, VapK = {102,0.000042343,0.89806,44.783,-39.662,0}, Racketparam = 0, UniquacR = 1.6724, UniquacQ = 1.5928, ChaoSeadAF = 0.0380703, ChaoSeadSP = 19866.7, ChaoSeadLV = 0.0457176); + end Hydrogeniodide; + + model Hydrogen + extends General_Properties( + SN = 13, name = "Hydrogen", CAS = "1333-74-0", Tc = 33.19, Pc = 1313000, Vc = 0.064147, Cc = 0.305, Tb = 20.39, Tm = 13.95, TT = 13.95, TP = 7220, MW = 2.01588, LVB = 0.0285681, AF = -0.215993, SP = 6648, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 130571, HFMP = 117100, HOC = -2.4182E+08, LiqDen = {105,2.9613,0.25981,33.19,0.19104,0}, VP = {101,13.05,-97.534,1.0355,0.00031816,2}, LiqCp = {16,14510,-1191.1,156.51,-6.1773,0.087907}, HOV = {106,1534700,3.214,-8.4567,8.4646,-2.8057}, VapCp = {16,3994.325,-48.69006,10.36209,-0.000340144,1.960333E-07}, LiqVis = {101,-32.531,97.304,5.9178,-0.0031563,2}, VapVis = {102,1.7916E-07,0.68557,-0.51413,132.61,0}, LiqK = {16,-0.34238,-4.3002,-0.53814,0.0011639,-0.00021792}, VapK = {102,0.0026851,0.74366,13.289,-31.305,0}, Racketparam = 0.3139, UniquacR = 0.4092, UniquacQ = 0.5516, ChaoSeadAF = 0, ChaoSeadSP = 6647.875, ChaoSeadLV = 0.031); + end Hydrogen; + + model Water + extends General_Properties( + SN = 14, name = "Water", CAS = "7732-18-5", Tc = 647.14, Pc = 2.2064E+07, Vc = 0.05595, Cc = 0.229, Tb = 373.15, Tm = 273.15, TT = 273.16, TP = 611.73, MW = 18.015, LVB = 0.01807, AF = 0.344, SP = 47860, DM = 6.17E-30, SH = 0.0, IGHF = -2.41814E+08, GEF = -2.2859E+08, AS = 188724, HFMP = 6001740, HOC = 0, LiqDen = {106,32.51621,-3.213004,7.92411,-7.359898,2.703522}, VP = {101,74.55502,-7295.586,-7.442448,0.0000042881,2}, LiqCp = {16,75539,-22297,136.02,-0.25622,0.00018273}, HOV = {106,5.964E+07,0.86515,-1.1134,0.67764,-0.026925}, VapCp = {16,33200,-878.9001,8.436956,0.00207627,-6.467085E-07}, LiqVis = {101,-133.7,6785.7,18.47,-0.000014736,2}, VapVis = {102,7.002327E-08,0.934576,195.6338,-13045.99,0}, LiqK = {16,-1.5697,-55.141,0.7832,0.0011484,-0.0000018151}, VapK = {102,0.0000065986,1.3947,59.478,-15484,0}, Racketparam = 0.2338, UniquacR = 0.92, UniquacQ = 1.4, ChaoSeadAF = 0.328, ChaoSeadSP = 47812.7, ChaoSeadLV = 0.0180674); + end Water; + + model Hydrogensulfide + extends General_Properties( + SN = 15, name = "Hydrogensulfide", CAS = "7783-06-4", Tc = 373.53, Pc = 8962910, Vc = 0.0985, Cc = 0.284, Tb = 212.8, Tm = 187.68, TT = 187.68, TP = 23200, MW = 34.0809, LVB = 0.0438045, AF = 0.0941677, SP = 18000, DM = 3.23E-30, SH = -20630000.0, IGHF = -2.063E+07, GEF = -3.344E+07, AS = 205600, HFMP = 2376500, HOC = -5.18E+08, LiqDen = {105,2.3565,0.25354,373.53,0.26514,0}, VP = {101,48.34868,-3078.428,-4.229632,6.844234E-06,2}, LiqCp = {16,68743,-100800,1016.4,-3.3645,0.0037533}, HOV = {106,2.7198E+07,0.69517,-0.69951,0.51422,-0.11694}, VapCp = {16,33121.9,-869.6079,9.605736,0.00110059,-3.859399E-07}, LiqVis = {101,7.527,261.77,-3.1833,0.0000078743,2}, VapVis = {102,3.4328E-08,1.0455,58.912,-13329,0}, LiqK = {16,-0.078369,-33.634,-0.24641,-0.0025463,-0.0000049089}, VapK = {102,1.0611E-07,1.8773,-355.78,45782,0}, Racketparam = 0.285, UniquacR = 1.234, UniquacQ = 1.241, ChaoSeadAF = 0.0941677, ChaoSeadSP = 18000.2, ChaoSeadLV = 0.0358604); + end Hydrogensulfide; + + model Ammonia + extends General_Properties( + SN = 16, name = "Ammonia", CAS = "7664-41-7", Tc = 405.4, Pc = 1.1353E+07, Vc = 0.07247, Cc = 0.255, Tb = 239.82, Tm = 195.41, TT = 195.41, TP = 6111.09, MW = 17.031, LVB = 0.02496, AF = 0.256, SP = 24790, DM = 4.9E-30, SH = -45898000.0, IGHF = -4.5898E+07, GEF = -1.64E+07, AS = 192660, HFMP = 5657000, HOC = -3.1683E+08, LiqDen = {105,4.0518,0.27129,405.4,0.31349,0}, VP = {101,62.8849,-4136.862,-6.320663,9.203947E-06,2}, LiqCp = {16,77659,-45330,445.74,-1.4197,0.0015508}, HOV = {106,2.4542E+07,-1.3178,4.7194,-5.4808,2.4196}, VapCp = {16,33239,-913.64,10.802,0.00021047,-4.1739E-08}, LiqVis = {101,-39.742,1486.5,4.7749,-0.000015796,2}, VapVis = {102,0.0000000459,0.96936,48.366,-2671.4,0}, LiqK = {16,-0.95309,14.684,0.56768,-0.00028968,-0.0000019238}, VapK = {102,0.000016165,1.3146,75.168,-8202.1,0}, Racketparam = 0, UniquacR = 0.9097, UniquacQ = 0.98, ChaoSeadAF = 0.2517, ChaoSeadSP = 29224.9, ChaoSeadLV = 0.0249801); + end Ammonia; + + model Neon + extends General_Properties( + SN = 17, name = "Neon", CAS = "7440-01-9", Tc = 44.4, Pc = 2653000, Vc = 0.0417, Cc = 0.3, Tb = 27.09, Tm = 24.55, TT = 24.56, TP = 43300, MW = 20.1797, LVB = 0.0167622, AF = -0.0395988, SP = 9440, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 146219, HFMP = 328100, HOC = 0, LiqDen = {105,7.3718,0.3067,44.4,0.2786,0}, VP = {101,29.459,-269.41,-2.5349,0.00051726,2}, LiqCp = {16,29948,-243.96,32.083,-0.79445,0.01023}, HOV = {106,1420900,-0.63029,-0.0022325,1.6268,-0.7611}, VapCp = {16,20786,-1728.5,-21.855,0.0020512,2.1139E-07}, LiqVis = {101,-83.002,434.94,18.35,-0.0034996,2}, VapVis = {102,7.6731E-07,0.65634,5.8941,175.84,0}, LiqK = {16,-0.49811,-1.8025,-0.49257,0.0090166,-0.00024023}, VapK = {102,0.0011717,0.66099,12.109,-70.155,0}, Racketparam = 0, UniquacR = 0.680949, UniquacQ = 0.776, ChaoSeadAF = -0.0413762, ChaoSeadSP = 9417.34, ChaoSeadLV = 0.0167622); + end Neon; + + model Nitricacid + extends General_Properties( + SN = 18, name = "Nitricacid", CAS = "7697-37-2", Tc = 520, Pc = 6890100, Vc = 0.145, Cc = 0.231, Tb = 356.15, Tm = 231.55, TT = 231.55, TP = 60.7682, MW = 63.0128, LVB = 0.041734, AF = 0.714406, SP = 29610, DM = 7.24E-30, SH = 0.0, IGHF = -1.343E+08, GEF = -7.401E+07, AS = 266370, HFMP = 1.047E+07, HOC = 1.34E+07, LiqDen = {105,6.9293,0.47274,520,0.49837,0}, VP = {101,26.654,-5017.1,-0.036699,-0.0000064771,2}, LiqCp = {16,111110,-611.57,-2.7202,0.014286,-0.000033905}, HOV = {106,7.01E+07,0.68707,-0.0019914,0.0028792,-0.0014403}, VapCp = {16,32639,-463.06,11.547,-0.00011018,4.1801E-09}, LiqVis = {101,264.29,-7985,-44.099,0.000074947,2}, VapVis = {102,2.2234E-07,0.72283,140.72,-0.0025913,0}, LiqK = {16,0.15591,-186.43,-2.2714,0.0033214,-0.0000018932}, VapK = {102,0.00063365,0.72057,645.24,0.005306,0}, Racketparam = 0, UniquacR = 1.638761, UniquacQ = 1.564, ChaoSeadAF = 0.714406, ChaoSeadSP = 29605.6, ChaoSeadLV = 0.041734); + end Nitricacid; + + model Nitricoxide + extends General_Properties( + SN = 19, name = "Nitricoxide", CAS = "10102-43-9", Tc = 180, Pc = 6480000, Vc = 0.058, Cc = 0.251, Tb = 121.38, Tm = 112.15, TT = 109.5, TP = 21890, MW = 30.006, LVB = 0.02344, AF = 0.582, SP = 23120, DM = 5.1E-31, SH = 90250000.0, IGHF = 9.025E+07, GEF = 8.657E+07, AS = 210600, HFMP = 2301000, HOC = -9.02489E+07, LiqDen = {105,2.1354,0.19686,180.16,0.15443,0}, VP = {101,98.67523,-3011.477,-13.21121,0.000072078,2}, LiqCp = {16,38756,-323.94,15.685,-0.060412,0.00033434}, HOV = {106,2.4721E+07,2.2365,-5.8672,6.8169,-2.7529}, VapCp = {16,29831.89,-2622.96,12.94433,-0.00260975,6.261468E-07}, LiqVis = {101,-50.098,734.63,8.0267,-0.00017996,2}, VapVis = {102,0.0000010289,0.55954,89.353,515.43,0}, LiqK = {16,-0.85384,4.7868,-0.010049,0.0010454,-0.0000086044}, VapK = {102,0.00046657,0.73353,58.917,-625.75,0}, Racketparam = 0, UniquacR = 0.9163, UniquacQ = 0.9859, ChaoSeadAF = 0.582944, ChaoSeadSP = 23117.6, ChaoSeadLV = 0.0234267); + end Nitricoxide; + + model Nitrogendioxide + extends General_Properties( + SN = 20, name = "Nitrogendioxide", CAS = "10102-44-0", Tc = 431.15, Pc = 1.01325E+07, Vc = 0.08249, Cc = 0.233, Tb = 294.15, Tm = 261.9, TT = 261.9, TP = 18728.3, MW = 46.0055, LVB = 0.031997, AF = 0.851088, SP = 33390, DM = 1.05E-30, SH = 33180000.0, IGHF = 3.318E+07, GEF = 5.1328E+07, AS = 239920, HFMP = 1.465E+07, HOC = -3.30954E+07, LiqDen = {105,2.2179,0.22994,431.38,0.19006,0}, VP = {101,18.404,-3508.6,0.81255,0.0000049983,2}, LiqCp = {16,77435,432.69,5.3737,0.020804,-0.000021695}, HOV = {106,5.37E+07,0.3,0,0,0}, VapCp = {16,32962.96,-578.7755,10.44921,0.0000793322,-5.181036E-08}, LiqVis = {101,-311.49,10041,49.027,-0.00010518,2}, VapVis = {102,1.2078E-08,1.1399,-382.56,78187,0}, LiqK = {16,0.11611,127610,-1409.1,5.1777,-0.0063738}, VapK = {102,0.070851,-0.2143,-1258,429500,0}, Racketparam = 0, UniquacR = 1.053395, UniquacQ = 1.1308, ChaoSeadAF = 0.851088, ChaoSeadSP = 33494.8, ChaoSeadLV = 0.0317854); + end Nitrogendioxide; + + model Nitrogen + extends General_Properties( + SN = 21, name = "Nitrogen", CAS = "7727-37-9", Tc = 126.2, Pc = 3398000, Vc = 0.0901, Cc = 0.289, Tb = 77.35, Tm = 63.149, TT = 63.149, TP = 12520, MW = 28.014, LVB = 0.03484, AF = 0.037, SP = 9082, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 191500, HFMP = 720000, HOC = 0, LiqDen = {105,2.435,0.25137,126.27,0.249,0}, VP = {101,42.32946,-965.9771,-4.321774,0.0000797271,2}, LiqCp = {16,55135,217.45,-0.9071,0.05327,0.00024166}, HOV = {106,2.7284E+07,7.8021,-19.125,19.518,-7.5428}, VapCp = {16,29103.63,-2305.946,11.31935,-0.00100557,1.706099E-07}, LiqVis = {101,3.4358,-24.706,-2.6748,-0.000041603,2}, VapVis = {102,4.6051E-07,0.65049,5.8019,2822.7,0}, LiqK = {16,-0.21743,10.383,-1.0631,0.00036245,-0.000023265}, VapK = {102,0.0003395,0.76921,19.592,293.93,0}, Racketparam = 0.2906, UniquacR = 1.0415, UniquacQ = 1.088, ChaoSeadAF = 0.045, ChaoSeadSP = 9081.94, ChaoSeadLV = 0.0346723); + end Nitrogen; + + model Nitrousoxide + extends General_Properties( + SN = 22, name = "Nitrousoxide", CAS = "10024-97-2", Tc = 309.6, Pc = 7255000, Vc = 0.097, Cc = 0.273, Tb = 184.67, Tm = 182.33, TT = 182.3, TP = 87850, MW = 44.013, LVB = 0.0359, AF = 0.162, SP = 8275, DM = 5.57E-31, SH = 82050000.0, IGHF = 8.205E+07, GEF = 1.0416E+08, AS = 219850, HFMP = 6539000, HOC = -8.20482E+07, LiqDen = {105,2.0978,0.2338,309.6,0.25899,0}, VP = {101,50.69662,-2836.473,-4.609937,7.237315E-06,2}, LiqCp = {16,72525,232.93,2.2666,0.037329,-0.000055304}, HOV = {106,2.585559E+07,0.982629,-2.292314,3.369827,-1.65657}, VapCp = {16,28650,-400.03,10.5,0.00014292,-6.728E-08}, LiqVis = {101,-10.876,472.99,0.14659,-0.000013815,2}, VapVis = {102,0.0000020512,0.47044,305.02,-521.81,0}, LiqK = {16,0.10112,-5274.1,16.778,-0.037729,-0.000048678}, VapK = {102,0.001121,0.66298,524.68,7332.7,0}, Racketparam = 0, UniquacR = 1.238, UniquacQ = 1.2442, ChaoSeadAF = 0.140894, ChaoSeadSP = 20308, ChaoSeadLV = 0.036002); + end Nitrousoxide; + + model Oxygen + extends General_Properties( + SN = 23, name = "Oxygen", CAS = "7782-44-7", Tc = 154.58, Pc = 5043000, Vc = 0.07337, Cc = 0.288, Tb = 90.17, Tm = 54.361, TT = 54.361, TP = 150, MW = 31.999, LVB = 0.02785, AF = 0.022, SP = 8182, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 205043, HFMP = 444000, HOC = 0, LiqDen = {105,2.6097,0.23614,154.78,0.23695,0}, VP = {101,40.55487,-1120.543,-3.776114,0.0000485344,2}, LiqCp = {16,53393,-1966.4,48.21,-0.31631,0.0010466}, HOV = {106,1.0672E+07,1.5661,-3.4356,3.5416,-1.2718}, VapCp = {16,29061.62,-1470.897,11.10778,-0.00128484,3.183122E-07}, LiqVis = {101,-5.2319,116.13,-1.0315,0.0000034376,2}, VapVis = {102,8.0134E-07,0.60321,56.09,1584.9,0}, LiqK = {16,-0.19654,-10.535,-0.46717,-0.0052064,-3.3418E-07}, VapK = {102,0.0004508,0.74544,58.278,-562.62,0}, Racketparam = 0.2908, UniquacR = 0.857, UniquacQ = 0.94, ChaoSeadAF = 0.019, ChaoSeadSP = 8181.93, ChaoSeadLV = 0.0280225); + end Oxygen; + + model Sulfurdioxide + extends General_Properties( + SN = 24, name = "Sulfurdioxide", CAS = "7446-09-5", Tc = 430.75, Pc = 7884100, Vc = 0.122, Cc = 0.269, Tb = 263.13, Tm = 200, TT = 197.67, TP = 1674.39, MW = 64.0638, LVB = 0.04688, AF = 0.245381, SP = 12270, DM = 5.44E-30, SH = -296840000.0, IGHF = -2.9684E+08, GEF = -3.0012E+08, AS = 248100, HFMP = 7401000, HOC = 0, LiqDen = {105,1.8477,0.24254,430.75,0.27051,0}, VP = {101,53.52766,-4260.124,-4.670429,0.0000030272,2}, LiqCp = {16,86911,53691,-599.94,2.2025,-0.0025885}, HOV = {106,4.8914E+07,1.8091,-2.9053,2.2271,-0.64793}, VapCp = {16,33406,-516.38,10.524,0.000013143,-6.1535E-08}, LiqVis = {101,50.887,-1574,-9.4517,1.5898E-07,2}, VapVis = {102,0.0000012144,0.53923,315.41,-2659.7,0}, LiqK = {16,-0.21664,-2.2484,-0.50659,-0.0009424,-0.0000010218}, VapK = {102,23.316,-0.95324,-1567.4,1330100,0}, Racketparam = 0, UniquacR = 1.6961, UniquacQ = 1.612, ChaoSeadAF = 0.2462, ChaoSeadSP = 12272.9, ChaoSeadLV = 0.0438228); + end Sulfurdioxide; + + model Sulfurtrioxide + extends General_Properties( + SN = 25, name = "Sulfurtrioxide", CAS = "7446-11-9", Tc = 490.85, Pc = 8210000, Vc = 0.127, Cc = 0.255, Tb = 317.9, Tm = 289.95, TT = 289.95, TP = 21130, MW = 80.0632, LVB = 0.0420954, AF = 0.42396, SP = 31130, DM = 0, SH = -296840000.0, IGHF = -3.9572E+08, GEF = -3.7095E+08, AS = 256510, HFMP = 7532000, HOC = 1.422E+08, LiqDen = {105,1.6186,0.20129,490.85,0.42123,0}, VP = {101,351.6001,-18247.39,-49.77065,0.0000409297,2}, LiqCp = {16,258090,-3271.8,-8.4929,0.0035868,-0.000028801}, HOV = {106,8.1339E+07,0.77728,-0.42427,0.68287,-0.4608}, VapCp = {16,32986,-404.97,11.171,-0.000087925,-8.9809E-09}, LiqVis = {101,-260.71,11505,38.839,-0.000061621,2}, VapVis = {102,0.0000010033,0.54515,135.63,19402,0}, LiqK = {16,0.021077,585.52,-5.8227,0.016099,-0.000027318}, VapK = {102,1.1717,-0.2465,2002.7,1327100,0}, Racketparam = 0, UniquacR = 2.145023, UniquacQ = 1.972376, ChaoSeadAF = 0.42396, ChaoSeadSP = 31130, ChaoSeadLV = 0.0420954); + end Sulfurtrioxide; + + model Chloroform + extends General_Properties( + SN = 26, name = "Chloroform", CAS = "67-66-3", Tc = 536.5, Pc = 5500000, Vc = 0.24, Cc = 0.296, Tb = 334.33, Tm = 209.63, TT = 209.63, TP = 68.1479, MW = 119.377, LVB = 0.08068, AF = 0.226, SP = 18920, DM = 3.37E-30, SH = -296840000.0, IGHF = -1.029E+08, GEF = -7.01E+07, AS = 295600, HFMP = 9540000, HOC = -3.8E+08, LiqDen = {105,0.53556,0.18404,536.5,0.18541,0}, VP = {101,99.91512,-6781.559,-11.93873,0.0000115883,2}, LiqCp = {16,93132,645.44,2.3739,0.024457,-0.000021097}, HOV = {106,5.1382E+07,0.7027,0.36748,-1.351,0.69236}, VapCp = {16,36659,-308.1,11.299,0.00003137,-3.3538E-08}, LiqVis = {101,-20.923,1248.9,1.655,-0.0000024787,2}, VapVis = {102,1.8024E-07,0.76204,109.36,-1373.9,0}, LiqK = {16,0.061417,-66.692,-1.6802,-0.001962,-0.0000044192}, VapK = {102,0.00041167,0.84476,1870.6,-7829.5,0}, Racketparam = 0, UniquacR = 2.7, UniquacQ = 2.34, ChaoSeadAF = 0.2059, ChaoSeadSP = 18919.5, ChaoSeadLV = 0.0805048); + end Chloroform; + + model Hydrogencyanide + extends General_Properties( + SN = 27, name = "Hydrogencyanide", CAS = "74-90-8", Tc = 456.65, Pc = 5390000, Vc = 0.139, Cc = 0.197, Tb = 298.85, Tm = 259.91, TT = 259.833, TP = 18625, MW = 27.0253, LVB = 0.0397695, AF = 0.409913, SP = 24810, DM = 9.94E-30, SH = -296840000.0, IGHF = 1.35143E+08, GEF = 1.24725E+08, AS = 201719, HFMP = 8405700, HOC = -6.2329E+08, LiqDen = {105,1.3163,0.18425,456.65,0.2794,0}, VP = {101,42.70101,-4001.496,-3.208729,5.620619E-06,2}, LiqCp = {16,70227,-10279,42.028,0.069085,-0.00024154}, HOV = {106,4.5225E+07,2.0549,-4.7432,4.7996,-1.8366}, VapCp = {16,29289,-482.84,10.404,-0.000041659,6.8553E-08}, LiqVis = {101,-12.545,843.5,0.21344,-0.0000012673,2}, VapVis = {102,1.2749E-08,1.0633,338.59,155.3,0}, LiqK = {16,0.06901,-183.38,0.87895,-0.0078031,0.000002353}, VapK = {102,0.000015837,1.2055,-98.566,53091,0}, Racketparam = 0, UniquacR = 1.1951, UniquacQ = 1.2098, ChaoSeadAF = 0.409913, ChaoSeadSP = 24806, ChaoSeadLV = 0.0397695); + end Hydrogencyanide; + + model Formaldehyde + extends General_Properties( + SN = 28, name = "Formaldehyde", CAS = "50-00-0", Tc = 408, Pc = 6590000, Vc = 0.115, Cc = 0.223, Tb = 254.05, Tm = 181.15, TT = 181.15, TP = 887, MW = 30.026, LVB = 0.04097, AF = 0.281846, SP = 21190, DM = 7.77E-30, SH = -108600000.0, IGHF = -1.086E+08, GEF = -1.026E+08, AS = 218660, HFMP = 7050000, HOC = -5.268E+08, LiqDen = {105,1.9413,0.22308,408,0.28569,0}, VP = {101,62.07923,-4207.675,-6.202287,5.521233E-06,2}, LiqCp = {16,62716,-69.453,3.2871,0.047782,-0.0001008}, HOV = {106,3.0902E+07,0.29722,-0.051281,0.13234,-0.080686}, VapCp = {16,33216.06,-1212.62,11.96032,-0.000635943,1.549232E-07}, LiqVis = {101,-11.303,753.06,-0.013733,-4.6837E-08,2}, VapVis = {102,8.1997E-07,0.57256,258.17,-5091,0}, LiqK = {16,0.10999,-161.62,0.83463,-0.01142,0.0000060772}, VapK = {102,44.841,-0.71285,-3466.2,5262100,0}, Racketparam = 0, UniquacR = 0.9183, UniquacQ = 0.78, ChaoSeadAF = 0.253, ChaoSeadSP = 23824.8, ChaoSeadLV = 0.0369129); + end Formaldehyde; + + model Methylchloride + extends General_Properties( + SN = 29, name = "Methylchloride", CAS = "74-87-3", Tc = 416.2, Pc = 6680000, Vc = 0.143, Cc = 0.276, Tb = 248.95, Tm = 175.45, TT = 175.43, TP = 867.6, MW = 50.488, LVB = 0.05059, AF = 0.151, SP = 17320, DM = 6.24E-30, SH = -81960000.0, IGHF = -8.196E+07, GEF = -5.844E+07, AS = 234180, HFMP = 6548000, HOC = -6.7538E+08, LiqDen = {105,1.6672,0.24865,416.26,0.26843,0}, VP = {101,73.95113,-4332.347,-8.308415,0.0000132119,2}, LiqCp = {16,72914,778.6,-9.5627,0.081286,-0.000092921}, HOV = {106,3.0406E+07,0.41721,-0.045158,-0.067629,0.055437}, VapCp = {16,32790.34,-743.4513,11.51178,-0.0000302967,1.138778E-09}, LiqVis = {101,-60.189,2252.1,8.022,-0.000019477,2}, VapVis = {102,8.5916E-08,0.87071,35.619,35.603,0}, LiqK = {16,-0.22503,12.649,-0.64685,-0.0003032,-0.0000029812}, VapK = {102,-22144,0.7661,-4.8548E+10,-3.7839E+10,0}, Racketparam = 0, UniquacR = 1.667106, UniquacQ = 1.568, ChaoSeadAF = 0.153068, ChaoSeadSP = 19719.7, ChaoSeadLV = 0.0501264); + end Methylchloride; + + model Methyliodide + extends General_Properties( + SN = 30, name = "Methyliodide", CAS = "74-88-4", Tc = 528, Pc = 7370000, Vc = 0.185, Cc = 0.311, Tb = 315.58, Tm = 206.7, TT = 206.7, TP = 254.555, MW = 141.939, LVB = 0.062667, AF = 0.19716, SP = 20180, DM = 5.4E-30, SH = -81960000.0, IGHF = 1.3E+07, GEF = 1.47E+07, AS = 254000, HFMP = 0, HOC = -7.096E+08, LiqDen = {105,1.3975,0.25854,528,0.2679,0}, VP = {101,56.57754,-4804.529,-5.238128,3.097144E-06,2}, LiqCp = {16,81227,-510450,4831.2,-15.234,0.016088}, HOV = {106,3.3737E+07,-0.25822,1.7219,-2.0034,0.83642}, VapCp = {16,33243,-588.89,11.23,0.00016737,-5.0885E-08}, LiqVis = {101,-8.0691,650.82,-0.30881,-1.1201E-07,2}, VapVis = {102,7.1469E-07,0.6322,292.39,-1664.7,0}, LiqK = {16,0.025022,-2.7147,-2.1673,-0.0005511,-0.000004231}, VapK = {102,0.15913,0.010769,1577.4,2109400,0}, Racketparam = 0, UniquacR = 2.1651, UniquacQ = 1.84, ChaoSeadAF = 0.192721, ChaoSeadSP = 20172.3, ChaoSeadLV = 0.062667); + end Methyliodide; + + model Methane + extends General_Properties( + SN = 31, name = "Methane", CAS = "74-82-8", Tc = 190.56, Pc = 4599000, Vc = 0.0986, Cc = 0.286, Tb = 111.66, Tm = 90.694, TT = 90.694, TP = 11696, MW = 16.043, LVB = 0.03554, AF = 0.011, SP = 11600, DM = 0, SH = -74520000.0, IGHF = -7.452E+07, GEF = -5.049E+07, AS = 186270, HFMP = 941400, HOC = -8.0262E+08, LiqDen = {105,1.894,0.23603,191.05,0.21974,0}, VP = {101,39.98844,-1337.308,-3.580049,0.0000320698,2}, LiqCp = {16,61157,5034.1,-48.913,-0.22998,0.0022243}, HOV = {106,1.4418E+07,2.3055,-5.4199,5.658,-2.1286}, VapCp = {16,33151.9,-1220.001,12.0907,-0.000384791,9.896403E-08}, LiqVis = {101,-45.328,724.39,6.5917,-0.00010373,2}, VapVis = {102,5.3432E-07,0.58831,114.58,-1338.5,0}, LiqK = {16,0.011567,-46.041,0.10435,-0.012133,-0.0000051716}, VapK = {102,0.0000074705,1.4432,-57.569,587.82,0}, Racketparam = 0.2876, UniquacR = 1.1239, UniquacQ = 1.152, ChaoSeadAF = 0, ChaoSeadSP = 11618.44, ChaoSeadLV = 0.0378392); + end Methane; + + model Methanol + extends General_Properties( + SN = 32, name = "Methanol", CAS = "67-56-1", Tc = 512.64, Pc = 8097000, Vc = 0.118, Cc = 0.224, Tb = 337.69, Tm = 175.47, TT = 175.47, TP = 0.111264, MW = 32.042, LVB = 0.04073, AF = 0.565, SP = 29440, DM = 5.67E-30, SH = -74520000.0, IGHF = -2.0094E+08, GEF = -1.6232E+08, AS = 239880, HFMP = 3215000, HOC = -6.382E+08, LiqDen = {105,1.7918,0.23929,512.64,0.21078,0}, VP = {101,73.40342,-6548.076,-7.409987,5.72492E-06,2}, LiqCp = {16,62799,1254.2,-5.9906,0.052937,-0.00004711}, HOV = {106,5.8058E+07,0.87168,-0.81501,0.1695,0.17846}, VapCp = {16,36313.16,-680.4577,11.10203,0.000756766,-2.902645E-07}, LiqVis = {101,-32.996,1981.4,3.3666,-0.0000039246,2}, VapVis = {102,3.0654E-07,0.69658,204.87,24.304,0}, LiqK = {16,-0.056817,13.156,-1.2214,-0.00028282,-0.0000010129}, VapK = {102,7.8368E-07,1.7569,108.12,-21101,0}, Racketparam = 0, UniquacR = 1.43, UniquacQ = 1.43, ChaoSeadAF = 0.5589, ChaoSeadSP = 29546.4, ChaoSeadLV = 0.0407027); + end Methanol; + + model Methylamine + extends General_Properties( + SN = 33, name = "Methylamine", CAS = "74-89-5", Tc = 430, Pc = 7420000, Vc = 0.125, Cc = 0.259, Tb = 266.82, Tm = 179.69, TT = 179.69, TP = 176.712, MW = 31.057, LVB = 0.04734, AF = 0.284, SP = 21270, DM = 4.37E-30, SH = -22970000.0, IGHF = -2.297E+07, GEF = 3.207E+07, AS = 243300, HFMP = 6134000, HOC = -9.7508E+08, LiqDen = {105,1.39,0.21405,430.05,0.2275,0}, VP = {101,74.79969,-5067.174,-8.028002,7.988835E-06,2}, LiqCp = {16,90815,374.96,2.7431,0.031527,-0.000044978}, HOV = {106,4.6499E+07,1.6058,-3.2311,3.4082,-1.3345}, VapCp = {16,40540,-902.15,12.495,-0.00072761,0.0000002382}, LiqVis = {101,9.645,448.12,-3.737,0.000017508,2}, VapVis = {102,5.4475E-07,0.58715,230.63,-2982.2,0}, LiqK = {16,0.19876,9592,-137.2,0.62482,-0.00097954}, VapK = {102,-51.979,1.0721,-4.4966E+08,4.2697E+09,0}, Racketparam = 0, UniquacR = 1.5959, UniquacQ = 1.544, ChaoSeadAF = 0.281272, ChaoSeadSP = 23116, ChaoSeadLV = 0.0447131); + end Methylamine; + + model Trichloroethylene + extends General_Properties( + SN = 34, name = "Trichloroethylene", CAS = "79-01-6", Tc = 571, Pc = 4910000, Vc = 0.256, Cc = 0.265, Tb = 360.1, Tm = 188.4, TT = 188.4, TP = 1.97868, MW = 131.388, LVB = 0.0901371, AF = 0.21662, SP = 18800, DM = 2.57E-30, SH = -22970000.0, IGHF = -9620000, GEF = 1.606E+07, AS = 325090, HFMP = 0, HOC = -8.6411E+08, LiqDen = {105,1.0632,0.27217,571,0.2986,0}, VP = {101,46.56173,-5021.974,-3.675161,4.330407E-06,2}, LiqCp = {16,111110,1042.6,-3.1013,0.043029,-0.000040867}, HOV = {106,4.571591E+07,0.581727,-0.122707,-0.842037,0.831632}, VapCp = {16,56305,-500.68,11.893,-0.00053611,1.6998E-07}, LiqVis = {101,-16.947,1157.4,0.95533,0.0000012051,2}, VapVis = {102,1.5903E-07,0.76088,56.852,7589.2,0}, LiqK = {16,0.079767,522.46,-9.4979,0.032021,-0.00005769}, VapK = {102,0.00050539,0.6741,584.61,3177.4,0}, Racketparam = 0, UniquacR = 3.31, UniquacQ = 2.86, ChaoSeadAF = 0.2456, ChaoSeadSP = 18796.4, ChaoSeadLV = 0.0901371); + end Trichloroethylene; + + model Dichloroacetylchloride + extends General_Properties( + SN = 35, name = "Dichloroacetylchloride", CAS = "79-36-7", Tc = 585, Pc = 4610000, Vc = 0.283, Cc = 0.268, Tb = 380.45, Tm = 230, TT = 230, TP = 27.15, MW = 147.388, LVB = 0.0969971, AF = 0.308927, SP = 19510, DM = 5.27E-30, SH = -22970000.0, IGHF = -2.4033E+08, GEF = -1.915E+08, AS = 350000, HFMP = 0, HOC = -6.2647E+08, LiqDen = {105,0.94766,0.26857,585,0.28586,0}, VP = {101,74.72886,-6808.875,-7.735182,4.475716E-06,2}, LiqCp = {16,140380,-122.15,7.1438,0.0089927,-3.0698E-07}, HOV = {106,1.182114E+08,5.662305,-14.25375,15.19267,-6.032208}, VapCp = {16,54272,-346.01,11.744,-0.00014147,6.1056E-08}, LiqVis = {101,-11.762,1691.3,-0.020172,2.8483E-09,2}, VapVis = {102,1.4668E-07,0.7617,110.57,-0.0060267,0}, LiqK = {16,0.045516,-168.82,-0.6335,-0.0052944,0.0000014358}, VapK = {102,0.00049754,0.6638,622.43,-0.0085753,0}, Racketparam = 0, UniquacR = 3.597891, UniquacQ = 3.044, ChaoSeadAF = 0.370509, ChaoSeadSP = 19942.4, ChaoSeadLV = 0.097018); + end Dichloroacetylchloride; + + model Trichloroacetaldehyde + extends General_Properties( + SN = 36, name = "Trichloroacetaldehyde", CAS = "75-87-6", Tc = 565, Pc = 4410000, Vc = 0.288, Cc = 0.27, Tb = 370.85, Tm = 216, TT = 216, TP = 10.133, MW = 147.388, LVB = 0.0983111, AF = 0.332334, SP = 19150, DM = 6.54E-30, SH = -22970000.0, IGHF = -1.97E+08, GEF = -1.48E+08, AS = 348000, HFMP = 0, HOC = -6.72E+08, LiqDen = {105,0.92352,0.2658,565,0.27915,0}, VP = {101,104.1738,-7649.009,-12.42192,0.0000106892,2}, LiqCp = {16,141170,-5.956,6.555,0.014383,-0.000012896}, HOV = {106,6.2611E+07,1.7765,-3.981,4.442,-1.8138}, VapCp = {16,75534,-497.17,11.711,-0.00021306,5.7567E-08}, LiqVis = {101,-15.452,1500.4,0.62119,1.0267E-07,2}, VapVis = {102,1.9624E-07,0.76217,181.59,-7289.4,0}, LiqK = {16,-0.0058147,-49.103,-1.1431,-0.0024848,-2.7456E-08}, VapK = {102,0.00037396,0.73494,540.31,2896.6,0}, Racketparam = 0.261398, UniquacR = 3.638102, UniquacQ = 3.132, ChaoSeadAF = 0.332283, ChaoSeadSP = 19153.3, ChaoSeadLV = 0.0983111); + end Trichloroacetaldehyde; + + model Acetylene + extends General_Properties( + SN = 37, name = "Acetylene", CAS = "74-86-2", Tc = 308.3, Pc = 6114000, Vc = 0.1122, Cc = 0.268, Tb = 188.4, Tm = 192.4, TT = 192.4, TP = 127445, MW = 26.038, LVB = 0.04347, AF = 0.189, SP = 7921, DM = 0, SH = 228200000.0, IGHF = 2.282E+08, GEF = 2.1068E+08, AS = 200810, HFMP = 3770000, HOC = -1.257E+09, LiqDen = {105,2.8265,0.29316,308.3,0.31711,0}, VP = {101,82.22155,-3603.253,-10.0271,0.0000269397,2}, LiqCp = {16,79227,3177.2,-44.249,0.23814,-0.00030171}, HOV = {106,3.8817E+07,1.497,-1.0261,0.037348,-0.024401}, VapCp = {16,28271.69,-404.2493,11.05572,-0.000229636,1.424209E-07}, LiqVis = {101,-10.822,283.23,0.22007,-0.0000091126,2}, VapVis = {102,0.0000010997,0.50414,259.72,2787.3,0}, LiqK = {16,-0.060328,-110.3,0.44567,-0.0073832,0.0000024581}, VapK = {102,0.000078096,1.0286,-36.515,33144,0}, Racketparam = 0.2712, UniquacR = 1.52, UniquacQ = 1.39, ChaoSeadAF = 0.1841, ChaoSeadSP = 18813, ChaoSeadLV = 0.0421382); + end Acetylene; + + model Dichloroacetaldehyde + extends General_Properties( + SN = 38, name = "Dichloroacetaldehyde", CAS = "79-02-7", Tc = 555, Pc = 4950000, Vc = 0.239, Cc = 0.256, Tb = 362, Tm = 223, TT = 223, TP = 30.4712, MW = 112.943, LVB = 0.0800261, AF = 0.343679, SP = 21090, DM = 7.87E-30, SH = 228200000.0, IGHF = -1.8E+08, GEF = -1.387E+08, AS = 329000, HFMP = 1.4E+07, HOC = -8.11E+08, LiqDen = {105,1.0695,0.25535,555,0.28663,0}, VP = {101,90.61988,-7239.82,-10.19237,7.278159E-06,2}, LiqCp = {16,79819,-93.388,10.443,0.0030492,-0.0000015371}, HOV = {106,5.4311E+07,0.74287,-0.97767,1.092,-0.46681}, VapCp = {16,68025,-873.5,12.537,-0.00086712,2.2298E-07}, LiqVis = {101,-19.012,2548.4,0.73092,-0.0000016452,2}, VapVis = {102,3.0229E-07,0.67781,216.84,-7478.9,0}, LiqK = {16,-0.006509,-45.732,-1.1121,-0.0023494,-2.6574E-07}, VapK = {102,0.00042346,0.72759,609.27,10645,0}, Racketparam = 0.260402, UniquacR = 3.058668, UniquacQ = 2.632, ChaoSeadAF = 0.343679, ChaoSeadSP = 21250.9, ChaoSeadLV = 0.0788193); + end Dichloroacetaldehyde; + + model Vinylchloride + extends General_Properties( + SN = 39, name = "Vinylchloride", CAS = "75-01-4", Tc = 432, Pc = 5670000, Vc = 0.179, Cc = 0.283, Tb = 259.25, Tm = 119.36, TT = 119.36, TP = 0.0191781, MW = 62.4982, LVB = 0.0692236, AF = 0.100107, SP = 15960, DM = 4.84E-30, SH = 28450000.0, IGHF = 2.845E+07, GEF = 4.195E+07, AS = 273540, HFMP = 4744000, HOC = -1.178E+09, LiqDen = {105,1.4882,0.26866,432,0.2693,0}, VP = {101,30.50309,-3204.111,-1.15716,-3.151817E-06,2}, LiqCp = {16,29928,167.46,5.6386,0.023319,-0.000024747}, HOV = {106,2.6581E+07,-2.1189,8.303,-9.8551,4.0685}, VapCp = {16,39013,-667.91,11.935,-0.00030895,9.1245E-08}, LiqVis = {101,-3.586,386.19,-1.1014,-9.1164E-07,2}, VapVis = {102,4.1288E-07,0.63726,118.97,5390.5,0}, LiqK = {16,0.060341,155.36,-4.6785,0.015523,-0.000038165}, VapK = {102,-260.51,0.58623,-1.7838E+08,-1.6691E+09,0}, Racketparam = 0.281776, UniquacR = 1.9124, UniquacQ = 1.492, ChaoSeadAF = 0.100107, ChaoSeadSP = 17766.2, ChaoSeadLV = 0.0646597); + end Vinylchloride; + + model Acetylchloride + extends General_Properties( + SN = 40, name = "Acetylchloride", CAS = "75-36-5", Tc = 508, Pc = 5740000, Vc = 0.196, Cc = 0.266, Tb = 323.9, Tm = 160.3, TT = 160.3, TP = 0.0945737, MW = 78.4976, LVB = 0.0713449, AF = 0.334018, SP = 19730, DM = 9.07E-30, SH = 28450000.0, IGHF = -2.4351E+08, GEF = -2.058E+08, AS = 295000, HFMP = 2.75307E+08, HOC = -8.7599E+08, LiqDen = {105,1.4254,0.27938,508,0.26304,0}, VP = {101,99.17638,-7177.914,-11.22425,-0.0000057394,2}, LiqCp = {16,42690,1356.4,-2.0032,0.038796,-0.000032805}, HOV = {106,4.0E+07,0.3,0,0,0}, VapCp = {16,55490,-733.46,11.97,-0.00022853,6.1958E-08}, LiqVis = {101,4.4371,130.26,-2.2299,-8.5166E-07,2}, VapVis = {102,5.0377E-08,0.94052,79.768,-9041.6,0}, LiqK = {16,0.11965,1957.5,-32.911,0.1548,-0.00027429}, VapK = {102,-27944,0.34599,-4.878E+09,-7.8546E+10,0}, Racketparam = 0.26125, UniquacR = 2.438365, UniquacQ = 2.208, ChaoSeadAF = 0.334018, ChaoSeadSP = 20189.2, ChaoSeadLV = 0.0712327); + end Acetylchloride; + + model OneOneTwotrichloroethane + extends General_Properties( + SN = 41, name = "OneOneTwotrichloroethane", CAS = "79-00-5", Tc = 602, Pc = 4480000, Vc = 0.281, Cc = 0.252, Tb = 387, Tm = 236.5, TT = 236.5, TP = 44.7475, MW = 133.404, LVB = 0.0929898, AF = 0.259135, SP = 19890, DM = 4.17E-30, SH = 28450000.0, IGHF = -1.42E+08, GEF = -8.097E+07, AS = 337100, HFMP = 1.13E+07, HOC = -9.685E+08, LiqDen = {105,0.9055,0.25465,602,0.30987,0}, VP = {101,66.05096,-6428.165,-6.44717,3.27127E-06,2}, LiqCp = {16,121000,433.16,2.2235,0.034423,-0.000040901}, HOV = {106,5.0503E+07,0.64021,-1.1382,1.5379,-0.66031}, VapCp = {16,56506,-535.36,12.166,-0.00021958,4.8605E-08}, LiqVis = {101,-26.218,1571.3,2.5992,-0.0000081378,2}, VapVis = {102,2.8974E-07,0.68713,200.47,-854.38,0}, LiqK = {16,-0.027258,-78.724,-0.73941,-0.0030401,8.8565E-07}, VapK = {102,0.000095455,1.0427,1258.3,-2960.2,0}, Racketparam = 0.267821, UniquacR = 3.526, UniquacQ = 2.948, ChaoSeadAF = 0.259768, ChaoSeadSP = 19818.9, ChaoSeadLV = 0.0929898); + end OneOneTwotrichloroethane; + + model Acetonitrile + extends General_Properties( + SN = 42, name = "Acetonitrile", CAS = "75-05-8", Tc = 545.5, Pc = 4830000, Vc = 0.173, Cc = 0.184, Tb = 354.75, Tm = 229.32, TT = 229.32, TP = 186.945, MW = 41.0519, LVB = 0.0528577, AF = 0.337886, SP = 24050, DM = 1.31E-29, SH = 28450000.0, IGHF = 7.404E+07, GEF = 9.1868E+07, AS = 243290, HFMP = 8167000, HOC = -1.19043E+09, LiqDen = {105,1.3064,0.22597,545.5,0.28678,0}, VP = {101,63.90188,-5635.018,-6.338065,5.801644E-06,2}, LiqCp = {16,78687,635.92,1.7473,0.02389,-0.000017421}, HOV = {106,4.416703E+07,0.0989791,1.817987,-3.443548,1.854664}, VapCp = {16,41003,-679.99,11.578,0.00010104,-4.1014E-08}, LiqVis = {101,-31.531,1522.1,3.3306,-0.0000059061,2}, VapVis = {102,5.1905E-08,0.88581,38.325,87.034,0}, LiqK = {16,0.18265,8401.9,-103.1,0.40559,-0.00056286}, VapK = {102,4.7622E-08,2.1156,30.88,-14671,0}, Racketparam = 0.260911, UniquacR = 1.87, UniquacQ = 1.72, ChaoSeadAF = 0.338174, ChaoSeadSP = 24093.5, ChaoSeadLV = 0.0526772); + end Acetonitrile; + + model Ethylene + extends General_Properties( + SN = 43, name = "Ethylene", CAS = "74-85-1", Tc = 282.34, Pc = 5041000, Vc = 0.1311, Cc = 0.282, Tb = 169.42, Tm = 104, TT = 104, TP = 125.988, MW = 28.054, LVB = 0.05107, AF = 0.087, SP = 12440, DM = 0, SH = 52510000.0, IGHF = 5.251E+07, GEF = 6.844E+07, AS = 219200, HFMP = 3351000, HOC = -1.323E+09, LiqDen = {105,2.3782,0.29542,282.36,0.32456,0}, VP = {101,54.53229,-2458.42,-5.660037,0.0000194185,2}, LiqCp = {16,68016,-22414,286.75,-1.1802,0.0017304}, HOV = {106,2.1658E+07,1.2164,-2.1538,2.0768,-0.73096}, VapCp = {16,33071.93,-860.0281,12.22807,-0.000509703,1.628387E-07}, LiqVis = {101,-8.9556,288.21,-0.21985,-0.000010831,2}, VapVis = {102,0.0000021134,0.41436,359.51,-2291.7,0}, LiqK = {16,-0.19499,-11.178,-0.31182,-0.0034844,3.5873E-07}, VapK = {102,0.0000093247,1.4607,410.48,-44405,0}, Racketparam = 0.281, UniquacR = 1.57, UniquacQ = 1.49, ChaoSeadAF = 0.0949, ChaoSeadSP = 12436.64, ChaoSeadLV = 0.061); + end Ethylene; + + model OneOnedichloroethane + extends General_Properties( + SN = 44, name = "OneOnedichloroethane", CAS = "75-34-3", Tc = 523, Pc = 5100000, Vc = 0.236, Cc = 0.277, Tb = 330.45, Tm = 176.19, TT = 176.19, TP = 2.21455, MW = 98.959, LVB = 0.08473, AF = 0.244, SP = 18300, DM = 6.87E-30, SH = 52510000.0, IGHF = -1.2941E+08, GEF = -7.259E+07, AS = 305010, HFMP = 7870000, HOC = -1.1104E+09, LiqDen = {105,1.1057,0.26536,523,0.28703,0}, VP = {101,66.53401,-5492.415,-6.715993,5.298782E-06,2}, LiqCp = {16,115470,479.34,1.2009,0.029511,-0.000025794}, HOV = {106,4.458773E+07,0.555838,0.0209485,-0.722234,0.56963}, VapCp = {16,45661,-449.92,11.802,0.00015496,-5.3829E-08}, LiqVis = {101,-9.7803,891.16,-0.14866,-3.5884E-07,2}, VapVis = {102,0.0000001814,0.74706,93.461,1513.7,0}, LiqK = {16,0.011357,-64.086,-0.98127,-0.0039469,6.6106E-07}, VapK = {102,0.00013381,1.01,1042.5,-2442,0}, Racketparam = 0, UniquacR = 2.9617, UniquacQ = 2.532, ChaoSeadAF = 0.244612, ChaoSeadSP = 18299.2, ChaoSeadLV = 0.0847207); + end OneOnedichloroethane; + + model OneTwodichloroethane + extends General_Properties( + SN = 45, name = "OneTwodichloroethane", CAS = "107-06-2", Tc = 561, Pc = 5400000, Vc = 0.22, Cc = 0.255, Tb = 356.66, Tm = 237.49, TT = 237.49, TP = 237.127, MW = 98.959, LVB = 0.07945, AF = 0.286, SP = 20260, DM = 4.8E-30, SH = 52510000.0, IGHF = -1.2979E+08, GEF = -7.3945E+07, AS = 308280, HFMP = 8830000, HOC = -1.105E+09, LiqDen = {105,1.1942,0.27053,561.61,0.29157,0}, VP = {101,81.47902,-6503.169,-8.960273,7.32894E-06,2}, LiqCp = {16,92757,224.15,8.5223,0.0025656,0.000005106}, HOV = {106,5.072427E+07,0.517321,0.205828,-0.637156,0.265499}, VapCp = {16,62073,-758.84,12.345,-0.0004196,0.0000001146}, LiqVis = {101,25.747,-385.45,-5.5912,0.0000027937,2}, VapVis = {102,1.1983E-07,0.79504,20.791,14003,0}, LiqK = {16,0.015945,-110.67,-0.74013,-0.0032664,-5.0786E-07}, VapK = {102,0.00023592,0.93945,1368.6,23794,0}, Racketparam = 0, UniquacR = 2.88, UniquacQ = 2.52, ChaoSeadAF = 0.2876, ChaoSeadSP = 20249.5, ChaoSeadLV = 0.0794424); + end OneTwodichloroethane; + + model Acetaldehyde + extends General_Properties( + SN = 46, name = "Acetaldehyde", CAS = "75-07-0", Tc = 466, Pc = 5550000, Vc = 0.154, Cc = 0.221, Tb = 294, Tm = 150.15, TT = 150.15, TP = 0.323203, MW = 44.0526, LVB = 0.0568878, AF = 0.290734, SP = 20110, DM = 8.97E-30, SH = -166400000.0, IGHF = -1.664E+08, GEF = -1.333E+08, AS = 264200, HFMP = 3220000, HOC = -1.1045E+09, LiqDen = {105,1.2346,0.22392,466,0.25025,0}, VP = {101,132.6058,-7086.883,-17.42481,0.0000237457,2}, LiqCp = {16,72077,1068.4,-6.4275,0.06878,-0.000079154}, HOV = {106,1.4565E+07,-6.1925,18.559,-20.707,8.5605}, VapCp = {16,42578,-730.39,11.883,0.000033485,-3.0296E-08}, LiqVis = {101,-4.0316,623.05,-1.1589,8.4583E-07,2}, VapVis = {102,1.1933E-07,0.78879,65.293,1023.3,0}, LiqK = {16,0.014392,-40.45,-0.67323,-0.0036191,0.0000011083}, VapK = {102,3.2627E-07,1.8293,-23.073,3397.7,0}, Racketparam = 0, UniquacR = 1.9, UniquacQ = 1.8, ChaoSeadAF = 0.316685, ChaoSeadSP = 19818.5, ChaoSeadLV = 0.0564965); + end Acetaldehyde; + + model Ethyleneoxide + extends General_Properties( + SN = 47, name = "Ethyleneoxide", CAS = "75-21-8", Tc = 469.15, Pc = 7190000, Vc = 0.140296, Cc = 0.25876, Tb = 283.6, Tm = 160.65, TT = 160.65, TP = 7.78791, MW = 44.0526, LVB = 0.0508328, AF = 0.197447, SP = 21050, DM = 6.3E-30, SH = -52630000.0, IGHF = -5.263E+07, GEF = -1.323E+07, AS = 242990, HFMP = 5171400, HOC = -1.218E+09, LiqDen = {105,0.99773,0.19368,469.15,0.19965,0}, VP = {101,69.60869,-4890.744,-7.346771,8.198478E-06,2}, LiqCp = {16,81911,-50003,534.49,-1.8654,0.00223}, HOV = {106,5.9285E+07,3.2175,-7.404,7.8553,-3.1858}, VapCp = {16,31884.09,-715.0886,12.13937,-0.0000867837,-5.187264E-09}, LiqVis = {101,-8.5785,634.7,-0.32031,-8.1095E-08,2}, VapVis = {102,0.0000010777,0.52994,452.12,-16957,0}, LiqK = {16,-0.2748,8.1093,-0.70065,-0.00041054,-6.2588E-07}, VapK = {102,-0.00032904,1.1711,-7027.1,89001,0}, Racketparam = 0, UniquacR = 1.5927, UniquacQ = 1.32, ChaoSeadAF = 0.202, ChaoSeadSP = 21584, ChaoSeadLV = 0.0497046); + end Ethyleneoxide; + + model Aceticacid + extends General_Properties( + SN = 48, name = "Aceticacid", CAS = "64-19-7", Tc = 594.45, Pc = 5790000, Vc = 0.171, Cc = 0.2, Tb = 391.04, Tm = 289.81, TT = 289.81, TP = 1280, MW = 60.053, LVB = 0.05753, AF = 0.46, SP = 19060, DM = 5.8E-30, SH = -52630000.0, IGHF = -4.328E+08, GEF = -3.745E+08, AS = 282500, HFMP = 1.173E+07, HOC = -7.866E+08, LiqDen = {105,1.0627,0.22174,594.76,0.22566,0}, VP = {101,87.50607,-7603.906,-9.655308,7.168835E-06,2}, LiqCp = {16,49034,1051.1,0.77564,0.031667,-0.000028344}, HOV = {106,6.6203E+07,6.7121,-17.45,17.2,-6.0038}, VapCp = {16,40110,-588.24,12.017,0.00016249,-8.6918E-08}, LiqVis = {101,-58.528,2990.9,7.4911,-0.000011028,2}, VapVis = {102,4.3395E-09,1.24,-175.09,25013,0}, LiqK = {16,0.11159,-531.13,1.6359,-0.009369,-7.1996E-07}, VapK = {102,0.34137,-0.80579,-824.3,175840,0}, Racketparam = 0, UniquacR = 2.23, UniquacQ = 2.04, ChaoSeadAF = 0.4566, ChaoSeadSP = 18501.7, ChaoSeadLV = 0.0575804); + end Aceticacid; + + model Methylformate + extends General_Properties( + SN = 49, name = "Methylformate", CAS = "107-31-3", Tc = 487.2, Pc = 6000000, Vc = 0.172, Cc = 0.255, Tb = 304.9, Tm = 174.15, TT = 174.15, TP = 6.88085, MW = 60.053, LVB = 0.06214, AF = 0.253, SP = 20500, DM = 5.9E-30, SH = -52630000.0, IGHF = -3.524E+08, GEF = -2.95E+08, AS = 285200, HFMP = 7531000, HOC = -8.924E+08, LiqDen = {105,1.213,0.23619,487.2,0.24621,0}, VP = {101,70.6458,-5401.751,-7.334787,5.934343E-06,2}, LiqCp = {16,97064,3377.4,-42.373,0.22648,-0.00029763}, HOV = {106,7.0578E+07,3.7855,-9.0874,9.6043,-3.7868}, VapCp = {16,41319,-570.15,12.038,-0.000034216,-2.7109E-11}, LiqVis = {101,-9.949,1214.4,-0.53562,0.000010346,2}, VapVis = {102,0.0000069776,0.31537,1034.6,13.293,0}, LiqK = {16,0.0090363,23.594,-1.5627,0.00089283,-0.0000058101}, VapK = {102,-817050,-0.23016,2.5314E+08,-1.5205E+12,0}, Racketparam = 0, UniquacR = 2.1431, UniquacQ = 2.036, ChaoSeadAF = 0.257, ChaoSeadSP = 20503.4, ChaoSeadLV = 0.0620841); + end Methylformate; + + model Ethylchloride + extends General_Properties( + SN = 50, name = "Ethylchloride", CAS = "75-00-3", Tc = 460.3, Pc = 5300000, Vc = 0.199, Cc = 0.276, Tb = 285.42, Tm = 136.75, TT = 134.8, TP = 0.1249, MW = 64.514, LVB = 0.07258, AF = 0.194, SP = 17250, DM = 6.84E-30, SH = -112260000.0, IGHF = -1.1226E+08, GEF = -6.0499E+07, AS = 275780, HFMP = 4451800, HOC = -1.2849E+09, LiqDen = {105,1.3553,0.26895,460.36,0.24994,0}, VP = {101,51.28342,-4206.393,-4.478839,3.812824E-06,2}, LiqCp = {16,95946,-7247,67.469,-0.16696,0.00017795}, HOV = {106,3.61548E+07,0.981924,-2.026046,2.205811,-0.774155}, VapCp = {16,12765.96,-117.0948,11.04141,0.00111696,-3.565557E-07}, LiqVis = {101,-10.065,698.32,-0.097691,8.0018E-08,2}, VapVis = {102,3.2572E-07,0.66869,165.43,-2726.9,0}, LiqK = {16,0.062544,150.84,-4.3182,0.012599,-0.000031799}, VapK = {102,-19.83,0.20145,-728060,-2.7917E+08,0}, Racketparam = 0, UniquacR = 2.3665, UniquacQ = 2.112, ChaoSeadAF = 0.190636, ChaoSeadSP = 17772.6, ChaoSeadLV = 0.0708426); + end Ethylchloride; + + model Ethane + extends General_Properties( + SN = 51, name = "Ethane", CAS = "74-84-0", Tc = 305.32, Pc = 4872000, Vc = 0.1455, Cc = 0.279, Tb = 184.55, Tm = 90.352, TT = 90.352, TP = 1.13, MW = 30.07, LVB = 0.04615, AF = 0.099, SP = 12400, DM = 0, SH = -83820000.0, IGHF = -8.382E+07, GEF = -3.192E+07, AS = 229120, HFMP = 2859000, HOC = -1.42864E+09, LiqDen = {105,1.3749,0.23949,305.43,0.22875,0}, VP = {101,61.43744,-2814.319,-6.778053,0.0000210827,2}, LiqCp = {16,68726,-1953.6,31.772,-0.10571,0.00019673}, HOV = {106,2.3996E+07,1.4625,-2.8991,2.8421,-0.99532}, VapCp = {16,35666.22,-616.5198,11.69914,0.000444525,-1.541942E-07}, LiqVis = {101,-33.92204,743.404,4.302492,-0.0000364469,2}, VapVis = {102,5.2452E-07,0.58906,188.8,-2953.8,0}, LiqK = {16,-0.073876,-9.6787,-0.67405,-0.003407,-0.0000022023}, VapK = {102,0.000074549,1.168,506.4,-881.74,0}, Racketparam = 0.2793, UniquacR = 1.8022, UniquacQ = 1.696, ChaoSeadAF = 0.0908, ChaoSeadSP = 12375.2, ChaoSeadLV = 0.0551979); + end Ethane; + + model Ethanol + extends General_Properties( + SN = 52, name = "Ethanol", CAS = "64-17-5", Tc = 513.92, Pc = 6148000, Vc = 0.167, Cc = 0.24, Tb = 351.8, Tm = 159.05, TT = 159.05, TP = 0.000495642, MW = 46.069, LVB = 0.05868, AF = 0.649, SP = 26140, DM = 5.64E-30, SH = -83820000.0, IGHF = -2.3495E+08, GEF = -1.6785E+08, AS = 280640, HFMP = 4931000, HOC = -1.235E+09, LiqDen = {105,1.3539,0.24957,515.66,0.22099,0}, VP = {101,88.0754,-7652.06,-9.471507,5.928087E-06,2}, LiqCp = {16,76684,675.72,-0.093875,0.037153,-0.000031214}, HOV = {106,6.3899E+07,1.2782,-2.673,2.7973,-1.0209}, VapCp = {16,44530,-660.89,12.153,0.000019532,-1.5636E-08}, LiqVis = {101,8.061,774.76,-3.0701,-4.3408E-09,2}, VapVis = {102,1.2467E-07,0.7862,76.034,-2017.3,0}, LiqK = {16,0.10247,-120.39,-0.48487,-0.0071706,0.000003461}, VapK = {102,-0.01001,0.64925,-7360.5,-255250,0}, Racketparam = 0, UniquacR = 2.11, UniquacQ = 1.97, ChaoSeadAF = 0.634, ChaoSeadSP = 26133.3, ChaoSeadLV = 0.0586177); + end Ethanol; + + model Dimethylether + extends General_Properties( + SN = 53, name = "Dimethylether", CAS = "115-10-6", Tc = 400.1, Pc = 5400000, Vc = 0.17, Cc = 0.276, Tb = 248.31, Tm = 131.66, TT = 131.65, TP = 3.04959, MW = 46.069, LVB = 0.06907, AF = 0.191, SP = 15120, DM = 4.34E-30, SH = -184100000.0, IGHF = -1.841E+08, GEF = -1.128E+08, AS = 266700, HFMP = 4937000, HOC = -1.3284E+09, LiqDen = {105,1.4889,0.26123,400.1,0.27948,0}, VP = {101,50.32175,-3631.453,-4.444735,5.290757E-06,2}, LiqCp = {16,97754,353.35,-1.896,0.040999,-0.000017816}, HOV = {106,3.8521E+07,2.2845,-5.7518,6.5695,-2.6976}, VapCp = {16,37573.94,-346.059,11.12596,0.00118434,-4.086847E-07}, LiqVis = {101,-10.661,449.83,0.0072727,-3.6906E-08,2}, VapVis = {102,0.0000027281,0.3952,534.12,2319,0}, LiqK = {16,-0.15344,-11.847,-0.56462,-0.0022104,5.6048E-07}, VapK = {102,0.059968,0.26671,1018.3,1098900,0}, Racketparam = 0, UniquacR = 2.0461, UniquacQ = 1.936, ChaoSeadAF = 0.2, ChaoSeadSP = 15212.1, ChaoSeadLV = 0.0703107); + end Dimethylether; + + model Ethyleneglycol + extends General_Properties( + SN = 54, name = "Ethyleneglycol", CAS = "107-21-1", Tc = 719, Pc = 8200000, Vc = 0.191, Cc = 0.262, Tb = 470.45, Tm = 260.15, TT = 260.15, TP = 0.21922, MW = 62.0678, LVB = 0.055908, AF = 0.506776, SP = 33840, DM = 8.04E-30, SH = -184100000.0, IGHF = -3.922E+08, GEF = -3.018E+08, AS = 304891, HFMP = 9958000, HOC = -1.0527E+09, LiqDen = {105,1.3106,0.25084,720,0.21838,0}, VP = {101,68.11797,-9617.267,-5.83171,-1.13705E-06,2}, LiqCp = {16,86990,-72.326,9.7466,0.0065456,-0.0000047}, HOV = {106,7.414E+07,0.16807,-0.19694,1.0417,-0.61488}, VapCp = {16,52948,-604.61,12.115,0.00010607,-4.9352E-08}, LiqVis = {101,-309.38,14928,45.49,-0.000044405,2}, VapVis = {102,1.2284E-07,0.79557,132.87,-5540.3,0}, LiqK = {16,0.1684,-313.75,-1.072,-0.000058054,-0.0000032443}, VapK = {102,-8962900,-0.31257,2.5313E+09,-1.2955E+13,0}, Racketparam = 0, UniquacR = 2.41, UniquacQ = 2.25, ChaoSeadAF = 0.48683, ChaoSeadSP = 33703.3, ChaoSeadLV = 0.0559089); + end Ethyleneglycol; + + model Dimethylsulfide + extends General_Properties( + SN = 55, name = "Dimethylsulfide", CAS = "75-18-3", Tc = 503, Pc = 5530000, Vc = 0.201, Cc = 0.266, Tb = 310.48, Tm = 174.88, TT = 174.88, TP = 7.86415, MW = 62.136, LVB = 0.07377, AF = 0.19, SP = 18530, DM = 5.0E-30, SH = -184100000.0, IGHF = -3.724E+07, GEF = 7302000, AS = 285850, HFMP = 7984700, HOC = -1.7443E+09, LiqDen = {105,1.1867,0.25844,503.06,0.24773,0}, VP = {101,14.07567,-3435.088,1.598135,-0.0000069451,2}, LiqCp = {16,112410,-20036,201.07,-0.63397,0.0007177}, HOV = {106,5.490637E+07,1.721854,-2.161256,0.932609,-0.0179494}, VapCp = {16,56893,-682.39,12.01,0.00013748,-5.7442E-08}, LiqVis = {101,-15.044,992.97,0.60378,0.0000010306,2}, VapVis = {102,4.8631E-07,0.62748,355.22,-11800,0}, LiqK = {16,0.10006,-155.98,-0.57159,-0.0045066,-0.0000087305}, VapK = {102,0.00026184,0.91507,780.75,-32167,0}, Racketparam = 0.273888, UniquacR = 2.5141, UniquacQ = 2.216, ChaoSeadAF = 0.189279, ChaoSeadSP = 18513.3, ChaoSeadLV = 0.0730914); + end Dimethylsulfide; + + model Ethylmercaptan + extends General_Properties( + SN = 56, name = "Ethylmercaptan", CAS = "75-08-1", Tc = 499, Pc = 5490000, Vc = 0.207, Cc = 0.274, Tb = 308.15, Tm = 125.26, TT = 125.26, TP = 0.00113837, MW = 62.136, LVB = 0.07458, AF = 0.189, SP = 18250, DM = 5.27E-30, SH = -184100000.0, IGHF = -4.63E+07, GEF = -4814000, AS = 296100, HFMP = 4975000, HOC = -1.7366E+09, LiqDen = {105,1.203,0.25909,499.16,0.26567,0}, VP = {101,65.4773,-5020.82,-6.678317,6.449817E-06,2}, LiqCp = {16,112430,-35384,348.44,-1.1065,0.0012231}, HOV = {106,4.1777E+07,0.6898,-0.36317,-0.097723,0.16958}, VapCp = {16,39403.72,-328.0582,11.29594,0.000950986,-3.249647E-07}, LiqVis = {101,-10.854,753.55,0.040849,-7.5884E-07,2}, VapVis = {102,0.0000001695,0.75553,151.56,-5377.8,0}, LiqK = {16,-0.021257,2.7237,-1.42,-0.0008779,-0.0000018277}, VapK = {102,0.0014607,0.7033,1243.2,53588,0}, Racketparam = 0, UniquacR = 2.551747, UniquacQ = 2.3, ChaoSeadAF = 0.192074, ChaoSeadSP = 18270.4, ChaoSeadLV = 0.0746133); + end Ethylmercaptan; + + model Ethylamine + extends General_Properties( + SN = 57, name = "Ethylamine", CAS = "75-04-7", Tc = 456.4, Pc = 5630000, Vc = 0.1818, Cc = 0.267, Tb = 289.75, Tm = 192.15, TT = 192.15, TP = 151.827, MW = 45.084, LVB = 0.06659, AF = 0.276, SP = 19100, DM = 4.07E-30, SH = -47150000.0, IGHF = -4.715E+07, GEF = 3.616E+07, AS = 284800, HFMP = 9350000, HOC = -1.5874E+09, LiqDen = {105,1.3663,0.25297,456.4,0.27948,0}, VP = {101,115.5255,-6764.221,-14.43912,0.0000155603,2}, LiqCp = {16,129790,-12366,-31.003,0.53709,-0.00091494}, HOV = {106,4.2765E+07,0.58718,-0.33502,0.17251,-0.0015134}, VapCp = {16,55762,-832.71,12.632,-0.00036845,1.1147E-07}, LiqVis = {101,-41.853,1619.5,5.3649,-0.000030563,2}, VapVis = {102,5.0871E-07,0.59417,255.23,-186.42,0}, LiqK = {16,0.17744,585.82,-11.165,0.043182,-0.000095024}, VapK = {102,0.40679,0.005162,1280.6,1721800,0}, Racketparam = 0, UniquacR = 2.2703, UniquacQ = 2.084, ChaoSeadAF = 0.285061, ChaoSeadSP = 19493.4, ChaoSeadLV = 0.0656335); + end Ethylamine; + + model Acrylonitrile + extends General_Properties( + SN = 58, name = "Acrylonitrile", CAS = "107-13-1", Tc = 535, Pc = 4480000, Vc = 0.212, Cc = 0.214, Tb = 350.5, Tm = 189.63, TT = 189.63, TP = 3.68289, MW = 53.0626, LVB = 0.0662367, AF = 0.349801, SP = 21560, DM = 1.29E-29, SH = -47150000.0, IGHF = 1.837E+08, GEF = 1.937E+08, AS = 275300, HFMP = 6230000, HOC = -1.69E+09, LiqDen = {105,1.0816,0.2293,535,0.28939,0}, VP = {101,74.54771,-6259.727,-7.785577,4.08032E-06,2}, LiqCp = {16,83847,240.59,6.8887,0.0095277,-0.0000046046}, HOV = {106,5.224752E+07,0.877802,-0.432396,-0.672186,0.607598}, VapCp = {16,42651,-533.04,11.728,0.00013096,-6.2176E-08}, LiqVis = {101,-0.5429,318.29,-1.481,-8.3759E-07,2}, VapVis = {102,4.616E-08,0.90278,67.424,-1672.6,0}, LiqK = {16,-0.15669,19.22,-1.0721,0.00025871,-0.0000022582}, VapK = {102,0.0012317,1.2472,60863,-1968600,0}, Racketparam = 0.259865, UniquacR = 2.31, UniquacQ = 2.05, ChaoSeadAF = 0.349801, ChaoSeadSP = 21555.4, ChaoSeadLV = 0.0662367); + end Acrylonitrile; + + model Methylacetylene + extends General_Properties( + SN = 59, name = "Methylacetylene", CAS = "74-99-7", Tc = 402.4, Pc = 5630000, Vc = 0.1635, Cc = 0.275, Tb = 250.12, Tm = 170.45, TT = 170.45, TP = 414.934, MW = 40.065, LVB = 0.06231, AF = 0.214, SP = 15870, DM = 2.61E-30, SH = 184900000.0, IGHF = 1.849E+08, GEF = 1.9384E+08, AS = 248360, HFMP = 5350000, HOC = -1.8487E+09, LiqDen = {105,1.5983,0.26361,402.4,0.27835,0}, VP = {101,68.97649,-4285.953,-7.418705,0.000010515,2}, LiqCp = {16,85291,38.538,6.7428,0.016885,-0.000022161}, HOV = {106,3.4954E+07,0.52948,0.26449,-0.89434,0.5174}, VapCp = {16,34169.26,-350.7621,11.18743,0.000684714,-2.185041E-07}, LiqVis = {101,-0.91891,242.44,-1.5439,5.0147E-07,2}, VapVis = {102,0.0000010586,0.48791,277.58,3995.6,0}, LiqK = {16,0.065025,-121.87,-0.025752,-0.0097723,0.0000047452}, VapK = {102,0.00029245,0.88088,248.57,78809,0}, Racketparam = 0.2703, UniquacR = 2.1931, UniquacQ = 1.936, ChaoSeadAF = 0.2176, ChaoSeadSP = 18393.2, ChaoSeadLV = 0.0596157); + end Methylacetylene; + + model Propadiene + extends General_Properties( + SN = 60, name = "Propadiene", CAS = "463-49-0", Tc = 394, Pc = 5250000, Vc = 0.1739, Cc = 0.279, Tb = 238.77, Tm = 136.87, TT = 136.87, TP = 18.2497, MW = 40.065, LVB = 0.06095, AF = 0.122, SP = 14010, DM = 0, SH = 190500000.0, IGHF = 1.905E+08, GEF = 2.008E+08, AS = 243900, HFMP = 4400000, HOC = -1.8563E+09, LiqDen = {105,0.86549,0.19732,394,0.21029,0}, VP = {101,59.80183,-3745.303,-6.036523,8.205156E-06,2}, LiqCp = {16,78665,-12422,151.08,-0.53356,0.00065986}, HOV = {106,1.54657E+07,-3.722436,11.45729,-12.9266,5.522823}, VapCp = {16,34671.52,-447.4983,11.46556,0.000444481,-1.470826E-07}, LiqVis = {101,-9.5153,310.76,-0.034725,-0.0000021543,2}, VapVis = {102,6.3119E-07,0.52792,129.92,8459.5,0}, LiqK = {16,0.06063,169.42,-4.6941,0.014436,-0.000036249}, VapK = {102,0.000059663,1.0782,9.0271,65666,0}, Racketparam = 0, UniquacR = 1.7917, UniquacQ = 1.528, ChaoSeadAF = 0.3125, ChaoSeadSP = 17551, ChaoSeadLV = 0.0604292); + end Propadiene; + + model Propylene + extends General_Properties( + SN = 61, name = "Propylene", CAS = "115-07-1", Tc = 364.85, Pc = 4600000, Vc = 0.185, Cc = 0.281, Tb = 225.45, Tm = 87.9, TT = 87.89, TP = 0.00117, MW = 42.0797, LVB = 0.0832412, AF = 0.137588, SP = 11890, DM = 1.22E-30, SH = 20230000.0, IGHF = 2.023E+07, GEF = 6.264E+07, AS = 267000, HFMP = 2936000, HOC = -1.9262E+09, LiqDen = {105,0.98129,0.22226,365.58,0.24039,0}, VP = {101,55.10362,-3330.452,-5.40588,0.0000093641,2}, LiqCp = {16,79790,300.8,5.1342,0.0095615,0.000012777}, HOV = {106,2.7525E+07,0.61217,-0.41646,0.083772,0.12092}, VapCp = {16,38965.36,-516.3838,11.75322,0.000509119,-1.771348E-07}, LiqVis = {101,-54.05485,1437.773,7.536247,-0.0000342733,2}, VapVis = {102,7.3873E-07,0.54213,262.33,-108.51,0}, LiqK = {16,-0.044587,22.061,-1.744,0.0015214,-0.0000078162}, VapK = {102,0.000045373,1.2,415.83,2757.2,0}, Racketparam = 0.2785, UniquacR = 2.25, UniquacQ = 2.02, ChaoSeadAF = 0.1477, ChaoSeadSP = 13152.4, ChaoSeadLV = 0.068956); + end Propylene; + + model Acetone + extends General_Properties( + SN = 62, name = "Acetone", CAS = "67-64-1", Tc = 508.1, Pc = 4700000, Vc = 0.209, Cc = 0.233, Tb = 329.22, Tm = 178.45, TT = 178.45, TP = 2.78509, MW = 58.08, LVB = 0.07394, AF = 0.307, SP = 19730, DM = 9.61E-30, SH = 20230000.0, IGHF = -2.157E+08, GEF = -1.513E+08, AS = 295400, HFMP = 5774000, HOC = -1.659E+09, LiqDen = {105,1.1051,0.24556,508.21,0.27409,0}, VP = {101,72.77713,-5752.936,-7.680083,6.83076E-06,2}, LiqCp = {16,107130,725.57,0.95296,0.025981,-0.00001439}, HOV = {106,6.6943E+07,3.4736,-8.9271,10.062,-4.1656}, VapCp = {16,52915,-669.27,12.201,0.00012839,-5.8844E-08}, LiqVis = {101,-14.064,1000.7,0.45349,3.9456E-07,2}, VapVis = {102,3.1012E-08,0.97616,23.042,14.834,0}, LiqK = {16,0.01013,-95.32,-0.21151,-0.0052616,0.0000023043}, VapK = {102,-26.882,0.9036,-1.2095E+08,-6.0879E+08,0}, Racketparam = 0, UniquacR = 2.5735, UniquacQ = 2.336, ChaoSeadAF = 0.3099, ChaoSeadSP = 19729.7, ChaoSeadLV = 0.0738386); + end Acetone; + + model Ethylformate + extends General_Properties( + SN = 63, name = "Ethylformate", CAS = "109-94-4", Tc = 508.5, Pc = 4740000, Vc = 0.229, Cc = 0.257, Tb = 327.47, Tm = 193.55, TT = 193.55, TP = 18.1186, MW = 74.079, LVB = 0.08093, AF = 0.282, SP = 19070, DM = 6.44E-30, SH = 20230000.0, IGHF = -3.883E+08, GEF = -3.031E+08, AS = 328200, HFMP = 9204800, HOC = -1.50696E+09, LiqDen = {105,0.85568,0.22882,508.5,0.23792,0}, VP = {101,69.04518,-5678.642,-7.031396,0.0000050057,2}, LiqCp = {16,115910,228.3,4.0783,0.027366,-0.000029781}, HOV = {106,5.9813E+07,2.1931,-4.6587,4.7089,-1.7696}, VapCp = {16,52378,-459.08,11.875,0.00065506,-2.4832E-07}, LiqVis = {101,-8.9483,848.56,-0.31567,2.8582E-07,2}, VapVis = {102,6.0691E-07,0.60378,450.04,-20466,0}, LiqK = {16,-0.030927,19.999,-1.4911,-0.000052048,-0.0000024111}, VapK = {102,381.39,0.9159,1.8E+09,-1.1462E+10,0}, Racketparam = 0, UniquacR = 2.8175, UniquacQ = 2.576, ChaoSeadAF = 0.285, ChaoSeadSP = 18938.7, ChaoSeadLV = 0.0808277); + end Ethylformate; + + model Methylacetate + extends General_Properties( + SN = 64, name = "Methylacetate", CAS = "79-20-9", Tc = 506.8, Pc = 4690000, Vc = 0.228, Cc = 0.254, Tb = 330.09, Tm = 175.15, TT = 175.15, TP = 1.01703, MW = 74.079, LVB = 0.07989, AF = 0.323, SP = 19350, DM = 5.6E-30, SH = 20230000.0, IGHF = -4.119E+08, GEF = -3.242E+08, AS = 319800, HFMP = 7970000, HOC = -1.461E+09, LiqDen = {105,0.98331,0.2428,506.86,0.2549,0}, VP = {101,83.01817,-6288.581,-9.185862,7.595367E-06,2}, LiqCp = {16,6314.4,680.3,4.1767,0.026148,-0.000027341}, HOV = {106,4.9929E+07,0.79197,-0.73136,0.37429,-0.019974}, VapCp = {16,62235,-685.05,12.348,0.00012363,-8.5641E-08}, LiqVis = {101,11.12,-100.13,-3.2745,-5.3051E-07,2}, VapVis = {102,0.0000013226,0.48849,504.21,4.2341,0}, LiqK = {16,-0.28416,27.186,-0.94457,0.00083974,-0.0000024412}, VapK = {102,-23257,-0.1738,1.0287E+07,-6.9243E+10,0}, Racketparam = 0, UniquacR = 2.8, UniquacQ = 2.58, ChaoSeadAF = 0.326, ChaoSeadSP = 19435.1, ChaoSeadLV = 0.0798903); + end Methylacetate; + + model Propionicacid + extends General_Properties( + SN = 65, name = "Propionicacid", CAS = "79-09-4", Tc = 604, Pc = 4530000, Vc = 0.233, Cc = 0.207, Tb = 414.31, Tm = 252.45, TT = 252.45, TP = 13.1, MW = 74.079, LVB = 0.07497, AF = 0.544, SP = 19490, DM = 5.84E-30, SH = 20230000.0, IGHF = -4.535E+08, GEF = -3.568E+08, AS = 294900, HFMP = 1.066E+07, HOC = -1.395E+09, LiqDen = {105,0.88103,0.22848,612.66,0.25898,0}, VP = {101,58.42,-7261.2,-4.9024,0.0000010406,2}, LiqCp = {16,120710,704.7,1.1886,0.028883,-0.000020278}, HOV = {106,4.8878E+07,3.7167,-10.822,11.498,-4.1176}, VapCp = {16,47961,-474.81,12.167,0.00020648,-6.6213E-08}, LiqVis = {101,-53.41646,2724.985,6.7143,-9.670276E-06,2}, VapVis = {102,1.6155E-08,1.0459,-115.32,27680,0}, LiqK = {16,0.067757,-235.87,-0.022659,-0.0065033,0.0000026666}, VapK = {102,0.004145,0.70902,13255,-4962900,0}, Racketparam = 0, UniquacR = 2.9, UniquacQ = 2.58, ChaoSeadAF = 0.52, ChaoSeadSP = 19130.1, ChaoSeadLV = 0.0749523); + end Propionicacid; + + model Nndimethylformamide + extends General_Properties( + SN = 66, name = "Nndimethylformamide", CAS = "68-12-2", Tc = 649.6, Pc = 4420000, Vc = 0.26199, Cc = 0.214, Tb = 425.15, Tm = 212.72, TT = 212.72, TP = 0.195325, MW = 73.0938, LVB = 0.0773903, AF = 0.31771, SP = 23960, DM = 1.27E-29, SH = 20230000.0, IGHF = -1.917E+08, GEF = -8.84E+07, AS = 326000, HFMP = 1.615E+07, HOC = -1.78871E+09, LiqDen = {105,0.65216,0.20032,649.6,0.24418,0}, VP = {101,68.99879,-7311.388,-6.749791,3.063845E-06,2}, LiqCp = {16,141440,162.91,4.0696,0.019381,-0.000013063}, HOV = {106,5.7496E+07,0.2466,0.21619,-0.11587,0.026126}, VapCp = {16,68728,-846.07,13.139,-0.00064688,1.6133E-07}, LiqVis = {101,-9.089031,826.091,-0.0843389,-3.479212E-06,2}, VapVis = {102,0.0000034602,0.37991,1156.9,8715.8,0}, LiqK = {16,0.14084,-2496,20.244,-0.064914,0.000049356}, VapK = {102,0.015205,0.35461,594.92,741220,0}, Racketparam = 0, UniquacR = 3.0856, UniquacQ = 2.736, ChaoSeadAF = 0.375516, ChaoSeadSP = 23964.9, ChaoSeadLV = 0.0773743); + end Nndimethylformamide; + + model Propane + extends General_Properties( + SN = 67, name = "Propane", CAS = "74-98-6", Tc = 369.83, Pc = 4248000, Vc = 0.2, Cc = 0.276, Tb = 231.02, Tm = 85.47, TT = 85.47, TP = 0.0001685, MW = 44.097, LVB = 0.07487, AF = 0.152, SP = 13100, DM = 0, SH = -104680000.0, IGHF = -1.0468E+08, GEF = -2.439E+07, AS = 270200, HFMP = 3524000, HOC = -2.04311E+09, LiqDen = {105,1.3186,0.27005,369.86,0.27852,0}, VP = {101,55.2725,-3396.946,-5.423393,8.953731E-06,2}, LiqCp = {16,87486,-13371,156.92,-0.5459,0.00068504}, HOV = {106,3.0459E+07,1.2001,-2.1107,1.9732,-0.65316}, VapCp = {16,37840.4,-445.5789,11.83871,0.000653764,-2.200137E-07}, LiqVis = {101,-35.23159,966.1472,4.395026,-0.0000255079,2}, VapVis = {102,4.7422E-08,0.90416,-4.7484,478.57,0}, LiqK = {16,0.02937,-16.323,-1.3313,-0.0012596,-0.000011206}, VapK = {102,-1.139,0.10904,-9898.6,-7669600,0}, Racketparam = 0.2763, UniquacR = 2.4766, UniquacQ = 2.236, ChaoSeadAF = 0.1538, ChaoSeadSP = 13091.2, ChaoSeadLV = 0.084); + end Propane; + + model Isopropanol + extends General_Properties( + SN = 68, name = "Isopropanol", CAS = "67-63-0", Tc = 508.3, Pc = 4762000, Vc = 0.22, Cc = 0.248, Tb = 355.39, Tm = 185.28, TT = 185.28, TP = 0.0363946, MW = 60.096, LVB = 0.07692, AF = 0.665, SP = 23420, DM = 5.54E-30, SH = -104680000.0, IGHF = -2.727E+08, GEF = -1.7347E+08, AS = 309200, HFMP = 5410000, HOC = -1.83E+09, LiqDen = {105,1.1898,0.26648,508.3,0.23986,0}, VP = {101,77.70856,-7630.115,-7.63517,9.965114E-07,2}, LiqCp = {16,-188260,277.99,9.4459,0.010702,-0.0000091964}, HOV = {106,1.100995E+08,4.1961,-10.70959,11.69444,-4.625499}, VapCp = {16,52738,-555.28,12.347,0.000094247,-4.5945E-08}, LiqVis = {101,-7.4407,2259.7,-1.1149,0.0000002963,2}, VapVis = {102,1.9931E-07,0.72329,178.01,-15.318,0}, LiqK = {16,-0.15761,49.41,-1.6579,0.0019566,-0.0000034939}, VapK = {102,0.0028843,0.91609,11082,-222500,0}, Racketparam = 0.2493, UniquacR = 2.78, UniquacQ = 2.51, ChaoSeadAF = 0.7238, ChaoSeadSP = 23408.3, ChaoSeadLV = 0.0768988); + end Isopropanol; + + model Onepropanol + extends General_Properties( + SN = 69, name = "Onepropanol", CAS = "71-23-8", Tc = 536.78, Pc = 5175000, Vc = 0.219, Cc = 0.254, Tb = 370.93, Tm = 146.95, TT = 146.95, TP = 3.69121E-07, MW = 60.096, LVB = 0.07514, AF = 0.629, SP = 24450, DM = 5.6E-30, SH = -104680000.0, IGHF = -2.552E+08, GEF = -1.599E+08, AS = 322470, HFMP = 5372000, HOC = -1.84381E+09, LiqDen = {105,1.1537,0.26188,536.78,0.23549,0}, VP = {101,141.3971,-10434.27,-17.45829,0.0000113246,2}, LiqCp = {16,100520,125.3,4.7194,0.024513,-0.000019669}, HOV = {106,8.36461E+07,3.338812,-9.831137,11.8901,-4.905709}, VapCp = {16,56681,-627.22,12.379,0.00012228,-5.0293E-08}, LiqVis = {101,-98.08798,4904.749,13.57131,-0.0000219968,2}, VapVis = {102,7.9322E-07,0.54936,416.77,-100.81,0}, LiqK = {16,0.076645,-189.91,-0.13475,-0.0069283,0.0000033645}, VapK = {102,-453.4,0.64532,-2.843E+08,-2.8865E+10,0}, Racketparam = 0.2451, UniquacR = 2.78, UniquacQ = 2.51, ChaoSeadAF = 0.623, ChaoSeadSP = 24557.3, ChaoSeadLV = 0.0749393); + end Onepropanol; + + model Trimethylamine + extends General_Properties( + SN = 70, name = "Trimethylamine", CAS = "75-50-3", Tc = 433.3, Pc = 4075000, Vc = 0.254, Cc = 0.266, Tb = 276.02, Tm = 156.08, TT = 156.08, TP = 9.92058, MW = 59.111, LVB = 0.09428, AF = 0.206243, SP = 14360, DM = 2.04E-30, SH = -24310000.0, IGHF = -2.431E+07, GEF = 9.899E+07, AS = 287000, HFMP = 6544000, HOC = -2.2449E+09, LiqDen = {105,0.67928,0.21649,433.3,0.20925,0}, VP = {101,110.254,-5770.536,-14.1719,0.0000238614,2}, LiqCp = {16,112140,1253.3,-12.905,0.10424,-0.00013798}, HOV = {106,4.743116E+07,0.966273,0.752593,-2.762744,1.513109}, VapCp = {16,65203,-794.87,12.953,-0.00031634,6.4426E-08}, LiqVis = {101,9.9961,-126.46,-3.1956,-6.7828E-08,2}, VapVis = {102,0.000001161,0.48519,364.43,10928,0}, LiqK = {16,-0.0043132,-14.875,-1.2529,-0.0019969,-0.0000017575}, VapK = {102,0.00027205,0.90104,140.75,139110,0}, Racketparam = 0, UniquacR = 2.99, UniquacQ = 2.64, ChaoSeadAF = 0.205, ChaoSeadSP = 15311.1, ChaoSeadLV = 0.0902163); + end Trimethylamine; + + model Vinylacetylene + extends General_Properties( + SN = 71, name = "Vinylacetylene", CAS = "689-97-4", Tc = 454, Pc = 4860000, Vc = 0.205, Cc = 0.264, Tb = 278.25, Tm = 0, TT = 0, TP = 0, MW = 52.0746, LVB = 0.0769826, AF = 0.106852, SP = 16360, DM = 1.3E-30, SH = 304600000.0, IGHF = 3.046E+08, GEF = 3.06E+08, AS = 279400, HFMP = 0, HOC = -2.362E+09, LiqDen = {105,1.2594,0.25931,454,0.29553,0}, VP = {101,79.0442,-5001.865,-8.984128,0.0000129415,2}, LiqCp = {16,68382,-63.514,9.912,0.0031404,-1.0307E-07}, HOV = {106,3.313507E+07,-0.0105563,0.71867,-0.291074,0.0215152}, VapCp = {16,49981,-581.7,12.052,-0.00010825,3.173E-08}, LiqVis = {101,-2.2453,320.68,-1.2895,-5.6512E-09,2}, VapVis = {102,6.7484E-07,0.5304,230.17,-0.0024795,0}, LiqK = {16,-0.05887,-27.718,-0.92317,-0.0023581,1.5773E-07}, VapK = {102,0.000054197,1.0632,-70.589,90617,0}, Racketparam = 0.281184, UniquacR = 3.526, UniquacQ = 2.94, ChaoSeadAF = 0.11815, ChaoSeadSP = 17035, ChaoSeadLV = 0.0740148); + end Vinylacetylene; + + model Thiophene + extends General_Properties( + SN = 72, name = "Thiophene", CAS = "110-02-1", Tc = 580, Pc = 5660000, Vc = 0.219, Cc = 0.252, Tb = 357.31, Tm = 234.94, TT = 234.94, TP = 185.638, MW = 84.142, LVB = 0.07947, AF = 0.186, SP = 20120, DM = 1.8E-30, SH = 304600000.0, IGHF = 1.1544E+08, GEF = 1.267E+08, AS = 278400, HFMP = 5085600, HOC = -2.4352E+09, LiqDen = {105,0.73395,0.21494,580,0.2288,0}, VP = {101,88.26733,-6809.188,-9.975872,0.0000074967,2}, LiqCp = {16,84631,-77.085,9.4174,0.0060386,-0.0000042543}, HOV = {106,4.87E+07,0.35468,0.57965,-0.92941,0.39593}, VapCp = {16,31580,-546.03,12.548,-0.00032144,9.6227E-08}, LiqVis = {101,-15.561,1306.6,0.66009,3.2071E-07,2}, VapVis = {102,0.0000010722,0.54275,557.27,2874.5,0}, LiqK = {16,0.024119,-20.319,-1.5338,-0.0014869,-6.6677E-07}, VapK = {102,0.00013168,0.98328,649.4,-5290.1,0}, Racketparam = 0.274238, UniquacR = 2.8569, UniquacQ = 2.14, ChaoSeadAF = 0.192846, ChaoSeadSP = 20219.8, ChaoSeadLV = 0.0794773); + end Thiophene; + + model Methacrylonitrile + extends General_Properties( + SN = 73, name = "Methacrylonitrile", CAS = "126-98-7", Tc = 554, Pc = 3880000, Vc = 0.265, Cc = 0.223, Tb = 363.45, Tm = 237.35, TT = 237.35, TP = 268.868, MW = 67.0892, LVB = 0.0844058, AF = 0.301271, SP = 19090, DM = 1.23E-29, SH = 304600000.0, IGHF = 9.803E+07, GEF = 1.64E+08, AS = 223800, HFMP = 0, HOC = -2.243E+09, LiqDen = {105,0.89537,0.23729,554,0.29629,0}, VP = {101,56.07917,-5342.951,-5.152858,4.011012E-06,2}, LiqCp = {16,125060,169.88,6.1441,0.015707,-0.000014502}, HOV = {106,4.4103E+07,0.56334,-0.51577,0.31852,-0.072403}, VapCp = {16,68640,-664.02,12.252,0.000039427,-4.9098E-08}, LiqVis = {101,-14.973,1174.5,0.57272,-0.0000017357,2}, VapVis = {102,3.3003E-07,0.64938,329.57,-240,0}, LiqK = {16,0.095479,1984.5,-23.334,0.076497,-0.000098215}, VapK = {102,0.0010085,1.2282,49915,0.89214,0}, Racketparam = 0, UniquacR = 2.987475, UniquacQ = 2.712, ChaoSeadAF = 0.301271, ChaoSeadSP = 19094, ChaoSeadLV = 0.0844058); + end Methacrylonitrile; + + model Dimethylacetylene + extends General_Properties( + SN = 74, name = "Dimethylacetylene", CAS = "503-17-3", Tc = 473.2, Pc = 4870000, Vc = 0.221, Cc = 0.274, Tb = 300.13, Tm = 240.91, TT = 240.91, TP = 6121.21, MW = 54.0904, LVB = 0.0788997, AF = 0.238542, SP = 17480, DM = 1.32E-29, SH = 304600000.0, IGHF = 1.457E+08, GEF = 1.849E+08, AS = 283300, HFMP = 9234000, HOC = -2.4189E+09, LiqDen = {105,1.1717,0.25895,473.2,0.27289,0}, VP = {101,66.56107,-4998.053,-6.834282,6.682052E-06,2}, LiqCp = {16,116500,35.116,5.8634,0.0049877,0.000013087}, HOV = {106,4761730,-11.5565,30.6629,-31.89366,12.67797}, VapCp = {16,62226,-826.04,12.513,-0.0002013,4.9424E-08}, LiqVis = {101,-0.045622,305.04,-1.6582,-4.749E-08,2}, VapVis = {102,0.0000021802,0.39407,508.41,3758,0}, LiqK = {16,0.0074431,-154.13,-0.25098,-0.0046292,-7.3662E-08}, VapK = {102,0.00021497,0.91998,214.54,130500,0}, Racketparam = 0, UniquacR = 2.8635, UniquacQ = 2.48, ChaoSeadAF = 0.1301, ChaoSeadSP = 17463.7, ChaoSeadLV = 0.0789036); + end Dimethylacetylene; + + model Ethylacetylene + extends General_Properties( + SN = 75, name = "Ethylacetylene", CAS = "107-00-6", Tc = 440, Pc = 4600000, Vc = 0.208, Cc = 0.262, Tb = 281.21, Tm = 147.429, TT = 147.43, TP = 1.17966, MW = 54.092, LVB = 0.08322, AF = 0.245, SP = 15950, DM = 2.7E-30, SH = 165200000.0, IGHF = 1.652E+08, GEF = 2.0225E+08, AS = 290390, HFMP = 6029270, HOC = -2.4647E+09, LiqDen = {105,1.3447,0.27928,440,0.29778,0}, VP = {101,76.044,-5031.59,-8.40406,9.681824E-06,2}, LiqCp = {16,109820,1148.7,-9.607,0.084548,-0.00010384}, HOV = {106,3.604722E+07,0.546439,-0.26185,0,0}, VapCp = {16,44709,-441.89,11.889,0.00039371,-1.2645E-07}, LiqVis = {101,-4.3451,354.46,-0.92921,-0.0000006027,2}, VapVis = {102,0.0000027867,0.37696,663.32,30.832,0}, LiqK = {16,-0.032845,13.956,-1.5811,-0.00025138,-0.0000029965}, VapK = {102,0.000036868,1.1429,-57.854,83816,0}, Racketparam = 0, UniquacR = 2.8675, UniquacQ = 2.476, ChaoSeadAF = 0.246864, ChaoSeadSP = 16554, ChaoSeadLV = 0.0809511); + end Ethylacetylene; + + model OneTwobutadiene + extends General_Properties( + SN = 76, name = "OneTwobutadiene", CAS = "590-19-2", Tc = 452, Pc = 4360000, Vc = 0.22, Cc = 0.255, Tb = 284, Tm = 136.95, TT = 136.95, TP = 0.4472, MW = 54.0904, LVB = 0.0838169, AF = 0.165877, SP = 15650, DM = 1.34E-30, SH = 162300000.0, IGHF = 1.623E+08, GEF = 1.986E+08, AS = 293000, HFMP = 6962000, HOC = -2.4617E+09, LiqDen = {105,0.86492,0.22148,452,0.28373,0}, VP = {101,53.27585,-4559.624,-4.46417,-6.771964E-06,2}, LiqCp = {16,109750,-2425.1,12.655,0.059068,-0.00014415}, HOV = {106,3.715905E+07,0.824251,0.000387028,-2.253417,2.024613}, VapCp = {16,39504.04,-354.1475,11.62099,0.00074321,-2.513775E-07}, LiqVis = {101,-9.9134,468.65,-0.069814,2.8031E-07,2}, VapVis = {102,6.4328E-07,0.52378,170.73,9690.7,0}, LiqK = {16,-0.29344,3.1314,-0.70701,-0.00052702,-3.6665E-07}, VapK = {102,0.000085434,1.0359,127.53,78342,0}, Racketparam = 0, UniquacR = 2.466, UniquacQ = 2.024, ChaoSeadAF = 0.3394, ChaoSeadSP = 16360.6, ChaoSeadLV = 0.0816506); + end OneTwobutadiene; + + model OneThreebutadiene + extends General_Properties( + SN = 77, name = "OneThreebutadiene", CAS = "106-99-0", Tc = 425, Pc = 4320000, Vc = 0.221, Cc = 0.27, Tb = 268.62, Tm = 164.25, TT = 164.25, TP = 69.1989, MW = 54.092, LVB = 0.08804, AF = 0.195, SP = 14460, DM = 0, SH = 109240000.0, IGHF = 1.0924E+08, GEF = 1.4972E+08, AS = 278890, HFMP = 7984000, HOC = -2.409E+09, LiqDen = {105,1.3314,0.28213,425,0.30137,0}, VP = {101,64.81816,-4314.788,-6.766483,8.589719E-06,2}, LiqCp = {16,88166,583.44,1.8231,0.030118,-0.000025695}, HOV = {106,3.4211E+07,0.45981,0.016247,-0.15407,0.054476}, VapCp = {16,38238.49,-511.235,12.39338,-0.000121482,4.39211E-08}, LiqVis = {101,12.653,-139.12,-3.6735,-0.0000014093,2}, VapVis = {102,3.4426E-07,0.6407,174.17,-2393.4,0}, LiqK = {16,-0.096853,19.016,-1.4201,0.00020099,-0.0000029536}, VapK = {102,-18588,0.94195,-7.31E+10,-9.6975E+11,0}, Racketparam = 0.2713, UniquacR = 2.6908, UniquacQ = 2.352, ChaoSeadAF = 0.2028, ChaoSeadSP = 14195.77, ChaoSeadLV = 0.088); + end OneThreebutadiene; + + model Onebutene + extends General_Properties( + SN = 78, name = "Onebutene", CAS = "106-98-9", Tc = 419.5, Pc = 4020000, Vc = 0.2408, Cc = 0.278, Tb = 266.92, Tm = 87.8, TT = 87.8, TP = 0.000000694, MW = 56.108, LVB = 0.09534, AF = 0.194, SP = 13630, DM = 1.13E-30, SH = -500000.0, IGHF = -500000, GEF = 7.041E+07, AS = 307400, HFMP = 3848000, HOC = -2.5408E+09, LiqDen = {105,0.98,0.25169,419.54,0.26645,0}, VP = {101,41.66588,-3605.004,-2.983562,6.665773E-07,2}, LiqCp = {16,100270,86.345,7.7333,0.00096546,0.000020281}, HOV = {106,3.5338E+07,0.68186,-0.28099,-0.25369,0.26017}, VapCp = {16,53529,-619.26,12.431,0.000096632,-3.9013E-08}, LiqVis = {101,-10.764,591.51,-0.0017307,2.5723E-08,2}, VapVis = {102,7.0347E-07,0.54535,308.83,-232.73,0}, LiqK = {16,0.071267,99.471,-4.2011,0.014325,-0.000041157}, VapK = {102,0.000092115,1.1181,717.19,13037,0}, Racketparam = 0.2736, UniquacR = 2.92, UniquacQ = 2.56, ChaoSeadAF = 0.2085, ChaoSeadSP = 13827.58, ChaoSeadLV = 0.0953); + end Onebutene; + + model CisTwobutene + extends General_Properties( + SN = 79, name = "CisTwobutene", CAS = "590-18-1", Tc = 435.5, Pc = 4210000, Vc = 0.2338, Cc = 0.269, Tb = 276.87, Tm = 134.26, TT = 134.26, TP = 0.272, MW = 56.108, LVB = 0.09101, AF = 0.203, SP = 14720, DM = 1.0E-30, SH = -7400000.0, IGHF = -7400000, GEF = 6.536E+07, AS = 301200, HFMP = 7309400, HOC = -2.5339E+09, LiqDen = {105,1.1591,0.27085,435.5,0.28116,0}, VP = {101,82.92441,-5022.628,-9.652369,0.0000133961,2}, LiqCp = {16,79532,110.96,9.7654,-0.0036798,0.000019578}, HOV = {106,3.4358E+07,0.38004,0,0,0}, VapCp = {16,53149,-719.47,12.619,-0.000047815,4.5198E-10}, LiqVis = {101,-17.96838,892.0637,1.159883,-2.883463E-06,2}, VapVis = {102,4.0697E-08,0.91942,-12.143,1343.2,0}, LiqK = {16,-0.032373,19.125,-1.716,0.00030408,-0.0000042934}, VapK = {102,0.000075196,1.0578,-53.701,131760,0}, Racketparam = 0.2705, UniquacR = 2.9189, UniquacQ = 2.563, ChaoSeadAF = 0.2575, ChaoSeadSP = 13827.58, ChaoSeadLV = 0.0912); + end CisTwobutene; + + model TransTwobutene + extends General_Properties( + SN = 80, name = "TransTwobutene", CAS = "624-64-6", Tc = 428.6, Pc = 4100000, Vc = 0.2377, Cc = 0.276, Tb = 274.03, Tm = 167.62, TT = 167.62, TP = 74.5, MW = 56.108, LVB = 0.09365, AF = 0.218, SP = 14210, DM = 0, SH = -11000000.0, IGHF = -1.1E+07, GEF = 6.32E+07, AS = 296500, HFMP = 9757500, HOC = -2.53E+09, LiqDen = {105,1.1523,0.27235,428.6,0.28543,0}, VP = {101,56.602,-4026.7,-5.5178,0.0000079176,2}, LiqCp = {16,98730,549.96,0.83133,0.038607,-0.000044392}, HOV = {106,3.3476E+07,0.31355,0.41478,-0.75555,0.40695}, VapCp = {16,60006,-649.72,12.368,0.00014661,-5.1566E-08}, LiqVis = {101,-16.05639,833.2986,0.849646,-2.292227E-06,2}, VapVis = {102,0.0000010493,0.48674,358.01,137.53,0}, LiqK = {16,0.060004,368.81,-7.3737,0.025078,-0.000049526}, VapK = {102,0.000078563,1.0565,14.753,105810,0}, Racketparam = 0.2721, UniquacR = 2.9189, UniquacQ = 2.563, ChaoSeadAF = 0.2138, ChaoSeadSP = 14207.7, ChaoSeadLV = 0.0893483); + end TransTwobutene; + + model Isobutene + extends General_Properties( + SN = 81, name = "Isobutene", CAS = "115-11-7", Tc = 417.9, Pc = 4000000, Vc = 0.2388, Cc = 0.275, Tb = 266.24, Tm = 132.81, TT = 132.81, TP = 0.644929, MW = 56.108, LVB = 0.09524, AF = 0.2, SP = 13660, DM = 1.67E-30, SH = -17100000.0, IGHF = -1.71E+07, GEF = 5.808E+07, AS = 293090, HFMP = 5931200, HOC = -2.5242E+09, LiqDen = {105,1.01,0.25611,417.9,0.2642,0}, VP = {101,47.13879,-3682.162,-3.952514,4.044185E-06,2}, LiqCp = {16,95317,-68.58,9.3268,0.0023434,0.0000076824}, HOV = {106,3.916E+07,1.1638,-1.4033,0.81203,-0.13521}, VapCp = {16,49784,-472.84,12.012,0.00052863,-1.7772E-07}, LiqVis = {101,-12.717,644.93,0.3696,-0.0000023983,2}, VapVis = {102,0.0000028839,0.33897,365.04,17752,0}, LiqK = {16,0.061493,33.335,-2.4686,0.0041425,-0.000023609}, VapK = {102,-418.21,0.91306,-1.5105E+09,3.1789E+10,0}, Racketparam = 0.2727, UniquacR = 2.9195, UniquacQ = 2.684, ChaoSeadAF = 0.1951, ChaoSeadSP = 13659.3, ChaoSeadLV = 0.0953727); + end Isobutene; + + model Twomethylpropanal + extends General_Properties( + SN = 82, name = "Twomethylpropanal", CAS = "78-84-2", Tc = 507, Pc = 4100000, Vc = 0.263, Cc = 0.256, Tb = 337.25, Tm = 208.15, TT = 208.15, TP = 34.8247, MW = 72.1057, LVB = 0.0920264, AF = 0.36218, SP = 18450, DM = 9.0E-30, SH = -17100000.0, IGHF = -2.158E+08, GEF = -1.214E+08, AS = 331200, HFMP = 1.2E+07, HOC = -2.2913E+09, LiqDen = {105,0.97266,0.25698,507,0.28571,0}, VP = {101,102.1731,-7116.016,-12.16592,0.0000111612,2}, LiqCp = {16,143330,110.87,5.2999,0.018869,-0.000016131}, HOV = {106,4.95108E+07,0.263532,1.209662,-2.271572,1.223299}, VapCp = {16,68500,-741.45,12.977,-0.00061649,3.0243E-07}, LiqVis = {101,-10.535,970.52,-0.049339,1.1673E-08,2}, VapVis = {102,1.9586E-07,0.71384,159.71,-212.67,0}, LiqK = {16,0.10024,-223.61,-0.25771,-0.00474,-0.000011884}, VapK = {102,-2151.4,-0.21039,974960,-5.0943E+09,0}, Racketparam = 0, UniquacR = 3.2471, UniquacQ = 2.872, ChaoSeadAF = 0.37009, ChaoSeadSP = 18234.6, ChaoSeadLV = 0.0920137); + end Twomethylpropanal; + + model Methylethylketone + extends General_Properties( + SN = 83, name = "Methylethylketone", CAS = "78-93-3", Tc = 536.8, Pc = 4210000, Vc = 0.267, Cc = 0.252, Tb = 352.71, Tm = 186.48, TT = 186.48, TP = 1.3904, MW = 72.107, LVB = 0.09013, AF = 0.322, SP = 18880, DM = 9.21E-30, SH = -17100000.0, IGHF = -2.39E+08, GEF = -1.47E+08, AS = 339400, HFMP = 8385000, HOC = -2.268E+09, LiqDen = {105,0.16518,0.10716,536.8,0.15066,0}, VP = {101,84.00012,-6498.964,-9.389584,8.32043E-06,2}, LiqCp = {16,137210,245.98,6.3249,0.009404,3.3143E-07}, HOV = {106,4.7221E+07,0.30759,0.48591,-0.8645,0.45018}, VapCp = {16,69404,-545.04,12.139,0.00045578,-1.6351E-07}, LiqVis = {101,-0.60519,503.02,-1.5659,5.5782E-08,2}, VapVis = {102,2.8817E-08,0.96765,-28.58,7703,0}, LiqK = {16,-0.17871,4.3086,-1.0343,0.00010801,-0.0000015411}, VapK = {102,-4970700,-0.23106,2.2577E+09,-1.0834E+13,0}, Racketparam = 0, UniquacR = 3.25, UniquacQ = 2.88, ChaoSeadAF = 0.3241, ChaoSeadSP = 18878.7, ChaoSeadLV = 0.0901936); + end Methylethylketone; + + model Tetrahydrofuran + extends General_Properties( + SN = 84, name = "Tetrahydrofuran", CAS = "109-99-9", Tc = 540.2, Pc = 5190000, Vc = 0.224, Cc = 0.259, Tb = 339.12, Tm = 164.65, TT = 164.65, TP = 0.195542, MW = 72.107, LVB = 0.08171, AF = 0.225, SP = 18970, DM = 5.44E-30, SH = -17100000.0, IGHF = -1.8418E+08, GEF = -7.969E+07, AS = 297290, HFMP = 8540000, HOC = -2.325E+09, LiqDen = {105,1.054,0.25754,540.2,0.26776,0}, VP = {101,82.74347,-6236.553,-9.221137,0.0000078089,2}, LiqCp = {16,83351,774.14,0.38273,0.036255,-0.00003559}, HOV = {106,4.770629E+07,0.8303,-0.617577,-0.253996,0.501899}, VapCp = {16,41616,-744.85,13.048,-0.00029616,7.4486E-08}, LiqVis = {101,-10.047,896.61,-0.11864,2.5625E-07,2}, VapVis = {102,3.3286E-07,0.67758,342.35,-15667,0}, LiqK = {16,-0.22085,9.5971,-0.99496,-0.00017415,-6.4958E-07}, VapK = {102,0.000010439,1.4482,729.36,-9829.3,0}, Racketparam = 0.259, UniquacR = 2.94, UniquacQ = 2.4, ChaoSeadAF = 0.225, ChaoSeadSP = 19042.3, ChaoSeadLV = 0.0819417); + end Tetrahydrofuran; + + model OneFourdioxane + extends General_Properties( + SN = 85, name = "OneFourdioxane", CAS = "123-91-1", Tc = 587, Pc = 5170000, Vc = 0.238, Cc = 0.255, Tb = 374.5, Tm = 284.95, TT = 284.95, TP = 2532.46, MW = 88.106, LVB = 0.08529, AF = 0.279262, SP = 20540, DM = 0, SH = -17100000.0, IGHF = -3.158E+08, GEF = -1.816E+08, AS = 300120, HFMP = 1.284E+07, HOC = -2.1863E+09, LiqDen = {105,1.0039,0.25926,587,0.28278,0}, VP = {101,50.11504,-5577.21,-4.046854,2.080567E-06,2}, LiqCp = {16,151550,-65314,519.35,-1.3402,0.0011989}, HOV = {106,2.1367E+08,9.1812,-22.992,23.854,-9.34}, VapCp = {16,46250,-613.41,12.822,0.000004782,-2.2238E-08}, LiqVis = {101,-79.28,4198.4,10.393,-0.0000085568,2}, VapVis = {102,2.7334E-07,0.7393,129.93,-0.0004206,0}, LiqK = {16,0.089834,46.421,-1.1898,-0.0037338,-0.0000061358}, VapK = {102,2.3873E-07,1.8505,-94.575,7804.2,0}, Racketparam = 0.254, UniquacR = 3.07, UniquacQ = 2.28, ChaoSeadAF = 0.280373, ChaoSeadSP = 20163.3, ChaoSeadLV = 0.0856635); + end OneFourdioxane; + + model Nbutyricacid + extends General_Properties( + SN = 86, name = "Nbutyricacid", CAS = "107-92-6", Tc = 624, Pc = 4030000, Vc = 0.292, Cc = 0.227, Tb = 436.87, Tm = 267.95, TT = 267.95, TP = 10.3, MW = 88.106, LVB = 0.09246, AF = 0.72, SP = 20180, DM = 5.5E-30, SH = -17100000.0, IGHF = -4.758E+08, GEF = -3.6E+08, AS = 360100, HFMP = 1.159E+07, HOC = -2.008E+09, LiqDen = {105,0.702,0.22902,628.16,0.24275,0}, VP = {101,54.31047,-7692.649,-4.148708,2.624319E-07,2}, LiqCp = {16,135560,664.7,1.9592,0.027685,-0.000020111}, HOV = {106,5.1387E+07,1.1517,-2.7656,2.6617,-0.66983}, VapCp = {16,75565,-613.25,12.671,-0.000058773,-2.4845E-08}, LiqVis = {101,14.241,534.99,-4.0411,0.0000053437,2}, VapVis = {102,2.2745E-08,1.0055,13.097,182.58,0}, LiqK = {16,-0.043955,57.698,-1.8847,0.00050649,-0.0000013441}, VapK = {102,0.00010747,1.3444,19634,-7296600,0}, Racketparam = 0, UniquacR = 3.5512, UniquacQ = 3.152, ChaoSeadAF = 0.683, ChaoSeadSP = 20262.7, ChaoSeadLV = 0.0924567); + end Nbutyricacid; + + model Ethylacetate + extends General_Properties( + SN = 87, name = "Ethylacetate", CAS = "141-78-6", Tc = 523.2, Pc = 3830000, Vc = 0.286, Cc = 0.252, Tb = 350.21, Tm = 189.6, TT = 189.6, TP = 1.43179, MW = 88.106, LVB = 0.09855, AF = 0.361, SP = 18350, DM = 5.94E-30, SH = -17100000.0, IGHF = -4.445E+08, GEF = -3.28E+08, AS = 359700, HFMP = 1.048E+07, HOC = -2.061E+09, LiqDen = {105,0.78926,0.24295,523.26,0.25762,0}, VP = {101,93.16862,-7073.291,-10.65983,8.16528E-06,2}, LiqCp = {16,129430,961.92,-0.12694,0.034745,-0.000031346}, HOV = {106,4.9527E+07,0.37029,0.072685,-0.077493,0.017381}, VapCp = {16,97183,-1121.4,13.827,-0.0012343,3.6158E-07}, LiqVis = {101,16.428,-219.29,-4.124,6.0568E-07,2}, VapVis = {102,0.0000034514,0.35236,732.29,-3982.4,0}, LiqK = {16,0.040771,-127.25,-0.26995,-0.0055753,9.9363E-07}, VapK = {102,2.3264E-07,1.902,102.58,-17015,0}, Racketparam = 0, UniquacR = 3.48, UniquacQ = 3.12, ChaoSeadAF = 0.362, ChaoSeadSP = 18345.6, ChaoSeadLV = 0.0985939); + end Ethylacetate; + + model Methylpropionate + extends General_Properties( + SN = 88, name = "Methylpropionate", CAS = "554-12-1", Tc = 530.6, Pc = 4000000, Vc = 0.282, Cc = 0.256, Tb = 352.6, Tm = 185.65, TT = 185.65, TP = 0.634091, MW = 88.106, LVB = 0.09693, AF = 0.349, SP = 18630, DM = 5.681E-30, SH = -17100000.0, IGHF = -4.275E+08, GEF = -3.11E+08, AS = 359600, HFMP = 1.01E+07, HOC = -2.078E+09, LiqDen = {105,0.72945,0.23284,530.6,0.24422,0}, VP = {101,91.97365,-7071.987,-10.4626,7.767427E-06,2}, LiqCp = {16,140380,1173.7,0.81056,0.020863,-0.000005642}, HOV = {106,7.6303E+07,2.9196,-6.5593,6.8235,-2.6926}, VapCp = {16,11365,-258.45,12.315,0.00033508,-7.4281E-08}, LiqVis = {101,-8.2868,807.93,-0.36444,-0.0000010038,2}, VapVis = {102,3.2912E-07,0.63237,126.55,15669,0}, LiqK = {16,0.034599,27.577,-2.1207,0.00098891,-0.0000051703}, VapK = {102,-197.62,-0.13413,101740,-8.2156E+08,0}, Racketparam = 0, UniquacR = 3.4786, UniquacQ = 3.116, ChaoSeadAF = 0.391, ChaoSeadSP = 18626.5, ChaoSeadLV = 0.0969396); + end Methylpropionate; + + model Npropylformate + extends General_Properties( + SN = 89, name = "Npropylformate", CAS = "110-74-7", Tc = 538, Pc = 4060000, Vc = 0.285, Cc = 0.259, Tb = 354.69, Tm = 180.25, TT = 180.25, TP = 0.211011, MW = 88.106, LVB = 0.09794, AF = 0.32, SP = 18470, DM = 6.37E-30, SH = -17100000.0, IGHF = -4.076E+08, GEF = -2.936E+08, AS = 367800, HFMP = 1.32E+07, HOC = -2.041E+09, LiqDen = {105,0.915,0.26134,538,0.28,0}, VP = {101,71.35267,-6244.56,-7.280094,4.220422E-06,2}, LiqCp = {16,76453,-41.853,10.797,0.0021776,0.0000016375}, HOV = {106,5.414398E+07,0.597341,-0.589234,1.004533,-0.602007}, VapCp = {16,48655,-455.54,12.53,0.000075917,-4.246E-09}, LiqVis = {101,-51.649,2317.7,6.5556,-0.000012396,2}, VapVis = {102,6.0899E-07,0.58607,368.57,-171.06,0}, LiqK = {16,0.017242,-22.474,-1.4478,-0.0011278,-0.0000020716}, VapK = {102,661.08,0.99232,5.8449E+09,-9.0597E+10,0}, Racketparam = 0, UniquacR = 3.4919, UniquacQ = 3.116, ChaoSeadAF = 0.314, ChaoSeadSP = 18339.9, ChaoSeadLV = 0.0979424); + end Npropylformate; + + model Sulfolane + extends General_Properties( + SN = 90, name = "Sulfolane", CAS = "126-33-0", Tc = 855, Pc = 7290000, Vc = 0.3365, Cc = 0.345074, Tb = 560.45, Tm = 300.55, TT = 300.55, TP = 0.704459, MW = 120.17, LVB = 0.0952677, AF = 0.5234, SP = 26110, DM = 1.56E-29, SH = -17100000.0, IGHF = -3.727E+08, GEF = -2.431E+08, AS = 347500, HFMP = 1373000, HOC = -2.397E+09, LiqDen = {105,0.89997,0.26972,853,0.30746,0}, VP = {101,112.0995,-12237.47,-12.64533,4.157394E-06,2}, LiqCp = {16,122690,-336.31,11.614,0.0017011,-5.0866E-07}, HOV = {106,1.605659E+08,3.828131,-7.67047,6.739132,-2.353929}, VapCp = {16,92921,-999.97,13.757,-0.00093192,0.0000002258}, LiqVis = {101,-56.251,4046.1,6.7894,-0.0000052803,2}, VapVis = {102,2.9074E-08,0.97453,81.209,-9361.1,0}, LiqK = {16,0.079581,-84.501,-1.1134,-0.0025206,2.9748E-07}, VapK = {102,0.000077821,1.0313,528.38,54551,0}, Racketparam = 0.257009, UniquacR = 4.0357, UniquacQ = 3.2, ChaoSeadAF = 0.377998, ChaoSeadSP = 26335.8, ChaoSeadLV = 0.0952677); + end Sulfolane; + + model Nndimethylacetamide + extends General_Properties( + SN = 91, name = "Nndimethylacetamide", CAS = "127-19-5", Tc = 658, Pc = 4030000, Vc = 0.321, Cc = 0.236, Tb = 439.25, Tm = 253.15, TT = 253.15, TP = 7.64072, MW = 87.1204, LVB = 0.0930285, AF = 0.363509, SP = 22350, DM = 1.27088E-29, SH = -17100000.0, IGHF = -2.25E+08, GEF = -8.85E+07, AS = 351000, HFMP = 1.04182E+07, HOC = -2.38E+09, LiqDen = {105,0.72553,0.2328,658,0.27034,0}, VP = {101,67.333,-7592.9,-6.3978,0.0000021543,2}, LiqCp = {16,175450,252.77,11.249,-0.052983,0.00011812}, HOV = {106,5.8939E+07,0.34564,-0.28415,0.52832,-0.2171}, VapCp = {16,41899,-423.52,12.444,0.00039958,-1.2339E-07}, LiqVis = {101,16.727,-219.71,-4.0135,-0.0000013942,2}, VapVis = {102,3.4592E-07,0.64442,412.29,-8784,0}, LiqK = {16,0.06447,-206.75,-0.7204,0.00031649,-0.000010441}, VapK = {102,0.0011762,0.72055,943.06,275760,0}, Racketparam = 0.258662, UniquacR = 3.760053, UniquacQ = 3.276, ChaoSeadAF = 0.363509, ChaoSeadSP = 22352.7, ChaoSeadLV = 0.0930285); + end Nndimethylacetamide; + + model Nbutane + extends General_Properties( + SN = 92, name = "Nbutane", CAS = "106-97-8", Tc = 425.12, Pc = 3796000, Vc = 0.255, Cc = 0.274, Tb = 272.66, Tm = 134.86, TT = 134.86, TP = 0.67358, MW = 58.123, LVB = 0.10048, AF = 0.199, SP = 13510, DM = 0, SH = -125790000.0, IGHF = -1.2579E+08, GEF = -1.67E+07, AS = 309910, HFMP = 4661000, HOC = -2.65732E+09, LiqDen = {105,1.0023,0.26457,425.17,0.27138,0}, VP = {101,68.5773,-4444.916,-7.395837,9.857432E-06,2}, LiqCp = {16,115150,-3564.7,41.067,-0.098803,0.0001183}, HOV = {106,3.6258E+07,0.83741,-0.83676,0.41526,-0.007606}, VapCp = {16,44749.95,-338.1412,11.81452,0.00097744,-3.359129E-07}, LiqVis = {101,-46.56549,1439.945,6.168131,-0.000023917,2}, VapVis = {102,2.7078E-08,0.97147,-51.16,6431,0}, LiqK = {16,0.00024966,-43.155,-0.78129,-0.0043776,-4.136E-08}, VapK = {102,0.042635,0.45147,4234,1756600,0}, Racketparam = 0.2728, UniquacR = 3.151, UniquacQ = 2.776, ChaoSeadAF = 0.1953, ChaoSeadSP = 13766.21, ChaoSeadLV = 0.1014); + end Nbutane; + + model Isobutane + extends General_Properties( + SN = 93, name = "Isobutane", CAS = "75-28-5", Tc = 407.85, Pc = 3640000, Vc = 0.2627, Cc = 0.278, Tb = 261.34, Tm = 113.54, TT = 113.54, TP = 0.0120622, MW = 58.123, LVB = 0.10436, AF = 0.186, SP = 12560, DM = 4.4E-31, SH = -134990000.0, IGHF = -1.3499E+08, GEF = -2.144E+07, AS = 295500, HFMP = 4540000, HOC = -2.64812E+09, LiqDen = {105,0.89934,0.25371,407.85,0.25125,0}, VP = {101,70.58866,-4298.161,-7.798635,0.0000116,2}, LiqCp = {16,89466,-323.61,12.827,-0.010476,0.000025037}, HOV = {106,3.4869E+07,0.64449,-0.15424,-0.28822,0.20982}, VapCp = {16,39746.03,-371.573,12.02593,0.000755039,-2.59608E-07}, LiqVis = {101,-39.10125,1315.145,4.876982,-0.0000203993,2}, VapVis = {102,3.951E-08,0.90975,-52.076,8625.4,0}, LiqK = {16,0.029586,56.323,-2.8746,0.0051627,-0.000017826}, VapK = {102,0.091178,0.18264,626.56,1124600,0}, Racketparam = 0.275, UniquacR = 3.1502, UniquacQ = 2.772, ChaoSeadAF = 0.1825, ChaoSeadSP = 13766.21, ChaoSeadLV = 0.1055); + end Isobutane; + + model Onebutanol + extends General_Properties( + SN = 94, name = "Onebutanol", CAS = "71-36-3", Tc = 563.05, Pc = 4423000, Vc = 0.275, Cc = 0.26, Tb = 390.88, Tm = 183.85, TT = 184.51, TP = 0.000320123, MW = 74.123, LVB = 0.09196, AF = 0.591, SP = 23510, DM = 5.83737E-30, SH = -134990000.0, IGHF = -2.746E+08, GEF = -1.503E+08, AS = 361480, HFMP = 9372000, HOC = -2.45601E+09, LiqDen = {105,0.7931,0.24201,563.05,0.22263,0}, VP = {101,94.3424,-9140.942,-10.0038,1.706963E-06,2}, LiqCp = {16,118540,928.1,-3.4067,0.053827,-0.000053611}, HOV = {106,1.03317E+08,2.061287,-3.612692,3.240107,-1.125287}, VapCp = {16,63521,-568.25,12.587,0.0001566,-5.9966E-08}, LiqVis = {101,-44.688,3409.1,4.8758,-0.0000057302,2}, VapVis = {102,0.0000014735,0.46162,554.37,6760.2,0}, LiqK = {16,0.019408,-19.063,-1.4625,-0.0014843,-4.7683E-07}, VapK = {102,0.00022746,1.1142,3597.3,-411420,0}, Racketparam = 0.2538, UniquacR = 3.4543, UniquacQ = 3.052, ChaoSeadAF = 0.593, ChaoSeadSP = 23289.2, ChaoSeadLV = 0.0919432); + end Onebutanol; + + model TwomethylOnepropanol + extends General_Properties( + SN = 95, name = "TwomethylOnepropanol", CAS = "78-83-1", Tc = 547.78, Pc = 4300000, Vc = 0.273, Cc = 0.258, Tb = 381.04, Tm = 165.15, TT = 165.15, TP = 2.46096E-06, MW = 74.123, LVB = 0.09291, AF = 0.59, SP = 22900, DM = 5.47E-30, SH = -134990000.0, IGHF = -2.832E+08, GEF = -1.549E+08, AS = 348000, HFMP = 6322000, HOC = -2.449E+09, LiqDen = {105,0.80194,0.24515,547.81,0.21175,0}, VP = {101,174.0368,-12288.81,-22.23928,0.0000131856,2}, LiqCp = {16,114500,844.65,-3.6753,0.058766,-0.000062464}, HOV = {106,6.1411E+07,-0.67703,2.6884,-2.3416,0.75942}, VapCp = {16,20857,-275.26,12.137,0.00070478,-0.0000002462}, LiqVis = {101,-107.9662,6199.736,14.5721,-0.000017552,2}, VapVis = {102,7.9881E-07,0.52424,295.54,17281,0}, LiqK = {16,-0.27685,36.722,-1.0689,0.00066056,-0.0000014048}, VapK = {102,2189.9,0.91222,1.1244E+10,-5.1003E+11,0}, Racketparam = 0, UniquacR = 3.4535, UniquacQ = 3.048, ChaoSeadAF = 0.592, ChaoSeadSP = 23750.6, ChaoSeadLV = 0.0930277); + end TwomethylOnepropanol; + + model Twobutanol + extends General_Properties( + SN = 96, name = "Twobutanol", CAS = "78-92-2", Tc = 536.05, Pc = 4179000, Vc = 0.269, Cc = 0.252, Tb = 372.66, Tm = 158.45, TT = 158.45, TP = 3.16526E-06, MW = 74.123, LVB = 0.09235, AF = 0.574, SP = 22620, DM = 5.54E-30, SH = -134990000.0, IGHF = -2.929E+08, GEF = -1.696E+08, AS = 364690, HFMP = 5971000, HOC = -2.4408E+09, LiqDen = {105,0.65041,0.21558,536.05,0.22084,0}, VP = {101,145.55,-10811,-17.957,0.0000094132,2}, LiqCp = {16,68513,631.42,2.7425,0.03164,-0.000028572}, HOV = {106,9.123771E+07,1.779726,-3.389854,3.546493,-1.385264}, VapCp = {16,70319,-564.51,12.517,0.00018661,-6.3166E-08}, LiqVis = {101,19.329,3026.9,-6.6532,0.000029986,2}, VapVis = {102,1.3231E-07,0.76798,139.73,-4888.6,0}, LiqK = {16,0.031711,-158.34,-0.24491,-0.0057475,0.000002591}, VapK = {102,0.0000011661,1.7056,340.33,-60553,0}, Racketparam = 0, UniquacR = 3.4535, UniquacQ = 3.048, ChaoSeadAF = 0.571133, ChaoSeadSP = 22629.5, ChaoSeadLV = 0.0921178); + end Twobutanol; + + model TwomethylTwopropanol + extends General_Properties( + SN = 97, name = "TwomethylTwopropanol", CAS = "75-65-0", Tc = 506.21, Pc = 3973000, Vc = 0.275, Cc = 0.26, Tb = 355.49, Tm = 298.97, TT = 298.97, TP = 5884.28, MW = 74.123, LVB = 0.09488, AF = 0.613, SP = 21620, DM = 5.57E-30, SH = -134990000.0, IGHF = -3.124E+08, GEF = -1.776E+08, AS = 326300, HFMP = 6703000, HOC = -2.4239E+09, LiqDen = {105,0.40838,0.17034,508.88,0.1974,0}, VP = {101,196.8976,-12439.78,-26.03107,0.0000198743,2}, LiqCp = {16,-158220,-166.8,13.168,0.0013959,-0.0000019876}, HOV = {106,9.49928E+07,1.077392,-0.185452,-0.822732,0.535399}, VapCp = {16,65560,-540.88,12.558,0.00014695,-5.2324E-08}, LiqVis = {101,-933.24,39184,142.25,-0.0001583,2}, VapVis = {102,2.5934E-07,0.64853,136.6,9124.5,0}, LiqK = {16,0.0056947,358.71,-5.5774,0.012913,-0.000018273}, VapK = {102,4.2365E-07,1.7929,-130.93,17989,0}, Racketparam = 0, UniquacR = 3.4528, UniquacQ = 3.128, ChaoSeadAF = 0.612, ChaoSeadSP = 21491.8, ChaoSeadLV = 0.0948614); + end TwomethylTwopropanol; + + model Diethylether + extends General_Properties( + SN = 98, name = "Diethylether", CAS = "60-29-7", Tc = 466.7, Pc = 3640000, Vc = 0.28, Cc = 0.263, Tb = 307.59, Tm = 156.85, TT = 156.85, TP = 0.395447, MW = 74.123, LVB = 0.10475, AF = 0.281, SP = 15420, DM = 3.84E-30, SH = -134990000.0, IGHF = -2.521E+08, GEF = -1.221E+08, AS = 342300, HFMP = 7190000, HOC = -2.5035E+09, LiqDen = {105,0.97479,0.27114,466.7,0.28433,0}, VP = {101,75.39748,-5436.852,-8.193869,7.812562E-06,2}, LiqCp = {16,145290,-2.8208,5.9722,0.017041,-0.0000078238}, HOV = {106,5.331574E+07,0.876213,0.475413,-1.944676,1.061631}, VapCp = {16,81727,-660.7,12.61,0.00016979,-7.4028E-08}, LiqVis = {101,10.139,-61.707,-3.2168,-9.5022E-09,2}, VapVis = {102,0.0000019481,0.40997,495.46,85.073,0}, LiqK = {16,-0.14221,30.008,-1.3139,0.00048013,-0.0000026572}, VapK = {102,-0.0044909,0.61494,-3258.3,85.806,0}, Racketparam = 0, UniquacR = 3.39, UniquacQ = 3.02, ChaoSeadAF = 0.284607, ChaoSeadSP = 15530.3, ChaoSeadLV = 0.104692); + end Diethylether; + + model Diethyleneglycol + extends General_Properties( + SN = 99, name = "Diethyleneglycol", CAS = "111-46-6", Tc = 744.6, Pc = 4600000, Vc = 0.312, Cc = 0.232, Tb = 517.95, Tm = 262.7, TT = 262.7, TP = 0.00319709, MW = 106.12, LVB = 0.0952681, AF = 0.622105, SP = 28920, DM = 8.41E-30, SH = -134990000.0, IGHF = -5.464E+08, GEF = -3.84E+08, AS = 440000, HFMP = 1.3481E+07, HOC = -2.155E+09, LiqDen = {105,0.81894,0.25823,744.6,0.23979,0}, VP = {101,46.26595,-10205.15,-2.102723,-7.036466E-06,2}, LiqCp = {16,188290,227.63,5.7157,0.020545,-0.000018798}, HOV = {106,1.0853E+08,-0.00876655,1.770951,-1.359893,-0.0210292}, VapCp = {16,82107,-687.16,13.353,-0.00070647,2.4155E-07}, LiqVis = {101,-374.29,18192,55.132,-0.000049166,2}, VapVis = {102,6.4523E-08,0.8468,24.322,7352.9,0}, LiqK = {16,-0.11579,8.2246,-1.6466,0.002673,-0.0000035412}, VapK = {102,500.16,1.0276,7.9617E+09,-7.5258E+11,0}, Racketparam = 0, UniquacR = 4.9415, UniquacQ = 4.8, ChaoSeadAF = 0.621104, ChaoSeadSP = 27775.2, ChaoSeadLV = 0.0952681); + end Diethyleneglycol; + + model Diethylamine + extends General_Properties( + SN = 100, name = "Diethylamine", CAS = "109-89-7", Tc = 496.6, Pc = 3710000, Vc = 0.301, Cc = 0.27, Tb = 328.6, Tm = 223.35, TT = 223.35, TP = 374.108, MW = 73.138, LVB = 0.10424, AF = 0.303856, SP = 16610, DM = 3.07E-30, SH = -134990000.0, IGHF = -7.142E+07, GEF = 7.308E+07, AS = 352200, HFMP = 1.14E+07, HOC = -2.8003E+09, LiqDen = {105,0.73036,0.23814,496.66,0.24991,0}, VP = {101,64.68388,-5484.939,-6.37255,4.185124E-06,2}, LiqCp = {16,107090,694.46,2.8508,0.027204,-0.000024864}, HOV = {106,3.911798E+07,0.292165,-0.28266,0.355094,0.0257197}, VapCp = {16,85298,-793.64,13.085,-0.00026826,6.6572E-08}, LiqVis = {101,-21.138,1492,1.4401,-0.0000012994,2}, VapVis = {102,4.3797E-07,0.60244,253.34,-614.36,0}, LiqK = {16,0.066644,-97.786,-0.73312,-0.0054502,-7.5663E-08}, VapK = {102,0.000016939,1.2488,-114.17,77881,0}, Racketparam = 0.27, UniquacR = 3.68, UniquacQ = 3.17, ChaoSeadAF = 0.303733, ChaoSeadSP = 16543.3, ChaoSeadLV = 0.104234); + end Diethylamine; + + model Furfural + extends General_Properties( + SN = 101, name = "Furfural", CAS = "98-01-1", Tc = 670.15, Pc = 5660000, Vc = 0.252, Cc = 0.256, Tb = 434.85, Tm = 236.65, TT = 236.65, TP = 1.54565, MW = 96.0841, LVB = 0.0832248, AF = 0.367784, SP = 23610, DM = 1.2E-29, SH = -134990000.0, IGHF = -1.51E+08, GEF = -1.028E+08, AS = 333300, HFMP = 1.44E+07, HOC = -2.2564E+09, LiqDen = {105,1.0614,0.26706,670.15,0.30028,0}, VP = {101,25.656,-5514,-0.19573,-0.0000013402,2}, LiqCp = {16,122630,404.51,3.0587,0.029945,-0.000031496}, HOV = {106,6.3009E+07,0.4784,0.066802,-0.59102,0.42453}, VapCp = {16,45855,-497.61,12.549,-0.000033724,-2.8785E-08}, LiqVis = {101,2.6487,910.16,-2.1754,0.0000028413,2}, VapVis = {102,5.1928E-08,0.91224,70.285,-5476.4,0}, LiqK = {16,0.13228,19058,-182.25,0.56426,-0.00059782}, VapK = {102,0.00022183,0.91119,617.18,55137,0}, Racketparam = 0.258287, UniquacR = 3.168, UniquacQ = 2.484, ChaoSeadAF = 0.383, ChaoSeadSP = 23643.5, ChaoSeadLV = 0.0831649); + end Furfural; + + model Pyridine + extends General_Properties( + SN = 102, name = "Pyridine", CAS = "110-86-1", Tc = 620, Pc = 5670000, Vc = 0.254, Cc = 0.267, Tb = 388.37, Tm = 231.53, TT = 231.51, TP = 20.5354, MW = 79.101, LVB = 0.08088, AF = 0.242, SP = 21570, DM = 7.31E-30, SH = -134990000.0, IGHF = 1.4037E+08, GEF = 1.9049E+08, AS = 282780, HFMP = 8280000, HOC = -2.6721E+09, LiqDen = {105,0.67102,0.2057,620,0.26001,0}, VP = {101,82.05373,-7269.578,-8.810082,4.816564E-06,2}, LiqCp = {16,101830,209.77,5.3544,0.019802,-0.000018129}, HOV = {106,8.4421E+07,2.7457,-5.3078,4.8654,-1.7952}, VapCp = {16,36223,-620.9,12.812,-0.00029215,7.7524E-08}, LiqVis = {101,-82.798,4102.8,11.028,-0.0000093419,2}, VapVis = {102,5.339E-08,0.90066,85.55,-5060.2,0}, LiqK = {16,0.018788,-54.761,-1.2916,-0.00062226,-0.0000029942}, VapK = {102,-7052.4,0.17223,-5.768E+07,-1.624E+11,0}, Racketparam = 0.269325, UniquacR = 3, UniquacQ = 2.16, ChaoSeadAF = 0.238898, ChaoSeadSP = 21804.1, ChaoSeadLV = 0.0808341); + end Pyridine; + + model Isoprene + extends General_Properties( + SN = 103, name = "Isoprene", CAS = "78-79-5", Tc = 484, Pc = 3850030, Vc = 0.276, Cc = 0.264, Tb = 307.205, Tm = 127.27, TT = 127.27, TP = 0.00247682, MW = 68.117, LVB = 0.100775, AF = 0.158323, SP = 15330, DM = 8.3391E-31, SH = -134990000.0, IGHF = 7.57304E+07, GEF = 1.45896E+08, AS = 315641, HFMP = 4924570, HOC = -2.98424E+09, LiqDen = {105,0.95762,0.265,484,0.28587,0}, VP = {101,59.64382,-4808.579,-5.723014,3.325462E-06,2}, LiqCp = {16,111430,579.88,0.11179,0.042713,-0.000046991}, HOV = {106,4.7482E+07,1.7472,-3.7153,4.0508,-1.6134}, VapCp = {16,46067,-400.72,12.189,0.00043981,-1.4681E-07}, LiqVis = {101,-8.3004,457.06,-0.22583,-0.0000048674,2}, VapVis = {102,5.2484E-07,0.58768,291.05,-6176.5,0}, LiqK = {16,-0.0093138,-47.475,-0.82654,-0.0037828,8.2245E-07}, VapK = {102,0.0010775,0.73105,657.17,112780,0}, Racketparam = 0, UniquacR = 3.36, UniquacQ = 3.01, ChaoSeadAF = 0.1642, ChaoSeadSP = 15333.3, ChaoSeadLV = 0.100775); + end Isoprene; + + model Cyclopentane + extends General_Properties( + SN = 104, name = "Cyclopentane", CAS = "287-92-3", Tc = 511.6, Pc = 4508000, Vc = 0.26, Cc = 0.276, Tb = 322.38, Tm = 179.311, TT = 179.28, TP = 9.07217, MW = 70.134, LVB = 0.09473, AF = 0.194, SP = 16550, DM = 0, SH = -134990000.0, IGHF = -7.703E+07, GEF = 3.885E+07, AS = 292900, HFMP = 608800, HOC = -3.0709E+09, LiqDen = {105,0.92461,0.26305,511.77,0.22002,0}, VP = {101,-74.77148,-401.0576,15.6271,-0.0000260872,2}, LiqCp = {16,84725,368.5,3.0559,0.030633,-0.000031124}, HOV = {106,4.513618E+07,1.248318,-2.311302,2.401073,-0.943348}, VapCp = {16,39785,-704.2,13.082,-0.00014913,2.4491E-08}, LiqVis = {101,-5.1843,670.87,-0.84082,-7.0656E-07,2}, VapVis = {102,2.1433E-07,0.68815,135.42,-1597.6,0}, LiqK = {16,0.10961,-598.59,3.5098,-0.016258,-0.0000091635}, VapK = {102,0.0000098408,1.4611,639.53,7396.1,0}, Racketparam = 0.2687, UniquacR = 3.3, UniquacQ = 2.47, ChaoSeadAF = 0.2051, ChaoSeadSP = 16589.01, ChaoSeadLV = 0.0947); + end Cyclopentane; + + model TwomethylOnebutene + extends General_Properties( + SN = 105, name = "TwomethylOnebutene", CAS = "563-46-2", Tc = 465, Pc = 3447000, Vc = 0.292, Cc = 0.26, Tb = 304.305, Tm = 135.578, TT = 135.578, TP = 0.0205382, MW = 70.1329, LVB = 0.10872, AF = 0.234056, SP = 14700, DM = 1.7E-30, SH = -134990000.0, IGHF = -3.53E+07, GEF = 6.668E+07, AS = 339500, HFMP = 7910700, HOC = -3.1159E+09, LiqDen = {105,0.91622,0.26752,465,0.28165,0}, VP = {101,77.29304,-5304.146,-8.607604,9.513458E-06,2}, LiqCp = {16,121560,527.31,1.2291,0.036295,-0.000037525}, HOV = {106,4.6374E+07,1.4214,-2.5789,2.5516,-0.95454}, VapCp = {16,81218,-803.24,13.077,-0.00034159,9.7536E-08}, LiqVis = {101,-10.065,690.04,-0.13044,0.0000004745,2}, VapVis = {102,5.0873E-07,0.55006,197.77,-68.455,0}, LiqK = {16,-0.024046,2.4654,-1.5931,-0.00074325,-0.0000024745}, VapK = {102,0.00018088,0.94101,77.857,153680,0}, Racketparam = 0.270022, UniquacR = 3.5939, UniquacQ = 3.224, ChaoSeadAF = 0.228663, ChaoSeadSP = 14695.4, ChaoSeadLV = 0.10868); + end TwomethylOnebutene; + + model ThreemethylOnebutene + extends General_Properties( + SN = 106, name = "ThreemethylOnebutene", CAS = "563-45-1", Tc = 452.7, Pc = 3550000, Vc = 0.3049, Cc = 0.288, Tb = 293.21, Tm = 104.66, TT = 104.66, TP = 0.0000144678, MW = 70.134, LVB = 0.11277, AF = 0.211, SP = 13780, DM = 1.07E-30, SH = -27600000.0, IGHF = -2.76E+07, GEF = 7.605E+07, AS = 333900, HFMP = 5359700, HOC = -3.1253E+09, LiqDen = {105,0.85968,0.26229,452.7,0.27579,0}, VP = {101,74.66163,-4956.256,-8.290047,0.0000100425,2}, LiqCp = {16,94996,92.422,8.4061,0.009093,-0.0000045826}, HOV = {106,3.9174E+07,0.58094,0.12579,-0.78785,0.49354}, VapCp = {16,82557,-671.08,12.784,-0.00012458,4.234E-08}, LiqVis = {101,-11.214,821.55,-0.010133,9.4673E-08,2}, VapVis = {102,0.0000016555,0.42535,455.3,876.91,0}, LiqK = {16,-0.017622,5.9209,-1.694,-0.00045405,-0.0000033564}, VapK = {102,0.00014816,0.97375,75.281,116540,0}, Racketparam = 0.272045, UniquacR = 3.5945, UniquacQ = 3.1, ChaoSeadAF = 0.2285, ChaoSeadSP = 14010.2, ChaoSeadLV = 0.111819); + end ThreemethylOnebutene; + + model TwomethylTwobutene + extends General_Properties( + SN = 107, name = "TwomethylTwobutene", CAS = "513-35-9", Tc = 470, Pc = 3860000, Vc = 0.292, Cc = 0.288, Tb = 311.7, Tm = 139.39, TT = 139.39, TP = 0.01937, MW = 70.134, LVB = 0.10757, AF = 0.339, SP = 15210, DM = 1.13E-30, SH = -27600000.0, IGHF = -4.18E+07, GEF = 6.045E+07, AS = 338600, HFMP = 7597700, HOC = -3.1088E+09, LiqDen = {105,0.93623,0.2731,470,0.25849,0}, VP = {101,82.2327,-5590.502,-9.366663,0.0000104545,2}, LiqCp = {16,127040,1071.7,-7.883,0.075072,-0.000089164}, HOV = {106,4.3456E+07,0.64226,-0.070051,-0.5395,0.35656}, VapCp = {16,75343,-774.17,12.975,-0.00022009,6.0763E-08}, LiqVis = {101,-11.234,703.42,0.094871,-0.0000017625,2}, VapVis = {102,8.6256E-07,0.47637,263.56,-2475.7,0}, LiqK = {16,-0.050847,3.0532,-1.4724,-0.00063704,-0.0000020121}, VapK = {102,0.00020806,0.92265,107.34,175680,0}, Racketparam = 0.260813, UniquacR = 3.5919, UniquacQ = 3.22, ChaoSeadAF = 0.27667, ChaoSeadSP = 15247.2, ChaoSeadLV = 0.106707); + end TwomethylTwobutene; + + model Onepentene + extends General_Properties( + SN = 108, name = "Onepentene", CAS = "109-67-1", Tc = 464.8, Pc = 3560000, Vc = 0.2984, Cc = 0.275, Tb = 303.11, Tm = 108.016, TT = 108.016, TP = 0.000037, MW = 70.134, LVB = 0.1104, AF = 0.237, SP = 14410, DM = 1.7E-30, SH = -27600000.0, IGHF = -2.162E+07, GEF = 7.837E+07, AS = 346200, HFMP = 5937400, HOC = -3.13037E+09, LiqDen = {105,0.44335,0.18566,473.43,0.23587,0}, VP = {101,39.52954,-3893.399,-2.686504,1.952359E-06,2}, LiqCp = {16,92753,117.21,8.6537,0.007447,-0.0000026759}, HOV = {106,3.077277E+07,-0.570706,2.243398,-2.258065,0.928488}, VapCp = {16,66520,-609.44,12.683,0.000062395,-2.5354E-08}, LiqVis = {101,-10.79591,682.8004,0.00564316,-9.176806E-07,2}, VapVis = {102,0.0000017549,0.42295,561.21,-17046,0}, LiqK = {16,-0.010825,-30.065,-1.1172,-0.0023327,-0.0000015541}, VapK = {102,0.0000026412,1.549,-2.5891,24389,0}, Racketparam = 0.2944, UniquacR = 3.5953, UniquacQ = 3.104, ChaoSeadAF = 0.2198, ChaoSeadSP = 14420.78, ChaoSeadLV = 0.1104); + end Onepentene; + + model CisTwopentene + extends General_Properties( + SN = 109, name = "CisTwopentene", CAS = "627-20-3", Tc = 475, Pc = 3690000, Vc = 0.3021, Cc = 0.273, Tb = 310.07, Tm = 121.75, TT = 121.75, TP = 0.000554, MW = 70.134, LVB = 0.10785, AF = 0.253, SP = 15060, DM = 1.008E-30, SH = -27600000.0, IGHF = -2.63E+07, GEF = 7.37E+07, AS = 346300, HFMP = 7112000, HOC = -3.123E+09, LiqDen = {105,0.90921,0.26313,475,0.30422,0}, VP = {101,87.54937,-5782.462,-10.18969,0.00001126,2}, LiqCp = {16,132080,-10569,112.64,-0.34846,0.00041161}, HOV = {106,3.808893E+07,0.541071,-0.876512,1.300916,-0.612383}, VapCp = {16,68358,-741.07,12.923,-0.00013529,3.1324E-08}, LiqVis = {101,-10.01,644.41,-0.11124,1.3682E-07,2}, VapVis = {102,7.0321E-08,0.83123,33.115,-394.35,0}, LiqK = {16,-0.06994,-6.3331,-1.1883,-0.0013351,-7.8623E-07}, VapK = {102,0.00017973,0.95148,124.65,170420,0}, Racketparam = 0, UniquacR = 3.5933, UniquacQ = 3.103, ChaoSeadAF = 0.206, ChaoSeadSP = 14420.78, ChaoSeadLV = 0.1078); + end CisTwopentene; + + model TransTwopentene + extends General_Properties( + SN = 110, name = "TransTwopentene", CAS = "646-04-8", Tc = 474.2, Pc = 3660000, Vc = 0.293, Cc = 0.272, Tb = 309.49, Tm = 132.89, TT = 132.89, TP = 0.00574, MW = 70.1329, LVB = 0.1091, AF = 0.248372, SP = 14970, DM = 0, SH = -27600000.0, IGHF = -3.11E+07, GEF = 6.98E+07, AS = 343100, HFMP = 8351700, HOC = -3.119E+09, LiqDen = {105,0.9122,0.26869,474.2,0.28253,0}, VP = {101,77.717,-5422.6,-8.6403,0.0000092035,2}, LiqCp = {16,117170,204.39,5.1039,0.022516,-0.00002152}, HOV = {106,4.3712E+07,0.84137,-0.81266,0.47134,-0.094225}, VapCp = {16,79715,-780.23,12.979,-0.00024552,0.0000000696}, LiqVis = {101,-10.52,657.15,-0.02693,1.6882E-07,2}, VapVis = {102,1.2614E-07,0.75299,74.21,1685.7,0}, LiqK = {16,-0.074338,-10.004,-1.1218,-0.0016085,-2.2796E-07}, VapK = {102,0.000026669,1.1894,-123.11,111540,0}, Racketparam = 0.268765, UniquacR = 3.5933, UniquacQ = 3.103, ChaoSeadAF = 0.209, ChaoSeadSP = 14420.78, ChaoSeadLV = 0.109); + end TransTwopentene; + + model Threepentanone + extends General_Properties( + SN = 111, name = "Threepentanone", CAS = "96-22-0", Tc = 561.5, Pc = 3730000, Vc = 0.336, Cc = 0.268, Tb = 375.14, Tm = 234.18, TT = 234.18, TP = 73.4224, MW = 86.134, LVB = 0.10641, AF = 0.342, SP = 18410, DM = 9.41E-30, SH = -27600000.0, IGHF = -2.579E+08, GEF = -1.344E+08, AS = 370000, HFMP = 1.159E+07, HOC = -2.8804E+09, LiqDen = {105,0.68664,0.23603,561.5,0.27471,0}, VP = {101,58.885,-6044.5,-5.3259,0.0000023057,2}, LiqCp = {16,169130,405.25,3.0239,0.024087,-0.000018434}, HOV = {106,5.083729E+07,0.764461,-0.828447,-0.00277131,0.530942}, VapCp = {16,93124,-637.87,12.577,0.00022827,-1.0612E-07}, LiqVis = {101,-1.367,550.49,-1.4469,4.9148E-07,2}, VapVis = {102,0.0000002611,0.65778,216.39,-3537.8,0}, LiqK = {16,0.0080662,16.294,-1.6509,-0.0010676,-9.5001E-07}, VapK = {102,22.162,1.0028,1.8597E+08,9.2842E+08,0}, Racketparam = 0, UniquacR = 3.9223, UniquacQ = 3.416, ChaoSeadAF = 0.344, ChaoSeadSP = 18259.5, ChaoSeadLV = 0.106401); + end Threepentanone; + + model Methylisopropylketone + extends General_Properties( + SN = 112, name = "Methylisopropylketone", CAS = "563-80-4", Tc = 567.7, Pc = 3620000, Vc = 0.31, Cc = 0.238, Tb = 367.55, Tm = 180.15, TT = 180.15, TP = 0.295357, MW = 86.134, LVB = 0.10791, AF = 0.216, SP = 17710, DM = 9.21E-30, SH = -27600000.0, IGHF = -2.626E+08, GEF = -1.393E+08, AS = 369900, HFMP = 9343000, HOC = -2.877E+09, LiqDen = {105,0.22922,0.13849,567.7,0.18207,0}, VP = {101,57.033,-5794.3,-5.09,0.0000023975,2}, LiqCp = {16,142840,463.87,4.1439,0.020347,-0.000013989}, HOV = {106,1.3282E+07,-7.596951,21.963,-24.77369,10.66731}, VapCp = {16,65899,-628.39,12.858,0.000023331,-5.0246E-08}, LiqVis = {101,-11.042,1043.1,-0.038423,1.1535E-07,2}, VapVis = {102,1.5484E-07,0.72865,149.15,-3826.1,0}, LiqK = {16,-0.11038,18.412,-1.2824,-0.000057222,-0.000001541}, VapK = {102,-6058400,-0.090573,3.176E+09,-2.84E+13,0}, Racketparam = 0.259, UniquacR = 3.9215, UniquacQ = 3.412, ChaoSeadAF = 0.350039, ChaoSeadSP = 18253.3, ChaoSeadLV = 0.106975); + end Methylisopropylketone; + + model Npropylacetate + extends General_Properties( + SN = 113, name = "Npropylacetate", CAS = "109-60-4", Tc = 549.4, Pc = 3330000, Vc = 0.345, Cc = 0.252, Tb = 374.65, Tm = 178.15, TT = 178.15, TP = 0.0171129, MW = 102.133, LVB = 0.11572, AF = 0.389, SP = 17890, DM = 5.97E-30, SH = -27600000.0, IGHF = -4.648E+08, GEF = -3.204E+08, AS = 402300, HFMP = 1.12E+07, HOC = -2.672E+09, LiqDen = {105,0.57751,0.2255,549.4,0.25884,0}, VP = {101,106.6613,-8095.022,-12.62161,8.999471E-06,2}, LiqCp = {16,124410,36.932,8.3883,0.012662,-0.000012028}, HOV = {106,8.047503E+07,1.798019,-2.259874,1.293466,-0.333711}, VapCp = {16,108820,-937.38,13.511,-0.00062962,1.4249E-07}, LiqVis = {101,15.453,-157.9,-3.9304,-3.2102E-07,2}, VapVis = {102,1.9633E-07,0.69295,104.27,10438,0}, LiqK = {16,0.045513,-31.328,-1.5572,-0.00066538,-0.0000053334}, VapK = {102,1128.5,1.014,1.1605E+10,-1.2869E+11,0}, Racketparam = 0, UniquacR = 4.153, UniquacQ = 3.656, ChaoSeadAF = 0.391, ChaoSeadSP = 18004.7, ChaoSeadLV = 0.115712); + end Npropylacetate; + + model Isopentane + extends General_Properties( + SN = 114, name = "Isopentane", CAS = "78-78-4", Tc = 460.39, Pc = 3381000, Vc = 0.3083, Cc = 0.272, Tb = 300.99, Tm = 113.25, TT = 113.25, TP = 0.00012144, MW = 72.15, LVB = 0.11646, AF = 0.229, SP = 13870, DM = 4.34E-31, SH = -27600000.0, IGHF = -1.537E+08, GEF = -1.405E+07, AS = 343740, HFMP = 5150000, HOC = -3.23954E+09, LiqDen = {105,0.73194,0.24835,460.99,0.25733,0}, VP = {101,71.04288,-4967.235,-7.674379,8.659929E-06,2}, LiqCp = {16,112460,-54.259,8.8747,0.0083911,-0.0000034773}, HOV = {106,4.14248E+07,0.799342,-0.581969,0.0834724,0.117826}, VapCp = {16,59843,-493.27,12.516,0.00046099,-1.5305E-07}, LiqVis = {101,-12.596,889.14,0.20472,4.0592E-09,2}, VapVis = {102,6.6346E-08,0.82828,-68.082,25303,0}, LiqK = {16,0.061061,89.857,-3.522,0.0075154,-0.000023032}, VapK = {102,0.00090019,0.7738,456.82,231390,0}, Racketparam = 0.2716, UniquacR = 3.82, UniquacQ = 3.31, ChaoSeadAF = 0.2104, ChaoSeadSP = 14359.41, ChaoSeadLV = 0.1174); + end Isopentane; + + model Npentane + extends General_Properties( + SN = 115, name = "Npentane", CAS = "109-66-0", Tc = 469.7, Pc = 3370000, Vc = 0.311, Cc = 0.268, Tb = 309.22, Tm = 143.42, TT = 143.42, TP = 0.0686418, MW = 72.15, LVB = 0.11522, AF = 0.251, SP = 14380, DM = 0, SH = -27600000.0, IGHF = -1.4676E+08, GEF = -8813000, AS = 349450, HFMP = 8401500, HOC = -3.24494E+09, LiqDen = {105,0.77386,0.25574,469.7,0.26319,0}, VP = {101,72.14242,-5265.589,-7.720709,7.151866E-06,2}, LiqCp = {16,122980,401.5,3.9651,0.024056,-0.000020161}, HOV = {106,4.0854E+07,0.25483,0.96045,-1.5349,0.72504}, VapCp = {16,81062,-706.86,12.962,-0.000049298,2.8357E-09}, LiqVis = {101,-28.93847,1176.355,3.050544,-9.721368E-06,2}, VapVis = {102,5.9173E-08,0.85109,8.4138,3723.2,0}, LiqK = {16,0.023649,-75.089,-0.64229,-0.005078,-2.7196E-07}, VapK = {102,-603.2,0.74698,-8.1823E+08,-8.7865E+09,0}, Racketparam = 0.2685, UniquacR = 3.8254, UniquacQ = 3.316, ChaoSeadAF = 0.2387, ChaoSeadSP = 14359.41, ChaoSeadLV = 0.1161); + end Npentane; + + model Neopentane + extends General_Properties( + SN = 116, name = "Neopentane", CAS = "463-82-1", Tc = 433.75, Pc = 3199000, Vc = 0.3032, Cc = 0.269, Tb = 282.65, Tm = 256.6, TT = 256.6, TP = 35745.2, MW = 72.15, LVB = 0.12216, AF = 0.197, SP = 12510, DM = 0, SH = -168070000.0, IGHF = -1.6807E+08, GEF = -1.714E+07, AS = 305890, HFMP = 3146000, HOC = -3.25039E+09, LiqDen = {105,0.90246,0.2775,433.8,0.29085,0}, VP = {101,85.887,-5169,-10.119,0.000013061,2}, LiqCp = {16,116590,146.32,1.9197,0.044936,-0.000054657}, HOV = {106,3.3957E+07,0.38208,0,0,0}, VapCp = {16,31525,-309.56,12.21,0.00085791,-2.6395E-07}, LiqVis = {101,-36.861,2459.5,3.4416,0.0000070474,2}, VapVis = {102,8.1019E-07,0.5294,468.47,-22580,0}, LiqK = {16,0.027667,-243.53,0.83395,-0.010754,0.0000058849}, VapK = {102,0.0000044729,1.4644,-142.95,66180,0}, Racketparam = 0.2762, UniquacR = 3.8239, UniquacQ = 3.392, ChaoSeadAF = 0.195, ChaoSeadSP = 14359.41, ChaoSeadLV = 0.1233); + end Neopentane; + + model OneTwoFourtrichlorobenzene + extends General_Properties( + SN = 117, name = "OneTwoFourtrichlorobenzene", CAS = "120-82-1", Tc = 725, Pc = 3720000, Vc = 0.395, Cc = 0.244, Tb = 486.15, Tm = 290.15, TT = 290.15, TP = 33.0937, MW = 181.447, LVB = 0.12525, AF = 0.358106, SP = 20620, DM = 4.20291E-30, SH = -168070000.0, IGHF = -1.1757E+07, GEF = 4.30523E+07, AS = 380911, HFMP = 1.55647E+07, HOC = -2.65632E+09, LiqDen = {105,0.61713,0.2524,725,0.2857,0}, VP = {101,47.20405,-7460.647,-3.164866,-3.316432E-06,2}, LiqCp = {16,145370,234.69,6.2789,0.017012,-0.000015675}, HOV = {106,6.897E+07,0.4026,0,0,0}, VapCp = {16,63130,-426.63,12.569,-0.000095696,1.4713E-08}, LiqVis = {101,-241,9893.2,36.115,-0.000047458,2}, VapVis = {102,9.2097E-08,0.80621,99.511,1477.5,0}, LiqK = {16,0.070105,-290.72,-0.20366,-0.0074415,0.0000024779}, VapK = {102,-743.07,0.74159,-2.1746E+09,-6.4502E+10,0}, Racketparam = 0.259136, UniquacR = 5.0625, UniquacQ = 3.732, ChaoSeadAF = 0.358106, ChaoSeadSP = 20618.1, ChaoSeadLV = 0.12525); + end OneTwoFourtrichlorobenzene; + + model Mdichlorobenzene + extends General_Properties( + SN = 118, name = "Mdichlorobenzene", CAS = "541-73-1", Tc = 683.95, Pc = 4070000, Vc = 0.351, Cc = 0.251, Tb = 446.23, Tm = 248.39, TT = 248.39, TP = 6.40787, MW = 147.002, LVB = 0.114533, AF = 0.27898, SP = 19570, DM = 5.74E-30, SH = -168070000.0, IGHF = 2.57E+07, GEF = 7.79E+07, AS = 343530, HFMP = 1.259E+07, HOC = -2.825E+09, LiqDen = {105,0.74132,0.26094,683.95,0.31392,0}, VP = {101,100.37,-9087,-11.404,0.0000055122,2}, LiqCp = {16,89111,785.31,3.6098,0.022491,-0.00001896}, HOV = {106,5.2076E+07,0.15554,-0.20298,0.94291,-0.55524}, VapCp = {16,56066,-490.93,12.649,-0.00012726,2.3703E-08}, LiqVis = {101,-114.79,4907.5,16.374,-0.000020623,2}, VapVis = {102,2.3524E-07,0.71383,257.29,1880.2,0}, LiqK = {16,0.042347,-224.09,-0.2096,-0.006185,0.0000024486}, VapK = {102,-1552.3,0.68852,-2.6293E+09,-1.7751E+11,0}, Racketparam = 0, UniquacR = 4.4376, UniquacQ = 3.288, ChaoSeadAF = 0.215834, ChaoSeadSP = 19575.7, ChaoSeadLV = 0.114641); + end Mdichlorobenzene; + + model Odichlorobenzene + extends General_Properties( + SN = 119, name = "Odichlorobenzene", CAS = "95-50-1", Tc = 705, Pc = 4070000, Vc = 0.351, Cc = 0.244, Tb = 453.57, Tm = 256.15, TT = 256.15, TP = 6.48939, MW = 147.002, LVB = 0.112969, AF = 0.219189, SP = 20310, DM = 8.34E-30, SH = -168070000.0, IGHF = 3.02E+07, GEF = 8.29E+07, AS = 341850, HFMP = 1.266E+07, HOC = -2.826E+09, LiqDen = {105,0.74261,0.26108,705,0.30655,0}, VP = {101,75.75983,-8226.762,-7.552754,6.191298E-07,2}, LiqCp = {16,127840,-59.156,8.3728,0.0093569,-0.0000051714}, HOV = {106,8.774E+07,2.8227,-6.8433,7.6547,-3.1275}, VapCp = {16,55560,-490.51,12.648,-0.00012186,2.1792E-08}, LiqVis = {101,-37.699,2377,4.0848,-0.0000020768,2}, VapVis = {102,1.6041E-07,0.76289,205.1,-39.728,0}, LiqK = {16,0.06919,-379.09,0.89948,-0.0099037,0.0000041677}, VapK = {102,-1200.2,0.7235,-2.8422E+09,-8.8684E+10,0}, Racketparam = 0.271326, UniquacR = 4.4376, UniquacQ = 3.288, ChaoSeadAF = 0.214215, ChaoSeadSP = 20271.3, ChaoSeadLV = 0.11318); + end Odichlorobenzene; + + model Pdichlorobenzene + extends General_Properties( + SN = 120, name = "Pdichlorobenzene", CAS = "106-46-7", Tc = 684.75, Pc = 4070000, Vc = 0.351, Cc = 0.251, Tb = 447.21, Tm = 326.14, TT = 326.14, TP = 1225.03, MW = 147.002, LVB = 0.117406, AF = 0.284638, SP = 19330, DM = 0, SH = -168070000.0, IGHF = 2.25E+07, GEF = 7.67E+07, AS = 336740, HFMP = 1.82E+07, HOC = -2.802E+09, LiqDen = {105,0.74861,0.26271,684.75,0.30815,0}, VP = {101,40.63688,-6607.72,-2.221184,-3.90747E-06,2}, LiqCp = {16,155200,855.07,0.88585,0.024843,-0.000014582}, HOV = {106,6.112633E+07,0.426201,-0.0366365,0.00811781,-0.00754654}, VapCp = {16,55695,-489.46,12.649,-0.00012524,2.3115E-08}, LiqVis = {101,-131.86,5312.8,19.284,-0.000029085,2}, VapVis = {102,1.5946E-07,0.76369,193.94,-148.97,0}, LiqK = {16,0.02927,-28.287,-2.0319,0.000077764,-0.0000037797}, VapK = {102,-2269.7,0.68598,-3.774E+09,-2.6655E+11,0}, Racketparam = 0.265583, UniquacR = 4.4376, UniquacQ = 3.288, ChaoSeadAF = 0.234279, ChaoSeadSP = 19187.2, ChaoSeadLV = 0.117341); + end Pdichlorobenzene; + + model Bromobenzene + extends General_Properties( + SN = 121, name = "Bromobenzene", CAS = "108-86-1", Tc = 670.15, Pc = 4519100, Vc = 0.324, Cc = 0.263, Tb = 429.236, Tm = 242.43, TT = 242.43, TP = 7.8364, MW = 157.008, LVB = 0.105567, AF = 0.250575, SP = 19940, DM = 5.67059E-30, SH = -168070000.0, IGHF = 1.05018E+08, GEF = 1.38532E+08, AS = 324386, HFMP = 1.06274E+07, HOC = -3.01917E+09, LiqDen = {105,0.8226,0.26632,670.15,0.2821,0}, VP = {101,146.6319,-10375.07,-18.74897,0.0000147083,2}, LiqCp = {16,97487,953.8,2.1839,0.023716,-0.000017458}, HOV = {106,5.656362E+07,0.347537,0.135082,0.0123621,-0.140849}, VapCp = {16,65656,-767.67,13.165,-0.00063667,1.8215E-07}, LiqVis = {101,-54.93,2754.4,6.973,-0.000009784,2}, VapVis = {102,2.2327E-07,0.71456,185.02,-22.393,0}, LiqK = {16,0.032562,-180.04,-0.56464,-0.0046562,1.7973E-07}, VapK = {102,0.00025787,0.79923,269.79,163730,0}, Racketparam = 0, UniquacR = 3.9709, UniquacQ = 2.952, ChaoSeadAF = 0.250575, ChaoSeadSP = 19944.7, ChaoSeadLV = 0.105567); + end Bromobenzene; + + model Monochlorobenzene + extends General_Properties( + SN = 122, name = "Monochlorobenzene", CAS = "108-90-7", Tc = 632.4, Pc = 4520000, Vc = 0.308, Cc = 0.265, Tb = 404.91, Tm = 227.95, TT = 227.95, TP = 8.4456, MW = 112.558, LVB = 0.10222, AF = 0.251, SP = 19350, DM = 5.64E-30, SH = -168070000.0, IGHF = 5.109E+07, GEF = 9.829E+07, AS = 314030, HFMP = 9556000, HOC = -2.976E+09, LiqDen = {105,0.78287,0.25464,632.4,0.26342,0}, VP = {101,51.41334,-6020.539,-4.204143,1.293848E-06,2}, LiqCp = {16,139150,-333.42,10.906,-0.018036,0.000054846}, HOV = {106,4.9039E+07,0.24473,-0.048652,0.40537,-0.25012}, VapCp = {16,74680,-1001.5,13.827,-0.0014014,4.6413E-07}, LiqVis = {101,0.029483,556.49,-1.5963,1.2171E-07,2}, VapVis = {102,1.1217E-07,0.79382,109.37,1134.4,0}, LiqK = {16,0.083427,-157.94,-0.89724,-0.0049259,-0.0000027589}, VapK = {102,0.0004167,0.92033,1902.9,123750,0}, Racketparam = 0, UniquacR = 3.79, UniquacQ = 2.84, ChaoSeadAF = 0.2459, ChaoSeadSP = 19345.3, ChaoSeadLV = 0.10229); + end Monochlorobenzene; + + model Iodobenzene + extends General_Properties( + SN = 123, name = "Iodobenzene", CAS = "591-50-4", Tc = 721.15, Pc = 4519100, Vc = 0.351, Cc = 0.265, Tb = 461.6, Tm = 241.83, TT = 241.83, TP = 1.17521, MW = 204.008, LVB = 0.111976, AF = 0.246574, SP = 20450, DM = 5.67E-30, SH = -168070000.0, IGHF = 1.649E+08, GEF = 1.902E+08, AS = 334100, HFMP = 9749000, HOC = -3.05E+09, LiqDen = {105,0.7521,0.26381,721.15,0.2895,0}, VP = {101,79.186,-8185.3,-8.2636,0.0000035963,2}, LiqCp = {16,139830,578.69,1.6453,0.031278,-0.000034279}, HOV = {106,6.148821E+07,0.433906,-0.0102943,-0.0130647,-0.0329532}, VapCp = {16,63442,-692.72,13.003,-0.00048297,1.3499E-07}, LiqVis = {101,-57.177,3157.8,7.1529,-0.0000070913,2}, VapVis = {102,2.1908E-07,0.74366,231.22,-43.688,0}, LiqK = {16,0.077923,1284.8,-17.082,0.050362,-0.00006779}, VapK = {102,0.00026878,0.78911,373.97,187720,0}, Racketparam = 0, UniquacR = 4.2857, UniquacQ = 3.112, ChaoSeadAF = 0.246574, ChaoSeadSP = 20367.4, ChaoSeadLV = 0.111976); + end Iodobenzene; + + model Nitrobenzene + extends General_Properties( + SN = 124, name = "Nitrobenzene", CAS = "98-95-3", Tc = 719, Pc = 4400000, Vc = 0.349, Cc = 0.257, Tb = 483.95, Tm = 278.91, TT = 278.87, TP = 6.69814, MW = 123.109, LVB = 0.102717, AF = 0.449158, SP = 22610, DM = 1.41E-29, SH = -168070000.0, IGHF = 6.75E+07, GEF = 1.63E+08, AS = 342100, HFMP = 1.16E+07, HOC = -2.9782E+09, LiqDen = {105,0.69124,0.24124,719,0.28137,0}, VP = {101,112.2302,-10538.91,-12.95686,5.116363E-06,2}, LiqCp = {16,146460,1160.6,0.44135,0.024575,-0.000013049}, HOV = {106,4.9884E+07,-2.0813,7.5215,-8.8126,3.6947}, VapCp = {16,112710,-1114.3,13.93,-0.0013044,3.7699E-07}, LiqVis = {101,-78.652,4202,10.37,-0.0000091095,2}, VapVis = {102,1.1361E-07,0.80626,193.03,-46.762,0}, LiqK = {16,0.11293,-401.92,1.2826,-0.013207,0.0000075932}, VapK = {102,0.00014373,0.9615,718,-0.0027852,0}, Racketparam = 0.251146, UniquacR = 4.13, UniquacQ = 3.14, ChaoSeadAF = 0.447966, ChaoSeadSP = 22612.4, ChaoSeadLV = 0.102717); + end Nitrobenzene; + + model Benzene + extends General_Properties( + SN = 125, name = "Benzene", CAS = "71-43-2", Tc = 562.05, Pc = 4895000, Vc = 0.256, Cc = 0.268, Tb = 353.24, Tm = 278.68, TT = 278.68, TP = 4764.22, MW = 78.114, LVB = 0.08941, AF = 0.209, SP = 18700, DM = 0, SH = -168070000.0, IGHF = 8.288E+07, GEF = 1.296E+08, AS = 269300, HFMP = 9866000, HOC = -3.136E+09, LiqDen = {105,0.99938,0.26348,562.05,0.27856,0}, VP = {101,88.368,-6712.9,-10.022,0.000007694,2}, LiqCp = {16,111460,-1854.3,22.399,-0.028936,0.000028991}, HOV = {106,4.881E+07,0.61066,-0.25882,0.032238,0.022475}, VapCp = {16,34010.24,-588.0978,12.81777,-0.000197306,5.142899E-08}, LiqVis = {101,-24.61,1576.5,2.1698,-0.0000051366,2}, VapVis = {102,3.1366E-08,0.9675,8.0285,-35.629,0}, LiqK = {16,0.049539,-177.97,0.19475,-0.0073805,0.0000027938}, VapK = {102,0.0000049549,1.4519,154.14,26202,0}, Racketparam = 0.2696, UniquacR = 3.1878, UniquacQ = 2.4, ChaoSeadAF = 0.213, ChaoSeadSP = 18736.78, ChaoSeadLV = 0.0894); + end Benzene; + + model Phenol + extends General_Properties( + SN = 126, name = "Phenol", CAS = "108-95-2", Tc = 694.25, Pc = 6130000, Vc = 0.229, Cc = 0.243, Tb = 455.04, Tm = 314.06, TT = 314.06, TP = 187.979, MW = 94.113, LVB = 0.08787, AF = 0.442, SP = 24630, DM = 4.84E-30, SH = -168070000.0, IGHF = -9.6399E+07, GEF = -3.2637E+07, AS = 314810, HFMP = 1.151E+07, HOC = -2.921E+09, LiqDen = {105,1.4937,0.32883,694.25,0.34018,0}, VP = {101,300.97,-20269,-40.743,0.000021631,2}, LiqCp = {16,86710,-628.11,15.735,-0.0091743,0.0000081827}, HOV = {106,7.270282E+07,-0.265673,2.248545,-2.018709,0.353169}, VapCp = {16,39758,-470.56,12.627,0.000068347,-4.9708E-08}, LiqVis = {101,-203.001,10884.21,28.73615,-0.0000224564,2}, VapVis = {102,1.0771E-07,0.79384,145.89,-11364,0}, LiqK = {16,0.14109,-966.5,10.659,-0.049095,0.000038703}, VapK = {102,0.03495,0.27845,1585.2,862070,0}, Racketparam = 0, UniquacR = 3.5517, UniquacQ = 2.68, ChaoSeadAF = 0.442, ChaoSeadSP = 24632.6, ChaoSeadLV = 0.0889403); + end Phenol; + + model Aniline + extends General_Properties( + SN = 127, name = "Aniline", CAS = "62-53-3", Tc = 699, Pc = 5310000, Vc = 0.2739, Cc = 0.256, Tb = 457.17, Tm = 267.13, TT = 267.13, TP = 7.13219, MW = 93.128, LVB = 0.09152, AF = 0.38, SP = 24120, DM = 5.1E-30, SH = -168070000.0, IGHF = 8.71E+07, GEF = 1.668E+08, AS = 319800, HFMP = 1.054E+07, HOC = -3.239E+09, LiqDen = {105,1.0034,0.27828,699.16,0.26553,0}, VP = {101,51.415,-7256.776,-3.968851,1.89237E-06,1.941839}, LiqCp = {16,113560,-229.45,12.348,-0.001777,0.0000025731}, HOV = {106,6.518054E+07,-0.829815,5.221579,-7.587726,3.672676}, VapCp = {16,53776,-561.43,12.878,-0.00018357,4.6595E-08}, LiqVis = {101,-411.9909,17880.72,61.83069,-0.0000659764,2}, VapVis = {102,1.8398E-07,0.71832,209.33,-5579.1,0}, LiqK = {16,0.065783,-186.09,-0.85045,-0.0016475,-0.0000028261}, VapK = {102,0.00025341,0.90822,897.01,-19862,0}, Racketparam = 0, UniquacR = 3.72, UniquacQ = 2.82, ChaoSeadAF = 0.404143, ChaoSeadSP = 24125.7, ChaoSeadLV = 0.0916034); + end Aniline; + + model Cyclohexanone + extends General_Properties( + SN = 128, name = "Cyclohexanone", CAS = "108-94-1", Tc = 653, Pc = 4000000, Vc = 0.311, Cc = 0.229, Tb = 428.58, Tm = 242, TT = 242, TP = 6.80118, MW = 98.143, LVB = 0.104111, AF = 0.299006, SP = 20250, DM = 1.03E-29, SH = -168070000.0, IGHF = -2.261E+08, GEF = -9.028E+07, AS = 334260, HFMP = 1190000, HOC = -3.299E+09, LiqDen = {105,0.8601,0.26829,653,0.29808,0}, VP = {101,69.93885,-7280.529,-6.943105,3.624646E-06,2}, LiqCp = {16,17987,-72.539,10.794,0.0063056,-0.0000049607}, HOV = {106,6.763E+07,1.0666,-1.0647,0.39633,0.019258}, VapCp = {16,63931,-772.15,13.468,-0.00038098,7.7306E-08}, LiqVis = {101,-37.877,3012.8,3.7501,0.0000021994,2}, VapVis = {102,5.3484E-08,0.89115,65.345,-657.26,0}, LiqK = {16,0.11507,-853.65,4.7946,-0.021722,0.0000091954}, VapK = {102,-1104.9,-0.018396,479160,-8.1392E+09,0}, Racketparam = 0.23, UniquacR = 4.07, UniquacQ = 3.11, ChaoSeadAF = 0.445, ChaoSeadSP = 20139.4, ChaoSeadLV = 0.104167); + end Cyclohexanone; + + model Cyclohexane + extends General_Properties( + SN = 129, name = "Cyclohexane", CAS = "110-82-7", Tc = 553.5, Pc = 4073000, Vc = 0.308, Cc = 0.273, Tb = 353.93, Tm = 279.69, TT = 279.69, TP = 5362.51, MW = 84.161, LVB = 0.10875, AF = 0.211, SP = 16740, DM = 0, SH = -168070000.0, IGHF = -1.233E+08, GEF = 3.191E+07, AS = 297276, HFMP = 2740000, HOC = -3.656E+09, LiqDen = {105,0.93459,0.28022,553.5,0.29409,0}, VP = {101,79.82965,-6246.688,-8.778766,6.933726E-06,2}, LiqCp = {16,116110,127.67,6.7654,0.01311,-0.0000060013}, HOV = {106,4.4856E+07,0.35691,0.26181,-0.47647,0.25741}, VapCp = {16,42569,-588.9,12.962,0.00028376,-1.4009E-07}, LiqVis = {101,-132.2852,5905.41,18.88092,-0.000023942,2}, VapVis = {102,6.7726E-08,0.83665,36.786,-20.301,0}, LiqK = {16,0.073881,-301.5,0.30119,-0.0068406,-0.0000028646}, VapK = {102,8.5865E-07,1.771,243.16,-9.1779,0}, Racketparam = 0.2729, UniquacR = 4.0464, UniquacQ = 3.24, ChaoSeadAF = 0.2032, ChaoSeadSP = 16773.1, ChaoSeadLV = 0.1087); + end Cyclohexane; + + model Onehexene + extends General_Properties( + SN = 130, name = "Onehexene", CAS = "592-41-6", Tc = 504, Pc = 3143000, Vc = 0.3551, Cc = 0.266, Tb = 336.63, Tm = 133.39, TT = 133.39, TP = 0.000516, MW = 84.161, LVB = 0.1259, AF = 0.281, SP = 15130, DM = 1.5E-30, SH = -168070000.0, IGHF = -4.167E+07, GEF = 8.7E+07, AS = 386300, HFMP = 9347000, HOC = -3.7397E+09, LiqDen = {105,0.42588,0.20073,504,0.21659,0}, VP = {101,61.18966,-5302.032,-5.914346,4.387106E-06,2}, LiqCp = {16,120740,197.35,7.4671,0.012038,-0.0000076352}, HOV = {106,4.3654E+07,0.036065,1.7176,-2.6805,1.3349}, VapCp = {16,79063,-588.63,12.822,0.00010837,-3.9549E-08}, LiqVis = {101,-10.027,774.41,-0.14562,-2.993E-08,2}, VapVis = {102,7.708E-08,0.81478,53.202,774.03,0}, LiqK = {16,0.049094,18.334,-2.2175,0.0015607,-0.000010695}, VapK = {102,0.000064257,1.1355,445.14,64830,0}, Racketparam = 0, UniquacR = 4.27, UniquacQ = 3.64, ChaoSeadAF = 0.2463, ChaoSeadSP = 15136.7, ChaoSeadLV = 0.1258); + end Onehexene; + + model Methylcyclopentane + extends General_Properties( + SN = 131, name = "Methylcyclopentane", CAS = "96-37-7", Tc = 532.79, Pc = 3784000, Vc = 0.319, Cc = 0.272, Tb = 344.98, Tm = 130.73, TT = 130.73, TP = 0.000224525, MW = 84.161, LVB = 0.11313, AF = 0.227, SP = 16100, DM = 0, SH = -168070000.0, IGHF = -1.062E+08, GEF = 3.63E+07, AS = 339900, HFMP = 6929000, HOC = -3.6741E+09, LiqDen = {105,0.63455,0.23477,532.79,0.24394,0}, VP = {101,63.18203,-5470.368,-6.215132,4.384737E-06,2}, LiqCp = {16,102830,317.53,4.999,0.022368,-0.000020298}, HOV = {106,4.986429E+07,0.75425,-0.186227,-0.50621,0.35999}, VapCp = {16,55624,-676.34,13.207,-0.0001363,2.6321E-08}, LiqVis = {101,-9.2288,846.65,-0.18612,-0.0000022383,2}, VapVis = {102,0.0000009078,0.495,355.78,10.622,0}, LiqK = {16,-0.040815,4.4808,-1.5434,-0.00050494,-0.0000017671}, VapK = {102,0.0076653,0.48521,479.72,658190,0}, Racketparam = 0, UniquacR = 3.97, UniquacQ = 3.01, ChaoSeadAF = 0.2346, ChaoSeadSP = 16057.17, ChaoSeadLV = 0.1131); + end Methylcyclopentane; + + model Cyclohexanol + extends General_Properties( + SN = 132, name = "Cyclohexanol", CAS = "108-93-0", Tc = 650.1, Pc = 4260000, Vc = 0.322, Cc = 0.254, Tb = 434, Tm = 296.6, TT = 296.6, TP = 76.4997, MW = 100.159, LVB = 0.105751, AF = 0.369047, SP = 23730, DM = 6.2E-30, SH = -168070000.0, IGHF = -2.862E+08, GEF = -1.095E+08, AS = 327700, HFMP = 1783000, HOC = -3.4639E+09, LiqDen = {105,0.90826,0.27716,650.1,0.30685,0}, VP = {101,-31.63718,-3989.985,9.013268,-0.0000126698,2}, LiqCp = {16,-69485,774.7,4.4167,0.025384,-0.000022994}, HOV = {106,7.128838E+07,0.392061,-2.168338,5.552036,-3.376933}, VapCp = {16,82477,-807.95,13.526,-0.00028702,2.5016E-08}, LiqVis = {101,-437.51,22529,63.787,-0.000049001,2}, VapVis = {102,8.1528E-08,0.83387,90.96,4936.6,0}, LiqK = {16,0.075187,-249.81,-0.16784,-0.0068233,0.0000026882}, VapK = {102,0.0030349,0.6097,669.35,478820,0}, Racketparam = 0.24, UniquacR = 4.27, UniquacQ = 3.51, ChaoSeadAF = 0.514148, ChaoSeadSP = 23672.2, ChaoSeadLV = 0.104294); + end Cyclohexanol; + + model TwoTwodimethylbutane + extends General_Properties( + SN = 133, name = "TwoTwodimethylbutane", CAS = "75-83-2", Tc = 488.7, Pc = 3080000, Vc = 0.3591, Cc = 0.272, Tb = 322.87, Tm = 174.28, TT = 174.28, TP = 4.0748, MW = 86.177, LVB = 0.13373, AF = 0.233, SP = 13770, DM = 0, SH = -168070000.0, IGHF = -1.8468E+08, GEF = -8745000, AS = 358340, HFMP = 579100, HOC = -3.8411E+09, LiqDen = {105,0.68727,0.26184,489.01,0.26217,0}, VP = {101,94.2252,-6117.857,-11.25759,0.0000123761,2}, LiqCp = {16,117360,-28.344,9.2143,0.0086854,-0.00000596}, HOV = {106,5.850808E+07,1.595989,-1.437803,0.0287957,0.293443}, VapCp = {16,73375,-521.55,12.775,0.00038975,-1.1854E-07}, LiqVis = {101,22.562,-455.85,-5.0804,-5.7101E-07,2}, VapVis = {102,1.9362E-07,0.68259,102.35,-10.082,0}, LiqK = {16,-0.038291,4.8824,-1.6311,-0.00047294,-0.0000023877}, VapK = {102,0.00018521,0.9549,83.825,174320,0}, Racketparam = 0, UniquacR = 4.4983, UniquacQ = 3.932, ChaoSeadAF = 0.23385, ChaoSeadSP = 13771.5, ChaoSeadLV = 0.133712); + end TwoTwodimethylbutane; + + model TwoThreedimethylbutane + extends General_Properties( + SN = 134, name = "TwoThreedimethylbutane", CAS = "79-29-8", Tc = 499.9, Pc = 3130000, Vc = 0.3576, Cc = 0.269, Tb = 331.12, Tm = 145.19, TT = 145.19, TP = 0.0152127, MW = 86.177, LVB = 0.13117, AF = 0.248, SP = 14300, DM = 0, SH = -168070000.0, IGHF = -1.768E+08, GEF = -3125000, AS = 365920, HFMP = 799100, HOC = -3.84761E+09, LiqDen = {105,0.67999,0.25932,500.01,0.25836,0}, VP = {101,76.80058,-5679.218,-8.443302,7.93783E-06,2}, LiqCp = {16,126350,-53.429,8.8794,0.010279,-0.0000080841}, HOV = {106,4.7443E+07,0.91932,-0.91329,0.50392,-0.089442}, VapCp = {16,46722,-391.59,12.599,0.00056088,-1.7583E-07}, LiqVis = {101,6.9204,231.1,-2.7393,-1.3079E-07,2}, VapVis = {102,6.8449E-07,0.52371,291.92,-3199.1,0}, LiqK = {16,-0.05308,-5.5491,-1.4118,-0.0011735,-7.4229E-07}, VapK = {102,0.000032078,1.1749,-107.52,129270,0}, Racketparam = 0.2694, UniquacR = 4.4982, UniquacQ = 3.848, ChaoSeadAF = 0.24754, ChaoSeadSP = 14352.8, ChaoSeadLV = 0.13105); + end TwoThreedimethylbutane; + + model Nhexane + extends General_Properties( + SN = 135, name = "Nhexane", CAS = "110-54-3", Tc = 507.6, Pc = 3025000, Vc = 0.368, Cc = 0.264, Tb = 341.88, Tm = 177.83, TT = 177.83, TP = 0.901695, MW = 86.177, LVB = 0.13159, AF = 0.297, SP = 14870, DM = 0, SH = -168070000.0, IGHF = -1.6694E+08, GEF = -66340, AS = 388740, HFMP = 1.308E+07, HOC = -3.8551E+09, LiqDen = {105,0.55661,0.23506,507.6,0.24183,0}, VP = {101,71.56625,-5848.968,-7.46028,0.0000050823,2}, LiqCp = {16,155690,5.9137,7.3123,0.013809,-0.0000093814}, HOV = {106,4.086241E+07,-1.014854,4.97802,-6.266175,2.685532}, VapCp = {16,94649,-698.41,13.164,-0.00011992,2.9719E-08}, LiqVis = {101,-62.582,2308.7,8.5085,-0.000019741,2}, VapVis = {102,3.3843E-07,0.62082,239.17,-260.6,0}, LiqK = {16,-0.12682,-1.5015,-1.0467,-0.00088709,-9.3679E-07}, VapK = {102,-569.52,0.7943,-1.1379E+09,-8.2055E+09,0}, Racketparam = 0.2635, UniquacR = 4.4998, UniquacQ = 3.856, ChaoSeadAF = 0.2927, ChaoSeadSP = 14870.79, ChaoSeadLV = 0.1316); + end Nhexane; + + model Twomethylpentane + extends General_Properties( + SN = 136, name = "Twomethylpentane", CAS = "107-83-5", Tc = 497.5, Pc = 3010000, Vc = 0.3667, Cc = 0.267, Tb = 333.4, Tm = 119.55, TT = 119.55, TP = 0.0000206558, MW = 86.177, LVB = 0.13289, AF = 0.278, SP = 14400, DM = 0, SH = -168070000.0, IGHF = -1.7455E+08, GEF = -5338000, AS = 380890, HFMP = 6268000, HOC = -3.84915E+09, LiqDen = {105,0.657,0.25467,497.71,0.26808,0}, VP = {101,77.6873,-5802.911,-8.543267,7.871718E-06,2}, LiqCp = {16,137510,-55.266,8.2006,0.013273,-0.00001165}, HOV = {106,4.724E+07,0.784961,-0.571271,0.114935,0.0796185}, VapCp = {16,70761,-504.8,12.795,0.00029839,-9.4564E-08}, LiqVis = {101,-12.416,938.41,0.18259,4.2586E-07,2}, VapVis = {102,0.0000020458,0.38326,542.64,-1147.6,0}, LiqK = {16,-0.099248,3.6931,-1.2881,-0.00063949,-0.0000011122}, VapK = {102,0.000056887,1.0953,-66.761,139530,0}, Racketparam = 0.2581, UniquacR = 4.499, UniquacQ = 3.852, ChaoSeadAF = 0.2791, ChaoSeadSP = 14417.6, ChaoSeadLV = 0.132931); + end Twomethylpentane; + + model Threemethylpentane + extends General_Properties( + SN = 137, name = "Threemethylpentane", CAS = "96-14-0", Tc = 504.4, Pc = 3120000, Vc = 0.3667, Cc = 0.273, Tb = 336.4, Tm = 110.251, TT = 110.25, TP = 4.13745E-07, MW = 86.177, LVB = 0.13062, AF = 0.273, SP = 14680, DM = 0, SH = -168070000.0, IGHF = -1.72E+08, GEF = -3420000, AS = 383000, HFMP = 5303200, HOC = -3.85137E+09, LiqDen = {105,0.64191,0.2518,504.61,0.25114,0}, VP = {101,103.3869,-6792.289,-12.56583,0.0000127267,2}, LiqCp = {16,124870,37.47,8.4986,0.010489,-0.0000074005}, HOV = {106,5.261039E+07,1.021512,-0.656827,-0.222599,0.294618}, VapCp = {16,66323,-479.35,12.713,0.00041058,-1.3725E-07}, LiqVis = {101,-4.4466,561.39,-0.97496,-4.1525E-07,2}, VapVis = {102,0.0000014857,0.42502,455.77,119.73,0}, LiqK = {16,0.013685,32.912,-2.24,0.00097964,-0.0000056292}, VapK = {102,0.000050178,1.1143,-67.556,138050,0}, Racketparam = 0.2575, UniquacR = 4.499, UniquacQ = 3.852, ChaoSeadAF = 0.275, ChaoSeadSP = 14871.5, ChaoSeadLV = 0.130633); + end Threemethylpentane; + + model Triethyleneglycol + extends General_Properties( + SN = 138, name = "Triethyleneglycol", CAS = "112-27-6", Tc = 769.5, Pc = 3320000, Vc = 0.443, Cc = 0.23, Tb = 561.5, Tm = 265.95, TT = 265.95, TP = 0.000327262, MW = 150.173, LVB = 0.134127, AF = 0.755952, SP = 25710, DM = 9.97E-30, SH = -168070000.0, IGHF = -7.251E+08, GEF = -4.86E+08, AS = 556500, HFMP = 1.82E+07, HOC = -3.2498E+09, LiqDen = {105,0.60697,0.26444,769.5,0.24805,0}, VP = {101,-148.0973,-1446.895,26.95817,-0.0000266538,2}, LiqCp = {16,234210,-89.741,10.328,0.0058089,-0.0000030565}, HOV = {106,1.392895E+08,1.422819,-1.625802,1.207667,-0.563316}, VapCp = {16,88442,-417.2,12.845,0.00037163,-1.3999E-07}, LiqVis = {101,-354.9911,16471.68,54.55389,-0.0481353,1}, VapVis = {102,8.2508E-08,0.8077,134.01,-6653.4,0}, LiqK = {16,-0.089806,0.43077,-1.6802,0.0024003,-0.0000033612}, VapK = {102,0.0000048035,1.4025,164.43,15114,0}, Racketparam = 0.224225, UniquacR = 6.5342, UniquacQ = 6.12, ChaoSeadAF = 0.758714, ChaoSeadSP = 23437.3, ChaoSeadLV = 0.134187); + end Triethyleneglycol; + + model Triethylamine + extends General_Properties( + SN = 139, name = "Triethylamine", CAS = "121-44-8", Tc = 535, Pc = 3000000, Vc = 0.39, Cc = 0.263, Tb = 362.9, Tm = 158.45, TT = 158.45, TP = 0.0106462, MW = 101.192, LVB = 0.13996, AF = 0.316193, SP = 15170, DM = 2.2E-30, SH = -168070000.0, IGHF = -9.58E+07, GEF = 1.141E+08, AS = 405400, HFMP = 8520000, HOC = -4.0405E+09, LiqDen = {105,0.74443,0.28147,535,0.29639,0}, VP = {101,109.5632,-7670.939,-13.23524,8.526035E-06,2}, LiqCp = {16,-68176,-83.963,12.887,-0.00053012,0.0000014554}, HOV = {106,5.6361E+07,1.8179,-4.3508,5.0206,-2.0828}, VapCp = {16,118700,-798.83,13.439,-0.00026576,5.0253E-08}, LiqVis = {101,-8.1405,722.62,-0.37234,-0.0000014417,2}, VapVis = {102,3.6298E-07,0.63337,296.37,-2057.9,0}, LiqK = {16,-0.073124,-11.318,-1.1721,-0.001404,-1.7908E-07}, VapK = {102,0.00013191,0.98598,87.622,150050,0}, Racketparam = 0.262814, UniquacR = 5.01, UniquacQ = 4.26, ChaoSeadAF = 0.316157, ChaoSeadSP = 15176.2, ChaoSeadLV = 0.139672); + end Triethylamine; + + model Toluene + extends General_Properties( + SN = 140, name = "Toluene", CAS = "108-88-3", Tc = 591.75, Pc = 4108000, Vc = 0.316, Cc = 0.264, Tb = 383.79, Tm = 178.18, TT = 178.18, TP = 0.0475285, MW = 92.141, LVB = 0.10687, AF = 0.264, SP = 18250, DM = 1.2E-30, SH = -168070000.0, IGHF = 5.017E+07, GEF = 1.222E+08, AS = 320990, HFMP = 6636000, HOC = -3.734E+09, LiqDen = {105,0.89799,0.27359,591.75,0.30006,0}, VP = {101,32.89891,-5013.81,-1.348918,-1.869928E-06,2}, LiqCp = {16,28291,48.171,10.912,0.0020542,8.7875E-07}, HOV = {106,5.3752E+07,0.50341,0.24755,-0.72898,0.37794}, VapCp = {16,47225,-565.85,12.856,0.000005535,-1.998E-08}, LiqVis = {101,-152.84,5644.6,22.826,-0.000040987,2}, VapVis = {102,8.5581E-07,0.49514,307.82,1891.6,0}, LiqK = {16,-0.072922,-23.153,-1.0277,-0.0017074,3.6787E-07}, VapK = {102,0.000006541,1.4227,190.97,21890,0}, Racketparam = 0.2646, UniquacR = 3.9228, UniquacQ = 2.968, ChaoSeadAF = 0.2591, ChaoSeadSP = 18245.86, ChaoSeadLV = 0.1068); + end Toluene; + + model Mcresol + extends General_Properties( + SN = 141, name = "Mcresol", CAS = "108-39-4", Tc = 705.7, Pc = 4560000, Vc = 0.312, Cc = 0.241, Tb = 475.38, Tm = 285.39, TT = 285.39, TP = 5.86242, MW = 108.14, LVB = 0.10499, AF = 0.452, SP = 23900, DM = 5.3E-30, SH = -168070000.0, IGHF = -1.323E+08, GEF = -4.019E+07, AS = 356040, HFMP = 1.0707E+07, HOC = -3.52783E+09, LiqDen = {105,0.76595,0.25907,705.86,0.2605,0}, VP = {101,143.16,-12586,-17.327,0.0000073113,2}, LiqCp = {16,62676,-205.39,12.221,0.0027125,-0.0000038975}, HOV = {106,9.4557E+07,0.36419,1.602,-2.5634,1.0947}, VapCp = {16,58129,-537.86,12.936,-0.000090368,1.797E-08}, LiqVis = {101,-1098.989,45628.63,168.1502,-0.000185183,2}, VapVis = {102,1.4432E-07,0.74376,166.32,-45.138,0}, LiqK = {16,0.10478,-476.78,0.8844,-0.0090128,0.0000031516}, VapK = {102,0.00016795,0.9362,585.89,24552,0}, Racketparam = 0.241, UniquacR = 4.7567, UniquacQ = 3.888, ChaoSeadAF = 0.45, ChaoSeadSP = 24080.3, ChaoSeadLV = 0.104996); + end Mcresol; + + model Ocresol + extends General_Properties( + SN = 142, name = "Ocresol", CAS = "95-48-7", Tc = 697.6, Pc = 5000000, Vc = 0.282, Cc = 0.243, Tb = 464.17, Tm = 304.19, TT = 304.19, TP = 65.3261, MW = 108.14, LVB = 0.10364, AF = 0.435, SP = 22870, DM = 4.84E-30, SH = -168070000.0, IGHF = -1.2857E+08, GEF = -3.543E+07, AS = 352590, HFMP = 1.582E+07, HOC = -3.528E+09, LiqDen = {105,1.1115,0.30952,697.6,0.31161,0}, VP = {101,140.51,-11819,-17.163,0.0000087043,2}, LiqCp = {16,146600,-116.23,11.009,0.0034596,-0.0000033446}, HOV = {106,9.9721E+07,1.0333,0.08043,-1.2193,0.58124}, VapCp = {16,64367,-535.92,12.871,-0.000033383,-2.2759E-09}, LiqVis = {101,-455.0775,20670.83,67.87773,-0.0000660983,2}, VapVis = {102,8.7371E-08,0.80775,98.538,-0.0034513,0}, LiqK = {16,0.065471,92.351,-2.8415,0.0012245,-0.0000029956}, VapK = {102,0.00018648,0.9302,709.37,-0.0036596,0}, Racketparam = 0, UniquacR = 4.7567, UniquacQ = 3.888, ChaoSeadAF = 0.433455, ChaoSeadSP = 23397.9, ChaoSeadLV = 0.104368); + end Ocresol; + + model Pcresol + extends General_Properties( + SN = 143, name = "Pcresol", CAS = "106-44-5", Tc = 704.5, Pc = 5150000, Vc = 0.277, Cc = 0.244, Tb = 475.12, Tm = 307.93, TT = 307.93, TP = 34.4658, MW = 108.14, LVB = 0.105, AF = 0.51, SP = 24030, DM = 5.2E-30, SH = -168070000.0, IGHF = -1.2535E+08, GEF = -3.166E+07, AS = 350750, HFMP = 1.2707E+07, HOC = -3.52256E+09, LiqDen = {105,0.94818,0.2877,704.66,0.2873,0}, VP = {101,236.9207,-17215.31,-31.28645,0.0000163766,2}, LiqCp = {16,142400,625.27,3.2944,0.02818,-0.000027958}, HOV = {106,1.3617E+08,1.404,0.8091,-3.6055,2.0268}, VapCp = {16,58748,-529.02,12.887,-0.0000351,-1.6131E-09}, LiqVis = {101,-820.7853,35522.87,124.3969,-0.000127538,2}, VapVis = {102,1.4308E-07,0.74508,159.9,-24.834,0}, LiqK = {16,0.061771,-123.88,-1.1823,-0.0033339,0.0000010151}, VapK = {102,0.00016735,0.93839,592.49,25704,0}, Racketparam = 0, UniquacR = 4.7567, UniquacQ = 3.888, ChaoSeadAF = 0.508, ChaoSeadSP = 23827.4, ChaoSeadLV = 0.104957); + end Pcresol; + + model Methylcyclohexane + extends General_Properties( + SN = 144, name = "Methylcyclohexane", CAS = "108-87-2", Tc = 572.19, Pc = 3471000, Vc = 0.368, Cc = 0.268, Tb = 374.09, Tm = 146.58, TT = 146.58, TP = 0.000152251, MW = 98.188, LVB = 0.12835, AF = 0.235, SP = 16060, DM = 0, SH = -168070000.0, IGHF = -1.548E+08, GEF = 2.733E+07, AS = 343300, HFMP = 6751000, HOC = -4.25714E+09, LiqDen = {105,0.54994,0.23476,572.19,0.25237,0}, VP = {101,84.02524,-6720.084,-9.367446,6.892527E-06,2}, LiqCp = {16,121540,-7.0302,8.197,0.012761,-0.000010388}, HOV = {106,5.3741E+07,0.65698,0.0050875,-0.53082,0.29149}, VapCp = {16,82902,-804.58,13.697,-0.00042977,1.1051E-07}, LiqVis = {101,-11.411,1214.3,0.0090457,-0.0000000327,2}, VapVis = {102,6.5256E-07,0.52942,310.39,23.825,0}, LiqK = {16,0.035771,-249.64,0.10904,-0.0066567,0.0000013937}, VapK = {102,0.000074754,1.119,613.15,22882,0}, Racketparam = 0.2699, UniquacR = 4.72, UniquacQ = 3.776, ChaoSeadAF = 0.2421, ChaoSeadSP = 16016.26, ChaoSeadLV = 0.1283); + end Methylcyclohexane; + + model Ethylcyclopentane + extends General_Properties( + SN = 145, name = "Ethylcyclopentane", CAS = "1640-89-7", Tc = 569.5, Pc = 3397000, Vc = 0.375, Cc = 0.269, Tb = 376.59, Tm = 134.71, TT = 134.71, TP = 3.71437E-06, MW = 98.188, LVB = 0.12883, AF = 0.27, SP = 16250, DM = 0, SH = -168070000.0, IGHF = -1.269E+08, GEF = 4.48E+07, AS = 378300, HFMP = 6869700, HOC = -4.2839E+09, LiqDen = {105,0.72259,0.26996,569.5,0.2784,0}, VP = {101,95.769,-7366.4,-11.099,0.0000081014,2}, LiqCp = {16,128880,403.43,3.1567,0.031507,-0.000033176}, HOV = {106,5.78221E+07,0.856257,-0.338119,-0.391894,0.299953}, VapCp = {16,61352,-623.48,13.275,-0.000068613,9.3089E-09}, LiqVis = {101,-3.6105,709.69,-1.12,8.8328E-07,2}, VapVis = {102,0.0000021783,0.38064,577.64,269.9,0}, LiqK = {16,-0.019932,6.51,-1.7114,-0.0004148,-0.0000019629}, VapK = {102,0.0047981,0.52948,335.74,590020,0}, Racketparam = 0, UniquacR = 4.72, UniquacQ = 3.776, ChaoSeadAF = 0.271548, ChaoSeadSP = 16339.4, ChaoSeadLV = 0.128749); + end Ethylcyclopentane; + + model Oneheptene + extends General_Properties( + SN = 146, name = "Oneheptene", CAS = "592-76-7", Tc = 537.3, Pc = 2920000, Vc = 0.409, Cc = 0.267, Tb = 366.79, Tm = 154.12, TT = 154.12, TP = 0.00186, MW = 98.188, LVB = 0.14177, AF = 0.343, SP = 15310, DM = 2.1E-30, SH = -168070000.0, IGHF = -6.289E+07, GEF = 9.482E+07, AS = 425200, HFMP = 1.264E+07, HOC = -4.3499E+09, LiqDen = {105,0.26107,0.16952,537.3,0.1874,0}, VP = {101,109.9184,-7605.67,-13.43227,0.0000123163,2}, LiqCp = {16,58419,89.259,10.549,0.0039271,-8.6181E-07}, HOV = {106,5.631368E+07,1.145386,-1.731438,1.615943,-0.650835}, VapCp = {16,94067,-609.56,13.043,0.000046316,-2.1105E-08}, LiqVis = {101,-10.29,827.04,-0.087144,0.0000001052,2}, VapVis = {102,7.4687E-08,0.81173,52.725,1460.7,0}, LiqK = {16,-0.038053,-34.158,-1.0057,-0.0023353,-3.7702E-08}, VapK = {102,0.000013676,1.341,365.19,6251.8,0}, Racketparam = 0.260462, UniquacR = 4.9441, UniquacQ = 4.184, ChaoSeadAF = 0.358, ChaoSeadSP = 15313.2, ChaoSeadLV = 0.141709); + end Oneheptene; + + model Nheptane + extends General_Properties( + SN = 147, name = "Nheptane", CAS = "142-82-5", Tc = 540.2, Pc = 2740000, Vc = 0.428, Cc = 0.261, Tb = 371.57, Tm = 182.57, TT = 182.57, TP = 0.182694, MW = 100.204, LVB = 0.14747, AF = 0.35, SP = 15240, DM = 0, SH = -168070000.0, IGHF = -1.8765E+08, GEF = 8165000, AS = 427980, HFMP = 1.405E+07, HOC = -4.46473E+09, LiqDen = {105,0.57043,0.25304,540.2,0.27335,0}, VP = {101,89.80457,-7084.845,-10.17918,7.441708E-06,2}, LiqCp = {16,134750,14.937,10.603,0.001438,0.0000036711}, HOV = {106,4.275764E+07,-1.051245,4.601706,-5.558946,2.369496}, VapCp = {16,109310,-704.2,13.352,-0.00017922,4.6992E-08}, LiqVis = {101,-61.08861,2532.297,8.091665,-0.0000152585,2}, VapVis = {102,2.6134E-08,0.948,-37.497,9005.3,0}, LiqK = {16,0.083657,49.111,-3.4536,0.0077989,-0.000025112}, VapK = {102,-0.076333,0.38025,-7539.9,-2646800,0}, Racketparam = 0.2611, UniquacR = 5.1742, UniquacQ = 4.396, ChaoSeadAF = 0.3403, ChaoSeadSP = 15230, ChaoSeadLV = 0.1475); + end Nheptane; + + model Styrene + extends General_Properties( + SN = 148, name = "Styrene", CAS = "100-42-5", Tc = 636, Pc = 3840000, Vc = 0.352, Cc = 0.256, Tb = 418.31, Tm = 242.54, TT = 242.54, TP = 10.6132, MW = 104.149, LVB = 0.115667, AF = 0.297097, SP = 19020, DM = 4.33E-31, SH = -168070000.0, IGHF = 1.474E+08, GEF = 2.139E+08, AS = 345100, HFMP = 1.095E+07, HOC = -4.219E+09, LiqDen = {105,0.57789,0.23139,640.77,0.26351,0}, VP = {101,399.8489,-19017.34,-58.96286,0.0000747957,2}, LiqCp = {16,134310,-99.916,9.4935,0.0058294,-0.0000013972}, HOV = {106,1.110621E+08,3.429275,-6.061051,4.605581,-1.408226}, VapCp = {16,57806.72,-550.4249,12.95376,-0.0000950882,2.294759E-08}, LiqVis = {101,-24.717,1824,1.9977,-4.7933E-07,2}, VapVis = {102,3.6968E-08,0.90482,-32.023,10027,0}, LiqK = {16,-0.071817,-30.013,-1.0262,-0.0015623,2.7674E-07}, VapK = {102,0.010229,0.40085,535.56,704200,0}, Racketparam = 0, UniquacR = 4.37, UniquacQ = 3.3, ChaoSeadAF = 0.2302, ChaoSeadSP = 19015.9, ChaoSeadLV = 0.115667); + end Styrene; + + model Ethylbenzene + extends General_Properties( + SN = 149, name = "Ethylbenzene", CAS = "100-41-4", Tc = 617.15, Pc = 3609000, Vc = 0.374, Cc = 0.263, Tb = 409.36, Tm = 178.2, TT = 178.2, TP = 0.00390778, MW = 106.167, LVB = 0.12308, AF = 0.304, SP = 17980, DM = 2.0E-30, SH = -168070000.0, IGHF = 2.992E+07, GEF = 1.3073E+08, AS = 360630, HFMP = 9180300, HOC = -4.3448E+09, LiqDen = {105,0.66155,0.25394,617.21,0.27883,0}, VP = {101,137.5088,-9745.069,-17.34457,0.0000127987,2}, LiqCp = {16,131820,-90.983,10.031,0.0026504,0.0000033965}, HOV = {106,5.990732E+07,0.380483,1.094304,-2.185536,1.1369}, VapCp = {16,65434,-619.34,13.166,-0.00016412,4.1529E-08}, LiqVis = {101,-14.506,1237.2,0.52859,-9.1363E-08,2}, VapVis = {102,0.0000016833,0.39831,366.45,23750,0}, LiqK = {16,-0.026087,13.301,-1.6623,-0.00027844,-0.0000018214}, VapK = {102,0.000015932,1.3226,486.47,14367,0}, Racketparam = 0, UniquacR = 4.6, UniquacQ = 3.51, ChaoSeadAF = 0.2936, ChaoSeadSP = 17979.95, ChaoSeadLV = 0.1231); + end Ethylbenzene; + + model Mxylene + extends General_Properties( + SN = 150, name = "Mxylene", CAS = "108-38-3", Tc = 617, Pc = 3541000, Vc = 0.375, Cc = 0.259, Tb = 412.34, Tm = 225.3, TT = 225.3, TP = 3.18019, MW = 106.167, LVB = 0.12347, AF = 0.327, SP = 18050, DM = 1.0E-30, SH = -168070000.0, IGHF = 1.732E+07, GEF = 1.1876E+08, AS = 358540, HFMP = 1.157E+07, HOC = -4.3318E+09, LiqDen = {105,0.68902,0.26086,617,0.27479,0}, VP = {101,97.968,-8164.7,-11.269,0.0000072101,2}, LiqCp = {16,127090,-62.999,9.3762,0.0068549,-0.0000032778}, HOV = {106,5.9562E+07,0.67841,-0.38938,0.0061115,0.10219}, VapCp = {16,62092,-572.21,12.975,0.000062577,-3.7811E-08}, LiqVis = {101,-13.362,1141.4,0.37182,-3.9423E-07,2}, VapVis = {102,7.2954E-08,0.8097,14.386,8844.3,0}, LiqK = {16,-0.021158,-27.324,-1.2663,-0.0016664,-3.6744E-07}, VapK = {102,2.8001E-09,2.4298,-575.12,122260,0}, Racketparam = 0.2593, UniquacR = 4.66, UniquacQ = 3.54, ChaoSeadAF = 0.3045, ChaoSeadSP = 18041.31, ChaoSeadLV = 0.1235); + end Mxylene; + + model Oxylene + extends General_Properties( + SN = 151, name = "Oxylene", CAS = "95-47-6", Tc = 630.3, Pc = 3732000, Vc = 0.37, Cc = 0.263, Tb = 417.59, Tm = 247.98, TT = 247.98, TP = 21.842, MW = 106.167, LVB = 0.12125, AF = 0.312, SP = 18390, DM = 2.1E-30, SH = -168070000.0, IGHF = 1.908E+07, GEF = 1.22E+08, AS = 353830, HFMP = 1.36E+07, HOC = -4.333E+09, LiqDen = {105,0.69962,0.26143,630.3,0.27365,0}, VP = {101,88.08217,-7844.793,-9.738423,5.713756E-06,2}, LiqCp = {16,134490,-170.61,10.247,0.0049096,-0.0000031727}, HOV = {106,6.6979E+07,1.259,-1.849,1.5198,-0.50455}, VapCp = {16,73986,-589.13,12.936,0.000080122,-4.5074E-08}, LiqVis = {101,-11.059,1251.7,-0.076438,0.000001254,2}, VapVis = {102,6.783E-08,0.82039,-1.2715,13072,0}, LiqK = {16,-0.018751,-22.77,-1.3391,-0.0014281,-6.1692E-07}, VapK = {102,0.0000059387,1.356,-206,65058,0}, Racketparam = 0.2633, UniquacR = 4.66, UniquacQ = 3.54, ChaoSeadAF = 0.2904, ChaoSeadSP = 18389.04, ChaoSeadLV = 0.1212); + end Oxylene; + + model Pxylene + extends General_Properties( + SN = 152, name = "Pxylene", CAS = "106-42-3", Tc = 616.2, Pc = 3511000, Vc = 0.378, Cc = 0.259, Tb = 411.53, Tm = 286.41, TT = 286.41, TP = 575.533, MW = 106.167, LVB = 0.12393, AF = 0.322, SP = 17910, DM = 0, SH = -168070000.0, IGHF = 1.803E+07, GEF = 1.214E+08, AS = 352165, HFMP = 1.711E+07, HOC = -4.333E+09, LiqDen = {105,0.67752,0.25887,616.2,0.27596,0}, VP = {101,97.352,-8082.1,-11.197,0.0000072605,2}, LiqCp = {16,63084,-343.38,13.438,-0.0033851,0.0000045592}, HOV = {106,5.6332E+07,0.37965,0.42395,-0.85683,0.43704}, VapCp = {16,62397,-585.6,13.025,0.0000037921,-1.7044E-08}, LiqVis = {101,-23.916,1499.8,2.0719,-0.0000037065,2}, VapVis = {102,2.4281E-08,0.95421,-91.329,17547,0}, LiqK = {16,0.00066881,-122.94,-0.60875,-0.0037322,9.7446E-07}, VapK = {102,0.0000001261,1.8916,-453.43,111720,0}, Racketparam = 0.2589, UniquacR = 4.66, UniquacQ = 3.54, ChaoSeadAF = 0.2969, ChaoSeadSP = 17939.04, ChaoSeadLV = 0.124); + end Pxylene; + + model Ethylcyclohexane + extends General_Properties( + SN = 153, name = "Ethylcyclohexane", CAS = "1678-91-7", Tc = 609.15, Pc = 3040000, Vc = 0.43, Cc = 0.258, Tb = 404.945, Tm = 161.839, TT = 161.839, TP = 0.000357389, MW = 112.213, LVB = 0.143036, AF = 0.245525, SP = 16340, DM = 0, SH = -168070000.0, IGHF = -1.715E+08, GEF = 3.955E+07, AS = 382600, HFMP = 8334100, HOC = -4.87051E+09, LiqDen = {105,0.61774,0.26525,609.15,0.28064,0}, VP = {101,80.60435,-7221.846,-8.661516,4.619539E-06,2}, LiqCp = {16,106540,50.724,9.3758,0.0085193,-0.0000058679}, HOV = {106,6.1066E+07,1.1095,-1.6401,1.5232,-0.54256}, VapCp = {16,99579,-799.66,13.811,-0.00043634,1.1487E-07}, LiqVis = {101,-22.531,1686,1.7093,-0.0000001282,2}, VapVis = {102,4.2871E-07,0.57053,258.88,-2237.2,0}, LiqK = {16,-0.040212,3.9673,-1.6044,-0.00049691,-0.0000012623}, VapK = {102,0.000062751,1.1219,488.85,45648,0}, Racketparam = 0, UniquacR = 5.3944, UniquacQ = 4.316, ChaoSeadAF = 0.2426, ChaoSeadSP = 16360, ChaoSeadLV = 0.143117); + end Ethylcyclohexane; + + model Npropylcyclopentane + extends General_Properties( + SN = 154, name = "Npropylcyclopentane", CAS = "2040-96-2", Tc = 596, Pc = 3020000, Vc = 0.428, Cc = 0.261, Tb = 404.11, Tm = 155.81, TT = 155.81, TP = 0.0000458874, MW = 112.213, LVB = 0.145193, AF = 0.326642, SP = 16360, DM = 0, SH = -168070000.0, IGHF = -1.481E+08, GEF = 5.344E+07, AS = 414500, HFMP = 1.003E+07, HOC = -4.89356E+09, LiqDen = {105,0.63061,0.26934,596,0.28169,0}, VP = {101,95.39512,-7846.538,-10.93845,7.332031E-06,2}, LiqCp = {16,121270,281.76,6.7151,0.017545,-0.000016082}, HOV = {106,7.088104E+07,1.477689,-1.919309,1.219865,-0.332624}, VapCp = {16,82387,-676.01,13.514,-0.00019546,4.9854E-08}, LiqVis = {101,-22.725,1601.8,1.7512,2.3108E-07,2}, VapVis = {102,0.0000028167,0.32978,562.31,4948.1,0}, LiqK = {16,-0.033741,2.5308,-1.6237,-0.00058186,-0.0000013118}, VapK = {102,0.000098309,1.0636,611.41,33175,0}, Racketparam = 0, UniquacR = 5.3944, UniquacQ = 4.316, ChaoSeadAF = 0.27189, ChaoSeadSP = 16393.5, ChaoSeadLV = 0.145193); + end Npropylcyclopentane; + + model Noctane + extends General_Properties( + SN = 155, name = "Noctane", CAS = "111-65-9", Tc = 568.7, Pc = 2490000, Vc = 0.492, Cc = 0.259, Tb = 398.82, Tm = 216.38, TT = 216.38, TP = 2.1083, MW = 114.231, LVB = 0.16353, AF = 0.397, SP = 15490, DM = 0, SH = -168070000.0, IGHF = -2.0875E+08, GEF = 1.6E+07, AS = 467230, HFMP = 2.074E+07, HOC = -5.07415E+09, LiqDen = {105,0.4436,0.23818,568.77,0.25171,0}, VP = {101,87.46069,-7578.199,-9.657211,5.664818E-06,2}, LiqCp = {16,184080,362.58,6.1268,0.015908,-0.000010697}, HOV = {106,6.509104E+07,0.906328,-0.61829,0.0251605,0.114898}, VapCp = {16,123360,-700.1,13.486,-0.00019118,4.5401E-08}, LiqVis = {101,-67.06275,2937.699,8.939458,-0.0000146474,2}, VapVis = {102,7.2215E-09,1.1166,-127.08,17623,0}, LiqK = {16,-0.03316,17.841,-1.6367,-0.000047737,-0.0000026501}, VapK = {102,-8968.5,0.84408,-2.7564E+10,-6.5097E+10,0}, Racketparam = 0.2567, UniquacR = 5.8486, UniquacQ = 4.936, ChaoSeadAF = 0.3992, ChaoSeadSP = 15445.57, ChaoSeadLV = 0.163455); + end Noctane; + + model TwoTwoThreetrimethylpentane + extends General_Properties( + SN = 156, name = "TwoTwoThreetrimethylpentane", CAS = "564-02-3", Tc = 563.4, Pc = 2730000, Vc = 0.436, Cc = 0.254, Tb = 382.99, Tm = 160.89, TT = 160.89, TP = 0.0021759, MW = 114.231, LVB = 0.16043, AF = 0.298, SP = 14690, DM = 0, SH = -168070000.0, IGHF = -2.1995E+08, GEF = 1.7726E+07, AS = 423880, HFMP = 8619000, HOC = -5.06754E+09, LiqDen = {105,0.53892,0.263,563.51,0.24185,0}, VP = {101,87.50671,-7031.238,-9.863302,7.128886E-06,2}, LiqCp = {16,170570,-194.18,8.4382,0.017272,-0.000019404}, HOV = {106,6.030131E+07,1.053957,-0.826185,0.00124096,0.214352}, VapCp = {16,45546,-344.09,12.853,0.00059243,-1.8071E-07}, LiqVis = {101,-8.9806,1118.5,-0.42179,0.000001606,2}, VapVis = {102,4.6777E-07,0.5509,223.7,10.797,0}, LiqK = {16,-0.050146,3.605,-1.5994,-0.00051269,-0.0000013443}, VapK = {102,0.000016836,1.25,-167.06,132290,0}, Racketparam = 0, UniquacR = 5.85, UniquacQ = 4.94, ChaoSeadAF = 0.2975, ChaoSeadSP = 14768.5, ChaoSeadLV = 0.160344); + end TwoTwoThreetrimethylpentane; + + model TwoTwoFourtrimethylpentane + extends General_Properties( + SN = 157, name = "TwoTwoFourtrimethylpentane", CAS = "540-84-1", Tc = 543.9, Pc = 2570000, Vc = 0.4697, Cc = 0.266, Tb = 372.39, Tm = 165.777, TT = 165.777, TP = 0.0170695, MW = 114.231, LVB = 0.16607, AF = 0.304, SP = 14080, DM = 0, SH = -168070000.0, IGHF = -2.2401E+08, GEF = 1.394E+07, AS = 422960, HFMP = 9196000, HOC = -5.06528E+09, LiqDen = {105,0.48523,0.24924,543.9,0.25602,0}, VP = {101,83.71044,-6701.601,-9.312194,6.808451E-06,2}, LiqCp = {16,159470,-380.54,12.372,-0.00044236,0.0000034887}, HOV = {106,4.633E+07,0.37451,-0.066775,-0.010135,0.080832}, VapCp = {16,84635,-470.35,13.011,0.00041124,-1.2926E-07}, LiqVis = {101,-22.241,1365.6,1.8379,-0.0000051189,2}, VapVis = {102,1.9933E-07,0.67222,163.02,-5306.3,0}, LiqK = {16,0.044744,-42.414,-1.7361,-0.0023225,-0.0000040597}, VapK = {102,0.000011401,1.3632,286.23,6065.2,0}, Racketparam = 0, UniquacR = 5.85, UniquacQ = 4.94, ChaoSeadAF = 0.3033, ChaoSeadSP = 14050.5, ChaoSeadLV = 0.165452); + end TwoTwoFourtrimethylpentane; + + model TwoThreeThreetrimethylpentane + extends General_Properties( + SN = 158, name = "TwoThreeThreetrimethylpentane", CAS = "560-21-4", Tc = 573.5, Pc = 2820000, Vc = 0.4551, Cc = 0.269, Tb = 387.92, Tm = 172.22, TT = 172.22, TP = 0.0168197, MW = 114.231, LVB = 0.15815, AF = 0.291, SP = 14920, DM = 0, SH = -168070000.0, IGHF = -2.1845E+08, GEF = 1.828E+07, AS = 427020, HFMP = 857720, HOC = -5.06876E+09, LiqDen = {105,0.56592,0.26622,573.5,0.26429,0}, VP = {101,82.87517,-6894.749,-9.15013,6.430758E-06,2}, LiqCp = {16,217000,82.075,1.8853,0.036678,-0.000031911}, HOV = {106,5.838161E+07,1.059379,-1.234692,0.816701,-0.225175}, VapCp = {16,48585,-365.95,12.926,0.00051631,-1.5846E-07}, LiqVis = {101,-10.941,1191.2,-0.045562,-0.0000023087,2}, VapVis = {102,8.2493E-07,0.49302,371.93,-89.774,0}, LiqK = {16,-0.040193,3.6823,-1.645,-0.00052834,-0.0000014091}, VapK = {102,0.000018829,1.2378,-181.1,146480,0}, Racketparam = 0, UniquacR = 5.85, UniquacQ = 4.94, ChaoSeadAF = 0.2903, ChaoSeadSP = 14919.5, ChaoSeadLV = 0.158155); + end TwoThreeThreetrimethylpentane; + + model TwoThreeFourtrimethylpentane + extends General_Properties( + SN = 159, name = "TwoThreeFourtrimethylpentane", CAS = "565-75-3", Tc = 566.3, Pc = 2730000, Vc = 0.4562, Cc = 0.267, Tb = 386.62, Tm = 163.95, TT = 163.95, TP = 0.00303425, MW = 114.231, LVB = 0.15974, AF = 0.316, SP = 14940, DM = 0, SH = -168070000.0, IGHF = -2.1732E+08, GEF = 1.9E+07, AS = 428400, HFMP = 9267560, HOC = -5.06943E+09, LiqDen = {105,0.44061,0.23657,566.41,0.23009,0}, VP = {101,83.41936,-6957.084,-9.207327,0.0000063783,2}, LiqCp = {16,108880,-13.14,10.55,0.00536,-0.0000028819}, HOV = {106,5.6943E+07,0.86512,-0.77048,0.30586,0.021601}, VapCp = {16,26624,-291.65,12.829,0.00059553,-0.0000001821}, LiqVis = {101,-6.3467,935.74,-0.76144,7.5545E-07,2}, VapVis = {102,6.7868E-07,0.51422,325.4,22.347,0}, LiqK = {16,-0.048086,3.7835,-1.6094,-0.00050636,-0.0000013704}, VapK = {102,0.000017892,1.241,-169.67,132780,0}, Racketparam = 0, UniquacR = 5.85, UniquacQ = 4.94, ChaoSeadAF = 0.316137, ChaoSeadSP = 14934.3, ChaoSeadLV = 0.159513); + end TwoThreeFourtrimethylpentane; + + model Tetraethyleneglycol + extends General_Properties( + SN = 160, name = "Tetraethyleneglycol", CAS = "112-60-7", Tc = 795, Pc = 2590000, Vc = 0.564, Cc = 0.221, Tb = 602.7, Tm = 268.15, TT = 268.15, TP = 0.0000138348, MW = 194.226, LVB = 0.172862, AF = 0.917442, SP = 23690, DM = 1.08E-29, SH = -168070000.0, IGHF = -8.83E+08, GEF = -5.599E+08, AS = 650100, HFMP = 3.66E+07, HOC = -4.3431E+09, LiqDen = {105,0.46229,0.26105,795,0.27055,0}, VP = {101,106.7938,-15323.17,-10.86107,-5.284752E-07,2}, LiqCp = {16,180650,-180.95,12.547,0.0020505,-0.0000018444}, HOV = {106,1.282157E+08,0.159236,1.504015,-1.941373,0.658104}, VapCp = {16,122630,-416.14,13.02,0.00050957,-2.1012E-07}, LiqVis = {101,-702.8128,30403.47,106.7279,-0.000116388,2}, VapVis = {102,7.6872E-08,0.801,119.91,0.29361,0}, LiqK = {16,-0.11138,-134.47,-0.46393,-0.00084854,-4.1141E-07}, VapK = {102,0.00016749,0.91863,699.93,16777,0}, Racketparam = 0, UniquacR = 8.1269, UniquacQ = 7.440001, ChaoSeadAF = 0.930639, ChaoSeadSP = 23571.8, ChaoSeadLV = 0.173363); + end Tetraethyleneglycol; + + model Indene + extends General_Properties( + SN = 161, name = "Indene", CAS = "95-13-6", Tc = 687, Pc = 3820000, Vc = 0.368, Cc = 0.246, Tb = 455.77, Tm = 271.7, TT = 271.7, TP = 17.0209, MW = 116.16, LVB = 0.116856, AF = 0.333766, SP = 20310, DM = 2.23E-30, SH = -168070000.0, IGHF = 1.6328E+08, GEF = 2.3396E+08, AS = 336870, HFMP = 1.02E+07, HOC = -4.61948E+09, LiqDen = {105,0.68574,0.25341,687,0.30914,0}, VP = {101,198.3126,-13212.05,-26.47637,0.0000206314,2}, LiqCp = {16,87661,-18.633,10.258,0.0056195,-0.0000040934}, HOV = {106,1.127174E+08,2.195635,-2.278889,0.782692,-0.231351}, VapCp = {16,54598,-572.63,13.077,-0.000062304,-1.4084E-09}, LiqVis = {101,-136.89,6165.4,19.669,-0.000025488,2}, VapVis = {102,8.1278E-07,0.4938,370.54,-3708.9,0}, LiqK = {16,-0.0034145,-80.459,-0.91571,-0.0024408,2.3991E-07}, VapK = {102,0.000075165,1.055,558.89,35355,0}, Racketparam = 0.261272, UniquacR = 4.431773, UniquacQ = 2.892, ChaoSeadAF = 0.262, ChaoSeadSP = 20467.4, ChaoSeadLV = 0.116856); + end Indene; + + model Indane + extends General_Properties( + SN = 162, name = "Indane", CAS = "496-11-7", Tc = 684.9, Pc = 3950000, Vc = 0.393, Cc = 0.273, Tb = 451, Tm = 221.74, TT = 221.74, TP = 0.152927, MW = 118.178, LVB = 0.12315, AF = 0.309213, SP = 19420, DM = 1.8E-30, SH = -168070000.0, IGHF = 6.07E+07, GEF = 1.668E+08, AS = 348910, HFMP = 8598000, HOC = -4.7626E+09, LiqDen = {105,0.63627,0.25179,684.9,0.29165,0}, VP = {101,97.02207,-8795.05,-11.00248,6.105132E-06,2}, LiqCp = {16,136380,-29.478,8.0608,0.01305,-0.000010993}, HOV = {106,6.2067E+07,-0.0045874,2.0817,-3.2476,1.6013}, VapCp = {16,60321,-643.06,13.337,-0.00018807,3.6677E-08}, LiqVis = {101,-151.95,6810.2,21.863,-0.00002342,2}, VapVis = {102,0.0000002842,0.64259,225.95,-643.44,0}, LiqK = {16,-0.041318,5.7098,-1.5369,-0.00043639,-0.0000010195}, VapK = {102,0.0089527,0.43447,617.91,764370,0}, Racketparam = 0.263427, UniquacR = 4.66381, UniquacQ = 3.108, ChaoSeadAF = 0.305, ChaoSeadSP = 19405.1, ChaoSeadLV = 0.123128); + end Indane; + + model Cumene + extends General_Properties( + SN = 163, name = "Cumene", CAS = "98-82-8", Tc = 631, Pc = 3209000, Vc = 0.4347, Cc = 0.261, Tb = 425.52, Tm = 177.14, TT = 177.14, TP = 0.000471313, MW = 120.194, LVB = 0.14017, AF = 0.326, SP = 17420, DM = 1.3E-30, SH = -168070000.0, IGHF = 4000000, GEF = 1.379E+08, AS = 386000, HFMP = 7326000, HOC = -4.951E+09, LiqDen = {105,0.50221,0.23722,631.11,0.26133,0}, VP = {101,118.1491,-9251.635,-14.30054,9.196883E-06,2}, LiqCp = {16,41467,-297.98,13.905,-0.0047724,0.0000064694}, HOV = {106,5.766E+07,0.38939,0,0,0}, VapCp = {16,86134,-649.19,13.375,-0.00027067,7.9617E-08}, LiqVis = {101,-16.711,1557.8,0.70915,0.000002636,2}, VapVis = {102,3.9385E-07,0.59572,281.33,-806.82,0}, LiqK = {16,0.085857,481.58,-8.587,0.025021,-0.000042138}, VapK = {102,1.6743E-07,1.8369,-449.46,112760,0}, Racketparam = 0.2617, UniquacR = 5.2708, UniquacQ = 4.044, ChaoSeadAF = 0.3353, ChaoSeadSP = 17436.2, ChaoSeadLV = 0.139854); + end Cumene; + + model Npropylbenzene + extends General_Properties( + SN = 164, name = "Npropylbenzene", CAS = "103-65-1", Tc = 638.35, Pc = 3200000, Vc = 0.44, Cc = 0.265, Tb = 432.35, Tm = 173.55, TT = 173.55, TP = 0.000181372, MW = 120.194, LVB = 0.1402, AF = 0.345, SP = 17670, DM = 1.23E-30, SH = -168070000.0, IGHF = 7900000, GEF = 1.376E+08, AS = 400140, HFMP = 9268000, HOC = -4.95415E+09, LiqDen = {105,0.56872,0.25108,638.35,0.29337,0}, VP = {101,90.904,-8254.5,-10.105,0.0000055769,2}, LiqCp = {16,44429,65.841,10.897,0.0032658,-5.4402E-07}, HOV = {106,7.1312E+07,1.0445,-0.61076,-0.59569,0.63332}, VapCp = {16,82370,-622.6,13.289,-0.00014307,2.6658E-08}, LiqVis = {101,-15.601,1467.9,0.61045,8.0442E-07,2}, VapVis = {102,4.6834E-07,0.55936,217.09,10253,0}, LiqK = {16,-0.081391,2.87,-1.3455,-0.00061835,-5.1664E-07}, VapK = {102,0.025018,0.26728,100.66,971170,0}, Racketparam = 0.2599, UniquacR = 5.2716, UniquacQ = 4.048, ChaoSeadAF = 0.3444, ChaoSeadSP = 17805.4, ChaoSeadLV = 0.139831); + end Npropylbenzene; + + model Npropylcyclohexane + extends General_Properties( + SN = 165, name = "Npropylcyclohexane", CAS = "1678-92-8", Tc = 639.15, Pc = 2807000, Vc = 0.477, Cc = 0.252, Tb = 429.897, Tm = 178.25, TT = 178.25, TP = 0.000859078, MW = 126.239, LVB = 0.159758, AF = 0.259535, SP = 16350, DM = 0, SH = -168070000.0, IGHF = -1.933E+08, GEF = 4.738E+07, AS = 419530, HFMP = 1.037E+07, HOC = -5.47966E+09, LiqDen = {105,0.55532,0.26594,639.15,0.29886,0}, VP = {101,82.958,-7871.7,-8.8759,0.0000037842,2}, LiqCp = {16,47569,39.903,11.009,0.0038436,-0.0000012583}, HOV = {106,6.8086E+07,1.2548,-2.1193,2.1809,-0.84474}, VapCp = {16,123230,-835.51,14.003,-0.00055451,1.5912E-07}, LiqVis = {101,-18.964,1768.3,1.0133,0.0000031666,2}, VapVis = {102,0.0000010206,0.44533,352.16,7219.8,0}, LiqK = {16,-0.049742,3.3035,-1.5814,-0.00048571,-0.000001015}, VapK = {102,0.000001205,1.6222,-42.945,15739,0}, Racketparam = 0, UniquacR = 6.068799, UniquacQ = 4.856, ChaoSeadAF = 0.2577, ChaoSeadSP = 16377.1, ChaoSeadLV = 0.159758); + end Npropylcyclohexane; + + model Nnonane + extends General_Properties( + SN = 166, name = "Nnonane", CAS = "111-84-2", Tc = 594.6, Pc = 2290000, Vc = 0.555, Cc = 0.257, Tb = 423.97, Tm = 219.66, TT = 219.66, TP = 0.430583, MW = 128.258, LVB = 0.1797, AF = 0.443, SP = 15630, DM = 0, SH = -168070000.0, IGHF = -2.2874E+08, GEF = 2.498E+07, AS = 506400, HFMP = 1.547E+07, HOC = -5.68455E+09, LiqDen = {105,0.46379,0.25569,594.6,0.27961,0}, VP = {101,34.38252,-6235.412,-1.153933,-6.408486E-06,2}, LiqCp = {16,263370,-14466,134.04,-0.36823,0.00038456}, HOV = {106,8.427482E+07,1.573752,-1.785921,0.692082,0.00268541}, VapCp = {16,137710,-699.52,13.613,-0.00021735,5.3695E-08}, LiqVis = {101,-75.488,3420.7,10.183,-0.000014836,2}, VapVis = {102,1.0363E-07,0.77284,221.39,-190.1,0}, LiqK = {16,0.022998,-23.224,-1.6475,-0.000633,-0.0000035211}, VapK = {102,-0.065472,0.27739,-3569.2,-1629700,0}, Racketparam = 0.251687, UniquacR = 6.523, UniquacQ = 5.476, ChaoSeadAF = 0.4439, ChaoSeadSP = 15648.08, ChaoSeadLV = 0.1796); + end Nnonane; + + model Naphthalene + extends General_Properties( + SN = 167, name = "Naphthalene", CAS = "91-20-3", Tc = 748.4, Pc = 4050000, Vc = 0.407, Cc = 0.265, Tb = 491.16, Tm = 353.434, TT = 353.43, TP = 991.297, MW = 128.174, LVB = 0.12913, AF = 0.304, SP = 19490, DM = 0, SH = -168070000.0, IGHF = 1.5058E+08, GEF = 2.2408E+08, AS = 333150, HFMP = 1.898E+07, HOC = -4.9809E+09, LiqDen = {105,0.45282,0.21953,748.4,0.23236,0}, VP = {101,93.15947,-9448.063,-10.23844,4.335455E-06,2}, LiqCp = {16,149170,579.65,3.8152,0.021624,-0.000015657}, HOV = {106,7.732822E+07,1.116621,-1.313575,0.672121,-0.00584514}, VapCp = {16,49831,-547.92,13.201,-0.00013999,2.8208E-08}, LiqVis = {101,-8.2151,1338.2,-0.46592,0.00000135,2}, VapVis = {102,1.2323E-08,1.0475,-162.06,35144,0}, LiqK = {16,0.033214,-361.89,-0.012818,-0.0040236,0.0000012782}, VapK = {102,0.000017754,1.2123,69.759,78517,0}, Racketparam = 0.261, UniquacR = 4.920237, UniquacQ = 3.368, ChaoSeadAF = 0.302, ChaoSeadSP = 19187.5, ChaoSeadLV = 0.130825); + end Naphthalene; + + model Onemethylindene + extends General_Properties( + SN = 168, name = "Onemethylindene", CAS = "767-59-9", Tc = 703, Pc = 3460000, Vc = 0.436, Cc = 0.258, Tb = 471.65, Tm = 0, TT = 0, TP = 0, MW = 130.186, LVB = 0.134643, AF = 0.334861, SP = 19120, DM = 0, SH = -168070000.0, IGHF = 1.912E+08, GEF = 2.97E+08, AS = 354000, HFMP = 0, HOC = -5.28E+09, LiqDen = {105,0.61191,0.25938,703,0.29267,0}, VP = {101,86.18824,-8859.756,-9.212247,3.741568E-06,2}, LiqCp = {16,152820,-189.88,10.81,0.00256,-0.0000011085}, HOV = {106,8.0901E+07,1.9933,-4.5733,5.098,-2.0923}, VapCp = {16,-133130,-213.74,13.196,0.00017372,-4.8074E-08}, LiqVis = {0,0,0,0,0,0}, VapVis = {102,0.0000033072,0.32792,786.18,680.97,0}, LiqK = {16,-0.018671,-66.592,-0.99313,-0.0021306,2.0941E-07}, VapK = {102,0.000091267,1.0385,720.72,-19410,0}, Racketparam = 0.261176, UniquacR = 5.105471, UniquacQ = 3.424, ChaoSeadAF = 0.33569, ChaoSeadSP = 18312.4, ChaoSeadLV = 0.134207); + end Onemethylindene; + + model Twomethylindene + extends General_Properties( + SN = 169, name = "Twomethylindene", CAS = "2177-47-1", Tc = 711, Pc = 3460000, Vc = 0.436, Cc = 0.255, Tb = 479.45, Tm = 353.15, TT = 353.15, TP = 3020.69, MW = 130.186, LVB = 0.13407, AF = 0.350814, SP = 19650, DM = 0, SH = -168070000.0, IGHF = 1.15E+08, GEF = 2.19E+08, AS = 361000, HFMP = 0, HOC = -5.21E+09, LiqDen = {105,0.58652,0.25339,711,0.28941,0}, VP = {101,92.273,-9299.2,-10.097,0.0000042786,2}, LiqCp = {16,156160,-200.07,10.512,0.0025015,-0.0000010635}, HOV = {106,7.303067E+07,0.433923,0.764504,-1.615634,0.843055}, VapCp = {16,-154380,-193.88,13.203,0.00019348,-5.2535E-08}, LiqVis = {0,0,0,0,0,0}, VapVis = {102,9.6835E-07,0.47111,397.83,9327.5,0}, LiqK = {16,0.057046,-181.52,-0.63312,-0.0038758,-8.2839E-07}, VapK = {102,0.00009568,1.0268,701.49,-31051,0}, Racketparam = 0.259776, UniquacR = 5.104812, UniquacQ = 3.552, ChaoSeadAF = 0.32769, ChaoSeadSP = 17790.3, ChaoSeadLV = 0.133656); + end Twomethylindene; + + model Dicyclopentadiene + extends General_Properties( + SN = 170, name = "Dicyclopentadiene", CAS = "77-73-6", Tc = 660, Pc = 3060000, Vc = 0.445, Cc = 0.248, Tb = 443, Tm = 305.15, TT = 305.15, TP = 566.19, MW = 132.202, LVB = 0.134736, AF = 0.288011, SP = 17800, DM = 0, SH = -168070000.0, IGHF = 1.961E+08, GEF = 3.75E+08, AS = 240000, HFMP = 2090000, HOC = -5.535E+09, LiqDen = {105,0.41899,0.20539,660,0.34053,0}, VP = {101,72.31496,-7292.827,-7.388294,3.746895E-06,2}, LiqCp = {16,83937,-392.22,13.886,-0.0031138,0.000003368}, HOV = {106,7.0543E+07,1.9867,-4.6545,5.1772,-2.0831}, VapCp = {16,38735,-535.99,13.553,-0.00031277,0.0000001075}, LiqVis = {101,-11.633,1272.8,0.067676,-1.2999E-07,2}, VapVis = {102,0.0000004337,0.561,232.6,-0.00081701,0}, LiqK = {16,0.029848,47.178,-2.5363,0.0023572,-0.0000058893}, VapK = {102,0.00025878,0.8604,51.14,244020,0}, Racketparam = 0, UniquacR = 5.8156, UniquacQ = 4.548, ChaoSeadAF = 0.285111, ChaoSeadSP = 17445.1, ChaoSeadLV = 0.138585); + end Dicyclopentadiene; + + model Nbutylbenzene + extends General_Properties( + SN = 171, name = "Nbutylbenzene", CAS = "104-51-8", Tc = 660.5, Pc = 2890000, Vc = 0.497, Cc = 0.262, Tb = 456.42, Tm = 185.3, TT = 185.3, TP = 0.000154386, MW = 134.221, LVB = 0.15678, AF = 0.393, SP = 17510, DM = 1.23E-30, SH = -168070000.0, IGHF = -1.314E+07, GEF = 1.454E+08, AS = 439490, HFMP = 1.122E+07, HOC = -5.5644E+09, LiqDen = {105,0.50648,0.25203,660.5,0.29203,0}, VP = {101,100.11,-9186.6,-11.379,0.0000058585,2}, LiqCp = {16,173590,115.14,7.4501,0.014631,-0.000011875}, HOV = {106,6.5698E+07,0.30842,0.67062,-1.1135,0.53276}, VapCp = {16,97423,-619.62,13.35,-0.000032816,-9.3502E-09}, LiqVis = {101,-18.829,1737.7,1.0385,0.0000015468,2}, VapVis = {102,3.4687E-07,0.59512,233.67,177.63,0}, LiqK = {16,0.081204,245.71,-5.5946,0.01322,-0.00002506}, VapK = {102,0.19225,-0.0011093,-156.74,1712400,0}, Racketparam = 0, UniquacR = 5.946, UniquacQ = 4.588, ChaoSeadAF = 0.3923, ChaoSeadSP = 17450.9, ChaoSeadLV = 0.156494); + end Nbutylbenzene; + + model Nbutylcyclohexane + extends General_Properties( + SN = 172, name = "Nbutylcyclohexane", CAS = "1678-93-9", Tc = 667, Pc = 2570000, Vc = 0.534, Cc = 0.247, Tb = 454.131, Tm = 198.42, TT = 198.42, TP = 0.00365804, MW = 140.266, LVB = 0.176266, AF = 0.274326, SP = 16400, DM = 0, SH = -168070000.0, IGHF = -2.1317E+08, GEF = 5.654E+07, AS = 458480, HFMP = 1.416E+07, HOC = -6.0902E+09, LiqDen = {105,0.49786,0.26572,667,0.30254,0}, VP = {101,82.702,-8417.7,-8.6968,0.0000027713,2}, LiqCp = {16,117850,44.861,10.356,0.0053947,-0.0000020204}, HOV = {106,7.7656E+07,1.637,-3.3269,3.6698,-1.48}, VapCp = {16,145450,-890.37,14.241,-0.0007098,2.1101E-07}, LiqVis = {101,-66.15115,3536.438,8.46644,-7.612217E-06,2}, VapVis = {102,5.6992E-07,0.52089,326.29,-3328.7,0}, LiqK = {16,-0.040753,3.9448,-1.6588,-0.00045987,-0.0000010215}, VapK = {102,0.000063509,1.1032,470.22,42922,0}, Racketparam = 0, UniquacR = 6.7432, UniquacQ = 5.396, ChaoSeadAF = 0.3618, ChaoSeadSP = 16411.2, ChaoSeadLV = 0.176266); + end Nbutylcyclohexane; + + model Ndecane + extends General_Properties( + SN = 173, name = "Ndecane", CAS = "124-18-5", Tc = 617.7, Pc = 2110000, Vc = 0.624, Cc = 0.256, Tb = 447.3, Tm = 243.51, TT = 243.51, TP = 1.39297, MW = 142.285, LVB = 0.19595, AF = 0.491, SP = 15720, DM = 0, SH = -168070000.0, IGHF = -2.4946E+08, GEF = 3.318E+07, AS = 545700, HFMP = 2.871E+07, HOC = -6.29422E+09, LiqDen = {105,0.37424,0.2405,617.7,0.27182,0}, VP = {101,6.023802,-5713.196,3.410225,-0.000012633,2}, LiqCp = {16,160660,291.43,8.5687,0.0098408,-0.0000060811}, HOV = {106,5.7689E+07,-1.1412,5.1463,-6.2946,2.6623}, VapCp = {16,152020,-697.29,13.714,-0.00021747,4.9426E-08}, LiqVis = {101,-102.98,4517.9,14.495,-0.00002056,2}, VapVis = {102,2.3638E-08,0.95886,24.698,7541.9,0}, LiqK = {16,0.071684,-217.03,-0.47424,-0.0039028,-0.0000049442}, VapK = {102,-668.49,0.93224,-4.0687E+09,-1.0176E+09,0}, Racketparam = 0.2503, UniquacR = 7.2, UniquacQ = 6.02, ChaoSeadAF = 0.4869, ChaoSeadSP = 15791.26, ChaoSeadLV = 0.196); + end Ndecane; + + model Onemethylnaphthalene + extends General_Properties( + SN = 174, name = "Onemethylnaphthalene", CAS = "90-12-0", Tc = 772, Pc = 3600000, Vc = 0.462, Cc = 0.259, Tb = 517.84, Tm = 242.67, TT = 242.67, TP = 0.043382, MW = 142.2, LVB = 0.13937, AF = 0.348, SP = 19890, DM = 1.7E-30, SH = -168070000.0, IGHF = 1.169E+08, GEF = 2.179E+08, AS = 377400, HFMP = 6945000, HOC = -5.5958E+09, LiqDen = {105,0.59739,0.26468,772,0.2918,0}, VP = {101,73.89852,-9115.529,-7.252019,2.094885E-06,2}, LiqCp = {16,134210,116.27,8.3119,0.012175,-0.000010378}, HOV = {106,7.0001E+07,0.3382,0.060354,-0.021035,-0.0086978}, VapCp = {16,67134,-530.75,13.222,-0.000033319,-3.2916E-09}, LiqVis = {101,8.170859,1169.912,-3.261889,6.874562E-06,2}, VapVis = {102,2.4606E-07,0.6456,239.2,-8656.8,0}, LiqK = {16,-0.049867,2.2749,-1.45,-0.00045282,-7.0729E-07}, VapK = {102,1.5229,-0.35024,-1389.7,2465100,0}, Racketparam = 0, UniquacR = 5.610415, UniquacQ = 3.936, ChaoSeadAF = 0.3337, ChaoSeadSP = 20129.2, ChaoSeadLV = 0.1398); + end Onemethylnaphthalene; + + model Twomethylnaphthalene + extends General_Properties( + SN = 175, name = "Twomethylnaphthalene", CAS = "91-57-6", Tc = 761, Pc = 3540000, Vc = 0.462, Cc = 0.258, Tb = 514.2, Tm = 307.73, TT = 307.73, TP = 18.6897, MW = 142.2, LVB = 0.14577, AF = 0.374, SP = 19680, DM = 1.4E-30, SH = -168070000.0, IGHF = 1.161E+08, GEF = 2.163E+08, AS = 380000, HFMP = 1.212E+07, HOC = -5.58286E+09, LiqDen = {105,0.53405,0.25024,761.16,0.28587,0}, VP = {101,98.05854,-10275.56,-10.82814,3.919145E-06,2}, LiqCp = {16,74335,-307.25,13.46,-0.0028051,0.000003645}, HOV = {106,9.0724E+07,1.2004,-1.1581,0.47852,-0.081108}, VapCp = {16,69292,-534.4,13.21,-0.00001663,-8.8386E-09}, LiqVis = {101,-88.346,4977.8,11.629,-0.0000078261,2}, VapVis = {102,0.0000029847,0.34183,891.22,-28677,0}, LiqK = {16,0.0084839,-307.37,0.18174,-0.0046509,0.0000016652}, VapK = {102,0.000098384,1.0234,722.6,42453,0}, Racketparam = 0, UniquacR = 5.610415, UniquacQ = 3.936, ChaoSeadAF = 0.3815, ChaoSeadSP = 19870.3, ChaoSeadLV = 0.143396); + end Twomethylnaphthalene; + + model Nundecane + extends General_Properties( + SN = 176, name = "Nundecane", CAS = "1120-21-4", Tc = 639, Pc = 1980000, Vc = 0.689, Cc = 0.257, Tb = 469.08, Tm = 247.571, TT = 247.571, TP = 0.408414, MW = 156.312, LVB = 0.21224, AF = 0.538, SP = 15880, DM = 0, SH = -168070000.0, IGHF = -2.7043E+08, GEF = 4.116E+07, AS = 584930, HFMP = 2.218E+07, HOC = -6.9036E+09, LiqDen = {105,0.36785,0.24938,639,0.28395,0}, VP = {101,128.8551,-11029.21,-15.54009,8.030888E-06,2}, LiqCp = {16,208030,521.1,6.1551,0.017086,-0.000013175}, HOV = {106,8.9735E+07,0.81788,0.31647,-1.4781,0.80673}, VapCp = {16,177700,-730.83,13.81,-0.00021088,5.7776E-08}, LiqVis = {101,-92.575,4408.9,12.698,-0.000015556,2}, VapVis = {102,2.9213E-08,0.9335,118.62,-4363.8,0}, LiqK = {16,0.015185,-212.29,-0.044539,-0.0049614,0.0000013629}, VapK = {102,0.037608,0.6852,33443,9124600,0}, Racketparam = 0.243351, UniquacR = 7.871799, UniquacQ = 6.556, ChaoSeadAF = 0.521, ChaoSeadSP = 15934.45, ChaoSeadLV = 0.2122); + end Nundecane; + + model Acenaphthene + extends General_Properties( + SN = 177, name = "Acenaphthene", CAS = "83-32-9", Tc = 803.15, Pc = 3100000, Vc = 0.553, Cc = 0.257, Tb = 550.54, Tm = 366.56, TT = 366.56, TP = 199.997, MW = 154.208, LVB = 0.149792, AF = 0.381147, SP = 19480, DM = 8.5E-31, SH = -168070000.0, IGHF = 1.55E+08, GEF = 2.602E+08, AS = 368900, HFMP = 2.1462E+07, HOC = -6.0014E+09, LiqDen = {105,0.39942,0.22066,803.15,0.24043,0}, VP = {101,73.737,-9735.5,-7.1321,0.0000016079,2}, LiqCp = {16,173930,379.65,5.6292,0.017939,-0.000013551}, HOV = {106,3.785978E+08,10.14483,-25.41937,26.03775,-9.982155}, VapCp = {16,60762,-515.4,13.307,-0.000026823,-1.013E-08}, LiqVis = {101,-8.2073,1373.2,-0.25871,-0.0000036859,2}, VapVis = {102,0.0000015547,0.4064,630.11,26.274,0}, LiqK = {16,0.059552,-91.592,-1.7169,-0.0019056,1.2951E-07}, VapK = {102,0.000078027,1.0286,593.39,37622,0}, Racketparam = 0.257114, UniquacR = 5.997356, UniquacQ = 3.96, ChaoSeadAF = 0.382, ChaoSeadSP = 19480.5, ChaoSeadLV = 0.149792); + end Acenaphthene; + + model Biphenyl + extends General_Properties( + SN = 178, name = "Biphenyl", CAS = "92-52-4", Tc = 789.26, Pc = 3847270, Vc = 0.491118, Cc = 0.294, Tb = 528.15, Tm = 342.35, TT = 342.372, TP = 84.2725, MW = 154.211, LVB = 0.155536, AF = 0.3643, SP = 19383, DM = 0, SH = -168070000.0, IGHF = 1.82088E+08, GEF = 2.80077E+08, AS = 392668, HFMP = 1.85769E+07, HOC = -6.0317E+09, LiqDen = {105,0.50803,0.25417,789.26,0.2795,0}, VP = {101,154.3401,-13555.42,-19.05582,8.30386E-06,2}, LiqCp = {16,24132,-12.395,11.585,0.0029407,-0.0000014331}, HOV = {106,8.680865E+07,0.473092,1.061004,-2.226343,1.156876}, VapCp = {16,79583,-635.84,13.574,-0.00034935,9.291E-08}, LiqVis = {101,-10.998,1574.4,-0.022671,-3.4058E-07,2}, VapVis = {102,1.7776E-07,0.70632,118.6,61798,0}, LiqK = {16,0.086277,-343.48,0.36261,-0.00791,0.0000032504}, VapK = {102,0.000031971,1.1528,215.14,115000,0}, Racketparam = 0, UniquacR = 6.0434, UniquacQ = 4.24, ChaoSeadAF = 0.3643, ChaoSeadSP = 19383, ChaoSeadLV = 0.155536); + end Biphenyl; + + model Ndodecane + extends General_Properties( + SN = 179, name = "Ndodecane", CAS = "112-40-3", Tc = 658, Pc = 1820000, Vc = 0.754, Cc = 0.251, Tb = 489.48, Tm = 263.568, TT = 263.568, TP = 0.615203, MW = 170.338, LVB = 0.22859, AF = 0.571, SP = 15930, DM = 0, SH = -168070000.0, IGHF = -2.9072E+08, GEF = 4.981E+07, AS = 624150, HFMP = 3.684E+07, HOC = -7.51368E+09, LiqDen = {105,0.30334,0.23617,658,0.2706,0}, VP = {101,127.8877,-11582.12,-15.22541,6.680034E-06,2}, LiqCp = {16,203950,627.31,6.2796,0.014676,-0.0000079758}, HOV = {106,9.812979E+07,0.939672,-0.0412509,-0.949322,0.501567}, VapCp = {16,193680,-732.61,13.902,-0.00022284,6.2257E-08}, LiqVis = {101,-83.21108,4238.311,11.14639,-0.0000124656,2}, VapVis = {102,5.4481E-08,0.85223,245.71,-11928,0}, LiqK = {16,0.029364,-108.04,-0.7007,-0.0040791,6.1377E-07}, VapK = {102,0.0000055504,1.4726,558.15,3563.6,0}, Racketparam = 0.2466, UniquacR = 8.5462, UniquacQ = 7.096, ChaoSeadAF = 0.561, ChaoSeadSP = 16036.72, ChaoSeadLV = 0.2286); + end Ndodecane; + + model Fluorene + extends General_Properties( + SN = 180, name = "Fluorene", CAS = "86-73-7", Tc = 826, Pc = 3000000, Vc = 0.524, Cc = 0.229, Tb = 570.44, Tm = 387.94, TT = 387.94, TP = 281.665, MW = 166.219, LVB = 0.15327, AF = 0.404163, SP = 19820, DM = 8.3E-31, SH = -168070000.0, IGHF = 1.869E+08, GEF = 2.901E+08, AS = 381500, HFMP = 1.9578E+07, HOC = -6.4251E+09, LiqDen = {105,0.43683,0.229,826,0.28571,0}, VP = {101,141.8746,-13833.84,-17.04805,0.0000063782,2}, LiqCp = {16,172320,813.11,3.2969,0.023275,-0.000018014}, HOV = {106,9.581E+07,1.317,-1.4739,-0.0034969,0.61586}, VapCp = {16,57825,-560.42,13.575,-0.00027161,7.5804E-08}, LiqVis = {101,-33.053,2454.9,3.4575,-0.0000042581,2}, VapVis = {102,5.7084E-07,0.56204,373.69,-49.196,0}, LiqK = {16,-0.013258,-130.68,-0.68476,-0.0022566,3.0043E-07}, VapK = {102,0.00017437,0.9152,500.25,62613,0}, Racketparam = 0, UniquacR = 6.174687, UniquacQ = 4.076, ChaoSeadAF = 0.349259, ChaoSeadSP = 21645.7, ChaoSeadLV = 0.128237); + end Fluorene; + + model Ntridecane + extends General_Properties( + SN = 181, name = "Ntridecane", CAS = "629-50-5", Tc = 675, Pc = 1680000, Vc = 0.823, Cc = 0.246, Tb = 508.63, Tm = 267.76, TT = 267.76, TP = 0.250959, MW = 184.365, LVB = 0.24494, AF = 0.61, SP = 16060, DM = 0, SH = -168070000.0, IGHF = -3.1177E+08, GEF = 5.771E+07, AS = 663370, HFMP = 2.85E+07, HOC = -8.1229E+09, LiqDen = {105,0.29787,0.24164,675,0.29254,0}, VP = {101,143.3256,-12766.72,-17.45421,7.99709E-06,2}, LiqCp = {16,37167,123.48,11.52,0.0033147,-0.0000011194}, HOV = {106,9.732822E+07,0.667983,0.462399,-1.329972,0.649193}, VapCp = {16,191240,-657.52,13.861,-0.00011498,3.3409E-08}, LiqVis = {101,-81.45907,4309.552,10.81921,-0.000011395,2}, VapVis = {102,3.0146E-08,0.91936,136.12,2279.8,0}, LiqK = {16,0.037294,-193.16,-0.1108,-0.0058295,0.0000022551}, VapK = {102,0.0000050471,1.4806,553.99,7554.4,0}, Racketparam = 0.2465, UniquacR = 9.2206, UniquacQ = 7.636, ChaoSeadAF = 0.6002, ChaoSeadSP = 16139, ChaoSeadLV = 0.2449); + end Ntridecane; + + model Phenanthrene + extends General_Properties( + SN = 182, name = "Phenanthrene", CAS = "85-01-8", Tc = 869, Pc = 2900000, Vc = 0.554, Cc = 0.222, Tb = 610.03, Tm = 372.38, TT = 372.38, TP = 29.2781, MW = 178.229, LVB = 0.167077, AF = 0.470716, SP = 19910, DM = 0, SH = -168070000.0, IGHF = 2.012E+08, GEF = 3.0219E+08, AS = 394500, HFMP = 1.6463E+07, HOC = -6.8282E+09, LiqDen = {105,0.4558,0.25237,869,0.24848,0}, VP = {101,275.0593,-20918.1,-36.87097,0.0000193212,2}, LiqCp = {16,115950,-43.82,10.979,0.0042773,-0.0000023928}, HOV = {106,9.2455E+07,0.28979,1.1393,-1.9946,0.92537}, VapCp = {16,66200,-509.49,13.435,-0.000075274,6.0366E-09}, LiqVis = {101,-22.439,2565.4,1.5699,3.8655E-09,2}, VapVis = {102,0.0000004717,0.52643,268.46,10947,0}, LiqK = {16,0.11683,-580.68,-0.62222,-0.006256,4.1638E-07}, VapK = {102,0.000092871,0.99317,671.87,29972,0}, Racketparam = 0.249255, UniquacR = 6.562953, UniquacQ = 4.336, ChaoSeadAF = 0.54, ChaoSeadSP = 20142.5, ChaoSeadLV = 0.167078); + end Phenanthrene; + + model Ntetradecane + extends General_Properties( + SN = 183, name = "Ntetradecane", CAS = "629-59-4", Tc = 693, Pc = 1570000, Vc = 0.894, Cc = 0.244, Tb = 526.76, Tm = 279.01, TT = 279.01, TP = 0.252685, MW = 198.392, LVB = 0.26132, AF = 0.644, SP = 16140, DM = 0, SH = -168070000.0, IGHF = -3.3244E+08, GEF = 6.599E+07, AS = 702590, HFMP = 4.507E+07, HOC = -8.73282E+09, LiqDen = {105,0.26297,0.23695,693,0.26861,0}, VP = {101,141.7696,-13265.67,-17.07041,6.905252E-06,2}, LiqCp = {16,84257,110.32,11.507,0.0033723,-0.0000011739}, HOV = {106,1.216371E+08,1.28014,-0.352636,-1.241735,0.826459}, VapCp = {16,204940,-657.01,13.943,-0.00013248,4.0902E-08}, LiqVis = {101,-84.61448,4567.43,11.25434,-0.0000111579,2}, VapVis = {102,3.4874E-09,1.2039,-69.467,11809,0}, LiqK = {16,0.039135,-208.63,-0.066493,-0.005844,0.0000021711}, VapK = {102,-122.4,0.86814,-5.5021E+08,-2.1347E+10,0}, Racketparam = 0.234049, UniquacR = 9.895, UniquacQ = 8.176001, ChaoSeadAF = 0.6399, ChaoSeadSP = 16200.36, ChaoSeadLV = 0.2613); + end Ntetradecane; + + model Npentadecane + extends General_Properties( + SN = 184, name = "Npentadecane", CAS = "629-62-9", Tc = 708, Pc = 1480000, Vc = 0.966, Cc = 0.243, Tb = 543.83, Tm = 283.072, TT = 283.072, TP = 0.128872, MW = 212.419, LVB = 0.27771, AF = 0.685, SP = 16210, DM = 0, SH = -168070000.0, IGHF = -3.5311E+08, GEF = 7.426E+07, AS = 741810, HFMP = 3.459E+07, HOC = -9.34237E+09, LiqDen = {105,0.26611,0.24483,708,0.29579,0}, VP = {101,105.7905,-12176.19,-11.51031,2.157424E-06,2}, LiqCp = {16,44888,73.977,11.979,0.0027483,-9.4622E-07}, HOV = {106,1.334182E+08,1.382258,-0.345375,-1.508041,0.995233}, VapCp = {16,218790,-655.87,14.013,-0.00013811,4.3573E-08}, LiqVis = {101,-91.37005,4965.801,12.24551,-0.0000115231,2}, VapVis = {102,3.2252E-08,0.90575,168.22,3233.4,0}, LiqK = {16,0.010742,-152.75,-0.43594,-0.0040245,0.0000012373}, VapK = {102,0.0000047787,1.4851,642.9,182.7,0}, Racketparam = 0.245, UniquacR = 10.5694, UniquacQ = 8.716001, ChaoSeadAF = 0.6743, ChaoSeadSP = 16282.18, ChaoSeadLV = 0.2778); + end Npentadecane; + + model Fluoranthene + extends General_Properties( + SN = 185, name = "Fluoranthene", CAS = "206-44-0", Tc = 905, Pc = 2610000, Vc = 0.655, Cc = 0.227, Tb = 655.95, Tm = 383.33, TT = 383.33, TP = 15.7016, MW = 202.251, LVB = 0.184362, AF = 0.587526, SP = 19290, DM = 7.6E-31, SH = -168070000.0, IGHF = 2.889E+08, GEF = 3.862E+08, AS = 418500, HFMP = 1.873E+07, HOC = -7.695E+09, LiqDen = {105,0.34656,0.22699,905,0.28508,0}, VP = {101,96.11781,-12362.08,-10.3511,0.0000032319,2}, LiqCp = {16,241580,1296.9,0.78013,0.023496,-0.000011773}, HOV = {106,1.442678E+08,2.403711,-3.376173,1.404001,0.0327511}, VapCp = {16,59938,-461.32,13.513,-0.00005781,-5.6701E-09}, LiqVis = {101,-68.502,5208.9,8.4007,-0.0000042979,2}, VapVis = {102,0.0000010875,0.41309,444.51,-25.424,0}, LiqK = {16,-0.045864,-83.397,-0.96049,-0.0013219,-5.1355E-10}, VapK = {102,0.00011776,0.94788,660.84,38292,0}, Racketparam = 0.239005, UniquacR = 7.187871, UniquacQ = 4.504, ChaoSeadAF = 0.5, ChaoSeadSP = 19277.2, ChaoSeadLV = 0.184693); + end Fluoranthene; + + model Pyrene + extends General_Properties( + SN = 186, name = "Pyrene", CAS = "129-00-0", Tc = 936, Pc = 2610000, Vc = 0.66, Cc = 0.221, Tb = 667.95, Tm = 423.81, TT = 423.81, TP = 70.0313, MW = 202.251, LVB = 0.184923, AF = 0.507416, SP = 19670, DM = 0, SH = -168070000.0, IGHF = 2.25E+08, GEF = 3.272E+08, AS = 402000, HFMP = 1.736E+07, HOC = -7.63094E+09, LiqDen = {105,0.54272,0.27165,936,0.41522,0}, VP = {101,68.91405,-11628.85,-6.184331,6.420723E-07,2}, LiqCp = {16,149400,-94.468,11.128,0.0038746,-0.0000019128}, HOV = {106,9.198843E+07,-0.224752,1.989996,-2.139885,0.666532}, VapCp = {16,117680,-754.3,14.068,-0.00069165,2.0484E-07}, LiqVis = {101,-131.9,8597.1,17.746,-0.000010523,2}, VapVis = {102,4.4284E-07,0.52754,289.9,15025,0}, LiqK = {16,0.10165,-731.42,0.75712,-0.0079846,0.0000028317}, VapK = {102,0.000092503,0.97453,647.35,45503,0}, Racketparam = 0.246034, UniquacR = 7.187871, UniquacQ = 4.504, ChaoSeadAF = 0.344, ChaoSeadSP = 20762.5, ChaoSeadLV = 0.17368); + end Pyrene; + + model Onephenylnaphthalene + extends General_Properties( + SN = 187, name = "Onephenylnaphthalene", CAS = "605-02-7", Tc = 849, Pc = 2630000, Vc = 0.656, Cc = 0.244, Tb = 607.15, Tm = 318.15, TT = 318.15, TP = 0.282425, MW = 204.266, LVB = 0.189925, AF = 0.530878, SP = 19910, DM = 0, SH = -168070000.0, IGHF = 2.47E+08, GEF = 3.71108E+08, AS = 459000, HFMP = 0, HOC = -7.92E+09, LiqDen = {105,0.36822,0.24155,849,0.29048,0}, VP = {101,136.2471,-14614.66,-16.02104,5.425361E-06,2}, LiqCp = {16,180260,-2.5213,10.037,0.0072742,-0.0000049656}, HOV = {106,1.0967E+08,1.3201,-2.3901,2.4598,-0.96728}, VapCp = {16,77509,-521.03,13.602,-0.000094316,9.2363E-09}, LiqVis = {101,-6.144,1205.6,-0.56682,-0.0000005706,2}, VapVis = {102,0.0000030793,0.30949,742.15,16342,0}, LiqK = {16,-0.052282,-21.251,-1.3126,-0.00073663,-3.6032E-07}, VapK = {102,0.000092251,0.99676,619.05,42835,0}, Racketparam = 0, UniquacR = 7.679631, UniquacQ = 5.184, ChaoSeadAF = 0.530878, ChaoSeadSP = 19911.7, ChaoSeadLV = 0.189925); + end Onephenylnaphthalene; + + model Nhexadecane + extends General_Properties( + SN = 188, name = "Nhexadecane", CAS = "544-76-3", Tc = 723, Pc = 1400000, Vc = 1.034, Cc = 0.241, Tb = 559.98, Tm = 291.308, TT = 291.308, TP = 0.0922432, MW = 226.446, LVB = 0.29411, AF = 0.726, SP = 16190, DM = 0, SH = -168070000.0, IGHF = -3.7417E+08, GEF = 8.216E+07, AS = 781020, HFMP = 5.3358E+07, HOC = -9.95145E+09, LiqDen = {105,0.23237,0.23642,723,0.28403,0}, VP = {101,138.0173,-14151.1,-16.24379,5.027608E-06,2}, LiqCp = {16,387360,-123.61,10.738,0.005,-0.0000019617}, HOV = {106,1.2775E+08,0.92612,0.52583,-2.1415,1.2039}, VapCp = {16,232700,-655.34,14.079,-0.0001451,4.6597E-08}, LiqVis = {101,-84.70059,4841.907,11.15158,-9.617336E-06,2}, VapVis = {102,1.3203E-07,0.72722,424.3,4562.7,0}, LiqK = {16,0.006807,-152.97,-0.44096,-0.0038892,0.0000012245}, VapK = {102,0.0000035961,1.5118,510.88,23814,0}, Racketparam = 0.226854, UniquacR = 11.24, UniquacQ = 9.26, ChaoSeadAF = 0.7078, ChaoSeadSP = 16343.54, ChaoSeadLV = 0.2941); + end Nhexadecane; + + model Chrysene + extends General_Properties( + SN = 189, name = "Chrysene", CAS = "218-01-9", Tc = 979, Pc = 2390000, Vc = 0.749, Cc = 0.22, Tb = 714.15, Tm = 531.15, TT = 531.15, TP = 1028.09, MW = 228.288, LVB = 0.223221, AF = 0.603008, SP = 18920, DM = 2.33E-30, SH = -168070000.0, IGHF = 2.698E+08, GEF = 4.03E+08, AS = 440000, HFMP = 2.62E+07, HOC = -8.6796E+09, LiqDen = {105,0.30846,0.21991,979,0.32162,0}, VP = {101,171.0845,-19845.5,-20.41887,4.689312E-06,2}, LiqCp = {16,314190,239.97,9.0147,0.0068894,-0.0000035685}, HOV = {106,1.2779E+08,0.96651,-1.3609,1.2985,-0.49651}, VapCp = {16,124010,-668.94,14.001,-0.0004632,1.3177E-07}, LiqVis = {101,-12.612,2823.3,-0.058693,2.8981E-08,2}, VapVis = {102,3.4146E-07,0.54263,230.08,-3.8758,0}, LiqK = {16,0.032525,-322.45,-0.056163,-0.0034819,4.4935E-07}, VapK = {102,0.0001111,0.947,689.64,45041,0}, Racketparam = 0.237646, UniquacR = 8.250494, UniquacQ = 5.304, ChaoSeadAF = 0.603954, ChaoSeadSP = 19486.9, ChaoSeadLV = 0.210334); + end Chrysene; + + model Cisdecahydronaphthalene + extends General_Properties( + SN = 190, name = "Cisdecahydronaphthalene", CAS = "493-01-6", Tc = 702.25, Pc = 3242400, Vc = 0.48, Cc = 0.267, Tb = 468.965, Tm = 230.17, TT = 230.2, TP = 0.157166, MW = 138.253, LVB = 0.154615, AF = 0.294204, SP = 17625.3, DM = 0, SH = -168070000.0, IGHF = -1.6924E+08, GEF = 8.552E+07, AS = 377730, HFMP = 9489000, HOC = -5.89213E+09, LiqDen = {105,0.5563,0.26613,702.25,0.2872,0}, VP = {101,133.51,-10671,-16.446,0.0000090618,2}, LiqCp = {16,22875,183.22,9.7191,0.0080113,-0.0000053261}, HOV = {106,7.893812E+07,1.120046,-0.590284,-0.648808,0.601197}, VapCp = {16,90923,-788.66,14.021,-0.00046171,0.0000001235}, LiqVis = {101,-102.87,5387.9,14.086,-0.000014127,2}, VapVis = {102,7.2745E-07,0.51364,404.18,49.274,0}, LiqK = {16,0.087597,-101,-1.0253,-0.0090174,0.0000045064}, VapK = {102,0.0000017593,1.7742,317.62,37605,0}, Racketparam = 0.264744, UniquacR = 6.289, UniquacQ = 4.776, ChaoSeadAF = 0.294204, ChaoSeadSP = 17625.3, ChaoSeadLV = 0.154615); + end Cisdecahydronaphthalene; + + model Transdecahydronaphthalene + extends General_Properties( + SN = 191, name = "Transdecahydronaphthalene", CAS = "493-02-7", Tc = 687.05, Pc = 2837100, Vc = 0.48, Cc = 0.238, Tb = 460.46, Tm = 242.77, TT = 242.79, TP = 1.14983, MW = 138.253, LVB = 0.159325, AF = 0.253611, SP = 17042.7, DM = 0, SH = -168070000.0, IGHF = -1.8217E+08, GEF = 7.355E+07, AS = 374550, HFMP = 1.441E+07, HOC = -5.88088E+09, LiqDen = {105,0.5599,0.26991,687.05,0.2952,0}, VP = {101,112.0059,-9619.314,-13.21808,6.974439E-06,2}, LiqCp = {16,110470,-81.629,10.313,0.0068781,-0.0000045952}, HOV = {106,7.646155E+07,0.918445,0.395142,-2.202434,1.398354}, VapCp = {16,81351,-707.34,13.793,-0.00018944,2.0365E-08}, LiqVis = {101,-47.21,3037.9,5.4682,-0.0000042842,2}, VapVis = {102,2.7061E-07,0.60485,153.09,81.09,0}, LiqK = {16,0.087771,45.415,-2.1613,-0.0061939,0.0000022159}, VapK = {102,-13.928,0.65448,-2837300,-2.043E+09,0}, Racketparam = 0.268306, UniquacR = 6.289, UniquacQ = 4.776, ChaoSeadAF = 0.253611, ChaoSeadSP = 17042.7, ChaoSeadLV = 0.159325); + end Transdecahydronaphthalene; + + model Methyltertbutylether + extends General_Properties( + SN = 192, name = "Methyltertbutylether", CAS = "1634-04-4", Tc = 497.1, Pc = 3430000, Vc = 0.329, Cc = 0.273, Tb = 328.35, Tm = 164.55, TT = 164.55, TP = 0.535656, MW = 88.1482, LVB = 0.119887, AF = 0.266059, SP = 15070, DM = 4.54E-30, SH = -168070000.0, IGHF = -2.835E+08, GEF = -1.175E+08, AS = 357800, HFMP = 7600000, HOC = -3.1049E+09, LiqDen = {105,1.013,0.29119,513.95,0.39929,0}, VP = {101,63.31041,-5322.676,-6.212745,3.951136E-06,2}, LiqCp = {16,135550,-54.229,8.6558,0.010329,-0.0000078206}, HOV = {106,7.685222E+07,4.561833,-12.06881,13.61234,-5.569118}, VapCp = {16,89729,-682.14,12.912,0.000021441,-2.0192E-08}, LiqVis = {101,-7.136,821.59,-0.64419,4.8322E-07,2}, VapVis = {102,1.6185E-07,0.73614,130.03,-727.78,0}, LiqK = {16,0.073008,306.73,-6.3111,0.019235,-0.000037933}, VapK = {102,0.00023034,0.92128,391.6,80274,0}, Racketparam = 0.267213, UniquacR = 4.0678, UniquacQ = 3.632, ChaoSeadAF = 0.266059, ChaoSeadSP = 15070, ChaoSeadLV = 0.119887); + end Methyltertbutylether; + + model Methyltertpentylether + extends General_Properties( + SN = 193, name = "Methyltertpentylether", CAS = "994-05-8", Tc = 534, Pc = 3040000, Vc = 0.386, Cc = 0.264, Tb = 359.51, Tm = 0, TT = 0, TP = 0, MW = 102.175, LVB = 0.133437, AF = 0.298071, SP = 15480, DM = 4.90339E-30, SH = -168070000.0, IGHF = -3.054E+08, GEF = -1.137E+08, AS = 408000, HFMP = 0, HOC = -3.71229E+09, LiqDen = {105,0.68843,0.26574,534,0.27067,0}, VP = {101,127.09,-8433.7,-15.94,0.000013112,2}, LiqCp = {16,96936,-844.6,17.426,-0.01423,0.000014683}, HOV = {106,6.112039E+07,2.144847,-4.987322,5.569725,-2.294462}, VapCp = {16,86134,-503.3,12.828,0.00026316,-9.3404E-08}, LiqVis = {101,-11.271,991.37,-0.019082,-2.1664E-08,2}, VapVis = {102,6.9893E-08,0.83491,61.227,-3034.8,0}, LiqK = {16,-0.10613,12.391,-1.3082,-0.00026248,-0.0000013654}, VapK = {102,0.12493,0.14978,1706.4,1349200,0}, Racketparam = 0.264404, UniquacR = 4.7422, UniquacQ = 4.172, ChaoSeadAF = 0.298071, ChaoSeadSP = 15480, ChaoSeadLV = 0.133437); + end Methyltertpentylether; + + model TwomethylTwobutanol + extends General_Properties( + SN = 194, name = "TwomethylTwobutanol", CAS = "75-85-4", Tc = 545, Pc = 3790000, Vc = 0.323, Cc = 0.27, Tb = 375.15, Tm = 264.35, TT = 264.35, TP = 161.196, MW = 88.15, LVB = 0.1095, AF = 0.478, SP = 20840, DM = 5.67E-30, SH = -168070000.0, IGHF = -3.297E+08, GEF = -1.652E+08, AS = 362800, HFMP = 4456000, HOC = -3.0391E+09, LiqDen = {105,0.71131,0.24603,545,0.25077,0}, VP = {101,111.96,-9620.4,-12.673,0.0000022964,2}, LiqCp = {16,145240,-80.948,10.283,0.0042992,0.0000021924}, HOV = {106,1.022286E+08,1.245977,-0.515176,-0.350588,0.262112}, VapCp = {16,74328,-529.61,12.79,0.000073612,-9.0525E-09}, LiqVis = {101,-783.84,31606,120.39,-0.00015466,2}, VapVis = {102,1.8945E-07,0.71394,173.97,-1855.4,0}, LiqK = {16,0.052544,-120.78,-0.20746,-0.0081579,0.0000039201}, VapK = {102,1156.2,0.93842,5.9829E+09,-1.5337E+11,0}, Racketparam = 0.248616, UniquacR = 4.5972, UniquacQ = 4.284, ChaoSeadAF = 0.478, ChaoSeadSP = 20840, ChaoSeadLV = 0.1095); + end TwomethylTwobutanol; + + model Nitrogentrioxide + extends General_Properties( + SN = 195, name = "Nitrogentrioxide", CAS = "10544-73-7", Tc = 451, Pc = 6990000, Vc = 0.195, Cc = 0.386, Tb = 276.65, Tm = 171.15, TT = 172.45, TP = 15.1767, MW = 76.0116, LVB = 0.0531885, AF = 0.431227, SP = 32600, DM = 7.078E-30, SH = 82843000.0, IGHF = 8.2843E+07, GEF = 1.39727E+08, AS = 308450, HFMP = 0, HOC = -8.2843E+07, LiqDen = {105,2.7664,0.37489,451,0.040027,0}, VP = {101,137.96,-7584.5,-17.9,0.000022014,2}, LiqCp = {0,0,0,0,0,0}, HOV = {106,6.1243E+07,0.17457,-0.20195,-0.16172,0.24757}, VapCp = {16,37365,-232.94,10.977,0.00031169,-1.1931E-07}, LiqVis = {0,0,0,0,0,0}, VapVis = {0,0,0,0,0,0}, LiqK = {16,0,0,0,0,0}, VapK = {0,0,0,0,0,0}, Racketparam = 0.386, UniquacR = 1.738827, UniquacQ = 1.7628, ChaoSeadAF = 0.431227, ChaoSeadSP = 32600, ChaoSeadLV = 0.0531885); + end Nitrogentrioxide; + + model Nitrogentetroxide + extends General_Properties( + SN = 196, name = "Nitrogentetroxide", CAS = "10544-72-6", Tc = 431.15, Pc = 1.00312E+07, Vc = 0.08249, Cc = 0.233, Tb = 294.3, Tm = 263.01, TT = 261.9, TP = 18558.7, MW = 92.011, LVB = 0.06407, AF = 0.853274, SP = 24123.32, DM = 0, SH = 9162960.0, IGHF = 9162960, GEF = 9.785E+07, AS = 304320, HFMP = 1.465E+07, HOC = 1983170, LiqDen = {105,2.117,0.32671,431.15,0.20832,0}, VP = {101,72.419,-5432,-7.7259,0.00001711,2}, LiqCp = {16,112080,15.081,5.5387,0.025083,-0.000030338}, HOV = {106,3.0678E+07,0.17744,-0.16521,-0.11792,0.13193}, VapCp = {16,39950.82,-260.1236,11.41281,0.000224817,-1.049284E-07}, LiqVis = {101,-340.1,10957,53.641,-0.00011365,2}, VapVis = {102,0.0000080298,0.2905,212.56,117290,0}, LiqK = {16,0.11499,26916,-297.75,1.089,-0.0013592}, VapK = {102,0.000019664,1.1277,265.48,-210280,0}, Racketparam = 0.233, UniquacR = 1.982861, UniquacQ = 1.984, ChaoSeadAF = 0.853274, ChaoSeadSP = 24123.32, ChaoSeadLV = 0.06407); + end Nitrogentetroxide; + + model HeliumFour + extends General_Properties( + SN = 197, name = "HeliumFour", CAS = "7440-59-7", Tc = 5.19, Pc = 227000, Vc = 0.0573, Cc = 0.301, Tb = 4.3, Tm = 1.763, TT = 1.763, TP = 1478.21, MW = 4.003, LVB = 0.03254, AF = -0.39, SP = 1222, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 126044, HFMP = 50000, HOC = 0, LiqDen = {105,0.31844,0.089499,5.21,0.063807,0}, VP = {101,8.8804,-4.8932,2.5648,0.0062779,2}, LiqCp = {16,-72432,14.864,0.90909,1.9106,-0.057997}, HOV = {106,191120,4.6881,-12.652,12.947,-4.5859}, VapCp = {1,20786,0,0,0,0}, LiqVis = {101,-21.436,10.949,5.7389,-0.11646,2}, VapVis = {102,3.3098E-07,0.71183,-10.485,126.3,0}, LiqK = {16,-0.19278,-0.8853,-0.83633,-0.19115,0.016867}, VapK = {102,0.00226,0.7305,-18.63,440,0}, Racketparam = 0.301, UniquacR = 0.456163, UniquacQ = 0.592, ChaoSeadAF = -0.39, ChaoSeadSP = 1222, ChaoSeadLV = 0.03254); + end HeliumFour; + + model Fluorine + extends General_Properties( + SN = 198, name = "Fluorine", CAS = "7782-41-4", Tc = 144.3, Pc = 5215000, Vc = 0.0662, Cc = 0.288, Tb = 84.95, Tm = 53.53, TT = 53.48, TP = 252, MW = 37.997, LVB = 0.02516, AF = 0.051, SP = 15210, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 202690, HFMP = 510360, HOC = 0, LiqDen = {105,2.7003,0.23171,144.42,0.21541,0}, VP = {101,19.18299,-840.6862,0.560464,-0.0000352006,2}, LiqCp = {16,56031,-8382.1,267.49,-2.7228,0.0096889}, HOV = {106,2.7497E+07,7.2112,-17.699,17.895,-6.7781}, VapCp = {16,29021.05,-721.5995,10.44015,-0.00105401,3.331903E-07}, LiqVis = {101,9.2895,-86.903,-3.7445,0.0000058477,2}, VapVis = {102,7.0875E-07,0.64956,73.747,-637.02,0}, LiqK = {16,-0.15422,9.0003,-1.0608,-0.0018487,-0.00001682}, VapK = {102,0.00012664,0.93229,1.6645,205.53,0}, Racketparam = 0.288, UniquacR = 0.75, UniquacQ = 0.88, ChaoSeadAF = 0.051, ChaoSeadSP = 15210, ChaoSeadLV = 0.02516); + end Fluorine; + + model Krypton + extends General_Properties( + SN = 199, name = "Krypton", CAS = "7439-90-9", Tc = 209.4, Pc = 5500000, Vc = 0.0912, Cc = 0.288, Tb = 119.74, Tm = 115.77, TT = 115.78, TP = 73149.9, MW = 83.8, LVB = 0.03463, AF = 0.005, SP = 15280, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 163975, HFMP = 1640130, HOC = 0, LiqDen = {105,2.5742,0.26395,209.4,0.25018,0}, VP = {101,48.208,-1609,-4.9593,0.0000342,2}, LiqCp = {16,36193,105.13,3.9876,0.048456,-0.0001134}, HOV = {106,1.7515E+07,2.6595,-6.0031,6.068,-2.2776}, VapCp = {16,20754,0,0,0,0}, LiqVis = {101,-7.7422,-0.3975,-0.00054036,-9.2221E-08,2}, VapVis = {102,0.0000018282,0.5384,165.83,-1432.5,0}, LiqK = {16,-0.22624,-10.133,-0.77044,-0.0023081,-0.0000013009}, VapK = {102,0.00075369,0.52925,198.58,-4150.2,0}, Racketparam = 0.288, UniquacR = 1.12, UniquacQ = 1.12, ChaoSeadAF = 0.005, ChaoSeadSP = 15280, ChaoSeadLV = 0.03463); + end Krypton; + + model Xenon + extends General_Properties( + SN = 200, name = "Xenon", CAS = "7440-63-3", Tc = 289.74, Pc = 5840000, Vc = 0.118, Cc = 0.286, Tb = 165.01, Tm = 161.25, TT = 161.25, TP = 81667.9, MW = 131.29, LVB = 0.04291, AF = 0.006, SP = 15910, DM = 0, SH = 0.0, IGHF = 0, GEF = 0, AS = 169578, HFMP = 2294950, HOC = 0, LiqDen = {105,2.4063,0.28552,289.74,0.28967,0}, VP = {101,31.497,-1758.9,-1.8727,0.0000091652,2}, LiqCp = {16,44610,-221,1.0811,0.026515,-0.000013257}, HOV = {106,1.740633E+07,-0.233725,3.148357,-4.995262,2.477111}, VapCp = {16,20786,0,0,0,0}, LiqVis = {101,-7.7421,-0.53776,-0.00050184,-5.2934E-08,2}, VapVis = {102,0.0000014055,0.57778,188.46,-312.26,0}, LiqK = {16,-0.012175,143.58,-4.2655,0.011041,-0.000032937}, VapK = {102,0.00026719,0.62046,215.6,-8144.4,0}, Racketparam = 0.286, UniquacR = 1.13, UniquacQ = 1.13, ChaoSeadAF = 0.006, ChaoSeadSP = 15910, ChaoSeadLV = 0.04291); + end Xenon; + + model Ozone + extends General_Properties( + SN = 201, name = "Ozone", CAS = "10028-15-6", Tc = 261.05, Pc = 5570000, Vc = 0.0894, Cc = 0.229, Tb = 161.8, Tm = 22.1499, TT = 80.15, TP = 0.734621, MW = 47.998, LVB = 0.0354, AF = 0.224, SP = 18740, DM = 1.8E-30, SH = 143100000.0, IGHF = 1.431E+08, GEF = 1.63164E+08, AS = 238823, HFMP = 2000000, HOC = -1.42671E+08, LiqDen = {105,2.6432,0.26544,261.05,0.25239,0}, VP = {101,33.80011,-2066.264,-1.865143,3.696996E-08,2}, LiqCp = {16,64500,-60.205,9.9787,0.0080434,-0.000010929}, HOV = {106,1.6254E+07,-0.073447,0.14823,0.62225,-0.43277}, VapCp = {16,32859.57,-604.7407,10.91207,-0.000287995,2.632407E-08}, LiqVis = {101,-37.036,815.78,4.8971,-0.000047646,2}, VapVis = {102,0.0000001896,0.78539,36.908,-2041.9,0}, LiqK = {16,0.23255,-678.09,-6.5705,-0.074977,0.00025391}, VapK = {102,0.0043907,0.47832,709.48,233.72,0}, Racketparam = 0.229, UniquacR = 1.1, UniquacQ = 1.27, ChaoSeadAF = 0.224, ChaoSeadSP = 18740, ChaoSeadLV = 0.0354); + end Ozone; + + model Carbonylsulfide + extends General_Properties( + SN = 202, name = "Carbonylsulfide", CAS = "463-58-1", Tc = 375.15, Pc = 6349000, Vc = 0.14, Cc = 0.272, Tb = 223.15, Tm = 134.35, TT = 134.3, TP = 101.325, MW = 60.0751, LVB = 0.0510474, AF = 0.137779, SP = 14270, DM = 2.37E-30, SH = -138410000.0, IGHF = -1.3841E+08, GEF = -1.692E+08, AS = 231470, HFMP = 4725000, HOC = -5.4827E+08, LiqDen = {105,1.8896,0.27226,378.81,0.25315,0}, VP = {101,74.34266,-3813.497,-8.620386,0.0000180431,2}, LiqCp = {16,71808,-8528.4,73.159,-0.16854,0.00016953}, HOV = {106,3.0555E+07,0.84937,-0.32129,-0.52716,0.40226}, VapCp = {16,28351,-363.89,10.752,-0.00019902,7.0945E-08}, LiqVis = {101,-9.091,494.42,-0.20653,-6.4588E-07,2}, VapVis = {102,0.000010184,0.2938,1012.7,-12250,0}, LiqK = {16,0.032218,-41.011,-0.83624,-0.0051268,0.0000012154}, VapK = {102,0.0012701,0.60437,545.23,3627.6,0}, Racketparam = 0.272, UniquacR = 1.707317, UniquacQ = 1.620988, ChaoSeadAF = 0.096, ChaoSeadSP = 14270, ChaoSeadLV = 0.0510474); + end Carbonylsulfide; + + model Sulfurhexafluoride + extends General_Properties( + SN = 203, name = "Sulfurhexafluoride", CAS = "2551-62-4", Tc = 318.72, Pc = 3760000, Vc = 0.1984, Cc = 0.282, Tb = 209.25, Tm = 222.65, TT = 223.15, TP = 232670, MW = 146.056, LVB = 0.07981, AF = 0.208, SP = 7681, DM = 0, SH = -1209000000.0, IGHF = -1.209E+09, GEF = -1.1053E+09, AS = 291710, HFMP = 5024200, HOC = 9.24E+08, LiqDen = {105,1.0016,0.23435,318.74,0.24027,0}, VP = {101,-17.60907,-1028.369,6.556299,-0.0000178874,2}, LiqCp = {16,119500,-2040,-9.5251,0.005216,-0.000044691}, HOV = {106,5.0769E+07,8.5605,-25.709,29.437,-11.774}, VapCp = {16,32322,-368.1,12.478,-0.00063326,1.9169E-07}, LiqVis = {101,20.959,-457.46,-4.9486,0.0000065105,2}, VapVis = {102,5.9343E-07,0.62415,62.573,13289,0}, LiqK = {16,-0.064331,-179.32,0.36969,-0.0050683,-0.0000040693}, VapK = {102,0.0013269,0.52727,30.264,73930,0}, Racketparam = 0.282, UniquacR = 3.085036, UniquacQ = 3.28, ChaoSeadAF = 0.208, ChaoSeadSP = 7681, ChaoSeadLV = 0.07981); + end Sulfurhexafluoride; + + model Dimethylsulfoxide + extends General_Properties( + SN = 204, name = "Dimethylsulfoxide", CAS = "67-68-5", Tc = 729, Pc = 5650000, Vc = 0.227, Cc = 0.212, Tb = 462.15, Tm = 291.67, TT = 291.67, TP = 50.2288, MW = 78.1334, LVB = 0.071277, AF = 0.280551, SP = 26750, DM = 1.32E-29, SH = -1209000000.0, IGHF = -2.092E+08, GEF = -1.157E+08, AS = 306300, HFMP = 1.393E+07, HOC = -1.6054E+09, LiqDen = {105,1.1064,0.25156,729,0.33043,0}, VP = {101,87.24911,-9095.583,-9.246359,3.215062E-06,2}, LiqCp = {16,148920,274.35,2.2127,0.017296,-0.000001184}, HOV = {106,4.1934E+08,12.701,-33.974,36.922,-14.839}, VapCp = {16,61635,-582.63,12.205,-0.000053872,2.2232E-08}, LiqVis = {101,33.492,223.29,-7.3227,0.000014294,2}, VapVis = {102,8.6219E-08,0.83436,168.37,-97.445,0}, LiqK = {16,0.081843,-215.42,0.15922,-0.0051305,0.0000011114}, VapK = {102,0.0006441,0.77214,1010.2,82198,0}, Racketparam = 0.212, UniquacR = 2.8266, UniquacQ = 2.472, ChaoSeadAF = 0.280551, ChaoSeadSP = 26750, ChaoSeadLV = 0.071277); + end Dimethylsulfoxide; + + model Nheptadecane + extends General_Properties( + SN = 205, name = "Nheptadecane", CAS = "629-78-7", Tc = 736, Pc = 1340000, Vc = 1.103, Cc = 0.242, Tb = 574.56, Tm = 295.127, TT = 295.134, TP = 0.0465559, MW = 240.473, LVB = 0.31045, AF = 0.762, SP = 16100, DM = 0, SH = -1209000000.0, IGHF = -3.939E+08, GEF = 9.083E+07, AS = 820230, HFMP = 4.0459E+07, HOC = -1.05618E+10, LiqDen = {105,0.1972,0.22446,736,0.27261,0}, VP = {101,230.4768,-19512.15,-29.73776,0.0000119109,2}, LiqCp = {16,341660,-48.077,11.234,0.0041437,-0.0000017269}, HOV = {106,1.1837E+08,0.45937,1.0501,-1.8353,0.77357}, VapCp = {16,247870,-663.74,14.166,-0.00017722,5.7891E-08}, LiqVis = {101,-77.193,4597,9.9892,-0.0000084702,2}, VapVis = {102,3.2694E-07,0.5961,448.22,45523,0}, LiqK = {16,-0.015537,-239.33,0.042685,-0.0038367,8.6547E-07}, VapK = {102,-115.33,1.0524,-2.1515E+09,-1.3137E+10,0}, Racketparam = 0.242, UniquacR = 11.9182, UniquacQ = 9.796, ChaoSeadAF = 0.762, ChaoSeadSP = 16100, ChaoSeadLV = 0.31045); + end Nheptadecane; + + model Noctadecane + extends General_Properties( + SN = 206, name = "Noctadecane", CAS = "593-45-3", Tc = 747, Pc = 1290000, Vc = 1.189, Cc = 0.247, Tb = 588.3, Tm = 301.33, TT = 301.33, TP = 0.0339091, MW = 254.5, LVB = 0.32666, AF = 0.808, SP = 16100, DM = 0, SH = -1209000000.0, IGHF = -4.1457E+08, GEF = 9.921E+07, AS = 859450, HFMP = 6.1986E+07, HOC = -1.11726E+10, LiqDen = {105,0.21099,0.23901,748.16,0.28153,0}, VP = {101,156.4726,-16120.27,-18.72498,5.38655E-06,2}, LiqCp = {16,332820,-15.176,11.369,0.0039066,-0.0000015738}, HOV = {106,1.214E+08,0.36333,1.283,-2.0514,0.85175}, VapCp = {16,258960,-641.43,14.136,-0.000068602,1.814E-08}, LiqVis = {101,-83.956,4978.7,10.99,-0.0000089834,2}, VapVis = {102,3.2955E-07,0.58255,343.75,67974,0}, LiqK = {16,-0.046627,-130.56,-0.64842,-0.0017182,-4.6995E-07}, VapK = {102,-198.99,1.1011,-5.9685E+09,5.2419E+11,0}, Racketparam = 0.247, UniquacR = 12.5926, UniquacQ = 10.336, ChaoSeadAF = 0.808, ChaoSeadSP = 16100, ChaoSeadLV = 0.32666); + end Noctadecane; + + model Nnonadecane + extends General_Properties( + SN = 207, name = "Nnonadecane", CAS = "629-92-5", Tc = 760, Pc = 1230000, Vc = 1.1, Cc = 0.215, Tb = 603.75, Tm = 305.05, TT = 305.04, TP = 0.0159089, MW = 268.521, LVB = 0.343701, AF = 0.8271, SP = 16200, DM = 0, SH = -1209000000.0, IGHF = -4.3514E+08, GEF = 1.075E+08, AS = 898930, HFMP = 5.02E+07, HOC = -1.17812E+10, LiqDen = {105,0.20149,0.23831,760,0.29903,0}, VP = {101,182.4003,-17843.62,-22.48728,7.349606E-06,2}, LiqCp = {16,244790,42.54,11.446,0.0046334,-0.0000026668}, HOV = {106,1.5404E+08,1.2215,-0.32899,-1.0541,0.6821}, VapCp = {16,274480,-648.39,14.221,-0.00011095,3.3607E-08}, LiqVis = {101,-84.761,5101,11.082,-0.0000087239,2}, VapVis = {102,3.0651E-07,0.58942,341.93,67425,0}, LiqK = {16,-0.057019,73.111,-2.1518,0.0021618,-0.0000035171}, VapK = {102,0.000043333,1.271,2799.6,138170,0}, Racketparam = 0.215, UniquacR = 13.267, UniquacQ = 10.876, ChaoSeadAF = 0.8271, ChaoSeadSP = 16200, ChaoSeadLV = 0.343701); + end Nnonadecane; + + model Nheneicosane + extends General_Properties( + SN = 208, name = "Nheneicosane", CAS = "629-94-7", Tc = 798.64, Pc = 1391000, Vc = 1.197, Cc = 0.211, Tb = 629.65, Tm = 313.65, TT = 313.35, TP = 0.00621532, MW = 296.574, LVB = 0.376581, AF = 0.942004, SP = 15900, DM = 0, SH = -1209000000.0, IGHF = -4.778E+08, GEF = 1.229E+08, AS = 985000, HFMP = 4.7698E+07, HOC = -1.296E+10, LiqDen = {105,0.0010945,0.018629,798.64,0.095543,0}, VP = {101,107.2451,-14833.82,-11.21418,3.606473E-07,2}, LiqCp = {16,268470,50.971,11.858,0.0031331,-0.0000010628}, HOV = {106,2.0592E+08,3.1557,-6.6833,7.1267,-3.099}, VapCp = {16,253120,-507.31,13.984,0.00027572,-9.6316E-08}, LiqVis = {101,-25.108,2540.9,2.0324,-0.0000013549,2}, VapVis = {102,2.9575E-07,0.62136,718.74,3255.3,0}, LiqK = {16,-0.22263,31.196,-1.0701,0.0001617,-7.0064E-07}, VapK = {102,-237.86,1.0527,-4.9708E+09,-8.9521E+10,0}, Racketparam = 0.211, UniquacR = 14.6158, UniquacQ = 11.956, ChaoSeadAF = 0.942004, ChaoSeadSP = 15900, ChaoSeadLV = 0.376581); + end Nheneicosane; + + model Ndocosane + extends General_Properties( + SN = 209, name = "Ndocosane", CAS = "629-97-0", Tc = 808.83, Pc = 1339000, Vc = 1.252, Cc = 0.209, Tb = 641.75, Tm = 318.25, TT = 317.15, TP = 0.00359575, MW = 310.601, LVB = 0.393226, AF = 0.973, SP = 15800, DM = 0, SH = -1209000000.0, IGHF = -4.985E+08, GEF = 1.307E+08, AS = 1019000, HFMP = 4.8953E+07, HOC = -1.357E+10, LiqDen = {105,0.00088994,0.017172,808.83,0.094179,0}, VP = {101,270.663,-22731.61,-35.81794,0.0000193308,2}, LiqCp = {16,94846,-114.81,13.466,0.000531,3.3532E-07}, HOV = {106,1.5383E+08,1.0955,-1.2067,1.3977,-0.85529}, VapCp = {16,291820,-567.43,14.157,0.00012912,-4.9166E-08}, LiqVis = {101,-27.314,2728.1,2.3358,-0.0000013135,2}, VapVis = {102,2.8858E-07,0.62154,714.54,4582.3,0}, LiqK = {16,-0.148,-22.716,-0.91136,-0.00059496,-3.4759E-07}, VapK = {102,-270.77,1.0546,-5.8977E+09,-1.0935E+11,0}, Racketparam = 0.209, UniquacR = 15.2902, UniquacQ = 12.496, ChaoSeadAF = 0.973, ChaoSeadSP = 15800, ChaoSeadLV = 0.393226); + end Ndocosane; + + model Ntricosane + extends General_Properties( + SN = 210, name = "Ntricosane", CAS = "638-67-5", Tc = 818.25, Pc = 1290000, Vc = 1.307, Cc = 0.208, Tb = 653.15, Tm = 320.95, TT = 320.65, TP = 0.00186855, MW = 324.627, LVB = 0.4074, AF = 1.02617, SP = 15800, DM = 0, SH = -1209000000.0, IGHF = -5.192E+08, GEF = 1.39E+08, AS = 1064000, HFMP = 5.3974E+07, HOC = -1.417E+10, LiqDen = {105,0.048866,0.12922,818.25,0.20531,0}, VP = {101,-22.08031,-9534.111,8.274049,-0.0000125255,2}, LiqCp = {16,-58655,-99.845,13.754,0.00030768,3.7705E-07}, HOV = {106,1.6434E+08,1.0068,-0.55169,0.31454,-0.3244}, VapCp = {16,304710,-567.01,14.201,0.00012862,-4.8999E-08}, LiqVis = {101,-8.8394,1949.8,-0.47088,0.0000010446,2}, VapVis = {102,2.8518E-07,0.61933,704.01,6598.3,0}, LiqK = {16,-0.18218,0.19147,-0.94906,-0.00035642,-3.5025E-07}, VapK = {102,-232.83,1.0566,-5.2747E+09,-9.8604E+10,0}, Racketparam = 0.208, UniquacR = 15.9646, UniquacQ = 13.036, ChaoSeadAF = 1.02617, ChaoSeadSP = 15800, ChaoSeadLV = 0.4074); + end Ntricosane; + + model Ntetracosane + extends General_Properties( + SN = 211, name = "Ntetracosane", CAS = "646-31-1", Tc = 810, Pc = 1020000, Vc = 1.36, Cc = 0.207, Tb = 664.45, Tm = 324.05, TT = 323.75, TP = 0.00138507, MW = 338.654, LVB = 0.426088, AF = 1.07102, SP = 15800, DM = 0, SH = -1209000000.0, IGHF = -5.4E+08, GEF = 1.472E+08, AS = 1097000, HFMP = 5.4894E+07, HOC = -1.479E+10, LiqDen = {105,0.013821,0.07087,810,0.13885,0}, VP = {101,118.4643,-17014.83,-12.51446,1.109888E-07,2}, LiqCp = {16,397960,-97.814,12.108,0.0038156,-0.0000022229}, HOV = {106,1.5462E+08,0.24892,1.8808,-2.829,1.1319}, VapCp = {16,318880,-569.39,14.249,0.00012213,-4.6983E-08}, LiqVis = {101,-64.748,4433,8.0272,-0.0000059771,2}, VapVis = {102,2.9788E-07,0.59708,514.64,49388,0}, LiqK = {16,0.046069,-245.01,-0.62562,-0.0019192,-0.0000023135}, VapK = {102,-232.02,1.063,-5.6529E+09,-8.4042E+10,0}, Racketparam = 0.207, UniquacR = 16.639, UniquacQ = 13.576, ChaoSeadAF = 1.07102, ChaoSeadSP = 15800, ChaoSeadLV = 0.426088); + end Ntetracosane; + + model Npentacosane + extends General_Properties( + SN = 212, name = "Npentacosane", CAS = "629-99-2", Tc = 836.31, Pc = 1202000, Vc = 1.418, Cc = 0.205, Tb = 675.05, Tm = 327.9, TT = 326.65, TP = 0.00079876, MW = 352.68, LVB = 0.442767, AF = 1.10526, SP = 15800, DM = 0, SH = -1209000000.0, IGHF = -5.607E+08, GEF = 1.553E+08, AS = 1143000, HFMP = 5.7739E+07, HOC = -1.539E+10, LiqDen = {105,0.00063401,0.015388,836.31,0.093752,0}, VP = {101,-203.2504,-1095.063,35.1974,-0.0000282197,2}, LiqCp = {16,528340,-126.87,12.075,0.002955,-9.8642E-07}, HOV = {106,1.9288E+08,1.8937,-3.4712,3.9636,-1.9344}, VapCp = {16,330530,-566.25,14.283,0.00012874,-4.9096E-08}, LiqVis = {101,-9.804,1971.8,-0.26998,3.9914E-07,2}, VapVis = {102,2.8769E-07,0.61575,746.72,4040.4,0}, LiqK = {16,0.0058343,-203.86,-0.37432,-0.0029792,2.4773E-07}, VapK = {102,-266.99,1.0606,-6.4961E+09,-1.2167E+11,0}, Racketparam = 0.205, UniquacR = 17.3134, UniquacQ = 14.116, ChaoSeadAF = 1.10526, ChaoSeadSP = 15800, ChaoSeadLV = 0.442767); + end Npentacosane; + + model Nhexacosane + extends General_Properties( + SN = 213, name = "Nhexacosane", CAS = "630-01-3", Tc = 844.7, Pc = 1162000, Vc = 1.473, Cc = 0.203, Tb = 685.35, Tm = 329.55, TT = 329.25, TP = 0.000515816, MW = 366.707, LVB = 0.4561, AF = 1.15444, SP = 15800, DM = 0, SH = -1209000000.0, IGHF = -5.814E+08, GEF = 1.636E+08, AS = 1176000, HFMP = 5.9496E+07, HOC = -1.6E+10, LiqDen = {105,0.0012458,0.021983,844.7,0.10464,0}, VP = {101,-181.3952,-2296.288,31.90668,-0.0000256231,2}, LiqCp = {16,657670,-651.68,14.164,-0.00036454,7.7672E-07}, HOV = {106,2.0502E+08,2.0708,-3.8957,4.3419,-2.0579}, VapCp = {16,342560,-564.25,14.318,0.00013185,-5.001E-08}, LiqVis = {101,-92.13292,5845.982,12.08985,-8.198834E-06,2}, VapVis = {102,2.7977E-07,0.616,732.48,6359.2,0}, LiqK = {16,0.020148,-211.96,-0.39294,-0.0031327,1.9698E-07}, VapK = {102,-164.53,1.0626,-4.163E+09,-7.6944E+10,0}, Racketparam = 0.203, UniquacR = 17.9878, UniquacQ = 14.656, ChaoSeadAF = 1.15444, ChaoSeadSP = 15800, ChaoSeadLV = 0.4561); + end Nhexacosane; + + model Nheptacosane + extends General_Properties( + SN = 214, name = "Nheptacosane", CAS = "593-49-7", Tc = 826, Pc = 883000, Vc = 1.58, Cc = 0.203, Tb = 695.25, Tm = 332.65, TT = 332.15, TP = 0.000283125, MW = 380.734, LVB = 0.48815, AF = 1.21357, SP = 15810, DM = 0, SH = -1209000000.0, IGHF = -6.021E+08, GEF = 1.716E+08, AS = 1216000, HFMP = 6.0417E+07, HOC = -1.66E+10, LiqDen = {105,0.13373,0.23061,826,0.29272,0}, VP = {101,254.28,-25266,-32.268,0.0000098574,2}, LiqCp = {16,287690,-499.88,15.238,-0.0020847,0.000001614}, HOV = {106,1.738E+08,0.55455,0.6619,-1.1864,0.39235}, VapCp = {16,324210,-507.11,14.235,0.00027032,-9.4813E-08}, LiqVis = {101,-11.337,2071.7,-0.014083,1.056E-08,2}, VapVis = {102,2.7943E-07,0.60493,599.04,42458,0}, LiqK = {16,-0.12846,8.4662,-1.1232,-0.00036291,-3.8993E-07}, VapK = {102,-177.26,1.0676,-4.7446E+09,-7.2852E+10,0}, Racketparam = 0.203, UniquacR = 18.6622, UniquacQ = 15.196, ChaoSeadAF = 1.21357, ChaoSeadSP = 15810, ChaoSeadLV = 0.48815); + end Nheptacosane; + + model Noctacosane + extends General_Properties( + SN = 215, name = "Noctacosane", CAS = "630-02-4", Tc = 843, Pc = 888000, Vc = 1.58, Cc = 0.2, Tb = 704.75, Tm = 334.55, TT = 334.35, TP = 0.000104457, MW = 394.76, LVB = 0.492645, AF = 1.23752, SP = 15700, DM = 0, SH = -1209000000.0, IGHF = -6.228E+08, GEF = 1.799E+08, AS = 1255000, HFMP = 6.4643E+07, HOC = -1.722E+10, LiqDen = {105,0.0073167,0.055448,843,0.13236,0}, VP = {101,196.5874,-22285.21,-23.91336,7.155924E-06,2}, LiqCp = {16,494250,-131.76,12.406,0.0033619,-0.0000018387}, HOV = {106,2.0593E+08,0.90796,0.4061,-1.298,0.44283}, VapCp = {16,335140,-505.51,14.268,0.00027376,-9.6008E-08}, LiqVis = {101,-110.67,6750.2,14.886,-0.000010312,2}, VapVis = {102,0.0000003028,0.58316,487.28,64252,0}, LiqK = {16,-0.0095167,-82.828,-0.8204,-0.0023614,5.0131E-07}, VapK = {102,-190.77,1.0711,-5.355E+09,-7.036E+10,0}, Racketparam = 0.2, UniquacR = 19.3366, UniquacQ = 15.736, ChaoSeadAF = 1.23752, ChaoSeadSP = 15700, ChaoSeadLV = 0.492645); + end Noctacosane; + + model Nnonacosane + extends General_Properties( + SN = 216, name = "Nnonacosane", CAS = "630-03-5", Tc = 838, Pc = 826000, Vc = 1.69, Cc = 0.2, Tb = 713.95, Tm = 339.15, TT = 336.85, TP = 0.0000684619, MW = 408.787, LVB = 0.523824, AF = 1.26531, SP = 15500, DM = 0, SH = -1209000000.0, IGHF = -6.435E+08, GEF = 1.879E+08, AS = 1295000, HFMP = 6.6107E+07, HOC = -1.782E+10, LiqDen = {105,0.12857,0.23366,838,0.30121,0}, VP = {101,-4.241455,-11668.64,5.534214,-8.103778E-06,2}, LiqCp = {16,-89782,-199.31,14.448,-0.00027681,5.1812E-07}, HOV = {106,1.9213E+08,0.53282,0.78359,-0.96953,0.062608}, VapCp = {16,383900,-568.27,14.435,0.00012081,-4.6695E-08}, LiqVis = {101,-11.543,2141.6,0.0076776,-5.4408E-09,2}, VapVis = {102,2.7904E-07,0.59854,575.23,50800,0}, LiqK = {16,-0.1272,8.851,-1.1267,-0.00035068,-3.6961E-07}, VapK = {102,-257.69,1.0697,-7.2501E+09,-1.1593E+11,0}, Racketparam = 0.2, UniquacR = 20.011, UniquacQ = 16.276, ChaoSeadAF = 1.26531, ChaoSeadSP = 15500, ChaoSeadLV = 0.523824); + end Nnonacosane; + + model Squalane + extends General_Properties( + SN = 217, name = "Squalane", CAS = "111-01-3", Tc = 863, Pc = 868000, Vc = 1.64, Cc = 0.198, Tb = 623.15, Tm = 235.15, TT = 235.15, TP = 1.70072E-12, MW = 422.813, LVB = 0.526135, AF = 0.915303, SP = 14490, DM = 0, SH = -1209000000.0, IGHF = -6.896E+08, GEF = 1.868E+08, AS = 1272000, HFMP = 4.7E+07, HOC = -1.85E+10, LiqDen = {105,0.15996,0.26223,863,0.38604,0}, VP = {101,518.45,-40342,-70.491,0.00002486,2}, LiqCp = {16,-38276,-113.46,13.728,0.001186,-3.7363E-07}, HOV = {106,1.3274E+08,0.38,0,0,0}, VapCp = {16,369830,-553.39,14.489,0.00010319,-3.8186E-08}, LiqVis = {118,-347.8968,71874.9,53.72611,-0.0000616157,1.3}, VapVis = {102,2.2128E-07,0.5436,144.2,25.787,0}, LiqK = {16,-0.045427,7.6198,-1.8982,-0.00026051,-5.9557E-07}, VapK = {102,0.000056714,1.0625,551.79,75579,0}, Racketparam = 0.198, UniquacR = 20.6854, UniquacQ = 16.816, ChaoSeadAF = 0.915303, ChaoSeadSP = 14490, ChaoSeadLV = 0.526135); + end Squalane; + + model Twomethylhexane + extends General_Properties( + SN = 218, name = "Twomethylhexane", CAS = "591-76-4", Tc = 530.1, Pc = 2730000, Vc = 0.421, Cc = 0.261, Tb = 363.18, Tm = 154.9, TT = 154.9, TP = 0.00429886, MW = 100.204, LVB = 0.1486, AF = 0.331, SP = 14730, DM = 0, SH = -1209000000.0, IGHF = -1.9472E+08, GEF = 3470000, AS = 420410, HFMP = 9184000, HOC = -4.45935E+09, LiqDen = {105,0.4821,0.23526,530.41,0.23824,0}, VP = {101,90.20617,-6876.202,-10.31895,8.219062E-06,2}, LiqCp = {16,142210,82.605,8.5784,0.010085,-0.000006336}, HOV = {106,4.861947E+07,0.640142,-0.832218,0.945728,-0.370956}, VapCp = {16,88324,-552.27,13.044,0.00017909,-6.2753E-08}, LiqVis = {101,-10.237,971.42,-0.18335,0.0000010057,2}, VapVis = {102,0.0000041509,0.28637,700.76,14523,0}, LiqK = {16,0.060786,305.44,-6.3461,0.018265,-0.000033419}, VapK = {102,0.000062491,1.0749,-62.587,153720,0}, Racketparam = 0.261, UniquacR = 5.1734, UniquacQ = 4.392, ChaoSeadAF = 0.331, ChaoSeadSP = 14730, ChaoSeadLV = 0.1486); + end Twomethylhexane; + + model Threemethylhexane + extends General_Properties( + SN = 219, name = "Threemethylhexane", CAS = "589-34-4", Tc = 535.2, Pc = 2810000, Vc = 0.404, Cc = 0.255, Tb = 365, Tm = 153.75, TT = 153.75, TP = 0.00321303, MW = 100.204, LVB = 0.14674, AF = 0.323, SP = 14950, DM = 0, SH = -1209000000.0, IGHF = -1.9133E+08, GEF = 5080000, AS = 425930, HFMP = 9460000, HOC = -4.46177E+09, LiqDen = {105,0.53784,0.24926,535.2,0.22945,0}, VP = {101,86.76736,-6773.074,-9.77749,7.535909E-06,2}, LiqCp = {16,151720,437.07,3.0907,0.032504,-0.000034822}, HOV = {106,5.817768E+07,1.085699,-1.05321,0.37877,0.0254378}, VapCp = {16,80171,-511.41,12.979,0.00025345,-8.5984E-08}, LiqVis = {101,-11.794,999.53,0.086997,-2.3727E-07,2}, VapVis = {102,4.5226E-07,0.55481,210.53,14.061,0}, LiqK = {16,-0.14432,11.474,-1.2132,-0.00022172,-0.0000010949}, VapK = {102,0.000041038,1.1288,-121.44,150080,0}, Racketparam = 0.255, UniquacR = 5.1734, UniquacQ = 4.392, ChaoSeadAF = 0.323, ChaoSeadSP = 14950, ChaoSeadLV = 0.14674); + end Threemethylhexane; + + model Threeethylpentane + extends General_Properties( + SN = 220, name = "Threeethylpentane", CAS = "617-78-7", Tc = 540.5, Pc = 2890000, Vc = 0.4158, Cc = 0.267, Tb = 366.63, Tm = 154.55, TT = 154.55, TP = 0.00170947, MW = 100.204, LVB = 0.1444, AF = 0.311, SP = 15040, DM = 0, SH = -1209000000.0, IGHF = -1.89661E+08, GEF = 1.09202E+07, AS = 411540, HFMP = 9547890, HOC = -4.4642E+09, LiqDen = {105,0.56112,0.24813,540.61,0.27074,0}, VP = {101,89.99315,-6915.896,-10.27777,8.039283E-06,2}, LiqCp = {16,152590,204.56,5.9318,0.021701,-0.000022224}, HOV = {106,5.3257E+07,1.2647,-2.6729,3.1124,-1.3109}, VapCp = {16,102980,-630.04,13.15,0.000058616,-2.6799E-08}, LiqVis = {101,-11.885,1001.1,0.10351,-0.0000003544,2}, VapVis = {102,6.1521E-07,0.52741,287.77,1840.5,0}, LiqK = {16,-0.055574,4.7874,-1.5746,-0.0003945,-0.0000016303}, VapK = {102,0.000065519,1.0691,-74.423,161360,0}, Racketparam = 0.267, UniquacR = 5.1734, UniquacQ = 4.392, ChaoSeadAF = 0.311, ChaoSeadSP = 15040, ChaoSeadLV = 0.1444); + end Threeethylpentane; + + model TwoTwodimethylpentane + extends General_Properties( + SN = 221, name = "TwoTwodimethylpentane", CAS = "590-35-2", Tc = 520.4, Pc = 2770000, Vc = 0.4158, Cc = 0.266, Tb = 352.32, Tm = 149.34, TT = 149.34, TP = 0.00317517, MW = 100.204, LVB = 0.14967, AF = 0.287, SP = 14260, DM = 0, SH = -1209000000.0, IGHF = -2.06146E+08, GEF = 550000, AS = 392580, HFMP = 5824000, HOC = -4.45048E+09, LiqDen = {105,0.5639,0.25328,520.51,0.25578,0}, VP = {101,85.15112,-6377.959,-9.646055,8.426861E-06,2}, LiqCp = {16,129920,-35.818,9.4637,0.0091865,-0.0000074351}, HOV = {106,5.34663E+07,0.794603,-0.00994342,-0.969824,0.623819}, VapCp = {16,80553,-507.91,12.99,0.00027095,-7.6982E-08}, LiqVis = {101,-24.348,1370.4,2.2619,-0.0000092505,2}, VapVis = {102,3.1425E-07,0.61072,160.83,5436.3,0}, LiqK = {16,-0.052706,3.783,-1.5822,-0.00046167,-0.0000017248}, VapK = {102,0.000010009,1.3247,-199.43,115550,0}, Racketparam = 0.266, UniquacR = 5.1727, UniquacQ = 4.472, ChaoSeadAF = 0.287, ChaoSeadSP = 14260, ChaoSeadLV = 0.14967); + end TwoTwodimethylpentane; + + model TwoThreedimethylpentane + extends General_Properties( + SN = 222, name = "TwoThreedimethylpentane", CAS = "565-59-3", Tc = 537.3, Pc = 2910000, Vc = 0.393, Cc = 0.256, Tb = 362.91, Tm = 0, TT = 0, TP = 0, MW = 100.204, LVB = 0.14505, AF = 0.297, SP = 14820, DM = 0, SH = -1209000000.0, IGHF = -1.941E+08, GEF = 5610000, AS = 414550, HFMP = 0, HOC = -4.45567E+09, LiqDen = {105,0.60743,0.26317,537.3,0.2444,0}, VP = {101,81.051,-6444.3,-8.9383,0.0000069583,2}, LiqCp = {16,144370,-45.964,9.0642,0.010184,-0.0000082901}, HOV = {106,5.686611E+07,1.319959,-1.914129,1.410201,-0.377243}, VapCp = {16,33579,-324.43,12.683,0.00063287,-2.0243E-07}, LiqVis = {101,-16.952,1255.2,0.89405,-0.0000015964,2}, VapVis = {102,0.0000005037,0.54462,227.41,8.0354,0}, LiqK = {16,-0.054333,2.0859,-1.4922,-0.00079317,-0.0000012037}, VapK = {102,0.000019733,1.2301,-158.93,129950,0}, Racketparam = 0.256, UniquacR = 5.1726, UniquacQ = 4.388, ChaoSeadAF = 0.297, ChaoSeadSP = 14820, ChaoSeadLV = 0.14505); + end TwoThreedimethylpentane; + + model TwoFourdimethylpentane + extends General_Properties( + SN = 223, name = "TwoFourdimethylpentane", CAS = "108-08-7", Tc = 519.7, Pc = 2740000, Vc = 0.4175, Cc = 0.265, Tb = 353.62, Tm = 153.908, TT = 153.912, TP = 0.0066994, MW = 100.204, LVB = 0.14995, AF = 0.304, SP = 14290, DM = 0, SH = -1209000000.0, IGHF = -2.0167E+08, GEF = 3310000, AS = 397000, HFMP = 6845000, HOC = -4.454E+09, LiqDen = {105,0.49944,0.24101,519.81,0.23086,0}, VP = {101,86.23433,-6498.287,-9.772628,8.133363E-06,2}, LiqCp = {16,90283,22.117,10.293,0.0058192,-0.0000033296}, HOV = {106,5.636917E+07,1.083678,-0.919235,0.1428,0.13605}, VapCp = {16,66100,-427.67,12.876,0.00036594,-1.1245E-07}, LiqVis = {101,-15.849,1204.5,0.70216,-0.0000021284,2}, VapVis = {102,1.8633E-07,0.67603,100.62,-68.047,0}, LiqK = {16,-0.10048,3.798,-1.3824,-0.00040413,-0.0000011783}, VapK = {102,0.0002569,0.9033,147.33,182490,0}, Racketparam = 0.265, UniquacR = 5.1726, UniquacQ = 4.388, ChaoSeadAF = 0.304, ChaoSeadSP = 14290, ChaoSeadLV = 0.14995); + end TwoFourdimethylpentane; + + model ThreeThreedimethylpentane + extends General_Properties( + SN = 224, name = "ThreeThreedimethylpentane", CAS = "562-49-2", Tc = 536.3, Pc = 2950000, Vc = 0.4141, Cc = 0.274, Tb = 359.19, Tm = 138.7, TT = 138.7, TP = 0.000229687, MW = 100.204, LVB = 0.1454, AF = 0.269, SP = 14530, DM = 0, SH = -1209000000.0, IGHF = -2.0146E+08, GEF = 2719600, AS = 398150, HFMP = 7066780, HOC = -4.45458E+09, LiqDen = {105,0.57981,0.25238,536.41,0.28345,0}, VP = {101,74.58125,-6059.883,-7.986446,6.250113E-06,2}, LiqCp = {16,122500,86.779,8.7861,0.0099608,-0.0000069264}, HOV = {106,5.254E+07,1.1834,-1.8011,1.5275,-0.48856}, VapCp = {16,67595,-428.94,12.79,0.00052141,-1.6453E-07}, LiqVis = {101,-7.1051,998.94,-0.73694,0.0000026961,2}, VapVis = {102,9.3561E-07,0.48169,385.32,9.0702,0}, LiqK = {16,-0.050708,3.465,-1.5874,-0.00046821,-0.000001622}, VapK = {102,0.000069501,1.0643,-68.32,160740,0}, Racketparam = 0.274, UniquacR = 5.1727, UniquacQ = 4.472, ChaoSeadAF = 0.269, ChaoSeadSP = 14530, ChaoSeadLV = 0.1454); + end ThreeThreedimethylpentane; + + model TwoTwoThreetrimethylbutane + extends General_Properties( + SN = 225, name = "TwoTwoThreetrimethylbutane", CAS = "464-06-2", Tc = 531.1, Pc = 2950000, Vc = 0.3976, Cc = 0.266, Tb = 354.01, Tm = 248.253, TT = 248.57, TP = 914.054, MW = 100.204, LVB = 0.14615, AF = 0.25, SP = 14250, DM = 0, SH = -1209000000.0, IGHF = -2.04765E+08, GEF = 4600000, AS = 383340, HFMP = 2261030, HOC = -4.45223E+09, LiqDen = {105,0.36152,0.20413,531.16,0.1958,0}, VP = {101,68.92285,-5729.492,-7.139255,5.482993E-06,2}, LiqCp = {16,95157,-51.889,10.538,0.0057229,-0.0000043706}, HOV = {106,4.4282E+07,0.37696,0.13995,-0.28638,0.1473}, VapCp = {16,64561,-425.21,12.779,0.00055174,-1.7221E-07}, LiqVis = {101,15.143,240.01,-4.2433,0.0000080652,2}, VapVis = {102,8.5825E-08,0.78963,152.98,-29510,0}, LiqK = {16,0.044619,-214.12,0.30167,-0.0096656,0.0000053979}, VapK = {102,0.000030164,1.1874,-102.65,141040,0}, Racketparam = 0.266, UniquacR = 5.1719, UniquacQ = 4.468, ChaoSeadAF = 0.25, ChaoSeadSP = 14250, ChaoSeadLV = 0.14615); + end TwoTwoThreetrimethylbutane; + + model Twomethylheptane + extends General_Properties( + SN = 226, name = "Twomethylheptane", CAS = "592-27-8", Tc = 559.6, Pc = 2480000, Vc = 0.4882, Cc = 0.26, Tb = 390.8, Tm = 164.16, TT = 164.16, TP = 0.0010587, MW = 114.231, LVB = 0.16463, AF = 0.378, SP = 15050, DM = 0, SH = -1209000000.0, IGHF = -2.154E+08, GEF = 1.18E+07, AS = 459570, HFMP = 1.1878E+07, HOC = -5.06933E+09, LiqDen = {105,0.40246,0.22797,559.66,0.23428,0}, VP = {101,97.9971,-7746.664,-11.37588,8.143433E-06,2}, LiqCp = {16,66821,33.207,11.285,0.0021902,8.6142E-07}, HOV = {106,6.657838E+07,1.352117,-1.871983,1.354613,-0.391149}, VapCp = {16,108850,-612.4,13.327,-0.0000091854,-2.9587E-09}, LiqVis = {101,-7.3762,968.16,-0.65227,0.0000018143,2}, VapVis = {102,4.5347E-07,0.55194,231.19,-1256.6,0}, LiqK = {16,-0.00038221,38.981,-2.075,0.00062625,-0.0000038423}, VapK = {102,0.000048089,1.0964,-142.76,170130,0}, Racketparam = 0.26, UniquacR = 5.8478, UniquacQ = 4.932, ChaoSeadAF = 0.378, ChaoSeadSP = 15050, ChaoSeadLV = 0.16463); + end Twomethylheptane; + + model Threemethylheptane + extends General_Properties( + SN = 227, name = "Threemethylheptane", CAS = "589-81-1", Tc = 563.6, Pc = 2550000, Vc = 0.4711, Cc = 0.253, Tb = 392.08, Tm = 152.65, TT = 152.6, TP = 0.0000523002, MW = 114.231, LVB = 0.16278, AF = 0.371, SP = 15180, DM = 0, SH = -1209000000.0, IGHF = -2.1251E+08, GEF = 1.275E+07, AS = 465510, HFMP = 1.163E+07, HOC = -5.0721E+09, LiqDen = {105,0.48768,0.25064,563.66,0.24544,0}, VP = {101,94.76732,-7652.539,-10.86325,7.450521E-06,2}, LiqCp = {16,137930,50.329,9.9028,0.0059467,-0.0000024618}, HOV = {106,6.899021E+07,1.39863,-1.771662,1.093723,-0.270846}, VapCp = {16,103080,-583.42,13.271,0.000052348,-2.126E-08}, LiqVis = {101,-7.3817,976.23,-0.66335,0.0000021183,2}, VapVis = {102,0.0000069865,0.21161,854.03,-2592.5,0}, LiqK = {16,-0.043161,22.706,-1.6829,-0.000063735,-0.0000020484}, VapK = {102,0.000042535,1.1138,-151.71,168420,0}, Racketparam = 0.253, UniquacR = 5.8478, UniquacQ = 4.932, ChaoSeadAF = 0.371, ChaoSeadSP = 15180, ChaoSeadLV = 0.16278); + end Threemethylheptane; + + model Fourmethylheptane + extends General_Properties( + SN = 228, name = "Fourmethylheptane", CAS = "589-53-7", Tc = 561.7, Pc = 2540000, Vc = 0.476, Cc = 0.259, Tb = 390.86, Tm = 152.19, TT = 152.2, TP = 0.0000457034, MW = 114.231, LVB = 0.16306, AF = 0.371, SP = 15140, DM = 0, SH = -1209000000.0, IGHF = -2.1196E+08, GEF = 1.571E+07, AS = 457390, HFMP = 1.08E+07, HOC = -5.07282E+09, LiqDen = {105,0.41247,0.23007,561.76,0.23229,0}, VP = {101,97.33843,-7742.706,-11.25952,7.843366E-06,2}, LiqCp = {16,123600,-18.717,11.067,0.0020327,0.0000016218}, HOV = {106,6.797167E+07,1.151616,-0.835173,-0.171743,0.314726}, VapCp = {16,100250,-569.74,13.266,0.000060406,-2.5661E-08}, LiqVis = {101,-11.11,1066.3,-0.039384,1.7455E-07,2}, VapVis = {102,0.0000043616,0.27023,695.06,-2959.1,0}, LiqK = {16,-0.096483,12.321,-1.3603,-0.00031289,-0.0000012186}, VapK = {102,0.000040274,1.1204,-164.18,166050,0}, Racketparam = 0.259, UniquacR = 5.8478, UniquacQ = 4.932, ChaoSeadAF = 0.371, ChaoSeadSP = 15140, ChaoSeadLV = 0.16306); + end Fourmethylheptane; + + model Threeethylhexane + extends General_Properties( + SN = 229, name = "Threeethylhexane", CAS = "619-99-8", Tc = 565.4, Pc = 2610000, Vc = 0.4605, Cc = 0.253, Tb = 391.69, Tm = 0, TT = 0, TP = 0, MW = 114.231, LVB = 0.16101, AF = 0.362, SP = 15210, DM = 0, SH = -1209000000.0, IGHF = -2.10874E+08, GEF = 1.68615E+07, AS = 457860, HFMP = 0, HOC = -5.07398E+09, LiqDen = {105,0.46206,0.24436,565.51,0.22747,0}, VP = {101,97.09596,-7733.566,-11.22583,7.810756E-06,2}, LiqCp = {16,80628,-64.909,11.186,0.0048319,-0.0000040172}, HOV = {106,5.4799E+07,0.26737,0.81877,-1.2904,0.59915}, VapCp = {16,115160,-618.28,13.279,0.0000464,-2.6202E-08}, LiqVis = {101,-7.8742,897.68,-0.5066,2.0784E-08,2}, VapVis = {102,3.7627E-07,0.57415,196.9,-172.94,0}, LiqK = {16,-0.001637,-138.28,-0.62782,-0.0040963,8.9774E-07}, VapK = {102,0.000056588,1.0789,-123.05,173090,0}, Racketparam = 0.253, UniquacR = 5.8478, UniquacQ = 4.932, ChaoSeadAF = 0.362, ChaoSeadSP = 15210, ChaoSeadLV = 0.16101); + end Threeethylhexane; + + model TwoTwodimethylhexane + extends General_Properties( + SN = 230, name = "TwoTwodimethylhexane", CAS = "590-73-8", Tc = 549.8, Pc = 2530000, Vc = 0.478, Cc = 0.265, Tb = 379.99, Tm = 151.97, TT = 151.97, TP = 0.000215228, MW = 114.231, LVB = 0.16529, AF = 0.339, SP = 14580, DM = 0, SH = -1209000000.0, IGHF = -2.24723E+08, GEF = 1.0711E+07, AS = 432710, HFMP = 6778080, HOC = -5.06247E+09, LiqDen = {105,0.54681,0.26386,549.8,0.27774,0}, VP = {101,94.06922,-7328.821,-10.84298,7.99047E-06,2}, LiqCp = {16,125360,373.89,5.844,0.022419,-0.00002308}, HOV = {106,6.211522E+07,1.000418,-0.588989,-0.277913,0.313577}, VapCp = {16,97647,-528.4,13.112,0.00027844,-9.0187E-08}, LiqVis = {101,-11.328,1166.6,-0.039718,2.6889E-07,2}, VapVis = {102,0.0000018535,0.38476,528.24,78.686,0}, LiqK = {16,-0.03878,5.2314,-1.6985,-0.00038448,-0.000001806}, VapK = {102,0.000045965,1.1142,-113.91,162780,0}, Racketparam = 0.265, UniquacR = 5.8471, UniquacQ = 5.012, ChaoSeadAF = 0.339, ChaoSeadSP = 14580, ChaoSeadLV = 0.16529); + end TwoTwodimethylhexane; + + model TwoThreedimethylhexane + extends General_Properties( + SN = 231, name = "TwoThreedimethylhexane", CAS = "584-94-1", Tc = 563.4, Pc = 2630000, Vc = 0.4682, Cc = 0.263, Tb = 388.76, Tm = 0, TT = 0, TP = 0, MW = 114.231, LVB = 0.16131, AF = 0.347, SP = 15020, DM = 0, SH = -1209000000.0, IGHF = -2.13886E+08, GEF = 1.50206E+07, AS = 451960, HFMP = 0, HOC = -5.07176E+09, LiqDen = {105,0.48655,0.24924,563.43,0.24533,0}, VP = {101,106.31,-8083.9,-12.636,0.000008991,2}, LiqCp = {16,-256410,53.354,11.988,0.00458,-0.0000045457}, HOV = {106,5.5877E+07,0.44475,0.4503,-0.98905,0.49662}, VapCp = {16,55247,-379.2,12.913,0.00048944,-1.5722E-07}, LiqVis = {101,8.0389,480.9,-3.1555,0.0000074225,2}, VapVis = {102,4.4497E-07,0.56168,244.71,41.585,0}, LiqK = {16,-0.0041864,-133.36,-0.65326,-0.003975,8.3867E-07}, VapK = {102,0.000025619,1.1862,-177.9,153600,0}, Racketparam = 0.263, UniquacR = 5.847, UniquacQ = 4.928, ChaoSeadAF = 0.347, ChaoSeadSP = 15020, ChaoSeadLV = 0.16131); + end TwoThreedimethylhexane; + + model TwoFourdimethylhexane + extends General_Properties( + SN = 232, name = "TwoFourdimethylhexane", CAS = "589-43-5", Tc = 553.5, Pc = 2560000, Vc = 0.472, Cc = 0.263, Tb = 382.58, Tm = 0, TT = 0, TP = 0, MW = 114.231, LVB = 0.16408, AF = 0.344, SP = 14650, DM = 0, SH = -1209000000.0, IGHF = -2.19409E+08, GEF = 1.17152E+07, AS = 447600, HFMP = 0, HOC = -5.06733E+09, LiqDen = {105,0.49412,0.25086,553.5,0.26728,0}, VP = {101,110.28,-8135.7,-13.268,0.0000097316,2}, LiqCp = {16,-373730,38.479,12.478,0.0035274,-0.0000034858}, HOV = {106,5.4006E+07,0.43973,0.30966,-0.70429,0.35515}, VapCp = {16,68028,-390.94,12.9,0.00049032,-1.6117E-07}, LiqVis = {101,-12.459,1208.2,0.16649,-2.1296E-07,2}, VapVis = {102,0.0000013835,0.41886,453.95,-1216.3,0}, LiqK = {16,-0.012272,-146.3,-0.49024,-0.0043592,0.0000013669}, VapK = {102,0.000028277,1.1747,-150.01,140960,0}, Racketparam = 0.263, UniquacR = 5.847, UniquacQ = 4.928, ChaoSeadAF = 0.344, ChaoSeadSP = 14650, ChaoSeadLV = 0.16408); + end TwoFourdimethylhexane; + + model TwoFivedimethylhexane + extends General_Properties( + SN = 233, name = "TwoFivedimethylhexane", CAS = "592-13-2", Tc = 550, Pc = 2490000, Vc = 0.482, Cc = 0.262, Tb = 382.26, Tm = 182, TT = 182, TP = 0.0683715, MW = 114.231, LVB = 0.1657, AF = 0.357, SP = 14740, DM = 0, SH = -1209000000.0, IGHF = -2.22631E+08, GEF = 1.046E+07, AS = 442330, HFMP = 1.29537E+07, HOC = -5.06398E+09, LiqDen = {105,0.49779,0.2525,550,0.26429,0}, VP = {101,87.65473,-7122.285,-9.843559,7.04047E-06,2}, LiqCp = {16,-51796,-110.09,12.759,0.00089408,-0.0000004354}, HOV = {106,6.2389E+07,1.0017,-0.72582,-0.024698,0.19155}, VapCp = {16,66542,-399.08,12.9,0.00049831,-1.6255E-07}, LiqVis = {101,-2.9399,836.45,-1.3966,0.00000447,2}, VapVis = {102,8.3872E-07,0.47833,344.26,27.957,0}, LiqK = {16,-0.074336,3.6543,-1.5091,-0.00039812,-0.0000013255}, VapK = {102,0.000029331,1.1695,-138.07,145330,0}, Racketparam = 0.262, UniquacR = 5.847, UniquacQ = 4.928, ChaoSeadAF = 0.357, ChaoSeadSP = 14740, ChaoSeadLV = 0.1657); + end TwoFivedimethylhexane; + + model ThreeThreedimethylhexane + extends General_Properties( + SN = 234, name = "ThreeThreedimethylhexane", CAS = "563-16-6", Tc = 562, Pc = 2650000, Vc = 0.4428, Cc = 0.251, Tb = 385.12, Tm = 147.05, TT = 147.05, TP = 0.0000473645, MW = 114.231, LVB = 0.16181, AF = 0.32, SP = 14880, DM = 0, SH = -1209000000.0, IGHF = -2.2012E+08, GEF = 1.32633E+07, AS = 438230, HFMP = 7112800, HOC = -5.06682E+09, LiqDen = {105,0.45959,0.24567,562,0.21162,0}, VP = {101,109.95,-8119.3,-13.232,0.0000097251,2}, LiqCp = {16,130950,-54.41,9.7102,0.0098373,-0.0000089507}, HOV = {106,5.8755E+07,0.81257,-0.27217,-0.51422,0.40803}, VapCp = {16,73854,-426.62,12.974,0.00044554,-1.4645E-07}, LiqVis = {101,-7.0202,924.42,-0.69061,0.0000021821,2}, VapVis = {102,1.9286E-07,0.65784,75.166,8686.9,0}, LiqK = {16,-0.074777,3.6654,-1.4953,-0.00045709,-0.000001113}, VapK = {102,0.000028072,1.1786,-168.43,151580,0}, Racketparam = 0.251, UniquacR = 5.8471, UniquacQ = 5.012, ChaoSeadAF = 0.32, ChaoSeadSP = 14880, ChaoSeadLV = 0.16181); + end ThreeThreedimethylhexane; + + model ThreeFourdimethylhexane + extends General_Properties( + SN = 235, name = "ThreeFourdimethylhexane", CAS = "583-48-2", Tc = 568.8, Pc = 2690000, Vc = 0.4588, Cc = 0.265, Tb = 390.88, Tm = 0, TT = 0, TP = 0, MW = 114.231, LVB = 0.15973, AF = 0.338, SP = 15140, DM = 0, SH = -1209000000.0, IGHF = -2.13007E+08, GEF = 1.674E+07, AS = 451580, HFMP = 0, HOC = -5.07251E+09, LiqDen = {105,0.45439,0.24011,568.8,0.23618,0}, VP = {101,93.68625,-7521.509,-10.73445,7.52569E-06,2}, LiqCp = {16,-327870,47.226,12.229,0.0041484,-0.000004128}, HOV = {106,5.4702E+07,0.45918,0.1856,-0.51513,0.26338}, VapCp = {16,34075,-331.34,12.881,0.00054108,-1.7153E-07}, LiqVis = {101,-41.742,2125.1,4.8163,-0.0000056466,2}, VapVis = {102,6.4152E-07,0.51789,310.46,157.69,0}, LiqK = {16,-0.0004002,-144.47,-0.57247,-0.0042745,0.0000010836}, VapK = {102,0.000020807,1.2133,-200.76,152640,0}, Racketparam = 0.265, UniquacR = 5.847, UniquacQ = 4.928, ChaoSeadAF = 0.338, ChaoSeadSP = 15140, ChaoSeadLV = 0.15973); + end ThreeFourdimethylhexane; + + model TwomethylThreeethylpentane + extends General_Properties( + SN = 236, name = "TwomethylThreeethylpentane", CAS = "609-26-7", Tc = 567, Pc = 2700000, Vc = 0.4453, Cc = 0.254, Tb = 388.81, Tm = 158.2, TT = 158.2, TP = 0.000447428, MW = 114.231, LVB = 0.15972, AF = 0.331, SP = 15140, DM = 0, SH = -1209000000.0, IGHF = -2.11208E+08, GEF = 1.87861E+07, AS = 443760, HFMP = 1.13386E+07, HOC = -5.07477E+09, LiqDen = {105,0.54567,0.26412,567.03,0.24308,0}, VP = {101,92.12933,-7403.468,-10.51119,7.396006E-06,2}, LiqCp = {16,11076,-131.1,12.479,0.0013888,-7.3844E-07}, HOV = {106,5.9697E+07,0.73134,0.033175,-0.91459,0.58962}, VapCp = {16,86476,-441,12.894,0.00051253,-1.9205E-07}, LiqVis = {101,-10.931,1059.8,-0.066598,1.3283E-07,2}, VapVis = {102,5.6587E-07,0.52506,255.1,-76.481,0}, LiqK = {16,-0.069311,4.0311,-1.5221,-0.00039448,-0.0000012799}, VapK = {102,0.000026967,1.1845,-133.92,140280,0}, Racketparam = 0.254, UniquacR = 5.847, UniquacQ = 4.928, ChaoSeadAF = 0.331, ChaoSeadSP = 15140, ChaoSeadLV = 0.15972); + end TwomethylThreeethylpentane; + + model ThreemethylThreeethylpentane + extends General_Properties( + SN = 237, name = "ThreemethylThreeethylpentane", CAS = "1067-08-9", Tc = 576.5, Pc = 2810000, Vc = 0.4551, Cc = 0.267, Tb = 391.42, Tm = 182.28, TT = 182.28, TP = 0.0625263, MW = 114.231, LVB = 0.15788, AF = 0.305, SP = 15060, DM = 0, SH = -1209000000.0, IGHF = -2.1485E+08, GEF = 2.288E+07, AS = 432960, HFMP = 1.08E+07, HOC = -5.0716E+09, LiqDen = {105,0.59884,0.27253,576.5,0.28169,0}, VP = {101,85.77668,-7097.92,-9.572218,6.70781E-06,2}, LiqCp = {16,77769,172.95,9.182,0.01021,-0.0000086615}, HOV = {106,6.3775E+07,1.5194,-2.4569,2.0687,-0.69375}, VapCp = {16,89715,-509.11,13.135,0.00024858,-7.767E-08}, LiqVis = {101,-18.59,1270.3,1.2467,-0.0000036226,2}, VapVis = {102,7.5822E-07,0.50218,361.22,-3635.6,0}, LiqK = {16,-0.037427,7.7785,-1.7161,-0.00028317,-0.0000017728}, VapK = {102,0.000021773,1.2197,-136.64,138470,0}, Racketparam = 0.267, UniquacR = 5.8471, UniquacQ = 5.012, ChaoSeadAF = 0.305, ChaoSeadSP = 15060, ChaoSeadLV = 0.15788); + end ThreemethylThreeethylpentane; + + model TwoTwoThreeThreetetramethylbutane + extends General_Properties( + SN = 238, name = "TwoTwoThreeThreetetramethylbutane", CAS = "594-82-1", Tc = 567.8, Pc = 2870000, Vc = 0.482, Cc = 0.28, Tb = 379.44, Tm = 373.84, TT = 373.96, TP = 86930.2, MW = 114.231, LVB = 0.13902, AF = 0.248, SP = 12790, DM = 0, SH = -1209000000.0, IGHF = -2.256E+08, GEF = 2.223E+07, AS = 389360, HFMP = 7540000, HOC = -5.0558E+09, LiqDen = {105,0.61397,0.27674,567.8,0.28198,0}, VP = {101,120.66,-8500.6,-14.863,0.000010649,2}, LiqCp = {16,239620,55.905,3.1054,0.027363,-0.000020376}, HOV = {106,5.3062E+07,0.30484,0.85323,-1.2161,0.48282}, VapCp = {16,73914,-415.76,12.897,0.00056384,-1.6707E-07}, LiqVis = {101,-17.538,1603.5,0.8804,-0.0000034564,2}, VapVis = {102,7.9099E-07,0.51128,412.18,-5389.1,0}, LiqK = {16,-0.0058143,-354.88,0.79351,-0.0067293,0.0000023134}, VapK = {102,0.000012508,1.3068,-132.52,121650,0}, Racketparam = 0.28, UniquacR = 5.8456, UniquacQ = 5.088, ChaoSeadAF = 0.248, ChaoSeadSP = 12790, ChaoSeadLV = 0.13902); + end TwoTwoThreeThreetetramethylbutane; + + model TwoTwoFivetrimethylhexane + extends General_Properties( + SN = 239, name = "TwoTwoFivetrimethylhexane", CAS = "3522-94-9", Tc = 568.05, Pc = 2330000, Vc = 0.519, Cc = 0.255, Tb = 397.24, Tm = 167.39, TT = 167.39, TP = 0.000968629, MW = 128.255, LVB = 0.18225, AF = 0.3571, SP = 14380, DM = 0, SH = -1209000000.0, IGHF = -2.533E+08, GEF = 1.38E+07, AS = 461700, HFMP = 6200000, HOC = -5.66643E+09, LiqDen = {105,0.45081,0.25256,569.81,0.27357,0}, VP = {101,133.84,-9023.578,-17.08913,0.0000169305,2}, LiqCp = {16,84566,233.86,8.46,0.013452,-0.000012421}, HOV = {106,8.039801E+07,1.702411,-1.574913,0.0056916,0.373292}, VapCp = {16,102010,-531.68,13.312,0.00017105,-4.7837E-08}, LiqVis = {101,-12.084,1011.7,0.13186,-0.000000312,2}, VapVis = {102,6.7588E-07,0.49876,301.49,-1437,0}, LiqK = {16,-0.13721,56.65,-1.9542,0.0024543,-0.0000043702}, VapK = {102,0.000030176,1.1642,-156.95,161470,0}, Racketparam = 0.255, UniquacR = 6.5207, UniquacQ = 5.548, ChaoSeadAF = 0.3571, ChaoSeadSP = 14380, ChaoSeadLV = 0.18225); + end TwoTwoFivetrimethylhexane; + + model TwoFourFourtrimethylhexane + extends General_Properties( + SN = 240, name = "TwoFourFourtrimethylhexane", CAS = "16747-30-1", Tc = 583, Pc = 2500000, Vc = 0.509, Cc = 0.26, Tb = 403.81, Tm = 159.78, TT = 159.78, TP = 0.000306827, MW = 128.255, LVB = 0.178125, AF = 0.352203, SP = 14590, DM = 0, SH = -1209000000.0, IGHF = -2.403E+08, GEF = 2.5E+07, AS = 468400, HFMP = 1.13E+07, HOC = -5.68E+09, LiqDen = {105,0.098546,0.11862,583,0.15161,0}, VP = {101,143.1127,-9541.532,-18.4559,0.0000171318,2}, LiqCp = {16,36795,-79.414,11.689,0.0041098,-0.0000031494}, HOV = {106,5.5551E+07,0.63316,-0.60532,0.59593,-0.24062}, VapCp = {16,84170,-452.22,13.167,0.00035197,-1.1076E-07}, LiqVis = {101,-6.9748,1194.1,-0.75025,-2.9452E-08,2}, VapVis = {102,0.0000003308,0.60466,252.52,-7535.6,0}, LiqK = {16,-0.061213,3.6115,-1.5687,-0.00048198,-0.000001134}, VapK = {102,0.000028131,1.1825,-103.57,142450,0}, Racketparam = 0.26, UniquacR = 6.5207, UniquacQ = 5.548, ChaoSeadAF = 0.352203, ChaoSeadSP = 14590, ChaoSeadLV = 0.178125); + end TwoFourFourtrimethylhexane; + + model ThreeThreediethylpentane + extends General_Properties( + SN = 241, name = "ThreeThreediethylpentane", CAS = "1067-20-5", Tc = 610.05, Pc = 2674980, Vc = 0.473, Cc = 0.249, Tb = 419.34, Tm = 240.12, TT = 240.12, TP = 13.7918, MW = 128.255, LVB = 0.171012, AF = 0.3379, SP = 15220, DM = 0, SH = -1209000000.0, IGHF = -2.31835E+08, GEF = 4.17E+07, AS = 436500, HFMP = 9800000, HOC = -5.68438E+09, LiqDen = {105,0.61216,0.28967,610.05,0.29325,0}, VP = {101,143.8917,-9842.666,-18.51396,0.000016514,2}, LiqCp = {16,167890,37.678,8.6605,0.012988,-0.000011813}, HOV = {106,5.0222E+07,-0.028455,0.90984,-0.78409,0.24027}, VapCp = {16,120540,-563.25,13.32,0.00012473,-3.6626E-08}, LiqVis = {101,-12.975,1131.8,0.25767,-3.4761E-07,2}, VapVis = {102,3.6575E-07,0.57536,184.44,2017.7,0}, LiqK = {16,-0.021495,-29.993,-1.4603,-0.0013716,-7.6272E-07}, VapK = {102,0.000069723,1.0959,342.29,74930,0}, Racketparam = 0.249, UniquacR = 6.5215, UniquacQ = 5.552, ChaoSeadAF = 0.3379, ChaoSeadSP = 15220, ChaoSeadLV = 0.171012); + end ThreeThreediethylpentane; + + model TwoTwoThreeThreetetramethylpentane + extends General_Properties( + SN = 242, name = "TwoTwoThreeThreetetramethylpentane", CAS = "7154-79-2", Tc = 607.6, Pc = 2740000, Vc = 0.478, Cc = 0.269, Tb = 413.44, Tm = 263.26, TT = 263.26, TP = 133.839, MW = 128.258, LVB = 0.17034, AF = 0.304, SP = 15060, DM = 0, SH = -1209000000.0, IGHF = -2.36856E+08, GEF = 3.74E+07, AS = 436600, HFMP = 2300000, HOC = -5.68149E+09, LiqDen = {105,0.58952,0.28267,607.6,0.29572,0}, VP = {101,139.0487,-9535.451,-17.78617,0.0000157521,2}, LiqCp = {16,116740,-86.104,11.13,0.0046308,-0.000003068}, HOV = {106,5.3713E+07,0.39899,-0.032998,0.06374,-0.0535}, VapCp = {16,55048,-357.31,13.013,0.00055209,-1.6211E-07}, LiqVis = {101,-9.7597,1441.2,-0.37772,-0.000001226,2}, VapVis = {102,8.1934E-07,0.48521,356.82,-1384.3,0}, LiqK = {16,-0.0045701,-120.11,-0.775,-0.0036256,9.650699E-07}, VapK = {102,0.000014917,1.2661,-211.67,155870,0}, Racketparam = 0.269, UniquacR = 6.52, UniquacQ = 5.628, ChaoSeadAF = 0.304, ChaoSeadSP = 15060, ChaoSeadLV = 0.17034); + end TwoTwoThreeThreetetramethylpentane; + + model TwoTwoThreeFourtetramethylpentane + extends General_Properties( + SN = 243, name = "TwoTwoThreeFourtetramethylpentane", CAS = "1186-53-4", Tc = 592.7, Pc = 2530000, Vc = 0.49, Cc = 0.258, Tb = 406.18, Tm = 152.06, TT = 152.06, TP = 0.000053591, MW = 128.258, LVB = 0.179229, AF = 0.301, SP = 14730, DM = 0, SH = -1209000000.0, IGHF = -2.37358E+08, GEF = 3.26352E+07, AS = 452834, HFMP = 500000, HOC = -5.68208E+09, LiqDen = {105,0.42889,0.24425,592.7,0.24983,0}, VP = {101,137.07,-9700.5,-17.255,0.000012062,2}, LiqCp = {16,177720,-50.337,8.3416,0.015008,-0.000013849}, HOV = {106,5.771831E+07,1.016576,-1.835135,2.12911,-0.921819}, VapCp = {16,83946,-465.16,13.193,0.000328,-9.6189E-08}, LiqVis = {101,-8.182,1248.5,-0.55988,-2.1902E-07,2}, VapVis = {102,3.9083E-07,0.57522,220.52,-776.34,0}, LiqK = {16,-0.045924,4.3553,-1.6529,-0.00040588,-0.000001389}, VapK = {102,0.000019408,1.2262,-198.62,159810,0}, Racketparam = 0.258, UniquacR = 6.5199, UniquacQ = 5.544, ChaoSeadAF = 0.301, ChaoSeadSP = 14730, ChaoSeadLV = 0.179229); + end TwoTwoThreeFourtetramethylpentane; + + model TwoTwoFourFourtetramethylpentane + extends General_Properties( + SN = 244, name = "TwoTwoFourFourtetramethylpentane", CAS = "1070-87-7", Tc = 571.35, Pc = 2360870, Vc = 0.504, Cc = 0.263, Tb = 395.44, Tm = 206.95, TT = 206.95, TP = 1.83952, MW = 128.255, LVB = 0.17923, AF = 0.313609, SP = 14150, DM = 0, SH = -1209000000.0, IGHF = -2.41375E+08, GEF = 3.40159E+07, AS = 431496, HFMP = 9700000, HOC = -5.67978E+09, LiqDen = {105,0.47711,0.25904,574.61,0.26647,0}, VP = {101,136.5701,-9035.55,-17.5287,0.0000167892,2}, LiqCp = {16,119280,88.665,9.3063,0.010453,-0.0000091934}, HOV = {106,5.75823E+07,1.154086,-2.055247,2.209851,-0.923166}, VapCp = {16,122670,-599.26,13.402,0.000099085,-1.741E-08}, LiqVis = {101,-10.148,1468.8,-0.33327,-0.0000013179,2}, VapVis = {102,5.8808E-07,0.52306,289.62,-2721.1,0}, LiqK = {16,-0.038909,-2.6455,-1.623,-0.0006558,-0.0000013711}, VapK = {102,0.000015165,1.2696,-148.49,133700,0}, Racketparam = 0.263, UniquacR = 6.52, UniquacQ = 5.628, ChaoSeadAF = 0.313609, ChaoSeadSP = 14150, ChaoSeadLV = 0.17923); + end TwoTwoFourFourtetramethylpentane; + + model TwoThreeThreeFourtetramethylpentane + extends General_Properties( + SN = 245, name = "TwoThreeThreeFourtetramethylpentane", CAS = "16747-38-9", Tc = 607.1, Pc = 2670000, Vc = 0.493, Cc = 0.261, Tb = 414.71, Tm = 171.05, TT = 171.03, TP = 0.00089642, MW = 128.258, LVB = 0.17076, AF = 0.313, SP = 15110, DM = 0, SH = -1209000000.0, IGHF = -2.361E+08, GEF = 3.8E+07, AS = 436900, HFMP = 9000000, HOC = -5.6822E+09, LiqDen = {105,0.49299,0.25927,607.51,0.27003,0}, VP = {101,79.047,-7201.2,-8.4677,0.0000051332,2}, LiqCp = {16,61477,20.611,11.082,0.0041652,-0.0000014763}, HOV = {106,5.5207E+07,0.63465,-0.82041,1.0175,-0.45604}, VapCp = {16,50811,-338.13,12.991,0.00056259,-1.7284E-07}, LiqVis = {101,-7.4098,1217,-0.67198,-2.7904E-07,2}, VapVis = {102,3.7299E-07,0.59636,289.93,-9056.4,0}, LiqK = {16,-0.058699,3.5637,-1.5648,-0.000479,-0.0000010469}, VapK = {102,0.000035577,1.1602,-50.424,142790,0}, Racketparam = 0.261, UniquacR = 6.5199, UniquacQ = 5.544, ChaoSeadAF = 0.313, ChaoSeadSP = 15110, ChaoSeadLV = 0.17076); + end TwoThreeThreeFourtetramethylpentane; + + model Twomethyloctane + extends General_Properties( + SN = 246, name = "Twomethyloctane", CAS = "3221-61-2", Tc = 587, Pc = 2310000, Vc = 0.529, Cc = 0.25, Tb = 416.44, Tm = 193.05, TT = 193.05, TP = 0.0206, MW = 128.258, LVB = 0.18075, AF = 0.423, SP = 15310, DM = 0, SH = -1209000000.0, IGHF = -2.348E+08, GEF = 2.21E+07, AS = 496800, HFMP = 1.8E+07, HOC = -5.6791E+09, LiqDen = {105,0.048725,0.083928,587,0.13299,0}, VP = {101,117.6637,-9065.067,-14.28093,0.0000101806,2}, LiqCp = {16,69326,112.91,10.449,0.0058606,-0.0000035224}, HOV = {106,6.8687E+07,1.3406,-2.5809,2.7985,-1.1501}, VapCp = {16,145390,-732.92,13.658,-0.00027343,8.6186E-08}, LiqVis = {101,-14.31,1234.5,0.50422,-0.0000012054,2}, VapVis = {102,0.0000005318,0.52649,272.37,-710.16,0}, LiqK = {16,-0.15278,14.586,-1.1974,-0.00013887,-9.4417E-07}, VapK = {102,0.00002892,1.1595,-163.72,160440,0}, Racketparam = 0.25, UniquacR = 6.5222, UniquacQ = 5.472, ChaoSeadAF = 0.423, ChaoSeadSP = 15310, ChaoSeadLV = 0.18075); + end Twomethyloctane; + + model Threemethyloctane + extends General_Properties( + SN = 247, name = "Threemethyloctane", CAS = "2216-33-3", Tc = 590.15, Pc = 2340000, Vc = 0.529, Cc = 0.252, Tb = 417.38, Tm = 165.55, TT = 165.55, TP = 0.0000898613, MW = 128.255, LVB = 0.178944, AF = 0.412346, SP = 15380, DM = 0, SH = -1209000000.0, IGHF = -2.336E+08, GEF = 2.17E+07, AS = 501660, HFMP = 1.7E+07, HOC = -5.68128E+09, LiqDen = {105,0.4999,0.26438,590.15,0.29155,0}, VP = {101,169.345,-11170.36,-22.26865,0.0000190112,2}, LiqCp = {16,39163,25.328,11.626,0.0021572,2.6369E-07}, HOV = {106,6.3378E+07,0.67667,-0.53996,0.45608,-0.18958}, VapCp = {16,118620,-596.81,13.418,0.0000088283,-1.2271E-08}, LiqVis = {101,-11.252,1147.6,-0.021999,4.3706E-08,2}, VapVis = {102,4.9482E-07,0.53152,245.99,4.1109,0}, LiqK = {16,-0.1642,10.91,-1.1265,-0.00023366,-7.9637E-07}, VapK = {102,0.000040968,1.1096,-178.72,180220,0}, Racketparam = 0.252, UniquacR = 6.5222, UniquacQ = 5.472, ChaoSeadAF = 0.412346, ChaoSeadSP = 15380, ChaoSeadLV = 0.178944); + end Threemethyloctane; + + model Fourmethyloctane + extends General_Properties( + SN = 248, name = "Fourmethyloctane", CAS = "2216-34-4", Tc = 587.65, Pc = 2340000, Vc = 0.523, Cc = 0.25, Tb = 415.59, Tm = 159.95, TT = 159.95, TP = 0.0000317697, MW = 128.255, LVB = 0.179037, AF = 0.412925, SP = 15300, DM = 0, SH = -1209000000.0, IGHF = -2.336E+08, GEF = 2.17E+07, AS = 501660, HFMP = 1.6E+07, HOC = -5.68166E+09, LiqDen = {105,0.51336,0.26824,587.65,0.29075,0}, VP = {101,168.4912,-11138.63,-22.13486,0.0000188399,2}, LiqCp = {16,71582,100.57,10.612,0.0050783,-0.0000024905}, HOV = {106,6.2916E+07,0.7446,-0.80882,0.80228,-0.33895}, VapCp = {16,116790,-588.34,13.412,0.000015201,-1.4561E-08}, LiqVis = {101,-11.837,1162,0.077237,-2.6336E-07,2}, VapVis = {102,3.2706E-07,0.5848,183.92,0.068678,0}, LiqK = {16,-0.1663,9.2848,-1.1068,-0.00028405,-0.0000007408}, VapK = {102,0.000038784,1.117,-185.06,177130,0}, Racketparam = 0.25, UniquacR = 6.5222, UniquacQ = 5.472, ChaoSeadAF = 0.412925, ChaoSeadSP = 15300, ChaoSeadLV = 0.179037); + end Fourmethyloctane; + + model Threeethylheptane + extends General_Properties( + SN = 249, name = "Threeethylheptane", CAS = "15869-80-4", Tc = 594.3, Pc = 2430000, Vc = 0.5213, Cc = 0.257, Tb = 416.35, Tm = 158.25, TT = 158.25, TP = 0.0000277743, MW = 128.255, LVB = 0.177515, AF = 0.407991, SP = 15300, DM = 0, SH = -1209000000.0, IGHF = -2.3146E+08, GEF = 2.494E+07, AS = 497400, HFMP = 1.6E+07, HOC = -5.6838E+09, LiqDen = {105,0.38578,0.23273,594.3,0.25158,0}, VP = {101,103.6653,-8269.445,-12.32292,0.000012256,2}, LiqCp = {16,29546,-3.2521,11.386,0.0045932,-0.0000035582}, HOV = {106,6.3311E+07,1.0505,-1.9581,2.2955,-0.98973}, VapCp = {16,137360,-689.88,13.586,-0.00018791,5.2355E-08}, LiqVis = {101,-11.279,1149.8,-0.019903,1.7111E-07,2}, VapVis = {102,0.0000007497,0.48637,340.94,-2876.9,0}, LiqK = {16,-0.038271,3.4169,-1.6847,-0.00052626,-0.0000013295}, VapK = {102,0.000030963,1.1527,-150.17,156710,0}, Racketparam = 0.257, UniquacR = 6.5222, UniquacQ = 5.472, ChaoSeadAF = 0.407991, ChaoSeadSP = 15300, ChaoSeadLV = 0.177515); + end Threeethylheptane; + + model TwoTwodimethylheptane + extends General_Properties( + SN = 250, name = "TwoTwodimethylheptane", CAS = "1071-26-7", Tc = 577.8, Pc = 2350000, Vc = 0.525, Cc = 0.257, Tb = 405.97, Tm = 160.15, TT = 160.15, TP = 0.000152983, MW = 128.258, LVB = 0.18151, AF = 0.383, SP = 14720, DM = 0, SH = -1209000000.0, IGHF = -2.461E+08, GEF = 1.79E+07, AS = 471800, HFMP = 8900000, HOC = -5.672E+09, LiqDen = {105,0.19929,0.16944,577.8,0.19098,0}, VP = {101,173.1768,-10891.65,-23.04354,0.0000217483,2}, LiqCp = {16,188490,-126.2,10.161,0.0065361,-0.0000033154}, HOV = {106,5.677584E+07,0.420266,0.0606766,-0.058971,-0.0565229}, VapCp = {16,119340,-582.53,13.386,0.000067675,-2.1229E-08}, LiqVis = {101,-11.654,1250.4,0.03445,-6.0618E-08,2}, VapVis = {102,8.0205E-07,0.4765,340.6,-3260.3,0}, LiqK = {16,-0.04961,4.5364,-1.657,-0.00038774,-0.0000014465}, VapK = {102,0.000023582,1.1966,-148.34,144910,0}, Racketparam = 0.257, UniquacR = 6.5215, UniquacQ = 5.552, ChaoSeadAF = 0.383, ChaoSeadSP = 14720, ChaoSeadLV = 0.18151); + end TwoTwodimethylheptane; + + model ThreeThreeFivetrimethylheptane + extends General_Properties( + SN = 251, name = "ThreeThreeFivetrimethylheptane", CAS = "7154-80-5", Tc = 609.6, Pc = 2320000, Vc = 0.564, Cc = 0.258, Tb = 428.83, Tm = 165, TT = 165, TP = 0.0000151957, MW = 142.285, LVB = 0.19248, AF = 0.383, SP = 15010, DM = 0, SH = -1209000000.0, IGHF = -2.588E+08, GEF = 3.23E+07, AS = 513420, HFMP = 1.4E+07, HOC = -6.2911E+09, LiqDen = {105,0.32798,0.22465,609.6,0.2413,0}, VP = {101,165.0702,-10873.83,-21.67781,0.0000174271,2}, LiqCp = {16,181900,88.778,8.7398,0.011239,-0.0000078705}, HOV = {106,5.692041E+07,-0.369689,2.788348,-3.430471,1.37842}, VapCp = {16,93450,-461.09,13.294,0.00031582,-1.0309E-07}, LiqVis = {101,-7.8795,1294.8,-0.60549,-4.2086E-07,2}, VapVis = {102,5.7085E-07,0.52829,329.98,-4470.2,0}, LiqK = {16,0.0037809,-39.052,-1.5072,-0.0019367,-8.6862E-07}, VapK = {102,0.000042493,1.1211,-89.298,167970,0}, Racketparam = 0.258, UniquacR = 7.1951, UniquacQ = 6.088, ChaoSeadAF = 0.383, ChaoSeadSP = 15010, ChaoSeadLV = 0.19248); + end ThreeThreeFivetrimethylheptane; + + model TwoTwodimethyloctane + extends General_Properties( + SN = 252, name = "TwoTwodimethyloctane", CAS = "15869-87-1", Tc = 602.4, Pc = 2110000, Vc = 0.5897, Cc = 0.248, Tb = 430.05, Tm = 0, TT = 0, TP = 0, MW = 142.282, LVB = 0.197405, AF = 0.428759, SP = 14870, DM = 0, SH = -1209000000.0, IGHF = -2.67E+08, GEF = 2.6E+07, AS = 511000, HFMP = 1.7E+07, HOC = -6.281E+09, LiqDen = {105,0.27519,0.20873,602.4,0.22241,0}, VP = {101,128.2162,-9736.787,-15.87938,0.0000121145,2}, LiqCp = {16,130180,214,8.9638,0.010626,-0.0000085091}, HOV = {106,6.2139E+07,0.81955,-1.4728,1.7846,-0.74179}, VapCp = {16,133300,-582.81,13.49,0.000049115,-1.5637E-08}, LiqVis = {101,-12.132,1337.2,0.10372,-1.6576E-07,2}, VapVis = {102,6.6483E-07,0.48953,292.37,276.07,0}, LiqK = {16,-0.054905,-9.2849,-1.513,-0.00077582,-8.6839E-07}, VapK = {102,0.000023992,1.186,-157.89,154490,0}, Racketparam = 0.248, UniquacR = 7.1959, UniquacQ = 6.092, ChaoSeadAF = 0.428759, ChaoSeadSP = 14870, ChaoSeadLV = 0.197405); + end TwoTwodimethyloctane; + + model Threemethylnonane + extends General_Properties( + SN = 253, name = "Threemethylnonane", CAS = "5911-04-6", Tc = 613.7, Pc = 2140000, Vc = 0.5904, Cc = 0.247, Tb = 440.95, Tm = 188.35, TT = 188.35, TP = 0.000565366, MW = 142.282, LVB = 0.195076, AF = 0.464925, SP = 15470, DM = 0, SH = -1209000000.0, IGHF = -2.544E+08, GEF = 2.88E+07, AS = 543900, HFMP = 1.88E+07, HOC = -6.291E+09, LiqDen = {105,0.19012,0.17319,613.7,0.19349,0}, VP = {101,90.738,-8476.8,-10.023,0.0000053448,2}, LiqCp = {16,78506,74.892,11.023,0.0040568,-0.0000015927}, HOV = {106,8.354164E+07,1.024481,-0.0908156,-1.228122,0.762381}, VapCp = {16,133050,-599.42,13.53,-0.000017353,-3.363E-09}, LiqVis = {101,-12.922,1267.3,0.28159,-8.3807E-07,2}, VapVis = {102,6.1879E-07,0.49638,289.26,-877.62,0}, LiqK = {16,-0.1781,10.557,-1.078,-0.00023148,-6.8221E-07}, VapK = {102,0.000033407,1.1338,-162.76,171650,0}, Racketparam = 0.247, UniquacR = 7.196599, UniquacQ = 6.012, ChaoSeadAF = 0.464925, ChaoSeadSP = 15470, ChaoSeadLV = 0.195076); + end Threemethylnonane; + + model Twomethylnonane + extends General_Properties( + SN = 254, name = "Twomethylnonane", CAS = "871-83-0", Tc = 621, Pc = 2050000, Vc = 0.601, Cc = 0.244, Tb = 440.15, Tm = 198.5, TT = 198.5, TP = 0.00248675, MW = 142.282, LVB = 0.196826, AF = 0.472342, SP = 15380, DM = 0, SH = -1209000000.0, IGHF = -2.5652E+08, GEF = 2.841E+07, AS = 538020, HFMP = 1.75E+07, HOC = -6.2888E+09, LiqDen = {105,0.2243,0.18661,621,0.23259,0}, VP = {101,133.13,-10462,-16.388,0.0000099287,2}, LiqCp = {16,-52606,80.981,11.786,0.0026831,-6.0448E-07}, HOV = {106,7.023987E+07,-0.879246,6.371272,-9.404583,4.418702}, VapCp = {16,137030,-599.28,13.509,0.0000018563,-1.0781E-08}, LiqVis = {101,-3.1519,949.54,-1.2725,0.0000012986,2}, VapVis = {102,9.2127E-07,0.44292,352.44,-1163.9,0}, LiqK = {16,-0.16513,15.121,-1.1582,-0.00011252,-0.0000008534}, VapK = {102,0.000030641,1.1437,-171.78,168770,0}, Racketparam = 0.244, UniquacR = 7.196599, UniquacQ = 6.012, ChaoSeadAF = 0.472342, ChaoSeadSP = 15380, ChaoSeadLV = 0.196826); + end Twomethylnonane; + + model Fourmethylnonane + extends General_Properties( + SN = 255, name = "Fourmethylnonane", CAS = "17301-94-9", Tc = 613.7, Pc = 2140000, Vc = 0.5904, Cc = 0.248, Tb = 438.85, Tm = 174.45, TT = 174.45, TP = 0.000108068, MW = 142.282, LVB = 0.195426, AF = 0.465073, SP = 15500, DM = 0, SH = -1209000000.0, IGHF = -2.547E+08, GEF = 2.89E+07, AS = 541900, HFMP = 1.52E+07, HOC = -6.291E+09, LiqDen = {105,0.046753,0.085687,613.7,0.13909,0}, VP = {101,143.6866,-10632.15,-18.17547,0.0000137486,2}, LiqCp = {16,41953,56.5,11.484,0.0029861,-0.0000006055}, HOV = {106,6.2873E+07,0.39496,-0.054115,0.081779,-0.040701}, VapCp = {16,130820,-589.61,13.519,-0.0000013811,-1.0182E-08}, LiqVis = {101,-8.7174,1148.5,-0.42278,0.000000818,2}, VapVis = {102,5.0899E-07,0.5228,260.59,-971.93,0}, LiqK = {16,-0.16198,12.531,-1.1439,-0.00019006,-7.9079E-07}, VapK = {102,0.000039332,1.1131,-152.11,174490,0}, Racketparam = 0.248, UniquacR = 7.196599, UniquacQ = 6.012, ChaoSeadAF = 0.465073, ChaoSeadSP = 15500, ChaoSeadLV = 0.195426); + end Fourmethylnonane; + + model Fivemethylnonane + extends General_Properties( + SN = 256, name = "Fivemethylnonane", CAS = "15869-85-9", Tc = 609.6, Pc = 2140000, Vc = 0.5904, Cc = 0.248, Tb = 438.25, Tm = 186, TT = 185.45, TP = 0.000438465, MW = 142.282, LVB = 0.195298, AF = 0.456177, SP = 15440, DM = 0, SH = -1209000000.0, IGHF = -2.5472E+08, GEF = 3.06E+07, AS = 536500, HFMP = 1.66E+07, HOC = -6.291E+09, LiqDen = {105,0.41463,0.2529,610.01,0.28051,0}, VP = {101,215.6392,-13712.31,-29.15861,0.0000236309,2}, LiqCp = {16,230160,-61.977,9.1603,0.0096645,-0.0000061376}, HOV = {106,6.5588E+07,0.029762,1.6061,-2.0417,0.80324}, VapCp = {16,131700,-594.98,13.529,-0.000014234,-5.0987E-09}, LiqVis = {101,-13.838,1303.8,0.41828,-8.7942E-07,2}, VapVis = {102,5.7631E-07,0.50736,283.05,-1279.5,0}, LiqK = {16,-0.183,10.49,-1.0698,-0.00021616,-6.8913E-07}, VapK = {102,0.00003614,1.1239,-159.13,172680,0}, Racketparam = 0.248, UniquacR = 7.196599, UniquacQ = 6.012, ChaoSeadAF = 0.456177, ChaoSeadSP = 15440, ChaoSeadLV = 0.195298); + end Fivemethylnonane; + + model CisTwohexene + extends General_Properties( + SN = 257, name = "CisTwohexene", CAS = "7688-21-3", Tc = 511.4, Pc = 3160000, Vc = 0.345, Cc = 0.256, Tb = 342.03, Tm = 132, TT = 132.03, TP = 0.000232, MW = 84.1595, LVB = 0.1234, AF = 0.287374, SP = 15360, DM = 1.015E-30, SH = -1209000000.0, IGHF = -4.856E+07, GEF = 8.025E+07, AS = 386500, HFMP = 8857530, HOC = -3.728E+09, LiqDen = {105,0.77464,0.2672,511.4,0.28571,0}, VP = {101,104.3995,-6791.221,-12.84602,0.0000165576,2}, LiqCp = {16,135610,570.7,1.6392,0.033591,-0.000032605}, HOV = {106,4.9E+07,1.281,-2.4971,2.499,-0.86824}, VapCp = {16,88576,-789.82,13.286,-0.00034537,1.0091E-07}, LiqVis = {101,-10.864,787.8,0.0025561,-7.6676E-08,2}, VapVis = {102,3.6061E-08,0.91362,-8.4415,1515.2,0}, LiqK = {16,-0.038625,3.4165,-1.4421,-0.00078927,-0.0000017176}, VapK = {102,0.000053674,1.0887,-86.934,155330,0}, Racketparam = 0.256, UniquacR = 4.2677, UniquacQ = 3.643, ChaoSeadAF = 0.287374, ChaoSeadSP = 15360, ChaoSeadLV = 0.1234); + end CisTwohexene; + + model TransTwohexene + extends General_Properties( + SN = 258, name = "TransTwohexene", CAS = "4050-45-7", Tc = 509.8, Pc = 3168000, Vc = 0.345, Cc = 0.258, Tb = 341.02, Tm = 140.17, TT = 140.17, TP = 0.00179, MW = 84.1595, LVB = 0.125, AF = 0.288635, SP = 15250, DM = 0, SH = -1209000000.0, IGHF = -5.381E+07, GEF = 7.675E+07, AS = 380600, HFMP = 8255030, HOC = -3.72648E+09, LiqDen = {105,0.7854,0.271,509.8,0.28571,0}, VP = {101,102.7613,-6858.249,-12.46469,0.0000134849,2}, LiqCp = {16,145330,591.61,0.45085,0.040176,-0.000043449}, HOV = {106,4.402196E+07,0.563356,-0.497314,0.306975,0.0161359}, VapCp = {16,96839,-758.81,13.112,-0.00018911,4.7057E-08}, LiqVis = {101,-11.296,798.85,0.074688,-2.5765E-07,2}, VapVis = {102,3.5985E-08,0.91455,-9.2013,1687.6,0}, LiqK = {16,-0.091076,-0.14352,-1.1963,-0.00093801,-0.0000007123}, VapK = {102,0.000094853,1.0175,2.8366,154410,0}, Racketparam = 0.258, UniquacR = 4.2677, UniquacQ = 3.643, ChaoSeadAF = 0.288635, ChaoSeadSP = 15250, ChaoSeadLV = 0.125); + end TransTwohexene; + + model Oneoctene + extends General_Properties( + SN = 259, name = "Oneoctene", CAS = "111-66-0", Tc = 567, Pc = 2680000, Vc = 0.468, Cc = 0.266, Tb = 394.44, Tm = 171.45, TT = 171.45, TP = 0.00298, MW = 112.215, LVB = 0.15785, AF = 0.393, SP = 15540, DM = 1.4E-30, SH = -1209000000.0, IGHF = -8.194E+07, GEF = 1.057E+08, AS = 463700, HFMP = 1.531E+07, HOC = -4.961E+09, LiqDen = {105,0.44684,0.23463,567,0.24846,0}, VP = {101,177.7155,-11137.29,-23.58923,0.000019592,2}, LiqCp = {16,-24253,87.834,11.35,0.0032002,-0.0000012467}, HOV = {106,5.7062E+07,0.3453,0.41628,-0.36125,-0.059539}, VapCp = {16,106430,-593.77,13.154,0.00006689,-2.6274E-08}, LiqVis = {101,-5.8042,945.32,-0.93827,0.0000032767,2}, VapVis = {102,0.000047664,0.084052,3514.6,21127,0}, LiqK = {16,0.035226,40.754,-2.2668,0.00092297,-0.0000060301}, VapK = {102,0.000014109,1.354,610.51,-30915,0}, Racketparam = 0.266, UniquacR = 5.6185, UniquacQ = 4.724, ChaoSeadAF = 0.393, ChaoSeadSP = 15540, ChaoSeadLV = 0.15785); + end Oneoctene; + + model Onenonene + extends General_Properties( + SN = 260, name = "Onenonene", CAS = "124-11-8", Tc = 594, Pc = 2330000, Vc = 0.526, Cc = 0.248, Tb = 420.03, Tm = 191.91, TT = 191.91, TP = 0.0204, MW = 126.242, LVB = 0.17405, AF = 0.411, SP = 15500, DM = 2.0E-30, SH = -1209000000.0, IGHF = -1.035E+08, GEF = 1.123E+08, AS = 504100, HFMP = 1.9359E+07, HOC = -5.5716E+09, LiqDen = {105,0.18062,0.15802,594,0.18969,0}, VP = {101,120.37,-9418.7,-14.583,0.0000094863,2}, LiqCp = {16,58309,119.15,10.75,0.0042025,-0.0000015805}, HOV = {106,5.0729E+07,-0.72017,3.2276,-3.6347,1.4659}, VapCp = {16,122350,-622.4,13.352,-0.000015236,-2.3169E-10}, LiqVis = {101,-10.296,1057.3,-0.12431,2.0281E-07,2}, VapVis = {102,7.2319E-08,0.81707,155.31,-12572,0}, LiqK = {16,0.024602,-118.29,-0.40946,-0.0056136,0.0000021909}, VapK = {102,0.000019761,1.2983,563.96,24829,0}, Racketparam = 0.248, UniquacR = 6.2929, UniquacQ = 5.264, ChaoSeadAF = 0.411, ChaoSeadSP = 15500, ChaoSeadLV = 0.17405); + end Onenonene; + + model Oneundecene + extends General_Properties( + SN = 261, name = "Oneundecene", CAS = "821-95-4", Tc = 637.8, Pc = 2044000, Vc = 0.657, Cc = 0.253, Tb = 465.82, Tm = 223.99, TT = 223.99, TP = 0.0473, MW = 154.292, LVB = 0.2065, AF = 0.522466, SP = 15680, DM = 1.8E-30, SH = -1209000000.0, IGHF = -1.449E+08, GEF = 1.283E+08, AS = 582180, HFMP = 1.699E+07, HOC = -6.7878E+09, LiqDen = {105,0.38001,0.24991,637.8,0.28571,0}, VP = {101,93.64799,-9306.494,-10.26144,4.149832E-06,2}, LiqCp = {16,99868,144.48,10.69,0.0042614,-0.0000010791}, HOV = {106,2.3696E+07,-6.3933,18.084,-19.033,7.4719}, VapCp = {16,138670,-549.63,13.4,0.00014861,-5.2026E-08}, LiqVis = {101,-49.01257,2643.166,5.957949,-8.451873E-06,2}, VapVis = {102,5.0406E-08,0.85093,112.38,-8900.1,0}, LiqK = {16,0.067847,-250.41,0.40201,-0.0082828,0.0000014058}, VapK = {102,0.000018335,1.3031,709.58,-2804.6,0}, Racketparam = 0.253, UniquacR = 7.6417, UniquacQ = 6.344, ChaoSeadAF = 0.522466, ChaoSeadSP = 15680, ChaoSeadLV = 0.2065); + end Oneundecene; + + model TwomethylOnepentene + extends General_Properties( + SN = 262, name = "TwomethylOnepentene", CAS = "763-29-1", Tc = 507, Pc = 3160000, Vc = 0.359, Cc = 0.261, Tb = 335.26, Tm = 137.43, TT = 137.42, TP = 0.000805463, MW = 84.1595, LVB = 0.124649, AF = 0.261138, SP = 15070, DM = 1.89E-30, SH = -1209000000.0, IGHF = -5.22581E+07, GEF = 7.2969E+07, AS = 374000, HFMP = 7029120, HOC = -3.72209E+09, LiqDen = {105,0.13372,0.11276,507,0.1472,0}, VP = {101,85.161,-6171.1,-9.6632,0.0000085639,2}, LiqCp = {16,173630,-41311,386.78,-1.1602,0.0012063}, HOV = {106,5.397303E+07,1.23932,-1.433928,0.797889,-0.142823}, VapCp = {16,92049,-683.66,13.009,-0.000089454,1.0969E-08}, LiqVis = {101,-11.406,797.71,0.099228,-5.3373E-07,2}, VapVis = {102,6.3076E-07,0.52447,272.22,-3046.8,0}, LiqK = {16,-0.026056,4.3913,-1.6749,-0.00048682,-0.0000023385}, VapK = {102,0.000074858,1.0485,-32.169,140340,0}, Racketparam = 0.261, UniquacR = 4.2689, UniquacQ = 3.64, ChaoSeadAF = 0.261138, ChaoSeadSP = 15070, ChaoSeadLV = 0.124649); + end TwomethylOnepentene; + + model FourmethylcisTwopentene + extends General_Properties( + SN = 263, name = "FourmethylcisTwopentene", CAS = "691-38-3", Tc = 499, Pc = 3220000, Vc = 0.346, Cc = 0.269, Tb = 329.53, Tm = 138.72, TT = 138.3, TP = 0.00215772, MW = 84.1595, LVB = 0.126648, AF = 0.244178, SP = 14610, DM = 7.18E-31, SH = -1209000000.0, IGHF = -5.03335E+07, GEF = 7.69856E+07, AS = 373338, HFMP = 7363840, HOC = -3.72502E+09, LiqDen = {105,0.77793,0.27017,499,0.2861,0}, VP = {101,83.573,-5993.9,-9.4501,0.0000085686,2}, LiqCp = {16,-59803,-16.203,11.773,0.0034333,-0.0000037581}, HOV = {106,5.4227E+07,1.5628,-2.6171,2.4298,-0.92758}, VapCp = {16,101130,-861.95,13.463,-0.00060529,2.0212E-07}, LiqVis = {101,-11.752,820.42,0.14056,-7.3435E-07,2}, VapVis = {102,6.3021E-07,0.52941,268.94,16.597,0}, LiqK = {16,-0.050868,4.0553,-1.554,-0.00045968,-0.000001981}, VapK = {102,0.000052516,1.0978,-60.883,128130,0}, Racketparam = 0.269, UniquacR = 4.2669, UniquacQ = 3.639, ChaoSeadAF = 0.244178, ChaoSeadSP = 14610, ChaoSeadLV = 0.126648); + end FourmethylcisTwopentene; + + model FourmethyltransTwopentene + extends General_Properties( + SN = 264, name = "FourmethyltransTwopentene", CAS = "674-76-0", Tc = 501, Pc = 3220000, Vc = 0.346, Cc = 0.267, Tb = 331.76, Tm = 132.36, TT = 132.35, TP = 0.000344783, MW = 84.1595, LVB = 0.126739, AF = 0.255237, SP = 14730, DM = 3.63E-31, SH = -1209000000.0, IGHF = -5.43501E+07, GEF = 7.43497E+07, AS = 368390, HFMP = 7154640, HOC = -3.7205E+09, LiqDen = {105,0.77321,0.26966,501,0.28578,0}, VP = {101,81.691,-5972.8,-9.1408,0.0000081285,2}, LiqCp = {16,22279,6.5061,10.859,0.0058182,-0.000006387}, HOV = {106,5.3985E+07,1.4966,-2.4784,2.2857,-0.85991}, VapCp = {16,95377,-622.83,12.814,0.000074545,-3.6318E-08}, LiqVis = {101,-11.038,805.55,0.01464,-7.2359E-08,2}, VapVis = {102,7.4971E-07,0.50587,292.11,780.77,0}, LiqK = {16,-0.02241,4.5423,-1.7038,-0.00048445,-0.0000024834}, VapK = {102,0.000062348,1.0772,-17.479,116240,0}, Racketparam = 0.267, UniquacR = 4.2669, UniquacQ = 3.639, ChaoSeadAF = 0.255237, ChaoSeadSP = 14730, ChaoSeadLV = 0.126739); + end FourmethyltransTwopentene; + + model Cyclohexene + extends General_Properties( + SN = 265, name = "Cyclohexene", CAS = "110-83-8", Tc = 560.42, Pc = 4350000, Vc = 0.291, Cc = 0.272, Tb = 356.12, Tm = 169.67, TT = 169.67, TP = 0.103772, MW = 82.1436, LVB = 0.101877, AF = 0.212302, SP = 17420, DM = 1.83E-30, SH = -1209000000.0, IGHF = -4520000, GEF = 1.077E+08, AS = 310750, HFMP = 3290000, HOC = -3.532E+09, LiqDen = {105,0.807,0.25253,560.42,0.26738,0}, VP = {101,82.052,-6388.7,-9.1035,0.0000071317,2}, LiqCp = {16,97738,2.3363,7.7626,0.013772,-0.000011653}, HOV = {106,5.794402E+07,1.587579,-2.225474,1.109627,0.041589}, VapCp = {16,48919,-644.33,13.16,-0.0002758,9.0717E-08}, LiqVis = {101,-11.901,1159.3,0.11228,-1.9651E-07,2}, VapVis = {102,0.0000013322,0.45371,444.45,117.38,0}, LiqK = {16,0.11174,816.81,-14.373,0.055987,-0.00010104}, VapK = {102,0.000094336,1.0783,568.3,34471,0}, Racketparam = 0.272, UniquacR = 3.8143, UniquacQ = 3.027, ChaoSeadAF = 0.212302, ChaoSeadSP = 17420, ChaoSeadLV = 0.101877); + end Cyclohexene; + + model OneOnedimethylcyclopentane + extends General_Properties( + SN = 266, name = "OneOnedimethylcyclopentane", CAS = "1638-26-2", Tc = 547, Pc = 3445000, Vc = 0.36, Cc = 0.273, Tb = 361, Tm = 203.36, TT = 203.68, TP = 9.04909, MW = 98.1861, LVB = 0.130925, AF = 0.272354, SP = 15460, DM = 0, SH = -1209000000.0, IGHF = -1.3828E+08, GEF = 3.9037E+07, AS = 359280, HFMP = 1080000, HOC = -4.2752E+09, LiqDen = {105,0.77031,0.27731,547,0.30161,0}, VP = {101,80.69439,-6444.768,-8.840923,5.777915E-06,2}, LiqCp = {16,63403,-76.912,11.112,0.0033685,-0.0000013786}, HOV = {106,6.4753E+07,1.835,-2.4221,1.0097,0.083052}, VapCp = {16,84040,-831.97,13.78,-0.00060484,0.0000001825}, LiqVis = {101,-7.8132,901.76,-0.51373,0.0000011607,2}, VapVis = {102,0.0000055348,0.28035,888.45,60.9,0}, LiqK = {16,-0.012548,-26.729,-1.3811,-0.0017046,-8.8213E-07}, VapK = {102,0.0025566,0.60638,165.73,477660,0}, Racketparam = 0.273, UniquacR = 4.7193, UniquacQ = 3.856, ChaoSeadAF = 0.272354, ChaoSeadSP = 15460, ChaoSeadLV = 0.130925); + end OneOnedimethylcyclopentane; + + model CisOneTwodimethylcyclopentane + extends General_Properties( + SN = 267, name = "CisOneTwodimethylcyclopentane", CAS = "1192-18-3", Tc = 565.15, Pc = 3445050, Vc = 0.37, Cc = 0.271, Tb = 372.68, Tm = 219.26, TT = 219.26, TP = 24.1041, MW = 98.1861, LVB = 0.127822, AF = 0.2692, SP = 16160, DM = 0, SH = -1209000000.0, IGHF = -1.29453E+08, GEF = 4.58148E+07, AS = 366142, HFMP = 1657280, HOC = -4.28203E+09, LiqDen = {105,0.72465,0.26829,565.15,0.28378,0}, VP = {101,88.755,-6920,-10.09,0.0000077797,2}, LiqCp = {16,91966,30.661,9.7483,0.0064492,-0.0000032985}, HOV = {106,5.8904E+07,1.2615,-1.6517,1.1747,-0.3566}, VapCp = {16,85421,-827.36,13.75,-0.00058187,1.7604E-07}, LiqVis = {101,-30.744,1578.9,3.2397,-0.0000069313,2}, VapVis = {102,5.0794E-07,0.561,243.58,7280.5,0}, LiqK = {16,-0.014002,-51.607,-1.1286,-0.0024368,4.2617E-08}, VapK = {102,0.011269,0.40836,151.71,760020,0}, Racketparam = 0.271, UniquacR = 4.7192, UniquacQ = 3.772, ChaoSeadAF = 0.2692, ChaoSeadSP = 16160, ChaoSeadLV = 0.127822); + end CisOneTwodimethylcyclopentane; + + model TransOneTwodimethylcyclopentane + extends General_Properties( + SN = 268, name = "TransOneTwodimethylcyclopentane", CAS = "822-50-4", Tc = 553.15, Pc = 3445050, Vc = 0.36, Cc = 0.27, Tb = 365.02, Tm = 155.58, TT = 155.58, TP = 0.00329595, MW = 98.1861, LVB = 0.131474, AF = 0.2692, SP = 15760, DM = 0, SH = -1209000000.0, IGHF = -1.36566E+08, GEF = 3.84928E+07, AS = 366811, HFMP = 7167190, HOC = -4.27609E+09, LiqDen = {105,0.77149,0.27784,553.15,0.30964,0}, VP = {101,89.97,-6815.6,-10.323,0.000008493,2}, LiqCp = {16,-27570,-6.4733,11.325,0.0043522,-0.0000035776}, HOV = {106,5.4143E+07,0.72069,0.072069,-0.93971,0.57146}, VapCp = {16,86316,-831.39,13.757,-0.0005975,1.8263E-07}, LiqVis = {101,-10.501,979.94,-0.073247,2.6464E-07,2}, VapVis = {102,0.0000015301,0.42849,479.07,3.9541,0}, LiqK = {16,-0.028286,5.044,-1.6594,-0.00043322,-0.000001941}, VapK = {102,0.0087025,0.4463,190.1,689820,0}, Racketparam = 0.27, UniquacR = 4.7192, UniquacQ = 3.772, ChaoSeadAF = 0.2692, ChaoSeadSP = 15760, ChaoSeadLV = 0.131474); + end TransOneTwodimethylcyclopentane; + + model CisOneThreedimethylcyclopentane + extends General_Properties( + SN = 269, name = "CisOneThreedimethylcyclopentane", CAS = "2532-58-3", Tc = 551, Pc = 3400000, Vc = 0.3633, Cc = 0.277, Tb = 364.71, Tm = 139.45, TT = 139.45, TP = 0.000172698, MW = 98.188, LVB = 0.13191, AF = 0.276, SP = 15490, DM = 0, SH = -1209000000.0, IGHF = -1.3585E+08, GEF = 3.9204E+07, AS = 366810, HFMP = 7397000, HOC = -4.2771E+09, LiqDen = {105,0.77224,0.27858,551,0.31293,0}, VP = {101,59.262,-5561.3,-5.5932,0.0000039124,2}, LiqCp = {16,65786,-81.345,11.138,0.0032931,-0.0000013405}, HOV = {106,5.964754E+07,1.992198,-3.906039,3.442342,-1.064932}, VapCp = {16,86318,-831.43,13.758,-0.00059782,1.8276E-07}, LiqVis = {101,-11.311,1000.6,0.063555,-2.0388E-07,2}, VapVis = {102,4.8359E-07,0.57388,271.6,-5017.7,0}, LiqK = {16,-0.041732,3.5995,-1.581,-0.00048911,-0.0000016476}, VapK = {102,0.0021721,0.62882,203.61,446440,0}, Racketparam = 0.277, UniquacR = 4.7192, UniquacQ = 3.772, ChaoSeadAF = 0.276, ChaoSeadSP = 15490, ChaoSeadLV = 0.13191); + end CisOneThreedimethylcyclopentane; + + model TransOneThreedimethylcyclopentane + extends General_Properties( + SN = 270, name = "TransOneThreedimethylcyclopentane", CAS = "1759-58-6", Tc = 553, Pc = 3400000, Vc = 0.3633, Cc = 0.276, Tb = 363.9, Tm = 139.18, TT = 139.18, TP = 0.0000437759, MW = 98.188, LVB = 0.13264, AF = 0.253, SP = 15660, DM = 0, SH = -1209000000.0, IGHF = -1.336E+08, GEF = 4.1463E+07, AS = 366810, HFMP = 7398000, HOC = -4.279E+09, LiqDen = {105,0.77915,0.2805,553,0.30466,0}, VP = {101,72.714,-6038.9,-7.709,0.0000063511,2}, LiqCp = {16,128140,215.87,5.2004,0.02446,-0.000024789}, HOV = {106,6.568557E+07,1.547069,-1.429715,-0.00159084,0.362451}, VapCp = {16,86318,-831.43,13.758,-0.00059782,1.8276E-07}, LiqVis = {101,-11.152,996.91,0.036374,-1.1545E-07,2}, VapVis = {102,0.0000007023,0.52532,331.02,-5427.4,0}, LiqK = {16,-0.034026,3.551,-1.6156,-0.00049883,-0.0000017475}, VapK = {102,0.0021472,0.63073,213.01,445470,0}, Racketparam = 0.276, UniquacR = 4.7192, UniquacQ = 3.772, ChaoSeadAF = 0.253, ChaoSeadSP = 15660, ChaoSeadLV = 0.13264); + end TransOneThreedimethylcyclopentane; + + model Isopropylcyclopentane + extends General_Properties( + SN = 271, name = "Isopropylcyclopentane", CAS = "3875-51-2", Tc = 601, Pc = 3000000, Vc = 0.422, Cc = 0.259, Tb = 399.58, Tm = 161.79, TT = 161.79, TP = 0.000981869, MW = 112.213, LVB = 0.14527, AF = 0.302996, SP = 15940, DM = 0, SH = -1209000000.0, IGHF = -1.5071E+08, GEF = 5.305E+07, AS = 407080, HFMP = 1.041E+07, HOC = -4.8944E+09, LiqDen = {105,0.01997,0.048466,601,0.10484,0}, VP = {101,70.74905,-6671.509,-7.204875,3.983606E-06,2}, LiqCp = {16,77318,-174.75,11.36,0.00375,-0.0000015189}, HOV = {106,5.807013E+07,1.420456,-3.256998,3.923183,-1.686337}, VapCp = {16,31291,-392.29,12.88,0.0005799,-2.3026E-07}, LiqVis = {101,-11.637,1116.2,0.10394,-3.9216E-07,2}, VapVis = {102,6.3283E-08,0.84204,92.528,-7299.5,0}, LiqK = {16,-0.057129,3.4704,-1.5201,-0.00050193,-0.0000011418}, VapK = {102,0.10336,0.072913,-474.32,1330800,0}, Racketparam = 0.259, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.302996, ChaoSeadSP = 15940, ChaoSeadLV = 0.14527); + end Isopropylcyclopentane; + + model OnemethylOneethylcyclopentane + extends General_Properties( + SN = 272, name = "OnemethylOneethylcyclopentane", CAS = "16747-50-5", Tc = 582, Pc = 3020000, Vc = 0.428, Cc = 0.267, Tb = 394.672, Tm = 129.35, TT = 129.35, TP = 2.16711E-07, MW = 112.213, LVB = 0.144502, AF = 0.329811, SP = 15840, DM = 0, SH = -1209000000.0, IGHF = -1.549E+08, GEF = 5.067E+07, AS = 401000, HFMP = 0, HOC = -4.88921E+09, LiqDen = {105,0.62398,0.26553,582,0.28568,0}, VP = {101,70.30095,-6628.265,-7.112201,3.497931E-06,2}, LiqCp = {16,96111,-59.039,10.164,0.0078449,-0.0000067267}, HOV = {106,5.14848E+07,0.288357,0.487845,-0.669561,0.236062}, VapCp = {16,80936,-652.6,13.464,-0.00013102,2.6661E-08}, LiqVis = {101,-10.773,1099.9,-0.048343,1.7107E-07,2}, VapVis = {102,4.5602E-07,0.57042,274.82,-5055.3,0}, LiqK = {16,-0.0033033,9.4359,-1.8646,-0.00027,-0.0000024258}, VapK = {102,0.0026462,0.59802,270.85,473470,0}, Racketparam = 0.267, UniquacR = 5.3937, UniquacQ = 4.396, ChaoSeadAF = 0.329811, ChaoSeadSP = 15840, ChaoSeadLV = 0.144502); + end OnemethylOneethylcyclopentane; + + model Nbutylcyclopentane + extends General_Properties( + SN = 273, name = "Nbutylcyclopentane", CAS = "2040-95-1", Tc = 621, Pc = 2710000, Vc = 0.482, Cc = 0.254, Tb = 429.75, Tm = 165.165, TT = 165.18, TP = 0.0000370087, MW = 126.239, LVB = 0.161572, AF = 0.37188, SP = 16390, DM = 0, SH = -1209000000.0, IGHF = -1.683E+08, GEF = 6.217E+07, AS = 453800, HFMP = 1.131E+07, HOC = -5.5037E+09, LiqDen = {105,0.55321,0.26684,621,0.28873,0}, VP = {101,59.57026,-7247.203,-5.051393,-2.973642E-06,2}, LiqCp = {16,165400,317.8,5.7051,0.0202,-0.000017103}, HOV = {106,5.633912E+07,-0.222347,2.054738,-2.396364,0.924309}, VapCp = {16,82154,-554.7,13.299,0.00015408,-5.7536E-08}, LiqVis = {101,-10.446,1200.4,-0.12541,4.6316E-07,2}, VapVis = {102,0.0000029081,0.33269,700.46,-5220.4,0}, LiqK = {16,-0.059329,3.6894,-1.5397,-0.00046539,-0.0000010217}, VapK = {102,0.001615,0.65033,212.05,447790,0}, Racketparam = 0.254, UniquacR = 6.068799, UniquacQ = 4.856, ChaoSeadAF = 0.37188, ChaoSeadSP = 16390, ChaoSeadLV = 0.161572); + end Nbutylcyclopentane; + + model OneOnedimethylcyclohexane + extends General_Properties( + SN = 274, name = "OneOnedimethylcyclohexane", CAS = "590-66-9", Tc = 591.15, Pc = 2938430, Vc = 0.45, Cc = 0.269, Tb = 392.69, Tm = 239.66, TT = 239.66, TP = 60.5841, MW = 112.213, LVB = 0.144469, AF = 0.2376, SP = 15670, DM = 0, SH = -1209000000.0, IGHF = -1.81E+08, GEF = 3.52293E+07, AS = 365012, HFMP = 2020870, HOC = -4.8639E+09, LiqDen = {105,0.55073,0.24971,591.15,0.27534,0}, VP = {101,81.518,-6942.5,-8.9,0.0000054941,2}, LiqCp = {16,108760,-1.4419,9.7271,0.0071596,-0.0000038148}, HOV = {106,7.5815E+07,2.7664,-6.0218,6.1598,-2.4093}, VapCp = {16,97627,-847.07,13.952,-0.00053736,1.4024E-07}, LiqVis = {101,-7.7034,1042.4,-0.53177,8.3765E-07,2}, VapVis = {102,7.8141E-07,0.4995,371.04,124.2,0}, LiqK = {16,-0.0057011,-80.549,-0.98212,-0.0030094,4.8733E-07}, VapK = {102,0.01079,0.39433,-74.36,805370,0}, Racketparam = 0.269, UniquacR = 5.3937, UniquacQ = 4.396, ChaoSeadAF = 0.2376, ChaoSeadSP = 15670, ChaoSeadLV = 0.144469); + end OneOnedimethylcyclohexane; + + model CisOneTwodimethylcyclohexane + extends General_Properties( + SN = 275, name = "CisOneTwodimethylcyclohexane", CAS = "2207-01-4", Tc = 606.15, Pc = 2938430, Vc = 0.46, Cc = 0.268, Tb = 402.94, Tm = 223.16, TT = 223.16, TP = 6.41394, MW = 112.213, LVB = 0.141645, AF = 0.2363, SP = 16250, DM = 0, SH = -1209000000.0, IGHF = -1.72172E+08, GEF = 4.12124E+07, AS = 374510, HFMP = 1645150, HOC = -4.87084E+09, LiqDen = {105,0.52003,0.24148,606.15,0.2655,0}, VP = {101,79.675,-7110.6,-8.5422,0.0000045741,2}, LiqCp = {16,111710,52.625,9.3729,0.0077553,-0.0000040932}, HOV = {106,6.6247E+07,1.824,-3.744,3.9502,-1.5633}, VapCp = {16,99210,-835.35,13.925,-0.00054754,1.5043E-07}, LiqVis = {101,-12.312,1465.3,0.097955,-4.4792E-07,2}, VapVis = {102,8.4568E-07,0.48702,397.94,11.816,0}, LiqK = {16,-0.013234,-31.366,-1.3892,-0.0016087,-0.0000006162}, VapK = {102,0.015824,0.34516,-25.388,892770,0}, Racketparam = 0.268, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2363, ChaoSeadSP = 16250, ChaoSeadLV = 0.141645); + end CisOneTwodimethylcyclohexane; + + model TransOneTwodimethylcyclohexane + extends General_Properties( + SN = 276, name = "TransOneTwodimethylcyclohexane", CAS = "6876-23-9", Tc = 596.15, Pc = 2938430, Vc = 0.46, Cc = 0.273, Tb = 396.58, Tm = 184.99, TT = 184.99, TP = 0.0803872, MW = 112.213, LVB = 0.145347, AF = 0.2416, SP = 15780, DM = 0, SH = -1209000000.0, IGHF = -1.79996E+08, GEF = 3.44761E+07, AS = 370912, HFMP = 1.04223E+07, HOC = -4.86436E+09, LiqDen = {105,0.54418,0.25029,596.15,0.26582,0}, VP = {101,78.951,-6905.8,-8.4915,0.0000050406,2}, LiqCp = {16,107760,95.278,8.9456,0.0091345,-0.000005166}, HOV = {106,6.3964E+07,1.6946,-3.2086,3.1663,-1.1947}, VapCp = {16,97739,-799.79,13.856,-0.00049041,1.3436E-07}, LiqVis = {101,-9.8695,1124.4,-0.19468,4.6083E-07,2}, VapVis = {102,0.0000004616,0.56409,251.76,9969.9,0}, LiqK = {16,-0.096966,-4.6856,-1.2678,-0.00075424,-4.7962E-07}, VapK = {102,0.014659,0.3596,28.311,846250,0}, Racketparam = 0.273, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2416, ChaoSeadSP = 15780, ChaoSeadLV = 0.145347); + end TransOneTwodimethylcyclohexane; + + model CisOneThreedimethylcyclohexane + extends General_Properties( + SN = 277, name = "CisOneThreedimethylcyclohexane", CAS = "638-04-0", Tc = 591.15, Pc = 2938430, Vc = 0.45, Cc = 0.269, Tb = 393.24, Tm = 197.61, TT = 197.58, TP = 0.562747, MW = 112.213, LVB = 0.147281, AF = 0.2414, SP = 15640, DM = 0, SH = -1209000000.0, IGHF = -1.84765E+08, GEF = 2.98319E+07, AS = 370451, HFMP = 1.08211E+07, HOC = -4.85972E+09, LiqDen = {105,0.56146,0.25431,591.15,0.28196,0}, VP = {101,80.304,-6952.9,-8.6838,0.000005071,2}, LiqCp = {16,91638,67.51,9.6813,0.0069535,-0.0000034278}, HOV = {106,6.8345E+07,2.0984,-4.3187,4.4054,-1.7047}, VapCp = {16,100690,-836.69,13.908,-0.00051206,1.3582E-07}, LiqVis = {101,-19.068,1358.3,1.3526,-0.0000038202,2}, VapVis = {102,0.0000012434,0.44274,472.75,75.213,0}, LiqK = {16,-0.04198,-3.8682,-1.5284,-0.00074068,-0.0000011056}, VapK = {102,0.015195,0.35206,-46.167,870770,0}, Racketparam = 0.269, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2414, ChaoSeadSP = 15640, ChaoSeadLV = 0.147281); + end CisOneThreedimethylcyclohexane; + + model TransOneThreedimethylcyclohexane + extends General_Properties( + SN = 278, name = "TransOneThreedimethylcyclohexane", CAS = "2207-03-6", Tc = 598.15, Pc = 2938430, Vc = 0.46, Cc = 0.272, Tb = 397.61, Tm = 183.07, TT = 183.05, TP = 0.0422148, MW = 112.213, LVB = 0.143768, AF = 0.2356, SP = 16040, DM = 0, SH = -1209000000.0, IGHF = -1.76565E+08, GEF = 3.63171E+07, AS = 376225, HFMP = 9865870, HOC = -4.86695E+09, LiqDen = {105,0.51304,0.23992,598.15,0.27441,0}, VP = {101,80.341,-7070.2,-8.6503,0.0000047054,2}, LiqCp = {16,121960,76.643,8.8176,0.0095602,-0.0000057205}, HOV = {106,6.9382E+07,2.1184,-4.4766,4.6776,-1.8318}, VapCp = {16,101700,-844.25,13.931,-0.00056374,1.5762E-07}, LiqVis = {101,-10.854,1074.4,-0.03203,4.561E-08,2}, VapVis = {102,0.0000023976,0.3653,664.66,3836.7,0}, LiqK = {16,-0.046977,2.8897,-1.5646,-0.00046419,-0.0000013304}, VapK = {102,0.016485,0.34326,5.6687,894520,0}, Racketparam = 0.272, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2356, ChaoSeadSP = 16040, ChaoSeadLV = 0.143768); + end TransOneThreedimethylcyclohexane; + + model CisOneFourdimethylcyclohexane + extends General_Properties( + SN = 279, name = "CisOneFourdimethylcyclohexane", CAS = "624-29-3", Tc = 598.15, Pc = 2938430, Vc = 0.46, Cc = 0.272, Tb = 397.48, Tm = 185.744, TT = 185.72, TP = 0.0704204, MW = 112.213, LVB = 0.144106, AF = 0.2348, SP = 15980, DM = 0, SH = -1209000000.0, IGHF = -1.76648E+08, GEF = 3.79489E+07, AS = 370451, HFMP = 9307730, HOC = -4.86704E+09, LiqDen = {105,0.53336,0.24533,598.15,0.2771,0}, VP = {101,79.163,-7004.6,-8.4779,0.0000046053,2}, LiqCp = {16,110770,140.07,8.7617,0.0091373,-0.0000048302}, HOV = {106,7.1514E+07,2.3724,-5.2021,5.4751,-2.1521}, VapCp = {16,101700,-844.25,13.931,-0.00056374,1.5762E-07}, LiqVis = {101,-20.704,1391.4,1.6378,-0.0000047953,2}, VapVis = {102,0.0000024207,0.36412,666.44,4231,0}, LiqK = {16,-0.063527,3.3026,-1.4941,-0.0004362,-0.0000011663}, VapK = {102,0.016747,0.34072,-1.7965,898230,0}, Racketparam = 0.272, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2348, ChaoSeadSP = 15980, ChaoSeadLV = 0.144106); + end CisOneFourdimethylcyclohexane; + + model TransOneFourdimethylcyclohexane + extends General_Properties( + SN = 280, name = "TransOneFourdimethylcyclohexane", CAS = "2207-04-7", Tc = 590.15, Pc = 2940000, Vc = 0.45, Cc = 0.271, Tb = 392.51, Tm = 236.21, TT = 236.21, TP = 44.9802, MW = 112.213, LVB = 0.147921, AF = 0.2429, SP = 15490, DM = 0, SH = -1209000000.0, IGHF = -1.84598E+08, GEF = 3.17147E+07, AS = 364803, HFMP = 1.2332E+07, HOC = -4.86026E+09, LiqDen = {105,0.064652,0.087885,590.15,0.13093,0}, VP = {101,85.56244,-7078.051,-9.547047,6.602527E-06,2}, LiqCp = {16,119770,186.95,7.9604,0.011554,-0.0000069633}, HOV = {106,5.5648E+07,0.9536,-1.3747,1.3927,-0.55606}, VapCp = {16,97979,-830.68,13.935,-0.00055238,1.5056E-07}, LiqVis = {101,-8.7946,1113.8,-0.41314,9.8767E-07,2}, VapVis = {102,6.6365E-07,0.52158,345.67,-1560.6,0}, LiqK = {16,-0.0015458,-71.843,-1.1073,-0.0027831,1.5512E-07}, VapK = {102,0.012496,0.37939,-0.8405,811480,0}, Racketparam = 0.271, UniquacR = 5.3936, UniquacQ = 4.312, ChaoSeadAF = 0.2429, ChaoSeadSP = 15490, ChaoSeadLV = 0.147921); + end TransOneFourdimethylcyclohexane; + + model Tertbutylcyclohexane + extends General_Properties( + SN = 281, name = "Tertbutylcyclohexane", CAS = "3178-22-1", Tc = 652, Pc = 2660000, Vc = 0.51, Cc = 0.25, Tb = 444.65, Tm = 231.98, TT = 231.98, TP = 1.2, MW = 140.266, LVB = 0.1734, AF = 0.299134, SP = 16040, DM = 0, SH = -1209000000.0, IGHF = -2.169E+08, GEF = 5.695E+07, AS = 445700, HFMP = 1.12E+07, HOC = -6.091E+09, LiqDen = {105,0.52388,0.26705,652,0.32913,0}, VP = {101,123.1664,-9675.557,-15.08186,0.0000105041,2}, LiqCp = {16,40996,-122.74,11.846,0.0032488,-0.0000015611}, HOV = {106,6.9454E+07,0.40915,1.6494,-3.4494,1.9573}, VapCp = {16,95339,-601.24,13.623,-0.000018521,-1.574E-08}, LiqVis = {101,-11.549,1445.9,0,0,0}, VapVis = {102,4.6046E-08,0.87493,72.873,-5600.2,0}, LiqK = {16,0.054405,-203.55,-0.50495,-0.0065818,0.0000029095}, VapK = {102,0.077607,0.14004,-91.94,1372500,0}, Racketparam = 0.25, UniquacR = 6.7417, UniquacQ = 5.472, ChaoSeadAF = 0.299134, ChaoSeadSP = 16040, ChaoSeadLV = 0.1734); + end Tertbutylcyclohexane; + + model Oethyltoluene + extends General_Properties( + SN = 282, name = "Oethyltoluene", CAS = "611-14-3", Tc = 651.15, Pc = 3040000, Vc = 0.46, Cc = 0.26, Tb = 438.33, Tm = 192.35, TT = 192.35, TP = 0.00376669, MW = 120.192, LVB = 0.136967, AF = 0.2941, SP = 18090, DM = 1.87E-30, SH = -1209000000.0, IGHF = 1213360, GEF = 1.31055E+08, AS = 399350, HFMP = 9962100, HOC = -4.94607E+09, LiqDen = {105,0.37928,0.20513,651.15,0.23356,0}, VP = {101,96.1971,-8650.261,-10.86209,5.918239E-06,2}, LiqCp = {16,-102370,-26.419,12.162,0.0026059,-0.000002126}, HOV = {106,8.227273E+07,1.968046,-3.535916,3.107317,-1.061436}, VapCp = {16,85432,-569.61,13.054,0.000095945,-4.3717E-08}, LiqVis = {101,-10.303,1378.1,-0.24629,5.1436E-07,2}, VapVis = {102,4.4089E-07,0.56719,270.1,-4560.2,0}, LiqK = {16,-0.059289,4.2071,-1.4739,-0.00039236,-0.0000010623}, VapK = {102,0.000092842,1.0422,544.16,63099,0}, Racketparam = 0.26, UniquacR = 5.3322, UniquacQ = 4.076, ChaoSeadAF = 0.2941, ChaoSeadSP = 18090, ChaoSeadLV = 0.136967); + end Oethyltoluene; + + model Methyltoluene + extends General_Properties( + SN = 283, name = "Methyltoluene", CAS = "620-14-4", Tc = 637.15, Pc = 2840000, Vc = 0.49, Cc = 0.254, Tb = 434.48, Tm = 177.61, TT = 177.61, TP = 0.000664959, MW = 120.192, LVB = 0.139685, AF = 0.3232, SP = 17630, DM = 1.1E-30, SH = -1209000000.0, IGHF = -1920000, GEF = 1.2643E+08, AS = 404280, HFMP = 7610000, HOC = -4.94377E+09, LiqDen = {105,0.61007,0.26045,637.15,0.2946,0}, VP = {101,59.906,-6895.5,-5.4176,0.00000211,2}, LiqCp = {16,136340,-1484.6,20.724,-0.020829,0.000018949}, HOV = {106,6.562712E+07,1.251642,-2.311984,2.123485,-0.635116}, VapCp = {16,77831,-586.35,13.16,0.0000010287,-1.3417E-08}, LiqVis = {101,-10.732,1285.7,-0.12931,2.7444E-07,2}, VapVis = {102,4.7246E-07,0.55389,274.11,-5848.6,0}, LiqK = {16,-0.048117,4.2831,-1.5331,-0.00039971,-0.0000012216}, VapK = {102,0.000091259,1.0513,653.39,40428,0}, Racketparam = 0.254, UniquacR = 5.3322, UniquacQ = 4.076, ChaoSeadAF = 0.3232, ChaoSeadSP = 17630, ChaoSeadLV = 0.139685); + end Methyltoluene; + + model Pethyltoluene + extends General_Properties( + SN = 284, name = "Pethyltoluene", CAS = "622-96-8", Tc = 640.2, Pc = 3230000, Vc = 0.44, Cc = 0.259, Tb = 435.13, Tm = 210.83, TT = 210.83, TP = 0.0782406, MW = 120.194, LVB = 0.1396, AF = 0.364, SP = 17710, DM = 0, SH = -1209000000.0, IGHF = -3260000, GEF = 1.268E+08, AS = 398900, HFMP = 1.336E+07, HOC = -4.94268E+09, LiqDen = {105,0.60155,0.25704,640.2,0.31664,0}, VP = {101,21.19382,-5103.792,0.409026,-2.319216E-06,2}, LiqCp = {16,30748,-85.511,11.539,0.0037389,-0.0000030029}, HOV = {106,7.1677E+07,1.0708,-1.1055,0.62044,-0.16372}, VapCp = {16,75636,-568.13,13.103,0.000082441,-4.4902E-08}, LiqVis = {101,-23.973,1681.2,1.9315,6.328E-08,2}, VapVis = {102,5.7075E-07,0.5347,318.96,-7211.9,0}, LiqK = {16,-0.065655,1.2156,-1.4285,-0.00047761,-9.6417E-07}, VapK = {102,0.000095782,1.0471,660.61,40132,0}, Racketparam = 0.259, UniquacR = 5.3322, UniquacQ = 4.076, ChaoSeadAF = 0.364, ChaoSeadSP = 17710, ChaoSeadLV = 0.1396); + end Pethyltoluene; + + model OneTwoThreetrimethylbenzene + extends General_Properties( + SN = 285, name = "OneTwoThreetrimethylbenzene", CAS = "526-73-8", Tc = 664.5, Pc = 3454000, Vc = 0.435, Cc = 0.267, Tb = 449.23, Tm = 247.79, TT = 247.79, TP = 3.70834, MW = 120.194, LVB = 0.13322, AF = 0.367, SP = 18480, DM = 1.87E-30, SH = -1209000000.0, IGHF = -9568810, GEF = 1.244E+08, AS = 380500, HFMP = 8170000, HOC = -4.93394E+09, LiqDen = {105,0.47081,0.22935,664.5,0.22914,0}, VP = {101,103.4032,-9139.734,-11.94112,6.875135E-06,2}, LiqCp = {16,158190,-110.87,9.7005,0.0066246,-0.000003875}, HOV = {106,5.897E+07,0.31296,0.11034,-0.18707,0.12203}, VapCp = {16,97344,-642.53,13.123,0.000061931,-4.6438E-08}, LiqVis = {101,-13.622,1547.6,0.25604,-4.4218E-07,2}, VapVis = {102,7.8569E-07,0.49843,362.98,-102.15,0}, LiqK = {16,0.066267,303.46,-5.2163,0.0092731,-0.000014825}, VapK = {102,0.000093303,1.0419,539.24,56545,0}, Racketparam = 0.267, UniquacR = 5.3928, UniquacQ = 4.104, ChaoSeadAF = 0.367, ChaoSeadSP = 18480, ChaoSeadLV = 0.13322); + end OneTwoThreetrimethylbenzene; + + model OneTwoFourtrimethylbenzene + extends General_Properties( + SN = 286, name = "OneTwoFourtrimethylbenzene", CAS = "95-63-6", Tc = 649.1, Pc = 3232000, Vc = 0.435, Cc = 0.256, Tb = 442.49, Tm = 229.38, TT = 229.33, TP = 0.69347, MW = 120.194, LVB = 0.136, AF = 0.377, SP = 18090, DM = 1.0E-30, SH = -1209000000.0, IGHF = -1.392E+07, GEF = 1.17E+08, AS = 395870, HFMP = 1.319E+07, HOC = -4.93067E+09, LiqDen = {105,0.61782,0.26243,649.1,0.28053,0}, VP = {101,60.23044,-7113.208,-5.408973,1.637451E-06,2}, LiqCp = {16,159260,100.48,7.176,0.015511,-0.000013842}, HOV = {106,6.6212E+07,0.612793,0.157992,-1.024462,0.66352}, VapCp = {16,86220,-588.22,13.049,0.00013217,-6.3042E-08}, LiqVis = {101,-22.655,1676.9,1.8204,-0.0000040799,2}, VapVis = {102,9.0311E-07,0.47728,388.95,-1321.5,0}, LiqK = {16,-0.097311,-7.9329,-1.1933,-0.00075728,-4.2291E-07}, VapK = {102,0.000071734,1.0715,503.12,48355,0}, Racketparam = 0.256, UniquacR = 5.3928, UniquacQ = 4.104, ChaoSeadAF = 0.377, ChaoSeadSP = 18090, ChaoSeadLV = 0.136); + end OneTwoFourtrimethylbenzene; + + model Mesitylene + extends General_Properties( + SN = 287, name = "Mesitylene", CAS = "108-67-8", Tc = 637.3, Pc = 3127000, Vc = 0.43, Cc = 0.252, Tb = 437.9, Tm = 228.46, TT = 228.42, TP = 0.742135, MW = 120.194, LVB = 0.14299, AF = 0.399, SP = 17940, DM = 0, SH = -1209000000.0, IGHF = -1.605E+07, GEF = 1.181E+08, AS = 385410, HFMP = 9514000, HOC = -4.92904E+09, LiqDen = {105,0.59019,0.25742,637.3,0.27724,0}, VP = {101,118.5616,-9560.276,-14.30644,9.375247E-06,2}, LiqCp = {16,152130,279.49,4.8304,0.024632,-0.000024309}, HOV = {106,6.9292E+07,1.0706,-1.5094,1.269,-0.42864}, VapCp = {16,76799,-561.49,13.016,0.00018488,-8.0041E-08}, LiqVis = {101,-11.283,1439.3,-0.15787,0.0000019934,2}, VapVis = {102,3.4877E-07,0.61399,342.31,-16742,0}, LiqK = {16,-0.012521,77.398,-2.4912,0.0027181,-0.0000053908}, VapK = {102,0.3225,-0.079944,-464.54,1938200,0}, Racketparam = 0.252, UniquacR = 5.3928, UniquacQ = 4.104, ChaoSeadAF = 0.399, ChaoSeadSP = 17940, ChaoSeadLV = 0.14299); + end Mesitylene; + + model Isobutylbenzene + extends General_Properties( + SN = 288, name = "Isobutylbenzene", CAS = "538-93-2", Tc = 650, Pc = 3050000, Vc = 0.48, Cc = 0.271, Tb = 445.9, Tm = 221.7, TT = 221.7, TP = 0.289087, MW = 134.221, LVB = 0.15808, AF = 0.383, SP = 16860, DM = 1.5E-30, SH = -1209000000.0, IGHF = -2.054E+07, GEF = 1.388E+08, AS = 439700, HFMP = 1.25E+07, HOC = -5.56974E+09, LiqDen = {105,0.54967,0.26271,650,0.30807,0}, VP = {101,97.24209,-8752.864,-11.04244,6.424651E-06,2}, LiqCp = {16,116150,-36.608,10.189,0.0074074,-0.0000060747}, HOV = {106,6.0838E+07,0.30052,0.25612,-0.19969,-0.0011249}, VapCp = {16,83364,-556.41,13.277,0.000016037,-2.0047E-08}, LiqVis = {101,-12.546,1392.5,0.17362,-2.3672E-07,2}, VapVis = {102,3.8764E-07,0.58977,249.51,1034.4,0}, LiqK = {16,-0.033263,-23.962,-1.3695,-0.001338,-2.5251E-07}, VapK = {102,0.000022162,1.2141,174.06,50162,0}, Racketparam = 0.271, UniquacR = 5.9452, UniquacQ = 4.584, ChaoSeadAF = 0.383, ChaoSeadSP = 16860, ChaoSeadLV = 0.15808); + end Isobutylbenzene; + + model Secbutylbenzene + extends General_Properties( + SN = 289, name = "Secbutylbenzene", CAS = "135-98-8", Tc = 664.54, Pc = 2930000, Vc = 0.478, Cc = 0.265, Tb = 446.48, Tm = 197.717, TT = 197.717, TP = 0.00180534, MW = 134.218, LVB = 0.156497, AF = 0.279149, SP = 17050, DM = 1.3E-30, SH = -1209000000.0, IGHF = -1.73E+07, GEF = 1.4523E+08, AS = 439600, HFMP = 9830000, HOC = -5.563E+09, LiqDen = {105,0.51273,0.25494,664.54,0.28096,0}, VP = {101,222.2329,-13854.88,-30.30702,0.0000262583,2}, LiqCp = {16,163140,-1794.7,23.385,-0.029199,0.000028}, HOV = {106,3.1793E+07,-4.1563,12.591,-13.449,5.2588}, VapCp = {16,118430,-784.79,13.745,-0.00050199,1.4393E-07}, LiqVis = {10,-9.695648,-444.5934,-129.1082,0,0}, VapVis = {102,0.000001223,0.44278,495.81,151.45,0}, LiqK = {16,-0.042864,5.3464,-1.6033,-0.00035754,-0.0000011781}, VapK = {102,0.000022,1.2101,186.5,49434,0}, Racketparam = 0.265, UniquacR = 5.9452, UniquacQ = 4.584, ChaoSeadAF = 0.279149, ChaoSeadSP = 17050, ChaoSeadLV = 0.156497); + end Secbutylbenzene; + + model Tertbutylbenzene + extends General_Properties( + SN = 290, name = "Tertbutylbenzene", CAS = "98-06-6", Tc = 660, Pc = 2970000, Vc = 0.46, Cc = 0.266, Tb = 442.3, Tm = 215.27, TT = 215.27, TP = 0.0910321, MW = 134.218, LVB = 0.155605, AF = 0.267406, SP = 17130, DM = 2.33E-30, SH = -1209000000.0, IGHF = -2.26E+07, GEF = 1.4995E+08, AS = 401400, HFMP = 8393000, HOC = -5.5547E+09, LiqDen = {105,0.50957,0.25071,660,0.30584,0}, VP = {101,87.574,-8352.2,-9.5118,0.0000039953,2}, LiqCp = {16,164930,701.24,1.184,0.037122,-0.000038006}, HOV = {106,6.3167E+07,0.45262,0,0,0}, VapCp = {16,113750,-776.86,13.825,-0.0005797,1.6467E-07}, LiqVis = {101,-11.7,1364.1,0.038741,-3.8013E-08,2}, VapVis = {102,7.2957E-07,0.50871,384.51,-23.513,0}, LiqK = {16,0.052023,-143.3,-0.69673,-0.0057333,0.0000022627}, VapK = {102,0.000018955,1.2291,130.74,53349,0}, Racketparam = 0.266, UniquacR = 5.9452, UniquacQ = 4.584, ChaoSeadAF = 0.267406, ChaoSeadSP = 17130, ChaoSeadLV = 0.155605); + end Tertbutylbenzene; + + model Ocymene + extends General_Properties( + SN = 291, name = "Ocymene", CAS = "527-84-4", Tc = 670.15, Pc = 2895870, Vc = 0.478, Cc = 0.26, Tb = 451.33, Tm = 201.64, TT = 201.64, TP = 0.0177118, MW = 134.218, LVB = 0.153824, AF = 0.2769, SP = 17160, DM = 2.0E-30, SH = -1209000000.0, IGHF = -2.56061E+07, GEF = 1.37359E+08, AS = 425500, HFMP = 1.0E+07, HOC = -5.56053E+09, LiqDen = {105,0.017298,0.046645,670.15,0.11526,0}, VP = {101,47.323,-6536.6,-3.5074,6.0254E-07,2}, LiqCp = {16,130330,-123.14,10.583,0.0062464,-0.0000049954}, HOV = {106,8.44827E+07,3.205721,-8.334975,9.055186,-3.399515}, VapCp = {16,105060,-664.9,13.437,-0.00013826,2.1794E-08}, LiqVis = {101,-8.1679,885.64,-0.29176,-7.7161E-07,2}, VapVis = {102,0.0000020745,0.37852,642.92,259.27,0}, LiqK = {16,0.06145,-173.56,-0.23519,-0.0077758,0.0000038715}, VapK = {102,0.000020459,1.2217,183.94,51167,0}, Racketparam = 0.26, UniquacR = 6.0058, UniquacQ = 4.612, ChaoSeadAF = 0.2769, ChaoSeadSP = 17160, ChaoSeadLV = 0.153824); + end Ocymene; + + model Mcymene + extends General_Properties( + SN = 292, name = "Mcymene", CAS = "535-77-3", Tc = 666.25, Pc = 2810000, Vc = 0.478, Cc = 0.257, Tb = 448.23, Tm = 209.44, TT = 209.44, TP = 0.0405569, MW = 134.218, LVB = 0.156604, AF = 0.342, SP = 17110, DM = 1.2E-30, SH = -1209000000.0, IGHF = -2.79909E+07, GEF = 1.301E+08, AS = 432200, HFMP = 1.37E+07, HOC = -5.55802E+09, LiqDen = {105,0.17699,0.14976,666.25,0.19922,0}, VP = {101,72.132,-7676.5,-7.2263,0.0000031742,2}, LiqCp = {16,129560,-114.64,10.436,0.006807,-0.0000055776}, HOV = {106,1.132017E+08,4.402749,-10.71693,11.0294,-4.113621}, VapCp = {16,118290,-808.58,13.818,-0.00057669,1.7291E-07}, LiqVis = {101,-8.2582,1048.3,-0.41448,-1.0836E-07,2}, VapVis = {102,0.0000018208,0.39157,589.66,3771.8,0}, LiqK = {16,-0.042558,-18.046,-1.3081,-0.0015377,2.6414E-07}, VapK = {102,0.0000098162,1.3084,45.918,51418,0}, Racketparam = 0.257, UniquacR = 6.0058, UniquacQ = 4.612, ChaoSeadAF = 0.342, ChaoSeadSP = 17110, ChaoSeadLV = 0.156604); + end Mcymene; + + model Pcymene + extends General_Properties( + SN = 293, name = "Pcymene", CAS = "99-87-6", Tc = 652, Pc = 2800000, Vc = 0.497, Cc = 0.248, Tb = 450.26, Tm = 205.25, TT = 205.25, TP = 0.010391, MW = 134.221, LVB = 0.15749, AF = 0.376, SP = 17290, DM = 0, SH = -1209000000.0, IGHF = -2.799E+07, GEF = 1.3352E+08, AS = 426400, HFMP = 9661000, HOC = -5.558E+09, LiqDen = {105,0.44838,0.23842,653.16,0.26866,0}, VP = {101,130.8986,-10357.88,-16.09943,9.850105E-06,2}, LiqCp = {16,99148,48.442,10.281,0.006034,-0.0000045515}, HOV = {106,8.966039E+07,1.950064,-3.032433,2.16162,-0.588861}, VapCp = {16,119360,-822.32,13.841,-0.00060036,1.8085E-07}, LiqVis = {101,-29.824,1974.9,2.8359,-0.0000010565,2}, VapVis = {102,0.0000032148,0.32014,730.34,10237,0}, LiqK = {16,0.018679,-10.656,-1.722,-0.0015047,-7.6885E-07}, VapK = {102,0.00010761,1.0275,670.75,67288,0}, Racketparam = 0.248, UniquacR = 6.0058, UniquacQ = 4.612, ChaoSeadAF = 0.376, ChaoSeadSP = 17290, ChaoSeadLV = 0.15749); + end Pcymene; + + model Odiethylbenzene + extends General_Properties( + SN = 294, name = "Odiethylbenzene", CAS = "135-01-3", Tc = 668, Pc = 2880000, Vc = 0.502, Cc = 0.26, Tb = 456.573, Tm = 241.91, TT = 241.929, TP = 1.04119, MW = 134.2182, LVB = 0.15328, AF = 0.3879, SP = 17760, DM = 1.96803E-30, SH = -1209000000.0, IGHF = -1.89535E+07, GEF = 1.41084E+08, AS = 434800, HFMP = 1.67778E+07, HOC = -5.5596E+09, LiqDen = {105,0.52086,0.25389,668,0.28666,0}, VP = {101,136.1844,-10760.78,-16.88233,0.0000109939,2}, LiqCp = {16,13731,7.9227,11.237,0.004718,-0.0000037106}, HOV = {106,4.4827E+07,-1.9073,6.1295,-6.3772,2.4857}, VapCp = {16,122330,-723.39,13.531,-0.00028953,7.2562E-08}, LiqVis = {101,-13.971,1608.7,0.32395,-5.0533E-07,2}, VapVis = {102,4.8451E-08,0.84013,-72.915,24855,0}, LiqK = {16,-0.047218,-11.073,-1.4189,-0.00077787,-7.5252E-07}, VapK = {102,0.000087851,1.0397,505.4,47466,0}, Racketparam = 0.26, UniquacR = 6.0066, UniquacQ = 4.616, ChaoSeadAF = 0.3879, ChaoSeadSP = 17760, ChaoSeadLV = 0.15328); + end Odiethylbenzene; + + model Mdiethylbenzene + extends General_Properties( + SN = 295, name = "Mdiethylbenzene", CAS = "141-93-5", Tc = 663, Pc = 2880000, Vc = 0.488, Cc = 0.255, Tb = 454.252, Tm = 189.23, TT = 189.259, TP = 0.000664991, MW = 134.2182, LVB = 0.156083, AF = 0.354019, SP = 17460, DM = 1.2E-30, SH = -1209000000.0, IGHF = -2.18E+07, GEF = 1.367E+08, AS = 439500, HFMP = 1.097E+07, HOC = -5.5546E+09, LiqDen = {105,0.52578,0.25663,663,0.2955,0}, VP = {101,153.5552,-11090.88,-19.79091,0.000016846,2}, LiqCp = {16,-15019,20.098,11.35,0.0044704,-0.0000034473}, HOV = {106,6.460804E+07,0.433681,-0.0244308,0.0154888,-0.0245419}, VapCp = {16,115660,-734.22,13.598,-0.00034186,8.9326E-08}, LiqVis = {101,-11.504,1313.6,0.03353,-9.5074E-08,2}, VapVis = {102,0.0000018496,0.38185,552.33,63.517,0}, LiqK = {16,-0.056303,5.6194,-1.5408,-0.00033118,-0.0000010873}, VapK = {102,0.25407,-0.039016,-216.19,1832400,0}, Racketparam = 0.255, UniquacR = 6.0066, UniquacQ = 4.616, ChaoSeadAF = 0.354019, ChaoSeadSP = 17460, ChaoSeadLV = 0.156083); + end Mdiethylbenzene; + + model Pdiethylbenzene + extends General_Properties( + SN = 296, name = "Pdiethylbenzene", CAS = "105-05-5", Tc = 657.9, Pc = 2803000, Vc = 0.4805, Cc = 0.247, Tb = 456.9, Tm = 230.3, TT = 230.325, TP = 0.21291, MW = 134.2182, LVB = 0.15645, AF = 0.403, SP = 17660, DM = 0, SH = -1209000000.0, IGHF = -2.23E+07, GEF = 1.385E+08, AS = 433100, HFMP = 1.06E+07, HOC = -5.5553E+09, LiqDen = {105,0.50239,0.25108,657.9,0.28806,0}, VP = {101,108.74,-9636.7,-12.656,0.000006664,2}, LiqCp = {16,42717,-14.138,11.106,0.0050234,-0.0000039715}, HOV = {106,5.468714E+07,-1.551219,6.621841,-8.199596,3.486311}, VapCp = {16,117030,-755.24,13.637,-0.00037709,9.9721E-08}, LiqVis = {101,-11.766,1322.3,0.075076,-1.4518E-07,2}, VapVis = {102,7.2136E-07,0.49617,343.97,-290.07,0}, LiqK = {16,-0.054323,-5.9143,-1.4413,-0.00065059,-8.3255E-07}, VapK = {102,0.000023956,1.1969,213.51,48127,0}, Racketparam = 0.247, UniquacR = 6.0066, UniquacQ = 4.616, ChaoSeadAF = 0.403, ChaoSeadSP = 17660, ChaoSeadLV = 0.15645); + end Pdiethylbenzene; + + model OneTwoThreeFourtetramethylbenzene + extends General_Properties( + SN = 297, name = "OneTwoThreeFourtetramethylbenzene", CAS = "488-23-3", Tc = 690, Pc = 2860000, Vc = 0.482, Cc = 0.256, Tb = 478.19, Tm = 266.9, TT = 266.9, TP = 2.9878, MW = 134.218, LVB = 0.149073, AF = 0.417172, SP = 18860, DM = 1.66E-30, SH = -1209000000.0, IGHF = -3.305E+07, GEF = 1.324E+08, AS = 416500, HFMP = 1.123E+07, HOC = -5.5376E+09, LiqDen = {105,0.62671,0.276,690,0.30501,0}, VP = {101,103.3938,-9866.6,-11.74655,5.432648E-06,2}, LiqCp = {16,191090,-1527.7,20.231,-0.019977,0.000019333}, HOV = {106,6.827737E+07,0.20659,0.354625,0.156354,-0.400825}, VapCp = {16,108680,-536.06,13.006,0.00026578,-1.0197E-07}, LiqVis = {101,-12.555,1810.8,0.0032112,-3.0199E-09,2}, VapVis = {102,8.0975E-08,0.80432,144.14,-8326.5,0}, LiqK = {16,-0.046705,-31.572,-1.2356,-0.0012463,-2.6103E-07}, VapK = {102,0.0001001,1.0331,653.92,21466,0}, Racketparam = 0.256, UniquacR = 6.1278, UniquacQ = 4.672, ChaoSeadAF = 0.417172, ChaoSeadSP = 18860, ChaoSeadLV = 0.149073); + end OneTwoThreeFourtetramethylbenzene; + + model OneTwoThreeFivetetramethylbenzene + extends General_Properties( + SN = 298, name = "OneTwoThreeFivetetramethylbenzene", CAS = "527-53-7", Tc = 679, Pc = 3220000, Vc = 0.436, Cc = 0.254, Tb = 471.15, Tm = 249.46, TT = 249.46, TP = 0.886139, MW = 134.218, LVB = 0.151385, AF = 0.459061, SP = 18330, DM = 0, SH = -1209000000.0, IGHF = -4.054E+07, GEF = 1.231E+08, AS = 422500, HFMP = 1.072E+07, HOC = -5.532E+09, LiqDen = {105,0.5261,0.25428,679,0.28565,0}, VP = {101,108.28,-9936.6,-12.519,0.0000062754,2}, LiqCp = {16,180380,-63.604,9.2496,0.0072443,-0.0000031051}, HOV = {106,6.6549E+07,0.31372,0.25924,-0.3264,0.12301}, VapCp = {16,109230,-579.21,13.116,0.00014705,-5.951E-08}, LiqVis = {101,-14.031,1747.6,0.263,-3.7653E-07,2}, VapVis = {102,6.7114E-07,0.50662,335.88,-402.07,0}, LiqK = {16,-0.064932,-8.9077,-1.3593,-0.00066705,-6.8372E-07}, VapK = {102,0.000082384,1.0555,595.15,34335,0}, Racketparam = 0.254, UniquacR = 6.1278, UniquacQ = 4.672, ChaoSeadAF = 0.426, ChaoSeadSP = 18330, ChaoSeadLV = 0.151385); + end OneTwoThreeFivetetramethylbenzene; + + model OneTwoFourFivetetramethylbenzene + extends General_Properties( + SN = 299, name = "OneTwoFourFivetetramethylbenzene", CAS = "95-93-2", Tc = 676, Pc = 2900000, Vc = 0.482, Cc = 0.249, Tb = 470, Tm = 352.384, TT = 352.384, TP = 1784.79, MW = 134.221, LVB = 0.15228, AF = 0.423, SP = 17140, DM = 0, SH = -1209000000.0, IGHF = -4.527E+07, GEF = 1.177E+08, AS = 418500, HFMP = 2.1E+07, HOC = -5.507E+09, LiqDen = {105,0.65779,0.28461,677.16,0.31429,0}, VP = {101,96.028,-9355.7,-10.676,0.0000049509,2}, LiqCp = {16,139940,1169.1,1.2977,0.02859,-0.000023286}, HOV = {106,1.607707E+08,4.915197,-10.37671,9.303886,-3.220797}, VapCp = {16,110940,-562.53,13.019,0.00027207,-1.0669E-07}, LiqVis = {101,-9.4175,1452.8,-0.39341,2.9469E-07,2}, VapVis = {102,7.2635E-07,0.49106,324.48,3435.1,0}, LiqK = {16,0.023024,-350.01,0.1946,-0.0044419,6.7822E-07}, VapK = {102,0.000066062,1.0649,306.1,93850,0}, Racketparam = 0.249, UniquacR = 6.1278, UniquacQ = 4.672, ChaoSeadAF = 0.423, ChaoSeadSP = 17140, ChaoSeadLV = 0.15228); + end OneTwoFourFivetetramethylbenzene; + + model Twoethylmxylene + extends General_Properties( + SN = 300, name = "Twoethylmxylene", CAS = "2870-04-4", Tc = 670, Pc = 2960000, Vc = 0.446, Cc = 0.261, Tb = 463.19, Tm = 257, TT = 256.89, TP = 2.81505, MW = 134.218, LVB = 0.151424, AF = 0.405, SP = 18140, DM = 0, SH = -1209000000.0, IGHF = -2.623E+07, GEF = 1.379E+08, AS = 421000, HFMP = 1.471E+07, HOC = -5.548E+09, LiqDen = {105,0.55372,0.25979,670,0.29804,0}, VP = {101,101.54,-9425,-11.552,0.0000057989,2}, LiqCp = {16,77646,-101.26,11.392,0.0045401,-0.0000038677}, HOV = {106,8.2672E+07,1.1027,-0.68529,-0.33367,0.36103}, VapCp = {16,80902,-471.57,13.059,0.00022749,-9.0171E-08}, LiqVis = {101,-15.587,1737.4,0.54173,-0.0000007502,2}, VapVis = {102,0.0000044354,0.29008,895.67,100.88,0}, LiqK = {16,-0.038284,-32.06,-1.2755,-0.0012699,-0.0000004068}, VapK = {102,0.000097738,1.031,536.66,42862,0}, Racketparam = 0.261, UniquacR = 6.0672, UniquacQ = 4.644, ChaoSeadAF = 0.405, ChaoSeadSP = 18140, ChaoSeadLV = 0.151424); + end Twoethylmxylene; + + model Twoethylpxylene + extends General_Properties( + SN = 301, name = "Twoethylpxylene", CAS = "1758-88-9", Tc = 680, Pc = 3380000, Vc = 0.461, Cc = 0.252, Tb = 460.09, Tm = 219, TT = 219.52, TP = 0.0748611, MW = 134.218, LVB = 0.153715, AF = 0.36, SP = 17610, DM = 0, SH = -1209000000.0, IGHF = -3.218E+07, GEF = 1.273E+08, AS = 436600, HFMP = 1.519E+07, HOC = -5.543E+09, LiqDen = {105,0.15639,0.13957,680,0.19566,0}, VP = {101,51.35796,-7093.865,-3.98884,0.0000002143,2}, LiqCp = {16,115180,-69.179,10.574,0.0065199,-0.0000055164}, HOV = {106,8.269938E+07,2.580922,-6.4761,7.125795,-2.740318}, VapCp = {16,90693,-533.27,13.139,0.00014143,-6.0863E-08}, LiqVis = {101,-12.139,1509,0.050995,-2.3531E-08,2}, VapVis = {102,0.0000010483,0.4491,412.22,-1561.4,0}, LiqK = {16,-0.080449,4.7926,-1.4191,-0.00032019,-9.3368E-07}, VapK = {102,0.000085732,1.0445,516.18,46622,0}, Racketparam = 0.252, UniquacR = 6.0672, UniquacQ = 4.644, ChaoSeadAF = 0.36, ChaoSeadSP = 17610, ChaoSeadLV = 0.153715); + end Twoethylpxylene; + + model Fourethylmxylene + extends General_Properties( + SN = 302, name = "Fourethylmxylene", CAS = "874-41-9", Tc = 665, Pc = 2850000, Vc = 0.456, Cc = 0.251, Tb = 461.59, Tm = 210, TT = 210.27, TP = 0.0181496, MW = 134.218, LVB = 0.153864, AF = 0.409, SP = 17650, DM = 0, SH = -1209000000.0, IGHF = -3.08E+07, GEF = 1.286E+08, AS = 436600, HFMP = 1.293E+07, HOC = -5.544E+09, LiqDen = {105,0.53184,0.25635,665,0.29535,0}, VP = {101,109.6,-9849.7,-12.73,0.0000063582,2}, LiqCp = {16,95699,-84.431,11.066,0.0051032,-0.0000041785}, HOV = {106,6.586476E+07,0.958711,-1.952194,2.240006,-0.865941}, VapCp = {16,90693,-533.27,13.139,0.00014143,-6.0863E-08}, LiqVis = {101,-12.665,1419.5,0.18354,-0.0000003451,2}, VapVis = {102,0.0000037216,0.29591,752.65,-7.7443,0}, LiqK = {16,-0.081171,5.0587,-1.4195,-0.00031748,-9.1756E-07}, VapK = {102,0.000083547,1.0482,520.64,45100,0}, Racketparam = 0.251, UniquacR = 6.0672, UniquacQ = 4.644, ChaoSeadAF = 0.409, ChaoSeadSP = 17650, ChaoSeadLV = 0.153864); + end Fourethylmxylene; + + model Fourethyloxylene + extends General_Properties( + SN = 303, name = "Fourethyloxylene", CAS = "934-80-5", Tc = 666, Pc = 2890000, Vc = 0.452, Cc = 0.254, Tb = 462.93, Tm = 206, TT = 206.22, TP = 0.00343448, MW = 134.218, LVB = 0.154172, AF = 0.42, SP = 17990, DM = 0, SH = -1209000000.0, IGHF = -3.209E+07, GEF = 1.274E+08, AS = 436600, HFMP = 1.205E+07, HOC = -5.542E+09, LiqDen = {105,0.54664,0.26088,666,0.29186,0}, VP = {101,96.694,-9142.9,-10.852,0.0000055519,2}, LiqCp = {16,89767,-77.889,11.113,0.0049399,-0.0000039958}, HOV = {106,4.3714E+07,-2.7554,9.4578,-11.023,4.6307}, VapCp = {16,90693,-533.27,13.139,0.00014143,-6.0863E-08}, LiqVis = {101,-9.1159,1410.6,-0.43411,7.8135E-07,2}, VapVis = {102,5.8567E-07,0.52279,312.52,-1851,0}, LiqK = {16,-0.061613,4.0176,-1.4936,-0.00037218,-9.9721E-07}, VapK = {102,0.000083697,1.0475,520.73,45665,0}, Racketparam = 0.254, UniquacR = 6.0672, UniquacQ = 4.644, ChaoSeadAF = 0.42, ChaoSeadSP = 17990, ChaoSeadLV = 0.154172); + end Fourethyloxylene; + + model OnemethylThreenpropylbenzene + extends General_Properties( + SN = 304, name = "OnemethylThreenpropylbenzene", CAS = "1074-43-7", Tc = 656, Pc = 2860000, Vc = 0.482, Cc = 0.249, Tb = 455.13, Tm = 190.57, TT = 190.57, TP = 0.000721452, MW = 134.218, LVB = 0.156623, AF = 0.412785, SP = 17510, DM = 4.07E-31, SH = -1209000000.0, IGHF = -2.414E+07, GEF = 1.352E+08, AS = 436800, HFMP = 1.06E+07, HOC = -5.5516E+09, LiqDen = {105,0.18222,0.15152,656,0.20178,0}, VP = {101,107.4588,-9508.773,-12.48918,6.776919E-06,2}, LiqCp = {16,156110,-38.093,10.159,0.0050313,-0.0000015247}, HOV = {106,6.194565E+07,0.0524158,1.088831,-1.22236,0.439479}, VapCp = {16,97127,-599.11,13.273,0.000011665,-1.9003E-08}, LiqVis = {101,-17.301,1601.4,0.91018,-0.0000014707,2}, VapVis = {102,7.3681E-08,0.81524,130.94,-9552,0}, LiqK = {16,-0.074198,4.023,-1.4364,-0.00042252,-0.0000008562}, VapK = {102,0.000083513,1.0517,570.8,33790,0}, Racketparam = 0.249, UniquacR = 6.0066, UniquacQ = 4.616, ChaoSeadAF = 0.412785, ChaoSeadSP = 17510, ChaoSeadLV = 0.156623); + end OnemethylThreenpropylbenzene; + + model OnemethylFournpropylbenzene + extends General_Properties( + SN = 305, name = "OnemethylFournpropylbenzene", CAS = "1074-55-1", Tc = 658, Pc = 2860000, Vc = 0.482, Cc = 0.248, Tb = 456.53, Tm = 209.455, TT = 209.55, TP = 0.0171898, MW = 134.218, LVB = 0.157097, AF = 0.413441, SP = 17460, DM = 0, SH = -1209000000.0, IGHF = -2.314E+07, GEF = 1.382E+08, AS = 430400, HFMP = 1.151E+07, HOC = -5.5528E+09, LiqDen = {105,0.48219,0.24259,658,0.32531,0}, VP = {101,103.2332,-9321.423,-11.85346,6.228128E-06,2}, LiqCp = {16,128960,-102.23,11.269,0.0022913,5.0742E-07}, HOV = {106,5.9632E+07,-0.13089,1.5769,-1.8325,0.74608}, VapCp = {16,97127,-599.11,13.273,0.000011665,-1.9003E-08}, LiqVis = {101,-65.00531,3273.06,8.413079,-0.0000101347,2}, VapVis = {102,7.8653E-08,0.80621,137.95,-9253.2,0}, LiqK = {16,-0.081049,3.2759,-1.4026,-0.00043634,-7.9035E-07}, VapK = {102,0.000083347,1.0517,573.97,33136,0}, Racketparam = 0.248, UniquacR = 6.0066, UniquacQ = 4.616, ChaoSeadAF = 0.413441, ChaoSeadSP = 17460, ChaoSeadLV = 0.157097); + end OnemethylFournpropylbenzene; + + model Pdiisopropylbenzene + extends General_Properties( + SN = 306, name = "Pdiisopropylbenzene", CAS = "100-18-5", Tc = 675, Pc = 2360000, Vc = 0.584, Cc = 0.256, Tb = 483.52, Tm = 256.08, TT = 256.08, TP = 0.697953, MW = 162.271, LVB = 0.190236, AF = 0.476415, SP = 16930, DM = 0, SH = -1209000000.0, IGHF = -7.76E+07, GEF = 1.47804E+08, AS = 488000, HFMP = 0, HOC = -6.77E+09, LiqDen = {105,0.77801,0.34547,675,0.38736,0}, VP = {101,121.6259,-10711.76,-14.56272,8.944308E-06,2}, LiqCp = {16,-70570,94.476,11.349,0.0048258,-0.0000034771}, HOV = {106,9.572101E+07,2.166143,-4.616074,4.777254,-1.852374}, VapCp = {16,100830,-531.56,13.456,0.000043333,-2.4118E-08}, LiqVis = {101,-8.9912,1148.7,-0.35833,4.6037E-07,2}, VapVis = {102,8.0354E-07,0.48062,391.1,176.97,0}, LiqK = {16,-0.043466,-14.777,-1.4776,-0.00080068,-0.0000006904}, VapK = {102,0.31596,-0.074042,-318.59,1928600,0}, Racketparam = 0.256, UniquacR = 7.3538, UniquacQ = 5.688, ChaoSeadAF = 0.390023, ChaoSeadSP = 16930, ChaoSeadLV = 0.190236); + end Pdiisopropylbenzene; + + model Methylisobutylketone + extends General_Properties( + SN = 307, name = "Methylisobutylketone", CAS = "108-10-1", Tc = 574.6, Pc = 3270000, Vc = 0.3406, Cc = 0.256, Tb = 389.15, Tm = 189.15, TT = 189.15, TP = 0.0698742, MW = 100.161, LVB = 0.12581, AF = 0.352, SP = 17420, DM = 9.0E-30, SH = -1209000000.0, IGHF = -2.88E+08, GEF = -1.351E+08, AS = 407000, HFMP = 9710000, HOC = -3.49E+09, LiqDen = {105,0.70438,0.26215,574.6,0.2872,0}, VP = {101,151.9969,-9958.63,-19.68914,0.0000167819,2}, LiqCp = {16,93433,-8.9197,10.885,0.0029916,-6.6769E-07}, HOV = {106,2.7929E+07,-4.5647,14.372,-16.097,6.5387}, VapCp = {16,97540,-634.68,12.939,0.000018497,-1.9665E-08}, LiqVis = {101,-9.5441,1138.8,-0.34128,0.0000016581,2}, VapVis = {102,2.9033E-07,0.63516,190.41,3013.2,0}, LiqK = {16,0.05085,-96.32,-0.95078,-0.0031661,-0.0000020547}, VapK = {102,-874190,0.020464,1.7911E+07,-8.1274E+12,0}, Racketparam = 0.256, UniquacR = 4.5959, UniquacQ = 3.952, ChaoSeadAF = 0.352, ChaoSeadSP = 17420, ChaoSeadLV = 0.12581); + end Methylisobutylketone; + + model Threeheptanone + extends General_Properties( + SN = 308, name = "Threeheptanone", CAS = "106-35-4", Tc = 605, Pc = 3010000, Vc = 0.421, Cc = 0.251, Tb = 420.55, Tm = 234.15, TT = 234.15, TP = 2.29921, MW = 114.185, LVB = 0.140257, AF = 0.407565, SP = 17940, DM = 9.37E-30, SH = -1209000000.0, IGHF = -3.01E+08, GEF = -1.196E+08, AS = 448500, HFMP = 1.81E+07, HOC = -4.098E+09, LiqDen = {105,0.65544,0.26958,605,0.29059,0}, VP = {101,59.93996,-7156.968,-5.201278,1.288938E-07,2}, LiqCp = {16,215140,447.78,3.9106,0.020539,-0.000013511}, HOV = {106,6.726896E+07,0.830475,-1.256385,1.592723,-0.756362}, VapCp = {16,122140,-668.77,13.117,-0.0000064986,-3.4969E-08}, LiqVis = {101,-11.982,1284.2,0.095491,-8.1894E-07,2}, VapVis = {102,1.4757E-07,0.71999,184.44,-6805,0}, LiqK = {16,-0.025728,-61.893,-0.97852,-0.0021604,1.2683E-07}, VapK = {102,1201.8,1.0398,1.4113E+10,-9.6162E+10,0}, Racketparam = 0.251, UniquacR = 5.2711, UniquacQ = 4.496, ChaoSeadAF = 0.407565, ChaoSeadSP = 17940, ChaoSeadLV = 0.140257); + end Threeheptanone; + + model Fourheptanone + extends General_Properties( + SN = 309, name = "Fourheptanone", CAS = "123-19-3", Tc = 595, Pc = 2920000, Vc = 0.421, Cc = 0.253, Tb = 417.15, Tm = 240.65, TT = 240.65, TP = 7.95766, MW = 114.185, LVB = 0.140625, AF = 0.471409, SP = 17410, DM = 8.34E-30, SH = -1209000000.0, IGHF = -3.01E+08, GEF = -1.196E+08, AS = 448600, HFMP = 1.86E+07, HOC = -4.09E+09, LiqDen = {105,0.78297,0.29215,595,0.33209,0}, VP = {101,121.5579,-9310.284,-14.85267,0.000010781,2}, LiqCp = {16,209750,222.65,6.403,0.014092,-0.0000084677}, HOV = {106,6.630562E+07,0.51436,0.600897,-1.414428,0.688564}, VapCp = {16,121670,-659.01,13.093,0.000016432,-4.1637E-08}, LiqVis = {101,-29.013,1989.1,2.6786,-0.0000019943,2}, VapVis = {102,1.5516E-07,0.71327,190.48,-6907.5,0}, LiqK = {16,-0.084176,-5.3333,-1.1753,-0.00094427,-3.0728E-07}, VapK = {102,2007.9,1.0403,2.325E+10,-1.556E+11,0}, Racketparam = 0.253, UniquacR = 5.2711, UniquacQ = 4.496, ChaoSeadAF = 0.411976, ChaoSeadSP = 17410, ChaoSeadLV = 0.140625); + end Fourheptanone; + + model Threehexanone + extends General_Properties( + SN = 310, name = "Threehexanone", CAS = "589-38-8", Tc = 582.8, Pc = 3320000, Vc = 0.378, Cc = 0.256, Tb = 396.65, Tm = 215, TT = 217.5, TP = 2.22016, MW = 100.161, LVB = 0.12343, AF = 0.38, SP = 17930, DM = 9.57E-30, SH = -1209000000.0, IGHF = -2.777E+08, GEF = -1.253E+08, AS = 409200, HFMP = 1.11E+07, HOC = -3.492E+09, LiqDen = {105,0.60844,0.24303,582.83,0.26177,0}, VP = {101,109.4591,-8520.55,-13.01531,9.019631E-06,2}, LiqCp = {16,185400,578.77,3.0261,0.02276,-0.000015777}, HOV = {106,5.134266E+07,-0.294625,1.94188,-1.96318,0.653572}, VapCp = {16,108160,-675.23,12.973,-0.000036372,-1.5789E-08}, LiqVis = {101,-3.119,957.18,-1.3764,0.0000033013,2}, VapVis = {102,1.7969E-07,0.70065,200.48,-7668.6,0}, LiqK = {16,0.0083801,80.808,-2.2377,0.00083175,-0.0000033028}, VapK = {102,-0.24291,0.11759,-2306.6,-3681900,0}, Racketparam = 0.256, UniquacR = 4.5967, UniquacQ = 3.956, ChaoSeadAF = 0.38, ChaoSeadSP = 17930, ChaoSeadLV = 0.12343); + end Threehexanone; + + model Twopentanone + extends General_Properties( + SN = 311, name = "Twopentanone", CAS = "107-87-9", Tc = 561.1, Pc = 3690000, Vc = 0.301, Cc = 0.238, Tb = 375.39, Tm = 196.29, TT = 196.29, TP = 0.752347, MW = 86.134, LVB = 0.10733, AF = 0.346, SP = 18290, DM = 9.07E-30, SH = -1209000000.0, IGHF = -2.592E+08, GEF = -1.384E+08, AS = 378600, HFMP = 1.062E+07, HOC = -2.88E+09, LiqDen = {105,0.8193,0.25958,561.1,0.28941,0}, VP = {101,92.01772,-7341.876,-10.45756,7.61086E-06,2}, LiqCp = {16,119520,155.09,9.2758,0.0038398,0.0000015236}, HOV = {106,6.074187E+07,1.097819,-1.350154,0.926065,-0.25017}, VapCp = {16,86927,-727.52,12.986,-0.00023161,6.926E-08}, LiqVis = {101,-8.4812,921.84,-0.40943,6.8984E-07,2}, VapVis = {102,2.4641E-07,0.66525,208.96,-62.76,0}, LiqK = {16,0.010889,-36.658,-1.2206,-0.0022413,-2.5211E-07}, VapK = {102,-0.017912,0.4825,-3887.7,-1296300,0}, Racketparam = 0.238, UniquacR = 3.9223, UniquacQ = 3.416, ChaoSeadAF = 0.346, ChaoSeadSP = 18290, ChaoSeadLV = 0.10733); + end Twopentanone; + + model Twohexanone + extends General_Properties( + SN = 312, name = "Twohexanone", CAS = "591-78-6", Tc = 587, Pc = 3320000, Vc = 0.378, Cc = 0.254, Tb = 400.7, Tm = 217.35, TT = 217.35, TP = 1.44559, MW = 100.161, LVB = 0.1241, AF = 0.393, SP = 17600, DM = 8.94E-30, SH = -1209000000.0, IGHF = -2.79826E+08, GEF = -1.30081E+08, AS = 417856, HFMP = 1.49E+07, HOC = -3.49E+09, LiqDen = {105,0.58528,0.23872,587.62,0.26191,0}, VP = {101,81.22606,-7467.987,-8.650385,4.736711E-06,2}, LiqCp = {16,171430,304.46,6.7554,0.010928,-0.0000044198}, HOV = {106,8.140665E+07,1.724728,-1.991428,0.65901,0.10235}, VapCp = {16,101950,-647,12.874,0.00017699,-1.3836E-07}, LiqVis = {101,-9.5407,1129.1,-0.30673,6.1273E-07,2}, VapVis = {102,1.7562E-07,0.7037,196.23,-7085.8,0}, LiqK = {16,-0.0056603,-27.398,-1.2811,-0.0017572,-3.9285E-07}, VapK = {102,-0.96934,0.03859,-1883.3,-1.1142E+07,0}, Racketparam = 0.254, UniquacR = 4.5967, UniquacQ = 3.956, ChaoSeadAF = 0.393, ChaoSeadSP = 17600, ChaoSeadLV = 0.1241); + end Twohexanone; + + model Twoheptanone + extends General_Properties( + SN = 313, name = "Twoheptanone", CAS = "110-43-0", Tc = 611.55, Pc = 2920000, Vc = 0.421, Cc = 0.251, Tb = 424.05, Tm = 238.15, TT = 238.15, TP = 3.54477, MW = 114.185, LVB = 0.140675, AF = 0.418982, SP = 17400, DM = 8.71E-30, SH = -1209000000.0, IGHF = -3.00453E+08, GEF = -1.21796E+08, AS = 456893, HFMP = 1.84E+07, HOC = -4.09952E+09, LiqDen = {105,0.42296,0.21673,611.55,0.2517,0}, VP = {101,104.1321,-8934.299,-12.02629,6.758209E-06,2}, LiqCp = {16,168580,759.37,3.3604,0.023088,-0.000017848}, HOV = {106,6.522658E+07,0.472207,0.238382,-0.54369,0.222217}, VapCp = {16,119760,-702.71,13.229,-0.000074262,-4.5595E-08}, LiqVis = {101,-9.5709,1186.6,-0.30187,0.0000013185,2}, VapVis = {102,1.5766E-07,0.71212,201.61,-8396.4,0}, LiqK = {16,0.061916,-162.99,-0.59984,-0.0044095,-0.0000013415}, VapK = {102,2047.3,1.0324,2.297E+10,7.8096E+08,0}, Racketparam = 0.251, UniquacR = 5.2711, UniquacQ = 4.496, ChaoSeadAF = 0.418982, ChaoSeadSP = 17400, ChaoSeadLV = 0.140675); + end Twoheptanone; + + model FivemethylTwohexanone + extends General_Properties( + SN = 314, name = "FivemethylTwohexanone", CAS = "110-12-3", Tc = 601, Pc = 2970000, Vc = 0.421, Cc = 0.25, Tb = 417.95, Tm = 199.25, TT = 199.25, TP = 0.0241997, MW = 114.185, LVB = 0.141298, AF = 0.434398, SP = 17740, DM = 0, SH = -1209000000.0, IGHF = -3.04E+08, GEF = -1.22E+08, AS = 446000, HFMP = 0, HOC = -4.1E+09, LiqDen = {105,0.59436,0.2568,601,0.28571,0}, VP = {101,114.12,-9180,-13.613,0.0000087656,2}, LiqCp = {16,125240,163.14,9.1111,0.0074883,-0.0000035144}, HOV = {106,8.005371E+07,1.17745,-0.708374,-0.221424,0.184955}, VapCp = {16,96832,-530.6,12.878,0.00028483,-1.1552E-07}, LiqVis = {101,-15.292,1388.7,0.61336,-0.0000015372,2}, VapVis = {102,3.5504E-07,0.6089,292.03,-90.104,0}, LiqK = {16,-0.18233,17.124,-1.0595,-0.000040298,-9.9547E-07}, VapK = {102,1467.4,1.0438,1.713E+10,-1.5385E+11,0}, Racketparam = 0.25, UniquacR = 5.2703, UniquacQ = 4.492, ChaoSeadAF = 0.434398, ChaoSeadSP = 17740, ChaoSeadLV = 0.141298); + end FivemethylTwohexanone; + + model ThreeThreedimethylTwobutanone + extends General_Properties( + SN = 315, name = "ThreeThreedimethylTwobutanone", CAS = "75-97-8", Tc = 567, Pc = 3470000, Vc = 0.368, Cc = 0.261, Tb = 379.45, Tm = 221.15, TT = 221.15, TP = 14.4334, MW = 100.159, LVB = 0.124869, AF = 0.327309, SP = 16920, DM = 9.37E-30, SH = -1209000000.0, IGHF = -2.905E+08, GEF = -1.307E+08, AS = 384400, HFMP = 1.133E+07, HOC = -3.4837E+09, LiqDen = {105,0.050005,0.070782,567,0.11676,0}, VP = {101,93.48771,-7385.263,-10.71444,7.878115E-06,2}, LiqCp = {16,154180,195.77,7.7152,0.0092036,-0.0000029177}, HOV = {106,5.0163E+07,0.36416,-0.10654,0.27936,-0.16414}, VapCp = {16,104260,-866.95,13.572,-0.00063607,2.0716E-07}, LiqVis = {101,-19.254,1373.2,1.3346,-0.0000032641,2}, VapVis = {102,1.8869E-07,0.70026,190.78,-6542.3,0}, LiqK = {16,-0.15399,9.8963,-1.0886,-0.00030883,-9.2007E-07}, VapK = {102,1744.4,1.0305,1.6872E+10,-1.3896E+11,0}, Racketparam = 0.261, UniquacR = 4.5952, UniquacQ = 4.032, ChaoSeadAF = 0.327309, ChaoSeadSP = 16920, ChaoSeadLV = 0.124869); + end ThreeThreedimethylTwobutanone; + + model Diisobutylketone + extends General_Properties( + SN = 316, name = "Diisobutylketone", CAS = "108-83-8", Tc = 620, Pc = 2530000, Vc = 0.522, Cc = 0.253, Tb = 441.4, Tm = 227, TT = 227.17, TP = 0.249815, MW = 142.239, LVB = 0.177418, AF = 0.511608, SP = 16450, DM = 8.87E-30, SH = -1209000000.0, IGHF = -3.576E+08, GEF = -1.13E+08, AS = 509000, HFMP = 0, HOC = -5.31E+09, LiqDen = {105,0.3783,0.23231,620,0.24664,0}, VP = {101,122.1783,-10064.3,-14.70184,8.652147E-06,2}, LiqCp = {16,85834,-102.6,11.702,0.0033978,-0.0000021321}, HOV = {106,4.9161E+07,-1.6509,5.8937,-6.6307,2.7354}, VapCp = {16,118320,-505.35,13.11,0.00028036,-1.0389E-07}, LiqVis = {101,-74.692,4018.6,9.6018,-0.0000061216,2}, VapVis = {102,1.3916E-07,0.72063,190.96,-7816.5,0}, LiqK = {16,-0.12088,22.25,-1.2974,0.0000088903,-0.0000012079}, VapK = {102,-380230,0.02484,1.3363E+08,-3.9523E+12,0}, Racketparam = 0.253, UniquacR = 6.6183, UniquacQ = 5.568, ChaoSeadAF = 0.511608, ChaoSeadSP = 16450, ChaoSeadLV = 0.177418); + end Diisobutylketone; + + model Diisopropylketone + extends General_Properties( + SN = 317, name = "Diisopropylketone", CAS = "565-80-0", Tc = 582, Pc = 3380000, Vc = 0.416, Cc = 0.262, Tb = 397.5, Tm = 204, TT = 204.81, TP = 0.820585, MW = 114.185, LVB = 0.142561, AF = 0.404427, SP = 16330, DM = 9.11E-30, SH = -1209000000.0, IGHF = -3.16E+08, GEF = -1.237E+08, AS = 427000, HFMP = 1.118E+07, HOC = -4.095E+09, LiqDen = {105,0.013793,0.039842,582,0.095675,0}, VP = {101,107.12,-8385.7,-12.681,0.0000089823,2}, LiqCp = {16,180230,-51.129,8.6687,0.010407,-0.0000076786}, HOV = {106,8.205456E+07,3.802881,-9.83224,10.38407,-3.829124}, VapCp = {16,60064,-502.12,13.055,0.00012498,-3.7343E-08}, LiqVis = {101,-5.6405,1129.7,-1.0122,0.0000027665,2}, VapVis = {102,1.7015E-07,0.70572,193.2,-7481.9,0}, LiqK = {16,-0.11955,20.681,-1.3034,0.0000051067,-0.0000013764}, VapK = {102,-9.5076,-0.0072136,2380.8,-7.251E+07,0}, Racketparam = 0.262, UniquacR = 5.0493, UniquacQ = 4.568, ChaoSeadAF = 0.404427, ChaoSeadSP = 16330, ChaoSeadLV = 0.142561); + end Diisopropylketone; + + model Propanal + extends General_Properties( + SN = 318, name = "Propanal", CAS = "123-38-6", Tc = 493.15, Pc = 4650000, Vc = 0.223, Cc = 0.239, Tb = 321.15, Tm = 193.15, TT = 170, TP = 1.31328, MW = 58.0791, LVB = 0.0734076, AF = 0.330077, SP = 19320, DM = 8.41E-30, SH = -1209000000.0, IGHF = -1.874E+08, GEF = -1.244E+08, AS = 304700, HFMP = 8580000, HOC = -1.6857E+09, LiqDen = {105,0.81482,0.2126,493.15,0.21277,0}, VP = {101,110.8631,-6856.828,-13.8218,0.0000173391,2}, LiqCp = {16,116710,75.622,5.752,0.010877,0.0000042986}, HOV = {106,6.196909E+07,1.837694,-1.953499,-0.000443949,0.620394}, VapCp = {16,-181030,9.3832,12.233,0.00079415,-2.4738E-07}, LiqVis = {101,-10.033,843.41,-0.14954,3.8846E-08,2}, VapVis = {102,1.9173E-07,0.71905,111.91,4618.1,0}, LiqK = {16,0.020248,-83.587,-0.55331,-0.0042681,0.0000015626}, VapK = {102,776.87,0.94095,4.8356E+09,-1.3358E+11,0}, Racketparam = 0.239, UniquacR = 2.5735, UniquacQ = 2.336, ChaoSeadAF = 0.255909, ChaoSeadSP = 19320, ChaoSeadLV = 0.0734076); + end Propanal; + + model Butanal + extends General_Properties( + SN = 319, name = "Butanal", CAS = "123-72-8", Tc = 521.15, Pc = 4000000, Vc = 0.263, Cc = 0.25, Tb = 347.95, Tm = 176.75, TT = 176.75, TP = 0.316993, MW = 72.1057, LVB = 0.0904328, AF = 0.277417, SP = 18660, DM = 9.07E-30, SH = -1209000000.0, IGHF = -2.07E+08, GEF = -1.1539E+08, AS = 344900, HFMP = 1.109E+07, HOC = -2.3035E+09, LiqDen = {105,1.0715,0.2723,521.3,0.27225,0}, VP = {101,99.51827,-7112.269,-11.7407,9.521179E-06,2}, LiqCp = {16,146790,-6569.4,41.653,-0.01116,-0.000075065}, HOV = {106,4.118197E+07,-1.36073,5.949252,-7.213209,2.926745}, VapCp = {16,84791,-954.83,13.167,-0.00050103,1.5222E-07}, LiqVis = {101,-14.207,1014.9,0.55992,-0.0000018129,2}, VapVis = {102,9.4037E-07,0.50713,464.89,-11049,0}, LiqK = {16,0.054171,0.30189,-1.9042,-0.00054405,-0.0000037387}, VapK = {102,784.27,0.98392,6.406E+09,-1.3461E+11,0}, Racketparam = 0.25, UniquacR = 3.2479, UniquacQ = 2.876, ChaoSeadAF = 0.277417, ChaoSeadSP = 18660, ChaoSeadLV = 0.0904328); + end Butanal; + + model Pentanal + extends General_Properties( + SN = 320, name = "Pentanal", CAS = "110-62-3", Tc = 554, Pc = 3500000, Vc = 0.316, Cc = 0.264, Tb = 376.15, Tm = 190.15, TT = 182, TP = 0.0522823, MW = 86.1323, LVB = 0.107035, AF = 0.390803, SP = 18440, DM = 8.57E-30, SH = -1209000000.0, IGHF = -2.2669E+08, GEF = -1.0711E+08, AS = 382890, HFMP = 1.5E+07, HOC = -2.91E+09, LiqDen = {105,0.76227,0.25072,566.11,0.27912,0}, VP = {101,92.63614,-7428.499,-10.51804,7.160109E-06,2}, LiqCp = {16,156770,199.89,4.2571,0.024547,-0.000022679}, HOV = {106,6.99504E+07,0.991037,0.252443,-1.761713,0.936026}, VapCp = {16,101560,-929.74,13.391,-0.0005525,1.6606E-07}, LiqVis = {101,-10.884,982.07,-0.00046989,2.2767E-08,2}, VapVis = {102,2.2718E-07,0.67661,192.16,-86.47,0}, LiqK = {16,0.010965,-0.28239,-1.5585,-0.0012856,-0.0000013221}, VapK = {102,-3901000,-0.05461,1.6551E+09,-2.4357E+13,0}, Racketparam = 0.264, UniquacR = 3.9223, UniquacQ = 3.416, ChaoSeadAF = 0.347159, ChaoSeadSP = 18440, ChaoSeadLV = 0.107035); + end Pentanal; + + model Hexanal + extends General_Properties( + SN = 321, name = "Hexanal", CAS = "66-25-1", Tc = 579, Pc = 3110000, Vc = 0.369, Cc = 0.26, Tb = 401.45, Tm = 217.15, TT = 217.15, TP = 1.24729, MW = 100.159, LVB = 0.123708, AF = 0.439121, SP = 18150, DM = 8.6E-30, SH = -1209000000.0, IGHF = -2.4732E+08, GEF = -9.882E+07, AS = 422140, HFMP = 1.89E+07, HOC = -3.52E+09, LiqDen = {105,1.3196,0.35571,579,0.38551,0}, VP = {101,209.3738,-12430.59,-28.59364,0.0000281667,2}, LiqCp = {16,175480,98.975,6.7267,0.013876,-0.0000081365}, HOV = {106,5.570251E+07,-0.000821879,0.788181,-0.0470431,-0.460389}, VapCp = {16,115820,-867.39,13.422,-0.00036658,7.4569E-08}, LiqVis = {101,-11.85,1055.4,0.17945,-3.4838E-07,2}, VapVis = {102,1.6626E-07,0.71206,185.2,-6483.1,0}, LiqK = {16,0.0039289,-19.957,-1.3588,-0.0017925,-6.0508E-07}, VapK = {102,-5919900,-0.017833,2.2842E+09,-4.7916E+13,0}, Racketparam = 0.26, UniquacR = 4.5967, UniquacQ = 3.956, ChaoSeadAF = 0.387184, ChaoSeadSP = 18150, ChaoSeadLV = 0.123708); + end Hexanal; + + model Heptanal + extends General_Properties( + SN = 322, name = "Heptanal", CAS = "111-71-7", Tc = 603, Pc = 2800000, Vc = 0.421, Cc = 0.267, Tb = 425.95, Tm = 230.15, TT = 229.8, TP = 1.44979, MW = 114.185, LVB = 0.140287, AF = 0.488466, SP = 17780, DM = 8.6E-30, SH = -1209000000.0, IGHF = -2.6401E+08, GEF = -8.653E+07, AS = 461380, HFMP = 2.359E+07, HOC = -4.136E+09, LiqDen = {105,0.53646,0.24452,616.81,0.26981,0}, VP = {101,108.36,-9179.6,-12.655,0.0000073363,2}, LiqCp = {16,200220,128.23,7.474,0.012008,-0.0000080423}, HOV = {106,6.244116E+07,0.224744,0.949788,-1.500319,0.675167}, VapCp = {16,131660,-858.87,13.596,-0.00041213,8.8955E-08}, LiqVis = {101,8.4077,475.87,-3.0758,0.0000053404,2}, VapVis = {102,1.4563E-07,0.72362,184.89,-7288.6,0}, LiqK = {16,0.02754,-55.074,-1.243,-0.0022084,-0.0000010637}, VapK = {102,1569.2,1.0102,1.4874E+10,2.7536E+11,0}, Racketparam = 0.267, UniquacR = 5.2711, UniquacQ = 4.496, ChaoSeadAF = 0.42794, ChaoSeadSP = 17780, ChaoSeadLV = 0.140287); + end Heptanal; + + model Diisopropylether + extends General_Properties( + SN = 323, name = "Diisopropylether", CAS = "108-20-3", Tc = 500.05, Pc = 2880000, Vc = 0.386, Cc = 0.267, Tb = 341.45, Tm = 187.65, TT = 187.65, TP = 6.8582, MW = 102.175, LVB = 0.141775, AF = 0.338683, SP = 14450, DM = 3.77E-30, SH = -1209000000.0, IGHF = -3.18988E+08, GEF = -1.248E+08, AS = 382000, HFMP = 1.103E+07, HOC = -3.70234E+09, LiqDen = {105,0.72527,0.27594,500.05,0.29413,0}, VP = {101,109.5333,-7120.297,-13.51365,0.0000143778,2}, LiqCp = {16,161880,-2.8879,7.7638,0.014551,-0.000013251}, HOV = {106,5.8041E+07,2.3385,-5.2086,5.0367,-1.6926}, VapCp = {16,69454,-410.18,12.642,0.00044085,-1.3595E-07}, LiqVis = {101,-9.064,932.47,-0.38815,0.0000010323,2}, VapVis = {102,4.0782E-07,0.58517,121.4,19303,0}, LiqK = {16,0.067752,-462.02,2.3997,-0.014453,0.0000029856}, VapK = {102,0.00010149,1.0246,180.97,93179,0}, Racketparam = 0.267, UniquacR = 4.7421, UniquacQ = 4.088, ChaoSeadAF = 0.338683, ChaoSeadSP = 14450, ChaoSeadLV = 0.141775); + end Diisopropylether; + + model Dinbutylether + extends General_Properties( + SN = 324, name = "Dinbutylether", CAS = "142-96-1", Tc = 580.15, Pc = 2380000, Vc = 0.511, Cc = 0.247, Tb = 415.35, Tm = 177.95, TT = 175.3, TP = 0.000714135, MW = 130.228, LVB = 0.17041, AF = 0.447646, SP = 15830, DM = 3.9E-30, SH = -1209000000.0, IGHF = -3.339E+08, GEF = -8.827E+07, AS = 481200, HFMP = 1.63E+07, HOC = -4.94716E+09, LiqDen = {105,0.22926,0.17412,584.11,0.21764,0}, VP = {101,95.7043,-8294.241,-10.81822,6.127187E-06,2}, LiqCp = {16,198760,65.432,9.8123,0.0039694,8.4178E-07}, HOV = {106,6.4859E+07,0.77992,-0.72383,0.38094,-0.025388}, VapCp = {16,152990,-805.71,13.605,-0.00024656,5.3497E-08}, LiqVis = {101,20.743,-83.003,-4.9404,0.000004096,2}, VapVis = {102,0.0000002113,0.66224,141.56,6932,0}, LiqK = {16,-0.067128,2.4703,-1.3291,-0.0010011,-2.5742E-07}, VapK = {102,0.0036064,0.57918,1401.9,287150,0}, Racketparam = 0.247, UniquacR = 6.0925, UniquacQ = 5.176, ChaoSeadAF = 0.447646, ChaoSeadSP = 15830, ChaoSeadLV = 0.17041); + end Dinbutylether; + + model Disecbutylether + extends General_Properties( + SN = 325, name = "Disecbutylether", CAS = "6863-58-7", Tc = 562, Pc = 2556000, Vc = 0.487, Cc = 0.269, Tb = 394.2, Tm = 173.15, TT = 173.15, TP = 0.0027863, MW = 130.228, LVB = 0.171577, AF = 0.329, SP = 14950, DM = 0, SH = -1209000000.0, IGHF = -3.609E+08, GEF = -1.157E+08, AS = 501000, HFMP = 0, HOC = -4.9233E+09, LiqDen = {105,0.038135,0.072155,562,0.11862,0}, VP = {101,102.5292,-8146.755,-11.97808,8.058954E-06,2}, LiqCp = {16,102180,-37.551,10.606,0.0064949,-0.0000048029}, HOV = {106,5.5999E+07,0.34375,0.18962,-0.14755,-0.0040987}, VapCp = {16,94528,-497.39,13.241,0.000057744,-1.2606E-09}, LiqVis = {101,-10.318,1230.4,-0.20919,4.9411E-07,2}, VapVis = {102,1.1864E-07,0.74861,137.78,-4500.8,0}, LiqK = {16,0.027499,27.604,-2.2754,0.00032105,-0.0000044406}, VapK = {102,0.00016749,0.96101,656.84,-691.7,0}, Racketparam = 0.269, UniquacR = 6.0909, UniquacQ = 5.168, ChaoSeadAF = 0.329, ChaoSeadSP = 14950, ChaoSeadLV = 0.171577); + end Disecbutylether; + + model Methylethylether + extends General_Properties( + SN = 326, name = "Methylethylether", CAS = "540-67-0", Tc = 437.8, Pc = 4400000, Vc = 0.221, Cc = 0.267, Tb = 280.5, Tm = 160, TT = 160, TP = 7.85121, MW = 60.096, LVB = 0.08585, AF = 0.236, SP = 15370, DM = 4.1E-30, SH = -216400000.0, IGHF = -2.164E+08, GEF = -1.177E+08, AS = 308810, HFMP = 7980000, HOC = -1.9314E+09, LiqDen = {105,1.1195,0.26367,437.86,0.25231,0}, VP = {101,63.84,-4659.2,-6.4137,0.0000057727,2}, LiqCp = {16,109050,-31.645,7.7783,0.0084684,0.0000041202}, HOV = {106,1.3679E+08,9.4948,-25.655,28.424,-11.603}, VapCp = {16,60571,-557.18,12.079,0.00048084,-1.7581E-07}, LiqVis = {101,-11.138,628.05,0.042345,-2.0281E-08,2}, VapVis = {102,2.9661E-07,0.6716,174.02,-2778.1,0}, LiqK = {16,0.029003,34.124,-1.9356,0.0010295,-0.0000079939}, VapK = {102,0.00021058,0.94472,515.36,8108.3,0}, Racketparam = 0.267, UniquacR = 2.7205, UniquacQ = 2.476, ChaoSeadAF = 0.236, ChaoSeadSP = 15370, ChaoSeadLV = 0.08585); + end Methylethylether; + + model Methylnpropylether + extends General_Properties( + SN = 327, name = "Methylnpropylether", CAS = "557-17-5", Tc = 472, Pc = 3801000, Vc = 0.274, Cc = 0.265, Tb = 312.29, Tm = 123.15, TT = 133.97, TP = 0.00289599, MW = 74.1216, LVB = 0.1032, AF = 0.276999, SP = 15730, DM = 4.14E-30, SH = -216400000.0, IGHF = -2.379E+08, GEF = -1.108E+08, AS = 352000, HFMP = 7670000, HOC = -2.517E+09, LiqDen = {105,1.1427,0.28927,472,0.3185,0}, VP = {101,59.81269,-4968.626,-5.703041,3.962175E-06,2}, LiqCp = {16,136920,43.97,5.0864,0.024992,-0.000027384}, HOV = {106,4.425282E+07,0.586164,-0.378014,0.582618,-0.440041}, VapCp = {16,93668,-926.82,13.189,-0.0004818,0.000000144}, LiqVis = {101,-11.301,802.09,0.054938,-4.1844E-07,2}, VapVis = {102,1.0896E-07,0.78578,98.829,-6562.3,0}, LiqK = {16,-0.0079788,3.9001,-1.4224,-0.0010693,-0.0000025315}, VapK = {102,0.010718,0.485,2083.9,283110,0}, Racketparam = 0.265, UniquacR = 3.3949, UniquacQ = 3.016, ChaoSeadAF = 0.276999, ChaoSeadSP = 15730, ChaoSeadLV = 0.1032); + end Methylnpropylether; + + model Isopropylbutylether + extends General_Properties( + SN = 328, name = "Isopropylbutylether", CAS = "1860-27-1", Tc = 549, Pc = 2740000, Vc = 0.435, Cc = 0.261, Tb = 378.15, Tm = 180, TT = 180, TP = 0.0337504, MW = 116.201, LVB = 0.155791, AF = 0.403229, SP = 15260, DM = 4.24E-30, SH = -216400000.0, IGHF = -3.269E+08, GEF = -1.071E+08, AS = 450200, HFMP = 1.22E+07, HOC = -4.324E+09, LiqDen = {105,0.62258,0.27082,549,0.30735,0}, VP = {101,85.99635,-7315.405,-9.426402,5.236755E-06,2}, LiqCp = {16,200760,-0.77126,8.116,0.0093067,-0.00000176}, HOV = {106,5.2177E+07,0.38027,0,0,0}, VapCp = {16,76973,-443.41,12.925,0.00032949,-1.1644E-07}, LiqVis = {101,-11.496,1171.6,0.0066892,-1.6659E-08,2}, VapVis = {102,0.000000176,0.70157,181.76,-5946.4,0}, LiqK = {16,-0.10095,17.355,-1.4146,-0.000082157,-0.0000014735}, VapK = {102,0.00016013,0.96562,574.46,18419,0}, Racketparam = 0.261, UniquacR = 5.4173, UniquacQ = 4.632, ChaoSeadAF = 0.403229, ChaoSeadSP = 15260, ChaoSeadLV = 0.155791); + end Isopropylbutylether; + + model Methylisobutylether + extends General_Properties( + SN = 329, name = "Methylisobutylether", CAS = "625-44-5", Tc = 497, Pc = 3410000, Vc = 0.329, Cc = 0.272, Tb = 331.7, Tm = 0, TT = 0, TP = 0, MW = 88.1482, LVB = 0.121242, AF = 0.307786, SP = 15100, DM = 4.7E-30, SH = -216400000.0, IGHF = -2.66E+08, GEF = -1.07E+08, AS = 381000, HFMP = 0, HOC = -3.122E+09, LiqDen = {105,0.83514,0.27544,497,0.27525,0}, VP = {101,67.83965,-5584.772,-6.90156,5.177794E-06,2}, LiqCp = {16,156890,481.87,3.1798,0.023292,-0.000015219}, HOV = {106,4.281E+07,0.34436,0.050812,-0.029168,0.014527}, VapCp = {16,84480,-573.48,12.645,0.00036001,-1.6026E-07}, LiqVis = {101,-6.5049,776.05,-0.79051,0.0000029469,2}, VapVis = {102,2.7344E-07,0.65828,203.42,-5560.1,0}, LiqK = {16,-0.1664,6.1773,-1.0308,-0.0004394,-9.9213E-07}, VapK = {102,0.00016088,0.97231,471.48,30281,0}, Racketparam = 0.272, UniquacR = 4.0685, UniquacQ = 3.552, ChaoSeadAF = 0.307786, ChaoSeadSP = 15100, ChaoSeadLV = 0.121242); + end Methylisobutylether; + + model Methylisopropylether + extends General_Properties( + SN = 330, name = "Methylisopropylether", CAS = "598-53-8", Tc = 464.48, Pc = 3762000, Vc = 0.276, Cc = 0.269, Tb = 303.92, Tm = 127.93, TT = 127.93, TP = 0.00332352, MW = 74.1216, LVB = 0.1046, AF = 0.26555, SP = 15160, DM = 4.16E-30, SH = -216400000.0, IGHF = -2.52E+08, GEF = -1.209E+08, AS = 338300, HFMP = 5850000, HOC = -2.5311E+09, LiqDen = {105,0.82094,0.24798,464.48,0.26184,0}, VP = {101,61.57822,-4874.158,-6.034163,5.097159E-06,2}, LiqCp = {16,123760,190.2,5.9878,0.016259,-0.000010176}, HOV = {106,4.2811E+07,1.2196,-2.6572,3.1706,-1.3477}, VapCp = {16,84263,-798.1,12.945,-0.00018216,3.6316E-08}, LiqVis = {101,-10.884,730.8,-0.038881,2.6764E-07,2}, VapVis = {102,1.9275E-07,0.70897,109.56,-107.54,0}, LiqK = {16,-0.21567,5.2547,-0.85956,-0.00045627,-9.7493E-07}, VapK = {102,1.3675,-0.14071,1446.2,3030500,0}, Racketparam = 0.269, UniquacR = 3.3941, UniquacQ = 3.012, ChaoSeadAF = 0.26555, ChaoSeadSP = 15160, ChaoSeadLV = 0.1046); + end Methylisopropylether; + + model Tertbutylethylether + extends General_Properties( + SN = 331, name = "Tertbutylethylether", CAS = "637-92-3", Tc = 512, Pc = 3149000, Vc = 0.382, Cc = 0.272, Tb = 345.65, Tm = 176.15, TT = 179.15, TP = 0.880264, MW = 102.175, LVB = 0.138991, AF = 0.295672, SP = 14800, DM = 4.07E-30, SH = -216400000.0, IGHF = -3.165E+08, GEF = -1.217E+08, AS = 397500, HFMP = 9530000, HOC = -3.684E+09, LiqDen = {105,0.74373,0.27619,512,0.30602,0}, VP = {101,59.92213,-5564.171,-5.601322,3.389291E-06,2}, LiqCp = {16,135520,9.8807,8.6914,0.01077,-0.0000076034}, HOV = {106,4.5825E+07,0.349787,0.137025,-0.301886,0.219717}, VapCp = {16,78915,-487.03,12.843,0.00025385,-8.879E-08}, LiqVis = {101,-12.011,1089.8,0.081011,-2.1688E-07,2}, VapVis = {102,1.9715E-07,0.697,171.3,-4885.5,0}, LiqK = {16,-0.1316,11.716,-1.2478,-0.00024672,-0.0000012519}, VapK = {102,0.000058788,1.0907,235.7,33150,0}, Racketparam = 0.272, UniquacR = 4.7422, UniquacQ = 4.172, ChaoSeadAF = 0.295672, ChaoSeadSP = 14800, ChaoSeadLV = 0.138991); + end Tertbutylethylether; + + model Ethyltertpentylether + extends General_Properties( + SN = 332, name = "Ethyltertpentylether", CAS = "919-94-8", Tc = 544, Pc = 2740000, Vc = 0.435, Cc = 0.273, Tb = 374.15, Tm = 190, TT = 190, TP = 0.729523, MW = 116.201, LVB = 0.152635, AF = 0.338192, SP = 14970, DM = 5.14E-30, SH = -216400000.0, IGHF = -3.324E+08, GEF = -1.094E+08, AS = 439200, HFMP = 1.2E+07, HOC = -4.32E+09, LiqDen = {105,0.65888,0.27797,544,0.29227,0}, VP = {101,47.12433,-5006.625,-3.892102,0.0000058438,2}, LiqCp = {16,-79604,-398.25,15.392,-0.0067505,0.0000071337}, HOV = {106,6.448049E+07,2.475757,-5.830862,5.958177,-2.135539}, VapCp = {16,119820,-647.93,13.251,-0.00004893,2.8951E-09}, LiqVis = {101,-11.435,1134.3,-0.0102,2.552E-08,2}, VapVis = {102,1.2029E-07,0.7552,122.76,-2833.2,0}, LiqK = {16,-0.13805,13.252,-1.2618,-0.00018101,-0.0000010967}, VapK = {102,0.00013295,0.98504,431.52,34060,0}, Racketparam = 0.273, UniquacR = 5.4166, UniquacQ = 4.712, ChaoSeadAF = 0.338192, ChaoSeadSP = 14970, ChaoSeadLV = 0.152635); + end Ethyltertpentylether; + + model Butylvinylether + extends General_Properties( + SN = 333, name = "Butylvinylether", CAS = "111-34-2", Tc = 540.5, Pc = 3200000, Vc = 0.38362, Cc = 0.273, Tb = 367.131, Tm = 181.15, TT = 181.15, TP = 0.134811, MW = 100.163, LVB = 0.130251, AF = 0.358, SP = 16460, DM = 4.16955E-30, SH = -216400000.0, IGHF = -1.83E+08, GEF = -3.61974E+07, AS = 428000, HFMP = 1.38E+07, HOC = -3.59144E+09, LiqDen = {105,0.51202,0.22443,540.5,0.25269,0}, VP = {101,80.48089,-6835.53,-8.641032,5.192611E-06,2}, LiqCp = {16,179060,294.15,4.464,0.023293,-0.000021892}, HOV = {106,5.9857E+07,1.4054,-2.9112,3.3585,-1.4378}, VapCp = {16,70271,-440.11,12.531,0.00054467,-2.1666E-07}, LiqVis = {101,-13.973,1139.1,0.44727,-0.0000011861,2}, VapVis = {102,9.4315E-08,0.78571,41.584,9100.4,0}, LiqK = {16,-0.13174,16.987,-1.2513,-0.000050242,-0.000001447}, VapK = {102,0.00002407,1.1842,65.04,40153,0}, Racketparam = 0.273, UniquacR = 4.7403, UniquacQ = 4.192, ChaoSeadAF = 0.358, ChaoSeadSP = 16460, ChaoSeadLV = 0.130251); + end Butylvinylether; + + model Anisole + extends General_Properties( + SN = 334, name = "Anisole", CAS = "100-66-3", Tc = 642.15, Pc = 4180000, Vc = 0.337, Cc = 0.267, Tb = 426.95, Tm = 235.85, TT = 235.65, TP = 2.44662, MW = 108.138, LVB = 0.109167, AF = 0.350169, SP = 20110, DM = 4.54E-30, SH = -216400000.0, IGHF = -6.8E+07, GEF = 2.27E+07, AS = 361000, HFMP = 9600000, HOC = -3.6018E+09, LiqDen = {105,0.67524,0.24431,645.61,0.26239,0}, VP = {101,117.0581,-9318.991,-14.12565,9.850515E-06,2}, LiqCp = {16,128070,-77.615,10.002,0.0059631,-0.0000043683}, HOV = {106,6.1782E+07,0.29654,0.81637,-1.3762,0.64684}, VapCp = {16,-116340,-170.41,12.829,0.00034368,-1.0767E-07}, LiqVis = {101,-16.864,1572.6,0.82898,-2.2828E-07,2}, VapVis = {102,1.7587E-07,0.71998,171.18,1705.8,0}, LiqK = {16,-0.15959,21.142,-1.1373,-0.0000023738,-0.0000009757}, VapK = {102,0.00055356,0.7624,342.48,235670,0}, Racketparam = 0.267, UniquacR = 4.1667, UniquacQ = 3.208, ChaoSeadAF = 0.350169, ChaoSeadSP = 20110, ChaoSeadLV = 0.109167); + end Anisole; + + model Isopropylacetate + extends General_Properties( + SN = 335, name = "Isopropylacetate", CAS = "108-21-4", Tc = 516.15, Pc = 3495640, Vc = 0.343881, Cc = 0.25, Tb = 361.65, Tm = 199.75, TT = 199.75, TP = 3.8692, MW = 102.132, LVB = 0.117579, AF = 0.542817, SP = 17150, DM = 5.84E-30, SH = -216400000.0, IGHF = -4.817E+08, GEF = -3.337E+08, AS = 390200, HFMP = 8880000, HOC = -2.658E+09, LiqDen = {105,1.7447,0.38746,516.15,0.46246,0}, VP = {101,53.596,-5675.5,-4.5065,0.0000012831,2}, LiqCp = {16,131390,-46.486,8.1047,0.013597,-0.000010999}, HOV = {106,4.852874E+07,0.139799,0.87492,-1.379465,0.721356}, VapCp = {16,49388,-461.23,12.886,-0.00010674,6.959E-08}, LiqVis = {101,-10.895,1115.7,-0.084451,4.8399E-07,2}, VapVis = {102,3.7177E-07,0.62086,249.31,-266.55,0}, LiqK = {16,-0.09612,7.576,-1.2028,-0.00070085,-9.2097E-07}, VapK = {102,-5913400,-0.12076,3.6992E+09,-2.5996E+13,0}, Racketparam = 0.25, UniquacR = 4.1522, UniquacQ = 3.652, ChaoSeadAF = 0.367774, ChaoSeadSP = 17150, ChaoSeadLV = 0.117579); + end Isopropylacetate; + + model Nbutylacetate + extends General_Properties( + SN = 336, name = "Nbutylacetate", CAS = "123-86-4", Tc = 579, Pc = 3090000, Vc = 0.4128, Cc = 0.253, Tb = 399.12, Tm = 199.65, TT = 199.65, TP = 0.0816516, MW = 116.16, LVB = 0.13251, AF = 0.407, SP = 17670, DM = 6.14E-30, SH = -216400000.0, IGHF = -4.856E+08, GEF = -3.123E+08, AS = 442500, HFMP = 1.44E+07, HOC = -3.283E+09, LiqDen = {105,0.13588,0.1193,579,0.16305,0}, VP = {101,90.42793,-7625.342,-10.22284,8.987208E-06,2}, LiqCp = {16,201710,-19.025,8.0191,0.0068889,0.0000021505}, HOV = {106,8.192574E+07,1.151594,0.0889674,-1.859865,1.113952}, VapCp = {16,92876,-666.17,13.432,-0.00066148,3.0678E-07}, LiqVis = {101,-17.008,1461.1,0.8424,1.1193E-07,2}, VapVis = {102,1.0488E-07,0.76809,52.337,8271.1,0}, LiqK = {16,0.04366,-125.65,-0.40686,-0.0059305,0.0000024167}, VapK = {102,5.9364E-09,2.3739,-402.22,69606,0}, Racketparam = 0.253, UniquacR = 4.8274, UniquacQ = 4.196, ChaoSeadAF = 0.407, ChaoSeadSP = 17670, ChaoSeadLV = 0.13251); + end Nbutylacetate; + + model Isobutylacetate + extends General_Properties( + SN = 337, name = "Isobutylacetate", CAS = "110-19-0", Tc = 561, Pc = 3160000, Vc = 0.413, Cc = 0.266, Tb = 389.72, Tm = 174.3, TT = 174.3, TP = 0.00622415, MW = 116.16, LVB = 0.13387, AF = 0.456, SP = 17050, DM = 6.24E-30, SH = -216400000.0, IGHF = -4.93E+08, GEF = -3.222E+08, AS = 441000, HFMP = 1.24E+07, HOC = -3.319E+09, LiqDen = {105,0.40843,0.20784,561,0.21394,0}, VP = {101,28.45261,-5051.537,-0.615949,-1.95606E-06,2}, LiqCp = {16,161610,660.76,3.3098,0.024476,-0.000019195}, HOV = {106,6.408651E+07,1.313221,-1.992233,1.203843,-0.0654865}, VapCp = {16,100140,-654.65,13.176,-0.00017464,3.2068E-08}, LiqVis = {101,-7.1351,566.94,-0.24427,-0.0000078548,2}, VapVis = {102,1.0879E-07,0.78101,111.13,1059.5,0}, LiqK = {16,0.070874,405.28,-7.1892,0.020474,-0.000033831}, VapK = {102,-0.0010112,0.95292,-6813.9,270410,0}, Racketparam = 0.266, UniquacR = 4.8266, UniquacQ = 4.192, ChaoSeadAF = 0.456, ChaoSeadSP = 17050, ChaoSeadLV = 0.13387); + end Isobutylacetate; + + model Npentylacetate + extends General_Properties( + SN = 338, name = "Npentylacetate", CAS = "628-63-7", Tc = 605.15, Pc = 2800000, Vc = 0.442, Cc = 0.245, Tb = 422.15, Tm = 202.35, TT = 202.35, TP = 0.0185761, MW = 130.185, LVB = 0.149382, AF = 0.413866, SP = 17360, DM = 6.44E-30, SH = -216400000.0, IGHF = -5.055E+08, GEF = -3.035E+08, AS = 481800, HFMP = 1.65E+07, HOC = -3.89405E+09, LiqDen = {105,0.12608,0.12252,605.15,0.16886,0}, VP = {101,168.7214,-11229.65,-22.11732,0.0000177213,2}, LiqCp = {16,162580,80.092,8.5511,0.011513,-0.0000095523}, HOV = {106,7.883914E+07,0.946213,-0.171734,-0.730153,0.419139}, VapCp = {16,47433,-339.24,12.756,0.0005476,-2.1862E-07}, LiqVis = {101,-24.376,1661.3,2.1378,-0.0000051198,2}, VapVis = {102,4.6095E-07,0.57889,337.64,-259.28,0}, LiqK = {16,-0.08346,4.4855,-1.2866,-0.00064282,-6.6262E-07}, VapK = {102,-0.014827,0.47704,-3337.4,-1003300,0}, Racketparam = 0.245, UniquacR = 5.5018, UniquacQ = 4.736, ChaoSeadAF = 0.447773, ChaoSeadSP = 17360, ChaoSeadLV = 0.149382); + end Npentylacetate; + + model Vinylacetate + extends General_Properties( + SN = 339, name = "Vinylacetate", CAS = "108-05-4", Tc = 501.45, Pc = 4150000, Vc = 0.266, Cc = 0.248, Tb = 345.65, Tm = 180.35, TT = 180.35, TP = 0.70586, MW = 86.0892, LVB = 0.0929486, AF = 0.529352, SP = 18580, DM = 5.97E-30, SH = -216400000.0, IGHF = -3.157E+08, GEF = -2.287E+08, AS = 334400, HFMP = 5370000, HOC = -1.95E+09, LiqDen = {105,0.80837,0.2388,524.34,0.25151,0}, VP = {101,-28.90631,-2451.071,8.43748,-0.000014969,2}, LiqCp = {16,104670,68.241,7.8309,0.01301,-0.00001011}, HOV = {106,5.178411E+07,1.329393,-3.127105,3.542901,-1.384803}, VapCp = {16,50651,-432.89,12.118,0.00048734,-1.8964E-07}, LiqVis = {101,-20.187,1398,1.3362,8.2076E-07,2}, VapVis = {102,1.4727E-07,0.76076,119.27,67.359,0}, LiqK = {16,-0.068153,28.848,-1.5016,0.00051317,-0.0000030057}, VapK = {102,-5281900,-0.16154,2.8419E+09,-1.7045E+13,0}, Racketparam = 0.248, UniquacR = 3.2485, UniquacQ = 2.904, ChaoSeadAF = 0.351307, ChaoSeadSP = 18580, ChaoSeadLV = 0.0929486); + end Vinylacetate; + + model Nhexylacetate + extends General_Properties( + SN = 340, name = "Nhexylacetate", CAS = "142-92-7", Tc = 623.5, Pc = 2410000, Vc = 0.519, Cc = 0.244, Tb = 444.65, Tm = 192.25, TT = 192.25, TP = 0.000851561, MW = 144.211, LVB = 0.166008, AF = 0.461433, SP = 17200, DM = 6.2E-30, SH = -216400000.0, IGHF = -5.263E+08, GEF = -2.954E+08, AS = 520900, HFMP = 1.69E+07, HOC = -4.505E+09, LiqDen = {105,0.39801,0.22828,623.5,0.26879,0}, VP = {101,135.2,-10778,-16.633,0.000010146,2}, LiqCp = {16,152410,849.23,3.575,0.024024,-0.000019964}, HOV = {106,7.6365E+07,1.3535,-2.7266,3.0189,-1.2516}, VapCp = {16,74275,-423.1,13.088,0.00020721,-5.6794E-08}, LiqVis = {101,-11.853,1437.9,0.03568,-1.5887E-07,2}, VapVis = {102,0.0000001052,0.76244,141.7,-5217.3,0}, LiqK = {16,0.076217,432.06,-6.6217,0.014354,-0.00002134}, VapK = {102,-96.991,-0.0010535,51726,-1.0193E+09,0}, Racketparam = 0.244, UniquacR = 6.1762, UniquacQ = 5.276, ChaoSeadAF = 0.539588, ChaoSeadSP = 17200, ChaoSeadLV = 0.166008); + end Nhexylacetate; + + model Onepentanol + extends General_Properties( + SN = 341, name = "Onepentanol", CAS = "71-41-0", Tc = 588.15, Pc = 3909000, Vc = 0.326, Cc = 0.262, Tb = 411.16, Tm = 194.95, TT = 195.56, TP = 0.000345245, MW = 88.15, LVB = 0.10863, AF = 0.579, SP = 22520, DM = 5.67059E-30, SH = -216400000.0, IGHF = -3.0016E+08, GEF = -1.46022E+08, AS = 402501, HFMP = 9790560, HOC = -3.06051E+09, LiqDen = {105,0.54137,0.21848,588.15,0.20812,0}, VP = {101,150.9933,-11938.85,-18.59103,8.735585E-06,2}, LiqCp = {16,151460,721.52,-3.5691,0.059604,-0.000063767}, HOV = {106,1.1853E+08,1.9668,-2.5741,1.6268,-0.41037}, VapCp = {16,78144,-573.83,12.781,0.00015431,-6.6745E-08}, LiqVis = {101,-29.696,3126.2,2.4167,-0.0000024327,2}, VapVis = {102,1.9935E-07,0.70293,200.97,-2040.7,0}, LiqK = {16,0.14679,201570,-2097.5,7.255,-0.0083973}, VapK = {102,1221.5,0.95117,8.0014E+09,-2.8255E+11,0}, Racketparam = 0.262, UniquacR = 4.5987, UniquacQ = 4.208, ChaoSeadAF = 0.579, ChaoSeadSP = 22520, ChaoSeadLV = 0.10863); + end Onepentanol; + + model Twopentanol + extends General_Properties( + SN = 342, name = "Twopentanol", CAS = "6032-29-7", Tc = 552, Pc = 3880000, Vc = 0.327, Cc = 0.26, Tb = 392.15, Tm = 200, TT = 200, TP = 0.00596587, MW = 88.1482, LVB = 0.109448, AF = 0.674371, SP = 21700, DM = 5.39E-30, SH = -216400000.0, IGHF = -3.138E+08, GEF = -1.593E+08, AS = 396400, HFMP = 8480000, HOC = -3.0515E+09, LiqDen = {105,1.319,0.3371,552,0.32218,0}, VP = {101,156.6278,-11701.22,-19.61134,0.0000119964,2}, LiqCp = {16,223900,2827.9,-24.806,0.11426,-0.00010479}, HOV = {106,8.4515E+07,0.5603,0.52669,-1.3675,0.83639}, VapCp = {16,81533,-562.17,12.749,0.00015514,-6.2807E-08}, LiqVis = {101,-161.5575,9388.477,22.02304,-0.0000121894,2}, VapVis = {102,3.2586E-07,0.63457,242.49,-572.84,0}, LiqK = {16,-0.29342,50.682,-1.2923,0.0017888,-0.0000028966}, VapK = {102,1300.2,0.95377,8.1158E+09,-2.9211E+11,0}, Racketparam = 0.26, UniquacR = 4.5979, UniquacQ = 4.204, ChaoSeadAF = 0.558707, ChaoSeadSP = 21700, ChaoSeadLV = 0.109448); + end Twopentanol; + + model TwomethylOnebutanol + extends General_Properties( + SN = 343, name = "TwomethylOnebutanol", CAS = "137-32-6", Tc = 575.4, Pc = 3940000, Vc = 0.329, Cc = 0.271, Tb = 401.85, Tm = 195, TT = 195, TP = 0.000803, MW = 88.148, LVB = 0.1083, AF = 0.587733, SP = 22080, DM = 6.27E-30, SH = -216400000.0, IGHF = -3.0209E+08, GEF = -1.41E+08, AS = 386900, HFMP = 7430000, HOC = -3.062E+09, LiqDen = {105,0.88123,0.27569,576.16,0.26459,0}, VP = {101,169.4054,-12535.91,-21.44821,0.000011664,2}, LiqCp = {16,64512,-115.41,11.54,0.0018322,0.0000027168}, HOV = {106,1.7446E+08,5.4789,-13.886,15.653,-6.6531}, VapCp = {16,76232,-567.6,12.811,0.000074113,-1.3012E-08}, LiqVis = {101,0.00893998,2796.534,-2.732303,0.0000087109,2}, VapVis = {102,0.000000189,0.70643,185.92,-6046.6,0}, LiqK = {16,0.080313,-215.29,-0.17577,-0.0076457,0.000003672}, VapK = {102,1262.3,0.94565,7.7547E+09,-2.8418E+11,0}, Racketparam = 0.271, UniquacR = 4.5979, UniquacQ = 4.204, ChaoSeadAF = 0.587733, ChaoSeadSP = 22080, ChaoSeadLV = 0.1083); + end TwomethylOnebutanol; + + model TwoTwodimethylOnepropanol + extends General_Properties( + SN = 344, name = "TwoTwodimethylOnepropanol", CAS = "75-84-3", Tc = 552.7, Pc = 4078000, Vc = 0.327, Cc = 0.29, Tb = 386.25, Tm = 328.15, TT = 328.15, TP = 8050, MW = 88.1482, LVB = 0.1255, AF = 0.595013, SP = 19040, DM = 5.47E-30, SH = -216400000.0, IGHF = -3.021E+08, GEF = -1.4E+08, AS = 370000, HFMP = 3500000, HOC = -3.061E+09, LiqDen = {105,0.88741,0.29,552.7,0.28571,0}, VP = {101,192.4683,-12413.62,-25.59931,0.0000246643,2}, LiqCp = {16,124850,368.96,4.9094,0.027472,-0.00002893}, HOV = {106,4.5224E+07,-1.2435,2.138,0.13988,-0.73989}, VapCp = {16,72294.67,-550.0374,12.86817,0.000039202,-1.255351E-08}, LiqVis = {101,-12.693,3446.8,-0.71456,0.0000011322,2}, VapVis = {102,0.000021696,0.15612,1926.2,5137.4,0}, LiqK = {16,-0.11602,10.416,-1.227,-0.00033355,-0.00000113}, VapK = {102,1.2842E-07,1.9773,-61.933,2946,0}, Racketparam = 0.29, UniquacR = 4.5972, UniquacQ = 4.284, ChaoSeadAF = 0.595013, ChaoSeadSP = 19040, ChaoSeadLV = 0.1255); + end TwoTwodimethylOnepropanol; + + model Onehexanol + extends General_Properties( + SN = 345, name = "Onehexanol", CAS = "111-27-3", Tc = 611.4, Pc = 3510000, Vc = 0.381, Cc = 0.263, Tb = 430.44, Tm = 228.55, TT = 228.55, TP = 0.0295499, MW = 102.177, LVB = 0.12519, AF = 0.58, SP = 21830, DM = 5.5E-30, SH = -216400000.0, IGHF = -3.18E+08, GEF = -1.344E+08, AS = 440000, HFMP = 1.54E+07, HOC = -3.67439E+09, LiqDen = {105,0.12172,0.11263,611.4,0.13194,0}, VP = {101,140.4065,-11996.05,-16.8497,6.25688E-06,2}, LiqCp = {16,-13352,695.57,4.4864,0.026504,-0.000025444}, HOV = {106,9.9912E+07,1.0345,-0.71214,0.038869,0.22103}, VapCp = {16,93733,-618.92,13.098,-0.000028541,-8.6478E-09}, LiqVis = {101,-78.019,5186.5,9.8395,-0.0000094042,2}, VapVis = {102,2.3121E-07,0.66402,127.06,17987,0}, LiqK = {16,0.09203,1297.6,-15.712,0.045447,-0.000056017}, VapK = {102,-2143900,-0.092957,1.682E+08,-1.0339E+13,0}, Racketparam = 0.263, UniquacR = 5.2731, UniquacQ = 4.748, ChaoSeadAF = 0.58, ChaoSeadSP = 21830, ChaoSeadLV = 0.12519); + end Onehexanol; + + model Oneheptanol + extends General_Properties( + SN = 346, name = "Oneheptanol", CAS = "111-70-6", Tc = 631.9, Pc = 3150000, Vc = 0.435, Cc = 0.261, Tb = 449.81, Tm = 239.15, TT = 239.15, TP = 0.0117728, MW = 116.203, LVB = 0.14195, AF = 0.582, SP = 21540, DM = 5.57E-30, SH = -216400000.0, IGHF = -3.32E+08, GEF = -1.253E+08, AS = 480000, HFMP = 1.322E+07, HOC = -4.2887E+09, LiqDen = {105,0.53584,0.24833,632.61,0.25556,0}, VP = {101,251.8216,-17683.63,-33.48375,0.000017626,2}, LiqCp = {16,-85727,742.02,4.7157,0.026441,-0.000025674}, HOV = {106,1.173181E+08,1.489028,-2.632241,3.547284,-1.892409}, VapCp = {16,106760,-598.85,13.165,0.000054117,-4.1018E-08}, LiqVis = {101,-78.864,5896.7,9.4721,-3.3466E-07,2}, VapVis = {102,2.5718E-07,0.65021,248.54,12.534,0}, LiqK = {16,0.090359,1107.5,-13.417,0.037115,-0.000045589}, VapK = {102,-0.060066,0.28898,-3437.9,-1686200,0}, Racketparam = 0.261, UniquacR = 5.2731, UniquacQ = 4.748, ChaoSeadAF = 0.582, ChaoSeadSP = 21540, ChaoSeadLV = 0.14195); + end Oneheptanol; + + model OneFourbutanediol + extends General_Properties( + SN = 347, name = "OneFourbutanediol", CAS = "110-63-4", Tc = 667, Pc = 4880000, Vc = 0.297, Cc = 0.261, Tb = 501.15, Tm = 293.05, TT = 293.05, TP = 0.437872, MW = 90.121, LVB = 0.0888513, AF = 1.17696, SP = 28850, DM = 1.31E-29, SH = -216400000.0, IGHF = -4.267E+08, GEF = -2.78E+08, AS = 381000, HFMP = 1.63E+07, HOC = -2.2801E+09, LiqDen = {105,0.87669,0.26038,667,0.18382,0}, VP = {101,273.87,-20688,-36.39,0.000020662,2}, LiqCp = {16,-147300,-151.29,13.013,0.00082927,-4.8483E-07}, HOV = {106,8.835E+07,0.2441,0,0,0}, VapCp = {16,78857,-613.48,12.793,-0.00013274,6.7309E-08}, LiqVis = {101,-135.2818,9167.078,18.06409,-0.0000115446,2}, VapVis = {102,1.0592E-07,0.79673,195.38,-19182,0}, LiqK = {16,0.17847,-272.57,-0.42428,-0.0080796,0.0000034419}, VapK = {102,-0.69878,0.86746,-2810400,-7.1005E+07,0}, Racketparam = 0.261, UniquacR = 4.6976, UniquacQ = 4.56, ChaoSeadAF = 1.17696, ChaoSeadSP = 28850, ChaoSeadLV = 0.0888513); + end OneFourbutanediol; + + model Methylmercaptan + extends General_Properties( + SN = 348, name = "Methylmercaptan", CAS = "74-93-1", Tc = 470, Pc = 7230000, Vc = 0.145, Cc = 0.268, Tb = 279.11, Tm = 150.18, TT = 150.18, TP = 3.14785, MW = 48.109, LVB = 0.05552, AF = 0.15, SP = 19470, DM = 5.07E-30, SH = -22600000.0, IGHF = -2.26E+07, GEF = -9920000, AS = 255000, HFMP = 5904000, HOC = -1.1517E+09, LiqDen = {105,1.954,0.28171,470,0.28737,0}, VP = {101,115.1598,-6300.053,-14.66478,0.0000195265,2}, LiqCp = {16,87318,-59222,550.29,-1.6599,0.001702}, HOV = {106,3.221375E+07,-0.00310105,0.657759,-0.0249162,-0.340052}, VapCp = {16,38535,-588.35,11.232,0.00044782,-1.6363E-07}, LiqVis = {101,-8.947,607.01,-0.26447,0.0000011807,2}, VapVis = {102,1.9969E-07,0.74097,130.67,-839.04,0}, LiqK = {16,-0.011242,-11.424,-1.1701,-0.0017729,-0.0000012043}, VapK = {102,0.000024689,1.1702,4.7184,35466,0}, Racketparam = 0.268, UniquacR = 1.877, UniquacQ = 1.676, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); + end Methylmercaptan; + + model Npropylmercaptan + extends General_Properties( + SN = 349, name = "Npropylmercaptan", CAS = "107-03-9", Tc = 536, Pc = 4520000, Vc = 0.254, Cc = 0.264, Tb = 340.65, Tm = 159.85, TT = 160, TP = 0.0651025, MW = 76.1606, LVB = 0.0911676, AF = 0.225, SP = 18020, DM = 5.17E-30, SH = -22600000.0, IGHF = -6.75E+07, GEF = 2700000, AS = 336400, HFMP = 5477000, HOC = -2.345E+09, LiqDen = {105,0.98491,0.2613,536.61,0.28105,0}, VP = {101,81.44938,-6196.556,-9.018418,0.0000073391,2}, LiqCp = {16,104970,204.83,8.2793,0.0048108,0.0000020317}, HOV = {106,4.183879E+07,-0.0306824,1.010385,-0.640892,-0.0194755}, VapCp = {16,69258,-718.05,12.587,-0.000090812,1.349E-08}, LiqVis = {101,-8.6328,806.3,-0.3609,0.0000011977,2}, VapVis = {102,2.0609E-07,0.72623,217.41,-10810,0}, LiqK = {16,-0.061115,3.3836,-1.3478,-0.00049487,-0.0000016211}, VapK = {102,0.0088953,0.51444,2337.9,345110,0}, Racketparam = 0.264, UniquacR = 3.2265, UniquacQ = 2.756, ChaoSeadAF = 0.225, ChaoSeadSP = 18020, ChaoSeadLV = 0.0911676); + end Npropylmercaptan; + + model Tertbutylmercaptan + extends General_Properties( + SN = 350, name = "Tertbutylmercaptan", CAS = "75-66-1", Tc = 530, Pc = 4060000, Vc = 0.307, Cc = 0.283, Tb = 337.37, Tm = 274.26, TT = 274.42, TP = 7907.71, MW = 90.1872, LVB = 0.113524, AF = 0.191395, SP = 15790, DM = 5.3E-30, SH = -22600000.0, IGHF = -1.096E+08, GEF = 1006000, AS = 338000, HFMP = 2482000, HOC = -2.9396E+09, LiqDen = {105,0.89711,0.27544,530,0.31359,0}, VP = {101,107.5154,-7030.549,-13.1586,0.0000127338,2}, LiqCp = {16,154160,506.03,1.848,0.027991,-0.000021961}, HOV = {106,5.3137E+07,1.4502,-2.4713,2.4297,-0.95458}, VapCp = {16,81989,-677.66,12.907,-0.00021031,4.8543E-08}, LiqVis = {101,-8.3337,1214.8,-0.59208,0.0000022318,2}, VapVis = {102,3.9123E-07,0.6395,316.74,-8533.3,0}, LiqK = {16,0.031454,-260.91,0.599,-0.0079027,0.0000031638}, VapK = {102,0.032499,0.31482,1562.3,775320,0}, Racketparam = 0.283, UniquacR = 4.3543, UniquacQ = 3.912, ChaoSeadAF = 0.191395, ChaoSeadSP = 15790, ChaoSeadLV = 0.113524); + end Tertbutylmercaptan; + + model Isobutylmercaptan + extends General_Properties( + SN = 351, name = "Isobutylmercaptan", CAS = "513-44-0", Tc = 557, Pc = 3900000, Vc = 0.307, Cc = 0.268, Tb = 361.64, Tm = 128.31, TT = 128.3, TP = 4.75023E-06, MW = 90.1872, LVB = 0.108751, AF = 0.25, SP = 17240, DM = 5.1E-30, SH = -22600000.0, IGHF = -9.694E+07, GEF = 6100000, AS = 362840, HFMP = 4982300, HOC = -2.949E+09, LiqDen = {105,0.97433,0.28543,557,0.30684,0}, VP = {101,94.36165,-7005.04,-10.97315,8.971409E-06,2}, LiqCp = {16,113680,117.72,9.1822,0.0046628,2.8876E-09}, HOV = {106,4.696233E+07,0.280539,0.393074,-0.340509,0.0160184}, VapCp = {16,83649,-694.35,12.849,-0.00014111,3.1023E-08}, LiqVis = {101,-10.885,935.58,0.015703,-1.4837E-10,2}, VapVis = {102,8.5691E-08,0.8336,119.56,-8012,0}, LiqK = {16,-0.03575,3.5477,-1.4952,-0.00050318,-0.0000017356}, VapK = {102,0.00014532,0.98673,557.5,22542,0}, Racketparam = 0.268, UniquacR = 3.9001, UniquacQ = 3.292, ChaoSeadAF = 0.25, ChaoSeadSP = 17240, ChaoSeadLV = 0.108751); + end Isobutylmercaptan; + + model Secbutylmercaptan + extends General_Properties( + SN = 352, name = "Secbutylmercaptan", CAS = "513-53-1", Tc = 551, Pc = 3970000, Vc = 0.307, Cc = 0.271, Tb = 358.13, Tm = 133.01, TT = 133.01, TP = 0.0000339902, MW = 90.1872, LVB = 0.10943, AF = 0.25, SP = 17000, DM = 5.17E-30, SH = -22600000.0, IGHF = -9.66E+07, GEF = 5200000, AS = 366730, HFMP = 6477000, HOC = -2.95E+09, LiqDen = {105,0.81743,0.26237,554.01,0.28149,0}, VP = {101,85.20348,-6580.804,-9.568603,0.0000075683,2}, LiqCp = {16,132220,286.96,6.629,0.011753,-0.0000059086}, HOV = {106,4.567571E+07,0.16352,0.885588,-1.131485,0.438377}, VapCp = {16,85634,-697.09,12.792,-0.00003836,-5.0229E-09}, LiqVis = {101,-11.718,953.76,0.15985,-4.5581E-07,2}, VapVis = {102,8.4539E-08,0.83594,117.21,-7872.1,0}, LiqK = {16,-0.032852,4.221,-1.5207,-0.0004702,-0.0000018598}, VapK = {102,0.97519,-0.11286,1130.7,3149700,0}, Racketparam = 0.271, UniquacR = 4.1276, UniquacQ = 3.604, ChaoSeadAF = 0.25, ChaoSeadSP = 17000, ChaoSeadLV = 0.10943); + end Secbutylmercaptan; + + model Nhexylmercaptan + extends General_Properties( + SN = 353, name = "Nhexylmercaptan", CAS = "111-31-9", Tc = 622, Pc = 3025000, Vc = 0.412, Cc = 0.245, Tb = 424.15, Tm = 192.15, TT = 192.62, TP = 0.0130959, MW = 118.24, LVB = 0.141006, AF = 0.369, SP = 17450, DM = 5.17E-30, SH = -22600000.0, IGHF = -1.292E+08, GEF = 2.77E+07, AS = 454600, HFMP = 1.801E+07, HOC = -4.176E+09, LiqDen = {105,0.60827,0.26212,623.01,0.27785,0}, VP = {101,102.0208,-8530.272,-11.91139,8.521739E-06,2}, LiqCp = {16,168110,243.92,7.741,0.0099925,-0.0000054522}, HOV = {106,6.053718E+07,0.532372,-0.222059,0.0696209,-0.00101028}, VapCp = {16,116170,-711.75,13.18,-0.000044297,1.0562E-09}, LiqVis = {101,-35.723,1823.3,4.0853,-0.0000098564,2}, VapVis = {102,6.7616E-08,0.85134,101.57,-4277.1,0}, LiqK = {16,-0.076932,5.5076,-1.3601,-0.00033003,-0.000001155}, VapK = {102,0.090806,0.27994,4707,1982000,0}, Racketparam = 0.245, UniquacR = 5.2497, UniquacQ = 4.376, ChaoSeadAF = 0.369, ChaoSeadSP = 17450, ChaoSeadLV = 0.141006); + end Nhexylmercaptan; + + model Methylethylsulfide + extends General_Properties( + SN = 354, name = "Methylethylsulfide", CAS = "624-89-5", Tc = 533, Pc = 4260000, Vc = 0.26, Cc = 0.25, Tb = 339.8, Tm = 167.24, TT = 167.23, TP = 0.224563, MW = 76.163, LVB = 0.09102, AF = 0.208, SP = 18010, DM = 5.34E-30, SH = -22600000.0, IGHF = -5.93E+07, GEF = 1.19E+07, AS = 332100, HFMP = 9761000, HOC = -2.3531E+09, LiqDen = {105,1.067,0.27102,533,0.29364,0}, VP = {101,84.44792,-6287.173,-9.497514,8.101952E-06,2}, LiqCp = {16,128430,1340.2,-7.9347,0.062009,-0.00006022}, HOV = {106,5.1014E+07,1.045,-1.3834,1.1914,-0.41055}, VapCp = {16,65018,-602.45,12.269,0.00023938,-9.0299E-08}, LiqVis = {101,-11.137,871.68,0.048227,-1.2198E-07,2}, VapVis = {102,1.5396E-07,0.76205,156.76,-5273.3,0}, LiqK = {16,-0.050172,-1.1207,-1.3208,-0.00082247,-0.0000013076}, VapK = {102,0.0034168,0.62158,1811.6,162180,0}, Racketparam = 0.25, UniquacR = 3.1885, UniquacQ = 2.756, ChaoSeadAF = 0.208, ChaoSeadSP = 18010, ChaoSeadLV = 0.09102); + end Methylethylsulfide; + + model Methylnpropylsulfide + extends General_Properties( + SN = 355, name = "Methylnpropylsulfide", CAS = "3877-15-4", Tc = 552, Pc = 3800000, Vc = 0.322, Cc = 0.259, Tb = 368.69, Tm = 160.17, TT = 160.17, TP = 0.00425588, MW = 90.1872, LVB = 0.107699, AF = 0.356915, SP = 17710, DM = 5.5E-30, SH = -22600000.0, IGHF = -8.19E+07, GEF = 1.793E+07, AS = 371700, HFMP = 9912000, HOC = -2.962E+09, LiqDen = {105,1.528,0.35328,552,0.39953,0}, VP = {101,83.78969,-6786.538,-9.267875,6.742312E-06,2}, LiqCp = {16,140680,477.81,3.8109,0.020949,-0.000014877}, HOV = {106,5.460643E+07,0.610381,0.183873,-0.864255,0.448129}, VapCp = {16,76201,-575.5,12.472,0.00030373,-1.0224E-07}, LiqVis = {101,-11.683,983.43,0.11996,-4.1262E-07,2}, VapVis = {102,5.4928E-08,0.89154,78.07,-5628.6,0}, LiqK = {16,-0.062059,3.0814,-1.3629,-0.00055214,-0.0000012783}, VapK = {102,0.0023304,0.67586,1803.3,153300,0}, Racketparam = 0.259, UniquacR = 3.8629, UniquacQ = 3.296, ChaoSeadAF = 0.273669, ChaoSeadSP = 17710, ChaoSeadLV = 0.107699); + end Methylnpropylsulfide; + + model Methyltbutylsulfide + extends General_Properties( + SN = 356, name = "Methyltbutylsulfide", CAS = "6163-64-0", Tc = 585, Pc = 3400000, Vc = 0.37, Cc = 0.269, Tb = 372.048, Tm = 190.84, TT = 190.84, TP = 0.818336, MW = 104.214, LVB = 0.12697, AF = 0.107514, SP = 16230, DM = 5.2E-30, SH = -22600000.0, IGHF = -1.209E+08, GEF = 7400000, AS = 414300, HFMP = 8414000, HOC = -3.558E+09, LiqDen = {105,0.0025324,0.015967,585,0.080614,0}, VP = {101,84.46516,-6786.586,-9.396892,6.668285E-06,2}, LiqCp = {16,141210,178.65,7.6994,0.011393,-0.0000080501}, HOV = {106,6.776086E+07,2.156989,-4.009149,3.630339,-1.236406}, VapCp = {16,87862,-573.15,12.832,0.000097962,-4.8038E-08}, LiqVis = {101,-10.768,996.37,0.0046964,-1.0865E-08,2}, VapVis = {102,1.4934E-07,0.74231,170.99,-8263.5,0}, LiqK = {16,-0.049324,-5.479,-1.3559,-0.00091706,-9.5073E-07}, VapK = {102,0.00016838,0.95767,599.31,12993,0}, Racketparam = 0.269, UniquacR = 4.5358, UniquacQ = 3.912, ChaoSeadAF = 0.233365, ChaoSeadSP = 16230, ChaoSeadLV = 0.12697); + end Methyltbutylsulfide; + + model Methyltpentylsulfide + extends General_Properties( + SN = 357, name = "Methyltpentylsulfide", CAS = "13286-92-5", Tc = 632, Pc = 3130000, Vc = 0.412, Cc = 0.259, Tb = 401.15, Tm = 195, TT = 195, TP = 0.0547032, MW = 118.24, LVB = 0.141236, AF = 0.283554, SP = 16850, DM = 5.2E-30, SH = -22600000.0, IGHF = -1.374E+08, GEF = 2.884E+07, AS = 422900, HFMP = 8320000, HOC = -4.171E+09, LiqDen = {105,0.59566,0.25918,632,0.28571,0}, VP = {101,71.41151,-7073.516,-7.244729,3.628693E-06,2}, LiqCp = {16,181970,283.58,5.3016,0.020294,-0.000016827}, HOV = {106,5.4045E+07,0.37325,0,0,0}, VapCp = {16,109660,-656.23,13.164,-0.000084618,-5.7336E-09}, LiqVis = {101,-11.248,1169.1,-0.00088104,1.198E-09,2}, VapVis = {102,8.9322E-08,0.79515,142.11,-9151.1,0}, LiqK = {16,-0.059845,-0.6973,-1.3681,-0.00062696,-0.0000008708}, VapK = {102,0.00014528,0.96627,637.8,13351,0}, Racketparam = 0.259, UniquacR = 5.2102, UniquacQ = 4.452, ChaoSeadAF = 0.283554, ChaoSeadSP = 16850, ChaoSeadLV = 0.141236); + end Methyltpentylsulfide; + + model Dinpropylsulfide + extends General_Properties( + SN = 358, name = "Dinpropylsulfide", CAS = "111-47-7", Tc = 608, Pc = 3080000, Vc = 0.412, Cc = 0.251, Tb = 415.978, Tm = 170.55, TT = 170.44, TP = 0.000440358, MW = 118.24, LVB = 0.141918, AF = 0.374042, SP = 17110, DM = 5.5E-30, SH = -22600000.0, IGHF = -1.254E+08, GEF = 2.15E+07, AS = 447000, HFMP = 1.214E+07, HOC = -4.1801E+09, LiqDen = {105,0.66296,0.27313,608,0.29224,0}, VP = {101,149.6373,-10251.56,-19.3067,0.0000171365,2}, LiqCp = {16,165300,330.45,6.4516,0.01426,-0.000009041}, HOV = {106,5.7575E+07,0.38334,0.098397,-0.17233,0.065159}, VapCp = {16,105470,-659.93,13.199,-0.00015,2.3041E-08}, LiqVis = {101,-10.285,1150.9,-0.17064,6.2281E-07,2}, VapVis = {102,7.5739E-08,0.838,116.99,-6475.6,0}, LiqK = {16,-0.078109,7.1733,-1.4231,-0.000097639,-0.0000015465}, VapK = {102,0.0086151,0.48706,1648.6,489220,0}, Racketparam = 0.251, UniquacR = 5.2117, UniquacQ = 4.376, ChaoSeadAF = 0.374042, ChaoSeadSP = 17110, ChaoSeadLV = 0.141918); + end Dinpropylsulfide; + + model Diethylsulfide + extends General_Properties( + SN = 359, name = "Diethylsulfide", CAS = "352-93-2", Tc = 557, Pc = 3960000, Vc = 0.318, Cc = 0.269, Tb = 365.25, Tm = 169.22, TT = 169.2, TP = 0.099321, MW = 90.189, LVB = 0.10851, AF = 0.295, SP = 17490, DM = 5.14E-30, SH = -22600000.0, IGHF = -8.347E+07, GEF = 1.778E+07, AS = 368000, HFMP = 1.19035E+07, HOC = -2.9607E+09, LiqDen = {105,0.71845,0.24674,557.16,0.25292,0}, VP = {101,70.99138,-6108.92,-7.37143,5.835752E-06,2}, LiqCp = {16,145900,1485.7,-9.9348,0.077005,-0.000088463}, HOV = {106,4.6317E+07,0.40563,-0.17525,0.12561,0.018959}, VapCp = {16,84916,-751.54,12.969,-0.00026179,6.4336E-08}, LiqVis = {101,-2.9987,606.92,-1.2077,8.2651E-07,2}, VapVis = {102,6.8477E-08,0.85168,55.152,236.99,0}, LiqK = {16,-0.07619,7.9978,-1.3835,-0.00020735,-0.0000016592}, VapK = {102,0.0017352,0.67658,1116.5,181260,0}, Racketparam = 0.269, UniquacR = 3.8629, UniquacQ = 3.296, ChaoSeadAF = 0.295, ChaoSeadSP = 17490, ChaoSeadLV = 0.10851); + end Diethylsulfide; + + model Diethyldisulfide + extends General_Properties( + SN = 360, name = "Diethyldisulfide", CAS = "110-81-6", Tc = 642, Pc = 3870000, Vc = 0.358, Cc = 0.26, Tb = 427.15, Tm = 171.65, TT = 171.64, TP = 0.000220562, MW = 122.252, LVB = 0.12376, AF = 0.346925, SP = 18630, DM = 6.54E-30, SH = -22600000.0, IGHF = -7.47E+07, GEF = 2.301E+07, AS = 414000, HFMP = 9406000, HOC = -3.257E+09, LiqDen = {105,0.77633,0.27774,642,0.3008,0}, VP = {101,177.1651,-11358.16,-23.65597,0.0000232121,2}, LiqCp = {16,184820,1402.4,-9.485,0.072797,-0.00007939}, HOV = {106,5.898575E+07,0.279736,0.523521,-0.500907,0.0214669}, VapCp = {16,100900,-621.21,12.713,-0.0000050655,-1.705E-08}, LiqVis = {101,-12.559,1373.4,0.15118,-3.7692E-07,2}, VapVis = {102,6.5143E-08,0.87157,110.73,-9132.4,0}, LiqK = {16,-0.047803,3.9799,-1.4697,-0.00042308,-0.0000011998}, VapK = {102,0.00017171,0.93356,610.03,20030,0}, Racketparam = 0.26, UniquacR = 4.5748, UniquacQ = 3.816, ChaoSeadAF = 0.346925, ChaoSeadSP = 18630, ChaoSeadLV = 0.12376); + end Diethyldisulfide; + + model Dimethyldisulfide + extends General_Properties( + SN = 361, name = "Dimethyldisulfide", CAS = "624-92-0", Tc = 606, Pc = 5360000, Vc = 0.252, Cc = 0.264, Tb = 382.9, Tm = 188.44, TT = 188.44, TP = 0.207156, MW = 94.199, LVB = 0.0890926, AF = 0.266353, SP = 20060, DM = 6.57E-30, SH = -22600000.0, IGHF = -2.35978E+07, GEF = 1.53553E+07, AS = 336686, HFMP = 9192000, HOC = -2.04376E+09, LiqDen = {105,1.0289,0.26919,615.01,0.29771,0}, VP = {101,81.238,-6951.5,-8.8055,0.0000055663,2}, LiqCp = {16,143050,-21950,190.58,-0.51509,0.00050194}, HOV = {106,5.473869E+07,0.511523,0.456682,-1.152343,0.579651}, VapCp = {16,74603,-691.43,12.21,-0.0000028522,-1.9217E-08}, LiqVis = {101,-11.014,1197,-0.085106,2.8649E-07,2}, VapVis = {102,7.8221E-08,0.86272,109.17,-8364.4,0}, LiqK = {16,-0.035195,-0.25311,-1.4287,-0.00064815,-0.0000012773}, VapK = {102,0.00022814,0.8901,687.63,4695.8,0}, Racketparam = 0.264, UniquacR = 3.226, UniquacQ = 2.736, ChaoSeadAF = 0.205916, ChaoSeadSP = 20060, ChaoSeadLV = 0.0890926); + end Dimethyldisulfide; + + model Dinpropyldisulfide + extends General_Properties( + SN = 362, name = "Dinpropyldisulfide", CAS = "629-19-6", Tc = 727.15, Pc = 3009350, Vc = 0.518, Cc = 0.25, Tb = 466.65, Tm = 187.15, TT = 187.66, TP = 0.000767693, MW = 150.305, LVB = 0.157229, AF = 0.142024, SP = 17950, DM = 6.6E-30, SH = -22600000.0, IGHF = -1.173E+08, GEF = 3.849E+07, AS = 490000, HFMP = 1.381E+07, HOC = -4.53027E+09, LiqDen = {105,0.0083051,0.032244,727.15,0.12866,0}, VP = {101,37.30305,-7362.883,-1.323142,-8.891834E-06,2}, LiqCp = {16,195280,206.99,8.2539,0.0083402,-0.0000036311}, HOV = {106,5.27924E+07,-0.627848,2.812662,-3.633008,1.997715}, VapCp = {16,135200,-728.45,13.4,-0.00037376,9.4294E-08}, LiqVis = {101,-9.576,1437.8,-0.35065,0.0000011166,2}, VapVis = {102,6.2944E-08,0.86495,121.54,-9663.6,0}, LiqK = {16,-0.066065,4.827,-1.4132,-0.00039942,-9.1868E-07}, VapK = {102,0.00015595,0.95139,651.61,14665,0}, Racketparam = 0.25, UniquacR = 5.9236, UniquacQ = 4.896, ChaoSeadAF = 0.436981, ChaoSeadSP = 17950, ChaoSeadLV = 0.157229); + end Dinpropyldisulfide; + + model Ditertbutyldisulfide + extends General_Properties( + SN = 363, name = "Ditertbutyldisulfide", CAS = "110-06-5", Tc = 689.7, Pc = 3159000, Vc = 0.518, Cc = 0.285, Tb = 473.6, Tm = 268.2, TT = 268.2, TP = 9.12, MW = 178.359, LVB = 0.1947, AF = 0.402005, SP = 15680, DM = 6.2E-30, SH = -22600000.0, IGHF = -1.998E+08, GEF = 3.427E+07, AS = 500100, HFMP = 1.31E+07, HOC = -5.665E+09, LiqDen = {105,0.60778,0.31522,689.7,0.2884,0}, VP = {101,113.63,-10180,-13.332,0.0000068178,2}, LiqCp = {16,273850,-799.3,13.794,-0.001521,0.0000014598}, HOV = {106,5.0039E+07,-1.4285,5.5884,-6.8503,3.0089}, VapCp = {16,171300,-806,13.98,-0.00069575,1.6372E-07}, LiqVis = {101,-10.435,1172.7,0,0,0}, VapVis = {102,0.0000001005,0.79652,148.51,-7648.2,0}, LiqK = {16,-0.019283,-53.989,-1.1745,-0.0017696,-1.3435E-07}, VapK = {102,0.00018425,0.91582,448.35,58650,0}, Racketparam = 0.285, UniquacR = 5.9221, UniquacQ = 4.972, ChaoSeadAF = 0.402005, ChaoSeadSP = 15680, ChaoSeadLV = 0.1947); + end Ditertbutyldisulfide; + + model Ethylmethyldisulfide + extends General_Properties( + SN = 364, name = "Ethylmethyldisulfide", CAS = "20333-39-5", Tc = 628.9, Pc = 4615000, Vc = 0.312, Cc = 0.275, Tb = 407.15, Tm = 183.22, TT = 183.22, TP = 0.0416, MW = 108.226, LVB = 0.1066, AF = 0.301, SP = 18730, DM = 8.25E-30, SH = -22600000.0, IGHF = -4.94E+07, GEF = 1.709E+07, AS = 381100, HFMP = 9210000, HOC = -2.65E+09, LiqDen = {105,0.88258,0.27523,628.9,0.28571,0}, VP = {101,96.027,-8038.4,-10.972,0.0000070895,2}, LiqCp = {100,187520,-208.62,0.55295,0,0}, HOV = {106,4.8216E+07,0.48633,-0.6279,0.476,0}, VapCp = {16,84149,-628.71,12.564,-0.0001652,8.9754E-08}, LiqVis = {101,-74.45287,3204.964,10.10529,-0.0000144504,2}, VapVis = {102,7.0201E-08,0.85571,90.077,-7385.7,0}, LiqK = {16,-0.21083,11.426,-1.0307,0.00012249,-0.0000010671}, VapK = {102,0.00027958,0.86411,843.3,7471.1,0}, Racketparam = 0.275, UniquacR = 3.9004, UniquacQ = 3.276, ChaoSeadAF = 0.301, ChaoSeadSP = 18730, ChaoSeadLV = 0.1066); + end Ethylmethyldisulfide; + + model Ethylpropyldisulfide + extends General_Properties( + SN = 365, name = "Ethylpropyldisulfide", CAS = "30453-31-7", Tc = 660, Pc = 3612000, Vc = 0.417, Cc = 0.274, Tb = 446.85, Tm = 165, TT = 165, TP = 0.00002, MW = 136.279, LVB = 0.1405, AF = 0.391, SP = 17840, DM = 7.69E-30, SH = -22600000.0, IGHF = -9.625E+07, GEF = 2.796E+07, AS = 460300, HFMP = 1.08E+07, HOC = -3.866E+09, LiqDen = {105,0.65822,0.27459,660,0.28571,0}, VP = {101,110.6,-9574.8,-12.96,0.0000072115,2}, LiqCp = {100,223630,-139.83,0.57232,0,0}, HOV = {106,5.9782E+07,0.63427,-0.74757,0.47275,0}, VapCp = {16,105720,-573.79,12.857,0.000058344,8.0803E-09}, LiqVis = {101,-37.87,2334.8,4.1564,-0.0000036099,2}, VapVis = {102,6.9027E-08,0.8462,109.98,-9618.4,0}, LiqK = {16,-0.20064,12.059,-1.0757,0.00011826,-0.000000977}, VapK = {102,0.00000124,1.5526,-137.7,30422,0}, Racketparam = 0.274, UniquacR = 5.2492, UniquacQ = 4.356, ChaoSeadAF = 0.391, ChaoSeadSP = 17840, ChaoSeadLV = 0.1405); + end Ethylpropyldisulfide; + + model Diphenyldisulfide + extends General_Properties( + SN = 366, name = "Diphenyldisulfide", CAS = "882-33-7", Tc = 829.8, Pc = 3569000, Vc = 0.584, Cc = 0.302, Tb = 583.15, Tm = 333.5, TT = 333.5, TP = 0.49, MW = 218.338, LVB = 0.2076, AF = 0.569717, SP = 20480, DM = 5.97E-30, SH = -22600000.0, IGHF = 2.628E+08, GEF = 3.518E+08, AS = 489300, HFMP = 1.93E+07, HOC = -6.676E+09, LiqDen = {105,0.5173,0.302,829.8,0.28571,0}, VP = {101,927.5541,-59320.23,-131.1073,0.000060625,2}, LiqCp = {100,267470,28.884,0.54728,0,0}, HOV = {106,1.1805E+08,0.46278,0.25764,-0.22402,-0.0012437}, VapCp = {16,50433,-472.23,13.469,-0.00011605,2.3877E-08}, LiqVis = {101,-10.832,1659.3,-0.039017,-1.1543E-07,2}, VapVis = {102,5.542E-08,0.87669,123.7,-14104,0}, LiqK = {16,-0.040762,-52.269,-1.2013,-0.001172,-1.6247E-07}, VapK = {102,0.0000021936,1.4453,-128.48,46604,0}, Racketparam = 0.302, UniquacR = 7.6308, UniquacQ = 5.496, ChaoSeadAF = 0.569717, ChaoSeadSP = 20480, ChaoSeadLV = 0.2076); + end Diphenyldisulfide; + + model Monoethanolamine + extends General_Properties( + SN = 367, name = "Monoethanolamine", CAS = "141-43-5", Tc = 671.4, Pc = 8030000, Vc = 0.225, Cc = 0.284, Tb = 444.15, Tm = 283.65, TT = 283.65, TP = 13.3683, MW = 61.0831, LVB = 0.0603415, AF = 0.550815, SP = 31830, DM = 2.59E-30, SH = -22600000.0, IGHF = -1.96E+08, GEF = -1.033E+08, AS = 320000, HFMP = 2.0496E+07, HOC = -1.363E+09, LiqDen = {105,0.648,0.18183,678.21,0.17947,0}, VP = {10,23.09274,4319.625,-69.95024,0,0}, LiqCp = {4,78653.42,311.4162,-0.0607137,-2.713217E-06,-0.000017988}, HOV = {106,1.012031E+08,1.976961,-4.399887,4.906054,-1.945886}, VapCp = {16,50668,-516.86,12.167,0.00008641,2.8656E-10}, LiqVis = {101,-370.3,17780,54.624,-0.000051065,2}, VapVis = {102,5.78881E-08,0.876532,75.00276,628.0161,0}, LiqK = {16,-0.37218,78.8,-1.5916,0.0043895,-0.0000053291}, VapK = {102,-9539.9,0.39852,-1.7433E+09,-6.3715E+10,0}, Racketparam = 0.284, UniquacR = 3.0436, UniquacQ = 2.976, ChaoSeadAF = 0.446737, ChaoSeadSP = 31830, ChaoSeadLV = 0.0603415); + end Monoethanolamine; + + model Diethanolamine + extends General_Properties( + SN = 368, name = "Diethanolamine", CAS = "111-42-2", Tc = 736.6, Pc = 4720000, Vc = 0.349, Cc = 0.243, Tb = 542, Tm = 301.15, TT = 301.15, TP = 0.102031, MW = 105.136, LVB = 0.096244, AF = 0.991515, SP = 29260, DM = 2.84E-30, SH = -22600000.0, IGHF = -3.73E+08, GEF = -2.2574E+08, AS = 429000, HFMP = 2.5104E+07, HOC = -2.4439E+09, LiqDen = {105,0.5251,0.20924,736.61,0.18363,0}, VP = {10,23.735,5441.7,-95.519,0,0}, LiqCp = {4,88234.68,483.2566,0.294569,-0.000214761,0}, HOV = {106,7.90134E+07,-1.865152,6.820965,-7.963053,3.251551}, VapCp = {16,92216,-624.1,12.938,-0.00014779,6.6337E-08}, LiqVis = {101,-0.28702,6080.5,-3.8708,0.00001517,2}, VapVis = {102,4.7852E-08,0.89857,99.058,-7265.2,0}, LiqK = {16,-0.91328,16.824,-0.15997,0.0011516,-0.0000013756}, VapK = {102,-10221,0.42596,-2.5172E+09,-7.9932E+10,0}, Racketparam = 0.243, UniquacR = 5.2302, UniquacQ = 4.956, ChaoSeadAF = 0.952882, ChaoSeadSP = 29260, ChaoSeadLV = 0.096244); + end Diethanolamine; + + model Triethanolamine + extends General_Properties( + SN = 369, name = "Triethanolamine", CAS = "102-71-6", Tc = 787, Pc = 3590000, Vc = 0.472, Cc = 0.202, Tb = 613, Tm = 294.35, TT = 294.35, TP = 0.000287009, MW = 149.188, LVB = 0.132992, AF = 1.28411, SP = 27430, DM = 3.6E-30, SH = -22600000.0, IGHF = -5.54E+08, GEF = -2.994E+08, AS = 538000, HFMP = 2.7191E+07, HOC = -3.5025E+09, LiqDen = {105,0.028938,0.058014,787,0.099632,0}, VP = {101,283.76,-24672,-37.048,0.000015689,2}, LiqCp = {16,285560,313.35,6.351,0.016374,-0.000012842}, HOV = {106,1.354875E+08,0.343894,0.961738,-1.466285,0.442687}, VapCp = {16,114870,-616.04,13.509,-0.00048074,2.2464E-07}, LiqVis = {101,33.605,4399.7,-8.9203,0.000021038,2}, VapVis = {102,3.0013E-08,0.95199,45.139,-3355.9,0}, LiqK = {16,-0.76863,26.11,-0.3374,0.0010847,-0.0000011937}, VapK = {102,0.043843,0.38395,6681.4,1202500,0}, Racketparam = 0.202, UniquacR = 7.3317, UniquacQ = 6.932, ChaoSeadAF = 1.28411, ChaoSeadSP = 27430, ChaoSeadLV = 0.132992); + end Triethanolamine; + + model Ethylenediamine + extends General_Properties( + SN = 370, name = "Ethylenediamine", CAS = "107-15-3", Tc = 592.95, Pc = 6290000, Vc = 0.206, Cc = 0.337, Tb = 390.15, Tm = 281.65, TT = 284.29, TP = 677.511, MW = 60.0983, LVB = 0.0672757, AF = 0.472367, SP = 25200, DM = 6.34E-30, SH = -22600000.0, IGHF = -1.78E+07, GEF = 1.032E+08, AS = 321833, HFMP = 109700, HOC = -1.691E+09, LiqDen = {105,0.77469,0.20588,592.95,0.20098,0}, VP = {101,133.543,-9787.615,-16.57909,0.0000129717,2}, LiqCp = {16,143860,434.68,4.2425,0.021662,-0.000021123}, HOV = {106,7.5708E+07,1.0826,-0.65481,-0.27019,0.25065}, VapCp = {16,58340,-554.75,12.205,0.00022368,-7.8562E-08}, LiqVis = {101,-9.2076,2247.2,-0.93509,0.0000071501,2}, VapVis = {102,2.0005E-07,0.70929,192.67,-6383.4,0}, LiqK = {16,0.020715,-158.25,0.1953,-0.004385,0.0000010035}, VapK = {102,0.16528,0.18013,3835.1,1598900,0}, Racketparam = 0.337, UniquacR = 2.7384, UniquacQ = 2.472, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); + end Ethylenediamine; + + model Diisopropylamine + extends General_Properties( + SN = 371, name = "Diisopropylamine", CAS = "108-18-9", Tc = 522.15, Pc = 3200000, Vc = 0.031, Cc = 0.308, Tb = 357.05, Tm = 176.85, TT = 176.85, TP = 0.00447237, MW = 101.19, LVB = 0.141919, AF = 0.388315, SP = 15060, DM = 0, SH = -22600000.0, IGHF = -1.5E+08, GEF = 6.42E+07, AS = 412000, HFMP = 6530000, HOC = -3.99E+09, LiqDen = {105,0.72754,0.27918,522.15,0.29458,0}, VP = {101,237.36,-12403,-33.276,0.000035165,2}, LiqCp = {16,150380,276.56,5.7411,0.021881,-0.000021998}, HOV = {106,8.537039E+07,-2.459337,14.73933,-19.70849,7.844199}, VapCp = {16,61641,-432.93,12.839,0.00037342,-1.4329E-07}, LiqVis = {101,-7.0105,766.59,-0.57101,-0.0000016173,2}, VapVis = {102,5.4462E-07,0.56686,334.62,-4787.5,0}, LiqK = {16,0.046488,-113.84,-0.63846,-0.0065631,0.0000029442}, VapK = {102,0.00048482,0.81453,349.64,151910,0}, Racketparam = 0.308, UniquacR = 5.0308, UniquacQ = 4.244, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); + end Diisopropylamine; + + model Naminoethylpiperazine + extends General_Properties( + SN = 372, name = "Naminoethylpiperazine", CAS = "140-31-8", Tc = 708, Pc = 3850000, Vc = 0.475, Cc = 0.266, Tb = 495.15, Tm = 254.15, TT = 254.15, TP = 0.0694812, MW = 129.203, LVB = 0.132257, AF = 0.557243, SP = 21520, DM = 0, SH = -22600000.0, IGHF = 2.51E+07, GEF = 2.79E+08, AS = 451000, HFMP = 0, HOC = -4.135E+09, LiqDen = {105,0.66681,0.27137,708,0.27214,0}, VP = {101,127.7429,-12067.23,-15.04915,6.424073E-06,2}, LiqCp = {16,259220,331.04,3.608,0.023605,-0.000018248}, HOV = {106,9.785579E+07,0.814708,0.0237006,-0.690218,0.260899}, VapCp = {16,70888,-450.73,13.066,0.00018285,-6.5268E-08}, LiqVis = {101,-497.9054,22666.52,74.36022,-0.0000702789,2}, VapVis = {102,7.7705E-08,0.8233,132.06,-8963.7,0}, LiqK = {16,-0.089882,-7.0061,-1.0711,-0.00065668,-0.0000005629}, VapK = {102,0.00012973,0.99814,630.8,21962,0}, Racketparam = 0.266, UniquacR = 5.5591, UniquacQ = 4.424, ChaoSeadAF = 0.557243, ChaoSeadSP = 21520, ChaoSeadLV = 0.132257); + end Naminoethylpiperazine; + + model Diethylenetriamine + extends General_Properties( + SN = 373, name = "Diethylenetriamine", CAS = "111-40-0", Tc = 676, Pc = 4220000, Vc = 0.426, Cc = 0.257, Tb = 480, Tm = 234, TT = 234.15, TP = 0.0524649, MW = 103.166, LVB = 0.108088, AF = 0.70022, SP = 22210, DM = 0, SH = -22600000.0, IGHF = -5860000, GEF = 2.07293E+08, AS = 444000, HFMP = 1.97E+07, HOC = -3.08E+09, LiqDen = {105,0.75082,0.25686,676,0.285,0}, VP = {101,100.1854,-10608.36,-10.96201,4.74905E-06,2}, LiqCp = {16,42291,-130.86,11.696,0.0024243,-0.0000011576}, HOV = {106,6.200873E+07,-0.521717,2.922507,-3.785965,1.591946}, VapCp = {16,73737,-451.7,12.705,0.00030197,-1.0181E-07}, LiqVis = {101,-10.117,2075.7,-0.40711,6.9322E-07,2}, VapVis = {102,5.7285E-08,0.85783,72.519,-3817.5,0}, LiqK = {16,-0.078667,1.4114,-1.3167,-0.00041656,-8.7844E-07}, VapK = {102,0.00017737,0.94914,591.08,27011,0}, Racketparam = 0.257, UniquacR = 4.6198, UniquacQ = 3.948, ChaoSeadAF = 0.70022, ChaoSeadSP = 22210, ChaoSeadLV = 0.108088); + end Diethylenetriamine; + + model Naminoethylethanolamine + extends General_Properties( + SN = 374, name = "Naminoethylethanolamine", CAS = "111-41-1", Tc = 698, Pc = 4460000, Vc = 0.387, Cc = 0.252, Tb = 517, Tm = 0, TT = 0, TP = 0, MW = 104.151, LVB = 0.101519, AF = 1.04726, SP = 29230, DM = 0, SH = -22600000.0, IGHF = -1.91E+08, GEF = 3810000, AS = 447000, HFMP = 0, HOC = -2.74E+09, LiqDen = {105,0.76828,0.25238,698,0.28565,0}, VP = {101,214.43,-18769,-27.15,0.00001141,2}, LiqCp = {16,65604,-121.74,11.802,0.0023485,-7.9478E-07}, HOV = {106,1.2005E+08,0.3465,0.971,-1.7132,0.81091}, VapCp = {16,75533,-495.37,12.77,0.00015714,-4.9852E-08}, LiqVis = {101,-27.66295,5326.5,1.362383,-1.706454E-06,2}, VapVis = {102,1.2606E-07,0.76222,173.4,-8594.2,0}, LiqK = {16,-0.1257,-10.607,-0.88928,-0.00060102,-5.9478E-07}, VapK = {102,0.00019261,0.93731,615.43,23918,0}, Racketparam = 0.252, UniquacR = 4.925, UniquacQ = 4.452, ChaoSeadAF = 1.04726, ChaoSeadSP = 29230, ChaoSeadLV = 0.101519); + end Naminoethylethanolamine; + + model Pphenylenediamine + extends General_Properties( + SN = 375, name = "Pphenylenediamine", CAS = "106-50-3", Tc = 796, Pc = 5180000, Vc = 0.377, Cc = 0.248, Tb = 540, Tm = 419, TT = 413, TP = 1388.21, MW = 108.141, LVB = 0.102198, AF = 0.53864, SP = 24810, DM = 5.1E-30, SH = -22600000.0, IGHF = 9.12E+07, GEF = 2.1E+08, AS = 349000, HFMP = 2.68E+07, HOC = -3.33E+09, LiqDen = {105,0.78274,0.24798,796,0.28573,0}, VP = {101,120.7365,-13060.28,-13.71648,4.333592E-06,2}, LiqCp = {16,199750,494.23,5.1045,0.015817,-0.000010858}, HOV = {106,1.0783E+08,1.6408,-3.3392,3.5461,-1.4179}, VapCp = {16,58132,-482.33,12.882,-0.000085339,9.0492E-09}, LiqVis = {101,-8.9816,2291,-0.53494,2.8717E-07,2}, VapVis = {102,1.4679E-07,0.74191,224.79,-11478,0}, LiqK = {16,0.0030572,-268.6,0.38244,-0.0036549,8.2114E-07}, VapK = {102,0.000070276,1.0203,189.91,62690,0}, Racketparam = 0.248, UniquacR = 4.2452, UniquacQ = 3.232, ChaoSeadAF = 0.53864, ChaoSeadSP = 24810, ChaoSeadLV = 0); + end Pphenylenediamine; + + model Piperazine + extends General_Properties( + SN = 376, name = "Piperazine", CAS = "110-85-0", Tc = 656.3, Pc = 5420000, Vc = 0.267, Cc = 0.2652, Tb = 419.15, Tm = 379.15, TT = 379.15, TP = 26372.2, MW = 86.1356, LVB = 0.129371, AF = 0.269668, SP = 17960, DM = 4.90339E-30, SH = -22600000.0, IGHF = 2.26E+07, GEF = 1.7E+08, AS = 321000, HFMP = 1.17E+07, HOC = -2.76E+09, LiqDen = {105,1.4074,0.323,638,0.28571,0}, VP = {101,143.27,-11245,-17.657,0.0000096236,2}, LiqCp = {4,32886.27,346.6189,0.473406,-0.000434168,0}, HOV = {106,6.6945E+07,0.99602,-2.0069,2.4018,-0.97129}, VapCp = {16,68463,-744.16,13.556,-0.00073698,1.7652E-07}, LiqVis = {101,24.341,105.42,-5.6537,0.0000060109,2}, VapVis = {102,0.0000022951,0.42453,937.27,-18307,0}, LiqK = {16,0.029211,-334.85,0.86034,-0.0073343,0.0000029317}, VapK = {102,0.0014866,0.6319,-11.551,345800,0}, Racketparam = 0.323, UniquacR = 3.7628, UniquacQ = 2.952, ChaoSeadAF = 0.41376, ChaoSeadSP = 17960, ChaoSeadLV = 0.129371); + end Piperazine; + + model Methylethanolamine + extends General_Properties( + SN = 377, name = "Methylethanolamine", CAS = "109-83-1", Tc = 630, Pc = 5300000, Vc = 0.25901, Cc = 0.262, Tb = 432.388, Tm = 268.65, TT = 268.65, TP = 11.1091, MW = 75.112, LVB = 0.082206, AF = 0.604, SP = 25930, DM = 7.2E-30, SH = -22600000.0, IGHF = -1.98E+08, GEF = -6.11E+07, AS = 344000, HFMP = 8760000, HOC = -2.01E+09, LiqDen = {105,0.982868,0.255663,630,0.231239,0}, VP = {101,101.1268,-9896.461,-11.12231,4.333878E-06,2}, LiqCp = {4,65879.9,415.0007,0.00004583,2.109E-09,-0.0000030816}, HOV = {106,8.3715E+07,1.1304,-1.7736,1.7333,-0.66961}, VapCp = {16,50351,-464.92,12.353,0.00032078,-1.1521E-07}, LiqVis = {101,-8.8113,2947,-0.99316,4.0603E-07,2}, VapVis = {102,2.1919E-07,0.70935,211,-8775.4,0}, LiqK = {16,-0.011378,-96.849,-0.47605,-0.0029428,4.7129E-07}, VapK = {102,0.00021463,0.94857,622.07,15372,0}, Racketparam = 0.262, UniquacR = 3.7825, UniquacQ = 3.524, ChaoSeadAF = 0.604, ChaoSeadSP = 25930, ChaoSeadLV = 0.082206); + end Methylethanolamine; + + model Dimethylethanolamine + extends General_Properties( + SN = 378, name = "Dimethylethanolamine", CAS = "108-01-0", Tc = 571.82, Pc = 4140000, Vc = 0.331, Cc = 0.261, Tb = 404.15, Tm = 214.15, TT = 214.15, TP = 0.0376223, MW = 89.1362, LVB = 0.101094, AF = 0.710963, SP = 22790, DM = 7.37E-30, SH = -22600000.0, IGHF = -2.02E+08, GEF = -3.64E+07, AS = 384000, HFMP = 0, HOC = -2.65E+09, LiqDen = {105,0.87166,0.26133,571.82,0.28585,0}, VP = {101,121.6094,-10451.37,-14.23754,0.000006927,2}, LiqCp = {16,66692,-55.489,10.897,0.0047237,-0.0000030382}, HOV = {106,7.9011E+07,0.56455,-0.031757,-0.28621,0.17191}, VapCp = {16,71203,-582.55,12.891,-0.000082299,3.2172E-08}, LiqVis = {101,-15.376,3350.8,-0.34232,9.4723E-07,2}, VapVis = {102,1.2904E-07,0.77955,165.36,-6888.3,0}, LiqK = {16,-0.083559,-10.945,-0.99458,-0.00097463,-8.1342E-07}, VapK = {102,0.00023136,0.92757,412.5,95357,0}, Racketparam = 0.261, UniquacR = 4.4363, UniquacQ = 4.068, ChaoSeadAF = 0.710963, ChaoSeadSP = 22790, ChaoSeadLV = 0.101094); + end Dimethylethanolamine; + + model Nitromethane + extends General_Properties( + SN = 379, name = "Nitromethane", CAS = "75-52-5", Tc = 588, Pc = 5870000, Vc = 0.173, Cc = 0.208, Tb = 374.35, Tm = 244.6, TT = 244.6, TP = 146.529, MW = 61.04, LVB = 0.05396, AF = 0.348026, SP = 25700, DM = 1.15E-29, SH = -22600000.0, IGHF = -7.48E+07, GEF = -6940000, AS = 275000, HFMP = 9703000, HOC = -6.432E+08, LiqDen = {105,1.2195,0.22476,588.16,0.2787,0}, VP = {101,93.27,-7345.1,-10.689,0.0000086998,2}, LiqCp = {16,80588,345.48,6.7575,0.0084794,-0.0000031326}, HOV = {106,4.160998E+07,-0.662124,2.67118,-2.702805,0.931262}, VapCp = {16,38681,-615.84,11.895,0.000023118,-2.9677E-08}, LiqVis = {101,-10.411,1047.6,-0.095445,6.9198E-07,2}, VapVis = {102,4.2141E-07,0.64539,383.4,-1344.5,0}, LiqK = {16,0.050889,-150.55,-0.2952,-0.0028403,-0.0000022109}, VapK = {102,0.000031393,1.1117,-91.903,128140,0}, Racketparam = 0.208, UniquacR = 2.0086, UniquacQ = 1.868, ChaoSeadAF = 0.348026, ChaoSeadSP = 257, ChaoSeadLV = 0); + end Nitromethane; + + model Nitroethane + extends General_Properties( + SN = 380, name = "Nitroethane", CAS = "79-24-3", Tc = 557.15, Pc = 5160000, Vc = 0.236, Cc = 0.247, Tb = 387.22, Tm = 183.63, TT = 183.63, TP = 0.0317711, MW = 75.0666, LVB = 0.0720005, AF = 0.672348, SP = 23090, DM = 1.22E-29, SH = -22600000.0, IGHF = -1.022E+08, GEF = -4900000, AS = 315400, HFMP = 9853000, HOC = -1.25E+09, LiqDen = {105,0.90007,0.22451,593.01,0.26359,0}, VP = {101,81.03385,-7188.308,-8.680357,0.0000053196,2}, LiqCp = {16,67990,798.52,2.4874,0.02816,-0.000027001}, HOV = {106,5.428692E+07,0.314015,-0.225443,1.068645,-0.953684}, VapCp = {16,48198,-581.79,12.283,0.000023838,-2.2739E-08}, LiqVis = {101,15.403,194.75,-4.2217,0.0000078126,2}, VapVis = {102,2.4631E-07,0.70062,285.76,-1030.8,0}, LiqK = {16,-0.1486,6.324,-1.0708,0.00009663,-0.0000015981}, VapK = {102,0.0011064,0.69186,675.03,236860,0}, Racketparam = 0.247, UniquacR = 2.6829, UniquacQ = 2.408, ChaoSeadAF = 0.380324, ChaoSeadSP = 23090, ChaoSeadLV = 0.0720005); + end Nitroethane; + + model Onenitropropane + extends General_Properties( + SN = 381, name = "Onenitropropane", CAS = "108-03-2", Tc = 605, Pc = 4350000, Vc = 0.288, Cc = 0.249, Tb = 404.33, Tm = 169.16, TT = 169.16, TP = 0.000688982, MW = 89.0932, LVB = 0.0894679, AF = 0.412773, SP = 21290, DM = 1.22E-29, SH = -22600000.0, IGHF = -1.24E+08, GEF = 335000, AS = 355600, HFMP = 9220000, HOC = -1.859E+09, LiqDen = {105,0.85075,0.24483,605,0.27413,0}, VP = {101,38.65807,-5750.644,-2.115655,-1.225423E-06,2}, LiqCp = {16,-8835.6,176.43,9.53,0.0096176,-0.0000099253}, HOV = {106,5.6307E+07,0.47767,-0.18338,0.057255,-0.028311}, VapCp = {16,57745,-538.37,12.483,0.00011202,-5.1502E-08}, LiqVis = {101,-19.997,1653,1.2605,0.0000015194,2}, VapVis = {102,1.7108E-07,0.7401,220.03,-15.073,0}, LiqK = {16,-0.068381,13.221,-1.3628,-0.00024357,-0.0000012535}, VapK = {102,0.0022117,0.61538,875.34,312410,0}, Racketparam = 0.249, UniquacR = 3.3573, UniquacQ = 2.948, ChaoSeadAF = 0.412773, ChaoSeadSP = 21290, ChaoSeadLV = 0.0894679); + end Onenitropropane; + + model Twonitropropane + extends General_Properties( + SN = 382, name = "Twonitropropane", CAS = "79-46-9", Tc = 595, Pc = 4450000, Vc = 0.288, Cc = 0.26, Tb = 393.4, Tm = 181.83, TT = 181.83, TP = 0.021584, MW = 89.0932, LVB = 0.0905535, AF = 0.383568, SP = 20530, DM = 1.24E-29, SH = -22600000.0, IGHF = -1.39E+08, GEF = -1.2803E+07, AS = 347700, HFMP = 7790000, HOC = -1.846E+09, LiqDen = {105,0.27031,0.13967,595,0.17588,0}, VP = {101,57.04038,-6262.318,-4.993807,1.61213E-06,2}, LiqCp = {16,67863,138.63,8.8679,0.01051,-0.00001051}, HOV = {106,5.543435E+07,0.377393,0.18894,-0.0391329,-0.243258}, VapCp = {16,58543,-558.36,12.559,0.000040137,-3.1383E-08}, LiqVis = {101,-26.48,1441.6,2.6439,-0.0000074647,2}, VapVis = {102,0.000005644,0.32789,1291.7,6279.8,0}, LiqK = {16,0.085284,-50.915,-1.467,-0.0035856,-0.000001687}, VapK = {102,0.0042281,0.52696,790.25,431610,0}, Racketparam = 0.26, UniquacR = 3.3573, UniquacQ = 2.948, ChaoSeadAF = 0.383568, ChaoSeadSP = 20530, ChaoSeadLV = 0.0905535); + end Twonitropropane; + + model Onenitrobutane + extends General_Properties( + SN = 383, name = "Onenitrobutane", CAS = "627-05-4", Tc = 623, Pc = 3600000, Vc = 0.338, Cc = 0.248, Tb = 425.92, Tm = 191.82, TT = 191.82, TP = 0.00329301, MW = 103.12, LVB = 0.106476, AF = 0.454584, SP = 20780, DM = 1.13E-29, SH = -22600000.0, IGHF = -1.439E+08, GEF = 1.5E+07, AS = 379100, HFMP = 1.27E+07, HOC = -2.46965E+09, LiqDen = {105,0.709,0.24401,623,0.28339,0}, VP = {101,275.2044,-15483.84,-38.70231,0.0000386,2}, LiqCp = {16,56152,6.6387,10.762,0.003942,-0.0000013791}, HOV = {106,5.525605E+07,-1.025854,4.47262,-4.675607,1.466497}, VapCp = {16,69545,-548.77,12.729,0.0001233,-6.7656E-08}, LiqVis = {101,-8.4776,1274.9,-0.51437,0.0000019485,2}, VapVis = {102,9.0308E-08,0.82266,144.36,-9193.7,0}, LiqK = {16,-0.088752,4.014,-1.2388,-0.00043694,-0.0000009691}, VapK = {102,0.00013665,0.98745,630.3,15608,0}, Racketparam = 0.248, UniquacR = 4.0317, UniquacQ = 3.488, ChaoSeadAF = 0.454584, ChaoSeadSP = 20780, ChaoSeadLV = 0.106476); + end Onenitrobutane; + + model Onitrotoluene + extends General_Properties( + SN = 384, name = "Onitrotoluene", CAS = "88-72-2", Tc = 720, Pc = 3800000, Vc = 0.441, Cc = 0.28, Tb = 494.85, Tm = 269.65, TT = 269.98, TP = 1.72928, MW = 137.136, LVB = 0.118442, AF = 0.487824, SP = 21420, DM = 1.25E-29, SH = -22600000.0, IGHF = 4.71E+07, GEF = 1.715E+08, AS = 380800, HFMP = 1.148E+07, HOC = -3.5914E+09, LiqDen = {105,0.49527,0.21852,720,0.27202,0}, VP = {101,110.496,-10356.21,-12.86215,7.080827E-06,2}, LiqCp = {16,167320,675.67,2.8482,0.023742,-0.00001748}, HOV = {106,7.853006E+07,0.959622,-1.263212,1.073123,-0.436452}, VapCp = {16,126830,-1053.5,13.982,-0.0011308,3.2272E-07}, LiqVis = {101,-227.78,9560.6,33.954,-0.00004379,2}, VapVis = {102,3.9111E-08,0.92063,61.279,-2619.3,0}, LiqK = {16,-0.28005,20.455,-0.90478,0.000049377,-4.8022E-07}, VapK = {102,0.00013501,0.95252,632.43,27080,0}, Racketparam = 0.28, UniquacR = 4.2801, UniquacQ = 3.272, ChaoSeadAF = 0.487824, ChaoSeadSP = 21420, ChaoSeadLV = 0.118442); + end Onitrotoluene; + + model Pnitrotoluene + extends General_Properties( + SN = 385, name = "Pnitrotoluene", CAS = "99-99-0", Tc = 736, Pc = 3800000, Vc = 0.441, Cc = 0.229, Tb = 511.15, Tm = 325.05, TT = 324.75, TP = 40.4829, MW = 137.136, LVB = 0.121894, AF = 0.542405, SP = 21110, DM = 1.48E-29, SH = -22600000.0, IGHF = 3.1E+07, GEF = 1.554E+08, AS = 380800, HFMP = 1.6676E+07, HOC = -3.553E+09, LiqDen = {105,0.76802,0.27463,736,0.3126,0}, VP = {101,115.4618,-11239.6,-13.3636,5.387653E-06,2}, LiqCp = {16,90280,945.96,3.9359,0.019415,-0.000013352}, HOV = {106,1.550237E+08,1.89329,-1.014085,-0.0168324,-0.442436}, VapCp = {16,126830,-1053.5,13.982,-0.0011308,3.2272E-07}, LiqVis = {101,-164.01,7455.2,23.73,-0.000026464,2}, VapVis = {102,4.1207E-08,0.91154,64.997,-92.66,0}, LiqK = {16,-0.1404,23.385,-1.2743,-0.000067534,-5.8708E-07}, VapK = {102,0.000064675,1.0353,391.41,37904,0}, Racketparam = 0.229, UniquacR = 4.2801, UniquacQ = 3.272, ChaoSeadAF = 0.425222, ChaoSeadSP = 21110, ChaoSeadLV = 0.121894); + end Pnitrotoluene; + + model Mnitrotoluene + extends General_Properties( + SN = 386, name = "Mnitrotoluene", CAS = "99-08-1", Tc = 734, Pc = 3800000, Vc = 0.441, Cc = 0.275, Tb = 504, Tm = 288.65, TT = 289.2, TP = 6.84272, MW = 137.136, LVB = 0.118913, AF = 0.491987, SP = 21470, DM = 1.41E-29, SH = -22600000.0, IGHF = 2.58E+07, GEF = 1.502E+08, AS = 380800, HFMP = 1.406E+07, HOC = -3.5696E+09, LiqDen = {105,0.50673,0.22353,734,0.25642,0}, VP = {101,174.0974,-13266.49,-22.50751,0.0000146534,2}, LiqCp = {16,165480,678.6,2.6976,0.024579,-0.000018568}, HOV = {106,1.23147E+08,2.991682,-5.10633,3.432299,-0.844633}, VapCp = {16,126830,-1053.5,13.982,-0.0011308,3.2272E-07}, LiqVis = {101,-219.04,9323.8,32.506,-0.000040609,2}, VapVis = {102,3.6657E-08,0.9283,56.912,-1935.8,0}, LiqK = {16,-0.16653,2.5129,-1.0577,-0.0003596,-3.0249E-07}, VapK = {102,0.00013182,0.95336,611.68,32295,0}, Racketparam = 0.275, UniquacR = 4.2801, UniquacQ = 3.272, ChaoSeadAF = 0.491987, ChaoSeadSP = 21470, ChaoSeadLV = 0.118913); + end Mnitrotoluene; + + model TwoFourdinitrotoluene + extends General_Properties( + SN = 387, name = "TwoFourdinitrotoluene", CAS = "121-14-2", Tc = 814, Pc = 3400000, Vc = 0.487, Cc = 0.245, Tb = 553, Tm = 333, TT = 342.65, TP = 7.8719, MW = 182.134, LVB = 0.137448, AF = 0.712571, SP = 21470, DM = 1.44E-29, SH = -22600000.0, IGHF = 3.36E+07, GEF = 2.18E+08, AS = 414000, HFMP = 2.0126E+07, HOC = -3.416E+09, LiqDen = {105,0.5108,0.24037,814,0.26806,0}, VP = {101,128.9329,-13393.44,-15.15736,5.597038E-06,2}, LiqCp = {16,88958,1324.4,2.7528,0.019721,-0.000011079}, HOV = {106,1.2919E+08,1.3248,1.0872,-4.8737,2.858}, VapCp = {16,94512,-582.56,13.27,-0.00026587,5.3735E-08}, LiqVis = {101,-41.408,3947.7,4.2203,-0.0000035178,2}, VapVis = {102,1.9809E-08,1.0159,22.316,-3670.3,0}, LiqK = {16,-0.057001,-67.01,-0.90194,-0.0013614,-3.0209E-08}, VapK = {102,0.00011852,0.95914,734.05,13896,0}, Racketparam = 0.245, UniquacR = 5.7, UniquacQ = 4.376, ChaoSeadAF = 0.712571, ChaoSeadSP = 21470, ChaoSeadLV = 0.137448); + end TwoFourdinitrotoluene; + + model Two6dinitrotoluene + extends General_Properties( + SN = 388, name = "Two6dinitrotoluene", CAS = "606-20-2", Tc = 780, Pc = 3400000, Vc = 0.487, Cc = 0.242, Tb = 553, Tm = 339, TT = 337.85, TP = 24.9565, MW = 182.134, LVB = 0.136568, AF = 0.714206, SP = 20760, DM = 9.37E-30, SH = -22600000.0, IGHF = 2.86E+07, GEF = 2.32E+08, AS = 414000, HFMP = 2.12E+07, HOC = -3.429E+09, LiqDen = {105,0.27332,0.17415,780,0.22386,0}, VP = {101,115.7657,-12082.2,-13.31782,5.09858E-06,2}, LiqCp = {16,163490,785.69,5.0684,0.014589,-0.0000070833}, HOV = {106,1.041715E+08,1.247529,0.0309575,-2.851863,1.938855}, VapCp = {16,94512,-582.56,13.27,-0.00026587,5.3735E-08}, LiqVis = {101,-70.386,5310.9,8.6262,-0.0000081126,2}, VapVis = {102,5.9592E-08,0.88167,135.78,-11605,0}, LiqK = {16,-0.039901,-99.466,-0.76681,-0.0019329,1.8512E-07}, VapK = {102,0.00015932,0.92355,690.15,19720,0}, Racketparam = 0.242, UniquacR = 5.7, UniquacQ = 4.376, ChaoSeadAF = 0.714206, ChaoSeadSP = 20760, ChaoSeadLV = 0.136568); + end Two6dinitrotoluene; + + model ThreeFourdinitrotoluene + extends General_Properties( + SN = 389, name = "ThreeFourdinitrotoluene", CAS = "610-39-9", Tc = 842, Pc = 3400000, Vc = 0.487, Cc = 0.237, Tb = 610, Tm = 331.45, TT = 331.45, TP = 2.66366, MW = 182.134, LVB = 0.139231, AF = 0.709209, SP = 21410, DM = 2.13E-29, SH = -22600000.0, IGHF = 3.58E+07, GEF = 2.59E+08, AS = 414000, HFMP = 2.08E+07, HOC = -3.466E+09, LiqDen = {105,0.48567,0.23619,842,0.28583,0}, VP = {101,62.33838,-11025.98,-5.109566,1.997931E-07,2}, LiqCp = {16,144440,677.88,6.2554,0.011911,-0.000005235}, HOV = {106,6.888359E+07,-1.153409,5.750305,-8.495374,4.124815}, VapCp = {16,94512,-582.56,13.27,-0.00026587,5.3735E-08}, LiqVis = {101,-13.817,2734.2,0.029663,-2.4471E-08,2}, VapVis = {102,2.8655E-08,0.96106,104.06,-10189,0}, LiqK = {16,-0.082395,-25.284,-1.0996,-0.00075328,-2.6136E-07}, VapK = {102,0.0001043,0.96342,702.61,22699,0}, Racketparam = 0.237, UniquacR = 5.7, UniquacQ = 4.376, ChaoSeadAF = 0.709209, ChaoSeadSP = 21410, ChaoSeadLV = 0.139231); + end ThreeFourdinitrotoluene; + + model TwoFivedinitrotoluene + extends General_Properties( + SN = 390, name = "TwoFivedinitrotoluene", CAS = "619-15-8", Tc = 814, Pc = 3400000, Vc = 0.487, Cc = 0.237, Tb = 590, Tm = 325.65, TT = 323.48, TP = 3.04164, MW = 182.134, LVB = 0.135666, AF = 0.712285, SP = 21390, DM = 1.93E-30, SH = -22600000.0, IGHF = 2.71E+07, GEF = 2.36E+08, AS = 414000, HFMP = 2.03E+07, HOC = -3.446E+09, LiqDen = {105,0.50237,0.23693,814,0.28571,0}, VP = {101,90.89499,-12036.13,-9.395524,2.853055E-06,2}, LiqCp = {16,152220,711.2,5.8598,0.012789,-0.0000058246}, HOV = {106,5.5817E+07,-1.8578,6.6656,-8.4526,3.8136}, VapCp = {16,94512,-582.56,13.27,-0.00026587,5.3735E-08}, LiqVis = {101,-10.391,2604.7,-0.5024,5.1688E-07,2}, VapVis = {102,3.8924E-08,0.93015,82.835,-8099.3,0}, LiqK = {16,-0.078898,-29.065,-1.0796,-0.00084649,-2.5074E-07}, VapK = {102,0.0001568,0.92031,704.11,20197,0}, Racketparam = 0.237, UniquacR = 5.7, UniquacQ = 4.376, ChaoSeadAF = 0.712285, ChaoSeadSP = 21390, ChaoSeadLV = 0.135666); + end TwoFivedinitrotoluene; + + model ThreeFivedinitrotoluene + extends General_Properties( + SN = 391, name = "ThreeFivedinitrotoluene", CAS = "618-85-9", Tc = 800, Pc = 2150000, Vc = 0.487, Cc = 0.238, Tb = 588, Tm = 366.15, TT = 365.65, TP = 35.4684, MW = 182.134, LVB = 0.140577, AF = 0.702302, SP = 21440, DM = 1.44E-29, SH = -22600000.0, IGHF = 2.71E+07, GEF = 2.34E+08, AS = 414000, HFMP = 2.29E+07, HOC = -3.437E+09, LiqDen = {105,0.45727,0.227,814.01,0.27155,0}, VP = {101,63.61855,-10355.64,-5.423477,2.374318E-07,2}, LiqCp = {16,211860,-5.3058,8.1208,0.009225,-0.0000034389}, HOV = {106,5.989509E+07,-0.991558,3.414071,-4.448985,2.238465}, VapCp = {16,94512,-582.56,13.27,-0.00026587,5.3735E-08}, LiqVis = {101,-0.25652,2097.7,-2.0147,0.0000014987,2}, VapVis = {102,4.7633E-08,0.90246,116.57,-8469.6,0}, LiqK = {16,-0.029795,-134.57,-0.63203,-0.0021751,3.0388E-07}, VapK = {102,0.00014433,0.92815,684.42,24021,0}, Racketparam = 0.238, UniquacR = 5.7, UniquacQ = 4.376, ChaoSeadAF = 0.702302, ChaoSeadSP = 21440, ChaoSeadLV = 0.140577); + end ThreeFivedinitrotoluene; + + model TwoFour6trinitrotoluene + extends General_Properties( + SN = 392, name = "TwoFour6trinitrotoluene", CAS = "118-96-7", Tc = 795, Pc = 3040000, Vc = 0.48, Cc = 0.253, Tb = 573, Tm = 355, TT = 354, TP = 0.936248, MW = 227.131, LVB = 0.154989, AF = 0.897249, SP = 23070, DM = 3.87E-30, SH = -22600000.0, IGHF = 1.64E+07, GEF = 2.844E+08, AS = 460700, HFMP = 2.12E+07, HOC = -3.2919E+09, LiqDen = {105,0.99663,0.34261,803.06,0.50647,0}, VP = {101,245.81,-20425,-32.225,0.00001503,2}, LiqCp = {16,188750,750.94,4.5661,0.019107,-0.00001348}, HOV = {106,2.111008E+07,-12.33056,37.27643,-41.67226,16.622}, VapCp = {16,209680,-1410.9,14.902,-0.0017672,4.5403E-07}, LiqVis = {101,92.002,-1238.6,-16.127,0.000013297,2}, VapVis = {102,5.1205E-08,0.89283,134.66,-13583,0}, LiqK = {16,-0.10196,-488.31,0.35873,-0.0039133,0.0000039064}, VapK = {102,0.00015986,0.89621,647.63,36973,0}, Racketparam = 0.253, UniquacR = 6.5886, UniquacQ = 5.08, ChaoSeadAF = 0.897249, ChaoSeadSP = 23070, ChaoSeadLV = 0.154989); + end TwoFour6trinitrotoluene; + + model Oxalicacid + extends General_Properties( + SN = 393, name = "Oxalicacid", CAS = "144-62-7", Tc = 804, Pc = 7020000, Vc = 0.205, Cc = 0.215, Tb = 569, Tm = 462.65, TT = 462.65, TP = 2152.34, MW = 90.0349, LVB = 0.0614585, AF = 0.917597, SP = 35980, DM = 8.77E-30, SH = -22600000.0, IGHF = -7.338E+08, GEF = -6.614E+08, AS = 343300, HFMP = 0, HOC = -2.01E+08, LiqDen = {105,1.0501,0.215,804,0.28571,0}, VP = {101,216.92,-20979,-27.004,0.0000086326,2}, LiqCp = {16,81965,-1.9623,9.0826,0.0038828,2.1663E-07}, HOV = {106,1.2079E+08,0.30321,0.62049,-0.9257,0.38682}, VapCp = {16,25231,-1473.6,15.259,-0.0058042,0.0000026122}, LiqVis = {0,0,0,0,0,0}, VapVis = {102,1.3016E-07,0.7814,154.56,-3949.8,0}, LiqK = {16,-0.088775,-213.56,0.1118,-0.0022725,3.5301E-07}, VapK = {102,0.084868,0.23486,15441,507600,0}, Racketparam = 0.215, UniquacR = 2.6026, UniquacQ = 2.448, ChaoSeadAF = 0.917597, ChaoSeadSP = 35980, ChaoSeadLV = 0.0614585); + end Oxalicacid; + + model Acrylicacid + extends General_Properties( + SN = 394, name = "Acrylicacid", CAS = "79-10-7", Tc = 654.15, Pc = 5664070, Vc = 0.210712, Cc = 0.23, Tb = 414.15, Tm = 286.15, TT = 286.15, TP = 257.117, MW = 72.0627, LVB = 0.068927, AF = 0.220736, SP = 19230, DM = 4.87E-30, SH = -22600000.0, IGHF = -3.371E+08, GEF = -2.861E+08, AS = 315000, HFMP = 1.117E+07, HOC = -1.28022E+09, LiqDen = {105,0.11535,0.078693,654.15,0.16945,0}, VP = {101,55.86645,-7062.889,-4.564151,1.238643E-06,2}, LiqCp = {16,142250,1837.1,-38.373,0.21763,-0.00027035}, HOV = {106,6.9258E+07,1.9796,2.7587,-12.283,8.2823}, VapCp = {16,49916,-589.6,12.259,-0.00013536,3.0855E-08}, LiqVis = {101,-113.67,5526.6,15.75,-0.000015983,2}, VapVis = {102,2.4666E-07,0.69704,207.66,-6104.4,0}, LiqK = {16,-0.40695,33.472,-0.79449,0.00078306,-0.0000013868}, VapK = {102,0.00092475,0.70367,626.1,112700,0}, Racketparam = 0.23, UniquacR = 2.6467, UniquacQ = 2.4, ChaoSeadAF = 0.538324, ChaoSeadSP = 19230, ChaoSeadLV = 0.068927); + end Acrylicacid; + + model Methacrylicacid + extends General_Properties( + SN = 395, name = "Methacrylicacid", CAS = "79-41-4", Tc = 643, Pc = 4700000, Vc = 0.27, Cc = 0.244, Tb = 433.65, Tm = 288.15, TT = 288.15, TP = 58.5615, MW = 86.0892, LVB = 0.0852843, AF = 0.331817, SP = 21000, DM = 5.5E-30, SH = -22600000.0, IGHF = -3.68E+08, GEF = -2.88E+08, AS = 350000, HFMP = 0, HOC = -1.93E+09, LiqDen = {105,2.1083,0.37321,643,0.47743,0}, VP = {101,9.843112,-6238.161,2.965581,-0.0000105952,2}, LiqCp = {16,130480,265.42,3.971,0.026507,-0.000026858}, HOV = {106,7009500,-12.334,36.335,-42.263,18.248}, VapCp = {16,48894,-560.59,12.692,-0.00031458,1.4407E-07}, LiqVis = {101,0.054722,968.88,-1.7788,0.0000031087,2}, VapVis = {102,9.4671E-08,0.81582,92.397,383.72,0}, LiqK = {16,-0.067603,29.398,-1.512,0.00016774,-0.0000015769}, VapK = {102,0.000065218,1.0555,299.46,29315,0}, Racketparam = 0.244, UniquacR = 3.3197, UniquacQ = 3.06, ChaoSeadAF = 0.331817, ChaoSeadSP = 21000, ChaoSeadLV = 0.0852843); + end Methacrylicacid; + + model Benzoicacid + extends General_Properties( + SN = 396, name = "Benzoicacid", CAS = "65-85-0", Tc = 751, Pc = 4470000, Vc = 0.344, Cc = 0.246, Tb = 523.15, Tm = 395.55, TT = 395.45, TP = 795.501, MW = 122.121, LVB = 0.112442, AF = 0.602794, SP = 24590, DM = 3.34E-30, SH = -22600000.0, IGHF = -2.902E+08, GEF = -2.142E+08, AS = 369000, HFMP = 1.807E+07, HOC = -3.0951E+09, LiqDen = {105,0.7147,0.24811,751,0.28445,0}, VP = {101,444.4847,-30166.81,-61.25117,0.000029739,2}, LiqCp = {16,78008,1056.8,2.5621,0.02421,-0.000017579}, HOV = {106,6.7437E+07,0.13946,-2.3071,5.0416,-2.5138}, VapCp = {16,71253,-905.31,13.682,-0.00087786,2.5351E-07}, LiqVis = {101,-204.19,11713,28.642,-0.000020228,2}, VapVis = {102,7.426E-08,0.8289,91.171,5.6616,0}, LiqK = {16,-0.26694,24.352,-0.89204,0.00010336,-5.9141E-07}, VapK = {102,0.000021559,1.1593,126.16,64371,0}, Racketparam = 0.246, UniquacR = 4.323, UniquacQ = 3.344, ChaoSeadAF = 0.602794, ChaoSeadSP = 24590, ChaoSeadLV = 0.112442); + end Benzoicacid; + + model Otoluicacid + extends General_Properties( + SN = 397, name = "Otoluicacid", CAS = "118-90-1", Tc = 751, Pc = 3860000, Vc = 0.397, Cc = 0.245, Tb = 532, Tm = 376.85, TT = 376.85, TP = 237.832, MW = 136.148, LVB = 0.126888, AF = 0.657237, SP = 22920, DM = 5.67059E-30, SH = -22600000.0, IGHF = -3.22796E+08, GEF = -2.13346E+08, AS = 406141, HFMP = 2.01774E+07, HOC = -3.69902E+09, LiqDen = {105,0.61816,0.24687,751,0.2856,0}, VP = {101,133.1988,-13740.37,-15.5105,5.245068E-06,2}, LiqCp = {16,129490,18.011,10.105,0.0057419,-0.000003975}, HOV = {106,9.9956E+07,0.80217,-0.93427,0.8805,-0.3406}, VapCp = {16,85949,-929.05,14.065,-0.0013145,5.0858E-07}, LiqVis = {101,-8.7015,1473.1,-0.25079,0.0000003109,2}, VapVis = {102,1.2379E-07,0.7551,177.89,-5611.1,0}, LiqK = {16,-0.13162,29.195,-1.2663,0.000070644,-8.4448E-07}, VapK = {102,0.000027427,1.1315,204.73,55122,0}, Racketparam = 0.245, UniquacR = 5.058, UniquacQ = 3.912, ChaoSeadAF = 0.657237, ChaoSeadSP = 22920, ChaoSeadLV = 0.126888); + end Otoluicacid; + + model Ptoluicacid + extends General_Properties( + SN = 398, name = "Ptoluicacid", CAS = "99-94-5", Tc = 773, Pc = 3860000, Vc = 0.397, Cc = 0.238, Tb = 548.15, Tm = 452.75, TT = 452.75, TP = 5208.62, MW = 136.148, LVB = 0.129817, AF = 0.661017, SP = 22040, DM = 0, SH = -22600000.0, IGHF = -3.22796E+08, GEF = -2.13346E+08, AS = 406141, HFMP = 2.2737E+07, HOC = -3.69222E+09, LiqDen = {105,0.60059,0.238,773,0.28571,0}, VP = {101,180.79,-16901,-22.327,0.0000079041,2}, LiqCp = {16,204240,558.58,5.081,0.015699,-0.000010465}, HOV = {106,1.0299E+08,0.94653,-1.474,1.5504,-0.62044}, VapCp = {16,85949,-929.05,14.065,-0.0013145,5.0858E-07}, LiqVis = {101,-16.393,2717.5,0.51437,-3.3608E-07,2}, VapVis = {102,8.0828E-08,0.81038,114.97,-489.3,0}, LiqK = {16,-0.14095,29.118,-1.2124,0.000049104,-7.6374E-07}, VapK = {102,0.00002977,1.1214,206.56,62002,0}, Racketparam = 0.238, UniquacR = 5.058, UniquacQ = 3.912, ChaoSeadAF = 0.661017, ChaoSeadSP = 22040, ChaoSeadLV = 0.129817); + end Ptoluicacid; + + model Salicylicacid + extends General_Properties( + SN = 399, name = "Salicylicacid", CAS = "69-72-7", Tc = 739, Pc = 5180000, Vc = 0.364, Cc = 0.275, Tb = 529, Tm = 431.75, TT = 431.75, TP = 2802.65, MW = 138.121, LVB = 0.119591, AF = 0.851182, SP = 24210, DM = 8.84E-30, SH = -22600000.0, IGHF = -4.948E+08, GEF = -3.954E+08, AS = 399800, HFMP = 1.959E+07, HOC = -2.8901E+09, LiqDen = {105,0.8432,0.27522,739,0.28574,0}, VP = {101,252.5417,-21148.9,-32.63925,0.0000130693,2}, LiqCp = {16,129500,160.82,8.5105,0.0092921,-0.0000057493}, HOV = {106,1.3325E+08,-0.11849,3.6062,-5.1635,2.13}, VapCp = {16,83388,-879.57,13.917,-0.0013499,0.0000005122}, LiqVis = {101,-50.743,5203.6,5.2837,2.047E-08,2}, VapVis = {102,1.0029E-07,0.78423,131.87,-154.53,0}, LiqK = {16,0.0043799,-391.31,0.63544,-0.0048323,0.0000010995}, VapK = {102,0.000028337,1.1043,106.43,67783,0}, Racketparam = 0.275, UniquacR = 4.6869, UniquacQ = 3.624, ChaoSeadAF = 0.851182, ChaoSeadSP = 24210, ChaoSeadLV = 0.119591); + end Salicylicacid; + + model Adipicacid + extends General_Properties( + SN = 400, name = "Adipicacid", CAS = "124-04-9", Tc = 809, Pc = 3530000, Vc = 0.4, Cc = 0.21, Tb = 611, Tm = 426.15, TT = 425.5, TP = 78.0827, MW = 146.141, LVB = 0.133942, AF = 1.05065, SP = 25370, DM = 7.74E-30, SH = -22600000.0, IGHF = -8.65E+08, GEF = -6.82E+08, AS = 482000, HFMP = 1.67E+07, HOC = -2.58E+09, LiqDen = {105,0.64797,0.25918,809,0.28198,0}, VP = {101,255.2237,-23233.92,-32.83085,0.000013435,2}, LiqCp = {16,235940,-32.997,10.809,0.0032672,-0.0000019456}, HOV = {106,1.949255E+08,0.823008,2.518159,-5.646327,2.784565}, VapCp = {16,85474,-423.41,12.745,0.00026178,-1.1462E-07}, LiqVis = {101,-8.4738,3093.2,-0.68319,4.5668E-07,2}, VapVis = {102,8.6397E-08,0.79699,129.04,-83.45,0}, LiqK = {16,-0.15138,31.723,-1.1417,0.000072402,-7.2467E-07}, VapK = {102,0.00019846,0.87712,520.45,62013,0}, Racketparam = 0.21, UniquacR = 5.3002, UniquacQ = 4.608, ChaoSeadAF = 1.05065, ChaoSeadSP = 25370, ChaoSeadLV = 0.133942); + end Adipicacid; + + model Phthalicacid + extends General_Properties( + SN = 401, name = "Phthalicacid", CAS = "88-99-3", Tc = 943.0648, Pc = 4492234, Vc = 0.4235, Cc = 0.242627, Tb = 651.424, Tm = 483.15, TT = 0, TP = 0, MW = 166.131, LVB = 0.115821, AF = 1.16031, SP = 29038.44, DM = 8.67E-30, SH = -22600000.0, IGHF = -6.63E+08, GEF = -5.42E+08, AS = 442000, HFMP = 0, HOC = -3.0915E+09, LiqDen = {105,0.59385,0.252,800,0.28571,0}, VP = {101,214.6186,-21678.73,-26.54136,7.94063E-06,2}, LiqCp = {16,126080,73.955,9.4222,0.0070682,-0.0000039598}, HOV = {106,1.16446E+08,0.325842,-0.000233021,0.00216992,0.484323}, VapCp = {16,78972,-814.12,13.621,-0.00057909,1.2469E-07}, LiqVis = {101,-20.315,4089.4,0.87699,-5.3713E-07,2}, VapVis = {102,5.1978E-08,0.86126,68.544,-136.86,0}, LiqK = {16,-0.13007,40.261,-1.3314,0.00027982,-9.4309E-07}, VapK = {102,0.00011576,0.91053,351.24,130660,0}, Racketparam = 0.242627, UniquacR = 5.456, UniquacQ = 4.288, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); + end Phthalicacid; + + model Maleicacid + extends General_Properties( + SN = 402, name = "Maleicacid", CAS = "110-16-7", Tc = 773, Pc = 4990000, Vc = 0.297, Cc = 0.231, Tb = 411, Tm = 403.45, TT = 403.8, TP = 98.6734, MW = 116.072, LVB = 0.090835, AF = 0.997587, SP = 30550, DM = 1.06E-29, SH = -22600000.0, IGHF = -6.794E+08, GEF = -5.96E+08, AS = 416000, HFMP = 3.47E+07, HOC = -1.2684E+09, LiqDen = {105,0.77641,0.231,773,0.28571,0}, VP = {101,187.4602,-19104.39,-22.78106,6.967225E-06,2}, LiqCp = {16,148240,706.52,4.046,0.018422,-0.000011933}, HOV = {106,1.16446E+08,0.325842,-0.000233021,0.00216992,0.484323}, VapCp = {16,60872,-493.34,12.58,-0.00028606,0.0000001493}, LiqVis = {101,-11.993,2508.3,0.079857,-1.8766E-08,2}, VapVis = {102,9.0189E-08,0.80995,111.91,-70.22,0}, LiqK = {16,-0.061944,-160.86,-0.25643,-0.0021458,2.3954E-07}, VapK = {102,0.0000021963,1.4191,-285.03,84199,0}, Racketparam = 0.231, UniquacR = 3.7193, UniquacQ = 3.315, ChaoSeadAF = 0.997587, ChaoSeadSP = 30550, ChaoSeadLV = 0.090835); + end Maleicacid; + + model Terephthalicacid + extends General_Properties( + SN = 403, name = "Terephthalicacid", CAS = "100-21-0", Tc = 943.0648, Pc = 4492234, Vc = 0.4235, Cc = 0.242627, Tb = 665.55, Tm = 573.15, TT = 0, TP = 0, MW = 166.131, LVB = 0.115821, AF = 1.16031, SP = 29038.44, DM = 0, SH = -22600000.0, IGHF = -7.179E+08, GEF = -5.99E+08, AS = 448000, HFMP = 0, HOC = -3.0576E+09, LiqDen = {105,0.42685,0.181,1113,0.28571,0}, VP = {101,215.8574,-29586.64,-25.50026,3.863371E-06,2}, LiqCp = {0,0,0,0,0,0}, HOV = {106,8.9802E+07,0.189,-0.50305,-1.1074,4.311}, VapCp = {16,83070,-852.74,13.689,-0.000643,1.4167E-07}, LiqVis = {0,0,0,0,0,0}, VapVis = {102,2.4248E-08,0.96894,40.456,-14256,0}, LiqK = {16,0,0,0,0,0}, VapK = {102,0.00016184,0.88608,624.29,90960,0}, Racketparam = 0.242627, UniquacR = 5.456, UniquacQ = 4.288, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); + end Terephthalicacid; + + model Aceticanhydride + extends General_Properties( + SN = 404, name = "Aceticanhydride", CAS = "108-24-7", Tc = 569.15, Pc = 4280000, Vc = 0.29, Cc = 0.23, Tb = 413.15, Tm = 200.15, TT = 200.15, TP = 0.0219995, MW = 102.089, LVB = 0.0949602, AF = 0.809524, SP = 22010, DM = 9.3E-30, SH = -22600000.0, IGHF = -5.735E+08, GEF = -4.767E+08, AS = 389900, HFMP = 1.05E+07, HOC = -1.675E+09, LiqDen = {105,1.3543,0.3062,584.65,0.43334,0}, VP = {101,94.79499,-8627.117,-10.49847,0.0000051448,2}, LiqCp = {16,-76055,674.26,4.7415,0.026829,-0.000028167}, HOV = {106,4.787557E+07,-0.639261,1.651354,-0.778133,-0.0411955}, VapCp = {16,63862,-716.36,13.016,-0.00041944,1.1702E-07}, LiqVis = {101,-13.196,1321.3,0.29135,3.1938E-07,2}, VapVis = {102,1.3132E-07,0.7781,96.036,3593.8,0}, LiqK = {16,0.0017236,-11.978,-1.3413,-0.0012823,-6.1388E-07}, VapK = {102,0.0003967,0.81349,426.6,140300,0}, Racketparam = 0.23, UniquacR = 3.586025, UniquacQ = 3.224, ChaoSeadAF = 0.453, ChaoSeadSP = 22010, ChaoSeadLV = 0.0949602); + end Aceticanhydride; + + model Maleicanhydride + extends General_Properties( + SN = 405, name = "Maleicanhydride", CAS = "108-31-6", Tc = 721, Pc = 7280000, Vc = 0.219, Cc = 0.266, Tb = 473.15, Tm = 325.927, TT = 325.72, TP = 289.837, MW = 98.0569, LVB = 0.0741215, AF = 0.54629, SP = 25870, DM = 1.31E-29, SH = -22600000.0, IGHF = -4.167E+08, GEF = -3.55E+08, AS = 317000, HFMP = 1.15E+07, HOC = -1.38E+09, LiqDen = {105,1.1934,0.26153,721,0.35499,0}, VP = {101,181.7423,-13070.32,-23.83155,0.0000182982,2}, LiqCp = {16,7374.3,412.68,8.4647,0.0086559,-0.0000060424}, HOV = {106,5.7421E+07,0.064434,0.35394,-0.39596,0.19018}, VapCp = {16,-39596,-169.57,12.496,6.0181E-08,4.1214E-08}, LiqVis = {101,93.459,-2744.1,-16.078,0.000015825,2}, VapVis = {102,7.5282E-08,0.87275,168.46,-10784,0}, LiqK = {16,0.0050361,-137.05,-0.46443,-0.0029116,3.9472E-07}, VapK = {102,0.00030053,0.85542,634.55,21624,0}, Racketparam = 0.266, UniquacR = 2.903098, UniquacQ = 2.384, ChaoSeadAF = 0.54629, ChaoSeadSP = 25870, ChaoSeadLV = 0.0741215); + end Maleicanhydride; + + model Ketene + extends General_Properties( + SN = 406, name = "Ketene", CAS = "463-51-4", Tc = 370, Pc = 5810000, Vc = 0.144, Cc = 0.272, Tb = 217.15, Tm = 122.15, TT = 122, TP = 7.19493, MW = 42.0367, LVB = 0.06374, AF = 0.125656, SP = 13820, DM = 4.74E-30, SH = -61100000.0, IGHF = -6.11E+07, GEF = -6.02914E+07, AS = 241800, HFMP = 0, HOC = -9.67759E+08, LiqDen = {105,1.8886,0.272,370,0.28571,0}, VP = {101,58.628,-3467,-5.9337,0.000010248,2}, LiqCp = {16,41971,267.01,4.7755,0.029953,-0.000037749}, HOV = {106,4.6158E+07,4.5264,-12.408,14.257,-5.881}, VapCp = {16,33110,-414.32,10.968,0.00041237,-1.3222E-07}, LiqVis = {101,-18.659,731.69,1.5497,-0.000011288,2}, VapVis = {102,0.000001285,0.50552,367.45,-2188.3,0}, LiqK = {16,-0.007072,-11.763,-0.74777,-0.0024777,-0.0000018714}, VapK = {102,0.000028519,1.1477,-97.436,37387,0}, Racketparam = 0.272, UniquacR = 1.694792, UniquacQ = 1.610932, ChaoSeadAF = 0.125656, ChaoSeadSP = 13820, ChaoSeadLV = 0.06374); + end Ketene; + + model Methylmethacrylate + extends General_Properties( + SN = 407, name = "Methylmethacrylate", CAS = "80-62-6", Tc = 563.15, Pc = 3670000, Vc = 0.324, Cc = 0.253, Tb = 374.15, Tm = 225.15, TT = 225.6, TP = 19.0855, MW = 100.116, LVB = 0.106736, AF = 0.280233, SP = 18530, DM = 6.57E-30, SH = -61100000.0, IGHF = -3.6E+08, GEF = -2.54E+08, AS = 401000, HFMP = 1.44348E+07, HOC = -2.54E+09, LiqDen = {105,0.91648,0.27205,563.15,0.3201,0}, VP = {101,129.5007,-8907.818,-16.17497,0.000012098,2}, LiqCp = {16,45251,733.56,4.0201,0.024183,-0.000020347}, HOV = {106,5.397285E+07,-0.0862845,1.857786,-2.127696,0.775243}, VapCp = {16,40862.92,-408.0793,12.53452,0.000265188,-1.105927E-07}, LiqVis = {101,-8.2342,780.75,-0.30393,-0.0000019127,2}, VapVis = {102,4.0508E-07,0.64362,435.99,-25064,0}, LiqK = {16,0.093744,-51.297,-0.18289,-0.0078351,-0.0000030405}, VapK = {102,0.0023506,0.61168,848.43,252520,0}, Racketparam = 0.253, UniquacR = 3.9215, UniquacQ = 3.564, ChaoSeadAF = 0.280233, ChaoSeadSP = 18530, ChaoSeadLV = 0.106736); + end Methylmethacrylate; + + model Dimethylterephthalate + extends General_Properties( + SN = 408, name = "Dimethylterephthalate", CAS = "120-61-6", Tc = 772, Pc = 2780000, Vc = 0.529, Cc = 0.229, Tb = 555.15, Tm = 413.8, TT = 413.8, TP = 1257.73, MW = 194.184, LVB = 0.180564, AF = 0.637086, SP = 17710, DM = 7.3E-30, SH = -61100000.0, IGHF = -6.37E+08, GEF = -4.74E+08, AS = 550000, HFMP = 3.09E+07, HOC = -4.4115E+09, LiqDen = {105,0.50864,0.26895,772,0.26133,0}, VP = {101,87.35202,-11061.82,-8.88269,1.566691E-07,2}, LiqCp = {16,306140,1151.8,1.8179,0.019226,-0.0000087371}, HOV = {106,4.927268E+07,-0.826644,0.840569,0.547723,-0.373819}, VapCp = {16,95546,-944.26,15.059,-0.0027373,0.0000012901}, LiqVis = {101,-9.6027,1845.8,-0.28991,2.7867E-07,2}, VapVis = {102,1.5497E-10,1.62,-527.6,101960,0}, LiqK = {16,-0.015206,-275.63,0.058569,-0.0035078,7.3745E-07}, VapK = {102,-21938,0.32202,-4.3275E+09,-1.5265E+11,0}, Racketparam = 0.229, UniquacR = 6.6618, UniquacQ = 5.296, ChaoSeadAF = 0.637086, ChaoSeadSP = 17710, ChaoSeadLV = 0.180564); + end Dimethylterephthalate; + + model OneTwopropyleneoxide + extends General_Properties( + SN = 409, name = "OneTwopropyleneoxide", CAS = "75-56-9", Tc = 482.25, Pc = 4920000, Vc = 0.186, Cc = 0.228, Tb = 307.05, Tm = 161.22, TT = 161.22, TP = 0.965624, MW = 58.0791, LVB = 0.0705481, AF = 0.268304, SP = 19050, DM = 6.7E-30, SH = -61100000.0, IGHF = -9.372E+07, GEF = -2.58E+07, AS = 286700, HFMP = 6531000, HOC = -1.79E+09, LiqDen = {105,1.5769,0.28598,482.25,0.29139,0}, VP = {101,83.693,-5715.8,-9.522,0.00001033,2}, LiqCp = {16,78704,274.26,7.2963,0.0088641,-0.0000023407}, HOV = {106,5.241305E+07,1.339985,-1.496096,0.72766,-0.151947}, VapCp = {16,42195,-578.73,12.252,0.00010777,-4.7082E-08}, LiqVis = {101,20.905,283.5,-5.5156,0.000016261,2}, VapVis = {102,1.1059E-07,0.81831,109.91,-5863.4,0}, LiqK = {16,0.10066,294.75,-5.9561,0.019433,-0.000039547}, VapK = {102,0.00022671,0.95467,579.31,32798,0}, Racketparam = 0.228, UniquacR = 2.2663, UniquacQ = 1.856, ChaoSeadAF = 0.268304, ChaoSeadSP = 19050, ChaoSeadLV = 0.0705481); + end OneTwopropyleneoxide; + + model Cumenehydroperoxide + extends General_Properties( + SN = 410, name = "Cumenehydroperoxide", CAS = "80-15-9", Tc = 605, Pc = 3340000, Vc = 0.463, Cc = 0.278, Tb = 442.7, Tm = 264.26, TT = 264.26, TP = 0.00236574, MW = 152.19, LVB = 0.145892, AF = 0.995, SP = 21500, DM = 5.95412E-30, SH = -61100000.0, IGHF = -7.84E+07, GEF = 9.6E+07, AS = 455000, HFMP = 0, HOC = -4.8444E+09, LiqDen = {105,0.6643,0.27801,605,0.28637,0}, VP = {101,156.523,-16668.56,-17.98221,0.0000113017,2}, LiqCp = {16,83403,-35.074,9.3262,0.010979,-0.00001071}, HOV = {106,7.2836E+07,0.18056,-0.22381,-0.21673,0.35898}, VapCp = {16,70090,-408.89,12.927,0.00036839,-1.5886E-07}, LiqVis = {0,0,0,0,0,0}, VapVis = {102,1.9678E-07,0.71936,203.36,-7639,0}, LiqK = {16,-0.022189,-77.144,-1.2225,-0.0023354,4.0588E-08}, VapK = {102,0.00018194,0.94296,592.69,22533,0}, Racketparam = 0.278, UniquacR = 5.817402, UniquacQ = 4.648, ChaoSeadAF = 0.995, ChaoSeadSP = 21500, ChaoSeadLV = 0.145892); + end Cumenehydroperoxide; + + model Propionitrile + extends General_Properties( + SN = 411, name = "Propionitrile", CAS = "107-12-0", Tc = 564.4, Pc = 4180000, Vc = 0.229, Cc = 0.204, Tb = 370.5, Tm = 180.26, TT = 180.26, TP = 0.169356, MW = 55.0785, LVB = 0.0708565, AF = 0.324267, SP = 21760, DM = 1.34E-29, SH = -61100000.0, IGHF = 5.15E+07, GEF = 9.74949E+07, AS = 286600, HFMP = 5029170, HOC = -1.8007E+09, LiqDen = {105,0.90359,0.2211,564.4,0.26246,0}, VP = {101,81.601,-6646.8,-8.9882,0.0000074443,2}, LiqCp = {16,105770,154.89,4.5843,0.018329,-0.000011984}, HOV = {106,3.633259E+07,-2.107222,8.013128,-9.747514,4.114254}, VapCp = {16,47947,-544.83,11.91,0.00026005,-9.1233E-08}, LiqVis = {101,-8.0958,775.57,-0.393,-7.9624E-07,2}, VapVis = {102,9.8851E-08,0.79377,155.28,-11568,0}, LiqK = {16,0.13846,2645.2,-37.177,0.15078,-0.00022598}, VapK = {102,0.00048871,1.327,43042,-3226700,0}, Racketparam = 0.204, UniquacR = 2.5445, UniquacQ = 2.264, ChaoSeadAF = 0.324267, ChaoSeadSP = 21760, ChaoSeadLV = 0.0708565); + end Propionitrile; + + model Dimethylcarbonate + extends General_Properties( + SN = 412, name = "Dimethylcarbonate", CAS = "616-38-6", Tc = 557, Pc = 4800000, Vc = 0.25163, Cc = 0.261, Tb = 363.24, Tm = 276.15, TT = 273.15, TP = 1825.53, MW = 90.084, LVB = 0.084825, AF = 0.337, SP = 20240, DM = 3.0E-30, SH = -61100000.0, IGHF = -5.701E+08, GEF = -4.524E+08, AS = 321600, HFMP = 1.2E+07, HOC = -1.295E+09, LiqDen = {105,0.0073625,0.022214,557,0.083013,0}, VP = {101,127.2975,-8353.984,-16.14514,0.0000181933,2}, LiqCp = {16,170430,-2560.3,-9.9628,-0.012169,0.000014736}, HOV = {106,5.291764E+07,1.146922,-2.489366,2.898325,-1.182726}, VapCp = {16,62577,-594.2,12.53,-0.000022352,-2.2803E-08}, LiqVis = {101,-235.18,9633.9,34.904,-0.000038795,2}, VapVis = {102,3.5376E-07,0.64846,244.72,-7103.7,0}, LiqK = {16,0.011223,-183.44,0.22279,-0.0056614,0.0000021056}, VapK = {102,0.00023689,0.89541,568.87,19356,0}, Racketparam = 0.261, UniquacR = 3.3822, UniquacQ = 3.086, ChaoSeadAF = 0.337, ChaoSeadSP = 20240, ChaoSeadLV = 0.084825); + end Dimethylcarbonate; + + model DiEthylCarbonate + extends General_Properties( + SN = 413, name = "DiEthylCarbonate", CAS = "105-58-8", Tc = 577, Pc = 3420000, Vc = 0.35725, Cc = 0.254676, Tb = 399.95, Tm = 230.15, TT = 0, TP = 0, MW = 118.1322, LVB = 0.12721, AF = 0.3544, SP = 18727.86, DM = 0, SH = -61100000.0, IGHF = 4.443408E+07, GEF = -1.919535, AS = 1202641, HFMP = 0, HOC = -3.223334, LiqDen = {0,0,0,0,0,0}, VP = {10,20.45386,2817.834,-84.304,0,0}, LiqCp = {0,0,0,0,0,0}, HOV = {106,2.9807E+07,0.38,0,0,0}, VapCp = {4,-748.0008,383.84,-0.1938,0.0000364,0}, LiqVis = {0,0,0,0,0,0}, VapVis = {0,0,0,0,0,0}, LiqK = {16,0,0,0,0,0}, VapK = {0,0,0,0,0,0}, Racketparam = 0.254676, UniquacR = 4.731, UniquacQ = 4.166, ChaoSeadAF = 0.3544, ChaoSeadSP = 0, ChaoSeadLV = 0.12721); + end DiEthylCarbonate; + + model MethylEthylCarbonate + extends General_Properties( + SN = 414, name = "MethylEthylCarbonate", CAS = "623-53-0", Tc = 565.93, Pc = 3828600, Vc = 0.30149, Cc = 0.24531, Tb = 385.68, Tm = 258.65, TT = 0, TP = 0, MW = 104.1054, LVB = 0.1108, AF = 0.31086, SP = 20328.39, DM = 0, SH = -61100000.0, IGHF = 6.510304E+07, GEF = -2.776586, AS = 1164449, HFMP = 0, HOC = -2.608223, LiqDen = {0,0,0,0,0,0}, VP = {10,21.71522,3376.596,-49.461,0,0}, LiqCp = {0,0,0,0,0,0}, HOV = {106,2.0559E+07,0.38,0,0,0}, VapCp = {4,160.9996,288.84,-0.1394,0.0000245,0}, LiqVis = {0,0,0,0,0,0}, VapVis = {0,0,0,0,0,0}, LiqK = {16,0,0,0,0,0}, VapK = {0,0,0,0,0,0}, Racketparam = 0.24531, UniquacR = 4.0566, UniquacQ = 3.626, ChaoSeadAF = 0.31086, ChaoSeadSP = 0, ChaoSeadLV = 0.1108); + end MethylEthylCarbonate; + + model MethylPhenylCarbonate + extends General_Properties( + SN = 415, name = "MethylPhenylCarbonate", CAS = "13509-27-8", Tc = 711.76, Pc = 3441000, Vc = 0.42129, Cc = 0.244961, Tb = 491.76, Tm = 0, TT = 0, TP = 0, MW = 152.1494, LVB = 0.1385, AF = 0.41299, SP = 19646.23, DM = 0, SH = -61100000.0, IGHF = 1.345156E+08, GEF = 1.178139E+08, AS = 931814.4, HFMP = 0, HOC = -4.252756, LiqDen = {0,0,0,0,0,0}, VP = {10,23.07041,5677.005,0,0,0}, LiqCp = {0,0,0,0,0,0}, HOV = {106,4.6776E+07,0.38,0,0,0}, VapCp = {4,-37380,589.92,-0.3882,0.0000976,0}, LiqVis = {0,0,0,0,0,0}, VapVis = {0,0,0,0,0,0}, LiqK = {16,0,0,0,0,0}, VapK = {0,0,0,0,0,0}, Racketparam = 0.244961, UniquacR = 5.5028, UniquacQ = 4.358, ChaoSeadAF = 0.41299, ChaoSeadSP = 0, ChaoSeadLV = 0.1385); + end MethylPhenylCarbonate; + + model EthylPhenylCarbonate + extends General_Properties( + SN = 416, name = "EthylPhenylCarbonate", CAS = "3878-46-4", Tc = 729.29, Pc = 2529800, Vc = 0.55209, Cc = 0.230336, Tb = 522.67, Tm = 0, TT = 0, TP = 0, MW = 166.1762, LVB = 0.18105, AF = 0.54406, SP = 18670.52, DM = 0, SH = -61100000.0, IGHF = 1.138466E+08, GEF = 1.263844E+08, AS = 970006.4, HFMP = 0, HOC = -4.867867, LiqDen = {0,0,0,0,0,0}, VP = {10,22.88975,5939.5,0,0,0}, LiqCp = {0,0,0,0,0,0}, HOV = {106,5.2005E+07,0.38,0,0,0}, VapCp = {4,-38289,684.92,-0.4426,0.0001095,0}, LiqVis = {0,0,0,0,0,0}, VapVis = {0,0,0,0,0,0}, LiqK = {16,0,0,0,0,0}, VapK = {0,0,0,0,0,0}, Racketparam = 0.230336, UniquacR = 6.1772, UniquacQ = 4.898, ChaoSeadAF = 0.54406, ChaoSeadSP = 0, ChaoSeadLV = 0.18105); + end EthylPhenylCarbonate; + + model DiPhenylCarbonate + extends General_Properties( + SN = 417, name = "DiPhenylCarbonate", CAS = "102-09-0", Tc = 799.32, Pc = 2796500, Vc = 0.59685, Cc = 0.251145, Tb = 572.99, Tm = 352.15, TT = 0, TP = 0, MW = 214.2202, LVB = 0.18261, AF = 0.55805, SP = 18788.28, DM = 0, SH = -61100000.0, IGHF = 1.832592E+08, GEF = 2.719642E+08, AS = 737371.8, HFMP = 0, HOC = -6.512399E+09, LiqDen = {0,0,0,0,0,0}, VP = {10,23.41177,6810.358,0,0,0}, LiqCp = {3,-164882.8,994.6407,-0.464037,0,0}, HOV = {106,7.141145E+07,0.38,0,0,0}, VapCp = {4,-72586.55,927.9609,-0.573626,0.000147143,0}, LiqVis = {101,-49.44655,15931.93,0,0,0}, VapVis = {0,0,0,0,0,0}, LiqK = {3,0.101839,0.000518198,-1.230409E-06,0,0}, VapK = {3,-0.0506874,0.00020251,-1.156856E-07,0,0}, Racketparam = 0.251145, UniquacR = 7.6234, UniquacQ = 5.63, ChaoSeadAF = 0.55805, ChaoSeadSP = 0, ChaoSeadLV = 0.18261); + end DiPhenylCarbonate; + + model Ethylenecarbonate + extends General_Properties( + SN = 418, name = "Ethylenecarbonate", CAS = "96-49-1", Tc = 806, Pc = 6770000, Vc = 0.193, Cc = 0.195, Tb = 521.15, Tm = 309.15, TT = 309.55, TP = 8.01004, MW = 88.0621, LVB = 0.0664942, AF = 0.442272, SP = 29660, DM = 1.5E-29, SH = -61100000.0, IGHF = -5.069E+08, GEF = -4.1E+08, AS = 260000, HFMP = 1.0E+07, HOC = -1.083E+09, LiqDen = {105,1.5442,0.2959,806,0.28857,0}, VP = {101,132.44,-12293,-15.875,0.0000073572,2}, LiqCp = {16,-57259,-17.021,11.366,0.0033817,-0.0000020646}, HOV = {106,8.7297E+07,-0.075043,3.7018,-6.1954,2.9631}, VapCp = {16,50075,-516.61,12.288,0.000013893,-2.689E-08}, LiqVis = {101,-8.7402,1424.5,-0.45708,0.0000005934,2}, VapVis = {102,8.5517E-08,0.85448,116.16,-3914.9,0}, LiqK = {16,0.00091342,-110.82,-0.51748,-0.0023793,3.9376E-07}, VapK = {102,0.030823,0.34958,3003.2,830800,0}, Racketparam = 0.195, UniquacR = 2.9288, UniquacQ = 2.47, ChaoSeadAF = 0.442272, ChaoSeadSP = 29660, ChaoSeadLV = 0.0664942); + end Ethylenecarbonate; + + model Propylenecarbonate + extends General_Properties( + SN = 419, name = "Propylenecarbonate", CAS = "108-32-7", Tc = 778, Pc = 5410000, Vc = 0.246, Cc = 0.206, Tb = 514.9, Tm = 218.62, TT = 224.85, TP = 0.00116652, MW = 102.089, LVB = 0.0852768, AF = 0.449764, SP = 27300, DM = 1.65E-29, SH = -61100000.0, IGHF = -6.0116E+08, GEF = -4.555E+08, AS = 296300, HFMP = 9617000, HOC = -1.6678E+09, LiqDen = {105,1.122,0.27599,778,0.40344,0}, VP = {101,102.32,-10530,-11.489,0.0000052921,2}, LiqCp = {16,121750,105.89,6.5083,0.016964,-0.000014577}, HOV = {106,3.145898E+08,9.998207,-26.2884,28.38292,-11.49051}, VapCp = {16,51696,-502.59,12.655,-0.000076494,1.3781E-08}, LiqVis = {101,-818.33,28057,129.62,-0.00022812,2}, VapVis = {102,4.7119E-08,0.92676,86.628,-9783.8,0}, LiqK = {16,-0.096241,6.7832,-1.0385,-0.00032841,-6.9782E-07}, VapK = {102,0.00017416,0.94857,659.28,16364,0}, Racketparam = 0.206, UniquacR = 3.6024, UniquacQ = 3.006, ChaoSeadAF = 0.449764, ChaoSeadSP = 27300, ChaoSeadLV = 0.0852768); + end Propylenecarbonate; + + model TwomethylOneheptene + extends General_Properties( + SN = 420, name = "TwomethylOneheptene", CAS = "15870-10-7", Tc = 564, Pc = 2400000, Vc = 0.497, Cc = 0.25, Tb = 392.37, Tm = 185.78, TT = 185.77, TP = 0.113498, MW = 112.213, LVB = 0.156655, AF = 0.35513, SP = 15180, DM = 0, SH = -61100000.0, IGHF = -9.699E+07, GEF = 9.32E+07, AS = 457800, HFMP = 1.44E+07, HOC = -4.948E+09, LiqDen = {105,0.53765,0.25476,567.01,0.28376,0}, VP = {101,108.46,-8257.2,-12.941,0.0000091062,2}, LiqCp = {16,88257,855.11,3.1929,0.026245,-0.000022451}, HOV = {106,5.8021E+07,1.4711,-3.336,3.8018,-1.5579}, VapCp = {16,92500,-450.54,12.712,0.00068864,-3.0334E-07}, LiqVis = {101,-34.674,1655.3,3.8693,-0.0000085602,2}, VapVis = {102,5.7686E-07,0.51551,255.32,-429.98,0}, LiqK = {16,-0.0714,1.7767,-1.4729,-0.00055517,-0.0000010492}, VapK = {102,0.00085233,0.71803,81.386,330930,0}, Racketparam = 0.25, UniquacR = 5.6171, UniquacQ = 4.844, ChaoSeadAF = 0.35513, ChaoSeadSP = 15180, ChaoSeadLV = 0.156655); + end TwomethylOneheptene; + + model TwoMethoxyTwoMethylHeptane + extends General_Properties( + SN = 421, name = "TwoMethoxyTwoMethylHeptane", CAS = "76589-16-7", Tc = 618.2025, Pc = 2357849, Vc = 0.53093, Cc = 0.24355, Tb = 446.7301, Tm = 0, TT = 0, TP = 0, MW = 144.2564, LVB = 0.18511, AF = 0.433286, SP = 14871.82, DM = 0, SH = -61100000.0, IGHF = -9790565, GEF = -6.029269, AS = 1629362, HFMP = 0, HOC = -5.95423E+09, LiqDen = {0,0,0,0,0,0}, VP = {200,-8.2705,2.1937,-3.6992,-3.7256,2357800}, LiqCp = {0,0,0,0,0,0}, HOV = {106,6.6655E+07,0.38,0,0,0}, VapCp = {4,-4265.999,921.48,-0.5266,0.000113,0}, LiqVis = {0,0,0,0,0,0}, VapVis = {0,0,0,0,0,0}, LiqK = {16,0,0,0,0,0}, VapK = {0,0,0,0,0,0}, Racketparam = 0.24355, UniquacR = 6.7654, UniquacQ = 5.792, ChaoSeadAF = 0.433286, ChaoSeadSP = 14871.82, ChaoSeadLV = 0.18511); + end TwoMethoxyTwoMethylHeptane; + + model TwoMethylTwoHeptanol + extends General_Properties( + SN = 422, name = "TwoMethylTwoHeptanol", CAS = "625-25-2", Tc = 636.6534, Pc = 2716180, Vc = 0.48244, Cc = 0.247551, Tb = 467.6976, Tm = 0, TT = 0, TP = 0, MW = 130.2296, LVB = 0.15788, AF = 0.723562, SP = 17397.3, DM = 0, SH = -61100000.0, IGHF = -1.238045, GEF = -1.233886, AS = 1322185, HFMP = 0, HOC = -5.204435, LiqDen = {0,0,0,0,0,0}, VP = {200,-10.016,3.415,-6.8543,-4.7824,2716200}, LiqCp = {0,0,0,0,0,0}, HOV = {106,7.9114E+07,0.38,0,0,0}, VapCp = {4,-23566,923.66,-0.6136,0.0001657,0}, LiqVis = {0,0,0,0,0,0}, VapVis = {0,0,0,0,0,0}, LiqK = {16,0,0,0,0,0}, VapK = {0,0,0,0,0,0}, Racketparam = 0.247551, UniquacR = 6.6204, UniquacQ = 5.904, ChaoSeadAF = 0.723562, ChaoSeadSP = 17397.3, ChaoSeadLV = 0.15788); + end TwoMethylTwoHeptanol; + + model Methylal + extends General_Properties( + SN = 423, name = "Methylal", CAS = "109-87-5", Tc = 480.6, Pc = 3950000, Vc = 0.213, Cc = 0.211, Tb = 315, Tm = 168, TT = 168.35, TP = 1.13284, MW = 76.0944, LVB = 0.0891275, AF = 0.285565, SP = 17430, DM = 2.47E-30, SH = -61100000.0, IGHF = -3.482E+08, GEF = -2.263E+08, AS = 335700, HFMP = 8330000, HOC = -1.7998E+09, LiqDen = {105,1.4351,0.30572,480.6,0.31739,0}, VP = {101,62.15058,-5217.94,-5.982976,3.491239E-06,2}, LiqCp = {16,134330,575.02,0.73414,0.035906,-0.00003541}, HOV = {106,4.956236E+07,0.517705,0.708214,-1.530256,0.744705}, VapCp = {16,73387,-1249,14.774,-0.0029552,0.0000012399}, LiqVis = {101,-8.4058,722.36,-0.36572,2.4819E-07,2}, VapVis = {102,4.8512E-07,0.60235,248.43,-1208.9,0}, LiqK = {16,0.11543,-776.65,7.882,-0.041206,0.000038121}, VapK = {102,0.0014869,0.65846,470.64,206460,0}, Racketparam = 0.211, UniquacR = 2.964403, UniquacQ = 2.716, ChaoSeadAF = 0.285565, ChaoSeadSP = 17430, ChaoSeadLV = 0.0891275); + end Methylal; + + model MethylDiEthanolAmine + extends General_Properties( + SN = 424, name = "MethylDiEthanolAmine", CAS = "105-59-9", Tc = 741.9, Pc = 4160000, Vc = 0.365, Cc = 0.246154, Tb = 520.15, Tm = 252.15, TT = 252.15, TP = 0.00203612, MW = 119.162, LVB = 0.115302, AF = 1.1649, SP = 28140, DM = 9.53993E-30, SH = -61100000.0, IGHF = -3.8E+08, GEF = -1.69E+08, AS = 469000, HFMP = 0, HOC = -3.06E+09, LiqDen = {105,0.69135,0.25418,675,0.2857,0}, VP = {101,-0.352098,-4812.65,3.121045,6.605463E-06,2}, LiqCp = {4,181326,26.21689,0.880838,0,-0.00001581}, HOV = {106,1.40201E+08,0.632751,0.350924,-0.633597,0.0584955}, VapCp = {16,89777,-550.24,13.01,0.000045139,-3.2024E-08}, LiqVis = {101,-162.0804,9995.149,22.49076,-0.0000361184,1.932506}, VapVis = {102,7.7364E-08,0.84268,140.24,-9063.1,0}, LiqK = {16,-0.869,15,0,0,0}, VapK = {102,0.00016443,0.97072,595.54,41960,0}, Racketparam = 0.254, UniquacR = 5.8841, UniquacQ = 5.5, ChaoSeadAF = 1.1649, ChaoSeadSP = 28140, ChaoSeadLV = 0.115302); + end MethylDiEthanolAmine; + + model Diethylethanolamine + extends General_Properties( + SN = 425, name = "Diethylethanolamine", CAS = "100-37-8", Tc = 616, Pc = 2650000, Vc = 0.4231, Cc = 0.218914, Tb = 434.15, Tm = 235.15, TT = 253, TP = 4.85244, MW = 117.189, LVB = 0.132864, AF = 0.781757, SP = 19100, DM = 8.11E-30, SH = -61100000.0, IGHF = -2.575E+08, GEF = -3.323E+07, AS = 459800, HFMP = 1.84E+07, HOC = -4.03338E+09, LiqDen = {105,0.63795,0.25988,592,0.27186,0}, VP = {101,442.3122,-22650.03,-64.35227,0.0000641088,2}, LiqCp = {4,28933.37,738.1104,-0.669126,0.000593149,0}, HOV = {106,6.442525E+07,-0.590881,4.028331,-5.586056,2.388691}, VapCp = {16,91061,-562.7,13.172,-0.000023606,6.7111E-09}, LiqVis = {101,-83.307,6061.8,10.089,-1.4583E-07,2}, VapVis = {102,1.3335E-07,0.7599,186.08,-6648.4,0}, LiqK = {16,-0.0045149,-46.605,-1.1875,-0.0019723,-5.2781E-08}, VapK = {102,0.00013877,0.99774,582.26,23748,0}, Racketparam = 0.259, UniquacR = 5.315095, UniquacQ = 4.532, ChaoSeadAF = 0.781757, ChaoSeadSP = 19100, ChaoSeadLV = 0.132864); + end Diethylethanolamine; + + model Diisopropanolamine + extends General_Properties( + SN = 426, name = "Diisopropanolamine", CAS = "110-97-4", Tc = 672, Pc = 3600000, Vc = 0.454, Cc = 0.293, Tb = 521.9, Tm = 315, TT = 318.15, TP = 0.217912, MW = 133.189, LVB = 0.134763, AF = 1.38914, SP = 26610, DM = 0, SH = -61100000.0, IGHF = -4.54E+08, GEF = -2.15E+08, AS = 513000, HFMP = 2.636E+07, HOC = -3.82E+09, LiqDen = {105,0.54022,0.24621,672,0.22052,0}, VP = {101,339.329,-25910.98,-45.42461,0.0000223088,2}, LiqCp = {4,119382.9,778.3072,-0.00245385,-1.190941E-06,-0.0000013464}, HOV = {106,1.4113E+08,0.38119,1.0156,-1.8242,0.83437}, VapCp = {16,104010,-559.93,13.272,-0.00018865,9.0295E-08}, LiqVis = {101,-158.9768,13684.82,19.79212,0.0000178855,1.442815}, VapVis = {102,1.7289E-07,0.71286,205.1,-6089.6,0}, LiqK = {16,-0.070378,-101.18,-0.46641,-0.0021528,2.0992E-07}, VapK = {102,0.0002313,0.90558,651.81,18136,0}, Racketparam = 0.293, UniquacR = 6.5774, UniquacQ = 6.028, ChaoSeadAF = 1.38914, ChaoSeadSP = 26610, ChaoSeadLV = 0.134763); + end Diisopropanolamine; + + model Cyclobutane + extends General_Properties( + SN = 427, name = "Cyclobutane", CAS = "287-23-0", Tc = 459.93, Pc = 4980000, Vc = 0.21, Cc = 0.273, Tb = 285.66, Tm = 182.48, TT = 182.48, TP = 180.101, MW = 56.1063, LVB = 0.0814243, AF = 0.18474, SP = 16020, DM = 0, SH = 28500000.0, IGHF = 2.85E+07, GEF = 1.122E+08, AS = 265400, HFMP = 1088000, HOC = -2.5678E+09, LiqDen = {105,1.407691,0.295395,459.93,0.248729,0}, VP = {101,60.70694,-4389.85,-6.086364,7.387074E-06,2}, LiqCp = {16,-3355.973,25.71519,11.14976,-0.0000199586,4.55626E-06}, HOV = {106,3.344974E+07,0.35995,-0.0547115,0.0583309,-0.0233634}, VapCp = {16,37380.05,-673.6637,12.72112,-0.000063263,1.539025E-09}, LiqVis = {16,0.0000263799,486.4199,-9.034853,-0.00420404,4.708051E-07}, VapVis = {16,2.344771E-06,-353.1514,-11.15186,0.000996526,-0.0000002755}, LiqK = {16,0.0169674,14.7154,-1.831383,-0.000155026,-0.0000048849}, VapK = {16,0.00541541,-765.5803,-2.581507,0.00174448,-3.307726E-07}, Racketparam = 0, UniquacR = 0, UniquacQ = 0, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); + end Cyclobutane; + + model Isopropylmercaptan + extends General_Properties( + SN = 428, name = "Isopropylmercaptan", CAS = "75-33-2", Tc = 517.3, Pc = 4750000, Vc = 0.254, Cc = 0.281, Tb = 325.75, Tm = 142.61, TT = 142.64, TP = 0.00973089, MW = 76.1606, LVB = 0.0941865, AF = 0.21381, SP = 16970, DM = 5.47E-30, SH = 28500000.0, IGHF = -7.59E+07, GEF = -2180000, AS = 324300, HFMP = 5736000, HOC = -2.3684E+09, LiqDen = {105,1.093001,0.27762,517,0.29781,0}, VP = {101,52.49398,-5018.813,-4.414151,1.969036E-13,2}, LiqCp = {16,-4182.09,11.57821,11.69322,0.0000133303,0.0000020152}, HOV = {106,4.07186E+07,0.189905,0.420769,-0.0231137,-0.258009}, VapCp = {16,68588.92,-673.2911,12.50044,1.486465E-06,-1.964897E-08}, LiqVis = {16,0.0000158085,630.9957,-8.670452,-0.006493,5.676279E-06}, VapVis = {16,2.562672E-06,-300.3637,-11.49051,0.00155043,-4.080467E-07}, LiqK = {16,0.019346,8.361977,-1.76982,-0.000539416,-3.287583E-06}, VapK = {102,0.00018367,0.9627,646.01,0,0}, Racketparam = 0, UniquacR = 3.225445, UniquacQ = 2.84, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); + end Isopropylmercaptan; + + model Glycerol + extends General_Properties( + SN = 429, name = "Glycerol", CAS = "56-81-5", Tc = 725.15, Pc = 6660000, Vc = 0.264, Cc = 0.28, Tb = 563.15, Tm = 291.15, TT = 291.33, TP = 0.00952225, MW = 92.0938, LVB = 0.0732027, AF = 1.544133, SP = 34540, DM = 1.4E-29, SH = 28500000.0, IGHF = -5.828E+08, GEF = -4.471E+08, AS = 396000, HFMP = 1.831E+07, HOC = -1.477E+09, LiqDen = {105,0.933664,0.246209,850,0.220672,0}, VP = {101,99.57469,-13673.87,-10.09699,1.227718E-11,2}, LiqCp = {16,115.6361,-33.33621,11.80006,0.00238285,-0.0000010098}, HOV = {106,1.1E+08,1,-2.5,3.4,-1.65}, VapCp = {16,31366.31,-311.2541,12.31511,0.000195602,1.752076E-09}, LiqVis = {10,-27,-10000,70,0,0}, VapVis = {16,1.418624E-06,-375.5227,-11.1197,0.000710923,4.531819E-08}, LiqK = {16,0.00821317,-13.47096,-1.285018,0.000197192,1.226656E-07}, VapK = {16,-0.00880104,-445.7976,-2.857337,0.000677005,8.722756E-08}, Racketparam = 0, UniquacR = 3.385629, UniquacQ = 3.06, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); + end Glycerol; + + model Neicosane + extends General_Properties( + SN = 430, name = "Neicosane", CAS = "112-95-8", Tc = 767, Pc = 1160000, Vc = 1.19, Cc = 0.213, Tb = 616.95, Tm = 309.58, TT = 309.58, TP = 0.00925737, MW = 282.547, LVB = 0.360385, AF = 0.9065, SP = 16000, DM = 0, SH = 28500000.0, IGHF = -4.5576E+08, GEF = 1.157E+08, AS = 934120, HFMP = 7.03E+07, HOC = -1.239199E+10, LiqDen = {105,0.18166,0.23351,768,0.28571,0}, VP = {101,164.6909,-17503.89,-19.74205,5.399206E-06,2}, LiqCp = {100,352720,807.32,0.2122,0,0}, HOV = {106,1.286E+08,0.50351,0.32986,-0.42184,0}, VapCp = {107,324810,1109000,1636,745000,726.27}, LiqVis = {101,-10.5557,1830.385,-0.148602,-7.471032E-06,-7.49069E-06}, VapVis = {102,2.9236E-07,0.62458,702.84,0,0}, LiqK = {100,0.2178,-0.0002233,0,0,0}, VapK = {102,-375.32,1.0708,-8.7836E+09,0,0}, Racketparam = 0, UniquacR = 13.9414, UniquacQ = 11.416, ChaoSeadAF = 0.9065, ChaoSeadSP = 16000, ChaoSeadLV = 0.360385); + end Neicosane; + + model DiButylCarbonate + extends General_Properties( + SN = 431, name = "DiButylCarbonate", CAS = "542-52-9", Tc = 577.9457, Pc = 2554740, Vc = 0.48029, Cc = 0.255346, Tb = 480.6, Tm = 0, TT = 0, TP = 0, MW = 174.2374, LVB = 0.16285, AF = 0.380499, SP = 14896.02, DM = 0, SH = 28500000.0, IGHF = -3.824176E+07, GEF = 1.508667E+07, AS = 1355409, HFMP = 0, HOC = -5.683778E+09, LiqDen = {0,0,0,0,0,0}, VP = {10,22.02883,4492.482,-50.81,0,0}, LiqCp = {0,0,0,0,0,0}, HOV = {0,0,0,0,0,0}, VapCp = {0,0,0,0,0,0}, LiqVis = {0,0,0,0,0,0}, VapVis = {0,0,0,0,0,0}, LiqK = {100,0,0,0,0,0}, VapK = {0,0,0,0,0,0}, Racketparam = 0, UniquacR = 0, UniquacQ = 0, ChaoSeadAF = 0, ChaoSeadSP = 0, ChaoSeadLV = 0); + end DiButylCarbonate; +end Chemsep_Database; diff --git a/Simulator/Simulator/Files/Chemsep_Database/package.order b/Simulator/Simulator/Files/Chemsep_Database/package.order new file mode 100644 index 0000000..7fe7473 --- /dev/null +++ b/Simulator/Simulator/Files/Chemsep_Database/package.order @@ -0,0 +1,432 @@ +General_Properties +Air +Argon +Bromine +Carbontetrachloride +Carbonmonoxide +Carbondioxide +Carbondisulfide +Phosgene +Trichloroacetylchloride +Hydrogenchloride +Chlorine +Hydrogeniodide +Hydrogen +Water +Hydrogensulfide +Ammonia +Neon +Nitricacid +Nitricoxide +Nitrogendioxide +Nitrogen +Nitrousoxide +Oxygen +Sulfurdioxide +Sulfurtrioxide +Chloroform +Hydrogencyanide +Formaldehyde +Methylchloride +Methyliodide +Methane +Methanol +Methylamine +Trichloroethylene +Dichloroacetylchloride +Trichloroacetaldehyde +Acetylene +Dichloroacetaldehyde +Vinylchloride +Acetylchloride +OneOneTwotrichloroethane +Acetonitrile +Ethylene +OneOnedichloroethane +OneTwodichloroethane +Acetaldehyde +Ethyleneoxide +Aceticacid +Methylformate +Ethylchloride +Ethane +Ethanol +Dimethylether +Ethyleneglycol +Dimethylsulfide +Ethylmercaptan +Ethylamine +Acrylonitrile +Methylacetylene +Propadiene +Propylene +Acetone +Ethylformate +Methylacetate +Propionicacid +Nndimethylformamide +Propane +Isopropanol +Onepropanol +Trimethylamine +Vinylacetylene +Thiophene +Methacrylonitrile +Dimethylacetylene +Ethylacetylene +OneTwobutadiene +OneThreebutadiene +Onebutene +CisTwobutene +TransTwobutene +Isobutene +Twomethylpropanal +Methylethylketone +Tetrahydrofuran +OneFourdioxane +Nbutyricacid +Ethylacetate +Methylpropionate +Npropylformate +Sulfolane +Nndimethylacetamide +Nbutane +Isobutane +Onebutanol +TwomethylOnepropanol +Twobutanol +TwomethylTwopropanol +Diethylether +Diethyleneglycol +Diethylamine +Furfural +Pyridine +Isoprene +Cyclopentane +TwomethylOnebutene +ThreemethylOnebutene +TwomethylTwobutene +Onepentene +CisTwopentene +TransTwopentene +Threepentanone +Methylisopropylketone +Npropylacetate +Isopentane +Npentane +Neopentane +OneTwoFourtrichlorobenzene +Mdichlorobenzene +Odichlorobenzene +Pdichlorobenzene +Bromobenzene +Monochlorobenzene +Iodobenzene +Nitrobenzene +Benzene +Phenol +Aniline +Cyclohexanone +Cyclohexane +Onehexene +Methylcyclopentane +Cyclohexanol +TwoTwodimethylbutane +TwoThreedimethylbutane +Nhexane +Twomethylpentane +Threemethylpentane +Triethyleneglycol +Triethylamine +Toluene +Mcresol +Ocresol +Pcresol +Methylcyclohexane +Ethylcyclopentane +Oneheptene +Nheptane +Styrene +Ethylbenzene +Mxylene +Oxylene +Pxylene +Ethylcyclohexane +Npropylcyclopentane +Noctane +TwoTwoThreetrimethylpentane +TwoTwoFourtrimethylpentane +TwoThreeThreetrimethylpentane +TwoThreeFourtrimethylpentane +Tetraethyleneglycol +Indene +Indane +Cumene +Npropylbenzene +Npropylcyclohexane +Nnonane +Naphthalene +Onemethylindene +Twomethylindene +Dicyclopentadiene +Nbutylbenzene +Nbutylcyclohexane +Ndecane +Onemethylnaphthalene +Twomethylnaphthalene +Nundecane +Acenaphthene +Biphenyl +Ndodecane +Fluorene +Ntridecane +Phenanthrene +Ntetradecane +Npentadecane +Fluoranthene +Pyrene +Onephenylnaphthalene +Nhexadecane +Chrysene +Cisdecahydronaphthalene +Transdecahydronaphthalene +Methyltertbutylether +Methyltertpentylether +TwomethylTwobutanol +Nitrogentrioxide +Nitrogentetroxide +HeliumFour +Fluorine +Krypton +Xenon +Ozone +Carbonylsulfide +Sulfurhexafluoride +Dimethylsulfoxide +Nheptadecane +Noctadecane +Nnonadecane +Nheneicosane +Ndocosane +Ntricosane +Ntetracosane +Npentacosane +Nhexacosane +Nheptacosane +Noctacosane +Nnonacosane +Squalane +Twomethylhexane +Threemethylhexane +Threeethylpentane +TwoTwodimethylpentane +TwoThreedimethylpentane +TwoFourdimethylpentane +ThreeThreedimethylpentane +TwoTwoThreetrimethylbutane +Twomethylheptane +Threemethylheptane +Fourmethylheptane +Threeethylhexane +TwoTwodimethylhexane +TwoThreedimethylhexane +TwoFourdimethylhexane +TwoFivedimethylhexane +ThreeThreedimethylhexane +ThreeFourdimethylhexane +TwomethylThreeethylpentane +ThreemethylThreeethylpentane +TwoTwoThreeThreetetramethylbutane +TwoTwoFivetrimethylhexane +TwoFourFourtrimethylhexane +ThreeThreediethylpentane +TwoTwoThreeThreetetramethylpentane +TwoTwoThreeFourtetramethylpentane +TwoTwoFourFourtetramethylpentane +TwoThreeThreeFourtetramethylpentane +Twomethyloctane +Threemethyloctane +Fourmethyloctane +Threeethylheptane +TwoTwodimethylheptane +ThreeThreeFivetrimethylheptane +TwoTwodimethyloctane +Threemethylnonane +Twomethylnonane +Fourmethylnonane +Fivemethylnonane +CisTwohexene +TransTwohexene +Oneoctene +Onenonene +Oneundecene +TwomethylOnepentene +FourmethylcisTwopentene +FourmethyltransTwopentene +Cyclohexene +OneOnedimethylcyclopentane +CisOneTwodimethylcyclopentane +TransOneTwodimethylcyclopentane +CisOneThreedimethylcyclopentane +TransOneThreedimethylcyclopentane +Isopropylcyclopentane +OnemethylOneethylcyclopentane +Nbutylcyclopentane +OneOnedimethylcyclohexane +CisOneTwodimethylcyclohexane +TransOneTwodimethylcyclohexane +CisOneThreedimethylcyclohexane +TransOneThreedimethylcyclohexane +CisOneFourdimethylcyclohexane +TransOneFourdimethylcyclohexane +Tertbutylcyclohexane +Oethyltoluene +Methyltoluene +Pethyltoluene +OneTwoThreetrimethylbenzene +OneTwoFourtrimethylbenzene +Mesitylene +Isobutylbenzene +Secbutylbenzene +Tertbutylbenzene +Ocymene +Mcymene +Pcymene +Odiethylbenzene +Mdiethylbenzene +Pdiethylbenzene +OneTwoThreeFourtetramethylbenzene +OneTwoThreeFivetetramethylbenzene +OneTwoFourFivetetramethylbenzene +Twoethylmxylene +Twoethylpxylene +Fourethylmxylene +Fourethyloxylene +OnemethylThreenpropylbenzene +OnemethylFournpropylbenzene +Pdiisopropylbenzene +Methylisobutylketone +Threeheptanone +Fourheptanone +Threehexanone +Twopentanone +Twohexanone +Twoheptanone +FivemethylTwohexanone +ThreeThreedimethylTwobutanone +Diisobutylketone +Diisopropylketone +Propanal +Butanal +Pentanal +Hexanal +Heptanal +Diisopropylether +Dinbutylether +Disecbutylether +Methylethylether +Methylnpropylether +Isopropylbutylether +Methylisobutylether +Methylisopropylether +Tertbutylethylether +Ethyltertpentylether +Butylvinylether +Anisole +Isopropylacetate +Nbutylacetate +Isobutylacetate +Npentylacetate +Vinylacetate +Nhexylacetate +Onepentanol +Twopentanol +TwomethylOnebutanol +TwoTwodimethylOnepropanol +Onehexanol +Oneheptanol +OneFourbutanediol +Methylmercaptan +Npropylmercaptan +Tertbutylmercaptan +Isobutylmercaptan +Secbutylmercaptan +Nhexylmercaptan +Methylethylsulfide +Methylnpropylsulfide +Methyltbutylsulfide +Methyltpentylsulfide +Dinpropylsulfide +Diethylsulfide +Diethyldisulfide +Dimethyldisulfide +Dinpropyldisulfide +Ditertbutyldisulfide +Ethylmethyldisulfide +Ethylpropyldisulfide +Diphenyldisulfide +Monoethanolamine +Diethanolamine +Triethanolamine +Ethylenediamine +Diisopropylamine +Naminoethylpiperazine +Diethylenetriamine +Naminoethylethanolamine +Pphenylenediamine +Piperazine +Methylethanolamine +Dimethylethanolamine +Nitromethane +Nitroethane +Onenitropropane +Twonitropropane +Onenitrobutane +Onitrotoluene +Pnitrotoluene +Mnitrotoluene +TwoFourdinitrotoluene +Two6dinitrotoluene +ThreeFourdinitrotoluene +TwoFivedinitrotoluene +ThreeFivedinitrotoluene +TwoFour6trinitrotoluene +Oxalicacid +Acrylicacid +Methacrylicacid +Benzoicacid +Otoluicacid +Ptoluicacid +Salicylicacid +Adipicacid +Phthalicacid +Maleicacid +Terephthalicacid +Aceticanhydride +Maleicanhydride +Ketene +Methylmethacrylate +Dimethylterephthalate +OneTwopropyleneoxide +Cumenehydroperoxide +Propionitrile +Dimethylcarbonate +DiEthylCarbonate +MethylEthylCarbonate +MethylPhenylCarbonate +EthylPhenylCarbonate +DiPhenylCarbonate +Ethylenecarbonate +Propylenecarbonate +TwomethylOneheptene +TwoMethoxyTwoMethylHeptane +TwoMethylTwoHeptanol +Methylal +MethylDiEthanolAmine +Diethylethanolamine +Diisopropanolamine +Cyclobutane +Isopropylmercaptan +Glycerol +Neicosane +DiButylCarbonate diff --git a/Simulator/Simulator/Files/Connection/enConn.mo b/Simulator/Simulator/Files/Connection/enConn.mo new file mode 100644 index 0000000..ede074c --- /dev/null +++ b/Simulator/Simulator/Files/Connection/enConn.mo @@ -0,0 +1,7 @@ +within Simulator.Files.Connection; + +connector enConn + Real enFlo; + annotation( + Icon(coordinateSystem(initialScale = 0.1), graphics = {Rectangle(fillColor = {255, 255, 33}, fillPattern = FillPattern.Solid, extent = {{-100, 100}, {100, -100}})})); +end enConn; diff --git a/Simulator/Simulator/Files/Connection/matConn.mo b/Simulator/Simulator/Files/Connection/matConn.mo new file mode 100644 index 0000000..41ae257 --- /dev/null +++ b/Simulator/Simulator/Files/Connection/matConn.mo @@ -0,0 +1,8 @@ +within Simulator.Files.Connection; + +connector matConn + Real P(min = 0, start = 101325), T(min = 0, start = 273.15), mixMolFlo(min = 0, start = 100), mixMolEnth, mixMolEntr, mixMolFrac[3, connNOC](each min = 0, each max = 1, each start = 1 / (connNOC + 1)), vapPhasMolFrac(min = 0, max = 1, start = 0.5); + parameter Integer connNOC(start = 2); + annotation( + Icon(coordinateSystem(initialScale = 0.1), graphics = {Rectangle(fillColor = {175, 175, 175}, fillPattern = FillPattern.Solid, extent = {{-100, 100}, {100, -100}})})); +end matConn; diff --git a/Simulator/Simulator/Files/Connection/package.mo b/Simulator/Simulator/Files/Connection/package.mo new file mode 100644 index 0000000..8c6727d --- /dev/null +++ b/Simulator/Simulator/Files/Connection/package.mo @@ -0,0 +1,24 @@ +within Simulator.Files; + +package Connection + connector matConn + Real P(min = 0, start = 101325), T(min = 0, start = 273.15), mixMolFlo(min = 0, start = 100), mixMolEnth, mixMolEntr, mixMolFrac[3, connNOC](each min = 0, each max = 1, each start = 1/(connNOC + 1)), vapPhasMolFrac(min = 0, max = 1, start = 0.5); + parameter Integer connNOC(start = 2); + annotation( + Icon(coordinateSystem(initialScale = 0.1), graphics = {Rectangle(fillPattern = FillPattern.Solid, extent = {{-50, 50}, {50, -50}})})); + end matConn; + + connector enConn + Real enFlo; + annotation( + Icon(coordinateSystem(initialScale = 0.1), graphics = {Rectangle(lineColor = {255, 0, 0},fillColor = {255, 0, 0}, fillPattern = FillPattern.Solid, extent = {{-50, 50}, {50, -50}})})); + end enConn; + + connector trayConn + Real mixMolFlo(min = 0, start = 100), mixMolEnth, mixMolFrac[connNOC](each min = 0, each max = 1, each start = 1/(connNOC + 1)); + parameter Integer connNOC; + annotation( + Icon(coordinateSystem(initialScale = 0.1), graphics = {Rectangle(fillColor = {8, 184, 211}, fillPattern = FillPattern.Solid, extent = {{-100, 100}, {100, -100}})})); + end trayConn; + +end Connection; diff --git a/Simulator/Simulator/Files/Connection/package.order b/Simulator/Simulator/Files/Connection/package.order new file mode 100644 index 0000000..ed3ffc4 --- /dev/null +++ b/Simulator/Simulator/Files/Connection/package.order @@ -0,0 +1,3 @@ +matConn +enConn +trayConn diff --git a/Simulator/Simulator/Files/Connection/trayConn.mo b/Simulator/Simulator/Files/Connection/trayConn.mo new file mode 100644 index 0000000..5ae6108 --- /dev/null +++ b/Simulator/Simulator/Files/Connection/trayConn.mo @@ -0,0 +1,8 @@ +within Simulator.Files.Connection; + +connector trayConn + Real mixMolFlo(min = 0, start = 100), mixMolEnth, mixMolFrac[connNOC](each min = 0, each max = 1, each start = 1 / (connNOC + 1)); + parameter Integer connNOC; + annotation( + Icon(coordinateSystem(initialScale = 0.1), graphics = {Rectangle(fillColor = {8, 184, 211}, fillPattern = FillPattern.Solid, extent = {{-100, 100}, {100, -100}})})); +end trayConn; diff --git a/Simulator/Simulator/Files/Icons/Adiabatic_Compressor.mo b/Simulator/Simulator/Files/Icons/Adiabatic_Compressor.mo new file mode 100644 index 0000000..b255767 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Adiabatic_Compressor.mo @@ -0,0 +1,7 @@ +within Simulator.Files.Icons; + +model Adiabatic_Compressor +equation + +annotation( + Icon(graphics = {Polygon(points = {{-100, 80}, {100, 50}, {100, -50}, {-100, -80}, {-100, 80}}), Text(origin = {-17, -123}, extent = {{-79, 17}, {127, -57}}, textString = "%name")}));end Adiabatic_Compressor; diff --git a/Simulator/Simulator/Files/Icons/Adiabatic_Expander.mo b/Simulator/Simulator/Files/Icons/Adiabatic_Expander.mo new file mode 100644 index 0000000..0d9a6ac --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Adiabatic_Expander.mo @@ -0,0 +1,6 @@ +within Simulator.Files.Icons; + +model Adiabatic_Expander + annotation( + Icon(graphics = {Polygon(points = {{-100, 50}, {100, 80}, {100, -80}, {-100, -50}, {-100, 50}}), Text(origin = {-1, -131}, extent = {{-97, 27}, {101, -43}}, textString = "%name")})); +end Adiabatic_Expander; diff --git a/Simulator/Simulator/Files/Icons/Centrifugal_Pump.mo b/Simulator/Simulator/Files/Icons/Centrifugal_Pump.mo new file mode 100644 index 0000000..012e62c --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Centrifugal_Pump.mo @@ -0,0 +1,7 @@ +within Simulator.Files.Icons; + +model Centrifugal_Pump +equation + +annotation( + Icon(graphics = {Ellipse(origin = {0, 15}, extent = {{-85, 85}, {85, -85}}, endAngle = 360), Line(origin = {-66, -60}, points = {{0, 0}, {0, 0}}), Line(points = {{0, 100}, {100, 100}}), Rectangle(extent = {{-90, -80}, {90, -100}}), Line(points = {{-100, 15}, {0, 15}}), Text(origin = {-32, -117}, extent = {{-58, 11}, {128, -57}}, textString = "%name")}));end Centrifugal_Pump; diff --git a/Simulator/Simulator/Files/Icons/Compound_Separator.mo b/Simulator/Simulator/Files/Icons/Compound_Separator.mo new file mode 100644 index 0000000..161f1d4 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Compound_Separator.mo @@ -0,0 +1,9 @@ +within Simulator.Files.Icons; + +model Compound_Separator +equation + +annotation( + Icon(coordinateSystem(extent = {{-100, -200}, {100, 200}}, initialScale = 0.1), graphics = {Line(points = {{-100, 100}, {-100, -100}}), Line(origin = {0, -1.51852}, points = {{100, 100}, {100, -100}}), Line(origin = {-2.79, 117.21}, points = {{-100, 100}, {0, 200}, {100, 100}}, smooth = Smooth.Bezier), Line(origin = {0, 112}, points = {{-99.7984, -16.7984}, {-85.7984, 1.20165}, {-37.7984, 17.2016}, {36.2016, 17.2016}, {84.2016, 5.20165}, {100.202, -12.7984}, {100.202, -10.7984}}, smooth = Smooth.Bezier), Line(origin = {-0.62963, -115.796}, rotation = 180, points = {{-99.7984, -16.7984}, {-85.7984, 1.20165}, {-37.7984, 17.2016}, {36.2016, 17.2016}, {84.2016, 5.20165}, {100.202, -12.7984}, {100.202, -10.7984}}, smooth = Smooth.Bezier), Rectangle(origin = {-1, 77}, extent = {{-119, 3}, {119, -3}}), Rectangle(origin = {-5, -75}, extent = {{-115, -3}, {115, 3}}), Rectangle(origin = {111, 56}, extent = {{-11, 8}, {11, -8}}), Rectangle(origin = {110, -50}, extent = {{-10, 8}, {10, -8}}), Rectangle(origin = {-109, -3}, extent = {{-9, 13}, {9, -13}})}), + Icon(coordinateSystem(extent = {{-100, -200}, {100, 200}}, initialScale = 0.1), graphics = {Line(points = {{-100, 150}, {-100, -150}}), Line(origin = {0, -1.52}, points = {{100, 150}, {100, -150}}), Line(origin = {0, 168}, points = {{-99.7984, -16.7984}, {-85.7984, 1.20165}, {-37.7984, 17.2016}, {36.2016, 17.2016}, {84.2016, 5.20165}, {100.202, -12.7984}, {100.202, -10.7984}}, smooth = Smooth.Bezier), Line(origin = {-0.62963, -163.796}, rotation = 180, points = {{-99.7984, -16.7984}, {-85.7984, 1.20165}, {-37.7984, 17.2016}, {36.2016, 17.2016}, {84.2016, 5.20165}, {100.202, -12.7984}, {100.202, -10.7984}}, smooth = Smooth.Bezier), Rectangle(origin = {-1, 125}, extent = {{-119, 3}, {119, -3}}), Rectangle(origin = {-5, -121}, extent = {{-115, -3}, {115, 3}}), Text(origin = {0, -237}, extent = {{-102, 25}, {96, -35}}, textString = "%name")}), + __OpenModelica_commandLineOptions = "");end Compound_Separator; diff --git a/Simulator/Simulator/Files/Icons/Conversion_Reactor.mo b/Simulator/Simulator/Files/Icons/Conversion_Reactor.mo new file mode 100644 index 0000000..647a694 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Conversion_Reactor.mo @@ -0,0 +1,7 @@ +within Simulator.Files.Icons; + +model Conversion_Reactor +equation +annotation( + Icon(coordinateSystem(extent = {{-100, -200}, {100, 200}}, initialScale = 0.1), graphics = {Line(points = {{-100, 150}, {-100, -150}}), Line(origin = {0, -1.52}, points = {{100, 150}, {100, -150}}), Line(origin = {0, 166}, points = {{-99.7984, -16.7984}, {-85.7984, 1.20165}, {-37.7984, 17.2016}, {36.2016, 17.2016}, {84.2016, 5.20165}, {100.202, -12.7984}, {100.202, -10.7984}}, smooth = Smooth.Bezier), Line(origin = {-0.62963, -167.796}, rotation = 180, points = {{-99.7984, -16.7984}, {-85.7984, 1.20165}, {-37.7984, 17.2016}, {36.2016, 17.2016}, {84.2016, 5.20165}, {100.202, -12.7984}, {100.202, -10.7984}}, smooth = Smooth.Bezier), Rectangle(origin = {-1, 123}, extent = {{-119, 3}, {119, -3}}), Rectangle(origin = {-5, -123}, extent = {{-115, -3}, {115, 3}}), Text(origin = {0, -249}, extent = {{-96, 33}, {96, -33}}, textString = "%name"), Line(origin = {1, 82}, points = {{-99, 0}, {99, 0}}), Line(origin = {-0.248122, 1.20711}, points = {{-99.7519, -81.2071}, {100.248, -81.2071}, {30.2481, 80.7929}, {-43.7519, -81.2071}, {-97.7519, 78.7929}, {-99.7519, 80.7929}}), Line(origin = {-1.9975, 1.57511}, points = {{-98.0025, -77.5751}, {-38.0025, 78.4249}, {37.9975, -75.5751}, {97.9975, 76.4249}})}), + __OpenModelica_commandLineOptions = "");end Conversion_Reactor; diff --git a/Simulator/Simulator/Files/Icons/Cooler.mo b/Simulator/Simulator/Files/Icons/Cooler.mo new file mode 100644 index 0000000..e4aecef --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Cooler.mo @@ -0,0 +1,7 @@ +within Simulator.Files.Icons; + +model Cooler +equation + +annotation( + Icon(graphics = {Ellipse(origin = {-1, 2}, extent = {{-100, 100}, {100, -100}}, endAngle = 360), Line(origin = {-1.21, 0.36}, points = {{-100, 100}, {100, -100}}, color = {255, 0, 0}), Line(origin = {90, -90}, points = {{10, 10}, {10, -10}, {-10, -10}}, color = {255, 0, 0}), Text(origin = {-3, -5}, extent = {{-50, 50}, {50, -50}}, textString = "C", textStyle = {TextStyle.Bold}), Text(origin = {-1, -130}, extent = {{-97, 28}, {97, -28}}, textString = "%name")}));end Cooler; diff --git a/Simulator/Simulator/Files/Icons/Distillation_Column.mo b/Simulator/Simulator/Files/Icons/Distillation_Column.mo new file mode 100644 index 0000000..5a73890 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Distillation_Column.mo @@ -0,0 +1,10 @@ +within Simulator.Files.Icons; + +model Distillation_Column +equation + +annotation( + Icon(coordinateSystem(extent = {{-200, -400}, {200, 400}}), graphics = {Line(points = {{-200, 300}, {-200, -300}}), Line(origin = {200, 0}, points = {{-200, 300}, {-200, -300}}), Line(origin = {-100, 330.8}, points = {{-102.002, -24.7972}, {-64.0022, 25.2028}, {61.9978, 25.2028}, {101.998, -24.7972}, {101.998, -24.7972}}, smooth = Smooth.Bezier), Line(origin = {-100, -317.2}, rotation = 180, points = {{-102.002, -24.7972}, {-64.0022, 25.2028}, {61.9978, 25.2028}, {101.998, -24.7972}, {101.998, -24.7972}}, smooth = Smooth.Bezier)}), + Icon(coordinateSystem(extent = {{-200, -800}, {200, 800}}), graphics = {Line(points = {{-200, 700}, {-200, -700}}), Line(origin = {200, 0}, points = {{-200, 700}, {-200, -700}}), Line(origin = {-100, 732.8}, points = {{-102.002, -24.7972}, {-64.0022, 25.2028}, {61.9978, 25.2028}, {101.998, -24.7972}, {101.998, -24.7972}}, smooth = Smooth.Bezier), Line(origin = {-100, -729.2}, rotation = 180, points = {{-102.002, -24.7972}, {-64.0022, 25.2028}, {61.9978, 25.2028}, {101.998, -24.7972}, {101.998, -24.7972}}, smooth = Smooth.Bezier), Ellipse(origin = {156, 709}, extent = {{-100, 100}, {100, -100}}, endAngle = 360), Ellipse(origin = {179, -625}, extent = {{-100, 100}, {100, -100}}, endAngle = 360), Line(origin = {182, 522}, points = {{-182, 0}, {176, 0}, {176, 0}, {182, 0}}), Line(origin = {169, -445}, points = {{-163, -3}, {163, 3}})}), + __OpenModelica_commandLineOptions = "", + Diagram(coordinateSystem(extent = {{-200, -800}, {200, 800}})));end Distillation_Column; diff --git a/Simulator/Simulator/Files/Icons/Energy_Stream.mo b/Simulator/Simulator/Files/Icons/Energy_Stream.mo new file mode 100644 index 0000000..541aafc --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Energy_Stream.mo @@ -0,0 +1,8 @@ +within Simulator.Files.Icons; + +model Energy_Stream +annotation( + Icon(graphics = {Polygon(origin = {0, -1}, lineColor = {255, 0, 0}, lineThickness = 1.5, points = {{-100, 25}, {26, 25}, {4, 100}, {100, 0}, {4, -100}, {26, -25}, {-100, -25}, {-100, 25}})}, coordinateSystem(initialScale = 0.1))); + + +end Energy_Stream; diff --git a/Simulator/Simulator/Files/Icons/Flash.mo b/Simulator/Simulator/Files/Icons/Flash.mo new file mode 100644 index 0000000..4314480 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Flash.mo @@ -0,0 +1,8 @@ +within Simulator.Files.Icons; + +model Flash +annotation( + + Icon(coordinateSystem(extent = {{-100, -200}, {100, 200}}, initialScale = 0.1), graphics = {Line(points = {{-100, 150}, {-100, -150}}), Line(origin = {0, -1.52}, points = {{100, 150}, {100, -150}}), Line(origin = {0, 166}, points = {{-99.7984, -16.7984}, {-85.7984, 1.20165}, {-37.7984, 17.2016}, {36.2016, 17.2016}, {84.2016, 5.20165}, {100.202, -12.7984}, {100.202, -10.7984}}, smooth = Smooth.Bezier), Line(origin = {-0.62963, -167.796}, rotation = 180, points = {{-99.7984, -16.7984}, {-85.7984, 1.20165}, {-37.7984, 17.2016}, {36.2016, 17.2016}, {84.2016, 5.20165}, {100.202, -12.7984}, {100.202, -10.7984}}, smooth = Smooth.Bezier), Rectangle(origin = {-1, 123}, extent = {{-119, 3}, {119, -3}}), Rectangle(origin = {-5, -123}, extent = {{-115, -3}, {115, 3}}), Line(origin = {0.04, -2.94}, points = {{-100.04, 2.93919}, {-70.0405, 16.9392}, {-44.0405, -17.0608}, {-8.04049, 18.9392}, {21.9595, -17.0608}, {45.9595, 16.9392}, {71.9595, -19.0608}, {87.9595, 12.9392}, {99.9595, -1.06081}}, smooth = Smooth.Bezier), Text(origin = {0, -249}, extent = {{-96, 33}, {96, -33}}, textString = "%name")}), + __OpenModelica_commandLineOptions = ""); +end Flash; diff --git a/Simulator/Simulator/Files/Icons/Heat_Exchanger.mo b/Simulator/Simulator/Files/Icons/Heat_Exchanger.mo new file mode 100644 index 0000000..4cf0268 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Heat_Exchanger.mo @@ -0,0 +1,6 @@ +within Simulator.Files.Icons; + +model Heat_Exchanger + annotation( + Icon(graphics = {Ellipse(extent = {{-100, 100}, {100, -100}}, endAngle = 360), Line(points = {{-100, 0}, {-35, 30}, {35, -30}, {100, 0}}), Text(origin = {-3, -135}, extent = {{-91, 25}, {91, -41}}, textString = "%name")}, coordinateSystem(initialScale = 0.1))); +end Heat_Exchanger; diff --git a/Simulator/Simulator/Files/Icons/Heater.mo b/Simulator/Simulator/Files/Icons/Heater.mo new file mode 100644 index 0000000..b4594d5 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Heater.mo @@ -0,0 +1,7 @@ +within Simulator.Files.Icons; + +model Heater + annotation( + Diagram, + Icon(graphics = {Ellipse(extent = {{-100, 100}, {100, -100}}, endAngle = 360), Line(points = {{-100, -100}, {100, 100}}, color = {255, 0, 0}), Line(origin = {90, 90}, points = {{-10, 10}, {10, 10}, {10, -10}}, color = {255, 0, 0}), Text(extent = {{-50, 50}, {50, -50}}, textString = "H", textStyle = {TextStyle.Bold}), Text(origin = {4, -132}, extent = {{-100, 24}, {102, -50}}, textString = "%name")}, coordinateSystem(initialScale = 0.1))); +end Heater; diff --git a/Simulator/Simulator/Files/Icons/Material_Stream.mo b/Simulator/Simulator/Files/Icons/Material_Stream.mo new file mode 100644 index 0000000..49c9181 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Material_Stream.mo @@ -0,0 +1,8 @@ +within Simulator.Files.Icons; + +model Material_Stream + +annotation( + Icon(graphics = {Polygon(origin = {0, -1}, lineThickness = 1, points = {{-100, 25}, {26, 25}, {4, 100}, {100, 0}, {4, -100}, {26, -25}, {-100, -25}, {-100, 25}})}, coordinateSystem(initialScale = 0.1))); + +end Material_Stream; diff --git a/Simulator/Simulator/Files/Icons/Mixer.mo b/Simulator/Simulator/Files/Icons/Mixer.mo new file mode 100644 index 0000000..a9357f6 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Mixer.mo @@ -0,0 +1,7 @@ +within Simulator.Files.Icons; + +model Mixer + + annotation( + Icon(coordinateSystem(initialScale = 0.1), graphics = {Polygon(origin = {-1, 1}, fillColor = {19, 224, 255}, points = {{-100, 100}, {0, 100}, {100, 0}, {0, -100}, {-100, -100}, {-100, 100}})})); +end Mixer; diff --git a/Simulator/Simulator/Files/Icons/PFR.mo b/Simulator/Simulator/Files/Icons/PFR.mo new file mode 100644 index 0000000..eaad80b --- /dev/null +++ b/Simulator/Simulator/Files/Icons/PFR.mo @@ -0,0 +1,9 @@ +within Simulator.Files.Icons; + +model PFR +equation + +annotation( + Icon(coordinateSystem(extent = {{-180, -100}, {180, 100}}), graphics = {Line(origin = {1.9999, 0.273377}, points = {{-120, 59.7266}, {-120, -60.2734}, {-59.9999, 57.7266}, {6.943e-05, -60.2734}, {60.0001, 57.7266}, {120, -60.2734}, {118, 59.7266}, {60.0001, -60.2734}, {6.943e-05, 59.7266}, {-59.9999, -58.2734}, {-118, 57.7266}, {-120, 57.7266}}), Line(origin = {0, 60}, points = {{-160, 0}, {160, 0}, {160, 0}}), Line(origin = {0, -59}, points = {{-160, -1}, {160, -1}, {160, 1}}), Line(origin = {165.84, 0.01}, points = {{-5.83649, 59.9864}, {6.16351, 33.9864}, {6.16351, -30.0136}, {-5.83649, -60.0136}}, smooth = Smooth.Bezier), Line(origin = {-152.16, 0.00999999}, points = {{-5.83649, 59.9864}, {6.16351, 33.9864}, {6.16351, -30.0136}, {-5.83649, -60.0136}}, smooth = Smooth.Bezier), Line(origin = {-166.16, -1.99}, rotation = 180, points = {{-5.83649, 59.9864}, {6.16351, 33.9864}, {6.16351, -30.0136}, {-5.83649, -60.0136}}, smooth = Smooth.Bezier), Text(origin = {5, -84}, extent = {{-83, 14}, {71, -20}}, textString = "%name")}), + Diagram(coordinateSystem(extent = {{-180, -100}, {180, 100}})), + __OpenModelica_commandLineOptions = "");end PFR; diff --git a/Simulator/Simulator/Files/Icons/Splitter.mo b/Simulator/Simulator/Files/Icons/Splitter.mo new file mode 100644 index 0000000..c857141 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Splitter.mo @@ -0,0 +1,7 @@ +within Simulator.Files.Icons; + +model Splitter + +annotation( + Icon(coordinateSystem(initialScale = 0.1), graphics = {Polygon(origin = {-1, 1}, rotation = 180, fillColor = {19, 224, 255}, points = {{-100, 100}, {0, 100}, {100, 0}, {0, -100}, {-100, -100}, {-100, 100}}), Text(origin = {-13, -125}, extent = {{-75, 15}, {105, -43}}, textString = "%name")})); +end Splitter; diff --git a/Simulator/Simulator/Files/Icons/Valve.mo b/Simulator/Simulator/Files/Icons/Valve.mo new file mode 100644 index 0000000..3add9d1 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/Valve.mo @@ -0,0 +1,7 @@ +within Simulator.Files.Icons; + +model Valve +equation + +annotation( + Icon(graphics = {Polygon(origin = {0, -4}, points = {{-100, 66}, {-100, -66}, {100, 66}, {100, -66}, {-100, 66}}), Text(origin = {-19, -106}, extent = {{-79, 20}, {119, -40}}, textString = "%name")}));end Valve; diff --git a/Simulator/Simulator/Files/Icons/en_stm.mo b/Simulator/Simulator/Files/Icons/en_stm.mo new file mode 100644 index 0000000..8e86054 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/en_stm.mo @@ -0,0 +1,6 @@ +within Simulator.Files.Icons; + +model en_stm +annotation( + Icon(graphics = {Line(points = {{-100, 0}, {100, 0}}, color = {255, 0, 0}), Line(origin = {60, 0}, points = {{0, 40}, {40, 0}, {0, -40}}, color = {255, 0, 0}), Text(origin = {-20, -79}, extent = {{-76, 17}, {114, -45}}, textString = "%name")}, coordinateSystem(initialScale = 0.1))); +end en_stm; diff --git a/Simulator/Simulator/Files/Icons/package.mo b/Simulator/Simulator/Files/Icons/package.mo new file mode 100644 index 0000000..1bb2e62 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/package.mo @@ -0,0 +1,4 @@ +within Simulator.Files; + +package Icons +end Icons; diff --git a/Simulator/Simulator/Files/Icons/package.order b/Simulator/Simulator/Files/Icons/package.order new file mode 100644 index 0000000..f624541 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/package.order @@ -0,0 +1,18 @@ +Material_Stream +Mixer +Heater +Energy_Stream +stm +en_stm +Heat_Exchanger +Cooler +Valve +Splitter +Compound_Separator +Centrifugal_Pump +Adiabatic_Compressor +Adiabatic_Expander +Flash +Conversion_Reactor +PFR +Distillation_Column diff --git a/Simulator/Simulator/Files/Icons/stm.mo b/Simulator/Simulator/Files/Icons/stm.mo new file mode 100644 index 0000000..087e452 --- /dev/null +++ b/Simulator/Simulator/Files/Icons/stm.mo @@ -0,0 +1,6 @@ +within Simulator.Files.Icons; + +model stm + +annotation( + Icon(graphics = {Line(points = {{-100, 0}, {100, 0}}), Line(origin = {60, 0}, points = {{0, 40}, {40, 0}, {0, -40}}), Text(origin = {-5, -33}, extent = {{-102, -26}, {108, -98}}, textString = "%name")}, coordinateSystem(initialScale = 0.1)));end stm; diff --git a/Simulator/Simulator/Files/Images.bak-mo b/Simulator/Simulator/Files/Images.bak-mo new file mode 100644 index 0000000..01df560 --- /dev/null +++ b/Simulator/Simulator/Files/Images.bak-mo @@ -0,0 +1,8 @@ +within Simulator.Files; + +package Icons +model Material_Stream + +end Material_Stream; + +end Icons; diff --git a/Simulator/Simulator/Files/Models/Flash.mo b/Simulator/Simulator/Files/Models/Flash.mo new file mode 100644 index 0000000..69a1e48 --- /dev/null +++ b/Simulator/Simulator/Files/Models/Flash.mo @@ -0,0 +1,54 @@ +within Simulator.Files.Models; + +model Flash + //this is basic flash model. comp and NOC has to be defined in model. thermodyanamic model must also be extended along with this model for K value. + import Simulator.Files.*; + Real totMolFlo[3](each min = 0, each start = 100), compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), compMolSpHeat[3, NOC], compMolEnth[3, NOC], compMolEntr[3, NOC], phasMolSpHeat[3], phasMolEnth[3], phasMolEntr[3], liqPhasMolFrac(min = 0, max = 1, start = 0.5), vapPhasMolFrac(min = 0, max = 1, start = 0.5), P(min = 0, start = 101325), T(min = 0, start = 298.15); + Real Pbubl(start = 101325, min = 0) "Bubble point pressure", Pdew(start = 101325, min = 0) "dew point pressure"; +equation +//Mole Balance + totMolFlo[1] = totMolFlo[2] + totMolFlo[3]; + compMolFrac[1, :] .* totMolFlo[1] = compMolFrac[2, :] .* totMolFlo[2] + compMolFrac[3, :] .* totMolFlo[3]; +//Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); + if P >= Pbubl then + compMolFrac[3, :] = zeros(NOC); + sum(compMolFrac[2, :]) = 1; + elseif P >= Pdew then +//VLE region + for i in 1:NOC loop + compMolFrac[3, i] = K[i] * compMolFrac[2, i]; + end for; + sum(compMolFrac[3, :]) = 1; +//sum y = 1 + else +//above dew point region + compMolFrac[2, :] = zeros(NOC); + sum(compMolFrac[3, :]) = 1; + end if; +//Energy Balance + for i in 1:NOC loop +//Specific Heat and Enthalpy calculation + compMolSpHeat[2, i] = Thermodynamic_Functions.LiqCpId(comp[i].LiqCp, T); + compMolSpHeat[3, i] = Thermodynamic_Functions.VapCpId(comp[i].VapCp, T); + compMolEnth[2, i] = Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + compMolEnth[3, i] = Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + (compMolEntr[2, i], compMolEntr[3, i]) = Thermodynamic_Functions.SId(comp[i].AS, comp[i].VapCp, comp[i].HOV, comp[i].Tb, comp[i].Tc, T, P, compMolFrac[2, i], compMolFrac[3, i]); + end for; + for i in 2:3 loop + phasMolSpHeat[i] = sum(compMolFrac[i, :] .* compMolSpHeat[i, :]) + resMolSpHeat[i]; + phasMolEnth[i] = sum(compMolFrac[i, :] .* compMolEnth[i, :]) + resMolEnth[i]; + phasMolEntr[i] = sum(compMolFrac[i, :] .* compMolEntr[i, :]) + resMolEntr[i]; + end for; + phasMolSpHeat[1] = liqPhasMolFrac * phasMolSpHeat[2] + vapPhasMolFrac * phasMolSpHeat[3]; + compMolSpHeat[1, :] = compMolFrac[1, :] .* phasMolSpHeat[1]; + phasMolEnth[1] = liqPhasMolFrac * phasMolEnth[2] + vapPhasMolFrac * phasMolEnth[3]; + compMolEnth[1, :] = compMolFrac[1, :] .* phasMolEnth[1]; + phasMolEntr[1] = liqPhasMolFrac * phasMolEntr[2] + vapPhasMolFrac * phasMolEntr[3]; + compMolEntr[1, :] = compMolFrac[1, :] * phasMolEntr[1]; +//phase molar fractions + liqPhasMolFrac = totMolFlo[2] / totMolFlo[1]; + vapPhasMolFrac = totMolFlo[3] / totMolFlo[1]; +end Flash; diff --git a/Simulator/Simulator/Files/Models/ReactionManager/Arhenious.mo b/Simulator/Simulator/Files/Models/ReactionManager/Arhenious.mo new file mode 100644 index 0000000..d790631 --- /dev/null +++ b/Simulator/Simulator/Files/Models/ReactionManager/Arhenious.mo @@ -0,0 +1,12 @@ +within Simulator.Files.Models.ReactionManager; + +function Arhenious + // Reaction rate constant k = A*exp(-E/RT) + input Integer Nr; + input Real A1[Nr] "To calulate reaction rate for forward reaction (Arrhenius constants of forward reaction)"; + input Real E1[Nr] "To calculate reaction rate for forward reaction"; + input Real T; + output Real k1[Nr] "reaction rate constants for forward reaction"; +algorithm + k1 := A1 .* exp(-E1 / (8.314 * T)); +end Arhenious; diff --git a/Simulator/Simulator/Files/Models/ReactionManager/Reaction_Manager.mo b/Simulator/Simulator/Files/Models/ReactionManager/Reaction_Manager.mo new file mode 100644 index 0000000..d1c0a80 --- /dev/null +++ b/Simulator/Simulator/Files/Models/ReactionManager/Reaction_Manager.mo @@ -0,0 +1,37 @@ +within Simulator.Files.Models.ReactionManager; + +model Reaction_Manager + //=================================================================================================== + import Simulator.Files.*; + import data = Simulator.Files.Chemsep_Database; + parameter Chemsep_Database.General_Properties comp[NOC]; + parameter Integer NOC; + parameter Integer Nr; + //Number of Reactions involved in the process + parameter Integer Bc[Nr] "Base component of reactions"; + parameter Integer Comp; + //Number of components involved in the reaction + parameter Real Sc[NOC, Nr]; + //Stochiometry of reactions + parameter Real DO[NOC, Nr]; + //Direct order of reactions + parameter Real RO[NOC, Nr]; + //Reverse order of reactions + Real Stoic_Check[Nr]; + //Returns whether the specified stoichiometry is correct + Real HOF_comp[NOC]; + Real HOR[Nr]; + parameter Real A1[Nr] "Arrhenius constants of forward reaction"; + parameter Real E1[Nr] "Activation Energy of the forward reaction"; + parameter Real A2[Nr] "Arrhenius constants of reverse reaction"; + parameter Real E2[Nr] "Activation Energy for the reverse reaction"; +equation +//Check of stoichiometric balance + Stoic_Check = Stoichiometrycheck(Nr, NOC, comp[:].MW, Sc); +//Calculation of Heat of Reaction + HOF_comp[:] = comp[:].IGHF .* 1E-3; +//============================================================================================= + for i in 1:Nr loop + HOR[i] = sum(HOF_comp[:] .* Sc[:, i]) / Bc[i]; + end for; +end Reaction_Manager; diff --git a/Simulator/Simulator/Files/Models/ReactionManager/Stoichiometrycheck.mo b/Simulator/Simulator/Files/Models/ReactionManager/Stoichiometrycheck.mo new file mode 100644 index 0000000..7ade3f5 --- /dev/null +++ b/Simulator/Simulator/Files/Models/ReactionManager/Stoichiometrycheck.mo @@ -0,0 +1,23 @@ +within Simulator.Files.Models.ReactionManager; + +function Stoichiometrycheck + //This functions checks the stoichiometry of the reaction we have given and returns "1" as output if the stoichiometry is okay and returns 0 otherwise. + input Integer Nr "No. of Reactions"; + input Integer NOC "Nomber of components in the required reactions"; + input Real MW[NOC] "Molecular weight"; + input Real Sc[NOC, Nr] "Reaction coefficients"; + output Integer Check[Nr]; +protected + Real D[Nr] = fill(0, Nr); +algorithm + for i in 1:Nr loop + for j in 1:NOC loop + D[i] := D[i] + MW[j] * Sc[j, i]; + end for; + if D[i] <= 0.1 and D[i] >= (-0.1) then + Check[i] := 1; + else + Check[i] := 0; + end if; + end for; +end Stoichiometrycheck; diff --git a/Simulator/Simulator/Files/Models/ReactionManager/package.mo b/Simulator/Simulator/Files/Models/ReactionManager/package.mo new file mode 100644 index 0000000..49ce112 --- /dev/null +++ b/Simulator/Simulator/Files/Models/ReactionManager/package.mo @@ -0,0 +1,88 @@ +within Simulator.Files.Models; + +package ReactionManager + function Stoichiometrycheck + //This functions checks the stoichiometry of the reaction we have given and returns "1" as output if the stoichiometry is okay and returns 0 otherwise. + input Integer Nr"No. of Reactions"; + input Integer NOC"Nomber of components in the required reactions"; + input Real MW[NOC]"Molecular weight"; + input Real Sc[NOC,Nr]"Reaction coefficients"; + output Integer Check[Nr]; + + protected + Real D[Nr]=fill(0,Nr); + + algorithm + for i in 1:Nr loop + for j in 1:NOC loop + D[i]:=D[i]+(MW[j]*Sc[j,i]); + end for; + if D[i]<=0.1 and D[i]>=-0.1 then + Check[i]:=1; + else + Check[i]:=0; + end if; + end for; + end Stoichiometrycheck; + + + function Arhenious + // Reaction rate constant k = A*exp(-E/RT) + input Integer Nr ; + input Real A1[Nr] "To calulate reaction rate for forward reaction (Arrhenius constants of forward reaction)"; + input Real E1[Nr] "To calculate reaction rate for forward reaction"; + input Real T; + + output Real k1[Nr] "reaction rate constants for forward reaction"; + + algorithm + + k1 := A1 .* exp(-E1/(8.314*T)); + + + end Arhenious; + + + + model Reaction_Manager + //=================================================================================================== + import Simulator.Files.*; + import data = Simulator.Files.Chemsep_Database; + + parameter Chemsep_Database.General_Properties comp[NOC]; + + parameter Integer NOC; + parameter Integer Nr; //Number of Reactions involved in the process + parameter Integer Bc[Nr] "Base component of reactions"; + parameter Integer Comp; +//Number of components involved in the reaction + + parameter Real Sc[NOC,Nr]; //Stochiometry of reactions + parameter Real DO[NOC,Nr]; //Direct order of reactions + parameter Real RO[NOC,Nr]; //Reverse order of reactions + Real Stoic_Check[Nr]; + +//Returns whether the specified stoichiometry is correct + + Real HOF_comp[NOC]; + Real HOR[Nr]; + + parameter Real A1[Nr]"Arrhenius constants of forward reaction"; + parameter Real E1[Nr]"Activation Energy of the forward reaction"; + parameter Real A2[Nr]"Arrhenius constants of reverse reaction"; + parameter Real E2[Nr]"Activation Energy for the reverse reaction"; + + equation + +//Check of stoichiometric balance + Stoic_Check = Stoichiometrycheck(Nr, NOC, comp[:].MW, Sc); +//Calculation of Heat of Reaction + HOF_comp[:] = comp[:].IGHF .* 1E-3; +//============================================================================================= + for i in 1:Nr loop + HOR[i] = (sum(HOF_comp[:] .* Sc[:, i]))/Bc[i]; + end for; + end Reaction_Manager; + +//============================================================================================== +end ReactionManager; diff --git a/Simulator/Simulator/Files/Models/ReactionManager/package.order b/Simulator/Simulator/Files/Models/ReactionManager/package.order new file mode 100644 index 0000000..45bd766 --- /dev/null +++ b/Simulator/Simulator/Files/Models/ReactionManager/package.order @@ -0,0 +1,3 @@ +Stoichiometrycheck +Arhenious +Reaction_Manager diff --git a/Simulator/Simulator/Files/Models/gammaNRTL.mo b/Simulator/Simulator/Files/Models/gammaNRTL.mo new file mode 100644 index 0000000..24ed514 --- /dev/null +++ b/Simulator/Simulator/Files/Models/gammaNRTL.mo @@ -0,0 +1,31 @@ +within Simulator.Files.Models; + +model gammaNRTL + // input Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + parameter Integer NOC; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + Real molFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), T(min = 0, start = 273.15); + Real gamma[NOC](each start = 1); + Real tau[NOC, NOC], G[NOC, NOC], alpha[NOC, NOC], A[NOC, NOC], BIPS[NOC, NOC, 2]; + Real sum1[NOC](each start = 1), sum2[NOC](each start = 1); + constant Real R = 1.98721; +equation + BIPS = Simulator.Files.Thermodynamic_Functions.BIPNRTL(NOC, comp.CAS); + A = BIPS[:, :, 1]; + alpha = BIPS[:, :, 2]; + tau = A ./ (R * T); +// G = exp(-alpha .* tau);//this equation is giving error in OM 1.11 hence for loop used + for i in 1:NOC loop + for j in 1:NOC loop + G[i, j] = exp(-alpha[i, j] * tau[i, j]); + end for; + end for; +//G = {{1, 1.1574891705 }, {0.8455436959, 1}}; + for i in 1:NOC loop + sum1[i] = sum(molFrac[:] .* G[:, i]); + sum2[i] = sum(molFrac[:] .* tau[:, i] .* G[:, i]); + end for; + for i in 1:NOC loop + log(gamma[i]) = sum(molFrac[:] .* tau[:, i] .* G[:, i]) / sum(molFrac[:] .* G[:, i]) + sum(molFrac[:] .* G[i, :] ./ sum1[:] .* (tau[i, :] .- sum2[:] ./ sum1[:])); + end for; +end gammaNRTL; diff --git a/Simulator/Simulator/Files/Models/package.mo b/Simulator/Simulator/Files/Models/package.mo new file mode 100644 index 0000000..e4a1dd5 --- /dev/null +++ b/Simulator/Simulator/Files/Models/package.mo @@ -0,0 +1,96 @@ +within Simulator.Files; + +package Models + model Flash + //this is basic flash model. comp and NOC has to be defined in model. thermodyanamic model must also be extended along with this model for K value. + import Simulator.Files.*; + Real totMolFlo[3](each min = 0, each start = 100), compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), compMolSpHeat[3, NOC], compMolEnth[3, NOC], compMolEntr[3, NOC], phasMolSpHeat[3], phasMolEnth[3], phasMolEntr[3], liqPhasMolFrac(min = 0, max = 1, start = 0.5), vapPhasMolFrac(min = 0, max = 1, start = 0.5), P(min = 0, start = 101325), T(min = 0, start = 298.15); + Real Pbubl(start = 101325, min = 0)"Bubble point pressure", Pdew(start = 101325, min = 0)"dew point pressure"; + equation +//Mole Balance + totMolFlo[1] = totMolFlo[2] + totMolFlo[3]; + compMolFrac[1, :] .* totMolFlo[1] = compMolFrac[2, :] .* totMolFlo[2] + compMolFrac[3, :] .* totMolFlo[3]; + + //Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); + //Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); + if P >= Pbubl then + compMolFrac[3, :] = zeros(NOC); + // sum(compMolFrac[2, :]) = 1; + totMolFlo[3] = 0; + elseif P >= Pdew then + //VLE region + for i in 1:NOC loop + // compMolFrac[3, i] = K[i] * compMolFrac[2, i]; + compMolFrac[2, i] = compMolFrac[1, i] ./ (1 + vapPhasMolFrac * (K[i] - 1)); + end for; + sum(compMolFrac[2, :]) = 1; + //sum y = 1 + else + //above dew point region + compMolFrac[2, :] = zeros(NOC); + // sum(compMolFrac[3, :]) = 1; + totMolFlo[2] = 0; + end if; + //Energy Balance + for i in 1:NOC loop +//Specific Heat and Enthalpy calculation + compMolSpHeat[2, i] = Thermodynamic_Functions.LiqCpId(comp[i].LiqCp, T); + compMolSpHeat[3, i] = Thermodynamic_Functions.VapCpId(comp[i].VapCp, T); + compMolEnth[2, i] = Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + compMolEnth[3, i] = Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + (compMolEntr[2, i], compMolEntr[3, i]) = Thermodynamic_Functions.SId(comp[i].AS, comp[i].VapCp, comp[i].HOV, comp[i].Tb, comp[i].Tc, T, P, compMolFrac[2, i], compMolFrac[3, i]); + end for; + for i in 2:3 loop + phasMolSpHeat[i] = sum(compMolFrac[i, :] .* compMolSpHeat[i, :]) + resMolSpHeat[i]; + phasMolEnth[i] = sum(compMolFrac[i, :] .* compMolEnth[i, :]) + resMolEnth[i]; + phasMolEntr[i] = sum(compMolFrac[i, :] .* compMolEntr[i, :]) + resMolEntr[i]; + end for; + phasMolSpHeat[1] = liqPhasMolFrac * phasMolSpHeat[2] + vapPhasMolFrac * phasMolSpHeat[3]; + compMolSpHeat[1, :] = compMolFrac[1, :] .* phasMolSpHeat[1]; + phasMolEnth[1] = liqPhasMolFrac * phasMolEnth[2] + vapPhasMolFrac * phasMolEnth[3]; + compMolEnth[1, :] = compMolFrac[1, :] .* phasMolEnth[1]; + phasMolEntr[1] = liqPhasMolFrac * phasMolEntr[2] + vapPhasMolFrac * phasMolEntr[3]; + compMolEntr[1, :] = compMolFrac[1, :] * phasMolEntr[1]; +//phase molar fractions + liqPhasMolFrac = totMolFlo[2] / totMolFlo[1]; + vapPhasMolFrac = totMolFlo[3] / totMolFlo[1]; + end Flash; + + + + + + + model gammaNRTL + // input Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + parameter Integer NOC; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + Real molFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), T(min =0, start = 273.15); + Real gamma[NOC](each start = 1); + Real tau[NOC, NOC], G[NOC, NOC], alpha[NOC, NOC], A[NOC, NOC], BIPS[NOC, NOC, 2]; + Real sum1[NOC](each start = 1), sum2[NOC](each start = 1); + constant Real R = 1.98721; + equation + BIPS = Simulator.Files.Thermodynamic_Functions.BIPNRTL(NOC, comp.CAS); + A = BIPS[:, :, 1]; + alpha = BIPS[:, :, 2]; + tau = A ./ (R * T); + // G = exp(-alpha .* tau);//this equation is giving error in OM 1.11 hence for loop used + for i in 1:NOC loop + for j in 1:NOC loop + G[i, j] = exp(-alpha[i, j] * tau[i, j]); + end for; + end for; + //G = {{1, 1.1574891705 }, {0.8455436959, 1}}; + for i in 1:NOC loop + sum1[i] = sum(molFrac[:] .* G[:, i]); + sum2[i] = sum(molFrac[:] .* tau[:, i] .* G[:, i]); + end for; + for i in 1:NOC loop + log(gamma[i]) = sum(molFrac[:] .* tau[:, i] .* G[:, i]) / sum(molFrac[:] .* G[:, i]) + sum(molFrac[:] .* G[i, :] ./ sum1[:] .* (tau[i, :] .- sum2[:] ./ sum1[:])); + end for; + end gammaNRTL; + +end Models; diff --git a/Simulator/Simulator/Files/Models/package.order b/Simulator/Simulator/Files/Models/package.order new file mode 100644 index 0000000..e3b45ea --- /dev/null +++ b/Simulator/Simulator/Files/Models/package.order @@ -0,0 +1,3 @@ +Flash +gammaNRTL +ReactionManager diff --git a/Simulator/Simulator/Files/Other_Functions/colBoolCalc.mo b/Simulator/Simulator/Files/Other_Functions/colBoolCalc.mo new file mode 100644 index 0000000..de4b5b4 --- /dev/null +++ b/Simulator/Simulator/Files/Other_Functions/colBoolCalc.mo @@ -0,0 +1,12 @@ +within Simulator.Files.Other_Functions; + +function colBoolCalc + //column boolean calculator + input Integer noOfStages, noOfExCons, exConStages[noOfExCons]; + output Boolean bool[noOfStages]; +algorithm + bool := fill(false, noOfStages); + for i in 1:noOfExCons loop + bool[exConStages[i]] := true; + end for; +end colBoolCalc; diff --git a/Simulator/Simulator/Files/Other_Functions/package.mo b/Simulator/Simulator/Files/Other_Functions/package.mo new file mode 100644 index 0000000..5dfe8e6 --- /dev/null +++ b/Simulator/Simulator/Files/Other_Functions/package.mo @@ -0,0 +1,15 @@ +within Simulator.Files; + +package Other_Functions +function colBoolCalc//column boolean calculator + input Integer noOfStages, noOfExCons, exConStages[noOfExCons]; + output Boolean bool[noOfStages]; + + algorithm + bool := fill(false, noOfStages); + for i in 1:noOfExCons loop + bool[exConStages[i]] := true; + end for; + end colBoolCalc; + +end Other_Functions; diff --git a/Simulator/Simulator/Files/Other_Functions/package.order b/Simulator/Simulator/Files/Other_Functions/package.order new file mode 100644 index 0000000..292facd --- /dev/null +++ b/Simulator/Simulator/Files/Other_Functions/package.order @@ -0,0 +1 @@ +colBoolCalc diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/BIPNRTL.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/BIPNRTL.mo new file mode 100644 index 0000000..185ae32 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/BIPNRTL.mo @@ -0,0 +1,41 @@ +within Simulator.Files.Thermodynamic_Functions; + +function BIPNRTL + input Integer NOC; + input String CAS[NOC]; + output Real value[NOC, NOC, 2]; +protected + constant String underscore = "_"; + String c[NOC, NOC]; + String d[NOC, NOC]; + constant String CAS1_CAS2[352] = {"67-56-1_56-23-5", "67-56-1_75-25-2", "67-66-3_67-56-1", "75-09-2_67-56-1", "67-56-1_75-12-7", "151-67-7_67-56-1", "75-01-4_67-56-1", "67-56-1_75-05-8", "67-56-1_107-06-2", "67-56-1_64-19-7", "107-31-3_67-56-1", "67-56-1_64-17-5", "67-56-1_67-68-5", "124-40-3_67-56-1", "67-64-1_67-56-1", "123-38-6_67-56-1", "75-56-9_67-56-1", "79-20-9_67-56-1", "67-56-1_79-09-4", "67-56-1_68-12-2", "67-56-1_71-23-8", "109-87-5_67-56-1", "67-56-1_110-02-1", "106-99-0_67-56-1", "67-56-1_96-33-3", "115-11-7_67-56-1", "67-56-1_78-93-3", "67-56-1_109-99-9", "67-56-1_123-91-1", "67-56-1_141-78-6", "67-56-1_126-33-0", "106-97-8_67-56-1", "67-56-1_71-36-3", "67-56-1_78-92-2", "60-29-7_67-56-1", "67-56-1_110-63-4", "67-56-1_110-86-1", "542-92-7_67-56-1", "78-79-5_67-56-1", "1574-41-0_67-56-1", "2004-70-8_67-56-1", "67-56-1_80-62-6", "513-35-9_67-56-1", "67-56-1_563-80-4", "67-56-1_110-89-4", "1634-04-4_67-56-1", "67-56-1_392-56-3", "67-56-1_108-90-7", "67-56-1_71-43-2", "67-56-1_62-53-3", "67-56-1_109-06-8", "67-56-1_108-99-6", "67-56-1_108-89-4", "67-56-1_110-83-8", "67-56-1_110-82-7", "592-41-6_67-56-1", "67-56-1_123-86-4", "67-56-1_110-54-3", "67-56-1_121-44-8", "67-56-1_108-88-3", "67-56-1_108-48-5", "67-56-1_592-76-7", "67-56-1_108-87-2", "67-56-1_142-82-5", "67-56-1_100-41-4", "67-56-1_108-38-3", "67-56-1_106-42-3", "67-56-1_111-66-0", "67-56-1_111-65-9", "67-56-1_540-84-1", "56-23-5_67-56-1", "67-66-3_64-17-5", "75-09-2_64-17-5", "64-17-5_127-18-4", "64-17-5_75-05-8", "64-17-5_107-06-2", "64-17-5_64-19-7", "64-17-5_107-21-1", "124-40-3_64-17-5", "67-64-1_64-17-5", "79-20-9_64-17-5", "64-17-5_67-63-0", "64-17-5_110-02-1", "108-05-4_64-17-5", "64-17-5_78-93-3", "109-99-9_64-17-5", "64-17-5_123-91-1", "141-78-6_64-17-5", "64-17-5_126-33-0", "64-17-5_78-92-2", "60-29-7_64-17-5", "64-17-5_78-83-1", "109-73-9_64-17-5", "64-17-5_110-86-1", "78-79-5_64-17-5", "64-17-5_80-62-6", "513-35-9_64-17-5", "64-17-5_563-80-4", "64-17-5_109-60-4", "78-78-4_64-17-5", "109-66-0_64-17-5", "64-17-5_123-51-3", "64-17-5_108-86-1", "64-17-5_108-90-7", "64-17-5_71-43-2", "64-17-5_62-53-3", "64-17-5_108-99-6", "64-17-5_110-82-7", "592-41-6_64-17-5", "64-17-5_108-93-0", "64-17-5_123-86-4", "110-54-3_64-17-5", "64-17-5_111-43-3", "64-17-5_121-44-8", "64-17-5_108-88-3", "64-17-5_100-66-3", "64-17-5_108-48-5", "64-17-5_628-63-7", "64-17-5_142-82-5", "64-17-5_100-41-4", "64-17-5_106-42-3", "64-17-5_111-65-9", "64-17-5_540-84-1", "64-17-5_544-76-3", "64-17-5_112-80-1", "56-23-5_71-23-8", "71-23-8_127-18-4", "79-01-6_71-23-8", "107-06-2_71-23-8", "71-23-8_64-19-7", "124-40-3_71-23-8", "71-23-8_79-09-4", "67-63-0_71-23-8", "71-23-8_109-86-4", "107-10-8_71-23-8", "71-23-8_79-41-4", "78-93-3_71-23-8", "109-99-9_71-23-8", "109-69-3_71-23-8", "71-23-8_78-83-1", "109-73-9_71-23-8", "71-23-8_110-86-1", "71-23-8_80-62-6", "71-23-8_109-60-4", "71-23-8_123-51-3", "392-56-3_71-23-8", "71-23-8_108-90-7", "71-43-2_71-23-8", "71-23-8_109-06-8", "71-23-8_108-99-6", "71-23-8_108-89-4", "110-82-7_71-23-8", "110-54-3_71-23-8", "71-23-8_142-84-7", "121-44-8_71-23-8", "71-23-8_107-46-0", "71-23-8_108-88-3", "71-23-8_108-48-5", "71-23-8_142-82-5", "71-23-8_100-41-4", "71-23-8_111-65-9", "71-23-8_124-18-5", "71-23-8_112-30-1", "67-56-1_7732-18-5", "67-56-1_67-66-3", "67-56-1_64-17-5", "67-56-1_67-64-1", "67-56-1_71-43-2", "67-56-1_110-82-7", "67-56-1_108-88-3", "67-56-1_142-82-5", "7732-18-5_67-64-1", "7732-18-5_78-93-3", "7732-18-5_108-95-2", "64-17-5_7732-18-5", "64-17-5_67-66-3", "64-17-5_67-64-1", "64-17-5_78-93-3", "64-17-5_71-43-2", "64-17-5_110-82-7", "64-17-5_108-88-3", "64-17-5_142-82-5", "64-17-5_106-42-3", "67-64-1_67-66-3", "67-64-1_71-43-2", "67-64-1_108-95-2", "67-64-1_110-82-7", "67-64-1_108-88-3", "78-93-3_71-43-2", "78-93-3_110-82-7", "78-93-3_108-88-3", "78-93-3_142-82-5", "71-43-2_67-66-3", "71-43-2_108-95-2", "71-43-2_108-88-3", "71-43-2_106-42-3", "108-88-3_67-66-3", "108-88-3_106-42-3", "108-87-2_108-95-2", "7732-18-5_79-34-5", "109-87-5_7732-18-5", "107-10-8_7732-18-5", "78-93-3_7732-18-5", "78-84-2_7732-18-5", "109-99-9_7732-18-5", "7732-18-5_123-91-1", "141-78-6_7732-18-5", "7732-18-5_126-33-0", "7732-18-5_127-19-5", "7732-18-5_110-91-8", "7732-18-5_71-36-3", "78-83-1_7732-18-5", "75-65-0_7732-18-5", "60-29-7_7732-18-5", "7732-18-5_110-63-4", "7732-18-5_513-85-9", "7732-18-5_111-46-6", "109-73-9_7732-18-5", "109-89-7_7732-18-5", "7732-18-5_98-01-1", "7732-18-5_110-86-1", "7732-18-5_120-94-5", "7732-18-5_123-51-3", "7732-18-5_75-85-4", "7732-18-5_108-95-2", "7732-18-5_62-53-3", "7732-18-5_109-06-8", "7732-18-5_108-99-6", "7732-18-5_108-89-4", "7732-18-5_100-63-0", "7732-18-5_108-94-1", "7732-18-5_141-79-7", "7732-18-5_108-93-0", "7732-18-5_123-86-4", "7732-18-5_123-42-2", "108-20-3_7732-18-5", "7732-18-5_111-27-3", "7732-18-5_626-93-7", "7732-18-5_111-76-2", "121-44-8_7732-18-5", "7732-18-5_100-51-6", "7732-18-5_108-48-5", "7732-18-5_123-92-2", "7732-18-5_98-86-2", "7732-18-5_91-22-5", "7732-18-5_98-82-8", "56-23-5_71-43-2", "71-43-2_75-25-2", "67-66-3_71-43-2", "74-88-4_71-43-2", "71-43-2_75-52-5", "75-15-0_71-43-2", "76-13-1_71-43-2", "71-43-2_127-18-4", "71-43-2_79-01-6", "71-43-2_76-01-7", "71-43-2_79-34-5", "71-55-6_71-43-2", "71-43-2_106-93-4", "71-43-2_107-06-2", "75-03-6_71-43-2", "71-43-2_123-39-7", "71-43-2_79-24-3", "71-43-2_67-68-5", "71-43-2_107-15-3", "71-43-2_68-12-2", "71-43-2_108-03-2", "71-43-2_79-46-9", "71-43-2_110-02-1", "109-73-9_71-43-2", "75-64-9_71-43-2", "109-89-7_71-43-2", "71-43-2_110-86-1", "71-43-2_392-56-3", "71-43-2_106-46-7", "71-43-2_108-86-1", "71-43-2_108-90-7", "71-43-2_462-06-6", "71-43-2_98-95-3", "71-43-2_62-53-3", "71-43-2_108-91-8", "71-43-2_121-44-8", "71-43-2_100-47-0", "71-43-2_108-88-3", "71-43-2_100-60-7", "71-43-2_100-42-5", "71-43-2_100-41-4", "71-43-2_108-38-3", "71-43-2_106-42-3", "71-43-2_91-66-7", "71-43-2_98-82-8", "71-43-2_103-65-1", "71-43-2_92-06-8", "56-23-5_108-88-3", "67-66-3_108-88-3", "75-15-0_108-88-3", "79-01-6_108-88-3", "75-05-8_108-88-3", "624-83-9_108-88-3", "107-06-2_108-88-3", "108-88-3_79-24-3", "108-88-3_67-68-5", "108-88-3_107-15-3", "107-12-0_108-88-3", "108-88-3_68-12-2", "110-02-1_108-88-3", "108-88-3_126-33-0", "109-89-7_108-88-3", "108-88-3_110-86-1", "392-56-3_108-88-3", "108-88-3_108-86-1", "108-88-3_108-90-7", "462-06-6_108-88-3", "108-88-3_98-95-3", "108-88-3_109-06-8", "108-88-3_108-99-6", "108-88-3_100-47-0", "108-88-3_100-41-4", "108-88-3_106-42-3", "107-13-1_100-42-5", "100-41-4_100-42-5", "100-42-5_103-65-1", "56-23-5_100-41-4", "75-05-8_100-41-4", "107-13-1_100-41-4", "109-89-7_100-41-4", "108-90-7_100-41-4", "100-41-4_98-95-3", "100-41-4_62-53-3", "100-41-4_98-82-8", "100-41-4_104-51-8", "56-23-5_108-38-3", "108-38-3_68-12-2", "110-86-1_108-38-3", "108-38-3_62-53-3", "106-42-3_108-38-3", "107-06-2_95-47-6", "107-15-3_95-47-6", "95-47-6_68-12-2", "56-23-5_106-42-3", "75-05-8_106-42-3", "107-06-2_106-42-3", "106-42-3_68-12-2", "392-56-3_106-42-3", "108-90-7_106-42-3", "106-42-3_62-53-3", "56-23-5_98-82-8", "103-65-1_98-95-3", "95-63-6_526-73-8", "104-51-8_98-95-3", "99-87-6_62-53-3", "91-57-6_90-12-0"}; + constant Real BI_Values[352, 3] = {{378.8254, 1430.7379, 0.2892}, {879.0968, 1063.6098, 0.6381}, {1414.2712, -141.8030, 0.2949}, {1560.0282, 441.3372, 0.6234}, {617.5847, -153.4695, 0.3003}, {9870.3530, -6982.8569, 0.187e-1}, {1789.7165, -34.9448, 0.2912}, {343.7042, 314.5879, 0.2981}, {348.6035, 1020.1431, 0.2921}, {16.6465, -217.1261, 0.3051}, {584.5720, 298.5567, 0.2962}, {-327.9991, 376.2667, 0.3057}, {-168.3182, -497.4171, 0.3079}, {-1018.1430, -54.3882, 0.3134}, {184.2662, 226.5580, 0.3009}, {1046.6524, -865.2660, 0.3084}, {924.8499, -61.1796, 0.2986}, {381.4559, 346.5360, 0.2965}, {-50.1450, -78.0859, 0.3056}, {-124.0904, 0.3428, 09.1633}, {24.9003, 9.5349, 0.3011}, {608.9115, 712.0226, 0.7259}, {-90.1051, 1217.1035, 0.2976}, {1353.0599, 610.8292, 0.4670}, {676.8360, 169.9831, 0.2958}, {1333.6000, 556.3608, 0.3697}, {307.4271, 217.9098, 0.3003}, {169.4153, 383.1579, 0.3002}, {607.4050, 76.7683, 0.2985}, {345.5416, 420.7355, 0.2962}, {1069.2756, 906.5741, 0.7182}, {1440.1498, 1053.7716, 0.4647}, {793.8173, -486.3299, 0.2483}, {-308.5610, 285.4420, 0.3036}, {705.9989, 211.1580, 0.2953}, {446.9520, -450.5858, 0.3152}, {-45.0888, 84.1956, 0.3027}, {1541.9324, 736.0352, 0.4515}, {1445.6425, 543.5270, 0.4260}, {1545.3339, 799.1289, 0.4753}, {1514.2761, 782.1729, 0.4657}, {590.2790, 380.8401, 0.2963}, {1355.6853, 660.9164, 0.3381}, {642.3761, -6.2901, 0.2987}, {590.8820, -1169.7242, 0.1387}, {851.4954, 465.8360, 0.8178}, {930.5910, 1244.1303, 0.4701}, {857.0852, 1348.0903, 0.4707}, {721.6136, 1158.5131, 0.4694}, {407.7440, 117.2473, 0.3008}, {226.0820, -385.6823, 0.3095}, {-163.4505, -86.1482, 0.3075}, {304.2242, -452.3483, 0.3053}, {1178.5792, 1618.9792, 0.4568}, {1315.1631, 1497.2135, 0.4222}, {1222.6032, 1145.1085, 0.4402}, {328.2162, 453.0017, 0.2961}, {1619.3829, 1622.2911, 0.4365}, {-476.8503, 1126.1143, 0.2874}, {939.7275, 1090.9297, 0.4643}, {-273.3320, 59.6250, 0.3051}, {1313.5497, 1143.9059, 0.4163}, {1444.5850, 1719.4586, 0.4397}, {1500.2043, 1519.3346, 0.4277}, {1080.1231, 1038.1572, 0.4251}, {991.1609, 822.1357, 0.2910}, {974.6545, 851.1070, 0.2921}, {1456.3583, 1147.8132, 0.4396}, {1681.6918, 1511.4353, 0.4381}, {1447.0909, 1386.4703, 0.4313}, {1339.9000, 488.6648, 0.4622}, {1438.3602, -327.5518, 0.3023}, {1332.8036, -153.0761, 0.3057}, {685.8542, 807.5935, 0.2900}, {529.7267, 338.1632, 0.2964}, {333.3502, 939.3870, 0.2926}, {-34.1971, -190.7763, 0.3050}, {1644.0484, -203.7691, 0.3704}, {-1224.5739, 370.7683, 0.3105}, {36.2965, 434.8228, 0.2987}, {188.3139, 158.0118, 0.3013}, {690.1392, -529.3472, 0.3125}, {222.3096, 1057.7115, 0.2918}, {505.1637, 320.7403, 0.2959}, {64.4957, 463.1931, 0.3010}, {661.3708, -200.6915, 0.3015}, {505.5637, 111.8389, 0.2988}, {305.6041, 330.5105, 0.2988}, {1195.1601, 705.0897, 0.5676}, {-559.8205, 802.5411, 0.2721}, {763.6707, 71.1984, 0.2946}, {53.1671, 82.0442, 0.3023}, {-612.3956, -5.7834, 0.3062}, {163.6655, -169.9802, 0.3017}, {1402.5377, 653.4866, 0.5056}, {456.9676, 386.5893, 0.2963}, {1412.7516, 674.7726, 0.4569}, {-54.0946, 639.6806, 0.3009}, {760.4933, 129.3970, 0.2950}, {1610.2811, 935.1426, 0.4960}, {1183.3812, 412.7546, 0.2886}, {51.1705, -42.8613, 0.3009}, {820.8023, 1349.6853, 0.4995}, {645.7829, 1383.7110, 0.5229}, {516.1410, 1065.9086, 0.4774}, {1823.3542, -523.0474, 0.3005}, {315.6078, -339.0825, 0.3056}, {876.7933, 1390.4162, 0.4485}, {1399.1806, 949.7239, 0.5011}, {1719.8644, -833.8389, 0.2920}, {841.9935, -55.3231, 0.2958}, {1218.1065, 575.2985, 0.2882}, {442.6124, 634.1687, 0.2945}, {-248.0407, 697.9004, 0.2996}, {713.5653, 1147.8607, 0.5292}, {3458.4788, -1438.8884, 0.1704}, {-48.2159, -19.6212, 0.3016}, {552.3897, 266.1248, 0.2964}, {1137.2650, 1453.5947, 0.4786}, {801.7191, 1006.8831, 0.4962}, {768.3633, 760.0800, 0.2914}, {1206.8097, 1385.3721, 0.4717}, {1091.0432, 1500.6711, 0.4738}, {2359.4082, 1509.2033, 0.4448}, {975.6816, -343.5446, 0.2988}, {1537.6384, 537.2439, 0.6310}, {608.3777, 646.0412, 0.2913}, {926.6139, 196.0696, 0.3007}, {636.9927, 364.0596, 0.2956}, {256.8999, -327.5173, 0.3044}, {81.4870, -703.3731, 0.2697}, {-189.7856, -32.4657, 0.3070}, {167.2501, -175.2928, 0.3057}, {-406.3767, 830.8897, 0.3013}, {-602.9687, -45.3543, 0.3061}, {276.6356, -423.9162, 0.3025}, {148.8670, 213.3829, 0.3016}, {562.4611, -302.2498, 0.3003}, {1201.9959, 506.8982, 0.5468}, {-2.8139, -13.8657, 0.3034}, {-698.9510, 34.7593, 0.3001}, {374.8691, -412.2861, 0.3110}, {504.0900, 125.6451, 0.2993}, {340.0210, 111.7437, 0.3005}, {12.2207, -31.8303, 0.3033}, {922.5224, 528.5894, 0.2937}, {456.2867, 538.5114, 0.2946}, {874.2419, 285.7774, 0.2899}, {529.6444, -608.3163, 0.3054}, {479.7439, -540.4699, 0.3045}, {523.8291, -603.0924, 0.3084}, {1707.7883, 353.2705, 0.5914}, {1092.1470, 480.6740, 0.2940}, {617.3558, -459.5845, 0.2892}, {991.6157, -435.2018, 0.3067}, {1615.0711, -498.3638, 0.1028}, {25.6220, 922.0009, 0.175e-1}, {472.9353, -545.1853, 0.2960}, {1198.9720, 1377.2975, 0.5193}, {563.6173, 475.5966, 0.2921}, {1109.3040, 334.2112, 0.2907}, {945.3159, 520.2926, 0.2895}, {1068.0694, -588.3325, 0.2958}, {-189.0469, 792.8020, 0.2999}, {-105.4657, 1335.3416, 0.2873}, {67.2902, -70.5092, 0.3009}, {296.2432, 118.0803, 0.3003}, {761.7553, 1094.8556, 0.4893}, {1313.9316, 1862.4639, 0.4410}, {884.0230, 1008.0037, 0.4064}, {1566.4390, 1598.3126, 0.4408}, {1324.9767, 814.1435, 0.5663}, {653.9718, 1883.6007, 0.3607}, {2419.3354, 1844.3794, 0.6308}, {-57.9601, 1241.7396, 0.2937}, {-285.3881, 1289.2198, 0.2909}, {375.3497, 45.3706, 0.3006}, {437.1923, 33.6363, 0.3022}, {255.3591, 1047.1959, 0.2970}, {761.7739, 1393.7993, 0.4376}, {542.4128, 772.4394, 0.2937}, {1114.2947, 1305.9242, 0.4758}, {1020.8405, 889.3461, 0.6180}, {-651.1909, 301.8389, 0.3054}, {-396.4935, 886.5703, 0.2971}, {-754.9547, -280.3830, 0.3086}, {429.8705, 727.6490, 0.2925}, {-247.9492, 727.5102, 0.2950}, {-644.8573, 898.3999, 0.1563}, {605.7381, 235.4493, 0.2963}, {503.0737, -181.5533, 0.2996}, {681.5104, 931.4616, 0.9809}, {-227.3671, -86.1025, 0.3062}, {373.4202, 318.1885, 0.2986}, {60.1980, -51.0865, 0.3019}, {-50.2635, 14.2180, 0.3056}, {-583.6169, 629.2214, 0.2974}, {226.4602, -241.7457, 0.2874}, {2587.8730, -439.4469, 0.2836}, {2435.8879, 102.7658, 0.972e-1}, {1608.0700, 1818.2947, 0.4898}, {-455.9152, 1301.6396, 0.2981}, {674.4614, 1809.8868, 0.3536}, {1166.8333, 1090.0262, 0.2862}, {915.7450, 1725.0977, 0.4522}, {715.9592, 548.8965, 0.2920}, {1285.9880, 1606.0820, 0.4393}, {1160.1372, 467.9008, 0.5573}, {75.5965, 328.8977, 0.3009}, {-803.1654, 1732.7268, 0.2954}, {2633.6951, 504.0381, 0.4447}, {639.8173, 2491.0163, 0.4385}, {471.7718, 2030.8877, 0.5155}, {1544.0251, 2086.4776, 0.3792}, {1310.8994, 1920.1402, 0.5778}, {2531.7402, -758.0034, 0.3020}, {1186.7304, -99.9000, 0.2974}, {160.3429, 2104.4002, 0.6379}, {-169.1652, 1372.3121, 0.2932}, {2602.6374, 436.9686, 0.3950}, {1835.0881, 419.8087, 0.6802}, {-239.6197, 573.8298, 0.3055}, {3633.5330, -494.8389, 0.2816}, {19947.2334, -15910.4563, 0.56e-2}, {2385.3714, 282.6970, 0.4942}, {11965.5274, -7391.5468, 0.235e-1}, {1979.5492, 197.0009, 0.6371}, {2559.3708, 418.7524, 0.5361}, {2325.9141, 162.3029, 0.5622}, {1473.9606, -66.4169, 0.811e-1}, {2983.8991, -171.6660, 0.2673}, {2121.4973, 101.3068, 0.1504}, {2232.9727, 641.3504, 0.4399}, {3805.0038, 918.2419, 0.2951}, {1323.2731, 845.9826, 0.6780}, {2665.1471, 4202.0746, 0.5409}, {2991.1845, -464.8054, 0.1563}, {1880.1699, 489.1746, 0.2938}, {1914.0077, 220.0262, 0.4776}, {-5096.5280, 28437.1380, 0.381e-1}, {4689.8409, 301.3998, 0.3168}, {2222.5960, 831.9908, 0.5706}, {1874.8967, 856.9565, 0.3734}, {725.1364, 858.8268, 00.}, {11675.1604, -3887.1802, 0.902e-1}, {2986.1161, -84.8485, 0.860e-1}, {-4.9421, 84.0212, 0.3055}, {893.4167, -566.9011, 0.2551}, {176.8791, -288.2136, 0.3061}, {294.4424, -185.2944, 0.3013}, {273.5119, 524.9030, 0.2961}, {161.2943, 431.5524, 0.3008}, {-53.1528, 551.9630, 0.3013}, {-94.1122, 288.6566, 0.3023}, {140.5075, -127.4605, 0.3064}, {-225.8274, 197.7460, 0.3030}, {-73.7504, -250.7743, 0.3055}, {-73.4845, 97.5682, 0.3038}, {-100.9240, 300.0048, 0.3046}, {58.8289, -39.5526, 0.3035}, {394.5891, 298.1172, 0.3004}, {1512.9737, 639.2332, 0.5231}, {527.2886, -57.1531, 0.3004}, {810.5440, 408.5646, 0.6691}, {490.0693, 560.0207, 0.2957}, {736.7867, -251.4046, 0.3074}, {-157.3069, 595.6615, 0.3012}, {1088.4773, -446.4137, 0.3068}, {-347.2708, 503.5971, 0.3045}, {65.9717, 67.1231, 0.3024}, {-344.6666, 757.9930, 0.3067}, {52.3512, -42.2029, 0.2813}, {541.0855, -319.8327, 0.2795}, {1085.4557, -715.7662, 0.2989}, {1441.9721, -865.5699, 0.2830}, {1538.3464, -819.5924, 0.3214}, {700.4097, -450.6274, 0.3251}, {277.6641, -292.2391, 0.3040}, {1311.3264, -523.3212, 0.3110}, {776.8671, -178.3464, 0.2990}, {717.4228, -684.6315, 0.2908}, {130.6061, -27.3294, 0.3037}, {1390.4880, -636.1853, 0.2851}, {111.1157, -121.2437, 0.3033}, {52.3967, 94.0417, 0.3020}, {-643.5999, 970.4264, 0.3110}, {-70.8372, 57.0902, 0.3034}, {-454.1872, 615.2806, 0.2878}, {-50.2635, 14.2180, 0.3056}, {85.2080, 104.9548, 0.3019}, {1915.7178, -810.5032, 0.3693}, {-192.1433, 141.5054, 0.3032}, {64.1947, 78.6570, 0.3022}, {-69.6810, 95.3839, 0.3041}, {629.2214, -583.6169, 0.2974}, {-591.6879, 1052.8580, 0.2439}, {185.3799, -250.7688, 0.3062}, {790.7250, 724.0955, 0.9353}, {-167.8974, 104.6027, 0.3029}, {-217.7768, 251.5704, 0.3097}, {537.4434, 21.7626, 0.3011}, {1063.2839, 192.0041, 0.2898}, {432.7908, 592.5054, 0.2969}, {-95.6685, 717.0741, 0.3009}, {-2260.2463, 3666.1775, 0.711e-1}, {510.1471, -197.5696, 0.3015}, {5175.2573, 224.8869, 0.4600}, {91.4853, -153.9388, 05.1012}, {264.6428, -60.3423, 0.2992}, {668.6525, -666.7128, 0.2414}, {-47.4722, 15.0630, 0.3049}, {-40.5158, 15.0972, 0.3037}, {386.4643, -304.6112, 0.3083}, {806.4313, -288.9774, 0.2969}, {396.5492, -97.1224, 0.3028}, {-490.8706, 1036.9557, 0.2963}, {-676.6725, 1239.9195, 0.3000}, {663.0837, -482.5109, 0.3005}, {226.4602, -241.7457, 0.2874}, {598.0263, -130.4323, 0.3023}, {-539.7919, 813.9959, 0.3466}, {649.8687, -453.4673, 0.3067}, {-172.3762, 122.4657, 0.3034}, {1102.5396, 5.3234, 0.2980}, {1304.6073, -338.2481, 0.2994}, {928.9662, -553.9006, 0.3457}, {357.7079, -307.8057, 0.3076}, {519.4154, -64.0219, 0.3003}, {243.6463, 384.0030, 0.2989}, {26.2560, -27.6358, 0.3043}, {-789.9294, 957.1492, 0.3026}, {-232.4578, 163.8924, 0.3047}, {308.9034, 548.6670, 0.2960}, {-78.8985, 351.0029, 0.3009}, {-259.4169, 1034.4099, 0.2992}, {282.0248, -254.9358, 0.3085}, {718.2538, -479.1971, 0.2870}, {1357.7269, -110.2727, 0.1967}, {559.7795, 332.8093, 0.2947}, {-192.9687, 121.7193, 0.3044}, {1413.0042, -210.0314, 0.2938}, {848.1184, -557.9036, 0.2733}, {153.1239, 722.4999, 0.2942}, {1004.5491, -949.1003, 0.2906}, {-395.6312, 359.7555, 0.3055}, {311.9792, 408.2084, 0.2972}, {-106.8166, 13.4903, 0.3033}, {329.7212, 143.3943, 0.3007}, {878.2759, -655.9008, 0.3261}, {370.6529, 140.0817, 0.3003}, {-118.3505, 885.1196, 0.2950}, {-615.6730, 811.3338, 0.3353}}; +algorithm + for i in 1:NOC loop + for j in 1:NOC loop + for k in 1:2 loop + value[i, j, k] := 0; + end for; + end for; + end for; + for i in 1:NOC loop + for j in 1:NOC loop + c[i, j] := CAS[i] + underscore + CAS[j]; + d[i, j] := CAS[j] + underscore + CAS[i]; + for k in 1:352 loop + if c[i, j] == CAS1_CAS2[k] then + value[i, j, 1] := BI_Values[k, 1]; + value[j, i, 1] := BI_Values[k, 2]; + value[i, j, 2] := BI_Values[k, 3]; + value[j, i, 2] := BI_Values[k, 3]; + end if; + if d[i, j] == CAS1_CAS2[k] then + value[j, i, 1] := BI_Values[k, 1]; + value[i, j, 1] := BI_Values[k, 2]; + value[i, j, 2] := BI_Values[k, 3]; + value[j, i, 2] := BI_Values[k, 3]; + end if; + end for; + end for; + end for; +end BIPNRTL; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/BIP_PR.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/BIP_PR.mo new file mode 100644 index 0000000..d47fb3e --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/BIP_PR.mo @@ -0,0 +1,26 @@ +within Simulator.Files.Thermodynamic_Functions; + +function BIP_PR + input Integer Nc; + input String comp[Nc]; + output Real kij[Nc, Nc]; +protected + String name; + String nameRev; + constant String Comp1_Comp2[179] = {"Heliumfour_Carbonmonoxide", "Hydrogen_Nitrogen", "Hydrogen_Carbonmonoxide", "Hydrogen_Methane", "Hydrogen_Ethylene", "Hydrogen_Ethane", "Hydrogen_Carbondioxide", "Hydrogen_Propylene", "Hydrogen_Propane", "Hydrogen_Nbutane", "Hydrogen_Nhexane", "Hydrogen_Nheptane", "Hydrogen_Toluene", "Hydrogen_Quinoline", "Hydrogen_Bicyclohexyl", "Hydrogen_Onemethylnaphthalene", "Nitrogen_Carbonmonoxide", "Nitrogen_Argon", "Nitrogen_Oxygen", "Nitrogen_Methane", "Nitrogen_Ethylene", "Nitrogen_Ethane", "Nitrogen_Nitrousoxide", "Nitrogen_Carbondioxide", "Nitrogen_Hydrogensulfide", "Nitrogen_Propylene", "Nitrogen_Propane", "Nitrogen_Ammonia", "Nitrogen_Dichlorodiflouromethane", "Nitrogen_Isobutane", "Nitrogen_Sulfurdioxide", "Nitrogen_Nbutane", "Nitrogen_Isoc5", "Nitrogen_Npentane", "Nitrogen_Methanol", "Nitrogen_Nhexane", "Nitrogen_Benzene", "Nitrogen_Nheptane", "Nitrogen_Noctane", "Nitrogen_Ndecane", "Carbonmonoxide_Methane", "Carbonmonoxide_Ethane", "Carbonmonoxide_Hydrogensulfide", "Carbonmonoxide_Propane", "Argon_Oxygen", "Argon_Methane", "Argon_Ammonia", "Oxygen_Krypton", "Oxygen_Nitrousoxide", "Methane_Ethylene", "Methane_Ethane", "Methane_Nitrousoxide", "Methane_Carbondioxide", "Methane_Carbonylsulfide", "Methane_Propylene", "Methane_Propane", "Methane_Isobutane", "Methane_Sulfurdioxide", "Methane_Nbutane", "Methane_Isoc5", "Methane_Npentane", "Methane_Nhexane", "Methane_Benzene", "Methane_Cyclohexane", "Methane_Nheptane", "Methane_Toluene", "Methane_Noctane", "Methane_Mxylene", "Methane_Nnonane", "Methane_Ndecane", "Methane_Mcresol", "Methane_Tetralin", "Methane_Onemethylnaphthalene", "Methane_Diphenylmethane", "Ethylene_Ethane", "Ethylene_Acetylene", "Ethylene_Carbondioxide", "Ethylene_Nbutane", "Ethylene_Benzene", "Ethylene_Nheptane", "Ethylene_Ndecane", "Carbondioxide_Ethane", "Ethane_Hydrogensulfide", "Ethane_Propylene", "Ethane_Propane", "Ethane_Isobutane", "Ethane_Nbutane", "Ethane_Ethylether", "Ethane_Npentane", "Ethane_Acetone", "Ethane_Methylacetate", "Ethane_Methanol", "Ethane_Nhexane", "Ethane_Benzene", "Ethane_Cyclohexane", "Ethane_Nheptane", "Ethane_Noctane", "Ethane_Ndecane", "Carbondioxide_Nitrousoxidedioxide", "Acetylene_Propylene", "Trifluoromethane_Triflourochloromethane", "Trifluorochloromethane_Dichlorodifluoromethane", "Carbondioxide_Hydrogensulfide", "Carbondioxide_Difluoromethane", "Carbondioxide_Propylene", "Carbondioxide_Propane", "Carbondioxide_Isobutane", "Carbondioxide_Onebutene", "Carbondioxide_Nbutane", "Carbondioxide_Isoc5", "Carbondioxide_Ethylether", "Carbondioxide_Npentane", "Carbondioxide_Methylacetate", "Carbondioxide_Methanol", "Carbondioxide_Nhexane", "Carbondioxide_Benzene", "Carbondioxide_Cyclohexane", "Carbondioxide_Nheptane", "Carbondioxide_Water", "Carbondioxide_Toluene", "Carbondioxide_Ndecane", "Carbondioxide_Nbutylbenzene", "Hydrogensulfide_Propane", "Hydrogensulfide_Isobutane", "Hydrogensulfide_Npentane", "Hydrogensulfide_Water", "Hydrogensulfide_Ndecane", "Propylene_Propane", "Propylene_Isobutane", "Propylene_Onecfour", "Propane_Isobutane", "Propane_Nbutane", "Propane_Isopentane", "Propane_Npentane", "Propane_Nhexane", "Propane_Ethanol", "Propane_Benzene", "Propane_Nheptane", "Propane_Noctane", "Propane_Ndecane", "Pentaflourohloroethane_Difluorochloromethane", "Difluorochloromethane_Dichlorodifluoromethane", "Ammonia_Water", "Ammonia_Watert=two7three.one5k", "Isobutane_Nbutane", "Sulfurdioxide_Benzene", "Onebutene_One", "Onebutene_Nbutane", "One_Threebutadiene", "Nbutane_Npentane", "Nbutane_Nhexane", "Nbutane_Nheptane", "Nbutane_Noctane", "Nbutane_Ndecane", "Npentane_Benzene", "Npentane_Cyclohexane", "Npentane_Nheptane", "Npentane_Noctane", "Two_Twodimethylbutane", "Two_Threedimethylbutane", "Twomethylpentane_Onepentanol", "Onepentanol_Threemethylpentane", "Methanol_Water", "Nhexane_Benzene", "Nhexane_Cyclohexane", "Nhexane_Twopropanol", "Nhexane_Nheptane", "Nhexane_Isopentanol", "Nhexane_Onepentanol", "Cyclohexane_Benzene", "Benzene_Nheptane", "Benzene_Isooctane", "Benzene_Noctane", "Cyclohexene_Cyclohexane", "Cyclohexane_One", "Cyclohexane_Cyclohexanone", "One_Twodichloroethane", "Nheptane_Isooctane", "Nheptane_Twopentanone"}; + constant Real BI_Val[size(Comp1_Comp2, 1)] = {1, 7.1100E-02, 9.1900E-02, 2.6300E-02, 6.3300E-02, -7.5600E-02, 0, 0, 0, 0, -3.00E-02, 0, -1, -1, -1, 0, 3.300E-02, -2.6000E-03, -1.5900E-02, 2.8900E-02, 8.5600E-02, 3.4400E-02, 4.4000E-03, -2.2200E-02, 0, 9.00E-02, 8.7800E-02, 0, 1.0700E-02, 0, 8.00E-02, 7.1100E-02, 9.2200E-02, 0, 0, 0, 0, 0, 0, 0, 3.00E-02, -2.2600E-02, 5.4400E-02, 2.5900E-02, 1.0700E-02, 2.300E-02, 0, 2.5600E-02, 4.7800E-02, 3.7800E-02, -3.3000E-03, 2.5600E-02, 7.9300E-02, 2.8900E-02, 3.300E-02, 1.1900E-02, 2.5600E-02, 0, 2.4400E-02, -5.6000E-03, 2.300E-02, 4.00E-02, 8.0700E-02, 3.8900E-02, 4.0100E-02, 9.700E-02, 4.9600E-02, 8.4400E-02, 4.7400E-02, 4.8900E-02, 0, 0, 0, 8.7400E-02, 1.1900E-02, 6.5200E-02, 5.7800E-02, 9.2200E-02, 3.1100E-02, 1.4400E-02, 2.5300E-02, 0, 8.2200E-02, 8.9000E-03, 1.1000E-03, -6.7000E-03, 8.9000E-03, 1.8100E-02, 7.8000E-03, 0, 0, 2.700E-02, -4.00E-02, 3.2200E-02, 1.7800E-02, 7.4000E-03, 1.8500E-02, 1.4400E-02, 4.8000E-03, 0, 0, 3.3700E-02, 9.7800E-02, 1.700E-02, 9.3300E-02, 0, 0, 5.9300E-02, 0, 0, 4.700E-02, -1.00E-02, -4.9300E-02, 2.200E-02, 0, 7.7400E-02, 0, 0, 6.3000E-03, 0, 0, 0, 6.00E-02, 4.7400E-02, 6.300E-02, 3.9400E-02, 3.3300E-02, 9.6000E-03, -1.4400E-02, 4.0000E-04, -7.8000E-03, 3.3000E-03, 1.1100E-02, 2.6700E-02, 7.0000E-04, 3.1500E-02, 2.3300E-02, 5.6000E-03, 0, 0, 8.7400E-02, 5.2200E-02, 0, 0, -4.0000E-04, 1.5000E-03, 2.2000E-03, 7.0000E-04, 1.4100E-02, 1.7400E-02, -5.6000E-03, 3.3000E-03, 7.4000E-03, 7.8000E-03, 1.8900E-02, 3.7000E-03, 7.4000E-03, 0, 4.5200E-02, 4.6700E-02, 4.6700E-02, 4.7800E-02, -7.7800E-02, 8.9000E-03, -3.000E-03, 8.4400E-02, -7.8000E-03, 4.8500E-02, 4.5600E-02, 1.2600E-02, 1.1000E-03, 4.0000E-04, 3.000E-03, 1.1000E-03, 7.300E-02, 6.5900E-02, 4.300E-02, 4.0000E-04, 6.9300E-02}; +algorithm + for i in 1:Nc loop + for j in 1:Nc loop + name := comp[i] + "_" + comp[j]; + nameRev := comp[j] + "_" + comp[i]; + if i == j then + kij[i, j] := 0; + elseif FindString(Comp1_Comp2, name) == (-1) then + kij[i, j] := BI_Val[index(Comp1_Comp2, nameRev)]; + else + kij[i, j] := BI_Val[index(Comp1_Comp2, name)]; + end if; + end for; + end for; +end BIP_PR; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/BIP_UNIQUAC.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/BIP_UNIQUAC.mo new file mode 100644 index 0000000..43ccbb2 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/BIP_UNIQUAC.mo @@ -0,0 +1,36 @@ +within Simulator.Files.Thermodynamic_Functions; + +function BIP_UNIQUAC + input Integer NOC; + input String Comp[NOC]; + output Real value[NOC, NOC]; + constant String underscore = "_"; + String c[NOC, NOC]; + String d[NOC, NOC]; + constant String Comp1_Comp2[440] = {"Butane_Methanol", "Pentane_Ethanol", "Twomethylbutane_Ethanol", "Hexane_Ethanol", "Hexane_Onepropanol", "Cyclohexane_Onepropanol", "Methylcyclohexane_Phenol", "Isobutylene_Methanol", "Twomethyltwobutene_Methanol", "Twomethyltwobutene_Ethanol", "Onehexene_Methanol", "Onehexene_Ethanol", "Onethreebutadiene_Methanol", "Onethreepentadiene_Methanol", "Transonethreepentadiene_Methanol", "Isoprene_Methanol", "Isoprene_Ethanol", "Cyclopentadiene_Methanol", "Benzene_Chloroform", "Benzene_Phenol", "Benzene_Toluene", "Benzene_Pxylene", "Benzene_Onepropanol", "Toluene_Chloroform", "Toluene_Pxylene", "Acetaldehyde_Water", "Propionicaldehyde_Water", "Propionicaldehyde_Methanol", "Isobutyraldehyde_Water", "Acetone_Chloroform", "Acetone_Benzene", "Acetone_Phenol", "Acetone_Cyclohexane", "Acetone_Toluene", "Acetone_Ethanol", "Twobutanone_Benzene", "Twobutanone_Cyclohexane", "Twobutanone_Toluene", "Twobutanone_Nheptane", "Twobutanone_Water", "Twobutanone_Onepropanol", "Methanol_Water", "Methanol_Chloroform", "Methanol_Ethanol", "Methanol_Acetone", "Methanol_Benzene", "Methanol_Cyclohexane", "Methanol_Toluene", "Methanol_Nheptane", "Methanol_Tetrachloromethane", "Methanol_Tribromomethane", "Methanol_Acetonitrile", "Methanol_Onetwodichloroethane", "Methanol_Aceticacid", "Methanol_Dimethylsulfoxide", "Methanol_Propionicacid", "Methanol_Nndimethylformamide", "Methanol_Propanol", "Methanol_Thiophene", "Methanol_Methylacrylate", "Methanol_Twobutanone", "Methanol_Tetrahyrofuran", "Methanol_Onefourdioxane", "Methanol_Ethylacetate", "Methanol_Sulfolane", "Methanol_Onebutanol", "Methanol_Twobutanol", "Methanol_Tertbutanol", "Methanol_Onefourbutanediol", "Methanol_Pyridine", "Methanol_Methylmethacrylate", "Methanol_Methylisopropylketone", "Methanol_Threepentanone", "Methanol_Piperidine", "Methanol_Hexafluorobenzene", "Methanol_Chlorobenzene", "Methanol_Aniline", "Methanol_Twomethylpyridine", "Methanol_Threemethylpyridine", "Methanol_Fourmethylpyridine", "Methanol_Cyclohexene", "Methanol_Nbutylacetate", "Methanol_Hexane", "Methanol_Triethylamine", "Methanol_Twomethylphenol", "Methanol_Two6dimethylpyridine", "Methanol_Oneheptane", "Methanol_Methylcyclohexane", "Methanol_Heptane", "Methanol_Ethylbenzene", "Methanol_Mxylene", "Methanol_Pxylene", "Methanol_Oneoctene", "Methanol_Octane", "Methanol_Twotwofourtrimethylpentane", "Methanol_Onedodecanol", "Methanol_Oleic acid", "Ethanol_Water", "Ethanol_Chloroform", "Ethanol_Acetone", "Ethanol_Twobutanone", "Ethanol_Benzene", "Ethanol_Cyclohexane", "Ethanol_Toluene", "Ethanol_Nheptane", "Ethanol_Pxylene", "Ethanol_Tetrachloroethylene", "Ethanol_Acetonitrile", "Ethanol_Onetwodichloroethane", "Ethanol_Acetic acid", "Ethanol_Onetwoethanediol", "Ethanol_Twopropanol", "Ethanol_Onetwopropanediol", "Ethanol_Thiophene", "Ethanol_Onefourdioxane", "Ethanol_Sulfolane", "Ethanol_Morpholine", "Ethanol_Twobutanol", "Ethanol_Twomethylonepropanol", "Ethanol_Pyridine", "Ethanol_Methylmethacrylate", "Ethanol_Methylisopropyl", "Ethanol_Propylacetate", "Ethanol_Threemethylonebutanol", "Ethanol_Bromobenzene", "Ethanol_Chlorobezene", "Ethanol_Aniline", "Ethanol_Twomethylpyridine", "Ethanol_Threemethylpyridine", "Ethanol_Cyclohexanol", "Ethanol_Butylacetate", "Ethanol_Dipropylether", "Ethanol_Triethylamine", "Ethanol_Anisole", "Ethanol_Two6dimethylpyridine", "Ethanol_Pentylacetate", "Ethanol_Heptane", "Ethanol_Ethylbezene", "Ethanol_Octane", "Ethanol_Twotwofourtrimethylpentane", "Ethanol_Hexadecane", "Ethanol_Oleicacid", "Onepropanol_Water", "Onepropanol_Tetrachloroethylene", "Onepropanol_Aceticacid", "Onepropanol_Propionicacid", "Onepropanol_Twomethoxyethanol", "Propylamine_Onepropanol", "Onepropanol_Methacrylicacid", "Onepropanol_Twomethylonepropanol", "Onepropanol_Pyridine", "Onepropanol_Methylmethacrylate", "Onepropnaol_Propylacetate", "Onepropanol_Threemethylbutanol", "Onepropnaol_Chlorobenzene", "Onepropanol_Twomethylpyridine", "Onepropanol_Threemethylpyridine", "Onepropanol_Fourmethylpyridine", "Onepropanol_Propylpropionate", "Onepropanol_Dipropylamine", "Onepropanol_Hexamethyldisiloxane", "Onepropanol_Toluene", "Onepropnaol_Two6dimethylpyridine", "Onepropanol_Heptane", "Onepropanol_Pxylene", "Onepropanol_Octane", "Onepropanol_Decane", "Onepropanol_Onedecanol", "Twopropanol_Water", "Twopropanol_Onepropanol", "Isobutanol_Water", "Tertbutanol_Water", "Allylalcohol_Water", "Methylformate_Methanol", "Methylacetate_Water", "Methylacetate_Methanol", "Methylacetate_Ethanol", "Ethylacetate_Water", "Ethylacetate_Ethanol", "Vinylacetate_Ethanol", "Diethylether_Water", "Diethylether_Methanol", "Diethylether_Ethanol", "Diisopropylether_Water", "Methyltertbutylether_Methanol", "Dimethoxymethane_Water", "Dimethoxymethane_Methanol", "Ethyleneoxide_Water", "Propyleneoxide_Methanol", "Tetrahydrofuran_Water", "Tetrahydrofuran_Ethanol", "Tetrahydrofuran_Onepropanol", "Tetrachloromethane_Methanol", "Tertachloromethane_Onepropanol", "Vinylcloride_Methanol", "Dichloromethane_Methanol", "Dichloromethane_Ethanol", "Chloroform_Methanol", "Chloroform_Ethanol", "Onetwodichloroethane_Onepropanol", "Trichloroethylene_Onepropanol", "Threechloroonepropene_Water", "Butylchloride_Onepropanol", "Dimethylamine_Water", "Dimethylamine_Methanol", "Dimethylamine_Ethanol", "Dimethylamine_Onepropanol", "Ethylamine_Water", "Triethylamine_Water", "Triethylamine_Onepropanol", "Diethylamine_Water", "Diethylamine_Ethanol", "Propylamine_Water", "Nbutylamine_Water", "Butylamine_Ethanol", "Butylamine_Onepropanol", "Isopropylamine_Water", "Acetonitrile_Water", "Propionitrile_Water", "Acrylonitrile_Water", "Hexafluorobenzene_Onepropnaol", "Water_Acetone", "Water_Twobutanone", "Water_Phenol", "Water_Aceticacid", "Water_Nmethylformamide", "Water_Dimethylsulfoxide", "Water_Ethylenediamine", "Water_Acrylicacid", "Water_Propionicacid", "Water_Onethreefivetrioxane", "Water_Nndimethylformamide", "Water_Onefourdioxane", "Water_Sulfolane", "Water_Nndimethylacetamide", "Water_Morpholine", "Water_Nbutanol", "Water_Onefourbutanediol", "Water_Twothreebutanediol", "Water_Diethylenegylcol", "Water_Furfural", "Water_Pyridine", "Water_Nmethylpyrrolidone", "Water_Threemethylbutanol", "Water_Twomethyltwobutanol", "Water_Aniline", "Water_Twomethylpyridine", "Water_Threemethylpyridine", "Water_Fourmethylpyridine", "Water_Phenylhydrazine", "Water_Cyclohexanone", "Water_Mesityloxide", "Water_Cyclohexanol", "Water_Nbutylacetate", "Water_Diacetonealcohol", "Water_Onehexanol", "Water_Twohexanol", "Water_Twobutoxyethanol", "Water_Benzylalcohol", "Water_Two6dimethylpyridinr", "Water_Isopentylacetate", "Water_Acetophenone", "Water_Quinoline", "Water_Isopropylbenzene", "Halothane_Methanol", "Methanol_Formamide", "Methane_Acetone", "Methane_Propane", "Methane_Nbutane", "Methane_Npentane", "Methane_Benzene", "Methane_Nhexane", "Methane_Ndecane", "Ethane_Nheptane", "Ibutane_Nbutane", "Npentane_Acetone", "Nhexane_Nitroethane", "Nhexane_Aniline", "Nhexane_Methylcyclop", "Nhexane_Toluene", "Nheptane_Benzene", "Nheptane_Toluene", "Noctane_Nitroethane", "Noctane_Ipropanol", "Twotwofourtrimethylpentane_Nitroethane", "Twotwofourtrimethylpentane_Furfural", "Twotwofourtrimethylpentane_Benzene", "Twotwofourtrimethylpentane_Cyclohexane", "Twotwofourtrimethylpentane_Toluene", "Ndecane_Npropanol", "Ndecane_Nbutanol", "Ndecane_Ipropanol", "Cyclopentane_Benzene", "Methylcyclopentane_Benzene", "Methylcyclopentane_Toluene", "Cyclohexane_Nitromethan", "Cyclohexane_Npropanol", "Cyclohexane_Nbutanol", "Cyclohexane_Benzene", "Cyclohexane_Methylcyclop", "Cyclohexane_Nhexane", "Cyclohexane_Toluene", "Cyclohexane_Heptane", "Methylcyclohexane_Toluene", "Onebutene_Ibutane", "Onebutene_Propane", "Onebutene_Nbutane", "Benzene_Twobutanone", "Benzene_Nbutanol", "Benzene_Nhexane", "Benzene_Water", "Toluene_Furfural", "Hydrogen_Methanol", "Hydrogen_Acetone", "Hydrogen_Benzene", "Hydrogen_Nhexane", "Hydrogen_Mxylene", "Hydrogen_Noctane", "Hydrogen_Water", "Hydrogen_Ammonia", "Nitrogen_Nbutane", "Nitrogen_Nhexane", "Nitrogen_Water", "Nitrogen_Ammonia", "Carbonmonoxide_Methanol", "Carbonmonoxide_Acetone", "Carbonmonoxide_Benzene", "Carbonmonoxide_Noctane", "Acetaldehyde_Aceticacid", "Acetaldehyde_Vinylacetat", "Acetone_Carbontetra", "Acetone_Acetonitrile", "Acetone_Methanol", "Acetone_Aceticacid", "Acetone_Furfural", "Acetone_Nhexane", "Acetone_Water", "Acetone_Vinylacetat", "Methanol_Carbontetra", "Methanol_Ipropanol", "Methanol_Ethylacetat", "Methanol_Diethylamin", "Methanol_Methylisobut", "Methanol_Nhexane", "Methanol_Two.threedimethyl", "Methanol_Triethylamin", "Methanol_Anisole", "Ethanol_One.twodichloro", "Ethanol_Aceticacid", "Ethanol_Npropanol", "Ethanol_Tertbutanol", "Ethanol_Methylcyclop", "Ethanol_Nhexane", "Ethanol_Methylcyclo", "Ethanol_Noctane", "Ethanol_Twotwofourtrimethyl", "Ethanol_Ndecane", "Npropanol_Carbontetra", "Npropanol_Aceticacid", "Npropanol_Benzene", "Npropanol_Nhexane", "Npropanol_Toluene", "Npropanol_Nheptane", "Npropanol_Water", "Ipropanol_Ethylacetat", "Ipropanol_Benzene", "Ipropanol_Nheptane", "Ipropanol_Water", "Ipropanol_Twotwofourtrimethyl", "Nbutanol_Carbontetra", "Nbutanol_Aceticacid", "Nbutanol_Nhexane", "Nbutanol_Nheptane", "Nbutanol_Noctane", "Ibutanol_Benzene", "Secbutanol_Benzene", "Tertbutanol_Benzene", "Formicacid_Aceticacid", "Aceticacid_Toluene", "Aceticacid_Nheptane", "Propionicacid_Methylisobut", "Propionicacid_Noctane", "Methylacetate_Chloroform", "Methylacetate_Benzene", "Ethylacetate_Aceticacid", "Ethylacetate_Npropanol", "Ethylacetate_Furfural", "Ethylacetate_Benzene", "Ethylacetate_Toluene", "Ethylacetate_Ethylbenzen", "Vinylacetate_Aceticacid", "Vinylacetate_Water", "Dioxane_Benzene", "Carbontetrachloride_Acetonitrile", "Carbontetrachloride_Ethanol", "Carbontetrachloride_Furfural", "Carbontetrachloride_Benzene", "Carbontetrachloride_Cyclohexane", "Carbontetrachloride_Methylcyclop", "Carbontetrachloride_Toluene", "Carbontetrachloride_Nheptane", "Dichloromethane_Dichloroetan", "Chloroform_Carbontetra", "Chloroform_Formicacid", "Chloroform_Aceticacid", "Chloroform_Ethylacetate", "Chloroform_Benzene", "Nitromethane_Carbontetra", "Nitromethane_Benzene", "Nitroethane_Carbontetra", "Nitroethane_Npropanol", "Nitroethane_Benzene", "Onenitropropane_Carbontetra", "Onenitropropane_Benzene", "Twonitropropane_Carbontetra", "Twonitropropane_Benzene", "Twonitropropane_Nhexane", "Acetonitrile_Benzene", "Acetonitrile_Nheptane", "Acrylonitrile_Acetonitrile", "Aniline_Methylcyclop", "Furfural_Onebutene", "Furfural_Nbutane", "Furfural_Ibutane", "Furfural_Benzene", "Furfural_Cyclohexane", "Water_Formicacid", "Water_Acetonitrile", "Water_Nitroethane", "Water_Dioxane", "Water_Onebutene", "Water_Ibutane", "Water_Toluene", "Water_Acrylonitril", "Water_Cisbutenetwo", "Water_Transbutene", "Water_Isobutene", "Water_Butadiene", "Carbondisulfide_Methanol", "Carbondisulfide_Acetone"}; + constant Real BI_Values[440, 2] = {{1289.4881, 6.7114}, {938.0838, -112.7209}, {849.013, -56.7699}, {1056.8977, -135.5484}, {743.1034, -127.2476}, {1251.6417, -391.9511}, {1525.5351, -516.0584}, {1403.5125, -70.3003}, {1499.6766, -66.3796}, {983.1208, -123.8651}, {1329.9294, -21.5842}, {970.6914, -128.7022}, {1300.2481, -72.9715}, {1489.1438, -97.747}, {1477.5985, -92.9294}, {1514.3534, -144.3088}, {912.9208, -118.3758}, {1410.4509, -61.3753}, {-119.7224, -29.4499}, {72.2429, 197.453}, {70.7224, -58.3017}, {5.7397, 0.5699}, {378.6125, 20.5261}, {860.8206, -554.8868}, {121.3912, -119.706}, {-1132.16, -231.7521}, {735.9692, 208.343}, {416.3831, -377.9488}, {1263.005, -81.883}, {1566.0069, -781.5877}, {-358.9226, 604.28}, {-468.3882, 27.3851}, {-77.5361, 543.595}, {-315.279, 555.7418}, {94.5536, 117.867}, {-300.8429, 385.863}, {146.0313, 100.2596}, {366.3689, -250.2784}, {-184.485, 559.8999}, {775.153, 30.4806}, {147.6576, -8.2705}, {-337.1298, 549.2958}, {-271.0633, 1304.9835}, {-474.7791, 762.8153}, {-84.2364, 403.8524}, {-67.7213, 1117.8797}, {-32.2887, 1703.2055}, {-58.1103, 1190.6454}, {17.9144, 1360.0217}, {-95.2921, 1463.4548}, {-92.0642, 984.2538}, {101.9628, 334.9587}, {-80.7067, 1094.1304}, {-40.7254, -51.0491}, {-366.7607, 84.4189}, {7.1816, 0.3295}, {-156.3839, 103.9406}, {-26.2861, 113.5565}, {-265.3781, 1099.9741}, {-25.1614, 600.3028}, {-136.0158, 584.0634}, {-153.2518, 629.7314}, {-19.0988, 451.089}, {-138.9829, 770.3047}, {-28.6882, 675.1045}, {40.3898, 121.5049}, {471.807, -279.7321}, {-291.983, 403.6892}, {-286.6527, 490.8909}, {425.4563, -393.3415}, {-98.6602, 843.2593}, {-100.1669, 594.2312}, {-83.8392, 609.2057}, {-383.9791, 153.8253}, {-90.0876, 1245.166}, {-118.0717, 1402.7818}, {-144.7753, 517.8626}, {-603.5633, 950.103}, {-206.2407, 81.4664}, {-78.8509, -53.173}, {-38.5257, 1529.9926}, {-174.2617, 892.9417}, {38.3254, 1391.4917}, {-318.8007, 905.0708}, {-502.2428, 548.3889}, {-272.5909, 272.4921}, {-12.605, 1363.9261}, {1.0023, 1552.7297}, {-27.9877, 1578.6097}, {-57.095, 1259.4286}, {-41.7377, 1208.1529}, {-47.6694, 1231.2086}, {-32.2567, 1396.3019}, {-32.7911, 1561.8955}, {-59.6929, 1577.3145}, {18.9334, 484.2757}, {-149.1808, 952.0283}, {173.801, 109.8687}, {-305.3246, 881.3549}, {94.2417, 98.7523}, {-25.7234, 250.3958}, {-127.9893, 744.8826}, {-153.0128, 1100.3231}, {-97.5633, 698.6183}, {-150.277, 1127.5232}, {-63.9673, 664.259}, {-61.6485, 783.4873}, {392.2083, 91.3933}, {-39.1051, 669.688}, {-25.2901, -86.9343}, {818.093, -200.1567}, {437.5184, -324.6275}, {181.0206, -57.8238}, {-77.9585, 662.4746}, {50.8172, 212.2982}, {177.7675, 306.35}, {-712.473, 1116.7138}, {-311.9029, 474.5511}, {-117.4292, 220.9133}, {378.8209, -378.8991}, {-105.4041, 544.4089}, {-260.5944, 652.4019}, {-13.0186, 405.1733}, {82.3751, -18.3336}, {-169.9204, 998.8196}, {-205.6039, 1032.724}, {1262.584, -446.4834}, {139.4905, -225.4203}, {-578.9542, 942.9023}, {634.1484, -339.732}, {-38.4912, 384.6715}, {-177.4837, 780.0513}, {-305.4069, 674.3341}, {928.9185, -379.9781}, {-432.4206, 583.2958}, {-161.4264, 631.1662}, {-115.7807, 1040.2891}, {-127.6343, 841.5199}, {-152.8323, 1156.688}, {-165.9382, 1120.4853}, {-401.4408, 1783.7857}, {-180.7604, 627.9668}, {190.5947, 290.554}, {-13.5513, 473.6899}, {-729.0848, 1660.0903}, {-83.3064, -4.418}, {-300.7498, 511.0851}, {-274.4208, 15.9476}, {114.789, -169.5098}, {47.0059, -46.6524}, {423.4439, -423.9207}, {-27.435, 256.1456}, {-91.8942, 278.7259}, {-19.2402, 27.9161}, {1.3035, 311.4544}, {163.7157, -281.9383}, {199.1862, -290.3666}, {180.7309, -293.8268}, {-585.5214, 1186.3162}, {-1.1304, 48.1557}, {-218.4928, 677.0367}, {-1.7464, 340.4905}, {-595.2165, 936.7248}, {-91.2018, 743.266}, {-74.7475, 427.6292}, {-48.752, 525.9933}, {-175.9432, 744.763}, {89.4506, 31.0832}, {327.443, 64.4408}, {103.5993, -103.7179}, {350.1707, 309.5428}, {230.5098, 271.3048}, {281.7442, 47.6526}, {623.2636, -2.0107}, {830.7943, 47.5023}, {611.2312, -70.982}, {267.0169, -79.2922}, {1441.5619, -205.7336}, {436.0416, -98.562}, {483.9533, -67.6116}, {1198.9207, 102.271}, {906.3646, -157.3556}, {642.6982, -171.8091}, {1415.2748, 81.2811}, {1024.985, -203.711}, {1098.9416, -44.1418}, {657.2765, -4.6934}, {10542.2026, -344.1682}, {791.0185, -210.2403}, {835.2626, 10.5163}, {559.1539, -260.1951}, {381.8256, -244.669}, {1029.3332, -171.0842}, {957.274, -252.3762}, {7661.2894, -187.7083}, {1516.5558, -229.3734}, {796.2935, -172.0713}, {1295.4282, -271.461}, {981.7658, -335.4504}, {272.4952, 107.634}, {538.1802, -90.5235}, {1260.1312, 81.3308}, {748.22, -172.7007}, {-1070.3252, 1057.3916}, {-520.5358, -200.8021}, {-1071.4286, 1018.5371}, {-71.2521, -231.1124}, {149.3345, -412.065}, {242.4137, 2458.766}, {701.924, -371.1197}, {721.1889, -312.3228}, {-613.4553, 1006.1474}, {426.0894, -302.8076}, {-379.6694, 874.815}, {-17.1391, -220.6087}, {-188.4751, -68.9772}, {-553.685, 1001.0323}, {266.3109, 332.5988}, {367.0686, 510.5582}, {395.4004, 537.1531}, {535.7543, -38.2344}, {-110.3829, 698.7989}, {752.9217, 39.6746}, {934.8834, -501.3763}, {-251.6868, 407.0073}, {-867.7066, 2091.772}, {-292.3021, -523.6271}, {-175.0216, -724.876}, {-417.4722, 1189.9025}, {486.4688, -146.6582}, {-210.5536, 915.1339}, {639.5742, -556.8715}, {-444.013, 1302.0378}, {-397.8616, 997.3999}, {453.4841, -463.0383}, {933.6195, -802.5279}, {548.2453, 89.0444}, {-370.3689, 1635.7568}, {489.1312, -286.7611}, {-346.2827, 900.5916}, {537.7334, -36.221}, {-56.5403, -97.5005}, {-801.2765, 1402.6755}, {819.6231, -223.7898}, {-178.9352, 1021.7979}, {-91.7122, 485.3384}, {-657.2675, 1253.468}, {1280.6209, -655.1387}, {-358.5748, 333.911}, {-334.1695, 857.6208}, {316.6082, 95.0342}, {-56.9399, 1043.7692}, {-286.8493, 1023.7144}, {394.2396, 756.4163}, {-351.0861, 1188.5242}, {-9.7248, 802.6348}, {-172.0599, 1138.3704}, {-178.571, 670.1422}, {83.4921, 304.0167}, {-497.9465, 893.7955}, {-250.5667, 1438.236}, {234.4706, 641.1422}, {-847.2235, 663.5428}, {-310.5637, 1655.4649}, {1653.8373, -379.2679}, {319.3243, -34.2606}, {-0.26, 471}, {-2.01, 604}, {-2.05, 731}, {-1.32, 509}, {-0.38, 473}, {-0.06, 94}, {-0.24, 150}, {264.89, -112.61}, {1, 1}, {266.31, -22.83}, {230.64, -5.86}, {283.76, 34.82}, {-138.84, 162.13}, {34.27, 4.3}, {245.42, -135.93}, {108.24, -72.96}, {333.48, -30.98}, {1107.44, -166.18}, {236.48, 10.66}, {410.08, -4.98}, {80.91, -27.13}, {141.01, -112.66}, {141.11, -94.6}, {1137.2, -201.82}, {1430.77, -259.67}, {1074.76, -207.27}, {15.19, 33.15}, {56.47, -6.47}, {89.77, -48.05}, {517.19, 105.01}, {1284.75, -173.42}, {1393.11, -196.9}, {-32.57, 88.26}, {144.37, -118.82}, {172.73, -145.56}, {83.67, -44.04}, {-76.36, 98.22}, {210.35, -134.19}, {-23.03, 35.11}, {126.71, -98.63}, {-23.03, 35.11}, {350.47, -226.16}, {928.9, -181.24}, {-77.13, 132.43}, {2057.42, 115.13}, {74.87, 244.12}, {3.94, 218}, {3.23, 218}, {1.97, 810}, {2.99, -4}, {2.09, 765}, {-0.05, 1646}, {9.97, -880}, {0.68, 1344}, {-1.67, 814}, {0.07, 336}, {3.76, 913}, {-3.35, 2098}, {0.83, 552}, {0.48, 408}, {-1.04, 1062}, {-3.38, 1878}, {458.43, -212.77}, {-117.74, 243.51}, {-92.32, 246.68}, {-176.38, 261.53}, {359.1, -96.9}, {461.81, -262.3}, {-101.3, 195.63}, {-33.08, 261.51}, {530.99, -100.71}, {-82.48, 110.6}, {-29.64, 1127.95}, {-24.85, 31.22}, {-107.54, 579.61}, {-374.88, 676.42}, {-105.94, 688.03}, {-2.66, 1636.05}, {-7.18, 1463.9}, {-186.66, 664.29}, {-48.39, 782.28}, {-105.66, 929.71}, {-210.53, 244.67}, {210.95, -67.7}, {-2.62, 9.24}, {-118.27, 1383.93}, {-108.93, 1441.57}, {-117.57, 1340.56}, {-109.08, 1385.91}, {-120.42, 1449.61}, {-127.48, 1254.65}, {-166.93, 1336.03}, {299.33, 445.77}, {-155.1, 928.5}, {-144.11, 1326.05}, {-195.4, 818.34}, {-160.43, 1306.22}, {78.37, 583.03}, {-190.57, 522.07}, {-145.52, 854.75}, {-162.54, 1295.6}, {217.23, 11.59}, {-198.06, 994}, {-188.77, 1248.17}, {-296.3, 546.68}, {-159.24, 1370.74}, {-251.11, 1291.98}, {-236.21, 1098.91}, {-162.39, 861.06}, {784.99, -168.83}, {744.89, -165.4}, {-144.58, 241.64}, {-67.91, 298.09}, {-8.49, 342.57}, {-78.49, 136.46}, {-183.2, 556.12}, {-187.87, 121.17}, {203.46, -143.88}, {-214.39, 63.04}, {539.64, -190.31}, {-19.15, 48.52}, {233.81, -181.49}, {309.41, -214.26}, {137.11, -105.5}, {330.03, -124.12}, {1557.23, 131.36}, {363.78, -197.65}, {458.86, -40.18}, {1192.49, -135.27}, {476.85, -100.42}, {-37.52, 43.39}, {98.18, -84.82}, {161.96, -129.21}, {-168.53, 203.67}, {88.3, -59.13}, {1, 1}, {-14.74, 38.19}, {461.38, 90.36}, {346.43, -98.44}, {24.16, -119.49}, {4.98, -50.53}, {0.59, 398.4}, {73.79, 82.2}, {73.06, 295.06}, {574.22, -94.39}, {16.61, 46.05}, {-95.68, 267.13}, {535.16, -246.81}, {-134.32, 307.25}, {794.91, -344.15}, {-32.95, 252.2}, {60.28, 89.57}, {23.71, 545.79}, {183.65, -142.35}, {54.36, 228.71}, {49.12, 242.1}, {88.87, 257.71}, {97.14, 268}, {71, 12}, {41.17, 354.83}, {-508.85, 1019.29}, {122.02, 122.07}, {138.44, 920.08}, {-328.7, 927.26}, {590.17, 777.95}, {646.79, 1173.23}, {305.71, 1371.36}, {155.78, 471.21}, {356.45, -18.31}, {356.45, -18.31}, {346.74, 657.5}, {496.1, 270.6}, {1166.49, 138.15}, {157.31, 103.91}}; +algorithm + for i in 1:NOC loop + for j in 1:NOC loop + for k in 1:2 loop + value[i, j] := 0; + end for; + end for; + end for; + for i in 1:NOC loop + for j in 1:NOC loop + c[i, j] := Comp[i] + underscore + Comp[j]; + d[i, j] := Comp[j] + underscore + Comp[i]; + for k in 1:440 loop + if c[i, j] == Comp1_Comp2[k] then + value[i, j] := BI_Values[k, 1]; + value[j, i] := BI_Values[k, 2]; + end if; + if d[i, j] == Comp1_Comp2[k] then + value[j, i] := BI_Values[k, 1]; + value[i, j] := BI_Values[k, 2]; + end if; + end for; + end for; + end for; +end BIP_UNIQUAC; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/Dens.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/Dens.mo new file mode 100644 index 0000000..2a04124 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/Dens.mo @@ -0,0 +1,23 @@ +within Simulator.Files.Thermodynamic_Functions; + +function Dens + //This function is developed by swaroop katta + //this function calculates density of pure componets as a function of temperature using chemsep database. + input Real LiqDen[6], TC, T, P; + output Real density "units kmol/m3"; +protected + Real Tr; +protected + parameter Real R = 8.314 "gas constant"; +algorithm + Tr := T / TC; + if T < TC then + if LiqDen[1] == 105 then + density := LiqDen[2] / LiqDen[3] ^ (1 + (1 - T / LiqDen[4]) ^ LiqDen[5]) * 1000; + elseif LiqDen[1] == 106 then + density := LiqDen[2] * (1 - Tr) ^ (LiqDen[3] + LiqDen[4] * Tr + LiqDen[5] * Tr ^ 2 + LiqDen[6] * Tr ^ 3) * 1000; + end if; + else + density := P / (R * T * 1000); + end if; +end Dens; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/Density_Racket.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/Density_Racket.mo new file mode 100644 index 0000000..b70f014 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/Density_Racket.mo @@ -0,0 +1,48 @@ +within Simulator.Files.Thermodynamic_Functions; + +function Density_Racket + input Integer NOC; + input Real T; + input Real P; + input Real Pc[NOC]; + input Real Tc[NOC]; + input Real Racketparam[NOC]; + input Real AF[NOC]; + input Real MW[NOC]; + input Real Psat[NOC]; + output Real Density[NOC]; + parameter Real R = 83.14; +protected + Real Tr[NOC], Pcm[NOC], temp[NOC], tempcor[NOC], a, b, c[NOC], d, e[NOC], Beta[NOC], f, g, h, j, k, Racketparam_new[NOC]; +algorithm + for i in 1:NOC loop + Pcm[i] := Pc[i] / 100000; + Tr[i] := T / Tc[i]; + if Tr[i] > 0.99 then + Tr[i] := 0.5; + end if; + if Racketparam[i] == 0 then + Racketparam_new[i] := 0.29056 - 0.08775 * AF[i]; + else + Racketparam_new[i] := Racketparam[i]; + end if; + temp[i] := R * (Tc[i] / Pcm[i]) * Racketparam_new[i] ^ (1 + (1 - Tr[i]) ^ (2 / 7)); + if T < Tc[i] then + a := -9.070217; + b := 62.45326; + d := -135.1102; + f := 4.79594; + g := 0.250047; + h := 1.14188; + j := 0.0861488; + k := 0.0344483; + e[NOC] := exp(f + g * AF[i] + h * AF[i] * AF[i]); + c[NOC] := j + k * AF[i]; + Beta[i] := Pc[i] * ((-1) + a * (1 - Tr[i]) ^ (1 / 3) + b * (1 - Tr[i]) ^ (2 / 3) + d * (1 - Tr[i]) + e[i] * (1 - Tr[i]) ^ (4 / 3)); + tempcor[i] := temp[i] * (1 - c[i] * log((Beta[i] + P) / (Beta[i] + Psat[i]))); + Density[i] := 0.001 * MW[i] / (tempcor[i] * 0.000001); + else + Density[i] := 0.001 * MW[i] / (temp[i] * 0.000001); + end if; + end for; +end Density_Racket; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_Constant1V.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_Constant1V.mo new file mode 100644 index 0000000..b5cdb4e --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_Constant1V.mo @@ -0,0 +1,15 @@ +within Simulator.Files.Thermodynamic_Functions; + +function EOS_Constant1V + input Integer NOC; + input Real compMolFrac[NOC]; + input Real a_ij[NOC, NOC]; + output Real amv; +protected + Real amvv[NOC]; +algorithm + for i in 1:NOC loop + amvv[i] := sum(compMolFrac[i] .* compMolFrac[:] .* a_ij[i, :]); + end for; + amv := sum(amvv[:]); +end EOS_Constant1V; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_ConstantII.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_ConstantII.mo new file mode 100644 index 0000000..20b5dea --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_ConstantII.mo @@ -0,0 +1,13 @@ +within Simulator.Files.Thermodynamic_Functions; + +function EOS_ConstantII + parameter Real R_gas = 8.314; + input Integer NOC; + input Real Tc[NOC], Pc[NOC]; + input Real T; + output Real b[NOC]; +algorithm + for i in 1:NOC loop + b[i] := 0.08664 * R_gas * (Tc[i] / Pc[i]); + end for; +end EOS_ConstantII; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_ConstantIII.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_ConstantIII.mo new file mode 100644 index 0000000..b3b663f --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_ConstantIII.mo @@ -0,0 +1,11 @@ +within Simulator.Files.Thermodynamic_Functions; + +function EOS_ConstantIII + input Integer NOC; + input Real a[NOC]; + output Real a_ij[NOC, NOC]; +algorithm + for i in 1:NOC loop + a_ij[i, :] := (a[i] .* a[:]) .^ 0.5; + end for; +end EOS_ConstantIII; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_Constants.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_Constants.mo new file mode 100644 index 0000000..801ee88 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/EOS_Constants.mo @@ -0,0 +1,13 @@ +within Simulator.Files.Thermodynamic_Functions; + +function EOS_Constants + parameter Real R_gas = 8.314; + input Integer NOC; + input Real Tc[NOC], Pc[NOC]; + input Real T; + output Real a[NOC]; +algorithm + for i in 1:NOC loop + a[i] := 0.42748 * R_gas ^ 2 * (Tc[i] ^ 2.5 / (Pc[i] * T ^ 0.5)); + end for; +end EOS_Constants; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/FindString.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/FindString.mo new file mode 100644 index 0000000..ede8f34 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/FindString.mo @@ -0,0 +1,18 @@ +within Simulator.Files.Thermodynamic_Functions; + +function FindString + input String compound_array[:]; + input String compound; + output Integer int; +protected + Integer i, len = size(compound_array, 1); +algorithm + int := -1; + i := 1; + while int == (-1) and i <= len loop + if compound_array[i] == compound then + int := i; + end if; + i := i + 1; + end while; +end FindString; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/HLiqId.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/HLiqId.mo new file mode 100644 index 0000000..f0a39ac --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/HLiqId.mo @@ -0,0 +1,13 @@ +within Simulator.Files.Thermodynamic_Functions; + +function HLiqId + /* Calculates Enthalpy of Ideal Liquid*/ + input Real SH(unit = "J/kmol") "from chemsep database std. Heat of formation"; + input Real VapCp[6] "from chemsep database"; + input Real HOV[6] "from chemsep database"; + input Real Tc "critical temp, from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real Ent(unit = "J/mol") "Molar Enthalpy"; +algorithm + Ent := HVapId(SH, VapCp, HOV, Tc, T) - Thermodynamic_Functions.HV(HOV, Tc, T); +end HLiqId; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/HV.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/HV.mo new file mode 100644 index 0000000..61eab5b --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/HV.mo @@ -0,0 +1,17 @@ +within Simulator.Files.Thermodynamic_Functions; + +function HV + /*Returns Heat of Vaporization*/ + input Real HOV[6] "from chemsep database"; + input Real Tc(unit = "K") "Critical Temperature"; + input Real T(unit = "K") "Temperature"; + output Real Hv(unit = "J/mol") "Heat of Vaporization"; +protected + Real Tr = T / Tc; +algorithm + if T < Tc then + Hv := HOV[2] * (1 - Tr) ^ (HOV[3] + HOV[4] * Tr + HOV[5] * Tr ^ 2 + HOV[6] * Tr ^ 3) / 1000; + else + Hv := 0; + end if; +end HV; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/HVapId.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/HVapId.mo new file mode 100644 index 0000000..a801044 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/HVapId.mo @@ -0,0 +1,19 @@ +within Simulator.Files.Thermodynamic_Functions; + +function HVapId + /* Calculates enthalpy of ideal vapor */ + input Real SH(unit = "J/kmol") "from chemsep database std. Heat of formation"; + input Real VapCp[6] "from chemsep database"; + input Real HOV[6] "from chemsep database"; + input Real Tc "critical temp, from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real Ent(unit = "J/mol") "Molar Enthalpy"; +protected + Integer n = 100; + Real Cp[n - 1]; +algorithm + for i in 1:n - 1 loop + Cp[i] := VapCpId(VapCp, 298.15 + i * (T - 298.15) / n); + end for; + Ent := (T - 298.15) * (VapCpId(VapCp, T) / 2 + sum(Cp[:]) + VapCpId(VapCp, 298.15) / 2) / n; +end HVapId; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/LiqCpId.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/LiqCpId.mo new file mode 100644 index 0000000..7fbc1b7 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/LiqCpId.mo @@ -0,0 +1,10 @@ +within Simulator.Files.Thermodynamic_Functions; + +function LiqCpId + /*Calculates specific heat of liquid at given Temperature*/ + input Real LiqCp[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real Cp(unit = "J/mol") "Specific heat of liquid"; +algorithm + Cp := (LiqCp[2] + exp(LiqCp[3] / T + LiqCp[4] + LiqCp[5] * T + LiqCp[6] * T ^ 2)) / 1000; +end LiqCpId; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/Liquid_Fugacity_Coeffcient.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/Liquid_Fugacity_Coeffcient.mo new file mode 100644 index 0000000..c79956f --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/Liquid_Fugacity_Coeffcient.mo @@ -0,0 +1,71 @@ +within Simulator.Files.Thermodynamic_Functions; + +function Liquid_Fugacity_Coeffcient + input Integer NOC; + input Real Sp[NOC]; + input Real Tc[NOC]; + input Real Pc[NOC]; + input Real w[NOC]; + input Real T, P; + input Real V[NOC]; + input Real S; + input Real gamma[NOC]; + output Real liqfugcoeff[NOC](each start = 2); +protected + Real Tr[NOC]; +protected + Real Pr[NOC]; +protected + Real v0[NOC](each start = 2), v1[NOC](each start = 2), v[NOC]; +protected + Real A[10]; +algorithm + for i in 1:NOC loop + Tr[i] := T / Tc[i]; + Pr[i] := P / Pc[i]; + if Tc[i] == 33.19 then + A[1] := 1.50709; + A[2] := 2.74283; + A[3] := -0.0211; + A[4] := 0.00011; + A[5] := 0; + A[6] := 0.008585; + A[7] := 0; + A[8] := 0; + A[9] := 0; + A[10] := 0; + v0[i] := 10 ^ (A[1] + A[2] / Tr[i] + A[3] * Tr[i] + A[4] * Tr[i] * Tr[i] + A[5] * Tr[i] * Tr[i] * Tr[i] + (A[6] + A[7] * Tr[i] + A[8] * Tr[i] * Tr[i]) * Pr[i] + (A[9] + A[10] * Tr[i]) * (Pr[i] * Pr[i]) - log10(Pr[i])); + elseif Tc[i] == 190.56 then + A[1] := 1.36822; + A[2] := -1.54831; + A[3] := 0; + A[4] := 0.02889; + A[5] := -0.01076; + A[6] := 0.10486; + A[7] := -0.02529; + A[8] := 0; + A[9] := 0; + A[10] := 0; + v0[i] := 10 ^ (A[1] + A[2] / Tr[i] + A[3] * Tr[i] + A[4] * Tr[i] * Tr[i] + A[5] * Tr[i] * Tr[i] * Tr[i] + (A[6] + A[7] * Tr[i] + A[8] * Tr[i] * Tr[i]) * Pr[i] + (A[9] + A[10] * Tr[i]) * (Pr[i] * Pr[i]) - log10(Pr[i])); + else + A[1] := 2.05135; + A[2] := -2.10889; + A[3] := 0; + A[4] := -0.19396; + A[5] := 0.02282; + A[6] := 0.08852; + A[7] := 0; + A[8] := -0.00872; + A[9] := -0.00353; + A[10] := 0.00203; + v0[i] := 10 ^ (A[1] + A[2] / Tr[i] + A[3] * Tr[i] + A[4] * Tr[i] * Tr[i] + A[5] * Tr[i] * Tr[i] * Tr[i] + (A[6] + A[7] * Tr[i] + A[8] * Tr[i] * Tr[i]) * Pr[i] + (A[9] + A[10] * Tr[i]) * (Pr[i] * Pr[i]) - log10(Pr[i])); + end if; + v1[i] := 10 ^ ((-4.23893) + 8.65808 * Tr[i] - 1.2206 / Tr[i] - 3.15224 * Tr[i] ^ 3 - 0.025 * (Pr[i] - 0.6)); + if v1[i] == 0 then + v[i] := 10 ^ log10(v0[i]); + else + v[i] := 10 ^ (log10(v0[i]) + w[i] * log10(v1[i])); + end if; + liqfugcoeff[i] := v[i] * gamma[i]; + end for; +end Liquid_Fugacity_Coeffcient; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/PoyntingCF.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/PoyntingCF.mo new file mode 100644 index 0000000..ebcf1d4 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/PoyntingCF.mo @@ -0,0 +1,26 @@ +within Simulator.Files.Thermodynamic_Functions; + +function PoyntingCF + import Simulator.Files.Thermodynamic_Functions.*; + input Integer NOC; + input Real Pc[NOC], Tc[NOC], Racketparam[NOC], AF[NOC], MW[NOC]; + input Real T, P; + input Real gamma[NOC], Psat[NOC], Density[NOC]; + parameter Integer Choice = 2; + output Real PCF[NOC]; +protected + Real vl[NOC]; +algorithm + for i in 1:NOC loop + if T < 0.98 * Tc[i] then + vl[i] := 1 / Density[i]; + end if; + end for; + for i in 1:NOC loop + if Choice == 1 then + PCF[i] := exp(vl[i] * abs(P - Psat[i]) / (8314.47 * T)); + else + PCF[i] := 1; + end if; + end for; +end PoyntingCF; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/Psat.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/Psat.mo new file mode 100644 index 0000000..508a201 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/Psat.mo @@ -0,0 +1,10 @@ +within Simulator.Files.Thermodynamic_Functions; + +function Psat + /*Returns vapor pressure at given temperature*/ + input Real VP[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real Vp(unit = "Pa") "Vapor pressure"; +algorithm + Vp := exp(VP[2] + VP[3] / T + VP[4] * log(T) + VP[5] .* T .^ VP[6]); +end Psat; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/SId.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/SId.mo new file mode 100644 index 0000000..478121d --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/SId.mo @@ -0,0 +1,45 @@ +within Simulator.Files.Thermodynamic_Functions; + +function SId + import Modelica.Constants.*; + input Real AS; + input Real VapCp[6]; + input Real HOV[6]; + input Real Tb; + input Real Tc; + input Real T; + input Real P; + input Real x; + input Real y; + output Real Sliq, Svap; +protected + parameter Real Tref = 298.15, Pref = 101325; + Real Entr, Cp[n - 1]; + parameter Integer n = 10; +algorithm + Entr := 0; + for i in 1:n - 1 loop + Cp[i] := Simulator.Files.Thermodynamic_Functions.VapCpId(VapCp, 298.15 + i * (T - 298.15) / n) / (298.15 + i * (T - 298.15) / n); + end for; + if T >= Tref then + Entr := (T - 298.15) * (Simulator.Files.Thermodynamic_Functions.VapCpId(VapCp, T) / (2 * T) + sum(Cp[:]) + Simulator.Files.Thermodynamic_Functions.VapCpId(VapCp, 298.15) / (2 * 298.15)) / n; + else + Entr := -(T - 298.15) * (Simulator.Files.Thermodynamic_Functions.VapCpId(VapCp, T) / (2 * T) + sum(Cp[:]) + Simulator.Files.Thermodynamic_Functions.VapCpId(VapCp, 298.15) / (2 * 298.15)) / n; + end if; + if x > 0 and y > 0 then + Sliq := Entr - R * log(P / Pref) - R * log(x) - HV(HOV, Tc, T) / T; + Svap := Entr - R * log(P / Pref) - R * log(y); + elseif x <= 0 and y <= 0 then + Sliq := 0; + Svap := 0; + elseif x == 0 then + Sliq := 0; + Svap := Entr - R * log(P / Pref) - R * log(y); + elseif y == 0 then + Sliq := Entr - R * log(P / Pref) - R * log(x) - HV(HOV, Tc, T) / T; + Svap := 0; + else + Sliq := 0; + Svap := 0; + end if; +end SId; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/Solublity_Parameter.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/Solublity_Parameter.mo new file mode 100644 index 0000000..1121dcb --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/Solublity_Parameter.mo @@ -0,0 +1,19 @@ +within Simulator.Files.Thermodynamic_Functions; + +function Solublity_Parameter + input Integer NOC; + input Real V[NOC]; + input Real Sp[NOC]; + input Real compMolFrac[NOC]; + output Real S; +protected + Real Vs, Vtot; +algorithm + Vtot := sum(compMolFrac[:] .* V[:]); + Vs := sum(compMolFrac[:] .* V[:] .* Sp[:]); + if Vtot == 0 then + S := 0; + else + S := Vs / Vtot; + end if; +end Solublity_Parameter; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/Tow_UNIQUAC.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/Tow_UNIQUAC.mo new file mode 100644 index 0000000..b38b10e --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/Tow_UNIQUAC.mo @@ -0,0 +1,16 @@ +within Simulator.Files.Thermodynamic_Functions; + +function Tow_UNIQUAC + input Integer NOC; + input Real a[NOC, NOC]; + input Real T; + output Real tow[NOC, NOC](start = 1); +protected + Real R_gas = 1.98721; +algorithm + for i in 1:NOC loop + for j in 1:NOC loop + tow[i, j] := exp(-a[i, j] / (R_gas * T)); + end for; + end for; +end Tow_UNIQUAC; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/VapCpId.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/VapCpId.mo new file mode 100644 index 0000000..004bc9e --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/VapCpId.mo @@ -0,0 +1,10 @@ +within Simulator.Files.Thermodynamic_Functions; + +function VapCpId + /*Calculates Vapor Specific Heat*/ + input Real VapCp[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real Cp(unit = "J/mol.K") "specific heat"; +algorithm + Cp := (VapCp[2] + exp(VapCp[3] / T + VapCp[4] + VapCp[5] * T + VapCp[6] * T ^ 2)) / 1000; +end VapCpId; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/index.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/index.mo new file mode 100644 index 0000000..c5caa7c --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/index.mo @@ -0,0 +1,9 @@ +within Simulator.Files.Thermodynamic_Functions; + +function index + input String[:] comps; + input String comp; + output Integer i; +algorithm + i := Modelica.Math.BooleanVectors.firstTrueIndex({k == comp for k in comps}); +end index; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/package.mo b/Simulator/Simulator/Files/Thermodynamic_Functions/package.mo new file mode 100644 index 0000000..a582aef --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/package.mo @@ -0,0 +1,599 @@ +within Simulator.Files; + +package Thermodynamic_Functions + function Psat + /*Returns vapor pressure at given temperature*/ + input Real VP[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real Vp(unit = "Pa") "Vapor pressure"; + algorithm + Vp := exp(VP[2] + VP[3] / T + VP[4] * log(T) + VP[5] .* T .^ VP[6]); + end Psat; + + function LiqCpId + /*Calculates specific heat of liquid at given Temperature*/ + input Real LiqCp[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real Cp(unit = "J/mol") "Specific heat of liquid"; + algorithm + Cp := (LiqCp[2] + exp(LiqCp[3] / T + LiqCp[4] + LiqCp[5] * T + LiqCp[6] * T ^ 2)) / 1000; + end LiqCpId; + + function VapCpId + /*Calculates Vapor Specific Heat*/ + input Real VapCp[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real Cp(unit = "J/mol.K") "specific heat"; + algorithm + Cp := (VapCp[2] + exp(VapCp[3] / T + VapCp[4] + VapCp[5] * T + VapCp[6] * T ^ 2)) / 1000; + end VapCpId; + + function HV + /*Returns Heat of Vaporization*/ + input Real HOV[6] "from chemsep database"; + input Real Tc(unit = "K") "Critical Temperature"; + input Real T(unit = "K") "Temperature"; + output Real Hv(unit = "J/mol") "Heat of Vaporization"; + protected + Real Tr = T / Tc; + algorithm + if T < Tc then + Hv := HOV[2] * (1 - Tr) ^ (HOV[3] + HOV[4] * Tr + HOV[5] * Tr ^ 2 + HOV[6] * Tr ^ 3) / 1000; + else + Hv := 0; + end if; + end HV; + + function HLiqId + /* Calculates Enthalpy of Ideal Liquid*/ + input Real SH(unit = "J/kmol") "from chemsep database std. Heat of formation"; + input Real VapCp[6] "from chemsep database"; + input Real HOV[6] "from chemsep database"; + input Real Tc "critical temp, from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real Ent(unit = "J/mol") "Molar Enthalpy"; + algorithm + Ent := HVapId(SH, VapCp, HOV, Tc, T) - Thermodynamic_Functions.HV(HOV, Tc, T); + end HLiqId; + + function HVapId + /* Calculates enthalpy of ideal vapor */ + input Real SH(unit = "J/kmol") "from chemsep database std. Heat of formation"; + input Real VapCp[6] "from chemsep database"; + input Real HOV[6] "from chemsep database"; + input Real Tc "critical temp, from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real Ent(unit = "J/mol") "Molar Enthalpy"; + protected + Integer n = 100; + Real Cp[n - 1]; + algorithm + for i in 1:n - 1 loop + Cp[i] := VapCpId(VapCp, 298.15 + i * (T - 298.15) / n); + end for; + Ent := (T - 298.15) * (VapCpId(VapCp, T) / 2 + sum(Cp[:]) + VapCpId(VapCp, 298.15) / 2) / n; + end HVapId; + + function SId + import Modelica.Constants.*; + + input Real AS; + input Real VapCp[6]; + input Real HOV[6]; + input Real Tb; + input Real Tc; + input Real T; + input Real P; + input Real x; + input Real y; + output Real Sliq, Svap; + protected + parameter Real Tref = 298.15, Pref = 101325; + Real Entr, Cp[n - 1]; + parameter Integer n = 10; + + algorithm + Entr := 0; + for i in 1:n - 1 loop + Cp[i] := Simulator.Files.Thermodynamic_Functions.VapCpId(VapCp, 298.15 + i * (T - 298.15) / n) / (298.15 + i * (T - 298.15) / n); + end for; + if T >= Tref then + Entr := (T - 298.15) * (Simulator.Files.Thermodynamic_Functions.VapCpId(VapCp, T) / (2 * T) + sum(Cp[:]) + Simulator.Files.Thermodynamic_Functions.VapCpId(VapCp, 298.15) / (2 * 298.15)) / n; + else + Entr := -(T - 298.15) * (Simulator.Files.Thermodynamic_Functions.VapCpId(VapCp, T) / (2 * T) + sum(Cp[:]) + Simulator.Files.Thermodynamic_Functions.VapCpId(VapCp, 298.15) / (2 * 298.15)) / n; + end if; + if x > 0 and y > 0 then + Sliq := Entr - R * log(P / Pref) - R * log(x) - HV(HOV, Tc, T) / T; + Svap := Entr - R * log(P / Pref) - R * log(y); + elseif x <= 0 and y <= 0 then + Sliq := 0; + Svap := 0; + elseif x == 0 then + Sliq := 0; + Svap := Entr - R * log(P / Pref) - R * log(y); + elseif y == 0 then + Sliq := Entr - R * log(P / Pref) - R * log(x) - HV(HOV, Tc, T) / T; + Svap := 0; + else + Sliq := 0; + Svap := 0; + end if; + end SId; + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + function Dens + //This function is developed by swaroop katta + //this function calculates density of pure componets as a function of temperature using chemsep database. + input Real LiqDen[6], TC, T, P; + output Real density "units kmol/m3"; + protected + Real Tr; + protected + parameter Real R = 8.314 "gas constant"; + algorithm + Tr := T / TC; + if T < TC then + if LiqDen[1] == 105 then + density := LiqDen[2] / LiqDen[3] ^ (1 + (1 - T / LiqDen[4]) ^ LiqDen[5]) * 1000; + elseif LiqDen[1] == 106 then + density := LiqDen[2] * (1 - Tr) ^ (LiqDen[3] + LiqDen[4] * Tr + LiqDen[5] * Tr ^ 2 + LiqDen[6] * Tr ^ 3) * 1000; + end if; + else + density := P / (R * T * 1000); + end if; + end Dens; + +function BIPNRTL +input Integer NOC; +input String CAS[NOC]; +output Real value[NOC, NOC, 2]; +protected +constant String underscore = "_"; +String c[NOC, NOC]; +String d[NOC, NOC]; +constant String CAS1_CAS2[352] = {"67-56-1_56-23-5", "67-56-1_75-25-2", "67-66-3_67-56-1", "75-09-2_67-56-1", "67-56-1_75-12-7", "151-67-7_67-56-1", "75-01-4_67-56-1", "67-56-1_75-05-8", "67-56-1_107-06-2", "67-56-1_64-19-7", "107-31-3_67-56-1", "67-56-1_64-17-5", "67-56-1_67-68-5", "124-40-3_67-56-1", "67-64-1_67-56-1", "123-38-6_67-56-1", "75-56-9_67-56-1", "79-20-9_67-56-1", "67-56-1_79-09-4", "67-56-1_68-12-2", "67-56-1_71-23-8", "109-87-5_67-56-1", "67-56-1_110-02-1", "106-99-0_67-56-1", "67-56-1_96-33-3", "115-11-7_67-56-1", "67-56-1_78-93-3", "67-56-1_109-99-9", "67-56-1_123-91-1", "67-56-1_141-78-6", "67-56-1_126-33-0", "106-97-8_67-56-1", "67-56-1_71-36-3", "67-56-1_78-92-2", "60-29-7_67-56-1", "67-56-1_110-63-4", "67-56-1_110-86-1", "542-92-7_67-56-1", "78-79-5_67-56-1", "1574-41-0_67-56-1", "2004-70-8_67-56-1", "67-56-1_80-62-6", "513-35-9_67-56-1", "67-56-1_563-80-4", "67-56-1_110-89-4", "1634-04-4_67-56-1", "67-56-1_392-56-3", "67-56-1_108-90-7", "67-56-1_71-43-2", "67-56-1_62-53-3", "67-56-1_109-06-8", "67-56-1_108-99-6", "67-56-1_108-89-4", "67-56-1_110-83-8", "67-56-1_110-82-7", "592-41-6_67-56-1", "67-56-1_123-86-4", "67-56-1_110-54-3", "67-56-1_121-44-8", "67-56-1_108-88-3", "67-56-1_108-48-5", "67-56-1_592-76-7", "67-56-1_108-87-2", "67-56-1_142-82-5", "67-56-1_100-41-4", "67-56-1_108-38-3", "67-56-1_106-42-3", "67-56-1_111-66-0", "67-56-1_111-65-9", "67-56-1_540-84-1", "56-23-5_67-56-1", "67-66-3_64-17-5", "75-09-2_64-17-5", "64-17-5_127-18-4", "64-17-5_75-05-8", "64-17-5_107-06-2", "64-17-5_64-19-7", "64-17-5_107-21-1", "124-40-3_64-17-5", "67-64-1_64-17-5", "79-20-9_64-17-5", "64-17-5_67-63-0", "64-17-5_110-02-1", "108-05-4_64-17-5", "64-17-5_78-93-3", "109-99-9_64-17-5", "64-17-5_123-91-1", "141-78-6_64-17-5", "64-17-5_126-33-0", "64-17-5_78-92-2", "60-29-7_64-17-5", "64-17-5_78-83-1", "109-73-9_64-17-5", "64-17-5_110-86-1", "78-79-5_64-17-5", "64-17-5_80-62-6", "513-35-9_64-17-5", "64-17-5_563-80-4", "64-17-5_109-60-4", "78-78-4_64-17-5", "109-66-0_64-17-5", "64-17-5_123-51-3", "64-17-5_108-86-1", "64-17-5_108-90-7", "64-17-5_71-43-2", "64-17-5_62-53-3", "64-17-5_108-99-6", "64-17-5_110-82-7", "592-41-6_64-17-5", "64-17-5_108-93-0", "64-17-5_123-86-4", "110-54-3_64-17-5", "64-17-5_111-43-3", "64-17-5_121-44-8", "64-17-5_108-88-3", "64-17-5_100-66-3", "64-17-5_108-48-5", "64-17-5_628-63-7", "64-17-5_142-82-5", "64-17-5_100-41-4", "64-17-5_106-42-3", "64-17-5_111-65-9", "64-17-5_540-84-1", "64-17-5_544-76-3", "64-17-5_112-80-1", "56-23-5_71-23-8", "71-23-8_127-18-4", "79-01-6_71-23-8", "107-06-2_71-23-8", "71-23-8_64-19-7", "124-40-3_71-23-8", "71-23-8_79-09-4", "67-63-0_71-23-8", "71-23-8_109-86-4", "107-10-8_71-23-8", "71-23-8_79-41-4", "78-93-3_71-23-8", "109-99-9_71-23-8", "109-69-3_71-23-8", "71-23-8_78-83-1", "109-73-9_71-23-8", "71-23-8_110-86-1", "71-23-8_80-62-6", "71-23-8_109-60-4", "71-23-8_123-51-3", "392-56-3_71-23-8", "71-23-8_108-90-7", "71-43-2_71-23-8", "71-23-8_109-06-8", "71-23-8_108-99-6", "71-23-8_108-89-4", "110-82-7_71-23-8", "110-54-3_71-23-8", "71-23-8_142-84-7", "121-44-8_71-23-8", "71-23-8_107-46-0", "71-23-8_108-88-3", "71-23-8_108-48-5", "71-23-8_142-82-5", "71-23-8_100-41-4", "71-23-8_111-65-9", "71-23-8_124-18-5", "71-23-8_112-30-1", "67-56-1_7732-18-5", "67-56-1_67-66-3", "67-56-1_64-17-5", "67-56-1_67-64-1", "67-56-1_71-43-2", "67-56-1_110-82-7", "67-56-1_108-88-3", "67-56-1_142-82-5", "7732-18-5_67-64-1", "7732-18-5_78-93-3", "7732-18-5_108-95-2", "64-17-5_7732-18-5", "64-17-5_67-66-3", "64-17-5_67-64-1", "64-17-5_78-93-3", "64-17-5_71-43-2", "64-17-5_110-82-7", "64-17-5_108-88-3", "64-17-5_142-82-5", "64-17-5_106-42-3", "67-64-1_67-66-3", "67-64-1_71-43-2", "67-64-1_108-95-2", "67-64-1_110-82-7", "67-64-1_108-88-3", "78-93-3_71-43-2", "78-93-3_110-82-7", "78-93-3_108-88-3", "78-93-3_142-82-5", "71-43-2_67-66-3", "71-43-2_108-95-2", "71-43-2_108-88-3", "71-43-2_106-42-3", "108-88-3_67-66-3", "108-88-3_106-42-3", "108-87-2_108-95-2", "7732-18-5_79-34-5", "109-87-5_7732-18-5", "107-10-8_7732-18-5", "78-93-3_7732-18-5", "78-84-2_7732-18-5", "109-99-9_7732-18-5", "7732-18-5_123-91-1", "141-78-6_7732-18-5", "7732-18-5_126-33-0", "7732-18-5_127-19-5", "7732-18-5_110-91-8", "7732-18-5_71-36-3", "78-83-1_7732-18-5", "75-65-0_7732-18-5", "60-29-7_7732-18-5", "7732-18-5_110-63-4", "7732-18-5_513-85-9", "7732-18-5_111-46-6", "109-73-9_7732-18-5", "109-89-7_7732-18-5", "7732-18-5_98-01-1", "7732-18-5_110-86-1", "7732-18-5_120-94-5", "7732-18-5_123-51-3", "7732-18-5_75-85-4", "7732-18-5_108-95-2", "7732-18-5_62-53-3", "7732-18-5_109-06-8", "7732-18-5_108-99-6", "7732-18-5_108-89-4", "7732-18-5_100-63-0", "7732-18-5_108-94-1", "7732-18-5_141-79-7", "7732-18-5_108-93-0", "7732-18-5_123-86-4", "7732-18-5_123-42-2", "108-20-3_7732-18-5", "7732-18-5_111-27-3", "7732-18-5_626-93-7", "7732-18-5_111-76-2", "121-44-8_7732-18-5", "7732-18-5_100-51-6", "7732-18-5_108-48-5", "7732-18-5_123-92-2", "7732-18-5_98-86-2", "7732-18-5_91-22-5", "7732-18-5_98-82-8", "56-23-5_71-43-2", "71-43-2_75-25-2", "67-66-3_71-43-2", "74-88-4_71-43-2", "71-43-2_75-52-5", "75-15-0_71-43-2", "76-13-1_71-43-2", "71-43-2_127-18-4", "71-43-2_79-01-6", "71-43-2_76-01-7", "71-43-2_79-34-5", "71-55-6_71-43-2", "71-43-2_106-93-4", "71-43-2_107-06-2", "75-03-6_71-43-2", "71-43-2_123-39-7", "71-43-2_79-24-3", "71-43-2_67-68-5", "71-43-2_107-15-3", "71-43-2_68-12-2", "71-43-2_108-03-2", "71-43-2_79-46-9", "71-43-2_110-02-1", "109-73-9_71-43-2", "75-64-9_71-43-2", "109-89-7_71-43-2", "71-43-2_110-86-1", "71-43-2_392-56-3", "71-43-2_106-46-7", "71-43-2_108-86-1", "71-43-2_108-90-7", "71-43-2_462-06-6", "71-43-2_98-95-3", "71-43-2_62-53-3", "71-43-2_108-91-8", "71-43-2_121-44-8", "71-43-2_100-47-0", "71-43-2_108-88-3", "71-43-2_100-60-7", "71-43-2_100-42-5", "71-43-2_100-41-4", "71-43-2_108-38-3", "71-43-2_106-42-3", "71-43-2_91-66-7", "71-43-2_98-82-8", "71-43-2_103-65-1", "71-43-2_92-06-8", "56-23-5_108-88-3", "67-66-3_108-88-3", "75-15-0_108-88-3", "79-01-6_108-88-3", "75-05-8_108-88-3", "624-83-9_108-88-3", "107-06-2_108-88-3", "108-88-3_79-24-3", "108-88-3_67-68-5", "108-88-3_107-15-3", "107-12-0_108-88-3", "108-88-3_68-12-2", "110-02-1_108-88-3", "108-88-3_126-33-0", "109-89-7_108-88-3", "108-88-3_110-86-1", "392-56-3_108-88-3", "108-88-3_108-86-1", "108-88-3_108-90-7", "462-06-6_108-88-3", "108-88-3_98-95-3", "108-88-3_109-06-8", "108-88-3_108-99-6", "108-88-3_100-47-0", "108-88-3_100-41-4", "108-88-3_106-42-3", "107-13-1_100-42-5", "100-41-4_100-42-5", "100-42-5_103-65-1", "56-23-5_100-41-4", "75-05-8_100-41-4", "107-13-1_100-41-4", "109-89-7_100-41-4", "108-90-7_100-41-4", "100-41-4_98-95-3", "100-41-4_62-53-3", "100-41-4_98-82-8", "100-41-4_104-51-8", "56-23-5_108-38-3", "108-38-3_68-12-2", "110-86-1_108-38-3", "108-38-3_62-53-3", "106-42-3_108-38-3", "107-06-2_95-47-6", "107-15-3_95-47-6", "95-47-6_68-12-2", "56-23-5_106-42-3", "75-05-8_106-42-3", "107-06-2_106-42-3", "106-42-3_68-12-2", "392-56-3_106-42-3", "108-90-7_106-42-3", "106-42-3_62-53-3", "56-23-5_98-82-8", "103-65-1_98-95-3", "95-63-6_526-73-8", "104-51-8_98-95-3", "99-87-6_62-53-3", "91-57-6_90-12-0"}; + +constant Real BI_Values[352, 3] = {{378.8254, 1430.7379, 0.2892}, {879.0968, 1063.6098, 0.6381}, {1414.2712, -141.8030, 0.2949}, {1560.0282, 441.3372, 0.6234}, {617.5847, -153.4695, 0.3003}, {9870.3530, -6982.8569, 0.187e-1}, {1789.7165, -34.9448, 0.2912}, {343.7042, 314.5879, 0.2981}, {348.6035, 1020.1431, 0.2921}, {16.6465, -217.1261, 0.3051}, {584.5720, 298.5567, 0.2962}, {-327.9991, 376.2667, 0.3057}, {-168.3182, -497.4171, 0.3079}, {-1018.1430, -54.3882, 0.3134}, {184.2662, 226.5580, 0.3009}, {1046.6524, -865.2660, 0.3084}, {924.8499, -61.1796, 0.2986}, {381.4559, 346.5360, 0.2965}, {-50.1450, -78.0859, 0.3056}, {-124.0904, 0.3428, 09.1633}, {24.9003, 9.5349, 0.3011}, {608.9115, 712.0226, 0.7259}, {-90.1051, 1217.1035, 0.2976}, {1353.0599, 610.8292, 0.4670}, {676.8360, 169.9831, 0.2958}, {1333.6000, 556.3608, 0.3697}, {307.4271, 217.9098, 0.3003}, {169.4153, 383.1579, 0.3002}, {607.4050, 76.7683, 0.2985}, {345.5416, 420.7355, 0.2962}, {1069.2756, 906.5741, 0.7182}, {1440.1498, 1053.7716, 0.4647}, {793.8173, -486.3299, 0.2483}, {-308.5610, 285.4420, 0.3036}, {705.9989, 211.1580, 0.2953}, {446.9520, -450.5858, 0.3152}, {-45.0888, 84.1956, 0.3027}, {1541.9324, 736.0352, 0.4515}, {1445.6425, 543.5270, 0.4260}, {1545.3339, 799.1289, 0.4753}, {1514.2761, 782.1729, 0.4657}, {590.2790, 380.8401, 0.2963}, {1355.6853, 660.9164, 0.3381}, {642.3761, -6.2901, 0.2987}, {590.8820, -1169.7242, 0.1387}, {851.4954, 465.8360, 0.8178}, {930.5910, 1244.1303, 0.4701}, {857.0852, 1348.0903, 0.4707}, {721.6136, 1158.5131, 0.4694}, {407.7440, 117.2473, 0.3008}, {226.0820, -385.6823, 0.3095}, {-163.4505, -86.1482, 0.3075}, {304.2242, -452.3483, 0.3053}, {1178.5792, 1618.9792, 0.4568}, {1315.1631, 1497.2135, 0.4222}, {1222.6032, 1145.1085, 0.4402}, {328.2162, 453.0017, 0.2961}, {1619.3829, 1622.2911, 0.4365}, {-476.8503, 1126.1143, 0.2874}, {939.7275, 1090.9297, 0.4643}, {-273.3320, 59.6250, 0.3051}, {1313.5497, 1143.9059, 0.4163}, {1444.5850, 1719.4586, 0.4397}, {1500.2043, 1519.3346, 0.4277}, {1080.1231, 1038.1572, 0.4251}, {991.1609, 822.1357, 0.2910}, {974.6545, 851.1070, 0.2921}, {1456.3583, 1147.8132, 0.4396}, {1681.6918, 1511.4353, 0.4381}, {1447.0909, 1386.4703, 0.4313}, {1339.9000, 488.6648, 0.4622}, {1438.3602, -327.5518, 0.3023}, {1332.8036, -153.0761, 0.3057}, {685.8542, 807.5935, 0.2900}, {529.7267, 338.1632, 0.2964}, {333.3502, 939.3870, 0.2926}, {-34.1971, -190.7763, 0.3050}, {1644.0484, -203.7691, 0.3704}, {-1224.5739, 370.7683, 0.3105}, {36.2965, 434.8228, 0.2987}, {188.3139, 158.0118, 0.3013}, {690.1392, -529.3472, 0.3125}, {222.3096, 1057.7115, 0.2918}, {505.1637, 320.7403, 0.2959}, {64.4957, 463.1931, 0.3010}, {661.3708, -200.6915, 0.3015}, {505.5637, 111.8389, 0.2988}, {305.6041, 330.5105, 0.2988}, {1195.1601, 705.0897, 0.5676}, {-559.8205, 802.5411, 0.2721}, {763.6707, 71.1984, 0.2946}, {53.1671, 82.0442, 0.3023}, {-612.3956, -5.7834, 0.3062}, {163.6655, -169.9802, 0.3017}, {1402.5377, 653.4866, 0.5056}, {456.9676, 386.5893, 0.2963}, {1412.7516, 674.7726, 0.4569}, {-54.0946, 639.6806, 0.3009}, {760.4933, 129.3970, 0.2950}, {1610.2811, 935.1426, 0.4960}, {1183.3812, 412.7546, 0.2886}, {51.1705, -42.8613, 0.3009}, {820.8023, 1349.6853, 0.4995}, {645.7829, 1383.7110, 0.5229}, {516.1410, 1065.9086, 0.4774}, {1823.3542, -523.0474, 0.3005}, {315.6078, -339.0825, 0.3056}, {876.7933, 1390.4162, 0.4485}, {1399.1806, 949.7239, 0.5011}, {1719.8644, -833.8389, 0.2920}, {841.9935, -55.3231, 0.2958}, {1218.1065, 575.2985, 0.2882}, {442.6124, 634.1687, 0.2945}, {-248.0407, 697.9004, 0.2996}, {713.5653, 1147.8607, 0.5292}, {3458.4788, -1438.8884, 0.1704}, {-48.2159, -19.6212, 0.3016}, {552.3897, 266.1248, 0.2964}, {1137.2650, 1453.5947, 0.4786}, {801.7191, 1006.8831, 0.4962}, {768.3633, 760.0800, 0.2914}, {1206.8097, 1385.3721, 0.4717}, {1091.0432, 1500.6711, 0.4738}, {2359.4082, 1509.2033, 0.4448}, {975.6816, -343.5446, 0.2988}, {1537.6384, 537.2439, 0.6310}, {608.3777, 646.0412, 0.2913}, {926.6139, 196.0696, 0.3007}, {636.9927, 364.0596, 0.2956}, {256.8999, -327.5173, 0.3044}, {81.4870, -703.3731, 0.2697}, {-189.7856, -32.4657, 0.3070}, {167.2501, -175.2928, 0.3057}, {-406.3767, 830.8897, 0.3013}, {-602.9687, -45.3543, 0.3061}, {276.6356, -423.9162, 0.3025}, {148.8670, 213.3829, 0.3016}, {562.4611, -302.2498, 0.3003}, {1201.9959, 506.8982, 0.5468}, {-2.8139, -13.8657, 0.3034}, {-698.9510, 34.7593, 0.3001}, {374.8691, -412.2861, 0.3110}, {504.0900, 125.6451, 0.2993}, {340.0210, 111.7437, 0.3005}, {12.2207, -31.8303, 0.3033}, {922.5224, 528.5894, 0.2937}, {456.2867, 538.5114, 0.2946}, {874.2419, 285.7774, 0.2899}, {529.6444, -608.3163, 0.3054}, {479.7439, -540.4699, 0.3045}, {523.8291, -603.0924, 0.3084}, {1707.7883, 353.2705, 0.5914}, {1092.1470, 480.6740, 0.2940}, {617.3558, -459.5845, 0.2892}, {991.6157, -435.2018, 0.3067}, {1615.0711, -498.3638, 0.1028}, {25.6220, 922.0009, 0.175e-1}, {472.9353, -545.1853, 0.2960}, {1198.9720, 1377.2975, 0.5193}, {563.6173, 475.5966, 0.2921}, {1109.3040, 334.2112, 0.2907}, {945.3159, 520.2926, 0.2895}, {1068.0694, -588.3325, 0.2958}, {-189.0469, 792.8020, 0.2999}, {-105.4657, 1335.3416, 0.2873}, {67.2902, -70.5092, 0.3009}, {296.2432, 118.0803, 0.3003}, {761.7553, 1094.8556, 0.4893}, {1313.9316, 1862.4639, 0.4410}, {884.0230, 1008.0037, 0.4064}, {1566.4390, 1598.3126, 0.4408}, {1324.9767, 814.1435, 0.5663}, {653.9718, 1883.6007, 0.3607}, {2419.3354, 1844.3794, 0.6308}, {-57.9601, 1241.7396, 0.2937}, {-285.3881, 1289.2198, 0.2909}, {375.3497, 45.3706, 0.3006}, {437.1923, 33.6363, 0.3022}, {255.3591, 1047.1959, 0.2970}, {761.7739, 1393.7993, 0.4376}, {542.4128, 772.4394, 0.2937}, {1114.2947, 1305.9242, 0.4758}, {1020.8405, 889.3461, 0.6180}, {-651.1909, 301.8389, 0.3054}, {-396.4935, 886.5703, 0.2971}, {-754.9547, -280.3830, 0.3086}, {429.8705, 727.6490, 0.2925}, {-247.9492, 727.5102, 0.2950}, {-644.8573, 898.3999, 0.1563}, {605.7381, 235.4493, 0.2963}, {503.0737, -181.5533, 0.2996}, {681.5104, 931.4616, 0.9809}, {-227.3671, -86.1025, 0.3062}, {373.4202, 318.1885, 0.2986}, {60.1980, -51.0865, 0.3019}, {-50.2635, 14.2180, 0.3056}, {-583.6169, 629.2214, 0.2974}, {226.4602, -241.7457, 0.2874}, {2587.8730, -439.4469, 0.2836}, {2435.8879, 102.7658, 0.972e-1}, {1608.0700, 1818.2947, 0.4898}, {-455.9152, 1301.6396, 0.2981}, {674.4614, 1809.8868, 0.3536}, {1166.8333, 1090.0262, 0.2862}, {915.7450, 1725.0977, 0.4522}, {715.9592, 548.8965, 0.2920}, {1285.9880, 1606.0820, 0.4393}, {1160.1372, 467.9008, 0.5573}, {75.5965, 328.8977, 0.3009}, {-803.1654, 1732.7268, 0.2954}, {2633.6951, 504.0381, 0.4447}, {639.8173, 2491.0163, 0.4385}, {471.7718, 2030.8877, 0.5155}, {1544.0251, 2086.4776, 0.3792}, {1310.8994, 1920.1402, 0.5778}, {2531.7402, -758.0034, 0.3020}, {1186.7304, -99.9000, 0.2974}, {160.3429, 2104.4002, 0.6379}, {-169.1652, 1372.3121, 0.2932}, {2602.6374, 436.9686, 0.3950}, {1835.0881, 419.8087, 0.6802}, {-239.6197, 573.8298, 0.3055}, {3633.5330, -494.8389, 0.2816}, {19947.2334, -15910.4563, 0.56e-2}, {2385.3714, 282.6970, 0.4942}, {11965.5274, -7391.5468, 0.235e-1}, {1979.5492, 197.0009, 0.6371}, {2559.3708, 418.7524, 0.5361}, {2325.9141, 162.3029, 0.5622}, {1473.9606, -66.4169, 0.811e-1}, {2983.8991, -171.6660, 0.2673}, {2121.4973, 101.3068, 0.1504}, {2232.9727, 641.3504, 0.4399}, {3805.0038, 918.2419, 0.2951}, {1323.2731, 845.9826, 0.6780}, {2665.1471, 4202.0746, 0.5409}, {2991.1845, -464.8054, 0.1563}, {1880.1699, 489.1746, 0.2938}, {1914.0077, 220.0262, 0.4776}, {-5096.5280, 28437.1380, 0.381e-1}, {4689.8409, 301.3998, 0.3168}, {2222.5960, 831.9908, 0.5706}, {1874.8967, 856.9565, 0.3734}, {725.1364, 858.8268, 00.}, {11675.1604, -3887.1802, 0.902e-1}, {2986.1161, -84.8485, 0.860e-1}, {-4.9421, 84.0212, 0.3055}, {893.4167, -566.9011, 0.2551}, {176.8791, -288.2136, 0.3061}, {294.4424, -185.2944, 0.3013}, {273.5119, 524.9030, 0.2961}, {161.2943, 431.5524, 0.3008}, {-53.1528, 551.9630, 0.3013}, {-94.1122, 288.6566, 0.3023}, {140.5075, -127.4605, 0.3064}, {-225.8274, 197.7460, 0.3030}, {-73.7504, -250.7743, 0.3055}, {-73.4845, 97.5682, 0.3038}, {-100.9240, 300.0048, 0.3046}, {58.8289, -39.5526, 0.3035}, {394.5891, 298.1172, 0.3004}, {1512.9737, 639.2332, 0.5231}, {527.2886, -57.1531, 0.3004}, {810.5440, 408.5646, 0.6691}, {490.0693, 560.0207, 0.2957}, {736.7867, -251.4046, 0.3074}, {-157.3069, 595.6615, 0.3012}, {1088.4773, -446.4137, 0.3068}, {-347.2708, 503.5971, 0.3045}, {65.9717, 67.1231, 0.3024}, {-344.6666, 757.9930, 0.3067}, {52.3512, -42.2029, 0.2813}, {541.0855, -319.8327, 0.2795}, {1085.4557, -715.7662, 0.2989}, {1441.9721, -865.5699, 0.2830}, {1538.3464, -819.5924, 0.3214}, {700.4097, -450.6274, 0.3251}, {277.6641, -292.2391, 0.3040}, {1311.3264, -523.3212, 0.3110}, {776.8671, -178.3464, 0.2990}, {717.4228, -684.6315, 0.2908}, {130.6061, -27.3294, 0.3037}, {1390.4880, -636.1853, 0.2851}, {111.1157, -121.2437, 0.3033}, {52.3967, 94.0417, 0.3020}, {-643.5999, 970.4264, 0.3110}, {-70.8372, 57.0902, 0.3034}, {-454.1872, 615.2806, 0.2878}, {-50.2635, 14.2180, 0.3056}, {85.2080, 104.9548, 0.3019}, {1915.7178, -810.5032, 0.3693}, {-192.1433, 141.5054, 0.3032}, {64.1947, 78.6570, 0.3022}, {-69.6810, 95.3839, 0.3041}, {629.2214, -583.6169, 0.2974}, {-591.6879, 1052.8580, 0.2439}, {185.3799, -250.7688, 0.3062}, {790.7250, 724.0955, 0.9353}, {-167.8974, 104.6027, 0.3029}, {-217.7768, 251.5704, 0.3097}, {537.4434, 21.7626, 0.3011}, {1063.2839, 192.0041, 0.2898}, {432.7908, 592.5054, 0.2969}, {-95.6685, 717.0741, 0.3009}, {-2260.2463, 3666.1775, 0.711e-1}, {510.1471, -197.5696, 0.3015}, {5175.2573, 224.8869, 0.4600}, {91.4853, -153.9388, 05.1012}, {264.6428, -60.3423, 0.2992}, {668.6525, -666.7128, 0.2414}, {-47.4722, 15.0630, 0.3049}, {-40.5158, 15.0972, 0.3037}, {386.4643, -304.6112, 0.3083}, {806.4313, -288.9774, 0.2969}, {396.5492, -97.1224, 0.3028}, {-490.8706, 1036.9557, 0.2963}, {-676.6725, 1239.9195, 0.3000}, {663.0837, -482.5109, 0.3005}, {226.4602, -241.7457, 0.2874}, {598.0263, -130.4323, 0.3023}, {-539.7919, 813.9959, 0.3466}, {649.8687, -453.4673, 0.3067}, {-172.3762, 122.4657, 0.3034}, {1102.5396, 5.3234, 0.2980}, {1304.6073, -338.2481, 0.2994}, {928.9662, -553.9006, 0.3457}, {357.7079, -307.8057, 0.3076}, {519.4154, -64.0219, 0.3003}, {243.6463, 384.0030, 0.2989}, {26.2560, -27.6358, 0.3043}, {-789.9294, 957.1492, 0.3026}, {-232.4578, 163.8924, 0.3047}, {308.9034, 548.6670, 0.2960}, {-78.8985, 351.0029, 0.3009}, {-259.4169, 1034.4099, 0.2992}, {282.0248, -254.9358, 0.3085}, {718.2538, -479.1971, 0.2870}, {1357.7269, -110.2727, 0.1967}, {559.7795, 332.8093, 0.2947}, {-192.9687, 121.7193, 0.3044}, {1413.0042, -210.0314, 0.2938}, {848.1184, -557.9036, 0.2733}, {153.1239, 722.4999, 0.2942}, {1004.5491, -949.1003, 0.2906}, {-395.6312, 359.7555, 0.3055}, {311.9792, 408.2084, 0.2972}, {-106.8166, 13.4903, 0.3033}, {329.7212, 143.3943, 0.3007}, {878.2759, -655.9008, 0.3261}, {370.6529, 140.0817, 0.3003}, {-118.3505, 885.1196, 0.2950}, {-615.6730, 811.3338, 0.3353}}; + +algorithm +for i in 1:NOC loop + for j in 1:NOC loop + for k in 1:2 loop + value[i, j, k] := 0; + end for; + end for; +end for; +for i in 1:NOC loop + for j in 1:NOC loop + c[i, j] := CAS[i] + underscore + CAS[j]; + d[i, j] := CAS[j] + underscore + CAS[i]; + for k in 1:352 loop + if c[i, j] == CAS1_CAS2[k] then + value[i, j, 1] := BI_Values[k, 1]; + value[j, i, 1] := BI_Values[k, 2]; + value[i, j, 2] := BI_Values[k, 3]; + value[j, i, 2] := BI_Values[k, 3]; + end if; + if d[i, j] == CAS1_CAS2[k] then + value[j, i, 1] := BI_Values[k, 1]; + value[i, j, 1] := BI_Values[k, 2]; + value[i, j, 2] := BI_Values[k, 3]; + value[j, i, 2] := BI_Values[k, 3]; + end if; + end for; + end for; +end for; +end BIPNRTL; + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + function Tow_UNIQUAC + + input Integer NOC; + input Real a[NOC,NOC]; + input Real T; + output Real tow[NOC,NOC](start = 1); + + protected Real R_gas = 1.98721; + algorithm + + for i in 1:NOC loop + for j in 1:NOC loop + tow[i,j] := exp(-a[i,j]/(R_gas * T)); + end for; + end for; + +end Tow_UNIQUAC; + + + function BIP_UNIQUAC + input Integer NOC; + input String Comp[NOC]; + output Real value[NOC, NOC]; + constant String underscore = "_"; + String c[NOC, NOC]; + String d[NOC, NOC]; + constant String Comp1_Comp2[440] = {"Butane_Methanol", "Pentane_Ethanol", "Twomethylbutane_Ethanol", "Hexane_Ethanol", "Hexane_Onepropanol", "Cyclohexane_Onepropanol", "Methylcyclohexane_Phenol", "Isobutylene_Methanol", "Twomethyltwobutene_Methanol", "Twomethyltwobutene_Ethanol", "Onehexene_Methanol", "Onehexene_Ethanol", "Onethreebutadiene_Methanol", "Onethreepentadiene_Methanol", "Transonethreepentadiene_Methanol", "Isoprene_Methanol", "Isoprene_Ethanol", "Cyclopentadiene_Methanol", "Benzene_Chloroform", "Benzene_Phenol", "Benzene_Toluene", "Benzene_Pxylene", "Benzene_Onepropanol", "Toluene_Chloroform", "Toluene_Pxylene", "Acetaldehyde_Water", "Propionicaldehyde_Water", "Propionicaldehyde_Methanol", "Isobutyraldehyde_Water", "Acetone_Chloroform", "Acetone_Benzene", "Acetone_Phenol", "Acetone_Cyclohexane", "Acetone_Toluene", "Acetone_Ethanol", "Twobutanone_Benzene", "Twobutanone_Cyclohexane", "Twobutanone_Toluene", "Twobutanone_Nheptane", "Twobutanone_Water", "Twobutanone_Onepropanol", "Methanol_Water", "Methanol_Chloroform", "Methanol_Ethanol", "Methanol_Acetone", "Methanol_Benzene", "Methanol_Cyclohexane", "Methanol_Toluene", "Methanol_Nheptane", "Methanol_Tetrachloromethane", "Methanol_Tribromomethane", "Methanol_Acetonitrile", "Methanol_Onetwodichloroethane", "Methanol_Aceticacid", "Methanol_Dimethylsulfoxide", "Methanol_Propionicacid", "Methanol_Nndimethylformamide", "Methanol_Propanol", "Methanol_Thiophene", "Methanol_Methylacrylate", "Methanol_Twobutanone", "Methanol_Tetrahyrofuran", "Methanol_Onefourdioxane", "Methanol_Ethylacetate", "Methanol_Sulfolane", "Methanol_Onebutanol", "Methanol_Twobutanol", "Methanol_Tertbutanol", "Methanol_Onefourbutanediol", "Methanol_Pyridine", "Methanol_Methylmethacrylate", "Methanol_Methylisopropylketone", "Methanol_Threepentanone", "Methanol_Piperidine", "Methanol_Hexafluorobenzene", "Methanol_Chlorobenzene", "Methanol_Aniline", "Methanol_Twomethylpyridine", "Methanol_Threemethylpyridine", "Methanol_Fourmethylpyridine", "Methanol_Cyclohexene", "Methanol_Nbutylacetate", "Methanol_Hexane", "Methanol_Triethylamine", "Methanol_Twomethylphenol", "Methanol_Two6dimethylpyridine", "Methanol_Oneheptane", "Methanol_Methylcyclohexane", "Methanol_Heptane", "Methanol_Ethylbenzene", "Methanol_Mxylene", "Methanol_Pxylene", "Methanol_Oneoctene", "Methanol_Octane", "Methanol_Twotwofourtrimethylpentane", "Methanol_Onedodecanol", "Methanol_Oleic acid", "Ethanol_Water", "Ethanol_Chloroform", "Ethanol_Acetone", "Ethanol_Twobutanone", "Ethanol_Benzene", "Ethanol_Cyclohexane", "Ethanol_Toluene", "Ethanol_Nheptane", "Ethanol_Pxylene", "Ethanol_Tetrachloroethylene", "Ethanol_Acetonitrile", "Ethanol_Onetwodichloroethane", "Ethanol_Acetic acid", "Ethanol_Onetwoethanediol", "Ethanol_Twopropanol", "Ethanol_Onetwopropanediol", "Ethanol_Thiophene", "Ethanol_Onefourdioxane", "Ethanol_Sulfolane", "Ethanol_Morpholine", "Ethanol_Twobutanol", "Ethanol_Twomethylonepropanol", "Ethanol_Pyridine", "Ethanol_Methylmethacrylate", "Ethanol_Methylisopropyl", "Ethanol_Propylacetate", "Ethanol_Threemethylonebutanol", "Ethanol_Bromobenzene", "Ethanol_Chlorobezene", "Ethanol_Aniline", "Ethanol_Twomethylpyridine", "Ethanol_Threemethylpyridine", "Ethanol_Cyclohexanol", "Ethanol_Butylacetate", "Ethanol_Dipropylether", "Ethanol_Triethylamine", "Ethanol_Anisole", "Ethanol_Two6dimethylpyridine", "Ethanol_Pentylacetate", "Ethanol_Heptane", "Ethanol_Ethylbezene", "Ethanol_Octane", "Ethanol_Twotwofourtrimethylpentane", "Ethanol_Hexadecane", "Ethanol_Oleicacid", "Onepropanol_Water", "Onepropanol_Tetrachloroethylene", "Onepropanol_Aceticacid", "Onepropanol_Propionicacid", "Onepropanol_Twomethoxyethanol", "Propylamine_Onepropanol", "Onepropanol_Methacrylicacid", "Onepropanol_Twomethylonepropanol", "Onepropanol_Pyridine", "Onepropanol_Methylmethacrylate", "Onepropnaol_Propylacetate", "Onepropanol_Threemethylbutanol", "Onepropnaol_Chlorobenzene", "Onepropanol_Twomethylpyridine", "Onepropanol_Threemethylpyridine", "Onepropanol_Fourmethylpyridine", "Onepropanol_Propylpropionate", "Onepropanol_Dipropylamine", "Onepropanol_Hexamethyldisiloxane", "Onepropanol_Toluene", "Onepropnaol_Two6dimethylpyridine", "Onepropanol_Heptane", "Onepropanol_Pxylene", "Onepropanol_Octane", "Onepropanol_Decane", "Onepropanol_Onedecanol", "Twopropanol_Water", "Twopropanol_Onepropanol", "Isobutanol_Water", "Tertbutanol_Water", "Allylalcohol_Water", "Methylformate_Methanol", "Methylacetate_Water", "Methylacetate_Methanol", "Methylacetate_Ethanol", "Ethylacetate_Water", "Ethylacetate_Ethanol", "Vinylacetate_Ethanol", "Diethylether_Water", "Diethylether_Methanol", "Diethylether_Ethanol", "Diisopropylether_Water", "Methyltertbutylether_Methanol", "Dimethoxymethane_Water", "Dimethoxymethane_Methanol", "Ethyleneoxide_Water", "Propyleneoxide_Methanol", "Tetrahydrofuran_Water", "Tetrahydrofuran_Ethanol", "Tetrahydrofuran_Onepropanol", "Tetrachloromethane_Methanol", "Tertachloromethane_Onepropanol", "Vinylcloride_Methanol", "Dichloromethane_Methanol", "Dichloromethane_Ethanol", "Chloroform_Methanol", "Chloroform_Ethanol", "Onetwodichloroethane_Onepropanol", "Trichloroethylene_Onepropanol", "Threechloroonepropene_Water", "Butylchloride_Onepropanol", "Dimethylamine_Water", "Dimethylamine_Methanol", "Dimethylamine_Ethanol", "Dimethylamine_Onepropanol", "Ethylamine_Water", "Triethylamine_Water", "Triethylamine_Onepropanol", "Diethylamine_Water", "Diethylamine_Ethanol", "Propylamine_Water", "Nbutylamine_Water", "Butylamine_Ethanol", "Butylamine_Onepropanol", "Isopropylamine_Water", "Acetonitrile_Water", "Propionitrile_Water", "Acrylonitrile_Water", "Hexafluorobenzene_Onepropnaol", "Water_Acetone", "Water_Twobutanone", "Water_Phenol", "Water_Aceticacid", "Water_Nmethylformamide", "Water_Dimethylsulfoxide", "Water_Ethylenediamine", "Water_Acrylicacid", "Water_Propionicacid", "Water_Onethreefivetrioxane", "Water_Nndimethylformamide", "Water_Onefourdioxane", "Water_Sulfolane", "Water_Nndimethylacetamide", "Water_Morpholine", "Water_Nbutanol", "Water_Onefourbutanediol", "Water_Twothreebutanediol", "Water_Diethylenegylcol", "Water_Furfural", "Water_Pyridine", "Water_Nmethylpyrrolidone", "Water_Threemethylbutanol", "Water_Twomethyltwobutanol", "Water_Aniline", "Water_Twomethylpyridine", "Water_Threemethylpyridine", "Water_Fourmethylpyridine", "Water_Phenylhydrazine", "Water_Cyclohexanone", "Water_Mesityloxide", "Water_Cyclohexanol", "Water_Nbutylacetate", "Water_Diacetonealcohol", "Water_Onehexanol", "Water_Twohexanol", "Water_Twobutoxyethanol", "Water_Benzylalcohol", "Water_Two6dimethylpyridinr", "Water_Isopentylacetate", "Water_Acetophenone", "Water_Quinoline", "Water_Isopropylbenzene", "Halothane_Methanol", "Methanol_Formamide", "Methane_Acetone", "Methane_Propane", "Methane_Nbutane", "Methane_Npentane", "Methane_Benzene", "Methane_Nhexane", "Methane_Ndecane", "Ethane_Nheptane", "Ibutane_Nbutane", "Npentane_Acetone", "Nhexane_Nitroethane", "Nhexane_Aniline", "Nhexane_Methylcyclop", "Nhexane_Toluene", "Nheptane_Benzene", "Nheptane_Toluene", "Noctane_Nitroethane", "Noctane_Ipropanol", "Twotwofourtrimethylpentane_Nitroethane", "Twotwofourtrimethylpentane_Furfural", "Twotwofourtrimethylpentane_Benzene", "Twotwofourtrimethylpentane_Cyclohexane", "Twotwofourtrimethylpentane_Toluene", "Ndecane_Npropanol", "Ndecane_Nbutanol", "Ndecane_Ipropanol", "Cyclopentane_Benzene", "Methylcyclopentane_Benzene", "Methylcyclopentane_Toluene", "Cyclohexane_Nitromethan", "Cyclohexane_Npropanol", "Cyclohexane_Nbutanol", "Cyclohexane_Benzene", "Cyclohexane_Methylcyclop", "Cyclohexane_Nhexane", "Cyclohexane_Toluene", "Cyclohexane_Heptane", "Methylcyclohexane_Toluene", "Onebutene_Ibutane", "Onebutene_Propane", "Onebutene_Nbutane", "Benzene_Twobutanone", "Benzene_Nbutanol", "Benzene_Nhexane", "Benzene_Water", "Toluene_Furfural", "Hydrogen_Methanol", "Hydrogen_Acetone", "Hydrogen_Benzene", "Hydrogen_Nhexane", "Hydrogen_Mxylene", "Hydrogen_Noctane", "Hydrogen_Water", "Hydrogen_Ammonia", "Nitrogen_Nbutane", "Nitrogen_Nhexane", "Nitrogen_Water", "Nitrogen_Ammonia", "Carbonmonoxide_Methanol", "Carbonmonoxide_Acetone", "Carbonmonoxide_Benzene", "Carbonmonoxide_Noctane", "Acetaldehyde_Aceticacid", "Acetaldehyde_Vinylacetat", "Acetone_Carbontetra", "Acetone_Acetonitrile", "Acetone_Methanol", "Acetone_Aceticacid", "Acetone_Furfural", "Acetone_Nhexane", "Acetone_Water", "Acetone_Vinylacetat", "Methanol_Carbontetra", "Methanol_Ipropanol", "Methanol_Ethylacetat", "Methanol_Diethylamin", "Methanol_Methylisobut", "Methanol_Nhexane", "Methanol_Two.threedimethyl", "Methanol_Triethylamin", "Methanol_Anisole", "Ethanol_One.twodichloro", "Ethanol_Aceticacid", "Ethanol_Npropanol", "Ethanol_Tertbutanol", "Ethanol_Methylcyclop", "Ethanol_Nhexane", "Ethanol_Methylcyclo", "Ethanol_Noctane", "Ethanol_Twotwofourtrimethyl", "Ethanol_Ndecane", "Npropanol_Carbontetra", "Npropanol_Aceticacid", "Npropanol_Benzene", "Npropanol_Nhexane", "Npropanol_Toluene", "Npropanol_Nheptane", "Npropanol_Water", "Ipropanol_Ethylacetat", "Ipropanol_Benzene", "Ipropanol_Nheptane", "Ipropanol_Water", "Ipropanol_Twotwofourtrimethyl", "Nbutanol_Carbontetra", "Nbutanol_Aceticacid", "Nbutanol_Nhexane", "Nbutanol_Nheptane", "Nbutanol_Noctane", "Ibutanol_Benzene", "Secbutanol_Benzene", "Tertbutanol_Benzene", "Formicacid_Aceticacid", "Aceticacid_Toluene", "Aceticacid_Nheptane", "Propionicacid_Methylisobut", "Propionicacid_Noctane", "Methylacetate_Chloroform", "Methylacetate_Benzene", "Ethylacetate_Aceticacid", "Ethylacetate_Npropanol", "Ethylacetate_Furfural", "Ethylacetate_Benzene", "Ethylacetate_Toluene", "Ethylacetate_Ethylbenzen", "Vinylacetate_Aceticacid", "Vinylacetate_Water", "Dioxane_Benzene", "Carbontetrachloride_Acetonitrile", "Carbontetrachloride_Ethanol", "Carbontetrachloride_Furfural", "Carbontetrachloride_Benzene", "Carbontetrachloride_Cyclohexane", "Carbontetrachloride_Methylcyclop", "Carbontetrachloride_Toluene", "Carbontetrachloride_Nheptane", "Dichloromethane_Dichloroetan", "Chloroform_Carbontetra", "Chloroform_Formicacid", "Chloroform_Aceticacid", "Chloroform_Ethylacetate", "Chloroform_Benzene", "Nitromethane_Carbontetra", "Nitromethane_Benzene", "Nitroethane_Carbontetra", "Nitroethane_Npropanol", "Nitroethane_Benzene", "Onenitropropane_Carbontetra", "Onenitropropane_Benzene", "Twonitropropane_Carbontetra", "Twonitropropane_Benzene", "Twonitropropane_Nhexane", "Acetonitrile_Benzene", "Acetonitrile_Nheptane", "Acrylonitrile_Acetonitrile", "Aniline_Methylcyclop", "Furfural_Onebutene", "Furfural_Nbutane", "Furfural_Ibutane", "Furfural_Benzene", "Furfural_Cyclohexane", "Water_Formicacid", "Water_Acetonitrile", "Water_Nitroethane", "Water_Dioxane", "Water_Onebutene", "Water_Ibutane", "Water_Toluene", "Water_Acrylonitril", "Water_Cisbutenetwo", "Water_Transbutene", "Water_Isobutene", "Water_Butadiene", "Carbondisulfide_Methanol", "Carbondisulfide_Acetone"}; + constant Real BI_Values[440, 2] = {{1289.4881, 6.7114}, {938.0838, -112.7209}, {849.013, -56.7699}, {1056.8977, -135.5484}, {743.1034, -127.2476}, {1251.6417, -391.9511}, {1525.5351, -516.0584}, {1403.5125, -70.3003}, {1499.6766, -66.3796}, {983.1208, -123.8651}, {1329.9294, -21.5842}, {970.6914, -128.7022}, {1300.2481, -72.9715}, {1489.1438, -97.747}, {1477.5985, -92.9294}, {1514.3534, -144.3088}, {912.9208, -118.3758}, {1410.4509, -61.3753}, {-119.7224, -29.4499}, {72.2429, 197.453}, {70.7224, -58.3017}, {5.7397, 0.5699}, {378.6125, 20.5261}, {860.8206, -554.8868}, {121.3912, -119.706}, {-1132.16, -231.7521}, {735.9692, 208.343}, {416.3831, -377.9488}, {1263.005, -81.883}, {1566.0069, -781.5877}, {-358.9226, 604.28}, {-468.3882, 27.3851}, {-77.5361, 543.595}, {-315.279, 555.7418}, {94.5536, 117.867}, {-300.8429, 385.863}, {146.0313, 100.2596}, {366.3689, -250.2784}, {-184.485, 559.8999}, {775.153, 30.4806}, {147.6576, -8.2705}, {-337.1298, 549.2958}, {-271.0633, 1304.9835}, {-474.7791, 762.8153}, {-84.2364, 403.8524}, {-67.7213, 1117.8797}, {-32.2887, 1703.2055}, {-58.1103, 1190.6454}, {17.9144, 1360.0217}, {-95.2921, 1463.4548}, {-92.0642, 984.2538}, {101.9628, 334.9587}, {-80.7067, 1094.1304}, {-40.7254, -51.0491}, {-366.7607, 84.4189}, {7.1816, 0.3295}, {-156.3839, 103.9406}, {-26.2861, 113.5565}, {-265.3781, 1099.9741}, {-25.1614, 600.3028}, {-136.0158, 584.0634}, {-153.2518, 629.7314}, {-19.0988, 451.089}, {-138.9829, 770.3047}, {-28.6882, 675.1045}, {40.3898, 121.5049}, {471.807, -279.7321}, {-291.983, 403.6892}, {-286.6527, 490.8909}, {425.4563, -393.3415}, {-98.6602, 843.2593}, {-100.1669, 594.2312}, {-83.8392, 609.2057}, {-383.9791, 153.8253}, {-90.0876, 1245.166}, {-118.0717, 1402.7818}, {-144.7753, 517.8626}, {-603.5633, 950.103}, {-206.2407, 81.4664}, {-78.8509, -53.173}, {-38.5257, 1529.9926}, {-174.2617, 892.9417}, {38.3254, 1391.4917}, {-318.8007, 905.0708}, {-502.2428, 548.3889}, {-272.5909, 272.4921}, {-12.605, 1363.9261}, {1.0023, 1552.7297}, {-27.9877, 1578.6097}, {-57.095, 1259.4286}, {-41.7377, 1208.1529}, {-47.6694, 1231.2086}, {-32.2567, 1396.3019}, {-32.7911, 1561.8955}, {-59.6929, 1577.3145}, {18.9334, 484.2757}, {-149.1808, 952.0283}, {173.801, 109.8687}, {-305.3246, 881.3549}, {94.2417, 98.7523}, {-25.7234, 250.3958}, {-127.9893, 744.8826}, {-153.0128, 1100.3231}, {-97.5633, 698.6183}, {-150.277, 1127.5232}, {-63.9673, 664.259}, {-61.6485, 783.4873}, {392.2083, 91.3933}, {-39.1051, 669.688}, {-25.2901, -86.9343}, {818.093, -200.1567}, {437.5184, -324.6275}, {181.0206, -57.8238}, {-77.9585, 662.4746}, {50.8172, 212.2982}, {177.7675, 306.35}, {-712.473, 1116.7138}, {-311.9029, 474.5511}, {-117.4292, 220.9133}, {378.8209, -378.8991}, {-105.4041, 544.4089}, {-260.5944, 652.4019}, {-13.0186, 405.1733}, {82.3751, -18.3336}, {-169.9204, 998.8196}, {-205.6039, 1032.724}, {1262.584, -446.4834}, {139.4905, -225.4203}, {-578.9542, 942.9023}, {634.1484, -339.732}, {-38.4912, 384.6715}, {-177.4837, 780.0513}, {-305.4069, 674.3341}, {928.9185, -379.9781}, {-432.4206, 583.2958}, {-161.4264, 631.1662}, {-115.7807, 1040.2891}, {-127.6343, 841.5199}, {-152.8323, 1156.688}, {-165.9382, 1120.4853}, {-401.4408, 1783.7857}, {-180.7604, 627.9668}, {190.5947, 290.554}, {-13.5513, 473.6899}, {-729.0848, 1660.0903}, {-83.3064, -4.418}, {-300.7498, 511.0851}, {-274.4208, 15.9476}, {114.789, -169.5098}, {47.0059, -46.6524}, {423.4439, -423.9207}, {-27.435, 256.1456}, {-91.8942, 278.7259}, {-19.2402, 27.9161}, {1.3035, 311.4544}, {163.7157, -281.9383}, {199.1862, -290.3666}, {180.7309, -293.8268}, {-585.5214, 1186.3162}, {-1.1304, 48.1557}, {-218.4928, 677.0367}, {-1.7464, 340.4905}, {-595.2165, 936.7248}, {-91.2018, 743.266}, {-74.7475, 427.6292}, {-48.752, 525.9933}, {-175.9432, 744.763}, {89.4506, 31.0832}, {327.443, 64.4408}, {103.5993, -103.7179}, {350.1707, 309.5428}, {230.5098, 271.3048}, {281.7442, 47.6526}, {623.2636, -2.0107}, {830.7943, 47.5023}, {611.2312, -70.982}, {267.0169, -79.2922}, {1441.5619, -205.7336}, {436.0416, -98.562}, {483.9533, -67.6116}, {1198.9207, 102.271}, {906.3646, -157.3556}, {642.6982, -171.8091}, {1415.2748, 81.2811}, {1024.985, -203.711}, {1098.9416, -44.1418}, {657.2765, -4.6934}, {10542.2026, -344.1682}, {791.0185, -210.2403}, {835.2626, 10.5163}, {559.1539, -260.1951}, {381.8256, -244.669}, {1029.3332, -171.0842}, {957.274, -252.3762}, {7661.2894, -187.7083}, {1516.5558, -229.3734}, {796.2935, -172.0713}, {1295.4282, -271.461}, {981.7658, -335.4504}, {272.4952, 107.634}, {538.1802, -90.5235}, {1260.1312, 81.3308}, {748.22, -172.7007}, {-1070.3252, 1057.3916}, {-520.5358, -200.8021}, {-1071.4286, 1018.5371}, {-71.2521, -231.1124}, {149.3345, -412.065}, {242.4137, 2458.766}, {701.924, -371.1197}, {721.1889, -312.3228}, {-613.4553, 1006.1474}, {426.0894, -302.8076}, {-379.6694, 874.815}, {-17.1391, -220.6087}, {-188.4751, -68.9772}, {-553.685, 1001.0323}, {266.3109, 332.5988}, {367.0686, 510.5582}, {395.4004, 537.1531}, {535.7543, -38.2344}, {-110.3829, 698.7989}, {752.9217, 39.6746}, {934.8834, -501.3763}, {-251.6868, 407.0073}, {-867.7066, 2091.772}, {-292.3021, -523.6271}, {-175.0216, -724.876}, {-417.4722, 1189.9025}, {486.4688, -146.6582}, {-210.5536, 915.1339}, {639.5742, -556.8715}, {-444.013, 1302.0378}, {-397.8616, 997.3999}, {453.4841, -463.0383}, {933.6195, -802.5279}, {548.2453, 89.0444}, {-370.3689, 1635.7568}, {489.1312, -286.7611}, {-346.2827, 900.5916}, {537.7334, -36.221}, {-56.5403, -97.5005}, {-801.2765, 1402.6755}, {819.6231, -223.7898}, {-178.9352, 1021.7979}, {-91.7122, 485.3384}, {-657.2675, 1253.468}, {1280.6209, -655.1387}, {-358.5748, 333.911}, {-334.1695, 857.6208}, {316.6082, 95.0342}, {-56.9399, 1043.7692}, {-286.8493, 1023.7144}, {394.2396, 756.4163}, {-351.0861, 1188.5242}, {-9.7248, 802.6348}, {-172.0599, 1138.3704}, {-178.571, 670.1422}, {83.4921, 304.0167}, {-497.9465, 893.7955}, {-250.5667, 1438.236}, {234.4706, 641.1422}, {-847.2235, 663.5428}, {-310.5637, 1655.4649}, {1653.8373, -379.2679}, {319.3243, -34.2606}, {-0.26, 471}, {-2.01, 604}, {-2.05, 731}, {-1.32, 509}, {-0.38, 473}, {-0.06, 94}, {-0.24, 150}, {264.89, -112.61}, {1, 1}, {266.31, -22.83}, {230.64, -5.86}, {283.76, 34.82}, {-138.84, 162.13}, {34.27, 4.3}, {245.42, -135.93}, {108.24, -72.96}, {333.48, -30.98}, {1107.44, -166.18}, {236.48, 10.66}, {410.08, -4.98}, {80.91, -27.13}, {141.01, -112.66}, {141.11, -94.6}, {1137.2, -201.82}, {1430.77, -259.67}, {1074.76, -207.27}, {15.19, 33.15}, {56.47, -6.47}, {89.77, -48.05}, {517.19, 105.01}, {1284.75, -173.42}, {1393.11, -196.9}, {-32.57, 88.26}, {144.37, -118.82}, {172.73, -145.56}, {83.67, -44.04}, {-76.36, 98.22}, {210.35, -134.19}, {-23.03, 35.11}, {126.71, -98.63}, {-23.03, 35.11}, {350.47, -226.16}, {928.9, -181.24}, {-77.13, 132.43}, {2057.42, 115.13}, {74.87, 244.12}, {3.94, 218}, {3.23, 218}, {1.97, 810}, {2.99, -4}, {2.09, 765}, {-0.05, 1646}, {9.97, -880}, {0.68, 1344}, {-1.67, 814}, {0.07, 336}, {3.76, 913}, {-3.35, 2098}, {0.83, 552}, {0.48, 408}, {-1.04, 1062}, {-3.38, 1878}, {458.43, -212.77}, {-117.74, 243.51}, {-92.32, 246.68}, {-176.38, 261.53}, {359.1, -96.9}, {461.81, -262.3}, {-101.3, 195.63}, {-33.08, 261.51}, {530.99, -100.71}, {-82.48, 110.6}, {-29.64, 1127.95}, {-24.85, 31.22}, {-107.54, 579.61}, {-374.88, 676.42}, {-105.94, 688.03}, {-2.66, 1636.05}, {-7.18, 1463.9}, {-186.66, 664.29}, {-48.39, 782.28}, {-105.66, 929.71}, {-210.53, 244.67}, {210.95, -67.7}, {-2.62, 9.24}, {-118.27, 1383.93}, {-108.93, 1441.57}, {-117.57, 1340.56}, {-109.08, 1385.91}, {-120.42, 1449.61}, {-127.48, 1254.65}, {-166.93, 1336.03}, {299.33, 445.77}, {-155.1, 928.5}, {-144.11, 1326.05}, {-195.4, 818.34}, {-160.43, 1306.22}, {78.37, 583.03}, {-190.57, 522.07}, {-145.52, 854.75}, {-162.54, 1295.6}, {217.23, 11.59}, {-198.06, 994}, {-188.77, 1248.17}, {-296.3, 546.68}, {-159.24, 1370.74}, {-251.11, 1291.98}, {-236.21, 1098.91}, {-162.39, 861.06}, {784.99, -168.83}, {744.89, -165.4}, {-144.58, 241.64}, {-67.91, 298.09}, {-8.49, 342.57}, {-78.49, 136.46}, {-183.2, 556.12}, {-187.87, 121.17}, {203.46, -143.88}, {-214.39, 63.04}, {539.64, -190.31}, {-19.15, 48.52}, {233.81, -181.49}, {309.41, -214.26}, {137.11, -105.5}, {330.03, -124.12}, {1557.23, 131.36}, {363.78, -197.65}, {458.86, -40.18}, {1192.49, -135.27}, {476.85, -100.42}, {-37.52, 43.39}, {98.18, -84.82}, {161.96, -129.21}, {-168.53, 203.67}, {88.3, -59.13}, {1, 1}, {-14.74, 38.19}, {461.38, 90.36}, {346.43, -98.44}, {24.16, -119.49}, {4.98, -50.53}, {0.59, 398.4}, {73.79, 82.2}, {73.06, 295.06}, {574.22, -94.39}, {16.61, 46.05}, {-95.68, 267.13}, {535.16, -246.81}, {-134.32, 307.25}, {794.91, -344.15}, {-32.95, 252.2}, {60.28, 89.57}, {23.71, 545.79}, {183.65, -142.35}, {54.36, 228.71}, {49.12, 242.1}, {88.87, 257.71}, {97.14, 268}, {71, 12}, {41.17, 354.83}, {-508.85, 1019.29}, {122.02, 122.07}, {138.44, 920.08}, {-328.7, 927.26}, {590.17, 777.95}, {646.79, 1173.23}, {305.71, 1371.36}, {155.78, 471.21}, {356.45, -18.31}, {356.45, -18.31}, {346.74, 657.5}, {496.1, 270.6}, {1166.49, 138.15}, {157.31, 103.91}}; + algorithm + for i in 1:NOC loop + for j in 1:NOC loop + for k in 1:2 loop + value[i, j] := 0; + end for; + end for; + end for; + for i in 1:NOC loop + for j in 1:NOC loop + c[i, j] := Comp[i] + underscore + Comp[j]; + d[i, j] := Comp[j] + underscore + Comp[i]; + for k in 1:440 loop + if c[i, j] == Comp1_Comp2[k] then + value[i, j] := BI_Values[k, 1]; + value[j, i] := BI_Values[k, 2]; + end if; + if d[i, j] == Comp1_Comp2[k] then + value[j, i] := BI_Values[k, 1]; + value[i, j] := BI_Values[k, 2]; + end if; + end for; + end for; + end for; + end BIP_UNIQUAC; + + function BIP_PR + input Integer Nc; + input String comp[Nc]; + output Real kij[Nc, Nc]; + protected + String name; + String nameRev; + constant String Comp1_Comp2[179] = {"Heliumfour_Carbonmonoxide", "Hydrogen_Nitrogen", "Hydrogen_Carbonmonoxide", "Hydrogen_Methane", "Hydrogen_Ethylene", "Hydrogen_Ethane", "Hydrogen_Carbondioxide", "Hydrogen_Propylene", "Hydrogen_Propane", "Hydrogen_Nbutane", "Hydrogen_Nhexane", "Hydrogen_Nheptane", "Hydrogen_Toluene", "Hydrogen_Quinoline", "Hydrogen_Bicyclohexyl", "Hydrogen_Onemethylnaphthalene", "Nitrogen_Carbonmonoxide", "Nitrogen_Argon", "Nitrogen_Oxygen", "Nitrogen_Methane", "Nitrogen_Ethylene", "Nitrogen_Ethane", "Nitrogen_Nitrousoxide", "Nitrogen_Carbondioxide", "Nitrogen_Hydrogensulfide", "Nitrogen_Propylene", "Nitrogen_Propane", "Nitrogen_Ammonia", "Nitrogen_Dichlorodiflouromethane", "Nitrogen_Isobutane", "Nitrogen_Sulfurdioxide", "Nitrogen_Nbutane", "Nitrogen_Isoc5", "Nitrogen_Npentane", "Nitrogen_Methanol", "Nitrogen_Nhexane", "Nitrogen_Benzene", "Nitrogen_Nheptane", "Nitrogen_Noctane", "Nitrogen_Ndecane", "Carbonmonoxide_Methane", "Carbonmonoxide_Ethane", "Carbonmonoxide_Hydrogensulfide", "Carbonmonoxide_Propane", "Argon_Oxygen", "Argon_Methane", "Argon_Ammonia", "Oxygen_Krypton", "Oxygen_Nitrousoxide", "Methane_Ethylene", "Methane_Ethane", "Methane_Nitrousoxide", "Methane_Carbondioxide", "Methane_Carbonylsulfide", "Methane_Propylene", "Methane_Propane", "Methane_Isobutane", "Methane_Sulfurdioxide", "Methane_Nbutane", "Methane_Isoc5", "Methane_Npentane", "Methane_Nhexane", "Methane_Benzene", "Methane_Cyclohexane", "Methane_Nheptane", "Methane_Toluene", "Methane_Noctane", "Methane_Mxylene", "Methane_Nnonane", "Methane_Ndecane", "Methane_Mcresol", "Methane_Tetralin", "Methane_Onemethylnaphthalene", "Methane_Diphenylmethane", "Ethylene_Ethane", "Ethylene_Acetylene", "Ethylene_Carbondioxide", "Ethylene_Nbutane", "Ethylene_Benzene", "Ethylene_Nheptane", "Ethylene_Ndecane", "Carbondioxide_Ethane", "Ethane_Hydrogensulfide", "Ethane_Propylene", "Ethane_Propane", "Ethane_Isobutane", "Ethane_Nbutane", "Ethane_Ethylether", "Ethane_Npentane", "Ethane_Acetone", "Ethane_Methylacetate", "Ethane_Methanol", "Ethane_Nhexane", "Ethane_Benzene", "Ethane_Cyclohexane", "Ethane_Nheptane", "Ethane_Noctane", "Ethane_Ndecane", "Carbondioxide_Nitrousoxidedioxide", "Acetylene_Propylene", "Trifluoromethane_Triflourochloromethane", "Trifluorochloromethane_Dichlorodifluoromethane", "Carbondioxide_Hydrogensulfide", "Carbondioxide_Difluoromethane", "Carbondioxide_Propylene", "Carbondioxide_Propane", "Carbondioxide_Isobutane", "Carbondioxide_Onebutene", "Carbondioxide_Nbutane", "Carbondioxide_Isoc5", "Carbondioxide_Ethylether", "Carbondioxide_Npentane", "Carbondioxide_Methylacetate", "Carbondioxide_Methanol", "Carbondioxide_Nhexane", "Carbondioxide_Benzene", "Carbondioxide_Cyclohexane", "Carbondioxide_Nheptane", "Carbondioxide_Water", "Carbondioxide_Toluene", "Carbondioxide_Ndecane", "Carbondioxide_Nbutylbenzene", "Hydrogensulfide_Propane", "Hydrogensulfide_Isobutane", "Hydrogensulfide_Npentane", "Hydrogensulfide_Water", "Hydrogensulfide_Ndecane", "Propylene_Propane", "Propylene_Isobutane", "Propylene_Onecfour", "Propane_Isobutane", "Propane_Nbutane", "Propane_Isopentane", "Propane_Npentane", "Propane_Nhexane", "Propane_Ethanol", "Propane_Benzene", "Propane_Nheptane", "Propane_Noctane", "Propane_Ndecane", "Pentaflourohloroethane_Difluorochloromethane", "Difluorochloromethane_Dichlorodifluoromethane", "Ammonia_Water", "Ammonia_Watert=two7three.one5k", "Isobutane_Nbutane", "Sulfurdioxide_Benzene", "Onebutene_One", "Onebutene_Nbutane", "One_Threebutadiene", "Nbutane_Npentane", "Nbutane_Nhexane", "Nbutane_Nheptane", "Nbutane_Noctane", "Nbutane_Ndecane", "Npentane_Benzene", "Npentane_Cyclohexane", "Npentane_Nheptane", "Npentane_Noctane", "Two_Twodimethylbutane", "Two_Threedimethylbutane", "Twomethylpentane_Onepentanol", "Onepentanol_Threemethylpentane", "Methanol_Water", "Nhexane_Benzene", "Nhexane_Cyclohexane", "Nhexane_Twopropanol", "Nhexane_Nheptane", "Nhexane_Isopentanol", "Nhexane_Onepentanol", "Cyclohexane_Benzene", "Benzene_Nheptane", "Benzene_Isooctane", "Benzene_Noctane", "Cyclohexene_Cyclohexane", "Cyclohexane_One", "Cyclohexane_Cyclohexanone", "One_Twodichloroethane", "Nheptane_Isooctane", "Nheptane_Twopentanone"}; + constant Real BI_Val[size(Comp1_Comp2, 1)] = {1, 7.1100E-02, 9.1900E-02, 2.6300E-02, 6.3300E-02, -7.5600E-02, 0, 0, 0, 0, -3.00E-02, 0, -1, -1, -1, 0, 3.300E-02, -2.6000E-03, -1.5900E-02, 2.8900E-02, 8.5600E-02, 3.4400E-02, 4.4000E-03, -2.2200E-02, 0, 9.00E-02, 8.7800E-02, 0, 1.0700E-02, 0, 8.00E-02, 7.1100E-02, 9.2200E-02, 0, 0, 0, 0, 0, 0, 0, 3.00E-02, -2.2600E-02, 5.4400E-02, 2.5900E-02, 1.0700E-02, 2.300E-02, 0, 2.5600E-02, 4.7800E-02, 3.7800E-02, -3.3000E-03, 2.5600E-02, 7.9300E-02, 2.8900E-02, 3.300E-02, 1.1900E-02, 2.5600E-02, 0, 2.4400E-02, -5.6000E-03, 2.300E-02, 4.00E-02, 8.0700E-02, 3.8900E-02, 4.0100E-02, 9.700E-02, 4.9600E-02, 8.4400E-02, 4.7400E-02, 4.8900E-02, 0, 0, 0, 8.7400E-02, 1.1900E-02, 6.5200E-02, 5.7800E-02, 9.2200E-02, 3.1100E-02, 1.4400E-02, 2.5300E-02, 0, 8.2200E-02, 8.9000E-03, 1.1000E-03, -6.7000E-03, 8.9000E-03, 1.8100E-02, 7.8000E-03, 0, 0, 2.700E-02, -4.00E-02, 3.2200E-02, 1.7800E-02, 7.4000E-03, 1.8500E-02, 1.4400E-02, 4.8000E-03, 0, 0, 3.3700E-02, 9.7800E-02, 1.700E-02, 9.3300E-02, 0, 0, 5.9300E-02, 0, 0, 4.700E-02, -1.00E-02, -4.9300E-02, 2.200E-02, 0, 7.7400E-02, 0, 0, 6.3000E-03, 0, 0, 0, 6.00E-02, 4.7400E-02, 6.300E-02, 3.9400E-02, 3.3300E-02, 9.6000E-03, -1.4400E-02, 4.0000E-04, -7.8000E-03, 3.3000E-03, 1.1100E-02, 2.6700E-02, 7.0000E-04, 3.1500E-02, 2.3300E-02, 5.6000E-03, 0, 0, 8.7400E-02, 5.2200E-02, 0, 0, -4.0000E-04, 1.5000E-03, 2.2000E-03, 7.0000E-04, 1.4100E-02, 1.7400E-02, -5.6000E-03, 3.3000E-03, 7.4000E-03, 7.8000E-03, 1.8900E-02, 3.7000E-03, 7.4000E-03, 0, 4.5200E-02, 4.6700E-02, 4.6700E-02, 4.7800E-02, -7.7800E-02, 8.9000E-03, -3.000E-03, 8.4400E-02, -7.8000E-03, 4.8500E-02, 4.5600E-02, 1.2600E-02, 1.1000E-03, 4.0000E-04, 3.000E-03, 1.1000E-03, 7.300E-02, 6.5900E-02, 4.300E-02, 4.0000E-04, 6.9300E-02}; + algorithm + for i in 1:Nc loop + for j in 1:Nc loop + name := comp[i] + "_" + comp[j]; + nameRev := comp[j] + "_" + comp[i]; + if i == j then + kij[i, j] := 0; + elseif FindString(Comp1_Comp2, name) == (-1) then + kij[i, j] := BI_Val[index(Comp1_Comp2, nameRev)]; + else + kij[i, j] := BI_Val[index(Comp1_Comp2, name)]; + end if; + end for; + end for; + end BIP_PR; + + function FindString + input String compound_array[:]; + input String compound; + output Integer int; + protected + Integer i, len = size(compound_array, 1); + algorithm + int := -1; + i := 1; + while int == (-1) and i <= len loop + if compound_array[i] == compound then + int := i; + end if; + i := i + 1; + end while; + end FindString; + + function index + input String[:] comps; + input String comp; + output Integer i; + algorithm + i := Modelica.Math.BooleanVectors.firstTrueIndex({k == comp for k in comps}); + end index; + + function Density_Racket + input Integer NOC; + input Real T; + input Real P; + input Real Pc[NOC]; + input Real Tc[NOC]; + input Real Racketparam[NOC]; + input Real AF[NOC]; + input Real MW[NOC]; + input Real Psat[NOC]; + output Real Density[NOC]; + parameter Real R = 83.14; +protected + Real Tr[NOC], Pcm[NOC], temp[NOC], tempcor[NOC], a, b, c[NOC], d, e[NOC], Beta[NOC], f, g, h, j, k, Racketparam_new[NOC]; +algorithm + for i in 1:NOC loop + Pcm[i] := Pc[i] / 100000; + Tr[i] := T / Tc[i]; + if Tr[i] > 0.99 then + Tr[i] := 0.5; + end if; + if Racketparam[i] == 0 then + Racketparam_new[i] := 0.29056 - 0.08775 * AF[i]; + else + Racketparam_new[i] := Racketparam[i]; + end if; + temp[i] := R * (Tc[i] / Pcm[i]) * Racketparam_new[i] ^ (1 + (1 - Tr[i]) ^ (2 / 7)); + if T < Tc[i] then + a := -9.070217; + b := 62.45326; + d := -135.1102; + f := 4.79594; + g := 0.250047; + h := 1.14188; + j := 0.0861488; + k := 0.0344483; + e[NOC] := exp(f + g * AF[i] + h * AF[i] * AF[i]); + c[NOC] := j + k * AF[i]; + Beta[i] := Pc[i] * ((-1) + a * (1 - Tr[i]) ^ (1 / 3) + b * (1 - Tr[i]) ^ (2 / 3) + d * (1 - Tr[i]) + e[i] * (1 - Tr[i]) ^ (4 / 3)); + tempcor[i] := temp[i] * (1 - c[i] * log((Beta[i] + P) / (Beta[i] + Psat[i]))); + Density[i] := 0.001 * MW[i] / (tempcor[i] * 0.000001); + else + Density[i] := 0.001 * MW[i] / (temp[i] * 0.000001); + end if; + end for; +end Density_Racket; + +function PoyntingCF + import Simulator.Files.Thermodynamic_Functions.*; + input Integer NOC; + input Real Pc[NOC], Tc[NOC], Racketparam[NOC], AF[NOC], MW[NOC]; + input Real T, P; + input Real gamma[NOC], Psat[NOC], Density[NOC]; + parameter Integer Choice = 2; + output Real PCF[NOC]; +protected + Real vl[NOC]; +algorithm + for i in 1:NOC loop + if T < 0.98 * Tc[i] then + vl[i] := 1 / Density[i]; + end if; + end for; + for i in 1:NOC loop + if Choice == 1 then + PCF[i] := exp(vl[i] * abs(P - Psat[i]) / (8314.47 * T)); + else + PCF[i] := 1; + end if; + end for; +end PoyntingCF; + + + function Solublity_Parameter + + input Integer NOC; + input Real V[NOC]; + input Real Sp[NOC]; + input Real compMolFrac[NOC]; + + output Real S; + protected Real Vs,Vtot; + + algorithm + + Vtot := sum(compMolFrac[:] .* V[:]); + Vs := sum(compMolFrac[:] .* V[:] .* Sp[:]); + + if(Vtot==0) then + S :=0; + else + S := Vs / Vtot; + end if; + + end Solublity_Parameter; + + + + function EOS_ConstantII + parameter Real R_gas = 8.314; + input Integer NOC; + input Real Tc[NOC],Pc[NOC]; + input Real T; + + output Real b[NOC]; + + algorithm + + for i in 1:NOC loop + b[i] := 0.08664 * R_gas * (Tc[i] / Pc[i]); + end for; + end EOS_ConstantII; + + + function EOS_ConstantIII + + input Integer NOC; + input Real a[NOC]; + + output Real a_ij[NOC,NOC]; + + algorithm + + for i in 1:NOC loop + a_ij[i,:] := (a[i] .* a[:]) .^ 0.5; + end for; + + end EOS_ConstantIII; + + function EOS_Constant1V + + input Integer NOC; + input Real compMolFrac[NOC]; + input Real a_ij[NOC,NOC]; + + output Real amv; + protected Real amvv[NOC]; + + algorithm + for i in 1:NOC loop + amvv[i] := sum(compMolFrac[i] .* compMolFrac[:] .* a_ij[i,:]); + end for; + amv := sum(amvv[:]); + end EOS_Constant1V; + + function EOS_Constants + + parameter Real R_gas = 8.314; + input Integer NOC; + input Real Tc[NOC],Pc[NOC]; + input Real T; + + output Real a[NOC]; + + algorithm + + for i in 1:NOC loop + a[i] := 0.42748 * (R_gas^2) * ((Tc[i] ^ 2.5) / (Pc[i] * (T ^ 0.5))); + + end for; + + end EOS_Constants; + + + function Liquid_Fugacity_Coeffcient + + input Integer NOC; + + input Real Sp[NOC]; + input Real Tc[NOC]; + input Real Pc[NOC]; + input Real w[NOC]; + input Real T,P; + input Real V[NOC]; + input Real S; + input Real gamma[NOC]; + + output Real liqfugcoeff[NOC](each start = 2); + protected Real Tr[NOC]; + protected Real Pr[NOC]; + protected Real v0[NOC](each start=2),v1[NOC](each start=2),v[NOC]; + protected Real A[10]; + + algorithm + + + for i in 1:NOC loop + Tr[i] := T / Tc[i]; + Pr[i] := P / Pc[i]; + + if(Tc[i] == 33.19) then + A[1] := 1.50709; + A[2] := 2.74283; + A[3] := -0.0211; + A[4] := 0.00011; + A[5] := 0; + A[6] := 0.008585; + A[7] := 0; + A[8] := 0; + A[9] := 0; + A[10] :=0; + + v0[i] := 10^(A[1] + (A[2]/Tr[i]) + (A[3]*Tr[i])+(A[4] *Tr[i] *Tr[i])+(A[5] *Tr[i]*Tr[i]*Tr[i])+((A[6] +(A[7] *Tr[i]) +(A[8]*Tr[i]*Tr[i]))*Pr[i])+((A[9] +(A[10]*Tr[i]))*(Pr[i]*Pr[i])) - (log10(Pr[i]))); + + elseif(Tc[i] == 190.56) then + A[1] := 1.36822; + A[2] := -1.54831; + A[3] := 0; + A[4] := 0.02889; + A[5] := -0.01076; + A[6] := 0.10486; + A[7] := -0.02529; + A[8] := 0; + A[9] := 0; + A[10] := 0; + + v0[i] := 10^(A[1] + (A[2]/Tr[i]) + (A[3]*Tr[i])+(A[4] *Tr[i] *Tr[i])+(A[5] *Tr[i]*Tr[i]*Tr[i])+((A[6] +(A[7] *Tr[i]) +(A[8]*Tr[i]*Tr[i]))*Pr[i])+((A[9] +(A[10]*Tr[i]))*(Pr[i]*Pr[i])) - (log10(Pr[i]))); + + else + A[1] := 2.05135; + A[2] := -2.10889; + A[3] := 0; + A[4] := -0.19396; + A[5] := 0.02282; + A[6] := 0.08852; + A[7] := 0; + A[8] := -0.00872; + A[9] := -0.00353; + A[10] := 0.00203; + + v0[i] := 10^(A[1] + (A[2]/Tr[i]) + (A[3]*Tr[i])+(A[4] *Tr[i] *Tr[i])+(A[5] *Tr[i]*Tr[i]*Tr[i])+((A[6] +(A[7] *Tr[i]) +(A[8]*Tr[i]*Tr[i]))*Pr[i])+((A[9] +(A[10]*Tr[i]))*(Pr[i]*Pr[i])) - (log10(Pr[i]))); + + end if; + + v1[i] := 10^(-4.23893 + (8.65808 * Tr[i]) - (1.2206 / Tr[i]) - (3.15224 * Tr[i] ^ 3) - 0.025 * (Pr[i] - 0.6)); + + if(v1[i] == 0) then + v[i] := 10^(log10(v0[i]) ); + else + v[i] := 10^(log10(v0[i]) + (w[i] * log10(v1[i]))); + end if; + liqfugcoeff[i] := v[i] * gamma[i]; + end for; + + end Liquid_Fugacity_Coeffcient; + +end Thermodynamic_Functions; diff --git a/Simulator/Simulator/Files/Thermodynamic_Functions/package.order b/Simulator/Simulator/Files/Thermodynamic_Functions/package.order new file mode 100644 index 0000000..bc1aa91 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Functions/package.order @@ -0,0 +1,22 @@ +Psat +LiqCpId +VapCpId +HV +HLiqId +HVapId +SId +Dens +BIPNRTL +Tow_UNIQUAC +BIP_UNIQUAC +BIP_PR +FindString +index +Density_Racket +PoyntingCF +Solublity_Parameter +EOS_ConstantII +EOS_ConstantIII +EOS_Constant1V +EOS_Constants +Liquid_Fugacity_Coeffcient diff --git a/Simulator/Simulator/Files/Thermodynamic_Packages/Grayson_Streed.mo b/Simulator/Simulator/Files/Thermodynamic_Packages/Grayson_Streed.mo new file mode 100644 index 0000000..7e1c18c --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Packages/Grayson_Streed.mo @@ -0,0 +1,206 @@ +within Simulator.Files.Thermodynamic_Packages; + +model Grayson_Streed +// import Simulator.Files.Thermodynamic_Functions.*; +// parameter Real R_gas = 8.314; +// parameter Real u = 1; +// import Simulator.Files.*; +// //w=Acentric Factor +// //Sp = Solublity Parameter +// //V = Molar Volume +// //All the above three parameters have to be mentioned as arguments while extending the thermodynamic Package Grayson Streed +// parameter Real w[NOC]; +// parameter Real Sp[NOC](each unit = "(cal/mL)^0.5"); +// parameter Real V[NOC](each unit = "mL/mol"); +// parameter Real Tc[NOC] = comp.Tc; +// parameter Real Pc[NOC] = comp.Pc; +// parameter Real R = 8314470; +// Real resMolSpHeat[3], resMolEnth[3], resMolEntr[3]; +// Real K[NOC]; +// Real S(start = 3), gamma[NOC]; +// Real liqfugcoeff[NOC](each start = 2), vapfugcoeff[NOC](each start = 0.99), vapfugcoeff_dew[NOC](each start = 1.2); +// Real S_bubl, liqfugcoeff_bubl[NOC](each start = 1.5), gamma_bubl[NOC]; +// //Vapour Phase Fugacity coefficient +// Real a[NOC], b[NOC]; +// Real a_ij[NOC, NOC]; +// Real amv, amv_dew, bmv, bmv_dew; +// Real AG, AG_dew, BG(start = 3), BG_dew; +// Real Zv(start = 3), Zv_dew; +// Real t1[NOC], t3[NOC], t4, t2(start = 10); +// Real t1_dew[NOC], t3_dew[NOC], t4_dew, t2_dew(start = 10); +// Real CV[4], Z_RV[3, 2], ZV[3]; +// Real CV_dew[4], Z_RV_dew[3, 2], ZV_dew[3]; +// Real gammaBubl[NOC](each start = 0.5), gammaDew[NOC](each start = 2.06221); +// Real gamma_liq[NOC], Psat[NOC]; +// Real A[NOC], B[NOC], C[NOC], D[NOC], E, G, H[NOC], I, J; +// Real dewLiqMolFrac[NOC]; +// Real Tr[NOC]; +// Real Pr_bubl[NOC](each start = 2); +// Real v0[NOC](each start = 2), v1[NOC](each start = 2), v[NOC]; +// Real Vs, Vtot; +//equation +////====================================================================================================== +////Calculation Routine for Liquid Phase Fugacity Coefficient +// S = Solublity_Parameter(NOC, V, Sp, compMolFrac[2, :]); +// for i in 1:NOC loop +// gamma[i] = exp(V[i] * (Sp[i] - S) ^ 2 / (R * T)); +// end for; +// liqfugcoeff = Liquid_Fugacity_Coeffcient(NOC, Sp, Tc, Pc, w, T, P, V, S, gamma); +// for i in 1:NOC loop +// Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); +// gamma_liq[i] = liqfugcoeff[i] * (P / Psat[i]); +// end for; +////======================================================================================================== +////Calculation Routine for Vapour Phase Fugacity Coefficient +////Calculation of Equation of State Constants +// a = EOS_Constants(NOC, Tc, Pc, T); +// b = EOS_ConstantII(NOC, Tc, Pc, T); +// a_ij = EOS_ConstantIII(NOC, a); +// amv = EOS_Constant1V(NOC, compMolFrac[3, :], a_ij); +// bmv = sum(compMolFrac[3, :] .* b[:]); +// AG = amv * P / (R_gas * T) ^ 2; +// BG = bmv * P / (R_gas * T); +// for i in 1:NOC loop +// if bmv == 0 then +// C[i] = 0; +// else +// C[i] = b[i] / bmv; +// end if; +// end for; +// for i in 1:NOC loop +// if amv == 0 then +// D[i] = 0; +// else +// D[i] = a[i] / amv; +// end if; +// end for; +// for i in 1:NOC loop +// t1[i] = b[i] * (Zv - 1) / bmv; +// t3[i] = AG / (BG * u ^ 2 ^ 0.5) * (C[i] - 2 * D[i] ^ 0.5); +// end for; +// t4 = log((2 * Zv + BG * (u + u ^ 2 ^ 0.5)) / (2 * Zv + BG * (u - u ^ 2 ^ 0.5))); +// t2 = -log(Zv - BG); +// resMolSpHeat[:] = zeros(3); +// resMolEnth[:] = zeros(3); +// resMolEntr[:] = zeros(3); +// for i in 1:NOC loop +// vapfugcoeff[i] = exp(t1[i] + t2 + t3[i] * t4); +// K[i] = liqfugcoeff[i] / vapfugcoeff[i]; +// end for; +////==================================================================================================== +////Bubble Point Algorithm +// Vtot = sum(compMolFrac[1, :] .* V[:]); +// Vs = sum(compMolFrac[1, :] .* V[:] .* Sp[:]); +// S_bubl = Vs / Vtot; +// for i in 1:NOC loop +// gamma_bubl[i] = exp(V[i] * (Sp[i] - S_bubl) ^ 2 / (R * T)); +// end for; +// for i in 1:NOC loop +// Tr[i] = T / Tc[i]; +// if Pc[i] <= 0 then +// Pr_bubl[i] = 0; +// else +// Pr_bubl[i] = Pbubl / Pc[i]; +// end if; +// if Tc[i] == 33.19 then +// v0[i] = 10 ^ (1.50709 + 2.74283 / Tr[i] + (-0.0211) * Tr[i] + 0.00011 * Tr[i] * Tr[i] + 0.008585 - log10(Pr_bubl[i])); +// elseif Tc[i] == 190.56 then +// v0[i] = 10 ^ (1.36822 + (-1.54831) / Tr[i] + 0.02889 * Tr[i] * Tr[i] + (-0.01076) * Tr[i] * Tr[i] * Tr[i] + 0.10486 + (-0.02529) * Tr[i] - log10(Pr_bubl[i])); +// else +// v0[i] = 10 ^ (2.05135 + (-2.10889) / Tr[i] + (-0.19396) * Tr[i] * Tr[i] + 0.02282 * Tr[i] * Tr[i] * Tr[i] + (0.08852 + (-0.00872) * Tr[i] * Tr[i]) * Pr_bubl[i] + ((-0.00353) + 0.00203 * Tr[i]) * (Pr_bubl[i] * Pr_bubl[i]) - log10(Pr_bubl[i])); +// end if; +// v1[i] = 10 ^ ((-4.23893) + 8.65808 * Tr[i] - 1.2206 / Tr[i] - 3.15224 * Tr[i] ^ 3 - 0.025 * (Pr_bubl[i] - 0.6)); +// if v1[i] == 0 then +// v[i] = 10 ^ log10(v0[i]); +// else +// v[i] = 10 ^ (log10(v0[i]) + w[i] * log10(v1[i])); +// end if; +// liqfugcoeff_bubl[i] = v[i] * gamma_bubl[i]; +// end for; +// for i in 1:NOC loop +// gammaBubl[i] = liqfugcoeff_bubl[i] * (Pbubl / Psat[i]); +// end for; +////=================================================================================== +////Dew Point Algorithm +// for i in 1:NOC loop +// if gammaDew[i] * Psat[i] == 0 then +// dewLiqMolFrac[i] = 0; +// else +// dewLiqMolFrac[i] = compMolFrac[1, i] * Pdew / (gammaDew[i] * Psat[i]); +// end if; +// end for; +// amv_dew = EOS_Constant1V(NOC, dewLiqMolFrac[:], a_ij); +// bmv_dew = sum(dewLiqMolFrac[:] .* b[:]); +// AG_dew = amv_dew * Pdew / (R_gas * T) ^ 2; +// BG_dew = bmv_dew * Pdew / (R_gas * T); +// for i in 1:NOC loop +// if bmv_dew == 0 then +// A[i] = 0; +// else +// A[i] = b[i] / bmv_dew; +// end if; +// end for; +// for i in 1:NOC loop +// if amv_dew == 0 then +// B[i] = 0; +// else +// B[i] = a[i] / amv_dew; +// end if; +// end for; +// if BG_dew * u ^ 2 ^ 0.5 == 0 then +// E = 0; +// else +// E = BG_dew * u ^ 2 ^ 0.5; +// end if; +// if E == 0 then +// G = 0; +// else +// G = AG_dew / E; +// end if; +// if bmv_dew == 0 then +// I = 0; +// else +// I = (Zv_dew - 1) / bmv_dew; +// end if; +// if Zv_dew - BG_dew <= 0 then +// J = 0; +// else +// J = -log(Zv_dew - BG_dew); +// end if; +// for i in 1:NOC loop +// t1_dew[i] = b[i] * I; +// t3_dew[i] = G * (A[i] - 2 * B[i] ^ 0.5); +// end for; +// if (2 * Zv_dew + BG_dew * (u + u ^ 2 ^ 0.5)) / (2 * Zv_dew + BG_dew * (u - u ^ 2 ^ 0.5)) <= 0 then +// t4_dew = 0; +// else +// t4_dew = log((2 * Zv_dew + BG_dew * (u + u ^ 2 ^ 0.5)) / (2 * Zv_dew + BG_dew * (u - u ^ 2 ^ 0.5))); +// end if; +// t2_dew = J; +// for i in 1:NOC loop +// vapfugcoeff_dew[i] = exp(t1_dew[i] + t2_dew + t3_dew[i] * t4_dew); +// if Psat[i] == 0 then +// H[i] = 0; +// else +// H[i] = Pdew / Psat[i]; +// end if; +// gammaDew[i] = vapfugcoeff_dew[i] * H[i]; +// end for; +//algorithm +// CV_dew[1] := 1; +// CV_dew[2] := -(1 + BG_dew - u * BG_dew); +// CV_dew[3] := AG_dew - u * BG_dew - u * BG_dew ^ 2; +// CV_dew[4] := -AG_dew * BG_dew; +// Z_RV_dew := Modelica.Math.Vectors.Utilities.roots(CV_dew); +// ZV_dew := {Z_RV_dew[i, 1] for i in 1:3}; +// Zv_dew := max({ZV_dew}); +//algorithm +// CV[1] := 1; +// CV[2] := -(1 + BG - u * BG); +// CV[3] := AG - u * BG - u * BG ^ 2; +// CV[4] := -AG * BG; +// Z_RV := Modelica.Math.Vectors.Utilities.roots(CV); +// ZV := {Z_RV[i, 1] for i in 1:3}; +// Zv := max({ZV}); +////========================================================================================================== +end Grayson_Streed; diff --git a/Simulator/Simulator/Files/Thermodynamic_Packages/NRTL.mo b/Simulator/Simulator/Files/Thermodynamic_Packages/NRTL.mo new file mode 100644 index 0000000..47067b2 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Packages/NRTL.mo @@ -0,0 +1,32 @@ +within Simulator.Files.Thermodynamic_Packages; + +model NRTL + import Simulator.Files.Thermodynamic_Functions.*; + Simulator.Files.Models.gammaNRTL Gamma(NOC = NOC, comp = comp, molFrac = compMolFrac[2, :], T = T), dewGamma(NOC = NOC, comp = comp, molFrac = dewLiqMolFrac, T = T), bublGamma(NOC = NOC, comp = comp, molFrac = compMolFrac[1, :], T = T); + Real dewLiqMolFrac[NOC], density[NOC]; + Real resMolSpHeat[3] "residual specific heat", resMolEnth[3] "residual enthalpy", resMolEntr[3] "residual Entropy", K[NOC], gamma[NOC](each start = 1), gammaBubl[NOC](each start = 1), gammaDew[NOC](each start = 1); + Real liqfugcoeff_bubl[NOC], vapfugcoeff_dew[NOC], Psat[NOC]; +equation + gamma = Gamma.gamma; + for i in 1:NOC loop + dewLiqMolFrac[i] = compMolFrac[1, i] * Pdew / (gammaDew[i] * Psat[i]); + density[i] = Dens(comp[i].LiqDen, comp[i].Tc, T, P); + end for; + for i in 1:NOC loop + liqfugcoeff_bubl[i] = 1; + vapfugcoeff_dew[i] = 1; + end for; + for i in 1:NOC loop + gammaBubl[i] = bublGamma.gamma[i]; + gammaDew[i] = dewGamma.gamma[i]; + end for; + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + end for; + for i in 1:NOC loop + K[i] = gamma[i] * Psat[i] / P; + end for; + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr = zeros(3); +end NRTL; diff --git a/Simulator/Simulator/Files/Thermodynamic_Packages/Peng_Robinson.mo b/Simulator/Simulator/Files/Thermodynamic_Packages/Peng_Robinson.mo new file mode 100644 index 0000000..877b541 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Packages/Peng_Robinson.mo @@ -0,0 +1,148 @@ +within Simulator.Files.Thermodynamic_Packages; + +model Peng_Robinson + import Simulator.Files.*; + parameter Real R = 8.314; + // feed composition + Real Tr[NOC](each start = 100) "reduced temperature"; + Real b[NOC]; + Real a[NOC](each start = 0.5); + Real m[NOC]; + Real q[NOC]; + parameter Real kij[NOC, NOC](each start = 1) = Simulator.Files.Thermodynamic_Functions.BIP_PR(NOC, comp.name); + Real aij[NOC, NOC]; + Real K[NOC](each start = 0.2); + Real Psat[NOC]; + Real liqfugcoeff[NOC](each start = 5); + Real vapfugcoeff[NOC](each start = 5); + Real gammaBubl[NOC], gammaDew[NOC]; + Real liqfugcoeff_bubl[NOC], vapfugcoeff_dew[NOC]; + Real resMolSpHeat[3], resMolEnth[3], resMolEntr[3]; + //Liquid Fugacity Coefficient + Real aML, bML; + Real AL, BL; + Real CL[4]; + Real Z_RL[3, 2]; + Real ZL[3], ZLL; + Real sum_xaL[NOC]; + //Vapour Fugacity Coefficient + Real aMV, bMV; + Real AV, BV; + Real CV[4]; + Real Z_RV[3, 2]; + Real ZV[3], ZvV; + Real sum_yaV[NOC]; + Real A, B, C, D[NOC], E, F, G, H[NOC], I[NOC], J[NOC]; + Real gamma[NOC]; +equation + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + gammaDew[i] = 1; + gammaBubl[i] = 1; + liqfugcoeff_bubl[i] = 1; + vapfugcoeff_dew[i] = 1; + gamma[i] = 1; + end for; + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr[:] = zeros(3); + Tr = T ./ comp.Tc; + b = 0.0778 * R * comp.Tc ./ comp.Pc; + m = 0.37464 .+ 1.54226 * comp.AF .- 0.26992 * comp.AF .^ 2; + q = 0.45724 * R ^ 2 * comp.Tc .^ 2 ./ comp.Pc; + a = q .* (1 .+ m .* (1 .- sqrt(Tr))) .^ 2; + aij = {{(1 - kij[i, j]) * sqrt(a[i] * a[j]) for i in 1:NOC} for j in 1:NOC}; +//Liquid_Fugacity Coefficient Calculation Routine + aML = sum({{compMolFrac[2, i] * compMolFrac[2, j] * aij[i, j] for i in 1:NOC} for j in 1:NOC}); + bML = sum(b .* compMolFrac[2, :]); + AL = aML * P / (R * T) ^ 2; + BL = bML * P / (R * T); + CL[1] = 1; + CL[2] = BL - 1; + CL[3] = AL - 3 * BL ^ 2 - 2 * BL; + CL[4] = BL ^ 3 + BL ^ 2 - AL * BL; + Z_RL = Modelica.Math.Vectors.Utilities.roots(CL); + ZL = {Z_RL[i, 1] for i in 1:3}; + ZLL = min({ZL}); + sum_xaL = {sum({compMolFrac[2, j] * aij[i, j] for j in 1:NOC}) for i in 1:NOC}; + if ZLL + 2.4142135 * BL <= 0 then + A = 1; + else + A = ZLL + 2.4142135 * BL; + end if; + if ZLL - 0.414213 * BL <= 0 then + B = 1; + else + B = ZLL - 0.414213 * BL; + end if; + if ZLL - BL <= 0 then + C = 0; + else + C = log(ZLL - BL); + end if; + for i in 1:NOC loop + if bML == 0 then + D[i] = 0; + else + D[i] = b[i] / bML; + end if; + end for; + for i in 1:NOC loop + if aML == 0 then + J[i] = 0; + else + J[i] = sum_xaL[i] / aML; + end if; + end for; + liqfugcoeff = exp(AL / (BL * sqrt(8)) * log(A / B) .* (D .- 2 * J) .+ (ZLL - 1) * D .- C); +//Vapour Fugacity Calculation Routine + aMV = sum({{compMolFrac[3, i] * compMolFrac[3, j] * aij[i, j] for i in 1:NOC} for j in 1:NOC}); + bMV = sum(b .* compMolFrac[3, :]); + AV = aMV * P / (R * T) ^ 2; + BV = bMV * P / (R * T); + CV[1] = 1; + CV[2] = BV - 1; + CV[3] = AV - 3 * BV ^ 2 - 2 * BV; + CV[4] = BV ^ 3 + BV ^ 2 - AV * BV; + Z_RV = Modelica.Math.Vectors.Utilities.roots(CV); + ZV = {Z_RV[i, 1] for i in 1:3}; + ZvV = max({ZV}); + sum_yaV = {sum({compMolFrac[3, j] * aij[i, j] for j in 1:NOC}) for i in 1:NOC}; + if ZvV + 2.4142135 * BV <= 0 then + E = 1; + else + E = ZvV + 2.4142135 * BV; + end if; + if ZvV - 0.414213 * BV <= 0 then + F = 1; + else + F = ZvV - 0.414213 * BV; + end if; + if ZvV - BV <= 0 then + G = 0; + else + G = log(ZvV - BV); + end if; + for i in 1:NOC loop + if bMV == 0 then + H[i] = 0; + else + H[i] = b[i] / bMV; + end if; + end for; + for i in 1:NOC loop + if aMV == 0 then + I[i] = 0; + else + I[i] = sum_yaV[i] / aMV; + end if; + end for; + vapfugcoeff = exp(AV / (BV * sqrt(8)) * log(E / F) .* (H .- 2 * I) .+ (ZvV - 1) * H .- G); + for i in 1:NOC loop + if liqfugcoeff[i] == 0 or vapfugcoeff[i] == 0 then + K[i] = 0; + else + K[i] = liqfugcoeff[i] / vapfugcoeff[i]; + end if; + end for; +end Peng_Robinson; diff --git a/Simulator/Simulator/Files/Thermodynamic_Packages/Raoults_Law.mo b/Simulator/Simulator/Files/Thermodynamic_Packages/Raoults_Law.mo new file mode 100644 index 0000000..c67fb4f --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Packages/Raoults_Law.mo @@ -0,0 +1,25 @@ +within Simulator.Files.Thermodynamic_Packages; + +model Raoults_Law + import Simulator.Files.Thermodynamic_Functions.*; + Real K[NOC](each min = 0), resMolSpHeat[3], resMolEnth[3], resMolEntr[3]; + Real gamma[NOC], gammaBubl[NOC], gammaDew[NOC]; + Real liqfugcoeff_bubl[NOC], vapfugcoeff_dew[NOC], Psat[NOC]; +equation + for i in 1:NOC loop + gamma[i] = 1; + gammaBubl[i] = 1; + gammaDew[i] = 1; + liqfugcoeff_bubl[i] = 1; + vapfugcoeff_dew[i] = 1; + end for; + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + end for; + for j in 1:NOC loop + K[j] = Psat[j] / P; + end for; + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr[:] = zeros(3); +end Raoults_Law; diff --git a/Simulator/Simulator/Files/Thermodynamic_Packages/UNIFAC.mo b/Simulator/Simulator/Files/Thermodynamic_Packages/UNIFAC.mo new file mode 100644 index 0000000..a7f2512 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Packages/UNIFAC.mo @@ -0,0 +1,188 @@ +within Simulator.Files.Thermodynamic_Packages; + +model UNIFAC + //Libraries + import Simulator.Files.*; + extends Simulator.Files.Thermodynamic_Functions; + //Parameter Section + parameter Integer m = 4 "substitue of number of different group"; + parameter Integer k = 4 "number of different group in component i"; + //Van de wal surface area and volume constant's + parameter Real V[NOC, k] = {{1, 1, 1, 0}, {1, 0, 1, 0}} "number of group of kind k in molecule "; + parameter Real R[NOC, k] = {{0.9011, 0.6744, 1.6724, 0}, {0.9011, 0, 1.6724, 0}} "group volume of group k "; + parameter Real Q[NOC, k] = {{0.848, 0.540, 1.448, 0}, {0.848, 0, 1.448, 0}} "group surface area of group k"; + //Intreraction parameter + parameter Real a[m, k] = {{0, 0, 476.4, 1318}, {0, 0, 476.4, 1318}, {26.76, 26.76, 0, 472.5}, {300, 300, -195.4, 0}} "Binary intraction parameter"; + Real Psat[NOC] "Saturated Vapour Pressure at the input temperature"; + //Intermediate values used to compute UNIFAC R and Q values + Real q[NOC] "Van der walls molecular surface area"; + Real r[NOC] "Van der walls molecular volume"; + Real e[k, NOC] "Group Surface area fraction of comp i"; + Real tau[m, k] "Boltzmann factors"; + Real B[NOC, k] "UNIFAC parameter "; + Real theta[k] "UNIFAC parameter"; + Real sum[NOC]; + Real S[k] "Unifac parameter "; + Real J[NOC] "Surface area fraction of comp i"; + Real L[NOC] "Molecular volume fraction of comp i"; + //Activity Coefficients + Real gammac[NOC] "Combinatorial activity coefficient of comp i"; + Real gammar[NOC] "Residual activity coefficient of comp i"; + Real gamma[NOC] " Activity coefficient"; + Real K[NOC] "Equlibrium constant of compound i"; + //Fugacity coefficient at the Bubble and Dew Points + Real liqfugcoeff_bubl[NOC], vapfugcoeff_dew[NOC]; + //Activity Coefficient at the Bubble and Dew Points + Real gammaBubl[NOC], gammaDew[NOC](each start = 1.5); + //Excess Energy Properties + Real resMolSpHeat[3], resMolEnth[3], resMolEntr[3]; + //=============================================================================== + //Bubble Point Calculation Variables + Real theta_bubl[k] "UNIFAC parameter"; + Real S_bubl[k] "Unifac parameter "; + Real J_bubl[NOC] "Surface area fraction of comp i"; + Real L_bubl[NOC] "Molecular volume fraction of comp i"; + Real gammac_bubl[NOC] "Combinatorial activity coefficient of components at bubble point"; + Real gammar_bubl[NOC] "Residual activity coefficient of components at bubble point"; + Real sum_bubl[NOC]; + //=============================================================================== + //Dew Point Calculation Routine + Real theta_dew[k] "UNIFAC parameter"; + Real S_dew[k] "Unifac parameter "; + Real J_dew[NOC] "Surface area fraction of comp i"; + Real L_dew[NOC] "Molecular volume fraction of comp i"; + Real gammac_dew[NOC] "combinatorial activity coefficient of components at dew point"; + Real gammar_dew[NOC] "residual activity coefficient of components at dew point"; + Real sum_dew[NOC]; + Real dewLiqMolFrac[NOC](each start = 0.5); + //============================================================================== +equation + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr[:] = zeros(3); + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP[:], T); + end for; + for i in 1:NOC loop + liqfugcoeff_bubl[i] = 1; + vapfugcoeff_dew[i] = 1; + end for; + for i in 1:m loop +//tau_m_k=exp((-a_m_k)/t) + tau[i, :] = exp((-a[i, :]) / T); + end for; +// Equlibrium constant + for i in 1:NOC loop + K[i] = gamma[i] * Psat[i] / P; + end for; +//surface area constant + for i in 1:NOC loop + q[i] = sum(V[i, :] .* Q[i, :]); +//surface volume constant + r[i] = sum(V[i, :] .* R[i, :]); + e[:, i] = V[i, :] .* Q[i, :] / q[i]; + end for; + for i in 1:NOC loop + J[i] = r[i] / sum(r[:] .* compMolFrac[2, :]); + L[i] = q[i] / sum(q[:] .* compMolFrac[2, :]); + gammac[i] = exp(1 - J[i] + log(J[i]) + (-5 * q[i] * (1 - J[i] / L[i] + log(J[i] / L[i])))); + end for; +//======================================================================================= + for j in 1:k loop + theta[j] = sum(compMolFrac[2, :] .* q[:] .* e[j, :]) / sum(compMolFrac[2, :] .* q[:]); + end for; + for i in 1:k loop + S[i] = sum(theta[:] .* tau[:, i]); + end for; +algorithm + for i in 1:NOC loop + for j in 1:k loop + for l in 1:m loop + B[i, j] := sum(e[:, i] .* tau[:, j]); + end for; + end for; + end for; + sum[:] := fill(0, NOC); + for j in 1:k loop + for i in 1:NOC loop + sum[i] := sum[i] + theta[j] * B[i, j] / S[j] - e[j, i] * log(B[i, j] / S[j]); + gammar[i] := exp(q[i] * (1 - sum[i])); + end for; + end for; +equation +// activity coefficient: + for i in 1:NOC loop + gamma[i] = exp(log(gammar[i]) + log(gammac[i])); + end for; +//=============================================================================================== +//Bubble Point Calculation Routine + for i in 1:NOC loop + J_bubl[i] = r[i] / sum(r[:] .* compMolFrac[1, :]); + L_bubl[i] = q[i] / sum(q[:] .* compMolFrac[1, :]); + gammac_bubl[i] = exp(1 - J_bubl[i] + log(J_bubl[i]) + (-5 * q[i] * (1 - J_bubl[i] / L_bubl[i] + log(J_bubl[i] / L_bubl[i])))); + end for; + for j in 1:k loop + theta_bubl[j] = sum(compMolFrac[1, :] .* q[:] .* e[j, :]) / sum(compMolFrac[1, :] .* q[:]); + end for; + for i in 1:k loop + S_bubl[i] = sum(theta_bubl[:] .* tau[:, i]); + end for; +algorithm + sum_bubl[:] := fill(0, NOC); + for j in 1:k loop + for i in 1:NOC loop + sum_bubl[i] := sum_bubl[i] + theta_bubl[j] * B[i, j] / S_bubl[j] - e[j, i] * log(B[i, j] / S_bubl[j]); + gammar_bubl[i] := exp(q[i] * (1 - sum_bubl[i])); + end for; + end for; +equation + for i in 1:NOC loop + gammaBubl[i] = exp(log(gammar_bubl[i]) + log(gammac_bubl[i])); + end for; +//======================================================================================================= +//Dew Point Calculation Routine + for i in 1:NOC loop + dewLiqMolFrac[i] = compMolFrac[1, i] * Pdew / (gammaDew[i] * Psat[i]); + end for; + for i in 1:NOC loop + J_dew[i] = r[i] / sum(r[:] .* dewLiqMolFrac[:]); + L_dew[i] = q[i] / sum(q[:] .* dewLiqMolFrac[:]); + gammac_dew[i] = exp(1 - J_dew[i] + log(J_dew[i]) + (-5 * q[i] * (1 - J_dew[i] / L_dew[i] + log(J_dew[i] / L_dew[i])))); + end for; + for j in 1:k loop + theta_dew[j] = sum(dewLiqMolFrac[:] .* q[:] .* e[j, :]) / sum(dewLiqMolFrac[:] .* q[:]); + end for; + for i in 1:k loop + S_dew[i] = sum(theta_dew[:] .* tau[:, i]); + end for; +algorithm + sum_dew[:] := fill(0, NOC); + for j in 1:k loop + for i in 1:NOC loop + sum_dew[i] := sum_dew[i] + theta_dew[j] * B[i, j] / S_dew[j] - e[j, i] * log(B[i, j] / S_dew[j]); + gammar_dew[i] := exp(q[i] * (1 - sum_dew[i])); + end for; + end for; +equation + for i in 1:NOC loop + gammaDew[i] = exp(log(gammar_dew[i]) + log(gammac_dew[i])); + end for; +//=================================================================================================s + annotation( + Documentation(info = "<html> + <p> + UNIFAC-Universal Functional group Model + </p> + <b>Description</b>:<br> + </p> + UNIFAC(Univeral functional group) model is a semi empherical system to determine the activity coefficient in non ideal mixtures. It makes use of the functional group present in the chemical molecule to predict the phase equlibria of the system. + The activity coefficent comprises of two major contibutions named as combinatorial and residual contribution + Combinatorial contribution focusses on the deviation from ideality as a result of molecular shape while the residual contribution quantifies the interaction between different groups in the system.<br> + </p> + <b>Equations and References</b>:<br> + </p>https://wikimedia.org/api/rest_v1/media/math/render/svg/b6eb40a653fe590b5bfa137fe76342eef6a502d2 + </p> + </tr> + </html>"), + experiment(StopTime = 1.0, Interval = 0.001)); +end UNIFAC; diff --git a/Simulator/Simulator/Files/Thermodynamic_Packages/UNIQUAC.mo b/Simulator/Simulator/Files/Thermodynamic_Packages/UNIQUAC.mo new file mode 100644 index 0000000..9b46fb4 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Packages/UNIQUAC.mo @@ -0,0 +1,345 @@ +within Simulator.Files.Thermodynamic_Packages; + +model UNIQUAC + //Libraries + import Simulator.Files.*; + //Parameter Section + //Binary Interaction Parameters + //Function :BIP_UNIQUAC is used to obtain the interaction parameters + parameter Real a[NOC, NOC] = Thermodynamic_Functions.BIP_UNIQUAC(NOC, comp.name); + //Uniquac Parameters R and Q called from Chemsep Database + parameter Real R[NOC] = comp.UniquacR; + parameter Real Q[NOC] = comp.UniquacQ; + parameter Integer Z = 10 "Compresseblity-Factor"; + //Variable Section + Real tow[NOC, NOC] "Energy interaction parameter"; + //Intermediate variables to calculate the combinatorial and residual part of activity coefficient at the input conditions + Real r(each start = 2, min = 0, max = 1), q(each start = 2); + Real teta[NOC]; + Real S[NOC](each start = 1); + Real sum[NOC]; + //Activity Coefficients + Real gammac[NOC](each start = 1.2) "Combinatorial Part of activity coefficent at input conditions"; + Real gammar[NOC](each start = 1.2) "Residual part of activity coefficient at input conditions"; + Real gamma_new[NOC](each start = 1.2); + Real gamma[NOC](each start = 1.2) "Activity coefficient with Poynting correction"; + //Fugacity coefficient + Real phil[NOC](each start = 0.5) "Fugacity coefficient at the input conditions"; + //Dew Point Calculation Variables + Real dewLiqMolFrac[NOC](each start = 0.5, each min = 0, each max = 1); + //Intermediate variables to calculate the combinatorial and residual part of activity coefficient at dew point + Real r_dew(start = 2), q_dew(start = 2); + Real teta_dew[NOC](each start = 2); + Real S_dew[NOC](each start = 1); + Real sum_dew[NOC](each start = 2); + //Activity Coefficients + Real gammac_dew[NOC](each start = 5) "Combinatorial Part of activity coefficent at dew point"; + Real gammar_dew[NOC](each start = 2.5) "Residual part of activity coefficient at dew point"; + Real gammaDew_old[NOC](each start = 2.2) "Combinatorial Part of activity coefficent(without correction)"; + Real gammaDew[NOC](each start = 2.2) "Activity coefficent at dew point"; + //Fugacity coefficient + Real vapfugcoeff_dew[NOC] "Vapour Fugacity coefficient at dew point"; + Real phil_dew[NOC](each start = 0.5); + Real PCF_dew[NOC] "Poynting Correction Factor"; + //Bubble Point Calculation Variables + //Intermediate variables to calculate the combinatorial and residual part of activity coefficient at bubble point + Real r_bubl(start = 2), q_bubl(start = 2); + Real teta_bubl[NOC]; + Real S_bubl[NOC]; + Real sum_bubl[NOC]; + //Activity Coefficients + Real gammac_bubl[NOC](each start = 2) "Combinatorial Part of activity coefficent at bubble point"; + Real gammar_bubl[NOC](each start = 1) "Residual part of activity coefficent at bubble point"; + Real gammaBubl_old[NOC](each start = 1) "Combinatorial Part of activity coefficent(without correction)"; + Real gammaBubl[NOC](each start = 1) "Activity coefficent at bubble point"; + //Fugacity coefficient + Real liqfugcoeff_bubl[NOC]; + Real phil_bubl[NOC](each start = 0.5) "Liquid Phase Fugacity coefficient"; + Real PCF_bubl[NOC] "Poynting Correction Factor"; + //Phase Envelope + Real Psat[NOC](each unit = "Pa") "Saturated Vapour Pressure at the input temperature"; + Real PCF[NOC] "Poynting correction factor"; + Real K[NOC](each start = 0.7) "Distribution Coefficient"; + //Residual Energy Parameters + Real resMolSpHeat[3], resMolEnth[3], resMolEntr[3]; + //Transport Properties at the input conditions + Real Density[NOC](each unit = "kmol/m^3"); + Real A[NOC], B[NOC], D[NOC], E[NOC], Ff[NOC]; + Real C[NOC]; + Real A_bubl[NOC], B_bubl[NOC], C_bubl[NOC], D_bubl[NOC], E_bubl[NOC], F_bubl[NOC]; + Real A_dew[NOC], B_dew[NOC], C_dew[NOC], D_dew[NOC], E_dew[NOC], F_dew[NOC]; + //=========================================================================================================== + //Equation Section +equation +//Fugacity coefficients set to 1 since the model type is Activity Coefficient + for i in 1:NOC loop + liqfugcoeff_bubl[i] = 1; + vapfugcoeff_dew[i] = 1; + end for; +//Calculation of Intermediate parameters to evaluate combinatorial and residual part of the activity coefficient +//Note : compMolFrac is the referenced from "Material Stream" model + r = sum(compMolFrac[2, :] .* R[:]); + q = sum(compMolFrac[2, :] .* Q[:]); +//Calculation of Energy interaction parameter at the input tempetraure +//Function :Tow_UNIQUAC is used to instantiated + tow = Simulator.Files.Thermodynamic_Functions.Tow_UNIQUAC(NOC, a, T); +//Calculation of Combinatorial and Residual Activity coefficient + for i in 1:NOC loop + if q > 0 then + teta[i] = compMolFrac[2, i] * Q[i] * (1 / q); + elseif q < 0 then + teta[i] = 0; + else + teta[i] = 0; + end if; + end for; + for i in 1:NOC loop + if teta[i] == 0 then + S[i] = 1; + else + S[i] = sum(teta[:] .* tow[i, :]); + end if; + if S[i] == 1 then + sum[i] = 0; + else + sum[i] = sum(teta[:] .* tow[i, :] ./ S[:]); + end if; + end for; + for i in 1:NOC loop + if S[i] == 1 then + C[i] = 0; + elseif S[i] > 0 then + C[i] = log(S[i]); + else + C[i] = 0; + end if; + gammar[i] = exp(Q[i] * (1 - C[i] - sum[i])); + end for; +// //=================================================================== +// equation + for i in 1:NOC loop + if r > 0 then + D[i] = R[i] / r; + elseif r <= 0 then + D[i] = 0; + else + D[i] = 0; + end if; + if q > 0 then + E[i] = Q[i] / q; + elseif q <= 0 then + E[i] = 0; + else + E[i] = 0; + end if; + if E[i] == 0 or D[i] == 0 then + Ff[i] = 0; + else + Ff[i] = D[i] / E[i]; + end if; + if D[i] > 0 then + A[i] = log(D[i]); + elseif D[i] == 1 then + A[i] = 0; + else + A[i] = 0; + end if; + if Ff[i] > 1 then + B[i] = log(Ff[i]); + elseif Ff[i] == 1 then + B[i] = 0; + else + B[i] = 0; + end if; + log(gammac[i]) = 1 - D[i] + A[i] + (-Z / 2 * Q[i] * (1 - Ff[i] + B[i])); + gamma[i] = gammac[i] * gammar[i]; + end for; +//===================================================================================================== +//Excess Energy parameters are set to 0 since the calculation mode is Ideal + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr[:] = zeros(3); +//Calculation of Saturated vapour pressure and Density at the given input condition + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + Density[i] = Simulator.Files.Thermodynamic_Functions.Dens(comp[i].LiqDen, comp[i].Tc, T, P) * 1E-3; + end for; +//Calculation of Poynting correction Factor at input conditions,Bubble Point and Dew Point +//Function :Poynting_CF is called from the Simulator Package + PCF[:] = Thermodynamic_Functions.PoyntingCF(NOC, comp[:].Pc, comp[:].Tc, comp[:].Racketparam, comp[:].AF, comp[:].MW, T, P, gamma[:], Psat[:], Density[:]); + PCF_bubl[:] = Thermodynamic_Functions.PoyntingCF(NOC, comp[:].Pc, comp[:].Tc, comp[:].Racketparam, comp[:].AF, comp[:].MW, T, Pbubl, gamma[:], Psat[:], Density[:]); + PCF_dew[:] = Thermodynamic_Functions.PoyntingCF(NOC, comp[:].Pc, comp[:].Tc, comp[:].Racketparam, comp[:].AF, comp[:].MW, T, Pdew, gamma[:], Psat[:], Density[:]); +//Calculation of Fugacity coefficient with Poynting correction + phil[:] = gamma[:] .* Psat[:] ./ P .* PCF[:]; + phil[:] = gamma_new[:] .* Psat[:] ./ P; +//Calculation of Distribution coefficient + K[:] = gamma_new[:] .* Psat[:] ./ P; +//Binary Phase Envelope +//The same calculation routine is followed at the DewPoint +//Dew Point + r_dew = sum(dewLiqMolFrac[:] .* R[:]); + q_dew = sum(dewLiqMolFrac[:] .* Q[:]); + for i in 1:NOC loop + if q_dew == 0 or compMolFrac[1, i] == 0 then + dewLiqMolFrac[i] = 0; + else + dewLiqMolFrac[i] = compMolFrac[1, i] * Pdew / (gammaDew[i] * Psat[i]); + end if; + if q_dew == 0 or dewLiqMolFrac[i] == 0 then + teta_dew[i] = 0; + else + teta_dew[i] = dewLiqMolFrac[i] * Q[i] * (1 / q_dew); + end if; + if teta_dew[i] == 0 then + S_dew[i] = 1; + else + S_dew[i] = sum(teta_dew[:] .* tow[i, :]); + end if; + end for; +//=================================================================================================== + for i in 1:NOC loop + if S_dew[i] == 1 then + sum_dew[i] = 0; + else + sum_dew[i] = sum(teta_dew[:] .* tow[i, :] ./ S_dew[:]); + end if; + if S_dew[i] == 1 then + C_dew[i] = 0; + elseif S_dew[i] > 0 then + C_dew[i] = log(S_dew[i]); + else + C_dew[i] = 0; + end if; + gammar_dew[i] = exp(Q[i] * (1 - C_dew[i] - sum_dew[i])); + end for; +//=============================================================================================== + for i in 1:NOC loop + if r_dew == 0 then + D_dew[i] = 0; + else + D_dew[i] = R[i] / r_dew; + end if; + if q_dew == 0 then + E_dew[i] = 0; + else + E_dew[i] = Q[i] / q_dew; + end if; + if E_dew[i] == 0 then + F_dew[i] = 0; + else + F_dew[i] = D_dew[i] / E_dew[i]; + end if; + if D_dew[i] > 0 then + A_dew[i] = log(D_dew[i]); + elseif D_dew[i] == 1 then + A_dew[i] = 0; + else + A_dew[i] = 0; + end if; + if F_dew[i] > 0 then + B_dew[i] = log(F_dew[i]); + elseif F_dew[i] == 1 then + B_dew[i] = 0; + else + B_dew[i] = 0; + end if; + log(gammac_dew[i]) = 1 - D_dew[i] + A_dew[i] + (-Z / 2 * Q[i] * (1 - F_dew[i] + B_dew[i])); + gammaDew_old[i] = gammac_dew[i] * gammar_dew[i]; + end for; + for i in 1:NOC loop + if Pdew == 0 then + phil_dew[i] = 1; + gammaDew[i] = 1; + else + phil_dew[i] = gammaDew_old[i] .* Psat[i] ./ Pdew .* PCF_dew[i]; + phil_dew[i] = gammaDew[i] .* Psat[i] ./ Pdew; + end if; + end for; +//The same calculation routine is followed at the Bubble Point +//Bubble Point + r_bubl = sum(compMolFrac[1, :] .* R[:]); + q_bubl = sum(compMolFrac[1, :] .* Q[:]); + for i in 1:NOC loop + if compMolFrac[1, i] == 0 then + teta_bubl[i] = 0; + else + teta_bubl[i] = compMolFrac[1, i] * Q[i] * (1 / q_bubl); + end if; + if teta_bubl[i] == 0 then + S_bubl[i] = 1; + else + S_bubl[i] = sum(teta_bubl[:] .* tow[i, :]); + end if; + if S_bubl[i] == 1 then + sum_bubl[i] = 0; + else + sum_bubl[i] = sum(teta_bubl[:] .* tow[i, :] ./ S_bubl[:]); + end if; + if S_bubl[i] == 1 then + C_bubl[i] = 0; + elseif S_bubl[i] > 0 then + C_bubl[i] = log(S_bubl[i]); + else + C_bubl[i] = 0; + end if; + log(gammar_bubl[i]) = Q[i] * (1 - C_bubl[i] - sum_bubl[i]); +//========================================================================================================= + if r_bubl == 0 then + D_bubl[i] = 0; + else + D_bubl[i] = R[i] / r_bubl; + end if; + if q_bubl == 0 then + E_bubl[i] = 0; + else + E_bubl[i] = Q[i] / q_bubl; + end if; + if E_bubl[i] == 0 then + F_bubl[i] = 0; + else + F_bubl[i] = D_bubl[i] / E_bubl[i]; + end if; + if D_bubl[i] > 0 then + A_bubl[i] = log(D_bubl[i]); + elseif D_bubl[i] == 1 then + A_bubl[i] = 0; + else + A_bubl[i] = 0; + end if; + if F_bubl[i] > 0 then + B_bubl[i] = log(F_bubl[i]); + elseif F_bubl[i] == 1 then + B_bubl[i] = 0; + else + B_bubl[i] = 0; + end if; + log(gammac_bubl[i]) = 1 - D_bubl[i] + A_bubl[i] + (-Z / 2 * Q[i] * (1 - F_bubl[i] + B_bubl[i])); + gammaBubl_old[i] = gammac_bubl[i] * gammar_bubl[i]; + end for; + for i in 1:NOC loop + if Pbubl == 0 then + phil_bubl[i] = 1; + gammaBubl[i] = 1; + else + phil_bubl[i] = gammaBubl_old[i] .* Psat[i] ./ Pbubl .* PCF_bubl[i]; + phil_bubl[i] = gammaBubl[i] .* Psat[i] ./ Pbubl; + end if; + end for; + annotation( + Documentation(info = "<html> + <p> + UNIQUAC-Universal Quasi Coefficient Model + </p> + <b>Description</b>:<br> + </p> + UNIQUAC(Univeral Quasi Coefficient) model is an activity coefficient based thermodynamic model used to predict phase equilibria in Chemical Engineering. + The activity coefficent comprises of two major contibutions named as combinatorial and residual contribution + Combinatorial contribution focusses on the deviation from ideality as a result of molecular shape while the residual contribution quantifies the enthalpic correction caused by the change in interactive forces between different molecules.<br> + </p> + <b>Equations and References</b>:<br> + </p>https://wikimedia.org/api/rest_v1/media/math/render/svg/21b673ea8edb013fc1675d11b7e40263bef90ffa + </p> + </tr> + </html>"), + experiment(StopTime = 1.0, Interval = 0.001)); +end UNIQUAC; diff --git a/Simulator/Simulator/Files/Thermodynamic_Packages/package.mo b/Simulator/Simulator/Files/Thermodynamic_Packages/package.mo new file mode 100644 index 0000000..d91716e --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Packages/package.mo @@ -0,0 +1,1063 @@ +within Simulator.Files; + +package Thermodynamic_Packages + model Raoults_Law + import Simulator.Files.Thermodynamic_Functions.*; + Real K[NOC](each min = 0), resMolSpHeat[3], resMolEnth[3], resMolEntr[3]; + Real gamma[NOC], gammaBubl[NOC], gammaDew[NOC]; + Real liqfugcoeff_bubl[NOC], vapfugcoeff_dew[NOC],Psat[NOC]; + equation + for i in 1:NOC loop + gamma[i] = 1; + gammaBubl[i] = 1; + gammaDew[i] = 1; + liqfugcoeff_bubl[i] = 1; + vapfugcoeff_dew[i] = 1; + end for; + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + end for; + + for j in 1:NOC loop + K[j] = Psat[j] / P; + end for; + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr[:] = zeros(3); + end Raoults_Law; + + model NRTL + import Simulator.Files.Thermodynamic_Functions.*; + Simulator.Files.Models.gammaNRTL Gamma(NOC = NOC, comp = comp, molFrac = compMolFrac[2, :], T = T), dewGamma(NOC = NOC, comp = comp, molFrac = dewLiqMolFrac, T = T), bublGamma(NOC = NOC, comp = comp, molFrac = compMolFrac[1, :], T = T); + Real dewLiqMolFrac[NOC], density[NOC]; + Real resMolSpHeat[3] "residual specific heat", resMolEnth[3] "residual enthalpy", resMolEntr[3] "residual Entropy", K[NOC], gamma[NOC](each start = 1), gammaBubl[NOC](each start = 1), gammaDew[NOC](each start = 1); + Real liqfugcoeff_bubl[NOC], vapfugcoeff_dew[NOC],Psat[NOC]; + equation + gamma = Gamma.gamma; + for i in 1:NOC loop + dewLiqMolFrac[i] = compMolFrac[1, i] * Pdew / (gammaDew[i] * Psat[i]); + density[i] = Dens(comp[i].LiqDen, comp[i].Tc, T, P); + end for; + for i in 1:NOC loop + liqfugcoeff_bubl[i] = 1; + vapfugcoeff_dew[i] = 1; + end for; + for i in 1:NOC loop + gammaBubl[i] = bublGamma.gamma[i]; + gammaDew[i] = dewGamma.gamma[i]; + end for; + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + end for; + for i in 1:NOC loop + K[i] = gamma[i] * Psat[i] / P; + end for; + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr = zeros(3); + end NRTL; + + + + model UNIQUAC + //Libraries + import Simulator.Files.*; + //Parameter Section + //Binary Interaction Parameters + //Function :BIP_UNIQUAC is used to obtain the interaction parameters + parameter Real a[NOC, NOC] = Thermodynamic_Functions.BIP_UNIQUAC(NOC, comp.name); + //Uniquac Parameters R and Q called from Chemsep Database + parameter Real R[NOC] = comp.UniquacR; + parameter Real Q[NOC] = comp.UniquacQ; + parameter Integer Z = 10 "Compresseblity-Factor"; + //Variable Section + Real tow[NOC, NOC] "Energy interaction parameter"; + //Intermediate variables to calculate the combinatorial and residual part of activity coefficient at the input conditions + Real r(each start=2, min=0,max=1), q(each start=2); + Real teta[NOC]; + Real S[NOC](each start = 1); + Real sum[NOC]; + //Activity Coefficients + Real gammac[NOC](each start = 1.2) "Combinatorial Part of activity coefficent at input conditions"; + Real gammar[NOC](each start = 1.2) "Residual part of activity coefficient at input conditions"; + Real gamma_new[NOC](each start = 1.2); + Real gamma[NOC](each start = 1.2) "Activity coefficient with Poynting correction"; + //Fugacity coefficient + Real phil[NOC](each start = 0.5) "Fugacity coefficient at the input conditions"; + //Dew Point Calculation Variables + Real dewLiqMolFrac[NOC](each start=0.5, each min=0, each max=1); + //Intermediate variables to calculate the combinatorial and residual part of activity coefficient at dew point + Real r_dew(start=2), q_dew(start=2); + Real teta_dew[NOC](each start=2); + Real S_dew[NOC](each start = 1); + Real sum_dew[NOC](each start=2); + //Activity Coefficients + Real gammac_dew[NOC](each start = 5) "Combinatorial Part of activity coefficent at dew point"; + Real gammar_dew[NOC](each start = 2.5) "Residual part of activity coefficient at dew point"; + Real gammaDew_old[NOC](each start = 2.2) "Combinatorial Part of activity coefficent(without correction)"; + Real gammaDew[NOC](each start = 2.2) "Activity coefficent at dew point"; + //Fugacity coefficient + Real vapfugcoeff_dew[NOC] "Vapour Fugacity coefficient at dew point"; + Real phil_dew[NOC](each start = 0.5); + Real PCF_dew[NOC] "Poynting Correction Factor"; + //Bubble Point Calculation Variables + //Intermediate variables to calculate the combinatorial and residual part of activity coefficient at bubble point + Real r_bubl(start=2), q_bubl(start=2); + Real teta_bubl[NOC]; + Real S_bubl[NOC]; + Real sum_bubl[NOC]; + //Activity Coefficients + Real gammac_bubl[NOC](each start = 2) "Combinatorial Part of activity coefficent at bubble point"; + Real gammar_bubl[NOC](each start = 1) "Residual part of activity coefficent at bubble point"; + Real gammaBubl_old[NOC](each start = 1) "Combinatorial Part of activity coefficent(without correction)"; + Real gammaBubl[NOC](each start = 1) "Activity coefficent at bubble point"; + //Fugacity coefficient + Real liqfugcoeff_bubl[NOC]; + Real phil_bubl[NOC](each start = 0.5) "Liquid Phase Fugacity coefficient"; + Real PCF_bubl[NOC] "Poynting Correction Factor"; + //Phase Envelope + Real Psat[NOC](each unit = "Pa") "Saturated Vapour Pressure at the input temperature"; + Real PCF[NOC] "Poynting correction factor"; + Real K[NOC](each start = 0.7) "Distribution Coefficient"; + //Residual Energy Parameters + Real resMolSpHeat[3], resMolEnth[3], resMolEntr[3]; + //Transport Properties at the input conditions + Real Density[NOC](each unit = "kmol/m^3"); + Real A[NOC],B[NOC],D[NOC],E[NOC],Ff[NOC]; + Real C[NOC]; + Real A_bubl[NOC],B_bubl[NOC],C_bubl[NOC],D_bubl[NOC],E_bubl[NOC],F_bubl[NOC]; + Real A_dew[NOC],B_dew[NOC],C_dew[NOC],D_dew[NOC],E_dew[NOC],F_dew[NOC]; + //=========================================================================================================== + //Equation Section + equation + //Fugacity coefficients set to 1 since the model type is Activity Coefficient + for i in 1:NOC loop + liqfugcoeff_bubl[i] = 1; + vapfugcoeff_dew[i] = 1; + end for; + //Calculation of Intermediate parameters to evaluate combinatorial and residual part of the activity coefficient + //Note : compMolFrac is the referenced from "Material Stream" model + + r = sum(compMolFrac[2, :] .* R[:]); + q = sum(compMolFrac[2, :] .* Q[:]); + + //Calculation of Energy interaction parameter at the input tempetraure + //Function :Tow_UNIQUAC is used to instantiated + tow = Simulator.Files.Thermodynamic_Functions.Tow_UNIQUAC(NOC, a, T); + //Calculation of Combinatorial and Residual Activity coefficient + + for i in 1:NOC loop + if(q>0) then + teta[i] = compMolFrac[2, i] * Q[i] * (1 / q); + elseif(q<0) then + teta[i]=0; + else + teta[i]=0; + end if; + end for; + + for i in 1:NOC loop + if (teta[i]==0) then + S[i]=1; + else + S[i] = sum(teta[:] .* tow[i, :]); + end if; + + if(S[i]==1) then + sum[i]=0; + else + sum[i] = sum(teta[:] .* tow[i, :] ./ S[:]); + end if; + end for; + + for i in 1:NOC loop + + if(S[i]==1) then + C[i] = 0; + elseif(S[i]>0) then + C[i] = log(S[i]); + else + C[i]=0; + end if; + + (gammar[i]) = exp(Q[i] * (1 - C[i] - sum[i])); + end for; + // //=================================================================== + // equation + + for i in 1:NOC loop + if(r>0) then + D[i] = R[i]/r; + elseif(r<=0) then + D[i] =0; + else + D[i]=0; + end if; + + if(q>0) then + E[i] = Q[i]/q; + elseif(q<=0) then + E[i] = 0; + else + E[i] = 0; + end if; + + if(E[i]==0 or D[i]==0) then + Ff[i]=0; + else + Ff[i] = D[i]/E[i]; + end if; + + + if(D[i]>0) then + A[i] =log(D[i]); + elseif(D[i]==1) then + A[i]=0; + else + A[i]=0; + end if; + + if(Ff[i]>1) then + B[i] =log(Ff[i]); + elseif(Ff[i]==1) then + B[i]=0; + else + B[i]=0; + end if; + + log(gammac[i])=1-D[i] + A[i] + (-Z / 2 * Q[i] * (1 - Ff[i] + B[i])); + + (gamma[i]) = (gammac[i]) * (gammar[i]); + end for; + //===================================================================================================== + //Excess Energy parameters are set to 0 since the calculation mode is Ideal + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr[:] = zeros(3); + //Calculation of Saturated vapour pressure and Density at the given input condition + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + Density[i] = Simulator.Files.Thermodynamic_Functions.Dens(comp[i].LiqDen, comp[i].Tc, T, P) * 1E-3; + end for; + //Calculation of Poynting correction Factor at input conditions,Bubble Point and Dew Point + //Function :Poynting_CF is called from the Simulator Package + PCF[:] = Thermodynamic_Functions.PoyntingCF(NOC, comp[:].Pc, comp[:].Tc, comp[:].Racketparam, comp[:].AF, comp[:].MW, T, P, gamma[:], Psat[:], Density[:]); + PCF_bubl[:] = Thermodynamic_Functions.PoyntingCF(NOC, comp[:].Pc, comp[:].Tc, comp[:].Racketparam, comp[:].AF, comp[:].MW, T, Pbubl, gamma[:], Psat[:], Density[:]); + PCF_dew[:] = Thermodynamic_Functions.PoyntingCF(NOC, comp[:].Pc, comp[:].Tc, comp[:].Racketparam, comp[:].AF, comp[:].MW, T, Pdew, gamma[:], Psat[:], Density[:]); + //Calculation of Fugacity coefficient with Poynting correction + phil[:] = gamma[:] .* Psat[:] ./ P .* PCF[:]; + phil[:] = gamma_new[:] .* Psat[:] ./ P; + //Calculation of Distribution coefficient + K[:] = gamma_new[:] .* Psat[:] ./ P; + //Binary Phase Envelope + //The same calculation routine is followed at the DewPoint + //Dew Point + r_dew = sum(dewLiqMolFrac[:] .* R[:]); + q_dew = sum(dewLiqMolFrac[:] .* Q[:]); + for i in 1:NOC loop + if(q_dew==0 or compMolFrac[1,i]==0) then + dewLiqMolFrac[i]=0; + else + dewLiqMolFrac[i] = compMolFrac[1, i] * Pdew / (gammaDew[i] * Psat[i]); + end if; + if(q_dew==0 or dewLiqMolFrac[i]==0) then + teta_dew[i]=0; + else + teta_dew[i] = dewLiqMolFrac[i] * Q[i] * (1 / q_dew); + end if; + if(teta_dew[i]==0) then + S_dew[i] =1; + else + S_dew[i] = sum(teta_dew[:] .* tow[i, :]); + end if; + end for; + //=================================================================================================== + + for i in 1:NOC loop + if(S_dew[i]==1) then + sum_dew[i]=0; + else + sum_dew[i] = sum(teta_dew[:] .* tow[i, :] ./ (S_dew[:])); + end if; + + + if(S_dew[i]==1) then + C_dew[i]=0; + elseif(S_dew[i]>0) then + C_dew[i] =log(S_dew[i]); + else + C_dew[i]=0; + end if; + + (gammar_dew[i]) = exp(Q[i] * (1 - C_dew[i] - sum_dew[i])); + end for; + //=============================================================================================== + + for i in 1:NOC loop + if(r_dew==0) then + D_dew[i] =0; + else + D_dew[i] = R[i]/r_dew; + end if; + + if(q_dew==0) then + E_dew[i] = 0; + else + E_dew[i] = Q[i]/q_dew; + end if; + + if(E_dew[i]==0) then + F_dew[i]=0; + else + F_dew[i] = D_dew[i]/E_dew[i]; + end if; + + + if(D_dew[i]>0) then + A_dew[i] =log(D_dew[i]); + elseif(D_dew[i]==1) then + A_dew[i]=0; + else + A_dew[i]=0; + end if; + + if(F_dew[i]>0) then + B_dew[i] =log(F_dew[i]); + elseif(F_dew[i]==1) then + B_dew[i]=0; + else + B_dew[i]=0; + end if; + + log(gammac_dew[i])=1-D_dew[i] + A_dew[i] + (-Z / 2 * Q[i] * (1 - F_dew[i] + B_dew[i])); + + (gammaDew_old[i]) = (gammac_dew[i]) * (gammar_dew[i]); + end for; + + for i in 1:NOC loop + if(Pdew==0) then + phil_dew[i]=1; + gammaDew[i]=1; + + else + + phil_dew[i] = gammaDew_old[i] .* Psat[i] ./ Pdew .* PCF_dew[i]; + phil_dew[i] = gammaDew[i] .* Psat[i] ./ Pdew; + end if; + end for; + //The same calculation routine is followed at the Bubble Point + //Bubble Point + r_bubl = sum(compMolFrac[1, :] .* R[:]); + q_bubl = sum(compMolFrac[1, :] .* Q[:]); + for i in 1:NOC loop + if(compMolFrac[1,i]==0) then + teta_bubl[i]=0; + else + teta_bubl[i] = compMolFrac[1, i] * Q[i] * (1 / q_bubl); + end if; + + if(teta_bubl[i]==0) then + S_bubl[i] =1; + else + S_bubl[i] = sum(teta_bubl[:] .* tow[i, :]); + end if; + + if(S_bubl[i]==1) then + sum_bubl[i]=0; + else + sum_bubl[i] = sum(teta_bubl[:] .* tow[i, :] ./ S_bubl[:]); + end if; + + + if(S_bubl[i]==1) then + C_bubl[i] =0 ; + elseif(S_bubl[i]>0) then + C_bubl[i]=log(S_bubl[i]); + else + C_bubl[i]=0; + end if; + log(gammar_bubl[i]) = Q[i] * (1 - C_bubl[i] - sum_bubl[i]); + //========================================================================================================= + + if(r_bubl==0) then + D_bubl[i] =0; + else + D_bubl[i] = R[i]/r_bubl; + end if; + + if(q_bubl==0) then + E_bubl[i] = 0; + else + E_bubl[i] = Q[i]/q_bubl; + end if; + + if(E_bubl[i]==0) then + F_bubl[i]=0; + else + F_bubl[i] = D_bubl[i]/E_bubl[i]; + end if; + + + if(D_bubl[i]>0) then + A_bubl[i] =log(D_bubl[i]); + elseif(D_bubl[i]==1) then + A_bubl[i]=0; + else + A_bubl[i]=0; + end if; + + if(F_bubl[i]>0) then + B_bubl[i] =log(F_bubl[i]); + elseif(F_bubl[i]==1) then + B_bubl[i]=0; + else + B_bubl[i]=0; + end if; + + log(gammac_bubl[i])=1-D_bubl[i] + A_bubl[i] + (-Z / 2 * Q[i] * (1 - F_bubl[i] + B_bubl[i])); + + (gammaBubl_old[i]) = (gammac_bubl[i]) * (gammar_bubl[i]); + end for; + + for i in 1:NOC loop + if(Pbubl==0) then + phil_bubl[i]=1; + gammaBubl[i]=1; + else + phil_bubl[i] = gammaBubl_old[i] .* Psat[i] ./ Pbubl .* PCF_bubl[i]; + phil_bubl[i] = gammaBubl[i] .* Psat[i] ./ Pbubl; + end if; + end for; + annotation( + Documentation(info = "<html> + <p> + UNIQUAC-Universal Quasi Coefficient Model + </p> + <b>Description</b>:<br> + </p> + UNIQUAC(Univeral Quasi Coefficient) model is an activity coefficient based thermodynamic model used to predict phase equilibria in Chemical Engineering. + The activity coefficent comprises of two major contibutions named as combinatorial and residual contribution + Combinatorial contribution focusses on the deviation from ideality as a result of molecular shape while the residual contribution quantifies the enthalpic correction caused by the change in interactive forces between different molecules.<br> + </p> + <b>Equations and References</b>:<br> + </p>https://wikimedia.org/api/rest_v1/media/math/render/svg/21b673ea8edb013fc1675d11b7e40263bef90ffa + </p> + </tr> + </html>"), + experiment(StopTime = 1.0, Interval = 0.001)); + end UNIQUAC; + + + + + //======================================================================================================= + + model UNIFAC + //Libraries + import Simulator.Files.*; + extends Simulator.Files.Thermodynamic_Functions; + //Parameter Section + parameter Integer m = 4 "substitue of number of different group"; + parameter Integer k = 4 "number of different group in component i"; + //Van de wal surface area and volume constant's + parameter Real V[NOC, k] = {{1,1,1,0},{1,0,1,0}} "number of group of kind k in molecule "; + parameter Real R[NOC, k] = {{0.9011,0.6744,1.6724,0},{0.9011,0,1.6724,0}} "group volume of group k "; + parameter Real Q[NOC, k] = {{0.848,0.540,1.448,0},{0.848,0,1.448,0}} "group surface area of group k"; + //Intreraction parameter + parameter Real a[m, k]={{0,0,476.4,1318},{0,0,476.4,1318},{26.76,26.76,0,472.5},{300,300,-195.4,0}} "Binary intraction parameter"; + Real Psat[NOC] "Saturated Vapour Pressure at the input temperature"; + //Intermediate values used to compute UNIFAC R and Q values + Real q[NOC] "Van der walls molecular surface area"; + Real r[NOC] "Van der walls molecular volume"; + Real e[k, NOC] "Group Surface area fraction of comp i"; + Real tau[m, k] "Boltzmann factors"; + Real B[NOC, k] "UNIFAC parameter "; + Real theta[k] "UNIFAC parameter"; + Real sum[NOC]; + Real S[k] "Unifac parameter "; + Real J[NOC] "Surface area fraction of comp i"; + Real L[NOC] "Molecular volume fraction of comp i"; + //Activity Coefficients + Real gammac[NOC] "Combinatorial activity coefficient of comp i"; + Real gammar[NOC] "Residual activity coefficient of comp i"; + Real gamma[NOC] " Activity coefficient"; + Real K[NOC] "Equlibrium constant of compound i"; + //Fugacity coefficient at the Bubble and Dew Points + Real liqfugcoeff_bubl[NOC], vapfugcoeff_dew[NOC]; + //Activity Coefficient at the Bubble and Dew Points + Real gammaBubl[NOC], gammaDew[NOC](each start = 1.5); + //Excess Energy Properties + Real resMolSpHeat[3], resMolEnth[3], resMolEntr[3]; + //=============================================================================== + //Bubble Point Calculation Variables + Real theta_bubl[k] "UNIFAC parameter"; + Real S_bubl[k] "Unifac parameter "; + Real J_bubl[NOC] "Surface area fraction of comp i"; + Real L_bubl[NOC] "Molecular volume fraction of comp i"; + Real gammac_bubl[NOC] "Combinatorial activity coefficient of components at bubble point"; + Real gammar_bubl[NOC] "Residual activity coefficient of components at bubble point"; + Real sum_bubl[NOC]; + //=============================================================================== + //Dew Point Calculation Routine + Real theta_dew[k] "UNIFAC parameter"; + Real S_dew[k] "Unifac parameter "; + Real J_dew[NOC] "Surface area fraction of comp i"; + Real L_dew[NOC] "Molecular volume fraction of comp i"; + Real gammac_dew[NOC] "combinatorial activity coefficient of components at dew point"; + Real gammar_dew[NOC] "residual activity coefficient of components at dew point"; + Real sum_dew[NOC]; + Real dewLiqMolFrac[NOC](each start = 0.5); + //============================================================================== + equation + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr[:] = zeros(3); + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP[:], T); + end for; + for i in 1:NOC loop + liqfugcoeff_bubl[i] = 1; + vapfugcoeff_dew[i] = 1; + end for; + for i in 1:m loop +//tau_m_k=exp((-a_m_k)/t) + tau[i, :] = exp((-a[i, :]) / T); + end for; +// Equlibrium constant + for i in 1:NOC loop + K[i] = gamma[i] * Psat[i] / P; + end for; +//surface area constant + for i in 1:NOC loop + q[i] = sum(V[i, :] .* Q[i, :]); +//surface volume constant + r[i] = sum(V[i, :] .* R[i, :]); + e[:, i] = V[i, :] .* Q[i, :] / q[i]; + end for; + for i in 1:NOC loop + J[i] = r[i] / sum(r[:] .* compMolFrac[2, :]); + L[i] = q[i] / sum(q[:] .* compMolFrac[2, :]); + gammac[i] = exp(1 - J[i] + log(J[i]) + (-5 * q[i] * (1 - J[i] / L[i] + log(J[i] / L[i])))); + end for; +//======================================================================================= + for j in 1:k loop + theta[j] = sum(compMolFrac[2, :] .* q[:] .* e[j, :]) / sum(compMolFrac[2, :] .* q[:]); + end for; + for i in 1:k loop + S[i] = sum(theta[:] .* tau[:, i]); + end for; + algorithm + for i in 1:NOC loop + for j in 1:k loop + for l in 1:m loop + B[i, j] := sum(e[:, i] .* tau[:, j]); + end for; + end for; + end for; + sum[:] := fill(0, NOC); + for j in 1:k loop + for i in 1:NOC loop + sum[i] := sum[i] + theta[j] * B[i, j] / S[j] - e[j, i] * log(B[i, j] / S[j]); + gammar[i] := exp(q[i] * (1 - sum[i])); + end for; + end for; + equation +// activity coefficient: + for i in 1:NOC loop + gamma[i] = exp(log(gammar[i]) + log(gammac[i])); + end for; +//=============================================================================================== +//Bubble Point Calculation Routine + for i in 1:NOC loop + J_bubl[i] = r[i] / sum(r[:] .* compMolFrac[1, :]); + L_bubl[i] = q[i] / sum(q[:] .* compMolFrac[1, :]); + gammac_bubl[i] = exp(1 - J_bubl[i] + log(J_bubl[i]) + (-5 * q[i] * (1 - J_bubl[i] / L_bubl[i] + log(J_bubl[i] / L_bubl[i])))); + end for; + for j in 1:k loop + theta_bubl[j] = sum(compMolFrac[1, :] .* q[:] .* e[j, :]) / sum(compMolFrac[1, :] .* q[:]); + end for; + for i in 1:k loop + S_bubl[i] = sum(theta_bubl[:] .* tau[:, i]); + end for; + algorithm + sum_bubl[:] := fill(0, NOC); + for j in 1:k loop + for i in 1:NOC loop + sum_bubl[i] := sum_bubl[i] + theta_bubl[j] * B[i, j] / S_bubl[j] - e[j, i] * log(B[i, j] / S_bubl[j]); + gammar_bubl[i] := exp(q[i] * (1 - sum_bubl[i])); + end for; + end for; + equation + for i in 1:NOC loop + gammaBubl[i] = exp(log(gammar_bubl[i]) + log(gammac_bubl[i])); + end for; +//======================================================================================================= +//Dew Point Calculation Routine + for i in 1:NOC loop + dewLiqMolFrac[i] = compMolFrac[1, i] * Pdew / (gammaDew[i] * Psat[i]); + end for; + for i in 1:NOC loop + J_dew[i] = r[i] / sum(r[:] .* dewLiqMolFrac[:]); + L_dew[i] = q[i] / sum(q[:] .* dewLiqMolFrac[:]); + gammac_dew[i] = exp(1 - J_dew[i] + log(J_dew[i]) + (-5 * q[i] * (1 - J_dew[i] / L_dew[i] + log(J_dew[i] / L_dew[i])))); + end for; + for j in 1:k loop + theta_dew[j] = sum(dewLiqMolFrac[:] .* q[:] .* e[j, :]) / sum(dewLiqMolFrac[:] .* q[:]); + end for; + for i in 1:k loop + S_dew[i] = sum(theta_dew[:] .* tau[:, i]); + end for; + algorithm + sum_dew[:] := fill(0, NOC); + for j in 1:k loop + for i in 1:NOC loop + sum_dew[i] := sum_dew[i] + theta_dew[j] * B[i, j] / S_dew[j] - e[j, i] * log(B[i, j] / S_dew[j]); + gammar_dew[i] := exp(q[i] * (1 - sum_dew[i])); + end for; + end for; + equation + for i in 1:NOC loop + gammaDew[i] = exp(log(gammar_dew[i]) + log(gammac_dew[i])); + end for; +//=================================================================================================s + annotation( + Documentation(info = "<html> + <p> + UNIFAC-Universal Functional group Model + </p> + <b>Description</b>:<br> + </p> + UNIFAC(Univeral functional group) model is a semi empherical system to determine the activity coefficient in non ideal mixtures. It makes use of the functional group present in the chemical molecule to predict the phase equlibria of the system. + The activity coefficent comprises of two major contibutions named as combinatorial and residual contribution + Combinatorial contribution focusses on the deviation from ideality as a result of molecular shape while the residual contribution quantifies the interaction between different groups in the system.<br> + </p> + <b>Equations and References</b>:<br> + </p>https://wikimedia.org/api/rest_v1/media/math/render/svg/b6eb40a653fe590b5bfa137fe76342eef6a502d2 + </p> + </tr> + </html>"), + experiment(StopTime = 1.0, Interval = 0.001)); + end UNIFAC; + + + + model Peng_Robinson + import Simulator.Files.*; + parameter Real R = 8.314; + // feed composition + Real Tr[NOC](each start = 100) "reduced temperature"; + Real b[NOC]; + Real a[NOC](each start = 0.5); + Real m[NOC]; + Real q[NOC]; + parameter Real kij[NOC, NOC](each start = 1) = Simulator.Files.Thermodynamic_Functions.BIP_PR(NOC, comp.name); + Real aij[NOC, NOC]; + Real K[NOC](each start = 0.2); + Real Psat[NOC]; + Real liqfugcoeff[NOC](each start = 5); + Real vapfugcoeff[NOC](each start = 5); + Real gammaBubl[NOC], gammaDew[NOC]; + Real liqfugcoeff_bubl[NOC], vapfugcoeff_dew[NOC]; + Real resMolSpHeat[3], resMolEnth[3], resMolEntr[3]; + //Liquid Fugacity Coefficient + Real aML, bML; + Real AL, BL; + Real CL[4]; + Real Z_RL[3, 2]; + Real ZL[3], ZLL; + Real sum_xaL[NOC]; + //Vapour Fugacity Coefficient + Real aMV, bMV; + Real AV, BV; + Real CV[4]; + Real Z_RV[3, 2]; + Real ZV[3], ZvV; + Real sum_yaV[NOC]; + + Real A,B,C,D[NOC],E,F,G,H[NOC],I[NOC],J[NOC]; + Real gamma[NOC]; + equation + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + gammaDew[i] = 1; + gammaBubl[i] = 1; + liqfugcoeff_bubl[i] = 1; + vapfugcoeff_dew[i] = 1; + gamma[i]=1; + end for; + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr[:] = zeros(3); + Tr = T ./ comp.Tc; + b = 0.0778 * R * comp.Tc ./ comp.Pc; + m = 0.37464 .+ 1.54226 * comp.AF .- 0.26992 * comp.AF .^ 2; + q = 0.45724 * R ^ 2 * comp.Tc .^ 2 ./ comp.Pc; + a = q .* (1 .+ m .* (1 .- sqrt(Tr))) .^ 2; + aij = {{(1 - kij[i, j]) * sqrt(a[i] * a[j]) for i in 1:NOC} for j in 1:NOC}; + + //Liquid_Fugacity Coefficient Calculation Routine + aML = sum({{compMolFrac[2, i] * compMolFrac[2, j] * aij[i, j] for i in 1:NOC} for j in 1:NOC}); + bML = sum(b .* compMolFrac[2, :]); + AL = aML * P / (R * T) ^ 2; + BL = bML * P / (R * T); + CL[1] = 1; + CL[2] = BL - 1; + CL[3] = AL - 3 * BL ^ 2 - 2 * BL; + CL[4] = BL ^ 3 + BL ^ 2 - AL * BL; + Z_RL = Modelica.Math.Vectors.Utilities.roots(CL); + ZL = {Z_RL[i, 1] for i in 1:3}; + ZLL = min({ZL}); + + sum_xaL = {sum({compMolFrac[2, j] * aij[i, j] for j in 1:NOC}) for i in 1:NOC}; + + if((ZLL + 2.4142135 * BL)<=0) then + A=1; + else + A=(ZLL + 2.4142135 * BL); + end if; + + if((ZLL - 0.414213 * BL)<=0) then + B=1; + else + B=(ZLL - 0.414213 * BL); + end if; + + if((ZLL - BL)<=0) then + C=0; + else + C= log(ZLL - BL); + end if; + + for i in 1:NOC loop + if(bML ==0) then + D[i] = 0; + else + D[i] = b[i]/bML; + end if; + end for; + + for i in 1:NOC loop + if(aML==0) then + J[i] = 0; + else + J[i] = sum_xaL[i]/aML; + end if; + end for; + + liqfugcoeff = exp(AL / (BL * sqrt(8)) * log(A /B) .* (D .- 2 * J) .+ (ZLL - 1) * (D) .- (C)); + + //Vapour Fugacity Calculation Routine + aMV = sum({{compMolFrac[3, i] * compMolFrac[3, j] * aij[i, j] for i in 1:NOC} for j in 1:NOC}); + bMV = sum(b .* compMolFrac[3, :]); + AV = aMV * P / (R * T) ^ 2; + BV = bMV * P / (R * T); + + CV[1] = 1; + CV[2] = BV - 1; + CV[3] = AV - 3 * BV ^ 2 - 2 * BV; + CV[4] = BV ^ 3 + BV ^ 2 - AV * BV; + + Z_RV = Modelica.Math.Vectors.Utilities.roots(CV); + ZV = {Z_RV[i, 1] for i in 1:3}; + ZvV = max({ZV}); + sum_yaV = {sum({compMolFrac[3, j] * aij[i, j] for j in 1:NOC}) for i in 1:NOC}; + + if((ZvV + 2.4142135 * BV)<=0) then + E=1; + else + E=(ZvV + 2.4142135 * BV); + end if; + + if((ZvV - 0.414213 * BV)<=0) then + F=1; + else + F=(ZvV - 0.414213 * BV); + end if; + + if((ZvV - BV)<=0) then + G=0; + else + G= log(ZvV - BV); + end if; + + for i in 1:NOC loop + if(bMV ==0) then + H[i] = 0; + else + H[i] = b[i]/bMV; + end if; + end for; + + for i in 1:NOC loop + if(aMV==0) then + I[i] = 0; + else + I[i] = sum_yaV[i]/aMV; + end if; + end for; + + vapfugcoeff = exp(AV / (BV * sqrt(8)) * log((E) /(F)) .* (H .- 2 * I) .+ (ZvV - 1) * (H) .- G); + + for i in 1:NOC loop + if(liqfugcoeff[i]==0 or vapfugcoeff[i]==0) then + K[i] = 0; + else + K[i] = liqfugcoeff[i]/vapfugcoeff[i]; + end if; + end for; + end Peng_Robinson; + +//============================================================================================================= + + model Grayson_Streed + + import Simulator.Files.Thermodynamic_Functions.*; + parameter Real R_gas = 8.314; + parameter Real u = 1; + import Simulator.Files.*; + + //w=Acentric Factor + //Sp = Solublity Parameter + //V = Molar Volume + //All the above three parameters have to be mentioned as arguments while extending the thermodynamic Package Grayson Streed + + parameter Real w[NOC] ; + parameter Real Sp[NOC](each unit = "(cal/mL)^0.5") ; + parameter Real V[NOC] (each unit = "mL/mol") ; + + parameter Real Tc[NOC] = comp.Tc; + parameter Real Pc[NOC] = comp.Pc; + parameter Real R= 8314470; + + Real resMolSpHeat[3],resMolEnth[3],resMolEntr[3]; + Real K[NOC] ; + Real S(start=3),gamma[NOC]; + Real liqfugcoeff[NOC](each start=2),vapfugcoeff[NOC](each start = 0.99),vapfugcoeff_dew[NOC](each start = 1.2); + + Real S_bubl,liqfugcoeff_bubl[NOC](each start=1.5),gamma_bubl[NOC]; + + //Vapour Phase Fugacity coefficient + Real a[NOC],b[NOC]; + Real a_ij[NOC,NOC]; + Real amv,amv_dew , bmv,bmv_dew; + Real AG ,AG_dew, BG(start=3),BG_dew; + Real Zv(start=3),Zv_dew; + Real t1[NOC], t3[NOC],t4,t2(start=10); + Real t1_dew[NOC], t3_dew[NOC],t4_dew,t2_dew(start=10); + Real CV[4],Z_RV[3,2],ZV[3]; + Real CV_dew[4],Z_RV_dew[3,2],ZV_dew[3]; + Real gammaBubl[NOC](each start = 0.5),gammaDew[NOC](each start= 2.06221); + Real gamma_liq[NOC],Psat[NOC]; + Real A[NOC],B[NOC],C[NOC],D[NOC],E,G,H[NOC],I,J; + + Real dewLiqMolFrac[NOC]; + Real Tr[NOC]; + Real Pr_bubl[NOC](each start=2); + Real v0[NOC](each start=2),v1[NOC](each start=2),v[NOC]; + Real Vs,Vtot; + + equation + + //====================================================================================================== + //Calculation Routine for Liquid Phase Fugacity Coefficient + S = Solublity_Parameter(NOC,V,Sp,compMolFrac[2,:]); + for i in 1:NOC loop + gamma[i] = exp(V[i] * ((Sp[i] - S) ^ 2) / (R * T)); + end for; + liqfugcoeff = Liquid_Fugacity_Coeffcient(NOC,Sp,Tc,Pc,w,T,P,V,S,gamma); + + for i in 1:NOC loop + Psat[i] = Simulator.Files.Thermodynamic_Functions.Psat(comp[i].VP, T); + gamma_liq[i] = liqfugcoeff[i] * (P/Psat[i]); + end for; + //======================================================================================================== + //Calculation Routine for Vapour Phase Fugacity Coefficient + //Calculation of Equation of State Constants + a = EOS_Constants(NOC,Tc,Pc,T); + b = EOS_ConstantII(NOC,Tc,Pc,T); + a_ij = EOS_ConstantIII(NOC,a); + amv = EOS_Constant1V(NOC,compMolFrac[3,:],a_ij); + bmv = sum(compMolFrac[3,:] .* b[:]); + + AG = (amv * P) / ((R_gas * T) ^ 2); + BG = (bmv * P) / ( R_gas * T); + + for i in 1:NOC loop + if(bmv==0) then + C[i]=0; + else + C[i]=b[i]/bmv; + end if; + end for; + + for i in 1:NOC loop + if(amv==0) then + D[i]=0; + else + D[i]=a[i]/amv; + end if; + end for; + + + for i in 1:NOC loop + t1[i] = b[i] * (Zv - 1)/ bmv; + t3[i] = AG /(BG * (((u) ^ 2)^ 0.5)) * ((C[i]) - ( 2 * ((D[i]) ^ 0.5))); + end for; + t4 = log(((2 * Zv) + (BG * (u + ((((u)^ 2)^ 0.5)))))/((2 * Zv) + (BG * (u - ((((u) ^ 2)^ 0.5)))))); + t2 = -log(Zv - BG); + + resMolSpHeat[:] = zeros(3); + resMolEnth[:] = zeros(3); + resMolEntr[:] = zeros(3); + + for i in 1:NOC loop + vapfugcoeff[i] = exp(t1[i] + t2 + (t3[i] * t4)); + K[i] = liqfugcoeff[i]/vapfugcoeff[i]; + end for; + + + //==================================================================================================== + //Bubble Point Algorithm + + Vtot = sum(compMolFrac[1,:] .* V[:]); + Vs = sum(compMolFrac[1,:] .* V[:] .* Sp[:]); + S_bubl = Vs / Vtot; + for i in 1:NOC loop + gamma_bubl[i] = exp(V[i] * ((Sp[i] - S_bubl) ^ 2) / (R * T)); + end for; + + for i in 1:NOC loop + Tr[i] = T / Tc[i]; + + if((Pc[i]<=0)) then + Pr_bubl[i] =0; + else + Pr_bubl[i] = Pbubl / Pc[i]; + end if; + + if(Tc[i] == 33.19) then + + (v0[i]) = 10^(( 1.50709)+(( 2.74283)/Tr[i])+((-0.0211)*Tr[i])+(( 0.00011)*Tr[i]*Tr[i])+(((0.008585)- (log10(Pr_bubl[i]))))); + + elseif(Tc[i] == 190.56) then + + (v0[i]) =10^((1.36822)+((-1.54831)/Tr[i])+((0.02889)*Tr[i]*Tr[i])+((-0.01076) *Tr[i]*Tr[i]*Tr[i])+(((0.10486)+((-0.02529)*Tr[i])-(log10(Pr_bubl[i]))))); + + else + + (v0[i]) = 10^((2.05135) + ((-2.10889)/Tr[i]) +((-0.19396) *Tr[i] *Tr[i])+((0.02282) *Tr[i]*Tr[i]*Tr[i])+(((0.08852)+((-0.00872)*Tr[i]*Tr[i]))*Pr_bubl[i])+(((-0.00353) +((0.00203)*Tr[i]))*(Pr_bubl[i]*Pr_bubl[i])) - (log10(Pr_bubl[i]))); + + end if; + + (v1[i]) = 10^(-4.23893 + (8.65808 * Tr[i]) - (1.2206 / Tr[i]) - (3.15224 * Tr[i] ^ 3) - 0.025 * (Pr_bubl[i] - 0.6)); + + if(v1[i] == 0) then + v[i] = 10^(log10(v0[i]) ); + else + v[i] = 10^(log10(v0[i]) + (w[i] * log10(v1[i]))); + end if; + liqfugcoeff_bubl[i] = v[i] * gamma_bubl[i]; + end for; + + for i in 1:NOC loop + gammaBubl[i] = liqfugcoeff_bubl[i] * (Pbubl/Psat[i]); + end for; + //=================================================================================== + //Dew Point Algorithm + for i in 1:NOC loop + if((gammaDew[i] * Psat[i]==0)) then + dewLiqMolFrac[i] = 0; + else + dewLiqMolFrac[i] = (compMolFrac[1, i] * Pdew) / (gammaDew[i] * Psat[i]); + end if; + end for; + + amv_dew = EOS_Constant1V(NOC,dewLiqMolFrac[:],a_ij); + bmv_dew = sum(dewLiqMolFrac[:] .* b[:]); + + AG_dew = (amv_dew * Pdew) / ((R_gas * T) ^ 2); + BG_dew = (bmv_dew * Pdew) / ( R_gas * T); + + for i in 1:NOC loop + if(bmv_dew==0) then + A[i]=0; + else + A[i] = b[i]/bmv_dew; + end if; + end for; + + for i in 1:NOC loop + if(amv_dew==0) then + B[i]=0; + else + B[i] = a[i]/amv_dew; + end if; + end for; + + if((BG_dew * (((u) ^ 2)^ 0.5))==0) then + E =0; + else + E = (BG_dew * (((u) ^ 2)^ 0.5)); + end if; + + if(E==0) then + G =0; + else + G = AG_dew /(E); + end if; + + if(bmv_dew==0) then + I =0; + else + I = (Zv_dew - 1)/ bmv_dew; + end if; + + if((Zv_dew - BG_dew)<=0) then + J = 0; + else + J = -log((Zv_dew - BG_dew)); + end if; + + for i in 1:NOC loop + t1_dew[i] = b[i] * I; + t3_dew[i] = G * ((A[i]) - ( 2 * ((B[i]) ^ 0.5))); + end for; + if((((2 * Zv_dew) + (BG_dew * (u + ((((u)^ 2)^ 0.5)))))/((2 * Zv_dew) + (BG_dew * (u - ((((u) ^ 2)^ 0.5))))))<=0) then + t4_dew =0; + else + t4_dew = log(((2 * Zv_dew) + (BG_dew * (u + ((((u)^ 2)^ 0.5)))))/((2 * Zv_dew) + (BG_dew * (u - ((((u) ^ 2)^ 0.5)))))); + end if; + t2_dew = J; + + for i in 1:NOC loop + vapfugcoeff_dew[i] = exp(t1_dew[i] + t2_dew + (t3_dew[i] * t4_dew)); + + if(Psat[i]==0) then + H[i]=0; + else + H[i] = Pdew/Psat[i]; + end if; + gammaDew[i] = vapfugcoeff_dew[i] * H[i]; + end for; + + algorithm + CV_dew[1] := 1; + CV_dew[2] := -(1+BG_dew - (u*BG_dew)); + CV_dew[3] := (AG_dew -(u * BG_dew)-(u*(BG_dew^2))); + CV_dew[4] := (-AG_dew *BG_dew ); + Z_RV_dew := Modelica.Math.Vectors.Utilities.roots(CV_dew); + ZV_dew := {Z_RV_dew[i, 1] for i in 1:3}; + Zv_dew := max({ZV_dew}); + algorithm + CV[1] := 1; + CV[2] := -(1+BG - (u*BG)); + CV[3] := (AG -(u * BG)-(u*(BG^2))); + CV[4] := (-AG *BG ); + Z_RV := Modelica.Math.Vectors.Utilities.roots(CV); + ZV := {Z_RV[i, 1] for i in 1:3}; + Zv := max({ZV}); + + //========================================================================================================== + end Grayson_Streed; + +end Thermodynamic_Packages; diff --git a/Simulator/Simulator/Files/Thermodynamic_Packages/package.order b/Simulator/Simulator/Files/Thermodynamic_Packages/package.order new file mode 100644 index 0000000..2597960 --- /dev/null +++ b/Simulator/Simulator/Files/Thermodynamic_Packages/package.order @@ -0,0 +1,6 @@ +Raoults_Law +NRTL +UNIQUAC +UNIFAC +Peng_Robinson +Grayson_Streed diff --git a/Simulator/Simulator/Files/Transport_Properties/LiqK.mo b/Simulator/Simulator/Files/Transport_Properties/LiqK.mo new file mode 100644 index 0000000..138360f --- /dev/null +++ b/Simulator/Simulator/Files/Transport_Properties/LiqK.mo @@ -0,0 +1,9 @@ +within Simulator.Files.Transport_Properties; + +function LiqK + input Real LiqK[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real k_liq; +algorithm + k_liq := LiqK[2] + exp(LiqK[3] / T + LiqK[4] + LiqK[5] * T + LiqK[6] * T ^ 2); +end LiqK; diff --git a/Simulator/Simulator/Files/Transport_Properties/LiqVis.mo b/Simulator/Simulator/Files/Transport_Properties/LiqVis.mo new file mode 100644 index 0000000..ddefe4f --- /dev/null +++ b/Simulator/Simulator/Files/Transport_Properties/LiqVis.mo @@ -0,0 +1,10 @@ +within Simulator.Files.Transport_Properties; + +function LiqVis + //This function calculates the liquid viscocity of the stream + input Real LiqVis[6]; + input Real T; + output Real Liqvisc; +algorithm + Liqvisc := exp(LiqVis[2] + LiqVis[3] / T + LiqVis[4] * log(T) + LiqVis[5] * T ^ LiqVis[6]); +end LiqVis; diff --git a/Simulator/Simulator/Files/Transport_Properties/VapK.mo b/Simulator/Simulator/Files/Transport_Properties/VapK.mo new file mode 100644 index 0000000..cde9841 --- /dev/null +++ b/Simulator/Simulator/Files/Transport_Properties/VapK.mo @@ -0,0 +1,9 @@ +within Simulator.Files.Transport_Properties; + +function VapK + input Real VapK[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real k_vap; +algorithm + k_vap := VapK[6] + VapK[2] * T ^ VapK[3] / (1 + VapK[4] / T + VapK[5] / T ^ 2); +end VapK; diff --git a/Simulator/Simulator/Files/Transport_Properties/VapVisc.mo b/Simulator/Simulator/Files/Transport_Properties/VapVisc.mo new file mode 100644 index 0000000..7ee88c1 --- /dev/null +++ b/Simulator/Simulator/Files/Transport_Properties/VapVisc.mo @@ -0,0 +1,9 @@ +within Simulator.Files.Transport_Properties; + +function VapVisc + input Real VapVis[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real vapvisc; +algorithm + vapvisc := VapVis[6] + VapVis[2] * T ^ VapVis[3] / (1 + VapVis[4] / T + VapVis[5] / T ^ 2); +end VapVisc; diff --git a/Simulator/Simulator/Files/Transport_Properties/package.mo b/Simulator/Simulator/Files/Transport_Properties/package.mo new file mode 100644 index 0000000..298dc2c --- /dev/null +++ b/Simulator/Simulator/Files/Transport_Properties/package.mo @@ -0,0 +1,36 @@ +within Simulator.Files; + +package Transport_Properties + function LiqVis + //This function calculates the liquid viscocity of the stream + input Real LiqVis[6]; + input Real T; + output Real Liqvisc; + algorithm + Liqvisc := exp(LiqVis[2] + LiqVis[3] / T + LiqVis[4] * log(T) + LiqVis[5] * T ^ LiqVis[6]); + end LiqVis; + + function LiqK + input Real LiqK[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real k_liq; + algorithm + k_liq := LiqK[2] + exp(LiqK[3] / T + LiqK[4] + LiqK[5] * T + LiqK[6] * T ^ 2); + end LiqK; + + function VapK + input Real VapK[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real k_vap; + algorithm + k_vap := VapK[6] + VapK[2] * T ^ VapK[3] / (1 + VapK[4] / T + VapK[5] / T ^ 2); + end VapK; + + function VapVisc + input Real VapVis[6] "from chemsep database"; + input Real T(unit = "K") "Temperature"; + output Real vapvisc; + algorithm + vapvisc := VapVis[6] + VapVis[2] * T ^ VapVis[3] / (1 + VapVis[4] / T + VapVis[5] / T ^ 2); + end VapVisc; +end Transport_Properties; diff --git a/Simulator/Simulator/Files/Transport_Properties/package.order b/Simulator/Simulator/Files/Transport_Properties/package.order new file mode 100644 index 0000000..c109137 --- /dev/null +++ b/Simulator/Simulator/Files/Transport_Properties/package.order @@ -0,0 +1,4 @@ +LiqVis +LiqK +VapK +VapVisc diff --git a/Simulator/Simulator/Files/package.mo b/Simulator/Simulator/Files/package.mo new file mode 100644 index 0000000..65aa07f --- /dev/null +++ b/Simulator/Simulator/Files/package.mo @@ -0,0 +1,4 @@ +within Simulator; +package Files + +end Files; diff --git a/Simulator/Simulator/Files/package.order b/Simulator/Simulator/Files/package.order new file mode 100644 index 0000000..3534df7 --- /dev/null +++ b/Simulator/Simulator/Files/package.order @@ -0,0 +1,8 @@ +Chemsep_Database +Thermodynamic_Packages +Transport_Properties +Thermodynamic_Functions +Connection +Models +Other_Functions +Icons diff --git a/Simulator/Simulator/Streams/Energy_Stream.mo b/Simulator/Simulator/Streams/Energy_Stream.mo new file mode 100644 index 0000000..0797a30 --- /dev/null +++ b/Simulator/Simulator/Streams/Energy_Stream.mo @@ -0,0 +1,14 @@ +within Simulator.Streams; + +model Energy_Stream + extends Simulator.Files.Icons.en_stm; + Real enFlo; + Files.Connection.enConn inlet annotation( + Placement(visible = true, transformation(origin = {-100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Files.Connection.enConn outlet annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//connector equation + enFlo = inlet.enFlo; + enFlo = outlet.enFlo; +end Energy_Stream; diff --git a/Simulator/Simulator/Streams/Material_Stream.mo b/Simulator/Simulator/Streams/Material_Stream.mo new file mode 100644 index 0000000..4cf8a68 --- /dev/null +++ b/Simulator/Simulator/Streams/Material_Stream.mo @@ -0,0 +1,119 @@ +within Simulator.Streams; + +model Material_Stream + //1 - Mixture, 2 - Liquid phase, 3 - Gas Phase +// extends Modelica.Icons.SourcesPackage; + extends Simulator.Files.Icons.stm; + import Simulator.Files.*; + parameter Integer NOC; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + Real P(min = 0, start = 101325) "Pressure", T(start = 273) "Temperature"; + Real Pbubl(min = 0, start = sum(comp[:].Pc) / NOC) "Bubble point pressure", Pdew(min = 0, start = sum(comp[:].Pc) / NOC) "dew point pressure"; + Real liqPhasMolFrac(start = 0.5, min = 0, max = 1) "Liquid Phase mole fraction", vapPhasMolFrac(start = 0.5, min = 0, max = 1) "Vapor Phase mole fraction", liqPhasMasFrac(start = 0.5, min = 0, max = 1) "Liquid Phase mass fraction", vapPhasMasFrac(start = 0.5, min = 0, max = 1) "Vapor Phase Mass fraction"; + Real totMolFlo[3](each min = 0, each start = 100) "Total molar flow", totMasFlo[3](each min = 0, each start = 100) "Total Mass Flow", MW[3](each start = 0, each min = 0) "Average Molecular weight of Phases"; + Real compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "Component mole fraction", compMasFrac[3, NOC](each start = 1 / (NOC + 1), each min = 0, each max = 1) "Component Mass fraction", compMolFlo[3, NOC](each start = 100, each min = 0) "Component Molar flow", compMasFlo[3, NOC](each min = 0, each start = 100) "Component Mass Fraction"; + Real phasMolSpHeat[3] "phase Molar Specific Heat", compMolSpHeat[3, NOC] "Component Molar Specific Heat"; + Real phasMolEnth[3] "Phase Molar Enthalpy", compMolEnth[3, NOC] "Component Molar Enthalpy"; + Real phasMolEntr[3] "Phase Molar Entropy", compMolEntr[3, NOC] "Component Molar Entropy"; + Simulator.Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//Connector equations + inlet.P = P; + inlet.T = T; + inlet.mixMolFlo = totMolFlo[1]; + inlet.mixMolEnth = phasMolEnth[1]; + inlet.mixMolEntr = phasMolEntr[1]; + inlet.mixMolFrac = compMolFrac; + inlet.vapPhasMolFrac = vapPhasMolFrac; + outlet.P = P; + outlet.T = T; + outlet.mixMolFlo = totMolFlo[1]; + outlet.mixMolEnth = phasMolEnth[1]; + outlet.mixMolEntr = phasMolEntr[1]; + outlet.mixMolFrac = compMolFrac; + outlet.vapPhasMolFrac = vapPhasMolFrac; +//===================================================================================== +//Mole Balance + totMolFlo[1] = totMolFlo[2] + totMolFlo[3]; + compMolFrac[1, :] .* totMolFlo[1] = compMolFrac[2, :] .* totMolFlo[2] + compMolFrac[3, :] .* totMolFlo[3]; +//component molar and mass flows + for i in 1:NOC loop + compMolFlo[:, i] = compMolFrac[:, i] .* totMolFlo[:]; + end for; + if P >= Pbubl then +//below bubble point region + compMasFrac[3, :] = zeros(NOC); + compMasFlo[1, :] = compMasFrac[1, :] .* totMasFlo[1]; + compMasFrac[2, :] = compMasFrac[1, :]; + elseif P >= Pdew then + for i in 1:NOC loop + compMasFlo[:, i] = compMasFrac[:, i] .* totMasFlo[:]; + end for; + else +//above dew point region + compMasFrac[2, :] = zeros(NOC); + compMasFlo[1, :] = compMasFrac[1, :] .* totMasFlo[1]; + compMasFrac[3, :] = compMasFrac[1, :]; + end if; +//phase molar and mass fractions + liqPhasMolFrac = totMolFlo[2] / totMolFlo[1]; + vapPhasMolFrac = totMolFlo[3] / totMolFlo[1]; + liqPhasMasFrac = totMasFlo[2] / totMasFlo[1]; + vapPhasMasFrac = totMasFlo[3] / totMasFlo[1]; +//Conversion between mole and mass flow + for i in 1:NOC loop + compMasFlo[:, i] = compMolFlo[:, i] * comp[i].MW; + end for; + totMasFlo[:] = totMolFlo[:] .* MW[:]; +//Energy Balance + for i in 1:NOC loop +//Specific Heat and Enthalpy calculation + compMolSpHeat[2, i] = Thermodynamic_Functions.LiqCpId(comp[i].LiqCp, T); + compMolSpHeat[3, i] = Thermodynamic_Functions.VapCpId(comp[i].VapCp, T); + compMolEnth[2, i] = Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + compMolEnth[3, i] = Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + (compMolEntr[2, i], compMolEntr[3, i]) = Thermodynamic_Functions.SId(comp[i].AS, comp[i].VapCp, comp[i].HOV, comp[i].Tb, comp[i].Tc, T, P, compMolFrac[2, i], compMolFrac[3, i]); + end for; + for i in 2:3 loop + phasMolSpHeat[i] = sum(compMolFrac[i, :] .* compMolSpHeat[i, :]) + resMolSpHeat[i]; + phasMolEnth[i] = sum(compMolFrac[i, :] .* compMolEnth[i, :]) + resMolEnth[i]; + phasMolEntr[i] = sum(compMolFrac[i, :] .* compMolEntr[i, :]) + resMolEntr[i]; + end for; + phasMolSpHeat[1] = liqPhasMolFrac * phasMolSpHeat[2] + vapPhasMolFrac * phasMolSpHeat[3]; + compMolSpHeat[1, :] = compMolFrac[1, :] .* phasMolSpHeat[1]; + phasMolEnth[1] = liqPhasMolFrac * phasMolEnth[2] + vapPhasMolFrac * phasMolEnth[3]; + compMolEnth[1, :] = compMolFrac[1, :] .* phasMolEnth[1]; + phasMolEntr[1] = liqPhasMolFrac * phasMolEntr[2] + vapPhasMolFrac * phasMolEntr[3]; + compMolEntr[1, :] = compMolFrac[1, :] * phasMolEntr[1]; +//Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); + if P >= Pbubl then +//below bubble point region + compMolFrac[3, :] = zeros(NOC); +// sum(compMolFrac[2, :]) = 1; + totMolFlo[3] = 0; + elseif P >= Pdew then +//VLE region + for i in 1:NOC loop +// compMolFrac[3, i] = K[i] * compMolFrac[2, i]; + compMolFrac[2, i] = compMolFrac[1, i] ./ (1 + vapPhasMolFrac * (K[i] - 1)); + end for; + sum(compMolFrac[3, :]) = 1; +//sum y = 1 + else +//above dew point region + compMolFrac[2, :] = zeros(NOC); +// sum(compMolFrac[3, :]) = 1; + totMolFlo[2] = 0; + end if; +algorithm + for i in 1:NOC loop + MW[:] := MW[:] + comp[i].MW * compMolFrac[:, i]; + end for; + +end Material_Stream; diff --git a/Simulator/Simulator/Streams/package.mo b/Simulator/Simulator/Streams/package.mo new file mode 100644 index 0000000..07aae14 --- /dev/null +++ b/Simulator/Simulator/Streams/package.mo @@ -0,0 +1,4 @@ +within Simulator; +package Streams + +end Streams; diff --git a/Simulator/Simulator/Streams/package.order b/Simulator/Simulator/Streams/package.order new file mode 100644 index 0000000..d9c5fe1 --- /dev/null +++ b/Simulator/Simulator/Streams/package.order @@ -0,0 +1,2 @@ +Material_Stream +Energy_Stream diff --git a/Simulator/Simulator/Test/CR_test.mo b/Simulator/Simulator/Test/CR_test.mo new file mode 100644 index 0000000..f257ced --- /dev/null +++ b/Simulator/Simulator/Test/CR_test.mo @@ -0,0 +1,38 @@ +within Simulator.Test; + +package CR_test + model ms + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.NRTL; + end ms; + + model test + import data = Simulator.Files.Chemsep_Database; + parameter Integer NOC = 4; + parameter data.Ethylacetate etac; + parameter data.Water wat; + parameter data.Aceticacid aa; + parameter data.Ethanol eth; + parameter data.General_Properties comp[NOC] = {etac, wat, aa, eth}; + conv_react cr(NOC = NOC, comp = comp, Nr = 1, Bc = {3}, Sc = {{1}, {1}, {-1}, {-1}}, X = {0.3}, calcMode = "Define_Outlet_Temperature", Tdef = 300) annotation( + Placement(visible = true, transformation(origin = {11, -7}, extent = {{-29, -29}, {29, 29}}, rotation = 0))); + CR_test.ms feed(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-83, -5}, extent = {{-13, -13}, {13, 13}}, rotation = 0))); + CR_test.ms product(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {88, -6}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(cr.outlet, product.inlet) annotation( + Line(points = {{32, -6}, {78, -6}})); + connect(feed.outlet, cr.inlet) annotation( + Line(points = {{-70, -6}, {-8, -6}, {-8, -6}, {-10, -6}})); + feed.P = 101325; + feed.T = 300; + feed.compMolFrac[1, :] = {0, 0, 0.4, 0.6}; + feed.totMolFlo[1] = 100; + end test; + + model conv_react + extends Simulator.Unit_Operations.Conversion_Reactor; + extends Simulator.Files.Models.ReactionManager.Reaction_Manager; + end conv_react; +end CR_test; diff --git a/Simulator/Simulator/Test/Heat_Exchanger.mo b/Simulator/Simulator/Test/Heat_Exchanger.mo new file mode 100644 index 0000000..6a6363d --- /dev/null +++ b/Simulator/Simulator/Test/Heat_Exchanger.mo @@ -0,0 +1,52 @@ +within Simulator.Test; + +package Heat_Exchanger + //Model of a General Purpouse Heat Exchanger operating with multiple modes + //================================================================================================================ + + model MS + extends Simulator.Streams.Material_Stream; + //material stream extended + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //thermodynamic package Raoults law is extended + end MS; + + model HX_Test + import data = Simulator.Files.Chemsep_Database; + //instantiation of ethanol + parameter data.Styrene sty; + //instantiation of acetic acid + parameter data.Toluene tol; + parameter Integer NOC = 2; + parameter data.General_Properties comp[NOC] = {sty, tol}; + Simulator.Unit_Operations.Rigorous_HX HX(NOC = NOC, comp = comp, deltap_hot = 0, deltap_cold = 0, Heat_Loss = 0, Calculation_Method = "Outlet_Temparatures") annotation( + Placement(visible = true, transformation(origin = {-34, 8}, extent = {{-16, -16}, {16, 16}}, rotation = 0))); + Simulator.Test.Heat_Exchanger.MS Hot_In(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-80, 6}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Test.Heat_Exchanger.MS Hot_Out(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {48, 70}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Test.Heat_Exchanger.MS Cold_In(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-78, 68}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Test.Heat_Exchanger.MS Cold_Out(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {54, -58}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(Cold_In.outlet, HX.Cold_In) annotation( + Line(points = {{-68, 68}, {-34, 68}, {-34, 24}})); + connect(Hot_In.outlet, HX.Hot_In) annotation( + Line(points = {{-70, 6}, {-56, 6}, {-56, 8}, {-50, 8}})); + connect(HX.Cold_Out, Cold_Out.inlet) annotation( + Line(points = {{-33, -8}, {-33, -58}, {44, -58}})); + connect(HX.Hot_Out, Hot_Out.inlet) annotation( + Line(points = {{-18, 8}, {-18, 45}, {38, 45}, {38, 70}})); + Hot_In.compMolFrac[1, :] = {1, 0}; + Cold_In.compMolFrac[1, :] = {0, 1}; + Hot_In.totMolFlo[1] = 181.46776; + Cold_In.totMolFlo[1] = 170.93083; + Hot_In.T = 422.03889; + Cold_In.T = 310.92778; + Hot_In.P = 344737.24128; + Cold_In.P = 620527.03429; + HX.U = 300; + HX.Qactual = 2700E03; + end HX_Test; +end Heat_Exchanger; diff --git a/Simulator/Simulator/Test/PFR_Test.mo b/Simulator/Simulator/Test/PFR_Test.mo new file mode 100644 index 0000000..c301966 --- /dev/null +++ b/Simulator/Simulator/Test/PFR_Test.mo @@ -0,0 +1,50 @@ +within Simulator.Test; + +package PFR_Test + model MS + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end MS; + + model PFR_Test_II + //Advicable to select the first component as the base component + // importing the thermodynamic data from chemsep database + import data = Simulator.Files.Chemsep_Database; + //instantiation of ethanol + parameter data.Ethyleneoxide eth; + //instantiation of acetic acid + parameter data.Ethyleneglycol eg; + //instantiation of water + parameter data.Water wat; + parameter Integer NOC = 3; + parameter data.General_Properties comp[NOC] = {eth, wat, eg}; + // Instantiating the material stream model(as inlet and outlet) and also the model for PFR with connectors + Simulator.Streams.Energy_Stream Energy annotation( + Placement(visible = true, transformation(origin = {2, -36}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Unit_Operations.PF_Reactor.PFR PFR(NOC = 3, Nr = 1, comp = {eth, wat, eg}, Mode = 2, Phase = 3, Tdef = 410) annotation( + Placement(visible = true, transformation(origin = {8, 22}, extent = {{-38, -38}, {38, 38}}, rotation = 0))); + MS Inlet(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-66, 8}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + MS Outlet(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {86, 10}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(Outlet.inlet, PFR.outlet) annotation( + Line(points = {{76, 10}, {60.5, 10}, {60.5, 22}, {41, 22}})); + connect(PFR.inlet, Inlet.outlet) annotation( + Line(points = {{-22, 22}, {-56, 22}, {-56, 8}})); + connect(Energy.inlet, PFR.en_Conn) annotation( + Line(points = {{-8, -36}, {0, -36}, {0, 5}, {3, 5}})); +// Connection of PFR with inlet and outlet stream +// Giving values to the instantiated inlet material stream +//mixture molar composition + Inlet.compMolFrac[1, :] = {0.2, 0.8, 0}; +//input pressure + Inlet.P = 101325; +//input temperature + Inlet.T = 395; +// total moles of inlet stream + Inlet.totMolFlo[1] = 100; +//Conversion of Base_component + PFR.X[1] = 0.0741; + end PFR_Test_II; +end PFR_Test; diff --git a/Simulator/Simulator/Test/adia_comp1.mo b/Simulator/Simulator/Test/adia_comp1.mo new file mode 100644 index 0000000..2eed4f0 --- /dev/null +++ b/Simulator/Simulator/Test/adia_comp1.mo @@ -0,0 +1,50 @@ +within Simulator.Test; + +package adia_comp1 + model ms + //This model will be instantiated in adia_comp model as outlet stream of heater. Dont run this model. Run adia_comp model for test + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end ms; + + model compres + extends Unit_Operations.Adiabatic_Compressor; + extends Files.Thermodynamic_Packages.Raoults_Law; + end compres; + + model main + import data = Simulator.Files.Chemsep_Database; + //instantiation of chemsep database + parameter data.Benzene ben; + //instantiation of methanol + parameter data.Toluene tol; + //instantiation of ethanol + parameter Integer NOC = 2; + parameter data.General_Properties comp[NOC] = {ben, tol}; + Simulator.Test.adia_comp1.compres adiabatic_Compressor1(NOC = NOC, comp = comp, eff = 0.75) annotation( + Placement(visible = true, transformation(origin = {-17, 17}, extent = {{-15, -15}, {15, 15}}, rotation = 0))); + Simulator.Test.adia_comp1.ms inlet(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-78, 8}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms outlet(NOC = NOC, comp = comp, T(start = 374)) annotation( + Placement(visible = true, transformation(origin = {58, 6}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream power annotation( + Placement(visible = true, transformation(origin = {-50, -56}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(inlet.outlet, adiabatic_Compressor1.inlet) annotation( + Line(points = {{-68, 8}, {-50, 8}, {-50, 17}, {-32, 17}})); + connect(adiabatic_Compressor1.outlet, outlet.inlet) annotation( + Line(points = {{-2, 17}, {31, 17}, {31, 6}, {48, 6}})); + connect(power.outlet, adiabatic_Compressor1.energy) annotation( + Line(points = {{-40, -56}, {-17, -56}, {-17, 7}})); + inlet.compMolFrac[1, :] = {0.5, 0.5}; +//mixture molar composition + inlet.P = 202650; +//input pressure + inlet.T = 372; +//input temperature + inlet.totMolFlo[1] = 100; +//input molar flow + adiabatic_Compressor1.pressInc = 10000; +//pressure increase + end main; +end adia_comp1; diff --git a/Simulator/Simulator/Test/adia_exp1.mo b/Simulator/Simulator/Test/adia_exp1.mo new file mode 100644 index 0000000..6e41d60 --- /dev/null +++ b/Simulator/Simulator/Test/adia_exp1.mo @@ -0,0 +1,49 @@ +within Simulator.Test; + +package adia_exp1 + model ms + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end ms; + + model exp + extends Simulator.Unit_Operations.Adiabatic_Expander; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end exp; + + model main + import data = Simulator.Files.Chemsep_Database; + //instantiation of chemsep database + parameter data.Benzene ben; + //instantiation of methanol + parameter data.Toluene tol; + //instantiation of ethanol + parameter Integer NOC = 2; + parameter data.General_Properties comp[NOC] = {ben, tol}; + Simulator.Test.adia_exp1.exp exp1(NOC = NOC, comp = comp, eff = 0.75) annotation( + Placement(visible = true, transformation(origin = {-9, 7}, extent = {{-23, -23}, {23, 23}}, rotation = 0))); + Simulator.Test.adia_comp1.ms inlet(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-78, 8}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms outlet(NOC = NOC, comp = comp, T(start = 374)) annotation( + Placement(visible = true, transformation(origin = {58, 6}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream power annotation( + Placement(visible = true, transformation(origin = {-50, -56}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(power.outlet, exp1.energy) annotation( + Line(points = {{-40, -56}, {-10, -56}, {-10, -16}, {-8, -16}})); + connect(exp1.outlet, outlet.inlet) annotation( + Line(points = {{14, 6}, {48, 6}, {48, 6}, {48, 6}})); + connect(inlet.outlet, exp1.inlet) annotation( + Line(points = {{-68, 8}, {-32, 8}})); + inlet.compMolFrac[1, :] = {0.5, 0.5}; +//mixture molar composition + inlet.P = 131325; +//input pressure + inlet.T = 372; +//input temperature + inlet.totMolFlo[1] = 100; +//input molar flow + exp1.pressDrop = 10000; +//pressure drop + end main; +end adia_exp1; diff --git a/Simulator/Simulator/Test/cmpstms.mo b/Simulator/Simulator/Test/cmpstms.mo new file mode 100644 index 0000000..ff3c516 --- /dev/null +++ b/Simulator/Simulator/Test/cmpstms.mo @@ -0,0 +1,27 @@ +within Simulator.Test; + +package cmpstms + model ms + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end ms; + + model main + //instance of database + import data = Simulator.Files.Chemsep_Database; + //instance of components + parameter data.Benzene benz; + parameter data.Toluene tol; + //declaration of NOC and comp + parameter Integer NOC = 2; + parameter data.General_Properties comp[NOC] = {benz, tol}; + //instance of composite material stream + Simulator.Test.cmpstms.ms ms1(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-79, -31}, extent = {{-11, -11}, {11, 11}}, rotation = 0))); + equation + ms1.P = 101325; + ms1.T = 368; + ms1.totMolFlo[1] = 100; + ms1.compMolFrac[1, :] = {0.5, 0.5}; + end main; +end cmpstms; diff --git a/Simulator/Simulator/Test/comp_sep1.mo b/Simulator/Simulator/Test/comp_sep1.mo new file mode 100644 index 0000000..3a859b7 --- /dev/null +++ b/Simulator/Simulator/Test/comp_sep1.mo @@ -0,0 +1,38 @@ +within Simulator.Test; + +package comp_sep1 + model ms + extends Simulator.Streams.Material_Stream(NOC = 2, comp = {benz, tol}); + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end ms; + + model main + import data = Simulator.Files.Chemsep_Database; + parameter data.Benzene benz; + parameter data.Toluene tol; + ms Inlet(NOC = 2, comp = {benz, tol}) annotation( + Placement(visible = true, transformation(origin = {-82, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms Outlet1(NOC = 2, comp = {benz, tol}) annotation( + Placement(visible = true, transformation(origin = {64, 18}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Test.comp_sep1.ms Outlet2(NOC = 2, comp = {benz, tol}) annotation( + Placement(visible = true, transformation(origin = {66, -20}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream Energy annotation( + Placement(visible = true, transformation(origin = {-40, -50}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Unit_Operations.Compound_Separator compound_Separator1(NOC = 2, comp = {benz, tol}, sepFact = {"Molar_Flow", "Mass_Flow"}, sepStrm = 1) annotation( + Placement(visible = true, transformation(origin = {-4, 2}, extent = {{-10, -20}, {10, 20}}, rotation = 0))); + equation + connect(Energy.outlet, compound_Separator1.energy) annotation( + Line(points = {{-30, -50}, {-4, -50}, {-4, -10}, {-4, -10}, {-4, -12}}, color = {255, 0, 0})); + connect(compound_Separator1.outlet2, Outlet2.inlet) annotation( + Line(points = {{8, -2}, {26, -2}, {26, -20}, {56, -20}, {56, -20}})); + connect(compound_Separator1.outlet1, Outlet1.inlet) annotation( + Line(points = {{8, 8}, {26, 8}, {26, 18}, {54, 18}, {54, 18}})); + connect(Inlet.outlet, compound_Separator1.inlet) annotation( + Line(points = {{-72, -2}, {-16, -2}, {-16, 2}, {-16, 2}})); + Inlet.P = 101325; + Inlet.T = 298.15; + Inlet.compMolFrac[1, :] = {0.5, 0.5}; + Inlet.totMolFlo[1] = 100; + compound_Separator1.sepFactVal = {20, 1500}; + end main; +end comp_sep1; diff --git a/Simulator/Simulator/Test/cooler1.mo b/Simulator/Simulator/Test/cooler1.mo new file mode 100644 index 0000000..62dd38f --- /dev/null +++ b/Simulator/Simulator/Test/cooler1.mo @@ -0,0 +1,49 @@ +within Simulator.Test; + +package cooler1 + model ms + //This model will be instantiated in maintest model as outlet stream of cooler. Dont run this model. Run maintest model for cooler test + extends Simulator.Streams.Material_Stream(NOC = 2); + //material stream extended + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //thermodynamic package Raoults law is extended + end ms; + + model cool + //use non linear solver hybrid to simulate this model + import data = Simulator.Files.Chemsep_Database; + //instantiation of chemsep database + parameter data.Methanol meth; + //instantiation of methanol + parameter data.Ethanol eth; + //instantiation of ethanol + parameter data.Water wat; + //instantiation of water + Simulator.Unit_Operations.Cooler cooler1(pressDrop = 0, eff = 1, NOC = 3, comp = {meth, eth, wat}) annotation( + Placement(visible = true, transformation(origin = {-6, 18}, extent = {{-14, -14}, {14, 14}}, rotation = 0))); + ms inlet(NOC = 3, comp = {meth, eth, wat}) annotation( + Placement(visible = true, transformation(origin = {-72, 18}, extent = {{-12, -12}, {12, 12}}, rotation = 0))); + ms outlet(NOC = 3, comp = {meth, eth, wat}, T(start = 352.6146), compMolFrac(start = {{0.33, 0.33, 0.34}, {0.27, 0.32, 0.39}, {0.48, 0.33, 0.18}}), P(start = 101325)) annotation( + Placement(visible = true, transformation(origin = {58, 18}, extent = {{-12, -12}, {12, 12}}, rotation = 0))); + Streams.Energy_Stream energy annotation( + Placement(visible = true, transformation(origin = {33, -43}, extent = {{-13, -13}, {13, 13}}, rotation = 0))); + equation + connect(inlet.outlet, cooler1.inlet) annotation( + Line(points = {{-60, 18}, {-20, 18}})); + connect(cooler1.outlet, outlet.inlet) annotation( + Line(points = {{8, 18}, {46, 18}})); + connect(cooler1.energy, energy.inlet) annotation( + Line(points = {{8, 4}, {8, -44}, {20, -44}})); + equation + inlet.compMolFrac[1, :] = {0.33, 0.33, 0.34}; +//mixture molar composition + inlet.P = 101325; +//input pressure + inlet.T = 353; +//input temperature + inlet.totMolFlo[1] = 100; +//input molar flow + cooler1.heatRem = 200000; +//heat removed + end cool; +end cooler1; diff --git a/Simulator/Simulator/Test/flash.mo b/Simulator/Simulator/Test/flash.mo new file mode 100644 index 0000000..cb1390f --- /dev/null +++ b/Simulator/Simulator/Test/flash.mo @@ -0,0 +1,40 @@ +within Simulator.Test; + +package flash + model ms + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end ms; + + model fls + extends Simulator.Unit_Operations.Flash; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end fls; + + model test + import data = Simulator.Files.Chemsep_Database; + parameter data.Benzene benz; + parameter data.Toluene tol; + parameter Integer NOC = 2; + parameter data.General_Properties comp[NOC] = {benz, tol}; + ms inlet(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-70, 2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + fls fls1(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-6, 4}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms outlet1(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {66, -20}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms outlet2(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {58, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(outlet2.inlet, fls1.vapor) annotation( + Line(points = {{48, 40}, {28, 40}, {28, 10}, {4, 10}, {4, 12}})); + connect(fls1.liquid, outlet1.inlet) annotation( + Line(points = {{4, -4}, {32, -4}, {32, -20}, {56, -20}, {56, -20}})); + connect(inlet.outlet, fls1.feed) annotation( + Line(points = {{-60, 2}, {-16, 2}, {-16, 4}, {-16, 4}})); + inlet.P = 101325; + inlet.T = 368; + inlet.compMolFrac[1, :] = {0.5, 0.5}; + inlet.totMolFlo[1] = 100; + end test; +end flash; diff --git a/Simulator/Simulator/Test/heater1.mo b/Simulator/Simulator/Test/heater1.mo new file mode 100644 index 0000000..ebd1851 --- /dev/null +++ b/Simulator/Simulator/Test/heater1.mo @@ -0,0 +1,52 @@ +within Simulator.Test; + +package heater1 + model ms + extends Simulator.Streams.Material_Stream; + //material stream extended + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //thermodynamic package Raoults law is extended + end ms; + + model heat + //instance of chemsep database + import data = Simulator.Files.Chemsep_Database; + //instance of methanol + parameter data.Methanol meth; + //instance of ethanol + parameter data.Ethanol eth; + //instance of water + parameter data.Water wat; + //instance of heater + parameter Integer NOC = 3; + parameter data.General_Properties comp[NOC] = {meth, eth, wat}; + Simulator.Unit_Operations.Heater heater1(pressDrop = 101325, eff = 1, NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-36, -4}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + //instances of composite material stream + Simulator.Test.heater1.ms inlet(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-80, 4}, extent = {{-12, -12}, {12, 12}}, rotation = 0))); + Simulator.Test.heater1.ms outlet(NOC = NOC, comp = comp, T(start = 353), compMolFrac(start = {{0.33, 0.33, 0.34}, {0.24, 0.31, 0.43}, {0.44, 0.34, 0.31}}), P(start = 101325)) annotation( + Placement(visible = true, transformation(origin = {20, 8}, extent = {{-12, -12}, {12, 12}}, rotation = 0))); + //instance of energy stream + Simulator.Streams.Energy_Stream energy annotation( + Placement(visible = true, transformation(origin = {-75, -35}, extent = {{-13, -13}, {13, 13}}, rotation = 0))); + equation + connect(energy.outlet, heater1.energy) annotation( + Line(points = {{-62, -35}, {-62, -34.5}, {-46, -34.5}, {-46, -14}})); + connect(inlet.outlet, heater1.inlet) annotation( + Line(points = {{-68, 4}, {-58, 4}, {-58, -4}, {-46, -4}})); + connect(heater1.outlet, outlet.inlet) annotation( + Line(points = {{-26, -4}, {-26, -8}, {8, -8}, {8, 8}})); + equation + inlet.compMolFrac[1, :] = {0.33, 0.33, 0.34}; +//mixture molar composition + inlet.P = 202650; +//input pressure + inlet.T = 320; +//input temperature + inlet.totMolFlo[1] = 100; +//input molar flow + heater1.heatAdd = 2000000; +//heat added + end heat; +end heater1; diff --git a/Simulator/Simulator/Test/mix1.mo b/Simulator/Simulator/Test/mix1.mo new file mode 100644 index 0000000..d42f75f --- /dev/null +++ b/Simulator/Simulator/Test/mix1.mo @@ -0,0 +1,76 @@ +within Simulator.Test; + +package mix1 + model ms + //This model will be instantiated in maintest model as material streams + extends Simulator.Streams.Material_Stream; + //material stream extended + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //thermodynamic package Raoults law is extended + end ms; + + model mix + import data = Simulator.Files.Chemsep_Database; + parameter data.Ethanol eth; + parameter data.Methanol meth; + parameter data.Water wat; + parameter Integer NOC = 3; + parameter data.General_Properties comp[NOC] = {meth, eth, wat}; + ms ms1(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-84, 88}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms ms2(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-84, 58}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms ms3(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-86, 24}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms ms4(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-84, -16}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms ms5(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-84, -52}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms ms6(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-82, -86}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Unit_Operations.Mixer mixer1(NOC = NOC, NI = 6, comp = comp, outPress = "Inlet_Average") annotation( + Placement(visible = true, transformation(origin = {-6,0}, extent = {{-26, -26}, {26, 26}}, rotation = 0))); + ms out1(NOC = NOC, comp = comp, T(start = 354), totMolFlo(start = 1600)) annotation( + Placement(visible = true, transformation(origin = {62, 2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(ms1.outlet, mixer1.inlet[1]) annotation( + Line(points = {{-74, 88}, {-32, 88}, {-32, -1}})); + connect(ms2.outlet, mixer1.inlet[2]) annotation( + Line(points = {{-74, 58}, {-44, 58}, {-44, -1}, {-32, -1}})); + connect(ms3.outlet, mixer1.inlet[3]) annotation( + Line(points = {{-76, 24}, {-50, 24}, {-50, 6}, {-32, 6}, {-32, -1}})); + connect(ms4.outlet, mixer1.inlet[4]) annotation( + Line(points = {{-74, -16}, {-50, -16}, {-50, -2}, {-32, -2}, {-32, -1}})); + connect(ms5.outlet, mixer1.inlet[5]) annotation( + Line(points = {{-74, -52}, {-44, -52}, {-44, -1}, {-32, -1}})); + connect(ms6.outlet, mixer1.inlet[6]) annotation( + Line(points = {{-72, -86}, {-34, -86}, {-34, -1}, {-32, -1}})); + connect(mixer1.outlet, out1.inlet) annotation( + Line(points = {{20, -1}, {39, -1}, {39, 2}, {52, 2}})); + equation + ms1.P = 101325; + ms2.P = 202650; + ms3.P = 126523; + ms4.P = 215365; + ms5.P = 152365; + ms6.P = 152568; + ms1.T = 353; + ms2.T = 353; + ms3.T = 353; + ms4.T = 353; + ms5.T = 353; + ms6.T = 353; + ms1.totMolFlo[1] = 100; + ms2.totMolFlo[1] = 100; + ms3.totMolFlo[1] = 300; + ms4.totMolFlo[1] = 500; + ms5.totMolFlo[1] = 400; + ms6.totMolFlo[1] = 200; + ms1.compMolFrac[1, :] = {0.25, 0.25, 0.5}; + ms2.compMolFrac[1, :] = {0, 0, 1}; + ms3.compMolFrac[1, :] = {0.3, 0.3, 0.4}; + ms4.compMolFrac[1, :] = {0.25, 0.25, 0.5}; + ms5.compMolFrac[1, :] = {0.2, 0.4, 0.4}; + ms6.compMolFrac[1, :] = {0, 1, 0}; + end mix; +end mix1; diff --git a/Simulator/Simulator/Test/msPH.mo b/Simulator/Simulator/Test/msPH.mo new file mode 100644 index 0000000..b2f5bfc --- /dev/null +++ b/Simulator/Simulator/Test/msPH.mo @@ -0,0 +1,27 @@ +within Simulator.Test; + +model msPH + //we have to first instance components to give to material stream model. + import data = Simulator.Files.Chemsep_Database; + //instantiation of chemsep database + parameter data.Methanol meth; + //instantiation of methanol + parameter data.Ethanol eth; + //instantiation of ethanol + parameter data.Water wat; + //instantiation of water + extends Streams.Material_Stream(NOC = 3, comp = {meth, eth, wat}, totMolFlo(each start = 1), compMolFrac(each start = 0.33), T(start = sum(comp.Tb) / NOC)); + //material stream model is extended and values of parameters NOC and comp are given. These parameters are declred in Material stream model. We are only giving them values here. + //we need to give proper initialization values for converging, Initialization values are provided for totMolFlo, compMolFrac and T while extending. + //NOC - number of components, comp - component array. + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //Thermodynamic package is extended. We can use other thermodynamics also(not yet added) after little modification and inclusion of residual properties equations. +equation +//These are the values to be specified by user. In this P, mixture molar enthalpy, mixture mole fraction and mixture molar flow is specified. These variables are declared in Material stream model, only values are given here. + P = 101325; + phasMolEnth[1] = -34452; + compMolFrac[1, :] = {0.33, 0.33, 0.34}; +//1 stands for mixture + totMolFlo[1] = 31.346262; +//1 stands for mixture +end msPH; diff --git a/Simulator/Simulator/Test/msPS.mo b/Simulator/Simulator/Test/msPS.mo new file mode 100644 index 0000000..8ee62b3 --- /dev/null +++ b/Simulator/Simulator/Test/msPS.mo @@ -0,0 +1,27 @@ +within Simulator.Test; + +model msPS + //we have to first instance components to give to material stream model. + import data = Simulator.Files.Chemsep_Database; + //instantiation of chemsep database + parameter data.Methanol meth; + //instantiation of methanol + parameter data.Ethanol eth; + //instantiation of ethanol + parameter data.Water wat; + //instantiation of water + extends Streams.Material_Stream(NOC = 3, comp = {meth, eth, wat}, totMolFlo(each start = 100), compMolFrac(each start = 0.33), T(start = sum(comp.Tb) / NOC)); + //material stream model is extended and values of parameters NOC and comp are given. These parameters are declred in Material stream model. We are only giving them values here. + //we need to give proper initialization values for converging, Initialization values are provided for totMolFlo, compMolFrac and T while extending. + //NOC - number of components, comp - component array. + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //Thermodynamic package is extended. We can use other thermodynamics also(not yet added) after little modification and inclusion of residual properties equations. +equation +//These are the values to be specified by user. In this P, mixture molar enthalpy, mixture mole fraction and mixture molar flow is specified. These variables are declared in Material stream model, only values are given here. + P = 101325; + phasMolEntr[1] = -84.39; + compMolFrac[1, :] = {0.33, 0.33, 0.34}; +//1 stands for mixture + totMolFlo[1] = 31.346262; +//1 stands for mixture +end msPS; diff --git a/Simulator/Simulator/Test/msPVF.mo b/Simulator/Simulator/Test/msPVF.mo new file mode 100644 index 0000000..d9cb97c --- /dev/null +++ b/Simulator/Simulator/Test/msPVF.mo @@ -0,0 +1,15 @@ +within Simulator.Test; + +model msPVF + import data = Simulator.Files.Chemsep_Database; + parameter data.Methanol meth; + parameter data.Ethanol eth; + parameter data.Water wat; + extends Streams.Material_Stream(NOC = 3, comp = {meth, eth, wat}, T(start = 355.97), compMolFrac(start = {{0.33, 0.33, 0.34}, {0.32, 0.33, 0.34}, {0.53, 0.32, 0.14}})); + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; +equation + P = 101325; + vapPhasMolFrac = 0.036257; + compMolFrac[1, :] = {0.33, 0.33, 0.34}; + totMolFlo[1] = 100; +end msPVF; diff --git a/Simulator/Simulator/Test/msTP.mo b/Simulator/Simulator/Test/msTP.mo new file mode 100644 index 0000000..1e8224b --- /dev/null +++ b/Simulator/Simulator/Test/msTP.mo @@ -0,0 +1,25 @@ +within Simulator.Test; + +model msTP + //we have to first instance components to give to material stream model. + import data = Simulator.Files.Chemsep_Database; + //instantiation of chemsep database + parameter data.Methanol meth; + //instantiation of methanol + parameter data.Ethanol eth; + //instantiation of ethanol + parameter data.Water wat; + //instantiation of water + extends Streams.Material_Stream(NOC = 3, comp = {meth, eth, wat}, compMolFrac(each min = 0.01, each max = 1, start = {{0.33, 0.33, 0.34}, {0.32, 0.33, 0.34}, {0.53, 0.32, 0.14}}), totMolFlo(each start = 50)); + //material stream model is extended and values of parameters NOC and comp are given. These parameters are declared in Material stream model. We are only giving them values here. + //NOC - number of components, comp - component array. + //start values are given for convergence + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //Thermodynamic package is extended. We can use other thermodynamics also(not yet added) after little modification and inclusion of residual properties equations. +equation +//These are the values to be specified by user. In this P, T, mixture mole fraction and mixture molar flow is specified. These variables are declared in Material stream model, only values are given here. + P = 101325; + T = 351; + compMolFrac[1, :] = {0.33, 0.33, 0.34}; + totMolFlo[1] = 100; +end msTP; diff --git a/Simulator/Simulator/Test/msTPGrayson.mo b/Simulator/Simulator/Test/msTPGrayson.mo new file mode 100644 index 0000000..a96579b --- /dev/null +++ b/Simulator/Simulator/Test/msTPGrayson.mo @@ -0,0 +1,21 @@ +within Simulator.Test; + +model msTPGrayson + import data = Simulator.Files.Chemsep_Database; + parameter data.Ethylene eth; + parameter data.Acetylene acet; + parameter data.OneOnedichloroethane dich; + parameter data.Propadiene prop; + //w=Acentric Factor + //Sp = Solublity Parameter + //V = Molar Volume + //All the above three parameters have to be mentioned as arguments while extending the thermodynamic Package Grayson Streed as shown below + extends Simulator.Files.Thermodynamic_Packages.Grayson_Streed(w = {0.0949, 0.1841, 0.244612, 0.3125}, Sp = {0.00297044, 0.00449341, 0.00437069, 0.00419199}, V = {61, 42.1382, 84.7207, 60.4292}); + extends Simulator.Streams.Material_Stream(NOC = 4, comp = {eth, acet, dich, prop}); + //Equations +equation + P = 101325; + T = 210.246; + compMolFrac[1, :] = {0.4, 0.2, 0.3, 0.1}; + totMolFlo[1] = 50; +end msTPGrayson; diff --git a/Simulator/Simulator/Test/msTPNRTL.mo b/Simulator/Simulator/Test/msTPNRTL.mo new file mode 100644 index 0000000..d0319ac --- /dev/null +++ b/Simulator/Simulator/Test/msTPNRTL.mo @@ -0,0 +1,14 @@ +within Simulator.Test; + +model msTPNRTL + import data = Simulator.Files.Chemsep_Database; + parameter data.Onehexene ohex; + parameter data.Ethanol eth; + extends Simulator.Streams.Material_Stream(NOC = 2, comp = {ohex, eth}, compMolFrac(each start = 0.33)); + extends Simulator.Files.Thermodynamic_Packages.NRTL; +equation + compMolFrac[1, :] = {0.5, 0.5}; + totMolFlo[1] = 100; + P = 101325; + T = 330; +end msTPNRTL; diff --git a/Simulator/Simulator/Test/msTPUNIQUAC.mo b/Simulator/Simulator/Test/msTPUNIQUAC.mo new file mode 100644 index 0000000..1bcd00f --- /dev/null +++ b/Simulator/Simulator/Test/msTPUNIQUAC.mo @@ -0,0 +1,14 @@ +within Simulator.Test; + +model msTPUNIQUAC + import data = Simulator.Files.Chemsep_Database; + parameter data.Ethanol eth; + parameter data.Water wat; + extends Simulator.Streams.Material_Stream(NOC = 2, comp = {eth, wat}, Pbubl(start = 101325), Pdew(start = 101325), compMolFrac(each start = 0.33)); + extends Simulator.Files.Thermodynamic_Packages.UNIQUAC; +equation + compMolFrac[1, :] = {0.5, 0.5}; + totMolFlo[1] = 50; + P = 101325; + T = 354; +end msTPUNIQUAC; diff --git a/Simulator/Simulator/Test/msTPbbp.mo b/Simulator/Simulator/Test/msTPbbp.mo new file mode 100644 index 0000000..7532552 --- /dev/null +++ b/Simulator/Simulator/Test/msTPbbp.mo @@ -0,0 +1,26 @@ +within Simulator.Test; + +model msTPbbp "material stream below bubble point" + //we have to first instance components to give to material stream model. + import data = Simulator.Files.Chemsep_Database; + //instantiation of chemsep database + parameter data.Methanol meth; + //instantiation of methanol + parameter data.Ethanol eth; + //instantiation of ethanol + parameter data.Water wat; + //instantiation of water + extends Streams.Material_Stream(NOC = 3, comp = {meth, eth, wat}, compMolEnth(each start = eth.SH), compMolEntr(each start = eth.AS), compMolFrac(each min = 0.01, each max = 1, each start = 0.33)); + //material stream model is extended and values of parameters NOC and comp are given. These parameters are declared in Material stream model. We are only giving them values here. + //NOC - number of components, comp - component array. + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //Thermodynamic package is extended. We can use other thermodynamics also(not yet added) after little modification and inclusion of residual properties equations. +equation +//These are the values to be specified by user. In this P, T, mixture mole fraction and mixture molar flow is specified. These variables are declared in Material stream model, only values are given here. + P = 202650; + T = 320; + compMolFrac[1, :] = {0.33, 0.33, 0.34}; +//1 stands for mixture + totMolFlo[1] = 31.346262; +//1 stands for mixture +end msTPbbp; diff --git a/Simulator/Simulator/Test/msTVF.mo b/Simulator/Simulator/Test/msTVF.mo new file mode 100644 index 0000000..21a1917 --- /dev/null +++ b/Simulator/Simulator/Test/msTVF.mo @@ -0,0 +1,18 @@ +within Simulator.Test; + +model msTVF + // database and components are instantiated, material stream and thermodynamic package extended + Simulator.Files.Chemsep_Database data; + parameter data.Methanol meth; + parameter data.Ethanol eth; + parameter data.Water wat; + extends Streams.Material_Stream(NOC = 3, comp = {meth, eth, wat}, compMolFrac(start = {{0.33, 0.33, 0.34}, {0.32, 0.33, 0.34}, {0.53, 0.32, 0.14}})); + //NOC - number of components, comp - component array. + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; +equation +//Here vapor phase mole fraction, temperature, mixture component mole fraction and mixture molar flow is given. + vapPhasMolFrac = 0.036257; + T = 351; + compMolFrac[1, :] = {0.33, 0.33, 0.34}; + totMolFlo[1] = 31.346262; +end msTVF; diff --git a/Simulator/Simulator/Test/package.mo b/Simulator/Simulator/Test/package.mo new file mode 100644 index 0000000..ff05a11 --- /dev/null +++ b/Simulator/Simulator/Test/package.mo @@ -0,0 +1,4 @@ +within Simulator; +package Test + +end Test; diff --git a/Simulator/Simulator/Test/package.order b/Simulator/Simulator/Test/package.order new file mode 100644 index 0000000..5e724a8 --- /dev/null +++ b/Simulator/Simulator/Test/package.order @@ -0,0 +1,26 @@ +msTP +msTVF +msPVF +msPH +msPS +msTPbbp +msTPUNIQUAC +msTPNRTL +msTPGrayson +cmpstms +heater1 +Heat_Exchanger +cooler1 +valve1 +mix1 +comp_sep1 +shortcut1 +flash +split +pump +adia_comp1 +adia_exp1 +rigDist +PFR_Test +CR_test +rigAbs diff --git a/Simulator/Simulator/Test/pump.mo b/Simulator/Simulator/Test/pump.mo new file mode 100644 index 0000000..c4b696c --- /dev/null +++ b/Simulator/Simulator/Test/pump.mo @@ -0,0 +1,34 @@ +within Simulator.Test; + +package pump + model ms + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end ms; + + model main + import data = Simulator.Files.Chemsep_Database; + parameter data.Benzene benz; + parameter data.Toluene tol; + Simulator.Test.pump.ms inlet(NOC = 2, comp = {benz, tol}) annotation( + Placement(visible = true, transformation(origin = {-70, -8}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Unit_Operations.Centrifugal_Pump pump(comp = {benz, tol}, NOC = 2, eff = 0.75) annotation( + Placement(visible = true, transformation(origin = {-2, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Test.pump.ms outlet(NOC = 2, comp = {benz, tol}, T(start = 300.089), compMolFrac(start = {{0.5, 0.5}, {0.5, 0.5}, {0, 0}}), totMolFlo(start = 100)) annotation( + Placement(visible = true, transformation(origin = {68, 16}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Streams.Energy_Stream energy annotation( + Placement(visible = true, transformation(origin = {-38, -44}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(inlet.outlet, pump.inlet) annotation( + Line(points = {{-60, -8}, {-35, -8}, {-35, 0}, {-12, 0}})); + connect(pump.outlet, outlet.inlet) annotation( + Line(points = {{8, 8}, {33, 8}, {33, 16}, {58, 16}})); + connect(energy.outlet, pump.energy) annotation( + Line(points = {{-28, -44}, {-2, -44}, {-2, -12}})); + inlet.totMolFlo[1] = 100; + inlet.compMolFrac[1, :] = {0.5, 0.5}; + inlet.P = 101325; + inlet.T = 300; + pump.pressInc = 101325; + end main; +end pump; diff --git a/Simulator/Simulator/Test/rigAbs.mo b/Simulator/Simulator/Test/rigAbs.mo new file mode 100644 index 0000000..1386730 --- /dev/null +++ b/Simulator/Simulator/Test/rigAbs.mo @@ -0,0 +1,54 @@ +within Simulator.Test; + +package rigAbs + model ms + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end ms; + + model Tray + extends Simulator.Unit_Operations.Absorption_Column.AbsTray; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end Tray; + + model AbsColumn + extends Simulator.Unit_Operations.Absorption_Column.AbsCol; + Tray tray[noOfStages](each NOC = NOC, each comp = comp, each liqMolFlo(each start = 30), each vapMolFlo(each start = 30), each T(start = 300)); + end AbsColumn; + + model Test + import data = Simulator.Files.Chemsep_Database; + parameter Integer NOC = 3; + parameter data.Acetone acet; + parameter data.Air air; + parameter data.Water wat; + parameter data.General_Properties comp[NOC] = {acet, air, wat}; + rigAbs.ms water(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-70, 62}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms air_acetone(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-70, -56}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + rigAbs.AbsColumn abs(NOC = NOC, comp = comp, noOfStages = 10) annotation( + Placement(visible = true, transformation(origin = {-3, 11}, extent = {{-33, -33}, {33, 33}}, rotation = 0))); + ms top(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {62, 60}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms bottom(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {66, -52}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(abs.bottom_product, bottom.inlet) annotation( + Line(points = {{30, -16}, {42, -16}, {42, -50}, {56, -50}, {56, -52}})); + connect(abs.top_product, top.inlet) annotation( + Line(points = {{30, 38}, {40, 38}, {40, 60}, {52, 60}, {52, 60}})); + connect(air_acetone.outlet, abs.bottom_feed) annotation( + Line(points = {{-60, -56}, {-52, -56}, {-52, -14}, {-36, -14}, {-36, -16}})); + connect(water.outlet, abs.top_feed) annotation( + Line(points = {{-60, 62}, {-48, 62}, {-48, 38}, {-36, 38}, {-36, 38}})); + water.P = 101325; + water.T = 325; + water.totMolFlo[1] = 30; + water.compMolFrac[1, :] = {0, 0, 1}; + air_acetone.P = 101325; + air_acetone.T = 335; + air_acetone.totMolFlo[1] = 30; + air_acetone.compMolFrac[1, :] = {0.5, 0.5, 0}; + end Test; +end rigAbs; diff --git a/Simulator/Simulator/Test/rigDist.mo b/Simulator/Simulator/Test/rigDist.mo new file mode 100644 index 0000000..c2fa5e8 --- /dev/null +++ b/Simulator/Simulator/Test/rigDist.mo @@ -0,0 +1,233 @@ +within Simulator.Test; + +package rigDist + model Condensor + extends Simulator.Unit_Operations.Distillation_Column.Cond; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end Condensor; + + model Tray + extends Simulator.Unit_Operations.Distillation_Column.DistTray; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end Tray; + + model Reboiler + extends Simulator.Unit_Operations.Distillation_Column.Reb; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end Reboiler; + + model DistColumn + extends Simulator.Unit_Operations.Distillation_Column.DistCol; + Condensor condensor(NOC = NOC, comp = comp, condType = condType, boolFeed = boolFeed[1], T(start = 300)); + Reboiler reboiler(NOC = NOC, comp = comp, boolFeed = boolFeed[noOfStages]); + Tray tray[noOfStages - 2](each NOC = NOC, each comp = comp, boolFeed = boolFeed[2:noOfStages - 1], each liqMolFlo(each start = 150), each vapMolFlo(each start = 150)); + end DistColumn; + + model ms + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end ms; + + model Test + parameter Integer NOC = 2; + import data = Simulator.Files.Chemsep_Database; + parameter data.Benzene benz; + parameter data.Toluene tol; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] = {benz, tol}; + DistColumn distCol(NOC = NOC, comp = comp, noOfStages = 4, noOfFeeds = 1, feedStages = {3}) annotation( + Placement(visible = true, transformation(origin = {-3, 3}, extent = {{-25, -25}, {25, 25}}, rotation = 0))); + ms feed(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-76, 2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms distillate(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {64, 22}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms bottoms(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {68, -16}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream cond_duty annotation( + Placement(visible = true, transformation(origin = {38, 62}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream reb_duty annotation( + Placement(visible = true, transformation(origin = {48, -52}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(distCol.condensor_duty, cond_duty.inlet) annotation( + Line(points = {{12, 28}, {12, 28}, {12, 62}, {28, 62}, {28, 62}})); + connect(distCol.reboiler_duty, reb_duty.inlet) annotation( + Line(points = {{16, -22}, {16, -22}, {16, -52}, {38, -52}, {38, -52}})); + connect(distCol.bottoms, bottoms.inlet) annotation( + Line(points = {{22, -14}, {56, -14}, {56, -16}, {58, -16}})); + connect(distCol.distillate, distillate.inlet) annotation( + Line(points = {{22, 22}, {54, 22}, {54, 22}, {54, 22}})); + connect(feed.outlet, distCol.feed[1]) annotation( + Line(points = {{-66, 2}, {-30, 2}, {-30, 2}, {-28, 2}})); + feed.P = 101325; + feed.T = 298.15; + feed.totMolFlo[1] = 100; + feed.compMolFrac[1, :] = {0.5, 0.5}; + distCol.condensor.P = 101325; + distCol.reboiler.P = 101325; + distCol.refluxRatio = 2; + bottoms.totMolFlo[1] = 50; + end Test; + + model Test2 + parameter Integer NOC = 2; + import data = Simulator.Files.Chemsep_Database; + parameter data.Benzene benz; + parameter data.Toluene tol; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] = {benz, tol}; + DistColumn distCol(NOC = NOC, comp = comp, noOfStages = 12, noOfFeeds = 1, feedStages = {7}) annotation( + Placement(visible = true, transformation(origin = {-3, 3}, extent = {{-25, -25}, {25, 25}}, rotation = 0))); + ms feed(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-76, 2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms distillate(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {64, 22}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms bottoms(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {68, -16}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream cond_duty annotation( + Placement(visible = true, transformation(origin = {38, 62}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream reb_duty annotation( + Placement(visible = true, transformation(origin = {48, -52}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(distCol.condensor_duty, cond_duty.inlet) annotation( + Line(points = {{12, 28}, {12, 28}, {12, 62}, {28, 62}, {28, 62}})); + connect(distCol.reboiler_duty, reb_duty.inlet) annotation( + Line(points = {{16, -22}, {16, -22}, {16, -52}, {38, -52}, {38, -52}})); + connect(distCol.bottoms, bottoms.inlet) annotation( + Line(points = {{22, -14}, {56, -14}, {56, -16}, {58, -16}})); + connect(distCol.distillate, distillate.inlet) annotation( + Line(points = {{22, 22}, {54, 22}, {54, 22}, {54, 22}})); + connect(feed.outlet, distCol.feed[1]) annotation( + Line(points = {{-66, 2}, {-30, 2}, {-30, 2}, {-28, 2}})); + feed.P = 101325; + feed.T = 298.15; + feed.totMolFlo[1] = 100; + feed.compMolFrac[1, :] = {0.5, 0.5}; + distCol.condensor.P = 101325; + distCol.reboiler.P = 101325; + distCol.refluxRatio = 2; + bottoms.totMolFlo[1] = 50; + end Test2; + + model Test3 + parameter Integer NOC = 2; + import data = Simulator.Files.Chemsep_Database; + parameter data.Benzene benz; + parameter data.Toluene tol; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] = {benz, tol}; + DistColumn distCol(NOC = NOC, comp = comp, noOfFeeds = 1, noOfStages = 22, feedStages = {10}) annotation( + Placement(visible = true, transformation(origin = {-3, 3}, extent = {{-25, -25}, {25, 25}}, rotation = 0))); + ms feed(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-76, 2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms distillate(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {64, 22}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms bottoms(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {68, -16}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream cond_duty annotation( + Placement(visible = true, transformation(origin = {38, 62}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream reb_duty annotation( + Placement(visible = true, transformation(origin = {48, -52}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(distCol.condensor_duty, cond_duty.inlet) annotation( + Line(points = {{12, 28}, {12, 28}, {12, 62}, {28, 62}, {28, 62}})); + connect(distCol.reboiler_duty, reb_duty.inlet) annotation( + Line(points = {{16, -22}, {16, -22}, {16, -52}, {38, -52}, {38, -52}})); + connect(distCol.bottoms, bottoms.inlet) annotation( + Line(points = {{22, -14}, {56, -14}, {56, -16}, {58, -16}})); + connect(distCol.distillate, distillate.inlet) annotation( + Line(points = {{22, 22}, {54, 22}, {54, 22}, {54, 22}})); + connect(feed.outlet, distCol.feed[1]) annotation( + Line(points = {{-66, 2}, {-30, 2}, {-30, 2}, {-28, 2}})); + feed.P = 101325; + feed.T = 298.15; + feed.totMolFlo[1] = 100; + feed.compMolFrac[1, :] = {0.3, 0.7}; + distCol.condensor.P = 101325; + distCol.reboiler.P = 101325; + distCol.refluxRatio = 1.5; + bottoms.totMolFlo[1] = 70; + end Test3; + + model Test4 + parameter Integer NOC = 2; + import data = Simulator.Files.Chemsep_Database; + parameter data.Benzene benz; + parameter data.Toluene tol; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] = {benz, tol}; + DistColumn distCol(NOC = NOC, comp = comp, noOfStages = 22, noOfFeeds = 1, feedStages = {10}, condensor.condType = "Partial", each tray.liqMolFlo(each start = 100), each tray.vapMolFlo(each start = 100)) annotation( + Placement(visible = true, transformation(origin = {-3, 3}, extent = {{-25, -25}, {25, 25}}, rotation = 0))); + ms feed(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-76, 2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms distillate(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {64, 22}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms bottoms(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {68, -16}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream cond_duty annotation( + Placement(visible = true, transformation(origin = {38, 62}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream reb_duty annotation( + Placement(visible = true, transformation(origin = {48, -52}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(distCol.condensor_duty, cond_duty.inlet) annotation( + Line(points = {{12, 28}, {12, 28}, {12, 62}, {28, 62}, {28, 62}})); + connect(distCol.reboiler_duty, reb_duty.inlet) annotation( + Line(points = {{16, -22}, {16, -22}, {16, -52}, {38, -52}, {38, -52}})); + connect(distCol.bottoms, bottoms.inlet) annotation( + Line(points = {{22, -14}, {56, -14}, {56, -16}, {58, -16}})); + connect(distCol.distillate, distillate.inlet) annotation( + Line(points = {{22, 22}, {54, 22}, {54, 22}, {54, 22}})); + connect(feed.outlet, distCol.feed[1]) annotation( + Line(points = {{-66, 2}, {-30, 2}, {-30, 2}, {-28, 2}})); + feed.P = 101325; + feed.T = 298.15; + feed.totMolFlo[1] = 96.8; + feed.compMolFrac[1, :] = {0.3, 0.7}; + distCol.condensor.P = 151325; + distCol.reboiler.P = 101325; + distCol.refluxRatio = 1.5; + bottoms.totMolFlo[1] = 70; + end Test4; + + model multiFeedTest + parameter Integer NOC = 2; + import data = Simulator.Files.Chemsep_Database; + parameter data.Benzene benz; + parameter data.Toluene tol; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] = {benz, tol}; + DistColumn distCol(NOC = NOC, comp = comp, noOfStages = 5, noOfFeeds = 2, feedStages = {3, 4}) annotation( + Placement(visible = true, transformation(origin = {-3, 3}, extent = {{-25, -25}, {25, 25}}, rotation = 0))); + ms feed(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-76, 2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms distillate(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {64, 22}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms bottoms(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {68, -16}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream cond_duty annotation( + Placement(visible = true, transformation(origin = {38, 62}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream reb_duty annotation( + Placement(visible = true, transformation(origin = {48, -52}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms ms1(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-80, 50}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(ms1.outlet, distCol.feed[2]) annotation( + Line(points = {{-70, 50}, {-26, 50}, {-26, 2}, {-28, 2}})); + connect(distCol.condensor_duty, cond_duty.inlet) annotation( + Line(points = {{12, 28}, {12, 28}, {12, 62}, {28, 62}, {28, 62}})); + connect(distCol.reboiler_duty, reb_duty.inlet) annotation( + Line(points = {{16, -22}, {16, -22}, {16, -52}, {38, -52}, {38, -52}})); + connect(distCol.bottoms, bottoms.inlet) annotation( + Line(points = {{22, -14}, {56, -14}, {56, -16}, {58, -16}})); + connect(distCol.distillate, distillate.inlet) annotation( + Line(points = {{22, 22}, {54, 22}, {54, 22}, {54, 22}})); + connect(feed.outlet, distCol.feed[1]) annotation( + Line(points = {{-66, 2}, {-30, 2}, {-30, 2}, {-28, 2}})); + feed.P = 101325; + feed.T = 298.15; + feed.totMolFlo[1] = 100; + feed.compMolFrac[1, :] = {0.5, 0.5}; + distCol.condensor.P = 101325; + distCol.reboiler.P = 101325; + distCol.refluxRatio = 2; + bottoms.totMolFlo[1] = 50; + ms1.P = 101325; + ms1.T = 298.15; + ms1.totMolFlo[1] = 100; + ms1.compMolFrac[1, :] = {0.5, 0.5}; + end multiFeedTest; +end rigDist; diff --git a/Simulator/Simulator/Test/shortcut1.mo b/Simulator/Simulator/Test/shortcut1.mo new file mode 100644 index 0000000..b17743c --- /dev/null +++ b/Simulator/Simulator/Test/shortcut1.mo @@ -0,0 +1,54 @@ +within Simulator.Test; + +package shortcut1 + model ms + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end ms; + + model Shortcut + extends Simulator.Unit_Operations.Shortcut_Column; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end Shortcut; + + model main + //use non linear solver homotopy for solving + import data = Simulator.Files.Chemsep_Database; + parameter data.Benzene benz; + parameter data.Toluene tol; + parameter Integer NOC = 2; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] = {benz, tol}; + Simulator.Test.shortcut1.Shortcut shortcut(NOC = NOC, comp = comp, condType = "Partial", HKey = 2, LKey = 1, mixMolFrac(start = {{0.5, 0.5}, {0.01, 0.99}, {0.99, 0.01}}), minN(start = 9.1859), theta(start = 1, min = 1), minR(start = 2, min = 0)) annotation( + Placement(visible = true, transformation(origin = {-8, -2}, extent = {{-30, -30}, {30, 30}}, rotation = 0))); + Simulator.Test.shortcut1.ms feed(NOC = NOC, comp = comp, compMolFrac(start = {{0.5, 0.5}, {0.34, 0.65}, {0.56, 0.44}})) annotation( + Placement(visible = true, transformation(origin = {-74, 4}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms bottoms(NOC = NOC, comp = comp, T(start = 383.08), compMolFrac(start = {{0.01, 0.99}, {0.01, 0.99}, {0, 0}})) annotation( + Placement(visible = true, transformation(origin = {76, -28}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms distillate(NOC = NOC, comp = comp, T(start = 353.83), compMolFrac(start = {{0.99, 0.01}, {0.99, 0.01}, {0, 0}})) annotation( + Placement(visible = true, transformation(origin = {76, 38}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream Condensor_Duty annotation( + Placement(visible = true, transformation(origin = {40, 76}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Streams.Energy_Stream Reboiler_Duty annotation( + Placement(visible = true, transformation(origin = {-8, -84}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(feed.outlet, shortcut.feed) annotation( + Line(points = {{-64, 4}, {-83, 4}, {-83, -2}, {-96, -2}})); + connect(shortcut.bottoms, bottoms.inlet) annotation( + Line(points = {{94, -189}, {51, -189}, {51, -28}, {66, -28}})); + connect(shortcut.distillate, distillate.inlet) annotation( + Line(points = {{94, 181}, {50, 181}, {50, 38}, {66, 38}})); + connect(Condensor_Duty.inlet, shortcut.condenser_duty) annotation( + Line(points = {{30, 76}, {30, 57}, {80, 57}, {80, 282}})); + connect(shortcut.reboiler_duty, Reboiler_Duty.outlet) annotation( + Line(points = {{88, -287}, {88, -55}, {2, -55}, {2, -84}})); + feed.P = 101325; + feed.T = 370; + feed.compMolFrac[1, :] = {0.5, 0.5}; + feed.totMolFlo[1] = 100; + shortcut.rebP = 101325; + shortcut.condP = 101325; + shortcut.mixMolFrac[2, shortcut.LKey] = 0.01; + shortcut.mixMolFrac[3, shortcut.HKey] = 0.01; + shortcut.actR = 2; + end main; +end shortcut1; diff --git a/Simulator/Simulator/Test/split.mo b/Simulator/Simulator/Test/split.mo new file mode 100644 index 0000000..3ae07d8 --- /dev/null +++ b/Simulator/Simulator/Test/split.mo @@ -0,0 +1,38 @@ +within Simulator.Test; + +package split + model ms + extends Simulator.Streams.Material_Stream; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + end ms; + + model main + import data = Simulator.Files.Chemsep_Database; + parameter data.Benzene benz; + parameter data.Toluene tol; + parameter Integer NOC = 2; + parameter data.General_Properties comp[NOC] = {benz, tol}; + ms inlet(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-80, 10}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms outlet1(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {38, 56}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + ms outlet2(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {38, -58}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Unit_Operations.Splitter split(NOC = NOC, comp = comp, NO = 2, calcType = "Molar_Flow") annotation( + Placement(visible = true, transformation(origin = {-30, 10}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + connect(inlet.outlet, split.inlet) annotation( + Line(points = {{-70, 10}, {-40, 10}})); + connect(outlet1.inlet, split.outlet[1]) annotation( + Line(points = {{28, 56}, {12, 56}, {12, 10}, {-20, 10}})); + connect(outlet2.inlet, split.outlet[2]) annotation( + Line(points = {{28, -58}, {16, -58}, {16, 10}, {-20, 10}})); +// connect(split.outlet[1], outlet1.inlet); +// connect(split.outlet[2], outlet2.inlet); + inlet.P = 101325; + inlet.T = 300; + inlet.compMolFrac[1, :] = {0.5, 0.5}; + inlet.totMolFlo[1] = 100; + split.specVal = {20, 80}; + end main; +end split; diff --git a/Simulator/Simulator/Test/valve1.mo b/Simulator/Simulator/Test/valve1.mo new file mode 100644 index 0000000..8c92147 --- /dev/null +++ b/Simulator/Simulator/Test/valve1.mo @@ -0,0 +1,45 @@ +within Simulator.Test; + +package valve1 + model ms + //This model will be instantiated in maintest model as outlet stream of valve. Dont run this model. Run maintest model for valve test + extends Simulator.Streams.Material_Stream; + //material stream extended + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //thermodynamic package Raoults law is extended + end ms; + + model valve + import data = Simulator.Files.Chemsep_Database; + //instantiation of chemsep database + parameter data.Methanol meth; + //instantiation of methanol + parameter data.Ethanol eth; + //instantiation of ethanol + parameter data.Water wat; + //instantiation of water + parameter Integer NOC = 3; + parameter data.General_Properties comp[NOC] = {meth, eth, wat}; + Unit_Operations.Valve valve1(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {0, 4}, extent = {{-14, -14}, {14, 14}}, rotation = 0))); + ms inlet(NOC = NOC, comp = comp) annotation( + Placement(visible = true, transformation(origin = {-74, 4}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Test.valve1.ms outlet(NOC = NOC, comp = comp, T(start = 352), compMolFrac(start = {{0.33, 0.33, 0.34}, {0.26, 0.32, 0.40}, {0.47, 0.34, 0.18}})) annotation( + Placement(visible = true, transformation(origin = {67, 3}, extent = {{-11, -11}, {11, 11}}, rotation = 0))); + equation + connect(valve1.outlet, outlet.inlet) annotation( + Line(points = {{14, 4}, {35, 4}, {35, 3}, {56, 3}})); + connect(inlet.outlet, valve1.inlet) annotation( + Line(points = {{-64, 4}, {-14, 4}})); + inlet.compMolFrac[1, :] = {0.33, 0.33, 0.34}; +//mixture molar composition + inlet.P = 202650; +//input pressure + valve1.pressDrop = 101325; +//Pressure Drop + inlet.T = 372; +//input temperature + inlet.totMolFlo[1] = 100; +//input molar flow + end valve; +end valve1; diff --git a/Simulator/Simulator/Unit_Operations/Absorption_Column/AbsCol.mo b/Simulator/Simulator/Unit_Operations/Absorption_Column/AbsCol.mo new file mode 100644 index 0000000..2fb8f86 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Absorption_Column/AbsCol.mo @@ -0,0 +1,44 @@ +within Simulator.Unit_Operations.Absorption_Column; + +model AbsCol + import data = Simulator.Files.Chemsep_Database; + parameter Integer NOC "Number of Components"; + parameter Integer noOfStages; + parameter data.General_Properties comp[NOC]; + Simulator.Files.Connection.matConn top_feed(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 80}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 80}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn bottom_feed(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, -80}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, -80}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn top_product(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 80}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 80}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn bottom_product(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, -80}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -80}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//connector equation + tray[1].liqMolFlo[1] = top_feed.mixMolFlo; + tray[1].liqCompMolFrac[1, :] = top_feed.mixMolFrac[1, :]; + tray[1].liqMolEnth[1] = top_feed.mixMolEnth; + tray[1].vapMolFlo[2] = top_product.mixMolFlo; + tray[1].vapCompMolFrac[2, :] = top_product.mixMolFrac[1, :]; +// tray[1].vapMolEnth[2] = top_product.mixMolEnth; + tray[1].T = top_product.T; + tray[noOfStages].liqMolFlo[2] = bottom_product.mixMolFlo; + tray[noOfStages].liqCompMolFrac[2, :] = bottom_product.mixMolFrac[1, :]; +// tray[noOfStages].liqMolEnth[2] = bottom_product.mixMolEnth; + tray[noOfStages].T = bottom_product.T; + tray[noOfStages].vapMolFlo[1] = bottom_feed.mixMolFlo; + tray[noOfStages].vapCompMolFrac[1, :] = bottom_feed.mixMolFrac[1, :]; + tray[noOfStages].vapMolEnth[1] = bottom_feed.mixMolEnth; + for i in 1:noOfStages - 1 loop + connect(tray[i].liquid_outlet, tray[i + 1].liquid_inlet); + connect(tray[i].vapor_inlet, tray[i + 1].vapor_outlet); + end for; +//tray pressures + for i in 2:noOfStages - 1 loop + tray[i].P = tray[1].P + i * (tray[noOfStages].P - tray[1].P) / (noOfStages - 1); + end for; + tray[1].P = top_feed.P; + tray[noOfStages].P = bottom_feed.P; + tray[1].P = top_product.P; + tray[noOfStages].P = bottom_product.P; +end AbsCol; diff --git a/Simulator/Simulator/Unit_Operations/Absorption_Column/AbsTray.mo b/Simulator/Simulator/Unit_Operations/Absorption_Column/AbsTray.mo new file mode 100644 index 0000000..ca35c3c --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Absorption_Column/AbsTray.mo @@ -0,0 +1,63 @@ +within Simulator.Unit_Operations.Absorption_Column; + +model AbsTray + import Simulator.Files.*; + parameter Integer NOC; + parameter Chemsep_Database.General_Properties comp[NOC]; + Real P(min = 0, start = 101325), T(min = 0, start = sum(comp[:].Tb) / NOC); + Real vapMolFlo[2](each min = 0, each start = 100), liqMolFlo[2](each min = 0, each start = 100), vapCompMolFrac[2, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), liqCompMolFrac[2, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), vapMolEnth[2], liqMolEnth[2], outVapCompMolEnth[NOC], outLiqCompMolEnth[NOC]; + Real compMolFrac[3, NOC](each min = 0, each max = 0, each start = 1 / (NOC + 1)), Pdew(min = 0, start = sum(comp[:].Pc) / NOC), Pbubl(min = 0, start = sum(comp[:].Pc) / NOC); + Simulator.Files.Connection.trayConn liquid_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn liquid_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//connector equation + liquid_inlet.mixMolFlo = liqMolFlo[1]; + liquid_inlet.mixMolEnth = liqMolEnth[1]; + liquid_inlet.mixMolFrac[:] = liqCompMolFrac[1, :]; + liquid_outlet.mixMolFlo = liqMolFlo[2]; + liquid_outlet.mixMolEnth = liqMolEnth[2]; + liquid_outlet.mixMolFrac[:] = liqCompMolFrac[2, :]; + vapor_inlet.mixMolFlo = vapMolFlo[1]; + vapor_inlet.mixMolEnth = vapMolEnth[1]; + vapor_inlet.mixMolFrac[:] = vapCompMolFrac[1, :]; + vapor_outlet.mixMolFlo = vapMolFlo[2]; + vapor_outlet.mixMolEnth = vapMolEnth[2]; + vapor_outlet.mixMolFrac[:] = vapCompMolFrac[2, :]; +//Adjustment for thermodynamic packages + compMolFrac[1, :] = (vapMolFlo[2] .* vapCompMolFrac[2, :] + liqMolFlo[2] .* liqCompMolFrac[2, :]) / (liqMolFlo[2] + vapMolFlo[2]); + compMolFrac[2, :] = liqCompMolFrac[2, :]; + compMolFrac[3, :] = vapCompMolFrac[2, :]; +//Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); +//molar balance + vapMolFlo[1] .* vapCompMolFrac[1, :] + liqMolFlo[1] .* liqCompMolFrac[1, :] = vapMolFlo[2] .* vapCompMolFrac[2, :] + liqMolFlo[2] .* liqCompMolFrac[2, :]; +//equillibrium + vapCompMolFrac[2, :] = K[:] .* liqCompMolFrac[2, :]; +// for i in 1:NOC loop +// vapCompMolFrac[2,i] = ((K[i]/(K[1])) * liqCompMolFrac[2,i]) / (1 + (K[i] / (K[1])) * liqCompMolFrac[2,i]); +// end for; +//summation equation + sum(liqCompMolFrac[2, :]) = 1; + sum(vapCompMolFrac[2, :]) = 1; +// Enthalpy balance + vapMolFlo[1] * vapMolEnth[1] + liqMolFlo[1] * liqMolEnth[1] = vapMolFlo[2] * vapMolEnth[2] + liqMolFlo[2] * liqMolEnth[2]; +//enthalpy calculation + for i in 1:NOC loop + outLiqCompMolEnth[i] = Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + outVapCompMolEnth[i] = Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + end for; + liqMolEnth[2] = sum(liqCompMolFrac[2, :] .* outLiqCompMolEnth[:]) + resMolEnth[2]; + vapMolEnth[2] = sum(vapCompMolFrac[2, :] .* outVapCompMolEnth[:]) + resMolEnth[3]; + annotation( + Diagram(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + Icon(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + __OpenModelica_commandLineOptions = ""); +end AbsTray; diff --git a/Simulator/Simulator/Unit_Operations/Absorption_Column/package.mo b/Simulator/Simulator/Unit_Operations/Absorption_Column/package.mo new file mode 100644 index 0000000..5783b9b --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Absorption_Column/package.mo @@ -0,0 +1,112 @@ +within Simulator.Unit_Operations; + +package Absorption_Column + model AbsTray + import Simulator.Files.*; + parameter Integer NOC; + parameter Chemsep_Database.General_Properties comp[NOC]; + Real P(min = 0, start = 101325), T(min = 0, start = sum(comp[:].Tb) / NOC); + Real vapMolFlo[2](each min = 0, each start = 100), liqMolFlo[2](each min = 0, each start = 100), vapCompMolFrac[2, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), liqCompMolFrac[2, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), vapMolEnth[2], liqMolEnth[2], outVapCompMolEnth[NOC], outLiqCompMolEnth[NOC]; + Real compMolFrac[3, NOC](each min =0, each max = 0, each start = 1/(NOC + 1)), Pdew(min = 0, start = sum(comp[:].Pc)/NOC), Pbubl(min = 0, start = sum(comp[:].Pc)/NOC); + + Simulator.Files.Connection.trayConn liquid_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn liquid_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation +//connector equation + liquid_inlet.mixMolFlo = liqMolFlo[1]; + liquid_inlet.mixMolEnth = liqMolEnth[1]; + liquid_inlet.mixMolFrac[:] = liqCompMolFrac[1, :]; + liquid_outlet.mixMolFlo = liqMolFlo[2]; + liquid_outlet.mixMolEnth = liqMolEnth[2]; + liquid_outlet.mixMolFrac[:] = liqCompMolFrac[2, :]; + vapor_inlet.mixMolFlo = vapMolFlo[1]; + vapor_inlet.mixMolEnth = vapMolEnth[1]; + vapor_inlet.mixMolFrac[:] = vapCompMolFrac[1, :]; + vapor_outlet.mixMolFlo = vapMolFlo[2]; + vapor_outlet.mixMolEnth = vapMolEnth[2]; + vapor_outlet.mixMolFrac[:] = vapCompMolFrac[2, :]; + + //Adjustment for thermodynamic packages + compMolFrac[1, :] = (vapMolFlo[2] .* vapCompMolFrac[2, :] + liqMolFlo[2] .* liqCompMolFrac[2, :]) / (liqMolFlo[2] + vapMolFlo[2]); + compMolFrac[2, :] = liqCompMolFrac[2,:]; + compMolFrac[3, :] = vapCompMolFrac[2,:]; + //Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); + //Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); + +//molar balance + vapMolFlo[1] .* vapCompMolFrac[1, :] + liqMolFlo[1] .* liqCompMolFrac[1, :] = vapMolFlo[2] .* vapCompMolFrac[2, :] + liqMolFlo[2] .* liqCompMolFrac[2, :]; +//equillibrium + vapCompMolFrac[2, :] = K[:] .* liqCompMolFrac[2, :]; +// for i in 1:NOC loop +// vapCompMolFrac[2,i] = ((K[i]/(K[1])) * liqCompMolFrac[2,i]) / (1 + (K[i] / (K[1])) * liqCompMolFrac[2,i]); +// end for; +//summation equation + sum(liqCompMolFrac[2, :]) = 1; + sum(vapCompMolFrac[2, :]) = 1; +// Enthalpy balance + vapMolFlo[1] * vapMolEnth[1] + liqMolFlo[1] * liqMolEnth[1] = vapMolFlo[2] * vapMolEnth[2] + liqMolFlo[2] * liqMolEnth[2]; +//enthalpy calculation + for i in 1:NOC loop + outLiqCompMolEnth[i] = Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + outVapCompMolEnth[i] = Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + end for; + liqMolEnth[2] = sum(liqCompMolFrac[2, :] .* outLiqCompMolEnth[:]) + resMolEnth[2]; + vapMolEnth[2] = sum(vapCompMolFrac[2, :] .* outVapCompMolEnth[:]) + resMolEnth[3]; + annotation( + Diagram(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + Icon(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + __OpenModelica_commandLineOptions = ""); + end AbsTray; + + model AbsCol + import data = Simulator.Files.Chemsep_Database; + parameter Integer NOC "Number of Components"; + parameter Integer noOfStages; + parameter data.General_Properties comp[NOC]; + Simulator.Files.Connection.matConn top_feed(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 80}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 80}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn bottom_feed(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, -80}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, -80}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn top_product(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 80}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 80}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn bottom_product(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, -80}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -80}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation +//connector equation + tray[1].liqMolFlo[1] = top_feed.mixMolFlo; + tray[1].liqCompMolFrac[1, :] = top_feed.mixMolFrac[1, :]; + tray[1].liqMolEnth[1] = top_feed.mixMolEnth; + tray[1].vapMolFlo[2] = top_product.mixMolFlo; + tray[1].vapCompMolFrac[2, :] = top_product.mixMolFrac[1, :]; +// tray[1].vapMolEnth[2] = top_product.mixMolEnth; + tray[1].T = top_product.T; + tray[noOfStages].liqMolFlo[2] = bottom_product.mixMolFlo; + tray[noOfStages].liqCompMolFrac[2, :] = bottom_product.mixMolFrac[1, :]; +// tray[noOfStages].liqMolEnth[2] = bottom_product.mixMolEnth; + tray[noOfStages].T = bottom_product.T; + tray[noOfStages].vapMolFlo[1] = bottom_feed.mixMolFlo; + tray[noOfStages].vapCompMolFrac[1, :] = bottom_feed.mixMolFrac[1, :]; + tray[noOfStages].vapMolEnth[1] = bottom_feed.mixMolEnth; + for i in 1:noOfStages - 1 loop + connect(tray[i].liquid_outlet, tray[i + 1].liquid_inlet); + connect(tray[i].vapor_inlet, tray[i + 1].vapor_outlet); + end for; +//tray pressures + for i in 2:noOfStages - 1 loop + tray[i].P = tray[1].P + i * (tray[noOfStages].P - tray[1].P) / (noOfStages - 1); + end for; + tray[1].P = top_feed.P; + tray[noOfStages].P = bottom_feed.P; + tray[1].P = top_product.P; + tray[noOfStages].P = bottom_product.P; + end AbsCol; + +end Absorption_Column; diff --git a/Simulator/Simulator/Unit_Operations/Absorption_Column/package.order b/Simulator/Simulator/Unit_Operations/Absorption_Column/package.order new file mode 100644 index 0000000..8322d9c --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Absorption_Column/package.order @@ -0,0 +1,2 @@ +AbsTray +AbsCol diff --git a/Simulator/Simulator/Unit_Operations/Adiabatic_Compressor.mo b/Simulator/Simulator/Unit_Operations/Adiabatic_Compressor.mo new file mode 100644 index 0000000..a24d44a --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Adiabatic_Compressor.mo @@ -0,0 +1,55 @@ +within Simulator.Unit_Operations; + +model Adiabatic_Compressor + extends Simulator.Files.Icons.Adiabatic_Compressor; + // This is generic Adibatic Compressor model. For using this model we need to extend this model and respective thermodynamic model and use the new model in flowsheets. Refer adia_comp models in Test section for this. + extends Simulator.Files.Models.Flash; + //==================================================================================== + Real inMolFlo(min = 0, start = 100) "inlet mixture molar flow rate", outMolFlo(min = 0, start = 100) "outlet mixture molar flow rate", reqPow "required Power", inP(min = 0, start = 101325) "Inlet pressure", outP(min = 0, start = 101325) "Outlet pressure", pressInc "Pressure Increase", inT(min = 0, start = 273.15) "Inlet Temperature", outT(min = 0, start = 273.15) "Outlet Temperature", tempInc "Temperature increase"; + Real inMixMolEnth "inlet mixture molar enthalpy", outMixMolEnth "outlet mixture molar enthalpy", inMixMolEntr "inlet mixture molar entropy", outMixMolEntr "outlet mixture molar entropy"; + Real inVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Inlet vapor mol fraction", outVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Outlet Vapor Mole fraction", mixMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "mixture mole fraction"; + parameter Real eff "Efficiency"; + parameter Integer NOC "number of components"; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + //======================================================================================== + Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn energy annotation( + Placement(visible = true, transformation(origin = {0, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {0, -66}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + //======================================================================================== +equation +//connector equations + inlet.P = inP; + inlet.T = inT; + inlet.mixMolFlo = inMolFlo; + inlet.mixMolEnth = inMixMolEnth; + inlet.mixMolEntr = inMixMolEntr; + inlet.mixMolFrac[1, :] = mixMolFrac[:]; + inlet.vapPhasMolFrac = inVapPhasMolFrac; + outlet.P = outP; + outlet.T = outT; + outlet.mixMolFlo = outMolFlo; + outlet.mixMolEnth = outMixMolEnth; + outlet.mixMolEntr = outMixMolEntr; + outlet.mixMolFrac[1, :] = mixMolFrac[:]; + outlet.vapPhasMolFrac = outVapPhasMolFrac; + energy.enFlo = reqPow; +//============================================================================================= + inMolFlo = outMolFlo; +//material balance + outMixMolEnth = inMixMolEnth + (phasMolEnth[1] - inMixMolEnth) / eff; + reqPow = inMolFlo * (phasMolEnth[1] - inMixMolEnth) / eff; +//energy balance + inP + pressInc = outP; +//pressure calculation + inT + tempInc = outT; +//temperature calculation +//========================================================================= +//ideal flash + inMolFlo = totMolFlo[1]; + outP = P; + inMixMolEntr = phasMolEntr[1]; + mixMolFrac[:] = compMolFrac[1, :]; +end Adiabatic_Compressor; diff --git a/Simulator/Simulator/Unit_Operations/Adiabatic_Expander.mo b/Simulator/Simulator/Unit_Operations/Adiabatic_Expander.mo new file mode 100644 index 0000000..b63f971 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Adiabatic_Expander.mo @@ -0,0 +1,55 @@ +within Simulator.Unit_Operations; + +model Adiabatic_Expander + extends Simulator.Files.Icons.Adiabatic_Expander; + // This is generic Adibatic Expander model. For using this model we need to extend this model and respective thermodynamic model and use the new model in flowsheets. Refer adia_comp models in Test section for this. + extends Simulator.Files.Models.Flash; + //==================================================================================== + Real inMolFlo(min = 0, start = 100) "inlet mixture molar flow rate", outMolFlo(min = 0, start = 100) "outlet mixture molar flow rate", genPow "generated Power", inP(min = 0, start = 101325) "Inlet pressure", outP(min = 0, start = 101325) "Outlet pressure", pressDrop "Pressure Drop", inT(min = 0, start = 273.15) "Inlet Temperature", outT(min = 0, start = 273.15) "Outlet Temperature", tempDrop "Temperature increase"; + Real inMixMolEnth "inlet mixture molar enthalpy", outMixMolEnth "outlet mixture molar enthalpy", inMixMolEntr "inlet mixture molar entropy", outMixMolEntr "outlet mixture molar entropy"; + Real inVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Inlet vapor mol fraction", outVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Outlet Vapor Mole fraction", mixMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "mixture mole fraction"; + parameter Real eff "Efficiency"; + parameter Integer NOC "number of components"; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + //======================================================================================== + Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn energy annotation( + Placement(visible = true, transformation(origin = {0, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {0, -66}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + //======================================================================================== +equation +//connector equations + inlet.P = inP; + inlet.T = inT; + inlet.mixMolFlo = inMolFlo; + inlet.mixMolEnth = inMixMolEnth; + inlet.mixMolEntr = inMixMolEntr; + inlet.mixMolFrac[1, :] = mixMolFrac[:]; + inlet.vapPhasMolFrac = inVapPhasMolFrac; + outlet.P = outP; + outlet.T = outT; + outlet.mixMolFlo = outMolFlo; + outlet.mixMolEnth = outMixMolEnth; + outlet.mixMolEntr = outMixMolEntr; + outlet.mixMolFrac[1, :] = mixMolFrac[:]; + outlet.vapPhasMolFrac = outVapPhasMolFrac; + energy.enFlo = genPow; +//============================================================================================= + inMolFlo = outMolFlo; +//material balance + outMixMolEnth = inMixMolEnth + (phasMolEnth[1] - inMixMolEnth) * eff; + genPow = inMolFlo * (phasMolEnth[1] - inMixMolEnth) * eff; +//energy balance + inP - pressDrop = outP; +//pressure calculation + inT - tempDrop = outT; +//temperature calculation +//========================================================================= +//ideal flash + inMolFlo = totMolFlo[1]; + outP = P; + inMixMolEntr = phasMolEntr[1]; + mixMolFrac[:] = compMolFrac[1, :]; +end Adiabatic_Expander; diff --git a/Simulator/Simulator/Unit_Operations/Centrifugal_Pump.mo b/Simulator/Simulator/Unit_Operations/Centrifugal_Pump.mo new file mode 100644 index 0000000..199780c --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Centrifugal_Pump.mo @@ -0,0 +1,46 @@ +within Simulator.Unit_Operations; + +model Centrifugal_Pump + extends Simulator.Files.Icons.Centrifugal_Pump; + parameter Integer NOC = 2 "Number of Components"; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] "Component array"; + Real inP(min = 0, start = 101325) "Inlet Pressure", outP(min = 0, start = 101325) "Outlet Pressure", inT(min = 0, start = 273.15) "Inlet Temperature", outT(min = 0, start = 273.15) "Outlet Temperature", tempInc "Temperature increase", pressInc "Pressure Increase", inMixMolEnth "Inlet Mixture Molar Enthalpy", outMixMolEnth "Outlet Mixture Molar Enthalpy", reqPow "Power required", compDens[NOC](each min = 0) "Component density", dens(min = 0) "Density", vapPress(min = 0, start = 101325) "Vapor pressure of Mixture at outlet Temperature", NPSH "NPSH", inMixMolFlo(min = 0, start = 100) "inlet Mixture Molar Flow", outMixMolFlo(min = 0, start = 100) "Outlet Mixture Molar flow", inMixMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "Inlet Mixuture Molar Fraction", outMixMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "Outlet Mixture Molar Fraction"; + parameter Real eff "efficiency"; + Simulator.Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 16}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {102, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 100}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Files.Connection.enConn energy annotation( + Placement(visible = true, transformation(origin = {2, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {2, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//Connector equation + inlet.P = inP; + inlet.T = inT; + inlet.mixMolFlo = inMixMolFlo; + inlet.mixMolEnth = inMixMolEnth; + inlet.mixMolFrac[1, :] = inMixMolFrac[:]; + outlet.P = outP; + outlet.T = outT; + outlet.mixMolFlo = outMixMolFlo; + outlet.mixMolEnth = outMixMolEnth; + outlet.mixMolFrac[1, :] = outMixMolFrac[:]; + energy.enFlo = reqPow; +//Pump equations +//balance + inMixMolFlo = outMixMolFlo; + inMixMolFrac = outMixMolFrac; + inP + pressInc = outP; + inT + tempInc = outT; +//density + for i in 1:NOC loop + compDens[i] = Simulator.Files.Thermodynamic_Functions.Dens(comp[i].LiqDen, comp[i].Tc, inT, inP); + end for; + dens = 1 / sum(inMixMolFrac ./ compDens); +//energy balance + outMixMolEnth = inMixMolEnth + pressInc / dens; + reqPow = inMixMolFlo * (outMixMolEnth - inMixMolEnth) / eff; +//NPSH + NPSH = (inP - vapPress) / dens; +//vap pressure of mixture at outT + vapPress = sum(inMixMolFrac .* exp(comp[:].VP[2] + comp[:].VP[3] / outT + comp[:].VP[4] * log(outT) + comp[:].VP[5] .* outT .^ comp[:].VP[6])); +end Centrifugal_Pump; diff --git a/Simulator/Simulator/Unit_Operations/Compound_Separator.mo b/Simulator/Simulator/Unit_Operations/Compound_Separator.mo new file mode 100644 index 0000000..ae055a7 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Compound_Separator.mo @@ -0,0 +1,71 @@ +within Simulator.Unit_Operations; + +model Compound_Separator + extends Simulator.Files.Icons.Compound_Separator; + parameter Integer NOC "Number of components", sepStrm "Specified Stream"; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC] "Components array"; + Real inP(min = 0, start = 101325) "inlet pressure", inT(min = 0, start = 273.15) "inlet temperature", inMixMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "inlet mixture mole fraction", inMixMolFlo(min = 0, start = 100) "inlet mixture molar flow", inCompMolFlo[NOC](each min = 0, each start = 100) "inlet compound molar flow", inCompMasFlo[NOC](each min = 0, each start = 100) "inlet compound mass flow", inMixMolEnth "inlet mixture molar enthalpy"; + Real outP[2](each min = 0, each start = 100) "outlet Pressure", outT[2](each min = 0, each start = 273.15) "outlet temperature", outMixMolFrac[2, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "outlet mixture mole fraction", outMixMolFlo[2](each min = 0, each start = 100) "Outlet mixture molar flow", outCompMolFlo[2, NOC](each min = 0, each start = 100) "outlet compounds molar flow", outCompMasFlo[2, NOC](each min = 0, each start = 100) "outlet compound mass flow", outMixMolEnth[2] "outlet mixture molar enthalpy"; + Real enReq "energy required"; + Real sepFactVal[NOC] "Separation factor value"; + parameter String sepFact[NOC] "Separation factor"; + // separation factor: Molar_Flow, Mass_Flow, Inlet_Molar_Flow_Percent, Inlet_Mass_Flow_Percent. + Simulator.Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-118, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn outlet1(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 70}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {122, 56}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn energy annotation( + Placement(visible = true, transformation(origin = {0, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {0, -132}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn outlet2(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, -70}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {120, -50}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +// Connector equation + inlet.P = inP; + inlet.T = inT; + inlet.mixMolFlo = inMixMolFlo; + inlet.mixMolFrac[1, :] = inMixMolFrac[:]; + inlet.mixMolEnth = inMixMolEnth; + outlet1.P = outP[1]; + outlet1.T = outT[1]; + outlet1.mixMolFlo = outMixMolFlo[1]; + outlet1.mixMolFrac[1, :] = outMixMolFrac[1, :]; + outlet1.mixMolEnth = outMixMolEnth[1]; + outlet2.mixMolFlo = outMixMolFlo[2]; + outlet2.mixMolFrac[1, :] = outMixMolFrac[2, :]; + outlet2.mixMolEnth = outMixMolEnth[2]; + outlet2.P = outP[2]; + outlet2.T = outT[2]; + energy.enFlo = enReq; +// Pressure and temperature equations + outP[1] = inP; + outP[2] = inP; + outT[1] = inT; + outT[2] = inT; +// mole balance + inMixMolFlo = sum(outMixMolFlo[:]); + inCompMolFlo[:] = outMixMolFrac[1, :] * outMixMolFlo[1] + outMixMolFrac[2, :] * outMixMolFlo[2]; +// Conversion + inCompMolFlo = inMixMolFrac .* inMixMolFlo; + inCompMasFlo = inCompMolFlo .* comp[:].MW; + for i in 1:2 loop + outCompMolFlo[i, :] = outMixMolFrac[i, :] .* outMixMolFlo[i]; + outCompMasFlo[i, :] = outCompMolFlo[i, :] .* comp[:].MW; + end for; + sum(outMixMolFrac[2, :]) = 1; + for i in 1:NOC loop + if sepFact[i] == "Molar_Flow" then + sepFactVal[i] = outCompMolFlo[sepStrm, i]; + elseif sepFact[i] == "Mass_Flow" then + sepFactVal[i] = outCompMasFlo[sepStrm, i]; + elseif sepFact[i] == "Inlet_Molar_Flow_Percent" then + outCompMolFlo[sepStrm, i] = sepFactVal[i] * inCompMolFlo[i] / 100; + elseif sepFact[i] == "Inlet_Mass_Flow_Percent" then + outCompMasFlo[sepStrm, i] = sepFactVal[i] * inCompMasFlo[i] / 100; + end if; + end for; +//Energy balance + enReq = sum(outMixMolEnth .* outMixMolFlo) - inMixMolFlo * inMixMolEnth; +annotation( + Icon(coordinateSystem(extent = {{-100, -200}, {100, 200}})), + Diagram(coordinateSystem(extent = {{-100, -200}, {100, 200}})), + __OpenModelica_commandLineOptions = "");end Compound_Separator; diff --git a/Simulator/Simulator/Unit_Operations/Conversion_Reactor.mo b/Simulator/Simulator/Unit_Operations/Conversion_Reactor.mo new file mode 100644 index 0000000..8f8252d --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Conversion_Reactor.mo @@ -0,0 +1,67 @@ +within Simulator.Unit_Operations; + +model Conversion_Reactor + extends Simulator.Files.Icons.Conversion_Reactor; + + //This is generic conversion reactor model. we need to extend reaction manager model with this model for using this model. + parameter Real X[Nr] = fill(0.4, Nr) "Conversion of base component"; + parameter Integer NOC "Number of components"; + parameter Real pressDrop = 0 "pressure drop"; + parameter Real Tdef = 300 "Defined outlet temperature, only applicable if define outlet temperature mode is chosen"; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + parameter String calcMode = "Isothermal" "Isothermal, Define_Outlet_Temperature, Adiabatic; choose the required operation"; + Real inMolFlo(min = 0, start = 100) "Inlet Molar Flowrate"; + Real outMolFlo(min = 0, start = 100) "Outlet Molar Flowrate"; + Real inCompMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "Inlet component Mole Fraction"; + Real outCompMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "Outlet component Mole Fraction"; + Real inMixMolEnth "Inlet Molar Enthalpy"; + Real outMixMolEnth "Outlet Molar Enthalpy"; + Real inP(min = 0, start = 101325) "Inlet pressure"; + Real outP(min = 0, start = 101325) "Outlet pressure"; + Real inT(min = 0, start = 273.15) "Inlet Temperature"; + Real outT(min = 0, start = 273.15) "Outlet Temperature"; + Real N[NOC, Nr] "Number of moles of components after reactions"; + Simulator.Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn energy annotation( + Placement(visible = true, transformation(origin = {0, -98}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {2, -186}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation + inlet.P = inP; + inlet.T = inT; + inlet.mixMolFlo = inMolFlo; + inlet.mixMolEnth = inMixMolEnth; + inlet.mixMolFrac[1, :] = inCompMolFrac[:]; + outlet.P = outP; + outlet.T = outT; + outlet.mixMolFlo = outMolFlo; + outlet.mixMolEnth = outMixMolEnth; + outlet.mixMolFrac[1, :] = outCompMolFrac[:]; +//Reactor equations + for i in 1:NOC loop + N[i, 1] = inMolFlo * inCompMolFrac[i] - Sc[i, 1] / Sc[Bc[1], 1] * inMolFlo * inCompMolFrac[Bc[1]] * X[1]; + end for; + if Nr > 1 then + for j in 2:Nr loop + for i in 1:NOC loop + N[i, j] = N[i, j - 1] - Sc[i, j] / Sc[Bc[j], j] * inMolFlo * inCompMolFrac[Bc[j]] * X[j]; + end for; + end for; + end if; + outMolFlo = sum(N[:, Nr]); + for i in 1:NOC loop + outCompMolFrac[i] = N[i, Nr] / outMolFlo; + end for; + inP - pressDrop = outP; + if calcMode == "Isothermal" then + inT = outT; + energy.enFlo = outMixMolEnth * outMolFlo - inMixMolEnth * inMolFlo; + elseif calcMode == "Adiabatic" then + outMixMolEnth * outMolFlo = inMixMolEnth * inMolFlo; + energy.enFlo = 0; + elseif calcMode == "Define_Outlet_Temperature" then + outT = Tdef; + energy.enFlo = outMixMolEnth * outMolFlo - inMixMolEnth * inMolFlo; + end if; +end Conversion_Reactor; diff --git a/Simulator/Simulator/Unit_Operations/Cooler.mo b/Simulator/Simulator/Unit_Operations/Cooler.mo new file mode 100644 index 0000000..71f3133 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Cooler.mo @@ -0,0 +1,48 @@ +within Simulator.Unit_Operations; + +model Cooler + extends Simulator.Files.Icons.Cooler; + // This is generic cooler model. For using this model we need to extend this model and incorporte ouput material stream since this model is not doing any flash calculations. Refer cooler models in Test section for this. + //==================================================================================== + Real inMolFlo(min = 0, start = 100) "inlet mixture molar flow rate", outMolFlo(min = 0, start = 100) "outlet mixture molar flow rate", heatRem "Heat removed", inP(min = 0, start = 101325) "Inlet pressure", outP(min = 0, start = 101325) "Outlet pressure", inT(min = 0, start = 273.15) "Inlet Temperature", outT(min = 0, start = 273.15) "Outlet Temperature", tempDrop "Temperature Drop", outVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Outlet Vapor Mole Fraction"; + Real inMixMolEnth "inlet mixture molar enthalpy", outMixMolEnth "outlet mixture molar enthalpy"; + Real inMixMolEntr "inlet mixture molar entropy", outMixMolEntr "outlet mixture molar entropy", mixMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "mixture mole fraction", inVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Inlet vapor phase mole fraction"; + //======================================================================================== + parameter Real pressDrop "Pressure drop", eff "Efficiency"; + parameter Integer NOC "number of components"; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + //======================================================================================== + Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn energy annotation( + Placement(visible = true, transformation(origin = {0, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + //======================================================================================== +equation +//connector equations + inlet.P = inP; + inlet.T = inT; + inlet.mixMolFlo = inMolFlo; + inlet.mixMolEnth = inMixMolEnth; + inlet.mixMolEntr = inMixMolEntr; + inlet.mixMolFrac[1, :] = mixMolFrac[:]; + inlet.vapPhasMolFrac = inVapPhasMolFrac; + outlet.P = outP; + outlet.T = outT; + outlet.mixMolFlo = outMolFlo; + outlet.mixMolEnth = outMixMolEnth; + outlet.mixMolEntr = outMixMolEntr; + outlet.mixMolFrac[1, :] = mixMolFrac[:]; + outlet.vapPhasMolFrac = outVapPhasMolFrac; + energy.enFlo = heatRem; +//============================================================================================= + inMolFlo = outMolFlo; +//material balance + inMixMolEnth - eff * heatRem / inMolFlo = outMixMolEnth; +//energy balance + inP - pressDrop = outP; +//pressure calculation + inT - tempDrop = outT; +//temperature calculation +end Cooler; diff --git a/Simulator/Simulator/Unit_Operations/Distillation_Column/Cond.mo b/Simulator/Simulator/Unit_Operations/Distillation_Column/Cond.mo new file mode 100644 index 0000000..9d69e36 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Distillation_Column/Cond.mo @@ -0,0 +1,86 @@ +within Simulator.Unit_Operations.Distillation_Column; + +model Cond + import Simulator.Files.*; + parameter Integer NOC = 2; + parameter Boolean boolFeed = false; + parameter Chemsep_Database.General_Properties comp[NOC]; + Real P(min = 0, start = 101325), T(min = 0, start = 273.15); + Real feedMolFlo(min = 0, start = 100), sideDrawMolFlo(min = 0, start = 100), inVapMolFlo(min = 0, start = 100), outLiqMolFlo(min = 0, start = 100), feedMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), sideDrawMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), inVapCompMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), outLiqCompMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), feedMolEnth, inVapMolEnth, outLiqMolEnth, heatLoad, sideDrawMolEnth, outLiqCompMolEnth[NOC]; + Real compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), Pdew(min = 0, start = sum(comp[:].Pc) / NOC), Pbubl(min = 0, start = sum(comp[:].Pc) / NOC); + //String sideDrawType(start = "Null"); + //L or V + parameter String condType "Partial or Total"; + replaceable Simulator.Files.Connection.matConn feed(connNOC = NOC) if boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn dummy_feed(connNOC = NOC, P = 0, T = 0, mixMolFrac = zeros(3, NOC), mixMolFlo = 0, mixMolEnth = 0, mixMolEntr = 0, vapPhasMolFrac = 0) if not boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn side_draw(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn liquid_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn heat_load annotation( + Placement(visible = true, transformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//connector equation + if boolFeed then + feed.mixMolFrac[1, :] = feedMolFrac[:]; + feed.mixMolEnth = feedMolEnth; + feed.mixMolFlo = feedMolFlo; + else + dummy_feed.mixMolFrac[1, :] = feedMolFrac[:]; + dummy_feed.mixMolEnth = feedMolEnth; + dummy_feed.mixMolFlo = feedMolFlo; + end if; + side_draw.P = P; + side_draw.T = T; + side_draw.mixMolFrac[1, :] = sideDrawMolFrac[:]; + side_draw.mixMolFlo = sideDrawMolFlo; + side_draw.mixMolEnth = sideDrawMolEnth; + liquid_outlet.mixMolFlo = outLiqMolFlo; + liquid_outlet.mixMolEnth = outLiqMolEnth; + liquid_outlet.mixMolFrac[:] = outLiqCompMolFrac[:]; + vapor_inlet.mixMolFlo = inVapMolFlo; + vapor_inlet.mixMolEnth = inVapMolEnth; + vapor_inlet.mixMolFrac[:] = inVapCompMolFrac[:]; + heat_load.enFlo = heatLoad; +//Adjustment for thermodynamic packages + compMolFrac[1, :] = (sideDrawMolFlo .* sideDrawMolFrac[:] + outLiqMolFlo .* outLiqCompMolFrac[:]) ./ (sideDrawMolFlo + outLiqMolFlo); + compMolFrac[2, :] = outLiqCompMolFrac[:]; + compMolFrac[3, :] = K[:] .* compMolFrac[2, :]; +//Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); +//molar balance +//feedMolFlo + inVapMolFlo = sideDrawMolFlo + outLiqMolFlo; + feedMolFlo .* feedMolFrac[:] + inVapMolFlo .* inVapCompMolFrac[:] = sideDrawMolFlo .* sideDrawMolFrac[:] + outLiqMolFlo .* outLiqCompMolFrac[:]; +//equillibrium + if condType == "Partial" then + sideDrawMolFrac[:] = K[:] .* outLiqCompMolFrac[:]; + elseif condType == "Total" then + sideDrawMolFrac[:] = outLiqCompMolFrac[:]; + end if; +//summation equation +// sum(outLiqCompMolFrac[:]) = 1; + sum(sideDrawMolFrac[:]) = 1; +// Enthalpy balance + feedMolFlo * feedMolEnth + inVapMolFlo * inVapMolEnth = sideDrawMolFlo * sideDrawMolEnth + outLiqMolFlo * outLiqMolEnth + heatLoad; +//Temperature calculation + if condType == "Total" then + P = sum(sideDrawMolFrac[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])); + elseif condType == "Partial" then + 1 / P = sum(sideDrawMolFrac[:] ./ exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])); + end if; +// outlet liquid molar enthalpy calculation + for i in 1:NOC loop + outLiqCompMolEnth[i] = Simulator.Files.Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + end for; + outLiqMolEnth = sum(outLiqCompMolFrac[:] .* outLiqCompMolEnth[:]) + resMolEnth[2]; + annotation( + Diagram(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + Icon(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + __OpenModelica_commandLineOptions = ""); +end Cond; diff --git a/Simulator/Simulator/Unit_Operations/Distillation_Column/DistCol.mo b/Simulator/Simulator/Unit_Operations/Distillation_Column/DistCol.mo new file mode 100644 index 0000000..2bcaf9c --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Distillation_Column/DistCol.mo @@ -0,0 +1,69 @@ +within Simulator.Unit_Operations.Distillation_Column; + +model DistCol + parameter Integer NOC; + import data = Simulator.Files.Chemsep_Database; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + parameter Boolean boolFeed[noOfStages] = Simulator.Files.Other_Functions.colBoolCalc(noOfStages, noOfFeeds, feedStages); + parameter Integer noOfStages = 4, noOfSideDraws = 0, noOfHeatLoads = 0, noOfFeeds = 1, feedStages[noOfFeeds]; + parameter String condType = "Total"; + //Total or Partial + Real refluxRatio(min = 0); + Simulator.Files.Connection.matConn feed[noOfFeeds](each connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-98, -4}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-98, -4}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn distillate(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {98, 72}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 72}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn bottoms(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, -74}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -72}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn condensor_duty annotation( + Placement(visible = true, transformation(origin = {60, 100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {60, 96}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn reboiler_duty annotation( + Placement(visible = true, transformation(origin = {60, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {72, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn side_draw[noOfSideDraws](each connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 20}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 24}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn heat_load[noOfHeatLoads](each connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, -20}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {102, -22}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation + for i in 1:noOfFeeds loop + if feedStages[i] == 1 then + connect(feed[i], condensor.feed); + elseif feedStages[i] == noOfStages then + connect(feed[i], reboiler.feed); + elseif feedStages[i] > 1 and feedStages[i] < noOfStages then +//this is adjustment done since OpenModelica 1.11 is not handling array modification properly + feed[i].P = tray[feedStages[i] - 1].dummyP1; + feed[i].T = tray[feedStages[i] - 1].dummyT1; + feed[i].mixMolFlo = tray[feedStages[i] - 1].dummyMixMolFlo1; + feed[i].mixMolFrac = tray[feedStages[i] - 1].dummyMixMolFrac1; + feed[i].mixMolEnth = tray[feedStages[i] - 1].dummyMixMolEnth1; + feed[i].mixMolEntr = tray[feedStages[i] - 1].dummyMixMolEntr1; + feed[i].vapPhasMolFrac = tray[feedStages[i] - 1].dummyVapPhasMolFrac1; + end if; + end for; + connect(condensor.side_draw, distillate); + connect(reboiler.side_draw, bottoms); + connect(condensor.heat_load, condensor_duty); + connect(reboiler.heat_load, reboiler_duty); + for i in 1:noOfStages - 3 loop + connect(tray[i].liquid_outlet, tray[i + 1].liquid_inlet); + connect(tray[i].vapor_inlet, tray[i + 1].vapor_outlet); + end for; + connect(tray[1].vapor_outlet, condensor.vapor_inlet); + connect(condensor.liquid_outlet, tray[1].liquid_inlet); + connect(tray[noOfStages - 2].liquid_outlet, reboiler.liquid_inlet); + connect(reboiler.vapor_outlet, tray[noOfStages - 2].vapor_inlet); +//tray pressures + for i in 1:noOfStages - 2 loop + tray[i].P = condensor.P + i * (reboiler.P - condensor.P) / (noOfStages - 1); + end for; + for i in 2:noOfStages - 1 loop + tray[i - 1].sideDrawType = "Null"; + tray[i - 1].side_draw.mixMolFrac = zeros(3, NOC); + tray[i - 1].side_draw.mixMolFlo = 0; + tray[i - 1].side_draw.mixMolEnth = 0; + tray[i - 1].side_draw.mixMolEntr = 0; + tray[i - 1].side_draw.vapPhasMolFrac = 0; + tray[i - 1].heatLoad = 0; + end for; + refluxRatio = condensor.outLiqMolFlo / condensor.side_draw.mixMolFlo; +end DistCol; diff --git a/Simulator/Simulator/Unit_Operations/Distillation_Column/DistTray.mo b/Simulator/Simulator/Unit_Operations/Distillation_Column/DistTray.mo new file mode 100644 index 0000000..a9e745c --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Distillation_Column/DistTray.mo @@ -0,0 +1,112 @@ +within Simulator.Unit_Operations.Distillation_Column; + +model DistTray + import Simulator.Files.*; + parameter Integer NOC = 2; + parameter Boolean boolFeed = true; + parameter Chemsep_Database.General_Properties comp[NOC]; + Real P(min = 0, start = 101325), T(min = 0, start = (min(comp[:].Tb) + max(comp[:].Tb)) / 2); + Real feedMolFlo(min = 0, start = 100), sideDrawMolFlo(min = 0, start = 100), vapMolFlo[2](each min = 0, each start = 100), liqMolFlo[2](each min = 0, each start = 100), feedMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), sideDrawMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), vapCompMolFrac[2, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), liqCompMolFrac[2, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), feedMolEnth, vapMolEnth[2], liqMolEnth[2], heatLoad, sideDrawMolEnth, outVapCompMolEnth[NOC], outLiqCompMolEnth[NOC]; + Real compMolFrac[3, NOC](each min = 0, each max = 0, each start = 1 / (NOC + 1)), Pdew(min = 0, start = sum(comp[:].Pc) / NOC), Pbubl(min = 0, start = sum(comp[:].Pc) / NOC); + Real dummyP1, dummyT1, dummyMixMolFrac1[3, NOC], dummyMixMolFlo1, dummyMixMolEnth1, dummyMixMolEntr1, dummyVapPhasMolFrac1; + //this is adjustment done since OpenModelica 1.11 is not handling array modification properly + String sideDrawType(start = "Null"); + //L or V + replaceable Simulator.Files.Connection.matConn feed(connNOC = NOC) if boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + replaceable Simulator.Files.Connection.matConn dummy_feed(connNOC = NOC, P = 0, T = 0, mixMolFlo = 0, mixMolFrac = zeros(3, NOC), mixMolEnth = 0, mixMolEntr = 0, vapPhasMolFrac = 0) if not boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn side_draw(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn liquid_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn liquid_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn heat_load annotation( + Placement(visible = true, transformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//connector equation + if boolFeed then + feed.P = dummyP1; +//this is adjustment done since OpenModelica 1.11 is not handling array modification properly + feed.T = dummyT1; + feed.mixMolFrac = dummyMixMolFrac1; + feed.mixMolFlo = dummyMixMolFlo1; + feed.mixMolEnth = dummyMixMolEnth1; + feed.mixMolEntr = dummyMixMolEntr1; + feed.vapPhasMolFrac = dummyVapPhasMolFrac1; + else + dummy_feed.P = dummyP1; + dummy_feed.T = dummyT1; + dummy_feed.mixMolFrac = dummyMixMolFrac1; + dummy_feed.mixMolFlo = dummyMixMolFlo1; + dummy_feed.mixMolEnth = dummyMixMolEnth1; + dummy_feed.mixMolEntr = dummyMixMolEntr1; + dummy_feed.vapPhasMolFrac = dummyVapPhasMolFrac1; + end if; +//this is adjustment done since OpenModelica 1.11 is not handling array modification properly + dummyMixMolFrac1[1, :] = feedMolFrac[:]; + dummyMixMolEnth1 = feedMolEnth; + dummyMixMolFlo1 = feedMolFlo; + side_draw.P = P; + side_draw.T = T; + side_draw.mixMolFlo = sideDrawMolFlo; + side_draw.mixMolEnth = sideDrawMolEnth; + liquid_inlet.mixMolFlo = liqMolFlo[1]; + liquid_inlet.mixMolEnth = liqMolEnth[1]; + liquid_inlet.mixMolFrac[:] = liqCompMolFrac[1, :]; + liquid_outlet.mixMolFlo = liqMolFlo[2]; + liquid_outlet.mixMolEnth = liqMolEnth[2]; + liquid_outlet.mixMolFrac[:] = liqCompMolFrac[2, :]; + vapor_inlet.mixMolFlo = vapMolFlo[1]; + vapor_inlet.mixMolEnth = vapMolEnth[1]; + vapor_inlet.mixMolFrac[:] = vapCompMolFrac[1, :]; + vapor_outlet.mixMolFlo = vapMolFlo[2]; + vapor_outlet.mixMolEnth = vapMolEnth[2]; + vapor_outlet.mixMolFrac[:] = vapCompMolFrac[2, :]; + heat_load.enFlo = heatLoad; +//Adjustment for thermodynamic packages + compMolFrac[1, :] = (sideDrawMolFlo .* sideDrawMolFrac[:] + vapMolFlo[2] .* vapCompMolFrac[2, :] + liqMolFlo[2] .* liqCompMolFrac[2, :]) / (liqMolFlo[2] + vapMolFlo[2] + sideDrawMolFlo); + compMolFrac[2, :] = liqCompMolFrac[2, :]; + compMolFrac[3, :] = vapCompMolFrac[2, :]; +//Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); +//molar balance +//feedMolFlo + vapMolFlo[1] + liqMolFlo[1] = sideDrawMolFlo + vapMolFlo[2] + liqMolFlo[2]; + feedMolFlo .* feedMolFrac[:] + vapMolFlo[1] .* vapCompMolFrac[1, :] + liqMolFlo[1] .* liqCompMolFrac[1, :] = sideDrawMolFlo .* sideDrawMolFrac[:] + vapMolFlo[2] .* vapCompMolFrac[2, :] + liqMolFlo[2] .* liqCompMolFrac[2, :]; +//equillibrium + vapCompMolFrac[2, :] = K[:] .* liqCompMolFrac[2, :]; +// for i in 1:NOC loop +// vapCompMolFrac[2,i] = ((K[i]/(K[1])) * liqCompMolFrac[2,i]) / (1 + (K[i] / (K[1])) * liqCompMolFrac[2,i]); +// end for; +//summation equation + sum(liqCompMolFrac[2, :]) = 1; + sum(vapCompMolFrac[2, :]) = 1; +// Enthalpy balance + feedMolFlo * feedMolEnth + vapMolFlo[1] * vapMolEnth[1] + liqMolFlo[1] * liqMolEnth[1] = sideDrawMolFlo * sideDrawMolEnth + vapMolFlo[2] * vapMolEnth[2] + liqMolFlo[2] * liqMolEnth[2] + heatLoad; +//enthalpy calculation + for i in 1:NOC loop + outLiqCompMolEnth[i] = Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + outVapCompMolEnth[i] = Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + end for; + liqMolEnth[2] = sum(liqCompMolFrac[2, :] .* outLiqCompMolEnth[:]) + resMolEnth[2]; + vapMolEnth[2] = sum(vapCompMolFrac[2, :] .* outVapCompMolEnth[:]) + resMolEnth[3]; +//sidedraw calculation + if sideDrawType == "L" then + sideDrawMolFrac[:] = liqCompMolFrac[2, :]; + elseif sideDrawType == "V" then + sideDrawMolFrac[:] = vapCompMolFrac[2, :]; + else + sideDrawMolFrac[:] = zeros(NOC); + end if; + annotation( + Diagram(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + Icon(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + __OpenModelica_commandLineOptions = ""); +end DistTray; diff --git a/Simulator/Simulator/Unit_Operations/Distillation_Column/Reb.mo b/Simulator/Simulator/Unit_Operations/Distillation_Column/Reb.mo new file mode 100644 index 0000000..cea9220 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Distillation_Column/Reb.mo @@ -0,0 +1,77 @@ +within Simulator.Unit_Operations.Distillation_Column; + +model Reb + import Simulator.Files.*; + parameter Integer NOC = 2; + parameter Boolean boolFeed = false; + parameter Chemsep_Database.General_Properties comp[NOC]; + Real P(min = 0, start = 101325), T(min = 0, start = 273.15); + Real feedMolFlo(min = 0, start = 100), sideDrawMolFlo(min = 0, start = 100), outVapMolFlo(min = 0, start = 100), inLiqMolFlo(min = 0, start = 100), feedMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), sideDrawMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), outVapCompMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), inLiqCompMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), feedMolEnth, outVapMolEnth, inLiqMolEnth, outVapCompMolEnth[NOC], heatLoad, sideDrawMolEnth; + Real compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), Pdew(min = 0, start = sum(comp[:].Pc) / NOC), Pbubl(min = 0, start = sum(comp[:].Pc) / NOC); + replaceable Simulator.Files.Connection.matConn feed(connNOC = NOC) if boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + replaceable Simulator.Files.Connection.matConn dummy_feed(connNOC = NOC, P = 0, T = 0, mixMolFrac = zeros(3, NOC), mixMolFlo = 0, mixMolEnth = 0, mixMolEntr = 0, vapPhasMolFrac = 0) if not boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn side_draw(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn liquid_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn heat_load annotation( + Placement(visible = true, transformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//connector equation + if boolFeed then + feed.mixMolFrac[1, :] = feedMolFrac[:]; + feed.mixMolEnth = feedMolEnth; + feed.mixMolFlo = feedMolFlo; + else + dummy_feed.mixMolFrac[1, :] = feedMolFrac[:]; + dummy_feed.mixMolEnth = feedMolEnth; + dummy_feed.mixMolFlo = feedMolFlo; + end if; + side_draw.P = P; + side_draw.T = T; + side_draw.mixMolFrac[1, :] = sideDrawMolFrac; + side_draw.mixMolFlo = sideDrawMolFlo; + side_draw.mixMolEnth = sideDrawMolEnth; + liquid_inlet.mixMolFlo = inLiqMolFlo; + liquid_inlet.mixMolEnth = inLiqMolEnth; + liquid_inlet.mixMolFrac[:] = inLiqCompMolFrac[:]; + vapor_outlet.mixMolFlo = outVapMolFlo; + vapor_outlet.mixMolEnth = outVapMolEnth; + vapor_outlet.mixMolFrac[:] = outVapCompMolFrac[:]; + heat_load.enFlo = heatLoad; +//Adjustment for thermodynamic packages + compMolFrac[1, :] = (sideDrawMolFlo .* sideDrawMolFrac[:] + outVapMolFlo .* outVapCompMolFrac[:]) ./ (sideDrawMolFlo + outVapMolFlo); + compMolFrac[2, :] = sideDrawMolFrac[:]; +//This equation is temporarily valid since this is only "partial" reboiler. Rewrite equation when "total" reboiler functionality is added + compMolFrac[3, :] = outVapCompMolFrac[:]; +//Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); +//molar balance +// feedMolFlo + inLiqMolFlo = sideDrawMolFlo + outVapMolFlo; + for i in 1:NOC loop + feedMolFlo .* feedMolFrac[i] + inLiqMolFlo .* inLiqCompMolFrac[i] = sideDrawMolFlo .* sideDrawMolFrac[i] + outVapMolFlo .* outVapCompMolFrac[i]; + end for; +//equillibrium + outVapCompMolFrac[:] = K[:] .* sideDrawMolFrac[:]; +//summation equation +// sum(outVapCompMolFrac[:]) = 1; + sum(sideDrawMolFrac[:]) = 1; + for i in 1:NOC loop + outVapCompMolEnth[i] = Simulator.Files.Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + end for; + outVapMolEnth = sum(outVapCompMolFrac[:] .* outVapCompMolEnth[:]) + resMolEnth[3]; +// bubble point calculations + P = sum(sideDrawMolFrac[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])); +// sideDrawMolFlo = 10; + feedMolFlo * feedMolEnth + inLiqMolFlo * inLiqMolEnth = sideDrawMolFlo * sideDrawMolEnth + outVapMolFlo * outVapMolEnth + heatLoad; + annotation( + Diagram(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + Icon(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + __OpenModelica_commandLineOptions = ""); +end Reb; diff --git a/Simulator/Simulator/Unit_Operations/Distillation_Column/package.mo b/Simulator/Simulator/Unit_Operations/Distillation_Column/package.mo new file mode 100644 index 0000000..d9fee3e --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Distillation_Column/package.mo @@ -0,0 +1,357 @@ +within Simulator.Unit_Operations; + +package Distillation_Column + model Cond + import Simulator.Files.*; + parameter Integer NOC = 2; + parameter Boolean boolFeed = false; + parameter Chemsep_Database.General_Properties comp[NOC]; + Real P(min = 0, start = 101325), T(min = 0, start = 273.15); + Real feedMolFlo(min = 0, start = 100), sideDrawMolFlo(min = 0, start = 100), inVapMolFlo(min = 0, start = 100), outLiqMolFlo(min = 0, start = 100), feedMolFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), sideDrawMolFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), inVapCompMolFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), outLiqCompMolFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), feedMolEnth, inVapMolEnth, outLiqMolEnth, heatLoad, sideDrawMolEnth, outLiqCompMolEnth[NOC]; + Real compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), Pdew(min = 0, start = sum(comp[:].Pc)/NOC), Pbubl(min = 0, start = sum(comp[:].Pc)/NOC); + //String sideDrawType(start = "Null"); + //L or V + parameter String condType "Partial or Total"; + replaceable Simulator.Files.Connection.matConn feed(connNOC = NOC) if boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn dummy_feed(connNOC = NOC, P = 0, T = 0, mixMolFrac = zeros(3, NOC), mixMolFlo = 0, mixMolEnth = 0, mixMolEntr = 0, vapPhasMolFrac = 0) if not boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn side_draw(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn liquid_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn heat_load annotation( + Placement(visible = true, transformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation +//connector equation + if boolFeed then + feed.mixMolFrac[1, :] = feedMolFrac[:]; + feed.mixMolEnth = feedMolEnth; + feed.mixMolFlo = feedMolFlo; + else + dummy_feed.mixMolFrac[1, :] = feedMolFrac[:]; + dummy_feed.mixMolEnth = feedMolEnth; + dummy_feed.mixMolFlo = feedMolFlo; + end if; + + side_draw.P = P; + side_draw.T = T; + side_draw.mixMolFrac[1, :] = sideDrawMolFrac[:]; + side_draw.mixMolFlo = sideDrawMolFlo; + side_draw.mixMolEnth = sideDrawMolEnth; + liquid_outlet.mixMolFlo = outLiqMolFlo; + liquid_outlet.mixMolEnth = outLiqMolEnth; + liquid_outlet.mixMolFrac[:] = outLiqCompMolFrac[:]; + vapor_inlet.mixMolFlo = inVapMolFlo; + vapor_inlet.mixMolEnth = inVapMolEnth; + vapor_inlet.mixMolFrac[:] = inVapCompMolFrac[:]; + heat_load.enFlo = heatLoad; +//Adjustment for thermodynamic packages + compMolFrac[1, :] = (sideDrawMolFlo .* sideDrawMolFrac[:] + outLiqMolFlo .* outLiqCompMolFrac[:])./(sideDrawMolFlo + outLiqMolFlo); + compMolFrac[2, :] = outLiqCompMolFrac[:]; + compMolFrac[3, :] = K[:] .* compMolFrac[2, :]; + //Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); + //Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); + +//molar balance +//feedMolFlo + inVapMolFlo = sideDrawMolFlo + outLiqMolFlo; + feedMolFlo .* feedMolFrac[:] + inVapMolFlo .* inVapCompMolFrac[:] = sideDrawMolFlo .* sideDrawMolFrac[:] + outLiqMolFlo .* outLiqCompMolFrac[:]; +//equillibrium + if condType == "Partial" then + sideDrawMolFrac[:] = K[:] .* outLiqCompMolFrac[:]; + elseif condType == "Total" then + sideDrawMolFrac[:] = outLiqCompMolFrac[:]; + end if; +//summation equation +// sum(outLiqCompMolFrac[:]) = 1; + sum(sideDrawMolFrac[:]) = 1; +// Enthalpy balance + feedMolFlo * feedMolEnth + inVapMolFlo * inVapMolEnth = sideDrawMolFlo * sideDrawMolEnth + outLiqMolFlo * outLiqMolEnth + heatLoad; +//Temperature calculation + if condType == "Total" then + P = sum(sideDrawMolFrac[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])); + elseif condType == "Partial" then + 1 / P = sum(sideDrawMolFrac[:] ./ exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])); + end if; +// outlet liquid molar enthalpy calculation + for i in 1:NOC loop + outLiqCompMolEnth[i] = Simulator.Files.Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + end for; + outLiqMolEnth = sum(outLiqCompMolFrac[:] .* outLiqCompMolEnth[:]) + resMolEnth[2]; + annotation( + Diagram(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + Icon(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + __OpenModelica_commandLineOptions = ""); + end Cond; + + + + + + + + + + + model DistTray + import Simulator.Files.*; + parameter Integer NOC = 2; + parameter Boolean boolFeed = true; + parameter Chemsep_Database.General_Properties comp[NOC]; + Real P(min = 0, start = 101325), T(min = 0, start = (min(comp[:].Tb) + max(comp[:].Tb)) / 2); + Real feedMolFlo(min = 0, start = 100), sideDrawMolFlo(min = 0, start = 100), vapMolFlo[2](each min = 0, each start = 100), liqMolFlo[2](each min = 0, each start = 100), feedMolFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), sideDrawMolFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), vapCompMolFrac[2, NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), liqCompMolFrac[2, NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), feedMolEnth, vapMolEnth[2], liqMolEnth[2], heatLoad, sideDrawMolEnth, outVapCompMolEnth[NOC], outLiqCompMolEnth[NOC]; + Real compMolFrac[3, NOC](each min =0, each max = 0, each start = 1/(NOC + 1)), Pdew(min = 0, start = sum(comp[:].Pc)/NOC), Pbubl(min = 0, start = sum(comp[:].Pc)/NOC); + Real dummyP1, dummyT1, dummyMixMolFrac1[3,NOC], dummyMixMolFlo1,dummyMixMolEnth1, dummyMixMolEntr1, dummyVapPhasMolFrac1;//this is adjustment done since OpenModelica 1.11 is not handling array modification properly + String sideDrawType(start = "Null"); + //L or V + replaceable Simulator.Files.Connection.matConn feed(connNOC = NOC) if boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + replaceable Simulator.Files.Connection.matConn dummy_feed(connNOC = NOC, P = 0, T = 0, mixMolFlo = 0, mixMolFrac = zeros(3, NOC), mixMolEnth = 0, mixMolEntr = 0, vapPhasMolFrac = 0) if not boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn side_draw(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn liquid_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn liquid_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, -40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn heat_load annotation( + Placement(visible = true, transformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation +//connector equation + if boolFeed then + feed.P = dummyP1;//this is adjustment done since OpenModelica 1.11 is not handling array modification properly + feed.T = dummyT1; + feed.mixMolFrac = dummyMixMolFrac1; + feed.mixMolFlo = dummyMixMolFlo1; + feed.mixMolEnth = dummyMixMolEnth1; + feed.mixMolEntr = dummyMixMolEntr1; + feed.vapPhasMolFrac = dummyVapPhasMolFrac1; + else + dummy_feed.P = dummyP1; + dummy_feed.T = dummyT1; + dummy_feed.mixMolFrac = dummyMixMolFrac1; + dummy_feed.mixMolFlo = dummyMixMolFlo1; + dummy_feed.mixMolEnth = dummyMixMolEnth1; + dummy_feed.mixMolEntr = dummyMixMolEntr1; + dummy_feed.vapPhasMolFrac = dummyVapPhasMolFrac1; + end if; + //this is adjustment done since OpenModelica 1.11 is not handling array modification properly + dummyMixMolFrac1[1,:] = feedMolFrac[:]; + dummyMixMolEnth1 = feedMolEnth; + dummyMixMolFlo1 = feedMolFlo; + + side_draw.P = P; + side_draw.T = T; + side_draw.mixMolFlo = sideDrawMolFlo; + side_draw.mixMolEnth = sideDrawMolEnth; + liquid_inlet.mixMolFlo = liqMolFlo[1]; + liquid_inlet.mixMolEnth = liqMolEnth[1]; + liquid_inlet.mixMolFrac[:] = liqCompMolFrac[1, :]; + liquid_outlet.mixMolFlo = liqMolFlo[2]; + liquid_outlet.mixMolEnth = liqMolEnth[2]; + liquid_outlet.mixMolFrac[:] = liqCompMolFrac[2, :]; + vapor_inlet.mixMolFlo = vapMolFlo[1]; + vapor_inlet.mixMolEnth = vapMolEnth[1]; + vapor_inlet.mixMolFrac[:] = vapCompMolFrac[1, :]; + vapor_outlet.mixMolFlo = vapMolFlo[2]; + vapor_outlet.mixMolEnth = vapMolEnth[2]; + vapor_outlet.mixMolFrac[:] = vapCompMolFrac[2, :]; + heat_load.enFlo = heatLoad; +//Adjustment for thermodynamic packages + compMolFrac[1, :] = (sideDrawMolFlo .* sideDrawMolFrac[:] + vapMolFlo[2] .* vapCompMolFrac[2, :] + liqMolFlo[2] .* liqCompMolFrac[2, :]) / (liqMolFlo[2] + vapMolFlo[2] + sideDrawMolFlo); + compMolFrac[2, :] = liqCompMolFrac[2,:]; + compMolFrac[3, :] = vapCompMolFrac[2,:]; + //Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); + //Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); +//molar balance +//feedMolFlo + vapMolFlo[1] + liqMolFlo[1] = sideDrawMolFlo + vapMolFlo[2] + liqMolFlo[2]; + feedMolFlo .* feedMolFrac[:] + vapMolFlo[1] .* vapCompMolFrac[1, :] + liqMolFlo[1] .* liqCompMolFrac[1, :] = sideDrawMolFlo .* sideDrawMolFrac[:] + vapMolFlo[2] .* vapCompMolFrac[2, :] + liqMolFlo[2] .* liqCompMolFrac[2, :]; +//equillibrium + vapCompMolFrac[2, :] = K[:] .* liqCompMolFrac[2, :]; +// for i in 1:NOC loop +// vapCompMolFrac[2,i] = ((K[i]/(K[1])) * liqCompMolFrac[2,i]) / (1 + (K[i] / (K[1])) * liqCompMolFrac[2,i]); +// end for; +//summation equation + sum(liqCompMolFrac[2, :]) = 1; + sum(vapCompMolFrac[2, :]) = 1; +// Enthalpy balance + feedMolFlo * feedMolEnth + vapMolFlo[1] * vapMolEnth[1] + liqMolFlo[1] * liqMolEnth[1] = sideDrawMolFlo * sideDrawMolEnth + vapMolFlo[2] * vapMolEnth[2] + liqMolFlo[2] * liqMolEnth[2] + heatLoad; +//enthalpy calculation + for i in 1:NOC loop + outLiqCompMolEnth[i] = Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + outVapCompMolEnth[i] = Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + end for; + liqMolEnth[2] = sum(liqCompMolFrac[2, :] .* outLiqCompMolEnth[:]) + resMolEnth[2]; + vapMolEnth[2] = sum(vapCompMolFrac[2, :] .* outVapCompMolEnth[:]) + resMolEnth[3]; +//sidedraw calculation + if sideDrawType == "L" then + sideDrawMolFrac[:] = liqCompMolFrac[2, :]; + elseif sideDrawType == "V" then + sideDrawMolFrac[:] = vapCompMolFrac[2, :]; + else + sideDrawMolFrac[:] = zeros(NOC); + end if; + annotation( + Diagram(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + Icon(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + __OpenModelica_commandLineOptions = ""); + end DistTray; + + model Reb + import Simulator.Files.*; + parameter Integer NOC = 2; + parameter Boolean boolFeed = false; + parameter Chemsep_Database.General_Properties comp[NOC]; + Real P(min = 0, start = 101325), T(min = 0, start = 273.15); + Real feedMolFlo(min = 0, start = 100), sideDrawMolFlo(min = 0, start = 100), outVapMolFlo(min = 0, start = 100), inLiqMolFlo(min = 0, start = 100), feedMolFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), sideDrawMolFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), outVapCompMolFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), inLiqCompMolFrac[NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), feedMolEnth, outVapMolEnth, inLiqMolEnth, + outVapCompMolEnth[NOC], heatLoad, sideDrawMolEnth; + Real compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)), Pdew(min = 0, start = sum(comp[:].Pc)/NOC), Pbubl(min = 0, start = sum(comp[:].Pc)/NOC); + replaceable Simulator.Files.Connection.matConn feed(connNOC = NOC) if boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + replaceable Simulator.Files.Connection.matConn dummy_feed(connNOC = NOC, P = 0, T = 0, mixMolFrac = zeros(3, NOC), mixMolFlo = 0, mixMolEnth = 0, mixMolEntr = 0, vapPhasMolFrac = 0) if not boolFeed annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn side_draw(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn liquid_inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.trayConn vapor_outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {50, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn heat_load annotation( + Placement(visible = true, transformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 40}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation +//connector equation + if boolFeed then + feed.mixMolFrac[1, :] = feedMolFrac[:]; + feed.mixMolEnth = feedMolEnth; + feed.mixMolFlo = feedMolFlo; + else + dummy_feed.mixMolFrac[1, :] = feedMolFrac[:]; + dummy_feed.mixMolEnth = feedMolEnth; + dummy_feed.mixMolFlo = feedMolFlo; + end if; + side_draw.P = P; + side_draw.T = T; + side_draw.mixMolFrac[1, :] = sideDrawMolFrac; + side_draw.mixMolFlo = sideDrawMolFlo; + side_draw.mixMolEnth = sideDrawMolEnth; + liquid_inlet.mixMolFlo = inLiqMolFlo; + liquid_inlet.mixMolEnth = inLiqMolEnth; + liquid_inlet.mixMolFrac[:] = inLiqCompMolFrac[:]; + vapor_outlet.mixMolFlo = outVapMolFlo; + vapor_outlet.mixMolEnth = outVapMolEnth; + vapor_outlet.mixMolFrac[:] = outVapCompMolFrac[:]; + heat_load.enFlo = heatLoad; +//Adjustment for thermodynamic packages + compMolFrac[1, :] = (sideDrawMolFlo .* sideDrawMolFrac[:] + outVapMolFlo .* outVapCompMolFrac[:])./(sideDrawMolFlo + outVapMolFlo); + compMolFrac[2, :] = sideDrawMolFrac[:];//This equation is temporarily valid since this is only "partial" reboiler. Rewrite equation when "total" reboiler functionality is added + compMolFrac[3, :] = outVapCompMolFrac[:]; + //Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); + //Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); +//molar balance +// feedMolFlo + inLiqMolFlo = sideDrawMolFlo + outVapMolFlo; + for i in 1:NOC loop + feedMolFlo .* feedMolFrac[i] + inLiqMolFlo .* inLiqCompMolFrac[i] = sideDrawMolFlo .* sideDrawMolFrac[i] + outVapMolFlo .* outVapCompMolFrac[i]; + end for; +//equillibrium + outVapCompMolFrac[:] = K[:] .* sideDrawMolFrac[:]; +//summation equation +// sum(outVapCompMolFrac[:]) = 1; + sum(sideDrawMolFrac[:]) = 1; + for i in 1:NOC loop + outVapCompMolEnth[i] = Simulator.Files.Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + end for; + outVapMolEnth = sum(outVapCompMolFrac[:] .* outVapCompMolEnth[:]) + resMolEnth[3]; +// bubble point calculations + P = sum(sideDrawMolFrac[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])); +// sideDrawMolFlo = 10; + feedMolFlo * feedMolEnth + inLiqMolFlo * inLiqMolEnth = sideDrawMolFlo * sideDrawMolEnth + outVapMolFlo * outVapMolEnth + heatLoad; + annotation( + Diagram(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + Icon(coordinateSystem(extent = {{-100, -40}, {100, 40}})), + __OpenModelica_commandLineOptions = ""); + end Reb; + + model DistCol + extends Simulator.Files.Icons.Compound_Separator; + parameter Integer NOC; + import data = Simulator.Files.Chemsep_Database; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + parameter Boolean boolFeed[noOfStages] = Simulator.Files.Other_Functions.colBoolCalc(noOfStages, noOfFeeds, feedStages); + parameter Integer noOfStages = 4, noOfSideDraws = 0, noOfHeatLoads = 0, noOfFeeds = 1, feedStages[noOfFeeds]; + parameter String condType = "Total"; + //Total or Partial + + Real refluxRatio(min = 0); + Simulator.Files.Connection.matConn feed[noOfFeeds](each connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-98, -4}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-120, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn distillate(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {98, 72}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {122, 58}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn bottoms(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, -74}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {122, -46}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn condensor_duty annotation( + Placement(visible = true, transformation(origin = {60, 100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {64, 120}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn reboiler_duty annotation( + Placement(visible = true, transformation(origin = {60, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {80, -114}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn side_draw[noOfSideDraws](each connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 20}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 24}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn heat_load[noOfHeatLoads](each connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, -20}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {102, -22}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + equation + for i in 1:noOfFeeds loop + if feedStages[i] == 1 then + connect(feed[i], condensor.feed); + elseif feedStages[i] == noOfStages then + connect(feed[i], reboiler.feed); + elseif (feedStages[i] > 1 and feedStages[i] < noOfStages) then + //this is adjustment done since OpenModelica 1.11 is not handling array modification properly + feed[i]. P = tray[feedStages[i] - 1].dummyP1; + feed[i].T = tray[feedStages[i] - 1].dummyT1; + feed[i].mixMolFlo = tray[feedStages[i] - 1].dummyMixMolFlo1; + feed[i].mixMolFrac = tray[feedStages[i] - 1].dummyMixMolFrac1; + feed[i].mixMolEnth = tray[feedStages[i] - 1].dummyMixMolEnth1; + feed[i].mixMolEntr = tray[feedStages[i] - 1].dummyMixMolEntr1; + feed[i].vapPhasMolFrac = tray[feedStages[i] - 1].dummyVapPhasMolFrac1; + end if; + end for; + connect(condensor.side_draw, distillate); + connect(reboiler.side_draw, bottoms); + connect(condensor.heat_load, condensor_duty); + connect(reboiler.heat_load, reboiler_duty); + for i in 1:noOfStages - 3 loop + connect(tray[i].liquid_outlet, tray[i + 1].liquid_inlet); + connect(tray[i].vapor_inlet, tray[i + 1].vapor_outlet); + end for; + connect(tray[1].vapor_outlet, condensor.vapor_inlet); + connect(condensor.liquid_outlet, tray[1].liquid_inlet); + connect(tray[noOfStages - 2].liquid_outlet, reboiler.liquid_inlet); + connect(reboiler.vapor_outlet, tray[noOfStages - 2].vapor_inlet); +//tray pressures + for i in 1:noOfStages - 2 loop + tray[i].P = condensor.P + i * (reboiler.P - condensor.P) / (noOfStages - 1); + end for; + + for i in 2:noOfStages - 1 loop + tray[i - 1].sideDrawType = "Null"; + tray[i - 1].side_draw.mixMolFrac = zeros(3, NOC); + tray[i - 1].side_draw.mixMolFlo = 0; + tray[i - 1].side_draw.mixMolEnth = 0; + tray[i - 1].side_draw.mixMolEntr = 0; + tray[i - 1].side_draw.vapPhasMolFrac = 0; + tray[i - 1].heatLoad = 0; + end for; + refluxRatio = condensor.outLiqMolFlo / condensor.side_draw.mixMolFlo; + end DistCol; + +end Distillation_Column; diff --git a/Simulator/Simulator/Unit_Operations/Distillation_Column/package.order b/Simulator/Simulator/Unit_Operations/Distillation_Column/package.order new file mode 100644 index 0000000..5a8f2be --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Distillation_Column/package.order @@ -0,0 +1,4 @@ +Cond +DistTray +Reb +DistCol diff --git a/Simulator/Simulator/Unit_Operations/Flash.mo b/Simulator/Simulator/Unit_Operations/Flash.mo new file mode 100644 index 0000000..d215b4f --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Flash.mo @@ -0,0 +1,96 @@ +within Simulator.Unit_Operations; + +model Flash + extends Simulator.Files.Icons.Flash; + //extend thermodynamic package with this model + import Simulator.Files.*; + parameter Integer NOC; + parameter Chemsep_Database.General_Properties comp[NOC]; + parameter Boolean overSepTemp = false, overSepPress = false; + parameter Real Tdef = 298.15, Pdef = 101325; + Real T(start = 298.15, min = 0), P(start = 101325, min = 0); + Real Pbubl(min = 0, start = sum(comp[:].Pc) / NOC) "Bubble point pressure", Pdew(min = 0, start = sum(comp[:].Pc) / NOC) "dew point pressure"; + Real totMolFlo[3](each min = 0, each start = 100), compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), compMolSpHeat[3, NOC], compMolEnth[3, NOC], compMolEntr[3, NOC], phasMolSpHeat[3], phasMolEnth[3], phasMolEntr[3], liqPhasMolFrac(min = 0, max = 1, start = 0.5), vapPhasMolFrac(min = 0, max = 1, start = 0.5); + Simulator.Files.Connection.matConn feed(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn vapor(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {102, 72}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {102, 72}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn liquid(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, -72}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -72}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//Connector equation + if overSepTemp then + Tdef = T; + else + feed.T = T; + end if; + if overSepPress then + Pdef = P; + else + feed.P = P; + end if; + feed.mixMolFlo = totMolFlo[1]; + feed.mixMolFrac[1, :] = compMolFrac[1, :]; + liquid.T = T; +// liquid.mixMolEnth = phasMolEnth[2]; + liquid.P = P; + liquid.mixMolFlo = totMolFlo[2]; + liquid.mixMolFrac[1, :] = compMolFrac[2, :]; + vapor.T = T; +// vapor.mixMolEnth= phasMolEnth[3]; + vapor.P = P; + vapor.mixMolFlo = totMolFlo[3]; + vapor.mixMolFrac[1, :] = compMolFrac[3, :]; +//Mole Balance + totMolFlo[1] = totMolFlo[2] + totMolFlo[3]; + compMolFrac[1, :] .* totMolFlo[1] = compMolFrac[2, :] .* totMolFlo[2] + compMolFrac[3, :] .* totMolFlo[3]; +//Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); + if P >= Pbubl then + compMolFrac[3, :] = zeros(NOC); +// sum(compMolFrac[2, :]) = 1; + totMolFlo[3] = 0; + elseif P >= Pdew then +//VLE region + for i in 1:NOC loop +// compMolFrac[3, i] = K[i] * compMolFrac[2, i]; + compMolFrac[2, i] = compMolFrac[1, i] ./ (1 + vapPhasMolFrac * (K[i] - 1)); + end for; +// sum(compMolFrac[3, :]) = 1; + sum(compMolFrac[2, :]) = 1; +//sum x = 1 + else +//above dew point region + compMolFrac[2, :] = zeros(NOC); +// sum(compMolFrac[3, :]) = 1; + totMolFlo[2] = 0; + end if; +//Energy Balance + for i in 1:NOC loop +//Specific Heat and Enthalpy calculation + compMolSpHeat[2, i] = Thermodynamic_Functions.LiqCpId(comp[i].LiqCp, T); + compMolSpHeat[3, i] = Thermodynamic_Functions.VapCpId(comp[i].VapCp, T); + compMolEnth[2, i] = Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + compMolEnth[3, i] = Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, T); + (compMolEntr[2, i], compMolEntr[3, i]) = Thermodynamic_Functions.SId(comp[i].AS, comp[i].VapCp, comp[i].HOV, comp[i].Tb, comp[i].Tc, T, P, compMolFrac[2, i], compMolFrac[3, i]); + end for; + for i in 2:3 loop + phasMolSpHeat[i] = sum(compMolFrac[i, :] .* compMolSpHeat[i, :]) + resMolSpHeat[i]; + phasMolEnth[i] = sum(compMolFrac[i, :] .* compMolEnth[i, :]) + resMolEnth[i]; + phasMolEntr[i] = sum(compMolFrac[i, :] .* compMolEntr[i, :]) + resMolEntr[i]; + end for; + phasMolSpHeat[1] = liqPhasMolFrac * phasMolSpHeat[2] + vapPhasMolFrac * phasMolSpHeat[3]; + compMolSpHeat[1, :] = compMolFrac[1, :] .* phasMolSpHeat[1]; + phasMolEnth[1] = liqPhasMolFrac * phasMolEnth[2] + vapPhasMolFrac * phasMolEnth[3]; + compMolEnth[1, :] = compMolFrac[1, :] .* phasMolEnth[1]; + phasMolEntr[1] = liqPhasMolFrac * phasMolEntr[2] + vapPhasMolFrac * phasMolEntr[3]; + compMolEntr[1, :] = compMolFrac[1, :] * phasMolEntr[1]; +//phase molar fractions + liqPhasMolFrac = totMolFlo[2] / totMolFlo[1]; + vapPhasMolFrac = totMolFlo[3] / totMolFlo[1]; +annotation( + Icon(coordinateSystem(extent = {{-100, -200}, {100, 200}})), + Diagram(coordinateSystem(extent = {{-100, -200}, {100, 200}})), + __OpenModelica_commandLineOptions = "");end Flash; diff --git a/Simulator/Simulator/Unit_Operations/Heater.mo b/Simulator/Simulator/Unit_Operations/Heater.mo new file mode 100644 index 0000000..469daed --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Heater.mo @@ -0,0 +1,46 @@ +within Simulator.Unit_Operations; + +model Heater + extends Simulator.Files.Icons.Heater; + // This is generic heater model. For using this model we need to extend this model and incorporte ouput material stream since this model is not doing any flash calculations. Refer heater models in Test section for this. + //======================================================================================== + Real inMolFlo(min = 0, start = 100) "inlet mixture molar flow rate", outMolFlo(min = 0, start = 100) "outlet mixture molar flow rate", heatAdd "Heat added", inP(min = 0, start = 101325) "Inlet pressure", outP(min = 0, start = 101325) "Outlet pressure", inT(min = 0, start = 273.15) "Inlet Temperature", outT(min = 0, start = 273.15) "Outlet Temperature", tempInc "Temperature Increase", outVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Outlet Vapor Mole Fraction"; + Real inMixMolEnth "inlet mixture molar enthalpy", outMixMolEnth "outlet mixture molar enthalpy"; + //======================================================================================== + parameter Real pressDrop "Pressure drop", eff "Efficiency"; + Real mixMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "mixture mole fraction", inVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Inlet vapor phase mole fraction"; + parameter Integer NOC "number of components"; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + //======================================================================================== + Simulator.Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn energy annotation( + Placement(visible = true, transformation(origin = {0, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-98, -98}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + //========================================================================================= +equation +//connector equations + inlet.P = inP; + inlet.T = inT; + inlet.mixMolFlo = inMolFlo; + inlet.mixMolEnth = inMixMolEnth; + inlet.mixMolFrac[1, :] = mixMolFrac[:]; + inlet.vapPhasMolFrac = inVapPhasMolFrac; + outlet.P = outP; + outlet.T = outT; + outlet.mixMolFlo = outMolFlo; + outlet.mixMolEnth = outMixMolEnth; + outlet.mixMolFrac[1, :] = mixMolFrac[:]; + outlet.vapPhasMolFrac = outVapPhasMolFrac; + energy.enFlo = heatAdd; +//============================================================================================= + inMolFlo = outMolFlo; +//material balance + inMixMolEnth + eff * heatAdd / inMolFlo = outMixMolEnth; +//energy balance + inP - pressDrop = outP; +//pressure calculation + inT + tempInc = outT; +//temperature calculation +end Heater; diff --git a/Simulator/Simulator/Unit_Operations/Mixer.mo b/Simulator/Simulator/Unit_Operations/Mixer.mo new file mode 100644 index 0000000..9e51d88 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Mixer.mo @@ -0,0 +1,54 @@ +within Simulator.Unit_Operations; + +model Mixer + extends Simulator.Files.Icons.Mixer; + import Simulator.Files.*; + parameter Integer NOC "Number of Components", NI = 6 "Number of Input streams"; + parameter Chemsep_Database.General_Properties comp[NOC]; + parameter String outPress; + Real outP(min = 0, start = 101325), inP[NI](min = 0, start = 101325); + Real inCompMolFrac[NI, NOC](each start = 1 / (NOC + 1), each min = 0, each max = 1) "Input stream component mol fraction", inMolFlo[NI](each min = 0, each start = 100) "Input stream Molar Flow"; + Real outCompMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "Output Stream component mol fraction", outMolFlo(each min = 0, each start = 100) "Output stream Molar Flow"; + Real inTotMolEnth[NI] "Inlet molar enthalpy of each stream", outTotMolEnth "Outlet molar enthalpy"; + Real inT[NI](each min = 0, each start = 273.15) "Temperature of each stream", outT(each min = 0, each start = 273.15) "Temperature of outlet stream", inTotMolEntr[NI] "Inlet molar enthalpy of each stream", outTotMolEntr "Outlet molar entropy", inVapPhasMolFrac[NI](each min = 0, each max = 1, each start = 0.5) "Inlet vapor phase mol fraction", outVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Outlet vapor phase mol fraction"; + //================================================================================ + // Files.Connection.matConn inlet[NI](each connNOC = NOC); + Simulator.Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Files.Connection.matConn inlet[NI](each connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//Connector equation + for i in 1:NI loop + inlet[i].P = inP[i]; + inlet[i].T = inT[i]; + inlet[i].mixMolFlo = inMolFlo[i]; + inlet[i].mixMolEnth = inTotMolEnth[i]; + inlet[i].mixMolEntr = inTotMolEntr[i]; + inlet[i].mixMolFrac[1, :] = inCompMolFrac[i, :]; + inlet[i].vapPhasMolFrac = inVapPhasMolFrac[i]; + end for; + outlet.P = outP; + outlet.T = outT; + outlet.mixMolFlo = outMolFlo; + outlet.mixMolEnth = outTotMolEnth; + outlet.mixMolEntr = outTotMolEntr; + outlet.mixMolFrac[1, :] = outCompMolFrac[:]; + outlet.vapPhasMolFrac = outVapPhasMolFrac; +//=================================================================================== +//Output Pressure + if outPress == "Inlet_Minimum" then + outP = min(inP); + elseif outPress == "Inlet_Average" then + outP = sum(inP) / NI; + elseif outPress == "Inlet_Maximum" then + outP = max(inP); + end if; +//Molar Balance + outMolFlo = sum(inMolFlo[:]); + for i in 1:NOC loop + outCompMolFrac[i] * outMolFlo = sum(inCompMolFrac[:, i] .* inMolFlo[:]); + end for; +//Energy balance + outTotMolEnth = sum(inTotMolEnth[:] .* inMolFlo[:] / outMolFlo); +end Mixer; diff --git a/Simulator/Simulator/Unit_Operations/PF_Reactor/Integral.mo b/Simulator/Simulator/Unit_Operations/PF_Reactor/Integral.mo new file mode 100644 index 0000000..2381d83 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/PF_Reactor/Integral.mo @@ -0,0 +1,11 @@ +within Simulator.Unit_Operations.PF_Reactor; + +function Integral + extends Modelica.Math.Nonlinear.Interfaces.partialScalarFunction; + input Integer n; + input Real Cao; + input Real Fao; + input Real k; +algorithm + y := Fao / (k * Cao ^ n) * (1 / (1 - u) ^ n); +end Integral; diff --git a/Simulator/Simulator/Unit_Operations/PF_Reactor/PFR.mo b/Simulator/Simulator/Unit_Operations/PF_Reactor/PFR.mo new file mode 100644 index 0000000..175d3f5 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/PF_Reactor/PFR.mo @@ -0,0 +1,387 @@ +within Simulator.Unit_Operations.PF_Reactor; + +model PFR + //Plug Flow Reactor + //Instantiation of Simulator-Package + import Simulator.Files.*; + import Simulator.Files.Thermodynamic_Functions.*; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + parameter Integer NOC "number of compounds "; + parameter Integer Nr "Number of reactions"; + //Input Variables-Connector + Real T(min = 0, start = 273.15) "Inlet Temperature"; + Real P(min = 0, start = 101325) "Inlet pressure"; + //Component Molar Flow rates of respective phases + Real compMolFlow[3, NOC](each min = 0, each start = 100); + //Total molar flow rates of respective phases + Real totMolFlow[3](each min = 0, each start = 100) "Total inlet molar flow rate"; + //Mole Fraction of components in respective phases + Real compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "Mole Fraction of components in inlet stream"; + Real Enth, Entr, Vapfrac(min = 0, max = 1, start = 0.5); + //Output Variables-Connectors + Real Tout(min = 0, start = 273.15) "Temperature for which calculations are made"; + Real Pout(min = 0, start = 101325) "outlet pressure in Pa"; + //Total molar flow rates of respective phases in the outlet streams + Real outTotMolFlow[3](each min = 0, each start = 50) "Total Outlet Molar Flow Rate"; + Real outCompMolFlow[3, NOC](each min = 0, each start = 50) "Component outlet molar flow rate"; + Real outCompMolFrac[3, NOC](each min = 0, each start = 0.5) "Mole Fraction of components in outlet stream"; + Real outEnth, outEntr, outVapfrac(min = 0, max = 1, start = 0.5); + //Phase-Equilibria + Real Pdew(unit = "Pa", start = max(comp[:].Pc), min = 0); + Real Pbubl(min = 0, unit = "Pa", start = min(comp[:].Pc)); + Real Beta(start = 0.5); + //Phase-Equilibria-Outlet Stream + Real Poutdew(unit = "Pa", start = max(comp[:].Pc), min = 0); + Real Poutbubl(min = 0, unit = "Pa", start = min(comp[:].Pc)); + Real Betaout(start = 0.5); + //Average Molecular weights-Outlets + Real Moutavg[3](each start = 30); + //Material Balance-Variables + parameter Real delta_P "Pressure Drop"; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //Mass Flow Rates and Compositions + Real totMasFlow[3](each start = 50) "Mass Flow Rate of phases"; + Real compMasFrac[3, NOC] "Mass Fraction of components in all phases"; + //Average Molecular weights + Real Mavg[3](each start = 30); + //Phase Volumetric Flow Rates + Real totVolFlow[3](each start = 30); + //Transport Properities + Real LiqDens[NOC]; + Real Liquid_Phase_Density; + Real VapDensity[NOC](unit = "kg/m^3"); + Real Vapour_Phase_Density; + Real Density_Mixture; + parameter Real Zv = 1; + //Inlet Concentration + Real Co[NOC]; + //Molar Flow rate inlet to reactor depending on reaction phase + Real Fo[NOC](each min = 0, each start = 100); + Real F[NOC](each min = 0, each start = 100); + //Reaction-Manager-Data + //Reaction-Phase + parameter Integer Phase; + Integer n "Order of the Reaction"; + Real k1[Nr] "Rate constant"; + parameter Integer Mode; + parameter Real Tdef; + Real Reaction_Heat "Heat of Reaction"; + //Material Balance + Real No[NOC, Nr] "Number of moles-initial state"; + Real X[NOC](each min = 0, each max = 1, each start = 0.5) "Conversion of the reaction components"; + Real Volume(min = 0, start = 1) "Volume of the reactor"; + //Base-comp indicates the position of the base component in the comp-array + parameter Integer Base_comp = 1; + extends Simulator.Files.Models.ReactionManager.Reaction_Manager(NOC = NOC, comp = comp, Nr = 1, Bc = {1}, Comp = 3, Sc = {{-1}, {-1}, {1}}, DO = {{1}, {0}, {0}}, RO = {{0}, {0}, {0}}, A1 = {0.005}, E1 = {0}, A2 = {0}, E2 = {0}); + //=========================================================================================================== + //Energy-Stream-Connector + Real energy_flo "The total energy given out/taken in due to the reactions"; + Simulator.Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-80, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-80, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {74, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {88, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn en_Conn annotation( + Placement(visible = true, transformation(origin = {0, -78}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-12, -46}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + //============================================================================================================ +equation +//Connector-Equations + inlet.P = P; + inlet.T = T; + inlet.mixMolFlo = totMolFlow[1]; + inlet.mixMolEnth = Enth; + inlet.mixMolEntr = Entr; + inlet.mixMolFrac[1, :] = compMolFrac[1, :]; + inlet.vapPhasMolFrac = Vapfrac; + outlet.P = Pout; + outlet.T = Tout; + outlet.mixMolFlo = outTotMolFlow[1]; + outlet.mixMolEnth = outEnth; + outlet.mixMolEntr = outEntr; + outlet.mixMolFrac[1, :] = outCompMolFrac[1, :]; + outlet.vapPhasMolFrac = outVapfrac; + en_Conn.enFlo = energy_flo; +//Phase Equilibria +//========================================================================================================== +//Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); + if P >= Pbubl then +//below bubble point region + compMolFrac[3, :] = zeros(NOC); + sum(compMolFrac[2, :]) = 1; + elseif P <= Pdew then +//above dew point region + compMolFrac[2, :] = zeros(NOC); + sum(compMolFrac[3, :]) = 1; + else +//VLE region + for i in 1:NOC loop + compMolFrac[3, i] = K[i] * compMolFrac[2, i]; + end for; + sum(compMolFrac[2, :]) = 1; +//sum y = 1 + end if; +//Rachford Rice Equation + for i in 1:NOC loop + compMolFrac[1, i] = compMolFrac[3, i] * Beta + compMolFrac[2, i] * (1 - Beta); + end for; +//=========================================================================================================== +//Calculation of Mass Fraction +//Average Molecular Weights of respective phases + if Beta <= 0 then + Mavg[1] = sum(compMolFrac[1, :] .* comp[:].MW); + Mavg[2] = sum(compMolFrac[2, :] .* comp[:].MW); + Mavg[3] = 0; + totMasFlow[1] = totMolFlow[1] * 1E-3 * Mavg[1]; + totMasFlow[2] = totMolFlow[2] * 1E-3 * Mavg[2]; + totMasFlow[3] = 0; + compMasFrac[1, :] = compMolFrac[1, :] .* comp[:].MW / Mavg[1]; + compMasFrac[2, :] = compMolFrac[2, :] .* comp[:].MW / Mavg[2]; + for i in 1:NOC loop + compMasFrac[3, i] = 0; + end for; +//Liquid_Phase_Density + LiqDens = Thermodynamic_Functions.Density_Racket(NOC, T, P, comp[:].Pc, comp[:].Tc, comp[:].Racketparam, comp[:].AF, comp[:].MW, Psat[:]); + Liquid_Phase_Density = 1 / sum(compMasFrac[2, :] ./ LiqDens[:]) / Mavg[2]; +//Vapour Phase Density + for i in 1:NOC loop + VapDensity[i] = 0; + end for; + Vapour_Phase_Density = 0; +//Density of Inlet-Mixture + Density_Mixture = 1 / ((1 - Beta) / Liquid_Phase_Density) * sum(compMolFrac[1, :] .* comp[:].MW); +//==================================================================================================== + elseif Beta == 1 then + Mavg[1] = sum(compMolFrac[1, :] .* comp[:].MW); + Mavg[2] = 0; + Mavg[3] = sum(compMolFrac[3, :] .* comp[:].MW); + totMasFlow[1] = totMolFlow[1] * 1E-3 * Mavg[1]; + totMasFlow[2] = 0; + totMasFlow[3] = totMolFlow[3] * 1E-3 * Mavg[3]; + compMasFrac[1, :] = compMolFrac[1, :] .* comp[:].MW / Mavg[1]; + for i in 1:NOC loop + compMasFrac[2, i] = 0; + end for; + compMasFrac[3, :] = compMolFrac[3, :] .* comp[:].MW / Mavg[3]; +//Calculation of Phase Densities +//Liquid Phase Density-Inlet Conditions + for i in 1:NOC loop + LiqDens[i] = 0; + end for; + Liquid_Phase_Density = 0; +//Vapour Phase Density + for i in 1:NOC loop + VapDensity[i] = P / (Zv * 8.314 * T) * comp[i].MW * 1E-3; + end for; + Vapour_Phase_Density = 1 / sum(compMasFrac[3, :] ./ VapDensity[:]) / Mavg[3]; +//Density of Inlet-Mixture + Density_Mixture = 1 / (Beta / Vapour_Phase_Density) * sum(compMolFrac[1, :] .* comp[:].MW); + else + Mavg[1] = sum(compMolFrac[1, :] .* comp[:].MW); + Mavg[2] = sum(compMolFrac[2, :] .* comp[:].MW); + Mavg[3] = sum(compMolFrac[3, :] .* comp[:].MW); + totMasFlow[1] = totMolFlow[1] * 1E-3 * Mavg[1]; + totMasFlow[2] = totMolFlow[2] * 1E-3 * Mavg[2]; + totMasFlow[3] = totMolFlow[3] * 1E-3 * Mavg[3]; + compMasFrac[1, :] = compMolFrac[1, :] .* comp[:].MW / Mavg[1]; + compMasFrac[2, :] = compMolFrac[2, :] .* comp[:].MW / Mavg[2]; + compMasFrac[3, :] = compMolFrac[3, :] .* comp[:].MW / Mavg[3]; +//Calculation of Phase Densities +//Liquid Phase Density-Inlet Conditions + LiqDens = Thermodynamic_Functions.Density_Racket(NOC, T, P, comp[:].Pc, comp[:].Tc, comp[:].Racketparam, comp[:].AF, comp[:].MW, Psat[:]); + Liquid_Phase_Density = 1 / sum(compMasFrac[2, :] ./ LiqDens[:]) / Mavg[2]; +//Vapour Phase Density + for i in 1:NOC loop + VapDensity[i] = P / (Zv * 8.314 * T) * comp[i].MW * 1E-3; + end for; + Vapour_Phase_Density = 1 / sum(compMasFrac[3, :] ./ VapDensity[:]) / Mavg[3]; +//Density of Inlet-Mixture + Density_Mixture = 1 / (Beta / Vapour_Phase_Density + (1 - Beta) / Liquid_Phase_Density) * sum(compMolFrac[1, :] .* comp[:].MW); + end if; +//===================================================================================================== +//Phase Flow Rates +//Phase Molar Flow Rates + totMolFlow[3] = totMolFlow[1] * Beta; + totMolFlow[2] = totMolFlow[1] * (1 - Beta); +//Component Molar Flow Rates in Phases + compMolFlow[1, :] = totMolFlow[1] .* compMolFrac[1, :]; + compMolFlow[2, :] = totMolFlow[2] .* compMolFrac[2, :]; + compMolFlow[3, :] = totMolFlow[3] .* compMolFrac[3, :]; +//====================================================================================================== +//Phase Volumetric flow rates + if Phase == 1 then + totVolFlow[1] = totMasFlow[1] / Density_Mixture; + totVolFlow[2] = totMasFlow[2] / (Liquid_Phase_Density * Mavg[2]); + totVolFlow[3] = totMasFlow[3] / (Vapour_Phase_Density * Mavg[3]); + elseif Phase == 2 then + totVolFlow[1] = totMasFlow[1] / Density_Mixture; + totVolFlow[2] = totMasFlow[2] / (Liquid_Phase_Density * Mavg[2]); + totVolFlow[3] = 0; + else + totVolFlow[1] = totMasFlow[1] / Density_Mixture; + totVolFlow[2] = 0; + totVolFlow[3] = totMasFlow[3] / (Vapour_Phase_Density * Mavg[3]); + end if; +//Mixture Phase +//============================================================================================================= +//Inlet Concentration + if Phase == 1 then + Co[:] = compMolFlow[1, :] / totVolFlow[1]; + for i in 1:NOC loop + if i == Base_comp then + Fo[i] = compMolFlow[1, i]; + F[i] = No[i, 1] * Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * Fo[Base_comp]; + else + Fo[i] = compMolFlow[1, i]; + F[i] = No[i, 1] * Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * compMolFlow[1, Base_comp]; + end if; + end for; +//Conversion of Reactants + for j in 2:NOC loop + if Sc[j, 1] < 0 then + X[j] = (compMolFlow[Phase, j] - F[j]) / compMolFlow[Phase, j]; + else + X[j] = 0; + end if; + end for; +//========================================================================================= +//Liquid-Phase + elseif Phase == 2 then + Co[:] = compMolFlow[2, :] / totVolFlow[2]; + for i in 1:NOC loop + if i == Base_comp then + Fo[i] = compMolFlow[2, i]; + F[i] = Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * Fo[Base_comp]; + else + Fo[i] = compMolFlow[1, i]; + F[i] = Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * Fo[Base_comp]; + end if; + end for; +//Conversion of Reactants + for j in 2:NOC loop + if Sc[j, 1] < 0 then + X[j] = (compMolFlow[Phase, j] - outCompMolFlow[Phase, j]) / compMolFlow[Phase, j]; + else + X[j] = 0; + end if; + end for; + else +//Vapour Phase +//====================================================================================================== + Co[:] = compMolFlow[3, :] / totVolFlow[3]; + for i in 1:NOC loop + if i == Base_comp then + Fo[i] = compMolFlow[3, i]; + F[i] = Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * Fo[Base_comp]; + else + Fo[i] = compMolFlow[1, i]; + F[i] = Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * Fo[Base_comp]; + end if; + end for; +//Conversion of Reactants + for j in 2:NOC loop + if Sc[j, 1] < 0 then + X[j] = (compMolFlow[Phase, j] - outCompMolFlow[Phase, j]) / compMolFlow[Phase, j]; + else + X[j] = 0; + end if; + end for; + end if; +//================================================================================================ +//Reaction Manager + n = sum(DO[:]); +//Calculation of Rate Constants + k1[:] = Simulator.Files.Models.ReactionManager.Arhenious(Nr, A1[:], E1[:], T); +//Material Balance +//Initial Number of Moles + for i in 1:Nr loop + for j in 1:NOC loop + if Sc[j, i] > 0 then + Sc[j, i] = No[j, i]; + else + Sc[j, i] = -No[j, i]; + end if; + end for; + end for; +//Calculation of volume with respect to conversion of limiting reeactant + Volume = Performance_PFR(n, Co[Base_comp], Fo[Base_comp], k1[1], X[Base_comp]); +//============================================================================================================ +//Calculation of Heat of Reaction at the reaction temperature +//Outlet temperature and energy stream +//Isothermal Mode + if Mode == 1 then + Reaction_Heat = HOR[1] * 1E-3 * Fo[Base_comp] * X[Base_comp]; + Tout = T; + energy_flo = Reaction_Heat - Enth / Mavg[1] * totMasFlow[1] + outEnth / Mavg[1] * totMasFlow[1]; +//Outlet temperature defined + elseif Mode == 2 then + Reaction_Heat = HOR[1] * 1E-3 * Fo[Base_comp] * X[Base_comp]; + Tout = Tdef; + energy_flo = Reaction_Heat - Enth / Mavg[1] * totMasFlow[1] + outEnth / Mavg[1] * totMasFlow[1]; +//Adiabatic Mode + else + Reaction_Heat = HOR[1] * 1E-3 * Fo[Base_comp] * X[Base_comp]; + energy_flo = 0; + outEnth / Moutavg[1] = Enth / Mavg[1] - Reaction_Heat; + end if; +//=========================================================================================================== +//Calculation of Outlet Pressure + Pout = P - delta_P; +//Calculation of Mole Fraction of outlet stream + outCompMolFrac[1, :] = F[:] / outTotMolFlow[1]; + sum(F[:]) = outTotMolFlow[1]; +//=========================================================================================================== +//Phase Equilibria for Outlet Stream +//Bubble point calculation + Poutbubl = sum(gammaBubl[:] .* outCompMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / Tout + comp[:].VP[4] * log(Tout) + comp[:].VP[5] .* Tout .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Poutdew = 1 / sum(outCompMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / Tout + comp[:].VP[4] * log(Tout) + comp[:].VP[5] .* Tout .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); + if Pout >= Poutbubl then +//below bubble point region + outCompMolFrac[3, :] = zeros(NOC); + sum(outCompMolFrac[2, :]) = 1; + elseif Pout <= Poutdew then +//above dew point region + outCompMolFrac[2, :] = zeros(NOC); + sum(outCompMolFrac[3, :]) = 1; + else +//VLE region + for i in 1:NOC loop + outCompMolFrac[3, i] = K[i] * outCompMolFrac[2, i]; + end for; + sum(outCompMolFrac[2, :]) = 1; +//sum y = 1 + end if; +//Rachford Rice Equation + for i in 1:NOC loop + outCompMolFrac[1, i] = outCompMolFrac[3, i] * Betaout + outCompMolFrac[2, i] * (1 - Betaout); + end for; + outTotMolFlow[3] = outTotMolFlow[1] * Betaout; + outTotMolFlow[2] = outTotMolFlow[1] * (1 - Betaout); +//=========================================================================================================== +//Calculation of Mass Fraction +//Average Molecular Weights of respective phases + if Betaout <= 0 then + Moutavg[1] = sum(outCompMolFrac[1, :] .* comp[:].MW); + Moutavg[2] = sum(outCompMolFrac[2, :] .* comp[:].MW); + Moutavg[3] = 0; +//==================================================================================================== + elseif Betaout == 1 then + Moutavg[1] = sum(outCompMolFrac[1, :] .* comp[:].MW); + Moutavg[2] = 0; + Moutavg[3] = sum(outCompMolFrac[3, :] .* comp[:].MW); + else + Moutavg[1] = sum(outCompMolFrac[1, :] .* comp[:].MW); + Moutavg[2] = sum(outCompMolFrac[2, :] .* comp[:].MW); + Moutavg[3] = sum(outCompMolFrac[3, :] .* comp[:].MW); + end if; +//===================================================================================================== +//Component Molar Flow Rates in Phases + outCompMolFlow[1, :] = outTotMolFlow[1] .* outCompMolFrac[1, :]; + outCompMolFlow[2, :] = outTotMolFlow[2] .* outCompMolFrac[2, :]; + outCompMolFlow[3, :] = outTotMolFlow[3] .* outCompMolFrac[3, :]; +//================================================================================================== + annotation( + Icon(coordinateSystem(initialScale = 0.1), graphics = {Bitmap(origin = {3, -6}, extent = {{-75, 28}, {75, -28}}, imageSource = "iVBORw0KGgoAAAANSUhEUgAAATIAAABeCAYAAACgh5hQAAAABHNCSVQICAgIfAhkiAAAAAlwSFlzAAAuIwAALiMBeKU/dgAAABl0RVh0U29mdHdhcmUAd3d3Lmlua3NjYXBlLm9yZ5vuPBoAACAASURBVHic7Z13eBzF+ce/s7vXpVPvkmVLttxk3I2xsXGhBAMhNogaQkmDkJAE0iDFkEIS8guQAAESCIZQAgIMOGDcsHEH3GRbbrKKJat3na7f7fz+WOlu93bvdCfdCcnez/PIz91oZnZ8t/ruO++88w7BILm+AKsI8ASAOAAtAFoBOAfbn4qKynlFPAjyQJECoIwCfy6uwnsPA/xgOiORNigpwBhQPA+CrwzmgioqKipBOASKm0qrcTLShhEJWUkBpoHgY1BkR3ohFRUVlTDooQy+8fZpvB9Jo7CF7LoCzGGATQASQ3YXsY2noqJyXkEHLHBTgmvfrsT6cLsMS3ZuykO2V4PPAeQMXJsBCOnrWjZAlXOAvDyKhQspdFrgaDnB/v3q00tlEFAeITTCCoJLSiuxP5yuBrwDvzMbms5O7ABwYdgDZDhQRistUzXtnOC6lW7ccL0bDOMv27efxZNP6eBUl3pUlBCrDAUIvADvAuiAonDS4cCsdQ2wRXIJRUoK8AsAfwws1xlNuPyWuzFu6iycOV6Gja89C7vV4vs9r4kH5Uz9Y/f/L1RGLdddY8Wt1/cq/u7QUS1+/39J4NWvWEWB/vkZAQ/W3o7+xUlCCIovWgbCMDiyazOoXNz+VlqFH4XTf1BKCjEeFIcBYhCLUGr2GDz44ofIKyr2ldVXnsAfv7kCLXXVfT0TuMzjQTmj8F69wUc1U8Zb8YcHKsGQ4F/k6+sy8eaHGcM4KpVRgcjLpOmtBuPqAQDoDEbc/3QpZi5ZAQAo274B/3fvdXDarOLWXp7B9HdOo3ygSwSlpADvAGSVWIUMcWb8vnSXRMT6qa88gV+VLIC1uxMAwGvMsGUtAQjTdyVVzUYjDKF46kfbMC6rJ2Q9j5fB3X9dhoY20zCNTGXk0y8xFJy1CfrWz3y/+cHjr2LRtbdKan/28Tv4673Xi5oTgKfvl1bja+FcRUbJWMwAgwNCT34BuudPL2JpyV1BO9zx/mt46v6v+97bspfDkToTIR7kKiOcK2ccwf3XbAir7rbySfjDu1fHeEQqowoCgKdIqHgJjLMDALDwmpvxwydfV6z+zE9ux6drX5F2QOicUI5/LujFGfwmUMSmXrgES66/M+SYF117K7avfQVlOzYCAHTt+9A79qugRBOyncrIhBCK6xa+Gnb9xVNO4Z/74lHflRbDUamMNnTth3wiptUb8PWf/zlo3Zt/+ij2bnjHN8WkABieuQ/gbw/WRlHIVo1DPkCupQQSS+qWn/4RhAy81H7zTx7F4Z2bQCkF6+yGrrMc1hx1I8BoZEH+PuQnN4VdnyE8Vs7+HH/b/c0YjkpltGFs2ul7vbTkLqRk5QWtm5yRg2Ul38T6l/8OoM+cIvSGlYX46dpKtCi1URQylsG3KaR+3emLr8CEmfPDGnRB8WzMXn4N9m3+QPhPnN0ES8GNYbVVGVlcNXl7xG0un7ADTx/6Adxe1QpXAbjeOmi7jgEACMNgxR0/HLDNVXf+CBtefQa81yuEaRBGz/LkNoD/q+I1AgtKABaU3CVYXv79mytuvy+iwV95+30+IdNYqqHtPgln8gUR9aHy5ZKg68aC3M8Grihr14OL8g7g07rFMRiVymjD2LjV97p4/lJkjZ0wYJv0vHGYtvBSlG0XfLOUApQhNwL0cSh43GVCRguwBARZRBTPkZFXgBmLI5saFl+0DDmFk1BfeUL4z9RthCN5ZkR9qHy5LMzdAw3jlpV3OxPwx70PosWWhp/O+z9MTjkuq7M0fxu21S0djmGqjHCMZzf7Xi9eeVvY7S5Z+Q2fkBFQEJC5KyfpJ6w9gVOBdRlZazArA/dMLl55GwijUDUEhBAs/pp/0MbGLSDUI0x4R8FPYpwGcycm+n6SzdovfUzD/bMoZ6fid/vrnb/DtrNLcKxjKu7f9jg6HUmyOguy94BjvV/6/0H9+XJ/NL014Gz1AACNVod5V6wKW0PmXnottHpD3zsKSgHO7b0WoCSwrkSdHgYYwtCVhEKyfWD+ipKwLy5mwdV+vxjjskDXFta2qRFBcX4cnrp7ku9nZkH8lz2kYYVjPJiX/bmsfOfZi/F50zzf+05HEv59VB6OE6+14IK0wzEdo8rIx9C0w/d6yvwlMJjC/zvSGU2YtmC57z0R5EtxaiiZWh7Jx3RCSbZY7nLGT0behKlhX1xMxphCjJs6C9XlBwAAxqZdcKSHt2AwWFZelI7vXR18RcTq8KLL6kFtiwOfnezCxoMdcHsGlcvtnGZi8kkYOfkWt3cr5E/Uj6pW4N4Zz0DPOSTlM9MP4kDzrJiNUWXko2/9wvd61tKrIm4/a9nV2P/J//reUVCQi6+8MCV+/WewQBQbJrHICMMs768+lItLBtK3/QAAdK2RO44jRathEG/ggv5kJukwKdeEy2el4Nc3F+K/P78ABZmGgTs+z7ggVW5NtdlTsbdR/iCyuk34tO4SWfm01CMxGZvKKIHy0HUc9b0VW1fhImlDeYAQraHDuihwl1CAkNGlBAREVClSJ38g0xdf4Xut6a0FZ20YUn/RJidFh2e+NxmJpuCxwecj09LkIrSx5nLwVNlXur7mSlnZ1NRyMES1ds9XND2nQbx2AIDJnIicgkkR95GZPx4JqeL9uwSE0HmB9Xx3ZQnAUuBisc7pDEZMnrso4ouLmTBzPgxxZt97fcfBIfUXKR/vb8Mdjx/FD549jodersDfP6jFoSqLpE5SnAbfvCJ3WMc10lGypr5omhu0/qGWGXDz0rixeK0FY8010R6ayihB3+G36otmXhTxgmE/E2aIM4hRMBSz8fAjBPAvSfp65sdrJwHELDbZxk+/EJwmIK9YhLAshyJRIK22fXinG+09bpw4a8UXFT34pKwDr29rxN1PH8N/PpFahpfPTAHDyBZDzkuyTQ1IM7ZKynjK4EjrtKBtHB49TnTIn7hKlp3K+YGuw//dF826aND9FM0UtaUUlNI5KJ9CxFrlEzLG651PiHRaOWn2wkFfXMxEUT+6jrKo9DlUXt7cAF6UPCvBxCElXo1EB5TF51RnEXrdcSHbKTn2VT/Z+Yu2UyxkCwbdj1TIvABIxk1H7ssTu8n8th5LZyMg7GIoKipGLGRc7xkQryNE7eGh1+GF1emVlBl1gzN9zzUKEqtkZWUt0wdsd6hlhqxsfNLpqIxJZXTBODt9/nCGZTF+usytFTaF0+aAZQUfNulLz+il3XPwyCOyqSWhlMgSjOVPHvjmDYexon4I5aGx1ESl36GQaOJg0vsd/JQCbT3yKPYvC0KAibkmrFqQjm8sz8aqBRmYPd48LNPfMeZaWVllV+GA7aq6CsLqS+XcR9tb43udmT8+ovixQHRGE7ILJkrKKKVzgNVAn5+s7y+ZgoCdQgnx7WIyxicgKT06p77FJ6XCnJyGng7B76KxVMGVGPkKRrQwaBk8sGosxJpwrLYXVoc3eCMFHrqxAF+90J+uZuFPPoc3RK7n938zExmJgs9x/+ke3PsP+dYeAJgzwYz7V45VDAtp7XbhL+/U4MDpHmx+dI6v/K0dTXh87ZmIxh+MMfFy8anqlotUIC32dPS64xCn8afDNnI2pOjb0e5IicrYVEYHnMV/DwWK0GDIGleEugp/kliep9NLyktJqbCjXBCyVZNNmXCRFPGcM2/CVISTsidc8oqKUb5X2Dyq6amOWr8DMbMwHvdenQe9lkW8gUVyvAbF+XEw6lhJvTd3hJ+qJpZcNTcVD91YADaI5ZWWoMWf7yzCn0pj8xkyhEdu/FlJGaUENd1jB2xLKcGZ7nxMTZVmJR6TUKsK2XkGZ63zvQ5nk/hAZI0rEr2jYBkyTnI9AGDdriIAEkd/btHgovmDkVc01S9kFrkPJlZMGROHKWNCO6k/2teGjQfah2lEwZkyxoRf3CAVsW6rB9uPdqKhw4k4PYu5RWYU5Zjww2vHxGQMGaZm6FjpcUj9llY4VHUXyIQsL74OB5vVhAHnE1yvX8gyoyFkkj54UMqOqU7qZEDBgwhCRnjQPCEQ1h+8ONhtScEQ9zecQhaKDosbr25txH8/bfyyhwIA+N5VY6Bh/SK290Q3fvVKBXoDprwrL0rHz64fF9g8KuTF1cnKanvCF02lunnx8j5Vzm00VtHUUmJNDQ6JRUYpKMMYcnc/lrn/kcZ6oM8iY0ByaV+FfqItZLmi/jhbE4jH5j9hKYZ8+EUrapr9q6QOlxfdNg/qWh04WW+ThGB8mWQm6TBngj9wuK3HjV++UqHot1u7pwWT8ky4dn561McxJkHuH2uxhX8dpbpKPjeVcxdCeV/GCyA6FplYDIkQggEN3zEWWF0PrAYnRMpyOV4iiS9D7vgpQ764GKkwUmisdXAlDN0JOBBbyzqw81hXzK8zVGYEZNdYv68t5OLD2t0tMRGyNEOrrGyoQpYVNzIsXpXhgbU3g3hdAITdQckZOUPuMyE1A8b4BNgs3UIBpfBS77iS8tLdpSgRNs7xQK445yLLaZCYljnki4uJS0yGzug/Jox1tEW1/9FOWoJ0B8WJs9YgNQUqG21hHNQcOcn6DllZi3VoQpak6xzSmFRGF6y92fc6LWds1BYN0/P87hRKCFgv7ytghCNKSI44VVliasag90WFIjHVL46M48t3rg+VUKEWkbbVaaSft90ZOhTEw9MhXT8YSXq56LTYwxeyVlsaaEDeu0R9F4h6HuB5A+v030PRNIikm8cpKOhYlJQA1BcQSyW2X2J6VtQuLiZJ1C/rHP1CFjj102tDi79eJFa9dmlbq8MjeZ8wQDaO5DgNODb6wbFK1lOrLfyj3Vy8Ft2uBEmZhnHDxIW2MFXOHRiRkCWkRM/9Ie5L2DFOM1qPbSMAwEy9oVgDHhniP4loTyuV+mXPAYustdsleZ+VrAta16RnJeLUEtC2rlW6bWv6uNCR0AumJIY7zIhIMsiFrMsZ2bW6nQmyskT9yPdTqkQH1uV3T5iTo3e+qaQvnoISCDfaI48QrqCs1kxBWFDqy4mRlBYji0zUL3cO+MiO10mtjPkTE3C6QZ5VFQDmT5KKQWDbsupeuL3UF35xxawUvLKlAQ0d0pguAIg3sLjrsqE7UJVQssgs7si2l/S65DFnSbpOnLUET5XEEODWpcF3knT2ulHf7kT5mV641Iy+IxrG6X9omVNiJGSgACVJloZ4gmyAYxl3HLzSYNjhsMjOBR/Z0TO9aO5y+bYdfeuKXHT2urHhQDs8XuHzZAiwcEoSfroq39fO7vRiV7lUMCx2DzYfbMeVc1IBAAYdi6fumYTfvVElyZ82MdeEX95YENL6Gyx6zgEDZ5eUeSkLh0cfUT8Wl1z4lHxvYhiG4N4QKcr7sbt4vLurGc+vP6sK2giFdfm/a3OMppYABSG079Sb1eAI4eIAqX9mWKaWrtEvZDxP8eLGejx0g7B4otcy+PXNhXjwhgK0dLvg8VJkJWmh4aS+s9e2NcmCXAHg2Y/qsGByom8KmpOix3Pfn4K2HhfaetwwGzlk9wmYw8UP6JOLlESdfPpndZtkzvuBUNoFEK2ppUHL4NalWZicZ8J9z5/wPTDOVdIStL70Um4vRWWjssU/kmCd/qllNH1kZomPjIJS+KY5jNbtjQMhkmDYaF5cjHjVgXWcG0vyH+xtwatbpXFSHEuQnazDmDS9TMQ+3t+GlzbVQ4mWLhceeOEkunqlWThSzVpMyjX5RMzq8OJX/4l+epzAw0MAZetqIJSmopE6++taHXjuozq88WkjPvyiFWdapJbirPFm3HxJbB64I4nrL87AmvuLseb+Yjzx7djHXUYD8dQyVs5+UB4A0afXPWF4GABHGGoSdib5hUwc7xVNdAZ/JD/h5b6faFDZaMN7e1p87xs7XSFqB6ex0yXpp749+HifXleLXce6cMMiIdWO2ShdcbQ5vThcbcHbO5sHDM49eqYXt/zlCG5fno3lM1KQavYne7Q6vNh2pBPPr6+T7UiwOYc+zdIy8s/K6o78XlDykWnYyFIkNXY6sWazNIvvDYsycf9K/xR95YIMvLq1MSbxdCqDh3H7H1rGePnCz2AxmcV+ZuGIJK7lUGJ5eamV8/JUdqdqdJH5RMJF0i/lQagHlET30I99FT3YV9Ez5H4qG20RZZg4WNmDg5U9IESwoOINLBiGwGLzoLXHHdFWqA6LG0+8dwZPvHcGqWYtkuI4WOxetPW4fFOpqflSsbDYPUpdRYSS2Di9kfviXF55enQtO7gHipi3djRh1YJ0jM0Q0htlJ+uQaNKgs3fk5JFTAQjv/66jqSWcVnwvUoAQGB1dSTxQzzGg8TykPhCtdhiEDAC8LoA7t04volQIy2jtjrxtfroeBq0/vVBVk73PPyYXgcIs6T7Vyka7rE6kKImNh4/8+1Fqo2GiIzZ1bQ6fkAGA2ciqQjbS4P3fh0YbvUUpSV99dgEPogMAjlJqRMAWAk4X/RUxQC6QhHeBIvYbx0cL96zIw5ILkn3vH3u7Gu/ubpHVMxs5fH2pP5TF4eJxtMYiqxcpGiIXhGgJWTQsMkDYXC+myxraEs1N1WPa2DgkmjQgBOixeXC8zorqJhvCNZJTzVrMmWBGilkDl5tHXZsD+yt64B7kQkNemh7F+XF9RxASdPS6Ud1kx6n66AQNcyxBcX4cCjINMOk5WB1enGmx43BN74CHUeu1DDSs4NflKYXV4YVey+DiKUnITNKis9eNQ1W9qG8Pnq6eEVlkXKyEDFQ4uJLwHEEJOAohKaxYyobLImO8TqgL6H42HeqQCNkDq8ZiUl4cDpzuQY/Ng+R4DfLT9bhyTprEd/bhF62Kq6CRoiQ2Xp5VqBkaRYtMQSQjZW5RgsQSrW11oDuIkM2flIi7V+RiUq6yj6++3YGXNjXgf5/LN8n3k2ji8OOv5eOyWakIzHPZZfXgyffO4FhtL9560J/K/b7nTuDzU8rm+JVzUnHbsuygB0LXtTpwzzPHoNeyePsheZr59EQt9j4uHI32woZ6vLBBmgDTpGdx27IsXLcwA/EG+Xdgc3qxdncLXt7SgB6b8uf246/l+5IRnKq34jevVuLpeyYh1ex3F/AUWPX7Q2jqDOI35v19D/UUNjGB+kEJwLNgOAAcCOsF8YZsEKuBgI/OU/pcYcuhdsweH49VC4TVXZYh+OqFaZJ02oGcqrfh6f9FJ9+X0vTvy7LIspJ0uG1ZNkx6BnF6DuOzjbhgXLxEUN7crpzV9+4Vubh9eU7gRENCTooev7qpALPGm/G7NyplCwZJcRo89/0pyE9X/ltINHF4+NZCvLhReQVajJZj8MjXC7FU9JBSIi9ND4OOHdTiRWGWEY/dNQE5KcH/do06FrcuzcKlM1Pw4JpTOFYb2gIkhOD3t42XiBgA7DjaGVTECO+GeOEwZlPLPigRbjaOYcF7A8yiWAmZVi99EvWn+lDx89jbNdh/2oI7L83G+Ozg0+52ixvv7xGerk53dOzamPrIIly1zEvThwyQXb+vDWt3N8vKb74kE3dc6t/1cKbFgbd2NKGqyQaeF/pdtSADU8YIltqKOamoabbjlS3SFdKHby2UiFhbjxsf7G1BVZMdGo5gZkE8rpybhtuXD3yuxcO3SkWsqdOJ9/e2+naB5KfrcenMFJ/16HDx+KLPqstN1fuCn90e3hcc3SCa2uWk6PDU3ZOQLDrOsKLBhk0H29HS5UJyvAZLL0jCtLFCWExGohZ/++4kfPepY6hqCu5bLcwygkAIMdp2pBMMQzCrMB5byuQZUnzw0u85mhYZYRiwLAevV2RN8pQFAA4UXgQEPGpjJWQB/RJvbEIwRjtbDrVjy6F2ZCfrMDHXhFSzBnotC5vTC4vdg8oGG2paHDHJfhENqIIpJN45MljsLh6Hqy1Yu7sZ247I4xDTE7W4e4Vf/I7U9OIHzx2Hw+UX+rJqCz76ohWP3lGEJdOEwPDbl2fj3V3Nvun5zMJ4XDjRHzZwqt6G7z97XDIdW7+vDes+b8XT90wOuXl/cXESlk33i9ie41146OUK2EVj2lEOvLatEdfMS4PbQ9HW48IPnjsBALjnqjyfWHb2enzlYn5RMk4iYi9sqMeLG89KLLvXtzVi1YIM/OQ64dCdeAOH39xSiLueLA+6os4Q4N3dzXjs7Rpf2c7yAXZoiGZZLMuBYSN3TYSC0+ngFU+LSb+QEXiHK8UKDbCZo3i2yTlJQ4dTca9lrHDz8gOKWTZy35uSP8zFR/Zk/mhfGybmGH0+MZ4CP3vxJL4IEVqzYk6aJB3S42trJCLWD0+BZz+s9QmZSc9iblECth4WLI1l06UHpfz+v1WKPqUjNb1449NGiQUYSL+bABDOX/j1f05LRKwfSoEPPgvurwvGlDFxmFvkF931+9pkvrN+3t3djKxkHW5bJiwUTco1YcGkhJCxjW/tkFu9IRFZS5w2etZYPxqtDk5b/5SYguWpMLUEJd5AZ7/L6UAsQmLdTulKB8/EZnUUEPxLSy5IxqKpichK1oFjCNotbmzY34YtZR3QcAxuWuyPDD9x1uoz589XlMSGI5HHp3GMvI3bG9kp7vVtDry44Sxe+nExzEYODAF+940JuOuJo0HFfdZ4/44Cnqf4eUnocw14Cp/PbWKu0Sdk4gWC2lZHyNXEbYc7gwoZIdIxbT3cEZVFGTELA7KgBE6RA3ltawNuXZLpOx914dSkoELm8vCyHRUDQRm/Beb1DD22MRCv2/+QJBSgPGVRAnCUR2AYmUxwooUroF/KRl+xAWEJ+YlvT8TMQrPsd11WD7aUdUCvkW5SfmtH03kvZEpioyRKA6HUJlKLDBB2U/zqldN48jsTwTAEiSYOf/nmRHz77+WwKSSeTIn3X4NhSNAVSyUSTP7/e6Io3VJDiB0dAIKv3EEIk9GKtqidbYv+35U4HMXt4VHdHFp4uqweNHe5fH637BDJB7qtnsgXHhj/5+j1uEEpjeqxkm6X//OmBADHuFAKcITAgwAli5WQyfplYiNk37oiV1HEVEKjFJEfNSFT6DscPj/VjafW1fmOvyvMMuDhWwvxi5dOyeLAeNFfXXWzHS98rDzFUkJs5XlEHZv0oTfmazXBf+8NiDML3HcbDTyilTqGIWAYMuAuEg3n/3sPFQvXY4vceqSiv2lKKbwed9Qc/v39ifFQ1qYFwPFgLIB0wC7X8AgZz0Z/akkIcM08f7iCl6f4+we12HG0EwYdi6S4c2snQTRR8pFFS8iU+g6XNz5txMRcI74yW0hxtLg4Cd+5Mg/PfSQNO2ntdmFC30pvqlmDTw53hLQoUs1atFtcsjodFjfG9e0eCBXOAAATc4Jbfb0OL3odXsTphelW/0ppNBGfEMYyQiDs4ergwdG5qXpJOEVtiKmjlx/Eajgj/ftyu5xREzKP2yX1s1MCPbRWHqVgQNjuQF9/zKaWAQJJY2CRZSfrJZlYtx/txJvbm9DQ4URloy0q+zDPVRT3SCpsJB8IpTCOSH1kgfzxrWrJgSy3L8/GZTOlTnnxdxtv4LBoalLQ/pLiNHj5gWKs+XExLg7wM5Wf6fW9To7XYGahcgYQQoAbFofOwPHZSb+7YsHkxJAhNSxDZGc3DMSnRzokFtjdV+b6/F9K4/3eVdKQln6/YLSghJHsn/a4ordYJe+LwqPR2QCAAaEyx9CwTS1j4CMLzHV/ok7NFR8uSlZTnLZXoWZolNoMdmrZj9PN4+f/PoUOizC1IAT41U0FEj/YR/vaJL6zX95YoOhiKMox4rnvT0FKvAYTc034051FKMrxC8ymg9Jceb+6qRC5qVLLjGUIvn/1GMydENqF8cY2f3YOliF4/FsTFYUx1azFX75ZhPTEyD6nhg4n3tvr38Y2a7wZv79tvCyy36Bj8YuScZJQkJ3HunCkJvLvdyAo67+P3FEUMmlfgli7oLEBAMdpDF1ur0NwyPV94tG8uGQgYiELUO5ooQmI6Qm2FUNFjsMrn0bFaQYhZApt7F7lbTmR0NzlwkMvV/hit3QaBo/dVYS7njyKth43unrd+Nv7tXiwL9FlgonDs/dOxukGG6qb7eB5irEZBkwMWAR45n+1OFXvT1hY0WDDxgPtuHyWYPHlpOjwxs+mYffxbtS22qHXsrhoUoJM3JQ4ekYI0bhliRDykJ6oxbP3TkFlox0VDVZ4vBSZSTpML4iHhiV44r0zEX8uT31Qi4k5Jl9GlGXTkzFvYgI+O9mNpg4nUhO0mD8xQfKQr2t14A//rYr4WmHBaAAIU9bYCRkASmFLzLTqAXCeyZd04uB7FP6U/aI4jejiEPVLYxh6IWZkhoyOTJQOGYnT9oIQGlGW2HiN3EfT6Qg+zYuEQ1UWPL72DH52/VgAgjD86c4i3PPMcbg9PN7f24I4A4vvXZUHtm+KNT7bqDil8/IUz68/izc+lW91euztamQla33R8BqOwSXTkgD4/x88T/HPj+tx94rgZxEAQr46SoFblmT5YicLswwozBq6uANCoPCP/nkCv765EIuLhfHF6Vksn668JWpfRQ8efq0yZllDxC4jjzM2U8t+ubIlX2VbNLWEcqVT3/Jcf0hrA4ip/8++q1V5D9tQEffr1Yfed6Yy/NjdBjg8ekmmWJZ4oeccsLvD/6NTmloOJGSUQhL+EiqR5bu7m5GeqMVUkfP8K7NTsK4voPS1rY3YV9GD25dnY8HkRFlK8F6HF5sPtuPtXc1BD4vpdXhx7z9O4JYlWbhhUYYkcp5SwdL62/tn0NLtwmxRrFi3wgyAp8BT62qx/WgnvrE8G/OKzLIVzLYeNzYeaENbj1Rc6tscvs8lVKYPi92Ln790CgunJOHmSzIxoyDeJ+SAILpHz/Tize1N2Hq4I2jmj5pmu+96dW2DEyHK+i1Vhy16U1eH1d+X8ECgzh7keh8GwAEA4Wk3CDH1my8xE7I2kZDpUkLUjAxC/KtHgZt8M5O0Ej/KmRa7YmR1OGg4BnMmmDF7vBnpCVoYdQy6rB6cZ4rpIQAAEPNJREFUbrBhz4nuoMGDYzMMkjMtTzXYQi6Rp5q1uHhqoiRDrRKZSVokiuKfalsdivFVkdDpSEJWnDR1d7zGEpGQxWsVLDJnaCHz8lRx+00wAlcsAzl51oqHXq4AxxKMyzAg0cTB7aVo7XahpcsVVgoel4fHms31eHlLPfLTDUg1a+DxUtS3OyVHAYY77rJqCx544SR0GgZjMwwwGzk43Txaupxo6VZOvvnBZ61hR/xTKmwh2lneCZOeRX66ASY9C7tTSONjsQ98b7zxaZOihRoJXm0SOKsQ+tLdHvoejoSuNtEuA8IAQJs+qYACAAc8AoB0ADTb32A4LLLUqPVLCMGa+4sVf3fHpTmSyOu7nizHsdrInhIMAa67OBO3L8+SZQLo50cA9p7owlMf1KIyYCPukmnJkunHI69XYv2+4MfhfX1ZFlbMScWmg+2yQ4D7YRmCp++Z7PPTtHS5UPLHsoj+X0p0OuVClqDrRost/NzrZq18ZbjLEZtzOAfC46WoCGJ1hQulgqVSM0Cwabg43TxOno3tIpTV4Y34Po8WvM7/0IqmkPWI+qIgoCB9BY/0nTROSL14o29ni/RGjhZdon75KFpkscSgY/H4tyfhgZX5QUWsn/mTEvHvHxfjilnS/9ub2xvRbvFPGe66LEdi9otJjtfga/PTYTZyKLk4+NL+FbNSJM7mFzbWRyULRodDPuVPM4S/B1DDumWnMXl4TvFkJZVzE6/eL2Q9URQyqSgSEKApPtvSb5EBFLRO7BUfHh9ZFIWMUt+8Ps7AYXKefypZ02yXTAOsjvBXMVmG4M93TsA80aZcj5diw4F27KvohtXhRXayDl+Zk+qbvuo0DFbfUginm/dlaLC7eLy0qR4/WTUWgJBK5iuzU/HhF3KBuHVJls+nc8uSTJTubJJZZQxDcMdl0lQ1H4ZIEBgJSpZTuin8mzHd0ILAJASdjqSIj5RTGb2ILbKejujcl7K+CAEFhLnm6tWUw+rVlL7+aB3hqW+Jr7M1NhaZuN9oChlP/X6K6ePi8fwPpvh+99/tTQP6moKxamGGRMTaely4/18nJUv1APDmjibcvjzbl0KGYQgeurEAh6rKfA7a9/e04OZLspCTIqzW3nV5NjYcaJOcy5gYp8Gqhf5sCf1W2ZrN0uR9l89MwZg0vzX2/Pq6qKX0UfJlRWKRpRnldQfyj6mcW3i1YossRkIGAgaMzzJiAICjjMRz2tPWAjqY7QkD0C1y1nmi6COLBQxDcMel/qR5PE/x0xdPyUQMEHwoazY3YK1IMM1GDiWL/FNDt5fiX6K9fzkpeqyYI/0Mbr4kE4Y+a6xf4G5ZkgmT3p9RgGEI7rzMP65jtdaoRme32uTZaNON4T8IlESvxRqbc1JVRia81m/VR9NHJu6LAKCENKeVt1IQgAEBKIFkaun1etDREjodSKRYOtvgtPtFYKT7yIrz43wnPANCFPTxAXYJvLihXrKs3Z/vqp+NB9oky/13XpbjS8onWF+CNdZl9fhWjsxGDjeIBPHSGcnIT/evID77YW1Uz3WstYyRlUUiZErT0Lre4JleVc49vDq/nzVWzn4egJvAV8AAgJvR1AZmOTxbcSxqAwCAulPlvteUMPCYRvbNnZsiDdgtC7ERt5+2HpckBXFeml7ysfJUGjaQlazDVXMFC+imxZkw6gTL6+P9bXhvT7NvOf7mSwSrjCGC+PXz+anukIkGB0Ndj/x7GRNfG3Z7pbq13XJxVDl3EbuNOprCz0AyEO2N/r4IATRgGkqnllAAYAACj6nobF/iIF/FsxXl8p6GQJ2oP68hCzwXnajmWMEFBCy6PeGZPeL4JJYhganesPNYl0QUr52fDr2WQckiwRrjeYp3djWjvt2J7eXC6p/ZyOGrF6Zj3sQEX1YGSoF/ROnQETGN1ixZ7rBMUxMMmvBCD8YlyA81VrLyVM5dPMYcUCHOC93tLbD2BM9AGy5OmxWdolkiBYFDl17RFz4mWGTrrrnGQQit6wsyAyAVnmggFka3OXTmzpFAc0DCvHC2k+i1jM+ZDwixXUo++Gc/9AvQ5DwTrhcd37WlrAN1rYJV98oWv5P/yjmpuGym36f2SVm7JBtEtOApg3qLNOMpIRRjzTVhtR+bIK+nCtn5BWV18Or9ftGmmooh99lQc8qXwocSBgS0s3fl881YvZoCoAwAitWrKQUpF/vJoi1k4v7c8QVR7TsWHKqywC6Kkl8+I0WSOVSJr16YLskIuvekcsbZQ1UW7OpLL0wIcH1fvBilwJpNfvE6Vmv1pYEpzDJgXpGQaaF/j2CsqO2RC09BwsAbjFMNbbJgWLvHgDb7yF7YUYk+nji/i6IxCkLWWH3K95qAAaE4mTZliU+x+gJiAVAcEWeKPVtxTHZYyFAQ+9xGg5A53bwkPUqcnsXvvjHBt6oYyPRx8ZJcT/1TxGA891Gdz1rLTBKmcp8e7ZTtCugPvWAZgrQEod66z1pR2xqbVEuAsgUVjpAp1amz5KkxZOchEiETidBgEYshJQQ8cBKlpT7JYvy/ZI6I7zd7b0/UHHXdbc2SGBCXeeQLGSAcqyU+Gn7uBDPW3D8NV8xORUq8BjoNg4JMA+69egye/t5kyebk17Y1Bt2QDPSdO3jAv02JUuClTfLDXg9WWnxnGQKCwL6wYeBDYYdCdZd86n9B2uEB2ynVqeoaHd+1SnQRL+ZFwyJrqhb1IURanOx39AN9kf0AgZdojnIBoWM1xw4hJWvoq4s1x0V7AAkDT1z+kPscDqwOL+577gSe+d4Un9WUn67HI7cWhmy37rNWiR8sGP/8uB7LZ6SAYwl2H+8Kuv9uzeZ6PPmdSQCEQ1LaemJ7sPGR9mmysskpx2Hg7LB7gvsKZ2ful5Udbr0gqmNTGR244/xWfTQssoYafx8UBCzICcHR/3D/qqXwO+f4/OME1C1euTx5YPeQBwAAJ/fv8r12xxeAxiBXf6yob3fi9sePYEtZ6PzvgBD/9eibVfjDm1VB06RI+3bg/b7pq5I11s/eE904VmuFxe7BK1tis+tCTF1PHtod0jg/jvGgOPVo0DYa1o2pqXK/6pE2uSiqnPu4RcZKfeUJ6engEUJ5XuKaIhRgtMYTfY5+AD6LDFi/vsJVUshWAMyU/sNIxAI0FMT9OFNi+4Q+2+bAn0r9IQDiaZkYh4uX1KtsDB5e0G314JcvV6Awy4gr56Ri7gQzMhK1MOpZdPZ6UFFvxa5jXfh4f1vEKYL+vbEeqWYtjp4Jnang5S31GJNmgMU+PBlvy9umYnHudknZnMx9+KJprmL96Wllsvz+No8RlV2hrVeVcxOPKQe81gzG1QOHrRe1J49g3JSZg+qrrqIc9t7+RSQCgHYm6K47LY5tEi3DEQDs5xSY0v/7yiP74HY6oNENnNI3GF6PGxWHPvO9dybFVsjaLe6w9la6vTTiPZiVjTY8vS784NBwaLe48ZtXTw9Yb/vRTmjY4Tt383DrBTIhuzx/I54v+y54Kl/wuGLsBllZedtUxboq5wMErsSp0LfsAQCc2r970EImnhkKWXrI3n9e87wX+/1KJr7LKM9im+TEcYcdxz6X3swRD2L/bkmWSGfqjCH1dy4STvodSoVEf8OFkm8rK64RszIOyMoNnB3L87eE1YfK+YMzxe9WOHVwz6D7OXXA35aAgBLswmpQiDLZSx6XjEe7lYJC7Ccr2yF/0kaCuL07fhw8htDHZ6mMDE60T4LTK/dlfm38e7Kyy/I3wcjJV2hV/9j5jTPJ//0Pxd8uFkFKCBjK7AzcMiMRstIqex0FKsXxZAe2fjjoAQDAgW0f+V7b0+cPqS+V4cPFaxX9YcvGfCJx+sdpevGtC16Q1bO7DTjQNCumY1QZ2TiTiwEi7B9uqaseVMJWS1e7dGcAhavbWLQPAUoW6MCgDME2cUFD1UmcOT64FMqBbR0ZCwbVj8qXw876i2VlDOHx6KKHMD2tDFlxjfjT4l8oZsfY03iRbM+myvkFZQ1wmf2LPSe+2BFxHyf27fQH5hMCMDi4sazMhoAD0uSeWC/5NDByYPdHb0U8AADY9b//+l7z2kQ4Umf2XV/9GQ0/O+ouhpf6c6H1k25swfOXfxdrr12JOZn7ZL8HgG11S7708as/X/6PM8Xv4BfPzsJFPCOkIACPT2WZGCBZtRTw8t7NLEN4EML0B07teO9V3Pij34Jh5Td1MCjPY/va//je23KWQQjJHT6HtcrQaLcn4bOGeViQE5mj1uo2YXvdQvW7VoE94yLEV70JADi47SPwXm/YOkIpxcGtfvEjADws1gVOKwEFIXv3DBpLCuheSsiC/uptDbXYv/V/mHvptWH/B8p2bkRzbaXvvS17OQgf24h0lejz4enLIxayzTVL4XQxIFC/7/MdV9JU8JwRjMeGno5WHP9iO6bOXxpW25P7d6GjuS9QnAAEaOZOrdwDlNLAuorpHCjFuwRY0LeZHACwfs3fIxKy9Wv+7nvtji+A25QHxmVRsgpVRjA7Ts9Ew6xMZMeHdyANpQTvHL4CrGvgRJQq5zb9auNIvxDGhq0AgO3vvRq2kIlndKAElMG7pShVPB9RUcgIQSlAHxOyownDObrnExz/fDsmz1s84AAqDu7FwU/X+97bMy8G5wieCUJlZPP2oSW4b9F/B64IYE/NBTjTqAcL9ftWEXCmzPAJ2d71b+OOXz8Jgyk+dBubFXvWl/oLCOD1sK8ISa7lKApZaRVqSwqxCRRXiMtf/8uD+O2bO0CY4NHalFK8/pcHfe95bQI8pmxoLDV+iVYZVXy0eyxWTU1GbnLoQ054SvDSlnnQ9NQMz8BURj4EoKwBvMYMxt0De28Ptpb+Gyvu+GHIZtveWQNrd6fvPQUq3q1x7w1WP2imQELxLwp6BUTzy5MHdmPTG8/j8lvvCT6At19C+WfbfO9d5iJoeqpDDlpl5PP8+8X47R3bA492kPD+riKcPd0DDaJ7joDK6MdtHgdduxCK9eFLT+KyW+6GRqucPMLjduF/Lz4uKiGgoE+H6j+okLWMwftpZ1AFQiUJpV559AEUFM/G+OnzZG3Onj6Gl/9wv+89zxkBAmgsVaBQWmtQGS2U7QPey8vEykuVfWUnq+Pwn9J4aDwDJ2BUOf+ghBOCY6kXrWdrsP7lv+Or3/6pYt0Nr/4DzXV99xEBKE/bXQ7Io65FhNSWGwpwNwWeDSxPSs/Cz/+1DgXFs31lZ46X4U/fuhrtomSMXkMGKKMJaK3OL0crhAHuuqkbV10mzdRx4rQWjz6Zgl6rukFcRUxA9L2rB4xbsNb1xjj8+YP9yBpXJKnTXFuJn391NmwWf4IESvDrtyvx+/CvFMCV46GL41EOQJaLRaPTY8l1d2D89HmoOrofW0v/DZfDnwqHZ/UAo4EqXOceUyd7sWiBB0YjxcHDLLbv0MCrhoypDAgB8VhB+uIL84qKsfq1T2BOFo5EtHS24be3XSrZDUSAOrsDk9Y1IHi6ZYQx27u+AFcTYF1k42VASWDQG1U1TUXlfIP4/ul7SwHen1MvPW8cvnb3L0AIg/ee/aN/StkHpbjh7WqUYgDCclvdUIA3KHBTeAMnql6pqKgEhQAYMN2ywIulVfhWOBVDn2/WBzXg23BgOigmD1yZqk59FRWVofKFicf3w60clne2tBy9oPgKgBODHpaKiopKeOwAcNmaGoR95mHYy0ylVajlOCwCwQeDGpqKiopKaFyE4K8OB75SWoWI8roPahZYUohlAO4AxXwAYwA0AjgLhK+gKioq5zWJIMgGRRqAIwTYTCn+XVqNk4Pp7P8BH9aT7eC2utoAAAAASUVORK5CYII=")})); +end PFR; diff --git a/Simulator/Simulator/Unit_Operations/PF_Reactor/Performance_PFR.mo b/Simulator/Simulator/Unit_Operations/PF_Reactor/Performance_PFR.mo new file mode 100644 index 0000000..788db03 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/PF_Reactor/Performance_PFR.mo @@ -0,0 +1,12 @@ +within Simulator.Unit_Operations.PF_Reactor; + +function Performance_PFR + input Integer n; + input Real C; + input Real F; + input Real k; + input Real X; + output Real V; +algorithm + V := Modelica.Math.Nonlinear.quadratureLobatto(function Integral(n = n, Cao = C, Fao = F, k = k), 0, X); +end Performance_PFR; diff --git a/Simulator/Simulator/Unit_Operations/PF_Reactor/package.mo b/Simulator/Simulator/Unit_Operations/PF_Reactor/package.mo new file mode 100644 index 0000000..75ce983 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/PF_Reactor/package.mo @@ -0,0 +1,425 @@ +within Simulator.Unit_Operations; + +package PF_Reactor + model PFR //Plug Flow Reactor + //Instantiation of Simulator-Package + extends Simulator.Files.Icons.PFR; + import Simulator.Files.*; + import Simulator.Files.Thermodynamic_Functions.*; + + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + parameter Integer NOC "number of compounds "; + parameter Integer Nr "Number of reactions"; + //Input Variables-Connector + Real T(min = 0, start = 273.15) "Inlet Temperature"; + Real P(min = 0, start = 101325) "Inlet pressure"; + //Component Molar Flow rates of respective phases + Real compMolFlow[3, NOC](each min = 0, each start = 100); + //Total molar flow rates of respective phases + Real totMolFlow[3](each min = 0, each start = 100) "Total inlet molar flow rate"; + //Mole Fraction of components in respective phases + Real compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1/(NOC + 1)) "Mole Fraction of components in inlet stream"; + Real Enth, Entr, Vapfrac(min = 0, max = 1, start = 0.5); + //Output Variables-Connectors + Real Tout(min = 0, start = 273.15) "Temperature for which calculations are made"; + Real Pout(min = 0, start = 101325) "outlet pressure in Pa"; + //Total molar flow rates of respective phases in the outlet streams + Real outTotMolFlow[3](each min = 0, each start = 50) "Total Outlet Molar Flow Rate"; + Real outCompMolFlow[3, NOC](each min = 0, each start = 50) "Component outlet molar flow rate"; + Real outCompMolFrac[3, NOC](each min = 0, each start = 0.5) "Mole Fraction of components in outlet stream"; + Real outEnth, outEntr, outVapfrac(min = 0, max = 1, start = 0.5); + //Phase-Equilibria + Real Pdew(unit = "Pa", start = max(comp[:].Pc), min = 0); + Real Pbubl(min = 0, unit = "Pa", start = min(comp[:].Pc)); + Real Beta(start = 0.5); + //Phase-Equilibria-Outlet Stream + Real Poutdew(unit = "Pa", start = max(comp[:].Pc), min = 0); + Real Poutbubl(min = 0, unit = "Pa", start = min(comp[:].Pc)); + Real Betaout(start = 0.5); + //Average Molecular weights-Outlets + Real Moutavg[3](each start = 30); + //Material Balance-Variables + parameter Real delta_P "Pressure Drop"; + extends Simulator.Files.Thermodynamic_Packages.Raoults_Law; + //Mass Flow Rates and Compositions + Real totMasFlow[3](each start = 50) "Mass Flow Rate of phases"; + Real compMasFrac[3, NOC] "Mass Fraction of components in all phases"; + //Average Molecular weights + Real Mavg[3](each start = 30); + //Phase Volumetric Flow Rates + Real totVolFlow[3](each start = 30); + //Transport Properities + Real LiqDens[NOC]; + Real Liquid_Phase_Density; + Real VapDensity[NOC](unit = "kg/m^3"); + Real Vapour_Phase_Density; + Real Density_Mixture; + parameter Real Zv = 1; + //Inlet Concentration + Real Co[NOC]; + //Molar Flow rate inlet to reactor depending on reaction phase + Real Fo[NOC](each min = 0, each start = 100); + Real F[NOC](each min = 0, each start = 100); + //Reaction-Manager-Data + //Reaction-Phase + parameter Integer Phase; + Integer n "Order of the Reaction"; + Real k1[Nr] "Rate constant"; + parameter Integer Mode; + + parameter Real Tdef; + Real Reaction_Heat "Heat of Reaction"; + //Material Balance + Real No[NOC, Nr] "Number of moles-initial state"; + Real X[NOC](each min = 0, each max = 1, each start = 0.5) "Conversion of the reaction components"; + Real Volume(min = 0, start = 1) "Volume of the reactor"; + //Base-comp indicates the position of the base component in the comp-array + parameter Integer Base_comp = 1; + + extends Simulator.Files.Models.ReactionManager.Reaction_Manager(NOC = NOC, comp = comp, Nr = 1,Bc = {1},Comp = 3, Sc = {{-1}, {-1}, {1}}, DO = {{1}, {0}, {0}}, RO = {{0}, {0}, {0}}, A1 = {0.005}, E1 = {0}, A2 = {0}, E2 = {0}); + //=========================================================================================================== + //Energy-Stream-Connector + Real energy_flo "The total energy given out/taken in due to the reactions"; + Simulator.Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-80, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-172, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {74, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {172, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn en_Conn annotation( + Placement(visible = true, transformation(origin = {0, -78}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {0, -60}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + //============================================================================================================ + equation +//Connector-Equations + inlet.P = P; + inlet.T = T; + inlet.mixMolFlo = totMolFlow[1]; + inlet.mixMolEnth = Enth; + inlet.mixMolEntr = Entr; + inlet.mixMolFrac[1, :] = compMolFrac[1, :]; + inlet.vapPhasMolFrac = Vapfrac; + + outlet.P = Pout; + outlet.T = Tout; + outlet.mixMolFlo = outTotMolFlow[1]; + outlet.mixMolEnth = outEnth; + outlet.mixMolEntr = outEntr; + outlet.mixMolFrac[1, :] = outCompMolFrac[1, :]; + outlet.vapPhasMolFrac = outVapfrac; + en_Conn.enFlo = energy_flo; +//Phase Equilibria +//========================================================================================================== +//Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); + if P >= Pbubl then +//below bubble point region + compMolFrac[3, :] = zeros(NOC); + sum(compMolFrac[2, :]) = 1; + elseif P <= Pdew then +//above dew point region + compMolFrac[2, :] = zeros(NOC); + sum(compMolFrac[3, :]) = 1; + else +//VLE region + for i in 1:NOC loop + compMolFrac[3, i] = K[i] * compMolFrac[2, i]; + end for; + sum(compMolFrac[2, :]) = 1; +//sum y = 1 + end if; +//Rachford Rice Equation + for i in 1:NOC loop + compMolFrac[1, i] = compMolFrac[3, i] * Beta + compMolFrac[2, i] * (1 - Beta); + end for; +//=========================================================================================================== +//Calculation of Mass Fraction +//Average Molecular Weights of respective phases + if Beta <= 0 then + Mavg[1] = sum(compMolFrac[1, :] .* comp[:].MW); + Mavg[2] = sum(compMolFrac[2, :] .* comp[:].MW); + Mavg[3] = 0; + totMasFlow[1] = totMolFlow[1] * 1E-3 * Mavg[1]; + totMasFlow[2] = totMolFlow[2] * 1E-3 * Mavg[2]; + totMasFlow[3] = 0; + compMasFrac[1, :] = compMolFrac[1, :] .* comp[:].MW / Mavg[1]; + compMasFrac[2, :] = compMolFrac[2, :] .* comp[:].MW / Mavg[2]; + for i in 1:NOC loop + compMasFrac[3, i] = 0; + end for; +//Liquid_Phase_Density + LiqDens = Thermodynamic_Functions.Density_Racket(NOC, T, P, comp[:].Pc, comp[:].Tc, comp[:].Racketparam, comp[:].AF, comp[:].MW, Psat[:]); + Liquid_Phase_Density = 1 / sum(compMasFrac[2, :] ./ LiqDens[:]) / Mavg[2]; +//Vapour Phase Density + for i in 1:NOC loop + VapDensity[i] = 0; + end for; + Vapour_Phase_Density = 0; +//Density of Inlet-Mixture + Density_Mixture = 1 / ((1 - Beta) / Liquid_Phase_Density) * sum(compMolFrac[1, :] .* comp[:].MW); +//==================================================================================================== + elseif Beta == 1 then + Mavg[1] = sum(compMolFrac[1, :] .* comp[:].MW); + Mavg[2] = 0; + Mavg[3] = sum(compMolFrac[3, :] .* comp[:].MW); + totMasFlow[1] = totMolFlow[1] * 1E-3 * Mavg[1]; + totMasFlow[2] = 0; + totMasFlow[3] = totMolFlow[3] * 1E-3 * Mavg[3]; + compMasFrac[1, :] = compMolFrac[1, :] .* comp[:].MW / Mavg[1]; + for i in 1:NOC loop + compMasFrac[2, i] = 0; + end for; + compMasFrac[3, :] = compMolFrac[3, :] .* comp[:].MW / Mavg[3]; +//Calculation of Phase Densities +//Liquid Phase Density-Inlet Conditions + for i in 1:NOC loop + LiqDens[i] = 0; + end for; + Liquid_Phase_Density = 0; +//Vapour Phase Density + for i in 1:NOC loop + VapDensity[i] = P / (Zv * 8.314 * T) * comp[i].MW * 1E-3; + end for; + Vapour_Phase_Density = 1 / sum(compMasFrac[3, :] ./ VapDensity[:]) / Mavg[3]; +//Density of Inlet-Mixture + Density_Mixture = 1 / (Beta / Vapour_Phase_Density) * sum(compMolFrac[1, :] .* comp[:].MW); + else + Mavg[1] = sum(compMolFrac[1, :] .* comp[:].MW); + Mavg[2] = sum(compMolFrac[2, :] .* comp[:].MW); + Mavg[3] = sum(compMolFrac[3, :] .* comp[:].MW); + totMasFlow[1] = totMolFlow[1] * 1E-3 * Mavg[1]; + totMasFlow[2] = totMolFlow[2] * 1E-3 * Mavg[2]; + totMasFlow[3] = totMolFlow[3] * 1E-3 * Mavg[3]; + compMasFrac[1, :] = compMolFrac[1, :] .* comp[:].MW / Mavg[1]; + compMasFrac[2, :] = compMolFrac[2, :] .* comp[:].MW / Mavg[2]; + compMasFrac[3, :] = compMolFrac[3, :] .* comp[:].MW / Mavg[3]; +//Calculation of Phase Densities +//Liquid Phase Density-Inlet Conditions + LiqDens = Thermodynamic_Functions.Density_Racket(NOC, T, P, comp[:].Pc, comp[:].Tc, comp[:].Racketparam, comp[:].AF, comp[:].MW, Psat[:]); + Liquid_Phase_Density = 1 / sum(compMasFrac[2, :] ./ LiqDens[:]) / Mavg[2]; +//Vapour Phase Density + for i in 1:NOC loop + VapDensity[i] = P / (Zv * 8.314 * T) * comp[i].MW * 1E-3; + end for; + Vapour_Phase_Density = 1 / sum(compMasFrac[3, :] ./ VapDensity[:]) / Mavg[3]; +//Density of Inlet-Mixture + Density_Mixture = 1 / (Beta / Vapour_Phase_Density + (1 - Beta) / Liquid_Phase_Density) * sum(compMolFrac[1, :] .* comp[:].MW); + end if; +//===================================================================================================== +//Phase Flow Rates +//Phase Molar Flow Rates + totMolFlow[3] = totMolFlow[1] * Beta; + totMolFlow[2] = totMolFlow[1] * (1 - Beta); +//Component Molar Flow Rates in Phases + compMolFlow[1, :] = totMolFlow[1] .* compMolFrac[1, :]; + compMolFlow[2, :] = totMolFlow[2] .* compMolFrac[2, :]; + compMolFlow[3, :] = totMolFlow[3] .* compMolFrac[3, :]; +//====================================================================================================== +//Phase Volumetric flow rates + if Phase == 1 then + totVolFlow[1] = totMasFlow[1] / Density_Mixture; + totVolFlow[2] = totMasFlow[2] / (Liquid_Phase_Density * Mavg[2]); + totVolFlow[3] = totMasFlow[3] / (Vapour_Phase_Density * Mavg[3]); + elseif Phase == 2 then + totVolFlow[1] = totMasFlow[1] / Density_Mixture; + totVolFlow[2] = totMasFlow[2] / (Liquid_Phase_Density * Mavg[2]); + totVolFlow[3] = 0; + else + totVolFlow[1] = totMasFlow[1] / Density_Mixture; + totVolFlow[2] = 0; + totVolFlow[3] = totMasFlow[3] / (Vapour_Phase_Density * Mavg[3]); + end if; +//Mixture Phase +//============================================================================================================= +//Inlet Concentration + if Phase == 1 then + Co[:] = compMolFlow[1, :] / totVolFlow[1]; + for i in 1:NOC loop + if i == Base_comp then + Fo[i] = compMolFlow[1, i]; + F[i] = No[i, 1] * Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * Fo[Base_comp]; + else + Fo[i] = compMolFlow[1, i]; + F[i] = No[i, 1] * Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * compMolFlow[1, Base_comp]; + end if; + end for; +//Conversion of Reactants + for j in 2:NOC loop + if Sc[j, 1] < 0 then + X[j] = (compMolFlow[Phase, j] - F[j]) / compMolFlow[Phase, j]; + else + X[j] = 0; + end if; + end for; +//========================================================================================= +//Liquid-Phase + elseif Phase == 2 then + Co[:] = compMolFlow[2, :] / totVolFlow[2]; + for i in 1:NOC loop + if i == Base_comp then + Fo[i] = compMolFlow[2, i]; + F[i] = Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * Fo[Base_comp]; + else + Fo[i] = compMolFlow[1, i]; + F[i] = Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * Fo[Base_comp]; + end if; + end for; +//Conversion of Reactants + for j in 2:NOC loop + if Sc[j, 1] < 0 then + X[j] = (compMolFlow[Phase, j] - outCompMolFlow[Phase, j]) / compMolFlow[Phase, j]; + else + X[j] = 0; + end if; + end for; + else +//Vapour Phase +//====================================================================================================== + Co[:] = compMolFlow[3, :] / totVolFlow[3]; + for i in 1:NOC loop + if i == Base_comp then + Fo[i] = compMolFlow[3, i]; + F[i] = Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * Fo[Base_comp]; + else + Fo[i] = compMolFlow[1, i]; + F[i] = Fo[i] + Sc[i, 1] / Bc[1] * X[Base_comp] * Fo[Base_comp]; + end if; + end for; +//Conversion of Reactants + for j in 2:NOC loop + if Sc[j, 1] < 0 then + X[j] = (compMolFlow[Phase, j] - outCompMolFlow[Phase, j]) / compMolFlow[Phase, j]; + else + X[j] = 0; + end if; + end for; + end if; +//================================================================================================ +//Reaction Manager + n = sum(DO[:]); +//Calculation of Rate Constants + k1[:] = Simulator.Files.Models.ReactionManager.Arhenious(Nr, A1[:], E1[:], T); +//Material Balance +//Initial Number of Moles + for i in 1:Nr loop + for j in 1:NOC loop + if Sc[j, i] > 0 then + Sc[j, i] = No[j, i]; + else + Sc[j, i] = -No[j, i]; + end if; + end for; + end for; +//Calculation of volume with respect to conversion of limiting reeactant + Volume = Performance_PFR(n, Co[Base_comp], Fo[Base_comp], k1[1], X[Base_comp]); +//============================================================================================================ +//Calculation of Heat of Reaction at the reaction temperature +//Outlet temperature and energy stream +//Isothermal Mode + if Mode == 1 then + Reaction_Heat = HOR[1] * 1E-3 * Fo[Base_comp] * X[Base_comp]; + Tout = T; + energy_flo = Reaction_Heat - Enth / Mavg[1] * totMasFlow[1] + outEnth / Mavg[1] * totMasFlow[1]; +//Outlet temperature defined + elseif Mode == 2 then + Reaction_Heat = HOR[1] * 1E-3 * Fo[Base_comp] * X[Base_comp]; + Tout = Tdef; + energy_flo = Reaction_Heat - Enth / Mavg[1] * totMasFlow[1] + outEnth / Mavg[1] * totMasFlow[1]; +//Adiabatic Mode + else + Reaction_Heat = HOR[1] * 1E-3 * Fo[Base_comp] * X[Base_comp]; + energy_flo = 0; + outEnth / Moutavg[1] = Enth / Mavg[1] - Reaction_Heat; + end if; +//=========================================================================================================== +//Calculation of Outlet Pressure + Pout = P - delta_P; +//Calculation of Mole Fraction of outlet stream + outCompMolFrac[1, :] = F[:] / outTotMolFlow[1]; + sum(F[:]) = outTotMolFlow[1]; +//=========================================================================================================== +//Phase Equilibria for Outlet Stream +//Bubble point calculation + Poutbubl = sum(gammaBubl[:] .* outCompMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / Tout + comp[:].VP[4] * log(Tout) + comp[:].VP[5] .* Tout .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Poutdew = 1 / sum(outCompMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / Tout + comp[:].VP[4] * log(Tout) + comp[:].VP[5] .* Tout .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); + if Pout >= Poutbubl then +//below bubble point region + outCompMolFrac[3, :] = zeros(NOC); + sum(outCompMolFrac[2, :]) = 1; + elseif Pout <= Poutdew then +//above dew point region + outCompMolFrac[2, :] = zeros(NOC); + sum(outCompMolFrac[3, :]) = 1; + else +//VLE region + for i in 1:NOC loop + outCompMolFrac[3, i] = K[i] * outCompMolFrac[2, i]; + end for; + sum(outCompMolFrac[2, :]) = 1; +//sum y = 1 + end if; +//Rachford Rice Equation + for i in 1:NOC loop + outCompMolFrac[1, i] = outCompMolFrac[3, i] * Betaout + outCompMolFrac[2, i] * (1 - Betaout); + end for; + outTotMolFlow[3] = outTotMolFlow[1] * Betaout; + outTotMolFlow[2] = outTotMolFlow[1] * (1 - Betaout); +//=========================================================================================================== +//Calculation of Mass Fraction +//Average Molecular Weights of respective phases + if Betaout <= 0 then + Moutavg[1] = sum(outCompMolFrac[1, :] .* comp[:].MW); + Moutavg[2] = sum(outCompMolFrac[2, :] .* comp[:].MW); + Moutavg[3] = 0; +//==================================================================================================== + elseif Betaout == 1 then + Moutavg[1] = sum(outCompMolFrac[1, :] .* comp[:].MW); + Moutavg[2] = 0; + Moutavg[3] = sum(outCompMolFrac[3, :] .* comp[:].MW); + else + Moutavg[1] = sum(outCompMolFrac[1, :] .* comp[:].MW); + Moutavg[2] = sum(outCompMolFrac[2, :] .* comp[:].MW); + Moutavg[3] = sum(outCompMolFrac[3, :] .* comp[:].MW); + end if; +//===================================================================================================== +//Component Molar Flow Rates in Phases + outCompMolFlow[1, :] = outTotMolFlow[1] .* outCompMolFrac[1, :]; + outCompMolFlow[2, :] = outTotMolFlow[2] .* outCompMolFrac[2, :]; + outCompMolFlow[3, :] = outTotMolFlow[3] .* outCompMolFrac[3, :]; +//================================================================================================== + annotation(Icon(coordinateSystem(extent = {{-180, -100}, {180, 100}})), + Diagram(coordinateSystem(extent = {{-180, -100}, {180, 100}})), + __OpenModelica_commandLineOptions = ""); + end PFR; + + +//=========================================================================================================== + + function Integral + extends Modelica.Math.Nonlinear.Interfaces.partialScalarFunction; + input Integer n; + input Real Cao; + input Real Fao; + input Real k; + algorithm + y := Fao / (k * Cao ^ n) * (1 / (1 - u) ^ n); + end Integral; + //========================================================================================================= + + function Performance_PFR + + input Integer n; + input Real C; + input Real F; + input Real k; + input Real X; + + output Real V; + + algorithm + + V := Modelica.Math.Nonlinear.quadratureLobatto(function Integral(n = n, Cao = C, Fao = F, k = k), 0, X); + + end Performance_PFR; + +end PF_Reactor; diff --git a/Simulator/Simulator/Unit_Operations/PF_Reactor/package.order b/Simulator/Simulator/Unit_Operations/PF_Reactor/package.order new file mode 100644 index 0000000..e5c6ef6 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/PF_Reactor/package.order @@ -0,0 +1,3 @@ +PFR +Integral +Performance_PFR diff --git a/Simulator/Simulator/Unit_Operations/Rigorous_HX.mo b/Simulator/Simulator/Unit_Operations/Rigorous_HX.mo new file mode 100644 index 0000000..d18a263 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Rigorous_HX.mo @@ -0,0 +1,188 @@ +within Simulator.Unit_Operations; + +model Rigorous_HX + extends Simulator.Files.Icons.Heat_Exchanger; + //Heat-Exchanger Operates in various modes + //Mode-I - Estimation of Hot Fluid Outlet Temperature + // Inputs : deltap_hot,deltap_cold,Heat_Loss,coutT,Flow Direction,Name of the calculation type,Area + //Mode-II - Estimation of Cold Fluid Outlet Temperature + // Inputs : deltap_hot,deltap_cold,Heat_Loss,houtT,Flow Direction,Name of the calculation type,Area + //Mode-III - Estimation of Both the fluid outlet temperature + // Inputs : deltap_hot,deltap_cold,Heat_Loss,Qactual,Flow Direction,Name of the calculation type,Area + //Mode-IV - Estimation of both the fluid outlet temperature-NTU Method + // Inputs : deltap_hot,deltap_cold,Heat_Loss,U,Flow Direction,Name of the calculation type,Area + //Mode-V-Estimation of Heat Transfer Area + // Inputs : deltap_hot,deltap_cold,Heat_Loss,U,Flow Direction,Name of the calculation type + //Mode-VI-Estimation of all parameters given the heat transfer efficiency + // Inputs : deltap_hot,deltap_cold,Heat_Loss,U,Efficiency,Flow Direction,Name of the calculation type + import Simulator.Files.*; + import Simulator.Files.Thermodynamic_Functions.*; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + parameter Integer NOC "number of compounds "; + Simulator.Files.Connection.matConn Hot_In(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-74, 38}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn Hot_Out(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {80, 38}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn Cold_In(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-74, -28}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {2, 100}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn Cold_Out(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {76, -30}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {4, -98}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + //Parameters + //Mode-I -Outlet Temperature-Hot Stream Calculaions + parameter Real Heat_Loss; + parameter Real deltap_hot; + parameter Real deltap_cold; + parameter String Mode; + parameter String Calculation_Method; + //Variables + //Hot Stream Inlet + Real hinP, hinT, hintotMolFlow[1], hinEnth, hinEntr, hincompMolFrac[2, NOC], hinVapfrac; + //Hot Stream Outlet + Real houtP, houtT, houttotMolFlow[1], houtEnth, houtEntr, houtcompMolFrac[2, NOC], houtVapfrac; + //Cold Stream Inlet + Real cinP, cinT, cintotMolFlow[1], cinEnth, cinEntr, cincompMolFrac[2, NOC], cinVapfrac; + //Cold Stream Outlet + Real coutP, coutT, couttT, couttotMolFlow[1], coutEnth, coutEntr, coutcompMolFrac[2, NOC], coutVapfrac; + Real Qactual(start = 2000) "Actual Heat Load"; + Real Qmax, Qmax_hot, Qmax_cold; + //Hot Stream Enthalpy at Cold Stream Inlet Temperature + Real hinCompMolEnth[2, NOC]; + Real hinPhasMolEnth[3]; + //Cold Stream Enthalpy at Hot Stream Inlet Temperature + Real cinCompMolEnth[2, NOC]; + Real cinPhasMolEnth[3]; + Real deltaH; + //Heat Exchanger Effeciency + Real Efficiency; + //LMTD + Real delta_T1(start = 20), delta_T2(start = 10); + Real LMTD "Log Mean Temperature Difference"; + //Global Heat Transfer Coefficient + Real U; + //Heat Transfer Area + Real Area; + //================================================================================================================== + //Mode-4-NTU Method-when both the outlet temperatures are unknown + //Heat Capacity Rate for hot and cold fluid + Real C_cold, C_hot; + //Number of Transfer Units for Hot Side and Cold Side + Real NTU_cold, NTU_hot; + //Heat Capacity Ratio for hot and cold side + Real R_cold, R_hot; + //Effectiveness Factor + Real Eff_cold, Eff_hot; +equation +//Hot Stream Inlet + Hot_In.P = hinP; + Hot_In.T = hinT; + Hot_In.mixMolFlo = hintotMolFlow[1]; + Hot_In.mixMolEnth = hinEnth; + Hot_In.mixMolEntr = hinEntr; + Hot_In.mixMolFrac[1, :] = hincompMolFrac[1, :]; + Hot_In.mixMolFrac[2, :] = hincompMolFrac[2, :]; + Hot_In.vapPhasMolFrac = hinVapfrac; +//Hot Stream Outlet + Hot_Out.P = houtP; + Hot_Out.T = houtT; + Hot_Out.mixMolFlo = houttotMolFlow[1]; + Hot_Out.mixMolEnth = houtEnth; + Hot_Out.mixMolEntr = houtEntr; + Hot_Out.mixMolFrac[1, :] = houtcompMolFrac[1, :]; + Hot_Out.mixMolFrac[2, :] = houtcompMolFrac[2, :]; + Hot_Out.vapPhasMolFrac = houtVapfrac; +//Cold Stream In + Cold_In.P = cinP; + Cold_In.T = cinT; + Cold_In.mixMolFlo = cintotMolFlow[1]; + Cold_In.mixMolEnth = cinEnth; + Cold_In.mixMolEntr = cinEntr; + Cold_In.mixMolFrac[1, :] = cincompMolFrac[1, :]; + Cold_In.mixMolFrac[2, :] = cincompMolFrac[2, :]; + Cold_In.vapPhasMolFrac = cinVapfrac; +//Cold Stream Out + Cold_Out.P = coutP; + Cold_Out.T = couttT; + Cold_Out.mixMolFlo = couttotMolFlow[1]; + Cold_Out.mixMolEnth = coutEnth; + Cold_Out.mixMolEntr = coutEntr; + Cold_Out.mixMolFrac[1, :] = coutcompMolFrac[1, :]; + Cold_Out.mixMolFrac[2, :] = coutcompMolFrac[2, :]; + Cold_Out.vapPhasMolFrac = coutVapfrac; +equation + hintotMolFlow[1] = houttotMolFlow[1]; + cintotMolFlow[1] = couttotMolFlow[1]; + hincompMolFrac[1] = houtcompMolFrac[1]; + cincompMolFrac[1] = coutcompMolFrac[1]; + houtP = hinP - deltap_hot; + coutP = cinP - deltap_cold; + Qactual = cintotMolFlow[1] * (coutEnth - cinEnth); + deltaH = -(Qactual + Heat_Loss * 1000) / hintotMolFlow[1]; + if Calculation_Method == "BothOutletTemp(UA" then + houtEnth = hinEnth - Qactual / hintotMolFlow[1] - Heat_Loss * 1000 / hintotMolFlow[1]; + coutT = cinT + Eff_cold * (hinT - cinT); + else + coutT = couttT; + houtEnth = hinEnth + deltaH; + end if; +//========================================================================================================== +//Calculation of Hot Stream Enthalpy at Cold Stream Inlet Temperature + for i in 1:NOC loop + hinCompMolEnth[1, i] = Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, cinT); + hinCompMolEnth[2, i] = Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, cinT); + end for; + for i in 1:2 loop + hinPhasMolEnth[i] = sum(hincompMolFrac[i, :] .* hinCompMolEnth[i, :]); +/*+ inResMolEnth[2, i]*/ + end for; + hinPhasMolEnth[3] = (1 - hinVapfrac) * hinPhasMolEnth[1] + hinVapfrac * hinPhasMolEnth[2]; +//Maximum Theoritical Heat Exchange-Hot Fluid + Qmax_hot = hintotMolFlow[1] * (hinEnth - hinPhasMolEnth[3]); +//=========================================================================================================== +//Enthalpy of Cold Stream Enthalpy at Hot Fluid Inlet Temperature + for i in 1:NOC loop + cinCompMolEnth[1, i] = Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, hinT); + cinCompMolEnth[2, i] = Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, hinT); + end for; + for i in 1:2 loop + cinPhasMolEnth[i] = sum(cincompMolFrac[i, :] .* cinCompMolEnth[i, :]); +/*+ inResMolEnth[1, i]*/ + end for; + cinPhasMolEnth[3] = (1 - cinVapfrac) * cinPhasMolEnth[1] + cinVapfrac * cinPhasMolEnth[2]; +//Maximum Theoritical Heat Exchange- Cold Fluid + Qmax_cold = cintotMolFlow[1] * abs(cinEnth - cinPhasMolEnth[3]); +//Maximum Heat Exchange + Qmax = min(Qmax_hot, Qmax_cold); + Efficiency = (Qactual - Heat_Loss * 1000) / Qmax * 100; +//Log Mean Temperature Difference + if Mode == "Parallal" then + delta_T1 = hinT - cinT; + delta_T2 = houtT - coutT; + else + delta_T1 = hinT - coutT; + delta_T2 = houtT - cinT; + end if; + if delta_T1 <= 0 or delta_T2 <= 0 then + LMTD = 1; + else + LMTD = (delta_T1 - delta_T2) / log(delta_T1 / delta_T2); + end if; + U = Qactual / (Area * LMTD); +//=========================================================================================================== +//========================================================================================================== +//NTU-Method + C_cold = cintotMolFlow[1] * ((coutEnth - cinEnth) / (coutT - cinT)); + C_hot = hintotMolFlow[1] * ((houtEnth - hinEnth) / (houtT - hinT)); +//Number of Transfer Units + NTU_cold = U * Area / C_cold; + NTU_hot = U * Area / C_hot; +//Heat Capacity Ratio for Hot and Cold Side + R_cold = C_cold / C_hot; + R_hot = C_hot / C_cold; + if Mode == "Parallal" then + Eff_cold = (1 - exp(-NTU_cold * (1 + R_cold))) / (1 + R_cold); + Eff_hot = (1 - exp(-NTU_hot * (1 + R_hot))) / (1 + R_hot); + else + Eff_cold = (1 - exp((R_cold - 1) * NTU_cold)) / (1 - R_cold * exp((R_cold - 1) * NTU_cold)); + Eff_hot = (1 - exp((R_hot - 1) * NTU_hot)) / (1 - R_hot * exp((R_hot - 1) * NTU_hot)); + end if; +end Rigorous_HX; diff --git a/Simulator/Simulator/Unit_Operations/Shortcut_Column.mo b/Simulator/Simulator/Unit_Operations/Shortcut_Column.mo new file mode 100644 index 0000000..f0be4e0 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Shortcut_Column.mo @@ -0,0 +1,135 @@ +within Simulator.Unit_Operations; + +model Shortcut_Column + extends Simulator.Files.Icons.Distillation_Column; + import data = Simulator.Files.Chemsep_Database; + parameter data.General_Properties comp[NOC]; + parameter Integer NOC; + Real mixMolFlo[3](each min = 0, each start = 100), mixMolFrac[3, NOC](each start = 1 / (NOC + 1), each min = 0, each max = 1), mixMolEnth[3], mixMolEntr[3]; + Real minN(min = 0, start = 10), minR(start = 1); + Real alpha[NOC], theta; + Real P(min = 0, start = 101325), T(min = 0, start = 273.15); + Real condT(start = max(comp[:].Tb), min = 0), condP(min = 0, start = 101325), rebP(min = 0, start = 101325), rebT(start = min(comp[:].Tb), min = 0); + parameter Integer HKey, LKey; + parameter String condType = "Total"; + Real vapPhasMolFrac[3](each min = 0, each max = 1, each start = 0.5), condLiqMixMolEnth, condVapMixMolEnth, condVapCompMolEnth[NOC], condLiqCompMolEnth[NOC], condLiqMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), condVapMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)); + Real compMolFrac[3, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)), Pdew(min = 0, start = sum(comp[:].Pc) / NOC), Pbubl(min = 0, start = sum(comp[:].Pc) / NOC); + Real actR, actN, x, y, feedN; + Real rectLiq(min = 0, start = 100), rectVap(min = 0, start = 100), stripLiq(min = 0, start = 100), stripVap(min = 0, start = 100), rebDuty, condDuty; + Simulator.Files.Connection.matConn feed(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-292, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn distillate(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 50}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {340, 610}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn bottoms(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, -50}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {340, -622}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn condenser_duty annotation( + Placement(visible = true, transformation(origin = {50, 100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {294, 946}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.enConn reboiler_duty annotation( + Placement(visible = true, transformation(origin = {50, -100}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {320, -950}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +// Connector equations + feed.P = P; + feed.T = T; + feed.mixMolFlo = mixMolFlo[1]; + feed.mixMolFrac[1, :] = mixMolFrac[1, :]; + feed.mixMolEnth = mixMolEnth[1]; + feed.mixMolEntr = mixMolEntr[1]; + feed.vapPhasMolFrac = vapPhasMolFrac[1]; + bottoms.P = rebP; + bottoms.T = rebT; + bottoms.mixMolFlo = mixMolFlo[2]; + bottoms.mixMolFrac[1, :] = mixMolFrac[2, :]; + bottoms.mixMolEnth = mixMolEnth[2]; + bottoms.mixMolEntr = mixMolEntr[2]; + bottoms.vapPhasMolFrac = vapPhasMolFrac[2]; + distillate.P = condP; + distillate.T = condT; + distillate.mixMolFlo = mixMolFlo[3]; + distillate.mixMolFrac[1, :] = mixMolFrac[3, :]; + distillate.mixMolEnth = mixMolEnth[3]; + distillate.mixMolEntr = mixMolEntr[3]; + distillate.vapPhasMolFrac = vapPhasMolFrac[3]; + reboiler_duty.enFlo = rebDuty; + condenser_duty.enFlo = condDuty; +//adjustment for thermodynamic packages + compMolFrac[1, :] = mixMolFrac[1, :]; + compMolFrac[2, :] = compMolFrac[1, :] ./ (1 .+ vapPhasMolFrac[1] .* (K[:] .- 1)); + for i in 1:NOC loop + compMolFrac[3, i] = K[i] * compMolFrac[2, i]; + end for; +// sum(compMolFrac[1,:] .* (K[:] .- 1) ./ (1 .+ vapPhasMolFrac[1] .* (K[:] .- 1))) = 0; +//Bubble point calculation + Pbubl = sum(gammaBubl[:] .* compMolFrac[1, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6]) ./ liqfugcoeff_bubl[:]); +//Dew point calculation + Pdew = 1 / sum(compMolFrac[1, :] ./ (gammaDew[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / T + comp[:].VP[4] * log(T) + comp[:].VP[5] .* T .^ comp[:].VP[6])) .* vapfugcoeff_dew[:]); +equation + for i in 1:NOC loop + if mixMolFrac[1, i] == 0 then + mixMolFrac[3, i] = 0; + else + mixMolFlo[1] .* mixMolFrac[1, i] = mixMolFlo[2] .* mixMolFrac[2, i] + mixMolFlo[3] .* mixMolFrac[3, i]; + end if; + end for; + sum(mixMolFrac[3, :]) = 1; + sum(mixMolFrac[2, :]) = 1; + for i in 1:NOC loop + if i <> HKey then + if condType == "Total" then + mixMolFrac[3, i] / mixMolFrac[3, HKey] = alpha[i] ^ minN * (mixMolFrac[2, i] / mixMolFrac[2, HKey]); + elseif condType == "Partial" then + mixMolFrac[3, i] / mixMolFrac[3, HKey] = alpha[i] ^ (minN + 1) * (mixMolFrac[2, i] / mixMolFrac[2, HKey]); + end if; + end if; + end for; + alpha[:] = K[:] / K[HKey]; +//Calculation of temperature at distillate and bottoms + if condType == "Partial" then + 1 / condP = sum(mixMolFrac[3, :] ./ (gamma[:] .* exp(comp[:].VP[2] + comp[:].VP[3] / condT + comp[:].VP[4] * log(condT) + comp[:].VP[5] .* condT .^ comp[:].VP[6]))); + rebP = sum(gamma[:] .* mixMolFrac[2, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / rebT + comp[:].VP[4] * log(rebT) + comp[:].VP[5] .* rebT .^ comp[:].VP[6])); + elseif condType == "Total" then + condP = sum(gamma[:] .* mixMolFrac[3, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / condT + comp[:].VP[4] * log(condT) + comp[:].VP[5] .* condT .^ comp[:].VP[6])); + rebP = sum(gamma[:] .* mixMolFrac[2, :] .* exp(comp[:].VP[2] + comp[:].VP[3] / rebT + comp[:].VP[4] * log(rebT) + comp[:].VP[5] .* rebT .^ comp[:].VP[6])); + end if; +//Minimum Reflux, Underwoods method +// 1 - q = vapPhasMolFrac[1]; +// 1 - q = sum(alpha[:] .* mixMolFrac[1, :] ./ (alpha[:] .- theta)); + vapPhasMolFrac[1] = sum(alpha[:] .* mixMolFrac[1, :] ./ (alpha[:] .- theta)); + minR + 1 = sum(alpha[:] .* mixMolFrac[3, :] ./ (alpha[:] .- theta)); +//Actual number of trays,Gillilands method + x = (actR - minR) / (actR + 1); + y = (actN - minN) / (actN + 1); + if x >= 0 then + y = 0.75 * (1 - x ^ 0.5668); + else + y = -1; + end if; +// Feed location, Fenske equation + feedN = actN / minN * log(mixMolFrac[1, LKey] / mixMolFrac[1, HKey] * (mixMolFrac[2, HKey] / mixMolFrac[2, LKey])) / log(K[LKey] / K[HKey]); +//rectifying and stripping flows + rectLiq = actR * mixMolFlo[3]; + stripLiq = (1 - vapPhasMolFrac[1]) * mixMolFlo[1] + rectLiq; + stripVap = stripLiq - mixMolFlo[2]; + rectVap = vapPhasMolFrac[1] * mixMolFlo[1] + stripVap; + for i in 1:NOC loop + condVapCompMolEnth[i] = Simulator.Files.Thermodynamic_Functions.HVapId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, condT); + condLiqCompMolEnth[i] = Simulator.Files.Thermodynamic_Functions.HLiqId(comp[i].SH, comp[i].VapCp, comp[i].HOV, comp[i].Tc, condT); + end for; + if condType == "Total" then + condLiqMixMolEnth = mixMolEnth[3]; + elseif condType == "Partial" then + condLiqMixMolEnth = sum(condLiqMolFrac[:] .* condLiqCompMolEnth[:]); + end if; + condVapMixMolEnth = sum(condVapMolFrac[:] .* condVapCompMolEnth[:]); + rectVap .* condVapMolFrac[:] = rectLiq .* condLiqMolFrac[:] + mixMolFlo[3] .* mixMolFrac[3, :]; + if condType == "Partial" then + mixMolFrac[3, :] = K[:] .* condLiqMolFrac[:]; + elseif condType == "Total" then + mixMolFrac[3, :] = condLiqMolFrac[:]; + end if; +//Energy Balance + mixMolFlo[1] * mixMolEnth[1] + rebDuty - condDuty = mixMolFlo[2] * mixMolEnth[2] + mixMolFlo[3] * mixMolEnth[3]; + rectVap * condVapMixMolEnth = condDuty + mixMolFlo[3] * mixMolEnth[3] + rectLiq * condLiqMixMolEnth; +annotation( + Icon(coordinateSystem(extent = {{-350, -1000}, {350, 1000}})), + Diagram(coordinateSystem(extent = {{-350, -1000}, {350, 1000}})), + __OpenModelica_commandLineOptions = "");end Shortcut_Column; diff --git a/Simulator/Simulator/Unit_Operations/Splitter.mo b/Simulator/Simulator/Unit_Operations/Splitter.mo new file mode 100644 index 0000000..8fb3a89 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Splitter.mo @@ -0,0 +1,47 @@ +within Simulator.Unit_Operations; + +model Splitter + extends Simulator.Files.Icons.Splitter; + parameter Integer NOC = 2 "number of Components", NO = 2 "number of outputs"; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + Real inP(min = 0, start = 101325) "inlet pressure", inT(min = 0, start = 273.15) "Inlet Temperature", outP[NO](each min = 0, each start = 101325) "Outlet Pressure", outT[NO](each min = 0, each start = 273.15) "Outlet Temperature", inMixMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "inlet Mixture Mole Fraction", outMixMolFrac[NO, NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "Outlet Mixture Molar Fraction", splRat[NO](each min = 0, each max = 1) "Split ratio", MW(each min = 0) "Stream molecular weight", inMixMolFlo(min = 0, start = 100) "inlet Mixture Molar Flow", outMixMolFlo[NO](each min = 0, each start = 100) "Outlet Mixture Molar Flow", outMixMasFlo[NO](each min = 0, each start = 100) "Outlet Mixture Mass Flow", specVal[NO] "Specification value"; + parameter String calcType "Split_Ratio, Mass_Flow or Molar_Flow"; + // Simulator.Files.Connection.matConn outlet[NO](each connNOC = NOC); + Simulator.Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Simulator.Files.Connection.matConn outlet[NO](each connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {102, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); +equation +//Connector equations + inlet.P = inP; + inlet.T = inT; + inlet.mixMolFrac[1, :] = inMixMolFrac[:]; + inlet.mixMolFlo = inMixMolFlo; + for i in 1:NO loop + outlet[i].P = outP[i]; + outlet[i].T = outT[i]; + outlet[i].mixMolFrac[1, :] = outMixMolFrac[i, :]; + outlet[i].mixMolFlo = outMixMolFlo[i]; + end for; +//specification value assigning equation + if calcType == "Split_Ratio" then + splRat[:] = specVal[:]; + elseif calcType == "Molar_Flow" then + outMixMolFlo[:] = specVal[:]; + elseif calcType == "Mass_Flow" then + outMixMasFlo[:] = specVal[:]; + end if; +//balance equation + for i in 1:NO loop + inP = outP[i]; + inT = outT[i]; + inMixMolFrac[:] = outMixMolFrac[i, :]; + splRat[i] = outMixMolFlo[i] / inMixMolFlo; + MW * outMixMolFlo[i] = outMixMasFlo[i]; + end for; +algorithm + MW := 0; + for i in 1:NOC loop + MW := MW + comp[i].MW * inMixMolFrac[i]; + end for; +end Splitter; diff --git a/Simulator/Simulator/Unit_Operations/Valve.mo b/Simulator/Simulator/Unit_Operations/Valve.mo new file mode 100644 index 0000000..dac2056 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/Valve.mo @@ -0,0 +1,44 @@ +within Simulator.Unit_Operations; + +model Valve + extends Simulator.Files.Icons.Valve; + // This is generic valve model. For using this model we need to extend this model and incorporte ouput material stream since this model is not doing any flash calculations. Refer valve model in Test section for this. + //==================================================================================== + Real inMolFlo(min = 0, start = 100) "inlet mixture molar flow rate", outMolFlo(min = 0, start = 100) "outlet mixture molar flow rate", inP(min = 0, start = 101325) "Inlet pressure", outP(min = 0, start = 101325) "Outlet pressure", pressDrop "Pressure drop", inT(min = 0, start = 273.15) "Inlet Temperature", outT(min = 0, start = 273.15) "Outlet Temperature", tempInc "Temperature Increase"; + Real inMixMolEnth "inlet mixture molar enthalpy", outMixMolEnth "outlet mixture molar enthalpy"; + Real inMixMolEntr "inlet mixture molar entropy", outMixMolEntr "outlet mixture molar entropy", mixMolFrac[NOC](each min = 0, each max = 1, each start = 1 / (NOC + 1)) "mixture mole fraction", inVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Inlet vapor phase mole fraction", outVapPhasMolFrac(min = 0, max = 1, start = 0.5) "Outlet vapor phase mole fraction"; + //======================================================================================== + parameter Integer NOC = 3 "number of components"; + parameter Simulator.Files.Chemsep_Database.General_Properties comp[NOC]; + //======================================================================================== + Files.Connection.matConn inlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {-100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + Files.Connection.matConn outlet(connNOC = NOC) annotation( + Placement(visible = true, transformation(origin = {100, 0}, extent = {{-10, -10}, {10, 10}}, rotation = 0), iconTransformation(origin = {100, -2}, extent = {{-10, -10}, {10, 10}}, rotation = 0))); + //======================================================================================== +equation +//connector equations + inlet.P = inP; + inlet.T = inT; + inlet.mixMolFlo = inMolFlo; + inlet.mixMolEnth = inMixMolEnth; + inlet.mixMolEntr = inMixMolEntr; + inlet.mixMolFrac[1, :] = mixMolFrac[:]; + inlet.vapPhasMolFrac = inVapPhasMolFrac; + outlet.P = outP; + outlet.T = outT; + outlet.mixMolFlo = outMolFlo; + outlet.mixMolEnth = outMixMolEnth; + outlet.mixMolEntr = outMixMolEntr; + outlet.mixMolFrac[1, :] = mixMolFrac[:]; + outlet.vapPhasMolFrac = outVapPhasMolFrac; +//============================================================================================= + inMolFlo = outMolFlo; +//material balance + inMixMolEnth = outMixMolEnth; +//energy balance + inP - pressDrop = outP; +//pressure calculation + inT + tempInc = outT; +//temperature calculation +end Valve; diff --git a/Simulator/Simulator/Unit_Operations/package.mo b/Simulator/Simulator/Unit_Operations/package.mo new file mode 100644 index 0000000..d27719b --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/package.mo @@ -0,0 +1,4 @@ +within Simulator; +package Unit_Operations + +end Unit_Operations; diff --git a/Simulator/Simulator/Unit_Operations/package.order b/Simulator/Simulator/Unit_Operations/package.order new file mode 100644 index 0000000..9b18f10 --- /dev/null +++ b/Simulator/Simulator/Unit_Operations/package.order @@ -0,0 +1,16 @@ +Mixer +Heater +Rigorous_HX +Cooler +Valve +Shortcut_Column +Compound_Separator +Flash +Splitter +Centrifugal_Pump +Adiabatic_Compressor +Adiabatic_Expander +Conversion_Reactor +PF_Reactor +Distillation_Column +Absorption_Column diff --git a/Simulator/Simulator/package.mo b/Simulator/Simulator/package.mo new file mode 100644 index 0000000..8e6e1da --- /dev/null +++ b/Simulator/Simulator/package.mo @@ -0,0 +1,19 @@ +package Simulator + /* This aims to be steady state chemical engineering process simulator. Currently this contains Chemsep Database(contains more than 400 compounds), thermodynamic packages, Various themodynamic functions , Material stream(generic flash unit) and some generic unit operations and some Tests of these models*/ + /* Chemsep Database is created by "Rahul Jain" and modified by "Pravin Dalve"*/ + extends Modelica.Icons.Package; + import SI = Modelica.SIunits; + import Cv = Modelica.SIunits.Conversions; + + + + + + + + + + + annotation( + uses(Modelica(version = "3.2.3"))); +end Simulator; diff --git a/Simulator/Simulator/package.order b/Simulator/Simulator/package.order new file mode 100644 index 0000000..5c92677 --- /dev/null +++ b/Simulator/Simulator/package.order @@ -0,0 +1,5 @@ +Files +Streams +Unit_Operations +Test +Binary_Phase_Envelope diff --git a/ToDoList.txt b/ToDoList.txt new file mode 100644 index 0000000..d5ea56d --- /dev/null +++ b/ToDoList.txt @@ -0,0 +1,20 @@ +Components with Energy Streams + +1. Heater +2. Cooler +3. CompSep +4. Pump +5. Adiabatic Compressor +6. Adiabatic Expander +7. Shortcut Column (x2) +8. Distillation Column (x2) +9. PFR +10. Conversion Reactor + +Components having Thermo_Packages + +1. Adiabatic Compressor +2. material stream +3. Shortcut Column +4. Adiabatic Expander +5. flash
\ No newline at end of file diff --git a/__pycache__/component_selector.cpython-36.pyc b/__pycache__/component_selector.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..480090e --- /dev/null +++ b/__pycache__/component_selector.cpython-36.pyc diff --git a/__pycache__/container.cpython-36.pyc b/__pycache__/container.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..4ac389d --- /dev/null +++ b/__pycache__/container.cpython-36.pyc diff --git a/__pycache__/dockWidget.cpython-36.pyc b/__pycache__/dockWidget.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..f34d38b --- /dev/null +++ b/__pycache__/dockWidget.cpython-36.pyc diff --git a/__pycache__/helper.cpython-36.pyc b/__pycache__/helper.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..c003404 --- /dev/null +++ b/__pycache__/helper.cpython-36.pyc diff --git a/__pycache__/resDockWidget.cpython-36.pyc b/__pycache__/resDockWidget.cpython-36.pyc Binary files differnew file mode 100644 index 0000000..10f2152 --- /dev/null +++ b/__pycache__/resDockWidget.cpython-36.pyc diff --git a/comp_selector.ui b/comp_selector.ui new file mode 100644 index 0000000..e0bf0b8 --- /dev/null +++ b/comp_selector.ui @@ -0,0 +1,133 @@ +<?xml version="1.0" encoding="UTF-8"?> +<ui version="4.0"> + <class>Dialog</class> + <widget class="QDialog" name="Dialog"> + <property name="geometry"> + <rect> + <x>0</x> + <y>0</y> + <width>461</width> + <height>289</height> + </rect> + </property> + <property name="windowTitle"> + <string>Compound Selector</string> + </property> + <widget class="QWidget" name="verticalLayoutWidget"> + <property name="geometry"> + <rect> + <x>10</x> + <y>20</y> + <width>441</width> + <height>256</height> + </rect> + </property> + <layout class="QVBoxLayout" name="verticalLayout"> + <item> + <widget class="QLabel" name="label"> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>12</pointsize> + </font> + </property> + <property name="text"> + <string>Search For Compounds :</string> + </property> + </widget> + </item> + <item> + <layout class="QHBoxLayout" name="horizontalLayout_2"> + <item> + <widget class="QLineEdit" name="lineEdit"/> + </item> + <item> + <widget class="QPushButton" name="compoundSelectButton"> + <property name="font"> + <font> + <family>Comic Sans MS</family> + </font> + </property> + <property name="text"> + <string>Select</string> + </property> + <property name="default"> + <bool>true</bool> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_3"> + <property name="font"> + <font> + <family>Comic Sans MS</family> + </font> + </property> + <property name="text"> + <string>Remove</string> + </property> + <property name="autoDefault"> + <bool>false</bool> + </property> + </widget> + </item> + </layout> + </item> + <item> + <widget class="QTableWidget" name="tableWidget"> + <column> + <property name="text"> + <string>CAS Number</string> + </property> + </column> + <column> + <property name="text"> + <string>Name</string> + </property> + </column> + <column> + <property name="text"> + <string>Molecular Formula</string> + </property> + </column> + <column> + <property name="text"> + <string>Molecular Weight</string> + </property> + </column> + </widget> + </item> + <item> + <layout class="QHBoxLayout" name="horizontalLayout_4"> + <item> + <widget class="QPushButton" name="pushButton"> + <property name="font"> + <font> + <family>Comic Sans MS</family> + </font> + </property> + <property name="text"> + <string>Submit</string> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_2"> + <property name="font"> + <font> + <family>Comic Sans MS</family> + </font> + </property> + <property name="text"> + <string>Cancel</string> + </property> + </widget> + </item> + </layout> + </item> + </layout> + </widget> + </widget> + <resources/> + <connections/> +</ui> diff --git a/component_selector.py b/component_selector.py new file mode 100644 index 0000000..3be0f0f --- /dev/null +++ b/component_selector.py @@ -0,0 +1,92 @@ +from PyQt5.QtCore import * +from PyQt5.QtWidgets import * +from PyQt5.QtGui import * +from PyQt5.uic import loadUiType +import pandas as pd +ui_dialog,_ = loadUiType('comp_selector.ui') + + +df = pd.read_csv("compoundsDatabase.csv") +compound_selected = [] +class componentSelector(QDialog,ui_dialog): + def __init__(self,parent=None): + #super(componentSelector,self).__init__(parent) + QDialog.__init__(self,parent) + self.setupUi(self) + + self.lines = [line.rstrip('\n') for line in open('compounds.txt')] + model = QStringListModel() + model.setStringList(self.lines) + + completer = QCompleter() + completer.setCaseSensitivity(Qt.CaseInsensitive) + completer.setModel(model) + + self.lineEdit.setCompleter(completer) + + self.compoundSelectButton.clicked.connect(self.compoundSelection) + self.compoundSelectButton.setAutoDefault(False) + self.pushButton.clicked.connect(self.accept) + self.pushButton_2.clicked.connect(self.cancel) + self.pushButton_3.clicked.connect(self.removeItems) + + def isCompSelected(self): + if not compound_selected: + return False + else: + return True + + def compoundSelection(self): + comp = self.lineEdit.text() + if comp in self.lines: + + compound_selected.append(comp) + self.lineEdit.clear() + print(compound_selected) + #self.addCompToList(comp) + a = df.loc[df['Name'] == comp] + print(a) + self.addToTable(a) + #print(compound_selected) + ''' + except Exception as e: + exc_type, exc_obj, exc_tb = sys.exc_info() + fname = os.path.split(exc_tb.tb_frame.f_code.co_filename)[1] + print(exc_type, fname, exc_tb.tb_lineno) + ''' + else: + self.Show_Error() + + def addToTable(self,a): + try: + rowPosition = self.tableWidget.rowCount() + self.tableWidget.insertRow(rowPosition) + self.tableWidget.setItem(rowPosition , 0, QTableWidgetItem(str(a.iloc[0][0]))) + self.tableWidget.setItem(rowPosition , 1, QTableWidgetItem(str(a.iloc[0][1]))) + self.tableWidget.setItem(rowPosition , 2, QTableWidgetItem(str(a.iloc[0][2]))) + self.tableWidget.setItem(rowPosition , 3, QTableWidgetItem(str(a.iloc[0][3]))) + except Exception as e: + exc_type, exc_obj, exc_tb = sys.exc_info() + fname = os.path.split(exc_tb.tb_frame.f_code.co_filename)[1] + print(exc_type, fname, exc_tb.tb_lineno) + + def addCompToList(self,comp): + self.item = QListWidgetItem() + self.item.setText(comp) + self.listWidget.addItem(self.item) + + def removeItems(self): + item = self.tableWidget.item(self.tableWidget.currentRow(),1).text() + self.tableWidget.removeRow(self.tableWidget.currentRow()) + + compound_selected.remove(item) + def Show_Error(self): + QMessageBox.about(self, 'Important', "Selected Compound is not Available") + def cancel(self): + compound_selected.clear() + self.tableWidget.setRowCount(0) + self.reject() + + + + diff --git a/compounds.txt b/compounds.txt new file mode 100644 index 0000000..558419e --- /dev/null +++ b/compounds.txt @@ -0,0 +1,431 @@ +Air +Argon +Bromine +Carbon tetrachloride +Carbon monoxide +Carbon dioxide +Carbon disulfide +Phosgene +Trichloroacetyl chloride +Hydrogen chloride +Chlorine +Hydrogen iodide +Hydrogen +Water +Hydrogen sulfide +Ammonia +Neon +Nitric acid +Nitric oxide +Nitrogen dioxide +Nitrogen +Nitrous oxide +Oxygen +Sulfur dioxide +Sulfur trioxide +Chloroform +Hydrogen cyanide +Formaldehyde +Methyl chloride +Methyl iodide +Methane +Methanol +Methylamine +Trichloroethylene +Dichloroacetyl chloride +Trichloroacetaldehyde +Acetylene +Dichloroacetaldehyde +Vinyl chloride +Acetyl chloride +1,1,2-trichloroethane +Acetonitrile +Ethylene +1,1-dichloroethane +1,2-dichloroethane +Acetaldehyde +Ethylene oxide +Acetic acid +Methyl formate +Ethyl chloride +Ethane +Ethanol +Dimethyl ether +Ethylene glycol +Dimethyl sulfide +Ethyl mercaptan +Ethylamine +Acrylonitrile +Methylacetylene +Propadiene +Propylene +Acetone +Ethyl formate +Methyl acetate +Propionic acid +N,n-dimethylformamide +Propane +Isopropanol +1-propanol +Trimethylamine +Vinylacetylene +Thiophene +Methacrylonitrile +Dimethylacetylene +Ethylacetylene +1,2-butadiene +1,3-butadiene +1-butene +Cis-2-butene +Trans-2-butene +Isobutene +2-methylpropanal +Methyl ethyl ketone +Tetrahydrofuran +1,4-dioxane +N-butyric acid +Ethyl acetate +Methyl propionate +N-propyl formate +Sulfolane +N,n-dimethylacetamide +N-butane +Isobutane +1-butanol +2-methyl-1-propanol +2-butanol +2-methyl-2-propanol +Diethyl ether +Diethylene glycol +Diethylamine +Furfural +Pyridine +Isoprene +Cyclopentane +2-methyl-1-butene +3-methyl-1-butene +2-methyl-2-butene +1-pentene +Cis-2-pentene +Trans-2-pentene +3-pentanone +Methyl isopropyl ketone +N-propyl acetate +Isopentane +N-pentane +Neopentane +1,2,4-trichlorobenzene +M-dichlorobenzene +O-dichlorobenzene +P-dichlorobenzene +Bromobenzene +Monochlorobenzene +Iodobenzene +Nitrobenzene +Benzene +Phenol +Aniline +Cyclohexanone +Cyclohexane +1-hexene +Methylcyclopentane +Cyclohexanol +2,2-dimethylbutane +2,3-dimethylbutane +N-hexane +2-methylpentane +3-methylpentane +Triethylene glycol +Triethylamine +Toluene +M-cresol +O-cresol +P-cresol +Methylcyclohexane +Ethylcyclopentane +1-heptene +N-heptane +Styrene +Ethylbenzene +M-xylene +O-xylene +P-xylene +Ethylcyclohexane +N-propylcyclopentane +N-octane +2,2,3-trimethylpentane +2,2,4-trimethylpentane +2,3,3-trimethylpentane +2,3,4-trimethylpentane +Tetraethylene glycol +Indene +Indane +Cumene +N-propylbenzene +N-propylcyclohexane +N-nonane +Naphthalene +1-methylindene +2-methylindene +Dicyclopentadiene +N-butylbenzene +N-butylcyclohexane +N-decane +1-methylnaphthalene +2-methylnaphthalene +N-undecane +Acenaphthene +Biphenyl +N-dodecane +Fluorene +N-tridecane +Phenanthrene +N-tetradecane +N-pentadecane +Fluoranthene +Pyrene +1-phenylnaphthalene +N-hexadecane +Chrysene +Cis-decahydronaphthalene +Trans-decahydronaphthalene +Methyl tert-butyl ether +Methyl tert-pentyl ether +2-methyl-2-butanol +Nitrogen trioxide +Nitrogen tetroxide +Helium-4 +Fluorine +Krypton +Xenon +Ozone +Carbonyl sulfide +Sulfur hexafluoride +Dimethyl sulfoxide +N-heptadecane +N-octadecane +N-nonadecane +N-heneicosane +N-docosane +N-tricosane +N-tetracosane +N-pentacosane +N-hexacosane +N-heptacosane +N-octacosane +N-nonacosane +Squalane +2-methylhexane +3-methylhexane +3-ethylpentane +2,2-dimethylpentane +2,3-dimethylpentane +2,4-dimethylpentane +3,3-dimethylpentane +2,2,3-trimethylbutane +2-methylheptane +3-methylheptane +4-methylheptane +3-ethylhexane +2,2-dimethylhexane +2,3-dimethylhexane +2,4-dimethylhexane +2,5-dimethylhexane +3,3-dimethylhexane +3,4-dimethylhexane +2-methyl-3-ethylpentane +3-methyl-3-ethylpentane +2,2,3,3-tetramethylbutane +2,2,5-trimethylhexane +2,4,4-trimethylhexane +3,3-diethylpentane +2,2,3,3-tetramethylpentane +2,2,3,4-tetramethylpentane +2,2,4,4-tetramethylpentane +2,3,3,4-tetramethylpentane +2-methyloctane +3-methyloctane +4-methyloctane +3-ethylheptane +2,2-dimethylheptane +3,3,5-trimethylheptane +2,2-dimethyloctane +3-methylnonane +2-methylnonane +4-methylnonane +5-methylnonane +Cis-2-hexene +Trans-2-hexene +1-octene +1-nonene +1-undecene +2-methyl-1-pentene +4-methyl-cis-2-pentene +4-methyl-trans-2-pentene +Cyclohexene +1,1-dimethylcyclopentane +Cis-1,2-dimethylcyclopentane +Trans-1,2-dimethylcyclopentane +Cis-1,3-dimethylcyclopentane +Trans-1,3-dimethylcyclopentane +Isopropylcyclopentane +1-methyl-1-ethylcyclopentane +N-butylcyclopentane +1,1-dimethylcyclohexane +Cis-1,2-dimethylcyclohexane +Trans-1,2-dimethylcyclohexane +Cis-1,3-dimethylcyclohexane +Trans-1,3-dimethylcyclohexane +Cis-1,4-dimethylcyclohexane +Trans-1,4-dimethylcyclohexane +Tert-butylcyclohexane +O-ethyltoluene +M-ethyltoluene +P-ethyltoluene +1,2,3-trimethylbenzene +1,2,4-trimethylbenzene +Mesitylene +Isobutylbenzene +Sec-butylbenzene +Tert-butylbenzene +O-cymene +M-cymene +P-cymene +O-diethylbenzene +M-diethylbenzene +P-diethylbenzene +1,2,3,4-tetramethylbenzene +1,2,3,5-tetramethylbenzene +1,2,4,5-tetramethylbenzene +2-ethyl-m-xylene +2-ethyl-p-xylene +4-ethyl-m-xylene +4-ethyl-o-xylene +1-methyl-3-n-propylbenzene +1-methyl-4-n-propylbenzene +P-diisopropylbenzene +Methyl isobutyl ketone +3-heptanone +4-heptanone +3-hexanone +2-pentanone +2-hexanone +2-heptanone +5-methyl-2-hexanone +3,3-dimethyl-2-butanone +Diisobutyl ketone +Diisopropyl ketone +Propanal +Butanal +Pentanal +Hexanal +Heptanal +Diisopropyl ether +Di-n-butyl ether +Di-sec-butyl ether +Methyl ethyl ether +Methyl n-propyl ether +Isopropyl butyl ether +Methyl isobutyl ether +Methyl isopropyl ether +Tert-butyl ethyl ether +Ethyl tert-pentyl ether +Butyl vinyl ether +Anisole +Isopropyl acetate +N-butyl acetate +Isobutyl acetate +N-pentyl acetate +Vinyl acetate +N-hexyl acetate +1-pentanol +2-pentanol +2-methyl-1-butanol +2,2-dimethyl-1-propanol +1-hexanol +1-heptanol +1,4-butanediol +Methyl mercaptan +N-propyl mercaptan +Tert-butyl mercaptan +Isobutyl mercaptan +Sec-butyl mercaptan +N-hexyl mercaptan +Methyl ethyl sulfide +Methyl n-propyl sulfide +Methyl t-butyl sulfide +Methyl t-pentyl sulfide +Di-n-propyl sulfide +Diethyl sulfide +Diethyl disulfide +Dimethyl disulfide +Di-n-propyl disulfide +Di-tert-butyl disulfide +Ethyl methyl disulfide +Ethyl propyl disulfide +Diphenyl disulfide +Monoethanolamine +Diethanolamine +Triethanolamine +Ethylenediamine +Diisopropylamine +N-aminoethyl piperazine +Diethylenetriamine +N-aminoethyl ethanolamine +P-phenylenediamine +Piperazine +Methylethanolamine +Dimethylethanolamine +Nitromethane +Nitroethane +1-nitropropane +2-nitropropane +1-nitrobutane +O-nitrotoluene +P-nitrotoluene +M-nitrotoluene +2,4-dinitrotoluene +2,6-dinitrotoluene +3,4-dinitrotoluene +2,5-dinitrotoluene +3,5-dinitrotoluene +2,4,6-trinitrotoluene +Oxalic acid +Acrylic acid +Methacrylic acid +Benzoic acid +O-toluic acid +P-toluic acid +Salicylic acid +Adipic acid +Phthalic acid +Maleic acid +Terephthalic acid +Acetic anhydride +Maleic anhydride +Ketene +Methyl methacrylate +Dimethyl terephthalate +1,2-propylene oxide +Cumene hydroperoxide +Propionitrile +Dimethyl carbonate +DiEthyl Carbonate +Methyl Ethyl Carbonate +Methyl Phenyl Carbonate +Ethyl Phenyl Carbonate +DiPhenyl Carbonate +Ethylene carbonate +Propylene carbonate +2-methyl-1-heptene +2-Methoxy-2-Methyl-Heptane +2-Methyl-2-Heptanol +Methylal +Methyl DiEthanolAmine +Diethylethanolamine +Diisopropanolamine +Cyclobutane +Isopropyl mercaptan +Glycerol +N-eicosane +DiButyl Carbonate diff --git a/compoundsDatabase.csv b/compoundsDatabase.csv new file mode 100644 index 0000000..2c98f74 --- /dev/null +++ b/compoundsDatabase.csv @@ -0,0 +1,432 @@ +CAS,Name,Molecular Formulae,Molecular Weight +132259-10-0,Air,(N2)0.781 (O2)0.209 (Ar)0.01,28.96 +7440-37-1,Argon,Ar,39.948 +7726-95-6,Bromine,BrBr,159.808 +56-23-5,Carbon tetrachloride,CCl4,153.8227 +630-08-0,Carbon monoxide,CO,28.0101 +124-38-9,Carbon dioxide,OCO,44.0095 +75-15-0,Carbon disulfide,SCS,76.1407 +75-44-5,Phosgene,COCl2,98.9161 +76-02-8,Trichloroacetyl chloride,CCl3COCl,181.8328 +7647-01-0,Hydrogen chloride,HCl,36.46094 +7782-50-5,Chlorine,Cl2,70.906 +10034-85-2,Hydrogen iodide,HI,127.9124 +1333-74-0,Hydrogen,H2,2.01588 +7732-18-5,Water,HOH,18.01528 +04-06-7783,Hydrogen sulfide,HSH,34.08088 +7664-41-7,Ammonia,NH3,17.03052 +09-01-7440,Neon,Ne,20.1797 +7697-37-2,Nitric acid,HNO3,63.01284 +10102-43-9,Nitric oxide,NO,30.0061 +10102-44-0,Nitrogen dioxide,ONO,46.0055 +7727-37-9,Nitrogen,N2,28.0134 +10024-97-2,Nitrous oxide,NON,44.0128 +7782-44-7,Oxygen,O2,31.9988 +05-09-7446,Sulfur dioxide,OSO,64.0638 +09-11-7446,Sulfur trioxide,SO3,80.0632 +67-66-3,Chloroform,CHCl3,119.3776 +74-90-8,Hydrogen cyanide,HCN,27.02534 +50-00-0,Formaldehyde,HCHO,30.02598 +74-87-3,Methyl chloride,CH3Cl,50.48752 +74-88-4,Methyl iodide,CH3I,141.939 +74-82-8,Methane,CH4,16.04246 +67-56-1,Methanol,CH3OH,32.04186 +74-89-5,Methylamine,CH3NH2,31.0571 +79-01-6,Trichloroethylene,CHClCCl2,131.3883 +79-36-7,Dichloroacetyl chloride,CHCl2COCl,147.3877 +75-87-6,Trichloroacetaldehyde,CCl3CHO,147.3877 +74-86-2,Acetylene,HCCH,26.03728 +79-02-7,Dichloroacetaldehyde,CHCl2CHO,112.9427 +75-01-4,Vinyl chloride,CH2CHCl,62.49822 +75-36-5,Acetyl chloride,CH3COCl,78.49762 +79-00-5,"1,1,2-trichloroethane",CHCl2CH2Cl,133.4042 +75-05-8,Acetonitrile,CH3CN,41.05192 +74-85-1,Ethylene,CH2CH2,28.05316 +75-34-3,"1,1-dichloroethane",CHCl2CH3,98.95916 +107-06-2,"1,2-dichloroethane",CH2ClCH2Cl,98.95916 +75-07-0,Acetaldehyde,CH3CHO,44.05256 +75-21-8,Ethylene oxide,CH2OCH2,44.05256 +64-19-7,Acetic acid,CH3COOH,60.05196 +107-31-3,Methyl formate,HCOOCH3,60.05196 +75-00-3,Ethyl chloride,CH3CH2Cl,64.5141 +74-84-0,Ethane,CH3CH3,30.06904 +64-17-5,Ethanol,CH3CH2OH,46.06844 +115-10-6,Dimethyl ether,CH3OCH3,46.06844 +107-21-1,Ethylene glycol,HOCH2CH2OH,62.06784 +75-18-3,Dimethyl sulfide,(CH3)2S,62.13404 +75-08-1,Ethyl mercaptan,CH3CH2SH,62.13404 +75-04-7,Ethylamine,CH3CH2NH2,45.08368 +107-13-1,Acrylonitrile,CH2CHCN,53.06262 +74-99-7,Methylacetylene,CH3CCH,40.06386 +463-49-0,Propadiene,CH2CCH2,40.06386 +115-07-1,Propylene,CH2CHCH3,42.07974 +67-64-1,Acetone,CH3COCH3,58.07914 +109-94-4,Ethyl formate,HCOOCH2CH3,74.07854 +79-20-9,Methyl acetate,CH3COOCH3,74.07854 +79-09-4,Propionic acid,CH3CH2COOH,74.07854 +68-12-2,"N,n-dimethylformamide",HCON(CH3)2,73.09378 +74-98-6,Propane,CH3CH2CH3,44.09562 +67-63-0,Isopropanol,CH3CH(OH)CH3,60.09502 +71-23-8,1-propanol,CH3(CH2)2OH,60.09502 +75-50-3,Trimethylamine,(CH3)3N,59.11026 +689-97-4,Vinylacetylene,CH2CHCCH,52.07456 +110-02-1,Thiophene,-S(CH)4-,84.13956 +126-98-7,Methacrylonitrile,CH2C(CH3)CN,67.0892 +503-17-3,Dimethylacetylene,CH3CCCH3,54.09044 +107-00-6,Ethylacetylene,CH3CH2CCH,54.09044 +590-19-2,"1,2-butadiene",CH2CCHCH3,54.09044 +106-99-0,"1,3-butadiene",CH2CHCHCH2,54.09044 +106-98-9,1-butene,CH2CHCH2CH3,56.10632 +590-18-1,Cis-2-butene,CH3CHCHCH3,56.10632 +624-64-6,Trans-2-butene,CH3CHCHCH3,56.10632 +115-11-7,Isobutene,CH2C(CH3)2,56.10632 +78-84-2,2-methylpropanal,CH3CH(CH3)CHO,72.10572 +78-93-3,Methyl ethyl ketone,CH3COCH2CH3,72.10572 +109-99-9,Tetrahydrofuran,-CH2CH2CH2CH2O-,72.10572 +123-91-1,"1,4-dioxane",-OCH2CH2OCH2CH2-,88.10513 +107-92-6,N-butyric acid,CH3CH2CH2COOH,88.10513 +141-78-6,Ethyl acetate,CH3COOC2H5,88.10513 +554-12-1,Methyl propionate,CH3CH2COOCH3,88.10513 +110-74-7,N-propyl formate,HCOOCH2CH2CH3,88.10513 +126-33-0,Sulfolane,-(CH2)2SO2(CH2)2-,120.1701 +127-19-5,"N,n-dimethylacetamide",(CH3)2NCOCH3,87.12036 +106-97-8,N-butane,CH3(CH2)2CH3,58.1222 +75-28-5,Isobutane,CH3CH(CH3)CH3,58.1222 +71-36-3,1-butanol,CH3(CH2)3OH,74.1216 +78-83-1,2-methyl-1-propanol,(CH3)2CHCH2OH,74.1216 +78-92-2,2-butanol,CH3CH2CH(OH)CH3,74.1216 +75-65-0,2-methyl-2-propanol,C(CH3)3OH,74.1216 +60-29-7,Diethyl ether,CH3CH2OCH2CH3,74.1216 +111-46-6,Diethylene glycol,HOCH2CH2OCH2CH2OH,106.1204 +109-89-7,Diethylamine,C2H5NHC2H5,73.13684 +98-01-1,Furfural,(OC4H3)CHO,96.08406 +110-86-1,Pyridine,-CHCHCHCHCHN-,79.0999 +78-79-5,Isoprene,CH2C(CH3)CHCH2,68.11702 +287-92-3,Cyclopentane,-(CH2)5-,70.1329 +563-46-2,2-methyl-1-butene,CH2C(CH3)CH2CH3,70.1329 +563-45-1,3-methyl-1-butene,CH2CHCH(CH3)CH3,70.1329 +513-35-9,2-methyl-2-butene,CH3CHC(CH3)CH3,70.1329 +109-67-1,1-pentene,CH2CH(CH2)2CH3,70.1329 +627-20-3,Cis-2-pentene,CH3CHCHCH2CH3,70.1329 +646-04-8,Trans-2-pentene,CH3CHCHCH2CH3,70.1329 +96-22-0,3-pentanone,CH3CH2COCH2CH3,86.1323 +563-80-4,Methyl isopropyl ketone,CH3CH(CH3)COCH3,86.1323 +109-60-4,N-propyl acetate,CH3COO(CH2)2CH3,102.1317 +78-78-4,Isopentane,CH3CH(CH3)CH2CH3,72.14878 +109-66-0,N-pentane,CH3(CH2)3CH3,72.14878 +463-82-1,Neopentane,C(CH3)4,72.14878 +120-82-1,"1,2,4-trichlorobenzene",(C6H3)Cl3,181.447 +541-73-1,M-dichlorobenzene,(C6H4)Cl2,147.002 +95-50-1,O-dichlorobenzene,(C6H4)Cl2,147.002 +106-46-7,P-dichlorobenzene,(C6H4)Cl2,147.002 +108-86-1,Bromobenzene,(C6H5)Br,157.0079 +108-90-7,Monochlorobenzene,C6H5Cl,112.5569 +591-50-4,Iodobenzene,C6H5I,204.0084 +98-95-3,Nitrobenzene,C6H5NO2,123.1094 +71-43-2,Benzene,-CHCHCHCHCHCH-,78.11184 +108-95-2,Phenol,(C6H5)OH,94.11124 +62-53-3,Aniline,C6H5NH2,93.12648 +108-94-1,Cyclohexanone,-CH2CO(CH2)3CH2-,98.143 +110-82-7,Cyclohexane,-(CH2)6-,84.15948 +592-41-6,1-hexene,CH2CH(CH2)3CH3,84.15948 +96-37-7,Methylcyclopentane,(C5H9)CH3,84.15948 +108-93-0,Cyclohexanol,-CH(OH)(CH2)4CH2-,100.1589 +75-83-2,"2,2-dimethylbutane",CH3CH2C(CH3)3,86.17536 +79-29-8,"2,3-dimethylbutane",(CH3)2CHCH(CH3)2,86.17536 +110-54-3,N-hexane,CH3(CH2)4CH3,86.17536 +107-83-5,2-methylpentane,CH3CH2CH2CH(CH3)2,86.17536 +96-14-0,3-methylpentane,CH3CH2CH(CH3)CH2CH3,86.17536 +112-27-6,Triethylene glycol,HOCH2CH2OCH2CH2OCH2CH2OH,150.173 +121-44-8,Triethylamine,(C2H5)3N,101.19 +108-88-3,Toluene,(C6H5)CH3,92.13843 +108-39-4,M-cresol,CH3(C6H4)OH,108.1378 +95-48-7,O-cresol,CH3(C6H4)OH,108.1378 +106-44-5,P-cresol,CH3(C6H4)OH,108.1378 +108-87-2,Methylcyclohexane,(C6H11)CH3,98.18607 +1640-89-7,Ethylcyclopentane,(C5H9)CH2CH3,98.18607 +592-76-7,1-heptene,CH2CH(CH2)4CH3,98.18607 +142-82-5,N-heptane,CH3(CH2)5CH3,100.202 +100-42-5,Styrene,(C6H5)CHCH2,104.149 +100-41-4,Ethylbenzene,(C6H5)CH2CH3,106.165 +108-38-3,M-xylene,CH3(C6H4)CH3,106.165 +95-47-6,O-xylene,CH3(C6H4)CH3,106.165 +106-42-3,P-xylene,CH3(C6H4)CH3,106.165 +1678-91-7,Ethylcyclohexane,(C6H11)CH2CH3,112.2126 +2040-96-2,N-propylcyclopentane,(C5H9)CH2CH2CH3,112.2126 +111-65-9,N-octane,CH3(CH2)6CH3,114.2285 +564-02-3,"2,2,3-trimethylpentane",CH3C(CH3)2CH(CH3)CH2CH3,114.2285 +540-84-1,"2,2,4-trimethylpentane",(CH3)3CCH2CH(CH3)2,114.2285 +560-21-4,"2,3,3-trimethylpentane",CH3CH(CH3)C(CH3)2CH2CH3,114.2285 +565-75-3,"2,3,4-trimethylpentane",CH3CH(CH3)CH(CH3)CH(CH3)CH3,114.2285 +112-60-7,Tetraethylene glycol,HOCH2(CH2OCH2)3CH2OH,194.2255 +95-13-6,Indene,C6H4(CH2CHCH),116.1598 +496-11-7,Indane,C6H4(CH2)3,118.1757 +98-82-8,Cumene,(C6H5)CH(CH3)2,120.1916 +103-65-1,N-propylbenzene,(C6H5)CH2CH2CH3,120.1916 +1678-92-8,N-propylcyclohexane,(C6H11)CH2CH2CH3,126.2392 +111-84-2,N-nonane,CH3(CH2)7CH3,128.2551 +91-20-3,Naphthalene,(C6H4)(C4H4),128.1705 +767-59-9,1-methylindene,CH3(C9H7),130.1864 +2177-47-1,2-methylindene,CH3(C9H7),130.1864 +77-73-6,Dicyclopentadiene,C10H12,132.2023 +104-51-8,N-butylbenzene,(C6H5)(CH2)3CH3,134.2182 +1678-93-9,N-butylcyclohexane,(C6H11)CH2CH2CH2CH3,140.2658 +124-18-5,N-decane,CH3(CH2)8CH3,142.2817 +90-12-0,1-methylnaphthalene,(C6H4)(C4H3)CH3,142.1971 +91-57-6,2-methylnaphthalene,(C6H4)(C4H3)CH3,142.1971 +1120-21-4,N-undecane,CH3(CH2)9CH3,156.3083 +83-32-9,Acenaphthene,C12H10,154.2078 +92-52-4,Biphenyl,(C6H5)2,154.2078 +112-40-3,N-dodecane,CH3(CH2)10CH3,170.3348 +86-73-7,Fluorene,(C6H4)CH2(C6H4),166.2185 +629-50-5,N-tridecane,CH3(CH2)11CH3,184.3614 +85-01-8,Phenanthrene,C14H10,178.2292 +629-59-4,N-tetradecane,CH3(CH2)12CH3,198.388 +629-62-9,N-pentadecane,CH3(CH2)13CH3,212.4146 +206-44-0,Fluoranthene,C16H10,202.2506 +129-00-0,Pyrene,C16H10,202.2506 +605-02-7,1-phenylnaphthalene,(C6H4)(C4H3)(C6H5),204.2665 +544-76-3,N-hexadecane,CH3(CH2)14CH3,226.4412 +218-01-9,Chrysene,C18H12,228.2879 +493-01-6,Cis-decahydronaphthalene,(CH2)4CHCH(CH2)4,138.2499 +493-02-7,Trans-decahydronaphthalene,(CH2)4CHCH(CH2)4,138.2499 +1634-04-4,Methyl tert-butyl ether,CH3OC(CH3)3,88.14818 +994-05-8,Methyl tert-pentyl ether,CH3OC(CH3)2CH2CH3,102.1748 +75-85-4,2-methyl-2-butanol,CH3CH2C(CH3)(OH)CH3,88.14818 +10544-73-7,Nitrogen trioxide,O2NNO,76.0116 +10544-72-6,Nitrogen tetroxide,O2NNO2,92.011 +7440-59-7,Helium-4,He,4.002602 +7782-41-4,Fluorine,F2,37.9968 +7439-90-9,Krypton,Kr,83.798 +7440-63-3,Xenon,Xe,131.293 +10028-15-6,Ozone,O3,47.9982 +463-58-1,Carbonyl sulfide,OCS,60.0751 +2551-62-4,Sulfur hexafluoride,SF6,146.0554 +67-68-5,Dimethyl sulfoxide,CH3SOCH3,78.13344 +629-78-7,N-heptadecane,CH3(CH2)15CH3,240.4677 +593-45-3,N-octadecane,CH3(CH2)16CH3,254.4943 +629-92-5,N-nonadecane,CH3(CH2)17CH3,268.5209 +629-94-7,N-heneicosane,CH3(CH2)19CH3,296.5741 +629-97-0,N-docosane,CH3(CH2)20CH3,310.6006 +638-67-5,N-tricosane,CH3(CH2)21CH3,324.6272 +646-31-1,N-tetracosane,CH3(CH2)22CH3,338.6538 +629-99-2,N-pentacosane,CH3(CH2)23CH3,352.6804 +630-01-3,N-hexacosane,CH3(CH2)24CH3,366.707 +593-49-7,N-heptacosane,CH3(CH2)25CH3,380.7336 +630-02-4,N-octacosane,CH3(CH2)26CH3,394.7601 +630-03-5,N-nonacosane,CH3(CH2)27CH3,408.7867 +111-01-3,Squalane,((CH3)2CH(C3H6CH(CH3))2C2H4)2,422.8133 +591-76-4,2-methylhexane,CH3CH(CH3)(CH2)3CH3,100.202 +589-34-4,3-methylhexane,CH3CH2CH(CH3)CH2CH2CH3,100.202 +617-78-7,3-ethylpentane,CH3CH2CH(CH2CH3)CH2CH3,100.202 +590-35-2,"2,2-dimethylpentane",CH3C(CH3)2CH2CH2CH3,100.202 +565-59-3,"2,3-dimethylpentane",CH3CH2CH(CH3)CH(CH3)2,100.202 +108-08-7,"2,4-dimethylpentane",(CH3)2CHCH2CH(CH3)2,100.202 +562-49-2,"3,3-dimethylpentane",CH3CH2C(CH3)2CH2CH3,100.202 +464-06-2,"2,2,3-trimethylbutane",(CH3)3CCH(CH3)2,100.202 +592-27-8,2-methylheptane,(CH3)2CH(CH2)4CH3,114.2285 +589-81-1,3-methylheptane,CH3CH2CH(CH3)(CH2)3CH3,114.2285 +589-53-7,4-methylheptane,CH3(CH2)2CH(CH3)(CH2)2CH3,114.2285 +619-99-8,3-ethylhexane,CH3CH2CH(C2H5)CH2CH2CH3,114.2285 +590-73-8,"2,2-dimethylhexane",CH3C(CH3)2CH2CH2CH2CH3,114.2285 +584-94-1,"2,3-dimethylhexane",CH3CH(CH3)CH(CH3)CH2CH2CH3,114.2285 +589-43-5,"2,4-dimethylhexane",CH3CH(CH3)CH2CH(CH3)CH2CH3,114.2285 +592-13-2,"2,5-dimethylhexane",CH3CH(CH3)CH2CH2CH(CH3)CH3,114.2285 +563-16-6,"3,3-dimethylhexane",CH3CH2C(CH3)2CH2CH2CH3,114.2285 +583-48-2,"3,4-dimethylhexane",CH3CH2CH(CH3)CH(CH3)CH2CH3,114.2285 +609-26-7,2-methyl-3-ethylpentane,CH3CH(CH3)CH(CH2CH3)CH2CH3,114.2285 +1067-08-9,3-methyl-3-ethylpentane,CH3CH2C(CH3)(CH2CH3)CH2CH3,114.2285 +594-82-1,"2,2,3,3-tetramethylbutane",(CH3)3CC(CH3)3,114.2285 +3522-94-9,"2,2,5-trimethylhexane",CH3C(CH3)2CH2CH2CH(CH3)2,128.2551 +16747-30-1,"2,4,4-trimethylhexane",CH3CH2C(CH3)2CH2CH(CH3)2,128.2551 +1067-20-5,"3,3-diethylpentane",CH3CH2C(C2H5)2CH2CH3,128.2551 +7154-79-2,"2,2,3,3-tetramethylpentane",CH3C(CH3)2C(CH3)2CH2CH3,128.2551 +1186-53-4,"2,2,3,4-tetramethylpentane",CH3C(CH3)2CH(CH3)CH(CH3)CH3,128.2551 +1070-87-7,"2,2,4,4-tetramethylpentane",CH3C(CH3)2CH2C(CH3)2CH3,128.2551 +16747-38-9,"2,3,3,4-tetramethylpentane",(CH3)2CHC(CH3)2CH(CH3)2,128.2551 +3221-61-2,2-methyloctane,(CH3)2CH(CH2)5CH3,128.2551 +2216-33-3,3-methyloctane,CH3CH2CH(CH3)(CH2)4CH3,128.2551 +2216-34-4,4-methyloctane,CH3(CH2)2CHCH3(CH2)3CH3,128.2551 +15869-80-4,3-ethylheptane,CH3CH2CH(C2H5)CH2(CH2)2CH3,128.2551 +1071-26-7,"2,2-dimethylheptane",CH3C(CH3)2(CH2)4CH3,128.2551 +7154-80-5,"3,3,5-trimethylheptane",CH3CH2C(CH3)2CH2CH(CH3)CH2CH3,142.2817 +15869-87-1,"2,2-dimethyloctane",CH3C(CH3)2(CH2)5CH3,142.2817 +06-04-5911,3-methylnonane,CH3CH2CH(CH3)(CH2)5CH3,142.2817 +871-83-0,2-methylnonane,(CH3)2CH(CH2)6CH3,142.2817 +17301-94-9,4-methylnonane,CH3(CH2)2CH(CH3)(CH2)4CH3,142.2817 +15869-85-9,5-methylnonane,CH3(CH2)3CH(CH3)(CH2)3CH3,142.2817 +7688-21-3,Cis-2-hexene,CH3CHCH(CH2)2CH3,84.15948 +4050-45-7,Trans-2-hexene,CH3CHCH(CH2)2CH3,84.15948 +111-66-0,1-octene,CH2CH(CH2)5CH3,112.2126 +124-11-8,1-nonene,CH2CH(CH2)6CH3,126.2392 +821-95-4,1-undecene,CH3(CH2)8CHCH2,154.2924 +763-29-1,2-methyl-1-pentene,CH2C(CH3)CH2CH2CH3,84.15948 +691-38-3,4-methyl-cis-2-pentene,CH3CHCHCH(CH3)2,84.15948 +674-76-0,4-methyl-trans-2-pentene,CH3CHCHCH(CH3)2,84.15948 +110-83-8,Cyclohexene,-CH2CHCHCH2CH2CH2-,82.1436 +1638-26-2,"1,1-dimethylcyclopentane",-CH2C(CH3)2CH2CH2CH2-,98.18607 +1192-18-3,"Cis-1,2-dimethylcyclopentane",-CH(CH3)CH(CH3)(CH2)3-,98.18607 +822-50-4,"Trans-1,2-dimethylcyclopentane",-CH(CH3)CH(CH3)(CH2)3-,98.18607 +2532-58-3,"Cis-1,3-dimethylcyclopentane",-CH2CH(CH3)CH2CH(CH3)CH2-,98.18607 +1759-58-6,"Trans-1,3-dimethylcyclopentane",-CH2CH(CH3)CH2CH(CH3)CH2-,98.18607 +3875-51-2,Isopropylcyclopentane,(C5H9)CH(CH3)2,112.2126 +16747-50-5,1-methyl-1-ethylcyclopentane,-C(CH3)(C2H5)CH2CH2CH2CH2-,112.2126 +2040-95-1,N-butylcyclopentane,(C5H9)CH2CH2CH2CH3,126.2392 +590-66-9,"1,1-dimethylcyclohexane",-C(CH3)2(CH2)5-,112.2126 +04-01-2207,"Cis-1,2-dimethylcyclohexane",-CH(CH3)CH(CH3)(CH2)4-,112.2126 +6876-23-9,"Trans-1,2-dimethylcyclohexane",-CH(CH3)CH(CH3)(CH2)4-,112.2126 +638-04-0,"Cis-1,3-dimethylcyclohexane",-CH(CH3)CH2CH(CH3)(CH2)3-,112.2126 +06-03-2207,"Trans-1,3-dimethylcyclohexane",-CH(CH3)CH2CH(CH3)(CH2)3-,112.2126 +624-29-3,"Cis-1,4-dimethylcyclohexane",-CH(CH3)CH2CH2CH(CH3)(CH2)2-,112.2126 +07-04-2207,"Trans-1,4-dimethylcyclohexane",-CH(CH3)CH2CH2CH(CH3)(CH2)2-,112.2126 +3178-22-1,Tert-butylcyclohexane,C6H11C(CH3)3,140.2658 +611-14-3,O-ethyltoluene,CH3(C6H4)CH2CH3,120.1916 +620-14-4,M-ethyltoluene,CH3(C6H4)CH2CH3,120.1916 +622-96-8,P-ethyltoluene,CH3(C6H4)CH2CH3,120.1916 +526-73-8,"1,2,3-trimethylbenzene",(C6H3)(CH3)3,120.1916 +95-63-6,"1,2,4-trimethylbenzene",(C6H3)(CH3)3,120.1916 +108-67-8,Mesitylene,(C6H3)(CH3)3,120.1916 +538-93-2,Isobutylbenzene,(C6H5)CH2CH(CH3)2,134.2182 +135-98-8,Sec-butylbenzene,(C6H5)CH(CH3)CH2CH3,134.2182 +98-06-6,Tert-butylbenzene,(C6H5)C(CH3)2CH3,134.2182 +527-84-4,O-cymene,CH3(C6H4)CH(CH3)2,134.2182 +535-77-3,M-cymene,CH3(C6H4)CH(CH3)2,134.2182 +99-87-6,P-cymene,CH3(C6H4)CH(CH3)2,134.2182 +135-01-3,O-diethylbenzene,CH3CH2(C6H4)CH2CH3,134.2182 +141-93-5,M-diethylbenzene,CH3CH2(C6H4)CH2CH3,134.2182 +105-05-5,P-diethylbenzene,CH3CH2(C6H4)CH2CH3,134.2182 +488-23-3,"1,2,3,4-tetramethylbenzene",(C6H2)(CH3)4,134.2182 +527-53-7,"1,2,3,5-tetramethylbenzene",(C6H2)(CH3)4,134.2182 +95-93-2,"1,2,4,5-tetramethylbenzene",(C6H2)(CH3)4,134.2182 +04-04-2870,2-ethyl-m-xylene,CH3CH2(C6H3)(CH3)2,134.2182 +1758-88-9,2-ethyl-p-xylene,CH3CH2(C6H3)(CH3)2,134.2182 +874-41-9,4-ethyl-m-xylene,CH3CH2(C6H3)(CH3)2,134.2182 +934-80-5,4-ethyl-o-xylene,CH3CH2(C6H3)(CH3)2,134.2182 +1074-43-7,1-methyl-3-n-propylbenzene,CH3(C6H4)CH2CH2CH3,134.2182 +1074-55-1,1-methyl-4-n-propylbenzene,CH3(C6H4)CH2CH2CH3,134.2182 +100-18-5,P-diisopropylbenzene,(CH3)2CH(C6H4)CH(CH3)2,162.2713 +108-10-1,Methyl isobutyl ketone,CH3COCH2CH(CH3)2,100.1589 +106-35-4,3-heptanone,CH3(CH2)3COC2H5,114.1855 +123-19-3,4-heptanone,(CH3CH2CH2)2CO,114.1855 +589-38-8,3-hexanone,CH3CH2CH2COCH2CH3,100.1589 +107-87-9,2-pentanone,CH3CO(CH2)2CH3,86.1323 +591-78-6,2-hexanone,CH3COCH2CH2CH2CH3,100.1589 +110-43-0,2-heptanone,CH3CO(CH2)4CH3,114.1855 +110-12-3,5-methyl-2-hexanone,CH3CO(CH2)2CH(CH3)2,114.1855 +75-97-8,"3,3-dimethyl-2-butanone",(CH3)3CCOCH3,100.1589 +108-83-8,Diisobutyl ketone,(CH3)2CHCH2COCH2CH(CH3)2,142.2386 +565-80-0,Diisopropyl ketone,(CH3)2CHCOCH(CH3)2,114.1855 +123-38-6,Propanal,CH3CH2CHO,58.07914 +123-72-8,Butanal,CH3CH2CH2CHO,72.10572 +110-62-3,Pentanal,CH3(CH2)3CHO,86.1323 +66-25-1,Hexanal,CH3(CH2)4CHO,100.1589 +111-71-7,Heptanal,CH3(CH2)5CHO,114.1855 +108-20-3,Diisopropyl ether,CH3CH(CH3)OCH(CH3)CH3,102.1748 +142-96-1,Di-n-butyl ether,(C4H9)2O,130.2279 +6863-58-7,Di-sec-butyl ether,C2H5(CH3)CHOCH(CH3)C2H5,130.2279 +540-67-0,Methyl ethyl ether,CH3CH2OCH3,60.09502 +557-17-5,Methyl n-propyl ether,CH3OCH2CH2CH3,74.1216 +1860-27-1,Isopropyl butyl ether,C4H9OCH(CH3)2,116.2013 +625-44-5,Methyl isobutyl ether,CH3OCH2CH(CH3)CH3,88.14818 +598-53-8,Methyl isopropyl ether,CH3OCH(CH3)2,74.1216 +637-92-3,Tert-butyl ethyl ether,(CH3)3COCH2CH3,102.1748 +919-94-8,Ethyl tert-pentyl ether,C2H5C(CH3)2OC2H5,116.2013 +111-34-2,Butyl vinyl ether,C4H9OCHCH2,100.1589 +100-66-3,Anisole,C6H5OCH3,108.1378 +108-21-4,Isopropyl acetate,CH3COOCH(CH3)2,102.1317 +123-86-4,N-butyl acetate,CH3COO(CH2)3CH3,116.1583 +110-19-0,Isobutyl acetate,CH3COOCH2CH(CH3)2,116.1583 +628-63-7,N-pentyl acetate,CH3COOCH2(CH2)3CH3,130.1849 +108-05-4,Vinyl acetate,CH3COOCHCH2,86.08924 +142-92-7,N-hexyl acetate,CH3COOCH2(CH2)4CH3,144.2114 +71-41-0,1-pentanol,CH3(CH2)4OH,88.14818 +6032-29-7,2-pentanol,CH3(CH2)2CH(OH)CH3,88.14818 +137-32-6,2-methyl-1-butanol,CH3CH2CH(CH3)CH2OH,88.14818 +75-84-3,"2,2-dimethyl-1-propanol",(CH3)3CCH2OH,88.14818 +111-27-3,1-hexanol,CH3(CH2)5OH,102.1748 +111-70-6,1-heptanol,CH3(CH2)6OH,116.2013 +110-63-4,"1,4-butanediol",HO(CH2)4OH,90.121 +74-93-1,Methyl mercaptan,CH3SH,48.10746 +107-03-9,N-propyl mercaptan,CH3CH2CH2SH,76.16061 +75-66-1,Tert-butyl mercaptan,C(CH3)3SH,90.18719 +513-44-0,Isobutyl mercaptan,(CH3)2CHCH2SH,90.18719 +513-53-1,Sec-butyl mercaptan,CH3CH2CH(SH)CH3,90.18719 +111-31-9,N-hexyl mercaptan,CH3(CH2)5SH,118.2404 +624-89-5,Methyl ethyl sulfide,CH3SC2H5,76.16061 +3877-15-4,Methyl n-propyl sulfide,CH3SCH2CH2CH3,90.18719 +6163-64-0,Methyl t-butyl sulfide,CH3SC(CH3)3,104.2138 +13286-92-5,Methyl t-pentyl sulfide,CH3SC(CH3)(CH3)C2H5,118.2404 +111-47-7,Di-n-propyl sulfide,CH3CH2CH2SCH2CH2CH3,118.2404 +352-93-2,Diethyl sulfide,CH3CH2SCH2CH3,90.18719 +110-81-6,Diethyl disulfide,C2H5SSC2H5,122.2522 +624-92-0,Dimethyl disulfide,CH3SSCH3,94.19904 +629-19-6,Di-n-propyl disulfide,CH3CH2CH2SSCH2CH2CH3,150.3054 +110-06-5,Di-tert-butyl disulfide,(CH3)3CS2C(CH3)3,178.3585 +20333-39-5,Ethyl methyl disulfide,CH3CH2SSCH3,108.2256 +30453-31-7,Ethyl propyl disulfide,CH3(CH2)2SSCH2CH3,136.2788 +882-33-7,Diphenyl disulfide,(C6H5)SS(C6H5),218.3378 +141-43-5,Monoethanolamine,HOCH2CH2NH2,61.08308 +111-42-2,Diethanolamine,(HOCH2CH2)2NH,105.1356 +102-71-6,Triethanolamine,(HOCH2CH2)3N,149.1882 +107-15-3,Ethylenediamine,H2NCH2CH2NH2,60.09832 +108-18-9,Diisopropylamine,((CH3)2CH)2NH,101.19 +140-31-8,N-aminoethyl piperazine,H2NC2H4(NCH2CH2NHCH2CH2),129.2034 +111-40-0,Diethylenetriamine,(H2NCH2CH2)2NH,103.1661 +111-41-1,N-aminoethyl ethanolamine,H2NCH2CH2NHCH2CH2OH,104.1509 +106-50-3,P-phenylenediamine,(C6H4)(NH2)2,108.1411 +110-85-0,Piperazine,-NHCH2CH2NHCH2CH2-,86.1356 +109-83-1,Methylethanolamine,CH3NHCH2CH2OH,75.10966 +108-01-0,Dimethylethanolamine,HOCH2CH2N(CH3)2,89.13624 +75-52-5,Nitromethane,CH3NO2,61.04002 +79-24-3,Nitroethane,CH3CH2NO2,75.0666 +108-03-2,1-nitropropane,CH3CH2CH2NO2,89.09318 +79-46-9,2-nitropropane,CH3CH(NO2)CH3,89.09318 +627-05-4,1-nitrobutane,CH3(CH2)3NO2,103.1198 +88-72-2,O-nitrotoluene,C6H4(NO2)(CH3),137.136 +99-99-0,P-nitrotoluene,C6H4(NO2)(CH3),137.136 +99-08-1,M-nitrotoluene,C6H4(NO2)(CH3),137.136 +121-14-2,"2,4-dinitrotoluene",CH3(C6H3)(NO2)2,182.1335 +606-20-2,"2,6-dinitrotoluene",CH3(C6H3)(NO2)2,182.1335 +610-39-9,"3,4-dinitrotoluene",CH3(C6H3)(NO2)2,182.1335 +619-15-8,"2,5-dinitrotoluene",CH3(C6H3)(NO2)2,182.1335 +618-85-9,"3,5-dinitrotoluene",CH3(C6H3)(NO2)2,182.1335 +118-96-7,"2,4,6-trinitrotoluene",(CH3)C6H2(NO2)3,227.1311 +144-62-7,Oxalic acid,HOOCCOOH,90.03488 +79-10-7,Acrylic acid,CH2CHCOOH,72.06266 +79-41-4,Methacrylic acid,CH2C(CH3)COOH,86.08924 +65-85-0,Benzoic acid,(C6H5)COOH,122.1213 +118-90-1,O-toluic acid,CH3(C6H4)COOH,136.1479 +99-94-5,P-toluic acid,CH3(C6H4)COOH,136.1479 +69-72-7,Salicylic acid,HO(C6H4)COOH,138.1207 +124-04-9,Adipic acid,HOOC(CH2)4COOH,146.1412 +88-99-3,Phthalic acid,COOH(C6H4)COOH,166.1308 +110-16-7,Maleic acid,HOOCCHCHCOOH,116.0722 +100-21-0,Terephthalic acid,COOH(C6H4)COOH,166.1308 +108-24-7,Acetic anhydride,CH3COOOCCH3,102.0886 +108-31-6,Maleic anhydride,-CHCOOCOCH-,98.05688 +463-51-4,Ketene,CH2CO,42.03668 +80-62-6,Methyl methacrylate,CH2C(CH3)COOCH3,100.1158 +120-61-6,Dimethyl terephthalate,C6H4(COOCH3)2,194.184 +75-56-9,"1,2-propylene oxide",CH3-CHCH2O-,58.07804 +80-15-9,Cumene hydroperoxide,(C6H5)C(CH3)2OOH,152.1904 +107-12-0,Propionitrile,CH3CH2CN,55.0785 +616-38-6,Dimethyl carbonate,(CH3O)2CO,90.07794 +105-58-8,DiEthyl Carbonate,CH3CH2(OCOO)CH2CH3,118.1311 +623-53-0,Methyl Ethyl Carbonate,CH3(OCOO)CH2CH3,104.1045 +13509-27-8,Methyl Phenyl Carbonate,CH3(OCOO)C6H5,152.1473 +3878-46-4,Ethyl Phenyl Carbonate,CH3CH2(OCOO)C6H5,166.1739 +102-09-0,DiPhenyl Carbonate,(C6H5)2(OCOO),214.2167 +96-49-1,Ethylene carbonate,-CH2OCOOCH2-,88.06207 +108-32-7,Propylene carbonate,-OCH(CH3)CH2OCO-,102.0886 +15870-10-7,2-methyl-1-heptene,CH2C(CH3)CH2(CH2)3CH3,112.2126 +76589-16-7,2-Methoxy-2-Methyl-Heptane,(CH3O)(CH3)2 C(CH2)4 CH3,144.2545 +625-25-2,2-Methyl-2-Heptanol,(CH3)2(OH)C(CH2)4CH3,130.2279 +109-87-5,Methylal,CH3OCH2OCH3,76.09442 +105-59-9,Methyl DiEthanolAmine,CH3N(CH2CH2OH)2,119.1622 +100-37-8,Diethylethanolamine,HOCH2CH2N(CH2CH3)2,117.1894 +110-97-4,Diisopropanolamine,CH3CH(OH)CH2NHCH2CH(OH)CH3,133.1888 +287-23-0,Cyclobutane,-(CH2)4-,56.10632 +75-33-2,Isopropyl mercaptan,(CH3)2CHSH,76.16061 +56-81-5,Glycerol,HOCH2CH(OH)CH2OH,92.09382 +112-95-8,N-eicosane,CH3(CH2)18CH3,282.5475 +542-52-9,DiButyl Carbonate,CH3CH2CH2CH2(OCOO)CH2CH2CH2CH3,174.2374 diff --git a/container.py b/container.py new file mode 100644 index 0000000..91d4833 --- /dev/null +++ b/container.py @@ -0,0 +1,116 @@ +from OMChem.Flowsheet import Flowsheet +from OMChem.MatStm import MatStm +from OMChem.Mixer import Mixer +from OMChem.Heater import Heater +from component_selector import * +from collections import defaultdict +from PyQt5.QtCore import * +from PyQt5.QtGui import * +import datetime +import itertools +class Container(): + def __init__(self,msgbrowser): + self.unitOp = [] + self.thermoPackage = None + self.compounds = None + self.conn = defaultdict(list) + self.op=defaultdict(list) + self.ip=defaultdict(list) + self.msg = msgbrowser + self.msg.setText("") + self.opl=[] + self.result=[] + + + def currentTime(self): + now = datetime.datetime.now() + time = str(now.hour) + ":" + str(now.minute) + ":" +str(now.second) + return time + + def updateConn(self,key,value): + self.conn[key].append(value) + self.msg.append("<span style=\"color:blue\">["+str(self.currentTime())+"]<b> "+key.name+" </b> output is connected to input of<b> "+value.name +" </b></span>") + def addUnitOp(self,obj): + if(obj in self.unitOp): + pass + else: + self.unitOp.append(obj) + self.msg.append("<span style=\"color:blue\">["+str(self.currentTime())+"]<b> "+obj.name+" </b>is instantiated .""</span>") + + def fetchObject(self,name): + for i in self.unitOp: + if(i.name==name): + return i + def addCompounds(self,comp): + self.compounds = comp + + def add_thermoPackage(self,thermo): + self.thermoPackage = thermo + + def connection(self): + try: + self.op.clear() + self.ip.clear() + self.opl.clear() + stm = ['MatStm','EngStm'] + for i in self.conn: + if i.type not in stm: + self.op[i]=self.conn[i] + + for j in range(len(self.conn[i])): + if self.conn[i][j].type not in stm: + self.ip[self.conn[i][j]].append(i) + + for i in self.op: + i.connect(InputStms=self.ip[i],OutputStms=self.op[i]) + + self.opl.append([self.op[i] for i in self.op]) + self.opl=flatlist(flatlist(self.opl)) + except Exception as e: + print(e) + + def msgBrowser(self,f): + std = f.stdout.decode("utf-8") + if(std): + stdout = str(std) + stdout = stdout.replace("\n","<br/>") + self.msg.append("<span style=\"color:green\">"+stdout+"</span>") + + stde = f.stderr.decode("utf-8") + if(stde): + stdout = str(stde) + stdout = stdout.replace("\n","<br/>") + self.msg.append("<span style=\"color:red\">"+stdout+"</span>") + + def simulate(self,mode): + print(mode) + self.compounds = compound_selected + self.connection() + f = Flowsheet() + f.add_comp_list(self.compounds) + print("######## connection master#########\n",self.conn) + for i in self.unitOp : + if i in self.opl: + print("here",i) + f.add_UnitOpn(i,1) + else: + f.add_UnitOpn(i,0) + if mode=='SM': + self.msg.append("<span>["+str(self.currentTime())+"] Simulating in <b>Sequential</b> mode ... </span>") + f.simulateSM(self.ip,self.op) + self.msgBrowser(f) + self.result=f.resdata + print("under SEQ mode simulation") + elif mode=='EQN': + self.msg.append("<span>["+str(self.currentTime())+"] Simulating in <b>equation</b> mode ... </span>") + f.simulateEQN() + self.msgBrowser(f) + self.result=f.resdata + print("under Eqn mode simulation") + +def flatlist(lst): + flat_list=[] + for sublist in lst: + for item in sublist: + flat_list.append(item) + return flat_list diff --git a/darkgray.css b/darkgray.css new file mode 100644 index 0000000..69e4eef --- /dev/null +++ b/darkgray.css @@ -0,0 +1,1281 @@ + +QToolTip +{ + border: 1px solid black; + background-color: #D1DBCB; + padding: 1px; + border-radius: 3px; + opacity: 100; +} + +QWidget +{ + color: #b1b1b1; + background-color: #323232; + selection-background-color:#323232; + selection-color: black; + background-clip: border; + border-image: none; + border: 0px transparent black; + outline: 0; +} + +QWidget:item:hover +{ + background-color: #D1DBCB; + color: black; +} + +QWidget:item:selected +{ + background-color: #D1DBCB; + border: 0px +} + +QCheckBox +{ + spacing: 5px; + outline: none; + color: #eff0f1; + margin-bottom: 2px; +} + +QCheckBox:disabled +{ + color: #76797C; +} + +QCheckBox::indicator,QGroupBox::indicator +{ + width: 18px; + height: 18px; +} + +QGroupBox::indicator +{ + margin-left: 2px; +} + +QCheckBox::indicator:unchecked +{ + image: url(:/qss_icons/rc/checkbox_unchecked.png); +} + +QCheckBox::indicator:unchecked:hover, +QCheckBox::indicator:unchecked:focus, +QCheckBox::indicator:unchecked:pressed, +QGroupBox::indicator:unchecked:hover, +QGroupBox::indicator:unchecked:focus, +QGroupBox::indicator:unchecked:pressed +{ + border: none; + image: url(:/qss_icons/rc/checkbox_unchecked_focus.png); +} + +QCheckBox::indicator:checked +{ + image: url(:/qss_icons/rc/checkbox_checked.png); +} + +QCheckBox::indicator:checked:hover, +QCheckBox::indicator:checked:focus, +QCheckBox::indicator:checked:pressed, +QGroupBox::indicator:checked:hover, +QGroupBox::indicator:checked:focus, +QGroupBox::indicator:checked:pressed +{ + border: none; + image: url(:/qss_icons/rc/checkbox_checked_focus.png); +} + + +QCheckBox::indicator:indeterminate +{ + image: url(:/qss_icons/rc/checkbox_indeterminate.png); +} + +QCheckBox::indicator:indeterminate:focus, +QCheckBox::indicator:indeterminate:hover, +QCheckBox::indicator:indeterminate:pressed +{ + image: url(:/qss_icons/rc/checkbox_indeterminate_focus.png); +} + +QCheckBox::indicator:checked:disabled, +QGroupBox::indicator:checked:disabled +{ + image: url(:/qss_icons/rc/checkbox_checked_disabled.png); +} + +QCheckBox::indicator:unchecked:disabled, +QGroupBox::indicator:unchecked:disabled +{ + image: url(:/qss_icons/rc/checkbox_unchecked_disabled.png); +} + +QRadioButton +{ + spacing: 5px; + outline: none; + color: #eff0f1; + margin-bottom: 2px; +} + +QRadioButton:disabled +{ + color: #76797C; +} +QRadioButton::indicator +{ + width: 21px; + height: 21px; +} + +QRadioButton::indicator:unchecked +{ + image: url(:/qss_icons/rc/radio_unchecked.png); +} + + +QRadioButton::indicator:unchecked:hover, +QRadioButton::indicator:unchecked:focus, +QRadioButton::indicator:unchecked:pressed +{ + border: none; + outline: none; + image: url(:/qss_icons/rc/radio_unchecked_focus.png); +} + +QRadioButton::indicator:checked +{ + border: none; + outline: none; + image: url(:/qss_icons/rc/radio_checked.png); +} + +QRadioButton::indicator:checked:hover, +QRadioButton::indicator:checked:focus, +QRadioButton::indicator:checked:pressed +{ + border: none; + outline: none; + image: url(:/qss_icons/rc/radio_checked_focus.png); +} + +QRadioButton::indicator:checked:disabled +{ + outline: none; + image: url(:/qss_icons/rc/radio_checked_disabled.png); +} + +QRadioButton::indicator:unchecked:disabled +{ + image: url(:/qss_icons/rc/radio_unchecked_disabled.png); +} + + +QMenuBar +{ + background-color: #323232; + color: #D1DBCB; +} + +QMenuBar::item +{ + background-color: #323232; + background: transparent; + /* padding: 2px 20px 2px 20px; */ +} + +QMenuBar::item:selected +{ + background: transparent; + /* border: 1px solid #76797C; */ +} + +QMenuBar::item:pressed +{ + border: 0px solid #76797C; + background-color: #D1DBCB; + color: #000; + margin-bottom:-1px; + padding-bottom:1px; +} + +QMenu +{ + background-color: #323232; + /* border: 1px solid #76797C; */ + color: #eff0f1; + /*margin: 2px; */ +} + +QMenu::icon +{ + /*margin: 5px;*/ +} + +QMenu::item +{ + padding: 2px 30px 2px 30px; + /*margin-left: 5px;*/ + border: 1px solid transparent; /* reserve space for selection border */ +} + +QMenu::item:selected +{ + color: #000000; +} + +QMenu::separator { + height: 2px; + background: #D1DBCB; + margin-left: 10px; + margin-right: 5px; +} + +QMenu::indicator { + width: 18px; + height: 18px; +} + +/* non-exclusive indicator = check box style indicator + (see QActionGroup::setExclusive) */ +QMenu::indicator:non-exclusive:unchecked { + image: url(:/qss_icons/rc/checkbox_unchecked.png); +} + +QMenu::indicator:non-exclusive:unchecked:selected { + image: url(:/qss_icons/rc/checkbox_unchecked_disabled.png); +} + +QMenu::indicator:non-exclusive:checked { + image: url(:/qss_icons/rc/checkbox_checked.png); +} + +QMenu::indicator:non-exclusive:checked:selected { + image: url(:/qss_icons/rc/checkbox_checked_disabled.png); +} + +/* exclusive indicator = radio button style indicator (see QActionGroup::setExclusive) */ +QMenu::indicator:exclusive:unchecked { + image: url(:/qss_icons/rc/radio_unchecked.png); +} + +QMenu::indicator:exclusive:unchecked:selected { + image: url(:/qss_icons/rc/radio_unchecked_disabled.png); +} + +QMenu::indicator:exclusive:checked { + image: url(:/qss_icons/rc/radio_checked.png); +} + +QMenu::indicator:exclusive:checked:selected { + image: url(:/qss_icons/rc/radio_checked_disabled.png); +} + +QMenu::right-arrow { + margin: 5px; + image: url(:/qss_icons/rc/right_arrow.png) +} + + +QWidget:disabled +{ + color: #454545; + background-color: #323232; +} + +QAbstractItemView +{ + alternate-background-color: #323232; + color: #eff0f1; + border: 1px solid 3A3939; + border-radius: 2px; +} + +QWidget:focus, QMenuBar:focus,QToolBar:focus,QScrollAreaViewer:focus +{ + /* border: 2px solid #D1DBCB; */ +} + +QTabWidget:focus, QCheckBox:focus, QRadioButton:focus, QSlider:focus +{ + border: none; +} + +QLineEdit +{ + background-color: #1e1e1e; + selection-background-color: #D1DBCB; + selection-color: black; + padding: 5px; + border-style: solid; + border: 1px solid #76797C; + border-radius: 2px; + color: #eff0f1; +} + +QGroupBox { + border:1px solid #76797C; + border-radius: 2px; + margin-top: 20px; +} + +QGroupBox::title { + subcontrol-origin: margin; + subcontrol-position: top center; + padding-left: 10px; + padding-right: 10px; + padding-top: 10px; +} + +QAbstractScrollArea +{ + border-radius: 0px; + border: 0px solid #76797C; + background-color: transparent; +} + +QScrollBar:horizontal +{ + height: 15px; + margin: 3px 15px 3px 15px; + border: 1px transparent #2A2929; + border-radius: 4px; + background-color: #2A2929; +} + +QScrollBar::handle:horizontal +{ + background-color: #605F5F; + min-width: 5px; + border-radius: 4px; +} + +QScrollBar::add-line:horizontal +{ + margin: 0px 3px 0px 3px; + border-image: url(:/qss_icons/rc/right_arrow_disabled.png); + width: 10px; + height: 10px; + subcontrol-position: right; + subcontrol-origin: margin; +} + +QScrollBar::sub-line:horizontal +{ + margin: 0px 3px 0px 3px; + border-image: url(:/qss_icons/rc/left_arrow_disabled.png); + height: 10px; + width: 10px; + subcontrol-position: left; + subcontrol-origin: margin; +} + +QScrollBar::add-line:horizontal:hover,QScrollBar::add-line:horizontal:on +{ + border-image: url(:/qss_icons/rc/right_arrow.png); + height: 10px; + width: 10px; + subcontrol-position: right; + subcontrol-origin: margin; +} + + +QScrollBar::sub-line:horizontal:hover, QScrollBar::sub-line:horizontal:on +{ + border-image: url(:/qss_icons/rc/left_arrow.png); + height: 10px; + width: 10px; + subcontrol-position: left; + subcontrol-origin: margin; +} + +QScrollBar::up-arrow:horizontal, QScrollBar::down-arrow:horizontal +{ + background: none; +} + + +QScrollBar::add-page:horizontal, QScrollBar::sub-page:horizontal +{ + background: none; +} + +QScrollBar:vertical +{ + background-color: #2A2929; + width: 15px; + margin: 15px 3px 15px 3px; + border: 1px transparent #2A2929; + border-radius: 4px; +} + +QScrollBar::handle:vertical +{ + background-color: #605F5F; + min-height: 5px; + border-radius: 4px; +} + +QScrollBar::sub-line:vertical +{ + margin: 3px 0px 3px 0px; + border-image: url(:/qss_icons/rc/up_arrow_disabled.png); + height: 10px; + width: 10px; + subcontrol-position: top; + subcontrol-origin: margin; +} + +QScrollBar::add-line:vertical +{ + margin: 3px 0px 3px 0px; + border-image: url(:/qss_icons/rc/down_arrow_disabled.png); + height: 10px; + width: 10px; + subcontrol-position: bottom; + subcontrol-origin: margin; +} + +QScrollBar::sub-line:vertical:hover,QScrollBar::sub-line:vertical:on +{ + + border-image: url(:/qss_icons/rc/up_arrow.png); + height: 10px; + width: 10px; + subcontrol-position: top; + subcontrol-origin: margin; +} + + +QScrollBar::add-line:vertical:hover, QScrollBar::add-line:vertical:on +{ + border-image: url(:/qss_icons/rc/down_arrow.png); + height: 10px; + width: 10px; + subcontrol-position: bottom; + subcontrol-origin: margin; +} + +QScrollBar::up-arrow:vertical, QScrollBar::down-arrow:vertical +{ + background: none; +} + + +QScrollBar::add-page:vertical, QScrollBar::sub-page:vertical +{ + background: none; +} + +QTextEdit +{ + background-color: #1e1e1e; + color: #eff0f1; + border: 1px solid #76797C; +} + +QPlainTextEdit +{ + background-color: #1e1e1e;; + color: #eff0f1; + border-radius: 2px; + border: 1px solid #76797C; +} + +QHeaderView::section +{ + background-color: #76797C; + color: #eff0f1; + padding: 5px; + border: 1px solid #76797C; +} + +QSizeGrip { + image: url(:/qss_icons/rc/sizegrip.png); + width: 12px; + height: 12px; +} + + +QMainWindow::separator +{ + background-color: #323232; + color: white; + padding-left: 4px; + spacing: 2px; + border: 1px dashed #76797C; +} + +QMainWindow::separator:hover +{ + + background-color: #787876; + color: white; + padding-left: 4px; + border: 1px solid #76797C; + spacing: 2px; +} + + +QMenu::separator +{ + height: 1px; + background-color: #76797C; + color: white; + padding-left: 4px; + margin-left: 10px; + margin-right: 5px; +} + +QFrame +{ + border-radius: 0px; + /*border: 1px solid #76797C;*/ +} + + +QFrame[frameShape="0"] +{ + border-radius: 0px; + border: 0px transparent #76797C; +} + +QStackedWidget +{ + border: 1px transparent black; +} + +QToolBar { + border: 0px transparent #393838; + background: 0px solid #323232; + font-weight: bold; +} + +QToolBar::handle:horizontal { + image: url(:/qss_icons/rc/Hmovetoolbar.png); +} +QToolBar::handle:vertical { + image: url(:/qss_icons/rc/Vmovetoolbar.png); +} +QToolBar::separator:horizontal { + image: url(:/qss_icons/rc/Hsepartoolbar.png); +} +QToolBar::separator:vertical { + image: url(:/qss_icons/rc/Vsepartoolbar.png); +} +QToolButton#qt_toolbar_ext_button { + background: #58595a +} + +QPushButton +{ + color: #eff0f1; + background-color: #323232; + border-width: 1px; + border-color: #76797C; + border-style: solid; + padding: 5px; + border-radius: 0px; + outline: none; +} + +QPushButton:disabled +{ + background-color: #323232; + border-width: 1px; + border-color: #454545; + border-style: solid; + padding-top: 5px; + padding-bottom: 5px; + padding-left: 10px; + padding-right: 10px; + border-radius: 2px; + color: #454545; +} + +QPushButton:focus { + background-color: #D1DBCB; + color: black; +} + +QPushButton:pressed +{ + color: black; + background-color: #D1DBCB; + padding-top: -15px; + padding-bottom: -17px; +} + +QComboBox +{ + selection-background-color: #D1DBCB; + background-color: #31363B; + border-style: solid; + border: 1px solid #76797C; + border-radius: 2px; + padding: 5px; + min-width: 75px; +} + +QPushButton:checked{ + background-color: #76797C; + border-color: #6A6969; +} + +QComboBox:hover,QPushButton:hover,QAbstractSpinBox:hover,QLineEdit:hover,QTextEdit:hover,QPlainTextEdit:hover,QAbstractView:hover,QTreeView:hover +{ + border: 1px solid #D1DBCB; +} + +QComboBox:on +{ + padding-top: 0px; + padding-left: 4px; + selection-background-color: #4a4a4a; +} + +QComboBox QAbstractItemView +{ + background-color: #1e1e1e; + border-radius: 2px; + border: 1px solid #76797C; + selection-background-color: #D1DBCB; +} + +QComboBox::drop-down +{ + subcontrol-origin: padding; + subcontrol-position: top right; + width: 15px; + + border-left-width: 0px; + border-left-color: darkgray; + border-left-style: solid; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +QComboBox::down-arrow +{ + image: url(:/qss_icons/rc/down_arrow_disabled.png); +} + +QComboBox::down-arrow:on, QComboBox::down-arrow:hover, +QComboBox::down-arrow:focus +{ + image: url(:/qss_icons/rc/down_arrow.png); +} + +QAbstractSpinBox { + padding: 2px; + margin: 2px; + background-color: #1e1e1e; + color: #eff0f1; + border-radius: 0px; + min-width: 75px; + selection-background-color: #D1DBCB; + selection-color: black; +} + +QAbstractSpinBox:up-button +{ + background-color: transparent; + subcontrol-origin: border; + subcontrol-position: center right; +} + +QAbstractSpinBox:down-button +{ + background-color: transparent; + subcontrol-origin: border; + subcontrol-position: center left; +} + +QAbstractSpinBox::up-arrow,QAbstractSpinBox::up-arrow:disabled,QAbstractSpinBox::up-arrow:off { + image: url(:/qss_icons/rc/up_arrow_disabled.png); + width: 10px; + height: 10px; +} +QAbstractSpinBox::up-arrow:hover +{ + image: url(:/qss_icons/rc/up_arrow.png); +} + + +QAbstractSpinBox::down-arrow,QAbstractSpinBox::down-arrow:disabled,QAbstractSpinBox::down-arrow:off +{ + image: url(:/qss_icons/rc/down_arrow_disabled.png); + width: 10px; + height: 10px; +} +QAbstractSpinBox::down-arrow:hover +{ + image: url(:/qss_icons/rc/down_arrow.png); +} + + +QLabel +{ + border: 0px solid black; + margin-left: 2px; + margin-right: 2px; + color: #D1DBCB; +} + +QTabWidget{ + border: 0px transparent black; +} + +QTabWidget::pane { + border: 1px solid #76797C; + padding: 5px; + margin: 0px; +} + +QTabWidget::tab-bar { + left: 5px; /* move to the right by 5px */ +} + +QTabBar +{ + qproperty-drawBase: 0; + border-radius: 3px; +} + +QTabBar::focus +{ + border: 0px transparent black; + color: black; +} + +QTabBar::hover +{ + border: 0px transparent black; + color: black; +} + +QTabBar::close-button { + image: url(:/qss_icons/rc/close.png); + background: transparent; +} + +QTabBar::close-button:hover +{ + image: url(:/qss_icons/rc/close-hover.png); + background: transparent; +} + +QTabBar::close-button:pressed { + image: url(:/qss_icons/rc/close-pressed.png); + background: transparent; +} + +/* TOP TABS */ +QTabBar::tab:top { + color: #eff0f1; + border: 1px solid #76797C; + border-bottom: 1px transparent black; + background-color: #323232; + padding: 5px; + min-width: 50px; + border-top-left-radius: 2px; + border-top-right-radius: 2px; +} + +QTabBar::tab:top:!selected +{ + color: #eff0f1; + background-color: #54575B; + border: 1px solid #76797C; + border-bottom: 1px transparent black; + border-top-left-radius: 2px; + border-top-right-radius: 2px; +} + +QTabBar::tab:top:!selected:hover { + background-color: #D1DBCB; + color: black; +} + +/* BOTTOM TABS */ +QTabBar::tab:bottom { + color: #eff0f1; + border: 1px solid #76797C; + border-top: 1px transparent black; + background-color: #323232; + padding: 5px; + border-bottom-left-radius: 2px; + border-bottom-right-radius: 2px; + min-width: 50px; +} + +QTabBar::tab:bottom:!selected +{ + color: #eff0f1; + background-color: #54575B; + border: 1px solid #76797C; + border-top: 1px transparent black; + border-bottom-left-radius: 2px; + border-bottom-right-radius: 2px; +} + +QTabBar::tab:bottom:!selected:hover { + background-color: #D1DBCB; + color: black; +} + +/* LEFT TABS */ +QTabBar::tab:left { + color: #eff0f1; + border: 1px solid #76797C; + border-left: 1px transparent black; + background-color: #323232; + padding: 5px; + border-top-right-radius: 2px; + border-bottom-right-radius: 2px; + min-height: 50px; +} + +QTabBar::tab:left:!selected +{ + color: #eff0f1; + background-color: #54575B; + border: 1px solid #76797C; + border-left: 1px transparent black; + border-top-right-radius: 2px; + border-bottom-right-radius: 2px; +} + +QTabBar::tab:left:!selected:hover { + background-color: #D1DBCB; + color: black; +} + + +/* RIGHT TABS */ +QTabBar::tab:right { + color: #eff0f1; + border: 1px solid #76797C; + border-right: 1px transparent black; + background-color: #323232; + padding: 5px; + border-top-left-radius: 2px; + border-bottom-left-radius: 2px; + min-height: 50px; +} + +QTabBar::tab:right:!selected +{ + color: #eff0f1; + background-color: #54575B; + border: 1px solid #76797C; + border-right: 1px transparent black; + border-top-left-radius: 2px; + border-bottom-left-radius: 2px; +} + +QTabBar::tab:right:!selected:hover { + background-color: #D1DBCB; + color: black; +} + +QTabBar QToolButton::right-arrow:enabled { + image: url(:/qss_icons/rc/right_arrow.png); + } + + QTabBar QToolButton::left-arrow:enabled { + image: url(:/qss_icons/rc/left_arrow.png); + } + +QTabBar QToolButton::right-arrow:disabled { + image: url(:/qss_icons/rc/right_arrow_disabled.png); + } + + QTabBar QToolButton::left-arrow:disabled { + image: url(:/qss_icons/rc/left_arrow_disabled.png); + } + + +QDockWidget { + background: #323232; + border: 1px solid #403F3F; + titlebar-close-icon: url(:/qss_icons/rc/close.png); + titlebar-normal-icon: url(:/qss_icons/rc/undock.png); +} + +QDockWidget::close-button, QDockWidget::float-button { + border: 1px solid transparent; + border-radius: 2px; + background: transparent; +} + +QDockWidget::close-button:hover, QDockWidget::float-button:hover { + background: rgba(255, 255, 255, 10); +} + +QDockWidget::close-button:pressed, QDockWidget::float-button:pressed { + padding: 1px -1px -1px 1px; + background: rgba(255, 255, 255, 10); +} + +QTreeView, QListView +{ + border: 1px solid #76797C; + background-color: #1e1e1e; +} + +QTreeView:branch:selected, QTreeView:branch:hover +{ + background: url(:/qss_icons/rc/transparent.png); +} + +QTreeView::branch:has-siblings:!adjoins-item { + border-image: url(:/qss_icons/rc/transparent.png); +} + +QTreeView::branch:has-siblings:adjoins-item { + border-image: url(:/qss_icons/rc/transparent.png); +} + +QTreeView::branch:!has-children:!has-siblings:adjoins-item { + border-image: url(:/qss_icons/rc/transparent.png); +} + +QTreeView::branch:has-children:!has-siblings:closed, +QTreeView::branch:closed:has-children:has-siblings { + image: url(:/qss_icons/rc/branch_closed.png); +} + +QTreeView::branch:open:has-children:!has-siblings, +QTreeView::branch:open:has-children:has-siblings { + image: url(:/qss_icons/rc/branch_open.png); +} + +QTreeView::branch:has-children:!has-siblings:closed:hover, +QTreeView::branch:closed:has-children:has-siblings:hover { + image: url(:/qss_icons/rc/branch_closed-on.png); + } + +QTreeView::branch:open:has-children:!has-siblings:hover, +QTreeView::branch:open:has-children:has-siblings:hover { + image: url(:/qss_icons/rc/branch_open-on.png); + } + +QListView::item:!selected:hover, QTreeView::item:!selected:hover { + background: #848383; + outline: 0; + color: #eff0f1; +} + +QListView::item:selected:hover, QTreeView::item:selected:hover { + background: #D1DBCB; +} + +QSlider::groove:horizontal { + border: 1px solid #565a5e; + height: 4px; + background: #565a5e; + margin: 0px; + border-radius: 2px; +} + +QSlider::handle:horizontal { + background: #D1DBCB; + border: 1px solid #999999; + width: 10px; + height: 10px; + margin: -5px 0; +} + +QSlider::add-page:qlineargradient { + background: #595858; + border-top-right-radius: 5px; + border-bottom-right-radius: 5px; + border-top-left-radius: 0px; + border-bottom-left-radius: 0px; +} + +QSlider::sub-page::qlineargradient:horizontal { + background: #D1DBCB; + border-top-right-radius: 0px; + border-bottom-right-radius: 0px; + border-top-left-radius: 5px; + border-bottom-left-radius: 5px; +} + +QSlider::groove:vertical { + border: 1px solid #565a5e; + width: 4px; + background: #565a5e; + margin: 0px; + border-radius: 3px; +} + +QSlider::handle:vertical { + background: #D1DBCB; + border: 1px solid #999999; + width: 10px; + height: 10px; + margin: 0 -5px; +} + +QToolButton { + color: #D1DBCB; + background-color: transparent; + border: 0px transparent #76797C; + border-radius: 0px; + padding: 1px; + margin-right: 5px; +} + +QToolButton[popupMode="1"] { /* only for MenuButtonPopup */ + padding-right: 20px; /* make way for the popup button */ + border: 1px #76797C; + border-radius: 0px; +} + +QToolButton[popupMode="2"] { /* only for InstantPopup */ + padding-right: 10px; /* make way for the popup button */ + border: 0px #76797C; +} + + +QToolButton:hover, QToolButton::menu-button:hover { + background-color: transparent; + border: 1px solid #D1DBCB; + padding: 2px; +} + +QToolButton:checked, QToolButton:pressed, + QToolButton::menu-button:pressed { + color: black; + background-color: #D1DBCB; + border: 0px solid #D1DBCB; + padding: 2px; +} + +/* the subcontrol below is used only in the InstantPopup or DelayedPopup mode */ +QToolButton::menu-indicator { + image: url(:/qss_icons/rc/down_arrow.png); + top: -7px; left: -2px; /* shift it a bit */ +} + +/* the subcontrols below are used only in the MenuButtonPopup mode */ +QToolButton::menu-button { + border: 1px transparent #76797C; + border-top-right-radius: 6px; + border-bottom-right-radius: 6px; + /* 16px width + 4px for border = 20px allocated above */ + width: 16px; + outline: none; +} + +QToolButton::menu-arrow { + image: url(:/qss_icons/rc/down_arrow.png); +} + +QToolButton::menu-arrow:open { + border: 1px solid #76797C; +} + +QPushButton::menu-indicator { + subcontrol-origin: padding; + subcontrol-position: bottom right; + left: 8px; +} + +QTableView +{ + border: 1px solid #76797C; + gridline-color: #323232; + background-color: #1e1e1e; +} + + +QTableView, QHeaderView +{ + border-radius: 0px; +} + +QTableView::item:pressed, QListView::item:pressed, QTreeView::item:pressed { + background: #D1DBCB; + color: black; +} + +QTableView::item:selected:active, QTreeView::item:selected:active, QListView::item:selected:active { + background: #D1DBCB; + color: black; +} + +QHeaderView +{ + background-color: #323232; + border: 1px transparent; + border-radius: 0px; + margin: 0px; + padding: 0px; + +} + +QHeaderView::section { + background-color: #323232; + color: #eff0f1; + padding: 5px; + border: 1px solid #76797C; + border-radius: 0px; + text-align: center; +} + +QHeaderView::section::vertical::first, QHeaderView::section::vertical::only-one +{ + border-top: 1px solid #76797C; +} + +QHeaderView::section::vertical +{ + border-top: transparent; +} + +QHeaderView::section::horizontal::first, QHeaderView::section::horizontal::only-one +{ + border-left: 1px solid #76797C; +} + +QHeaderView::section::horizontal +{ + border-left: transparent; +} + + +QHeaderView::section:checked + { + color: white; + background-color: #848383; + } + + /* style the sort indicator */ +QHeaderView::down-arrow { + image: url(:/qss_icons/rc/down_arrow.png); +} + +QHeaderView::up-arrow { + image: url(:/qss_icons/rc/up_arrow.png); +} + + +QTableCornerButton::section { + background-color: #323232; + border: 1px transparent #76797C; + border-radius: 0px; +} + +QToolBox { + padding: 5px; + border: 1px transparent black; +} + +QToolBox::tab { + color: #eff0f1; + background-color: #323232; + border: 1px solid #76797C; + border-bottom: 1px transparent #323232; + border-top-left-radius: 5px; + border-top-right-radius: 5px; +} + +QToolBox::tab:selected { /* italicize selected tabs */ + font: italic; + background-color: #323232; + border-color: #D1DBCB; + } + +QStatusBar::item { + border: 0px transparent dark; + margin: 0px; + border: 0px; + } + + +QFrame[height="3"], QFrame[width="3"] { + background-color: #76797C; +} + + +QSplitter::handle { + border: 1px dashed #76797C; +} + +QSplitter::handle:hover { + background-color: #787876; + border: 1px solid #76797C; +} + +QSplitter::handle:horizontal { + width: 1px; +} + +QSplitter::handle:vertical { + height: 1px; +} + +QProgressBar { + border: 1px solid #76797C; + border-radius: 5px; + text-align: center; +} + +QProgressBar::chunk { + background-color: #D1DBCB; +} + +QDateEdit +{ + selection-background-color: #D1DBCB; + border-style: solid; + border: 1px solid #CEE343; + border-radius: 2px; + padding: 1px; + min-width: 75px; +} + +QDateEdit:on +{ + padding-top: 3px; + padding-left: 4px; + selection-background-color: #4a4a4a; +} + +QDateEdit QAbstractItemView +{ + background-color: #1e1e1e; + border-radius: 2px; + border: 1px solid #3375A3; + selection-background-color: #D1DBCB; +} + +QDateEdit::drop-down +{ + subcontrol-origin: padding; + subcontrol-position: top right; + width: 15px; + border-left-width: 0px; + border-left-color: darkgray; + border-left-style: solid; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +QDateEdit::down-arrow +{ + image: url(:/qss_icons/rc/down_arrow_disabled.png); +} + +QDateEdit::down-arrow:on, QDateEdit::down-arrow:hover, +QDateEdit::down-arrow:focus +{ + image: url(:/qss_icons/rc/down_arrow.png); +} + diff --git a/darkorange.css b/darkorange.css new file mode 100644 index 0000000..9df2ee8 --- /dev/null +++ b/darkorange.css @@ -0,0 +1,520 @@ +QToolTip +{ + border: 1px solid black; + background-color: #ffa02f; + padding: 1px; + border-radius: 3px; + opacity: 100; +} + +QWidget +{ + color: #b1b1b1; + background-color: #323232; +} + +QTreeView, QListView +{ + background-color: silver; + margin-left: 5px; +} + +QWidget:item:hover +{ + background-color: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #ffa02f, stop: 1 #ca0619); + color: #000000; +} + +QWidget:item:selected +{ + background-color: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #ffa02f, stop: 1 #d7801a); +} + +QMenuBar::item +{ + background: transparent; +} + +QMenuBar::item:selected +{ + background: transparent; + border: 1px solid #ffaa00; +} + +QMenuBar::item:pressed +{ + background: #444; + border: 1px solid #000; + background-color: QLinearGradient( + x1:0, y1:0, + x2:0, y2:1, + stop:1 #212121, + stop:0.4 #343434/*, + stop:0.2 #343434, + stop:0.1 #ffaa00*/ + ); + margin-bottom:-1px; + padding-bottom:1px; +} + +QMenu +{ + border: 1px solid #000; +} + +QMenu::item +{ + padding: 2px 20px 2px 20px; +} + +QMenu::item:selected +{ + color: #000000; +} + +QWidget:disabled +{ + color: #808080; + background-color: #323232; +} + +QAbstractItemView +{ + background-color: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #4d4d4d, stop: 0.1 #646464, stop: 1 #5d5d5d); +} + +QWidget:focus +{ + /*border: 1px solid darkgray;*/ +} + +QLineEdit +{ + background-color: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #4d4d4d, stop: 0 #646464, stop: 1 #5d5d5d); + padding: 1px; + border-style: solid; + border: 1px solid #1e1e1e; + border-radius: 5; +} + +QPushButton +{ + color: #b1b1b1; + background-color: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #565656, stop: 0.1 #525252, stop: 0.5 #4e4e4e, stop: 0.9 #4a4a4a, stop: 1 #464646); + border-width: 1px; + border-color: #1e1e1e; + border-style: solid; + border-radius: 6; + padding: 3px; + font-size: 12px; + padding-left: 5px; + padding-right: 5px; + min-width: 40px; +} + +QPushButton:pressed +{ + background-color: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #2d2d2d, stop: 0.1 #2b2b2b, stop: 0.5 #292929, stop: 0.9 #282828, stop: 1 #252525); +} + +QComboBox +{ + selection-background-color: #ffaa00; + background-color: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #565656, stop: 0.1 #525252, stop: 0.5 #4e4e4e, stop: 0.9 #4a4a4a, stop: 1 #464646); + border-style: solid; + border: 1px solid #1e1e1e; + border-radius: 5; +} + +QComboBox:hover,QPushButton:hover +{ + border: 2px solid QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #ffa02f, stop: 1 #d7801a); +} + + +QComboBox:on +{ + padding-top: 3px; + padding-left: 4px; + background-color: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #2d2d2d, stop: 0.1 #2b2b2b, stop: 0.5 #292929, stop: 0.9 #282828, stop: 1 #252525); + selection-background-color: #ffaa00; +} + +QComboBox QAbstractItemView +{ + border: 2px solid darkgray; + selection-background-color: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #ffa02f, stop: 1 #d7801a); +} + +QComboBox::drop-down +{ + subcontrol-origin: padding; + subcontrol-position: top right; + width: 15px; + + border-left-width: 0px; + border-left-color: darkgray; + border-left-style: solid; /* just a single line */ + border-top-right-radius: 3px; /* same radius as the QComboBox */ + border-bottom-right-radius: 3px; + } + +QComboBox::down-arrow +{ + image: url(:/dark_orange/img/down_arrow.png); +} + +QGroupBox +{ + border: 1px solid darkgray; + margin-top: 10px; +} + +QGroupBox:focus +{ + border: 1px solid darkgray; +} + +QTextEdit:focus +{ + border: 1px solid darkgray; +} + +QScrollBar:horizontal { + border: 1px solid #222222; + background: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0.0 #121212, stop: 0.2 #282828, stop: 1 #484848); + height: 7px; + margin: 0px 16px 0 16px; +} + +QScrollBar::handle:horizontal +{ + background: QLinearGradient( x1: 0, y1: 0, x2: 1, y2: 0, stop: 0 #ffa02f, stop: 0.5 #d7801a, stop: 1 #ffa02f); + min-height: 20px; + border-radius: 2px; +} + +QScrollBar::add-line:horizontal { + border: 1px solid #1b1b19; + border-radius: 2px; + background: QLinearGradient( x1: 0, y1: 0, x2: 1, y2: 0, stop: 0 #ffa02f, stop: 1 #d7801a); + width: 14px; + subcontrol-position: right; + subcontrol-origin: margin; +} + +QScrollBar::sub-line:horizontal { + border: 1px solid #1b1b19; + border-radius: 2px; + background: QLinearGradient( x1: 0, y1: 0, x2: 1, y2: 0, stop: 0 #ffa02f, stop: 1 #d7801a); + width: 14px; + subcontrol-position: left; + subcontrol-origin: margin; +} + +QScrollBar::right-arrow:horizontal, QScrollBar::left-arrow:horizontal +{ + border: 1px solid black; + width: 1px; + height: 1px; + background: white; +} + +QScrollBar::add-page:horizontal, QScrollBar::sub-page:horizontal +{ + background: none; +} + +QScrollBar:vertical +{ + background: QLinearGradient( x1: 0, y1: 0, x2: 1, y2: 0, stop: 0.0 #121212, stop: 0.2 #282828, stop: 1 #484848); + width: 7px; + margin: 16px 0 16px 0; + border: 1px solid #222222; +} + +QScrollBar::handle:vertical +{ + background: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #ffa02f, stop: 0.5 #d7801a, stop: 1 #ffa02f); + min-height: 20px; + border-radius: 2px; +} + +QScrollBar::add-line:vertical +{ + border: 1px solid #1b1b19; + border-radius: 2px; + background: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #ffa02f, stop: 1 #d7801a); + height: 14px; + subcontrol-position: bottom; + subcontrol-origin: margin; +} + +QScrollBar::sub-line:vertical +{ + border: 1px solid #1b1b19; + border-radius: 2px; + background: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0 #d7801a, stop: 1 #ffa02f); + height: 14px; + subcontrol-position: top; + subcontrol-origin: margin; +} + +QScrollBar::up-arrow:vertical, QScrollBar::down-arrow:vertical +{ + border: 1px solid black; + width: 1px; + height: 1px; + background: white; +} + + +QScrollBar::add-page:vertical, QScrollBar::sub-page:vertical +{ + background: none; +} + +QTextEdit +{ + background-color: #242424; +} + +QPlainTextEdit +{ + background-color: #242424; +} + +QHeaderView::section +{ + background-color: QLinearGradient(x1:0, y1:0, x2:0, y2:1, stop:0 #616161, stop: 0.5 #505050, stop: 0.6 #434343, stop:1 #656565); + color: white; + padding-left: 4px; + border: 1px solid #6c6c6c; +} + +QCheckBox:disabled +{ +color: #414141; +} + +QDockWidget::title +{ + text-align: center; + spacing: 3px; /* spacing between items in the tool bar */ + background-color: QLinearGradient(x1:0, y1:0, x2:0, y2:1, stop:0 #323232, stop: 0.5 #242424, stop:1 #323232); +} + +QDockWidget::close-button, QDockWidget::float-button +{ + text-align: center; + spacing: 1px; /* spacing between items in the tool bar */ + background-color: QLinearGradient(x1:0, y1:0, x2:0, y2:1, stop:0 #323232, stop: 0.5 #242424, stop:1 #323232); +} + +QDockWidget::close-button:hover, QDockWidget::float-button:hover +{ + background: #242424; +} + +QDockWidget::close-button:pressed, QDockWidget::float-button:pressed +{ + padding: 1px -1px -1px 1px; +} + +QMainWindow::separator +{ + background-color: QLinearGradient(x1:0, y1:0, x2:0, y2:1, stop:0 #161616, stop: 0.5 #151515, stop: 0.6 #212121, stop:1 #343434); + color: white; + padding-left: 4px; + border: 1px solid #4c4c4c; + spacing: 3px; /* spacing between items in the tool bar */ +} + +QMainWindow::separator:hover +{ + + background-color: QLinearGradient(x1:0, y1:0, x2:0, y2:1, stop:0 #d7801a, stop:0.5 #b56c17 stop:1 #ffa02f); + color: white; + padding-left: 4px; + border: 1px solid #6c6c6c; + spacing: 3px; /* spacing between items in the tool bar */ +} + +QToolBar::handle +{ + spacing: 3px; /* spacing between items in the tool bar */ + background: url(:/dark_orange/img/handle.png); +} + +QMenu::separator +{ + height: 2px; + background-color: QLinearGradient(x1:0, y1:0, x2:0, y2:1, stop:0 #161616, stop: 0.5 #151515, stop: 0.6 #212121, stop:1 #343434); + color: white; + padding-left: 4px; + margin-left: 10px; + margin-right: 5px; +} + +QProgressBar +{ + border: 2px solid grey; + border-radius: 5px; + text-align: center; +} + +QProgressBar::chunk +{ + background-color: #d7801a; + width: 2.15px; + margin: 0.5px; +} + +QTabBar::tab { + color: #b1b1b1; + border: 1px solid #444; + border-bottom-style: none; + background-color: #323232; + padding-left: 10px; + padding-right: 10px; + padding-top: 3px; + padding-bottom: 2px; + margin-right: -1px; +} + +QTabWidget::pane { + border: 1px solid #444; + top: 1px; +} + +QTabBar::tab:last +{ + margin-right: 0; /* the last selected tab has nothing to overlap with on the right */ + border-top-right-radius: 3px; +} + +QTabBar::tab:first:!selected +{ + margin-left: 0px; /* the last selected tab has nothing to overlap with on the right */ + + + border-top-left-radius: 3px; +} + +QTabBar::tab:!selected +{ + color: #b1b1b1; + border-bottom-style: solid; + margin-top: 3px; + background-color: QLinearGradient(x1:0, y1:0, x2:0, y2:1, stop:1 #212121, stop:.4 #343434); +} + +QTabBar::tab:selected +{ + border-top-left-radius: 3px; + border-top-right-radius: 3px; + margin-bottom: 0px; +} + +QTabBar::tab:!selected:hover +{ + /*border-top: 2px solid #ffaa00; + padding-bottom: 3px;*/ + border-top-left-radius: 3px; + border-top-right-radius: 3px; + background-color: QLinearGradient(x1:0, y1:0, x2:0, y2:1, stop:1 #212121, stop:0.4 #343434, stop:0.2 #343434, stop:0.1 #ffaa00); +} + +QRadioButton::indicator:checked, QRadioButton::indicator:unchecked{ + color: #b1b1b1; + background-color: #323232; + border: 1px solid #b1b1b1; + border-radius: 6px; +} + +QRadioButton::indicator:checked +{ + background-color: qradialgradient( + cx: 0.5, cy: 0.5, + fx: 0.5, fy: 0.5, + radius: 1.0, + stop: 0.25 #ffaa00, + stop: 0.3 #323232 + ); +} + +QCheckBox::indicator{ + color: #b1b1b1; + background-color: #323232; + border: 1px solid #b1b1b1; + width: 9px; + height: 9px; +} + +QRadioButton::indicator +{ + border-radius: 6px; +} + +QRadioButton::indicator:hover, QCheckBox::indicator:hover +{ + border: 1px solid #ffaa00; +} + +QCheckBox::indicator:checked +{ + image:url(:/dark_orange/img/checkbox.png); +} + +QCheckBox::indicator:disabled, QRadioButton::indicator:disabled +{ + border: 1px solid #444; +} + + +QSlider::groove:horizontal { + border: 1px solid #3A3939; + height: 8px; + background: #201F1F; + margin: 2px 0; + border-radius: 2px; +} + +QSlider::handle:horizontal { + background: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, + stop: 0.0 silver, stop: 0.2 #a8a8a8, stop: 1 #727272); + border: 1px solid #3A3939; + width: 14px; + height: 14px; + margin: -4px 0; + border-radius: 2px; +} + +QSlider::groove:vertical { + border: 1px solid #3A3939; + width: 8px; + background: #201F1F; + margin: 0 0px; + border-radius: 2px; +} + +QSlider::handle:vertical { + background: QLinearGradient( x1: 0, y1: 0, x2: 0, y2: 1, stop: 0.0 silver, + stop: 0.2 #a8a8a8, stop: 1 #727272); + border: 1px solid #3A3939; + width: 14px; + height: 14px; + margin: 0 -4px; + border-radius: 2px; +} + +QAbstractSpinBox { + padding-top: 2px; + padding-bottom: 2px; + border: 1px solid darkgray; + + border-radius: 2px; + min-width: 50px; +} + + diff --git a/dockWidget.py b/dockWidget.py new file mode 100644 index 0000000..a4956c5 --- /dev/null +++ b/dockWidget.py @@ -0,0 +1,131 @@ +from PyQt5.QtCore import * +from PyQt5.QtWidgets import * +from PyQt5.QtGui import * +from PyQt5.uic import loadUiType +import pandas as pd +from functools import partial +from component_selector import * +from collections import defaultdict +ui_dialog,_ = loadUiType('dockWidget.ui') + + +class dockWidget(QDockWidget,ui_dialog): + + def __init__(self,name,comptype,obj,parent=None): + QDockWidget.__init__(self,parent) + self.setupUi(self) + self.setWindowTitle(obj.name) + self.name=name + self.obj=obj + self.type = comptype + self.inputdict = {} + self.compmolfraclist = [] + self.modes() + self.pushButton_2.clicked.connect(self.modeSelection) + #self.inputparamslist() + print(self.inputdict) + self.pushButton.clicked.connect(self.param) + self.dict = {} + + def modes(self): + modesList = self.obj.modesList() + if(modesList): + for j in modesList: + self.comboBox.addItem(str(j)) + self.modeSelection() + else: + self.inputdict= {} + self.inputdict = self.obj.paramgetter() + self.inputparamslist() + + def modeSelection(self): + self.inputdict= {} + for i in reversed(range(self.formLayout.count())): + self.formLayout.itemAt(i).widget().setParent(None) + self.inputdict = self.obj.paramgetter(self.comboBox.currentText()) + self.inputparamslist() + + def inputparamslist(self): + try: + print(self.inputdict) + for c,i in enumerate(self.inputdict): + if(i=="thermoPackage"): + print("thermo1") + combo = QComboBox() + self.lines = [line.rstrip('\n') for line in open('thermopackage.txt')] + print("thermo2") + for j in self.lines: + combo.addItem(str(j)) + self.formLayout.addRow(QLabel(i+":"),combo ) + self.inputdict[i] = combo + print("thermo") + elif(i=="condType"): + combo = QComboBox() + self.lines = ["Total","Partial"] + for j in self.lines: + combo.addItem(str(j)) + self.formLayout.addRow(QLabel("Condensor Type :"+":"),combo ) + self.inputdict[i] = combo + elif(i=="CompMolFrac"): + print("cmfnjkmnjkmnjkm") + noc = len(compound_selected) + print(noc) + self.compmolfraclist.clear() + for j in range(noc): + l = QLineEdit() + self.inputdict[i] = "compmolfrac" + self.formLayout.addRow(QLabel(str(compound_selected[j])+" Fraction"+":"),l ) + + self.compmolfraclist.append(l) + else: + print("elseloopo") + l = QLineEdit() + self.formLayout.addRow(QLabel(i+":"),l ) + self.inputdict[i] = l + + except Exception as e: + print(e) + def Show_Error(self): + QMessageBox.about(self, 'Important', "Please fill all fields with data") + def param(self): + try: + self.dict={} + for i in self.inputdict: + if(i=="thermoPackage"): + if (self.inputdict[i].currentText()): + self.dict[i] = self.inputdict[i].currentText() + else: + self.Show_Error() + break + elif(i=="condType"): + if (self.inputdict[i].currentText()): + self.dict[i] = self.inputdict[i].currentText() + else: + self.Show_Error() + break + elif(i =="CompMolFrac"): + l=[] + for mol_frac in self.compmolfraclist: + if (mol_frac.text()): + l.append(mol_frac.text()) + else: + self.Show_Error() + break + self.dict[i] = ",".join(l) + else: + if (self.inputdict[i].text()): + self.dict[i] = self.inputdict[i].text() + else: + print(self.inputdict[i].text()) + self.Show_Error() + break + self.obj.paramsetter(self.dict) + print(self.dict) + self.hide() + except Exception as e: + print(e) + + + + +
\ No newline at end of file diff --git a/dockWidget.ui b/dockWidget.ui new file mode 100644 index 0000000..a08f3c9 --- /dev/null +++ b/dockWidget.ui @@ -0,0 +1,175 @@ +<?xml version="1.0" encoding="UTF-8"?> +<ui version="4.0"> + <class>Form</class> + <widget class="QWidget" name="Form"> + <property name="geometry"> + <rect> + <x>0</x> + <y>0</y> + <width>250</width> + <height>382</height> + </rect> + </property> + <property name="sizePolicy"> + <sizepolicy hsizetype="Minimum" vsizetype="Fixed"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>250</width> + <height>250</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>250</width> + <height>600</height> + </size> + </property> + <property name="windowTitle"> + <string>Form</string> + </property> + <widget class="QPushButton" name="pushButton"> + <property name="geometry"> + <rect> + <x>10</x> + <y>350</y> + <width>231</width> + <height>23</height> + </rect> + </property> + <property name="text"> + <string>Submit</string> + </property> + <property name="autoDefault"> + <bool>true</bool> + </property> + <property name="default"> + <bool>true</bool> + </property> + </widget> + <widget class="QGroupBox" name="groupBox"> + <property name="geometry"> + <rect> + <x>10</x> + <y>30</y> + <width>231</width> + <height>61</height> + </rect> + </property> + <property name="title"> + <string>Modes Selection</string> + </property> + <property name="alignment"> + <set>Qt::AlignCenter</set> + </property> + <widget class="QWidget" name="horizontalLayoutWidget"> + <property name="geometry"> + <rect> + <x>0</x> + <y>20</y> + <width>231</width> + <height>32</height> + </rect> + </property> + <layout class="QHBoxLayout" name="horizontalLayout"> + <item> + <widget class="QLabel" name="label"> + <property name="minimumSize"> + <size> + <width>0</width> + <height>30</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>16777215</width> + <height>30</height> + </size> + </property> + <property name="text"> + <string>Mode:-</string> + </property> + </widget> + </item> + <item> + <widget class="QComboBox" name="comboBox"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Expanding" vsizetype="Fixed"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>30</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_2"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Fixed" vsizetype="Fixed"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>30</width> + <height>30</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>30</width> + <height>30</height> + </size> + </property> + <property name="text"> + <string>GO</string> + </property> + </widget> + </item> + </layout> + </widget> + </widget> + <widget class="QGroupBox" name="groupBox_2"> + <property name="geometry"> + <rect> + <x>10</x> + <y>90</y> + <width>231</width> + <height>251</height> + </rect> + </property> + <property name="title"> + <string>Parameter Selection</string> + </property> + <property name="alignment"> + <set>Qt::AlignCenter</set> + </property> + <widget class="QWidget" name="formLayoutWidget"> + <property name="geometry"> + <rect> + <x>10</x> + <y>20</y> + <width>211</width> + <height>221</height> + </rect> + </property> + <layout class="QFormLayout" name="formLayout"> + <property name="fieldGrowthPolicy"> + <enum>QFormLayout::AllNonFixedFieldsGrow</enum> + </property> + </layout> + </widget> + </widget> + </widget> + <resources/> + <connections/> +</ui> diff --git a/helper.py b/helper.py new file mode 100644 index 0000000..e6ecd0c --- /dev/null +++ b/helper.py @@ -0,0 +1,45 @@ +from OMChem.Flowsheet import Flowsheet +from OMChem.MatStm import MatStm +from OMChem.Mixer import Mixer +from OMChem.EngStm import EngStm +from OMChem.Heater import Heater +from OMChem.Flash import Flash +from OMChem.Splitter import Splitter +from OMChem.Valve import Valve +from OMChem.Cooler import Cooler +from OMChem.CompSep import CompSep +from OMChem.adiabatic_comp import AdiaComp +from OMChem.DistCol import DistCol +from OMChem.adiabatic_exp import AdiaExp +from OMChem.Pump import Pump +from OMChem.ShortcutColumn import ShortcutColumn +from component_selector import * + + +def helperFunc(type,name1,count): + if(type=="Mixer"): + return Mixer(name=name1) + elif(type=="MatStm"): + return MatStm(name=(name1,count),CompNames=compound_selected) + elif(type=="Splitter"): + return Splitter(name=name1) + elif(type=="Flash"): + return Flash(name=(name1,count)) + elif(type=="Heater"): + return Heater(name=name1) + elif(type=="Valve"): + return Valve(name=name1) + elif(type=="Cooler"): + return Cooler(name=name1) + elif(type=="CompSep"): + return CompSep(name=name1) + elif(type=="AdiaComp"): + return AdiaComp(name=(name1,count)) + elif(type=="AdiaExp"): + return AdiaExp(name=(name1,count)) + elif(type=="DistCol"): + return DistCol(name=(name1,count)) + elif(type=="Pump"): + return Pump(name=name1) + elif(type=="ShortCol"): + return ShortcutColumn(name=(name1,count)) diff --git a/icons/AdiaComp.png b/icons/AdiaComp.png Binary files differnew file mode 100644 index 0000000..08a874c --- /dev/null +++ b/icons/AdiaComp.png diff --git a/icons/AdiaExp.png b/icons/AdiaExp.png Binary files differnew file mode 100644 index 0000000..aaec6dc --- /dev/null +++ b/icons/AdiaExp.png diff --git a/icons/CompSep.png b/icons/CompSep.png Binary files differnew file mode 100644 index 0000000..6fd2d0c --- /dev/null +++ b/icons/CompSep.png diff --git a/icons/Cooler.png b/icons/Cooler.png Binary files differnew file mode 100644 index 0000000..08519ea --- /dev/null +++ b/icons/Cooler.png diff --git a/icons/DistCol.png b/icons/DistCol.png Binary files differnew file mode 100644 index 0000000..32a06b3 --- /dev/null +++ b/icons/DistCol.png diff --git a/icons/Equation.png b/icons/Equation.png Binary files differnew file mode 100644 index 0000000..687be3c --- /dev/null +++ b/icons/Equation.png diff --git a/icons/Flash.png b/icons/Flash.png Binary files differnew file mode 100644 index 0000000..4c38d8d --- /dev/null +++ b/icons/Flash.png diff --git a/icons/Heater.png b/icons/Heater.png Binary files differnew file mode 100644 index 0000000..18b891a --- /dev/null +++ b/icons/Heater.png diff --git a/icons/MatStm.png b/icons/MatStm.png Binary files differnew file mode 100644 index 0000000..ac543e4 --- /dev/null +++ b/icons/MatStm.png diff --git a/icons/Mixer.png b/icons/Mixer.png Binary files differnew file mode 100644 index 0000000..ee4b507 --- /dev/null +++ b/icons/Mixer.png diff --git a/icons/Pump.png b/icons/Pump.png Binary files differnew file mode 100644 index 0000000..daf804b --- /dev/null +++ b/icons/Pump.png diff --git a/icons/Sequential.png b/icons/Sequential.png Binary files differnew file mode 100644 index 0000000..3b08856 --- /dev/null +++ b/icons/Sequential.png diff --git a/icons/ShortCol.png b/icons/ShortCol.png Binary files differnew file mode 100644 index 0000000..32a06b3 --- /dev/null +++ b/icons/ShortCol.png diff --git a/icons/Splitter.png b/icons/Splitter.png Binary files differnew file mode 100644 index 0000000..28f6d52 --- /dev/null +++ b/icons/Splitter.png diff --git a/icons/Valve.png b/icons/Valve.png Binary files differnew file mode 100644 index 0000000..63bd362 --- /dev/null +++ b/icons/Valve.png diff --git a/icons/compoundSelector.png b/icons/compoundSelector.png Binary files differnew file mode 100644 index 0000000..cc878eb --- /dev/null +++ b/icons/compoundSelector.png diff --git a/icons/logo.png b/icons/logo.png Binary files differnew file mode 100644 index 0000000..541e99e --- /dev/null +++ b/icons/logo.png diff --git a/icons/new.svg b/icons/new.svg new file mode 100644 index 0000000..bd566f3 --- /dev/null +++ b/icons/new.svg @@ -0,0 +1,83 @@ +<?xml version="1.0" encoding="UTF-8" standalone="no"?> +<!-- Created with Inkscape (http://www.inkscape.org/) --> + +<svg + xmlns:dc="http://purl.org/dc/elements/1.1/" + xmlns:cc="http://creativecommons.org/ns#" + xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" + xmlns:svg="http://www.w3.org/2000/svg" + xmlns="http://www.w3.org/2000/svg" + xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd" + xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape" + width="32px" + height="32px" + id="svg3026" + version="1.1" + inkscape:version="0.48.4 r9939" + sodipodi:docname="new.svg"> + <defs + id="defs3028" /> + <sodipodi:namedview + id="base" + pagecolor="#ffffff" + bordercolor="#666666" + borderopacity="1.0" + inkscape:pageopacity="0.0" + inkscape:pageshadow="2" + inkscape:zoom="11.197802" + inkscape:cx="2.0686946" + inkscape:cy="16" + inkscape:current-layer="layer1" + showgrid="true" + inkscape:grid-bbox="true" + inkscape:document-units="px" + inkscape:window-width="1600" + inkscape:window-height="838" + inkscape:window-x="-8" + inkscape:window-y="-8" + inkscape:window-maximized="1" /> + <metadata + id="metadata3031"> + <rdf:RDF> + <cc:Work + rdf:about=""> + <dc:format>image/svg+xml</dc:format> + <dc:type + rdf:resource="http://purl.org/dc/dcmitype/StillImage" /> + <dc:title></dc:title> + </cc:Work> + </rdf:RDF> + </metadata> + <g + id="layer1" + inkscape:label="Layer 1" + inkscape:groupmode="layer"> + <g + id="Layer_x0020_1" + transform="matrix(-0.07242442,0,0,-0.06674202,26.765447,32.676694)"> + <path + class="fil0 str0" + d="m 190,30 h 140 c 11,0 20,9 20,20 v 400 c 0,11 -9,20 -20,20 H 50 C 39,470 30,461 30,450 V 190 L 190,30 z" + id="path9" + inkscape:connector-curvature="0" + style="fill:#ffffff;stroke:#434242;stroke-width:10;stroke-linecap:round;stroke-linejoin:round" /> + <path + class="fil1 str0" + d="M 160,190 H 30 L 190,30 v 130 c 0,17 -14,30 -30,30 z" + id="path11" + inkscape:connector-curvature="0" + style="fill:#fefefe;stroke:#434242;stroke-width:10;stroke-linecap:round;stroke-linejoin:round" /> + </g> + <g + transform="matrix(0.56015189,0,0,0.48838954,13.911275,0.32187356)" + style="font-size:63.53248596000000200px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#78a92b;fill-opacity:1;stroke:#78a92b;stroke-width:2.55788659999999980;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;font-family:Sans" + id="text4439"> + <path + d="m 11.886517,31.160178 0,-10.840424 -10.8437025,0 0.00166,-8.382915 10.8420435,0 0,-11.01540726 8.252363,-0.002202 -0.09092,11.01540726 11.025536,0 -4e-6,8.385117 -10.93462,0 0,10.842626 z" + id="path4952" + inkscape:connector-curvature="0" + sodipodi:nodetypes="ccccccccccccc" + style="stroke-width:2.55788659999999980;stroke-miterlimit:4;stroke-dasharray:none;fill:#78a92b;fill-opacity:1" /> + </g> + </g> +</svg> diff --git a/icons/package-icon.svg b/icons/package-icon.svg new file mode 100644 index 0000000..43382a3 --- /dev/null +++ b/icons/package-icon.svg @@ -0,0 +1,80 @@ +<?xml version="1.0" encoding="UTF-8" standalone="no"?> +<!-- Created with Inkscape (http://www.inkscape.org/) --> + +<svg + xmlns:dc="http://purl.org/dc/elements/1.1/" + xmlns:cc="http://creativecommons.org/ns#" + xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" + xmlns:svg="http://www.w3.org/2000/svg" + xmlns="http://www.w3.org/2000/svg" + xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd" + xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape" + width="32px" + height="32px" + id="svg2985" + version="1.1" + inkscape:version="0.48.4 r9939" + sodipodi:docname="package-icon.svg"> + <defs + id="defs2987" /> + <sodipodi:namedview + id="base" + pagecolor="#ffffff" + bordercolor="#666666" + borderopacity="1.0" + inkscape:pageopacity="0.0" + inkscape:pageshadow="2" + inkscape:zoom="11.197802" + inkscape:cx="14.160362" + inkscape:cy="16" + inkscape:current-layer="layer1" + showgrid="true" + inkscape:grid-bbox="true" + inkscape:document-units="px" + inkscape:window-width="1600" + inkscape:window-height="838" + inkscape:window-x="-8" + inkscape:window-y="-8" + inkscape:window-maximized="1" + inkscape:snap-global="false"> + <inkscape:grid + type="xygrid" + id="grid3786" /> + </sodipodi:namedview> + <metadata + id="metadata2990"> + <rdf:RDF> + <cc:Work + rdf:about=""> + <dc:format>image/svg+xml</dc:format> + <dc:type + rdf:resource="http://purl.org/dc/dcmitype/StillImage" /> + <dc:title /> + </cc:Work> + </rdf:RDF> + </metadata> + <g + id="layer1" + inkscape:label="Layer 1" + inkscape:groupmode="layer"> + <rect + style="fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:#740808;stroke-width:2;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0" + id="rect3012" + width="30.005886" + height="30.09519" + x="1.0716388" + y="0.92247248" /> + <text + xml:space="preserve" + style="font-size:40px;font-style:normal;font-variant:normal;font-weight:bold;font-stretch:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Courier New;-inkscape-font-specification:Courier New Bold" + x="5.4474978" + y="26.641806" + id="text3782" + sodipodi:linespacing="125%"><tspan + sodipodi:role="line" + id="tspan3784" + x="5.4474978" + y="26.641806" + style="font-size:36px;font-style:normal;font-variant:normal;font-weight:bold;font-stretch:normal;fill:#740808;fill-opacity:1;font-family:Courier New;-inkscape-font-specification:Courier New Bold">P</tspan></text> + </g> +</svg> diff --git a/icons/zoomIn.png b/icons/zoomIn.png Binary files differnew file mode 100644 index 0000000..b10c61a --- /dev/null +++ b/icons/zoomIn.png diff --git a/icons/zoomOut.png b/icons/zoomOut.png Binary files differnew file mode 100644 index 0000000..6c60a02 --- /dev/null +++ b/icons/zoomOut.png diff --git a/icons/zoomReset.png b/icons/zoomReset.png Binary files differnew file mode 100644 index 0000000..62fc917 --- /dev/null +++ b/icons/zoomReset.png diff --git a/light.css b/light.css new file mode 100644 index 0000000..be46e4d --- /dev/null +++ b/light.css @@ -0,0 +1,568 @@ +QMainWindow { + background-color:#f0f0f0; +} +QDockWidget { + background-color:rgb(222,192,222); +} +QDialog { + background-color:#f0f0f0; +} +QColorDialog { + background-color:#f0f0f0; +} +QLabel { + color:rgb(17,17,17); +} +QLineEdit { + background-color:rgb(255,255,255); + selection-background-color:rgb(236,116,64); + color:rgb(17,17,17); +} +QTextEdit { + border-width: 1px; + border-style: solid; + border-color:transparent; + color:rgb(17,17,17); + selection-background-color:rgb(236,116,64); +} +QPlainTextEdit { + border-width: 1px; + border-style: solid; + border-color:transparent; + color:rgb(17,17,17); + selection-background-color:rgb(236,116,64); +} +QPushButton{ + color:rgb(17,17,17); + border-width: 1px; + border-radius: 6px; + border-bottom-color: rgb(150,150,150); + border-right-color: rgb(165,165,165); + border-left-color: rgb(165,165,165); + border-top-color: rgb(180,180,180); + border-style: solid; + padding: 4px; + background-color: qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(220, 220, 220, 255), stop:1 rgba(255, 255, 255, 255)); +} +QPushButton:hover{ + color:rgb(17,17,17); + border-width: 1px; + border-radius:6px; + + border-top-color: rgb(255,150,60); + border-right-color: qlineargradient(spread:pad, x1:0, y1:1, x2:1, y2:0, stop:0 rgba(200, 70, 20, 255), stop:1 rgba(255,150,60, 255)); + border-left-color: qlineargradient(spread:pad, x1:1, y1:0, x2:0, y2:0, stop:0 rgba(200, 70, 20, 255), stop:1 rgba(255,150,60, 255)); + border-bottom-color: rgb(200,70,20); + border-style: solid; + padding: 2px; + background-color: qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(220, 220, 220, 255), stop:1 rgba(255, 255, 255, 255)); +} +QPushButton:default{ + color:rgb(17,17,17); + border-width: 1px; + border-radius:6px; + border-top-color: rgb(255,150,60); + border-right-color: qlineargradient(spread:pad, x1:0, y1:1, x2:1, y2:0, stop:0 rgba(200, 70, 20, 255), stop:1 rgba(255,150,60, 255)); + border-left-color: qlineargradient(spread:pad, x1:1, y1:0, x2:0, y2:0, stop:0 rgba(200, 70, 20, 255), stop:1 rgba(255,150,60, 255)); + border-bottom-color: rgb(200,70,20); + border-style: solid; + padding: 2px; + background-color: qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(220, 220, 220, 255), stop:1 rgba(255, 255, 255, 255)); +} +QPushButton:pressed{ + color:rgb(17,17,17); + border-width: 1px; + border-radius: 6px; + border-width: 1px; + border-top-color: rgba(255,150,60,200); + border-right-color: qlineargradient(spread:pad, x1:0, y1:1, x2:1, y2:0, stop:0 rgba(200, 70, 20, 255), stop:1 rgba(255,150,60, 200)); + border-left-color: qlineargradient(spread:pad, x1:1, y1:0, x2:0, y2:0, stop:0 rgba(200, 70, 20, 255), stop:1 rgba(255,150,60, 200)); + border-bottom-color: rgba(200,70,20,200); + border-style: solid; + padding: 2px; + background-color: qlineargradient(spread:pad, x1:0.5, y1:0, x2:0.5, y2:1, stop:0 rgba(220, 220, 220, 255), stop:1 rgba(255, 255, 255, 255)); +} +QPushButton:disabled{ + color:rgb(174,167,159); + border-width: 1px; + border-radius: 6px; + background-color: qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(200, 200, 200, 255), stop:1 rgba(230, 230, 230, 255)); +} +QProgressBar { + text-align: center; + color: rgb(0, 0, 0); + border-width: 1px; + border-radius: 10px; + border-style: inset; + border-color: rgb(150,150,150); + background-color:rgb(221,221,219); +} +QProgressBar::chunk:horizontal { + background-color: qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(225, 108, 54, 255), stop:1 rgba(246, 134, 86, 255)); + border-style: solid; + border-radius:8px; + border-width:1px; + border-bottom-color:qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(175,85,48,255), stop:1 rgba(236,114,67, 255)); + border-top-color:qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(253,156,113,255), stop:1 rgba(205,90,46, 255)); + border-right-color:qlineargradient(spread:pad, x1:0, y1:0.5, x2:1, y2:0.5, stop:0 rgba(253,156,113,255), stop:1 rgba(205,90,46, 255)); + border-left-color:qlineargradient(spread:pad, x1:1, y1:0.5, x2:0, y2:0.5, stop:0 rgba(253,156,113,255), stop:1 rgba(205,90,46, 255)); +} +QTabWidget { + color:rgb(0,0,0); + background-color:rgb(247,246,246); +} +QTabWidget::pane { + border-color: rgb(180,180,180); + background-color:rgb(247,246,246); + border-style: solid; + border-width: 1px; + border-radius: 6px; +} +QTabBar::tab { + padding-left:4px; + padding-right:4px; + padding-bottom:2px; + padding-top:2px; + color:rgb(81,72,65); + background-color: qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(221,218,217,255), stop:1 rgba(240,239,238,255)); + border-style: solid; + border-width: 1px; + border-top-right-radius:4px; + border-top-left-radius:4px; + border-top-color: rgb(180,180,180); + border-left-color: rgb(180,180,180); + border-right-color: rgb(180,180,180); + border-bottom-color: transparent; +} +QTabBar::tab:selected, QTabBar::tab:last:selected, QTabBar::tab:hover { + background-color:rgb(247,246,246); + margin-left: 0px; + margin-right: 1px; +} +QTabBar::tab:!selected { + margin-top: 1px; + margin-right: 1px; +} +QMenuBar { + color:rgb(223,219,210); + background-color:rgb(65,64,59); +} +QMenuBar::item { + padding-top:4px; + padding-left:4px; + padding-right:4px; + color:rgb(223,219,210); + background-color:rgb(65,64,59); +} +QMenuBar::item:selected { + color:rgb(255,255,255); + padding-top:2px; + padding-left:2px; + padding-right:2px; + border-top-width:2px; + border-left-width:2px; + border-right-width:2px; + border-top-right-radius:4px; + border-top-left-radius:4px; + border-style:solid; + background-color:rgb(65,64,59); + border-top-color: rgb(47,47,44); + border-right-color: qlineargradient(spread:pad, x1:0, y1:1, x2:1, y2:0, stop:0 rgba(90, 87, 78, 255), stop:1 rgba(47,47,44, 255)); + border-left-color: qlineargradient(spread:pad, x1:1, y1:0, x2:0, y2:0, stop:0 rgba(90, 87, 78, 255), stop:1 rgba(47,47,44, 255)); +} +QMenu::item:selected { + color:rgb(255,255,255); + background-color: qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(225, 108, 54, 255), stop:1 rgba(246, 134, 86, 255)); + border-style:solid; + border-width:3px; + padding-left:17px; + padding-top:4px; + padding-bottom:4px; + padding-right:7px; + border-bottom-color:qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(175,85,48,255), stop:1 rgba(236,114,67, 255)); + border-top-color:qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(253,156,113,255), stop:1 rgba(205,90,46, 255)); + border-right-color:qlineargradient(spread:pad, x1:0, y1:0.5, x2:1, y2:0.5, stop:0 rgba(253,156,113,255), stop:1 rgba(205,90,46, 255)); + border-left-color:qlineargradient(spread:pad, x1:1, y1:0.5, x2:0, y2:0.5, stop:0 rgba(253,156,113,255), stop:1 rgba(205,90,46, 255)); +} +QMenu::item { + color:rgb(223,219,210); + padding-left:20px; + padding-top:4px; + padding-bottom:4px; + padding-right:10px; +} +QMenu { + color:rgb(223,219,210); + background-color:rgb(65,64,59); +} +QCheckBox { + padding:2px; +} +QCheckBox:hover { + border-radius:4px; + border-style:solid; + border-width:1px; + padding-left: 1px; + padding-right: 1px; + padding-bottom: 1px; + padding-top: 1px; + border-color: rgb(255,150,60); + background-color:qlineargradient(spread:pad, x1:0.5, y1:1, x2:0.5, y2:0, stop:0 rgba(190, 90, 50, 50), stop:1 rgba(250, 130, 40, 50)); +} +QCheckBox::indicator:checked { + border-radius:4px; + border-style:solid; + border-width:1px; + border-color: rgb(246, 134, 86); + background-color:rgb(246, 134, 86) +} +QCheckBox::indicator:unchecked { + border-radius:4px; + border-style:solid; + border-width:1px; + border-color:rgb(246, 134, 86); + background-color:rgb(255,255,255); +} +QRadioButton { + padding: 1px; +} +QRadioButton::indicator:checked { + height: 10px; + width: 10px; + border-style:solid; + border-radius:5px; + border-width: 1px; + border-color: rgba(246, 134, 86, 255); + color: #a9b7c6; + background-color:rgba(246, 134, 86, 255); +} +QRadioButton::indicator:!checked { + height: 10px; + width: 10px; + border-style:solid; + border-radius:5px; + border-width: 1px; + border-color: rgb(246, 134, 86); + color: #a9b7c6; + background-color: transparent; +} +QStatusBar { + color:rgb(81,72,65); +} +QSpinBox { + color:rgb(81,72,65); + background-color: #ffffff; +} +QDoubleSpinBox { + color:rgb(81,72,65); + background-color: #ffffff; +} +QTimeEdit { + color:rgb(81,72,65); + background-color: #ffffff; +} +QDateTimeEdit { + color:rgb(81,72,65); + background-color: #ffffff; +} +QDateEdit { + color:rgb(81,72,65); + background-color: #ffffff; +} +QComboBox { + color:rgb(81,72,65); + background: #ffffff; +} +QComboBox:editable { + background: #ffffff; + color: rgb(81,72,65); + selection-color:rgb(81,72,65); + selection-background-color: #ffffff; +} +QComboBox QAbstractItemView { + color:rgb(81,72,65); + background: #ffffff; + selection-color: #ffffff; + selection-background-color: rgb(246, 134, 86); +} +QComboBox:!editable:on, QComboBox::drop-down:editable:on { + color: #1e1d23; + background: #ffffff; +} +QFontComboBox { + color:rgb(81,72,65); + background-color: #ffffff; +} +QHeaderView::section { + padding:3px; + margin:0px; + color:#F0F0F0; + border: 1px solid #F0F0F0; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 rgb(222,192,222), stop:1 rgb(222,192,242)); +} +QToolBox { + color:rgb(81,72,65); + background-color: #ffffff; +} +QToolBox::tab { + color:rgb(81,72,65); + background-color: #ffffff; +} +QToolBox::tab:selected { + color:rgb(81,72,65); + background-color: #ffffff; +} +QScrollArea { + color: #FFFFFF; + background-color:#f0f0f0; +} +QSlider::groove { + border-style: solid; + border-width: 1px; + border-color: rgb(207,207,207); +} +QSlider::groove:horizontal { + height: 5px; + background: rgb(246, 134, 86); +} +QSlider::groove:vertical { + width: 5px; + background: rgb(246, 134, 86); +} +QSlider::handle:horizontal { + background: rgb(253,253,253); + border-style: solid; + border-width: 1px; + border-color: rgb(207,207,207); + width: 12px; + margin: -5px 0; + border-radius: 7px; +} +QSlider::handle:vertical { + background: rgb(253,253,253); + border-style: solid; + border-width: 1px; + border-color: rgb(207,207,207); + height: 12px; + margin: 0 -5px; + border-radius: 7px; +} +QSlider::add-page:horizontal { + background: white; +} +QSlider::add-page:vertical { + background: white; +} +QSlider::sub-page:horizontal { + background: rgb(246, 134, 86); +} +QSlider::sub-page:vertical { + background: rgb(246, 134, 86); +} +QScrollBar:horizontal { + max-height: 20px; + border: 1px transparent grey; + margin: 0px 20px 0px 20px; +} +QScrollBar::handle:horizontal { + background: rgb(253,253,253); + border-style: solid; + border-width: 1px; + border-color: rgb(207,207,207); + border-radius: 7px; + min-width: 25px; +} +QScrollBar::handle:horizontal:hover { + background: rgb(253,253,253); + border-style: solid; + border-width: 1px; + border-color: rgb(255,150,60); + border-radius: 7px; + min-width: 25px; +} +QScrollBar::add-line:horizontal { + border: 1px solid; + border-color: rgb(207,207,207); + border-top-right-radius: 7px; + border-top-left-radius: 7px; + border-bottom-right-radius: 7px; + background: rgb(255, 255, 255); + width: 20px; + subcontrol-position: right; + subcontrol-origin: margin; +} +QScrollBar::add-line:horizontal:hover { + border: 1px solid; + border-top-right-radius: 7px; + border-top-left-radius: 7px; + border-bottom-right-radius: 7px; + border-color: rgb(255,150,60); + background: rgb(255, 255, 255); + width: 20px; + subcontrol-position: right; + subcontrol-origin: margin; +} +QScrollBar::add-line:horizontal:pressed { + border: 1px solid grey; + border-top-left-radius: 7px; + border-top-right-radius: 7px; + border-bottom-right-radius: 7px; + background: rgb(231,231,231); + width: 20px; + subcontrol-position: right; + subcontrol-origin: margin; +} +QScrollBar::sub-line:horizontal { + border: 1px solid; + border-color: rgb(207,207,207); + border-top-right-radius: 7px; + border-top-left-radius: 7px; + border-bottom-left-radius: 7px; + background: rgb(255, 255, 255); + width: 20px; + subcontrol-position: left; + subcontrol-origin: margin; +} +QScrollBar::sub-line:horizontal:hover { + border: 1px solid; + border-color: rgb(255,150,60); + border-top-right-radius: 7px; + border-top-left-radius: 7px; + border-bottom-left-radius: 7px; + background: rgb(255, 255, 255); + width: 20px; + subcontrol-position: left; + subcontrol-origin: margin; +} +QScrollBar::sub-line:horizontal:pressed { + border: 1px solid grey; + border-top-right-radius: 7px; + border-top-left-radius: 7px; + border-bottom-left-radius: 7px; + background: rgb(231,231,231); + width: 20px; + subcontrol-position: left; + subcontrol-origin: margin; +} +QScrollBar::left-arrow:horizontal { + border: 1px transparent grey; + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; + width: 6px; + height: 6px; + background: rgb(230,230,230); +} +QScrollBar::right-arrow:horizontal { + border: 1px transparent grey; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; + width: 6px; + height: 6px; + background: rgb(230,230,230); +} +QScrollBar::add-page:horizontal, QScrollBar::sub-page:horizontal { + background: none; +} +QScrollBar:vertical { + max-width: 20px; + border: 1px transparent grey; + margin: 20px 0px 20px 0px; +} +QScrollBar::add-line:vertical { + border: 1px solid; + border-color: rgb(207,207,207); + border-bottom-right-radius: 7px; + border-bottom-left-radius: 7px; + border-top-left-radius: 7px; + background: rgb(255, 255, 255); + height: 20px; + subcontrol-position: bottom; + subcontrol-origin: margin; +} +QScrollBar::add-line:vertical:hover { + border: 1px solid; + border-color: rgb(255,150,60); + border-bottom-right-radius: 7px; + border-bottom-left-radius: 7px; + border-top-left-radius: 7px; + background: rgb(255, 255, 255); + height: 20px; + subcontrol-position: bottom; + subcontrol-origin: margin; +} +QScrollBar::add-line:vertical:pressed { + border: 1px solid grey; + border-bottom-left-radius: 7px; + border-bottom-right-radius: 7px; + border-top-left-radius: 7px; + background: rgb(231,231,231); + height: 20px; + subcontrol-position: bottom; + subcontrol-origin: margin; +} +QScrollBar::sub-line:vertical { + border: 1px solid; + border-color: rgb(207,207,207); + border-top-right-radius: 7px; + border-top-left-radius: 7px; + border-bottom-left-radius: 7px; + background: rgb(255, 255, 255); + height: 20px; + subcontrol-position: top; + subcontrol-origin: margin; +} +QScrollBar::sub-line:vertical:hover { + border: 1px solid; + border-color: rgb(255,150,60); + border-top-right-radius: 7px; + border-top-left-radius: 7px; + border-bottom-left-radius: 7px; + background: rgb(255, 255, 255); + height: 20px; + subcontrol-position: top; + subcontrol-origin: margin; +} +QScrollBar::sub-line:vertical:pressed { + border: 1px solid grey; + border-top-left-radius: 7px; + border-top-right-radius: 7px; + background: rgb(231,231,231); + height: 20px; + subcontrol-position: top; + subcontrol-origin: margin; +} + QScrollBar::handle:vertical { + background: rgb(253,253,253); + border-style: solid; + border-width: 1px; + border-color: rgb(207,207,207); + border-radius: 7px; + min-height: 25px; +} +QScrollBar::handle:vertical:hover { + background: rgb(253,253,253); + border-style: solid; + border-width: 1px; + border-color: rgb(255,150,60); + border-radius: 7px; + min-height: 25px; +} +QScrollBar::up-arrow:vertical { + border: 1px transparent grey; + border-top-left-radius: 3px; + border-top-right-radius: 3px; + width: 6px; + height: 6px; + background: rgb(230,230,230); +} +QScrollBar::down-arrow:vertical { + border: 1px transparent grey; + border-bottom-left-radius: 3px; + border-bottom-right-radius: 3px; + width: 6px; + height: 6px; + background: rgb(230,230,230); +} +QScrollBar::add-page:vertical, QScrollBar::sub-page:vertical { + background: none; +}
\ No newline at end of file @@ -0,0 +1,1188 @@ +<?xml version="1.0" encoding="UTF-8"?> +<ui version="4.0"> + <class>MainWindow</class> + <widget class="QMainWindow" name="MainWindow"> + <property name="geometry"> + <rect> + <x>0</x> + <y>0</y> + <width>1068</width> + <height>810</height> + </rect> + </property> + <property name="windowTitle"> + <string>MainWindow</string> + </property> + <property name="windowIcon"> + <iconset> + <normaloff>icons/logo.png</normaloff>icons/logo.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>24</width> + <height>24</height> + </size> + </property> + <widget class="QWidget" name="centralwidget"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Maximum" vsizetype="Maximum"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <layout class="QGridLayout" name="gridLayout"> + <item row="0" column="0"> + <widget class="QGraphicsView" name="graphicsView"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Expanding" vsizetype="Expanding"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="font"> + <font> + <pointsize>12</pointsize> + </font> + </property> + <property name="mouseTracking"> + <bool>true</bool> + </property> + <property name="acceptDrops"> + <bool>true</bool> + </property> + <property name="autoFillBackground"> + <bool>true</bool> + </property> + <property name="styleSheet"> + <string notr="true"/> + </property> + <property name="verticalScrollBarPolicy"> + <enum>Qt::ScrollBarAsNeeded</enum> + </property> + <property name="horizontalScrollBarPolicy"> + <enum>Qt::ScrollBarAsNeeded</enum> + </property> + <property name="backgroundBrush"> + <brush brushstyle="NoBrush"> + <color alpha="255"> + <red>170</red> + <green>170</green> + <blue>127</blue> + </color> + </brush> + </property> + <property name="foregroundBrush"> + <brush brushstyle="NoBrush"> + <color alpha="255"> + <red>0</red> + <green>0</green> + <blue>0</blue> + </color> + </brush> + </property> + <property name="sceneRect"> + <rectf> + <x>0.000000000000000</x> + <y>0.000000000000000</y> + <width>5000.000000000000000</width> + <height>5000.000000000000000</height> + </rectf> + </property> + <property name="dragMode"> + <enum>QGraphicsView::RubberBandDrag</enum> + </property> + <property name="transformationAnchor"> + <enum>QGraphicsView::AnchorUnderMouse</enum> + </property> + <property name="resizeAnchor"> + <enum>QGraphicsView::AnchorUnderMouse</enum> + </property> + <property name="viewportUpdateMode"> + <enum>QGraphicsView::FullViewportUpdate</enum> + </property> + <property name="optimizationFlags"> + <set>QGraphicsView::DontClipPainter</set> + </property> + </widget> + </item> + <item row="1" column="0"> + <widget class="QDockWidget" name="dockWidget_2"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>109</width> + <height>150</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>524287</width> + <height>150</height> + </size> + </property> + <property name="allowedAreas"> + <set>Qt::BottomDockWidgetArea</set> + </property> + <property name="windowTitle"> + <string>Message Browser</string> + </property> + <widget class="QWidget" name="dockWidgetContents_2"> + <layout class="QVBoxLayout" name="verticalLayout_2"> + <item> + <widget class="QTextEdit" name="textBrowser"/> + </item> + </layout> + </widget> + </widget> + </item> + </layout> + </widget> + <widget class="QMenuBar" name="menubar"> + <property name="geometry"> + <rect> + <x>0</x> + <y>0</y> + <width>1068</width> + <height>21</height> + </rect> + </property> + <widget class="QMenu" name="menuFile"> + <property name="title"> + <string>File</string> + </property> + <addaction name="actionNew_Flowsheet"/> + </widget> + <widget class="QMenu" name="menuEdit"> + <property name="title"> + <string>Edit</string> + </property> + </widget> + <widget class="QMenu" name="menuView"> + <property name="title"> + <string>View</string> + </property> + <addaction name="actionZoomIn"/> + <addaction name="actionZoomOut"/> + <addaction name="actionResetZoom"/> + </widget> + <widget class="QMenu" name="menuSimulation"> + <property name="title"> + <string>Simulation</string> + </property> + <addaction name="actionEquation_oriented"/> + <addaction name="actionSequential_mode"/> + </widget> + <widget class="QMenu" name="menuComponds"> + <property name="title"> + <string>Compounds</string> + </property> + <addaction name="actionSelect_compouns"/> + </widget> + <widget class="QMenu" name="menuHelp"> + <property name="title"> + <string>Help</string> + </property> + <addaction name="actionHelp"/> + </widget> + <addaction name="menuFile"/> + <addaction name="menuEdit"/> + <addaction name="menuView"/> + <addaction name="menuSimulation"/> + <addaction name="menuComponds"/> + <addaction name="menuHelp"/> + </widget> + <widget class="QDockWidget" name="dockWidget"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Fixed" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>270</width> + <height>548</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>270</width> + <height>524287</height> + </size> + </property> + <property name="windowTitle"> + <string>Component Selector</string> + </property> + <attribute name="dockWidgetArea"> + <number>2</number> + </attribute> + <widget class="QWidget" name="dockWidgetContents"> + <layout class="QHBoxLayout" name="horizontalLayout_3"> + <item> + <widget class="QScrollArea" name="scrollArea"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>100</width> + <height>430</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>240</width> + <height>1000</height> + </size> + </property> + <property name="verticalScrollBarPolicy"> + <enum>Qt::ScrollBarAlwaysOn</enum> + </property> + <property name="widgetResizable"> + <bool>true</bool> + </property> + <widget class="QWidget" name="scrollAreaWidgetContents"> + <property name="geometry"> + <rect> + <x>0</x> + <y>0</y> + <width>221</width> + <height>956</height> + </rect> + </property> + <layout class="QVBoxLayout" name="verticalLayout_5"> + <item> + <widget class="QLabel" name="label_2"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>30</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>16777215</height> + </size> + </property> + <property name="font"> + <font> + <pointsize>18</pointsize> + <weight>75</weight> + <bold>true</bold> + </font> + </property> + <property name="layoutDirection"> + <enum>Qt::LeftToRight</enum> + </property> + <property name="styleSheet"> + <string notr="true">color:rgb(73,36,73,255)</string> + </property> + <property name="text"> + <string>Streams</string> + </property> + <property name="alignment"> + <set>Qt::AlignCenter</set> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Fixed" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + <italic>true</italic> + </font> + </property> + <property name="acceptDrops"> + <bool>true</bool> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left;</string> + </property> + <property name="text"> + <string>MatStm</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/MatStm.png</normaloff>icons/MatStm.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QLabel" name="label_3"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>30</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>16777215</height> + </size> + </property> + <property name="font"> + <font> + <pointsize>18</pointsize> + <weight>75</weight> + <bold>true</bold> + </font> + </property> + <property name="layoutDirection"> + <enum>Qt::LeftToRight</enum> + </property> + <property name="styleSheet"> + <string notr="true">color:rgb(73,36,73,255)</string> + </property> + <property name="text"> + <string>Mixer/Splitter</string> + </property> + <property name="alignment"> + <set>Qt::AlignCenter</set> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_7"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Fixed" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Mixer</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/Mixer.png</normaloff>icons/Mixer.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_10"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Splitter</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/Splitter.png</normaloff>icons/Splitter.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QLabel" name="label"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>30</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>16777215</height> + </size> + </property> + <property name="font"> + <font> + <pointsize>18</pointsize> + <weight>75</weight> + <bold>true</bold> + </font> + </property> + <property name="layoutDirection"> + <enum>Qt::LeftToRight</enum> + </property> + <property name="styleSheet"> + <string notr="true">color:rgb(73,36,73,255)</string> + </property> + <property name="text"> + <string>Exchangers</string> + </property> + <property name="alignment"> + <set>Qt::AlignCenter</set> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_11"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Heater</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/Heater.png</normaloff>icons/Heater.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_12"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Cooler</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/Cooler.png</normaloff>icons/Cooler.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QLabel" name="label_4"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>30</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>16777215</height> + </size> + </property> + <property name="font"> + <font> + <pointsize>18</pointsize> + <weight>75</weight> + <bold>true</bold> + </font> + </property> + <property name="layoutDirection"> + <enum>Qt::LeftToRight</enum> + </property> + <property name="styleSheet"> + <string notr="true">color:rgb(73,36,73,255)</string> + </property> + <property name="text"> + <string>Separator</string> + </property> + <property name="alignment"> + <set>Qt::AlignCenter</set> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_9"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Expanding"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Flash</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/Flash.png</normaloff>icons/Flash.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_13"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Component Seperator</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/CompSep.png</normaloff>icons/CompSep.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QLabel" name="label_5"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>30</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>16777215</height> + </size> + </property> + <property name="font"> + <font> + <pointsize>15</pointsize> + <weight>75</weight> + <bold>true</bold> + </font> + </property> + <property name="styleSheet"> + <string notr="true">color:rgb(73,36,73,255)</string> + </property> + <property name="text"> + <string>Pressure Changers</string> + </property> + <property name="alignment"> + <set>Qt::AlignCenter</set> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_25"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Valve</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/Valve.png</normaloff>icons/Valve.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_14"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Centrifugal Pump</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/Pump.png</normaloff>icons/Pump.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_15"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Adiabatic Compressor</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/AdiaComp.png</normaloff>icons/AdiaComp.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_16"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="autoFillBackground"> + <bool>false</bool> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Adiabatic Expander</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/AdiaExp.png</normaloff>icons/AdiaExp.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QLabel" name="label_6"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>30</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>16777215</height> + </size> + </property> + <property name="font"> + <font> + <pointsize>18</pointsize> + <weight>75</weight> + <bold>true</bold> + </font> + </property> + <property name="styleSheet"> + <string notr="true">color:rgb(73,36,73,255)</string> + </property> + <property name="text"> + <string>Columns</string> + </property> + <property name="alignment"> + <set>Qt::AlignCenter</set> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_26"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>50</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Distillation Column</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/DistCol.png</normaloff>icons/DistCol.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_18"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Preferred" vsizetype="Preferred"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>50</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>200</width> + <height>16777215</height> + </size> + </property> + <property name="font"> + <font> + <family>Comic Sans MS</family> + <pointsize>11</pointsize> + </font> + </property> + <property name="styleSheet"> + <string notr="true">Text-align:left</string> + </property> + <property name="text"> + <string>Shortcut Column</string> + </property> + <property name="icon"> + <iconset> + <normaloff>icons/ShortCol.png</normaloff>icons/ShortCol.png</iconset> + </property> + <property name="iconSize"> + <size> + <width>50</width> + <height>50</height> + </size> + </property> + </widget> + </item> + </layout> + </widget> + </widget> + </item> + </layout> + </widget> + </widget> + <widget class="QToolBar" name="toolBar"> + <property name="windowTitle"> + <string>toolBar</string> + </property> + <property name="styleSheet"> + <string notr="true"/> + </property> + <attribute name="toolBarArea"> + <enum>TopToolBarArea</enum> + </attribute> + <attribute name="toolBarBreak"> + <bool>false</bool> + </attribute> + <addaction name="actionNew_Flowsheet"/> + <addaction name="separator"/> + <addaction name="actionZoomIn"/> + <addaction name="actionZoomOut"/> + <addaction name="actionResetZoom"/> + <addaction name="separator"/> + <addaction name="actionEquation_oriented"/> + <addaction name="actionSequential_mode"/> + <addaction name="separator"/> + <addaction name="actionSelect_compouns"/> + </widget> + <action name="actionZoomIn"> + <property name="icon"> + <iconset> + <normaloff>icons/zoomIn.png</normaloff>icons/zoomIn.png</iconset> + </property> + <property name="text"> + <string>ZoomIn</string> + </property> + </action> + <action name="actionZoomOut"> + <property name="icon"> + <iconset> + <normaloff>icons/zoomOut.png</normaloff>icons/zoomOut.png</iconset> + </property> + <property name="text"> + <string>ZoomOut</string> + </property> + </action> + <action name="actionResetZoom"> + <property name="icon"> + <iconset> + <normaloff>icons/zoomReset.png</normaloff>icons/zoomReset.png</iconset> + </property> + <property name="text"> + <string>ResetZoom</string> + </property> + </action> + <action name="actionEquation_oriented"> + <property name="icon"> + <iconset> + <normaloff>icons/Equation.png</normaloff>icons/Equation.png</iconset> + </property> + <property name="text"> + <string>Equation oriented</string> + </property> + </action> + <action name="actionSequential_mode"> + <property name="icon"> + <iconset> + <normaloff>icons/Sequential.png</normaloff>icons/Sequential.png</iconset> + </property> + <property name="text"> + <string>Sequential mode</string> + </property> + </action> + <action name="actionSelect_compouns"> + <property name="icon"> + <iconset> + <normaloff>icons/compoundSelector.png</normaloff>icons/compoundSelector.png</iconset> + </property> + <property name="text"> + <string>Select Compounds</string> + </property> + </action> + <action name="actionNew_Flowsheet"> + <property name="icon"> + <iconset> + <normaloff>icons/new.svg</normaloff>icons/new.svg</iconset> + </property> + <property name="text"> + <string>New</string> + </property> + </action> + <action name="actionHelp"> + <property name="text"> + <string>Help</string> + </property> + </action> + <action name="actionSave"> + <property name="text"> + <string>save</string> + </property> + </action> + </widget> + <resources/> + <connections/> +</ui> diff --git a/mainApp.py b/mainApp.py new file mode 100644 index 0000000..9869621 --- /dev/null +++ b/mainApp.py @@ -0,0 +1,561 @@ +from functools import partial +from collections import defaultdict +import sys +import numpy as np +from OMChem.Flowsheet import Flowsheet +from OMChem.MatStm import MatStm +from OMChem.Mixer import Mixer +from OMChem.Heater import Heater +from OMChem.Splitter import Splitter +import pandas as pd +from PyQt5.QtCore import * +from PyQt5.QtWidgets import * +from PyQt5.QtGui import QTextDocument ,QTextCursor ,QTextCharFormat ,QFont ,QPixmap +from PyQt5.uic import loadUiType +from PyQt5.QtCore import Qt +from PyQt5.QtWidgets import QGraphicsProxyWidget, QGraphicsObject, QGraphicsEllipseItem ,QGraphicsPixmapItem,QApplication, QGraphicsView, QGraphicsScene, QHBoxLayout, QWidget, QLabel +from PyQt5.QtGui import QBrush ,QTransform ,QMouseEvent +import PyQt5.QtGui as QtGui +import PyQt5.QtCore as QtCore +import PyQt5.QtWidgets as QtWidgets +from component_selector import componentSelector +from component_selector import * +from dockWidget import dockWidget +from resDockWidget import resdockWidget +from helper import helperFunc +import datetime +from container import Container +ui,_ = loadUiType('main.ui') +#comp_dict is a dictionary in which keys are the type of component and value is a list [counter_of_that_particular_type ,Number of ip,Number of op] +comp_dict ={'MatStm':[1,1,1],'EngStm':[1,1,1],'Mixer':[1,4,1],'Splitter':[1,1,4],'Flash':[1,1,2],'Heater':[1,1,1],'Valve':[1,1,1],'Cooler':[1,1,1],'CompSep':[1,1,2],'Pump':[1,1,1],'AdiaComp':[1,1,1],'AdiaExp':[1,1,1],'DistCol':[1,2,2],'ShortCol':[1,1,2]} + +''' + MainApp class is responsible for all the main App Ui operations +''' +class MainApp(QMainWindow,ui): + def __init__(self): + QMainWindow.__init__(self) + self.setupUi(self) + style = open('light.css','r') + style = style.read() + + self.zoomcount = 0 + self.Container = Container(self.textBrowser) + self.setStyleSheet(style) + self.comp =componentSelector(self) + self.scene = QGraphicsScene() + self.scene.setItemIndexMethod(QGraphicsScene.BspTreeIndex) + self.graphicsView.setScene(self.scene) + self.graphicsView.setMouseTracking(True) + self.comp.show() + self.setDockNestingEnabled(True) + self.setCorner(Qt.BottomRightCorner, Qt.RightDockWidgetArea) + self.setCorner(Qt.BottomLeftCorner, Qt.LeftDockWidgetArea) + self.addDockWidget(Qt.BottomDockWidgetArea,self.dockWidget_2) + self.buttonHandler() + self.menuBar() + self.graphicsView.keyPressEvent=self.deleteCall + + + ''' + MenuBar function handels all the all the operations of + menu bar like,new,zoom,comounds selector,Simulation options. + ''' + def menuBar(self): + self.actionSelect_compouns.triggered.connect(self.selectCompounds) + self.actionZoomIn.triggered.connect(self.zoomin) + self.actionNew_Flowsheet.triggered.connect(self.new) + self.actionZoomOut.triggered.connect(self.zoomout) + self.actionResetZoom.triggered.connect(self.zoomReset) + self.actionHelp.triggered.connect(self.help) + self.actionSequential_mode.triggered.connect(partial(self.simulate,'SM')) + self.actionEquation_oriented.triggered.connect(partial(self.simulate,'EQN')) + + ''' + Handles all the buttons of different components. + ''' + def buttonHandler(self): + self.pushButton.clicked.connect(partial(self.component,'MatStm')) + self.pushButton_7.clicked.connect(partial(self.component,'Mixer')) + self.pushButton_14.clicked.connect(partial(self.component,'Pump')) + self.pushButton_26.clicked.connect(partial(self.component,'DistCol')) + self.pushButton_18.clicked.connect(partial(self.component,'ShortCol')) + self.pushButton_11.clicked.connect(partial(self.component,'Heater')) + self.pushButton_10.clicked.connect(partial(self.component,'Splitter')) + self.pushButton_9.clicked.connect(partial(self.component,'Flash')) + self.pushButton_25.clicked.connect(partial(self.component,'Valve')) + self.pushButton_12.clicked.connect(partial(self.component,'Cooler')) + self.pushButton_13.clicked.connect(partial(self.component,'CompSep')) + self.pushButton_15.clicked.connect(partial(self.component,'AdiaComp')) + self.pushButton_16.clicked.connect(partial(self.component,'AdiaExp')) + + ''' + Displays help box + ''' + def help(self): + msgBox = QMessageBox() + msgBox.setIcon(QMessageBox.Question) + msgBox.setTextFormat(Qt.RichText); + msgBox.setText("For any Help or Suggestion you can contact us at\n contact-om@fossee.in or at <a href='https://www.fossee.in'>Visit fossee.in!</a>") + msgBox.setStandardButtons(QMessageBox.Ok) + msgBox.exec_() + + ''' + Shows Compounds Selector Dialog + ''' + def selectCompounds(self): + self.comp.show() + + ''' + Returns currenttime in a required particular format + ''' + def currentTime(self): + now = datetime.datetime.now() + time = str(now.hour) + ":" + str(now.minute) + ":" +str(now.second) + return time + + ''' + Simulate function is responsible forthe simulation + of the designed flowsheet in a particular mode + selected by the user. + ''' + def simulate(self,mode): + self.Container.simulate(mode) + self.dockWidget_2.show() + self.res = resdockWidget(self.Container) + self.addDockWidget(Qt.LeftDockWidgetArea, self.res) + self.res.show() + + ''' + Resets the zoom level to default scalling + ''' + def zoomReset(self): + if(self.zoomcount>0): + for i in range(self.zoomcount): + self.zoomout() + elif(self.zoomcount<0): + for i in range(abs(self.zoomcount)): + self.zoomin() + + ''' + ZoomOut the canvas + ''' + def zoomout(self): + self.graphicsView.scale(1.0/1.15,1.0/1.15) + self.zoomcount -=1 + + ''' + ZoomIn the canvas + ''' + def zoomin(self): + self.graphicsView.scale(1.15,1.15) + self.zoomcount +=1 + + ''' + Instanciate a NodeItem object for selected type of + component and added that on canvas/flowsheeting area. + ''' + def component(self,conntype): + if(self.comp.isCompSelected()): + box=None + box = NodeItem(conntype,self.Container) + print(box) + self.scene.addItem(box) + box.setPos(2500-30, 2500-30) + else: + QMessageBox.about(self, 'Important', "Please Select Compounds first") + + ''' + New is used to delete all the existing work. + ''' + def new(self): + l=self.scene.items() + compound_selected.clear() + self.comp.tableWidget.setRowCount(0) + self.delete(l) + self.textBrowser.append("<span>["+str(self.currentTime())+"] <b>New</b> flowsheet is created ... </span>") + self.comp.show() + + ''' + handels all the operations which will happen when delete button is called. + ''' + def deleteCall(self,event): + try: + if event.key() == QtCore.Qt.Key_Delete: + l=self.scene.selectedItems() + self.delete(l) + except Exception as e: + print(e) + + ''' + deletes the selected item from the canvas and also the objects + created for that type. + ''' + def delete(self,l): + for item in l: + self.scene.removeItem(item) + if hasattr(item,'Input'): + for x in item.Input: + if x.newLine: + + self.scene.removeItem(x.newLine) + del x.newLine + + if x.otherLine: + + self.scene.removeItem(x.otherLine) + del x.otherLine + if hasattr(item,'Output'): + for x in item.Output: + if x.newLine: + + self.scene.removeItem(x.newLine) + del x.newLine + + if x.otherLine: + + self.scene.removeItem(x.otherLine) + del x.otherLine + if hasattr(item,'obj'): + self.Container.unitOp.remove(item.obj) + for k in list(self.Container.conn): + if item.obj==k: + del self.Container.conn[k] + + elif item.obj in self.Container.conn[k]: + self.Container.conn[k].remove(item.obj) + self.textBrowser.append("<span style=\"color:blue\">["+str(self.currentTime())+"]<b> "+item.obj.name+" </b>is deleted .""</span>") + del item.obj + del item + + +''' +============================================================ +--- GRAPHICS CLASSES +============================================================ +''' +class NodeLine(QtWidgets.QGraphicsPathItem): + def __init__(self, pointA, pointB , socket): + super(NodeLine, self).__init__() + self._pointA = pointA + self._pointB = pointB + self.socket = socket + self._source = None + self._target = None + self.setZValue(-1) + self.setBrush(QtGui.QColor(0,0,255,255)) + self.pen = QtGui.QPen() + + self.pen.setStyle(QtCore.Qt.SolidLine) + self.pen.setWidth(1) + self.pen.setColor(QtGui.QColor(0,0,255,255)) + self.setPen(self.pen) + + def updatePath(self): + path = QtGui.QPainterPath() + path.moveTo(self.pointA) + midptx = 0.5*(self.pointA.x() + self.pointB.x()) + + + ctrl1_1 = QtCore.QPointF(self.pointA.x(), self.pointA.y()) + ctrl2_1 = QtCore.QPointF(self.pointA.x(), self.pointA.y()) + pt1 = QtCore.QPointF(midptx , self.pointA.y()) + path.cubicTo(ctrl1_1, ctrl2_1, pt1) + + path.moveTo(pt1) + + ctrl1_2 = QtCore.QPointF(midptx, self.pointB.y()) + ctrl2_2 = QtCore.QPointF(midptx, self.pointB.y()) + pt2 = QtCore.QPointF(midptx , self.pointB.y()) + path.cubicTo(ctrl1_2, ctrl2_2, pt2) + path.moveTo(pt2) + + ctrl1_3 = QtCore.QPointF(midptx, self.pointB.y()) + ctrl2_3 = QtCore.QPointF(midptx, self.pointB.y()) + path.cubicTo(ctrl1_3, ctrl2_3, self.pointB) + self.setPath(path) + def paint(self, painter, option, widget): + painter.setPen(self.pen) + painter.drawPath(self.path()) + + @property + def pointA(self): + #print('a') + return self._pointA + + @pointA.setter + def pointA(self, point): + #print('seta') + self._pointA = point + self.updatePath() + + @property + def pointB(self): + #print('b') + return self._pointB + + @pointB.setter + def pointB(self, point): + #print('set b') + self._pointB = point + self.updatePath() + + @property + def source(self): + #print('source') + return self._source + + @source.setter + def source(self, widget): + #print('set source') + self._source = widget + + @property + def target(self): + #print('target') + return self._target + + @target.setter + def target(self, widget): + #print('set target') + self._target = widget + + def __delete__(self,instance): + del self._source + del self._target + del self._pointA + del self._pointB + +class NodeSocket(QtWidgets.QGraphicsItem): + def __init__(self, rect, parent, socketType,container): + super(NodeSocket, self).__init__(parent) + self.rect = rect + self.type = socketType + self.parent=parent + self.container=container + self.newLine=None + self.otherLine=None + + # Brush. + self.brush = QtGui.QBrush() + self.brush.setStyle(QtCore.Qt.SolidPattern) + self.brush.setColor(QtGui.QColor(180,20,90,255)) + # Pen. + self.pen = QtGui.QPen() + self.pen.setStyle(QtCore.Qt.SolidLine) + self.pen.setWidth(1) + self.pen.setColor(QtGui.QColor(20,20,20,255)) + + # Lines. + self.outLines = [] + self.inLines = [] + + def shape(self): + path = QtGui.QPainterPath() + path.addEllipse(self.boundingRect()) + return path + + def boundingRect(self): + return QtCore.QRectF(self.rect) + + def paint(self, painter, option, widget): + painter.setBrush(self.brush) + painter.setPen(self.pen) + painter.drawEllipse(self.rect) + + def mousePressEvent(self, event): + if self.type == 'op': + rect = self.boundingRect() + pointA = QtCore.QPointF(rect.x() + rect.width()/2, rect.y() + rect.height()/2) + pointA = self.mapToScene(pointA) + pointB = self.mapToScene(event.pos()) + self.newLine = NodeLine(pointA, pointB ,'op') + self.outLines.append(self.newLine) + self.scene().addItem(self.newLine) + elif self.type == 'in': + rect = self.boundingRect() + pointA = self.mapToScene(event.pos()) + pointB = QtCore.QPointF(rect.x() + rect.width()/2, rect.y() + rect.height()/2) + pointB = self.mapToScene(pointB) + self.newLine = NodeLine(pointA, pointB, 'in') + self.inLines.append(self.newLine) + self.scene().addItem(self.newLine) + else: + super(NodeSocket, self).mousePressEvent(event) + + def mouseMoveEvent(self, event): + if self.type == 'op': + pointB = self.mapToScene(event.pos()) + self.newLine.pointB = pointB + if self.otherLine: + self.otherLine.pointB=pointB + + elif self.type == 'in': + pointA = self.mapToScene(event.pos()) + self.newLine.pointA = pointA + if self.otherLine: + self.otherLine.pointA=pointA + else: + super(NodeSocket, self).mouseMoveEvent(event) + + def mouseReleaseEvent(self, event): + item = self.scene().itemAt(event.scenePos().toPoint(),QtGui.QTransform()) + item.otherLine=self.newLine + if (self.type == 'op') and (item.type == 'in'): + self.newLine.source = self + self.newLine.target = item + item.inLines.append(self.newLine) + self.newLine.pointB = item.getCenter() + self.container.updateConn(self.newLine.source.parent.obj,self.newLine.target.parent.obj) + elif (self.type =='in') and (item.type == 'op'): + self.newLine.source = item + self.newLine.target = self + item.outLines.append(self.newLine) + self.newLine.pointA = item.getCenter() + self.container.updateConn(self.newLine.source.parent.obj,self.newLine.target.parent.obj) + else: + self.scene().removeItem(self.newLine) + if(self.newLine in self.inLines): + self.inLines.remove(self.newLine) + if(self.newLine in self.outLines): + self.outLines.remove(self.newLine) + del self.newLine + super(NodeSocket, self).mouseReleaseEvent(event) + + def getCenter(self): + rect = self.boundingRect() + center = QtCore.QPointF(rect.x() + rect.width()/2, rect.y() + rect.height()/2) + center = self.mapToScene(center) + return center + + +class NodeItem(QtWidgets.QGraphicsItem): + def __init__(self,comptype,container): + l = ['Mixer','Splitter'] + super(NodeItem, self).__init__() + self.name = comptype + str(comp_dict[comptype][0]) + self.type = comptype + + self.setToolTip(self.name) + self.nin = comp_dict[comptype][1] + self.nop = comp_dict[comptype][2] + self.obj = helperFunc(self.type,self.name,comp_dict[comptype][0]) + self.container=container + self.container.addUnitOp(self.obj) + if(self.type not in l): + self.mainwindow=findMainWindow() + self.dockWidget=dockWidget(self.name,self.type,self.obj) + self.mainwindow.addDockWidget(Qt.LeftDockWidgetArea, self.dockWidget) + self.dockWidget.hide() + + comp_dict[comptype][0]+=1 + self.pic=QtGui.QPixmap("icons/"+self.type+".png") + self.rect = QtCore.QRect(0,0,self.pic.width(),self.pic.height()) + self.text = QGraphicsTextItem(self) + f = QFont() + f.setPointSize(8) + self.text.setFont(f) + self.text.setDefaultTextColor(QtGui.QColor(73,36,73,255)) + self.text.setParentItem(self) + self.text.setPos(-2.5, self.rect.height()-15) + self.text.setPlainText(self.name) + + #self.text.setPlainText(self.name) + self.setFlag(QtWidgets.QGraphicsPixmapItem.ItemIsMovable) + self.setFlag(QtWidgets.QGraphicsPixmapItem.ItemIsSelectable) + self.initUi() + + # Brush + self.brush = QtGui.QBrush() + self.brush.setStyle(QtCore.Qt.SolidPattern) + self.brush.setColor(QtGui.QColor(80,0,90,255)) + # Pen. + self.pen = QtGui.QPen() + self.pen.setStyle(QtCore.Qt.SolidLine) + self.pen.setWidth(1) + self.pen.setColor(QtGui.QColor(20,20,20,255)) + + self.selPen = QtGui.QPen() + self.selPen.setStyle(QtCore.Qt.SolidLine) + self.selPen.setWidth(2) + self.selPen.setColor(QtGui.QColor(222,192,222)) + + def initUi(self): + self.Input , self.Output = self.initializeSockets(self.type) + + def shape(self): + path = QtGui.QPainterPath() + path.addRect(self.boundingRect()) + return path + + def boundingRect(self): + return QtCore.QRectF(self.rect) + + def paint(self, painter, option, widget): + if self.isSelected(): + painter.setPen(self.selPen) + painter.drawRect(QtCore.QRectF(self.rect)) + else: + painter.setPen(self.pen) + + painter.drawPixmap(self.rect,self.pic) + + def initializeSockets(self,type): + if(self.type=="Flash" or self.type=="CompSep"): + Input = [NodeSocket(QtCore.QRect(-2.5+5.5,(self.rect.height()*x/(self.nin+1))-8,4,4), self, 'in',self.container) for x in range(1,self.nin+1) ] + Output = [NodeSocket(QtCore.QRect(self.rect.width()-7.5,(self.rect.height()*x*0.90/(self.nop+1))-4,4,4), self, 'op',self.container) for x in range(1,self.nop+1)] + return Input,Output + elif(self.type=="AdiaComp" or self.type=="AdiaExp" or self.type =="Mixer" or self.type =="Splitter" or self.type =="Valve" ): + Input = [NodeSocket(QtCore.QRect(-3.5,(self.rect.height()*x/(self.nin+1))-6,4,4), self, 'in',self.container) for x in range(1,self.nin+1) ] + Output = [NodeSocket(QtCore.QRect(self.rect.width()-2.5,(self.rect.height()*x/(self.nop+1))-6,4,4), self, 'op',self.container) for x in range(1,self.nop+1)] + return Input,Output + elif(self.type=="Cooler" or self.type=="Heater"): + Input = [NodeSocket(QtCore.QRect(3.5,(self.rect.height()*x/(self.nin+1))-4,4,4), self, 'in',self.container) for x in range(1,self.nin+1) ] + Output = [NodeSocket(QtCore.QRect(self.rect.width()-8.0,(self.rect.height()*x/(self.nop+1))-4,4,4), self, 'op',self.container) for x in range(1,self.nop+1)] + return Input,Output + + elif(self.type=="Pump"): + Input = [NodeSocket(QtCore.QRect(-2.5,(self.rect.height()*x/(self.nin+1))-10,4,4), self, 'in',self.container) for x in range(1,self.nin+1) ] + Output = [NodeSocket(QtCore.QRect(self.rect.width()-2.5,-2.5,4,4), self, 'op',self.container) for x in range(1,self.nop+1)] + return Input,Output + elif(self.type=="DistCol" or self.type=="ShortCol"): + Input = [NodeSocket(QtCore.QRect(-2.5,(self.rect.height()*x/(self.nin+1))-12,5,5), self, 'in',self.container) for x in range(1,self.nin+1) ] + Output = [NodeSocket(QtCore.QRect(self.rect.width()-5.5,(self.rect.height()*1.44*x/(self.nop+1))-67,5,5), self, 'op',self.container) for x in range(1,self.nop+1)] + return Input,Output + elif(self.type=="MatStm"): + Input = [NodeSocket(QtCore.QRect(-2.5,(self.rect.height()*x/(self.nin+1))-1,4,4), self, 'in',self.container) for x in range(1,self.nin+1) ] + Output = [NodeSocket(QtCore.QRect(self.rect.width()-2.5,(self.rect.height()*x/(self.nin+1))-1,4,4), self, 'op',self.container) for x in range(1,self.nop+1)] + return Input,Output + def mouseMoveEvent(self, event): + super(NodeItem, self).mouseMoveEvent(event) + for output in self.Output: + for line in output.outLines: + line.pointA = line.source.getCenter() + line.pointB = line.target.getCenter() + for input in self.Input: + for line in input.inLines: + line.pointA = line.source.getCenter() + line.pointB = line.target.getCenter() + def mouseDoubleClickEvent(self, event): + self.setPos(event.scenePos().x()-250,event.scenePos().y()) + self.dockWidget.show() + +''' + Global function to find the (open) QMainWindow in application +''' +def findMainWindow(): + app = QApplication.instance() + for widget in app.topLevelWidgets(): + if isinstance(widget, QMainWindow): + return widget + return None + + +def main(): + app = QApplication(sys.argv) + window = MainApp() + window.showMaximized() + app.exec() + +if __name__ == '__main__': + main() @@ -0,0 +1,347 @@ +QWidget#frmLogin,QWidget#frmPopup,QWidget#frmHostInfo,QWidget#frmLogout,QWidget#frmConfig,QWidget#frmData,QWidget#frmDefence,QWidget#frmHost,QWidget#frmMain,QWidget#frmPwd,QWidget#frmSelect,QWidget#frmMessageBox{ + border:1px solid #454648; + border-radius:0px; +} + +.QFrame{ + border:1px solid #B8B8B8; + border-radius:5px; +} + +QWidget#widget_title{ + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +QLabel#lab_Ico,QLabel#lab_Title{ + border-radius:0px; + color: #F0F0F0; + background-color:rgba(0,0,0,0); + border-style:none; +} + +QLineEdit { + border: 1px solid #B8B8B8; + border-radius: 5px; + padding: 2px; + background: none; + selection-background-color: #454648; +} + +QLineEdit[echoMode="2"] { + lineedit-password-character: 9679; +} + +.QGroupBox{ + border: 1px solid #B8B8B8; + border-radius: 5px; +} + +.QPushButton{ + border-style: none; + border: 0px; + color: #F0F0F0; + padding: 5px; + min-height: 20px; + border-radius:5px; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +.QPushButton[focusPolicy="0"] { + border-style: none; + border: 0px; + color: #F0F0F0; + padding: 0px; + min-height: 10px; + border-radius:3px; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +.QPushButton:hover{ + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #B8B8B8, stop:1 #D6D6D6); +} + +.QPushButton:pressed{ + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +QPushButton#btnMenu,QPushButton#btnMenu_Min,QPushButton#btnMenu_Max,QPushButton#btnMenu_Close{ + border-radius:0px; + color: #F0F0F0; + background-color:rgba(0,0,0,0); + border-style:none; +} + +QPushButton#btnMenu:hover,QPushButton#btnMenu_Min:hover,QPushButton#btnMenu_Max:hover{ + background-color: qlineargradient(spread:pad, x1:0, y1:1, x2:0, y2:0, stop:0 rgba(25, 134, 199, 0), stop:1 #B8B8B8); +} + +QPushButton#btnMenu_Close:hover{ + background-color: qlineargradient(spread:pad, x1:0, y1:1, x2:0, y2:0, stop:0 rgba(238, 0, 0, 128), stop:1 rgba(238, 44, 44, 255)); +} + +QCheckBox { + spacing: 2px; +} + +QCheckBox::indicator { + width: 20px; + height: 20px; +} + +QCheckBox::indicator:unchecked { + image: url(:/qss_icons/img_rc/checkbox_unchecked.png); +} + +QCheckBox::indicator:checked { + image: url(:/qss_icons/img_rc/checkbox_checked.png); +} + +QRadioButton { + spacing: 2px; +} + +QRadioButton::indicator { + width: 15px; + height: 15px; +} + +QRadioButton::indicator::unchecked { + image: url(:/qss_icons/img_rc/radio_normal.png); +} + +QRadioButton::indicator::checked { + image: url(:/qss_icons/img_rc/radio_selected.png); +} + +QComboBox,QDateEdit{ + border-radius: 3px; + padding: 1px 10px 1px 5px; + border: 1px solid #B8B8B8; +} + +QComboBox::drop-down,QDateEdit::drop-down { + subcontrol-origin: padding; + subcontrol-position: top right; + width: 15px; + border-left-width: 1px; + border-left-style: solid; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; + border-left-color: #B8B8B8; +} + +QComboBox::down-arrow,QDateEdit::down-arrow { + image: url(:/qss_icons/img_rc/array_down.png); +} + +QMenu { + background-color:#F0F0F0; + margin: 2px; +} + +QMenu::item { + padding: 2px 12px 2px 12px; +} + +QMenu::indicator { + width: 13px; + height: 13px; +} + +QMenu::item:selected { + color: #F0F0F0; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +QMenu::separator { + height: 1px; + background: #B8B8B8; +} + +QProgressBar { + border-radius: 5px; + text-align: center; + border: 1px solid #B8B8B8; +} + +QProgressBar::chunk { + width: 5px; + margin: 0.5px; + background-color: #454648; +} + +QSlider::groove:horizontal,QSlider::add-page:horizontal { + background: #808080; + height: 8px; + border-radius: 3px; +} + +QSlider::sub-page:horizontal { + height: 8px; + border-radius: 3px; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +QSlider::handle:horizontal { + width: 13px; + margin-top: -3px; + margin-bottom: -3px; + border-radius: 6px; + background: qradialgradient(spread:pad, cx:0.5, cy:0.5, radius:0.5, fx:0.5, fy:0.5,stop:0.6 #F0F0F0, stop:0.778409 #B8B8B8); +} + +QSlider::handle:horizontal:hover { + background: qradialgradient(spread: pad, cx: 0.5, cy: 0.5, radius: 0.5, fx: 0.5, fy: 0.5, stop: 0.6 #F0F0F0,stop:0.778409 #454648); +} + +QSlider::groove:vertical,QSlider::sub-page:vertical { + background:#808080; + width: 8px; + border-radius: 3px; +} + +QSlider::add-page:vertical { + width: 8px; + border-radius: 3px; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +QSlider::handle:vertical { + height: 14px; + margin-left: -3px; + margin-right: -3px; + border-radius: 6px; + background: qradialgradient(spread: pad, cx: 0.5, cy: 0.5, radius: 0.5, fx: 0.5, fy: 0.5, stop: 0.6 #F0F0F0, stop:0.778409 #B8B8B8); +} + +QSlider::handle:vertical:hover { + background: qradialgradient(spread: pad, cx: 0.5, cy: 0.5, radius: 0.5, fx: 0.5, fy: 0.5, stop: 0.6 #F0F0F0,stop:0.778409 #454648); +} + +QScrollBar:vertical { + width:10px; + background-color:rgba(0,0,0,0%); + padding-top:10px; + padding-bottom:10px; +} + +QScrollBar:horizontal { + height:10px; + background-color:rgba(0,0,0,0%); + padding-left:10px; padding-right:10px; +} + +QScrollBar::handle:vertical { + width:10px; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #B8B8B8, stop:1 #D6D6D6); +} + +QScrollBar::handle:horizontal { + height:10px; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #B8B8B8, stop:1 #D6D6D6); +} + +QScrollBar::handle:vertical:hover { + width:10px; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +QScrollBar::handle:horizontal:hover { + height:10px; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +QScrollBar::add-line:vertical { + height:10px; + width:10px; + subcontrol-position: bottom; + subcontrol-origin: margin; + border-image:url(:/qss_icons/img_rc/add-line_vertical.png); +} + +QScrollBar::add-line:horizontal { + height:10px; + width:10px; + subcontrol-position: right; + subcontrol-origin: margin; + border-image:url(:/qss_icons/img_rc/add-line_horizontal.png); +} + +QScrollBar::sub-line:vertical { + height:10px; + width:10px; + subcontrol-position: top; + subcontrol-origin: margin; + border-image:url(:/qss_icons/img_rc/sub-line_vertical.png); +} + +QScrollBar::sub-line:horizontal { + height:10px; + width:10px; + subcontrol-position: left; + subcontrol-origin: margin; + border-image:url(:/qss_icons/img_rc/sub-line_horizontal.png); +} + +QScrollBar::add-page:vertical,QScrollBar::sub-page:vertical { + width:10px; + background: #C0C0C0; +} + +QScrollBar::add-page:horizontal,QScrollBar::sub-page:horizontal { + height:10px; + background: #C0C0C0; +} + +QScrollArea { + border: 0px ; +} + +QTreeView,QListView,QTableView{ + border: 1px solid #B8B8B8; + selection-background-color: #454648; + selection-color: #F0F0F0; +} + +QTableView::item:selected, QListView::item:selected, QTreeView::item:selected { + color: #F0F0F0; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +QTableView::item:hover, QListView::item:hover, QTreeView::item:hover { + color: #F0F0F0; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #B8B8B8, stop:1 #D6D6D6); +} + +QTableView::item, QListView::item, QTreeView::item { + padding: 5px; + margin: 0px; +} + +QHeaderView::section { + padding:3px; + margin:0px; + color:#F0F0F0; + border: 1px solid #F0F0F0; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #B8B8B8, stop:1 #D6D6D6); +} + +QTabBar::tab { + border-bottom-left-radius:0px; + border-bottom-right-radius:0px; + color: #F0F0F0; + min-width: 60px; + min-height: 20px; + padding: 3px 8px 3px 8px; + margin:1px; + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #B8B8B8, stop:1 #D6D6D6); +} + +QTabBar::tab:selected, QTabBar::tab:hover { + background: qlineargradient(spread:pad, x1:0, y1:0, x2:0, y2:1, stop:0 #454648, stop:1 #7A7A7A); +} + +QStatusBar::item { + border: 1px solid #B8B8B8; + border-radius: 3px; +}
\ No newline at end of file diff --git a/paramDock.ui b/paramDock.ui new file mode 100644 index 0000000..b48ac9b --- /dev/null +++ b/paramDock.ui @@ -0,0 +1,147 @@ +<?xml version="1.0" encoding="UTF-8"?> +<ui version="4.0"> + <class>Form</class> + <widget class="QWidget" name="Form"> + <property name="geometry"> + <rect> + <x>0</x> + <y>0</y> + <width>250</width> + <height>321</height> + </rect> + </property> + <property name="minimumSize"> + <size> + <width>250</width> + <height>250</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>600</width> + <height>16777215</height> + </size> + </property> + <property name="windowTitle"> + <string>Form</string> + </property> + <widget class="QWidget" name="horizontalLayoutWidget"> + <property name="geometry"> + <rect> + <x>10</x> + <y>20</y> + <width>221</width> + <height>32</height> + </rect> + </property> + <layout class="QHBoxLayout" name="horizontalLayout"> + <item> + <widget class="QLabel" name="label"> + <property name="minimumSize"> + <size> + <width>0</width> + <height>30</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>16777215</width> + <height>30</height> + </size> + </property> + <property name="text"> + <string>Mode:-</string> + </property> + </widget> + </item> + <item> + <widget class="QComboBox" name="comboBox"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Expanding" vsizetype="Fixed"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>30</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_2"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Fixed" vsizetype="Fixed"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>30</width> + <height>30</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>30</width> + <height>30</height> + </size> + </property> + <property name="text"> + <string>GO</string> + </property> + </widget> + </item> + </layout> + </widget> + <widget class="QPushButton" name="pushButton"> + <property name="geometry"> + <rect> + <x>10</x> + <y>290</y> + <width>231</width> + <height>23</height> + </rect> + </property> + <property name="text"> + <string>Submit</string> + </property> + <property name="autoDefault"> + <bool>true</bool> + </property> + <property name="default"> + <bool>true</bool> + </property> + </widget> + <widget class="QWidget" name="widget" native="true"> + <property name="geometry"> + <rect> + <x>10</x> + <y>60</y> + <width>231</width> + <height>221</height> + </rect> + </property> + <widget class="QWidget" name="formLayoutWidget"> + <property name="geometry"> + <rect> + <x>0</x> + <y>10</y> + <width>231</width> + <height>211</height> + </rect> + </property> + <layout class="QFormLayout" name="formLayout"> + <property name="fieldGrowthPolicy"> + <enum>QFormLayout::AllNonFixedFieldsGrow</enum> + </property> + </layout> + </widget> + </widget> + </widget> + <resources/> + <connections/> +</ui> diff --git a/qdark.css b/qdark.css new file mode 100644 index 0000000..0ca3c73 --- /dev/null +++ b/qdark.css @@ -0,0 +1,1898 @@ +/* QDarkStyleSheet -------------------------------------------------------- + +This is the main style sheet, the palette has nine main colors. +It is based on three selecting colors, three greyish (background) colors +plus three whitish (foreground) colors. Each set of widgets of the same +type have a header like this: + + ------------------ + GroupName -------- + ------------------ + +And each widget is separated with a header like this: + + QWidgetName ------ + +This makes more easy to find and change some css field. The basic +configuration is described bellow. + + SELECTION ------------ + + sel_light #179AE0 #148CD2 (selection/hover/active) + sel_normal #3375A3 #1464A0 (selected) + sel_dark #18465D #14506E (selected disabled) + + FOREGROUND ----------- + + for_light #EFF0F1 #F0F0F0 (texts/labels) + for_dark #505F69 #787878 (disabled texts) + + BACKGROUND ----------- + + bac_light #4D545B #505F69 (unpressed) + bac_normal #31363B #32414B (border, disabled, pressed, checked, toolbars, menus) + bac_dark #232629 #19232D (background) + +If a stranger configuration is required because of a bugfix or anything +else, keep the comment on that line to nobodys changed it, including the +issue number. +--------------------------------------------------------------------------- */ + + + +/* QWidget ---------------------------------------------------------------- */ + +QWidget { + background-color: #19232D; + border: 0px solid #32414B; + padding: 0px; + color: #F0F0F0; + selection-background-color: #1464A0; + selection-color: #F0F0F0; +} + +QWidget:disabled { + background-color: #19232D; + color: #787878; + selection-background-color: #14506E; + selection-color: #787878; +} + +QWidget:item:selected { + background-color: #1464A0; +} + +QWidget:item:hover { + background-color: #148CD2; + color: #32414B; +} + +/* QMainWindow ------------------------------------------------------------ */ +/* This adjusts the splitter in the dock widget, not qsplitter */ + + +QMainWindow::separator { + background-color: #32414B; + border: 0 solid #19232D; + spacing: 0; + padding: 2px; +} + +QMainWindow::separator:hover { + background-color: #505F69; + border: 0px solid #148CD2; +} + +QMainWindow::separator:horizontal { + width: 5px; + margin-top: 2px; + margin-bottom: 2px; + image: url(:/qss_icons/rc/Vsepartoolbar.png); +} + +QMainWindow::separator:vertical { + height: 5px; + margin-left: 2px; + margin-right: 2px; + image: url(:/qss_icons/rc/Hsepartoolbar.png); +} + +/* QToolTip --------------------------------------------------------------- */ + +QToolTip { + background-color: #148CD2; + border: 1px solid #19232D; + color: #19232D; + padding: 0; /*remove padding, for fix combo box tooltip*/ + opacity: 230; /*reducing transparency to read better*/ +} + +/* QStatusBar ------------------------------------------------------------- */ + +QStatusBar { + border: 1px solid #32414B; +} + +QStatusBar QToolTip { + background-color: #148CD2; + border: 1px solid #19232D; + color: #19232D; + padding: 0; /*remove padding, for fix combo box tooltip*/ + opacity: 230; /*reducing transparency to read better*/ +} + +/* QCheckBox -------------------------------------------------------------- */ + +QCheckBox { + background-color: #19232D; + color: #F0F0F0; + spacing: 4px; + outline: none; + padding-top: 4px; + padding-bottom: 4px; +} + +QCheckBox:focus { + border: none; +} + +QCheckBox QWidget:disabled { + background-color: #19232D; + color: #787878; +} + +QCheckBox::indicator { + margin-left: 4px; + width: 16px; + height: 16px; +} + +QCheckBox::indicator:unchecked { + image: url(:/qss_icons/rc/checkbox_unchecked.png); +} + +QCheckBox::indicator:unchecked:hover, +QCheckBox::indicator:unchecked:focus, +QCheckBox::indicator:unchecked:pressed { + border: none; + image: url(:/qss_icons/rc/checkbox_unchecked_focus.png); +} + +QCheckBox::indicator:unchecked:disabled { + image: url(:/qss_icons/rc/checkbox_unchecked_disabled.png); +} + +QCheckBox::indicator:checked { + image: url(:/qss_icons/rc/checkbox_checked.png); +} + +QCheckBox::indicator:checked:hover, +QCheckBox::indicator:checked:focus, +QCheckBox::indicator:checked:pressed { + border: none; + image: url(:/qss_icons/rc/checkbox_checked_focus.png); +} + +QCheckBox::indicator:checked:disabled{ + image: url(:/qss_icons/rc/checkbox_checked_disabled.png); +} + +QCheckBox::indicator:indeterminate { + image: url(:/qss_icons/rc/checkbox_indeterminate.png); +} + +QCheckBox::indicator:indeterminate:disabled { + image: url(:/qss_icons/rc/checkbox_indeterminate_disabled.png); +} + +QCheckBox::indicator:indeterminate:focus, +QCheckBox::indicator:indeterminate:hover, +QCheckBox::indicator:indeterminate:pressed { + image: url(:/qss_icons/rc/checkbox_indeterminate_focus.png); +} + +/* QGroupBox -------------------------------------------------------------- */ + +QGroupBox { + font-weight: bold; + border: 1px solid #32414B; + border-radius: 4px; + padding: 4px; + margin-top: 16px; +} + + + +QGroupBox::title { + subcontrol-origin: margin; + subcontrol-position: top left; + left: 3px; + padding-left: 3px; + padding-right: 5px; + padding-top: 8px; + padding-bottom: 16px; +} + +QGroupBox::indicator { + margin-left: 4px; + width: 16px; + height: 16px; +} + +QGroupBox::indicator { + margin-left: 2px; +} + +QGroupBox::indicator:unchecked:hover, +QGroupBox::indicator:unchecked:focus, +QGroupBox::indicator:unchecked:pressed { + border: none; + image: url(:/qss_icons/rc/checkbox_unchecked_focus.png); +} + +QGroupBox::indicator:checked:hover, +QGroupBox::indicator:checked:focus, +QGroupBox::indicator:checked:pressed { + border: none; + image: url(:/qss_icons/rc/checkbox_checked_focus.png); +} + +QGroupBox::indicator:checked:disabled { + image: url(:/qss_icons/rc/checkbox_checked_disabled.png); +} + +QGroupBox::indicator:unchecked:disabled { + image: url(:/qss_icons/rc/checkbox_unchecked_disabled.png); +} + +/* QRadioButton ----------------------------------------------------------- */ + +QRadioButton { + background-color: #19232D; + color: #F0F0F0; + spacing: 0; + padding: 0; + border: none; + outline: none; +} + +QRadioButton:focus { + border: none; +} + +QRadioButton:disabled { + background-color: #19232D; + color: #787878; + border: none; + outline: none; +} + +QRadioButton QWidget { + background-color: #19232D; + color: #F0F0F0; + spacing: 0px; + padding: 0px; + outline: none; + border: none; +} + +QRadioButton::indicator { + border: none; + outline: none; + margin-bottom: 2px; + width: 25px; + height: 25px; +} + +QRadioButton::indicator:unchecked { + image: url(:/qss_icons/rc/radio_unchecked.png); +} + +QRadioButton::indicator:unchecked:hover, +QRadioButton::indicator:unchecked:focus, +QRadioButton::indicator:unchecked:pressed { + border: none; + outline: none; + image: url(:/qss_icons/rc/radio_unchecked_focus.png); +} + +QRadioButton::indicator:checked { + border: none; + outline: none; + image: url(:/qss_icons/rc/radio_checked.png); +} + +QRadioButton::indicator:checked:hover, +QRadioButton::indicator:checked:focus, +QRadioButton::indicator:checked:pressed { + border: none; + outline: none; + image: url(:/qss_icons/rc/radio_checked_focus.png); +} + +QRadioButton::indicator:checked:disabled { + outline: none; + image: url(:/qss_icons/rc/radio_checked_disabled.png); +} + +QRadioButton::indicator:unchecked:disabled { + image: url(:/qss_icons/rc/radio_unchecked_disabled.png); +} + +/* QMenuBar --------------------------------------------------------------- */ + +QMenuBar { + background-color: #32414B; + padding: 2px; + border: 1px solid #19232D; + color: #F0F0F0; +} + +QMenuBar:focus { + border: 1px solid #148CD2; +} + +QMenuBar::item { + background: transparent; + padding: 4px; +} + +QMenuBar::item:selected { + padding: 4px; + background: transparent; + border: 0px solid #32414B; +} + +QMenuBar::item:pressed { + padding: 4px; + border: 0px solid #32414B; + background-color: #148CD2; + color: #F0F0F0; + margin-bottom: 0px; + padding-bottom: 0px; +} + +/* QMenu ------------------------------------------------------------------ */ + +QMenu { + border: 0px solid #32414B; + color: #F0F0F0; + margin: 0px; +} + +QMenu::separator { + height: 2px; + background-color: #505F69; + color: #F0F0F0; + padding-left: 4px; + margin-left: 2px; + margin-right: 2px; +} + +QMenu::icon { + margin: 0px; + padding-left:4px; +} + +QMenu::item { + padding: 4px 24px 4px 24px; + border: 1px transparent #32414B; /* reserve space for selection border */ +} + +QMenu::item:selected { + color: #F0F0F0; +} + + + +QMenu::indicator { + width: 12px; + height: 12px; + padding-left:6px; +} + +/* non-exclusive indicator = check box style indicator (see QActionGroup::setExclusive) */ + +QMenu::indicator:non-exclusive:unchecked { + image: url(:/qss_icons/rc/checkbox_unchecked.png); +} + +QMenu::indicator:non-exclusive:unchecked:selected { + image: url(:/qss_icons/rc/checkbox_unchecked_disabled.png); +} + +QMenu::indicator:non-exclusive:checked { + image: url(:/qss_icons/rc/checkbox_checked.png); +} + +QMenu::indicator:non-exclusive:checked:selected { + image: url(:/qss_icons/rc/checkbox_checked_disabled.png); +} + +/* exclusive indicator = radio button style indicator (see QActionGroup::setExclusive) */ + +QMenu::indicator:exclusive:unchecked { + image: url(:/qss_icons/rc/radio_unchecked.png); +} + +QMenu::indicator:exclusive:unchecked:selected { + image: url(:/qss_icons/rc/radio_unchecked_disabled.png); +} + +QMenu::indicator:exclusive:checked { + image: url(:/qss_icons/rc/radio_checked.png); +} + +QMenu::indicator:exclusive:checked:selected { + image: url(:/qss_icons/rc/radio_checked_disabled.png); +} + +QMenu::right-arrow { + margin: 5px; + image: url(:/qss_icons/rc/right_arrow.png) +} + +/* QAbstractItemView ------------------------------------------------------ */ + +QAbstractItemView { + alternate-background-color: #19232D; + color: #F0F0F0; + border: 1px solid #32414B; + border-radius: 4px; +} + +QAbstractItemView QLineEdit { + padding: 2px; +} + +/* QAbstractScrollArea ---------------------------------------------------- */ + +QAbstractScrollArea { + background-color: #19232D; + border: 1px solid #32414B; + border-radius: 4px; + padding: 4px; + color: #F0F0F0; +} + +QAbstractScrollArea:disabled { + color: #787878; +} + +/* QScrollArea ------------------------------------------------------------ */ + +QScrollArea QWidget QWidget:disabled { + background-color: #19232D; +} + +/* QScrollBar ------------------------------------------------------------- */ + +QScrollBar:horizontal { + height: 16px; + margin: 2px 16px 2px 16px; + border: 1px solid #32414B; + border-radius: 4px; + background-color: #19232D; +} + +QScrollBar::handle:horizontal { + background-color: #787878; + border: 1px solid #32414B; + border-radius: 4px; + min-width: 8px; + +} + +QScrollBar::handle:horizontal:hover { + background-color: #148CD2; + border: 1px solid #148CD2; + border-radius: 4px; + min-width: 8px; +} + +QScrollBar::add-line:horizontal { + margin: 0px 0px 0px 0px; + border-image: url(:/qss_icons/rc/right_arrow_disabled.png); + width: 10px; + height: 10px; + subcontrol-position: right; + subcontrol-origin: margin; +} + +QScrollBar::sub-line:horizontal { + margin: 0px 3px 0px 3px; + border-image: url(:/qss_icons/rc/left_arrow_disabled.png); + height: 10px; + width: 10px; + subcontrol-position: left; + subcontrol-origin: margin; +} + +QScrollBar::add-line:horizontal:hover, +QScrollBar::add-line:horizontal:on { + border-image: url(:/qss_icons/rc/right_arrow.png); + height: 10px; + width: 10px; + subcontrol-position: right; + subcontrol-origin: margin; +} + +QScrollBar::sub-line:horizontal:hover, +QScrollBar::sub-line:horizontal:on { + border-image: url(:/qss_icons/rc/left_arrow.png); + height: 10px; + width: 10px; + subcontrol-position: left; + subcontrol-origin: margin; +} + +QScrollBar::up-arrow:horizontal, +QScrollBar::down-arrow:horizontal { + background: none; +} + +QScrollBar::add-page:horizontal, +QScrollBar::sub-page:horizontal { + background: none; +} + +QScrollBar:vertical { + background-color: #19232D; + width: 16px; + margin: 16px 2px 16px 2px; + border: 1px solid #32414B; + border-radius: 4px; +} + +QScrollBar::handle:vertical { + background-color: #787878; + border: 1px solid #32414B; + min-height: 8px; + border-radius: 4px; +} + +QScrollBar::handle:vertical:hover { + background-color: #148CD2; + border: 1px solid #148CD2; + border-radius: 4px; + min-height: 8px; + +} + +QScrollBar::sub-line:vertical { + margin: 3px 0px 3px 0px; + border-image: url(:/qss_icons/rc/up_arrow_disabled.png); + height: 10px; + width: 10px; + subcontrol-position: top; + subcontrol-origin: margin; +} + +QScrollBar::add-line:vertical { + margin: 3px 0px 3px 0px; + border-image: url(:/qss_icons/rc/down_arrow_disabled.png); + height: 10px; + width: 10px; + subcontrol-position: bottom; + subcontrol-origin: margin; +} + +QScrollBar::sub-line:vertical:hover, +QScrollBar::sub-line:vertical:on { + border-image: url(:/qss_icons/rc/up_arrow.png); + height: 10px; + width: 10px; + subcontrol-position: top; + subcontrol-origin: margin; +} + +QScrollBar::add-line:vertical:hover, +QScrollBar::add-line:vertical:on { + border-image: url(:/qss_icons/rc/down_arrow.png); + height: 10px; + width: 10px; + subcontrol-position: bottom; + subcontrol-origin: margin; +} + +QScrollBar::up-arrow:vertical, +QScrollBar::down-arrow:vertical { + background: none; +} + +QScrollBar::add-page:vertical, +QScrollBar::sub-page:vertical { + background: none; +} + +/* QTextEdit--------------------------------------------------------------- */ + +QTextEdit { + background-color: #19232D; + color: #F0F0F0; + border: 1px solid #32414B; +} + +QTextEdit:hover { + border: 1px solid #148CD2; + color: #F0F0F0; +} + +QTextEdit:selected { + background: #1464A0; + color: #32414B; +} + +/* QPlainTextEdit --------------------------------------------------------- */ + +QPlainTextEdit { + background-color: #19232D; + color: #F0F0F0; + border-radius: 4px; + border: 1px solid #32414B; +} + +QPlainTextEdit:hover { + border: 1px solid #148CD2; + color: #F0F0F0; +} + +QPlainTextEdit:selected { + background: #1464A0; + color: #32414B; +} + +/* QSizeGrip --------------------------------------------------------------- */ + +QSizeGrip { + image: url(:/qss_icons/rc/sizegrip.png); + width: 12px; + height: 12px; +} + +/* QStackedWidget --------------------------------------------------------- */ + +QStackedWidget { + padding: 4px; + border: 1px solid #32414B; + border: 1px solid #19232D; +} + +/* QToolBar --------------------------------------------------------------- */ + +QToolBar { + background-color: #32414B; + border-bottom: 1px solid #19232D; + padding: 2px; + font-weight: bold; +} + +QToolBar QToolButton{ + background-color: #32414B; +} + +QToolBar::handle:horizontal { + width: 6px; + image: url(:/qss_icons/rc/Hmovetoolbar.png); +} + +QToolBar::handle:vertical { + height: 6px; + image: url(:/qss_icons/rc/Vmovetoolbar.png); +} + +QToolBar::separator:horizontal { + width: 3px; + image: url(:/qss_icons/rc/Hsepartoolbar.png); +} + +QToolBar::separator:vertical { + height: 3px; + image: url(:/qss_icons/rc/Vsepartoolbar.png); +} + +QToolButton#qt_toolbar_ext_button { + background: #32414B; + border: 0px; + color: #F0F0F0; + image: url(:/qss_icons/rc/right_arrow.png); +} + +/* QAbstractSpinBox ------------------------------------------------------- */ + +QAbstractSpinBox { + background-color: #19232D; + border: 1px solid #32414B; + color: #F0F0F0; + padding-top: 2px; /* This fix 103, 111*/ + padding-bottom: 2px; /* This fix 103, 111*/ + padding-left: 4px; + padding-right: 4px; + border-radius: 4px; + /* min-width: 5px; removed to fix 109 */ +} + +QAbstractSpinBox:up-button { + background-color: transparent #19232D; + subcontrol-origin: border; + subcontrol-position: top right; + border-left: 1px solid #32414B; + margin: 1px; +} + +QAbstractSpinBox::up-arrow, +QAbstractSpinBox::up-arrow:disabled, +QAbstractSpinBox::up-arrow:off { + image: url(:/qss_icons/rc/up_arrow_disabled.png); + width: 9px; + height: 9px; +} + +QAbstractSpinBox::up-arrow:hover { + image: url(:/qss_icons/rc/up_arrow.png); +} + +QAbstractSpinBox:down-button { + background-color: transparent #19232D; + subcontrol-origin: border; + subcontrol-position: bottom right; + border-left: 1px solid #32414B; + margin: 1px; +} + +QAbstractSpinBox::down-arrow, +QAbstractSpinBox::down-arrow:disabled, +QAbstractSpinBox::down-arrow:off { + image: url(:/qss_icons/rc/down_arrow_disabled.png); + width: 9px; + height: 9px; +} + +QAbstractSpinBox::down-arrow:hover { + image: url(:/qss_icons/rc/down_arrow.png); +} + +QAbstractSpinBox:hover{ + border: 1px solid #148CD2; + color: #F0F0F0; +} + +QAbstractSpinBox:selected { + background: #1464A0; + color: #32414B; +} + +/* ------------------------------------------------------------------------ */ +/* DISPLAYS --------------------------------------------------------------- */ +/* ------------------------------------------------------------------------ */ + +/* QLabel ----------------------------------------------------------------- */ + +QLabel { + background-color: #19232D; + border: 0px solid #32414B; + padding: 2px; + margin: 0px; + color: #F0F0F0 +} + +QLabel::disabled { + background-color: #19232D; + border: 0px solid #32414B; + color: #787878; +} + +/* QTextBrowser ----------------------------------------------------------- */ + +QTextBrowser { + background-color: #19232D; + border: 1px solid #32414B; + color: #F0F0F0; + border-radius: 4px; +} + +QTextBrowser:disabled { + background-color: #19232D; + border: 1px solid #32414B; + color: #787878; + border-radius: 4px; +} + +QTextBrowser:hover, +QTextBrowser:!hover, +QTextBrowser::selected, +QTextBrowser::pressed { + border: 1px solid #32414B; +} + +/* QGraphicsView --------------------------------------------------------- */ + +QGraphicsView { + background-color: #19232D; + border: 1px solid #32414B; + color: #F0F0F0; + border-radius: 4px; +} + +QGraphicsView:disabled { + background-color: #19232D; + border: 1px solid #32414B; + color: #787878; + border-radius: 4px; +} + +QGraphicsView:hover, +QGraphicsView:!hover, +QGraphicsView::selected, +QGraphicsView::pressed { + border: 1px solid #32414B; +} + +/* QCalendarWidget -------------------------------------------------------- */ + +QCalendarWidget { + border: 1px solid #32414B; + border-radius: 4px; +} + +QCalendarWidget:disabled { + background-color: #19232D; + color: #787878; +} + +/* QLCDNumber ------------------------------------------------------------- */ + +QLCDNumber { + background-color: #19232D; + color: #F0F0F0; +} + +QLCDNumber:disabled { + background-color: #19232D; + color: #787878; +} + +/* QProgressBar ----------------------------------------------------------- */ + +QProgressBar { + background-color: #19232D; + border: 1px solid #32414B; + color: #F0F0F0; + border-radius: 4px; + text-align: center; +} + +QProgressBar:disabled { + background-color: #19232D; + border: 1px solid #32414B; + color: #787878; + border-radius: 4px; + text-align: center; +} + +QProgressBar::chunk { + background-color: #1464A0; + color: #19232D; + border-radius: 4px; +} + +QProgressBar::chunk:disabled { + background-color: #14506E; + color: #787878; + border-radius: 4px; +} + + +/* ------------------------------------------------------------------------ */ +/* BUTTONS ---------------------------------------------------------------- */ +/* ------------------------------------------------------------------------ */ + +/* QPushButton ------------------------------------------------------------ */ + +QPushButton { + background-color: #505F69 ; + border: 1px solid #32414B; + color: #F0F0F0; + border-radius: 4px; + padding: 3px; + outline: none; +} + +QPushButton:disabled { + background-color: #32414B; + border: 1px solid #32414B; + color: #787878; + border-radius: 4px; + padding: 3px; +} + + +QPushButton:checked { + background-color: #32414B; + border: 1px solid #32414B; + border-radius: 4px; + padding: 3px; + outline: none; +} + +QPushButton:checked:disabled { + background-color: #19232D; + border: 1px solid #32414B; + color: #787878; + border-radius: 4px; + padding: 3px; + outline: none; +} + +QPushButton::menu-indicator { + subcontrol-origin: padding; + subcontrol-position: bottom right; + bottom: 4px; +} + +QPushButton:pressed { + background-color: #19232D; + border: 1px solid #19232D; +} + +QPushButton:hover, +QPushButton:checked:hover{ + border: 1px solid #148CD2; + color: #F0F0F0; +} + +QPushButton:selected, +QPushButton:checked:selected{ + background: #1464A0; + color: #32414B; +} + +/* QToolButton ------------------------------------------------------------ */ + +QToolButton { + background-color: transparent; + border: 1px solid #32414B; + border-radius: 4px; + margin: 0px; + padding: 2px; +} + +QToolButton:checked { + background-color: #19232D; + border: 1px solid #19232D; +} + +QToolButton:disabled { + border: 1px solid #32414B; +} + +QToolButton:hover, +QToolButton:checked:hover{ + border: 1px solid #148CD2; +} + +/* the subcontrols below are used only in the MenuButtonPopup mode */ + +QToolButton[popupMode="1"] { + padding: 2px; + padding-right: 12px; /* only for MenuButtonPopup */ + border: 1px solid #32414B; /* make way for the popup button */ + border-radius: 4px; +} + +/* The subcontrol below is used only in the InstantPopup or DelayedPopup mode */ + +QToolButton[popupMode="2"] { + padding: 2px; + padding-right: 12px; /* only for InstantPopup */ + border: 1px solid #32414B; /* make way for the popup button */ +} + +QToolButton::menu-button { + padding: 2px; + border-radius: 4px; + border: 1px solid #32414B; + border-top-right-radius: 4px; + border-bottom-right-radius: 4px; + /* 16px width + 4px for border = 20px allocated above */ + width: 16px; + outline: none; +} + +QToolButton::menu-button:hover, +QToolButton::menu-button:checked:hover { + border: 1px solid #148CD2; +} + +QToolButton::menu-indicator { + image: url(:/qss_icons/rc/down_arrow.png); + top: -8px; /* shift it a bit */ + left: -4px; /* shift it a bit */ +} + +QToolButton::menu-arrow { + image: url(:/qss_icons/rc/down_arrow.png); +} + +QToolButton::menu-arrow:open { + border: 1px solid #32414B; +} + +/* QCommandLinkButton ----------------------------------------------------- */ + +QCommandLinkButton { + background-color: transparent; + border: 1px solid #32414B; + color: #F0F0F0; + border-radius: 4px; + padding: 0px; + margin: 0px; +} + +QCommandLinkButton:disabled { + background-color: transparent; + color: #787878; +} + +/* ------------------------------------------------------------------------ */ +/* INPUTS - NO FIELDS ----------------------------------------------------- */ +/* ------------------------------------------------------------------------ */ + +/* QCombobox -------------------------------------------------------------- */ + +QComboBox { + border: 1px solid #32414B; + border-radius: 4px; + selection-background-color: #1464A0; + padding-top: 2px; /* This fix #103, #111*/ + padding-bottom: 2px; /* This fix #103, #111*/ + padding-left: 4px; + padding-right: 4px; + /* min-width: 75px; removed to fix 109 */ +} + +QComboBox:disabled { + background-color: #19232D; + color: #787878; +} + +QComboBox:hover{ + border: 1px solid #148CD2; +} + +QComboBox:on { + selection-background-color: #19232D; +} + +QComboBox QAbstractItemView { + background-color: #19232D; + border-radius: 4px; + border: 1px solid #32414B; + selection-color: #148CD2; + selection-background-color: #32414B; +} + +QComboBox::drop-down { + subcontrol-origin: padding; + subcontrol-position: top right; + width: 20px; + border-left-width: 0px; + border-left-color: #32414B; + border-left-style: solid; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +QComboBox::down-arrow { + image: url(:/qss_icons/rc/down_arrow_disabled.png); +} + +QComboBox::down-arrow:on, +QComboBox::down-arrow:hover, +QComboBox::down-arrow:focus { + image: url(:/qss_icons/rc/down_arrow.png); +} + +/* QSlider ---------------------------------------------------------------- */ + +QSlider:disabled { + background: #19232D; +} + +QSlider:focus { + border: none; +} + +QSlider::groove:horizontal { + background: #32414B; + border: 1px solid #32414B; + height: 4px; + margin: 0px; + border-radius: 4px; +} + +QSlider::sub-page:horizontal { + background: #1464A0; + border: 1px solid #32414B; + height: 4px; + margin: 0px; + border-radius: 4px; +} + +QSlider::sub-page:horizontal:disabled { + background: #14506E; +} + +QSlider::handle:horizontal { + background: #787878; + border: 1px solid #32414B; + width: 8px; + height: 8px; + margin: -8px 0; + border-radius: 4px; +} + +QSlider::handle:horizontal:hover { + background: #148CD2; + border: 1px solid #148CD2; +} + +QSlider::groove:vertical { + background: #32414B; + border: 1px solid #32414B; + width: 4px; + margin: 0px; + border-radius: 4px; +} + +QSlider::sub-page:vertical { + background: #1464A0; + border: 1px solid #32414B; + width: 4px; + margin: 0px; + border-radius: 4px; +} + +QSlider::sub-page:vertical:disabled { + background: #14506E; +} + +QSlider::handle:vertical { + background: #787878; + border: 1px solid #32414B; + width: 8px; + height: 8px; + margin: 0 -8px; + border-radius: 4px; +} + +QSlider::handle:vertical:hover { + background: #148CD2; + border: 1px solid #148CD2; +} + +/* QLine ------------------------------------------------------------------ */ + +QLineEdit { + background-color: #19232D; + padding-top: 2px; /* This QLineEdit fix 103, 111 */ + padding-bottom: 2px; /* This QLineEdit fix 103, 111 */ + padding-left: 4px; + padding-right: 4px; + border-style: solid; + border: 1px solid #32414B; + border-radius: 4px; + color: #F0F0F0; +} + +QLineEdit:disabled { + background-color: #19232D; + color: #787878; +} + +QLineEdit:hover{ + border: 1px solid #148CD2; + color: #F0F0F0; +} + +QLineEdit:selected{ + background: #1464A0; + color: #32414B; +} + +/* QTabWiget -------------------------------------------------------------- */ + +QTabWidget { + padding: 2px; + selection-background-color: #32414B; +} + +QTabWidget QFrame{ + border: 0; +} + +QTabWidget::pane { + border: 1px solid #32414B; + border-radius: 4px; + padding: 2px; + margin: 0px; +} + +QTabWidget::pane:selected { + background-color: #32414B; + border: 1px solid #1464A0; +} + +/* QTabBar ---------------------------------------------------------------- */ + +QTabBar { + qproperty-drawBase: 0; + border-radius: 4px; + margin: 0px; + padding: 2px; + border: 0; + + /* left: 5px; move to the right by 5px - removed for fix */ + } + +QTabBar::close-button { + border: 0; + margin: 2px; + padding: 0; + image: url(:/qss_icons/rc/close.png); +} + +QTabBar::close-button:hover { + image: url(:/qss_icons/rc/close-hover.png); +} + +QTabBar::close-button:pressed { + image: url(:/qss_icons/rc/close-pressed.png); +} + +/* QTabBar::tab - selected ----------------------------------------------- */ + +QTabBar::tab:top:selected:disabled { + border-bottom: 3px solid #14506E; + color: #787878; + background-color: #32414B; +} + +QTabBar::tab:bottom:selected:disabled { + border-top: 3px solid #14506E; + color: #787878; + background-color: #32414B; +} + +QTabBar::tab:left:selected:disabled { + border-left: 3px solid #14506E; + color: #787878; + background-color: #32414B; +} + +QTabBar::tab:right:selected:disabled { + border-right: 3px solid #14506E; + color: #787878; + background-color: #32414B; +} + +/* QTabBar::tab - !selected and disabled ---------------------------------- */ + +QTabBar::tab:top:!selected:disabled { + border-bottom: 3px solid #19232D; + color: #787878; + background-color: #19232D; +} + +QTabBar::tab:bottom:!selected:disabled { + border-top: 3px solid #19232D; + color: #787878; + background-color: #19232D; +} + +QTabBar::tab:left:!selected:disabled { + border-right: 3px solid #19232D; + color: #787878; + background-color: #19232D; +} + +QTabBar::tab:right:!selected:disabled { + border-left: 3px solid #19232D; + color: #787878; + background-color: #19232D; +} + +/* QTabBar::tab - selected ----------------------------------------------- */ + +QTabBar::tab:top:!selected { + border-bottom: 2px solid #19232D; + margin-top: 2px; +} + +QTabBar::tab:bottom:!selected { + border-top: 2px solid #19232D; + margin-bottom: 3px; +} + +QTabBar::tab:left:!selected { + border-left: 2px solid #19232D; + margin-right: 2px; +} + +QTabBar::tab:right:!selected { + border-right: 2px solid #19232D; + margin-left: 2px; +} + + +QTabBar::tab:top { + background-color: #32414B; + color: #F0F0F0; + margin-left: 2px; + padding-left: 4px; + padding-right: 4px; + padding-top: 2px; + padding-bottom: 2px; + min-width: 5px; + border-bottom: 3px solid #32414B; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +QTabBar::tab:top:selected { + background-color: #505F69; + color: #F0F0F0; + border-bottom: 3px solid #1464A0; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +QTabBar::tab:top:!selected:hover { + border: 1px solid #148CD2; + border-bottom: 3px solid #148CD2; + padding: 0px; +} + +QTabBar::tab:bottom { + color: #F0F0F0; + border-top: 3px solid #32414B; + background-color: #32414B; + margin-left: 2px; + padding-left: 4px; + padding-right: 4px; + padding-top: 2px; + padding-bottom: 2px; + border-bottom-left-radius: 3px; + border-bottom-right-radius: 3px; + min-width: 5px; +} + +QTabBar::tab:bottom:selected { + color: #F0F0F0; + background-color: #505F69; + border-top: 3px solid #1464A0; + border-bottom-left-radius: 3px; + border-bottom-right-radius: 3px; +} + +QTabBar::tab:bottom:!selected:hover { + border: 1px solid #148CD2; + border-top: 3px solid #148CD2; + padding: 0px; +} + +QTabBar::tab:left { + color: #F0F0F0; + background-color: #32414B; + margin-top: 2px; + padding-left: 2px; + padding-right: 2px; + padding-top: 4px; + padding-bottom: 4px; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; + min-height: 5px; +} + +QTabBar::tab:left:selected { + color: #F0F0F0; + background-color: #505F69; + border-left: 3px solid #1464A0; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +QTabBar::tab:left:!selected:hover { + border: 1px solid #148CD2; + border-left: 3px solid #148CD2; + padding: 0px; +} + +QTabBar::tab:right { + color: #F0F0F0; + background-color: #32414B; + margin-top: 2px; + padding-left: 2px; + padding-right: 2px; + padding-top: 4px; + padding-bottom: 4px; + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; + min-height: 5px; +} + +QTabBar::tab:right:selected { + color: #F0F0F0; + background-color: #505F69; + border-right: 3px solid #1464A0; + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +QTabBar::tab:right:!selected:hover { + border: 1px solid #148CD2; + border-right: 3px solid #148CD2; + padding: 0px; +} + +QTabBar QToolButton::right-arrow:enabled { + image: url(:/qss_icons/rc/right_arrow.png); +} + +QTabBar QToolButton::left-arrow:enabled { + image: url(:/qss_icons/rc/left_arrow.png); +} + +QTabBar QToolButton::right-arrow:disabled { + image: url(:/qss_icons/rc/right_arrow_disabled.png); +} + +QTabBar QToolButton::left-arrow:disabled { + image: url(:/qss_icons/rc/left_arrow_disabled.png); +} + + +/* Some examples from internet to check + +QTabBar::tabButton() and QTabBar::tabIcon() +QTabBar::tear {width: 0px; border: none;} +QTabBar::tear {image: url(tear_indicator.png);} +QTabBar::scroller{width:85pix;} +QTabBar QToolbutton{background-color:"light blue";} + +But that left the buttons transparant. +Looked confusing as the tab buttons migrated behind the scroller buttons. +So we had to color the back ground of the scroller buttons +*/ + +/* QDockWiget ------------------------------------------------------------- */ + +QDockWidget { + outline: 1px solid #32414B; + background-color: #19232D; + border: 1px solid #32414B; + border-radius: 4px; + titlebar-close-icon: url(:/qss_icons/rc/close.png); + titlebar-normal-icon: url(:/qss_icons/rc/undock.png); +} + +QDockWidget::title { + padding: 6px; /* better size for title bar */ + border: none; + background-color: #32414B; +} + +QDockWidget::close-button { + background-color: #32414B; + border-radius: 4px; + border: none; +} + +QDockWidget::close-button:hover { + border: 1px solid #32414B; +} + +QDockWidget::close-button:pressed { + border: 1px solid #32414B; +} + +QDockWidget::float-button { + background-color: #32414B; + border-radius: 4px; + border: none; +} + +QDockWidget::float-button:hover { + border: 1px solid #32414B; +} + +QDockWidget::float-button:pressed { + border: 1px solid #32414B; +} + + +/* QTreeView QTableView QListView ----------------------------------------- */ + +QTreeView:branch:selected, +QTreeView:branch:hover { + background: url(:/qss_icons/rc/transparent.png); +} + +QTreeView::branch:has-siblings:!adjoins-item { + border-image: url(:/qss_icons/rc/transparent.png); +} + +QTreeView::branch:has-siblings:adjoins-item { + border-image: url(:/qss_icons/rc/transparent.png); +} + +QTreeView::branch:!has-children:!has-siblings:adjoins-item { + border-image: url(:/qss_icons/rc/transparent.png); +} + +QTreeView::branch:has-children:!has-siblings:closed, +QTreeView::branch:closed:has-children:has-siblings { + image: url(:/qss_icons/rc/branch_closed.png); +} + +QTreeView::branch:open:has-children:!has-siblings, +QTreeView::branch:open:has-children:has-siblings { + image: url(:/qss_icons/rc/branch_open.png); +} + +QTreeView::branch:has-children:!has-siblings:closed:hover, +QTreeView::branch:closed:has-children:has-siblings:hover { + image: url(:/qss_icons/rc/branch_closed-on.png); +} + +QTreeView::branch:open:has-children:!has-siblings:hover, +QTreeView::branch:open:has-children:has-siblings:hover { + image: url(:/qss_icons/rc/branch_open-on.png); +} + +QListView::item:!selected:hover, +QTreeView::item:!selected:hover, +QTableView::item:!selected:hover, +QColumnView::item:!selected:hover { + outline: 0; + color: #148CD2; + background-color: #32414B; +} + +QListView::item:selected:hover, +QTreeView::item:selected:hover, +QTableView::item:selected:hover, +QColumnView::item:selected:hover { + background: #1464A0; + color: #19232D; +} + +QTreeView::indicator:checked, +QListView::indicator:checked { + image: url(:/qss_icons/rc/checkbox_checked.png); +} + +QTreeView::indicator:unchecked, +QListView::indicator:unchecked { + image: url(:/qss_icons/rc/checkbox_unchecked.png); +} + +QTreeView::indicator:checked:hover, +QTreeView::indicator:checked:focus, +QTreeView::indicator:checked:pressed, +QListView::indicator:checked:hover, +QListView::indicator:checked:focus, +QListView::indicator:checked:pressed { + image: url(:/qss_icons/rc/checkbox_checked_focus.png); +} + +QTreeView::indicator:unchecked:hover, +QTreeView::indicator:unchecked:focus, +QTreeView::indicator:unchecked:pressed, +QListView::indicator:unchecked:hover, +QListView::indicator:unchecked:focus, +QListView::indicator:unchecked:pressed { + image: url(:/qss_icons/rc/checkbox_unchecked_focus.png); +} + +QTreeView::indicator:indeterminate:hover, +QTreeView::indicator:indeterminate:focus, +QTreeView::indicator:indeterminate:pressed, +QListView::indicator:indeterminate:hover, +QListView::indicator:indeterminate:focus, +QListView::indicator:indeterminate:pressed { + image: url(:/qss_icons/rc/checkbox_indeterminate_focus.png); +} + +QTreeView::indicator:indeterminate, +QListView::indicator:indeterminate { + image: url(:/qss_icons/rc/checkbox_indeterminate.png); +} + +QListView, +QTreeView, +QTableView, +QColumnView { + background-color: #19232D; + border: 1px solid #32414B; + color: #F0F0F0; + gridline-color: #32414B; + border-radius: 4px; +} + +QListView:disabled, +QTreeView:disabled, +QTableView:disabled, +QColumnView:disabled { + background-color: #19232D; + color: #787878; +} + +QListView:selected, +QTreeView:selected, +QTableView:selected, +QColumnView:selected { + background: #1464A0; + color: #32414B; +} + +QListView:hover, +QTreeView::hover, +QTableView::hover, +QColumnView::hover { + background-color: #19232D; + border: 1px solid #148CD2; +} + +QListView::item:pressed, +QTreeView::item:pressed, +QTableView::item:pressed, +QColumnView::item:pressed { + background-color: #1464A0; +} + +QListView::item:selected:active, +QTreeView::item:selected:active, +QTableView::item:selected:active, +QColumnView::item:selected:active { + background-color: #1464A0; +} + +QTableCornerButton::section { + background-color: #19232D; + border: 1px transparent #32414B; + border-radius: 0px; +} + +/* QHeaderView ------------------------------------------------------------ */ + +QHeaderView { + background-color: #32414B; + border: 0px transparent #32414B; + padding: 0px; + margin: 0px; + border-radius: 0px; +} + +QHeaderView:disabled { + background-color: #32414B; + border: 1px transparent #32414B; + padding: 2px; +} + +QHeaderView::section { + background-color: #32414B; + color: #F0F0F0; + padding: 2px; + border-radius: 0px; + text-align: left; +} + +QHeaderView::section:checked { + color: #F0F0F0; + background-color: #1464A0; +} + +QHeaderView::section:checked:disabled { + color: #787878; + background-color: #14506E; +} + +QHeaderView::section::horizontal:disabled, +QHeaderView::section::vertical:disabled { + color: #787878; +} + +QHeaderView::section::vertical::first, +QHeaderView::section::vertical::only-one { + border-top: 1px solid #32414B; +} + +QHeaderView::section::vertical { + border-top: 1px solid #19232D; +} + +QHeaderView::section::horizontal::first, +QHeaderView::section::horizontal::only-one { + border-left: 1px solid #32414B; +} + +QHeaderView::section::horizontal { + border-left: 1px solid #19232D; +} + +/* Those settings (border/width/height/background-color) solve bug */ +/* transparent arrow background and size */ + +QHeaderView::down-arrow { + background-color: #32414B; + width: 16px; + height: 16px; + border-right: 1px solid #19232D; + image: url(:/qss_icons/rc/down_arrow.png); +} + +QHeaderView::up-arrow { + background-color: #32414B; + width: 16px; + height: 16px; + border-right: 1px solid #19232D; + image: url(:/qss_icons/rc/up_arrow.png); +} + +/* QToolBox -------------------------------------------------------------- */ + +QToolBox { + padding: 0px; + border: 1px solid #32414B; +} + +QToolBox::selected { + padding: 0px; + border: 2px solid #1464A0; +} + +QToolBox::tab { + background-color: #19232D; + border: 1px solid #32414B; + color: #F0F0F0; + border-top-left-radius: 4px; + border-top-right-radius: 4px; +} + +QToolBox::tab:disabled { + color: #787878; +} + +QToolBox::tab:selected { + background-color: #505F69; + border-bottom: 2px solid #1464A0; +} + +QToolBox::tab:!selected { + background-color: #32414B; + border-bottom: 2px solid #32414B; +} + +QToolBox::tab:selected:disabled { + background-color: #32414B; + border-bottom: 2px solid #14506E; +} + +QToolBox::tab:!selected:disabled { + background-color: #19232D; +} + +QToolBox::tab:hover { + border-color: #148CD2; + border-bottom: 2px solid #148CD2; +} + +QToolBox QScrollArea QWidget QWidget { + padding: 0px; + background-color: #19232D; +} + +/* QFrame ----------------------------------------------------------------- */ + +QFrame { + border-radius: 4px; + border: 1px solid #32414B; +} + +QFrame[frameShape="0"] { + border-radius: 4px; + border: 1px transparent #32414B; +} + +QFrame[height="3"], +QFrame[width="3"] { + background-color: #19232D; +} + +/* QSplitter -------------------------------------------------------------- */ + +QSplitter { + background-color: #32414B; + spacing: 0; + padding: 0; + margin: 0; +} + +QSplitter::separator { + background-color: #32414B; + border: 0 solid #19232D; + spacing: 0; + padding: 1px; + margin: 0; +} + +QSplitter::separator:hover { + background-color: #787878; +} + +QSplitter::separator:horizontal { + width: 5px; + image: url(:/qss_icons/rc/Vsepartoolbar.png); +} + +QSplitter::separator:vertical { + height: 5px; + image: url(:/qss_icons/rc/Hsepartoolbar.png); +} + + +/* QDateEdit-------------------------------------------------------------- */ + +QDateEdit { + selection-background-color: #1464A0; + border-style: solid; + border: 1px solid #32414B; + border-radius: 4px; + padding-top: 2px; /* This fix #103, #111*/ + padding-bottom: 2px; /* This fix #103, #111*/ + padding-left: 4px; + padding-right: 4px; + min-width: 10px; +} + +QDateEdit:on { + selection-background-color: #1464A0; +} + +QDateEdit::drop-down { + subcontrol-origin: padding; + subcontrol-position: top right; + width: 20px; + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +QDateEdit::down-arrow { + image: url(:/qss_icons/rc/down_arrow_disabled.png); +} + +QDateEdit::down-arrow:on, +QDateEdit::down-arrow:hover, +QDateEdit::down-arrow:focus { + image: url(:/qss_icons/rc/down_arrow.png); +} + +QDateEdit QAbstractItemView { + background-color: #19232D; + border-radius: 4px; + border: 1px solid #32414B; + selection-background-color: #1464A0; +} + +QAbstractView:hover{ + border: 1px solid #148CD2; + color: #F0F0F0; +} + +QAbstractView:selected { + background: #1464A0; + color: #32414B; +} + + diff --git a/resDock.ui b/resDock.ui new file mode 100644 index 0000000..5f948e5 --- /dev/null +++ b/resDock.ui @@ -0,0 +1,187 @@ +<?xml version="1.0" encoding="UTF-8"?> +<ui version="4.0"> + <class>Form</class> + <widget class="QWidget" name="Form"> + <property name="geometry"> + <rect> + <x>0</x> + <y>0</y> + <width>352</width> + <height>650</height> + </rect> + </property> + <property name="sizePolicy"> + <sizepolicy hsizetype="Expanding" vsizetype="Expanding"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>350</width> + <height>500</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>3500</width> + <height>5000</height> + </size> + </property> + <property name="windowTitle"> + <string>Form</string> + </property> + <widget class="QWidget" name="widget" native="true"> + <property name="geometry"> + <rect> + <x>9</x> + <y>9</y> + <width>334</width> + <height>631</height> + </rect> + </property> + <layout class="QVBoxLayout" name="verticalLayout"> + <item> + <spacer name="verticalSpacer"> + <property name="orientation"> + <enum>Qt::Vertical</enum> + </property> + <property name="sizeType"> + <enum>QSizePolicy::Fixed</enum> + </property> + <property name="sizeHint" stdset="0"> + <size> + <width>20</width> + <height>20</height> + </size> + </property> + </spacer> + </item> + <item> + <layout class="QHBoxLayout" name="horizontalLayout"> + <item> + <widget class="QLabel" name="label_6"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Expanding" vsizetype="Fixed"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>0</width> + <height>20</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>16777215</width> + <height>30</height> + </size> + </property> + <property name="text"> + <string>Select Component :</string> + </property> + </widget> + </item> + <item> + <widget class="QComboBox" name="comboBox"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Expanding" vsizetype="Fixed"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>150</width> + <height>20</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>450</width> + <height>20</height> + </size> + </property> + </widget> + </item> + <item> + <widget class="QPushButton" name="pushButton_3"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Expanding" vsizetype="Fixed"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>50</width> + <height>20</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>250</width> + <height>20</height> + </size> + </property> + <property name="text"> + <string>Submit</string> + </property> + </widget> + </item> + </layout> + </item> + <item> + <widget class="QTableWidget" name="tableWidget"> + <property name="sizePolicy"> + <sizepolicy hsizetype="Expanding" vsizetype="Expanding"> + <horstretch>0</horstretch> + <verstretch>0</verstretch> + </sizepolicy> + </property> + <property name="minimumSize"> + <size> + <width>325</width> + <height>0</height> + </size> + </property> + <property name="maximumSize"> + <size> + <width>3200</width> + <height>5000</height> + </size> + </property> + <property name="layoutDirection"> + <enum>Qt::LeftToRight</enum> + </property> + <property name="autoFillBackground"> + <bool>true</bool> + </property> + <property name="styleSheet"> + <string notr="true">alternate-background-color:rgb(255, 170, 127) ; +background-color: white; +</string> + </property> + <property name="columnCount"> + <number>2</number> + </property> + <column> + <property name="text"> + <string>Property</string> + </property> + </column> + <column> + <property name="text"> + <string>Value</string> + </property> + </column> + </widget> + </item> + </layout> + </widget> + </widget> + <resources/> + <connections/> +</ui> diff --git a/resDockWidget.py b/resDockWidget.py new file mode 100644 index 0000000..5575cbd --- /dev/null +++ b/resDockWidget.py @@ -0,0 +1,89 @@ +from PyQt5.QtCore import * +from PyQt5.QtWidgets import * +from PyQt5.QtGui import * +from PyQt5.uic import loadUiType +import pandas as pd +from functools import partial +from component_selector import * +from collections import defaultdict +ui_dialog,_ = loadUiType('resDock.ui') + +class resdockWidget(QDockWidget,ui_dialog): + + def __init__(self,containerobj,parent=None): + QDockWidget.__init__(self,parent) + self.setupUi(self) + self.setWindowTitle("Results") + self.nameType = None + self.Container = containerobj + self.results() + + self.pushButton_3.clicked.connect(self.resultTree) + + def abriveation(self,key): + d ={"P":"Pressure","T":"Temperature", + "liqPhasMolFrac":"Liquid Phase Mol Fraction","liqPhasMasFrac":"Liquid Pase Mass Fraction", + "vapPhasMolFrac":"Vapour Phase Mol Fracrion","vapPhasMasFrac":"Vapour Phase Mass Fracrion", + "totMolFlo[1]":"Molar Flow","totMasFlo[1]":"Mass Flow","MW[1]":"Mixer Phase Molecular Weight", + "MW[2]":"Liquid Phase Molecular Weight","MW[3]":"Vapour Phase Molecular Weight", + "phasMolSpHeat[1]":"Mixer Phase molar Heat Capacity","phasMolSpHeat[2]":"Liquid Phase molar Heat Capacity", + "phasMolSpHeat[3]":"Vapour Phase molar Heat Capacity","phasMolEnth[1]":"Mixer Phase Molar Enthalpy", + "phasMolEnth[2]":"Liquid Phase Molar Enthalpy","phasMolEnth[3]":"Vapour Phase Molar Enthalpy", + "phasMolEntr[1]":"Mixer Phase Molar Entropy","phasMolEntr[2]":"Liquid Phase Molar Entropy", + "phasMolEntr[3]":"Vapour Phase Molar Entropy","totMolFlo[2]":"Liquid Phase Molar Flow Rate", + "totMolFlo[3]":"Vapour Phase Molar Flow Rate","totMasFlo[2]":"Liquid Phase Mass Flow Rate", + "totMolFlo[3]":"Liquid Phase Mass Flow Rate" + } + + for i in range(len(compound_selected)): + d["compMolFrac[1,"+str(i+1)+"]"] = str(compound_selected[i]) +" Mixer mole fraction" + d["compMolFrac[2,"+str(i+1)+"]"] = str(compound_selected[i]) +" Liquid mole fraction" + d["compMolFrac[3,"+str(i+1)+"]"] = str(compound_selected[i]) +" Vapour mole fraction" + + d["compMasFrac[1,"+str(i+1)+"]"] = str(compound_selected[i]) +" Mixer mass fraction" + d["compMasFrac[2,"+str(i+1)+"]"] = str(compound_selected[i]) +" Liquid mass fraction" + d["compMasFrac[3,"+str(i+1)+"]"] = str(compound_selected[i]) +" Vapour mass fraction" + + d["compMasFlo[1,"+str(i+1)+"]"] = str(compound_selected[i]) +" Mixer mass flo" + d["compMasFlo[2,"+str(i+1)+"]"] = str(compound_selected[i]) +" Liquid mass flo" + d["compMasFlo[3,"+str(i+1)+"]"] = str(compound_selected[i]) +" Vapour mass flo" + + d["compMolFlo[1,"+str(i+1)+"]"] = str(compound_selected[i]) +" Mixer mole flo" + d["compMolFlo[2,"+str(i+1)+"]"] = str(compound_selected[i]) +" Liquid mole flo" + d["compMolFlo[3,"+str(i+1)+"]"] = str(compound_selected[i]) +" Vapour mole flo" + if key in d.keys(): + return d[key] + else: + return key + + def resultsCategory(self,name): + try: + print("Under result category") + result=self.Container.result + obj = self.Container.fetchObject(name) + self.tableWidget.setRowCount(0); + for key, value in obj.Prop.items(): + propertyname = name + '.' + key + print(key,value) + if propertyname in result[0]: + ind = result[0].index(propertyname) + resultval = str(result[-1][ind]) + #stm.Prop[key] = resultval + print("######Resultsfetch####",key,resultval) + rowPosition = self.tableWidget.rowCount() + self.tableWidget.insertRow(rowPosition) + self.tableWidget.setItem(rowPosition , 0, QTableWidgetItem(str(self.abriveation(key)))) + self.tableWidget.setItem(rowPosition , 1, QTableWidgetItem(str(resultval))) + self.tableWidget.resizeColumnsToContents() + except Exception as e: + print(e) + + + def resultTree(self): + self.resultsCategory(self.comboBox.currentText()) + def results(self): + self.nameType={} + for i in self.Container.unitOp: + #nameslist.append(i.name) + self.nameType[i.name] = i.type + self.comboBox.addItem(str(i.name))
\ No newline at end of file diff --git a/thermopackage.txt b/thermopackage.txt new file mode 100644 index 0000000..050af5b --- /dev/null +++ b/thermopackage.txt @@ -0,0 +1,6 @@ +Raoults_Law +NRTL +INIQUAC +UNIFAC +Peng_Robinson +Grayson_Streed
\ No newline at end of file |
