summaryrefslogtreecommitdiff
path: root/lib/python2.7/lib-tk
diff options
context:
space:
mode:
authorrahulp132020-03-17 14:55:41 +0530
committerrahulp132020-03-17 14:55:41 +0530
commit296443137f4288cb030e92859ccfbe3204bc1088 (patch)
treeca4798c2da1e7244edc3bc108d81b462b537aea2 /lib/python2.7/lib-tk
parent0db48f6533517ecebfd9f0693f89deca28408b76 (diff)
downloadKiCad-eSim-296443137f4288cb030e92859ccfbe3204bc1088.tar.gz
KiCad-eSim-296443137f4288cb030e92859ccfbe3204bc1088.tar.bz2
KiCad-eSim-296443137f4288cb030e92859ccfbe3204bc1088.zip
initial commit
Diffstat (limited to 'lib/python2.7/lib-tk')
-rw-r--r--lib/python2.7/lib-tk/Canvas.py194
-rw-r--r--lib/python2.7/lib-tk/Dialog.py49
-rw-r--r--lib/python2.7/lib-tk/FileDialog.py274
-rw-r--r--lib/python2.7/lib-tk/FixTk.py81
-rw-r--r--lib/python2.7/lib-tk/ScrolledText.py55
-rw-r--r--lib/python2.7/lib-tk/SimpleDialog.py112
-rw-r--r--lib/python2.7/lib-tk/Tix.py1954
-rw-r--r--lib/python2.7/lib-tk/Tkconstants.py110
-rw-r--r--lib/python2.7/lib-tk/Tkdnd.py321
-rw-r--r--lib/python2.7/lib-tk/Tkinter.py3862
-rw-r--r--lib/python2.7/lib-tk/test/README14
-rw-r--r--lib/python2.7/lib-tk/test/runtktests.py70
-rw-r--r--lib/python2.7/lib-tk/test/test_tkinter/__init__.py0
-rw-r--r--lib/python2.7/lib-tk/test/test_tkinter/test_font.py97
-rw-r--r--lib/python2.7/lib-tk/test/test_tkinter/test_geometry_managers.py893
-rw-r--r--lib/python2.7/lib-tk/test/test_tkinter/test_images.py328
-rw-r--r--lib/python2.7/lib-tk/test/test_tkinter/test_loadtk.py45
-rw-r--r--lib/python2.7/lib-tk/test/test_tkinter/test_text.py47
-rw-r--r--lib/python2.7/lib-tk/test/test_tkinter/test_variables.py257
-rw-r--r--lib/python2.7/lib-tk/test/test_tkinter/test_widgets.py1199
-rw-r--r--lib/python2.7/lib-tk/test/test_ttk/__init__.py0
-rw-r--r--lib/python2.7/lib-tk/test/test_ttk/support.py105
-rw-r--r--lib/python2.7/lib-tk/test/test_ttk/test_extensions.py291
-rw-r--r--lib/python2.7/lib-tk/test/test_ttk/test_functions.py466
-rw-r--r--lib/python2.7/lib-tk/test/test_ttk/test_style.py92
-rw-r--r--lib/python2.7/lib-tk/test/test_ttk/test_widgets.py1674
-rw-r--r--lib/python2.7/lib-tk/test/widget_tests.py566
-rw-r--r--lib/python2.7/lib-tk/tkColorChooser.py72
-rw-r--r--lib/python2.7/lib-tk/tkCommonDialog.py60
-rw-r--r--lib/python2.7/lib-tk/tkFileDialog.py215
-rw-r--r--lib/python2.7/lib-tk/tkFont.py216
-rw-r--r--lib/python2.7/lib-tk/tkMessageBox.py134
-rw-r--r--lib/python2.7/lib-tk/tkSimpleDialog.py323
-rw-r--r--lib/python2.7/lib-tk/ttk.py1624
-rw-r--r--lib/python2.7/lib-tk/turtle.py4034
35 files changed, 19834 insertions, 0 deletions
diff --git a/lib/python2.7/lib-tk/Canvas.py b/lib/python2.7/lib-tk/Canvas.py
new file mode 100644
index 00000000..34464ab9
--- /dev/null
+++ b/lib/python2.7/lib-tk/Canvas.py
@@ -0,0 +1,194 @@
+# This module exports classes for the various canvas item types
+
+# NOTE: This module was an experiment and is now obsolete.
+# It's best to use the Tkinter.Canvas class directly.
+
+from warnings import warnpy3k
+warnpy3k("the Canvas module has been removed in Python 3.0", stacklevel=2)
+del warnpy3k
+
+from Tkinter import Canvas, _cnfmerge, _flatten
+
+
+class CanvasItem:
+ def __init__(self, canvas, itemType, *args, **kw):
+ self.canvas = canvas
+ self.id = canvas._create(itemType, args, kw)
+ if not hasattr(canvas, 'items'):
+ canvas.items = {}
+ canvas.items[self.id] = self
+ def __str__(self):
+ return str(self.id)
+ def __repr__(self):
+ return '<%s, id=%d>' % (self.__class__.__name__, self.id)
+ def delete(self):
+ del self.canvas.items[self.id]
+ self.canvas.delete(self.id)
+ def __getitem__(self, key):
+ v = self.canvas.tk.split(self.canvas.tk.call(
+ self.canvas._w, 'itemconfigure',
+ self.id, '-' + key))
+ return v[4]
+ cget = __getitem__
+ def __setitem__(self, key, value):
+ self.canvas.itemconfig(self.id, {key: value})
+ def keys(self):
+ if not hasattr(self, '_keys'):
+ self._keys = map(lambda x, tk=self.canvas.tk:
+ tk.splitlist(x)[0][1:],
+ self.canvas.tk.splitlist(
+ self.canvas._do(
+ 'itemconfigure',
+ (self.id,))))
+ return self._keys
+ def has_key(self, key):
+ return key in self.keys()
+ def __contains__(self, key):
+ return key in self.keys()
+ def addtag(self, tag, option='withtag'):
+ self.canvas.addtag(tag, option, self.id)
+ def bbox(self):
+ x1, y1, x2, y2 = self.canvas.bbox(self.id)
+ return (x1, y1), (x2, y2)
+ def bind(self, sequence=None, command=None, add=None):
+ return self.canvas.tag_bind(self.id, sequence, command, add)
+ def unbind(self, sequence, funcid=None):
+ self.canvas.tag_unbind(self.id, sequence, funcid)
+ def config(self, cnf={}, **kw):
+ return self.canvas.itemconfig(self.id, _cnfmerge((cnf, kw)))
+ def coords(self, pts = ()):
+ flat = ()
+ for x, y in pts: flat = flat + (x, y)
+ return self.canvas.coords(self.id, *flat)
+ def dchars(self, first, last=None):
+ self.canvas.dchars(self.id, first, last)
+ def dtag(self, ttd):
+ self.canvas.dtag(self.id, ttd)
+ def focus(self):
+ self.canvas.focus(self.id)
+ def gettags(self):
+ return self.canvas.gettags(self.id)
+ def icursor(self, index):
+ self.canvas.icursor(self.id, index)
+ def index(self, index):
+ return self.canvas.index(self.id, index)
+ def insert(self, beforethis, string):
+ self.canvas.insert(self.id, beforethis, string)
+ def lower(self, belowthis=None):
+ self.canvas.tag_lower(self.id, belowthis)
+ def move(self, xamount, yamount):
+ self.canvas.move(self.id, xamount, yamount)
+ def tkraise(self, abovethis=None):
+ self.canvas.tag_raise(self.id, abovethis)
+ raise_ = tkraise # BW compat
+ def scale(self, xorigin, yorigin, xscale, yscale):
+ self.canvas.scale(self.id, xorigin, yorigin, xscale, yscale)
+ def type(self):
+ return self.canvas.type(self.id)
+
+class Arc(CanvasItem):
+ def __init__(self, canvas, *args, **kw):
+ CanvasItem.__init__(self, canvas, 'arc', *args, **kw)
+
+class Bitmap(CanvasItem):
+ def __init__(self, canvas, *args, **kw):
+ CanvasItem.__init__(self, canvas, 'bitmap', *args, **kw)
+
+class ImageItem(CanvasItem):
+ def __init__(self, canvas, *args, **kw):
+ CanvasItem.__init__(self, canvas, 'image', *args, **kw)
+
+class Line(CanvasItem):
+ def __init__(self, canvas, *args, **kw):
+ CanvasItem.__init__(self, canvas, 'line', *args, **kw)
+
+class Oval(CanvasItem):
+ def __init__(self, canvas, *args, **kw):
+ CanvasItem.__init__(self, canvas, 'oval', *args, **kw)
+
+class Polygon(CanvasItem):
+ def __init__(self, canvas, *args, **kw):
+ CanvasItem.__init__(self, canvas, 'polygon', *args, **kw)
+
+class Rectangle(CanvasItem):
+ def __init__(self, canvas, *args, **kw):
+ CanvasItem.__init__(self, canvas, 'rectangle', *args, **kw)
+
+# XXX "Text" is taken by the Text widget...
+class CanvasText(CanvasItem):
+ def __init__(self, canvas, *args, **kw):
+ CanvasItem.__init__(self, canvas, 'text', *args, **kw)
+
+class Window(CanvasItem):
+ def __init__(self, canvas, *args, **kw):
+ CanvasItem.__init__(self, canvas, 'window', *args, **kw)
+
+class Group:
+ def __init__(self, canvas, tag=None):
+ if not tag:
+ tag = 'Group%d' % id(self)
+ self.tag = self.id = tag
+ self.canvas = canvas
+ self.canvas.dtag(self.tag)
+ def str(self):
+ return self.tag
+ __str__ = str
+ def _do(self, cmd, *args):
+ return self.canvas._do(cmd, (self.tag,) + _flatten(args))
+ def addtag_above(self, tagOrId):
+ self._do('addtag', 'above', tagOrId)
+ def addtag_all(self):
+ self._do('addtag', 'all')
+ def addtag_below(self, tagOrId):
+ self._do('addtag', 'below', tagOrId)
+ def addtag_closest(self, x, y, halo=None, start=None):
+ self._do('addtag', 'closest', x, y, halo, start)
+ def addtag_enclosed(self, x1, y1, x2, y2):
+ self._do('addtag', 'enclosed', x1, y1, x2, y2)
+ def addtag_overlapping(self, x1, y1, x2, y2):
+ self._do('addtag', 'overlapping', x1, y1, x2, y2)
+ def addtag_withtag(self, tagOrId):
+ self._do('addtag', 'withtag', tagOrId)
+ def bbox(self):
+ return self.canvas._getints(self._do('bbox'))
+ def bind(self, sequence=None, command=None, add=None):
+ return self.canvas.tag_bind(self.id, sequence, command, add)
+ def unbind(self, sequence, funcid=None):
+ self.canvas.tag_unbind(self.id, sequence, funcid)
+ def coords(self, *pts):
+ return self._do('coords', pts)
+ def dchars(self, first, last=None):
+ self._do('dchars', first, last)
+ def delete(self):
+ self._do('delete')
+ def dtag(self, tagToDelete=None):
+ self._do('dtag', tagToDelete)
+ def focus(self):
+ self._do('focus')
+ def gettags(self):
+ return self.canvas.tk.splitlist(self._do('gettags', self.tag))
+ def icursor(self, index):
+ return self._do('icursor', index)
+ def index(self, index):
+ return self.canvas.tk.getint(self._do('index', index))
+ def insert(self, beforeThis, string):
+ self._do('insert', beforeThis, string)
+ def config(self, cnf={}, **kw):
+ return self.canvas.itemconfigure(self.tag, _cnfmerge((cnf,kw)))
+ def lower(self, belowThis=None):
+ self._do('lower', belowThis)
+ def move(self, xAmount, yAmount):
+ self._do('move', xAmount, yAmount)
+ def tkraise(self, aboveThis=None):
+ self._do('raise', aboveThis)
+ lift = tkraise
+ def scale(self, xOrigin, yOrigin, xScale, yScale):
+ self._do('scale', xOrigin, yOrigin, xScale, yScale)
+ def select_adjust(self, index):
+ self.canvas._do('select', ('adjust', self.tag, index))
+ def select_from(self, index):
+ self.canvas._do('select', ('from', self.tag, index))
+ def select_to(self, index):
+ self.canvas._do('select', ('to', self.tag, index))
+ def type(self):
+ return self._do('type')
diff --git a/lib/python2.7/lib-tk/Dialog.py b/lib/python2.7/lib-tk/Dialog.py
new file mode 100644
index 00000000..2d089593
--- /dev/null
+++ b/lib/python2.7/lib-tk/Dialog.py
@@ -0,0 +1,49 @@
+# dialog.py -- Tkinter interface to the tk_dialog script.
+
+from Tkinter import *
+from Tkinter import _cnfmerge
+
+if TkVersion <= 3.6:
+ DIALOG_ICON = 'warning'
+else:
+ DIALOG_ICON = 'questhead'
+
+
+class Dialog(Widget):
+ def __init__(self, master=None, cnf={}, **kw):
+ cnf = _cnfmerge((cnf, kw))
+ self.widgetName = '__dialog__'
+ Widget._setup(self, master, cnf)
+ self.num = self.tk.getint(
+ self.tk.call(
+ 'tk_dialog', self._w,
+ cnf['title'], cnf['text'],
+ cnf['bitmap'], cnf['default'],
+ *cnf['strings']))
+ try: Widget.destroy(self)
+ except TclError: pass
+ def destroy(self): pass
+
+def _test():
+ d = Dialog(None, {'title': 'File Modified',
+ 'text':
+ 'File "Python.h" has been modified'
+ ' since the last time it was saved.'
+ ' Do you want to save it before'
+ ' exiting the application.',
+ 'bitmap': DIALOG_ICON,
+ 'default': 0,
+ 'strings': ('Save File',
+ 'Discard Changes',
+ 'Return to Editor')})
+ print d.num
+
+
+if __name__ == '__main__':
+ t = Button(None, {'text': 'Test',
+ 'command': _test,
+ Pack: {}})
+ q = Button(None, {'text': 'Quit',
+ 'command': t.quit,
+ Pack: {}})
+ t.mainloop()
diff --git a/lib/python2.7/lib-tk/FileDialog.py b/lib/python2.7/lib-tk/FileDialog.py
new file mode 100644
index 00000000..06ce2b92
--- /dev/null
+++ b/lib/python2.7/lib-tk/FileDialog.py
@@ -0,0 +1,274 @@
+"""File selection dialog classes.
+
+Classes:
+
+- FileDialog
+- LoadFileDialog
+- SaveFileDialog
+
+"""
+
+from Tkinter import *
+from Dialog import Dialog
+
+import os
+import fnmatch
+
+
+dialogstates = {}
+
+
+class FileDialog:
+
+ """Standard file selection dialog -- no checks on selected file.
+
+ Usage:
+
+ d = FileDialog(master)
+ fname = d.go(dir_or_file, pattern, default, key)
+ if fname is None: ...canceled...
+ else: ...open file...
+
+ All arguments to go() are optional.
+
+ The 'key' argument specifies a key in the global dictionary
+ 'dialogstates', which keeps track of the values for the directory
+ and pattern arguments, overriding the values passed in (it does
+ not keep track of the default argument!). If no key is specified,
+ the dialog keeps no memory of previous state. Note that memory is
+ kept even when the dialog is canceled. (All this emulates the
+ behavior of the Macintosh file selection dialogs.)
+
+ """
+
+ title = "File Selection Dialog"
+
+ def __init__(self, master, title=None):
+ if title is None: title = self.title
+ self.master = master
+ self.directory = None
+
+ self.top = Toplevel(master)
+ self.top.title(title)
+ self.top.iconname(title)
+
+ self.botframe = Frame(self.top)
+ self.botframe.pack(side=BOTTOM, fill=X)
+
+ self.selection = Entry(self.top)
+ self.selection.pack(side=BOTTOM, fill=X)
+ self.selection.bind('<Return>', self.ok_event)
+
+ self.filter = Entry(self.top)
+ self.filter.pack(side=TOP, fill=X)
+ self.filter.bind('<Return>', self.filter_command)
+
+ self.midframe = Frame(self.top)
+ self.midframe.pack(expand=YES, fill=BOTH)
+
+ self.filesbar = Scrollbar(self.midframe)
+ self.filesbar.pack(side=RIGHT, fill=Y)
+ self.files = Listbox(self.midframe, exportselection=0,
+ yscrollcommand=(self.filesbar, 'set'))
+ self.files.pack(side=RIGHT, expand=YES, fill=BOTH)
+ btags = self.files.bindtags()
+ self.files.bindtags(btags[1:] + btags[:1])
+ self.files.bind('<ButtonRelease-1>', self.files_select_event)
+ self.files.bind('<Double-ButtonRelease-1>', self.files_double_event)
+ self.filesbar.config(command=(self.files, 'yview'))
+
+ self.dirsbar = Scrollbar(self.midframe)
+ self.dirsbar.pack(side=LEFT, fill=Y)
+ self.dirs = Listbox(self.midframe, exportselection=0,
+ yscrollcommand=(self.dirsbar, 'set'))
+ self.dirs.pack(side=LEFT, expand=YES, fill=BOTH)
+ self.dirsbar.config(command=(self.dirs, 'yview'))
+ btags = self.dirs.bindtags()
+ self.dirs.bindtags(btags[1:] + btags[:1])
+ self.dirs.bind('<ButtonRelease-1>', self.dirs_select_event)
+ self.dirs.bind('<Double-ButtonRelease-1>', self.dirs_double_event)
+
+ self.ok_button = Button(self.botframe,
+ text="OK",
+ command=self.ok_command)
+ self.ok_button.pack(side=LEFT)
+ self.filter_button = Button(self.botframe,
+ text="Filter",
+ command=self.filter_command)
+ self.filter_button.pack(side=LEFT, expand=YES)
+ self.cancel_button = Button(self.botframe,
+ text="Cancel",
+ command=self.cancel_command)
+ self.cancel_button.pack(side=RIGHT)
+
+ self.top.protocol('WM_DELETE_WINDOW', self.cancel_command)
+ # XXX Are the following okay for a general audience?
+ self.top.bind('<Alt-w>', self.cancel_command)
+ self.top.bind('<Alt-W>', self.cancel_command)
+
+ def go(self, dir_or_file=os.curdir, pattern="*", default="", key=None):
+ if key and key in dialogstates:
+ self.directory, pattern = dialogstates[key]
+ else:
+ dir_or_file = os.path.expanduser(dir_or_file)
+ if os.path.isdir(dir_or_file):
+ self.directory = dir_or_file
+ else:
+ self.directory, default = os.path.split(dir_or_file)
+ self.set_filter(self.directory, pattern)
+ self.set_selection(default)
+ self.filter_command()
+ self.selection.focus_set()
+ self.top.wait_visibility() # window needs to be visible for the grab
+ self.top.grab_set()
+ self.how = None
+ self.master.mainloop() # Exited by self.quit(how)
+ if key:
+ directory, pattern = self.get_filter()
+ if self.how:
+ directory = os.path.dirname(self.how)
+ dialogstates[key] = directory, pattern
+ self.top.destroy()
+ return self.how
+
+ def quit(self, how=None):
+ self.how = how
+ self.master.quit() # Exit mainloop()
+
+ def dirs_double_event(self, event):
+ self.filter_command()
+
+ def dirs_select_event(self, event):
+ dir, pat = self.get_filter()
+ subdir = self.dirs.get('active')
+ dir = os.path.normpath(os.path.join(self.directory, subdir))
+ self.set_filter(dir, pat)
+
+ def files_double_event(self, event):
+ self.ok_command()
+
+ def files_select_event(self, event):
+ file = self.files.get('active')
+ self.set_selection(file)
+
+ def ok_event(self, event):
+ self.ok_command()
+
+ def ok_command(self):
+ self.quit(self.get_selection())
+
+ def filter_command(self, event=None):
+ dir, pat = self.get_filter()
+ try:
+ names = os.listdir(dir)
+ except os.error:
+ self.master.bell()
+ return
+ self.directory = dir
+ self.set_filter(dir, pat)
+ names.sort()
+ subdirs = [os.pardir]
+ matchingfiles = []
+ for name in names:
+ fullname = os.path.join(dir, name)
+ if os.path.isdir(fullname):
+ subdirs.append(name)
+ elif fnmatch.fnmatch(name, pat):
+ matchingfiles.append(name)
+ self.dirs.delete(0, END)
+ for name in subdirs:
+ self.dirs.insert(END, name)
+ self.files.delete(0, END)
+ for name in matchingfiles:
+ self.files.insert(END, name)
+ head, tail = os.path.split(self.get_selection())
+ if tail == os.curdir: tail = ''
+ self.set_selection(tail)
+
+ def get_filter(self):
+ filter = self.filter.get()
+ filter = os.path.expanduser(filter)
+ if filter[-1:] == os.sep or os.path.isdir(filter):
+ filter = os.path.join(filter, "*")
+ return os.path.split(filter)
+
+ def get_selection(self):
+ file = self.selection.get()
+ file = os.path.expanduser(file)
+ return file
+
+ def cancel_command(self, event=None):
+ self.quit()
+
+ def set_filter(self, dir, pat):
+ if not os.path.isabs(dir):
+ try:
+ pwd = os.getcwd()
+ except os.error:
+ pwd = None
+ if pwd:
+ dir = os.path.join(pwd, dir)
+ dir = os.path.normpath(dir)
+ self.filter.delete(0, END)
+ self.filter.insert(END, os.path.join(dir or os.curdir, pat or "*"))
+
+ def set_selection(self, file):
+ self.selection.delete(0, END)
+ self.selection.insert(END, os.path.join(self.directory, file))
+
+
+class LoadFileDialog(FileDialog):
+
+ """File selection dialog which checks that the file exists."""
+
+ title = "Load File Selection Dialog"
+
+ def ok_command(self):
+ file = self.get_selection()
+ if not os.path.isfile(file):
+ self.master.bell()
+ else:
+ self.quit(file)
+
+
+class SaveFileDialog(FileDialog):
+
+ """File selection dialog which checks that the file may be created."""
+
+ title = "Save File Selection Dialog"
+
+ def ok_command(self):
+ file = self.get_selection()
+ if os.path.exists(file):
+ if os.path.isdir(file):
+ self.master.bell()
+ return
+ d = Dialog(self.top,
+ title="Overwrite Existing File Question",
+ text="Overwrite existing file %r?" % (file,),
+ bitmap='questhead',
+ default=1,
+ strings=("Yes", "Cancel"))
+ if d.num != 0:
+ return
+ else:
+ head, tail = os.path.split(file)
+ if not os.path.isdir(head):
+ self.master.bell()
+ return
+ self.quit(file)
+
+
+def test():
+ """Simple test program."""
+ root = Tk()
+ root.withdraw()
+ fd = LoadFileDialog(root)
+ loadfile = fd.go(key="test")
+ fd = SaveFileDialog(root)
+ savefile = fd.go(key="test")
+ print loadfile, savefile
+
+
+if __name__ == '__main__':
+ test()
diff --git a/lib/python2.7/lib-tk/FixTk.py b/lib/python2.7/lib-tk/FixTk.py
new file mode 100644
index 00000000..8af27b58
--- /dev/null
+++ b/lib/python2.7/lib-tk/FixTk.py
@@ -0,0 +1,81 @@
+import sys, os
+
+# Delay import _tkinter until we have set TCL_LIBRARY,
+# so that Tcl_FindExecutable has a chance to locate its
+# encoding directory.
+
+# Unfortunately, we cannot know the TCL_LIBRARY directory
+# if we don't know the tcl version, which we cannot find out
+# without import Tcl. Fortunately, Tcl will itself look in
+# <TCL_LIBRARY>\..\tcl<TCL_VERSION>, so anything close to
+# the real Tcl library will do.
+
+# Expand symbolic links on Vista
+try:
+ import ctypes
+ ctypes.windll.kernel32.GetFinalPathNameByHandleW
+except (ImportError, AttributeError):
+ def convert_path(s):
+ return s
+else:
+ def convert_path(s):
+ assert isinstance(s, str) # sys.prefix contains only bytes
+ udir = s.decode("mbcs")
+ hdir = ctypes.windll.kernel32.\
+ CreateFileW(udir, 0x80, # FILE_READ_ATTRIBUTES
+ 1, # FILE_SHARE_READ
+ None, 3, # OPEN_EXISTING
+ 0x02000000, # FILE_FLAG_BACKUP_SEMANTICS
+ None)
+ if hdir == -1:
+ # Cannot open directory, give up
+ return s
+ buf = ctypes.create_unicode_buffer(u"", 32768)
+ res = ctypes.windll.kernel32.\
+ GetFinalPathNameByHandleW(hdir, buf, len(buf),
+ 0) # VOLUME_NAME_DOS
+ ctypes.windll.kernel32.CloseHandle(hdir)
+ if res == 0:
+ # Conversion failed (e.g. network location)
+ return s
+ s = buf[:res].encode("mbcs")
+ # Ignore leading \\?\
+ if s.startswith("\\\\?\\"):
+ s = s[4:]
+ if s.startswith("UNC"):
+ s = "\\" + s[3:]
+ return s
+
+prefix = os.path.join(sys.prefix,"tcl")
+if not os.path.exists(prefix):
+ # devdir/externals/tcltk/lib
+ tcltk = 'tcltk'
+ if sys.maxsize > 2**31 - 1:
+ tcltk = 'tcltk64'
+ prefix = os.path.join(sys.prefix, "externals", tcltk, "lib")
+ prefix = os.path.abspath(prefix)
+# if this does not exist, no further search is needed
+if os.path.exists(prefix):
+ prefix = convert_path(prefix)
+ if "TCL_LIBRARY" not in os.environ:
+ for name in os.listdir(prefix):
+ if name.startswith("tcl"):
+ tcldir = os.path.join(prefix,name)
+ if os.path.isdir(tcldir):
+ os.environ["TCL_LIBRARY"] = tcldir
+ # Compute TK_LIBRARY, knowing that it has the same version
+ # as Tcl
+ import _tkinter
+ ver = str(_tkinter.TCL_VERSION)
+ if "TK_LIBRARY" not in os.environ:
+ v = os.path.join(prefix, 'tk'+ver)
+ if os.path.exists(os.path.join(v, "tclIndex")):
+ os.environ['TK_LIBRARY'] = v
+ # We don't know the Tix version, so we must search the entire
+ # directory
+ if "TIX_LIBRARY" not in os.environ:
+ for name in os.listdir(prefix):
+ if name.startswith("tix"):
+ tixdir = os.path.join(prefix,name)
+ if os.path.isdir(tixdir):
+ os.environ["TIX_LIBRARY"] = tixdir
diff --git a/lib/python2.7/lib-tk/ScrolledText.py b/lib/python2.7/lib-tk/ScrolledText.py
new file mode 100644
index 00000000..a1ef79ca
--- /dev/null
+++ b/lib/python2.7/lib-tk/ScrolledText.py
@@ -0,0 +1,55 @@
+"""A ScrolledText widget feels like a text widget but also has a
+vertical scroll bar on its right. (Later, options may be added to
+add a horizontal bar as well, to make the bars disappear
+automatically when not needed, to move them to the other side of the
+window, etc.)
+
+Configuration options are passed to the Text widget.
+A Frame widget is inserted between the master and the text, to hold
+the Scrollbar widget.
+Most methods calls are inherited from the Text widget; Pack, Grid and
+Place methods are redirected to the Frame widget however.
+"""
+
+__all__ = ['ScrolledText']
+
+from Tkinter import Frame, Text, Scrollbar, Pack, Grid, Place
+from Tkconstants import RIGHT, LEFT, Y, BOTH
+
+class ScrolledText(Text):
+ def __init__(self, master=None, **kw):
+ self.frame = Frame(master)
+ self.vbar = Scrollbar(self.frame)
+ self.vbar.pack(side=RIGHT, fill=Y)
+
+ kw.update({'yscrollcommand': self.vbar.set})
+ Text.__init__(self, self.frame, **kw)
+ self.pack(side=LEFT, fill=BOTH, expand=True)
+ self.vbar['command'] = self.yview
+
+ # Copy geometry methods of self.frame without overriding Text
+ # methods -- hack!
+ text_meths = vars(Text).keys()
+ methods = vars(Pack).keys() + vars(Grid).keys() + vars(Place).keys()
+ methods = set(methods).difference(text_meths)
+
+ for m in methods:
+ if m[0] != '_' and m != 'config' and m != 'configure':
+ setattr(self, m, getattr(self.frame, m))
+
+ def __str__(self):
+ return str(self.frame)
+
+
+def example():
+ import __main__
+ from Tkconstants import END
+
+ stext = ScrolledText(bg='white', height=10)
+ stext.insert(END, __main__.__doc__)
+ stext.pack(fill=BOTH, side=LEFT, expand=True)
+ stext.focus_set()
+ stext.mainloop()
+
+if __name__ == "__main__":
+ example()
diff --git a/lib/python2.7/lib-tk/SimpleDialog.py b/lib/python2.7/lib-tk/SimpleDialog.py
new file mode 100644
index 00000000..cb08318d
--- /dev/null
+++ b/lib/python2.7/lib-tk/SimpleDialog.py
@@ -0,0 +1,112 @@
+"""A simple but flexible modal dialog box."""
+
+
+from Tkinter import *
+
+
+class SimpleDialog:
+
+ def __init__(self, master,
+ text='', buttons=[], default=None, cancel=None,
+ title=None, class_=None):
+ if class_:
+ self.root = Toplevel(master, class_=class_)
+ else:
+ self.root = Toplevel(master)
+ if title:
+ self.root.title(title)
+ self.root.iconname(title)
+ self.message = Message(self.root, text=text, aspect=400)
+ self.message.pack(expand=1, fill=BOTH)
+ self.frame = Frame(self.root)
+ self.frame.pack()
+ self.num = default
+ self.cancel = cancel
+ self.default = default
+ self.root.bind('<Return>', self.return_event)
+ for num in range(len(buttons)):
+ s = buttons[num]
+ b = Button(self.frame, text=s,
+ command=(lambda self=self, num=num: self.done(num)))
+ if num == default:
+ b.config(relief=RIDGE, borderwidth=8)
+ b.pack(side=LEFT, fill=BOTH, expand=1)
+ self.root.protocol('WM_DELETE_WINDOW', self.wm_delete_window)
+ self._set_transient(master)
+
+ def _set_transient(self, master, relx=0.5, rely=0.3):
+ widget = self.root
+ widget.withdraw() # Remain invisible while we figure out the geometry
+ widget.transient(master)
+ widget.update_idletasks() # Actualize geometry information
+ if master.winfo_ismapped():
+ m_width = master.winfo_width()
+ m_height = master.winfo_height()
+ m_x = master.winfo_rootx()
+ m_y = master.winfo_rooty()
+ else:
+ m_width = master.winfo_screenwidth()
+ m_height = master.winfo_screenheight()
+ m_x = m_y = 0
+ w_width = widget.winfo_reqwidth()
+ w_height = widget.winfo_reqheight()
+ x = m_x + (m_width - w_width) * relx
+ y = m_y + (m_height - w_height) * rely
+ if x+w_width > master.winfo_screenwidth():
+ x = master.winfo_screenwidth() - w_width
+ elif x < 0:
+ x = 0
+ if y+w_height > master.winfo_screenheight():
+ y = master.winfo_screenheight() - w_height
+ elif y < 0:
+ y = 0
+ widget.geometry("+%d+%d" % (x, y))
+ widget.deiconify() # Become visible at the desired location
+
+ def go(self):
+ self.root.wait_visibility()
+ self.root.grab_set()
+ self.root.mainloop()
+ self.root.destroy()
+ return self.num
+
+ def return_event(self, event):
+ if self.default is None:
+ self.root.bell()
+ else:
+ self.done(self.default)
+
+ def wm_delete_window(self):
+ if self.cancel is None:
+ self.root.bell()
+ else:
+ self.done(self.cancel)
+
+ def done(self, num):
+ self.num = num
+ self.root.quit()
+
+
+if __name__ == '__main__':
+
+ def test():
+ root = Tk()
+ def doit(root=root):
+ d = SimpleDialog(root,
+ text="This is a test dialog. "
+ "Would this have been an actual dialog, "
+ "the buttons below would have been glowing "
+ "in soft pink light.\n"
+ "Do you believe this?",
+ buttons=["Yes", "No", "Cancel"],
+ default=0,
+ cancel=2,
+ title="Test Dialog")
+ print d.go()
+ t = Button(root, text='Test', command=doit)
+ t.pack()
+ q = Button(root, text='Quit', command=t.quit)
+ q.pack()
+ t.mainloop()
+
+ test()
diff --git a/lib/python2.7/lib-tk/Tix.py b/lib/python2.7/lib-tk/Tix.py
new file mode 100644
index 00000000..45e8a903
--- /dev/null
+++ b/lib/python2.7/lib-tk/Tix.py
@@ -0,0 +1,1954 @@
+# -*-mode: python; fill-column: 75; tab-width: 8; coding: iso-latin-1-unix -*-
+#
+# $Id$
+#
+# Tix.py -- Tix widget wrappers.
+#
+# For Tix, see http://tix.sourceforge.net
+#
+# - Sudhir Shenoy (sshenoy@gol.com), Dec. 1995.
+# based on an idea of Jean-Marc Lugrin (lugrin@ms.com)
+#
+# NOTE: In order to minimize changes to Tkinter.py, some of the code here
+# (TixWidget.__init__) has been taken from Tkinter (Widget.__init__)
+# and will break if there are major changes in Tkinter.
+#
+# The Tix widgets are represented by a class hierarchy in python with proper
+# inheritance of base classes.
+#
+# As a result after creating a 'w = StdButtonBox', I can write
+# w.ok['text'] = 'Who Cares'
+# or w.ok['bg'] = w['bg']
+# or even w.ok.invoke()
+# etc.
+#
+# Compare the demo tixwidgets.py to the original Tcl program and you will
+# appreciate the advantages.
+#
+
+import os
+import Tkinter
+from Tkinter import *
+from Tkinter import _flatten, _cnfmerge
+
+# WARNING - TkVersion is a limited precision floating point number
+if TkVersion < 3.999:
+ raise ImportError, "This version of Tix.py requires Tk 4.0 or higher"
+
+import _tkinter # If this fails your Python may not be configured for Tk
+
+# Some more constants (for consistency with Tkinter)
+WINDOW = 'window'
+TEXT = 'text'
+STATUS = 'status'
+IMMEDIATE = 'immediate'
+IMAGE = 'image'
+IMAGETEXT = 'imagetext'
+BALLOON = 'balloon'
+AUTO = 'auto'
+ACROSSTOP = 'acrosstop'
+
+# A few useful constants for the Grid widget
+ASCII = 'ascii'
+CELL = 'cell'
+COLUMN = 'column'
+DECREASING = 'decreasing'
+INCREASING = 'increasing'
+INTEGER = 'integer'
+MAIN = 'main'
+MAX = 'max'
+REAL = 'real'
+ROW = 'row'
+S_REGION = 's-region'
+X_REGION = 'x-region'
+Y_REGION = 'y-region'
+
+# Some constants used by Tkinter dooneevent()
+TCL_DONT_WAIT = 1 << 1
+TCL_WINDOW_EVENTS = 1 << 2
+TCL_FILE_EVENTS = 1 << 3
+TCL_TIMER_EVENTS = 1 << 4
+TCL_IDLE_EVENTS = 1 << 5
+TCL_ALL_EVENTS = 0
+
+# BEWARE - this is implemented by copying some code from the Widget class
+# in Tkinter (to override Widget initialization) and is therefore
+# liable to break.
+
+# Could probably add this to Tkinter.Misc
+class tixCommand:
+ """The tix commands provide access to miscellaneous elements
+ of Tix's internal state and the Tix application context.
+ Most of the information manipulated by these commands pertains
+ to the application as a whole, or to a screen or
+ display, rather than to a particular window.
+
+ This is a mixin class, assumed to be mixed to Tkinter.Tk
+ that supports the self.tk.call method.
+ """
+
+ def tix_addbitmapdir(self, directory):
+ """Tix maintains a list of directories under which
+ the tix_getimage and tix_getbitmap commands will
+ search for image files. The standard bitmap directory
+ is $TIX_LIBRARY/bitmaps. The addbitmapdir command
+ adds directory into this list. By using this
+ command, the image files of an applications can
+ also be located using the tix_getimage or tix_getbitmap
+ command.
+ """
+ return self.tk.call('tix', 'addbitmapdir', directory)
+
+ def tix_cget(self, option):
+ """Returns the current value of the configuration
+ option given by option. Option may be any of the
+ options described in the CONFIGURATION OPTIONS section.
+ """
+ return self.tk.call('tix', 'cget', option)
+
+ def tix_configure(self, cnf=None, **kw):
+ """Query or modify the configuration options of the Tix application
+ context. If no option is specified, returns a dictionary all of the
+ available options. If option is specified with no value, then the
+ command returns a list describing the one named option (this list
+ will be identical to the corresponding sublist of the value
+ returned if no option is specified). If one or more option-value
+ pairs are specified, then the command modifies the given option(s)
+ to have the given value(s); in this case the command returns an
+ empty string. Option may be any of the configuration options.
+ """
+ # Copied from Tkinter.py
+ if kw:
+ cnf = _cnfmerge((cnf, kw))
+ elif cnf:
+ cnf = _cnfmerge(cnf)
+ if cnf is None:
+ return self._getconfigure('tix', 'configure')
+ if isinstance(cnf, StringType):
+ return self._getconfigure1('tix', 'configure', '-'+cnf)
+ return self.tk.call(('tix', 'configure') + self._options(cnf))
+
+ def tix_filedialog(self, dlgclass=None):
+ """Returns the file selection dialog that may be shared among
+ different calls from this application. This command will create a
+ file selection dialog widget when it is called the first time. This
+ dialog will be returned by all subsequent calls to tix_filedialog.
+ An optional dlgclass parameter can be passed to specified what type
+ of file selection dialog widget is desired. Possible options are
+ tix FileSelectDialog or tixExFileSelectDialog.
+ """
+ if dlgclass is not None:
+ return self.tk.call('tix', 'filedialog', dlgclass)
+ else:
+ return self.tk.call('tix', 'filedialog')
+
+ def tix_getbitmap(self, name):
+ """Locates a bitmap file of the name name.xpm or name in one of the
+ bitmap directories (see the tix_addbitmapdir command above). By
+ using tix_getbitmap, you can avoid hard coding the pathnames of the
+ bitmap files in your application. When successful, it returns the
+ complete pathname of the bitmap file, prefixed with the character
+ '@'. The returned value can be used to configure the -bitmap
+ option of the TK and Tix widgets.
+ """
+ return self.tk.call('tix', 'getbitmap', name)
+
+ def tix_getimage(self, name):
+ """Locates an image file of the name name.xpm, name.xbm or name.ppm
+ in one of the bitmap directories (see the addbitmapdir command
+ above). If more than one file with the same name (but different
+ extensions) exist, then the image type is chosen according to the
+ depth of the X display: xbm images are chosen on monochrome
+ displays and color images are chosen on color displays. By using
+ tix_ getimage, you can avoid hard coding the pathnames of the
+ image files in your application. When successful, this command
+ returns the name of the newly created image, which can be used to
+ configure the -image option of the Tk and Tix widgets.
+ """
+ return self.tk.call('tix', 'getimage', name)
+
+ def tix_option_get(self, name):
+ """Gets the options maintained by the Tix
+ scheme mechanism. Available options include:
+
+ active_bg active_fg bg
+ bold_font dark1_bg dark1_fg
+ dark2_bg dark2_fg disabled_fg
+ fg fixed_font font
+ inactive_bg inactive_fg input1_bg
+ input2_bg italic_font light1_bg
+ light1_fg light2_bg light2_fg
+ menu_font output1_bg output2_bg
+ select_bg select_fg selector
+ """
+ # could use self.tk.globalgetvar('tixOption', name)
+ return self.tk.call('tix', 'option', 'get', name)
+
+ def tix_resetoptions(self, newScheme, newFontSet, newScmPrio=None):
+ """Resets the scheme and fontset of the Tix application to
+ newScheme and newFontSet, respectively. This affects only those
+ widgets created after this call. Therefore, it is best to call the
+ resetoptions command before the creation of any widgets in a Tix
+ application.
+
+ The optional parameter newScmPrio can be given to reset the
+ priority level of the Tk options set by the Tix schemes.
+
+ Because of the way Tk handles the X option database, after Tix has
+ been has imported and inited, it is not possible to reset the color
+ schemes and font sets using the tix config command. Instead, the
+ tix_resetoptions command must be used.
+ """
+ if newScmPrio is not None:
+ return self.tk.call('tix', 'resetoptions', newScheme, newFontSet, newScmPrio)
+ else:
+ return self.tk.call('tix', 'resetoptions', newScheme, newFontSet)
+
+class Tk(Tkinter.Tk, tixCommand):
+ """Toplevel widget of Tix which represents mostly the main window
+ of an application. It has an associated Tcl interpreter."""
+ def __init__(self, screenName=None, baseName=None, className='Tix'):
+ Tkinter.Tk.__init__(self, screenName, baseName, className)
+ tixlib = os.environ.get('TIX_LIBRARY')
+ self.tk.eval('global auto_path; lappend auto_path [file dir [info nameof]]')
+ if tixlib is not None:
+ self.tk.eval('global auto_path; lappend auto_path {%s}' % tixlib)
+ self.tk.eval('global tcl_pkgPath; lappend tcl_pkgPath {%s}' % tixlib)
+ # Load Tix - this should work dynamically or statically
+ # If it's static, tcl/tix8.1/pkgIndex.tcl should have
+ # 'load {} Tix'
+ # If it's dynamic under Unix, tcl/tix8.1/pkgIndex.tcl should have
+ # 'load libtix8.1.8.3.so Tix'
+ self.tk.eval('package require Tix')
+
+ def destroy(self):
+ # For safety, remove the delete_window binding before destroy
+ self.protocol("WM_DELETE_WINDOW", "")
+ Tkinter.Tk.destroy(self)
+
+# The Tix 'tixForm' geometry manager
+class Form:
+ """The Tix Form geometry manager
+
+ Widgets can be arranged by specifying attachments to other widgets.
+ See Tix documentation for complete details"""
+
+ def config(self, cnf={}, **kw):
+ self.tk.call('tixForm', self._w, *self._options(cnf, kw))
+
+ form = config
+
+ def __setitem__(self, key, value):
+ Form.form(self, {key: value})
+
+ def check(self):
+ return self.tk.call('tixForm', 'check', self._w)
+
+ def forget(self):
+ self.tk.call('tixForm', 'forget', self._w)
+
+ def grid(self, xsize=0, ysize=0):
+ if (not xsize) and (not ysize):
+ x = self.tk.call('tixForm', 'grid', self._w)
+ y = self.tk.splitlist(x)
+ z = ()
+ for x in y:
+ z = z + (self.tk.getint(x),)
+ return z
+ return self.tk.call('tixForm', 'grid', self._w, xsize, ysize)
+
+ def info(self, option=None):
+ if not option:
+ return self.tk.call('tixForm', 'info', self._w)
+ if option[0] != '-':
+ option = '-' + option
+ return self.tk.call('tixForm', 'info', self._w, option)
+
+ def slaves(self):
+ return map(self._nametowidget,
+ self.tk.splitlist(
+ self.tk.call(
+ 'tixForm', 'slaves', self._w)))
+
+
+
+Tkinter.Widget.__bases__ = Tkinter.Widget.__bases__ + (Form,)
+
+class TixWidget(Tkinter.Widget):
+ """A TixWidget class is used to package all (or most) Tix widgets.
+
+ Widget initialization is extended in two ways:
+ 1) It is possible to give a list of options which must be part of
+ the creation command (so called Tix 'static' options). These cannot be
+ given as a 'config' command later.
+ 2) It is possible to give the name of an existing TK widget. These are
+ child widgets created automatically by a Tix mega-widget. The Tk call
+ to create these widgets is therefore bypassed in TixWidget.__init__
+
+ Both options are for use by subclasses only.
+ """
+ def __init__ (self, master=None, widgetName=None,
+ static_options=None, cnf={}, kw={}):
+ # Merge keywords and dictionary arguments
+ if kw:
+ cnf = _cnfmerge((cnf, kw))
+ else:
+ cnf = _cnfmerge(cnf)
+
+ # Move static options into extra. static_options must be
+ # a list of keywords (or None).
+ extra=()
+
+ # 'options' is always a static option
+ if static_options:
+ static_options.append('options')
+ else:
+ static_options = ['options']
+
+ for k,v in cnf.items()[:]:
+ if k in static_options:
+ extra = extra + ('-' + k, v)
+ del cnf[k]
+
+ self.widgetName = widgetName
+ Widget._setup(self, master, cnf)
+
+ # If widgetName is None, this is a dummy creation call where the
+ # corresponding Tk widget has already been created by Tix
+ if widgetName:
+ self.tk.call(widgetName, self._w, *extra)
+
+ # Non-static options - to be done via a 'config' command
+ if cnf:
+ Widget.config(self, cnf)
+
+ # Dictionary to hold subwidget names for easier access. We can't
+ # use the children list because the public Tix names may not be the
+ # same as the pathname component
+ self.subwidget_list = {}
+
+ # We set up an attribute access function so that it is possible to
+ # do w.ok['text'] = 'Hello' rather than w.subwidget('ok')['text'] = 'Hello'
+ # when w is a StdButtonBox.
+ # We can even do w.ok.invoke() because w.ok is subclassed from the
+ # Button class if you go through the proper constructors
+ def __getattr__(self, name):
+ if name in self.subwidget_list:
+ return self.subwidget_list[name]
+ raise AttributeError, name
+
+ def set_silent(self, value):
+ """Set a variable without calling its action routine"""
+ self.tk.call('tixSetSilent', self._w, value)
+
+ def subwidget(self, name):
+ """Return the named subwidget (which must have been created by
+ the sub-class)."""
+ n = self._subwidget_name(name)
+ if not n:
+ raise TclError, "Subwidget " + name + " not child of " + self._name
+ # Remove header of name and leading dot
+ n = n[len(self._w)+1:]
+ return self._nametowidget(n)
+
+ def subwidgets_all(self):
+ """Return all subwidgets."""
+ names = self._subwidget_names()
+ if not names:
+ return []
+ retlist = []
+ for name in names:
+ name = name[len(self._w)+1:]
+ try:
+ retlist.append(self._nametowidget(name))
+ except:
+ # some of the widgets are unknown e.g. border in LabelFrame
+ pass
+ return retlist
+
+ def _subwidget_name(self,name):
+ """Get a subwidget name (returns a String, not a Widget !)"""
+ try:
+ return self.tk.call(self._w, 'subwidget', name)
+ except TclError:
+ return None
+
+ def _subwidget_names(self):
+ """Return the name of all subwidgets."""
+ try:
+ x = self.tk.call(self._w, 'subwidgets', '-all')
+ return self.tk.splitlist(x)
+ except TclError:
+ return None
+
+ def config_all(self, option, value):
+ """Set configuration options for all subwidgets (and self)."""
+ if option == '':
+ return
+ elif not isinstance(option, StringType):
+ option = repr(option)
+ if not isinstance(value, StringType):
+ value = repr(value)
+ names = self._subwidget_names()
+ for name in names:
+ self.tk.call(name, 'configure', '-' + option, value)
+ # These are missing from Tkinter
+ def image_create(self, imgtype, cnf={}, master=None, **kw):
+ if not master:
+ master = Tkinter._default_root
+ if not master:
+ raise RuntimeError, 'Too early to create image'
+ if kw and cnf: cnf = _cnfmerge((cnf, kw))
+ elif kw: cnf = kw
+ options = ()
+ for k, v in cnf.items():
+ if hasattr(v, '__call__'):
+ v = self._register(v)
+ options = options + ('-'+k, v)
+ return master.tk.call(('image', 'create', imgtype,) + options)
+ def image_delete(self, imgname):
+ try:
+ self.tk.call('image', 'delete', imgname)
+ except TclError:
+ # May happen if the root was destroyed
+ pass
+
+# Subwidgets are child widgets created automatically by mega-widgets.
+# In python, we have to create these subwidgets manually to mirror their
+# existence in Tk/Tix.
+class TixSubWidget(TixWidget):
+ """Subwidget class.
+
+ This is used to mirror child widgets automatically created
+ by Tix/Tk as part of a mega-widget in Python (which is not informed
+ of this)"""
+
+ def __init__(self, master, name,
+ destroy_physically=1, check_intermediate=1):
+ if check_intermediate:
+ path = master._subwidget_name(name)
+ try:
+ path = path[len(master._w)+1:]
+ plist = path.split('.')
+ except:
+ plist = []
+
+ if not check_intermediate:
+ # immediate descendant
+ TixWidget.__init__(self, master, None, None, {'name' : name})
+ else:
+ # Ensure that the intermediate widgets exist
+ parent = master
+ for i in range(len(plist) - 1):
+ n = '.'.join(plist[:i+1])
+ try:
+ w = master._nametowidget(n)
+ parent = w
+ except KeyError:
+ # Create the intermediate widget
+ parent = TixSubWidget(parent, plist[i],
+ destroy_physically=0,
+ check_intermediate=0)
+ # The Tk widget name is in plist, not in name
+ if plist:
+ name = plist[-1]
+ TixWidget.__init__(self, parent, None, None, {'name' : name})
+ self.destroy_physically = destroy_physically
+
+ def destroy(self):
+ # For some widgets e.g., a NoteBook, when we call destructors,
+ # we must be careful not to destroy the frame widget since this
+ # also destroys the parent NoteBook thus leading to an exception
+ # in Tkinter when it finally calls Tcl to destroy the NoteBook
+ for c in self.children.values(): c.destroy()
+ if self._name in self.master.children:
+ del self.master.children[self._name]
+ if self._name in self.master.subwidget_list:
+ del self.master.subwidget_list[self._name]
+ if self.destroy_physically:
+ # This is bypassed only for a few widgets
+ self.tk.call('destroy', self._w)
+
+
+# Useful class to create a display style - later shared by many items.
+# Contributed by Steffen Kremser
+class DisplayStyle:
+ """DisplayStyle - handle configuration options shared by
+ (multiple) Display Items"""
+
+ def __init__(self, itemtype, cnf={}, **kw):
+ if 'refwindow' in kw:
+ master = kw['refwindow']
+ elif 'refwindow' in cnf:
+ master = cnf['refwindow']
+ else:
+ master = Tkinter._default_root
+ if not master:
+ raise RuntimeError("Too early to create display style: no root window")
+ self.tk = master.tk
+ self.stylename = self.tk.call('tixDisplayStyle', itemtype,
+ *self._options(cnf,kw) )
+
+ def __str__(self):
+ return self.stylename
+
+ def _options(self, cnf, kw):
+ if kw and cnf:
+ cnf = _cnfmerge((cnf, kw))
+ elif kw:
+ cnf = kw
+ opts = ()
+ for k, v in cnf.items():
+ opts = opts + ('-'+k, v)
+ return opts
+
+ def delete(self):
+ self.tk.call(self.stylename, 'delete')
+
+ def __setitem__(self,key,value):
+ self.tk.call(self.stylename, 'configure', '-%s'%key, value)
+
+ def config(self, cnf={}, **kw):
+ return self._getconfigure(
+ self.stylename, 'configure', *self._options(cnf,kw))
+
+ def __getitem__(self,key):
+ return self.tk.call(self.stylename, 'cget', '-%s'%key)
+
+
+######################################################
+### The Tix Widget classes - in alphabetical order ###
+######################################################
+
+class Balloon(TixWidget):
+ """Balloon help widget.
+
+ Subwidget Class
+ --------- -----
+ label Label
+ message Message"""
+
+ # FIXME: It should inherit -superclass tixShell
+ def __init__(self, master=None, cnf={}, **kw):
+ # static seem to be -installcolormap -initwait -statusbar -cursor
+ static = ['options', 'installcolormap', 'initwait', 'statusbar',
+ 'cursor']
+ TixWidget.__init__(self, master, 'tixBalloon', static, cnf, kw)
+ self.subwidget_list['label'] = _dummyLabel(self, 'label',
+ destroy_physically=0)
+ self.subwidget_list['message'] = _dummyLabel(self, 'message',
+ destroy_physically=0)
+
+ def bind_widget(self, widget, cnf={}, **kw):
+ """Bind balloon widget to another.
+ One balloon widget may be bound to several widgets at the same time"""
+ self.tk.call(self._w, 'bind', widget._w, *self._options(cnf, kw))
+
+ def unbind_widget(self, widget):
+ self.tk.call(self._w, 'unbind', widget._w)
+
+class ButtonBox(TixWidget):
+ """ButtonBox - A container for pushbuttons.
+ Subwidgets are the buttons added with the add method.
+ """
+ def __init__(self, master=None, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixButtonBox',
+ ['orientation', 'options'], cnf, kw)
+
+ def add(self, name, cnf={}, **kw):
+ """Add a button with given name to box."""
+
+ btn = self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
+ self.subwidget_list[name] = _dummyButton(self, name)
+ return btn
+
+ def invoke(self, name):
+ if name in self.subwidget_list:
+ self.tk.call(self._w, 'invoke', name)
+
+class ComboBox(TixWidget):
+ """ComboBox - an Entry field with a dropdown menu. The user can select a
+ choice by either typing in the entry subwidget or selecting from the
+ listbox subwidget.
+
+ Subwidget Class
+ --------- -----
+ entry Entry
+ arrow Button
+ slistbox ScrolledListBox
+ tick Button
+ cross Button : present if created with the fancy option"""
+
+ # FIXME: It should inherit -superclass tixLabelWidget
+ def __init__ (self, master=None, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixComboBox',
+ ['editable', 'dropdown', 'fancy', 'options'],
+ cnf, kw)
+ self.subwidget_list['label'] = _dummyLabel(self, 'label')
+ self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
+ self.subwidget_list['arrow'] = _dummyButton(self, 'arrow')
+ self.subwidget_list['slistbox'] = _dummyScrolledListBox(self,
+ 'slistbox')
+ try:
+ self.subwidget_list['tick'] = _dummyButton(self, 'tick')
+ self.subwidget_list['cross'] = _dummyButton(self, 'cross')
+ except TypeError:
+ # unavailable when -fancy not specified
+ pass
+
+ # align
+
+ def add_history(self, str):
+ self.tk.call(self._w, 'addhistory', str)
+
+ def append_history(self, str):
+ self.tk.call(self._w, 'appendhistory', str)
+
+ def insert(self, index, str):
+ self.tk.call(self._w, 'insert', index, str)
+
+ def pick(self, index):
+ self.tk.call(self._w, 'pick', index)
+
+class Control(TixWidget):
+ """Control - An entry field with value change arrows. The user can
+ adjust the value by pressing the two arrow buttons or by entering
+ the value directly into the entry. The new value will be checked
+ against the user-defined upper and lower limits.
+
+ Subwidget Class
+ --------- -----
+ incr Button
+ decr Button
+ entry Entry
+ label Label"""
+
+ # FIXME: It should inherit -superclass tixLabelWidget
+ def __init__ (self, master=None, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixControl', ['options'], cnf, kw)
+ self.subwidget_list['incr'] = _dummyButton(self, 'incr')
+ self.subwidget_list['decr'] = _dummyButton(self, 'decr')
+ self.subwidget_list['label'] = _dummyLabel(self, 'label')
+ self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
+
+ def decrement(self):
+ self.tk.call(self._w, 'decr')
+
+ def increment(self):
+ self.tk.call(self._w, 'incr')
+
+ def invoke(self):
+ self.tk.call(self._w, 'invoke')
+
+ def update(self):
+ self.tk.call(self._w, 'update')
+
+class DirList(TixWidget):
+ """DirList - displays a list view of a directory, its previous
+ directories and its sub-directories. The user can choose one of
+ the directories displayed in the list or change to another directory.
+
+ Subwidget Class
+ --------- -----
+ hlist HList
+ hsb Scrollbar
+ vsb Scrollbar"""
+
+ # FIXME: It should inherit -superclass tixScrolledHList
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixDirList', ['options'], cnf, kw)
+ self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+ def chdir(self, dir):
+ self.tk.call(self._w, 'chdir', dir)
+
+class DirTree(TixWidget):
+ """DirTree - Directory Listing in a hierarchical view.
+ Displays a tree view of a directory, its previous directories and its
+ sub-directories. The user can choose one of the directories displayed
+ in the list or change to another directory.
+
+ Subwidget Class
+ --------- -----
+ hlist HList
+ hsb Scrollbar
+ vsb Scrollbar"""
+
+ # FIXME: It should inherit -superclass tixScrolledHList
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixDirTree', ['options'], cnf, kw)
+ self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+ def chdir(self, dir):
+ self.tk.call(self._w, 'chdir', dir)
+
+class DirSelectBox(TixWidget):
+ """DirSelectBox - Motif style file select box.
+ It is generally used for
+ the user to choose a file. FileSelectBox stores the files mostly
+ recently selected into a ComboBox widget so that they can be quickly
+ selected again.
+
+ Subwidget Class
+ --------- -----
+ selection ComboBox
+ filter ComboBox
+ dirlist ScrolledListBox
+ filelist ScrolledListBox"""
+
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixDirSelectBox', ['options'], cnf, kw)
+ self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist')
+ self.subwidget_list['dircbx'] = _dummyFileComboBox(self, 'dircbx')
+
+class ExFileSelectBox(TixWidget):
+ """ExFileSelectBox - MS Windows style file select box.
+ It provides a convenient method for the user to select files.
+
+ Subwidget Class
+ --------- -----
+ cancel Button
+ ok Button
+ hidden Checkbutton
+ types ComboBox
+ dir ComboBox
+ file ComboBox
+ dirlist ScrolledListBox
+ filelist ScrolledListBox"""
+
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixExFileSelectBox', ['options'], cnf, kw)
+ self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
+ self.subwidget_list['ok'] = _dummyButton(self, 'ok')
+ self.subwidget_list['hidden'] = _dummyCheckbutton(self, 'hidden')
+ self.subwidget_list['types'] = _dummyComboBox(self, 'types')
+ self.subwidget_list['dir'] = _dummyComboBox(self, 'dir')
+ self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist')
+ self.subwidget_list['file'] = _dummyComboBox(self, 'file')
+ self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
+
+ def filter(self):
+ self.tk.call(self._w, 'filter')
+
+ def invoke(self):
+ self.tk.call(self._w, 'invoke')
+
+
+# Should inherit from a Dialog class
+class DirSelectDialog(TixWidget):
+ """The DirSelectDialog widget presents the directories in the file
+ system in a dialog window. The user can use this dialog window to
+ navigate through the file system to select the desired directory.
+
+ Subwidgets Class
+ ---------- -----
+ dirbox DirSelectDialog"""
+
+ # FIXME: It should inherit -superclass tixDialogShell
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixDirSelectDialog',
+ ['options'], cnf, kw)
+ self.subwidget_list['dirbox'] = _dummyDirSelectBox(self, 'dirbox')
+ # cancel and ok buttons are missing
+
+ def popup(self):
+ self.tk.call(self._w, 'popup')
+
+ def popdown(self):
+ self.tk.call(self._w, 'popdown')
+
+
+# Should inherit from a Dialog class
+class ExFileSelectDialog(TixWidget):
+ """ExFileSelectDialog - MS Windows style file select dialog.
+ It provides a convenient method for the user to select files.
+
+ Subwidgets Class
+ ---------- -----
+ fsbox ExFileSelectBox"""
+
+ # FIXME: It should inherit -superclass tixDialogShell
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixExFileSelectDialog',
+ ['options'], cnf, kw)
+ self.subwidget_list['fsbox'] = _dummyExFileSelectBox(self, 'fsbox')
+
+ def popup(self):
+ self.tk.call(self._w, 'popup')
+
+ def popdown(self):
+ self.tk.call(self._w, 'popdown')
+
+class FileSelectBox(TixWidget):
+ """ExFileSelectBox - Motif style file select box.
+ It is generally used for
+ the user to choose a file. FileSelectBox stores the files mostly
+ recently selected into a ComboBox widget so that they can be quickly
+ selected again.
+
+ Subwidget Class
+ --------- -----
+ selection ComboBox
+ filter ComboBox
+ dirlist ScrolledListBox
+ filelist ScrolledListBox"""
+
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixFileSelectBox', ['options'], cnf, kw)
+ self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist')
+ self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
+ self.subwidget_list['filter'] = _dummyComboBox(self, 'filter')
+ self.subwidget_list['selection'] = _dummyComboBox(self, 'selection')
+
+ def apply_filter(self): # name of subwidget is same as command
+ self.tk.call(self._w, 'filter')
+
+ def invoke(self):
+ self.tk.call(self._w, 'invoke')
+
+# Should inherit from a Dialog class
+class FileSelectDialog(TixWidget):
+ """FileSelectDialog - Motif style file select dialog.
+
+ Subwidgets Class
+ ---------- -----
+ btns StdButtonBox
+ fsbox FileSelectBox"""
+
+ # FIXME: It should inherit -superclass tixStdDialogShell
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixFileSelectDialog',
+ ['options'], cnf, kw)
+ self.subwidget_list['btns'] = _dummyStdButtonBox(self, 'btns')
+ self.subwidget_list['fsbox'] = _dummyFileSelectBox(self, 'fsbox')
+
+ def popup(self):
+ self.tk.call(self._w, 'popup')
+
+ def popdown(self):
+ self.tk.call(self._w, 'popdown')
+
+class FileEntry(TixWidget):
+ """FileEntry - Entry field with button that invokes a FileSelectDialog.
+ The user can type in the filename manually. Alternatively, the user can
+ press the button widget that sits next to the entry, which will bring
+ up a file selection dialog.
+
+ Subwidgets Class
+ ---------- -----
+ button Button
+ entry Entry"""
+
+ # FIXME: It should inherit -superclass tixLabelWidget
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixFileEntry',
+ ['dialogtype', 'options'], cnf, kw)
+ self.subwidget_list['button'] = _dummyButton(self, 'button')
+ self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
+
+ def invoke(self):
+ self.tk.call(self._w, 'invoke')
+
+ def file_dialog(self):
+ # FIXME: return python object
+ pass
+
+class HList(TixWidget, XView, YView):
+ """HList - Hierarchy display widget can be used to display any data
+ that have a hierarchical structure, for example, file system directory
+ trees. The list entries are indented and connected by branch lines
+ according to their places in the hierarchy.
+
+ Subwidgets - None"""
+
+ def __init__ (self,master=None,cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixHList',
+ ['columns', 'options'], cnf, kw)
+
+ def add(self, entry, cnf={}, **kw):
+ return self.tk.call(self._w, 'add', entry, *self._options(cnf, kw))
+
+ def add_child(self, parent=None, cnf={}, **kw):
+ if not parent:
+ parent = ''
+ return self.tk.call(
+ self._w, 'addchild', parent, *self._options(cnf, kw))
+
+ def anchor_set(self, entry):
+ self.tk.call(self._w, 'anchor', 'set', entry)
+
+ def anchor_clear(self):
+ self.tk.call(self._w, 'anchor', 'clear')
+
+ def column_width(self, col=0, width=None, chars=None):
+ if not chars:
+ return self.tk.call(self._w, 'column', 'width', col, width)
+ else:
+ return self.tk.call(self._w, 'column', 'width', col,
+ '-char', chars)
+
+ def delete_all(self):
+ self.tk.call(self._w, 'delete', 'all')
+
+ def delete_entry(self, entry):
+ self.tk.call(self._w, 'delete', 'entry', entry)
+
+ def delete_offsprings(self, entry):
+ self.tk.call(self._w, 'delete', 'offsprings', entry)
+
+ def delete_siblings(self, entry):
+ self.tk.call(self._w, 'delete', 'siblings', entry)
+
+ def dragsite_set(self, index):
+ self.tk.call(self._w, 'dragsite', 'set', index)
+
+ def dragsite_clear(self):
+ self.tk.call(self._w, 'dragsite', 'clear')
+
+ def dropsite_set(self, index):
+ self.tk.call(self._w, 'dropsite', 'set', index)
+
+ def dropsite_clear(self):
+ self.tk.call(self._w, 'dropsite', 'clear')
+
+ def header_create(self, col, cnf={}, **kw):
+ self.tk.call(self._w, 'header', 'create', col, *self._options(cnf, kw))
+
+ def header_configure(self, col, cnf={}, **kw):
+ if cnf is None:
+ return self._getconfigure(self._w, 'header', 'configure', col)
+ self.tk.call(self._w, 'header', 'configure', col,
+ *self._options(cnf, kw))
+
+ def header_cget(self, col, opt):
+ return self.tk.call(self._w, 'header', 'cget', col, opt)
+
+ def header_exists(self, col):
+ # A workaround to Tix library bug (issue #25464).
+ # The documented command is "exists", but only erroneous "exist" is
+ # accepted.
+ return self.tk.getboolean(self.tk.call(self._w, 'header', 'exist', col))
+ header_exist = header_exists
+
+ def header_delete(self, col):
+ self.tk.call(self._w, 'header', 'delete', col)
+
+ def header_size(self, col):
+ return self.tk.call(self._w, 'header', 'size', col)
+
+ def hide_entry(self, entry):
+ self.tk.call(self._w, 'hide', 'entry', entry)
+
+ def indicator_create(self, entry, cnf={}, **kw):
+ self.tk.call(
+ self._w, 'indicator', 'create', entry, *self._options(cnf, kw))
+
+ def indicator_configure(self, entry, cnf={}, **kw):
+ if cnf is None:
+ return self._getconfigure(
+ self._w, 'indicator', 'configure', entry)
+ self.tk.call(
+ self._w, 'indicator', 'configure', entry, *self._options(cnf, kw))
+
+ def indicator_cget(self, entry, opt):
+ return self.tk.call(self._w, 'indicator', 'cget', entry, opt)
+
+ def indicator_exists(self, entry):
+ return self.tk.call (self._w, 'indicator', 'exists', entry)
+
+ def indicator_delete(self, entry):
+ self.tk.call(self._w, 'indicator', 'delete', entry)
+
+ def indicator_size(self, entry):
+ return self.tk.call(self._w, 'indicator', 'size', entry)
+
+ def info_anchor(self):
+ return self.tk.call(self._w, 'info', 'anchor')
+
+ def info_bbox(self, entry):
+ return self._getints(
+ self.tk.call(self._w, 'info', 'bbox', entry)) or None
+
+ def info_children(self, entry=None):
+ c = self.tk.call(self._w, 'info', 'children', entry)
+ return self.tk.splitlist(c)
+
+ def info_data(self, entry):
+ return self.tk.call(self._w, 'info', 'data', entry)
+
+ def info_dragsite(self):
+ return self.tk.call(self._w, 'info', 'dragsite')
+
+ def info_dropsite(self):
+ return self.tk.call(self._w, 'info', 'dropsite')
+
+ def info_exists(self, entry):
+ return self.tk.call(self._w, 'info', 'exists', entry)
+
+ def info_hidden(self, entry):
+ return self.tk.call(self._w, 'info', 'hidden', entry)
+
+ def info_next(self, entry):
+ return self.tk.call(self._w, 'info', 'next', entry)
+
+ def info_parent(self, entry):
+ return self.tk.call(self._w, 'info', 'parent', entry)
+
+ def info_prev(self, entry):
+ return self.tk.call(self._w, 'info', 'prev', entry)
+
+ def info_selection(self):
+ c = self.tk.call(self._w, 'info', 'selection')
+ return self.tk.splitlist(c)
+
+ def item_cget(self, entry, col, opt):
+ return self.tk.call(self._w, 'item', 'cget', entry, col, opt)
+
+ def item_configure(self, entry, col, cnf={}, **kw):
+ if cnf is None:
+ return self._getconfigure(self._w, 'item', 'configure', entry, col)
+ self.tk.call(self._w, 'item', 'configure', entry, col,
+ *self._options(cnf, kw))
+
+ def item_create(self, entry, col, cnf={}, **kw):
+ self.tk.call(
+ self._w, 'item', 'create', entry, col, *self._options(cnf, kw))
+
+ def item_exists(self, entry, col):
+ return self.tk.call(self._w, 'item', 'exists', entry, col)
+
+ def item_delete(self, entry, col):
+ self.tk.call(self._w, 'item', 'delete', entry, col)
+
+ def entrycget(self, entry, opt):
+ return self.tk.call(self._w, 'entrycget', entry, opt)
+
+ def entryconfigure(self, entry, cnf={}, **kw):
+ if cnf is None:
+ return self._getconfigure(self._w, 'entryconfigure', entry)
+ self.tk.call(self._w, 'entryconfigure', entry,
+ *self._options(cnf, kw))
+
+ def nearest(self, y):
+ return self.tk.call(self._w, 'nearest', y)
+
+ def see(self, entry):
+ self.tk.call(self._w, 'see', entry)
+
+ def selection_clear(self, cnf={}, **kw):
+ self.tk.call(self._w, 'selection', 'clear', *self._options(cnf, kw))
+
+ def selection_includes(self, entry):
+ return self.tk.call(self._w, 'selection', 'includes', entry)
+
+ def selection_set(self, first, last=None):
+ self.tk.call(self._w, 'selection', 'set', first, last)
+
+ def show_entry(self, entry):
+ return self.tk.call(self._w, 'show', 'entry', entry)
+
+class InputOnly(TixWidget):
+ """InputOnly - Invisible widget. Unix only.
+
+ Subwidgets - None"""
+
+ def __init__ (self,master=None,cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixInputOnly', None, cnf, kw)
+
+class LabelEntry(TixWidget):
+ """LabelEntry - Entry field with label. Packages an entry widget
+ and a label into one mega widget. It can be used to simplify the creation
+ of ``entry-form'' type of interface.
+
+ Subwidgets Class
+ ---------- -----
+ label Label
+ entry Entry"""
+
+ def __init__ (self,master=None,cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixLabelEntry',
+ ['labelside','options'], cnf, kw)
+ self.subwidget_list['label'] = _dummyLabel(self, 'label')
+ self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
+
+class LabelFrame(TixWidget):
+ """LabelFrame - Labelled Frame container. Packages a frame widget
+ and a label into one mega widget. To create widgets inside a
+ LabelFrame widget, one creates the new widgets relative to the
+ frame subwidget and manage them inside the frame subwidget.
+
+ Subwidgets Class
+ ---------- -----
+ label Label
+ frame Frame"""
+
+ def __init__ (self,master=None,cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixLabelFrame',
+ ['labelside','options'], cnf, kw)
+ self.subwidget_list['label'] = _dummyLabel(self, 'label')
+ self.subwidget_list['frame'] = _dummyFrame(self, 'frame')
+
+
+class ListNoteBook(TixWidget):
+ """A ListNoteBook widget is very similar to the TixNoteBook widget:
+ it can be used to display many windows in a limited space using a
+ notebook metaphor. The notebook is divided into a stack of pages
+ (windows). At one time only one of these pages can be shown.
+ The user can navigate through these pages by
+ choosing the name of the desired page in the hlist subwidget."""
+
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixListNoteBook', ['options'], cnf, kw)
+ # Is this necessary? It's not an exposed subwidget in Tix.
+ self.subwidget_list['pane'] = _dummyPanedWindow(self, 'pane',
+ destroy_physically=0)
+ self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
+ self.subwidget_list['shlist'] = _dummyScrolledHList(self, 'shlist')
+
+ def add(self, name, cnf={}, **kw):
+ self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
+ self.subwidget_list[name] = TixSubWidget(self, name)
+ return self.subwidget_list[name]
+
+ def page(self, name):
+ return self.subwidget(name)
+
+ def pages(self):
+ # Can't call subwidgets_all directly because we don't want .nbframe
+ names = self.tk.split(self.tk.call(self._w, 'pages'))
+ ret = []
+ for x in names:
+ ret.append(self.subwidget(x))
+ return ret
+
+ def raise_page(self, name): # raise is a python keyword
+ self.tk.call(self._w, 'raise', name)
+
+class Meter(TixWidget):
+ """The Meter widget can be used to show the progress of a background
+ job which may take a long time to execute.
+ """
+
+ def __init__(self, master=None, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixMeter',
+ ['options'], cnf, kw)
+
+class NoteBook(TixWidget):
+ """NoteBook - Multi-page container widget (tabbed notebook metaphor).
+
+ Subwidgets Class
+ ---------- -----
+ nbframe NoteBookFrame
+ <pages> page widgets added dynamically with the add method"""
+
+ def __init__ (self,master=None,cnf={}, **kw):
+ TixWidget.__init__(self,master,'tixNoteBook', ['options'], cnf, kw)
+ self.subwidget_list['nbframe'] = TixSubWidget(self, 'nbframe',
+ destroy_physically=0)
+
+ def add(self, name, cnf={}, **kw):
+ self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
+ self.subwidget_list[name] = TixSubWidget(self, name)
+ return self.subwidget_list[name]
+
+ def delete(self, name):
+ self.tk.call(self._w, 'delete', name)
+ self.subwidget_list[name].destroy()
+ del self.subwidget_list[name]
+
+ def page(self, name):
+ return self.subwidget(name)
+
+ def pages(self):
+ # Can't call subwidgets_all directly because we don't want .nbframe
+ names = self.tk.split(self.tk.call(self._w, 'pages'))
+ ret = []
+ for x in names:
+ ret.append(self.subwidget(x))
+ return ret
+
+ def raise_page(self, name): # raise is a python keyword
+ self.tk.call(self._w, 'raise', name)
+
+ def raised(self):
+ return self.tk.call(self._w, 'raised')
+
+class NoteBookFrame(TixWidget):
+ # FIXME: This is dangerous to expose to be called on its own.
+ pass
+
+class OptionMenu(TixWidget):
+ """OptionMenu - creates a menu button of options.
+
+ Subwidget Class
+ --------- -----
+ menubutton Menubutton
+ menu Menu"""
+
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixOptionMenu',
+ ['labelside', 'options'], cnf, kw)
+ self.subwidget_list['menubutton'] = _dummyMenubutton(self, 'menubutton')
+ self.subwidget_list['menu'] = _dummyMenu(self, 'menu')
+
+ def add_command(self, name, cnf={}, **kw):
+ self.tk.call(self._w, 'add', 'command', name, *self._options(cnf, kw))
+
+ def add_separator(self, name, cnf={}, **kw):
+ self.tk.call(self._w, 'add', 'separator', name, *self._options(cnf, kw))
+
+ def delete(self, name):
+ self.tk.call(self._w, 'delete', name)
+
+ def disable(self, name):
+ self.tk.call(self._w, 'disable', name)
+
+ def enable(self, name):
+ self.tk.call(self._w, 'enable', name)
+
+class PanedWindow(TixWidget):
+ """PanedWindow - Multi-pane container widget
+ allows the user to interactively manipulate the sizes of several
+ panes. The panes can be arranged either vertically or horizontally.The
+ user changes the sizes of the panes by dragging the resize handle
+ between two panes.
+
+ Subwidgets Class
+ ---------- -----
+ <panes> g/p widgets added dynamically with the add method."""
+
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixPanedWindow', ['orientation', 'options'], cnf, kw)
+
+ # add delete forget panecget paneconfigure panes setsize
+ def add(self, name, cnf={}, **kw):
+ self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
+ self.subwidget_list[name] = TixSubWidget(self, name,
+ check_intermediate=0)
+ return self.subwidget_list[name]
+
+ def delete(self, name):
+ self.tk.call(self._w, 'delete', name)
+ self.subwidget_list[name].destroy()
+ del self.subwidget_list[name]
+
+ def forget(self, name):
+ self.tk.call(self._w, 'forget', name)
+
+ def panecget(self, entry, opt):
+ return self.tk.call(self._w, 'panecget', entry, opt)
+
+ def paneconfigure(self, entry, cnf={}, **kw):
+ if cnf is None:
+ return self._getconfigure(self._w, 'paneconfigure', entry)
+ self.tk.call(self._w, 'paneconfigure', entry, *self._options(cnf, kw))
+
+ def panes(self):
+ names = self.tk.splitlist(self.tk.call(self._w, 'panes'))
+ return [self.subwidget(x) for x in names]
+
+class PopupMenu(TixWidget):
+ """PopupMenu widget can be used as a replacement of the tk_popup command.
+ The advantage of the Tix PopupMenu widget is it requires less application
+ code to manipulate.
+
+
+ Subwidgets Class
+ ---------- -----
+ menubutton Menubutton
+ menu Menu"""
+
+ # FIXME: It should inherit -superclass tixShell
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixPopupMenu', ['options'], cnf, kw)
+ self.subwidget_list['menubutton'] = _dummyMenubutton(self, 'menubutton')
+ self.subwidget_list['menu'] = _dummyMenu(self, 'menu')
+
+ def bind_widget(self, widget):
+ self.tk.call(self._w, 'bind', widget._w)
+
+ def unbind_widget(self, widget):
+ self.tk.call(self._w, 'unbind', widget._w)
+
+ def post_widget(self, widget, x, y):
+ self.tk.call(self._w, 'post', widget._w, x, y)
+
+class ResizeHandle(TixWidget):
+ """Internal widget to draw resize handles on Scrolled widgets."""
+ def __init__(self, master, cnf={}, **kw):
+ # There seems to be a Tix bug rejecting the configure method
+ # Let's try making the flags -static
+ flags = ['options', 'command', 'cursorfg', 'cursorbg',
+ 'handlesize', 'hintcolor', 'hintwidth',
+ 'x', 'y']
+ # In fact, x y height width are configurable
+ TixWidget.__init__(self, master, 'tixResizeHandle',
+ flags, cnf, kw)
+
+ def attach_widget(self, widget):
+ self.tk.call(self._w, 'attachwidget', widget._w)
+
+ def detach_widget(self, widget):
+ self.tk.call(self._w, 'detachwidget', widget._w)
+
+ def hide(self, widget):
+ self.tk.call(self._w, 'hide', widget._w)
+
+ def show(self, widget):
+ self.tk.call(self._w, 'show', widget._w)
+
+class ScrolledHList(TixWidget):
+ """ScrolledHList - HList with automatic scrollbars."""
+
+ # FIXME: It should inherit -superclass tixScrolledWidget
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixScrolledHList', ['options'],
+ cnf, kw)
+ self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+class ScrolledListBox(TixWidget):
+ """ScrolledListBox - Listbox with automatic scrollbars."""
+
+ # FIXME: It should inherit -superclass tixScrolledWidget
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixScrolledListBox', ['options'], cnf, kw)
+ self.subwidget_list['listbox'] = _dummyListbox(self, 'listbox')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+class ScrolledText(TixWidget):
+ """ScrolledText - Text with automatic scrollbars."""
+
+ # FIXME: It should inherit -superclass tixScrolledWidget
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixScrolledText', ['options'], cnf, kw)
+ self.subwidget_list['text'] = _dummyText(self, 'text')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+class ScrolledTList(TixWidget):
+ """ScrolledTList - TList with automatic scrollbars."""
+
+ # FIXME: It should inherit -superclass tixScrolledWidget
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixScrolledTList', ['options'],
+ cnf, kw)
+ self.subwidget_list['tlist'] = _dummyTList(self, 'tlist')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+class ScrolledWindow(TixWidget):
+ """ScrolledWindow - Window with automatic scrollbars."""
+
+ # FIXME: It should inherit -superclass tixScrolledWidget
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixScrolledWindow', ['options'], cnf, kw)
+ self.subwidget_list['window'] = _dummyFrame(self, 'window')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+class Select(TixWidget):
+ """Select - Container of button subwidgets. It can be used to provide
+ radio-box or check-box style of selection options for the user.
+
+ Subwidgets are buttons added dynamically using the add method."""
+
+ # FIXME: It should inherit -superclass tixLabelWidget
+ def __init__(self, master, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixSelect',
+ ['allowzero', 'radio', 'orientation', 'labelside',
+ 'options'],
+ cnf, kw)
+ self.subwidget_list['label'] = _dummyLabel(self, 'label')
+
+ def add(self, name, cnf={}, **kw):
+ self.tk.call(self._w, 'add', name, *self._options(cnf, kw))
+ self.subwidget_list[name] = _dummyButton(self, name)
+ return self.subwidget_list[name]
+
+ def invoke(self, name):
+ self.tk.call(self._w, 'invoke', name)
+
+class Shell(TixWidget):
+ """Toplevel window.
+
+ Subwidgets - None"""
+
+ def __init__ (self,master=None,cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixShell', ['options', 'title'], cnf, kw)
+
+class DialogShell(TixWidget):
+ """Toplevel window, with popup popdown and center methods.
+ It tells the window manager that it is a dialog window and should be
+ treated specially. The exact treatment depends on the treatment of
+ the window manager.
+
+ Subwidgets - None"""
+
+ # FIXME: It should inherit from Shell
+ def __init__ (self,master=None,cnf={}, **kw):
+ TixWidget.__init__(self, master,
+ 'tixDialogShell',
+ ['options', 'title', 'mapped',
+ 'minheight', 'minwidth',
+ 'parent', 'transient'], cnf, kw)
+
+ def popdown(self):
+ self.tk.call(self._w, 'popdown')
+
+ def popup(self):
+ self.tk.call(self._w, 'popup')
+
+ def center(self):
+ self.tk.call(self._w, 'center')
+
+class StdButtonBox(TixWidget):
+ """StdButtonBox - Standard Button Box (OK, Apply, Cancel and Help) """
+
+ def __init__(self, master=None, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixStdButtonBox',
+ ['orientation', 'options'], cnf, kw)
+ self.subwidget_list['ok'] = _dummyButton(self, 'ok')
+ self.subwidget_list['apply'] = _dummyButton(self, 'apply')
+ self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
+ self.subwidget_list['help'] = _dummyButton(self, 'help')
+
+ def invoke(self, name):
+ if name in self.subwidget_list:
+ self.tk.call(self._w, 'invoke', name)
+
+class TList(TixWidget, XView, YView):
+ """TList - Hierarchy display widget which can be
+ used to display data in a tabular format. The list entries of a TList
+ widget are similar to the entries in the Tk listbox widget. The main
+ differences are (1) the TList widget can display the list entries in a
+ two dimensional format and (2) you can use graphical images as well as
+ multiple colors and fonts for the list entries.
+
+ Subwidgets - None"""
+
+ def __init__ (self,master=None,cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixTList', ['options'], cnf, kw)
+
+ def active_set(self, index):
+ self.tk.call(self._w, 'active', 'set', index)
+
+ def active_clear(self):
+ self.tk.call(self._w, 'active', 'clear')
+
+ def anchor_set(self, index):
+ self.tk.call(self._w, 'anchor', 'set', index)
+
+ def anchor_clear(self):
+ self.tk.call(self._w, 'anchor', 'clear')
+
+ def delete(self, from_, to=None):
+ self.tk.call(self._w, 'delete', from_, to)
+
+ def dragsite_set(self, index):
+ self.tk.call(self._w, 'dragsite', 'set', index)
+
+ def dragsite_clear(self):
+ self.tk.call(self._w, 'dragsite', 'clear')
+
+ def dropsite_set(self, index):
+ self.tk.call(self._w, 'dropsite', 'set', index)
+
+ def dropsite_clear(self):
+ self.tk.call(self._w, 'dropsite', 'clear')
+
+ def insert(self, index, cnf={}, **kw):
+ self.tk.call(self._w, 'insert', index, *self._options(cnf, kw))
+
+ def info_active(self):
+ return self.tk.call(self._w, 'info', 'active')
+
+ def info_anchor(self):
+ return self.tk.call(self._w, 'info', 'anchor')
+
+ def info_down(self, index):
+ return self.tk.call(self._w, 'info', 'down', index)
+
+ def info_left(self, index):
+ return self.tk.call(self._w, 'info', 'left', index)
+
+ def info_right(self, index):
+ return self.tk.call(self._w, 'info', 'right', index)
+
+ def info_selection(self):
+ c = self.tk.call(self._w, 'info', 'selection')
+ return self.tk.splitlist(c)
+
+ def info_size(self):
+ return self.tk.call(self._w, 'info', 'size')
+
+ def info_up(self, index):
+ return self.tk.call(self._w, 'info', 'up', index)
+
+ def nearest(self, x, y):
+ return self.tk.call(self._w, 'nearest', x, y)
+
+ def see(self, index):
+ self.tk.call(self._w, 'see', index)
+
+ def selection_clear(self, cnf={}, **kw):
+ self.tk.call(self._w, 'selection', 'clear', *self._options(cnf, kw))
+
+ def selection_includes(self, index):
+ return self.tk.call(self._w, 'selection', 'includes', index)
+
+ def selection_set(self, first, last=None):
+ self.tk.call(self._w, 'selection', 'set', first, last)
+
+class Tree(TixWidget):
+ """Tree - The tixTree widget can be used to display hierarchical
+ data in a tree form. The user can adjust
+ the view of the tree by opening or closing parts of the tree."""
+
+ # FIXME: It should inherit -superclass tixScrolledWidget
+ def __init__(self, master=None, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixTree',
+ ['options'], cnf, kw)
+ self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+ def autosetmode(self):
+ '''This command calls the setmode method for all the entries in this
+ Tree widget: if an entry has no child entries, its mode is set to
+ none. Otherwise, if the entry has any hidden child entries, its mode is
+ set to open; otherwise its mode is set to close.'''
+ self.tk.call(self._w, 'autosetmode')
+
+ def close(self, entrypath):
+ '''Close the entry given by entryPath if its mode is close.'''
+ self.tk.call(self._w, 'close', entrypath)
+
+ def getmode(self, entrypath):
+ '''Returns the current mode of the entry given by entryPath.'''
+ return self.tk.call(self._w, 'getmode', entrypath)
+
+ def open(self, entrypath):
+ '''Open the entry given by entryPath if its mode is open.'''
+ self.tk.call(self._w, 'open', entrypath)
+
+ def setmode(self, entrypath, mode='none'):
+ '''This command is used to indicate whether the entry given by
+ entryPath has children entries and whether the children are visible. mode
+ must be one of open, close or none. If mode is set to open, a (+)
+ indicator is drawn next to the entry. If mode is set to close, a (-)
+ indicator is drawn next to the entry. If mode is set to none, no
+ indicators will be drawn for this entry. The default mode is none. The
+ open mode indicates the entry has hidden children and this entry can be
+ opened by the user. The close mode indicates that all the children of the
+ entry are now visible and the entry can be closed by the user.'''
+ self.tk.call(self._w, 'setmode', entrypath, mode)
+
+
+# Could try subclassing Tree for CheckList - would need another arg to init
+class CheckList(TixWidget):
+ """The CheckList widget
+ displays a list of items to be selected by the user. CheckList acts
+ similarly to the Tk checkbutton or radiobutton widgets, except it is
+ capable of handling many more items than checkbuttons or radiobuttons.
+ """
+ # FIXME: It should inherit -superclass tixTree
+ def __init__(self, master=None, cnf={}, **kw):
+ TixWidget.__init__(self, master, 'tixCheckList',
+ ['options', 'radio'], cnf, kw)
+ self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+ def autosetmode(self):
+ '''This command calls the setmode method for all the entries in this
+ Tree widget: if an entry has no child entries, its mode is set to
+ none. Otherwise, if the entry has any hidden child entries, its mode is
+ set to open; otherwise its mode is set to close.'''
+ self.tk.call(self._w, 'autosetmode')
+
+ def close(self, entrypath):
+ '''Close the entry given by entryPath if its mode is close.'''
+ self.tk.call(self._w, 'close', entrypath)
+
+ def getmode(self, entrypath):
+ '''Returns the current mode of the entry given by entryPath.'''
+ return self.tk.call(self._w, 'getmode', entrypath)
+
+ def open(self, entrypath):
+ '''Open the entry given by entryPath if its mode is open.'''
+ self.tk.call(self._w, 'open', entrypath)
+
+ def getselection(self, mode='on'):
+ '''Returns a list of items whose status matches status. If status is
+ not specified, the list of items in the "on" status will be returned.
+ Mode can be on, off, default'''
+ c = self.tk.split(self.tk.call(self._w, 'getselection', mode))
+ return self.tk.splitlist(c)
+
+ def getstatus(self, entrypath):
+ '''Returns the current status of entryPath.'''
+ return self.tk.call(self._w, 'getstatus', entrypath)
+
+ def setstatus(self, entrypath, mode='on'):
+ '''Sets the status of entryPath to be status. A bitmap will be
+ displayed next to the entry its status is on, off or default.'''
+ self.tk.call(self._w, 'setstatus', entrypath, mode)
+
+
+###########################################################################
+### The subclassing below is used to instantiate the subwidgets in each ###
+### mega widget. This allows us to access their methods directly. ###
+###########################################################################
+
+class _dummyButton(Button, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyCheckbutton(Checkbutton, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyEntry(Entry, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyFrame(Frame, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyLabel(Label, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyListbox(Listbox, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyMenu(Menu, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyMenubutton(Menubutton, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyScrollbar(Scrollbar, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyText(Text, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyScrolledListBox(ScrolledListBox, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+ self.subwidget_list['listbox'] = _dummyListbox(self, 'listbox')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+class _dummyHList(HList, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyScrolledHList(ScrolledHList, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+ self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+class _dummyTList(TList, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyComboBox(ComboBox, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, ['fancy',destroy_physically])
+ self.subwidget_list['label'] = _dummyLabel(self, 'label')
+ self.subwidget_list['entry'] = _dummyEntry(self, 'entry')
+ self.subwidget_list['arrow'] = _dummyButton(self, 'arrow')
+
+ self.subwidget_list['slistbox'] = _dummyScrolledListBox(self,
+ 'slistbox')
+ try:
+ self.subwidget_list['tick'] = _dummyButton(self, 'tick')
+ #cross Button : present if created with the fancy option
+ self.subwidget_list['cross'] = _dummyButton(self, 'cross')
+ except TypeError:
+ # unavailable when -fancy not specified
+ pass
+
+class _dummyDirList(DirList, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+ self.subwidget_list['hlist'] = _dummyHList(self, 'hlist')
+ self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb')
+ self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb')
+
+class _dummyDirSelectBox(DirSelectBox, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+ self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist')
+ self.subwidget_list['dircbx'] = _dummyFileComboBox(self, 'dircbx')
+
+class _dummyExFileSelectBox(ExFileSelectBox, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+ self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
+ self.subwidget_list['ok'] = _dummyButton(self, 'ok')
+ self.subwidget_list['hidden'] = _dummyCheckbutton(self, 'hidden')
+ self.subwidget_list['types'] = _dummyComboBox(self, 'types')
+ self.subwidget_list['dir'] = _dummyComboBox(self, 'dir')
+ self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist')
+ self.subwidget_list['file'] = _dummyComboBox(self, 'file')
+ self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
+
+class _dummyFileSelectBox(FileSelectBox, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+ self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist')
+ self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist')
+ self.subwidget_list['filter'] = _dummyComboBox(self, 'filter')
+ self.subwidget_list['selection'] = _dummyComboBox(self, 'selection')
+
+class _dummyFileComboBox(ComboBox, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+ self.subwidget_list['dircbx'] = _dummyComboBox(self, 'dircbx')
+
+class _dummyStdButtonBox(StdButtonBox, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+ self.subwidget_list['ok'] = _dummyButton(self, 'ok')
+ self.subwidget_list['apply'] = _dummyButton(self, 'apply')
+ self.subwidget_list['cancel'] = _dummyButton(self, 'cancel')
+ self.subwidget_list['help'] = _dummyButton(self, 'help')
+
+class _dummyNoteBookFrame(NoteBookFrame, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=0):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+class _dummyPanedWindow(PanedWindow, TixSubWidget):
+ def __init__(self, master, name, destroy_physically=1):
+ TixSubWidget.__init__(self, master, name, destroy_physically)
+
+########################
+### Utility Routines ###
+########################
+
+#mike Should tixDestroy be exposed as a wrapper? - but not for widgets.
+
+def OptionName(widget):
+ '''Returns the qualified path name for the widget. Normally used to set
+ default options for subwidgets. See tixwidgets.py'''
+ return widget.tk.call('tixOptionName', widget._w)
+
+# Called with a dictionary argument of the form
+# {'*.c':'C source files', '*.txt':'Text Files', '*':'All files'}
+# returns a string which can be used to configure the fsbox file types
+# in an ExFileSelectBox. i.e.,
+# '{{*} {* - All files}} {{*.c} {*.c - C source files}} {{*.txt} {*.txt - Text Files}}'
+def FileTypeList(dict):
+ s = ''
+ for type in dict.keys():
+ s = s + '{{' + type + '} {' + type + ' - ' + dict[type] + '}} '
+ return s
+
+# Still to be done:
+# tixIconView
+class CObjView(TixWidget):
+ """This file implements the Canvas Object View widget. This is a base
+ class of IconView. It implements automatic placement/adjustment of the
+ scrollbars according to the canvas objects inside the canvas subwidget.
+ The scrollbars are adjusted so that the canvas is just large enough
+ to see all the objects.
+ """
+ # FIXME: It should inherit -superclass tixScrolledWidget
+ pass
+
+
+class Grid(TixWidget, XView, YView):
+ '''The Tix Grid command creates a new window and makes it into a
+ tixGrid widget. Additional options, may be specified on the command
+ line or in the option database to configure aspects such as its cursor
+ and relief.
+
+ A Grid widget displays its contents in a two dimensional grid of cells.
+ Each cell may contain one Tix display item, which may be in text,
+ graphics or other formats. See the DisplayStyle class for more information
+ about Tix display items. Individual cells, or groups of cells, can be
+ formatted with a wide range of attributes, such as its color, relief and
+ border.
+
+ Subwidgets - None'''
+ # valid specific resources as of Tk 8.4
+ # editdonecmd, editnotifycmd, floatingcols, floatingrows, formatcmd,
+ # highlightbackground, highlightcolor, leftmargin, itemtype, selectmode,
+ # selectunit, topmargin,
+ def __init__(self, master=None, cnf={}, **kw):
+ static= []
+ self.cnf= cnf
+ TixWidget.__init__(self, master, 'tixGrid', static, cnf, kw)
+
+ # valid options as of Tk 8.4
+ # anchor, bdtype, cget, configure, delete, dragsite, dropsite, entrycget,
+ # edit, entryconfigure, format, geometryinfo, info, index, move, nearest,
+ # selection, set, size, unset, xview, yview
+ def anchor_clear(self):
+ """Removes the selection anchor."""
+ self.tk.call(self, 'anchor', 'clear')
+
+ def anchor_get(self):
+ "Get the (x,y) coordinate of the current anchor cell"
+ return self._getints(self.tk.call(self, 'anchor', 'get'))
+
+ def anchor_set(self, x, y):
+ """Set the selection anchor to the cell at (x, y)."""
+ self.tk.call(self, 'anchor', 'set', x, y)
+
+ def delete_row(self, from_, to=None):
+ """Delete rows between from_ and to inclusive.
+ If to is not provided, delete only row at from_"""
+ if to is None:
+ self.tk.call(self, 'delete', 'row', from_)
+ else:
+ self.tk.call(self, 'delete', 'row', from_, to)
+
+ def delete_column(self, from_, to=None):
+ """Delete columns between from_ and to inclusive.
+ If to is not provided, delete only column at from_"""
+ if to is None:
+ self.tk.call(self, 'delete', 'column', from_)
+ else:
+ self.tk.call(self, 'delete', 'column', from_, to)
+
+ def edit_apply(self):
+ """If any cell is being edited, de-highlight the cell and applies
+ the changes."""
+ self.tk.call(self, 'edit', 'apply')
+
+ def edit_set(self, x, y):
+ """Highlights the cell at (x, y) for editing, if the -editnotify
+ command returns True for this cell."""
+ self.tk.call(self, 'edit', 'set', x, y)
+
+ def entrycget(self, x, y, option):
+ "Get the option value for cell at (x,y)"
+ if option and option[0] != '-':
+ option = '-' + option
+ return self.tk.call(self, 'entrycget', x, y, option)
+
+ def entryconfigure(self, x, y, cnf=None, **kw):
+ return self._configure(('entryconfigure', x, y), cnf, kw)
+
+ # def format
+ # def index
+
+ def info_exists(self, x, y):
+ "Return True if display item exists at (x,y)"
+ return self._getboolean(self.tk.call(self, 'info', 'exists', x, y))
+
+ def info_bbox(self, x, y):
+ # This seems to always return '', at least for 'text' displayitems
+ return self.tk.call(self, 'info', 'bbox', x, y)
+
+ def move_column(self, from_, to, offset):
+ """Moves the range of columns from position FROM through TO by
+ the distance indicated by OFFSET. For example, move_column(2, 4, 1)
+ moves the columns 2,3,4 to columns 3,4,5."""
+ self.tk.call(self, 'move', 'column', from_, to, offset)
+
+ def move_row(self, from_, to, offset):
+ """Moves the range of rows from position FROM through TO by
+ the distance indicated by OFFSET.
+ For example, move_row(2, 4, 1) moves the rows 2,3,4 to rows 3,4,5."""
+ self.tk.call(self, 'move', 'row', from_, to, offset)
+
+ def nearest(self, x, y):
+ "Return coordinate of cell nearest pixel coordinate (x,y)"
+ return self._getints(self.tk.call(self, 'nearest', x, y))
+
+ # def selection adjust
+ # def selection clear
+ # def selection includes
+ # def selection set
+ # def selection toggle
+
+ def set(self, x, y, itemtype=None, **kw):
+ args= self._options(self.cnf, kw)
+ if itemtype is not None:
+ args= ('-itemtype', itemtype) + args
+ self.tk.call(self, 'set', x, y, *args)
+
+ def size_column(self, index, **kw):
+ """Queries or sets the size of the column given by
+ INDEX. INDEX may be any non-negative
+ integer that gives the position of a given column.
+ INDEX can also be the string "default"; in this case, this command
+ queries or sets the default size of all columns.
+ When no option-value pair is given, this command returns a tuple
+ containing the current size setting of the given column. When
+ option-value pairs are given, the corresponding options of the
+ size setting of the given column are changed. Options may be one
+ of the follwing:
+ pad0 pixels
+ Specifies the paddings to the left of a column.
+ pad1 pixels
+ Specifies the paddings to the right of a column.
+ size val
+ Specifies the width of a column. Val may be:
+ "auto" -- the width of the column is set to the
+ width of the widest cell in the column;
+ a valid Tk screen distance unit;
+ or a real number following by the word chars
+ (e.g. 3.4chars) that sets the width of the column to the
+ given number of characters."""
+ return self.tk.split(self.tk.call(self._w, 'size', 'column', index,
+ *self._options({}, kw)))
+
+ def size_row(self, index, **kw):
+ """Queries or sets the size of the row given by
+ INDEX. INDEX may be any non-negative
+ integer that gives the position of a given row .
+ INDEX can also be the string "default"; in this case, this command
+ queries or sets the default size of all rows.
+ When no option-value pair is given, this command returns a list con-
+ taining the current size setting of the given row . When option-value
+ pairs are given, the corresponding options of the size setting of the
+ given row are changed. Options may be one of the follwing:
+ pad0 pixels
+ Specifies the paddings to the top of a row.
+ pad1 pixels
+ Specifies the paddings to the bottom of a row.
+ size val
+ Specifies the height of a row. Val may be:
+ "auto" -- the height of the row is set to the
+ height of the highest cell in the row;
+ a valid Tk screen distance unit;
+ or a real number following by the word chars
+ (e.g. 3.4chars) that sets the height of the row to the
+ given number of characters."""
+ return self.tk.split(self.tk.call(
+ self, 'size', 'row', index, *self._options({}, kw)))
+
+ def unset(self, x, y):
+ """Clears the cell at (x, y) by removing its display item."""
+ self.tk.call(self._w, 'unset', x, y)
+
+
+class ScrolledGrid(Grid):
+ '''Scrolled Grid widgets'''
+
+ # FIXME: It should inherit -superclass tixScrolledWidget
+ def __init__(self, master=None, cnf={}, **kw):
+ static= []
+ self.cnf= cnf
+ TixWidget.__init__(self, master, 'tixScrolledGrid', static, cnf, kw)
diff --git a/lib/python2.7/lib-tk/Tkconstants.py b/lib/python2.7/lib-tk/Tkconstants.py
new file mode 100644
index 00000000..63eee33d
--- /dev/null
+++ b/lib/python2.7/lib-tk/Tkconstants.py
@@ -0,0 +1,110 @@
+# Symbolic constants for Tk
+
+# Booleans
+NO=FALSE=OFF=0
+YES=TRUE=ON=1
+
+# -anchor and -sticky
+N='n'
+S='s'
+W='w'
+E='e'
+NW='nw'
+SW='sw'
+NE='ne'
+SE='se'
+NS='ns'
+EW='ew'
+NSEW='nsew'
+CENTER='center'
+
+# -fill
+NONE='none'
+X='x'
+Y='y'
+BOTH='both'
+
+# -side
+LEFT='left'
+TOP='top'
+RIGHT='right'
+BOTTOM='bottom'
+
+# -relief
+RAISED='raised'
+SUNKEN='sunken'
+FLAT='flat'
+RIDGE='ridge'
+GROOVE='groove'
+SOLID = 'solid'
+
+# -orient
+HORIZONTAL='horizontal'
+VERTICAL='vertical'
+
+# -tabs
+NUMERIC='numeric'
+
+# -wrap
+CHAR='char'
+WORD='word'
+
+# -align
+BASELINE='baseline'
+
+# -bordermode
+INSIDE='inside'
+OUTSIDE='outside'
+
+# Special tags, marks and insert positions
+SEL='sel'
+SEL_FIRST='sel.first'
+SEL_LAST='sel.last'
+END='end'
+INSERT='insert'
+CURRENT='current'
+ANCHOR='anchor'
+ALL='all' # e.g. Canvas.delete(ALL)
+
+# Text widget and button states
+NORMAL='normal'
+DISABLED='disabled'
+ACTIVE='active'
+# Canvas state
+HIDDEN='hidden'
+
+# Menu item types
+CASCADE='cascade'
+CHECKBUTTON='checkbutton'
+COMMAND='command'
+RADIOBUTTON='radiobutton'
+SEPARATOR='separator'
+
+# Selection modes for list boxes
+SINGLE='single'
+BROWSE='browse'
+MULTIPLE='multiple'
+EXTENDED='extended'
+
+# Activestyle for list boxes
+# NONE='none' is also valid
+DOTBOX='dotbox'
+UNDERLINE='underline'
+
+# Various canvas styles
+PIESLICE='pieslice'
+CHORD='chord'
+ARC='arc'
+FIRST='first'
+LAST='last'
+BUTT='butt'
+PROJECTING='projecting'
+ROUND='round'
+BEVEL='bevel'
+MITER='miter'
+
+# Arguments to xview/yview
+MOVETO='moveto'
+SCROLL='scroll'
+UNITS='units'
+PAGES='pages'
diff --git a/lib/python2.7/lib-tk/Tkdnd.py b/lib/python2.7/lib-tk/Tkdnd.py
new file mode 100644
index 00000000..1b09f91c
--- /dev/null
+++ b/lib/python2.7/lib-tk/Tkdnd.py
@@ -0,0 +1,321 @@
+"""Drag-and-drop support for Tkinter.
+
+This is very preliminary. I currently only support dnd *within* one
+application, between different windows (or within the same window).
+
+I am trying to make this as generic as possible -- not dependent on
+the use of a particular widget or icon type, etc. I also hope that
+this will work with Pmw.
+
+To enable an object to be dragged, you must create an event binding
+for it that starts the drag-and-drop process. Typically, you should
+bind <ButtonPress> to a callback function that you write. The function
+should call Tkdnd.dnd_start(source, event), where 'source' is the
+object to be dragged, and 'event' is the event that invoked the call
+(the argument to your callback function). Even though this is a class
+instantiation, the returned instance should not be stored -- it will
+be kept alive automatically for the duration of the drag-and-drop.
+
+When a drag-and-drop is already in process for the Tk interpreter, the
+call is *ignored*; this normally averts starting multiple simultaneous
+dnd processes, e.g. because different button callbacks all
+dnd_start().
+
+The object is *not* necessarily a widget -- it can be any
+application-specific object that is meaningful to potential
+drag-and-drop targets.
+
+Potential drag-and-drop targets are discovered as follows. Whenever
+the mouse moves, and at the start and end of a drag-and-drop move, the
+Tk widget directly under the mouse is inspected. This is the target
+widget (not to be confused with the target object, yet to be
+determined). If there is no target widget, there is no dnd target
+object. If there is a target widget, and it has an attribute
+dnd_accept, this should be a function (or any callable object). The
+function is called as dnd_accept(source, event), where 'source' is the
+object being dragged (the object passed to dnd_start() above), and
+'event' is the most recent event object (generally a <Motion> event;
+it can also be <ButtonPress> or <ButtonRelease>). If the dnd_accept()
+function returns something other than None, this is the new dnd target
+object. If dnd_accept() returns None, or if the target widget has no
+dnd_accept attribute, the target widget's parent is considered as the
+target widget, and the search for a target object is repeated from
+there. If necessary, the search is repeated all the way up to the
+root widget. If none of the target widgets can produce a target
+object, there is no target object (the target object is None).
+
+The target object thus produced, if any, is called the new target
+object. It is compared with the old target object (or None, if there
+was no old target widget). There are several cases ('source' is the
+source object, and 'event' is the most recent event object):
+
+- Both the old and new target objects are None. Nothing happens.
+
+- The old and new target objects are the same object. Its method
+dnd_motion(source, event) is called.
+
+- The old target object was None, and the new target object is not
+None. The new target object's method dnd_enter(source, event) is
+called.
+
+- The new target object is None, and the old target object is not
+None. The old target object's method dnd_leave(source, event) is
+called.
+
+- The old and new target objects differ and neither is None. The old
+target object's method dnd_leave(source, event), and then the new
+target object's method dnd_enter(source, event) is called.
+
+Once this is done, the new target object replaces the old one, and the
+Tk mainloop proceeds. The return value of the methods mentioned above
+is ignored; if they raise an exception, the normal exception handling
+mechanisms take over.
+
+The drag-and-drop processes can end in two ways: a final target object
+is selected, or no final target object is selected. When a final
+target object is selected, it will always have been notified of the
+potential drop by a call to its dnd_enter() method, as described
+above, and possibly one or more calls to its dnd_motion() method; its
+dnd_leave() method has not been called since the last call to
+dnd_enter(). The target is notified of the drop by a call to its
+method dnd_commit(source, event).
+
+If no final target object is selected, and there was an old target
+object, its dnd_leave(source, event) method is called to complete the
+dnd sequence.
+
+Finally, the source object is notified that the drag-and-drop process
+is over, by a call to source.dnd_end(target, event), specifying either
+the selected target object, or None if no target object was selected.
+The source object can use this to implement the commit action; this is
+sometimes simpler than to do it in the target's dnd_commit(). The
+target's dnd_commit() method could then simply be aliased to
+dnd_leave().
+
+At any time during a dnd sequence, the application can cancel the
+sequence by calling the cancel() method on the object returned by
+dnd_start(). This will call dnd_leave() if a target is currently
+active; it will never call dnd_commit().
+
+"""
+
+
+import Tkinter
+
+
+# The factory function
+
+def dnd_start(source, event):
+ h = DndHandler(source, event)
+ if h.root:
+ return h
+ else:
+ return None
+
+
+# The class that does the work
+
+class DndHandler:
+
+ root = None
+
+ def __init__(self, source, event):
+ if event.num > 5:
+ return
+ root = event.widget._root()
+ try:
+ root.__dnd
+ return # Don't start recursive dnd
+ except AttributeError:
+ root.__dnd = self
+ self.root = root
+ self.source = source
+ self.target = None
+ self.initial_button = button = event.num
+ self.initial_widget = widget = event.widget
+ self.release_pattern = "<B%d-ButtonRelease-%d>" % (button, button)
+ self.save_cursor = widget['cursor'] or ""
+ widget.bind(self.release_pattern, self.on_release)
+ widget.bind("<Motion>", self.on_motion)
+ widget['cursor'] = "hand2"
+
+ def __del__(self):
+ root = self.root
+ self.root = None
+ if root:
+ try:
+ del root.__dnd
+ except AttributeError:
+ pass
+
+ def on_motion(self, event):
+ x, y = event.x_root, event.y_root
+ target_widget = self.initial_widget.winfo_containing(x, y)
+ source = self.source
+ new_target = None
+ while target_widget:
+ try:
+ attr = target_widget.dnd_accept
+ except AttributeError:
+ pass
+ else:
+ new_target = attr(source, event)
+ if new_target:
+ break
+ target_widget = target_widget.master
+ old_target = self.target
+ if old_target is new_target:
+ if old_target:
+ old_target.dnd_motion(source, event)
+ else:
+ if old_target:
+ self.target = None
+ old_target.dnd_leave(source, event)
+ if new_target:
+ new_target.dnd_enter(source, event)
+ self.target = new_target
+
+ def on_release(self, event):
+ self.finish(event, 1)
+
+ def cancel(self, event=None):
+ self.finish(event, 0)
+
+ def finish(self, event, commit=0):
+ target = self.target
+ source = self.source
+ widget = self.initial_widget
+ root = self.root
+ try:
+ del root.__dnd
+ self.initial_widget.unbind(self.release_pattern)
+ self.initial_widget.unbind("<Motion>")
+ widget['cursor'] = self.save_cursor
+ self.target = self.source = self.initial_widget = self.root = None
+ if target:
+ if commit:
+ target.dnd_commit(source, event)
+ else:
+ target.dnd_leave(source, event)
+ finally:
+ source.dnd_end(target, event)
+
+
+
+# ----------------------------------------------------------------------
+# The rest is here for testing and demonstration purposes only!
+
+class Icon:
+
+ def __init__(self, name):
+ self.name = name
+ self.canvas = self.label = self.id = None
+
+ def attach(self, canvas, x=10, y=10):
+ if canvas is self.canvas:
+ self.canvas.coords(self.id, x, y)
+ return
+ if self.canvas:
+ self.detach()
+ if not canvas:
+ return
+ label = Tkinter.Label(canvas, text=self.name,
+ borderwidth=2, relief="raised")
+ id = canvas.create_window(x, y, window=label, anchor="nw")
+ self.canvas = canvas
+ self.label = label
+ self.id = id
+ label.bind("<ButtonPress>", self.press)
+
+ def detach(self):
+ canvas = self.canvas
+ if not canvas:
+ return
+ id = self.id
+ label = self.label
+ self.canvas = self.label = self.id = None
+ canvas.delete(id)
+ label.destroy()
+
+ def press(self, event):
+ if dnd_start(self, event):
+ # where the pointer is relative to the label widget:
+ self.x_off = event.x
+ self.y_off = event.y
+ # where the widget is relative to the canvas:
+ self.x_orig, self.y_orig = self.canvas.coords(self.id)
+
+ def move(self, event):
+ x, y = self.where(self.canvas, event)
+ self.canvas.coords(self.id, x, y)
+
+ def putback(self):
+ self.canvas.coords(self.id, self.x_orig, self.y_orig)
+
+ def where(self, canvas, event):
+ # where the corner of the canvas is relative to the screen:
+ x_org = canvas.winfo_rootx()
+ y_org = canvas.winfo_rooty()
+ # where the pointer is relative to the canvas widget:
+ x = event.x_root - x_org
+ y = event.y_root - y_org
+ # compensate for initial pointer offset
+ return x - self.x_off, y - self.y_off
+
+ def dnd_end(self, target, event):
+ pass
+
+class Tester:
+
+ def __init__(self, root):
+ self.top = Tkinter.Toplevel(root)
+ self.canvas = Tkinter.Canvas(self.top, width=100, height=100)
+ self.canvas.pack(fill="both", expand=1)
+ self.canvas.dnd_accept = self.dnd_accept
+
+ def dnd_accept(self, source, event):
+ return self
+
+ def dnd_enter(self, source, event):
+ self.canvas.focus_set() # Show highlight border
+ x, y = source.where(self.canvas, event)
+ x1, y1, x2, y2 = source.canvas.bbox(source.id)
+ dx, dy = x2-x1, y2-y1
+ self.dndid = self.canvas.create_rectangle(x, y, x+dx, y+dy)
+ self.dnd_motion(source, event)
+
+ def dnd_motion(self, source, event):
+ x, y = source.where(self.canvas, event)
+ x1, y1, x2, y2 = self.canvas.bbox(self.dndid)
+ self.canvas.move(self.dndid, x-x1, y-y1)
+
+ def dnd_leave(self, source, event):
+ self.top.focus_set() # Hide highlight border
+ self.canvas.delete(self.dndid)
+ self.dndid = None
+
+ def dnd_commit(self, source, event):
+ self.dnd_leave(source, event)
+ x, y = source.where(self.canvas, event)
+ source.attach(self.canvas, x, y)
+
+def test():
+ root = Tkinter.Tk()
+ root.geometry("+1+1")
+ Tkinter.Button(command=root.quit, text="Quit").pack()
+ t1 = Tester(root)
+ t1.top.geometry("+1+60")
+ t2 = Tester(root)
+ t2.top.geometry("+120+60")
+ t3 = Tester(root)
+ t3.top.geometry("+240+60")
+ i1 = Icon("ICON1")
+ i2 = Icon("ICON2")
+ i3 = Icon("ICON3")
+ i1.attach(t1.canvas)
+ i2.attach(t2.canvas)
+ i3.attach(t3.canvas)
+ root.mainloop()
+
+if __name__ == '__main__':
+ test()
diff --git a/lib/python2.7/lib-tk/Tkinter.py b/lib/python2.7/lib-tk/Tkinter.py
new file mode 100644
index 00000000..64e99247
--- /dev/null
+++ b/lib/python2.7/lib-tk/Tkinter.py
@@ -0,0 +1,3862 @@
+"""Wrapper functions for Tcl/Tk.
+
+Tkinter provides classes which allow the display, positioning and
+control of widgets. Toplevel widgets are Tk and Toplevel. Other
+widgets are Frame, Label, Entry, Text, Canvas, Button, Radiobutton,
+Checkbutton, Scale, Listbox, Scrollbar, OptionMenu, Spinbox
+LabelFrame and PanedWindow.
+
+Properties of the widgets are specified with keyword arguments.
+Keyword arguments have the same name as the corresponding resource
+under Tk.
+
+Widgets are positioned with one of the geometry managers Place, Pack
+or Grid. These managers can be called with methods place, pack, grid
+available in every Widget.
+
+Actions are bound to events by resources (e.g. keyword argument
+command) or with the method bind.
+
+Example (Hello, World):
+import Tkinter
+from Tkconstants import *
+tk = Tkinter.Tk()
+frame = Tkinter.Frame(tk, relief=RIDGE, borderwidth=2)
+frame.pack(fill=BOTH,expand=1)
+label = Tkinter.Label(frame, text="Hello, World")
+label.pack(fill=X, expand=1)
+button = Tkinter.Button(frame,text="Exit",command=tk.destroy)
+button.pack(side=BOTTOM)
+tk.mainloop()
+"""
+
+__version__ = "$Revision: 81008 $"
+
+import sys
+if sys.platform == "win32":
+ # Attempt to configure Tcl/Tk without requiring PATH
+ import FixTk
+import _tkinter # If this fails your Python may not be configured for Tk
+tkinter = _tkinter # b/w compat for export
+TclError = _tkinter.TclError
+from types import *
+from Tkconstants import *
+import re
+
+wantobjects = 1
+
+TkVersion = float(_tkinter.TK_VERSION)
+TclVersion = float(_tkinter.TCL_VERSION)
+
+READABLE = _tkinter.READABLE
+WRITABLE = _tkinter.WRITABLE
+EXCEPTION = _tkinter.EXCEPTION
+
+# These are not always defined, e.g. not on Win32 with Tk 8.0 :-(
+try: _tkinter.createfilehandler
+except AttributeError: _tkinter.createfilehandler = None
+try: _tkinter.deletefilehandler
+except AttributeError: _tkinter.deletefilehandler = None
+
+
+_magic_re = re.compile(r'([\\{}])')
+_space_re = re.compile(r'([\s])')
+
+def _join(value):
+ """Internal function."""
+ return ' '.join(map(_stringify, value))
+
+def _stringify(value):
+ """Internal function."""
+ if isinstance(value, (list, tuple)):
+ if len(value) == 1:
+ value = _stringify(value[0])
+ if value[0] == '{':
+ value = '{%s}' % value
+ else:
+ value = '{%s}' % _join(value)
+ else:
+ if isinstance(value, str):
+ value = unicode(value, 'utf-8')
+ elif not isinstance(value, unicode):
+ value = str(value)
+ if not value:
+ value = '{}'
+ elif _magic_re.search(value):
+ # add '\' before special characters and spaces
+ value = _magic_re.sub(r'\\\1', value)
+ value = _space_re.sub(r'\\\1', value)
+ elif value[0] == '"' or _space_re.search(value):
+ value = '{%s}' % value
+ return value
+
+def _flatten(tuple):
+ """Internal function."""
+ res = ()
+ for item in tuple:
+ if type(item) in (TupleType, ListType):
+ res = res + _flatten(item)
+ elif item is not None:
+ res = res + (item,)
+ return res
+
+try: _flatten = _tkinter._flatten
+except AttributeError: pass
+
+def _cnfmerge(cnfs):
+ """Internal function."""
+ if type(cnfs) is DictionaryType:
+ return cnfs
+ elif type(cnfs) in (NoneType, StringType):
+ return cnfs
+ else:
+ cnf = {}
+ for c in _flatten(cnfs):
+ try:
+ cnf.update(c)
+ except (AttributeError, TypeError), msg:
+ print "_cnfmerge: fallback due to:", msg
+ for k, v in c.items():
+ cnf[k] = v
+ return cnf
+
+try: _cnfmerge = _tkinter._cnfmerge
+except AttributeError: pass
+
+def _splitdict(tk, v, cut_minus=True, conv=None):
+ """Return a properly formatted dict built from Tcl list pairs.
+
+ If cut_minus is True, the supposed '-' prefix will be removed from
+ keys. If conv is specified, it is used to convert values.
+
+ Tcl list is expected to contain an even number of elements.
+ """
+ t = tk.splitlist(v)
+ if len(t) % 2:
+ raise RuntimeError('Tcl list representing a dict is expected '
+ 'to contain an even number of elements')
+ it = iter(t)
+ dict = {}
+ for key, value in zip(it, it):
+ key = str(key)
+ if cut_minus and key[0] == '-':
+ key = key[1:]
+ if conv:
+ value = conv(value)
+ dict[key] = value
+ return dict
+
+class Event:
+ """Container for the properties of an event.
+
+ Instances of this type are generated if one of the following events occurs:
+
+ KeyPress, KeyRelease - for keyboard events
+ ButtonPress, ButtonRelease, Motion, Enter, Leave, MouseWheel - for mouse events
+ Visibility, Unmap, Map, Expose, FocusIn, FocusOut, Circulate,
+ Colormap, Gravity, Reparent, Property, Destroy, Activate,
+ Deactivate - for window events.
+
+ If a callback function for one of these events is registered
+ using bind, bind_all, bind_class, or tag_bind, the callback is
+ called with an Event as first argument. It will have the
+ following attributes (in braces are the event types for which
+ the attribute is valid):
+
+ serial - serial number of event
+ num - mouse button pressed (ButtonPress, ButtonRelease)
+ focus - whether the window has the focus (Enter, Leave)
+ height - height of the exposed window (Configure, Expose)
+ width - width of the exposed window (Configure, Expose)
+ keycode - keycode of the pressed key (KeyPress, KeyRelease)
+ state - state of the event as a number (ButtonPress, ButtonRelease,
+ Enter, KeyPress, KeyRelease,
+ Leave, Motion)
+ state - state as a string (Visibility)
+ time - when the event occurred
+ x - x-position of the mouse
+ y - y-position of the mouse
+ x_root - x-position of the mouse on the screen
+ (ButtonPress, ButtonRelease, KeyPress, KeyRelease, Motion)
+ y_root - y-position of the mouse on the screen
+ (ButtonPress, ButtonRelease, KeyPress, KeyRelease, Motion)
+ char - pressed character (KeyPress, KeyRelease)
+ send_event - see X/Windows documentation
+ keysym - keysym of the event as a string (KeyPress, KeyRelease)
+ keysym_num - keysym of the event as a number (KeyPress, KeyRelease)
+ type - type of the event as a number
+ widget - widget in which the event occurred
+ delta - delta of wheel movement (MouseWheel)
+ """
+ pass
+
+_support_default_root = 1
+_default_root = None
+
+def NoDefaultRoot():
+ """Inhibit setting of default root window.
+
+ Call this function to inhibit that the first instance of
+ Tk is used for windows without an explicit parent window.
+ """
+ global _support_default_root
+ _support_default_root = 0
+ global _default_root
+ _default_root = None
+ del _default_root
+
+def _tkerror(err):
+ """Internal function."""
+ pass
+
+def _exit(code=0):
+ """Internal function. Calling it will raise the exception SystemExit."""
+ try:
+ code = int(code)
+ except ValueError:
+ pass
+ raise SystemExit, code
+
+_varnum = 0
+class Variable:
+ """Class to define value holders for e.g. buttons.
+
+ Subclasses StringVar, IntVar, DoubleVar, BooleanVar are specializations
+ that constrain the type of the value returned from get()."""
+ _default = ""
+ _tclCommands = None
+ def __init__(self, master=None, value=None, name=None):
+ """Construct a variable
+
+ MASTER can be given as master widget.
+ VALUE is an optional value (defaults to "")
+ NAME is an optional Tcl name (defaults to PY_VARnum).
+
+ If NAME matches an existing variable and VALUE is omitted
+ then the existing value is retained.
+ """
+ global _varnum
+ if not master:
+ master = _default_root
+ self._root = master._root()
+ self._tk = master.tk
+ if name:
+ self._name = name
+ else:
+ self._name = 'PY_VAR' + repr(_varnum)
+ _varnum += 1
+ if value is not None:
+ self.set(value)
+ elif not self._tk.getboolean(self._tk.call("info", "exists", self._name)):
+ self.set(self._default)
+ def __del__(self):
+ """Unset the variable in Tcl."""
+ if self._tk is None:
+ return
+ if self._tk.getboolean(self._tk.call("info", "exists", self._name)):
+ self._tk.globalunsetvar(self._name)
+ if self._tclCommands is not None:
+ for name in self._tclCommands:
+ #print '- Tkinter: deleted command', name
+ self._tk.deletecommand(name)
+ self._tclCommands = None
+ def __str__(self):
+ """Return the name of the variable in Tcl."""
+ return self._name
+ def set(self, value):
+ """Set the variable to VALUE."""
+ return self._tk.globalsetvar(self._name, value)
+ def get(self):
+ """Return value of variable."""
+ return self._tk.globalgetvar(self._name)
+ def trace_variable(self, mode, callback):
+ """Define a trace callback for the variable.
+
+ MODE is one of "r", "w", "u" for read, write, undefine.
+ CALLBACK must be a function which is called when
+ the variable is read, written or undefined.
+
+ Return the name of the callback.
+ """
+ f = CallWrapper(callback, None, self._root).__call__
+ cbname = repr(id(f))
+ try:
+ callback = callback.im_func
+ except AttributeError:
+ pass
+ try:
+ cbname = cbname + callback.__name__
+ except AttributeError:
+ pass
+ self._tk.createcommand(cbname, f)
+ if self._tclCommands is None:
+ self._tclCommands = []
+ self._tclCommands.append(cbname)
+ self._tk.call("trace", "variable", self._name, mode, cbname)
+ return cbname
+ trace = trace_variable
+ def trace_vdelete(self, mode, cbname):
+ """Delete the trace callback for a variable.
+
+ MODE is one of "r", "w", "u" for read, write, undefine.
+ CBNAME is the name of the callback returned from trace_variable or trace.
+ """
+ self._tk.call("trace", "vdelete", self._name, mode, cbname)
+ cbname = self._tk.splitlist(cbname)[0]
+ for m, ca in self.trace_vinfo():
+ if self._tk.splitlist(ca)[0] == cbname:
+ break
+ else:
+ self._tk.deletecommand(cbname)
+ try:
+ self._tclCommands.remove(cbname)
+ except ValueError:
+ pass
+ def trace_vinfo(self):
+ """Return all trace callback information."""
+ return map(self._tk.splitlist, self._tk.splitlist(
+ self._tk.call("trace", "vinfo", self._name)))
+ def __eq__(self, other):
+ """Comparison for equality (==).
+
+ Note: if the Variable's master matters to behavior
+ also compare self._master == other._master
+ """
+ return self.__class__.__name__ == other.__class__.__name__ \
+ and self._name == other._name
+
+class StringVar(Variable):
+ """Value holder for strings variables."""
+ _default = ""
+ def __init__(self, master=None, value=None, name=None):
+ """Construct a string variable.
+
+ MASTER can be given as master widget.
+ VALUE is an optional value (defaults to "")
+ NAME is an optional Tcl name (defaults to PY_VARnum).
+
+ If NAME matches an existing variable and VALUE is omitted
+ then the existing value is retained.
+ """
+ Variable.__init__(self, master, value, name)
+
+ def get(self):
+ """Return value of variable as string."""
+ value = self._tk.globalgetvar(self._name)
+ if isinstance(value, basestring):
+ return value
+ return str(value)
+
+class IntVar(Variable):
+ """Value holder for integer variables."""
+ _default = 0
+ def __init__(self, master=None, value=None, name=None):
+ """Construct an integer variable.
+
+ MASTER can be given as master widget.
+ VALUE is an optional value (defaults to 0)
+ NAME is an optional Tcl name (defaults to PY_VARnum).
+
+ If NAME matches an existing variable and VALUE is omitted
+ then the existing value is retained.
+ """
+ Variable.__init__(self, master, value, name)
+
+ def set(self, value):
+ """Set the variable to value, converting booleans to integers."""
+ if isinstance(value, bool):
+ value = int(value)
+ return Variable.set(self, value)
+
+ def get(self):
+ """Return the value of the variable as an integer."""
+ return getint(self._tk.globalgetvar(self._name))
+
+class DoubleVar(Variable):
+ """Value holder for float variables."""
+ _default = 0.0
+ def __init__(self, master=None, value=None, name=None):
+ """Construct a float variable.
+
+ MASTER can be given as master widget.
+ VALUE is an optional value (defaults to 0.0)
+ NAME is an optional Tcl name (defaults to PY_VARnum).
+
+ If NAME matches an existing variable and VALUE is omitted
+ then the existing value is retained.
+ """
+ Variable.__init__(self, master, value, name)
+
+ def get(self):
+ """Return the value of the variable as a float."""
+ return getdouble(self._tk.globalgetvar(self._name))
+
+class BooleanVar(Variable):
+ """Value holder for boolean variables."""
+ _default = False
+ def __init__(self, master=None, value=None, name=None):
+ """Construct a boolean variable.
+
+ MASTER can be given as master widget.
+ VALUE is an optional value (defaults to False)
+ NAME is an optional Tcl name (defaults to PY_VARnum).
+
+ If NAME matches an existing variable and VALUE is omitted
+ then the existing value is retained.
+ """
+ Variable.__init__(self, master, value, name)
+
+ def set(self, value):
+ """Set the variable to VALUE."""
+ return self._tk.globalsetvar(self._name, self._tk.getboolean(value))
+
+ def get(self):
+ """Return the value of the variable as a bool."""
+ return self._tk.getboolean(self._tk.globalgetvar(self._name))
+
+def mainloop(n=0):
+ """Run the main loop of Tcl."""
+ _default_root.tk.mainloop(n)
+
+getint = int
+
+getdouble = float
+
+def getboolean(s):
+ """Convert true and false to integer values 1 and 0."""
+ return _default_root.tk.getboolean(s)
+
+# Methods defined on both toplevel and interior widgets
+class Misc:
+ """Internal class.
+
+ Base class which defines methods common for interior widgets."""
+
+ # XXX font command?
+ _tclCommands = None
+ def destroy(self):
+ """Internal function.
+
+ Delete all Tcl commands created for
+ this widget in the Tcl interpreter."""
+ if self._tclCommands is not None:
+ for name in self._tclCommands:
+ #print '- Tkinter: deleted command', name
+ self.tk.deletecommand(name)
+ self._tclCommands = None
+ def deletecommand(self, name):
+ """Internal function.
+
+ Delete the Tcl command provided in NAME."""
+ #print '- Tkinter: deleted command', name
+ self.tk.deletecommand(name)
+ try:
+ self._tclCommands.remove(name)
+ except ValueError:
+ pass
+ def tk_strictMotif(self, boolean=None):
+ """Set Tcl internal variable, whether the look and feel
+ should adhere to Motif.
+
+ A parameter of 1 means adhere to Motif (e.g. no color
+ change if mouse passes over slider).
+ Returns the set value."""
+ return self.tk.getboolean(self.tk.call(
+ 'set', 'tk_strictMotif', boolean))
+ def tk_bisque(self):
+ """Change the color scheme to light brown as used in Tk 3.6 and before."""
+ self.tk.call('tk_bisque')
+ def tk_setPalette(self, *args, **kw):
+ """Set a new color scheme for all widget elements.
+
+ A single color as argument will cause that all colors of Tk
+ widget elements are derived from this.
+ Alternatively several keyword parameters and its associated
+ colors can be given. The following keywords are valid:
+ activeBackground, foreground, selectColor,
+ activeForeground, highlightBackground, selectBackground,
+ background, highlightColor, selectForeground,
+ disabledForeground, insertBackground, troughColor."""
+ self.tk.call(('tk_setPalette',)
+ + _flatten(args) + _flatten(kw.items()))
+ def tk_menuBar(self, *args):
+ """Do not use. Needed in Tk 3.6 and earlier."""
+ # obsolete since Tk 4.0
+ import warnings
+ warnings.warn('tk_menuBar() does nothing and will be removed in 3.6',
+ DeprecationWarning, stacklevel=2)
+ def wait_variable(self, name='PY_VAR'):
+ """Wait until the variable is modified.
+
+ A parameter of type IntVar, StringVar, DoubleVar or
+ BooleanVar must be given."""
+ self.tk.call('tkwait', 'variable', name)
+ waitvar = wait_variable # XXX b/w compat
+ def wait_window(self, window=None):
+ """Wait until a WIDGET is destroyed.
+
+ If no parameter is given self is used."""
+ if window is None:
+ window = self
+ self.tk.call('tkwait', 'window', window._w)
+ def wait_visibility(self, window=None):
+ """Wait until the visibility of a WIDGET changes
+ (e.g. it appears).
+
+ If no parameter is given self is used."""
+ if window is None:
+ window = self
+ self.tk.call('tkwait', 'visibility', window._w)
+ def setvar(self, name='PY_VAR', value='1'):
+ """Set Tcl variable NAME to VALUE."""
+ self.tk.setvar(name, value)
+ def getvar(self, name='PY_VAR'):
+ """Return value of Tcl variable NAME."""
+ return self.tk.getvar(name)
+ getint = int
+ getdouble = float
+ def getboolean(self, s):
+ """Return a boolean value for Tcl boolean values true and false given as parameter."""
+ return self.tk.getboolean(s)
+ def focus_set(self):
+ """Direct input focus to this widget.
+
+ If the application currently does not have the focus
+ this widget will get the focus if the application gets
+ the focus through the window manager."""
+ self.tk.call('focus', self._w)
+ focus = focus_set # XXX b/w compat?
+ def focus_force(self):
+ """Direct input focus to this widget even if the
+ application does not have the focus. Use with
+ caution!"""
+ self.tk.call('focus', '-force', self._w)
+ def focus_get(self):
+ """Return the widget which has currently the focus in the
+ application.
+
+ Use focus_displayof to allow working with several
+ displays. Return None if application does not have
+ the focus."""
+ name = self.tk.call('focus')
+ if name == 'none' or not name: return None
+ return self._nametowidget(name)
+ def focus_displayof(self):
+ """Return the widget which has currently the focus on the
+ display where this widget is located.
+
+ Return None if the application does not have the focus."""
+ name = self.tk.call('focus', '-displayof', self._w)
+ if name == 'none' or not name: return None
+ return self._nametowidget(name)
+ def focus_lastfor(self):
+ """Return the widget which would have the focus if top level
+ for this widget gets the focus from the window manager."""
+ name = self.tk.call('focus', '-lastfor', self._w)
+ if name == 'none' or not name: return None
+ return self._nametowidget(name)
+ def tk_focusFollowsMouse(self):
+ """The widget under mouse will get automatically focus. Can not
+ be disabled easily."""
+ self.tk.call('tk_focusFollowsMouse')
+ def tk_focusNext(self):
+ """Return the next widget in the focus order which follows
+ widget which has currently the focus.
+
+ The focus order first goes to the next child, then to
+ the children of the child recursively and then to the
+ next sibling which is higher in the stacking order. A
+ widget is omitted if it has the takefocus resource set
+ to 0."""
+ name = self.tk.call('tk_focusNext', self._w)
+ if not name: return None
+ return self._nametowidget(name)
+ def tk_focusPrev(self):
+ """Return previous widget in the focus order. See tk_focusNext for details."""
+ name = self.tk.call('tk_focusPrev', self._w)
+ if not name: return None
+ return self._nametowidget(name)
+ def after(self, ms, func=None, *args):
+ """Call function once after given time.
+
+ MS specifies the time in milliseconds. FUNC gives the
+ function which shall be called. Additional parameters
+ are given as parameters to the function call. Return
+ identifier to cancel scheduling with after_cancel."""
+ if not func:
+ # I'd rather use time.sleep(ms*0.001)
+ self.tk.call('after', ms)
+ else:
+ def callit():
+ try:
+ func(*args)
+ finally:
+ try:
+ self.deletecommand(name)
+ except TclError:
+ pass
+ callit.__name__ = func.__name__
+ name = self._register(callit)
+ return self.tk.call('after', ms, name)
+ def after_idle(self, func, *args):
+ """Call FUNC once if the Tcl main loop has no event to
+ process.
+
+ Return an identifier to cancel the scheduling with
+ after_cancel."""
+ return self.after('idle', func, *args)
+ def after_cancel(self, id):
+ """Cancel scheduling of function identified with ID.
+
+ Identifier returned by after or after_idle must be
+ given as first parameter."""
+ try:
+ data = self.tk.call('after', 'info', id)
+ # In Tk 8.3, splitlist returns: (script, type)
+ # In Tk 8.4, splitlist may return (script, type) or (script,)
+ script = self.tk.splitlist(data)[0]
+ self.deletecommand(script)
+ except TclError:
+ pass
+ self.tk.call('after', 'cancel', id)
+ def bell(self, displayof=0):
+ """Ring a display's bell."""
+ self.tk.call(('bell',) + self._displayof(displayof))
+
+ # Clipboard handling:
+ def clipboard_get(self, **kw):
+ """Retrieve data from the clipboard on window's display.
+
+ The window keyword defaults to the root window of the Tkinter
+ application.
+
+ The type keyword specifies the form in which the data is
+ to be returned and should be an atom name such as STRING
+ or FILE_NAME. Type defaults to STRING, except on X11, where the default
+ is to try UTF8_STRING and fall back to STRING.
+
+ This command is equivalent to:
+
+ selection_get(CLIPBOARD)
+ """
+ if 'type' not in kw and self._windowingsystem == 'x11':
+ try:
+ kw['type'] = 'UTF8_STRING'
+ return self.tk.call(('clipboard', 'get') + self._options(kw))
+ except TclError:
+ del kw['type']
+ return self.tk.call(('clipboard', 'get') + self._options(kw))
+
+ def clipboard_clear(self, **kw):
+ """Clear the data in the Tk clipboard.
+
+ A widget specified for the optional displayof keyword
+ argument specifies the target display."""
+ if 'displayof' not in kw: kw['displayof'] = self._w
+ self.tk.call(('clipboard', 'clear') + self._options(kw))
+ def clipboard_append(self, string, **kw):
+ """Append STRING to the Tk clipboard.
+
+ A widget specified at the optional displayof keyword
+ argument specifies the target display. The clipboard
+ can be retrieved with selection_get."""
+ if 'displayof' not in kw: kw['displayof'] = self._w
+ self.tk.call(('clipboard', 'append') + self._options(kw)
+ + ('--', string))
+ # XXX grab current w/o window argument
+ def grab_current(self):
+ """Return widget which has currently the grab in this application
+ or None."""
+ name = self.tk.call('grab', 'current', self._w)
+ if not name: return None
+ return self._nametowidget(name)
+ def grab_release(self):
+ """Release grab for this widget if currently set."""
+ self.tk.call('grab', 'release', self._w)
+ def grab_set(self):
+ """Set grab for this widget.
+
+ A grab directs all events to this and descendant
+ widgets in the application."""
+ self.tk.call('grab', 'set', self._w)
+ def grab_set_global(self):
+ """Set global grab for this widget.
+
+ A global grab directs all events to this and
+ descendant widgets on the display. Use with caution -
+ other applications do not get events anymore."""
+ self.tk.call('grab', 'set', '-global', self._w)
+ def grab_status(self):
+ """Return None, "local" or "global" if this widget has
+ no, a local or a global grab."""
+ status = self.tk.call('grab', 'status', self._w)
+ if status == 'none': status = None
+ return status
+ def option_add(self, pattern, value, priority = None):
+ """Set a VALUE (second parameter) for an option
+ PATTERN (first parameter).
+
+ An optional third parameter gives the numeric priority
+ (defaults to 80)."""
+ self.tk.call('option', 'add', pattern, value, priority)
+ def option_clear(self):
+ """Clear the option database.
+
+ It will be reloaded if option_add is called."""
+ self.tk.call('option', 'clear')
+ def option_get(self, name, className):
+ """Return the value for an option NAME for this widget
+ with CLASSNAME.
+
+ Values with higher priority override lower values."""
+ return self.tk.call('option', 'get', self._w, name, className)
+ def option_readfile(self, fileName, priority = None):
+ """Read file FILENAME into the option database.
+
+ An optional second parameter gives the numeric
+ priority."""
+ self.tk.call('option', 'readfile', fileName, priority)
+ def selection_clear(self, **kw):
+ """Clear the current X selection."""
+ if 'displayof' not in kw: kw['displayof'] = self._w
+ self.tk.call(('selection', 'clear') + self._options(kw))
+ def selection_get(self, **kw):
+ """Return the contents of the current X selection.
+
+ A keyword parameter selection specifies the name of
+ the selection and defaults to PRIMARY. A keyword
+ parameter displayof specifies a widget on the display
+ to use. A keyword parameter type specifies the form of data to be
+ fetched, defaulting to STRING except on X11, where UTF8_STRING is tried
+ before STRING."""
+ if 'displayof' not in kw: kw['displayof'] = self._w
+ if 'type' not in kw and self._windowingsystem == 'x11':
+ try:
+ kw['type'] = 'UTF8_STRING'
+ return self.tk.call(('selection', 'get') + self._options(kw))
+ except TclError:
+ del kw['type']
+ return self.tk.call(('selection', 'get') + self._options(kw))
+ def selection_handle(self, command, **kw):
+ """Specify a function COMMAND to call if the X
+ selection owned by this widget is queried by another
+ application.
+
+ This function must return the contents of the
+ selection. The function will be called with the
+ arguments OFFSET and LENGTH which allows the chunking
+ of very long selections. The following keyword
+ parameters can be provided:
+ selection - name of the selection (default PRIMARY),
+ type - type of the selection (e.g. STRING, FILE_NAME)."""
+ name = self._register(command)
+ self.tk.call(('selection', 'handle') + self._options(kw)
+ + (self._w, name))
+ def selection_own(self, **kw):
+ """Become owner of X selection.
+
+ A keyword parameter selection specifies the name of
+ the selection (default PRIMARY)."""
+ self.tk.call(('selection', 'own') +
+ self._options(kw) + (self._w,))
+ def selection_own_get(self, **kw):
+ """Return owner of X selection.
+
+ The following keyword parameter can
+ be provided:
+ selection - name of the selection (default PRIMARY),
+ type - type of the selection (e.g. STRING, FILE_NAME)."""
+ if 'displayof' not in kw: kw['displayof'] = self._w
+ name = self.tk.call(('selection', 'own') + self._options(kw))
+ if not name: return None
+ return self._nametowidget(name)
+ def send(self, interp, cmd, *args):
+ """Send Tcl command CMD to different interpreter INTERP to be executed."""
+ return self.tk.call(('send', interp, cmd) + args)
+ def lower(self, belowThis=None):
+ """Lower this widget in the stacking order."""
+ self.tk.call('lower', self._w, belowThis)
+ def tkraise(self, aboveThis=None):
+ """Raise this widget in the stacking order."""
+ self.tk.call('raise', self._w, aboveThis)
+ lift = tkraise
+ def colormodel(self, value=None):
+ """Useless. Not implemented in Tk."""
+ return self.tk.call('tk', 'colormodel', self._w, value)
+ def winfo_atom(self, name, displayof=0):
+ """Return integer which represents atom NAME."""
+ args = ('winfo', 'atom') + self._displayof(displayof) + (name,)
+ return getint(self.tk.call(args))
+ def winfo_atomname(self, id, displayof=0):
+ """Return name of atom with identifier ID."""
+ args = ('winfo', 'atomname') \
+ + self._displayof(displayof) + (id,)
+ return self.tk.call(args)
+ def winfo_cells(self):
+ """Return number of cells in the colormap for this widget."""
+ return getint(
+ self.tk.call('winfo', 'cells', self._w))
+ def winfo_children(self):
+ """Return a list of all widgets which are children of this widget."""
+ result = []
+ for child in self.tk.splitlist(
+ self.tk.call('winfo', 'children', self._w)):
+ try:
+ # Tcl sometimes returns extra windows, e.g. for
+ # menus; those need to be skipped
+ result.append(self._nametowidget(child))
+ except KeyError:
+ pass
+ return result
+
+ def winfo_class(self):
+ """Return window class name of this widget."""
+ return self.tk.call('winfo', 'class', self._w)
+ def winfo_colormapfull(self):
+ """Return true if at the last color request the colormap was full."""
+ return self.tk.getboolean(
+ self.tk.call('winfo', 'colormapfull', self._w))
+ def winfo_containing(self, rootX, rootY, displayof=0):
+ """Return the widget which is at the root coordinates ROOTX, ROOTY."""
+ args = ('winfo', 'containing') \
+ + self._displayof(displayof) + (rootX, rootY)
+ name = self.tk.call(args)
+ if not name: return None
+ return self._nametowidget(name)
+ def winfo_depth(self):
+ """Return the number of bits per pixel."""
+ return getint(self.tk.call('winfo', 'depth', self._w))
+ def winfo_exists(self):
+ """Return true if this widget exists."""
+ return getint(
+ self.tk.call('winfo', 'exists', self._w))
+ def winfo_fpixels(self, number):
+ """Return the number of pixels for the given distance NUMBER
+ (e.g. "3c") as float."""
+ return getdouble(self.tk.call(
+ 'winfo', 'fpixels', self._w, number))
+ def winfo_geometry(self):
+ """Return geometry string for this widget in the form "widthxheight+X+Y"."""
+ return self.tk.call('winfo', 'geometry', self._w)
+ def winfo_height(self):
+ """Return height of this widget."""
+ return getint(
+ self.tk.call('winfo', 'height', self._w))
+ def winfo_id(self):
+ """Return identifier ID for this widget."""
+ return self.tk.getint(
+ self.tk.call('winfo', 'id', self._w))
+ def winfo_interps(self, displayof=0):
+ """Return the name of all Tcl interpreters for this display."""
+ args = ('winfo', 'interps') + self._displayof(displayof)
+ return self.tk.splitlist(self.tk.call(args))
+ def winfo_ismapped(self):
+ """Return true if this widget is mapped."""
+ return getint(
+ self.tk.call('winfo', 'ismapped', self._w))
+ def winfo_manager(self):
+ """Return the window mananger name for this widget."""
+ return self.tk.call('winfo', 'manager', self._w)
+ def winfo_name(self):
+ """Return the name of this widget."""
+ return self.tk.call('winfo', 'name', self._w)
+ def winfo_parent(self):
+ """Return the name of the parent of this widget."""
+ return self.tk.call('winfo', 'parent', self._w)
+ def winfo_pathname(self, id, displayof=0):
+ """Return the pathname of the widget given by ID."""
+ args = ('winfo', 'pathname') \
+ + self._displayof(displayof) + (id,)
+ return self.tk.call(args)
+ def winfo_pixels(self, number):
+ """Rounded integer value of winfo_fpixels."""
+ return getint(
+ self.tk.call('winfo', 'pixels', self._w, number))
+ def winfo_pointerx(self):
+ """Return the x coordinate of the pointer on the root window."""
+ return getint(
+ self.tk.call('winfo', 'pointerx', self._w))
+ def winfo_pointerxy(self):
+ """Return a tuple of x and y coordinates of the pointer on the root window."""
+ return self._getints(
+ self.tk.call('winfo', 'pointerxy', self._w))
+ def winfo_pointery(self):
+ """Return the y coordinate of the pointer on the root window."""
+ return getint(
+ self.tk.call('winfo', 'pointery', self._w))
+ def winfo_reqheight(self):
+ """Return requested height of this widget."""
+ return getint(
+ self.tk.call('winfo', 'reqheight', self._w))
+ def winfo_reqwidth(self):
+ """Return requested width of this widget."""
+ return getint(
+ self.tk.call('winfo', 'reqwidth', self._w))
+ def winfo_rgb(self, color):
+ """Return tuple of decimal values for red, green, blue for
+ COLOR in this widget."""
+ return self._getints(
+ self.tk.call('winfo', 'rgb', self._w, color))
+ def winfo_rootx(self):
+ """Return x coordinate of upper left corner of this widget on the
+ root window."""
+ return getint(
+ self.tk.call('winfo', 'rootx', self._w))
+ def winfo_rooty(self):
+ """Return y coordinate of upper left corner of this widget on the
+ root window."""
+ return getint(
+ self.tk.call('winfo', 'rooty', self._w))
+ def winfo_screen(self):
+ """Return the screen name of this widget."""
+ return self.tk.call('winfo', 'screen', self._w)
+ def winfo_screencells(self):
+ """Return the number of the cells in the colormap of the screen
+ of this widget."""
+ return getint(
+ self.tk.call('winfo', 'screencells', self._w))
+ def winfo_screendepth(self):
+ """Return the number of bits per pixel of the root window of the
+ screen of this widget."""
+ return getint(
+ self.tk.call('winfo', 'screendepth', self._w))
+ def winfo_screenheight(self):
+ """Return the number of pixels of the height of the screen of this widget
+ in pixel."""
+ return getint(
+ self.tk.call('winfo', 'screenheight', self._w))
+ def winfo_screenmmheight(self):
+ """Return the number of pixels of the height of the screen of
+ this widget in mm."""
+ return getint(
+ self.tk.call('winfo', 'screenmmheight', self._w))
+ def winfo_screenmmwidth(self):
+ """Return the number of pixels of the width of the screen of
+ this widget in mm."""
+ return getint(
+ self.tk.call('winfo', 'screenmmwidth', self._w))
+ def winfo_screenvisual(self):
+ """Return one of the strings directcolor, grayscale, pseudocolor,
+ staticcolor, staticgray, or truecolor for the default
+ colormodel of this screen."""
+ return self.tk.call('winfo', 'screenvisual', self._w)
+ def winfo_screenwidth(self):
+ """Return the number of pixels of the width of the screen of
+ this widget in pixel."""
+ return getint(
+ self.tk.call('winfo', 'screenwidth', self._w))
+ def winfo_server(self):
+ """Return information of the X-Server of the screen of this widget in
+ the form "XmajorRminor vendor vendorVersion"."""
+ return self.tk.call('winfo', 'server', self._w)
+ def winfo_toplevel(self):
+ """Return the toplevel widget of this widget."""
+ return self._nametowidget(self.tk.call(
+ 'winfo', 'toplevel', self._w))
+ def winfo_viewable(self):
+ """Return true if the widget and all its higher ancestors are mapped."""
+ return getint(
+ self.tk.call('winfo', 'viewable', self._w))
+ def winfo_visual(self):
+ """Return one of the strings directcolor, grayscale, pseudocolor,
+ staticcolor, staticgray, or truecolor for the
+ colormodel of this widget."""
+ return self.tk.call('winfo', 'visual', self._w)
+ def winfo_visualid(self):
+ """Return the X identifier for the visual for this widget."""
+ return self.tk.call('winfo', 'visualid', self._w)
+ def winfo_visualsavailable(self, includeids=0):
+ """Return a list of all visuals available for the screen
+ of this widget.
+
+ Each item in the list consists of a visual name (see winfo_visual), a
+ depth and if INCLUDEIDS=1 is given also the X identifier."""
+ data = self.tk.split(
+ self.tk.call('winfo', 'visualsavailable', self._w,
+ includeids and 'includeids' or None))
+ if type(data) is StringType:
+ data = [self.tk.split(data)]
+ return map(self.__winfo_parseitem, data)
+ def __winfo_parseitem(self, t):
+ """Internal function."""
+ return t[:1] + tuple(map(self.__winfo_getint, t[1:]))
+ def __winfo_getint(self, x):
+ """Internal function."""
+ return int(x, 0)
+ def winfo_vrootheight(self):
+ """Return the height of the virtual root window associated with this
+ widget in pixels. If there is no virtual root window return the
+ height of the screen."""
+ return getint(
+ self.tk.call('winfo', 'vrootheight', self._w))
+ def winfo_vrootwidth(self):
+ """Return the width of the virtual root window associated with this
+ widget in pixel. If there is no virtual root window return the
+ width of the screen."""
+ return getint(
+ self.tk.call('winfo', 'vrootwidth', self._w))
+ def winfo_vrootx(self):
+ """Return the x offset of the virtual root relative to the root
+ window of the screen of this widget."""
+ return getint(
+ self.tk.call('winfo', 'vrootx', self._w))
+ def winfo_vrooty(self):
+ """Return the y offset of the virtual root relative to the root
+ window of the screen of this widget."""
+ return getint(
+ self.tk.call('winfo', 'vrooty', self._w))
+ def winfo_width(self):
+ """Return the width of this widget."""
+ return getint(
+ self.tk.call('winfo', 'width', self._w))
+ def winfo_x(self):
+ """Return the x coordinate of the upper left corner of this widget
+ in the parent."""
+ return getint(
+ self.tk.call('winfo', 'x', self._w))
+ def winfo_y(self):
+ """Return the y coordinate of the upper left corner of this widget
+ in the parent."""
+ return getint(
+ self.tk.call('winfo', 'y', self._w))
+ def update(self):
+ """Enter event loop until all pending events have been processed by Tcl."""
+ self.tk.call('update')
+ def update_idletasks(self):
+ """Enter event loop until all idle callbacks have been called. This
+ will update the display of windows but not process events caused by
+ the user."""
+ self.tk.call('update', 'idletasks')
+ def bindtags(self, tagList=None):
+ """Set or get the list of bindtags for this widget.
+
+ With no argument return the list of all bindtags associated with
+ this widget. With a list of strings as argument the bindtags are
+ set to this list. The bindtags determine in which order events are
+ processed (see bind)."""
+ if tagList is None:
+ return self.tk.splitlist(
+ self.tk.call('bindtags', self._w))
+ else:
+ self.tk.call('bindtags', self._w, tagList)
+ def _bind(self, what, sequence, func, add, needcleanup=1):
+ """Internal function."""
+ if type(func) is StringType:
+ self.tk.call(what + (sequence, func))
+ elif func:
+ funcid = self._register(func, self._substitute,
+ needcleanup)
+ cmd = ('%sif {"[%s %s]" == "break"} break\n'
+ %
+ (add and '+' or '',
+ funcid, self._subst_format_str))
+ self.tk.call(what + (sequence, cmd))
+ return funcid
+ elif sequence:
+ return self.tk.call(what + (sequence,))
+ else:
+ return self.tk.splitlist(self.tk.call(what))
+ def bind(self, sequence=None, func=None, add=None):
+ """Bind to this widget at event SEQUENCE a call to function FUNC.
+
+ SEQUENCE is a string of concatenated event
+ patterns. An event pattern is of the form
+ <MODIFIER-MODIFIER-TYPE-DETAIL> where MODIFIER is one
+ of Control, Mod2, M2, Shift, Mod3, M3, Lock, Mod4, M4,
+ Button1, B1, Mod5, M5 Button2, B2, Meta, M, Button3,
+ B3, Alt, Button4, B4, Double, Button5, B5 Triple,
+ Mod1, M1. TYPE is one of Activate, Enter, Map,
+ ButtonPress, Button, Expose, Motion, ButtonRelease
+ FocusIn, MouseWheel, Circulate, FocusOut, Property,
+ Colormap, Gravity Reparent, Configure, KeyPress, Key,
+ Unmap, Deactivate, KeyRelease Visibility, Destroy,
+ Leave and DETAIL is the button number for ButtonPress,
+ ButtonRelease and DETAIL is the Keysym for KeyPress and
+ KeyRelease. Examples are
+ <Control-Button-1> for pressing Control and mouse button 1 or
+ <Alt-A> for pressing A and the Alt key (KeyPress can be omitted).
+ An event pattern can also be a virtual event of the form
+ <<AString>> where AString can be arbitrary. This
+ event can be generated by event_generate.
+ If events are concatenated they must appear shortly
+ after each other.
+
+ FUNC will be called if the event sequence occurs with an
+ instance of Event as argument. If the return value of FUNC is
+ "break" no further bound function is invoked.
+
+ An additional boolean parameter ADD specifies whether FUNC will
+ be called additionally to the other bound function or whether
+ it will replace the previous function.
+
+ Bind will return an identifier to allow deletion of the bound function with
+ unbind without memory leak.
+
+ If FUNC or SEQUENCE is omitted the bound function or list
+ of bound events are returned."""
+
+ return self._bind(('bind', self._w), sequence, func, add)
+ def unbind(self, sequence, funcid=None):
+ """Unbind for this widget for event SEQUENCE the
+ function identified with FUNCID."""
+ self.tk.call('bind', self._w, sequence, '')
+ if funcid:
+ self.deletecommand(funcid)
+ def bind_all(self, sequence=None, func=None, add=None):
+ """Bind to all widgets at an event SEQUENCE a call to function FUNC.
+ An additional boolean parameter ADD specifies whether FUNC will
+ be called additionally to the other bound function or whether
+ it will replace the previous function. See bind for the return value."""
+ return self._bind(('bind', 'all'), sequence, func, add, 0)
+ def unbind_all(self, sequence):
+ """Unbind for all widgets for event SEQUENCE all functions."""
+ self.tk.call('bind', 'all' , sequence, '')
+ def bind_class(self, className, sequence=None, func=None, add=None):
+
+ """Bind to widgets with bindtag CLASSNAME at event
+ SEQUENCE a call of function FUNC. An additional
+ boolean parameter ADD specifies whether FUNC will be
+ called additionally to the other bound function or
+ whether it will replace the previous function. See bind for
+ the return value."""
+
+ return self._bind(('bind', className), sequence, func, add, 0)
+ def unbind_class(self, className, sequence):
+ """Unbind for all widgets with bindtag CLASSNAME for event SEQUENCE
+ all functions."""
+ self.tk.call('bind', className , sequence, '')
+ def mainloop(self, n=0):
+ """Call the mainloop of Tk."""
+ self.tk.mainloop(n)
+ def quit(self):
+ """Quit the Tcl interpreter. All widgets will be destroyed."""
+ self.tk.quit()
+ def _getints(self, string):
+ """Internal function."""
+ if string:
+ return tuple(map(getint, self.tk.splitlist(string)))
+ def _getdoubles(self, string):
+ """Internal function."""
+ if string:
+ return tuple(map(getdouble, self.tk.splitlist(string)))
+ def _getboolean(self, string):
+ """Internal function."""
+ if string:
+ return self.tk.getboolean(string)
+ def _displayof(self, displayof):
+ """Internal function."""
+ if displayof:
+ return ('-displayof', displayof)
+ if displayof is None:
+ return ('-displayof', self._w)
+ return ()
+ @property
+ def _windowingsystem(self):
+ """Internal function."""
+ try:
+ return self._root()._windowingsystem_cached
+ except AttributeError:
+ ws = self._root()._windowingsystem_cached = \
+ self.tk.call('tk', 'windowingsystem')
+ return ws
+ def _options(self, cnf, kw = None):
+ """Internal function."""
+ if kw:
+ cnf = _cnfmerge((cnf, kw))
+ else:
+ cnf = _cnfmerge(cnf)
+ res = ()
+ for k, v in cnf.items():
+ if v is not None:
+ if k[-1] == '_': k = k[:-1]
+ if hasattr(v, '__call__'):
+ v = self._register(v)
+ elif isinstance(v, (tuple, list)):
+ nv = []
+ for item in v:
+ if not isinstance(item, (basestring, int)):
+ break
+ elif isinstance(item, int):
+ nv.append('%d' % item)
+ else:
+ # format it to proper Tcl code if it contains space
+ nv.append(_stringify(item))
+ else:
+ v = ' '.join(nv)
+ res = res + ('-'+k, v)
+ return res
+ def nametowidget(self, name):
+ """Return the Tkinter instance of a widget identified by
+ its Tcl name NAME."""
+ name = str(name).split('.')
+ w = self
+
+ if not name[0]:
+ w = w._root()
+ name = name[1:]
+
+ for n in name:
+ if not n:
+ break
+ w = w.children[n]
+
+ return w
+ _nametowidget = nametowidget
+ def _register(self, func, subst=None, needcleanup=1):
+ """Return a newly created Tcl function. If this
+ function is called, the Python function FUNC will
+ be executed. An optional function SUBST can
+ be given which will be executed before FUNC."""
+ f = CallWrapper(func, subst, self).__call__
+ name = repr(id(f))
+ try:
+ func = func.im_func
+ except AttributeError:
+ pass
+ try:
+ name = name + func.__name__
+ except AttributeError:
+ pass
+ self.tk.createcommand(name, f)
+ if needcleanup:
+ if self._tclCommands is None:
+ self._tclCommands = []
+ self._tclCommands.append(name)
+ return name
+ register = _register
+ def _root(self):
+ """Internal function."""
+ w = self
+ while w.master: w = w.master
+ return w
+ _subst_format = ('%#', '%b', '%f', '%h', '%k',
+ '%s', '%t', '%w', '%x', '%y',
+ '%A', '%E', '%K', '%N', '%W', '%T', '%X', '%Y', '%D')
+ _subst_format_str = " ".join(_subst_format)
+ def _substitute(self, *args):
+ """Internal function."""
+ if len(args) != len(self._subst_format): return args
+ getboolean = self.tk.getboolean
+
+ getint = int
+ def getint_event(s):
+ """Tk changed behavior in 8.4.2, returning "??" rather more often."""
+ try:
+ return int(s)
+ except ValueError:
+ return s
+
+ nsign, b, f, h, k, s, t, w, x, y, A, E, K, N, W, T, X, Y, D = args
+ # Missing: (a, c, d, m, o, v, B, R)
+ e = Event()
+ # serial field: valid for all events
+ # number of button: ButtonPress and ButtonRelease events only
+ # height field: Configure, ConfigureRequest, Create,
+ # ResizeRequest, and Expose events only
+ # keycode field: KeyPress and KeyRelease events only
+ # time field: "valid for events that contain a time field"
+ # width field: Configure, ConfigureRequest, Create, ResizeRequest,
+ # and Expose events only
+ # x field: "valid for events that contain an x field"
+ # y field: "valid for events that contain a y field"
+ # keysym as decimal: KeyPress and KeyRelease events only
+ # x_root, y_root fields: ButtonPress, ButtonRelease, KeyPress,
+ # KeyRelease, and Motion events
+ e.serial = getint(nsign)
+ e.num = getint_event(b)
+ try: e.focus = getboolean(f)
+ except TclError: pass
+ e.height = getint_event(h)
+ e.keycode = getint_event(k)
+ e.state = getint_event(s)
+ e.time = getint_event(t)
+ e.width = getint_event(w)
+ e.x = getint_event(x)
+ e.y = getint_event(y)
+ e.char = A
+ try: e.send_event = getboolean(E)
+ except TclError: pass
+ e.keysym = K
+ e.keysym_num = getint_event(N)
+ e.type = T
+ try:
+ e.widget = self._nametowidget(W)
+ except KeyError:
+ e.widget = W
+ e.x_root = getint_event(X)
+ e.y_root = getint_event(Y)
+ try:
+ e.delta = getint(D)
+ except ValueError:
+ e.delta = 0
+ return (e,)
+ def _report_exception(self):
+ """Internal function."""
+ import sys
+ exc, val, tb = sys.exc_type, sys.exc_value, sys.exc_traceback
+ root = self._root()
+ root.report_callback_exception(exc, val, tb)
+
+ def _getconfigure(self, *args):
+ """Call Tcl configure command and return the result as a dict."""
+ cnf = {}
+ for x in self.tk.splitlist(self.tk.call(*args)):
+ x = self.tk.splitlist(x)
+ cnf[x[0][1:]] = (x[0][1:],) + x[1:]
+ return cnf
+
+ def _getconfigure1(self, *args):
+ x = self.tk.splitlist(self.tk.call(*args))
+ return (x[0][1:],) + x[1:]
+
+ def _configure(self, cmd, cnf, kw):
+ """Internal function."""
+ if kw:
+ cnf = _cnfmerge((cnf, kw))
+ elif cnf:
+ cnf = _cnfmerge(cnf)
+ if cnf is None:
+ return self._getconfigure(_flatten((self._w, cmd)))
+ if type(cnf) is StringType:
+ return self._getconfigure1(_flatten((self._w, cmd, '-'+cnf)))
+ self.tk.call(_flatten((self._w, cmd)) + self._options(cnf))
+ # These used to be defined in Widget:
+ def configure(self, cnf=None, **kw):
+ """Configure resources of a widget.
+
+ The values for resources are specified as keyword
+ arguments. To get an overview about
+ the allowed keyword arguments call the method keys.
+ """
+ return self._configure('configure', cnf, kw)
+ config = configure
+ def cget(self, key):
+ """Return the resource value for a KEY given as string."""
+ return self.tk.call(self._w, 'cget', '-' + key)
+ __getitem__ = cget
+ def __setitem__(self, key, value):
+ self.configure({key: value})
+ def __contains__(self, key):
+ raise TypeError("Tkinter objects don't support 'in' tests.")
+ def keys(self):
+ """Return a list of all resource names of this widget."""
+ splitlist = self.tk.splitlist
+ return [splitlist(x)[0][1:] for x in
+ splitlist(self.tk.call(self._w, 'configure'))]
+ def __str__(self):
+ """Return the window path name of this widget."""
+ return self._w
+ # Pack methods that apply to the master
+ _noarg_ = ['_noarg_']
+ def pack_propagate(self, flag=_noarg_):
+ """Set or get the status for propagation of geometry information.
+
+ A boolean argument specifies whether the geometry information
+ of the slaves will determine the size of this widget. If no argument
+ is given the current setting will be returned.
+ """
+ if flag is Misc._noarg_:
+ return self._getboolean(self.tk.call(
+ 'pack', 'propagate', self._w))
+ else:
+ self.tk.call('pack', 'propagate', self._w, flag)
+ propagate = pack_propagate
+ def pack_slaves(self):
+ """Return a list of all slaves of this widget
+ in its packing order."""
+ return map(self._nametowidget,
+ self.tk.splitlist(
+ self.tk.call('pack', 'slaves', self._w)))
+ slaves = pack_slaves
+ # Place method that applies to the master
+ def place_slaves(self):
+ """Return a list of all slaves of this widget
+ in its packing order."""
+ return map(self._nametowidget,
+ self.tk.splitlist(
+ self.tk.call(
+ 'place', 'slaves', self._w)))
+ # Grid methods that apply to the master
+ def grid_bbox(self, column=None, row=None, col2=None, row2=None):
+ """Return a tuple of integer coordinates for the bounding
+ box of this widget controlled by the geometry manager grid.
+
+ If COLUMN, ROW is given the bounding box applies from
+ the cell with row and column 0 to the specified
+ cell. If COL2 and ROW2 are given the bounding box
+ starts at that cell.
+
+ The returned integers specify the offset of the upper left
+ corner in the master widget and the width and height.
+ """
+ args = ('grid', 'bbox', self._w)
+ if column is not None and row is not None:
+ args = args + (column, row)
+ if col2 is not None and row2 is not None:
+ args = args + (col2, row2)
+ return self._getints(self.tk.call(*args)) or None
+
+ bbox = grid_bbox
+
+ def _gridconvvalue(self, value):
+ if isinstance(value, (str, _tkinter.Tcl_Obj)):
+ try:
+ svalue = str(value)
+ if not svalue:
+ return None
+ elif '.' in svalue:
+ return getdouble(svalue)
+ else:
+ return getint(svalue)
+ except ValueError:
+ pass
+ return value
+
+ def _grid_configure(self, command, index, cnf, kw):
+ """Internal function."""
+ if type(cnf) is StringType and not kw:
+ if cnf[-1:] == '_':
+ cnf = cnf[:-1]
+ if cnf[:1] != '-':
+ cnf = '-'+cnf
+ options = (cnf,)
+ else:
+ options = self._options(cnf, kw)
+ if not options:
+ return _splitdict(
+ self.tk,
+ self.tk.call('grid', command, self._w, index),
+ conv=self._gridconvvalue)
+ res = self.tk.call(
+ ('grid', command, self._w, index)
+ + options)
+ if len(options) == 1:
+ return self._gridconvvalue(res)
+
+ def grid_columnconfigure(self, index, cnf={}, **kw):
+ """Configure column INDEX of a grid.
+
+ Valid resources are minsize (minimum size of the column),
+ weight (how much does additional space propagate to this column)
+ and pad (how much space to let additionally)."""
+ return self._grid_configure('columnconfigure', index, cnf, kw)
+ columnconfigure = grid_columnconfigure
+ def grid_location(self, x, y):
+ """Return a tuple of column and row which identify the cell
+ at which the pixel at position X and Y inside the master
+ widget is located."""
+ return self._getints(
+ self.tk.call(
+ 'grid', 'location', self._w, x, y)) or None
+ def grid_propagate(self, flag=_noarg_):
+ """Set or get the status for propagation of geometry information.
+
+ A boolean argument specifies whether the geometry information
+ of the slaves will determine the size of this widget. If no argument
+ is given, the current setting will be returned.
+ """
+ if flag is Misc._noarg_:
+ return self._getboolean(self.tk.call(
+ 'grid', 'propagate', self._w))
+ else:
+ self.tk.call('grid', 'propagate', self._w, flag)
+ def grid_rowconfigure(self, index, cnf={}, **kw):
+ """Configure row INDEX of a grid.
+
+ Valid resources are minsize (minimum size of the row),
+ weight (how much does additional space propagate to this row)
+ and pad (how much space to let additionally)."""
+ return self._grid_configure('rowconfigure', index, cnf, kw)
+ rowconfigure = grid_rowconfigure
+ def grid_size(self):
+ """Return a tuple of the number of column and rows in the grid."""
+ return self._getints(
+ self.tk.call('grid', 'size', self._w)) or None
+ size = grid_size
+ def grid_slaves(self, row=None, column=None):
+ """Return a list of all slaves of this widget
+ in its packing order."""
+ args = ()
+ if row is not None:
+ args = args + ('-row', row)
+ if column is not None:
+ args = args + ('-column', column)
+ return map(self._nametowidget,
+ self.tk.splitlist(self.tk.call(
+ ('grid', 'slaves', self._w) + args)))
+
+ # Support for the "event" command, new in Tk 4.2.
+ # By Case Roole.
+
+ def event_add(self, virtual, *sequences):
+ """Bind a virtual event VIRTUAL (of the form <<Name>>)
+ to an event SEQUENCE such that the virtual event is triggered
+ whenever SEQUENCE occurs."""
+ args = ('event', 'add', virtual) + sequences
+ self.tk.call(args)
+
+ def event_delete(self, virtual, *sequences):
+ """Unbind a virtual event VIRTUAL from SEQUENCE."""
+ args = ('event', 'delete', virtual) + sequences
+ self.tk.call(args)
+
+ def event_generate(self, sequence, **kw):
+ """Generate an event SEQUENCE. Additional
+ keyword arguments specify parameter of the event
+ (e.g. x, y, rootx, rooty)."""
+ args = ('event', 'generate', self._w, sequence)
+ for k, v in kw.items():
+ args = args + ('-%s' % k, str(v))
+ self.tk.call(args)
+
+ def event_info(self, virtual=None):
+ """Return a list of all virtual events or the information
+ about the SEQUENCE bound to the virtual event VIRTUAL."""
+ return self.tk.splitlist(
+ self.tk.call('event', 'info', virtual))
+
+ # Image related commands
+
+ def image_names(self):
+ """Return a list of all existing image names."""
+ return self.tk.splitlist(self.tk.call('image', 'names'))
+
+ def image_types(self):
+ """Return a list of all available image types (e.g. phote bitmap)."""
+ return self.tk.splitlist(self.tk.call('image', 'types'))
+
+
+class CallWrapper:
+ """Internal class. Stores function to call when some user
+ defined Tcl function is called e.g. after an event occurred."""
+ def __init__(self, func, subst, widget):
+ """Store FUNC, SUBST and WIDGET as members."""
+ self.func = func
+ self.subst = subst
+ self.widget = widget
+ def __call__(self, *args):
+ """Apply first function SUBST to arguments, than FUNC."""
+ try:
+ if self.subst:
+ args = self.subst(*args)
+ return self.func(*args)
+ except SystemExit, msg:
+ raise SystemExit, msg
+ except:
+ self.widget._report_exception()
+
+
+class XView:
+ """Mix-in class for querying and changing the horizontal position
+ of a widget's window."""
+
+ def xview(self, *args):
+ """Query and change the horizontal position of the view."""
+ res = self.tk.call(self._w, 'xview', *args)
+ if not args:
+ return self._getdoubles(res)
+
+ def xview_moveto(self, fraction):
+ """Adjusts the view in the window so that FRACTION of the
+ total width of the canvas is off-screen to the left."""
+ self.tk.call(self._w, 'xview', 'moveto', fraction)
+
+ def xview_scroll(self, number, what):
+ """Shift the x-view according to NUMBER which is measured in "units"
+ or "pages" (WHAT)."""
+ self.tk.call(self._w, 'xview', 'scroll', number, what)
+
+
+class YView:
+ """Mix-in class for querying and changing the vertical position
+ of a widget's window."""
+
+ def yview(self, *args):
+ """Query and change the vertical position of the view."""
+ res = self.tk.call(self._w, 'yview', *args)
+ if not args:
+ return self._getdoubles(res)
+
+ def yview_moveto(self, fraction):
+ """Adjusts the view in the window so that FRACTION of the
+ total height of the canvas is off-screen to the top."""
+ self.tk.call(self._w, 'yview', 'moveto', fraction)
+
+ def yview_scroll(self, number, what):
+ """Shift the y-view according to NUMBER which is measured in
+ "units" or "pages" (WHAT)."""
+ self.tk.call(self._w, 'yview', 'scroll', number, what)
+
+
+class Wm:
+ """Provides functions for the communication with the window manager."""
+
+ def wm_aspect(self,
+ minNumer=None, minDenom=None,
+ maxNumer=None, maxDenom=None):
+ """Instruct the window manager to set the aspect ratio (width/height)
+ of this widget to be between MINNUMER/MINDENOM and MAXNUMER/MAXDENOM. Return a tuple
+ of the actual values if no argument is given."""
+ return self._getints(
+ self.tk.call('wm', 'aspect', self._w,
+ minNumer, minDenom,
+ maxNumer, maxDenom))
+ aspect = wm_aspect
+
+ def wm_attributes(self, *args):
+ """This subcommand returns or sets platform specific attributes
+
+ The first form returns a list of the platform specific flags and
+ their values. The second form returns the value for the specific
+ option. The third form sets one or more of the values. The values
+ are as follows:
+
+ On Windows, -disabled gets or sets whether the window is in a
+ disabled state. -toolwindow gets or sets the style of the window
+ to toolwindow (as defined in the MSDN). -topmost gets or sets
+ whether this is a topmost window (displays above all other
+ windows).
+
+ On Macintosh, XXXXX
+
+ On Unix, there are currently no special attribute values.
+ """
+ args = ('wm', 'attributes', self._w) + args
+ return self.tk.call(args)
+ attributes=wm_attributes
+
+ def wm_client(self, name=None):
+ """Store NAME in WM_CLIENT_MACHINE property of this widget. Return
+ current value."""
+ return self.tk.call('wm', 'client', self._w, name)
+ client = wm_client
+ def wm_colormapwindows(self, *wlist):
+ """Store list of window names (WLIST) into WM_COLORMAPWINDOWS property
+ of this widget. This list contains windows whose colormaps differ from their
+ parents. Return current list of widgets if WLIST is empty."""
+ if len(wlist) > 1:
+ wlist = (wlist,) # Tk needs a list of windows here
+ args = ('wm', 'colormapwindows', self._w) + wlist
+ if wlist:
+ self.tk.call(args)
+ else:
+ return map(self._nametowidget, self.tk.splitlist(self.tk.call(args)))
+ colormapwindows = wm_colormapwindows
+ def wm_command(self, value=None):
+ """Store VALUE in WM_COMMAND property. It is the command
+ which shall be used to invoke the application. Return current
+ command if VALUE is None."""
+ return self.tk.call('wm', 'command', self._w, value)
+ command = wm_command
+ def wm_deiconify(self):
+ """Deiconify this widget. If it was never mapped it will not be mapped.
+ On Windows it will raise this widget and give it the focus."""
+ return self.tk.call('wm', 'deiconify', self._w)
+ deiconify = wm_deiconify
+ def wm_focusmodel(self, model=None):
+ """Set focus model to MODEL. "active" means that this widget will claim
+ the focus itself, "passive" means that the window manager shall give
+ the focus. Return current focus model if MODEL is None."""
+ return self.tk.call('wm', 'focusmodel', self._w, model)
+ focusmodel = wm_focusmodel
+ def wm_frame(self):
+ """Return identifier for decorative frame of this widget if present."""
+ return self.tk.call('wm', 'frame', self._w)
+ frame = wm_frame
+ def wm_geometry(self, newGeometry=None):
+ """Set geometry to NEWGEOMETRY of the form =widthxheight+x+y. Return
+ current value if None is given."""
+ return self.tk.call('wm', 'geometry', self._w, newGeometry)
+ geometry = wm_geometry
+ def wm_grid(self,
+ baseWidth=None, baseHeight=None,
+ widthInc=None, heightInc=None):
+ """Instruct the window manager that this widget shall only be
+ resized on grid boundaries. WIDTHINC and HEIGHTINC are the width and
+ height of a grid unit in pixels. BASEWIDTH and BASEHEIGHT are the
+ number of grid units requested in Tk_GeometryRequest."""
+ return self._getints(self.tk.call(
+ 'wm', 'grid', self._w,
+ baseWidth, baseHeight, widthInc, heightInc))
+ grid = wm_grid
+ def wm_group(self, pathName=None):
+ """Set the group leader widgets for related widgets to PATHNAME. Return
+ the group leader of this widget if None is given."""
+ return self.tk.call('wm', 'group', self._w, pathName)
+ group = wm_group
+ def wm_iconbitmap(self, bitmap=None, default=None):
+ """Set bitmap for the iconified widget to BITMAP. Return
+ the bitmap if None is given.
+
+ Under Windows, the DEFAULT parameter can be used to set the icon
+ for the widget and any descendents that don't have an icon set
+ explicitly. DEFAULT can be the relative path to a .ico file
+ (example: root.iconbitmap(default='myicon.ico') ). See Tk
+ documentation for more information."""
+ if default:
+ return self.tk.call('wm', 'iconbitmap', self._w, '-default', default)
+ else:
+ return self.tk.call('wm', 'iconbitmap', self._w, bitmap)
+ iconbitmap = wm_iconbitmap
+ def wm_iconify(self):
+ """Display widget as icon."""
+ return self.tk.call('wm', 'iconify', self._w)
+ iconify = wm_iconify
+ def wm_iconmask(self, bitmap=None):
+ """Set mask for the icon bitmap of this widget. Return the
+ mask if None is given."""
+ return self.tk.call('wm', 'iconmask', self._w, bitmap)
+ iconmask = wm_iconmask
+ def wm_iconname(self, newName=None):
+ """Set the name of the icon for this widget. Return the name if
+ None is given."""
+ return self.tk.call('wm', 'iconname', self._w, newName)
+ iconname = wm_iconname
+ def wm_iconposition(self, x=None, y=None):
+ """Set the position of the icon of this widget to X and Y. Return
+ a tuple of the current values of X and X if None is given."""
+ return self._getints(self.tk.call(
+ 'wm', 'iconposition', self._w, x, y))
+ iconposition = wm_iconposition
+ def wm_iconwindow(self, pathName=None):
+ """Set widget PATHNAME to be displayed instead of icon. Return the current
+ value if None is given."""
+ return self.tk.call('wm', 'iconwindow', self._w, pathName)
+ iconwindow = wm_iconwindow
+ def wm_maxsize(self, width=None, height=None):
+ """Set max WIDTH and HEIGHT for this widget. If the window is gridded
+ the values are given in grid units. Return the current values if None
+ is given."""
+ return self._getints(self.tk.call(
+ 'wm', 'maxsize', self._w, width, height))
+ maxsize = wm_maxsize
+ def wm_minsize(self, width=None, height=None):
+ """Set min WIDTH and HEIGHT for this widget. If the window is gridded
+ the values are given in grid units. Return the current values if None
+ is given."""
+ return self._getints(self.tk.call(
+ 'wm', 'minsize', self._w, width, height))
+ minsize = wm_minsize
+ def wm_overrideredirect(self, boolean=None):
+ """Instruct the window manager to ignore this widget
+ if BOOLEAN is given with 1. Return the current value if None
+ is given."""
+ return self._getboolean(self.tk.call(
+ 'wm', 'overrideredirect', self._w, boolean))
+ overrideredirect = wm_overrideredirect
+ def wm_positionfrom(self, who=None):
+ """Instruct the window manager that the position of this widget shall
+ be defined by the user if WHO is "user", and by its own policy if WHO is
+ "program"."""
+ return self.tk.call('wm', 'positionfrom', self._w, who)
+ positionfrom = wm_positionfrom
+ def wm_protocol(self, name=None, func=None):
+ """Bind function FUNC to command NAME for this widget.
+ Return the function bound to NAME if None is given. NAME could be
+ e.g. "WM_SAVE_YOURSELF" or "WM_DELETE_WINDOW"."""
+ if hasattr(func, '__call__'):
+ command = self._register(func)
+ else:
+ command = func
+ return self.tk.call(
+ 'wm', 'protocol', self._w, name, command)
+ protocol = wm_protocol
+ def wm_resizable(self, width=None, height=None):
+ """Instruct the window manager whether this width can be resized
+ in WIDTH or HEIGHT. Both values are boolean values."""
+ return self.tk.call('wm', 'resizable', self._w, width, height)
+ resizable = wm_resizable
+ def wm_sizefrom(self, who=None):
+ """Instruct the window manager that the size of this widget shall
+ be defined by the user if WHO is "user", and by its own policy if WHO is
+ "program"."""
+ return self.tk.call('wm', 'sizefrom', self._w, who)
+ sizefrom = wm_sizefrom
+ def wm_state(self, newstate=None):
+ """Query or set the state of this widget as one of normal, icon,
+ iconic (see wm_iconwindow), withdrawn, or zoomed (Windows only)."""
+ return self.tk.call('wm', 'state', self._w, newstate)
+ state = wm_state
+ def wm_title(self, string=None):
+ """Set the title of this widget."""
+ return self.tk.call('wm', 'title', self._w, string)
+ title = wm_title
+ def wm_transient(self, master=None):
+ """Instruct the window manager that this widget is transient
+ with regard to widget MASTER."""
+ return self.tk.call('wm', 'transient', self._w, master)
+ transient = wm_transient
+ def wm_withdraw(self):
+ """Withdraw this widget from the screen such that it is unmapped
+ and forgotten by the window manager. Re-draw it with wm_deiconify."""
+ return self.tk.call('wm', 'withdraw', self._w)
+ withdraw = wm_withdraw
+
+
+class Tk(Misc, Wm):
+ """Toplevel widget of Tk which represents mostly the main window
+ of an application. It has an associated Tcl interpreter."""
+ _w = '.'
+ def __init__(self, screenName=None, baseName=None, className='Tk',
+ useTk=1, sync=0, use=None):
+ """Return a new Toplevel widget on screen SCREENNAME. A new Tcl interpreter will
+ be created. BASENAME will be used for the identification of the profile file (see
+ readprofile).
+ It is constructed from sys.argv[0] without extensions if None is given. CLASSNAME
+ is the name of the widget class."""
+ self.master = None
+ self.children = {}
+ self._tkloaded = 0
+ # to avoid recursions in the getattr code in case of failure, we
+ # ensure that self.tk is always _something_.
+ self.tk = None
+ if baseName is None:
+ import os
+ baseName = os.path.basename(sys.argv[0])
+ baseName, ext = os.path.splitext(baseName)
+ if ext not in ('.py', '.pyc', '.pyo'):
+ baseName = baseName + ext
+ interactive = 0
+ self.tk = _tkinter.create(screenName, baseName, className, interactive, wantobjects, useTk, sync, use)
+ if useTk:
+ self._loadtk()
+ if not sys.flags.ignore_environment:
+ # Issue #16248: Honor the -E flag to avoid code injection.
+ self.readprofile(baseName, className)
+ def loadtk(self):
+ if not self._tkloaded:
+ self.tk.loadtk()
+ self._loadtk()
+ def _loadtk(self):
+ self._tkloaded = 1
+ global _default_root
+ # Version sanity checks
+ tk_version = self.tk.getvar('tk_version')
+ if tk_version != _tkinter.TK_VERSION:
+ raise RuntimeError, \
+ "tk.h version (%s) doesn't match libtk.a version (%s)" \
+ % (_tkinter.TK_VERSION, tk_version)
+ # Under unknown circumstances, tcl_version gets coerced to float
+ tcl_version = str(self.tk.getvar('tcl_version'))
+ if tcl_version != _tkinter.TCL_VERSION:
+ raise RuntimeError, \
+ "tcl.h version (%s) doesn't match libtcl.a version (%s)" \
+ % (_tkinter.TCL_VERSION, tcl_version)
+ if TkVersion < 4.0:
+ raise RuntimeError, \
+ "Tk 4.0 or higher is required; found Tk %s" \
+ % str(TkVersion)
+ # Create and register the tkerror and exit commands
+ # We need to inline parts of _register here, _ register
+ # would register differently-named commands.
+ if self._tclCommands is None:
+ self._tclCommands = []
+ self.tk.createcommand('tkerror', _tkerror)
+ self.tk.createcommand('exit', _exit)
+ self._tclCommands.append('tkerror')
+ self._tclCommands.append('exit')
+ if _support_default_root and not _default_root:
+ _default_root = self
+ self.protocol("WM_DELETE_WINDOW", self.destroy)
+ def destroy(self):
+ """Destroy this and all descendants widgets. This will
+ end the application of this Tcl interpreter."""
+ for c in self.children.values(): c.destroy()
+ self.tk.call('destroy', self._w)
+ Misc.destroy(self)
+ global _default_root
+ if _support_default_root and _default_root is self:
+ _default_root = None
+ def readprofile(self, baseName, className):
+ """Internal function. It reads BASENAME.tcl and CLASSNAME.tcl into
+ the Tcl Interpreter and calls execfile on BASENAME.py and CLASSNAME.py if
+ such a file exists in the home directory."""
+ import os
+ if 'HOME' in os.environ: home = os.environ['HOME']
+ else: home = os.curdir
+ class_tcl = os.path.join(home, '.%s.tcl' % className)
+ class_py = os.path.join(home, '.%s.py' % className)
+ base_tcl = os.path.join(home, '.%s.tcl' % baseName)
+ base_py = os.path.join(home, '.%s.py' % baseName)
+ dir = {'self': self}
+ exec 'from Tkinter import *' in dir
+ if os.path.isfile(class_tcl):
+ self.tk.call('source', class_tcl)
+ if os.path.isfile(class_py):
+ execfile(class_py, dir)
+ if os.path.isfile(base_tcl):
+ self.tk.call('source', base_tcl)
+ if os.path.isfile(base_py):
+ execfile(base_py, dir)
+ def report_callback_exception(self, exc, val, tb):
+ """Report callback exception on sys.stderr.
+
+ Applications may want to override this internal function, and
+ should when sys.stderr is None."""
+ import traceback, sys
+ print >>sys.stderr, "Exception in Tkinter callback"
+ sys.last_type = exc
+ sys.last_value = val
+ sys.last_traceback = tb
+ traceback.print_exception(exc, val, tb)
+ def __getattr__(self, attr):
+ "Delegate attribute access to the interpreter object"
+ return getattr(self.tk, attr)
+
+# Ideally, the classes Pack, Place and Grid disappear, the
+# pack/place/grid methods are defined on the Widget class, and
+# everybody uses w.pack_whatever(...) instead of Pack.whatever(w,
+# ...), with pack(), place() and grid() being short for
+# pack_configure(), place_configure() and grid_columnconfigure(), and
+# forget() being short for pack_forget(). As a practical matter, I'm
+# afraid that there is too much code out there that may be using the
+# Pack, Place or Grid class, so I leave them intact -- but only as
+# backwards compatibility features. Also note that those methods that
+# take a master as argument (e.g. pack_propagate) have been moved to
+# the Misc class (which now incorporates all methods common between
+# toplevel and interior widgets). Again, for compatibility, these are
+# copied into the Pack, Place or Grid class.
+
+
+def Tcl(screenName=None, baseName=None, className='Tk', useTk=0):
+ return Tk(screenName, baseName, className, useTk)
+
+class Pack:
+ """Geometry manager Pack.
+
+ Base class to use the methods pack_* in every widget."""
+ def pack_configure(self, cnf={}, **kw):
+ """Pack a widget in the parent widget. Use as options:
+ after=widget - pack it after you have packed widget
+ anchor=NSEW (or subset) - position widget according to
+ given direction
+ before=widget - pack it before you will pack widget
+ expand=bool - expand widget if parent size grows
+ fill=NONE or X or Y or BOTH - fill widget if widget grows
+ in=master - use master to contain this widget
+ in_=master - see 'in' option description
+ ipadx=amount - add internal padding in x direction
+ ipady=amount - add internal padding in y direction
+ padx=amount - add padding in x direction
+ pady=amount - add padding in y direction
+ side=TOP or BOTTOM or LEFT or RIGHT - where to add this widget.
+ """
+ self.tk.call(
+ ('pack', 'configure', self._w)
+ + self._options(cnf, kw))
+ pack = configure = config = pack_configure
+ def pack_forget(self):
+ """Unmap this widget and do not use it for the packing order."""
+ self.tk.call('pack', 'forget', self._w)
+ forget = pack_forget
+ def pack_info(self):
+ """Return information about the packing options
+ for this widget."""
+ d = _splitdict(self.tk, self.tk.call('pack', 'info', self._w))
+ if 'in' in d:
+ d['in'] = self.nametowidget(d['in'])
+ return d
+ info = pack_info
+ propagate = pack_propagate = Misc.pack_propagate
+ slaves = pack_slaves = Misc.pack_slaves
+
+class Place:
+ """Geometry manager Place.
+
+ Base class to use the methods place_* in every widget."""
+ def place_configure(self, cnf={}, **kw):
+ """Place a widget in the parent widget. Use as options:
+ in=master - master relative to which the widget is placed
+ in_=master - see 'in' option description
+ x=amount - locate anchor of this widget at position x of master
+ y=amount - locate anchor of this widget at position y of master
+ relx=amount - locate anchor of this widget between 0.0 and 1.0
+ relative to width of master (1.0 is right edge)
+ rely=amount - locate anchor of this widget between 0.0 and 1.0
+ relative to height of master (1.0 is bottom edge)
+ anchor=NSEW (or subset) - position anchor according to given direction
+ width=amount - width of this widget in pixel
+ height=amount - height of this widget in pixel
+ relwidth=amount - width of this widget between 0.0 and 1.0
+ relative to width of master (1.0 is the same width
+ as the master)
+ relheight=amount - height of this widget between 0.0 and 1.0
+ relative to height of master (1.0 is the same
+ height as the master)
+ bordermode="inside" or "outside" - whether to take border width of
+ master widget into account
+ """
+ self.tk.call(
+ ('place', 'configure', self._w)
+ + self._options(cnf, kw))
+ place = configure = config = place_configure
+ def place_forget(self):
+ """Unmap this widget."""
+ self.tk.call('place', 'forget', self._w)
+ forget = place_forget
+ def place_info(self):
+ """Return information about the placing options
+ for this widget."""
+ d = _splitdict(self.tk, self.tk.call('place', 'info', self._w))
+ if 'in' in d:
+ d['in'] = self.nametowidget(d['in'])
+ return d
+ info = place_info
+ slaves = place_slaves = Misc.place_slaves
+
+class Grid:
+ """Geometry manager Grid.
+
+ Base class to use the methods grid_* in every widget."""
+ # Thanks to Masazumi Yoshikawa (yosikawa@isi.edu)
+ def grid_configure(self, cnf={}, **kw):
+ """Position a widget in the parent widget in a grid. Use as options:
+ column=number - use cell identified with given column (starting with 0)
+ columnspan=number - this widget will span several columns
+ in=master - use master to contain this widget
+ in_=master - see 'in' option description
+ ipadx=amount - add internal padding in x direction
+ ipady=amount - add internal padding in y direction
+ padx=amount - add padding in x direction
+ pady=amount - add padding in y direction
+ row=number - use cell identified with given row (starting with 0)
+ rowspan=number - this widget will span several rows
+ sticky=NSEW - if cell is larger on which sides will this
+ widget stick to the cell boundary
+ """
+ self.tk.call(
+ ('grid', 'configure', self._w)
+ + self._options(cnf, kw))
+ grid = configure = config = grid_configure
+ bbox = grid_bbox = Misc.grid_bbox
+ columnconfigure = grid_columnconfigure = Misc.grid_columnconfigure
+ def grid_forget(self):
+ """Unmap this widget."""
+ self.tk.call('grid', 'forget', self._w)
+ forget = grid_forget
+ def grid_remove(self):
+ """Unmap this widget but remember the grid options."""
+ self.tk.call('grid', 'remove', self._w)
+ def grid_info(self):
+ """Return information about the options
+ for positioning this widget in a grid."""
+ d = _splitdict(self.tk, self.tk.call('grid', 'info', self._w))
+ if 'in' in d:
+ d['in'] = self.nametowidget(d['in'])
+ return d
+ info = grid_info
+ location = grid_location = Misc.grid_location
+ propagate = grid_propagate = Misc.grid_propagate
+ rowconfigure = grid_rowconfigure = Misc.grid_rowconfigure
+ size = grid_size = Misc.grid_size
+ slaves = grid_slaves = Misc.grid_slaves
+
+class BaseWidget(Misc):
+ """Internal class."""
+ def _setup(self, master, cnf):
+ """Internal function. Sets up information about children."""
+ if _support_default_root:
+ global _default_root
+ if not master:
+ if not _default_root:
+ _default_root = Tk()
+ master = _default_root
+ self.master = master
+ self.tk = master.tk
+ name = None
+ if 'name' in cnf:
+ name = cnf['name']
+ del cnf['name']
+ if not name:
+ name = repr(id(self))
+ self._name = name
+ if master._w=='.':
+ self._w = '.' + name
+ else:
+ self._w = master._w + '.' + name
+ self.children = {}
+ if self._name in self.master.children:
+ self.master.children[self._name].destroy()
+ self.master.children[self._name] = self
+ def __init__(self, master, widgetName, cnf={}, kw={}, extra=()):
+ """Construct a widget with the parent widget MASTER, a name WIDGETNAME
+ and appropriate options."""
+ if kw:
+ cnf = _cnfmerge((cnf, kw))
+ self.widgetName = widgetName
+ BaseWidget._setup(self, master, cnf)
+ if self._tclCommands is None:
+ self._tclCommands = []
+ classes = []
+ for k in cnf.keys():
+ if type(k) is ClassType:
+ classes.append((k, cnf[k]))
+ del cnf[k]
+ self.tk.call(
+ (widgetName, self._w) + extra + self._options(cnf))
+ for k, v in classes:
+ k.configure(self, v)
+ def destroy(self):
+ """Destroy this and all descendants widgets."""
+ for c in self.children.values(): c.destroy()
+ self.tk.call('destroy', self._w)
+ if self._name in self.master.children:
+ del self.master.children[self._name]
+ Misc.destroy(self)
+ def _do(self, name, args=()):
+ # XXX Obsolete -- better use self.tk.call directly!
+ return self.tk.call((self._w, name) + args)
+
+class Widget(BaseWidget, Pack, Place, Grid):
+ """Internal class.
+
+ Base class for a widget which can be positioned with the geometry managers
+ Pack, Place or Grid."""
+ pass
+
+class Toplevel(BaseWidget, Wm):
+ """Toplevel widget, e.g. for dialogs."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a toplevel widget with the parent MASTER.
+
+ Valid resource names: background, bd, bg, borderwidth, class,
+ colormap, container, cursor, height, highlightbackground,
+ highlightcolor, highlightthickness, menu, relief, screen, takefocus,
+ use, visual, width."""
+ if kw:
+ cnf = _cnfmerge((cnf, kw))
+ extra = ()
+ for wmkey in ['screen', 'class_', 'class', 'visual',
+ 'colormap']:
+ if wmkey in cnf:
+ val = cnf[wmkey]
+ # TBD: a hack needed because some keys
+ # are not valid as keyword arguments
+ if wmkey[-1] == '_': opt = '-'+wmkey[:-1]
+ else: opt = '-'+wmkey
+ extra = extra + (opt, val)
+ del cnf[wmkey]
+ BaseWidget.__init__(self, master, 'toplevel', cnf, {}, extra)
+ root = self._root()
+ self.iconname(root.iconname())
+ self.title(root.title())
+ self.protocol("WM_DELETE_WINDOW", self.destroy)
+
+class Button(Widget):
+ """Button widget."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a button widget with the parent MASTER.
+
+ STANDARD OPTIONS
+
+ activebackground, activeforeground, anchor,
+ background, bitmap, borderwidth, cursor,
+ disabledforeground, font, foreground
+ highlightbackground, highlightcolor,
+ highlightthickness, image, justify,
+ padx, pady, relief, repeatdelay,
+ repeatinterval, takefocus, text,
+ textvariable, underline, wraplength
+
+ WIDGET-SPECIFIC OPTIONS
+
+ command, compound, default, height,
+ overrelief, state, width
+ """
+ Widget.__init__(self, master, 'button', cnf, kw)
+
+ def tkButtonEnter(self, *dummy):
+ self.tk.call('tkButtonEnter', self._w)
+
+ def tkButtonLeave(self, *dummy):
+ self.tk.call('tkButtonLeave', self._w)
+
+ def tkButtonDown(self, *dummy):
+ self.tk.call('tkButtonDown', self._w)
+
+ def tkButtonUp(self, *dummy):
+ self.tk.call('tkButtonUp', self._w)
+
+ def tkButtonInvoke(self, *dummy):
+ self.tk.call('tkButtonInvoke', self._w)
+
+ def flash(self):
+ """Flash the button.
+
+ This is accomplished by redisplaying
+ the button several times, alternating between active and
+ normal colors. At the end of the flash the button is left
+ in the same normal/active state as when the command was
+ invoked. This command is ignored if the button's state is
+ disabled.
+ """
+ self.tk.call(self._w, 'flash')
+
+ def invoke(self):
+ """Invoke the command associated with the button.
+
+ The return value is the return value from the command,
+ or an empty string if there is no command associated with
+ the button. This command is ignored if the button's state
+ is disabled.
+ """
+ return self.tk.call(self._w, 'invoke')
+
+# Indices:
+# XXX I don't like these -- take them away
+def AtEnd():
+ return 'end'
+def AtInsert(*args):
+ s = 'insert'
+ for a in args:
+ if a: s = s + (' ' + a)
+ return s
+def AtSelFirst():
+ return 'sel.first'
+def AtSelLast():
+ return 'sel.last'
+def At(x, y=None):
+ if y is None:
+ return '@%r' % (x,)
+ else:
+ return '@%r,%r' % (x, y)
+
+class Canvas(Widget, XView, YView):
+ """Canvas widget to display graphical elements like lines or text."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a canvas widget with the parent MASTER.
+
+ Valid resource names: background, bd, bg, borderwidth, closeenough,
+ confine, cursor, height, highlightbackground, highlightcolor,
+ highlightthickness, insertbackground, insertborderwidth,
+ insertofftime, insertontime, insertwidth, offset, relief,
+ scrollregion, selectbackground, selectborderwidth, selectforeground,
+ state, takefocus, width, xscrollcommand, xscrollincrement,
+ yscrollcommand, yscrollincrement."""
+ Widget.__init__(self, master, 'canvas', cnf, kw)
+ def addtag(self, *args):
+ """Internal function."""
+ self.tk.call((self._w, 'addtag') + args)
+ def addtag_above(self, newtag, tagOrId):
+ """Add tag NEWTAG to all items above TAGORID."""
+ self.addtag(newtag, 'above', tagOrId)
+ def addtag_all(self, newtag):
+ """Add tag NEWTAG to all items."""
+ self.addtag(newtag, 'all')
+ def addtag_below(self, newtag, tagOrId):
+ """Add tag NEWTAG to all items below TAGORID."""
+ self.addtag(newtag, 'below', tagOrId)
+ def addtag_closest(self, newtag, x, y, halo=None, start=None):
+ """Add tag NEWTAG to item which is closest to pixel at X, Y.
+ If several match take the top-most.
+ All items closer than HALO are considered overlapping (all are
+ closests). If START is specified the next below this tag is taken."""
+ self.addtag(newtag, 'closest', x, y, halo, start)
+ def addtag_enclosed(self, newtag, x1, y1, x2, y2):
+ """Add tag NEWTAG to all items in the rectangle defined
+ by X1,Y1,X2,Y2."""
+ self.addtag(newtag, 'enclosed', x1, y1, x2, y2)
+ def addtag_overlapping(self, newtag, x1, y1, x2, y2):
+ """Add tag NEWTAG to all items which overlap the rectangle
+ defined by X1,Y1,X2,Y2."""
+ self.addtag(newtag, 'overlapping', x1, y1, x2, y2)
+ def addtag_withtag(self, newtag, tagOrId):
+ """Add tag NEWTAG to all items with TAGORID."""
+ self.addtag(newtag, 'withtag', tagOrId)
+ def bbox(self, *args):
+ """Return a tuple of X1,Y1,X2,Y2 coordinates for a rectangle
+ which encloses all items with tags specified as arguments."""
+ return self._getints(
+ self.tk.call((self._w, 'bbox') + args)) or None
+ def tag_unbind(self, tagOrId, sequence, funcid=None):
+ """Unbind for all items with TAGORID for event SEQUENCE the
+ function identified with FUNCID."""
+ self.tk.call(self._w, 'bind', tagOrId, sequence, '')
+ if funcid:
+ self.deletecommand(funcid)
+ def tag_bind(self, tagOrId, sequence=None, func=None, add=None):
+ """Bind to all items with TAGORID at event SEQUENCE a call to function FUNC.
+
+ An additional boolean parameter ADD specifies whether FUNC will be
+ called additionally to the other bound function or whether it will
+ replace the previous function. See bind for the return value."""
+ return self._bind((self._w, 'bind', tagOrId),
+ sequence, func, add)
+ def canvasx(self, screenx, gridspacing=None):
+ """Return the canvas x coordinate of pixel position SCREENX rounded
+ to nearest multiple of GRIDSPACING units."""
+ return getdouble(self.tk.call(
+ self._w, 'canvasx', screenx, gridspacing))
+ def canvasy(self, screeny, gridspacing=None):
+ """Return the canvas y coordinate of pixel position SCREENY rounded
+ to nearest multiple of GRIDSPACING units."""
+ return getdouble(self.tk.call(
+ self._w, 'canvasy', screeny, gridspacing))
+ def coords(self, *args):
+ """Return a list of coordinates for the item given in ARGS."""
+ # XXX Should use _flatten on args
+ return map(getdouble,
+ self.tk.splitlist(
+ self.tk.call((self._w, 'coords') + args)))
+ def _create(self, itemType, args, kw): # Args: (val, val, ..., cnf={})
+ """Internal function."""
+ args = _flatten(args)
+ cnf = args[-1]
+ if type(cnf) in (DictionaryType, TupleType):
+ args = args[:-1]
+ else:
+ cnf = {}
+ return getint(self.tk.call(
+ self._w, 'create', itemType,
+ *(args + self._options(cnf, kw))))
+ def create_arc(self, *args, **kw):
+ """Create arc shaped region with coordinates x1,y1,x2,y2."""
+ return self._create('arc', args, kw)
+ def create_bitmap(self, *args, **kw):
+ """Create bitmap with coordinates x1,y1."""
+ return self._create('bitmap', args, kw)
+ def create_image(self, *args, **kw):
+ """Create image item with coordinates x1,y1."""
+ return self._create('image', args, kw)
+ def create_line(self, *args, **kw):
+ """Create line with coordinates x1,y1,...,xn,yn."""
+ return self._create('line', args, kw)
+ def create_oval(self, *args, **kw):
+ """Create oval with coordinates x1,y1,x2,y2."""
+ return self._create('oval', args, kw)
+ def create_polygon(self, *args, **kw):
+ """Create polygon with coordinates x1,y1,...,xn,yn."""
+ return self._create('polygon', args, kw)
+ def create_rectangle(self, *args, **kw):
+ """Create rectangle with coordinates x1,y1,x2,y2."""
+ return self._create('rectangle', args, kw)
+ def create_text(self, *args, **kw):
+ """Create text with coordinates x1,y1."""
+ return self._create('text', args, kw)
+ def create_window(self, *args, **kw):
+ """Create window with coordinates x1,y1,x2,y2."""
+ return self._create('window', args, kw)
+ def dchars(self, *args):
+ """Delete characters of text items identified by tag or id in ARGS (possibly
+ several times) from FIRST to LAST character (including)."""
+ self.tk.call((self._w, 'dchars') + args)
+ def delete(self, *args):
+ """Delete items identified by all tag or ids contained in ARGS."""
+ self.tk.call((self._w, 'delete') + args)
+ def dtag(self, *args):
+ """Delete tag or id given as last arguments in ARGS from items
+ identified by first argument in ARGS."""
+ self.tk.call((self._w, 'dtag') + args)
+ def find(self, *args):
+ """Internal function."""
+ return self._getints(
+ self.tk.call((self._w, 'find') + args)) or ()
+ def find_above(self, tagOrId):
+ """Return items above TAGORID."""
+ return self.find('above', tagOrId)
+ def find_all(self):
+ """Return all items."""
+ return self.find('all')
+ def find_below(self, tagOrId):
+ """Return all items below TAGORID."""
+ return self.find('below', tagOrId)
+ def find_closest(self, x, y, halo=None, start=None):
+ """Return item which is closest to pixel at X, Y.
+ If several match take the top-most.
+ All items closer than HALO are considered overlapping (all are
+ closests). If START is specified the next below this tag is taken."""
+ return self.find('closest', x, y, halo, start)
+ def find_enclosed(self, x1, y1, x2, y2):
+ """Return all items in rectangle defined
+ by X1,Y1,X2,Y2."""
+ return self.find('enclosed', x1, y1, x2, y2)
+ def find_overlapping(self, x1, y1, x2, y2):
+ """Return all items which overlap the rectangle
+ defined by X1,Y1,X2,Y2."""
+ return self.find('overlapping', x1, y1, x2, y2)
+ def find_withtag(self, tagOrId):
+ """Return all items with TAGORID."""
+ return self.find('withtag', tagOrId)
+ def focus(self, *args):
+ """Set focus to the first item specified in ARGS."""
+ return self.tk.call((self._w, 'focus') + args)
+ def gettags(self, *args):
+ """Return tags associated with the first item specified in ARGS."""
+ return self.tk.splitlist(
+ self.tk.call((self._w, 'gettags') + args))
+ def icursor(self, *args):
+ """Set cursor at position POS in the item identified by TAGORID.
+ In ARGS TAGORID must be first."""
+ self.tk.call((self._w, 'icursor') + args)
+ def index(self, *args):
+ """Return position of cursor as integer in item specified in ARGS."""
+ return getint(self.tk.call((self._w, 'index') + args))
+ def insert(self, *args):
+ """Insert TEXT in item TAGORID at position POS. ARGS must
+ be TAGORID POS TEXT."""
+ self.tk.call((self._w, 'insert') + args)
+ def itemcget(self, tagOrId, option):
+ """Return the resource value for an OPTION for item TAGORID."""
+ return self.tk.call(
+ (self._w, 'itemcget') + (tagOrId, '-'+option))
+ def itemconfigure(self, tagOrId, cnf=None, **kw):
+ """Configure resources of an item TAGORID.
+
+ The values for resources are specified as keyword
+ arguments. To get an overview about
+ the allowed keyword arguments call the method without arguments.
+ """
+ return self._configure(('itemconfigure', tagOrId), cnf, kw)
+ itemconfig = itemconfigure
+ # lower, tkraise/lift hide Misc.lower, Misc.tkraise/lift,
+ # so the preferred name for them is tag_lower, tag_raise
+ # (similar to tag_bind, and similar to the Text widget);
+ # unfortunately can't delete the old ones yet (maybe in 1.6)
+ def tag_lower(self, *args):
+ """Lower an item TAGORID given in ARGS
+ (optional below another item)."""
+ self.tk.call((self._w, 'lower') + args)
+ lower = tag_lower
+ def move(self, *args):
+ """Move an item TAGORID given in ARGS."""
+ self.tk.call((self._w, 'move') + args)
+ def postscript(self, cnf={}, **kw):
+ """Print the contents of the canvas to a postscript
+ file. Valid options: colormap, colormode, file, fontmap,
+ height, pageanchor, pageheight, pagewidth, pagex, pagey,
+ rotate, witdh, x, y."""
+ return self.tk.call((self._w, 'postscript') +
+ self._options(cnf, kw))
+ def tag_raise(self, *args):
+ """Raise an item TAGORID given in ARGS
+ (optional above another item)."""
+ self.tk.call((self._w, 'raise') + args)
+ lift = tkraise = tag_raise
+ def scale(self, *args):
+ """Scale item TAGORID with XORIGIN, YORIGIN, XSCALE, YSCALE."""
+ self.tk.call((self._w, 'scale') + args)
+ def scan_mark(self, x, y):
+ """Remember the current X, Y coordinates."""
+ self.tk.call(self._w, 'scan', 'mark', x, y)
+ def scan_dragto(self, x, y, gain=10):
+ """Adjust the view of the canvas to GAIN times the
+ difference between X and Y and the coordinates given in
+ scan_mark."""
+ self.tk.call(self._w, 'scan', 'dragto', x, y, gain)
+ def select_adjust(self, tagOrId, index):
+ """Adjust the end of the selection near the cursor of an item TAGORID to index."""
+ self.tk.call(self._w, 'select', 'adjust', tagOrId, index)
+ def select_clear(self):
+ """Clear the selection if it is in this widget."""
+ self.tk.call(self._w, 'select', 'clear')
+ def select_from(self, tagOrId, index):
+ """Set the fixed end of a selection in item TAGORID to INDEX."""
+ self.tk.call(self._w, 'select', 'from', tagOrId, index)
+ def select_item(self):
+ """Return the item which has the selection."""
+ return self.tk.call(self._w, 'select', 'item') or None
+ def select_to(self, tagOrId, index):
+ """Set the variable end of a selection in item TAGORID to INDEX."""
+ self.tk.call(self._w, 'select', 'to', tagOrId, index)
+ def type(self, tagOrId):
+ """Return the type of the item TAGORID."""
+ return self.tk.call(self._w, 'type', tagOrId) or None
+
+class Checkbutton(Widget):
+ """Checkbutton widget which is either in on- or off-state."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a checkbutton widget with the parent MASTER.
+
+ Valid resource names: activebackground, activeforeground, anchor,
+ background, bd, bg, bitmap, borderwidth, command, cursor,
+ disabledforeground, fg, font, foreground, height,
+ highlightbackground, highlightcolor, highlightthickness, image,
+ indicatoron, justify, offvalue, onvalue, padx, pady, relief,
+ selectcolor, selectimage, state, takefocus, text, textvariable,
+ underline, variable, width, wraplength."""
+ Widget.__init__(self, master, 'checkbutton', cnf, kw)
+ def deselect(self):
+ """Put the button in off-state."""
+ self.tk.call(self._w, 'deselect')
+ def flash(self):
+ """Flash the button."""
+ self.tk.call(self._w, 'flash')
+ def invoke(self):
+ """Toggle the button and invoke a command if given as resource."""
+ return self.tk.call(self._w, 'invoke')
+ def select(self):
+ """Put the button in on-state."""
+ self.tk.call(self._w, 'select')
+ def toggle(self):
+ """Toggle the button."""
+ self.tk.call(self._w, 'toggle')
+
+class Entry(Widget, XView):
+ """Entry widget which allows displaying simple text."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct an entry widget with the parent MASTER.
+
+ Valid resource names: background, bd, bg, borderwidth, cursor,
+ exportselection, fg, font, foreground, highlightbackground,
+ highlightcolor, highlightthickness, insertbackground,
+ insertborderwidth, insertofftime, insertontime, insertwidth,
+ invalidcommand, invcmd, justify, relief, selectbackground,
+ selectborderwidth, selectforeground, show, state, takefocus,
+ textvariable, validate, validatecommand, vcmd, width,
+ xscrollcommand."""
+ Widget.__init__(self, master, 'entry', cnf, kw)
+ def delete(self, first, last=None):
+ """Delete text from FIRST to LAST (not included)."""
+ self.tk.call(self._w, 'delete', first, last)
+ def get(self):
+ """Return the text."""
+ return self.tk.call(self._w, 'get')
+ def icursor(self, index):
+ """Insert cursor at INDEX."""
+ self.tk.call(self._w, 'icursor', index)
+ def index(self, index):
+ """Return position of cursor."""
+ return getint(self.tk.call(
+ self._w, 'index', index))
+ def insert(self, index, string):
+ """Insert STRING at INDEX."""
+ self.tk.call(self._w, 'insert', index, string)
+ def scan_mark(self, x):
+ """Remember the current X, Y coordinates."""
+ self.tk.call(self._w, 'scan', 'mark', x)
+ def scan_dragto(self, x):
+ """Adjust the view of the canvas to 10 times the
+ difference between X and Y and the coordinates given in
+ scan_mark."""
+ self.tk.call(self._w, 'scan', 'dragto', x)
+ def selection_adjust(self, index):
+ """Adjust the end of the selection near the cursor to INDEX."""
+ self.tk.call(self._w, 'selection', 'adjust', index)
+ select_adjust = selection_adjust
+ def selection_clear(self):
+ """Clear the selection if it is in this widget."""
+ self.tk.call(self._w, 'selection', 'clear')
+ select_clear = selection_clear
+ def selection_from(self, index):
+ """Set the fixed end of a selection to INDEX."""
+ self.tk.call(self._w, 'selection', 'from', index)
+ select_from = selection_from
+ def selection_present(self):
+ """Return True if there are characters selected in the entry, False
+ otherwise."""
+ return self.tk.getboolean(
+ self.tk.call(self._w, 'selection', 'present'))
+ select_present = selection_present
+ def selection_range(self, start, end):
+ """Set the selection from START to END (not included)."""
+ self.tk.call(self._w, 'selection', 'range', start, end)
+ select_range = selection_range
+ def selection_to(self, index):
+ """Set the variable end of a selection to INDEX."""
+ self.tk.call(self._w, 'selection', 'to', index)
+ select_to = selection_to
+
+class Frame(Widget):
+ """Frame widget which may contain other widgets and can have a 3D border."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a frame widget with the parent MASTER.
+
+ Valid resource names: background, bd, bg, borderwidth, class,
+ colormap, container, cursor, height, highlightbackground,
+ highlightcolor, highlightthickness, relief, takefocus, visual, width."""
+ cnf = _cnfmerge((cnf, kw))
+ extra = ()
+ if 'class_' in cnf:
+ extra = ('-class', cnf['class_'])
+ del cnf['class_']
+ elif 'class' in cnf:
+ extra = ('-class', cnf['class'])
+ del cnf['class']
+ Widget.__init__(self, master, 'frame', cnf, {}, extra)
+
+class Label(Widget):
+ """Label widget which can display text and bitmaps."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a label widget with the parent MASTER.
+
+ STANDARD OPTIONS
+
+ activebackground, activeforeground, anchor,
+ background, bitmap, borderwidth, cursor,
+ disabledforeground, font, foreground,
+ highlightbackground, highlightcolor,
+ highlightthickness, image, justify,
+ padx, pady, relief, takefocus, text,
+ textvariable, underline, wraplength
+
+ WIDGET-SPECIFIC OPTIONS
+
+ height, state, width
+
+ """
+ Widget.__init__(self, master, 'label', cnf, kw)
+
+class Listbox(Widget, XView, YView):
+ """Listbox widget which can display a list of strings."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a listbox widget with the parent MASTER.
+
+ Valid resource names: background, bd, bg, borderwidth, cursor,
+ exportselection, fg, font, foreground, height, highlightbackground,
+ highlightcolor, highlightthickness, relief, selectbackground,
+ selectborderwidth, selectforeground, selectmode, setgrid, takefocus,
+ width, xscrollcommand, yscrollcommand, listvariable."""
+ Widget.__init__(self, master, 'listbox', cnf, kw)
+ def activate(self, index):
+ """Activate item identified by INDEX."""
+ self.tk.call(self._w, 'activate', index)
+ def bbox(self, index):
+ """Return a tuple of X1,Y1,X2,Y2 coordinates for a rectangle
+ which encloses the item identified by the given index."""
+ return self._getints(self.tk.call(self._w, 'bbox', index)) or None
+ def curselection(self):
+ """Return the indices of currently selected item."""
+ return self._getints(self.tk.call(self._w, 'curselection')) or ()
+ def delete(self, first, last=None):
+ """Delete items from FIRST to LAST (included)."""
+ self.tk.call(self._w, 'delete', first, last)
+ def get(self, first, last=None):
+ """Get list of items from FIRST to LAST (included)."""
+ if last is not None:
+ return self.tk.splitlist(self.tk.call(
+ self._w, 'get', first, last))
+ else:
+ return self.tk.call(self._w, 'get', first)
+ def index(self, index):
+ """Return index of item identified with INDEX."""
+ i = self.tk.call(self._w, 'index', index)
+ if i == 'none': return None
+ return getint(i)
+ def insert(self, index, *elements):
+ """Insert ELEMENTS at INDEX."""
+ self.tk.call((self._w, 'insert', index) + elements)
+ def nearest(self, y):
+ """Get index of item which is nearest to y coordinate Y."""
+ return getint(self.tk.call(
+ self._w, 'nearest', y))
+ def scan_mark(self, x, y):
+ """Remember the current X, Y coordinates."""
+ self.tk.call(self._w, 'scan', 'mark', x, y)
+ def scan_dragto(self, x, y):
+ """Adjust the view of the listbox to 10 times the
+ difference between X and Y and the coordinates given in
+ scan_mark."""
+ self.tk.call(self._w, 'scan', 'dragto', x, y)
+ def see(self, index):
+ """Scroll such that INDEX is visible."""
+ self.tk.call(self._w, 'see', index)
+ def selection_anchor(self, index):
+ """Set the fixed end oft the selection to INDEX."""
+ self.tk.call(self._w, 'selection', 'anchor', index)
+ select_anchor = selection_anchor
+ def selection_clear(self, first, last=None):
+ """Clear the selection from FIRST to LAST (included)."""
+ self.tk.call(self._w,
+ 'selection', 'clear', first, last)
+ select_clear = selection_clear
+ def selection_includes(self, index):
+ """Return 1 if INDEX is part of the selection."""
+ return self.tk.getboolean(self.tk.call(
+ self._w, 'selection', 'includes', index))
+ select_includes = selection_includes
+ def selection_set(self, first, last=None):
+ """Set the selection from FIRST to LAST (included) without
+ changing the currently selected elements."""
+ self.tk.call(self._w, 'selection', 'set', first, last)
+ select_set = selection_set
+ def size(self):
+ """Return the number of elements in the listbox."""
+ return getint(self.tk.call(self._w, 'size'))
+ def itemcget(self, index, option):
+ """Return the resource value for an ITEM and an OPTION."""
+ return self.tk.call(
+ (self._w, 'itemcget') + (index, '-'+option))
+ def itemconfigure(self, index, cnf=None, **kw):
+ """Configure resources of an ITEM.
+
+ The values for resources are specified as keyword arguments.
+ To get an overview about the allowed keyword arguments
+ call the method without arguments.
+ Valid resource names: background, bg, foreground, fg,
+ selectbackground, selectforeground."""
+ return self._configure(('itemconfigure', index), cnf, kw)
+ itemconfig = itemconfigure
+
+class Menu(Widget):
+ """Menu widget which allows displaying menu bars, pull-down menus and pop-up menus."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct menu widget with the parent MASTER.
+
+ Valid resource names: activebackground, activeborderwidth,
+ activeforeground, background, bd, bg, borderwidth, cursor,
+ disabledforeground, fg, font, foreground, postcommand, relief,
+ selectcolor, takefocus, tearoff, tearoffcommand, title, type."""
+ Widget.__init__(self, master, 'menu', cnf, kw)
+ def tk_bindForTraversal(self):
+ # obsolete since Tk 4.0
+ import warnings
+ warnings.warn('tk_bindForTraversal() does nothing and '
+ 'will be removed in 3.6',
+ DeprecationWarning, stacklevel=2)
+ def tk_mbPost(self):
+ self.tk.call('tk_mbPost', self._w)
+ def tk_mbUnpost(self):
+ self.tk.call('tk_mbUnpost')
+ def tk_traverseToMenu(self, char):
+ self.tk.call('tk_traverseToMenu', self._w, char)
+ def tk_traverseWithinMenu(self, char):
+ self.tk.call('tk_traverseWithinMenu', self._w, char)
+ def tk_getMenuButtons(self):
+ return self.tk.call('tk_getMenuButtons', self._w)
+ def tk_nextMenu(self, count):
+ self.tk.call('tk_nextMenu', count)
+ def tk_nextMenuEntry(self, count):
+ self.tk.call('tk_nextMenuEntry', count)
+ def tk_invokeMenu(self):
+ self.tk.call('tk_invokeMenu', self._w)
+ def tk_firstMenu(self):
+ self.tk.call('tk_firstMenu', self._w)
+ def tk_mbButtonDown(self):
+ self.tk.call('tk_mbButtonDown', self._w)
+ def tk_popup(self, x, y, entry=""):
+ """Post the menu at position X,Y with entry ENTRY."""
+ self.tk.call('tk_popup', self._w, x, y, entry)
+ def activate(self, index):
+ """Activate entry at INDEX."""
+ self.tk.call(self._w, 'activate', index)
+ def add(self, itemType, cnf={}, **kw):
+ """Internal function."""
+ self.tk.call((self._w, 'add', itemType) +
+ self._options(cnf, kw))
+ def add_cascade(self, cnf={}, **kw):
+ """Add hierarchical menu item."""
+ self.add('cascade', cnf or kw)
+ def add_checkbutton(self, cnf={}, **kw):
+ """Add checkbutton menu item."""
+ self.add('checkbutton', cnf or kw)
+ def add_command(self, cnf={}, **kw):
+ """Add command menu item."""
+ self.add('command', cnf or kw)
+ def add_radiobutton(self, cnf={}, **kw):
+ """Addd radio menu item."""
+ self.add('radiobutton', cnf or kw)
+ def add_separator(self, cnf={}, **kw):
+ """Add separator."""
+ self.add('separator', cnf or kw)
+ def insert(self, index, itemType, cnf={}, **kw):
+ """Internal function."""
+ self.tk.call((self._w, 'insert', index, itemType) +
+ self._options(cnf, kw))
+ def insert_cascade(self, index, cnf={}, **kw):
+ """Add hierarchical menu item at INDEX."""
+ self.insert(index, 'cascade', cnf or kw)
+ def insert_checkbutton(self, index, cnf={}, **kw):
+ """Add checkbutton menu item at INDEX."""
+ self.insert(index, 'checkbutton', cnf or kw)
+ def insert_command(self, index, cnf={}, **kw):
+ """Add command menu item at INDEX."""
+ self.insert(index, 'command', cnf or kw)
+ def insert_radiobutton(self, index, cnf={}, **kw):
+ """Addd radio menu item at INDEX."""
+ self.insert(index, 'radiobutton', cnf or kw)
+ def insert_separator(self, index, cnf={}, **kw):
+ """Add separator at INDEX."""
+ self.insert(index, 'separator', cnf or kw)
+ def delete(self, index1, index2=None):
+ """Delete menu items between INDEX1 and INDEX2 (included)."""
+ if index2 is None:
+ index2 = index1
+
+ num_index1, num_index2 = self.index(index1), self.index(index2)
+ if (num_index1 is None) or (num_index2 is None):
+ num_index1, num_index2 = 0, -1
+
+ for i in range(num_index1, num_index2 + 1):
+ if 'command' in self.entryconfig(i):
+ c = str(self.entrycget(i, 'command'))
+ if c:
+ self.deletecommand(c)
+ self.tk.call(self._w, 'delete', index1, index2)
+ def entrycget(self, index, option):
+ """Return the resource value of a menu item for OPTION at INDEX."""
+ return self.tk.call(self._w, 'entrycget', index, '-' + option)
+ def entryconfigure(self, index, cnf=None, **kw):
+ """Configure a menu item at INDEX."""
+ return self._configure(('entryconfigure', index), cnf, kw)
+ entryconfig = entryconfigure
+ def index(self, index):
+ """Return the index of a menu item identified by INDEX."""
+ i = self.tk.call(self._w, 'index', index)
+ if i == 'none': return None
+ return getint(i)
+ def invoke(self, index):
+ """Invoke a menu item identified by INDEX and execute
+ the associated command."""
+ return self.tk.call(self._w, 'invoke', index)
+ def post(self, x, y):
+ """Display a menu at position X,Y."""
+ self.tk.call(self._w, 'post', x, y)
+ def type(self, index):
+ """Return the type of the menu item at INDEX."""
+ return self.tk.call(self._w, 'type', index)
+ def unpost(self):
+ """Unmap a menu."""
+ self.tk.call(self._w, 'unpost')
+ def yposition(self, index):
+ """Return the y-position of the topmost pixel of the menu item at INDEX."""
+ return getint(self.tk.call(
+ self._w, 'yposition', index))
+
+class Menubutton(Widget):
+ """Menubutton widget, obsolete since Tk8.0."""
+ def __init__(self, master=None, cnf={}, **kw):
+ Widget.__init__(self, master, 'menubutton', cnf, kw)
+
+class Message(Widget):
+ """Message widget to display multiline text. Obsolete since Label does it too."""
+ def __init__(self, master=None, cnf={}, **kw):
+ Widget.__init__(self, master, 'message', cnf, kw)
+
+class Radiobutton(Widget):
+ """Radiobutton widget which shows only one of several buttons in on-state."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a radiobutton widget with the parent MASTER.
+
+ Valid resource names: activebackground, activeforeground, anchor,
+ background, bd, bg, bitmap, borderwidth, command, cursor,
+ disabledforeground, fg, font, foreground, height,
+ highlightbackground, highlightcolor, highlightthickness, image,
+ indicatoron, justify, padx, pady, relief, selectcolor, selectimage,
+ state, takefocus, text, textvariable, underline, value, variable,
+ width, wraplength."""
+ Widget.__init__(self, master, 'radiobutton', cnf, kw)
+ def deselect(self):
+ """Put the button in off-state."""
+
+ self.tk.call(self._w, 'deselect')
+ def flash(self):
+ """Flash the button."""
+ self.tk.call(self._w, 'flash')
+ def invoke(self):
+ """Toggle the button and invoke a command if given as resource."""
+ return self.tk.call(self._w, 'invoke')
+ def select(self):
+ """Put the button in on-state."""
+ self.tk.call(self._w, 'select')
+
+class Scale(Widget):
+ """Scale widget which can display a numerical scale."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a scale widget with the parent MASTER.
+
+ Valid resource names: activebackground, background, bigincrement, bd,
+ bg, borderwidth, command, cursor, digits, fg, font, foreground, from,
+ highlightbackground, highlightcolor, highlightthickness, label,
+ length, orient, relief, repeatdelay, repeatinterval, resolution,
+ showvalue, sliderlength, sliderrelief, state, takefocus,
+ tickinterval, to, troughcolor, variable, width."""
+ Widget.__init__(self, master, 'scale', cnf, kw)
+ def get(self):
+ """Get the current value as integer or float."""
+ value = self.tk.call(self._w, 'get')
+ try:
+ return getint(value)
+ except ValueError:
+ return getdouble(value)
+ def set(self, value):
+ """Set the value to VALUE."""
+ self.tk.call(self._w, 'set', value)
+ def coords(self, value=None):
+ """Return a tuple (X,Y) of the point along the centerline of the
+ trough that corresponds to VALUE or the current value if None is
+ given."""
+
+ return self._getints(self.tk.call(self._w, 'coords', value))
+ def identify(self, x, y):
+ """Return where the point X,Y lies. Valid return values are "slider",
+ "though1" and "though2"."""
+ return self.tk.call(self._w, 'identify', x, y)
+
+class Scrollbar(Widget):
+ """Scrollbar widget which displays a slider at a certain position."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a scrollbar widget with the parent MASTER.
+
+ Valid resource names: activebackground, activerelief,
+ background, bd, bg, borderwidth, command, cursor,
+ elementborderwidth, highlightbackground,
+ highlightcolor, highlightthickness, jump, orient,
+ relief, repeatdelay, repeatinterval, takefocus,
+ troughcolor, width."""
+ Widget.__init__(self, master, 'scrollbar', cnf, kw)
+ def activate(self, index):
+ """Display the element at INDEX with activebackground and activerelief.
+ INDEX can be "arrow1","slider" or "arrow2"."""
+ self.tk.call(self._w, 'activate', index)
+ def delta(self, deltax, deltay):
+ """Return the fractional change of the scrollbar setting if it
+ would be moved by DELTAX or DELTAY pixels."""
+ return getdouble(
+ self.tk.call(self._w, 'delta', deltax, deltay))
+ def fraction(self, x, y):
+ """Return the fractional value which corresponds to a slider
+ position of X,Y."""
+ return getdouble(self.tk.call(self._w, 'fraction', x, y))
+ def identify(self, x, y):
+ """Return the element under position X,Y as one of
+ "arrow1","slider","arrow2" or ""."""
+ return self.tk.call(self._w, 'identify', x, y)
+ def get(self):
+ """Return the current fractional values (upper and lower end)
+ of the slider position."""
+ return self._getdoubles(self.tk.call(self._w, 'get'))
+ def set(self, *args):
+ """Set the fractional values of the slider position (upper and
+ lower ends as value between 0 and 1)."""
+ self.tk.call((self._w, 'set') + args)
+
+
+
+class Text(Widget, XView, YView):
+ """Text widget which can display text in various forms."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a text widget with the parent MASTER.
+
+ STANDARD OPTIONS
+
+ background, borderwidth, cursor,
+ exportselection, font, foreground,
+ highlightbackground, highlightcolor,
+ highlightthickness, insertbackground,
+ insertborderwidth, insertofftime,
+ insertontime, insertwidth, padx, pady,
+ relief, selectbackground,
+ selectborderwidth, selectforeground,
+ setgrid, takefocus,
+ xscrollcommand, yscrollcommand,
+
+ WIDGET-SPECIFIC OPTIONS
+
+ autoseparators, height, maxundo,
+ spacing1, spacing2, spacing3,
+ state, tabs, undo, width, wrap,
+
+ """
+ Widget.__init__(self, master, 'text', cnf, kw)
+ def bbox(self, *args):
+ """Return a tuple of (x,y,width,height) which gives the bounding
+ box of the visible part of the character at the index in ARGS."""
+ return self._getints(
+ self.tk.call((self._w, 'bbox') + args)) or None
+ def tk_textSelectTo(self, index):
+ self.tk.call('tk_textSelectTo', self._w, index)
+ def tk_textBackspace(self):
+ self.tk.call('tk_textBackspace', self._w)
+ def tk_textIndexCloser(self, a, b, c):
+ self.tk.call('tk_textIndexCloser', self._w, a, b, c)
+ def tk_textResetAnchor(self, index):
+ self.tk.call('tk_textResetAnchor', self._w, index)
+ def compare(self, index1, op, index2):
+ """Return whether between index INDEX1 and index INDEX2 the
+ relation OP is satisfied. OP is one of <, <=, ==, >=, >, or !=."""
+ return self.tk.getboolean(self.tk.call(
+ self._w, 'compare', index1, op, index2))
+ def debug(self, boolean=None):
+ """Turn on the internal consistency checks of the B-Tree inside the text
+ widget according to BOOLEAN."""
+ if boolean is None:
+ return self.tk.getboolean(self.tk.call(self._w, 'debug'))
+ self.tk.call(self._w, 'debug', boolean)
+ def delete(self, index1, index2=None):
+ """Delete the characters between INDEX1 and INDEX2 (not included)."""
+ self.tk.call(self._w, 'delete', index1, index2)
+ def dlineinfo(self, index):
+ """Return tuple (x,y,width,height,baseline) giving the bounding box
+ and baseline position of the visible part of the line containing
+ the character at INDEX."""
+ return self._getints(self.tk.call(self._w, 'dlineinfo', index))
+ def dump(self, index1, index2=None, command=None, **kw):
+ """Return the contents of the widget between index1 and index2.
+
+ The type of contents returned in filtered based on the keyword
+ parameters; if 'all', 'image', 'mark', 'tag', 'text', or 'window' are
+ given and true, then the corresponding items are returned. The result
+ is a list of triples of the form (key, value, index). If none of the
+ keywords are true then 'all' is used by default.
+
+ If the 'command' argument is given, it is called once for each element
+ of the list of triples, with the values of each triple serving as the
+ arguments to the function. In this case the list is not returned."""
+ args = []
+ func_name = None
+ result = None
+ if not command:
+ # Never call the dump command without the -command flag, since the
+ # output could involve Tcl quoting and would be a pain to parse
+ # right. Instead just set the command to build a list of triples
+ # as if we had done the parsing.
+ result = []
+ def append_triple(key, value, index, result=result):
+ result.append((key, value, index))
+ command = append_triple
+ try:
+ if not isinstance(command, str):
+ func_name = command = self._register(command)
+ args += ["-command", command]
+ for key in kw:
+ if kw[key]: args.append("-" + key)
+ args.append(index1)
+ if index2:
+ args.append(index2)
+ self.tk.call(self._w, "dump", *args)
+ return result
+ finally:
+ if func_name:
+ self.deletecommand(func_name)
+
+ ## new in tk8.4
+ def edit(self, *args):
+ """Internal method
+
+ This method controls the undo mechanism and
+ the modified flag. The exact behavior of the
+ command depends on the option argument that
+ follows the edit argument. The following forms
+ of the command are currently supported:
+
+ edit_modified, edit_redo, edit_reset, edit_separator
+ and edit_undo
+
+ """
+ return self.tk.call(self._w, 'edit', *args)
+
+ def edit_modified(self, arg=None):
+ """Get or Set the modified flag
+
+ If arg is not specified, returns the modified
+ flag of the widget. The insert, delete, edit undo and
+ edit redo commands or the user can set or clear the
+ modified flag. If boolean is specified, sets the
+ modified flag of the widget to arg.
+ """
+ return self.edit("modified", arg)
+
+ def edit_redo(self):
+ """Redo the last undone edit
+
+ When the undo option is true, reapplies the last
+ undone edits provided no other edits were done since
+ then. Generates an error when the redo stack is empty.
+ Does nothing when the undo option is false.
+ """
+ return self.edit("redo")
+
+ def edit_reset(self):
+ """Clears the undo and redo stacks
+ """
+ return self.edit("reset")
+
+ def edit_separator(self):
+ """Inserts a separator (boundary) on the undo stack.
+
+ Does nothing when the undo option is false
+ """
+ return self.edit("separator")
+
+ def edit_undo(self):
+ """Undoes the last edit action
+
+ If the undo option is true. An edit action is defined
+ as all the insert and delete commands that are recorded
+ on the undo stack in between two separators. Generates
+ an error when the undo stack is empty. Does nothing
+ when the undo option is false
+ """
+ return self.edit("undo")
+
+ def get(self, index1, index2=None):
+ """Return the text from INDEX1 to INDEX2 (not included)."""
+ return self.tk.call(self._w, 'get', index1, index2)
+ # (Image commands are new in 8.0)
+ def image_cget(self, index, option):
+ """Return the value of OPTION of an embedded image at INDEX."""
+ if option[:1] != "-":
+ option = "-" + option
+ if option[-1:] == "_":
+ option = option[:-1]
+ return self.tk.call(self._w, "image", "cget", index, option)
+ def image_configure(self, index, cnf=None, **kw):
+ """Configure an embedded image at INDEX."""
+ return self._configure(('image', 'configure', index), cnf, kw)
+ def image_create(self, index, cnf={}, **kw):
+ """Create an embedded image at INDEX."""
+ return self.tk.call(
+ self._w, "image", "create", index,
+ *self._options(cnf, kw))
+ def image_names(self):
+ """Return all names of embedded images in this widget."""
+ return self.tk.call(self._w, "image", "names")
+ def index(self, index):
+ """Return the index in the form line.char for INDEX."""
+ return str(self.tk.call(self._w, 'index', index))
+ def insert(self, index, chars, *args):
+ """Insert CHARS before the characters at INDEX. An additional
+ tag can be given in ARGS. Additional CHARS and tags can follow in ARGS."""
+ self.tk.call((self._w, 'insert', index, chars) + args)
+ def mark_gravity(self, markName, direction=None):
+ """Change the gravity of a mark MARKNAME to DIRECTION (LEFT or RIGHT).
+ Return the current value if None is given for DIRECTION."""
+ return self.tk.call(
+ (self._w, 'mark', 'gravity', markName, direction))
+ def mark_names(self):
+ """Return all mark names."""
+ return self.tk.splitlist(self.tk.call(
+ self._w, 'mark', 'names'))
+ def mark_set(self, markName, index):
+ """Set mark MARKNAME before the character at INDEX."""
+ self.tk.call(self._w, 'mark', 'set', markName, index)
+ def mark_unset(self, *markNames):
+ """Delete all marks in MARKNAMES."""
+ self.tk.call((self._w, 'mark', 'unset') + markNames)
+ def mark_next(self, index):
+ """Return the name of the next mark after INDEX."""
+ return self.tk.call(self._w, 'mark', 'next', index) or None
+ def mark_previous(self, index):
+ """Return the name of the previous mark before INDEX."""
+ return self.tk.call(self._w, 'mark', 'previous', index) or None
+ def scan_mark(self, x, y):
+ """Remember the current X, Y coordinates."""
+ self.tk.call(self._w, 'scan', 'mark', x, y)
+ def scan_dragto(self, x, y):
+ """Adjust the view of the text to 10 times the
+ difference between X and Y and the coordinates given in
+ scan_mark."""
+ self.tk.call(self._w, 'scan', 'dragto', x, y)
+ def search(self, pattern, index, stopindex=None,
+ forwards=None, backwards=None, exact=None,
+ regexp=None, nocase=None, count=None, elide=None):
+ """Search PATTERN beginning from INDEX until STOPINDEX.
+ Return the index of the first character of a match or an
+ empty string."""
+ args = [self._w, 'search']
+ if forwards: args.append('-forwards')
+ if backwards: args.append('-backwards')
+ if exact: args.append('-exact')
+ if regexp: args.append('-regexp')
+ if nocase: args.append('-nocase')
+ if elide: args.append('-elide')
+ if count: args.append('-count'); args.append(count)
+ if pattern and pattern[0] == '-': args.append('--')
+ args.append(pattern)
+ args.append(index)
+ if stopindex: args.append(stopindex)
+ return str(self.tk.call(tuple(args)))
+ def see(self, index):
+ """Scroll such that the character at INDEX is visible."""
+ self.tk.call(self._w, 'see', index)
+ def tag_add(self, tagName, index1, *args):
+ """Add tag TAGNAME to all characters between INDEX1 and index2 in ARGS.
+ Additional pairs of indices may follow in ARGS."""
+ self.tk.call(
+ (self._w, 'tag', 'add', tagName, index1) + args)
+ def tag_unbind(self, tagName, sequence, funcid=None):
+ """Unbind for all characters with TAGNAME for event SEQUENCE the
+ function identified with FUNCID."""
+ self.tk.call(self._w, 'tag', 'bind', tagName, sequence, '')
+ if funcid:
+ self.deletecommand(funcid)
+ def tag_bind(self, tagName, sequence, func, add=None):
+ """Bind to all characters with TAGNAME at event SEQUENCE a call to function FUNC.
+
+ An additional boolean parameter ADD specifies whether FUNC will be
+ called additionally to the other bound function or whether it will
+ replace the previous function. See bind for the return value."""
+ return self._bind((self._w, 'tag', 'bind', tagName),
+ sequence, func, add)
+ def tag_cget(self, tagName, option):
+ """Return the value of OPTION for tag TAGNAME."""
+ if option[:1] != '-':
+ option = '-' + option
+ if option[-1:] == '_':
+ option = option[:-1]
+ return self.tk.call(self._w, 'tag', 'cget', tagName, option)
+ def tag_configure(self, tagName, cnf=None, **kw):
+ """Configure a tag TAGNAME."""
+ return self._configure(('tag', 'configure', tagName), cnf, kw)
+ tag_config = tag_configure
+ def tag_delete(self, *tagNames):
+ """Delete all tags in TAGNAMES."""
+ self.tk.call((self._w, 'tag', 'delete') + tagNames)
+ def tag_lower(self, tagName, belowThis=None):
+ """Change the priority of tag TAGNAME such that it is lower
+ than the priority of BELOWTHIS."""
+ self.tk.call(self._w, 'tag', 'lower', tagName, belowThis)
+ def tag_names(self, index=None):
+ """Return a list of all tag names."""
+ return self.tk.splitlist(
+ self.tk.call(self._w, 'tag', 'names', index))
+ def tag_nextrange(self, tagName, index1, index2=None):
+ """Return a list of start and end index for the first sequence of
+ characters between INDEX1 and INDEX2 which all have tag TAGNAME.
+ The text is searched forward from INDEX1."""
+ return self.tk.splitlist(self.tk.call(
+ self._w, 'tag', 'nextrange', tagName, index1, index2))
+ def tag_prevrange(self, tagName, index1, index2=None):
+ """Return a list of start and end index for the first sequence of
+ characters between INDEX1 and INDEX2 which all have tag TAGNAME.
+ The text is searched backwards from INDEX1."""
+ return self.tk.splitlist(self.tk.call(
+ self._w, 'tag', 'prevrange', tagName, index1, index2))
+ def tag_raise(self, tagName, aboveThis=None):
+ """Change the priority of tag TAGNAME such that it is higher
+ than the priority of ABOVETHIS."""
+ self.tk.call(
+ self._w, 'tag', 'raise', tagName, aboveThis)
+ def tag_ranges(self, tagName):
+ """Return a list of ranges of text which have tag TAGNAME."""
+ return self.tk.splitlist(self.tk.call(
+ self._w, 'tag', 'ranges', tagName))
+ def tag_remove(self, tagName, index1, index2=None):
+ """Remove tag TAGNAME from all characters between INDEX1 and INDEX2."""
+ self.tk.call(
+ self._w, 'tag', 'remove', tagName, index1, index2)
+ def window_cget(self, index, option):
+ """Return the value of OPTION of an embedded window at INDEX."""
+ if option[:1] != '-':
+ option = '-' + option
+ if option[-1:] == '_':
+ option = option[:-1]
+ return self.tk.call(self._w, 'window', 'cget', index, option)
+ def window_configure(self, index, cnf=None, **kw):
+ """Configure an embedded window at INDEX."""
+ return self._configure(('window', 'configure', index), cnf, kw)
+ window_config = window_configure
+ def window_create(self, index, cnf={}, **kw):
+ """Create a window at INDEX."""
+ self.tk.call(
+ (self._w, 'window', 'create', index)
+ + self._options(cnf, kw))
+ def window_names(self):
+ """Return all names of embedded windows in this widget."""
+ return self.tk.splitlist(
+ self.tk.call(self._w, 'window', 'names'))
+ def yview_pickplace(self, *what):
+ """Obsolete function, use see."""
+ self.tk.call((self._w, 'yview', '-pickplace') + what)
+
+
+class _setit:
+ """Internal class. It wraps the command in the widget OptionMenu."""
+ def __init__(self, var, value, callback=None):
+ self.__value = value
+ self.__var = var
+ self.__callback = callback
+ def __call__(self, *args):
+ self.__var.set(self.__value)
+ if self.__callback:
+ self.__callback(self.__value, *args)
+
+class OptionMenu(Menubutton):
+ """OptionMenu which allows the user to select a value from a menu."""
+ def __init__(self, master, variable, value, *values, **kwargs):
+ """Construct an optionmenu widget with the parent MASTER, with
+ the resource textvariable set to VARIABLE, the initially selected
+ value VALUE, the other menu values VALUES and an additional
+ keyword argument command."""
+ kw = {"borderwidth": 2, "textvariable": variable,
+ "indicatoron": 1, "relief": RAISED, "anchor": "c",
+ "highlightthickness": 2}
+ Widget.__init__(self, master, "menubutton", kw)
+ self.widgetName = 'tk_optionMenu'
+ menu = self.__menu = Menu(self, name="menu", tearoff=0)
+ self.menuname = menu._w
+ # 'command' is the only supported keyword
+ callback = kwargs.get('command')
+ if 'command' in kwargs:
+ del kwargs['command']
+ if kwargs:
+ raise TclError, 'unknown option -'+kwargs.keys()[0]
+ menu.add_command(label=value,
+ command=_setit(variable, value, callback))
+ for v in values:
+ menu.add_command(label=v,
+ command=_setit(variable, v, callback))
+ self["menu"] = menu
+
+ def __getitem__(self, name):
+ if name == 'menu':
+ return self.__menu
+ return Widget.__getitem__(self, name)
+
+ def destroy(self):
+ """Destroy this widget and the associated menu."""
+ Menubutton.destroy(self)
+ self.__menu = None
+
+class Image:
+ """Base class for images."""
+ _last_id = 0
+ def __init__(self, imgtype, name=None, cnf={}, master=None, **kw):
+ self.name = None
+ if not master:
+ master = _default_root
+ if not master:
+ raise RuntimeError, 'Too early to create image'
+ self.tk = getattr(master, 'tk', master)
+ if not name:
+ Image._last_id += 1
+ name = "pyimage%r" % (Image._last_id,) # tk itself would use image<x>
+ # The following is needed for systems where id(x)
+ # can return a negative number, such as Linux/m68k:
+ if name[0] == '-': name = '_' + name[1:]
+ if kw and cnf: cnf = _cnfmerge((cnf, kw))
+ elif kw: cnf = kw
+ options = ()
+ for k, v in cnf.items():
+ if hasattr(v, '__call__'):
+ v = self._register(v)
+ elif k in ('data', 'maskdata'):
+ v = self.tk._createbytearray(v)
+ options = options + ('-'+k, v)
+ self.tk.call(('image', 'create', imgtype, name,) + options)
+ self.name = name
+ def __str__(self): return self.name
+ def __del__(self):
+ if self.name:
+ try:
+ self.tk.call('image', 'delete', self.name)
+ except TclError:
+ # May happen if the root was destroyed
+ pass
+ def __setitem__(self, key, value):
+ self.tk.call(self.name, 'configure', '-'+key, value)
+ def __getitem__(self, key):
+ return self.tk.call(self.name, 'configure', '-'+key)
+ def configure(self, **kw):
+ """Configure the image."""
+ res = ()
+ for k, v in _cnfmerge(kw).items():
+ if v is not None:
+ if k[-1] == '_': k = k[:-1]
+ if hasattr(v, '__call__'):
+ v = self._register(v)
+ elif k in ('data', 'maskdata'):
+ v = self.tk._createbytearray(v)
+ res = res + ('-'+k, v)
+ self.tk.call((self.name, 'config') + res)
+ config = configure
+ def height(self):
+ """Return the height of the image."""
+ return getint(
+ self.tk.call('image', 'height', self.name))
+ def type(self):
+ """Return the type of the imgage, e.g. "photo" or "bitmap"."""
+ return self.tk.call('image', 'type', self.name)
+ def width(self):
+ """Return the width of the image."""
+ return getint(
+ self.tk.call('image', 'width', self.name))
+
+class PhotoImage(Image):
+ """Widget which can display colored images in GIF, PPM/PGM format."""
+ def __init__(self, name=None, cnf={}, master=None, **kw):
+ """Create an image with NAME.
+
+ Valid resource names: data, format, file, gamma, height, palette,
+ width."""
+ Image.__init__(self, 'photo', name, cnf, master, **kw)
+ def blank(self):
+ """Display a transparent image."""
+ self.tk.call(self.name, 'blank')
+ def cget(self, option):
+ """Return the value of OPTION."""
+ return self.tk.call(self.name, 'cget', '-' + option)
+ # XXX config
+ def __getitem__(self, key):
+ return self.tk.call(self.name, 'cget', '-' + key)
+ # XXX copy -from, -to, ...?
+ def copy(self):
+ """Return a new PhotoImage with the same image as this widget."""
+ destImage = PhotoImage(master=self.tk)
+ self.tk.call(destImage, 'copy', self.name)
+ return destImage
+ def zoom(self, x, y=''):
+ """Return a new PhotoImage with the same image as this widget
+ but zoom it with a factor of x in the X direction and y in the Y
+ direction. If y is not given, the default value is the same as x.
+ """
+ destImage = PhotoImage(master=self.tk)
+ if y=='': y=x
+ self.tk.call(destImage, 'copy', self.name, '-zoom',x,y)
+ return destImage
+ def subsample(self, x, y=''):
+ """Return a new PhotoImage based on the same image as this widget
+ but use only every Xth or Yth pixel. If y is not given, the
+ default value is the same as x.
+ """
+ destImage = PhotoImage(master=self.tk)
+ if y=='': y=x
+ self.tk.call(destImage, 'copy', self.name, '-subsample',x,y)
+ return destImage
+ def get(self, x, y):
+ """Return the color (red, green, blue) of the pixel at X,Y."""
+ return self.tk.call(self.name, 'get', x, y)
+ def put(self, data, to=None):
+ """Put row formatted colors to image starting from
+ position TO, e.g. image.put("{red green} {blue yellow}", to=(4,6))"""
+ args = (self.name, 'put', data)
+ if to:
+ if to[0] == '-to':
+ to = to[1:]
+ args = args + ('-to',) + tuple(to)
+ self.tk.call(args)
+ # XXX read
+ def write(self, filename, format=None, from_coords=None):
+ """Write image to file FILENAME in FORMAT starting from
+ position FROM_COORDS."""
+ args = (self.name, 'write', filename)
+ if format:
+ args = args + ('-format', format)
+ if from_coords:
+ args = args + ('-from',) + tuple(from_coords)
+ self.tk.call(args)
+
+class BitmapImage(Image):
+ """Widget which can display a bitmap."""
+ def __init__(self, name=None, cnf={}, master=None, **kw):
+ """Create a bitmap with NAME.
+
+ Valid resource names: background, data, file, foreground, maskdata, maskfile."""
+ Image.__init__(self, 'bitmap', name, cnf, master, **kw)
+
+def image_names():
+ return _default_root.tk.splitlist(_default_root.tk.call('image', 'names'))
+
+def image_types():
+ return _default_root.tk.splitlist(_default_root.tk.call('image', 'types'))
+
+
+class Spinbox(Widget, XView):
+ """spinbox widget."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a spinbox widget with the parent MASTER.
+
+ STANDARD OPTIONS
+
+ activebackground, background, borderwidth,
+ cursor, exportselection, font, foreground,
+ highlightbackground, highlightcolor,
+ highlightthickness, insertbackground,
+ insertborderwidth, insertofftime,
+ insertontime, insertwidth, justify, relief,
+ repeatdelay, repeatinterval,
+ selectbackground, selectborderwidth
+ selectforeground, takefocus, textvariable
+ xscrollcommand.
+
+ WIDGET-SPECIFIC OPTIONS
+
+ buttonbackground, buttoncursor,
+ buttondownrelief, buttonuprelief,
+ command, disabledbackground,
+ disabledforeground, format, from,
+ invalidcommand, increment,
+ readonlybackground, state, to,
+ validate, validatecommand values,
+ width, wrap,
+ """
+ Widget.__init__(self, master, 'spinbox', cnf, kw)
+
+ def bbox(self, index):
+ """Return a tuple of X1,Y1,X2,Y2 coordinates for a
+ rectangle which encloses the character given by index.
+
+ The first two elements of the list give the x and y
+ coordinates of the upper-left corner of the screen
+ area covered by the character (in pixels relative
+ to the widget) and the last two elements give the
+ width and height of the character, in pixels. The
+ bounding box may refer to a region outside the
+ visible area of the window.
+ """
+ return self._getints(self.tk.call(self._w, 'bbox', index)) or None
+
+ def delete(self, first, last=None):
+ """Delete one or more elements of the spinbox.
+
+ First is the index of the first character to delete,
+ and last is the index of the character just after
+ the last one to delete. If last isn't specified it
+ defaults to first+1, i.e. a single character is
+ deleted. This command returns an empty string.
+ """
+ return self.tk.call(self._w, 'delete', first, last)
+
+ def get(self):
+ """Returns the spinbox's string"""
+ return self.tk.call(self._w, 'get')
+
+ def icursor(self, index):
+ """Alter the position of the insertion cursor.
+
+ The insertion cursor will be displayed just before
+ the character given by index. Returns an empty string
+ """
+ return self.tk.call(self._w, 'icursor', index)
+
+ def identify(self, x, y):
+ """Returns the name of the widget at position x, y
+
+ Return value is one of: none, buttondown, buttonup, entry
+ """
+ return self.tk.call(self._w, 'identify', x, y)
+
+ def index(self, index):
+ """Returns the numerical index corresponding to index
+ """
+ return self.tk.call(self._w, 'index', index)
+
+ def insert(self, index, s):
+ """Insert string s at index
+
+ Returns an empty string.
+ """
+ return self.tk.call(self._w, 'insert', index, s)
+
+ def invoke(self, element):
+ """Causes the specified element to be invoked
+
+ The element could be buttondown or buttonup
+ triggering the action associated with it.
+ """
+ return self.tk.call(self._w, 'invoke', element)
+
+ def scan(self, *args):
+ """Internal function."""
+ return self._getints(
+ self.tk.call((self._w, 'scan') + args)) or ()
+
+ def scan_mark(self, x):
+ """Records x and the current view in the spinbox window;
+
+ used in conjunction with later scan dragto commands.
+ Typically this command is associated with a mouse button
+ press in the widget. It returns an empty string.
+ """
+ return self.scan("mark", x)
+
+ def scan_dragto(self, x):
+ """Compute the difference between the given x argument
+ and the x argument to the last scan mark command
+
+ It then adjusts the view left or right by 10 times the
+ difference in x-coordinates. This command is typically
+ associated with mouse motion events in the widget, to
+ produce the effect of dragging the spinbox at high speed
+ through the window. The return value is an empty string.
+ """
+ return self.scan("dragto", x)
+
+ def selection(self, *args):
+ """Internal function."""
+ return self._getints(
+ self.tk.call((self._w, 'selection') + args)) or ()
+
+ def selection_adjust(self, index):
+ """Locate the end of the selection nearest to the character
+ given by index,
+
+ Then adjust that end of the selection to be at index
+ (i.e including but not going beyond index). The other
+ end of the selection is made the anchor point for future
+ select to commands. If the selection isn't currently in
+ the spinbox, then a new selection is created to include
+ the characters between index and the most recent selection
+ anchor point, inclusive. Returns an empty string.
+ """
+ return self.selection("adjust", index)
+
+ def selection_clear(self):
+ """Clear the selection
+
+ If the selection isn't in this widget then the
+ command has no effect. Returns an empty string.
+ """
+ return self.selection("clear")
+
+ def selection_element(self, element=None):
+ """Sets or gets the currently selected element.
+
+ If a spinbutton element is specified, it will be
+ displayed depressed
+ """
+ return self.selection("element", element)
+
+###########################################################################
+
+class LabelFrame(Widget):
+ """labelframe widget."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a labelframe widget with the parent MASTER.
+
+ STANDARD OPTIONS
+
+ borderwidth, cursor, font, foreground,
+ highlightbackground, highlightcolor,
+ highlightthickness, padx, pady, relief,
+ takefocus, text
+
+ WIDGET-SPECIFIC OPTIONS
+
+ background, class, colormap, container,
+ height, labelanchor, labelwidget,
+ visual, width
+ """
+ Widget.__init__(self, master, 'labelframe', cnf, kw)
+
+########################################################################
+
+class PanedWindow(Widget):
+ """panedwindow widget."""
+ def __init__(self, master=None, cnf={}, **kw):
+ """Construct a panedwindow widget with the parent MASTER.
+
+ STANDARD OPTIONS
+
+ background, borderwidth, cursor, height,
+ orient, relief, width
+
+ WIDGET-SPECIFIC OPTIONS
+
+ handlepad, handlesize, opaqueresize,
+ sashcursor, sashpad, sashrelief,
+ sashwidth, showhandle,
+ """
+ Widget.__init__(self, master, 'panedwindow', cnf, kw)
+
+ def add(self, child, **kw):
+ """Add a child widget to the panedwindow in a new pane.
+
+ The child argument is the name of the child widget
+ followed by pairs of arguments that specify how to
+ manage the windows. The possible options and values
+ are the ones accepted by the paneconfigure method.
+ """
+ self.tk.call((self._w, 'add', child) + self._options(kw))
+
+ def remove(self, child):
+ """Remove the pane containing child from the panedwindow
+
+ All geometry management options for child will be forgotten.
+ """
+ self.tk.call(self._w, 'forget', child)
+ forget=remove
+
+ def identify(self, x, y):
+ """Identify the panedwindow component at point x, y
+
+ If the point is over a sash or a sash handle, the result
+ is a two element list containing the index of the sash or
+ handle, and a word indicating whether it is over a sash
+ or a handle, such as {0 sash} or {2 handle}. If the point
+ is over any other part of the panedwindow, the result is
+ an empty list.
+ """
+ return self.tk.call(self._w, 'identify', x, y)
+
+ def proxy(self, *args):
+ """Internal function."""
+ return self._getints(
+ self.tk.call((self._w, 'proxy') + args)) or ()
+
+ def proxy_coord(self):
+ """Return the x and y pair of the most recent proxy location
+ """
+ return self.proxy("coord")
+
+ def proxy_forget(self):
+ """Remove the proxy from the display.
+ """
+ return self.proxy("forget")
+
+ def proxy_place(self, x, y):
+ """Place the proxy at the given x and y coordinates.
+ """
+ return self.proxy("place", x, y)
+
+ def sash(self, *args):
+ """Internal function."""
+ return self._getints(
+ self.tk.call((self._w, 'sash') + args)) or ()
+
+ def sash_coord(self, index):
+ """Return the current x and y pair for the sash given by index.
+
+ Index must be an integer between 0 and 1 less than the
+ number of panes in the panedwindow. The coordinates given are
+ those of the top left corner of the region containing the sash.
+ pathName sash dragto index x y This command computes the
+ difference between the given coordinates and the coordinates
+ given to the last sash coord command for the given sash. It then
+ moves that sash the computed difference. The return value is the
+ empty string.
+ """
+ return self.sash("coord", index)
+
+ def sash_mark(self, index):
+ """Records x and y for the sash given by index;
+
+ Used in conjunction with later dragto commands to move the sash.
+ """
+ return self.sash("mark", index)
+
+ def sash_place(self, index, x, y):
+ """Place the sash given by index at the given coordinates
+ """
+ return self.sash("place", index, x, y)
+
+ def panecget(self, child, option):
+ """Query a management option for window.
+
+ Option may be any value allowed by the paneconfigure subcommand
+ """
+ return self.tk.call(
+ (self._w, 'panecget') + (child, '-'+option))
+
+ def paneconfigure(self, tagOrId, cnf=None, **kw):
+ """Query or modify the management options for window.
+
+ If no option is specified, returns a list describing all
+ of the available options for pathName. If option is
+ specified with no value, then the command returns a list
+ describing the one named option (this list will be identical
+ to the corresponding sublist of the value returned if no
+ option is specified). If one or more option-value pairs are
+ specified, then the command modifies the given widget
+ option(s) to have the given value(s); in this case the
+ command returns an empty string. The following options
+ are supported:
+
+ after window
+ Insert the window after the window specified. window
+ should be the name of a window already managed by pathName.
+ before window
+ Insert the window before the window specified. window
+ should be the name of a window already managed by pathName.
+ height size
+ Specify a height for the window. The height will be the
+ outer dimension of the window including its border, if
+ any. If size is an empty string, or if -height is not
+ specified, then the height requested internally by the
+ window will be used initially; the height may later be
+ adjusted by the movement of sashes in the panedwindow.
+ Size may be any value accepted by Tk_GetPixels.
+ minsize n
+ Specifies that the size of the window cannot be made
+ less than n. This constraint only affects the size of
+ the widget in the paned dimension -- the x dimension
+ for horizontal panedwindows, the y dimension for
+ vertical panedwindows. May be any value accepted by
+ Tk_GetPixels.
+ padx n
+ Specifies a non-negative value indicating how much
+ extra space to leave on each side of the window in
+ the X-direction. The value may have any of the forms
+ accepted by Tk_GetPixels.
+ pady n
+ Specifies a non-negative value indicating how much
+ extra space to leave on each side of the window in
+ the Y-direction. The value may have any of the forms
+ accepted by Tk_GetPixels.
+ sticky style
+ If a window's pane is larger than the requested
+ dimensions of the window, this option may be used
+ to position (or stretch) the window within its pane.
+ Style is a string that contains zero or more of the
+ characters n, s, e or w. The string can optionally
+ contains spaces or commas, but they are ignored. Each
+ letter refers to a side (north, south, east, or west)
+ that the window will "stick" to. If both n and s
+ (or e and w) are specified, the window will be
+ stretched to fill the entire height (or width) of
+ its cavity.
+ width size
+ Specify a width for the window. The width will be
+ the outer dimension of the window including its
+ border, if any. If size is an empty string, or
+ if -width is not specified, then the width requested
+ internally by the window will be used initially; the
+ width may later be adjusted by the movement of sashes
+ in the panedwindow. Size may be any value accepted by
+ Tk_GetPixels.
+
+ """
+ if cnf is None and not kw:
+ return self._getconfigure(self._w, 'paneconfigure', tagOrId)
+ if type(cnf) == StringType and not kw:
+ return self._getconfigure1(
+ self._w, 'paneconfigure', tagOrId, '-'+cnf)
+ self.tk.call((self._w, 'paneconfigure', tagOrId) +
+ self._options(cnf, kw))
+ paneconfig = paneconfigure
+
+ def panes(self):
+ """Returns an ordered list of the child panes."""
+ return self.tk.splitlist(self.tk.call(self._w, 'panes'))
+
+######################################################################
+# Extensions:
+
+class Studbutton(Button):
+ def __init__(self, master=None, cnf={}, **kw):
+ Widget.__init__(self, master, 'studbutton', cnf, kw)
+ self.bind('<Any-Enter>', self.tkButtonEnter)
+ self.bind('<Any-Leave>', self.tkButtonLeave)
+ self.bind('<1>', self.tkButtonDown)
+ self.bind('<ButtonRelease-1>', self.tkButtonUp)
+
+class Tributton(Button):
+ def __init__(self, master=None, cnf={}, **kw):
+ Widget.__init__(self, master, 'tributton', cnf, kw)
+ self.bind('<Any-Enter>', self.tkButtonEnter)
+ self.bind('<Any-Leave>', self.tkButtonLeave)
+ self.bind('<1>', self.tkButtonDown)
+ self.bind('<ButtonRelease-1>', self.tkButtonUp)
+ self['fg'] = self['bg']
+ self['activebackground'] = self['bg']
+
+######################################################################
+# Test:
+
+def _test():
+ root = Tk()
+ text = "This is Tcl/Tk version %s" % TclVersion
+ if TclVersion >= 8.1:
+ try:
+ text = text + unicode("\nThis should be a cedilla: \347",
+ "iso-8859-1")
+ except NameError:
+ pass # no unicode support
+ label = Label(root, text=text)
+ label.pack()
+ test = Button(root, text="Click me!",
+ command=lambda root=root: root.test.configure(
+ text="[%s]" % root.test['text']))
+ test.pack()
+ root.test = test
+ quit = Button(root, text="QUIT", command=root.destroy)
+ quit.pack()
+ # The following three commands are needed so the window pops
+ # up on top on Windows...
+ root.iconify()
+ root.update()
+ root.deiconify()
+ root.mainloop()
+
+if __name__ == '__main__':
+ _test()
diff --git a/lib/python2.7/lib-tk/test/README b/lib/python2.7/lib-tk/test/README
new file mode 100644
index 00000000..79cd16c7
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/README
@@ -0,0 +1,14 @@
+Writing new tests
+=================
+
+Precaution
+----------
+
+ New tests should always use only one Tk window at once, like all the
+ current tests do. This means that you have to destroy the current window
+ before creating another one, and clean up after the test. The motivation
+ behind this is that some tests may depend on having its window focused
+ while it is running to work properly, and it may be hard to force focus
+ on your window across platforms (right now only test_traversal at
+ test_ttk.test_widgets.NotebookTest depends on this).
+
diff --git a/lib/python2.7/lib-tk/test/runtktests.py b/lib/python2.7/lib-tk/test/runtktests.py
new file mode 100644
index 00000000..d4b18931
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/runtktests.py
@@ -0,0 +1,70 @@
+"""
+Use this module to get and run all tk tests.
+
+Tkinter tests should live in a package inside the directory where this file
+lives, like test_tkinter.
+Extensions also should live in packages following the same rule as above.
+"""
+
+import os
+import sys
+import unittest
+import importlib
+import test.test_support
+
+this_dir_path = os.path.abspath(os.path.dirname(__file__))
+
+def is_package(path):
+ for name in os.listdir(path):
+ if name in ('__init__.py', '__init__.pyc', '__init.pyo'):
+ return True
+ return False
+
+def get_tests_modules(basepath=this_dir_path, gui=True, packages=None):
+ """This will import and yield modules whose names start with test_
+ and are inside packages found in the path starting at basepath.
+
+ If packages is specified it should contain package names that want
+ their tests collected.
+ """
+ py_ext = '.py'
+
+ for dirpath, dirnames, filenames in os.walk(basepath):
+ for dirname in list(dirnames):
+ if dirname[0] == '.':
+ dirnames.remove(dirname)
+
+ if is_package(dirpath) and filenames:
+ pkg_name = dirpath[len(basepath) + len(os.sep):].replace('/', '.')
+ if packages and pkg_name not in packages:
+ continue
+
+ filenames = filter(
+ lambda x: x.startswith('test_') and x.endswith(py_ext),
+ filenames)
+
+ for name in filenames:
+ try:
+ yield importlib.import_module(
+ ".%s" % name[:-len(py_ext)], pkg_name)
+ except test.test_support.ResourceDenied:
+ if gui:
+ raise
+
+def get_tests(text=True, gui=True, packages=None):
+ """Yield all the tests in the modules found by get_tests_modules.
+
+ If nogui is True, only tests that do not require a GUI will be
+ returned."""
+ attrs = []
+ if text:
+ attrs.append('tests_nogui')
+ if gui:
+ attrs.append('tests_gui')
+ for module in get_tests_modules(gui=gui, packages=packages):
+ for attr in attrs:
+ for test in getattr(module, attr, ()):
+ yield test
+
+if __name__ == "__main__":
+ test.test_support.run_unittest(*get_tests())
diff --git a/lib/python2.7/lib-tk/test/test_tkinter/__init__.py b/lib/python2.7/lib-tk/test/test_tkinter/__init__.py
new file mode 100644
index 00000000..e69de29b
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_tkinter/__init__.py
diff --git a/lib/python2.7/lib-tk/test/test_tkinter/test_font.py b/lib/python2.7/lib-tk/test/test_tkinter/test_font.py
new file mode 100644
index 00000000..4cbf82e8
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_tkinter/test_font.py
@@ -0,0 +1,97 @@
+import unittest
+import Tkinter as tkinter
+import tkFont as font
+from test.test_support import requires, run_unittest
+from test_ttk.support import AbstractTkTest
+
+requires('gui')
+
+fontname = "TkDefaultFont"
+
+class FontTest(AbstractTkTest, unittest.TestCase):
+
+ @classmethod
+ def setUpClass(cls):
+ AbstractTkTest.setUpClass.__func__(cls)
+ try:
+ cls.font = font.Font(root=cls.root, name=fontname, exists=True)
+ except tkinter.TclError:
+ cls.font = font.Font(root=cls.root, name=fontname, exists=False)
+
+ def test_configure(self):
+ options = self.font.configure()
+ self.assertGreaterEqual(set(options),
+ {'family', 'size', 'weight', 'slant', 'underline', 'overstrike'})
+ for key in options:
+ self.assertEqual(self.font.cget(key), options[key])
+ self.assertEqual(self.font[key], options[key])
+ for key in 'family', 'weight', 'slant':
+ self.assertIsInstance(options[key], str)
+ self.assertIsInstance(self.font.cget(key), str)
+ self.assertIsInstance(self.font[key], str)
+ sizetype = int if self.wantobjects else str
+ for key in 'size', 'underline', 'overstrike':
+ self.assertIsInstance(options[key], sizetype)
+ self.assertIsInstance(self.font.cget(key), sizetype)
+ self.assertIsInstance(self.font[key], sizetype)
+
+ def test_actual(self):
+ options = self.font.actual()
+ self.assertGreaterEqual(set(options),
+ {'family', 'size', 'weight', 'slant', 'underline', 'overstrike'})
+ for key in options:
+ self.assertEqual(self.font.actual(key), options[key])
+ for key in 'family', 'weight', 'slant':
+ self.assertIsInstance(options[key], str)
+ self.assertIsInstance(self.font.actual(key), str)
+ sizetype = int if self.wantobjects else str
+ for key in 'size', 'underline', 'overstrike':
+ self.assertIsInstance(options[key], sizetype)
+ self.assertIsInstance(self.font.actual(key), sizetype)
+
+ def test_name(self):
+ self.assertEqual(self.font.name, fontname)
+ self.assertEqual(str(self.font), fontname)
+
+ def test_eq(self):
+ font1 = font.Font(root=self.root, name=fontname, exists=True)
+ font2 = font.Font(root=self.root, name=fontname, exists=True)
+ self.assertIsNot(font1, font2)
+ self.assertEqual(font1, font2)
+ self.assertNotEqual(font1, font1.copy())
+ self.assertNotEqual(font1, 0)
+ self.assertNotIn(font1, [0])
+
+ def test_measure(self):
+ self.assertIsInstance(self.font.measure('abc'), int)
+
+ def test_metrics(self):
+ metrics = self.font.metrics()
+ self.assertGreaterEqual(set(metrics),
+ {'ascent', 'descent', 'linespace', 'fixed'})
+ for key in metrics:
+ self.assertEqual(self.font.metrics(key), metrics[key])
+ self.assertIsInstance(metrics[key], int)
+ self.assertIsInstance(self.font.metrics(key), int)
+
+ def test_families(self):
+ families = font.families(self.root)
+ self.assertIsInstance(families, tuple)
+ self.assertTrue(families)
+ for family in families:
+ self.assertIsInstance(family, (str, unicode))
+ self.assertTrue(family)
+
+ def test_names(self):
+ names = font.names(self.root)
+ self.assertIsInstance(names, tuple)
+ self.assertTrue(names)
+ for name in names:
+ self.assertIsInstance(name, (str, unicode))
+ self.assertTrue(name)
+ self.assertIn(fontname, names)
+
+tests_gui = (FontTest, )
+
+if __name__ == "__main__":
+ run_unittest(*tests_gui)
diff --git a/lib/python2.7/lib-tk/test/test_tkinter/test_geometry_managers.py b/lib/python2.7/lib-tk/test/test_tkinter/test_geometry_managers.py
new file mode 100644
index 00000000..941fb31b
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_tkinter/test_geometry_managers.py
@@ -0,0 +1,893 @@
+import unittest
+import re
+import Tkinter as tkinter
+from Tkinter import TclError
+from test.test_support import requires, run_unittest
+
+from test_ttk.support import pixels_conv, tcl_version, requires_tcl
+from widget_tests import AbstractWidgetTest, int_round
+
+requires('gui')
+
+
+class PackTest(AbstractWidgetTest, unittest.TestCase):
+
+ test_keys = None
+
+ def create2(self):
+ pack = tkinter.Toplevel(self.root, name='pack')
+ pack.wm_geometry('300x200+0+0')
+ pack.wm_minsize(1, 1)
+ a = tkinter.Frame(pack, name='a', width=20, height=40, bg='red')
+ b = tkinter.Frame(pack, name='b', width=50, height=30, bg='blue')
+ c = tkinter.Frame(pack, name='c', width=80, height=80, bg='green')
+ d = tkinter.Frame(pack, name='d', width=40, height=30, bg='yellow')
+ return pack, a, b, c, d
+
+ def test_pack_configure_after(self):
+ pack, a, b, c, d = self.create2()
+ with self.assertRaisesRegexp(TclError, 'window "%s" isn\'t packed' % b):
+ a.pack_configure(after=b)
+ with self.assertRaisesRegexp(TclError, 'bad window path name ".foo"'):
+ a.pack_configure(after='.foo')
+ a.pack_configure(side='top')
+ b.pack_configure(side='top')
+ c.pack_configure(side='top')
+ d.pack_configure(side='top')
+ self.assertEqual(pack.pack_slaves(), [a, b, c, d])
+ a.pack_configure(after=b)
+ self.assertEqual(pack.pack_slaves(), [b, a, c, d])
+ a.pack_configure(after=a)
+ self.assertEqual(pack.pack_slaves(), [b, a, c, d])
+
+ def test_pack_configure_anchor(self):
+ pack, a, b, c, d = self.create2()
+ def check(anchor, geom):
+ a.pack_configure(side='top', ipadx=5, padx=10, ipady=15, pady=20,
+ expand=True, anchor=anchor)
+ self.root.update()
+ self.assertEqual(a.winfo_geometry(), geom)
+ check('n', '30x70+135+20')
+ check('ne', '30x70+260+20')
+ check('e', '30x70+260+65')
+ check('se', '30x70+260+110')
+ check('s', '30x70+135+110')
+ check('sw', '30x70+10+110')
+ check('w', '30x70+10+65')
+ check('nw', '30x70+10+20')
+ check('center', '30x70+135+65')
+
+ def test_pack_configure_before(self):
+ pack, a, b, c, d = self.create2()
+ with self.assertRaisesRegexp(TclError, 'window "%s" isn\'t packed' % b):
+ a.pack_configure(before=b)
+ with self.assertRaisesRegexp(TclError, 'bad window path name ".foo"'):
+ a.pack_configure(before='.foo')
+ a.pack_configure(side='top')
+ b.pack_configure(side='top')
+ c.pack_configure(side='top')
+ d.pack_configure(side='top')
+ self.assertEqual(pack.pack_slaves(), [a, b, c, d])
+ a.pack_configure(before=d)
+ self.assertEqual(pack.pack_slaves(), [b, c, a, d])
+ a.pack_configure(before=a)
+ self.assertEqual(pack.pack_slaves(), [b, c, a, d])
+
+ def test_pack_configure_expand(self):
+ pack, a, b, c, d = self.create2()
+ def check(*geoms):
+ self.root.update()
+ self.assertEqual(a.winfo_geometry(), geoms[0])
+ self.assertEqual(b.winfo_geometry(), geoms[1])
+ self.assertEqual(c.winfo_geometry(), geoms[2])
+ self.assertEqual(d.winfo_geometry(), geoms[3])
+ a.pack_configure(side='left')
+ b.pack_configure(side='top')
+ c.pack_configure(side='right')
+ d.pack_configure(side='bottom')
+ check('20x40+0+80', '50x30+135+0', '80x80+220+75', '40x30+100+170')
+ a.pack_configure(side='left', expand='yes')
+ b.pack_configure(side='top', expand='on')
+ c.pack_configure(side='right', expand=True)
+ d.pack_configure(side='bottom', expand=1)
+ check('20x40+40+80', '50x30+175+35', '80x80+180+110', '40x30+100+135')
+ a.pack_configure(side='left', expand='yes', fill='both')
+ b.pack_configure(side='top', expand='on', fill='both')
+ c.pack_configure(side='right', expand=True, fill='both')
+ d.pack_configure(side='bottom', expand=1, fill='both')
+ check('100x200+0+0', '200x100+100+0', '160x100+140+100', '40x100+100+100')
+
+ def test_pack_configure_in(self):
+ pack, a, b, c, d = self.create2()
+ a.pack_configure(side='top')
+ b.pack_configure(side='top')
+ c.pack_configure(side='top')
+ d.pack_configure(side='top')
+ a.pack_configure(in_=pack)
+ self.assertEqual(pack.pack_slaves(), [b, c, d, a])
+ a.pack_configure(in_=c)
+ self.assertEqual(pack.pack_slaves(), [b, c, d])
+ self.assertEqual(c.pack_slaves(), [a])
+ with self.assertRaisesRegexp(TclError,
+ 'can\'t pack %s inside itself' % (a,)):
+ a.pack_configure(in_=a)
+ with self.assertRaisesRegexp(TclError, 'bad window path name ".foo"'):
+ a.pack_configure(in_='.foo')
+
+ def test_pack_configure_padx_ipadx_fill(self):
+ pack, a, b, c, d = self.create2()
+ def check(geom1, geom2, **kwargs):
+ a.pack_forget()
+ b.pack_forget()
+ a.pack_configure(**kwargs)
+ b.pack_configure(expand=True, fill='both')
+ self.root.update()
+ self.assertEqual(a.winfo_geometry(), geom1)
+ self.assertEqual(b.winfo_geometry(), geom2)
+ check('20x40+260+80', '240x200+0+0', side='right', padx=20)
+ check('20x40+250+80', '240x200+0+0', side='right', padx=(10, 30))
+ check('60x40+240+80', '240x200+0+0', side='right', ipadx=20)
+ check('30x40+260+80', '250x200+0+0', side='right', ipadx=5, padx=10)
+ check('20x40+260+80', '240x200+0+0', side='right', padx=20, fill='x')
+ check('20x40+249+80', '240x200+0+0',
+ side='right', padx=(9, 31), fill='x')
+ check('60x40+240+80', '240x200+0+0', side='right', ipadx=20, fill='x')
+ check('30x40+260+80', '250x200+0+0',
+ side='right', ipadx=5, padx=10, fill='x')
+ check('30x40+255+80', '250x200+0+0',
+ side='right', ipadx=5, padx=(5, 15), fill='x')
+ check('20x40+140+0', '300x160+0+40', side='top', padx=20)
+ check('20x40+120+0', '300x160+0+40', side='top', padx=(0, 40))
+ check('60x40+120+0', '300x160+0+40', side='top', ipadx=20)
+ check('30x40+135+0', '300x160+0+40', side='top', ipadx=5, padx=10)
+ check('30x40+130+0', '300x160+0+40', side='top', ipadx=5, padx=(5, 15))
+ check('260x40+20+0', '300x160+0+40', side='top', padx=20, fill='x')
+ check('260x40+25+0', '300x160+0+40',
+ side='top', padx=(25, 15), fill='x')
+ check('300x40+0+0', '300x160+0+40', side='top', ipadx=20, fill='x')
+ check('280x40+10+0', '300x160+0+40',
+ side='top', ipadx=5, padx=10, fill='x')
+ check('280x40+5+0', '300x160+0+40',
+ side='top', ipadx=5, padx=(5, 15), fill='x')
+ a.pack_configure(padx='1c')
+ self.assertEqual(a.pack_info()['padx'],
+ self._str(pack.winfo_pixels('1c')))
+ a.pack_configure(ipadx='1c')
+ self.assertEqual(a.pack_info()['ipadx'],
+ self._str(pack.winfo_pixels('1c')))
+
+ def test_pack_configure_pady_ipady_fill(self):
+ pack, a, b, c, d = self.create2()
+ def check(geom1, geom2, **kwargs):
+ a.pack_forget()
+ b.pack_forget()
+ a.pack_configure(**kwargs)
+ b.pack_configure(expand=True, fill='both')
+ self.root.update()
+ self.assertEqual(a.winfo_geometry(), geom1)
+ self.assertEqual(b.winfo_geometry(), geom2)
+ check('20x40+280+80', '280x200+0+0', side='right', pady=20)
+ check('20x40+280+70', '280x200+0+0', side='right', pady=(10, 30))
+ check('20x80+280+60', '280x200+0+0', side='right', ipady=20)
+ check('20x50+280+75', '280x200+0+0', side='right', ipady=5, pady=10)
+ check('20x40+280+80', '280x200+0+0', side='right', pady=20, fill='x')
+ check('20x40+280+69', '280x200+0+0',
+ side='right', pady=(9, 31), fill='x')
+ check('20x80+280+60', '280x200+0+0', side='right', ipady=20, fill='x')
+ check('20x50+280+75', '280x200+0+0',
+ side='right', ipady=5, pady=10, fill='x')
+ check('20x50+280+70', '280x200+0+0',
+ side='right', ipady=5, pady=(5, 15), fill='x')
+ check('20x40+140+20', '300x120+0+80', side='top', pady=20)
+ check('20x40+140+0', '300x120+0+80', side='top', pady=(0, 40))
+ check('20x80+140+0', '300x120+0+80', side='top', ipady=20)
+ check('20x50+140+10', '300x130+0+70', side='top', ipady=5, pady=10)
+ check('20x50+140+5', '300x130+0+70', side='top', ipady=5, pady=(5, 15))
+ check('300x40+0+20', '300x120+0+80', side='top', pady=20, fill='x')
+ check('300x40+0+25', '300x120+0+80',
+ side='top', pady=(25, 15), fill='x')
+ check('300x80+0+0', '300x120+0+80', side='top', ipady=20, fill='x')
+ check('300x50+0+10', '300x130+0+70',
+ side='top', ipady=5, pady=10, fill='x')
+ check('300x50+0+5', '300x130+0+70',
+ side='top', ipady=5, pady=(5, 15), fill='x')
+ a.pack_configure(pady='1c')
+ self.assertEqual(a.pack_info()['pady'],
+ self._str(pack.winfo_pixels('1c')))
+ a.pack_configure(ipady='1c')
+ self.assertEqual(a.pack_info()['ipady'],
+ self._str(pack.winfo_pixels('1c')))
+
+ def test_pack_configure_side(self):
+ pack, a, b, c, d = self.create2()
+ def check(side, geom1, geom2):
+ a.pack_configure(side=side)
+ self.assertEqual(a.pack_info()['side'], side)
+ b.pack_configure(expand=True, fill='both')
+ self.root.update()
+ self.assertEqual(a.winfo_geometry(), geom1)
+ self.assertEqual(b.winfo_geometry(), geom2)
+ check('top', '20x40+140+0', '300x160+0+40')
+ check('bottom', '20x40+140+160', '300x160+0+0')
+ check('left', '20x40+0+80', '280x200+20+0')
+ check('right', '20x40+280+80', '280x200+0+0')
+
+ def test_pack_forget(self):
+ pack, a, b, c, d = self.create2()
+ a.pack_configure()
+ b.pack_configure()
+ c.pack_configure()
+ self.assertEqual(pack.pack_slaves(), [a, b, c])
+ b.pack_forget()
+ self.assertEqual(pack.pack_slaves(), [a, c])
+ b.pack_forget()
+ self.assertEqual(pack.pack_slaves(), [a, c])
+ d.pack_forget()
+
+ def test_pack_info(self):
+ pack, a, b, c, d = self.create2()
+ with self.assertRaisesRegexp(TclError, 'window "%s" isn\'t packed' % a):
+ a.pack_info()
+ a.pack_configure()
+ b.pack_configure(side='right', in_=a, anchor='s', expand=True, fill='x',
+ ipadx=5, padx=10, ipady=2, pady=(5, 15))
+ info = a.pack_info()
+ self.assertIsInstance(info, dict)
+ self.assertEqual(info['anchor'], 'center')
+ self.assertEqual(info['expand'], self._str(0))
+ self.assertEqual(info['fill'], 'none')
+ self.assertEqual(info['in'], pack)
+ self.assertEqual(info['ipadx'], self._str(0))
+ self.assertEqual(info['ipady'], self._str(0))
+ self.assertEqual(info['padx'], self._str(0))
+ self.assertEqual(info['pady'], self._str(0))
+ self.assertEqual(info['side'], 'top')
+ info = b.pack_info()
+ self.assertIsInstance(info, dict)
+ self.assertEqual(info['anchor'], 's')
+ self.assertEqual(info['expand'], self._str(1))
+ self.assertEqual(info['fill'], 'x')
+ self.assertEqual(info['in'], a)
+ self.assertEqual(info['ipadx'], self._str(5))
+ self.assertEqual(info['ipady'], self._str(2))
+ self.assertEqual(info['padx'], self._str(10))
+ self.assertEqual(info['pady'], self._str((5, 15)))
+ self.assertEqual(info['side'], 'right')
+
+ def test_pack_propagate(self):
+ pack, a, b, c, d = self.create2()
+ pack.configure(width=300, height=200)
+ a.pack_configure()
+ pack.pack_propagate(False)
+ self.root.update()
+ self.assertEqual(pack.winfo_reqwidth(), 300)
+ self.assertEqual(pack.winfo_reqheight(), 200)
+ pack.pack_propagate(True)
+ self.root.update()
+ self.assertEqual(pack.winfo_reqwidth(), 20)
+ self.assertEqual(pack.winfo_reqheight(), 40)
+
+ def test_pack_slaves(self):
+ pack, a, b, c, d = self.create2()
+ self.assertEqual(pack.pack_slaves(), [])
+ a.pack_configure()
+ self.assertEqual(pack.pack_slaves(), [a])
+ b.pack_configure()
+ self.assertEqual(pack.pack_slaves(), [a, b])
+
+
+class PlaceTest(AbstractWidgetTest, unittest.TestCase):
+
+ test_keys = None
+
+ def create2(self):
+ t = tkinter.Toplevel(self.root, width=300, height=200, bd=0)
+ t.wm_geometry('300x200+0+0')
+ f = tkinter.Frame(t, width=154, height=84, bd=2, relief='raised')
+ f.place_configure(x=48, y=38)
+ f2 = tkinter.Frame(t, width=30, height=60, bd=2, relief='raised')
+ self.root.update()
+ return t, f, f2
+
+ def test_place_configure_in(self):
+ t, f, f2 = self.create2()
+ self.assertEqual(f2.winfo_manager(), '')
+ with self.assertRaisesRegexp(TclError, "can't place %s relative to "
+ "itself" % re.escape(str(f2))):
+ f2.place_configure(in_=f2)
+ if tcl_version >= (8, 5):
+ self.assertEqual(f2.winfo_manager(), '')
+ with self.assertRaisesRegexp(TclError, 'bad window path name'):
+ f2.place_configure(in_='spam')
+ f2.place_configure(in_=f)
+ self.assertEqual(f2.winfo_manager(), 'place')
+
+ def test_place_configure_x(self):
+ t, f, f2 = self.create2()
+ f2.place_configure(in_=f)
+ self.assertEqual(f2.place_info()['x'], '0')
+ self.root.update()
+ self.assertEqual(f2.winfo_x(), 50)
+ f2.place_configure(x=100)
+ self.assertEqual(f2.place_info()['x'], '100')
+ self.root.update()
+ self.assertEqual(f2.winfo_x(), 150)
+ f2.place_configure(x=-10, relx=1)
+ self.assertEqual(f2.place_info()['x'], '-10')
+ self.root.update()
+ self.assertEqual(f2.winfo_x(), 190)
+ with self.assertRaisesRegexp(TclError, 'bad screen distance "spam"'):
+ f2.place_configure(in_=f, x='spam')
+
+ def test_place_configure_y(self):
+ t, f, f2 = self.create2()
+ f2.place_configure(in_=f)
+ self.assertEqual(f2.place_info()['y'], '0')
+ self.root.update()
+ self.assertEqual(f2.winfo_y(), 40)
+ f2.place_configure(y=50)
+ self.assertEqual(f2.place_info()['y'], '50')
+ self.root.update()
+ self.assertEqual(f2.winfo_y(), 90)
+ f2.place_configure(y=-10, rely=1)
+ self.assertEqual(f2.place_info()['y'], '-10')
+ self.root.update()
+ self.assertEqual(f2.winfo_y(), 110)
+ with self.assertRaisesRegexp(TclError, 'bad screen distance "spam"'):
+ f2.place_configure(in_=f, y='spam')
+
+ def test_place_configure_relx(self):
+ t, f, f2 = self.create2()
+ f2.place_configure(in_=f)
+ self.assertEqual(f2.place_info()['relx'], '0')
+ self.root.update()
+ self.assertEqual(f2.winfo_x(), 50)
+ f2.place_configure(relx=0.5)
+ self.assertEqual(f2.place_info()['relx'], '0.5')
+ self.root.update()
+ self.assertEqual(f2.winfo_x(), 125)
+ f2.place_configure(relx=1)
+ self.assertEqual(f2.place_info()['relx'], '1')
+ self.root.update()
+ self.assertEqual(f2.winfo_x(), 200)
+ with self.assertRaisesRegexp(TclError, 'expected floating-point number '
+ 'but got "spam"'):
+ f2.place_configure(in_=f, relx='spam')
+
+ def test_place_configure_rely(self):
+ t, f, f2 = self.create2()
+ f2.place_configure(in_=f)
+ self.assertEqual(f2.place_info()['rely'], '0')
+ self.root.update()
+ self.assertEqual(f2.winfo_y(), 40)
+ f2.place_configure(rely=0.5)
+ self.assertEqual(f2.place_info()['rely'], '0.5')
+ self.root.update()
+ self.assertEqual(f2.winfo_y(), 80)
+ f2.place_configure(rely=1)
+ self.assertEqual(f2.place_info()['rely'], '1')
+ self.root.update()
+ self.assertEqual(f2.winfo_y(), 120)
+ with self.assertRaisesRegexp(TclError, 'expected floating-point number '
+ 'but got "spam"'):
+ f2.place_configure(in_=f, rely='spam')
+
+ def test_place_configure_anchor(self):
+ f = tkinter.Frame(self.root)
+ with self.assertRaisesRegexp(TclError, 'bad anchor "j"'):
+ f.place_configure(anchor='j')
+ with self.assertRaisesRegexp(TclError, 'ambiguous anchor ""'):
+ f.place_configure(anchor='')
+ for value in 'n', 'ne', 'e', 'se', 's', 'sw', 'w', 'nw', 'center':
+ f.place_configure(anchor=value)
+ self.assertEqual(f.place_info()['anchor'], value)
+
+ def test_place_configure_width(self):
+ t, f, f2 = self.create2()
+ f2.place_configure(in_=f, width=120)
+ self.root.update()
+ self.assertEqual(f2.winfo_width(), 120)
+ f2.place_configure(width='')
+ self.root.update()
+ self.assertEqual(f2.winfo_width(), 30)
+ with self.assertRaisesRegexp(TclError, 'bad screen distance "abcd"'):
+ f2.place_configure(width='abcd')
+
+ def test_place_configure_height(self):
+ t, f, f2 = self.create2()
+ f2.place_configure(in_=f, height=120)
+ self.root.update()
+ self.assertEqual(f2.winfo_height(), 120)
+ f2.place_configure(height='')
+ self.root.update()
+ self.assertEqual(f2.winfo_height(), 60)
+ with self.assertRaisesRegexp(TclError, 'bad screen distance "abcd"'):
+ f2.place_configure(height='abcd')
+
+ def test_place_configure_relwidth(self):
+ t, f, f2 = self.create2()
+ f2.place_configure(in_=f, relwidth=0.5)
+ self.root.update()
+ self.assertEqual(f2.winfo_width(), 75)
+ f2.place_configure(relwidth='')
+ self.root.update()
+ self.assertEqual(f2.winfo_width(), 30)
+ with self.assertRaisesRegexp(TclError, 'expected floating-point number '
+ 'but got "abcd"'):
+ f2.place_configure(relwidth='abcd')
+
+ def test_place_configure_relheight(self):
+ t, f, f2 = self.create2()
+ f2.place_configure(in_=f, relheight=0.5)
+ self.root.update()
+ self.assertEqual(f2.winfo_height(), 40)
+ f2.place_configure(relheight='')
+ self.root.update()
+ self.assertEqual(f2.winfo_height(), 60)
+ with self.assertRaisesRegexp(TclError, 'expected floating-point number '
+ 'but got "abcd"'):
+ f2.place_configure(relheight='abcd')
+
+ def test_place_configure_bordermode(self):
+ f = tkinter.Frame(self.root)
+ with self.assertRaisesRegexp(TclError, 'bad bordermode "j"'):
+ f.place_configure(bordermode='j')
+ with self.assertRaisesRegexp(TclError, 'ambiguous bordermode ""'):
+ f.place_configure(bordermode='')
+ for value in 'inside', 'outside', 'ignore':
+ f.place_configure(bordermode=value)
+ self.assertEqual(f.place_info()['bordermode'], value)
+
+ def test_place_forget(self):
+ foo = tkinter.Frame(self.root)
+ foo.place_configure(width=50, height=50)
+ self.root.update()
+ foo.place_forget()
+ self.root.update()
+ self.assertFalse(foo.winfo_ismapped())
+ with self.assertRaises(TypeError):
+ foo.place_forget(0)
+
+ def test_place_info(self):
+ t, f, f2 = self.create2()
+ f2.place_configure(in_=f, x=1, y=2, width=3, height=4,
+ relx=0.1, rely=0.2, relwidth=0.3, relheight=0.4,
+ anchor='se', bordermode='outside')
+ info = f2.place_info()
+ self.assertIsInstance(info, dict)
+ self.assertEqual(info['x'], '1')
+ self.assertEqual(info['y'], '2')
+ self.assertEqual(info['width'], '3')
+ self.assertEqual(info['height'], '4')
+ self.assertEqual(info['relx'], '0.1')
+ self.assertEqual(info['rely'], '0.2')
+ self.assertEqual(info['relwidth'], '0.3')
+ self.assertEqual(info['relheight'], '0.4')
+ self.assertEqual(info['anchor'], 'se')
+ self.assertEqual(info['bordermode'], 'outside')
+ self.assertEqual(info['x'], '1')
+ self.assertEqual(info['x'], '1')
+ with self.assertRaises(TypeError):
+ f2.place_info(0)
+
+ def test_place_slaves(self):
+ foo = tkinter.Frame(self.root)
+ bar = tkinter.Frame(self.root)
+ self.assertEqual(foo.place_slaves(), [])
+ bar.place_configure(in_=foo)
+ self.assertEqual(foo.place_slaves(), [bar])
+ with self.assertRaises(TypeError):
+ foo.place_slaves(0)
+
+
+class GridTest(AbstractWidgetTest, unittest.TestCase):
+
+ test_keys = None
+
+ def tearDown(self):
+ cols, rows = self.root.grid_size()
+ for i in range(cols + 1):
+ self.root.grid_columnconfigure(i, weight=0, minsize=0, pad=0, uniform='')
+ for i in range(rows + 1):
+ self.root.grid_rowconfigure(i, weight=0, minsize=0, pad=0, uniform='')
+ self.root.grid_propagate(1)
+ super(GridTest, self).tearDown()
+
+ def test_grid_configure(self):
+ b = tkinter.Button(self.root)
+ self.assertEqual(b.grid_info(), {})
+ b.grid_configure()
+ self.assertEqual(b.grid_info()['in'], self.root)
+ self.assertEqual(b.grid_info()['column'], self._str(0))
+ self.assertEqual(b.grid_info()['row'], self._str(0))
+ b.grid_configure({'column': 1}, row=2)
+ self.assertEqual(b.grid_info()['column'], self._str(1))
+ self.assertEqual(b.grid_info()['row'], self._str(2))
+
+ def test_grid_configure_column(self):
+ b = tkinter.Button(self.root)
+ with self.assertRaisesRegexp(TclError, 'bad column value "-1": '
+ 'must be a non-negative integer'):
+ b.grid_configure(column=-1)
+ b.grid_configure(column=2)
+ self.assertEqual(b.grid_info()['column'], self._str(2))
+
+ def test_grid_configure_columnspan(self):
+ b = tkinter.Button(self.root)
+ with self.assertRaisesRegexp(TclError, 'bad columnspan value "0": '
+ 'must be a positive integer'):
+ b.grid_configure(columnspan=0)
+ b.grid_configure(columnspan=2)
+ self.assertEqual(b.grid_info()['columnspan'], self._str(2))
+
+ def test_grid_configure_in(self):
+ f = tkinter.Frame(self.root)
+ b = tkinter.Button(self.root)
+ self.assertEqual(b.grid_info(), {})
+ b.grid_configure()
+ self.assertEqual(b.grid_info()['in'], self.root)
+ b.grid_configure(in_=f)
+ self.assertEqual(b.grid_info()['in'], f)
+ b.grid_configure({'in': self.root})
+ self.assertEqual(b.grid_info()['in'], self.root)
+
+ def test_grid_configure_ipadx(self):
+ b = tkinter.Button(self.root)
+ with self.assertRaisesRegexp(TclError, 'bad ipadx value "-1": '
+ 'must be positive screen distance'):
+ b.grid_configure(ipadx=-1)
+ b.grid_configure(ipadx=1)
+ self.assertEqual(b.grid_info()['ipadx'], self._str(1))
+ b.grid_configure(ipadx='.5c')
+ self.assertEqual(b.grid_info()['ipadx'],
+ self._str(int_round(pixels_conv('.5c') * self.scaling)))
+
+ def test_grid_configure_ipady(self):
+ b = tkinter.Button(self.root)
+ with self.assertRaisesRegexp(TclError, 'bad ipady value "-1": '
+ 'must be positive screen distance'):
+ b.grid_configure(ipady=-1)
+ b.grid_configure(ipady=1)
+ self.assertEqual(b.grid_info()['ipady'], self._str(1))
+ b.grid_configure(ipady='.5c')
+ self.assertEqual(b.grid_info()['ipady'],
+ self._str(int_round(pixels_conv('.5c') * self.scaling)))
+
+ def test_grid_configure_padx(self):
+ b = tkinter.Button(self.root)
+ with self.assertRaisesRegexp(TclError, 'bad pad value "-1": '
+ 'must be positive screen distance'):
+ b.grid_configure(padx=-1)
+ b.grid_configure(padx=1)
+ self.assertEqual(b.grid_info()['padx'], self._str(1))
+ b.grid_configure(padx=(10, 5))
+ self.assertEqual(b.grid_info()['padx'], self._str((10, 5)))
+ b.grid_configure(padx='.5c')
+ self.assertEqual(b.grid_info()['padx'],
+ self._str(int_round(pixels_conv('.5c') * self.scaling)))
+
+ def test_grid_configure_pady(self):
+ b = tkinter.Button(self.root)
+ with self.assertRaisesRegexp(TclError, 'bad pad value "-1": '
+ 'must be positive screen distance'):
+ b.grid_configure(pady=-1)
+ b.grid_configure(pady=1)
+ self.assertEqual(b.grid_info()['pady'], self._str(1))
+ b.grid_configure(pady=(10, 5))
+ self.assertEqual(b.grid_info()['pady'], self._str((10, 5)))
+ b.grid_configure(pady='.5c')
+ self.assertEqual(b.grid_info()['pady'],
+ self._str(int_round(pixels_conv('.5c') * self.scaling)))
+
+ def test_grid_configure_row(self):
+ b = tkinter.Button(self.root)
+ with self.assertRaisesRegexp(TclError, 'bad (row|grid) value "-1": '
+ 'must be a non-negative integer'):
+ b.grid_configure(row=-1)
+ b.grid_configure(row=2)
+ self.assertEqual(b.grid_info()['row'], self._str(2))
+
+ def test_grid_configure_rownspan(self):
+ b = tkinter.Button(self.root)
+ with self.assertRaisesRegexp(TclError, 'bad rowspan value "0": '
+ 'must be a positive integer'):
+ b.grid_configure(rowspan=0)
+ b.grid_configure(rowspan=2)
+ self.assertEqual(b.grid_info()['rowspan'], self._str(2))
+
+ def test_grid_configure_sticky(self):
+ f = tkinter.Frame(self.root, bg='red')
+ with self.assertRaisesRegexp(TclError, 'bad stickyness value "glue"'):
+ f.grid_configure(sticky='glue')
+ f.grid_configure(sticky='ne')
+ self.assertEqual(f.grid_info()['sticky'], 'ne')
+ f.grid_configure(sticky='n,s,e,w')
+ self.assertEqual(f.grid_info()['sticky'], 'nesw')
+
+ def test_grid_columnconfigure(self):
+ with self.assertRaises(TypeError):
+ self.root.grid_columnconfigure()
+ self.assertEqual(self.root.grid_columnconfigure(0),
+ {'minsize': 0, 'pad': 0, 'uniform': None, 'weight': 0})
+ with self.assertRaisesRegexp(TclError, 'bad option "-foo"'):
+ self.root.grid_columnconfigure(0, 'foo')
+ self.root.grid_columnconfigure((0, 3), weight=2)
+ with self.assertRaisesRegexp(TclError,
+ 'must specify a single element on retrieval'):
+ self.root.grid_columnconfigure((0, 3))
+ b = tkinter.Button(self.root)
+ b.grid_configure(column=0, row=0)
+ if tcl_version >= (8, 5):
+ self.root.grid_columnconfigure('all', weight=3)
+ with self.assertRaisesRegexp(TclError, 'expected integer but got "all"'):
+ self.root.grid_columnconfigure('all')
+ self.assertEqual(self.root.grid_columnconfigure(0, 'weight'), 3)
+ self.assertEqual(self.root.grid_columnconfigure(3, 'weight'), 2)
+ self.assertEqual(self.root.grid_columnconfigure(265, 'weight'), 0)
+ if tcl_version >= (8, 5):
+ self.root.grid_columnconfigure(b, weight=4)
+ self.assertEqual(self.root.grid_columnconfigure(0, 'weight'), 4)
+
+ def test_grid_columnconfigure_minsize(self):
+ with self.assertRaisesRegexp(TclError, 'bad screen distance "foo"'):
+ self.root.grid_columnconfigure(0, minsize='foo')
+ self.root.grid_columnconfigure(0, minsize=10)
+ self.assertEqual(self.root.grid_columnconfigure(0, 'minsize'), 10)
+ self.assertEqual(self.root.grid_columnconfigure(0)['minsize'], 10)
+
+ def test_grid_columnconfigure_weight(self):
+ with self.assertRaisesRegexp(TclError, 'expected integer but got "bad"'):
+ self.root.grid_columnconfigure(0, weight='bad')
+ with self.assertRaisesRegexp(TclError, 'invalid arg "-weight": '
+ 'should be non-negative'):
+ self.root.grid_columnconfigure(0, weight=-3)
+ self.root.grid_columnconfigure(0, weight=3)
+ self.assertEqual(self.root.grid_columnconfigure(0, 'weight'), 3)
+ self.assertEqual(self.root.grid_columnconfigure(0)['weight'], 3)
+
+ def test_grid_columnconfigure_pad(self):
+ with self.assertRaisesRegexp(TclError, 'bad screen distance "foo"'):
+ self.root.grid_columnconfigure(0, pad='foo')
+ with self.assertRaisesRegexp(TclError, 'invalid arg "-pad": '
+ 'should be non-negative'):
+ self.root.grid_columnconfigure(0, pad=-3)
+ self.root.grid_columnconfigure(0, pad=3)
+ self.assertEqual(self.root.grid_columnconfigure(0, 'pad'), 3)
+ self.assertEqual(self.root.grid_columnconfigure(0)['pad'], 3)
+
+ def test_grid_columnconfigure_uniform(self):
+ self.root.grid_columnconfigure(0, uniform='foo')
+ self.assertEqual(self.root.grid_columnconfigure(0, 'uniform'), 'foo')
+ self.assertEqual(self.root.grid_columnconfigure(0)['uniform'], 'foo')
+
+ def test_grid_rowconfigure(self):
+ with self.assertRaises(TypeError):
+ self.root.grid_rowconfigure()
+ self.assertEqual(self.root.grid_rowconfigure(0),
+ {'minsize': 0, 'pad': 0, 'uniform': None, 'weight': 0})
+ with self.assertRaisesRegexp(TclError, 'bad option "-foo"'):
+ self.root.grid_rowconfigure(0, 'foo')
+ self.root.grid_rowconfigure((0, 3), weight=2)
+ with self.assertRaisesRegexp(TclError,
+ 'must specify a single element on retrieval'):
+ self.root.grid_rowconfigure((0, 3))
+ b = tkinter.Button(self.root)
+ b.grid_configure(column=0, row=0)
+ if tcl_version >= (8, 5):
+ self.root.grid_rowconfigure('all', weight=3)
+ with self.assertRaisesRegexp(TclError, 'expected integer but got "all"'):
+ self.root.grid_rowconfigure('all')
+ self.assertEqual(self.root.grid_rowconfigure(0, 'weight'), 3)
+ self.assertEqual(self.root.grid_rowconfigure(3, 'weight'), 2)
+ self.assertEqual(self.root.grid_rowconfigure(265, 'weight'), 0)
+ if tcl_version >= (8, 5):
+ self.root.grid_rowconfigure(b, weight=4)
+ self.assertEqual(self.root.grid_rowconfigure(0, 'weight'), 4)
+
+ def test_grid_rowconfigure_minsize(self):
+ with self.assertRaisesRegexp(TclError, 'bad screen distance "foo"'):
+ self.root.grid_rowconfigure(0, minsize='foo')
+ self.root.grid_rowconfigure(0, minsize=10)
+ self.assertEqual(self.root.grid_rowconfigure(0, 'minsize'), 10)
+ self.assertEqual(self.root.grid_rowconfigure(0)['minsize'], 10)
+
+ def test_grid_rowconfigure_weight(self):
+ with self.assertRaisesRegexp(TclError, 'expected integer but got "bad"'):
+ self.root.grid_rowconfigure(0, weight='bad')
+ with self.assertRaisesRegexp(TclError, 'invalid arg "-weight": '
+ 'should be non-negative'):
+ self.root.grid_rowconfigure(0, weight=-3)
+ self.root.grid_rowconfigure(0, weight=3)
+ self.assertEqual(self.root.grid_rowconfigure(0, 'weight'), 3)
+ self.assertEqual(self.root.grid_rowconfigure(0)['weight'], 3)
+
+ def test_grid_rowconfigure_pad(self):
+ with self.assertRaisesRegexp(TclError, 'bad screen distance "foo"'):
+ self.root.grid_rowconfigure(0, pad='foo')
+ with self.assertRaisesRegexp(TclError, 'invalid arg "-pad": '
+ 'should be non-negative'):
+ self.root.grid_rowconfigure(0, pad=-3)
+ self.root.grid_rowconfigure(0, pad=3)
+ self.assertEqual(self.root.grid_rowconfigure(0, 'pad'), 3)
+ self.assertEqual(self.root.grid_rowconfigure(0)['pad'], 3)
+
+ def test_grid_rowconfigure_uniform(self):
+ self.root.grid_rowconfigure(0, uniform='foo')
+ self.assertEqual(self.root.grid_rowconfigure(0, 'uniform'), 'foo')
+ self.assertEqual(self.root.grid_rowconfigure(0)['uniform'], 'foo')
+
+ def test_grid_forget(self):
+ b = tkinter.Button(self.root)
+ c = tkinter.Button(self.root)
+ b.grid_configure(row=2, column=2, rowspan=2, columnspan=2,
+ padx=3, pady=4, sticky='ns')
+ self.assertEqual(self.root.grid_slaves(), [b])
+ b.grid_forget()
+ c.grid_forget()
+ self.assertEqual(self.root.grid_slaves(), [])
+ self.assertEqual(b.grid_info(), {})
+ b.grid_configure(row=0, column=0)
+ info = b.grid_info()
+ self.assertEqual(info['row'], self._str(0))
+ self.assertEqual(info['column'], self._str(0))
+ self.assertEqual(info['rowspan'], self._str(1))
+ self.assertEqual(info['columnspan'], self._str(1))
+ self.assertEqual(info['padx'], self._str(0))
+ self.assertEqual(info['pady'], self._str(0))
+ self.assertEqual(info['sticky'], '')
+
+ def test_grid_remove(self):
+ b = tkinter.Button(self.root)
+ c = tkinter.Button(self.root)
+ b.grid_configure(row=2, column=2, rowspan=2, columnspan=2,
+ padx=3, pady=4, sticky='ns')
+ self.assertEqual(self.root.grid_slaves(), [b])
+ b.grid_remove()
+ c.grid_remove()
+ self.assertEqual(self.root.grid_slaves(), [])
+ self.assertEqual(b.grid_info(), {})
+ b.grid_configure(row=0, column=0)
+ info = b.grid_info()
+ self.assertEqual(info['row'], self._str(0))
+ self.assertEqual(info['column'], self._str(0))
+ self.assertEqual(info['rowspan'], self._str(2))
+ self.assertEqual(info['columnspan'], self._str(2))
+ self.assertEqual(info['padx'], self._str(3))
+ self.assertEqual(info['pady'], self._str(4))
+ self.assertEqual(info['sticky'], 'ns')
+
+ def test_grid_info(self):
+ b = tkinter.Button(self.root)
+ self.assertEqual(b.grid_info(), {})
+ b.grid_configure(row=2, column=2, rowspan=2, columnspan=2,
+ padx=3, pady=4, sticky='ns')
+ info = b.grid_info()
+ self.assertIsInstance(info, dict)
+ self.assertEqual(info['in'], self.root)
+ self.assertEqual(info['row'], self._str(2))
+ self.assertEqual(info['column'], self._str(2))
+ self.assertEqual(info['rowspan'], self._str(2))
+ self.assertEqual(info['columnspan'], self._str(2))
+ self.assertEqual(info['padx'], self._str(3))
+ self.assertEqual(info['pady'], self._str(4))
+ self.assertEqual(info['sticky'], 'ns')
+
+ def test_grid_bbox(self):
+ self.assertEqual(self.root.grid_bbox(), (0, 0, 0, 0))
+ self.assertEqual(self.root.grid_bbox(0, 0), (0, 0, 0, 0))
+ self.assertEqual(self.root.grid_bbox(0, 0, 1, 1), (0, 0, 0, 0))
+ with self.assertRaisesRegexp(TclError, 'expected integer but got "x"'):
+ self.root.grid_bbox('x', 0)
+ with self.assertRaisesRegexp(TclError, 'expected integer but got "x"'):
+ self.root.grid_bbox(0, 'x')
+ with self.assertRaisesRegexp(TclError, 'expected integer but got "x"'):
+ self.root.grid_bbox(0, 0, 'x', 0)
+ with self.assertRaisesRegexp(TclError, 'expected integer but got "x"'):
+ self.root.grid_bbox(0, 0, 0, 'x')
+ with self.assertRaises(TypeError):
+ self.root.grid_bbox(0, 0, 0, 0, 0)
+ t = self.root
+ # de-maximize
+ t.wm_geometry('1x1+0+0')
+ t.wm_geometry('')
+ f1 = tkinter.Frame(t, width=75, height=75, bg='red')
+ f2 = tkinter.Frame(t, width=90, height=90, bg='blue')
+ f1.grid_configure(row=0, column=0)
+ f2.grid_configure(row=1, column=1)
+ self.root.update()
+ self.assertEqual(t.grid_bbox(), (0, 0, 165, 165))
+ self.assertEqual(t.grid_bbox(0, 0), (0, 0, 75, 75))
+ self.assertEqual(t.grid_bbox(0, 0, 1, 1), (0, 0, 165, 165))
+ self.assertEqual(t.grid_bbox(1, 1), (75, 75, 90, 90))
+ self.assertEqual(t.grid_bbox(10, 10, 0, 0), (0, 0, 165, 165))
+ self.assertEqual(t.grid_bbox(-2, -2, -1, -1), (0, 0, 0, 0))
+ self.assertEqual(t.grid_bbox(10, 10, 12, 12), (165, 165, 0, 0))
+
+ def test_grid_location(self):
+ with self.assertRaises(TypeError):
+ self.root.grid_location()
+ with self.assertRaises(TypeError):
+ self.root.grid_location(0)
+ with self.assertRaises(TypeError):
+ self.root.grid_location(0, 0, 0)
+ with self.assertRaisesRegexp(TclError, 'bad screen distance "x"'):
+ self.root.grid_location('x', 'y')
+ with self.assertRaisesRegexp(TclError, 'bad screen distance "y"'):
+ self.root.grid_location('1c', 'y')
+ t = self.root
+ # de-maximize
+ t.wm_geometry('1x1+0+0')
+ t.wm_geometry('')
+ f = tkinter.Frame(t, width=200, height=100,
+ highlightthickness=0, bg='red')
+ self.assertEqual(f.grid_location(10, 10), (-1, -1))
+ f.grid_configure()
+ self.root.update()
+ self.assertEqual(t.grid_location(-10, -10), (-1, -1))
+ self.assertEqual(t.grid_location(-10, 0), (-1, 0))
+ self.assertEqual(t.grid_location(-1, 0), (-1, 0))
+ self.assertEqual(t.grid_location(0, -10), (0, -1))
+ self.assertEqual(t.grid_location(0, -1), (0, -1))
+ self.assertEqual(t.grid_location(0, 0), (0, 0))
+ self.assertEqual(t.grid_location(200, 0), (0, 0))
+ self.assertEqual(t.grid_location(201, 0), (1, 0))
+ self.assertEqual(t.grid_location(0, 100), (0, 0))
+ self.assertEqual(t.grid_location(0, 101), (0, 1))
+ self.assertEqual(t.grid_location(201, 101), (1, 1))
+
+ def test_grid_propagate(self):
+ self.assertEqual(self.root.grid_propagate(), True)
+ with self.assertRaises(TypeError):
+ self.root.grid_propagate(False, False)
+ self.root.grid_propagate(False)
+ self.assertFalse(self.root.grid_propagate())
+ f = tkinter.Frame(self.root, width=100, height=100, bg='red')
+ f.grid_configure(row=0, column=0)
+ self.root.update()
+ self.assertEqual(f.winfo_width(), 100)
+ self.assertEqual(f.winfo_height(), 100)
+ f.grid_propagate(False)
+ g = tkinter.Frame(self.root, width=75, height=85, bg='green')
+ g.grid_configure(in_=f, row=0, column=0)
+ self.root.update()
+ self.assertEqual(f.winfo_width(), 100)
+ self.assertEqual(f.winfo_height(), 100)
+ f.grid_propagate(True)
+ self.root.update()
+ self.assertEqual(f.winfo_width(), 75)
+ self.assertEqual(f.winfo_height(), 85)
+
+ def test_grid_size(self):
+ with self.assertRaises(TypeError):
+ self.root.grid_size(0)
+ self.assertEqual(self.root.grid_size(), (0, 0))
+ f = tkinter.Scale(self.root)
+ f.grid_configure(row=0, column=0)
+ self.assertEqual(self.root.grid_size(), (1, 1))
+ f.grid_configure(row=4, column=5)
+ self.assertEqual(self.root.grid_size(), (6, 5))
+
+ def test_grid_slaves(self):
+ self.assertEqual(self.root.grid_slaves(), [])
+ a = tkinter.Label(self.root)
+ a.grid_configure(row=0, column=1)
+ b = tkinter.Label(self.root)
+ b.grid_configure(row=1, column=0)
+ c = tkinter.Label(self.root)
+ c.grid_configure(row=1, column=1)
+ d = tkinter.Label(self.root)
+ d.grid_configure(row=1, column=1)
+ self.assertEqual(self.root.grid_slaves(), [d, c, b, a])
+ self.assertEqual(self.root.grid_slaves(row=0), [a])
+ self.assertEqual(self.root.grid_slaves(row=1), [d, c, b])
+ self.assertEqual(self.root.grid_slaves(column=0), [b])
+ self.assertEqual(self.root.grid_slaves(column=1), [d, c, a])
+ self.assertEqual(self.root.grid_slaves(row=1, column=1), [d, c])
+
+
+tests_gui = (
+ PackTest, PlaceTest, GridTest,
+)
+
+if __name__ == '__main__':
+ run_unittest(*tests_gui)
diff --git a/lib/python2.7/lib-tk/test/test_tkinter/test_images.py b/lib/python2.7/lib-tk/test/test_tkinter/test_images.py
new file mode 100644
index 00000000..b9f97737
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_tkinter/test_images.py
@@ -0,0 +1,328 @@
+import unittest
+import Tkinter as tkinter
+import ttk
+import test.test_support as support
+from test_ttk.support import AbstractTkTest, requires_tcl
+
+support.requires('gui')
+
+
+class MiscTest(AbstractTkTest, unittest.TestCase):
+
+ def test_image_types(self):
+ image_types = self.root.image_types()
+ self.assertIsInstance(image_types, tuple)
+ self.assertIn('photo', image_types)
+ self.assertIn('bitmap', image_types)
+
+ def test_image_names(self):
+ image_names = self.root.image_names()
+ self.assertIsInstance(image_names, tuple)
+
+
+class BitmapImageTest(AbstractTkTest, unittest.TestCase):
+
+ @classmethod
+ def setUpClass(cls):
+ AbstractTkTest.setUpClass.__func__(cls)
+ cls.testfile = support.findfile('python.xbm', subdir='imghdrdata')
+
+ def test_create_from_file(self):
+ image = tkinter.BitmapImage('::img::test', master=self.root,
+ foreground='yellow', background='blue',
+ file=self.testfile)
+ self.assertEqual(str(image), '::img::test')
+ self.assertEqual(image.type(), 'bitmap')
+ self.assertEqual(image.width(), 16)
+ self.assertEqual(image.height(), 16)
+ self.assertIn('::img::test', self.root.image_names())
+ del image
+ self.assertNotIn('::img::test', self.root.image_names())
+
+ def test_create_from_data(self):
+ with open(self.testfile, 'rb') as f:
+ data = f.read()
+ image = tkinter.BitmapImage('::img::test', master=self.root,
+ foreground='yellow', background='blue',
+ data=data)
+ self.assertEqual(str(image), '::img::test')
+ self.assertEqual(image.type(), 'bitmap')
+ self.assertEqual(image.width(), 16)
+ self.assertEqual(image.height(), 16)
+ self.assertIn('::img::test', self.root.image_names())
+ del image
+ self.assertNotIn('::img::test', self.root.image_names())
+
+ def assertEqualStrList(self, actual, expected):
+ self.assertIsInstance(actual, str)
+ self.assertEqual(self.root.splitlist(actual), expected)
+
+ def test_configure_data(self):
+ image = tkinter.BitmapImage('::img::test', master=self.root)
+ self.assertEqual(image['data'], '-data {} {} {} {}')
+ with open(self.testfile, 'rb') as f:
+ data = f.read()
+ image.configure(data=data)
+ self.assertEqualStrList(image['data'],
+ ('-data', '', '', '', data))
+ self.assertEqual(image.width(), 16)
+ self.assertEqual(image.height(), 16)
+
+ self.assertEqual(image['maskdata'], '-maskdata {} {} {} {}')
+ image.configure(maskdata=data)
+ self.assertEqualStrList(image['maskdata'],
+ ('-maskdata', '', '', '', data))
+
+ def test_configure_file(self):
+ image = tkinter.BitmapImage('::img::test', master=self.root)
+ self.assertEqual(image['file'], '-file {} {} {} {}')
+ image.configure(file=self.testfile)
+ self.assertEqualStrList(image['file'],
+ ('-file', '', '', '',self.testfile))
+ self.assertEqual(image.width(), 16)
+ self.assertEqual(image.height(), 16)
+
+ self.assertEqual(image['maskfile'], '-maskfile {} {} {} {}')
+ image.configure(maskfile=self.testfile)
+ self.assertEqualStrList(image['maskfile'],
+ ('-maskfile', '', '', '', self.testfile))
+
+ def test_configure_background(self):
+ image = tkinter.BitmapImage('::img::test', master=self.root)
+ self.assertEqual(image['background'], '-background {} {} {} {}')
+ image.configure(background='blue')
+ self.assertEqual(image['background'], '-background {} {} {} blue')
+
+ def test_configure_foreground(self):
+ image = tkinter.BitmapImage('::img::test', master=self.root)
+ self.assertEqual(image['foreground'],
+ '-foreground {} {} #000000 #000000')
+ image.configure(foreground='yellow')
+ self.assertEqual(image['foreground'],
+ '-foreground {} {} #000000 yellow')
+
+
+class PhotoImageTest(AbstractTkTest, unittest.TestCase):
+
+ @classmethod
+ def setUpClass(cls):
+ AbstractTkTest.setUpClass.__func__(cls)
+ cls.testfile = support.findfile('python.gif', subdir='imghdrdata')
+
+ def create(self):
+ return tkinter.PhotoImage('::img::test', master=self.root,
+ file=self.testfile)
+
+ def colorlist(self, *args):
+ if tkinter.TkVersion >= 8.6 and self.wantobjects:
+ return args
+ else:
+ return tkinter._join(args)
+
+ def check_create_from_file(self, ext):
+ testfile = support.findfile('python.' + ext, subdir='imghdrdata')
+ image = tkinter.PhotoImage('::img::test', master=self.root,
+ file=testfile)
+ self.assertEqual(str(image), '::img::test')
+ self.assertEqual(image.type(), 'photo')
+ self.assertEqual(image.width(), 16)
+ self.assertEqual(image.height(), 16)
+ self.assertEqual(image['data'], '')
+ self.assertEqual(image['file'], testfile)
+ self.assertIn('::img::test', self.root.image_names())
+ del image
+ self.assertNotIn('::img::test', self.root.image_names())
+
+ def check_create_from_data(self, ext):
+ testfile = support.findfile('python.' + ext, subdir='imghdrdata')
+ with open(testfile, 'rb') as f:
+ data = f.read()
+ image = tkinter.PhotoImage('::img::test', master=self.root,
+ data=data)
+ self.assertEqual(str(image), '::img::test')
+ self.assertEqual(image.type(), 'photo')
+ self.assertEqual(image.width(), 16)
+ self.assertEqual(image.height(), 16)
+ self.assertEqual(image['data'], data if self.wantobjects
+ else data.decode('latin1'))
+ self.assertEqual(image['file'], '')
+ self.assertIn('::img::test', self.root.image_names())
+ del image
+ self.assertNotIn('::img::test', self.root.image_names())
+
+ def test_create_from_ppm_file(self):
+ self.check_create_from_file('ppm')
+
+ def test_create_from_ppm_data(self):
+ self.check_create_from_data('ppm')
+
+ def test_create_from_pgm_file(self):
+ self.check_create_from_file('pgm')
+
+ def test_create_from_pgm_data(self):
+ self.check_create_from_data('pgm')
+
+ def test_create_from_gif_file(self):
+ self.check_create_from_file('gif')
+
+ def test_create_from_gif_data(self):
+ self.check_create_from_data('gif')
+
+ @requires_tcl(8, 6)
+ def test_create_from_png_file(self):
+ self.check_create_from_file('png')
+
+ @requires_tcl(8, 6)
+ def test_create_from_png_data(self):
+ self.check_create_from_data('png')
+
+ def test_configure_data(self):
+ image = tkinter.PhotoImage('::img::test', master=self.root)
+ self.assertEqual(image['data'], '')
+ with open(self.testfile, 'rb') as f:
+ data = f.read()
+ image.configure(data=data)
+ self.assertEqual(image['data'], data if self.wantobjects
+ else data.decode('latin1'))
+ self.assertEqual(image.width(), 16)
+ self.assertEqual(image.height(), 16)
+
+ def test_configure_format(self):
+ image = tkinter.PhotoImage('::img::test', master=self.root)
+ self.assertEqual(image['format'], '')
+ image.configure(file=self.testfile, format='gif')
+ self.assertEqual(image['format'], ('gif',) if self.wantobjects
+ else 'gif')
+ self.assertEqual(image.width(), 16)
+ self.assertEqual(image.height(), 16)
+
+ def test_configure_file(self):
+ image = tkinter.PhotoImage('::img::test', master=self.root)
+ self.assertEqual(image['file'], '')
+ image.configure(file=self.testfile)
+ self.assertEqual(image['file'], self.testfile)
+ self.assertEqual(image.width(), 16)
+ self.assertEqual(image.height(), 16)
+
+ def test_configure_gamma(self):
+ image = tkinter.PhotoImage('::img::test', master=self.root)
+ self.assertEqual(image['gamma'], '1.0')
+ image.configure(gamma=2.0)
+ self.assertEqual(image['gamma'], '2.0')
+
+ def test_configure_width_height(self):
+ image = tkinter.PhotoImage('::img::test', master=self.root)
+ self.assertEqual(image['width'], '0')
+ self.assertEqual(image['height'], '0')
+ image.configure(width=20)
+ image.configure(height=10)
+ self.assertEqual(image['width'], '20')
+ self.assertEqual(image['height'], '10')
+ self.assertEqual(image.width(), 20)
+ self.assertEqual(image.height(), 10)
+
+ def test_configure_palette(self):
+ image = tkinter.PhotoImage('::img::test', master=self.root)
+ self.assertEqual(image['palette'], '')
+ image.configure(palette=256)
+ self.assertEqual(image['palette'], '256')
+ image.configure(palette='3/4/2')
+ self.assertEqual(image['palette'], '3/4/2')
+
+ def test_blank(self):
+ image = self.create()
+ image.blank()
+ self.assertEqual(image.width(), 16)
+ self.assertEqual(image.height(), 16)
+ self.assertEqual(image.get(4, 6), self.colorlist(0, 0, 0))
+
+ def test_copy(self):
+ image = self.create()
+ image2 = image.copy()
+ self.assertEqual(image2.width(), 16)
+ self.assertEqual(image2.height(), 16)
+ self.assertEqual(image.get(4, 6), image.get(4, 6))
+
+ def test_subsample(self):
+ image = self.create()
+ image2 = image.subsample(2, 3)
+ self.assertEqual(image2.width(), 8)
+ self.assertEqual(image2.height(), 6)
+ self.assertEqual(image2.get(2, 2), image.get(4, 6))
+
+ image2 = image.subsample(2)
+ self.assertEqual(image2.width(), 8)
+ self.assertEqual(image2.height(), 8)
+ self.assertEqual(image2.get(2, 3), image.get(4, 6))
+
+ def test_zoom(self):
+ image = self.create()
+ image2 = image.zoom(2, 3)
+ self.assertEqual(image2.width(), 32)
+ self.assertEqual(image2.height(), 48)
+ self.assertEqual(image2.get(8, 18), image.get(4, 6))
+ self.assertEqual(image2.get(9, 20), image.get(4, 6))
+
+ image2 = image.zoom(2)
+ self.assertEqual(image2.width(), 32)
+ self.assertEqual(image2.height(), 32)
+ self.assertEqual(image2.get(8, 12), image.get(4, 6))
+ self.assertEqual(image2.get(9, 13), image.get(4, 6))
+
+ def test_put(self):
+ image = self.create()
+ image.put('{red green} {blue yellow}', to=(4, 6))
+ self.assertEqual(image.get(4, 6), self.colorlist(255, 0, 0))
+ self.assertEqual(image.get(5, 6),
+ self.colorlist(0, 128 if tkinter.TkVersion >= 8.6
+ else 255, 0))
+ self.assertEqual(image.get(4, 7), self.colorlist(0, 0, 255))
+ self.assertEqual(image.get(5, 7), self.colorlist(255, 255, 0))
+
+ image.put((('#f00', '#00ff00'), ('#000000fff', '#ffffffff0000')))
+ self.assertEqual(image.get(0, 0), self.colorlist(255, 0, 0))
+ self.assertEqual(image.get(1, 0), self.colorlist(0, 255, 0))
+ self.assertEqual(image.get(0, 1), self.colorlist(0, 0, 255))
+ self.assertEqual(image.get(1, 1), self.colorlist(255, 255, 0))
+
+ def test_get(self):
+ image = self.create()
+ self.assertEqual(image.get(4, 6), self.colorlist(62, 116, 162))
+ self.assertEqual(image.get(0, 0), self.colorlist(0, 0, 0))
+ self.assertEqual(image.get(15, 15), self.colorlist(0, 0, 0))
+ self.assertRaises(tkinter.TclError, image.get, -1, 0)
+ self.assertRaises(tkinter.TclError, image.get, 0, -1)
+ self.assertRaises(tkinter.TclError, image.get, 16, 15)
+ self.assertRaises(tkinter.TclError, image.get, 15, 16)
+
+ def test_write(self):
+ image = self.create()
+ self.addCleanup(support.unlink, support.TESTFN)
+
+ image.write(support.TESTFN)
+ image2 = tkinter.PhotoImage('::img::test2', master=self.root,
+ format='ppm',
+ file=support.TESTFN)
+ self.assertEqual(str(image2), '::img::test2')
+ self.assertEqual(image2.type(), 'photo')
+ self.assertEqual(image2.width(), 16)
+ self.assertEqual(image2.height(), 16)
+ self.assertEqual(image2.get(0, 0), image.get(0, 0))
+ self.assertEqual(image2.get(15, 8), image.get(15, 8))
+
+ image.write(support.TESTFN, format='gif', from_coords=(4, 6, 6, 9))
+ image3 = tkinter.PhotoImage('::img::test3', master=self.root,
+ format='gif',
+ file=support.TESTFN)
+ self.assertEqual(str(image3), '::img::test3')
+ self.assertEqual(image3.type(), 'photo')
+ self.assertEqual(image3.width(), 2)
+ self.assertEqual(image3.height(), 3)
+ self.assertEqual(image3.get(0, 0), image.get(4, 6))
+ self.assertEqual(image3.get(1, 2), image.get(5, 8))
+
+
+tests_gui = (MiscTest, BitmapImageTest, PhotoImageTest,)
+
+if __name__ == "__main__":
+ support.run_unittest(*tests_gui)
diff --git a/lib/python2.7/lib-tk/test/test_tkinter/test_loadtk.py b/lib/python2.7/lib-tk/test/test_tkinter/test_loadtk.py
new file mode 100644
index 00000000..32c640de
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_tkinter/test_loadtk.py
@@ -0,0 +1,45 @@
+import os
+import sys
+import unittest
+from test import test_support
+from Tkinter import Tcl, TclError
+
+test_support.requires('gui')
+
+class TkLoadTest(unittest.TestCase):
+
+ @unittest.skipIf('DISPLAY' not in os.environ, 'No $DISPLAY set.')
+ def testLoadTk(self):
+ tcl = Tcl()
+ self.assertRaises(TclError,tcl.winfo_geometry)
+ tcl.loadtk()
+ self.assertEqual('1x1+0+0', tcl.winfo_geometry())
+ tcl.destroy()
+
+ def testLoadTkFailure(self):
+ old_display = None
+ if sys.platform.startswith(('win', 'darwin', 'cygwin')):
+ # no failure possible on windows?
+
+ # XXX Maybe on tk older than 8.4.13 it would be possible,
+ # see tkinter.h.
+ return
+ with test_support.EnvironmentVarGuard() as env:
+ if 'DISPLAY' in os.environ:
+ del env['DISPLAY']
+ # on some platforms, deleting environment variables
+ # doesn't actually carry through to the process level
+ # because they don't support unsetenv
+ # If that's the case, abort.
+ display = os.popen('echo $DISPLAY').read().strip()
+ if display:
+ return
+
+ tcl = Tcl()
+ self.assertRaises(TclError, tcl.winfo_geometry)
+ self.assertRaises(TclError, tcl.loadtk)
+
+tests_gui = (TkLoadTest, )
+
+if __name__ == "__main__":
+ test_support.run_unittest(*tests_gui)
diff --git a/lib/python2.7/lib-tk/test/test_tkinter/test_text.py b/lib/python2.7/lib-tk/test/test_tkinter/test_text.py
new file mode 100644
index 00000000..a439b6c4
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_tkinter/test_text.py
@@ -0,0 +1,47 @@
+import unittest
+import Tkinter as tkinter
+from test.test_support import requires, run_unittest
+from test_ttk.support import AbstractTkTest
+
+requires('gui')
+
+class TextTest(AbstractTkTest, unittest.TestCase):
+
+ def setUp(self):
+ super(TextTest, self).setUp()
+ self.text = tkinter.Text(self.root)
+
+ def test_debug(self):
+ text = self.text
+ olddebug = text.debug()
+ try:
+ text.debug(0)
+ self.assertEqual(text.debug(), 0)
+ text.debug(1)
+ self.assertEqual(text.debug(), 1)
+ finally:
+ text.debug(olddebug)
+ self.assertEqual(text.debug(), olddebug)
+
+ def test_search(self):
+ text = self.text
+
+ # pattern and index are obligatory arguments.
+ self.assertRaises(tkinter.TclError, text.search, None, '1.0')
+ self.assertRaises(tkinter.TclError, text.search, 'a', None)
+ self.assertRaises(tkinter.TclError, text.search, None, None)
+
+ # Invalid text index.
+ self.assertRaises(tkinter.TclError, text.search, '', 0)
+
+ # Check if we are getting the indices as strings -- you are likely
+ # to get Tcl_Obj under Tk 8.5 if Tkinter doesn't convert it.
+ text.insert('1.0', 'hi-test')
+ self.assertEqual(text.search('-test', '1.0', 'end'), '1.2')
+ self.assertEqual(text.search('test', '1.0', 'end'), '1.3')
+
+
+tests_gui = (TextTest, )
+
+if __name__ == "__main__":
+ run_unittest(*tests_gui)
diff --git a/lib/python2.7/lib-tk/test/test_tkinter/test_variables.py b/lib/python2.7/lib-tk/test/test_tkinter/test_variables.py
new file mode 100644
index 00000000..11f94149
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_tkinter/test_variables.py
@@ -0,0 +1,257 @@
+import unittest
+import gc
+from Tkinter import (Variable, StringVar, IntVar, DoubleVar, BooleanVar, Tcl,
+ TclError)
+
+
+class TestBase(unittest.TestCase):
+
+ def setUp(self):
+ self.root = Tcl()
+
+ def tearDown(self):
+ del self.root
+
+
+class TestVariable(TestBase):
+
+ def info_exists(self, *args):
+ return self.root.getboolean(self.root.call("info", "exists", *args))
+
+ def test_default(self):
+ v = Variable(self.root)
+ self.assertEqual("", v.get())
+ self.assertRegexpMatches(str(v), r"^PY_VAR(\d+)$")
+
+ def test_name_and_value(self):
+ v = Variable(self.root, "sample string", "varname")
+ self.assertEqual("sample string", v.get())
+ self.assertEqual("varname", str(v))
+
+ def test___del__(self):
+ self.assertFalse(self.info_exists("varname"))
+ v = Variable(self.root, "sample string", "varname")
+ self.assertTrue(self.info_exists("varname"))
+ del v
+ self.assertFalse(self.info_exists("varname"))
+
+ def test_dont_unset_not_existing(self):
+ self.assertFalse(self.info_exists("varname"))
+ v1 = Variable(self.root, name="name")
+ v2 = Variable(self.root, name="name")
+ del v1
+ self.assertFalse(self.info_exists("name"))
+ # shouldn't raise exception
+ del v2
+ self.assertFalse(self.info_exists("name"))
+
+ def test___eq__(self):
+ # values doesn't matter, only class and name are checked
+ v1 = Variable(self.root, name="abc")
+ v2 = Variable(self.root, name="abc")
+ self.assertEqual(v1, v2)
+
+ v3 = Variable(self.root, name="abc")
+ v4 = StringVar(self.root, name="abc")
+ self.assertNotEqual(v3, v4)
+
+ def test_invalid_name(self):
+ with self.assertRaises(TypeError):
+ Variable(self.root, name=123)
+
+ def test_null_in_name(self):
+ with self.assertRaises(ValueError):
+ Variable(self.root, name='var\x00name')
+ with self.assertRaises(ValueError):
+ self.root.globalsetvar('var\x00name', "value")
+ with self.assertRaises(ValueError):
+ self.root.setvar('var\x00name', "value")
+
+ def test_trace(self):
+ v = Variable(self.root)
+ vname = str(v)
+ trace = []
+ def read_tracer(*args):
+ trace.append(('read',) + args)
+ def write_tracer(*args):
+ trace.append(('write',) + args)
+ cb1 = v.trace_variable('r', read_tracer)
+ cb2 = v.trace_variable('wu', write_tracer)
+ self.assertEqual(sorted(v.trace_vinfo()), [('r', cb1), ('wu', cb2)])
+ self.assertEqual(trace, [])
+
+ v.set('spam')
+ self.assertEqual(trace, [('write', vname, '', 'w')])
+
+ trace = []
+ v.get()
+ self.assertEqual(trace, [('read', vname, '', 'r')])
+
+ trace = []
+ info = sorted(v.trace_vinfo())
+ v.trace_vdelete('w', cb1) # Wrong mode
+ self.assertEqual(sorted(v.trace_vinfo()), info)
+ with self.assertRaises(TclError):
+ v.trace_vdelete('r', 'spam') # Wrong command name
+ self.assertEqual(sorted(v.trace_vinfo()), info)
+ v.trace_vdelete('r', (cb1, 43)) # Wrong arguments
+ self.assertEqual(sorted(v.trace_vinfo()), info)
+ v.get()
+ self.assertEqual(trace, [('read', vname, '', 'r')])
+
+ trace = []
+ v.trace_vdelete('r', cb1)
+ self.assertEqual(v.trace_vinfo(), [('wu', cb2)])
+ v.get()
+ self.assertEqual(trace, [])
+
+ trace = []
+ del write_tracer
+ gc.collect()
+ v.set('eggs')
+ self.assertEqual(trace, [('write', vname, '', 'w')])
+
+ #trace = []
+ #del v
+ #gc.collect()
+ #self.assertEqual(trace, [('write', vname, '', 'u')])
+
+
+class TestStringVar(TestBase):
+
+ def test_default(self):
+ v = StringVar(self.root)
+ self.assertEqual("", v.get())
+
+ def test_get(self):
+ v = StringVar(self.root, "abc", "name")
+ self.assertEqual("abc", v.get())
+ self.root.globalsetvar("name", "value")
+ self.assertEqual("value", v.get())
+
+ def test_get_null(self):
+ v = StringVar(self.root, "abc\x00def", "name")
+ self.assertEqual("abc\x00def", v.get())
+ self.root.globalsetvar("name", "val\x00ue")
+ self.assertEqual("val\x00ue", v.get())
+
+
+class TestIntVar(TestBase):
+
+ def test_default(self):
+ v = IntVar(self.root)
+ self.assertEqual(0, v.get())
+
+ def test_get(self):
+ v = IntVar(self.root, 123, "name")
+ self.assertEqual(123, v.get())
+ self.root.globalsetvar("name", "345")
+ self.assertEqual(345, v.get())
+
+ def test_invalid_value(self):
+ v = IntVar(self.root, name="name")
+ self.root.globalsetvar("name", "value")
+ with self.assertRaises(ValueError):
+ v.get()
+ self.root.globalsetvar("name", "345.0")
+ with self.assertRaises(ValueError):
+ v.get()
+
+
+class TestDoubleVar(TestBase):
+
+ def test_default(self):
+ v = DoubleVar(self.root)
+ self.assertEqual(0.0, v.get())
+
+ def test_get(self):
+ v = DoubleVar(self.root, 1.23, "name")
+ self.assertAlmostEqual(1.23, v.get())
+ self.root.globalsetvar("name", "3.45")
+ self.assertAlmostEqual(3.45, v.get())
+
+ def test_get_from_int(self):
+ v = DoubleVar(self.root, 1.23, "name")
+ self.assertAlmostEqual(1.23, v.get())
+ self.root.globalsetvar("name", "3.45")
+ self.assertAlmostEqual(3.45, v.get())
+ self.root.globalsetvar("name", "456")
+ self.assertAlmostEqual(456, v.get())
+
+ def test_invalid_value(self):
+ v = DoubleVar(self.root, name="name")
+ self.root.globalsetvar("name", "value")
+ with self.assertRaises(ValueError):
+ v.get()
+
+
+class TestBooleanVar(TestBase):
+
+ def test_default(self):
+ v = BooleanVar(self.root)
+ self.assertIs(v.get(), False)
+
+ def test_get(self):
+ v = BooleanVar(self.root, True, "name")
+ self.assertIs(v.get(), True)
+ self.root.globalsetvar("name", "0")
+ self.assertIs(v.get(), False)
+ self.root.globalsetvar("name", 42 if self.root.wantobjects() else 1)
+ self.assertIs(v.get(), True)
+ self.root.globalsetvar("name", 0)
+ self.assertIs(v.get(), False)
+ self.root.globalsetvar("name", 42L if self.root.wantobjects() else 1L)
+ self.assertIs(v.get(), True)
+ self.root.globalsetvar("name", 0L)
+ self.assertIs(v.get(), False)
+ self.root.globalsetvar("name", "on")
+ self.assertIs(v.get(), True)
+ self.root.globalsetvar("name", u"0")
+ self.assertIs(v.get(), False)
+ self.root.globalsetvar("name", u"on")
+ self.assertIs(v.get(), True)
+
+ def test_set(self):
+ true = 1 if self.root.wantobjects() else "1"
+ false = 0 if self.root.wantobjects() else "0"
+ v = BooleanVar(self.root, name="name")
+ v.set(True)
+ self.assertEqual(self.root.globalgetvar("name"), true)
+ v.set("0")
+ self.assertEqual(self.root.globalgetvar("name"), false)
+ v.set(42)
+ self.assertEqual(self.root.globalgetvar("name"), true)
+ v.set(0)
+ self.assertEqual(self.root.globalgetvar("name"), false)
+ v.set(42L)
+ self.assertEqual(self.root.globalgetvar("name"), true)
+ v.set(0L)
+ self.assertEqual(self.root.globalgetvar("name"), false)
+ v.set("on")
+ self.assertEqual(self.root.globalgetvar("name"), true)
+ v.set(u"0")
+ self.assertEqual(self.root.globalgetvar("name"), false)
+ v.set(u"on")
+ self.assertEqual(self.root.globalgetvar("name"), true)
+
+ def test_invalid_value_domain(self):
+ false = 0 if self.root.wantobjects() else "0"
+ v = BooleanVar(self.root, name="name")
+ with self.assertRaises(TclError):
+ v.set("value")
+ self.assertEqual(self.root.globalgetvar("name"), false)
+ self.root.globalsetvar("name", "value")
+ with self.assertRaises(TclError):
+ v.get()
+ self.root.globalsetvar("name", "1.0")
+ with self.assertRaises(TclError):
+ v.get()
+
+
+tests_gui = (TestVariable, TestStringVar, TestIntVar,
+ TestDoubleVar, TestBooleanVar)
+
+
+if __name__ == "__main__":
+ from test.support import run_unittest
+ run_unittest(*tests_gui)
diff --git a/lib/python2.7/lib-tk/test/test_tkinter/test_widgets.py b/lib/python2.7/lib-tk/test/test_tkinter/test_widgets.py
new file mode 100644
index 00000000..4da30961
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_tkinter/test_widgets.py
@@ -0,0 +1,1199 @@
+import unittest
+import Tkinter as tkinter
+from Tkinter import TclError
+import os
+import sys
+from test.test_support import requires, run_unittest
+
+from test_ttk.support import (tcl_version, requires_tcl, get_tk_patchlevel,
+ widget_eq)
+from widget_tests import (
+ add_standard_options, noconv, noconv_meth, int_round, pixels_round,
+ AbstractWidgetTest, StandardOptionsTests,
+ IntegerSizeTests, PixelSizeTests,
+ setUpModule)
+
+requires('gui')
+
+
+class AbstractToplevelTest(AbstractWidgetTest, PixelSizeTests):
+ _conv_pad_pixels = noconv_meth
+
+ def test_class(self):
+ widget = self.create()
+ self.assertEqual(widget['class'],
+ widget.__class__.__name__.title())
+ self.checkInvalidParam(widget, 'class', 'Foo',
+ errmsg="can't modify -class option after widget is created")
+ widget2 = self.create(class_='Foo')
+ self.assertEqual(widget2['class'], 'Foo')
+
+ def test_colormap(self):
+ widget = self.create()
+ self.assertEqual(widget['colormap'], '')
+ self.checkInvalidParam(widget, 'colormap', 'new',
+ errmsg="can't modify -colormap option after widget is created")
+ widget2 = self.create(colormap='new')
+ self.assertEqual(widget2['colormap'], 'new')
+
+ def test_container(self):
+ widget = self.create()
+ self.assertEqual(widget['container'], 0 if self.wantobjects else '0')
+ self.checkInvalidParam(widget, 'container', 1,
+ errmsg="can't modify -container option after widget is created")
+ widget2 = self.create(container=True)
+ self.assertEqual(widget2['container'], 1 if self.wantobjects else '1')
+
+ def test_visual(self):
+ widget = self.create()
+ self.assertEqual(widget['visual'], '')
+ self.checkInvalidParam(widget, 'visual', 'default',
+ errmsg="can't modify -visual option after widget is created")
+ widget2 = self.create(visual='default')
+ self.assertEqual(widget2['visual'], 'default')
+
+
+@add_standard_options(StandardOptionsTests)
+class ToplevelTest(AbstractToplevelTest, unittest.TestCase):
+ OPTIONS = (
+ 'background', 'borderwidth',
+ 'class', 'colormap', 'container', 'cursor', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'menu', 'padx', 'pady', 'relief', 'screen',
+ 'takefocus', 'use', 'visual', 'width',
+ )
+
+ def create(self, **kwargs):
+ return tkinter.Toplevel(self.root, **kwargs)
+
+ def test_menu(self):
+ widget = self.create()
+ menu = tkinter.Menu(self.root)
+ self.checkParam(widget, 'menu', menu, eq=widget_eq)
+ self.checkParam(widget, 'menu', '')
+
+ def test_screen(self):
+ widget = self.create()
+ self.assertEqual(widget['screen'], '')
+ try:
+ display = os.environ['DISPLAY']
+ except KeyError:
+ self.skipTest('No $DISPLAY set.')
+ self.checkInvalidParam(widget, 'screen', display,
+ errmsg="can't modify -screen option after widget is created")
+ widget2 = self.create(screen=display)
+ self.assertEqual(widget2['screen'], display)
+
+ def test_use(self):
+ widget = self.create()
+ self.assertEqual(widget['use'], '')
+ parent = self.create(container=True)
+ wid = parent.winfo_id()
+ widget2 = self.create(use=wid)
+ self.assertEqual(int(widget2['use']), wid)
+
+
+@add_standard_options(StandardOptionsTests)
+class FrameTest(AbstractToplevelTest, unittest.TestCase):
+ OPTIONS = (
+ 'background', 'borderwidth',
+ 'class', 'colormap', 'container', 'cursor', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'padx', 'pady', 'relief', 'takefocus', 'visual', 'width',
+ )
+
+ def create(self, **kwargs):
+ return tkinter.Frame(self.root, **kwargs)
+
+
+@add_standard_options(StandardOptionsTests)
+class LabelFrameTest(AbstractToplevelTest, unittest.TestCase):
+ OPTIONS = (
+ 'background', 'borderwidth',
+ 'class', 'colormap', 'container', 'cursor',
+ 'font', 'foreground', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'labelanchor', 'labelwidget', 'padx', 'pady', 'relief',
+ 'takefocus', 'text', 'visual', 'width',
+ )
+
+ def create(self, **kwargs):
+ return tkinter.LabelFrame(self.root, **kwargs)
+
+ def test_labelanchor(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'labelanchor',
+ 'e', 'en', 'es', 'n', 'ne', 'nw',
+ 's', 'se', 'sw', 'w', 'wn', 'ws')
+ self.checkInvalidParam(widget, 'labelanchor', 'center')
+
+ def test_labelwidget(self):
+ widget = self.create()
+ label = tkinter.Label(self.root, text='Mupp', name='foo')
+ self.checkParam(widget, 'labelwidget', label, expected='.foo')
+ label.destroy()
+
+
+class AbstractLabelTest(AbstractWidgetTest, IntegerSizeTests):
+ _conv_pixels = noconv_meth
+
+ def test_highlightthickness(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'highlightthickness',
+ 0, 1.3, 2.6, 6, -2, '10p')
+
+
+@add_standard_options(StandardOptionsTests)
+class LabelTest(AbstractLabelTest, unittest.TestCase):
+ OPTIONS = (
+ 'activebackground', 'activeforeground', 'anchor',
+ 'background', 'bitmap', 'borderwidth', 'compound', 'cursor',
+ 'disabledforeground', 'font', 'foreground', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'image', 'justify', 'padx', 'pady', 'relief', 'state',
+ 'takefocus', 'text', 'textvariable',
+ 'underline', 'width', 'wraplength',
+ )
+
+ def create(self, **kwargs):
+ return tkinter.Label(self.root, **kwargs)
+
+
+@add_standard_options(StandardOptionsTests)
+class ButtonTest(AbstractLabelTest, unittest.TestCase):
+ OPTIONS = (
+ 'activebackground', 'activeforeground', 'anchor',
+ 'background', 'bitmap', 'borderwidth',
+ 'command', 'compound', 'cursor', 'default',
+ 'disabledforeground', 'font', 'foreground', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'image', 'justify', 'overrelief', 'padx', 'pady', 'relief',
+ 'repeatdelay', 'repeatinterval',
+ 'state', 'takefocus', 'text', 'textvariable',
+ 'underline', 'width', 'wraplength')
+
+ def create(self, **kwargs):
+ return tkinter.Button(self.root, **kwargs)
+
+ def test_default(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'default', 'active', 'disabled', 'normal')
+
+
+@add_standard_options(StandardOptionsTests)
+class CheckbuttonTest(AbstractLabelTest, unittest.TestCase):
+ OPTIONS = (
+ 'activebackground', 'activeforeground', 'anchor',
+ 'background', 'bitmap', 'borderwidth',
+ 'command', 'compound', 'cursor',
+ 'disabledforeground', 'font', 'foreground', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'image', 'indicatoron', 'justify',
+ 'offrelief', 'offvalue', 'onvalue', 'overrelief',
+ 'padx', 'pady', 'relief', 'selectcolor', 'selectimage', 'state',
+ 'takefocus', 'text', 'textvariable',
+ 'tristateimage', 'tristatevalue',
+ 'underline', 'variable', 'width', 'wraplength',
+ )
+
+ def create(self, **kwargs):
+ return tkinter.Checkbutton(self.root, **kwargs)
+
+
+ def test_offvalue(self):
+ widget = self.create()
+ self.checkParams(widget, 'offvalue', 1, 2.3, '', 'any string')
+
+ def test_onvalue(self):
+ widget = self.create()
+ self.checkParams(widget, 'onvalue', 1, 2.3, '', 'any string')
+
+
+@add_standard_options(StandardOptionsTests)
+class RadiobuttonTest(AbstractLabelTest, unittest.TestCase):
+ OPTIONS = (
+ 'activebackground', 'activeforeground', 'anchor',
+ 'background', 'bitmap', 'borderwidth',
+ 'command', 'compound', 'cursor',
+ 'disabledforeground', 'font', 'foreground', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'image', 'indicatoron', 'justify', 'offrelief', 'overrelief',
+ 'padx', 'pady', 'relief', 'selectcolor', 'selectimage', 'state',
+ 'takefocus', 'text', 'textvariable',
+ 'tristateimage', 'tristatevalue',
+ 'underline', 'value', 'variable', 'width', 'wraplength',
+ )
+
+ def create(self, **kwargs):
+ return tkinter.Radiobutton(self.root, **kwargs)
+
+ def test_value(self):
+ widget = self.create()
+ self.checkParams(widget, 'value', 1, 2.3, '', 'any string')
+
+
+@add_standard_options(StandardOptionsTests)
+class MenubuttonTest(AbstractLabelTest, unittest.TestCase):
+ OPTIONS = (
+ 'activebackground', 'activeforeground', 'anchor',
+ 'background', 'bitmap', 'borderwidth',
+ 'compound', 'cursor', 'direction',
+ 'disabledforeground', 'font', 'foreground', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'image', 'indicatoron', 'justify', 'menu',
+ 'padx', 'pady', 'relief', 'state',
+ 'takefocus', 'text', 'textvariable',
+ 'underline', 'width', 'wraplength',
+ )
+ _conv_pixels = staticmethod(pixels_round)
+
+ def create(self, **kwargs):
+ return tkinter.Menubutton(self.root, **kwargs)
+
+ def test_direction(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'direction',
+ 'above', 'below', 'flush', 'left', 'right')
+
+ def test_height(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'height', 100, -100, 0, conv=str)
+
+ test_highlightthickness = StandardOptionsTests.test_highlightthickness.im_func
+
+ @unittest.skipIf(sys.platform == 'darwin',
+ 'crashes with Cocoa Tk (issue19733)')
+ def test_image(self):
+ widget = self.create()
+ image = tkinter.PhotoImage(master=self.root, name='image1')
+ self.checkParam(widget, 'image', image, conv=str)
+ errmsg = 'image "spam" doesn\'t exist'
+ with self.assertRaises(tkinter.TclError) as cm:
+ widget['image'] = 'spam'
+ if errmsg is not None:
+ self.assertEqual(str(cm.exception), errmsg)
+ with self.assertRaises(tkinter.TclError) as cm:
+ widget.configure({'image': 'spam'})
+ if errmsg is not None:
+ self.assertEqual(str(cm.exception), errmsg)
+
+ def test_menu(self):
+ widget = self.create()
+ menu = tkinter.Menu(widget, name='menu')
+ self.checkParam(widget, 'menu', menu, eq=widget_eq)
+ menu.destroy()
+
+ def test_padx(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'padx', 3, 4.4, 5.6, '12m')
+ self.checkParam(widget, 'padx', -2, expected=0)
+
+ def test_pady(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'pady', 3, 4.4, 5.6, '12m')
+ self.checkParam(widget, 'pady', -2, expected=0)
+
+ def test_width(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'width', 402, -402, 0, conv=str)
+
+
+class OptionMenuTest(MenubuttonTest, unittest.TestCase):
+
+ def create(self, default='b', values=('a', 'b', 'c'), **kwargs):
+ return tkinter.OptionMenu(self.root, None, default, *values, **kwargs)
+
+
+@add_standard_options(IntegerSizeTests, StandardOptionsTests)
+class EntryTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'background', 'borderwidth', 'cursor',
+ 'disabledbackground', 'disabledforeground',
+ 'exportselection', 'font', 'foreground',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'insertbackground', 'insertborderwidth',
+ 'insertofftime', 'insertontime', 'insertwidth',
+ 'invalidcommand', 'justify', 'readonlybackground', 'relief',
+ 'selectbackground', 'selectborderwidth', 'selectforeground',
+ 'show', 'state', 'takefocus', 'textvariable',
+ 'validate', 'validatecommand', 'width', 'xscrollcommand',
+ )
+
+ def create(self, **kwargs):
+ return tkinter.Entry(self.root, **kwargs)
+
+ def test_disabledbackground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'disabledbackground')
+
+ def test_insertborderwidth(self):
+ widget = self.create(insertwidth=100)
+ self.checkPixelsParam(widget, 'insertborderwidth',
+ 0, 1.3, 2.6, 6, -2, '10p')
+ # insertborderwidth is bounded above by a half of insertwidth.
+ self.checkParam(widget, 'insertborderwidth', 60, expected=100//2)
+
+ def test_insertwidth(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'insertwidth', 1.3, 3.6, '10p')
+ self.checkParam(widget, 'insertwidth', 0.1, expected=2)
+ self.checkParam(widget, 'insertwidth', -2, expected=2)
+ if pixels_round(0.9) <= 0:
+ self.checkParam(widget, 'insertwidth', 0.9, expected=2)
+ else:
+ self.checkParam(widget, 'insertwidth', 0.9, expected=1)
+
+ def test_invalidcommand(self):
+ widget = self.create()
+ self.checkCommandParam(widget, 'invalidcommand')
+ self.checkCommandParam(widget, 'invcmd')
+
+ def test_readonlybackground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'readonlybackground')
+
+ def test_show(self):
+ widget = self.create()
+ self.checkParam(widget, 'show', '*')
+ self.checkParam(widget, 'show', '')
+ self.checkParam(widget, 'show', ' ')
+
+ def test_state(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'state',
+ 'disabled', 'normal', 'readonly')
+
+ def test_validate(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'validate',
+ 'all', 'key', 'focus', 'focusin', 'focusout', 'none')
+
+ def test_validatecommand(self):
+ widget = self.create()
+ self.checkCommandParam(widget, 'validatecommand')
+ self.checkCommandParam(widget, 'vcmd')
+
+
+@add_standard_options(StandardOptionsTests)
+class SpinboxTest(EntryTest, unittest.TestCase):
+ OPTIONS = (
+ 'activebackground', 'background', 'borderwidth',
+ 'buttonbackground', 'buttoncursor', 'buttondownrelief', 'buttonuprelief',
+ 'command', 'cursor', 'disabledbackground', 'disabledforeground',
+ 'exportselection', 'font', 'foreground', 'format', 'from',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'increment',
+ 'insertbackground', 'insertborderwidth',
+ 'insertofftime', 'insertontime', 'insertwidth',
+ 'invalidcommand', 'justify', 'relief', 'readonlybackground',
+ 'repeatdelay', 'repeatinterval',
+ 'selectbackground', 'selectborderwidth', 'selectforeground',
+ 'state', 'takefocus', 'textvariable', 'to',
+ 'validate', 'validatecommand', 'values',
+ 'width', 'wrap', 'xscrollcommand',
+ )
+
+ def create(self, **kwargs):
+ return tkinter.Spinbox(self.root, **kwargs)
+
+ test_show = None
+
+ def test_buttonbackground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'buttonbackground')
+
+ def test_buttoncursor(self):
+ widget = self.create()
+ self.checkCursorParam(widget, 'buttoncursor')
+
+ def test_buttondownrelief(self):
+ widget = self.create()
+ self.checkReliefParam(widget, 'buttondownrelief')
+
+ def test_buttonuprelief(self):
+ widget = self.create()
+ self.checkReliefParam(widget, 'buttonuprelief')
+
+ def test_format(self):
+ widget = self.create()
+ self.checkParam(widget, 'format', '%2f')
+ self.checkParam(widget, 'format', '%2.2f')
+ self.checkParam(widget, 'format', '%.2f')
+ self.checkParam(widget, 'format', '%2.f')
+ self.checkInvalidParam(widget, 'format', '%2e-1f')
+ self.checkInvalidParam(widget, 'format', '2.2')
+ self.checkInvalidParam(widget, 'format', '%2.-2f')
+ self.checkParam(widget, 'format', '%-2.02f')
+ self.checkParam(widget, 'format', '% 2.02f')
+ self.checkParam(widget, 'format', '% -2.200f')
+ self.checkParam(widget, 'format', '%09.200f')
+ self.checkInvalidParam(widget, 'format', '%d')
+
+ def test_from(self):
+ widget = self.create()
+ self.checkParam(widget, 'to', 100.0)
+ self.checkFloatParam(widget, 'from', -10, 10.2, 11.7)
+ self.checkInvalidParam(widget, 'from', 200,
+ errmsg='-to value must be greater than -from value')
+
+ def test_increment(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'increment', -1, 1, 10.2, 12.8, 0)
+
+ def test_to(self):
+ widget = self.create()
+ self.checkParam(widget, 'from', -100.0)
+ self.checkFloatParam(widget, 'to', -10, 10.2, 11.7)
+ self.checkInvalidParam(widget, 'to', -200,
+ errmsg='-to value must be greater than -from value')
+
+ def test_values(self):
+ # XXX
+ widget = self.create()
+ self.assertEqual(widget['values'], '')
+ self.checkParam(widget, 'values', 'mon tue wed thur')
+ self.checkParam(widget, 'values', ('mon', 'tue', 'wed', 'thur'),
+ expected='mon tue wed thur')
+ self.checkParam(widget, 'values', (42, 3.14, '', 'any string'),
+ expected='42 3.14 {} {any string}')
+ self.checkParam(widget, 'values', '')
+
+ def test_wrap(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'wrap')
+
+ def test_bbox(self):
+ widget = self.create()
+ self.assertIsBoundingBox(widget.bbox(0))
+ self.assertRaises(tkinter.TclError, widget.bbox, 'noindex')
+ self.assertRaises(tkinter.TclError, widget.bbox, None)
+ self.assertRaises(TypeError, widget.bbox)
+ self.assertRaises(TypeError, widget.bbox, 0, 1)
+
+
+@add_standard_options(StandardOptionsTests)
+class TextTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'autoseparators', 'background', 'blockcursor', 'borderwidth',
+ 'cursor', 'endline', 'exportselection',
+ 'font', 'foreground', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'inactiveselectbackground', 'insertbackground', 'insertborderwidth',
+ 'insertofftime', 'insertontime', 'insertunfocussed', 'insertwidth',
+ 'maxundo', 'padx', 'pady', 'relief',
+ 'selectbackground', 'selectborderwidth', 'selectforeground',
+ 'setgrid', 'spacing1', 'spacing2', 'spacing3', 'startline', 'state',
+ 'tabs', 'tabstyle', 'takefocus', 'undo', 'width', 'wrap',
+ 'xscrollcommand', 'yscrollcommand',
+ )
+ if tcl_version < (8, 5):
+ _stringify = True
+
+ def create(self, **kwargs):
+ return tkinter.Text(self.root, **kwargs)
+
+ def test_autoseparators(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'autoseparators')
+
+ @requires_tcl(8, 5)
+ def test_blockcursor(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'blockcursor')
+
+ @requires_tcl(8, 5)
+ def test_endline(self):
+ widget = self.create()
+ text = '\n'.join('Line %d' for i in range(100))
+ widget.insert('end', text)
+ self.checkParam(widget, 'endline', 200, expected='')
+ self.checkParam(widget, 'endline', -10, expected='')
+ self.checkInvalidParam(widget, 'endline', 'spam',
+ errmsg='expected integer but got "spam"')
+ self.checkParam(widget, 'endline', 50)
+ self.checkParam(widget, 'startline', 15)
+ self.checkInvalidParam(widget, 'endline', 10,
+ errmsg='-startline must be less than or equal to -endline')
+
+ def test_height(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'height', 100, 101.2, 102.6, '3c')
+ self.checkParam(widget, 'height', -100, expected=1)
+ self.checkParam(widget, 'height', 0, expected=1)
+
+ def test_maxundo(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'maxundo', 0, 5, -1)
+
+ @requires_tcl(8, 5)
+ def test_inactiveselectbackground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'inactiveselectbackground')
+
+ @requires_tcl(8, 6)
+ def test_insertunfocussed(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'insertunfocussed',
+ 'hollow', 'none', 'solid')
+
+ def test_selectborderwidth(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'selectborderwidth',
+ 1.3, 2.6, -2, '10p', conv=noconv,
+ keep_orig=tcl_version >= (8, 5))
+
+ def test_spacing1(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'spacing1', 20, 21.4, 22.6, '0.5c')
+ self.checkParam(widget, 'spacing1', -5, expected=0)
+
+ def test_spacing2(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'spacing2', 5, 6.4, 7.6, '0.1c')
+ self.checkParam(widget, 'spacing2', -1, expected=0)
+
+ def test_spacing3(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'spacing3', 20, 21.4, 22.6, '0.5c')
+ self.checkParam(widget, 'spacing3', -10, expected=0)
+
+ @requires_tcl(8, 5)
+ def test_startline(self):
+ widget = self.create()
+ text = '\n'.join('Line %d' for i in range(100))
+ widget.insert('end', text)
+ self.checkParam(widget, 'startline', 200, expected='')
+ self.checkParam(widget, 'startline', -10, expected='')
+ self.checkInvalidParam(widget, 'startline', 'spam',
+ errmsg='expected integer but got "spam"')
+ self.checkParam(widget, 'startline', 10)
+ self.checkParam(widget, 'endline', 50)
+ self.checkInvalidParam(widget, 'startline', 70,
+ errmsg='-startline must be less than or equal to -endline')
+
+ def test_state(self):
+ widget = self.create()
+ if tcl_version < (8, 5):
+ self.checkParams(widget, 'state', 'disabled', 'normal')
+ else:
+ self.checkEnumParam(widget, 'state', 'disabled', 'normal')
+
+ def test_tabs(self):
+ widget = self.create()
+ if get_tk_patchlevel() < (8, 5, 11):
+ self.checkParam(widget, 'tabs', (10.2, 20.7, '1i', '2i'),
+ expected=('10.2', '20.7', '1i', '2i'))
+ else:
+ self.checkParam(widget, 'tabs', (10.2, 20.7, '1i', '2i'))
+ self.checkParam(widget, 'tabs', '10.2 20.7 1i 2i',
+ expected=('10.2', '20.7', '1i', '2i'))
+ self.checkParam(widget, 'tabs', '2c left 4c 6c center',
+ expected=('2c', 'left', '4c', '6c', 'center'))
+ self.checkInvalidParam(widget, 'tabs', 'spam',
+ errmsg='bad screen distance "spam"',
+ keep_orig=tcl_version >= (8, 5))
+
+ @requires_tcl(8, 5)
+ def test_tabstyle(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'tabstyle', 'tabular', 'wordprocessor')
+
+ def test_undo(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'undo')
+
+ def test_width(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'width', 402)
+ self.checkParam(widget, 'width', -402, expected=1)
+ self.checkParam(widget, 'width', 0, expected=1)
+
+ def test_wrap(self):
+ widget = self.create()
+ if tcl_version < (8, 5):
+ self.checkParams(widget, 'wrap', 'char', 'none', 'word')
+ else:
+ self.checkEnumParam(widget, 'wrap', 'char', 'none', 'word')
+
+ def test_bbox(self):
+ widget = self.create()
+ self.assertIsBoundingBox(widget.bbox('1.1'))
+ self.assertIsNone(widget.bbox('end'))
+ self.assertRaises(tkinter.TclError, widget.bbox, 'noindex')
+ self.assertRaises(tkinter.TclError, widget.bbox, None)
+ self.assertRaises(tkinter.TclError, widget.bbox)
+ self.assertRaises(tkinter.TclError, widget.bbox, '1.1', 'end')
+
+
+@add_standard_options(PixelSizeTests, StandardOptionsTests)
+class CanvasTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'background', 'borderwidth',
+ 'closeenough', 'confine', 'cursor', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'insertbackground', 'insertborderwidth',
+ 'insertofftime', 'insertontime', 'insertwidth',
+ 'offset', 'relief', 'scrollregion',
+ 'selectbackground', 'selectborderwidth', 'selectforeground',
+ 'state', 'takefocus',
+ 'xscrollcommand', 'xscrollincrement',
+ 'yscrollcommand', 'yscrollincrement', 'width',
+ )
+
+ _conv_pixels = staticmethod(int_round)
+ _stringify = True
+
+ def create(self, **kwargs):
+ return tkinter.Canvas(self.root, **kwargs)
+
+ def test_closeenough(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'closeenough', 24, 2.4, 3.6, -3,
+ conv=float)
+
+ def test_confine(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'confine')
+
+ def test_offset(self):
+ widget = self.create()
+ self.assertEqual(widget['offset'], '0,0')
+ self.checkParams(widget, 'offset',
+ 'n', 'ne', 'e', 'se', 's', 'sw', 'w', 'nw', 'center')
+ self.checkParam(widget, 'offset', '10,20')
+ self.checkParam(widget, 'offset', '#5,6')
+ self.checkInvalidParam(widget, 'offset', 'spam')
+
+ def test_scrollregion(self):
+ widget = self.create()
+ self.checkParam(widget, 'scrollregion', '0 0 200 150')
+ self.checkParam(widget, 'scrollregion', (0, 0, 200, 150),
+ expected='0 0 200 150')
+ self.checkParam(widget, 'scrollregion', '')
+ self.checkInvalidParam(widget, 'scrollregion', 'spam',
+ errmsg='bad scrollRegion "spam"')
+ self.checkInvalidParam(widget, 'scrollregion', (0, 0, 200, 'spam'))
+ self.checkInvalidParam(widget, 'scrollregion', (0, 0, 200))
+ self.checkInvalidParam(widget, 'scrollregion', (0, 0, 200, 150, 0))
+
+ def test_state(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'state', 'disabled', 'normal',
+ errmsg='bad state value "{}": must be normal or disabled')
+
+ def test_xscrollincrement(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'xscrollincrement',
+ 40, 0, 41.2, 43.6, -40, '0.5i')
+
+ def test_yscrollincrement(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'yscrollincrement',
+ 10, 0, 11.2, 13.6, -10, '0.1i')
+
+
+@add_standard_options(IntegerSizeTests, StandardOptionsTests)
+class ListboxTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'activestyle', 'background', 'borderwidth', 'cursor',
+ 'disabledforeground', 'exportselection',
+ 'font', 'foreground', 'height',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'listvariable', 'relief',
+ 'selectbackground', 'selectborderwidth', 'selectforeground',
+ 'selectmode', 'setgrid', 'state',
+ 'takefocus', 'width', 'xscrollcommand', 'yscrollcommand',
+ )
+
+ def create(self, **kwargs):
+ return tkinter.Listbox(self.root, **kwargs)
+
+ def test_activestyle(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'activestyle',
+ 'dotbox', 'none', 'underline')
+
+ def test_listvariable(self):
+ widget = self.create()
+ var = tkinter.DoubleVar(self.root)
+ self.checkVariableParam(widget, 'listvariable', var)
+
+ def test_selectmode(self):
+ widget = self.create()
+ self.checkParam(widget, 'selectmode', 'single')
+ self.checkParam(widget, 'selectmode', 'browse')
+ self.checkParam(widget, 'selectmode', 'multiple')
+ self.checkParam(widget, 'selectmode', 'extended')
+
+ def test_state(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'state', 'disabled', 'normal')
+
+ def test_itemconfigure(self):
+ widget = self.create()
+ with self.assertRaisesRegexp(TclError, 'item number "0" out of range'):
+ widget.itemconfigure(0)
+ colors = 'red orange yellow green blue white violet'.split()
+ widget.insert('end', *colors)
+ for i, color in enumerate(colors):
+ widget.itemconfigure(i, background=color)
+ with self.assertRaises(TypeError):
+ widget.itemconfigure()
+ with self.assertRaisesRegexp(TclError, 'bad listbox index "red"'):
+ widget.itemconfigure('red')
+ self.assertEqual(widget.itemconfigure(0, 'background'),
+ ('background', 'background', 'Background', '', 'red'))
+ self.assertEqual(widget.itemconfigure('end', 'background'),
+ ('background', 'background', 'Background', '', 'violet'))
+ self.assertEqual(widget.itemconfigure('@0,0', 'background'),
+ ('background', 'background', 'Background', '', 'red'))
+
+ d = widget.itemconfigure(0)
+ self.assertIsInstance(d, dict)
+ for k, v in d.items():
+ self.assertIn(len(v), (2, 5))
+ if len(v) == 5:
+ self.assertEqual(v, widget.itemconfigure(0, k))
+ self.assertEqual(v[4], widget.itemcget(0, k))
+
+ def check_itemconfigure(self, name, value):
+ widget = self.create()
+ widget.insert('end', 'a', 'b', 'c', 'd')
+ widget.itemconfigure(0, **{name: value})
+ self.assertEqual(widget.itemconfigure(0, name)[4], value)
+ self.assertEqual(widget.itemcget(0, name), value)
+ with self.assertRaisesRegexp(TclError, 'unknown color name "spam"'):
+ widget.itemconfigure(0, **{name: 'spam'})
+
+ def test_itemconfigure_background(self):
+ self.check_itemconfigure('background', '#ff0000')
+
+ def test_itemconfigure_bg(self):
+ self.check_itemconfigure('bg', '#ff0000')
+
+ def test_itemconfigure_fg(self):
+ self.check_itemconfigure('fg', '#110022')
+
+ def test_itemconfigure_foreground(self):
+ self.check_itemconfigure('foreground', '#110022')
+
+ def test_itemconfigure_selectbackground(self):
+ self.check_itemconfigure('selectbackground', '#110022')
+
+ def test_itemconfigure_selectforeground(self):
+ self.check_itemconfigure('selectforeground', '#654321')
+
+ def test_box(self):
+ lb = self.create()
+ lb.insert(0, *('el%d' % i for i in range(8)))
+ lb.pack()
+ self.assertIsBoundingBox(lb.bbox(0))
+ self.assertIsNone(lb.bbox(-1))
+ self.assertIsNone(lb.bbox(10))
+ self.assertRaises(TclError, lb.bbox, 'noindex')
+ self.assertRaises(TclError, lb.bbox, None)
+ self.assertRaises(TypeError, lb.bbox)
+ self.assertRaises(TypeError, lb.bbox, 0, 1)
+
+ def test_curselection(self):
+ lb = self.create()
+ lb.insert(0, *('el%d' % i for i in range(8)))
+ lb.selection_clear(0, tkinter.END)
+ lb.selection_set(2, 4)
+ lb.selection_set(6)
+ self.assertEqual(lb.curselection(), (2, 3, 4, 6))
+ self.assertRaises(TypeError, lb.curselection, 0)
+
+ def test_get(self):
+ lb = self.create()
+ lb.insert(0, *('el%d' % i for i in range(8)))
+ self.assertEqual(lb.get(0), 'el0')
+ self.assertEqual(lb.get(3), 'el3')
+ self.assertEqual(lb.get('end'), 'el7')
+ self.assertEqual(lb.get(8), '')
+ self.assertEqual(lb.get(-1), '')
+ self.assertEqual(lb.get(3, 5), ('el3', 'el4', 'el5'))
+ self.assertEqual(lb.get(5, 'end'), ('el5', 'el6', 'el7'))
+ self.assertEqual(lb.get(5, 0), ())
+ self.assertEqual(lb.get(0, 0), ('el0',))
+ self.assertRaises(TclError, lb.get, 'noindex')
+ self.assertRaises(TclError, lb.get, None)
+ self.assertRaises(TypeError, lb.get)
+ self.assertRaises(TclError, lb.get, 'end', 'noindex')
+ self.assertRaises(TypeError, lb.get, 1, 2, 3)
+ self.assertRaises(TclError, lb.get, 2.4)
+
+
+@add_standard_options(PixelSizeTests, StandardOptionsTests)
+class ScaleTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'activebackground', 'background', 'bigincrement', 'borderwidth',
+ 'command', 'cursor', 'digits', 'font', 'foreground', 'from',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'label', 'length', 'orient', 'relief',
+ 'repeatdelay', 'repeatinterval',
+ 'resolution', 'showvalue', 'sliderlength', 'sliderrelief', 'state',
+ 'takefocus', 'tickinterval', 'to', 'troughcolor', 'variable', 'width',
+ )
+ default_orient = 'vertical'
+
+ def create(self, **kwargs):
+ return tkinter.Scale(self.root, **kwargs)
+
+ def test_bigincrement(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'bigincrement', 12.4, 23.6, -5)
+
+ def test_digits(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'digits', 5, 0)
+
+ def test_from(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'from', 100, 14.9, 15.1, conv=round)
+
+ def test_label(self):
+ widget = self.create()
+ self.checkParam(widget, 'label', 'any string')
+ self.checkParam(widget, 'label', '')
+
+ def test_length(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'length', 130, 131.2, 135.6, '5i')
+
+ def test_resolution(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'resolution', 4.2, 0, 6.7, -2)
+
+ def test_showvalue(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'showvalue')
+
+ def test_sliderlength(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'sliderlength',
+ 10, 11.2, 15.6, -3, '3m')
+
+ def test_sliderrelief(self):
+ widget = self.create()
+ self.checkReliefParam(widget, 'sliderrelief')
+
+ def test_tickinterval(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'tickinterval', 1, 4.3, 7.6, 0,
+ conv=round)
+ self.checkParam(widget, 'tickinterval', -2, expected=2,
+ conv=round)
+
+ def test_to(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'to', 300, 14.9, 15.1, -10,
+ conv=round)
+
+
+@add_standard_options(PixelSizeTests, StandardOptionsTests)
+class ScrollbarTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'activebackground', 'activerelief',
+ 'background', 'borderwidth',
+ 'command', 'cursor', 'elementborderwidth',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'jump', 'orient', 'relief',
+ 'repeatdelay', 'repeatinterval',
+ 'takefocus', 'troughcolor', 'width',
+ )
+ _conv_pixels = staticmethod(int_round)
+ _stringify = True
+ default_orient = 'vertical'
+
+ def create(self, **kwargs):
+ return tkinter.Scrollbar(self.root, **kwargs)
+
+ def test_activerelief(self):
+ widget = self.create()
+ self.checkReliefParam(widget, 'activerelief')
+
+ def test_elementborderwidth(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'elementborderwidth', 4.3, 5.6, -2, '1m')
+
+ def test_orient(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'orient', 'vertical', 'horizontal',
+ errmsg='bad orientation "{}": must be vertical or horizontal')
+
+ def test_activate(self):
+ sb = self.create()
+ for e in ('arrow1', 'slider', 'arrow2'):
+ sb.activate(e)
+ sb.activate('')
+ self.assertRaises(TypeError, sb.activate)
+ self.assertRaises(TypeError, sb.activate, 'arrow1', 'arrow2')
+
+ def test_set(self):
+ sb = self.create()
+ sb.set(0.2, 0.4)
+ self.assertEqual(sb.get(), (0.2, 0.4))
+ self.assertRaises(TclError, sb.set, 'abc', 'def')
+ self.assertRaises(TclError, sb.set, 0.6, 'def')
+ self.assertRaises(TclError, sb.set, 0.6, None)
+ self.assertRaises(TclError, sb.set, 0.6)
+ self.assertRaises(TclError, sb.set, 0.6, 0.7, 0.8)
+
+
+@add_standard_options(StandardOptionsTests)
+class PanedWindowTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'background', 'borderwidth', 'cursor',
+ 'handlepad', 'handlesize', 'height',
+ 'opaqueresize', 'orient', 'relief',
+ 'sashcursor', 'sashpad', 'sashrelief', 'sashwidth',
+ 'showhandle', 'width',
+ )
+ default_orient = 'horizontal'
+
+ def create(self, **kwargs):
+ return tkinter.PanedWindow(self.root, **kwargs)
+
+ def test_handlepad(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'handlepad', 5, 6.4, 7.6, -3, '1m')
+
+ def test_handlesize(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'handlesize', 8, 9.4, 10.6, -3, '2m',
+ conv=noconv)
+
+ def test_height(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'height', 100, 101.2, 102.6, -100, 0, '1i',
+ conv=noconv)
+
+ def test_opaqueresize(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'opaqueresize')
+
+ def test_sashcursor(self):
+ widget = self.create()
+ self.checkCursorParam(widget, 'sashcursor')
+
+ def test_sashpad(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'sashpad', 8, 1.3, 2.6, -2, '2m')
+
+ def test_sashrelief(self):
+ widget = self.create()
+ self.checkReliefParam(widget, 'sashrelief')
+
+ def test_sashwidth(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'sashwidth', 10, 11.1, 15.6, -3, '1m',
+ conv=noconv)
+
+ def test_showhandle(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'showhandle')
+
+ def test_width(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'width', 402, 403.4, 404.6, -402, 0, '5i',
+ conv=noconv)
+
+ def create2(self):
+ p = self.create()
+ b = tkinter.Button(p)
+ c = tkinter.Button(p)
+ p.add(b)
+ p.add(c)
+ return p, b, c
+
+ def test_paneconfigure(self):
+ p, b, c = self.create2()
+ self.assertRaises(TypeError, p.paneconfigure)
+ d = p.paneconfigure(b)
+ self.assertIsInstance(d, dict)
+ for k, v in d.items():
+ self.assertEqual(len(v), 5)
+ self.assertEqual(v, p.paneconfigure(b, k))
+ self.assertEqual(v[4], p.panecget(b, k))
+
+ def check_paneconfigure(self, p, b, name, value, expected, stringify=False):
+ conv = lambda x: x
+ if not self.wantobjects or stringify:
+ expected = str(expected)
+ if self.wantobjects and stringify:
+ conv = str
+ p.paneconfigure(b, **{name: value})
+ self.assertEqual(conv(p.paneconfigure(b, name)[4]), expected)
+ self.assertEqual(conv(p.panecget(b, name)), expected)
+
+ def check_paneconfigure_bad(self, p, b, name, msg):
+ with self.assertRaisesRegexp(TclError, msg):
+ p.paneconfigure(b, **{name: 'badValue'})
+
+ def test_paneconfigure_after(self):
+ p, b, c = self.create2()
+ self.check_paneconfigure(p, b, 'after', c, str(c))
+ self.check_paneconfigure_bad(p, b, 'after',
+ 'bad window path name "badValue"')
+
+ def test_paneconfigure_before(self):
+ p, b, c = self.create2()
+ self.check_paneconfigure(p, b, 'before', c, str(c))
+ self.check_paneconfigure_bad(p, b, 'before',
+ 'bad window path name "badValue"')
+
+ def test_paneconfigure_height(self):
+ p, b, c = self.create2()
+ self.check_paneconfigure(p, b, 'height', 10, 10,
+ stringify=get_tk_patchlevel() < (8, 5, 11))
+ self.check_paneconfigure_bad(p, b, 'height',
+ 'bad screen distance "badValue"')
+
+ @requires_tcl(8, 5)
+ def test_paneconfigure_hide(self):
+ p, b, c = self.create2()
+ self.check_paneconfigure(p, b, 'hide', False, 0)
+ self.check_paneconfigure_bad(p, b, 'hide',
+ 'expected boolean value but got "badValue"')
+
+ def test_paneconfigure_minsize(self):
+ p, b, c = self.create2()
+ self.check_paneconfigure(p, b, 'minsize', 10, 10)
+ self.check_paneconfigure_bad(p, b, 'minsize',
+ 'bad screen distance "badValue"')
+
+ def test_paneconfigure_padx(self):
+ p, b, c = self.create2()
+ self.check_paneconfigure(p, b, 'padx', 1.3, 1)
+ self.check_paneconfigure_bad(p, b, 'padx',
+ 'bad screen distance "badValue"')
+
+ def test_paneconfigure_pady(self):
+ p, b, c = self.create2()
+ self.check_paneconfigure(p, b, 'pady', 1.3, 1)
+ self.check_paneconfigure_bad(p, b, 'pady',
+ 'bad screen distance "badValue"')
+
+ def test_paneconfigure_sticky(self):
+ p, b, c = self.create2()
+ self.check_paneconfigure(p, b, 'sticky', 'nsew', 'nesw')
+ self.check_paneconfigure_bad(p, b, 'sticky',
+ 'bad stickyness value "badValue": must '
+ 'be a string containing zero or more of '
+ 'n, e, s, and w')
+
+ @requires_tcl(8, 5)
+ def test_paneconfigure_stretch(self):
+ p, b, c = self.create2()
+ self.check_paneconfigure(p, b, 'stretch', 'alw', 'always')
+ self.check_paneconfigure_bad(p, b, 'stretch',
+ 'bad stretch "badValue": must be '
+ 'always, first, last, middle, or never')
+
+ def test_paneconfigure_width(self):
+ p, b, c = self.create2()
+ self.check_paneconfigure(p, b, 'width', 10, 10,
+ stringify=get_tk_patchlevel() < (8, 5, 11))
+ self.check_paneconfigure_bad(p, b, 'width',
+ 'bad screen distance "badValue"')
+
+
+@add_standard_options(StandardOptionsTests)
+class MenuTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'activebackground', 'activeborderwidth', 'activeforeground',
+ 'background', 'borderwidth', 'cursor',
+ 'disabledforeground', 'font', 'foreground',
+ 'postcommand', 'relief', 'selectcolor', 'takefocus',
+ 'tearoff', 'tearoffcommand', 'title', 'type',
+ )
+ _conv_pixels = noconv_meth
+
+ def create(self, **kwargs):
+ return tkinter.Menu(self.root, **kwargs)
+
+ def test_postcommand(self):
+ widget = self.create()
+ self.checkCommandParam(widget, 'postcommand')
+
+ def test_tearoff(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'tearoff')
+
+ def test_tearoffcommand(self):
+ widget = self.create()
+ self.checkCommandParam(widget, 'tearoffcommand')
+
+ def test_title(self):
+ widget = self.create()
+ self.checkParam(widget, 'title', 'any string')
+
+ def test_type(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'type',
+ 'normal', 'tearoff', 'menubar')
+
+ def test_entryconfigure(self):
+ m1 = self.create()
+ m1.add_command(label='test')
+ self.assertRaises(TypeError, m1.entryconfigure)
+ with self.assertRaisesRegexp(TclError, 'bad menu entry index "foo"'):
+ m1.entryconfigure('foo')
+ d = m1.entryconfigure(1)
+ self.assertIsInstance(d, dict)
+ for k, v in d.items():
+ self.assertIsInstance(k, str)
+ self.assertIsInstance(v, tuple)
+ self.assertEqual(len(v), 5)
+ self.assertEqual(v[0], k)
+ self.assertEqual(m1.entrycget(1, k), v[4])
+ m1.destroy()
+
+ def test_entryconfigure_label(self):
+ m1 = self.create()
+ m1.add_command(label='test')
+ self.assertEqual(m1.entrycget(1, 'label'), 'test')
+ m1.entryconfigure(1, label='changed')
+ self.assertEqual(m1.entrycget(1, 'label'), 'changed')
+
+ def test_entryconfigure_variable(self):
+ m1 = self.create()
+ v1 = tkinter.BooleanVar(self.root)
+ v2 = tkinter.BooleanVar(self.root)
+ m1.add_checkbutton(variable=v1, onvalue=True, offvalue=False,
+ label='Nonsense')
+ self.assertEqual(str(m1.entrycget(1, 'variable')), str(v1))
+ m1.entryconfigure(1, variable=v2)
+ self.assertEqual(str(m1.entrycget(1, 'variable')), str(v2))
+
+
+@add_standard_options(PixelSizeTests, StandardOptionsTests)
+class MessageTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'anchor', 'aspect', 'background', 'borderwidth',
+ 'cursor', 'font', 'foreground',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'justify', 'padx', 'pady', 'relief',
+ 'takefocus', 'text', 'textvariable', 'width',
+ )
+ _conv_pad_pixels = noconv_meth
+
+ def create(self, **kwargs):
+ return tkinter.Message(self.root, **kwargs)
+
+ def test_aspect(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'aspect', 250, 0, -300)
+
+
+tests_gui = [
+ ButtonTest, CanvasTest, CheckbuttonTest, EntryTest,
+ FrameTest, LabelFrameTest,LabelTest, ListboxTest,
+ MenubuttonTest, MenuTest, MessageTest, OptionMenuTest,
+ PanedWindowTest, RadiobuttonTest, ScaleTest, ScrollbarTest,
+ SpinboxTest, TextTest, ToplevelTest,
+]
+
+if __name__ == '__main__':
+ run_unittest(*tests_gui)
diff --git a/lib/python2.7/lib-tk/test/test_ttk/__init__.py b/lib/python2.7/lib-tk/test/test_ttk/__init__.py
new file mode 100644
index 00000000..e69de29b
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_ttk/__init__.py
diff --git a/lib/python2.7/lib-tk/test/test_ttk/support.py b/lib/python2.7/lib-tk/test/test_ttk/support.py
new file mode 100644
index 00000000..c4d842aa
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_ttk/support.py
@@ -0,0 +1,105 @@
+import re
+import unittest
+import Tkinter as tkinter
+
+class AbstractTkTest:
+
+ @classmethod
+ def setUpClass(cls):
+ cls._old_support_default_root = tkinter._support_default_root
+ destroy_default_root()
+ tkinter.NoDefaultRoot()
+ cls.root = tkinter.Tk()
+ cls.wantobjects = cls.root.wantobjects()
+ # De-maximize main window.
+ # Some window managers can maximize new windows.
+ cls.root.wm_state('normal')
+ try:
+ cls.root.wm_attributes('-zoomed', False)
+ except tkinter.TclError:
+ pass
+
+ @classmethod
+ def tearDownClass(cls):
+ cls.root.update_idletasks()
+ cls.root.destroy()
+ del cls.root
+ tkinter._default_root = None
+ tkinter._support_default_root = cls._old_support_default_root
+
+ def setUp(self):
+ self.root.deiconify()
+
+ def tearDown(self):
+ for w in self.root.winfo_children():
+ w.destroy()
+ self.root.withdraw()
+
+def destroy_default_root():
+ if getattr(tkinter, '_default_root', None):
+ tkinter._default_root.update_idletasks()
+ tkinter._default_root.destroy()
+ tkinter._default_root = None
+
+def simulate_mouse_click(widget, x, y):
+ """Generate proper events to click at the x, y position (tries to act
+ like an X server)."""
+ widget.event_generate('<Enter>', x=0, y=0)
+ widget.event_generate('<Motion>', x=x, y=y)
+ widget.event_generate('<ButtonPress-1>', x=x, y=y)
+ widget.event_generate('<ButtonRelease-1>', x=x, y=y)
+
+
+import _tkinter
+tcl_version = tuple(map(int, _tkinter.TCL_VERSION.split('.')))
+
+def requires_tcl(*version):
+ return unittest.skipUnless(tcl_version >= version,
+ 'requires Tcl version >= ' + '.'.join(map(str, version)))
+
+_tk_patchlevel = None
+def get_tk_patchlevel():
+ global _tk_patchlevel
+ if _tk_patchlevel is None:
+ tcl = tkinter.Tcl()
+ patchlevel = tcl.call('info', 'patchlevel')
+ m = re.match(r'(\d+)\.(\d+)([ab.])(\d+)$', patchlevel)
+ major, minor, releaselevel, serial = m.groups()
+ major, minor, serial = int(major), int(minor), int(serial)
+ releaselevel = {'a': 'alpha', 'b': 'beta', '.': 'final'}[releaselevel]
+ if releaselevel == 'final':
+ _tk_patchlevel = major, minor, serial, releaselevel, 0
+ else:
+ _tk_patchlevel = major, minor, 0, releaselevel, serial
+ return _tk_patchlevel
+
+units = {
+ 'c': 72 / 2.54, # centimeters
+ 'i': 72, # inches
+ 'm': 72 / 25.4, # millimeters
+ 'p': 1, # points
+}
+
+def pixels_conv(value):
+ return float(value[:-1]) * units[value[-1:]]
+
+def tcl_obj_eq(actual, expected):
+ if actual == expected:
+ return True
+ if isinstance(actual, _tkinter.Tcl_Obj):
+ if isinstance(expected, str):
+ return str(actual) == expected
+ if isinstance(actual, tuple):
+ if isinstance(expected, tuple):
+ return (len(actual) == len(expected) and
+ all(tcl_obj_eq(act, exp)
+ for act, exp in zip(actual, expected)))
+ return False
+
+def widget_eq(actual, expected):
+ if actual == expected:
+ return True
+ if isinstance(actual, (str, tkinter.Widget)):
+ if isinstance(expected, (str, tkinter.Widget)):
+ return str(actual) == str(expected)
+ return False
diff --git a/lib/python2.7/lib-tk/test/test_ttk/test_extensions.py b/lib/python2.7/lib-tk/test/test_ttk/test_extensions.py
new file mode 100644
index 00000000..57ffdddb
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_ttk/test_extensions.py
@@ -0,0 +1,291 @@
+import sys
+import unittest
+import Tkinter as tkinter
+import ttk
+from test.test_support import requires, run_unittest, swap_attr
+from test_ttk.support import AbstractTkTest, destroy_default_root
+
+requires('gui')
+
+class LabeledScaleTest(AbstractTkTest, unittest.TestCase):
+
+ def tearDown(self):
+ self.root.update_idletasks()
+ super(LabeledScaleTest, self).tearDown()
+
+ def test_widget_destroy(self):
+ # automatically created variable
+ x = ttk.LabeledScale(self.root)
+ var = x._variable._name
+ x.destroy()
+ self.assertRaises(tkinter.TclError, x.tk.globalgetvar, var)
+
+ # manually created variable
+ myvar = tkinter.DoubleVar(self.root)
+ name = myvar._name
+ x = ttk.LabeledScale(self.root, variable=myvar)
+ x.destroy()
+ if self.wantobjects:
+ self.assertEqual(x.tk.globalgetvar(name), myvar.get())
+ else:
+ self.assertEqual(float(x.tk.globalgetvar(name)), myvar.get())
+ del myvar
+ self.assertRaises(tkinter.TclError, x.tk.globalgetvar, name)
+
+ # checking that the tracing callback is properly removed
+ myvar = tkinter.IntVar(self.root)
+ # LabeledScale will start tracing myvar
+ x = ttk.LabeledScale(self.root, variable=myvar)
+ x.destroy()
+ # Unless the tracing callback was removed, creating a new
+ # LabeledScale with the same var will cause an error now. This
+ # happens because the variable will be set to (possibly) a new
+ # value which causes the tracing callback to be called and then
+ # it tries calling instance attributes not yet defined.
+ ttk.LabeledScale(self.root, variable=myvar)
+ if hasattr(sys, 'last_type'):
+ self.assertNotEqual(sys.last_type, tkinter.TclError)
+
+
+ def test_initialization_no_master(self):
+ # no master passing
+ with swap_attr(tkinter, '_default_root', None), \
+ swap_attr(tkinter, '_support_default_root', True):
+ try:
+ x = ttk.LabeledScale()
+ self.assertIsNotNone(tkinter._default_root)
+ self.assertEqual(x.master, tkinter._default_root)
+ self.assertEqual(x.tk, tkinter._default_root.tk)
+ x.destroy()
+ finally:
+ destroy_default_root()
+
+ def test_initialization(self):
+ # master passing
+ master = tkinter.Frame(self.root)
+ x = ttk.LabeledScale(master)
+ self.assertEqual(x.master, master)
+ x.destroy()
+
+ # variable initialization/passing
+ passed_expected = (('0', 0), (0, 0), (10, 10),
+ (-1, -1), (sys.maxint + 1, sys.maxint + 1))
+ if self.wantobjects:
+ passed_expected += ((2.5, 2),)
+ for pair in passed_expected:
+ x = ttk.LabeledScale(self.root, from_=pair[0])
+ self.assertEqual(x.value, pair[1])
+ x.destroy()
+ x = ttk.LabeledScale(self.root, from_='2.5')
+ self.assertRaises(ValueError, x._variable.get)
+ x.destroy()
+ x = ttk.LabeledScale(self.root, from_=None)
+ self.assertRaises(ValueError, x._variable.get)
+ x.destroy()
+ # variable should have its default value set to the from_ value
+ myvar = tkinter.DoubleVar(self.root, value=20)
+ x = ttk.LabeledScale(self.root, variable=myvar)
+ self.assertEqual(x.value, 0)
+ x.destroy()
+ # check that it is really using a DoubleVar
+ x = ttk.LabeledScale(self.root, variable=myvar, from_=0.5)
+ self.assertEqual(x.value, 0.5)
+ self.assertEqual(x._variable._name, myvar._name)
+ x.destroy()
+
+ # widget positionment
+ def check_positions(scale, scale_pos, label, label_pos):
+ self.assertEqual(scale.pack_info()['side'], scale_pos)
+ self.assertEqual(label.place_info()['anchor'], label_pos)
+ x = ttk.LabeledScale(self.root, compound='top')
+ check_positions(x.scale, 'bottom', x.label, 'n')
+ x.destroy()
+ x = ttk.LabeledScale(self.root, compound='bottom')
+ check_positions(x.scale, 'top', x.label, 's')
+ x.destroy()
+ # invert default positions
+ x = ttk.LabeledScale(self.root, compound='unknown')
+ check_positions(x.scale, 'top', x.label, 's')
+ x.destroy()
+ x = ttk.LabeledScale(self.root) # take default positions
+ check_positions(x.scale, 'bottom', x.label, 'n')
+ x.destroy()
+
+ # extra, and invalid, kwargs
+ self.assertRaises(tkinter.TclError, ttk.LabeledScale, master, a='b')
+
+
+ def test_horizontal_range(self):
+ lscale = ttk.LabeledScale(self.root, from_=0, to=10)
+ lscale.pack()
+ lscale.wait_visibility()
+ lscale.update()
+
+ linfo_1 = lscale.label.place_info()
+ prev_xcoord = lscale.scale.coords()[0]
+ self.assertEqual(prev_xcoord, int(linfo_1['x']))
+ # change range to: from -5 to 5. This should change the x coord of
+ # the scale widget, since 0 is at the middle of the new
+ # range.
+ lscale.scale.configure(from_=-5, to=5)
+ # The following update is needed since the test doesn't use mainloop,
+ # at the same time this shouldn't affect test outcome
+ lscale.update()
+ curr_xcoord = lscale.scale.coords()[0]
+ self.assertNotEqual(prev_xcoord, curr_xcoord)
+ # the label widget should have been repositioned too
+ linfo_2 = lscale.label.place_info()
+ self.assertEqual(lscale.label['text'], 0 if self.wantobjects else '0')
+ self.assertEqual(curr_xcoord, int(linfo_2['x']))
+ # change the range back
+ lscale.scale.configure(from_=0, to=10)
+ self.assertNotEqual(prev_xcoord, curr_xcoord)
+ self.assertEqual(prev_xcoord, int(linfo_1['x']))
+
+ lscale.destroy()
+
+
+ def test_variable_change(self):
+ x = ttk.LabeledScale(self.root)
+ x.pack()
+ x.wait_visibility()
+ x.update()
+
+ curr_xcoord = x.scale.coords()[0]
+ newval = x.value + 1
+ x.value = newval
+ # The following update is needed since the test doesn't use mainloop,
+ # at the same time this shouldn't affect test outcome
+ x.update()
+ self.assertEqual(x.label['text'],
+ newval if self.wantobjects else str(newval))
+ self.assertGreater(x.scale.coords()[0], curr_xcoord)
+ self.assertEqual(x.scale.coords()[0],
+ int(x.label.place_info()['x']))
+
+ # value outside range
+ if self.wantobjects:
+ conv = lambda x: x
+ else:
+ conv = int
+ x.value = conv(x.scale['to']) + 1 # no changes shouldn't happen
+ x.update()
+ self.assertEqual(conv(x.label['text']), newval)
+ self.assertEqual(x.scale.coords()[0],
+ int(x.label.place_info()['x']))
+
+ x.destroy()
+
+
+ def test_resize(self):
+ x = ttk.LabeledScale(self.root)
+ x.pack(expand=True, fill='both')
+ x.wait_visibility()
+ x.update()
+
+ width, height = x.master.winfo_width(), x.master.winfo_height()
+ width_new, height_new = width * 2, height * 2
+
+ x.value = 3
+ x.update()
+ x.master.wm_geometry("%dx%d" % (width_new, height_new))
+ self.assertEqual(int(x.label.place_info()['x']),
+ x.scale.coords()[0])
+
+ # Reset geometry
+ x.master.wm_geometry("%dx%d" % (width, height))
+ x.destroy()
+
+
+class OptionMenuTest(AbstractTkTest, unittest.TestCase):
+
+ def setUp(self):
+ super(OptionMenuTest, self).setUp()
+ self.textvar = tkinter.StringVar(self.root)
+
+ def tearDown(self):
+ del self.textvar
+ super(OptionMenuTest, self).tearDown()
+
+
+ def test_widget_destroy(self):
+ var = tkinter.StringVar(self.root)
+ optmenu = ttk.OptionMenu(self.root, var)
+ name = var._name
+ optmenu.update_idletasks()
+ optmenu.destroy()
+ self.assertEqual(optmenu.tk.globalgetvar(name), var.get())
+ del var
+ self.assertRaises(tkinter.TclError, optmenu.tk.globalgetvar, name)
+
+
+ def test_initialization(self):
+ self.assertRaises(tkinter.TclError,
+ ttk.OptionMenu, self.root, self.textvar, invalid='thing')
+
+ optmenu = ttk.OptionMenu(self.root, self.textvar, 'b', 'a', 'b')
+ self.assertEqual(optmenu._variable.get(), 'b')
+
+ self.assertTrue(optmenu['menu'])
+ self.assertTrue(optmenu['textvariable'])
+
+ optmenu.destroy()
+
+
+ def test_menu(self):
+ items = ('a', 'b', 'c')
+ default = 'a'
+ optmenu = ttk.OptionMenu(self.root, self.textvar, default, *items)
+ found_default = False
+ for i in range(len(items)):
+ value = optmenu['menu'].entrycget(i, 'value')
+ self.assertEqual(value, items[i])
+ if value == default:
+ found_default = True
+ self.assertTrue(found_default)
+ optmenu.destroy()
+
+ # default shouldn't be in menu if it is not part of values
+ default = 'd'
+ optmenu = ttk.OptionMenu(self.root, self.textvar, default, *items)
+ curr = None
+ i = 0
+ while True:
+ last, curr = curr, optmenu['menu'].entryconfigure(i, 'value')
+ if last == curr:
+ # no more menu entries
+ break
+ self.assertNotEqual(curr, default)
+ i += 1
+ self.assertEqual(i, len(items))
+
+ # check that variable is updated correctly
+ optmenu.pack()
+ optmenu.wait_visibility()
+ optmenu['menu'].invoke(0)
+ self.assertEqual(optmenu._variable.get(), items[0])
+
+ # changing to an invalid index shouldn't change the variable
+ self.assertRaises(tkinter.TclError, optmenu['menu'].invoke, -1)
+ self.assertEqual(optmenu._variable.get(), items[0])
+
+ optmenu.destroy()
+
+ # specifying a callback
+ success = []
+ def cb_test(item):
+ self.assertEqual(item, items[1])
+ success.append(True)
+ optmenu = ttk.OptionMenu(self.root, self.textvar, 'a', command=cb_test,
+ *items)
+ optmenu['menu'].invoke(1)
+ if not success:
+ self.fail("Menu callback not invoked")
+
+ optmenu.destroy()
+
+
+tests_gui = (LabeledScaleTest, OptionMenuTest)
+
+if __name__ == "__main__":
+ run_unittest(*tests_gui)
diff --git a/lib/python2.7/lib-tk/test/test_ttk/test_functions.py b/lib/python2.7/lib-tk/test/test_ttk/test_functions.py
new file mode 100644
index 00000000..ea3f81c2
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_ttk/test_functions.py
@@ -0,0 +1,466 @@
+# -*- encoding: utf-8 -*-
+import sys
+import unittest
+import ttk
+
+class MockTkApp:
+
+ def splitlist(self, arg):
+ if isinstance(arg, tuple):
+ return arg
+ return arg.split(':')
+
+ def wantobjects(self):
+ return True
+
+
+class MockTclObj(object):
+ typename = 'test'
+
+ def __init__(self, val):
+ self.val = val
+
+ def __str__(self):
+ return unicode(self.val)
+
+
+class MockStateSpec(object):
+ typename = 'StateSpec'
+
+ def __init__(self, *args):
+ self.val = args
+
+ def __str__(self):
+ return ' '.join(self.val)
+
+
+class InternalFunctionsTest(unittest.TestCase):
+
+ def test_format_optdict(self):
+ def check_against(fmt_opts, result):
+ for i in range(0, len(fmt_opts), 2):
+ self.assertEqual(result.pop(fmt_opts[i]), fmt_opts[i + 1])
+ if result:
+ self.fail("result still got elements: %s" % result)
+
+ # passing an empty dict should return an empty object (tuple here)
+ self.assertFalse(ttk._format_optdict({}))
+
+ # check list formatting
+ check_against(
+ ttk._format_optdict({'fg': 'blue', 'padding': [1, 2, 3, 4]}),
+ {'-fg': 'blue', '-padding': '1 2 3 4'})
+
+ # check tuple formatting (same as list)
+ check_against(
+ ttk._format_optdict({'test': (1, 2, '', 0)}),
+ {'-test': '1 2 {} 0'})
+
+ # check untouched values
+ check_against(
+ ttk._format_optdict({'test': {'left': 'as is'}}),
+ {'-test': {'left': 'as is'}})
+
+ # check script formatting
+ check_against(
+ ttk._format_optdict(
+ {'test': [1, -1, '', '2m', 0], 'test2': 3,
+ 'test3': '', 'test4': 'abc def',
+ 'test5': '"abc"', 'test6': '{}',
+ 'test7': '} -spam {'}, script=True),
+ {'-test': '{1 -1 {} 2m 0}', '-test2': '3',
+ '-test3': '{}', '-test4': '{abc def}',
+ '-test5': '{"abc"}', '-test6': r'\{\}',
+ '-test7': r'\}\ -spam\ \{'})
+
+ opts = {u'αβγ': True, u'á': False}
+ orig_opts = opts.copy()
+ # check if giving unicode keys is fine
+ check_against(ttk._format_optdict(opts), {u'-αβγ': True, u'-á': False})
+ # opts should remain unchanged
+ self.assertEqual(opts, orig_opts)
+
+ # passing values with spaces inside a tuple/list
+ check_against(
+ ttk._format_optdict(
+ {'option': ('one two', 'three')}),
+ {'-option': '{one two} three'})
+ check_against(
+ ttk._format_optdict(
+ {'option': ('one\ttwo', 'three')}),
+ {'-option': '{one\ttwo} three'})
+
+ # passing empty strings inside a tuple/list
+ check_against(
+ ttk._format_optdict(
+ {'option': ('', 'one')}),
+ {'-option': '{} one'})
+
+ # passing values with braces inside a tuple/list
+ check_against(
+ ttk._format_optdict(
+ {'option': ('one} {two', 'three')}),
+ {'-option': r'one\}\ \{two three'})
+
+ # passing quoted strings inside a tuple/list
+ check_against(
+ ttk._format_optdict(
+ {'option': ('"one"', 'two')}),
+ {'-option': '{"one"} two'})
+ check_against(
+ ttk._format_optdict(
+ {'option': ('{one}', 'two')}),
+ {'-option': r'\{one\} two'})
+
+ # ignore an option
+ amount_opts = len(ttk._format_optdict(opts, ignore=(u'á'))) // 2
+ self.assertEqual(amount_opts, len(opts) - 1)
+
+ # ignore non-existing options
+ amount_opts = len(ttk._format_optdict(opts, ignore=(u'á', 'b'))) // 2
+ self.assertEqual(amount_opts, len(opts) - 1)
+
+ # ignore every option
+ self.assertFalse(ttk._format_optdict(opts, ignore=opts.keys()))
+
+
+ def test_format_mapdict(self):
+ opts = {'a': [('b', 'c', 'val'), ('d', 'otherval'), ('', 'single')]}
+ result = ttk._format_mapdict(opts)
+ self.assertEqual(len(result), len(opts.keys()) * 2)
+ self.assertEqual(result, ('-a', '{b c} val d otherval {} single'))
+ self.assertEqual(ttk._format_mapdict(opts, script=True),
+ ('-a', '{{b c} val d otherval {} single}'))
+
+ self.assertEqual(ttk._format_mapdict({2: []}), ('-2', ''))
+
+ opts = {u'üñíćódè': [(u'á', u'vãl')]}
+ result = ttk._format_mapdict(opts)
+ self.assertEqual(result, (u'-üñíćódè', u'á vãl'))
+
+ # empty states
+ valid = {'opt': [('', u'', 'hi')]}
+ self.assertEqual(ttk._format_mapdict(valid), ('-opt', '{ } hi'))
+
+ # when passing multiple states, they all must be strings
+ invalid = {'opt': [(1, 2, 'valid val')]}
+ self.assertRaises(TypeError, ttk._format_mapdict, invalid)
+ invalid = {'opt': [([1], '2', 'valid val')]}
+ self.assertRaises(TypeError, ttk._format_mapdict, invalid)
+ # but when passing a single state, it can be anything
+ valid = {'opt': [[1, 'value']]}
+ self.assertEqual(ttk._format_mapdict(valid), ('-opt', '1 value'))
+ # special attention to single states which evalute to False
+ for stateval in (None, 0, False, '', set()): # just some samples
+ valid = {'opt': [(stateval, 'value')]}
+ self.assertEqual(ttk._format_mapdict(valid),
+ ('-opt', '{} value'))
+
+ # values must be iterable
+ opts = {'a': None}
+ self.assertRaises(TypeError, ttk._format_mapdict, opts)
+
+ # items in the value must have size >= 2
+ self.assertRaises(IndexError, ttk._format_mapdict,
+ {'a': [('invalid', )]})
+
+
+ def test_format_elemcreate(self):
+ self.assertTrue(ttk._format_elemcreate(None), (None, ()))
+
+ ## Testing type = image
+ # image type expects at least an image name, so this should raise
+ # IndexError since it tries to access the index 0 of an empty tuple
+ self.assertRaises(IndexError, ttk._format_elemcreate, 'image')
+
+ # don't format returned values as a tcl script
+ # minimum acceptable for image type
+ self.assertEqual(ttk._format_elemcreate('image', False, 'test'),
+ ("test ", ()))
+ # specifying a state spec
+ self.assertEqual(ttk._format_elemcreate('image', False, 'test',
+ ('', 'a')), ("test {} a", ()))
+ # state spec with multiple states
+ self.assertEqual(ttk._format_elemcreate('image', False, 'test',
+ ('a', 'b', 'c')), ("test {a b} c", ()))
+ # state spec and options
+ res = ttk._format_elemcreate('image', False, 'test',
+ ('a', 'b'), a='x', b='y')
+ self.assertEqual(res[0], "test a b")
+ self.assertEqual(set(res[1]), {"-a", "x", "-b", "y"})
+ # format returned values as a tcl script
+ # state spec with multiple states and an option with a multivalue
+ self.assertEqual(ttk._format_elemcreate('image', True, 'test',
+ ('a', 'b', 'c', 'd'), x=[2, 3]), ("{test {a b c} d}", "-x {2 3}"))
+
+ ## Testing type = vsapi
+ # vsapi type expects at least a class name and a part_id, so this
+ # should raise a ValueError since it tries to get two elements from
+ # an empty tuple
+ self.assertRaises(ValueError, ttk._format_elemcreate, 'vsapi')
+
+ # don't format returned values as a tcl script
+ # minimum acceptable for vsapi
+ self.assertEqual(ttk._format_elemcreate('vsapi', False, 'a', 'b'),
+ ("a b ", ()))
+ # now with a state spec with multiple states
+ self.assertEqual(ttk._format_elemcreate('vsapi', False, 'a', 'b',
+ ('a', 'b', 'c')), ("a b {a b} c", ()))
+ # state spec and option
+ self.assertEqual(ttk._format_elemcreate('vsapi', False, 'a', 'b',
+ ('a', 'b'), opt='x'), ("a b a b", ("-opt", "x")))
+ # format returned values as a tcl script
+ # state spec with a multivalue and an option
+ self.assertEqual(ttk._format_elemcreate('vsapi', True, 'a', 'b',
+ ('a', 'b', [1, 2]), opt='x'), ("{a b {a b} {1 2}}", "-opt x"))
+
+ # Testing type = from
+ # from type expects at least a type name
+ self.assertRaises(IndexError, ttk._format_elemcreate, 'from')
+
+ self.assertEqual(ttk._format_elemcreate('from', False, 'a'),
+ ('a', ()))
+ self.assertEqual(ttk._format_elemcreate('from', False, 'a', 'b'),
+ ('a', ('b', )))
+ self.assertEqual(ttk._format_elemcreate('from', True, 'a', 'b'),
+ ('{a}', 'b'))
+
+
+ def test_format_layoutlist(self):
+ def sample(indent=0, indent_size=2):
+ return ttk._format_layoutlist(
+ [('a', {'other': [1, 2, 3], 'children':
+ [('b', {'children':
+ [('c', {'children':
+ [('d', {'nice': 'opt'})], 'something': (1, 2)
+ })]
+ })]
+ })], indent=indent, indent_size=indent_size)[0]
+
+ def sample_expected(indent=0, indent_size=2):
+ spaces = lambda amount=0: ' ' * (amount + indent)
+ return (
+ "%sa -other {1 2 3} -children {\n"
+ "%sb -children {\n"
+ "%sc -something {1 2} -children {\n"
+ "%sd -nice opt\n"
+ "%s}\n"
+ "%s}\n"
+ "%s}" % (spaces(), spaces(indent_size),
+ spaces(2 * indent_size), spaces(3 * indent_size),
+ spaces(2 * indent_size), spaces(indent_size), spaces()))
+
+ # empty layout
+ self.assertEqual(ttk._format_layoutlist([])[0], '')
+
+ # smallest (after an empty one) acceptable layout
+ smallest = ttk._format_layoutlist([('a', None)], indent=0)
+ self.assertEqual(smallest,
+ ttk._format_layoutlist([('a', '')], indent=0))
+ self.assertEqual(smallest[0], 'a')
+
+ # testing indentation levels
+ self.assertEqual(sample(), sample_expected())
+ for i in range(4):
+ self.assertEqual(sample(i), sample_expected(i))
+ self.assertEqual(sample(i, i), sample_expected(i, i))
+
+ # invalid layout format, different kind of exceptions will be
+ # raised
+
+ # plain wrong format
+ self.assertRaises(ValueError, ttk._format_layoutlist,
+ ['bad', 'format'])
+ self.assertRaises(TypeError, ttk._format_layoutlist, None)
+ # _format_layoutlist always expects the second item (in every item)
+ # to act like a dict (except when the value evalutes to False).
+ self.assertRaises(AttributeError,
+ ttk._format_layoutlist, [('a', 'b')])
+ # bad children formatting
+ self.assertRaises(ValueError, ttk._format_layoutlist,
+ [('name', {'children': {'a': None}})])
+
+
+ def test_script_from_settings(self):
+ # empty options
+ self.assertFalse(ttk._script_from_settings({'name':
+ {'configure': None, 'map': None, 'element create': None}}))
+
+ # empty layout
+ self.assertEqual(
+ ttk._script_from_settings({'name': {'layout': None}}),
+ "ttk::style layout name {\nnull\n}")
+
+ configdict = {u'αβγ': True, u'á': False}
+ self.assertTrue(
+ ttk._script_from_settings({'name': {'configure': configdict}}))
+
+ mapdict = {u'üñíćódè': [(u'á', u'vãl')]}
+ self.assertTrue(
+ ttk._script_from_settings({'name': {'map': mapdict}}))
+
+ # invalid image element
+ self.assertRaises(IndexError,
+ ttk._script_from_settings, {'name': {'element create': ['image']}})
+
+ # minimal valid image
+ self.assertTrue(ttk._script_from_settings({'name':
+ {'element create': ['image', 'name']}}))
+
+ image = {'thing': {'element create':
+ ['image', 'name', ('state1', 'state2', 'val')]}}
+ self.assertEqual(ttk._script_from_settings(image),
+ "ttk::style element create thing image {name {state1 state2} val} ")
+
+ image['thing']['element create'].append({'opt': 30})
+ self.assertEqual(ttk._script_from_settings(image),
+ "ttk::style element create thing image {name {state1 state2} val} "
+ "-opt 30")
+
+ image['thing']['element create'][-1]['opt'] = [MockTclObj(3),
+ MockTclObj('2m')]
+ self.assertEqual(ttk._script_from_settings(image),
+ "ttk::style element create thing image {name {state1 state2} val} "
+ "-opt {3 2m}")
+
+
+ def test_tclobj_to_py(self):
+ self.assertEqual(
+ ttk._tclobj_to_py((MockStateSpec('a', 'b'), 'val')),
+ [('a', 'b', 'val')])
+ self.assertEqual(
+ ttk._tclobj_to_py([MockTclObj('1'), 2, MockTclObj('3m')]),
+ [1, 2, '3m'])
+
+
+ def test_list_from_statespec(self):
+ def test_it(sspec, value, res_value, states):
+ self.assertEqual(ttk._list_from_statespec(
+ (sspec, value)), [states + (res_value, )])
+
+ states_even = tuple('state%d' % i for i in range(6))
+ statespec = MockStateSpec(*states_even)
+ test_it(statespec, 'val', 'val', states_even)
+ test_it(statespec, MockTclObj('val'), 'val', states_even)
+
+ states_odd = tuple('state%d' % i for i in range(5))
+ statespec = MockStateSpec(*states_odd)
+ test_it(statespec, 'val', 'val', states_odd)
+
+ test_it(('a', 'b', 'c'), MockTclObj('val'), 'val', ('a', 'b', 'c'))
+
+
+ def test_list_from_layouttuple(self):
+ tk = MockTkApp()
+
+ # empty layout tuple
+ self.assertFalse(ttk._list_from_layouttuple(tk, ()))
+
+ # shortest layout tuple
+ self.assertEqual(ttk._list_from_layouttuple(tk, ('name', )),
+ [('name', {})])
+
+ # not so interesting ltuple
+ sample_ltuple = ('name', '-option', 'value')
+ self.assertEqual(ttk._list_from_layouttuple(tk, sample_ltuple),
+ [('name', {'option': 'value'})])
+
+ # empty children
+ self.assertEqual(ttk._list_from_layouttuple(tk,
+ ('something', '-children', ())),
+ [('something', {'children': []})]
+ )
+
+ # more interesting ltuple
+ ltuple = (
+ 'name', '-option', 'niceone', '-children', (
+ ('otherone', '-children', (
+ ('child', )), '-otheropt', 'othervalue'
+ )
+ )
+ )
+ self.assertEqual(ttk._list_from_layouttuple(tk, ltuple),
+ [('name', {'option': 'niceone', 'children':
+ [('otherone', {'otheropt': 'othervalue', 'children':
+ [('child', {})]
+ })]
+ })]
+ )
+
+ # bad tuples
+ self.assertRaises(ValueError, ttk._list_from_layouttuple, tk,
+ ('name', 'no_minus'))
+ self.assertRaises(ValueError, ttk._list_from_layouttuple, tk,
+ ('name', 'no_minus', 'value'))
+ self.assertRaises(ValueError, ttk._list_from_layouttuple, tk,
+ ('something', '-children')) # no children
+
+
+ def test_val_or_dict(self):
+ def func(res, opt=None, val=None):
+ if opt is None:
+ return res
+ if val is None:
+ return "test val"
+ return (opt, val)
+
+ tk = MockTkApp()
+ tk.call = func
+
+ self.assertEqual(ttk._val_or_dict(tk, {}, '-test:3'),
+ {'test': '3'})
+ self.assertEqual(ttk._val_or_dict(tk, {}, ('-test', 3)),
+ {'test': 3})
+
+ self.assertEqual(ttk._val_or_dict(tk, {'test': None}, 'x:y'),
+ 'test val')
+
+ self.assertEqual(ttk._val_or_dict(tk, {'test': 3}, 'x:y'),
+ {'test': 3})
+
+
+ def test_convert_stringval(self):
+ tests = (
+ (0, 0), ('09', 9), ('a', 'a'), (u'áÚ', u'áÚ'), ([], '[]'),
+ (None, 'None')
+ )
+ for orig, expected in tests:
+ self.assertEqual(ttk._convert_stringval(orig), expected)
+
+ if sys.getdefaultencoding() == 'ascii':
+ self.assertRaises(UnicodeDecodeError,
+ ttk._convert_stringval, 'á')
+
+
+class TclObjsToPyTest(unittest.TestCase):
+
+ def test_unicode(self):
+ adict = {'opt': u'välúè'}
+ self.assertEqual(ttk.tclobjs_to_py(adict), {'opt': u'välúè'})
+
+ adict['opt'] = MockTclObj(adict['opt'])
+ self.assertEqual(ttk.tclobjs_to_py(adict), {'opt': u'välúè'})
+
+ def test_multivalues(self):
+ adict = {'opt': [1, 2, 3, 4]}
+ self.assertEqual(ttk.tclobjs_to_py(adict), {'opt': [1, 2, 3, 4]})
+
+ adict['opt'] = [1, 'xm', 3]
+ self.assertEqual(ttk.tclobjs_to_py(adict), {'opt': [1, 'xm', 3]})
+
+ adict['opt'] = (MockStateSpec('a', 'b'), u'válũè')
+ self.assertEqual(ttk.tclobjs_to_py(adict),
+ {'opt': [('a', 'b', u'válũè')]})
+
+ self.assertEqual(ttk.tclobjs_to_py({'x': ['y z']}),
+ {'x': ['y z']})
+
+ def test_nosplit(self):
+ self.assertEqual(ttk.tclobjs_to_py({'text': 'some text'}),
+ {'text': 'some text'})
+
+tests_nogui = (InternalFunctionsTest, TclObjsToPyTest)
+
+if __name__ == "__main__":
+ from test.test_support import run_unittest
+ run_unittest(*tests_nogui)
diff --git a/lib/python2.7/lib-tk/test/test_ttk/test_style.py b/lib/python2.7/lib-tk/test/test_ttk/test_style.py
new file mode 100644
index 00000000..fe122e73
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_ttk/test_style.py
@@ -0,0 +1,92 @@
+import unittest
+import Tkinter as tkinter
+import ttk
+from test.test_support import requires, run_unittest
+from test_ttk.support import AbstractTkTest
+
+requires('gui')
+
+class StyleTest(AbstractTkTest, unittest.TestCase):
+
+ def setUp(self):
+ super(StyleTest, self).setUp()
+ self.style = ttk.Style(self.root)
+
+
+ def test_configure(self):
+ style = self.style
+ style.configure('TButton', background='yellow')
+ self.assertEqual(style.configure('TButton', 'background'),
+ 'yellow')
+ self.assertIsInstance(style.configure('TButton'), dict)
+
+
+ def test_map(self):
+ style = self.style
+ style.map('TButton', background=[('active', 'background', 'blue')])
+ self.assertEqual(style.map('TButton', 'background'),
+ [('active', 'background', 'blue')] if self.wantobjects else
+ [('active background', 'blue')])
+ self.assertIsInstance(style.map('TButton'), dict)
+
+
+ def test_lookup(self):
+ style = self.style
+ style.configure('TButton', background='yellow')
+ style.map('TButton', background=[('active', 'background', 'blue')])
+
+ self.assertEqual(style.lookup('TButton', 'background'), 'yellow')
+ self.assertEqual(style.lookup('TButton', 'background',
+ ['active', 'background']), 'blue')
+ self.assertEqual(style.lookup('TButton', 'optionnotdefined',
+ default='iknewit'), 'iknewit')
+
+
+ def test_layout(self):
+ style = self.style
+ self.assertRaises(tkinter.TclError, style.layout, 'NotALayout')
+ tv_style = style.layout('Treeview')
+
+ # "erase" Treeview layout
+ style.layout('Treeview', '')
+ self.assertEqual(style.layout('Treeview'),
+ [('null', {'sticky': 'nswe'})]
+ )
+
+ # restore layout
+ style.layout('Treeview', tv_style)
+ self.assertEqual(style.layout('Treeview'), tv_style)
+
+ # should return a list
+ self.assertIsInstance(style.layout('TButton'), list)
+
+ # correct layout, but "option" doesn't exist as option
+ self.assertRaises(tkinter.TclError, style.layout, 'Treeview',
+ [('name', {'option': 'inexistent'})])
+
+
+ def test_theme_use(self):
+ self.assertRaises(tkinter.TclError, self.style.theme_use,
+ 'nonexistingname')
+
+ curr_theme = self.style.theme_use()
+ new_theme = None
+ for theme in self.style.theme_names():
+ if theme != curr_theme:
+ new_theme = theme
+ self.style.theme_use(theme)
+ break
+ else:
+ # just one theme available, can't go on with tests
+ return
+
+ self.assertFalse(curr_theme == new_theme)
+ self.assertFalse(new_theme != self.style.theme_use())
+
+ self.style.theme_use(curr_theme)
+
+
+tests_gui = (StyleTest, )
+
+if __name__ == "__main__":
+ run_unittest(*tests_gui)
diff --git a/lib/python2.7/lib-tk/test/test_ttk/test_widgets.py b/lib/python2.7/lib-tk/test/test_ttk/test_widgets.py
new file mode 100644
index 00000000..a84960d2
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/test_ttk/test_widgets.py
@@ -0,0 +1,1674 @@
+import unittest
+import Tkinter as tkinter
+from Tkinter import TclError
+import ttk
+from test.test_support import requires, run_unittest, have_unicode, u
+import sys
+
+from test_functions import MockTclObj
+from support import (AbstractTkTest, tcl_version, get_tk_patchlevel,
+ simulate_mouse_click)
+from widget_tests import (add_standard_options, noconv, noconv_meth,
+ AbstractWidgetTest, StandardOptionsTests,
+ IntegerSizeTests, PixelSizeTests,
+ setUpModule)
+
+requires('gui')
+
+
+class StandardTtkOptionsTests(StandardOptionsTests):
+
+ def test_class(self):
+ widget = self.create()
+ self.assertEqual(widget['class'], '')
+ errmsg='attempt to change read-only option'
+ if get_tk_patchlevel() < (8, 6, 0, 'beta', 3):
+ errmsg='Attempt to change read-only option'
+ self.checkInvalidParam(widget, 'class', 'Foo', errmsg=errmsg)
+ widget2 = self.create(class_='Foo')
+ self.assertEqual(widget2['class'], 'Foo')
+
+ def test_padding(self):
+ widget = self.create()
+ self.checkParam(widget, 'padding', 0, expected=('0',))
+ self.checkParam(widget, 'padding', 5, expected=('5',))
+ self.checkParam(widget, 'padding', (5, 6), expected=('5', '6'))
+ self.checkParam(widget, 'padding', (5, 6, 7),
+ expected=('5', '6', '7'))
+ self.checkParam(widget, 'padding', (5, 6, 7, 8),
+ expected=('5', '6', '7', '8'))
+ self.checkParam(widget, 'padding', ('5p', '6p', '7p', '8p'))
+ self.checkParam(widget, 'padding', (), expected='')
+
+ def test_style(self):
+ widget = self.create()
+ self.assertEqual(widget['style'], '')
+ errmsg = 'Layout Foo not found'
+ if hasattr(self, 'default_orient'):
+ errmsg = ('Layout %s.Foo not found' %
+ getattr(self, 'default_orient').title())
+ self.checkInvalidParam(widget, 'style', 'Foo',
+ errmsg=errmsg)
+ widget2 = self.create(class_='Foo')
+ self.assertEqual(widget2['class'], 'Foo')
+ # XXX
+ pass
+
+
+class WidgetTest(AbstractTkTest, unittest.TestCase):
+ """Tests methods available in every ttk widget."""
+
+ def setUp(self):
+ super(WidgetTest, self).setUp()
+ self.widget = ttk.Button(self.root, width=0, text="Text")
+ self.widget.pack()
+ self.widget.wait_visibility()
+
+
+ def test_identify(self):
+ self.widget.update_idletasks()
+ self.assertEqual(self.widget.identify(
+ self.widget.winfo_width() // 2,
+ self.widget.winfo_height() // 2
+ ), "label")
+ self.assertEqual(self.widget.identify(-1, -1), "")
+
+ self.assertRaises(tkinter.TclError, self.widget.identify, None, 5)
+ self.assertRaises(tkinter.TclError, self.widget.identify, 5, None)
+ self.assertRaises(tkinter.TclError, self.widget.identify, 5, '')
+
+
+ def test_widget_state(self):
+ # XXX not sure about the portability of all these tests
+ self.assertEqual(self.widget.state(), ())
+ self.assertEqual(self.widget.instate(['!disabled']), True)
+
+ # changing from !disabled to disabled
+ self.assertEqual(self.widget.state(['disabled']), ('!disabled', ))
+ # no state change
+ self.assertEqual(self.widget.state(['disabled']), ())
+ # change back to !disable but also active
+ self.assertEqual(self.widget.state(['!disabled', 'active']),
+ ('!active', 'disabled'))
+ # no state changes, again
+ self.assertEqual(self.widget.state(['!disabled', 'active']), ())
+ self.assertEqual(self.widget.state(['active', '!disabled']), ())
+
+ def test_cb(arg1, **kw):
+ return arg1, kw
+ self.assertEqual(self.widget.instate(['!disabled'],
+ test_cb, "hi", **{"msg": "there"}),
+ ('hi', {'msg': 'there'}))
+
+ # attempt to set invalid statespec
+ currstate = self.widget.state()
+ self.assertRaises(tkinter.TclError, self.widget.instate,
+ ['badstate'])
+ self.assertRaises(tkinter.TclError, self.widget.instate,
+ ['disabled', 'badstate'])
+ # verify that widget didn't change its state
+ self.assertEqual(currstate, self.widget.state())
+
+ # ensuring that passing None as state doesn't modify current state
+ self.widget.state(['active', '!disabled'])
+ self.assertEqual(self.widget.state(), ('active', ))
+
+
+class AbstractToplevelTest(AbstractWidgetTest, PixelSizeTests):
+ _conv_pixels = noconv_meth
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class FrameTest(AbstractToplevelTest, unittest.TestCase):
+ OPTIONS = (
+ 'borderwidth', 'class', 'cursor', 'height',
+ 'padding', 'relief', 'style', 'takefocus',
+ 'width',
+ )
+
+ def create(self, **kwargs):
+ return ttk.Frame(self.root, **kwargs)
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class LabelFrameTest(AbstractToplevelTest, unittest.TestCase):
+ OPTIONS = (
+ 'borderwidth', 'class', 'cursor', 'height',
+ 'labelanchor', 'labelwidget',
+ 'padding', 'relief', 'style', 'takefocus',
+ 'text', 'underline', 'width',
+ )
+
+ def create(self, **kwargs):
+ return ttk.LabelFrame(self.root, **kwargs)
+
+ def test_labelanchor(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'labelanchor',
+ 'e', 'en', 'es', 'n', 'ne', 'nw', 's', 'se', 'sw', 'w', 'wn', 'ws',
+ errmsg='Bad label anchor specification {}')
+ self.checkInvalidParam(widget, 'labelanchor', 'center')
+
+ def test_labelwidget(self):
+ widget = self.create()
+ label = ttk.Label(self.root, text='Mupp', name='foo')
+ self.checkParam(widget, 'labelwidget', label, expected='.foo')
+ label.destroy()
+
+
+class AbstractLabelTest(AbstractWidgetTest):
+
+ def checkImageParam(self, widget, name):
+ image = tkinter.PhotoImage(master=self.root, name='image1')
+ image2 = tkinter.PhotoImage(master=self.root, name='image2')
+ self.checkParam(widget, name, image, expected=('image1',))
+ self.checkParam(widget, name, 'image1', expected=('image1',))
+ self.checkParam(widget, name, (image,), expected=('image1',))
+ self.checkParam(widget, name, (image, 'active', image2),
+ expected=('image1', 'active', 'image2'))
+ self.checkParam(widget, name, 'image1 active image2',
+ expected=('image1', 'active', 'image2'))
+ self.checkInvalidParam(widget, name, 'spam',
+ errmsg='image "spam" doesn\'t exist')
+
+ def test_compound(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'compound',
+ 'none', 'text', 'image', 'center',
+ 'top', 'bottom', 'left', 'right')
+
+ def test_state(self):
+ widget = self.create()
+ self.checkParams(widget, 'state', 'active', 'disabled', 'normal')
+
+ def test_width(self):
+ widget = self.create()
+ self.checkParams(widget, 'width', 402, -402, 0)
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class LabelTest(AbstractLabelTest, unittest.TestCase):
+ OPTIONS = (
+ 'anchor', 'background', 'borderwidth',
+ 'class', 'compound', 'cursor', 'font', 'foreground',
+ 'image', 'justify', 'padding', 'relief', 'state', 'style',
+ 'takefocus', 'text', 'textvariable',
+ 'underline', 'width', 'wraplength',
+ )
+ _conv_pixels = noconv_meth
+
+ def create(self, **kwargs):
+ return ttk.Label(self.root, **kwargs)
+
+ def test_font(self):
+ widget = self.create()
+ self.checkParam(widget, 'font',
+ '-Adobe-Helvetica-Medium-R-Normal--*-120-*-*-*-*-*-*')
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class ButtonTest(AbstractLabelTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'command', 'compound', 'cursor', 'default',
+ 'image', 'padding', 'state', 'style',
+ 'takefocus', 'text', 'textvariable',
+ 'underline', 'width',
+ )
+
+ def create(self, **kwargs):
+ return ttk.Button(self.root, **kwargs)
+
+ def test_default(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'default', 'normal', 'active', 'disabled')
+
+ def test_invoke(self):
+ success = []
+ btn = ttk.Button(self.root, command=lambda: success.append(1))
+ btn.invoke()
+ self.assertTrue(success)
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class CheckbuttonTest(AbstractLabelTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'command', 'compound', 'cursor',
+ 'image',
+ 'offvalue', 'onvalue',
+ 'padding', 'state', 'style',
+ 'takefocus', 'text', 'textvariable',
+ 'underline', 'variable', 'width',
+ )
+
+ def create(self, **kwargs):
+ return ttk.Checkbutton(self.root, **kwargs)
+
+ def test_offvalue(self):
+ widget = self.create()
+ self.checkParams(widget, 'offvalue', 1, 2.3, '', 'any string')
+
+ def test_onvalue(self):
+ widget = self.create()
+ self.checkParams(widget, 'onvalue', 1, 2.3, '', 'any string')
+
+ def test_invoke(self):
+ success = []
+ def cb_test():
+ success.append(1)
+ return "cb test called"
+
+ cbtn = ttk.Checkbutton(self.root, command=cb_test)
+ # the variable automatically created by ttk.Checkbutton is actually
+ # undefined till we invoke the Checkbutton
+ self.assertEqual(cbtn.state(), ('alternate', ))
+ self.assertRaises(tkinter.TclError, cbtn.tk.globalgetvar,
+ cbtn['variable'])
+
+ res = cbtn.invoke()
+ self.assertEqual(res, "cb test called")
+ self.assertEqual(cbtn['onvalue'],
+ cbtn.tk.globalgetvar(cbtn['variable']))
+ self.assertTrue(success)
+
+ cbtn['command'] = ''
+ res = cbtn.invoke()
+ self.assertFalse(str(res))
+ self.assertLessEqual(len(success), 1)
+ self.assertEqual(cbtn['offvalue'],
+ cbtn.tk.globalgetvar(cbtn['variable']))
+
+
+@add_standard_options(IntegerSizeTests, StandardTtkOptionsTests)
+class EntryTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'background', 'class', 'cursor',
+ 'exportselection', 'font', 'foreground',
+ 'invalidcommand', 'justify',
+ 'show', 'state', 'style', 'takefocus', 'textvariable',
+ 'validate', 'validatecommand', 'width', 'xscrollcommand',
+ )
+
+ def setUp(self):
+ super(EntryTest, self).setUp()
+ self.entry = self.create()
+
+ def create(self, **kwargs):
+ return ttk.Entry(self.root, **kwargs)
+
+ def test_invalidcommand(self):
+ widget = self.create()
+ self.checkCommandParam(widget, 'invalidcommand')
+
+ def test_show(self):
+ widget = self.create()
+ self.checkParam(widget, 'show', '*')
+ self.checkParam(widget, 'show', '')
+ self.checkParam(widget, 'show', ' ')
+
+ def test_state(self):
+ widget = self.create()
+ self.checkParams(widget, 'state',
+ 'disabled', 'normal', 'readonly')
+
+ def test_validate(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'validate',
+ 'all', 'key', 'focus', 'focusin', 'focusout', 'none')
+
+ def test_validatecommand(self):
+ widget = self.create()
+ self.checkCommandParam(widget, 'validatecommand')
+
+
+ def test_bbox(self):
+ self.assertIsBoundingBox(self.entry.bbox(0))
+ self.assertRaises(tkinter.TclError, self.entry.bbox, 'noindex')
+ self.assertRaises(tkinter.TclError, self.entry.bbox, None)
+
+
+ def test_identify(self):
+ self.entry.pack()
+ self.entry.wait_visibility()
+ self.entry.update_idletasks()
+
+ self.assertEqual(self.entry.identify(5, 5), "textarea")
+ self.assertEqual(self.entry.identify(-1, -1), "")
+
+ self.assertRaises(tkinter.TclError, self.entry.identify, None, 5)
+ self.assertRaises(tkinter.TclError, self.entry.identify, 5, None)
+ self.assertRaises(tkinter.TclError, self.entry.identify, 5, '')
+
+
+ def test_validation_options(self):
+ success = []
+ test_invalid = lambda: success.append(True)
+
+ self.entry['validate'] = 'none'
+ self.entry['validatecommand'] = lambda: False
+
+ self.entry['invalidcommand'] = test_invalid
+ self.entry.validate()
+ self.assertTrue(success)
+
+ self.entry['invalidcommand'] = ''
+ self.entry.validate()
+ self.assertEqual(len(success), 1)
+
+ self.entry['invalidcommand'] = test_invalid
+ self.entry['validatecommand'] = lambda: True
+ self.entry.validate()
+ self.assertEqual(len(success), 1)
+
+ self.entry['validatecommand'] = ''
+ self.entry.validate()
+ self.assertEqual(len(success), 1)
+
+ self.entry['validatecommand'] = True
+ self.assertRaises(tkinter.TclError, self.entry.validate)
+
+
+ def test_validation(self):
+ validation = []
+ def validate(to_insert):
+ if not 'a' <= to_insert.lower() <= 'z':
+ validation.append(False)
+ return False
+ validation.append(True)
+ return True
+
+ self.entry['validate'] = 'key'
+ self.entry['validatecommand'] = self.entry.register(validate), '%S'
+
+ self.entry.insert('end', 1)
+ self.entry.insert('end', 'a')
+ self.assertEqual(validation, [False, True])
+ self.assertEqual(self.entry.get(), 'a')
+
+
+ def test_revalidation(self):
+ def validate(content):
+ for letter in content:
+ if not 'a' <= letter.lower() <= 'z':
+ return False
+ return True
+
+ self.entry['validatecommand'] = self.entry.register(validate), '%P'
+
+ self.entry.insert('end', 'avocado')
+ self.assertEqual(self.entry.validate(), True)
+ self.assertEqual(self.entry.state(), ())
+
+ self.entry.delete(0, 'end')
+ self.assertEqual(self.entry.get(), '')
+
+ self.entry.insert('end', 'a1b')
+ self.assertEqual(self.entry.validate(), False)
+ self.assertEqual(self.entry.state(), ('invalid', ))
+
+ self.entry.delete(1)
+ self.assertEqual(self.entry.validate(), True)
+ self.assertEqual(self.entry.state(), ())
+
+
+@add_standard_options(IntegerSizeTests, StandardTtkOptionsTests)
+class ComboboxTest(EntryTest, unittest.TestCase):
+ OPTIONS = (
+ 'background', 'class', 'cursor', 'exportselection',
+ 'font', 'foreground', 'height', 'invalidcommand',
+ 'justify', 'postcommand', 'show', 'state', 'style',
+ 'takefocus', 'textvariable',
+ 'validate', 'validatecommand', 'values',
+ 'width', 'xscrollcommand',
+ )
+
+ def setUp(self):
+ super(ComboboxTest, self).setUp()
+ self.combo = self.create()
+
+ def create(self, **kwargs):
+ return ttk.Combobox(self.root, **kwargs)
+
+ def test_height(self):
+ widget = self.create()
+ self.checkParams(widget, 'height', 100, 101.2, 102.6, -100, 0, '1i')
+
+ def _show_drop_down_listbox(self):
+ width = self.combo.winfo_width()
+ self.combo.event_generate('<ButtonPress-1>', x=width - 5, y=5)
+ self.combo.event_generate('<ButtonRelease-1>', x=width - 5, y=5)
+ self.combo.update_idletasks()
+
+
+ def test_virtual_event(self):
+ success = []
+
+ self.combo['values'] = [1]
+ self.combo.bind('<<ComboboxSelected>>',
+ lambda evt: success.append(True))
+ self.combo.pack()
+ self.combo.wait_visibility()
+
+ height = self.combo.winfo_height()
+ self._show_drop_down_listbox()
+ self.combo.update()
+ self.combo.event_generate('<Return>')
+ self.combo.update()
+
+ self.assertTrue(success)
+
+
+ def test_postcommand(self):
+ success = []
+
+ self.combo['postcommand'] = lambda: success.append(True)
+ self.combo.pack()
+ self.combo.wait_visibility()
+
+ self._show_drop_down_listbox()
+ self.assertTrue(success)
+
+ # testing postcommand removal
+ self.combo['postcommand'] = ''
+ self._show_drop_down_listbox()
+ self.assertEqual(len(success), 1)
+
+
+ def test_values(self):
+ def check_get_current(getval, currval):
+ self.assertEqual(self.combo.get(), getval)
+ self.assertEqual(self.combo.current(), currval)
+
+ self.assertEqual(self.combo['values'],
+ () if tcl_version < (8, 5) else '')
+ check_get_current('', -1)
+
+ self.checkParam(self.combo, 'values', 'mon tue wed thur',
+ expected=('mon', 'tue', 'wed', 'thur'))
+ self.checkParam(self.combo, 'values', ('mon', 'tue', 'wed', 'thur'))
+ self.checkParam(self.combo, 'values', (42, 3.14, '', 'any string'))
+ self.checkParam(self.combo, 'values', () if tcl_version < (8, 5) else '')
+
+ self.combo['values'] = ['a', 1, 'c']
+
+ self.combo.set('c')
+ check_get_current('c', 2)
+
+ self.combo.current(0)
+ check_get_current('a', 0)
+
+ self.combo.set('d')
+ check_get_current('d', -1)
+
+ # testing values with empty string
+ self.combo.set('')
+ self.combo['values'] = (1, 2, '', 3)
+ check_get_current('', 2)
+
+ # testing values with empty string set through configure
+ self.combo.configure(values=[1, '', 2])
+ self.assertEqual(self.combo['values'],
+ ('1', '', '2') if self.wantobjects else
+ '1 {} 2')
+
+ # testing values with spaces
+ self.combo['values'] = ['a b', 'a\tb', 'a\nb']
+ self.assertEqual(self.combo['values'],
+ ('a b', 'a\tb', 'a\nb') if self.wantobjects else
+ '{a b} {a\tb} {a\nb}')
+
+ # testing values with special characters
+ self.combo['values'] = [r'a\tb', '"a"', '} {']
+ self.assertEqual(self.combo['values'],
+ (r'a\tb', '"a"', '} {') if self.wantobjects else
+ r'a\\tb {"a"} \}\ \{')
+
+ # out of range
+ self.assertRaises(tkinter.TclError, self.combo.current,
+ len(self.combo['values']))
+ # it expects an integer (or something that can be converted to int)
+ self.assertRaises(tkinter.TclError, self.combo.current, '')
+
+ # testing creating combobox with empty string in values
+ combo2 = ttk.Combobox(self.root, values=[1, 2, ''])
+ self.assertEqual(combo2['values'],
+ ('1', '2', '') if self.wantobjects else '1 2 {}')
+ combo2.destroy()
+
+
+@add_standard_options(IntegerSizeTests, StandardTtkOptionsTests)
+class PanedWindowTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'cursor', 'height',
+ 'orient', 'style', 'takefocus', 'width',
+ )
+
+ def setUp(self):
+ super(PanedWindowTest, self).setUp()
+ self.paned = self.create()
+
+ def create(self, **kwargs):
+ return ttk.PanedWindow(self.root, **kwargs)
+
+ def test_orient(self):
+ widget = self.create()
+ self.assertEqual(str(widget['orient']), 'vertical')
+ errmsg='attempt to change read-only option'
+ if get_tk_patchlevel() < (8, 6, 0, 'beta', 3):
+ errmsg='Attempt to change read-only option'
+ self.checkInvalidParam(widget, 'orient', 'horizontal',
+ errmsg=errmsg)
+ widget2 = self.create(orient='horizontal')
+ self.assertEqual(str(widget2['orient']), 'horizontal')
+
+ def test_add(self):
+ # attempt to add a child that is not a direct child of the paned window
+ label = ttk.Label(self.paned)
+ child = ttk.Label(label)
+ self.assertRaises(tkinter.TclError, self.paned.add, child)
+ label.destroy()
+ child.destroy()
+ # another attempt
+ label = ttk.Label(self.root)
+ child = ttk.Label(label)
+ self.assertRaises(tkinter.TclError, self.paned.add, child)
+ child.destroy()
+ label.destroy()
+
+ good_child = ttk.Label(self.root)
+ self.paned.add(good_child)
+ # re-adding a child is not accepted
+ self.assertRaises(tkinter.TclError, self.paned.add, good_child)
+
+ other_child = ttk.Label(self.paned)
+ self.paned.add(other_child)
+ self.assertEqual(self.paned.pane(0), self.paned.pane(1))
+ self.assertRaises(tkinter.TclError, self.paned.pane, 2)
+ good_child.destroy()
+ other_child.destroy()
+ self.assertRaises(tkinter.TclError, self.paned.pane, 0)
+
+
+ def test_forget(self):
+ self.assertRaises(tkinter.TclError, self.paned.forget, None)
+ self.assertRaises(tkinter.TclError, self.paned.forget, 0)
+
+ self.paned.add(ttk.Label(self.root))
+ self.paned.forget(0)
+ self.assertRaises(tkinter.TclError, self.paned.forget, 0)
+
+
+ def test_insert(self):
+ self.assertRaises(tkinter.TclError, self.paned.insert, None, 0)
+ self.assertRaises(tkinter.TclError, self.paned.insert, 0, None)
+ self.assertRaises(tkinter.TclError, self.paned.insert, 0, 0)
+
+ child = ttk.Label(self.root)
+ child2 = ttk.Label(self.root)
+ child3 = ttk.Label(self.root)
+
+ self.assertRaises(tkinter.TclError, self.paned.insert, 0, child)
+
+ self.paned.insert('end', child2)
+ self.paned.insert(0, child)
+ self.assertEqual(self.paned.panes(), (str(child), str(child2)))
+
+ self.paned.insert(0, child2)
+ self.assertEqual(self.paned.panes(), (str(child2), str(child)))
+
+ self.paned.insert('end', child3)
+ self.assertEqual(self.paned.panes(),
+ (str(child2), str(child), str(child3)))
+
+ # reinserting a child should move it to its current position
+ panes = self.paned.panes()
+ self.paned.insert('end', child3)
+ self.assertEqual(panes, self.paned.panes())
+
+ # moving child3 to child2 position should result in child2 ending up
+ # in previous child position and child ending up in previous child3
+ # position
+ self.paned.insert(child2, child3)
+ self.assertEqual(self.paned.panes(),
+ (str(child3), str(child2), str(child)))
+
+
+ def test_pane(self):
+ self.assertRaises(tkinter.TclError, self.paned.pane, 0)
+
+ child = ttk.Label(self.root)
+ self.paned.add(child)
+ self.assertIsInstance(self.paned.pane(0), dict)
+ self.assertEqual(self.paned.pane(0, weight=None),
+ 0 if self.wantobjects else '0')
+ # newer form for querying a single option
+ self.assertEqual(self.paned.pane(0, 'weight'),
+ 0 if self.wantobjects else '0')
+ self.assertEqual(self.paned.pane(0), self.paned.pane(str(child)))
+
+ self.assertRaises(tkinter.TclError, self.paned.pane, 0,
+ badoption='somevalue')
+
+
+ def test_sashpos(self):
+ self.assertRaises(tkinter.TclError, self.paned.sashpos, None)
+ self.assertRaises(tkinter.TclError, self.paned.sashpos, '')
+ self.assertRaises(tkinter.TclError, self.paned.sashpos, 0)
+
+ child = ttk.Label(self.paned, text='a')
+ self.paned.add(child, weight=1)
+ self.assertRaises(tkinter.TclError, self.paned.sashpos, 0)
+ child2 = ttk.Label(self.paned, text='b')
+ self.paned.add(child2)
+ self.assertRaises(tkinter.TclError, self.paned.sashpos, 1)
+
+ self.paned.pack(expand=True, fill='both')
+ self.paned.wait_visibility()
+
+ curr_pos = self.paned.sashpos(0)
+ self.paned.sashpos(0, 1000)
+ self.assertNotEqual(curr_pos, self.paned.sashpos(0))
+ self.assertIsInstance(self.paned.sashpos(0), int)
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class RadiobuttonTest(AbstractLabelTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'command', 'compound', 'cursor',
+ 'image',
+ 'padding', 'state', 'style',
+ 'takefocus', 'text', 'textvariable',
+ 'underline', 'value', 'variable', 'width',
+ )
+
+ def create(self, **kwargs):
+ return ttk.Radiobutton(self.root, **kwargs)
+
+ def test_value(self):
+ widget = self.create()
+ self.checkParams(widget, 'value', 1, 2.3, '', 'any string')
+
+ def test_invoke(self):
+ success = []
+ def cb_test():
+ success.append(1)
+ return "cb test called"
+
+ myvar = tkinter.IntVar(self.root)
+ cbtn = ttk.Radiobutton(self.root, command=cb_test,
+ variable=myvar, value=0)
+ cbtn2 = ttk.Radiobutton(self.root, command=cb_test,
+ variable=myvar, value=1)
+
+ if self.wantobjects:
+ conv = lambda x: x
+ else:
+ conv = int
+
+ res = cbtn.invoke()
+ self.assertEqual(res, "cb test called")
+ self.assertEqual(conv(cbtn['value']), myvar.get())
+ self.assertEqual(myvar.get(),
+ conv(cbtn.tk.globalgetvar(cbtn['variable'])))
+ self.assertTrue(success)
+
+ cbtn2['command'] = ''
+ res = cbtn2.invoke()
+ self.assertEqual(str(res), '')
+ self.assertLessEqual(len(success), 1)
+ self.assertEqual(conv(cbtn2['value']), myvar.get())
+ self.assertEqual(myvar.get(),
+ conv(cbtn.tk.globalgetvar(cbtn['variable'])))
+
+ self.assertEqual(str(cbtn['variable']), str(cbtn2['variable']))
+
+
+class MenubuttonTest(AbstractLabelTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'compound', 'cursor', 'direction',
+ 'image', 'menu', 'padding', 'state', 'style',
+ 'takefocus', 'text', 'textvariable',
+ 'underline', 'width',
+ )
+
+ def create(self, **kwargs):
+ return ttk.Menubutton(self.root, **kwargs)
+
+ def test_direction(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'direction',
+ 'above', 'below', 'left', 'right', 'flush')
+
+ def test_menu(self):
+ widget = self.create()
+ menu = tkinter.Menu(widget, name='menu')
+ self.checkParam(widget, 'menu', menu, conv=str)
+ menu.destroy()
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class ScaleTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'command', 'cursor', 'from', 'length',
+ 'orient', 'style', 'takefocus', 'to', 'value', 'variable',
+ )
+ _conv_pixels = noconv_meth
+ default_orient = 'horizontal'
+
+ def setUp(self):
+ super(ScaleTest, self).setUp()
+ self.scale = self.create()
+ self.scale.pack()
+ self.scale.update()
+
+ def create(self, **kwargs):
+ return ttk.Scale(self.root, **kwargs)
+
+ def test_from(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'from', 100, 14.9, 15.1, conv=False)
+
+ def test_length(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'length', 130, 131.2, 135.6, '5i')
+
+ def test_to(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'to', 300, 14.9, 15.1, -10, conv=False)
+
+ def test_value(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'value', 300, 14.9, 15.1, -10, conv=False)
+
+ def test_custom_event(self):
+ failure = [1, 1, 1] # will need to be empty
+
+ funcid = self.scale.bind('<<RangeChanged>>', lambda evt: failure.pop())
+
+ self.scale['from'] = 10
+ self.scale['from_'] = 10
+ self.scale['to'] = 3
+
+ self.assertFalse(failure)
+
+ failure = [1, 1, 1]
+ self.scale.configure(from_=2, to=5)
+ self.scale.configure(from_=0, to=-2)
+ self.scale.configure(to=10)
+
+ self.assertFalse(failure)
+
+
+ def test_get(self):
+ if self.wantobjects:
+ conv = lambda x: x
+ else:
+ conv = float
+
+ scale_width = self.scale.winfo_width()
+ self.assertEqual(self.scale.get(scale_width, 0), self.scale['to'])
+
+ self.assertEqual(conv(self.scale.get(0, 0)), conv(self.scale['from']))
+ self.assertEqual(self.scale.get(), self.scale['value'])
+ self.scale['value'] = 30
+ self.assertEqual(self.scale.get(), self.scale['value'])
+
+ self.assertRaises(tkinter.TclError, self.scale.get, '', 0)
+ self.assertRaises(tkinter.TclError, self.scale.get, 0, '')
+
+
+ def test_set(self):
+ if self.wantobjects:
+ conv = lambda x: x
+ else:
+ conv = float
+
+ # set restricts the max/min values according to the current range
+ max = conv(self.scale['to'])
+ new_max = max + 10
+ self.scale.set(new_max)
+ self.assertEqual(conv(self.scale.get()), max)
+ min = conv(self.scale['from'])
+ self.scale.set(min - 1)
+ self.assertEqual(conv(self.scale.get()), min)
+
+ # changing directly the variable doesn't impose this limitation tho
+ var = tkinter.DoubleVar(self.root)
+ self.scale['variable'] = var
+ var.set(max + 5)
+ self.assertEqual(conv(self.scale.get()), var.get())
+ self.assertEqual(conv(self.scale.get()), max + 5)
+ del var
+
+ # the same happens with the value option
+ self.scale['value'] = max + 10
+ self.assertEqual(conv(self.scale.get()), max + 10)
+ self.assertEqual(conv(self.scale.get()), conv(self.scale['value']))
+
+ # nevertheless, note that the max/min values we can get specifying
+ # x, y coords are the ones according to the current range
+ self.assertEqual(conv(self.scale.get(0, 0)), min)
+ self.assertEqual(conv(self.scale.get(self.scale.winfo_width(), 0)), max)
+
+ self.assertRaises(tkinter.TclError, self.scale.set, None)
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class ProgressbarTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'cursor', 'orient', 'length',
+ 'mode', 'maximum', 'phase',
+ 'style', 'takefocus', 'value', 'variable',
+ )
+ _conv_pixels = noconv_meth
+ default_orient = 'horizontal'
+
+ def create(self, **kwargs):
+ return ttk.Progressbar(self.root, **kwargs)
+
+ def test_length(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'length', 100.1, 56.7, '2i')
+
+ def test_maximum(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'maximum', 150.2, 77.7, 0, -10, conv=False)
+
+ def test_mode(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'mode', 'determinate', 'indeterminate')
+
+ def test_phase(self):
+ # XXX
+ pass
+
+ def test_value(self):
+ widget = self.create()
+ self.checkFloatParam(widget, 'value', 150.2, 77.7, 0, -10,
+ conv=False)
+
+
+@unittest.skipIf(sys.platform == 'darwin',
+ 'ttk.Scrollbar is special on MacOSX')
+@add_standard_options(StandardTtkOptionsTests)
+class ScrollbarTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'command', 'cursor', 'orient', 'style', 'takefocus',
+ )
+ default_orient = 'vertical'
+
+ def create(self, **kwargs):
+ return ttk.Scrollbar(self.root, **kwargs)
+
+
+@add_standard_options(IntegerSizeTests, StandardTtkOptionsTests)
+class NotebookTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'cursor', 'height', 'padding', 'style', 'takefocus', 'width',
+ )
+
+ def setUp(self):
+ super(NotebookTest, self).setUp()
+ self.nb = self.create(padding=0)
+ self.child1 = ttk.Label(self.root)
+ self.child2 = ttk.Label(self.root)
+ self.nb.add(self.child1, text='a')
+ self.nb.add(self.child2, text='b')
+
+ def create(self, **kwargs):
+ return ttk.Notebook(self.root, **kwargs)
+
+ def test_tab_identifiers(self):
+ self.nb.forget(0)
+ self.nb.hide(self.child2)
+ self.assertRaises(tkinter.TclError, self.nb.tab, self.child1)
+ self.assertEqual(self.nb.index('end'), 1)
+ self.nb.add(self.child2)
+ self.assertEqual(self.nb.index('end'), 1)
+ self.nb.select(self.child2)
+
+ self.assertTrue(self.nb.tab('current'))
+ self.nb.add(self.child1, text='a')
+
+ self.nb.pack()
+ self.nb.wait_visibility()
+ if sys.platform == 'darwin':
+ tb_idx = "@20,5"
+ else:
+ tb_idx = "@5,5"
+ self.assertEqual(self.nb.tab(tb_idx), self.nb.tab('current'))
+
+ for i in range(5, 100, 5):
+ try:
+ if self.nb.tab('@%d, 5' % i, text=None) == 'a':
+ break
+ except tkinter.TclError:
+ pass
+
+ else:
+ self.fail("Tab with text 'a' not found")
+
+
+ def test_add_and_hidden(self):
+ self.assertRaises(tkinter.TclError, self.nb.hide, -1)
+ self.assertRaises(tkinter.TclError, self.nb.hide, 'hi')
+ self.assertRaises(tkinter.TclError, self.nb.hide, None)
+ self.assertRaises(tkinter.TclError, self.nb.add, None)
+ self.assertRaises(tkinter.TclError, self.nb.add, ttk.Label(self.root),
+ unknown='option')
+
+ tabs = self.nb.tabs()
+ self.nb.hide(self.child1)
+ self.nb.add(self.child1)
+ self.assertEqual(self.nb.tabs(), tabs)
+
+ child = ttk.Label(self.root)
+ self.nb.add(child, text='c')
+ tabs = self.nb.tabs()
+
+ curr = self.nb.index('current')
+ # verify that the tab gets readded at its previous position
+ child2_index = self.nb.index(self.child2)
+ self.nb.hide(self.child2)
+ self.nb.add(self.child2)
+ self.assertEqual(self.nb.tabs(), tabs)
+ self.assertEqual(self.nb.index(self.child2), child2_index)
+ self.assertEqual(str(self.child2), self.nb.tabs()[child2_index])
+ # but the tab next to it (not hidden) is the one selected now
+ self.assertEqual(self.nb.index('current'), curr + 1)
+
+
+ def test_forget(self):
+ self.assertRaises(tkinter.TclError, self.nb.forget, -1)
+ self.assertRaises(tkinter.TclError, self.nb.forget, 'hi')
+ self.assertRaises(tkinter.TclError, self.nb.forget, None)
+
+ tabs = self.nb.tabs()
+ child1_index = self.nb.index(self.child1)
+ self.nb.forget(self.child1)
+ self.assertNotIn(str(self.child1), self.nb.tabs())
+ self.assertEqual(len(tabs) - 1, len(self.nb.tabs()))
+
+ self.nb.add(self.child1)
+ self.assertEqual(self.nb.index(self.child1), 1)
+ self.assertNotEqual(child1_index, self.nb.index(self.child1))
+
+
+ def test_index(self):
+ self.assertRaises(tkinter.TclError, self.nb.index, -1)
+ self.assertRaises(tkinter.TclError, self.nb.index, None)
+
+ self.assertIsInstance(self.nb.index('end'), int)
+ self.assertEqual(self.nb.index(self.child1), 0)
+ self.assertEqual(self.nb.index(self.child2), 1)
+ self.assertEqual(self.nb.index('end'), 2)
+
+
+ def test_insert(self):
+ # moving tabs
+ tabs = self.nb.tabs()
+ self.nb.insert(1, tabs[0])
+ self.assertEqual(self.nb.tabs(), (tabs[1], tabs[0]))
+ self.nb.insert(self.child1, self.child2)
+ self.assertEqual(self.nb.tabs(), tabs)
+ self.nb.insert('end', self.child1)
+ self.assertEqual(self.nb.tabs(), (tabs[1], tabs[0]))
+ self.nb.insert('end', 0)
+ self.assertEqual(self.nb.tabs(), tabs)
+ # bad moves
+ self.assertRaises(tkinter.TclError, self.nb.insert, 2, tabs[0])
+ self.assertRaises(tkinter.TclError, self.nb.insert, -1, tabs[0])
+
+ # new tab
+ child3 = ttk.Label(self.root)
+ self.nb.insert(1, child3)
+ self.assertEqual(self.nb.tabs(), (tabs[0], str(child3), tabs[1]))
+ self.nb.forget(child3)
+ self.assertEqual(self.nb.tabs(), tabs)
+ self.nb.insert(self.child1, child3)
+ self.assertEqual(self.nb.tabs(), (str(child3), ) + tabs)
+ self.nb.forget(child3)
+ self.assertRaises(tkinter.TclError, self.nb.insert, 2, child3)
+ self.assertRaises(tkinter.TclError, self.nb.insert, -1, child3)
+
+ # bad inserts
+ self.assertRaises(tkinter.TclError, self.nb.insert, 'end', None)
+ self.assertRaises(tkinter.TclError, self.nb.insert, None, 0)
+ self.assertRaises(tkinter.TclError, self.nb.insert, None, None)
+
+
+ def test_select(self):
+ self.nb.pack()
+ self.nb.wait_visibility()
+
+ success = []
+ tab_changed = []
+
+ self.child1.bind('<Unmap>', lambda evt: success.append(True))
+ self.nb.bind('<<NotebookTabChanged>>',
+ lambda evt: tab_changed.append(True))
+
+ self.assertEqual(self.nb.select(), str(self.child1))
+ self.nb.select(self.child2)
+ self.assertTrue(success)
+ self.assertEqual(self.nb.select(), str(self.child2))
+
+ self.nb.update()
+ self.assertTrue(tab_changed)
+
+
+ def test_tab(self):
+ self.assertRaises(tkinter.TclError, self.nb.tab, -1)
+ self.assertRaises(tkinter.TclError, self.nb.tab, 'notab')
+ self.assertRaises(tkinter.TclError, self.nb.tab, None)
+
+ self.assertIsInstance(self.nb.tab(self.child1), dict)
+ self.assertEqual(self.nb.tab(self.child1, text=None), 'a')
+ # newer form for querying a single option
+ self.assertEqual(self.nb.tab(self.child1, 'text'), 'a')
+ self.nb.tab(self.child1, text='abc')
+ self.assertEqual(self.nb.tab(self.child1, text=None), 'abc')
+ self.assertEqual(self.nb.tab(self.child1, 'text'), 'abc')
+
+
+ def test_tabs(self):
+ self.assertEqual(len(self.nb.tabs()), 2)
+
+ self.nb.forget(self.child1)
+ self.nb.forget(self.child2)
+
+ self.assertEqual(self.nb.tabs(), ())
+
+
+ def test_traversal(self):
+ self.nb.pack()
+ self.nb.wait_visibility()
+
+ self.nb.select(0)
+
+ simulate_mouse_click(self.nb, 5, 5)
+ self.nb.focus_force()
+ self.nb.event_generate('<Control-Tab>')
+ self.assertEqual(self.nb.select(), str(self.child2))
+ self.nb.focus_force()
+ self.nb.event_generate('<Shift-Control-Tab>')
+ self.assertEqual(self.nb.select(), str(self.child1))
+ self.nb.focus_force()
+ self.nb.event_generate('<Shift-Control-Tab>')
+ self.assertEqual(self.nb.select(), str(self.child2))
+
+ self.nb.tab(self.child1, text='a', underline=0)
+ self.nb.enable_traversal()
+ self.nb.focus_force()
+ simulate_mouse_click(self.nb, 5, 5)
+ if sys.platform == 'darwin':
+ self.nb.event_generate('<Option-a>')
+ else:
+ self.nb.event_generate('<Alt-a>')
+ self.assertEqual(self.nb.select(), str(self.child1))
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class TreeviewTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'columns', 'cursor', 'displaycolumns',
+ 'height', 'padding', 'selectmode', 'show',
+ 'style', 'takefocus', 'xscrollcommand', 'yscrollcommand',
+ )
+
+ def setUp(self):
+ super(TreeviewTest, self).setUp()
+ self.tv = self.create(padding=0)
+
+ def create(self, **kwargs):
+ return ttk.Treeview(self.root, **kwargs)
+
+ def test_columns(self):
+ widget = self.create()
+ self.checkParam(widget, 'columns', 'a b c',
+ expected=('a', 'b', 'c'))
+ self.checkParam(widget, 'columns', ('a', 'b', 'c'))
+ self.checkParam(widget, 'columns', () if tcl_version < (8, 5) else '')
+
+ def test_displaycolumns(self):
+ widget = self.create()
+ widget['columns'] = ('a', 'b', 'c')
+ self.checkParam(widget, 'displaycolumns', 'b a c',
+ expected=('b', 'a', 'c'))
+ self.checkParam(widget, 'displaycolumns', ('b', 'a', 'c'))
+ self.checkParam(widget, 'displaycolumns', '#all',
+ expected=('#all',))
+ self.checkParam(widget, 'displaycolumns', (2, 1, 0))
+ self.checkInvalidParam(widget, 'displaycolumns', ('a', 'b', 'd'),
+ errmsg='Invalid column index d')
+ self.checkInvalidParam(widget, 'displaycolumns', (1, 2, 3),
+ errmsg='Column index 3 out of bounds')
+ self.checkInvalidParam(widget, 'displaycolumns', (1, -2),
+ errmsg='Column index -2 out of bounds')
+
+ def test_height(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'height', 100, -100, 0, '3c', conv=False)
+ self.checkPixelsParam(widget, 'height', 101.2, 102.6, conv=noconv)
+
+ def test_selectmode(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'selectmode',
+ 'none', 'browse', 'extended')
+
+ def test_show(self):
+ widget = self.create()
+ self.checkParam(widget, 'show', 'tree headings',
+ expected=('tree', 'headings'))
+ self.checkParam(widget, 'show', ('tree', 'headings'))
+ self.checkParam(widget, 'show', ('headings', 'tree'))
+ self.checkParam(widget, 'show', 'tree', expected=('tree',))
+ self.checkParam(widget, 'show', 'headings', expected=('headings',))
+
+ def test_bbox(self):
+ self.tv.pack()
+ self.assertEqual(self.tv.bbox(''), '')
+ self.tv.wait_visibility()
+ self.tv.update()
+
+ item_id = self.tv.insert('', 'end')
+ children = self.tv.get_children()
+ self.assertTrue(children)
+
+ bbox = self.tv.bbox(children[0])
+ self.assertIsBoundingBox(bbox)
+
+ # compare width in bboxes
+ self.tv['columns'] = ['test']
+ self.tv.column('test', width=50)
+ bbox_column0 = self.tv.bbox(children[0], 0)
+ root_width = self.tv.column('#0', width=None)
+ if not self.wantobjects:
+ root_width = int(root_width)
+ self.assertEqual(bbox_column0[0], bbox[0] + root_width)
+
+ # verify that bbox of a closed item is the empty string
+ child1 = self.tv.insert(item_id, 'end')
+ self.assertEqual(self.tv.bbox(child1), '')
+
+
+ def test_children(self):
+ # no children yet, should get an empty tuple
+ self.assertEqual(self.tv.get_children(), ())
+
+ item_id = self.tv.insert('', 'end')
+ self.assertIsInstance(self.tv.get_children(), tuple)
+ self.assertEqual(self.tv.get_children()[0], item_id)
+
+ # add item_id and child3 as children of child2
+ child2 = self.tv.insert('', 'end')
+ child3 = self.tv.insert('', 'end')
+ self.tv.set_children(child2, item_id, child3)
+ self.assertEqual(self.tv.get_children(child2), (item_id, child3))
+
+ # child3 has child2 as parent, thus trying to set child2 as a children
+ # of child3 should result in an error
+ self.assertRaises(tkinter.TclError,
+ self.tv.set_children, child3, child2)
+
+ # remove child2 children
+ self.tv.set_children(child2)
+ self.assertEqual(self.tv.get_children(child2), ())
+
+ # remove root's children
+ self.tv.set_children('')
+ self.assertEqual(self.tv.get_children(), ())
+
+
+ def test_column(self):
+ # return a dict with all options/values
+ self.assertIsInstance(self.tv.column('#0'), dict)
+ # return a single value of the given option
+ if self.wantobjects:
+ self.assertIsInstance(self.tv.column('#0', width=None), int)
+ # set a new value for an option
+ self.tv.column('#0', width=10)
+ # testing new way to get option value
+ self.assertEqual(self.tv.column('#0', 'width'),
+ 10 if self.wantobjects else '10')
+ self.assertEqual(self.tv.column('#0', width=None),
+ 10 if self.wantobjects else '10')
+ # check read-only option
+ self.assertRaises(tkinter.TclError, self.tv.column, '#0', id='X')
+
+ self.assertRaises(tkinter.TclError, self.tv.column, 'invalid')
+ invalid_kws = [
+ {'unknown_option': 'some value'}, {'stretch': 'wrong'},
+ {'anchor': 'wrong'}, {'width': 'wrong'}, {'minwidth': 'wrong'}
+ ]
+ for kw in invalid_kws:
+ self.assertRaises(tkinter.TclError, self.tv.column, '#0',
+ **kw)
+
+
+ def test_delete(self):
+ self.assertRaises(tkinter.TclError, self.tv.delete, '#0')
+
+ item_id = self.tv.insert('', 'end')
+ item2 = self.tv.insert(item_id, 'end')
+ self.assertEqual(self.tv.get_children(), (item_id, ))
+ self.assertEqual(self.tv.get_children(item_id), (item2, ))
+
+ self.tv.delete(item_id)
+ self.assertFalse(self.tv.get_children())
+
+ # reattach should fail
+ self.assertRaises(tkinter.TclError,
+ self.tv.reattach, item_id, '', 'end')
+
+ # test multiple item delete
+ item1 = self.tv.insert('', 'end')
+ item2 = self.tv.insert('', 'end')
+ self.assertEqual(self.tv.get_children(), (item1, item2))
+
+ self.tv.delete(item1, item2)
+ self.assertFalse(self.tv.get_children())
+
+
+ def test_detach_reattach(self):
+ item_id = self.tv.insert('', 'end')
+ item2 = self.tv.insert(item_id, 'end')
+
+ # calling detach without items is valid, although it does nothing
+ prev = self.tv.get_children()
+ self.tv.detach() # this should do nothing
+ self.assertEqual(prev, self.tv.get_children())
+
+ self.assertEqual(self.tv.get_children(), (item_id, ))
+ self.assertEqual(self.tv.get_children(item_id), (item2, ))
+
+ # detach item with children
+ self.tv.detach(item_id)
+ self.assertFalse(self.tv.get_children())
+
+ # reattach item with children
+ self.tv.reattach(item_id, '', 'end')
+ self.assertEqual(self.tv.get_children(), (item_id, ))
+ self.assertEqual(self.tv.get_children(item_id), (item2, ))
+
+ # move a children to the root
+ self.tv.move(item2, '', 'end')
+ self.assertEqual(self.tv.get_children(), (item_id, item2))
+ self.assertEqual(self.tv.get_children(item_id), ())
+
+ # bad values
+ self.assertRaises(tkinter.TclError,
+ self.tv.reattach, 'nonexistent', '', 'end')
+ self.assertRaises(tkinter.TclError,
+ self.tv.detach, 'nonexistent')
+ self.assertRaises(tkinter.TclError,
+ self.tv.reattach, item2, 'otherparent', 'end')
+ self.assertRaises(tkinter.TclError,
+ self.tv.reattach, item2, '', 'invalid')
+
+ # multiple detach
+ self.tv.detach(item_id, item2)
+ self.assertEqual(self.tv.get_children(), ())
+ self.assertEqual(self.tv.get_children(item_id), ())
+
+
+ def test_exists(self):
+ self.assertEqual(self.tv.exists('something'), False)
+ self.assertEqual(self.tv.exists(''), True)
+ self.assertEqual(self.tv.exists({}), False)
+
+ # the following will make a tk.call equivalent to
+ # tk.call(treeview, "exists") which should result in an error
+ # in the tcl interpreter since tk requires an item.
+ self.assertRaises(tkinter.TclError, self.tv.exists, None)
+
+
+ def test_focus(self):
+ # nothing is focused right now
+ self.assertEqual(self.tv.focus(), '')
+
+ item1 = self.tv.insert('', 'end')
+ self.tv.focus(item1)
+ self.assertEqual(self.tv.focus(), item1)
+
+ self.tv.delete(item1)
+ self.assertEqual(self.tv.focus(), '')
+
+ # try focusing inexistent item
+ self.assertRaises(tkinter.TclError, self.tv.focus, 'hi')
+
+
+ def test_heading(self):
+ # check a dict is returned
+ self.assertIsInstance(self.tv.heading('#0'), dict)
+
+ # check a value is returned
+ self.tv.heading('#0', text='hi')
+ self.assertEqual(self.tv.heading('#0', 'text'), 'hi')
+ self.assertEqual(self.tv.heading('#0', text=None), 'hi')
+
+ # invalid option
+ self.assertRaises(tkinter.TclError, self.tv.heading, '#0',
+ background=None)
+ # invalid value
+ self.assertRaises(tkinter.TclError, self.tv.heading, '#0',
+ anchor=1)
+
+ def test_heading_callback(self):
+ def simulate_heading_click(x, y):
+ simulate_mouse_click(self.tv, x, y)
+ self.tv.update()
+
+ success = [] # no success for now
+
+ self.tv.pack()
+ self.tv.wait_visibility()
+ self.tv.heading('#0', command=lambda: success.append(True))
+ self.tv.column('#0', width=100)
+ self.tv.update()
+
+ # assuming that the coords (5, 5) fall into heading #0
+ simulate_heading_click(5, 5)
+ if not success:
+ self.fail("The command associated to the treeview heading wasn't "
+ "invoked.")
+
+ success = []
+ commands = self.tv.master._tclCommands
+ self.tv.heading('#0', command=str(self.tv.heading('#0', command=None)))
+ self.assertEqual(commands, self.tv.master._tclCommands)
+ simulate_heading_click(5, 5)
+ if not success:
+ self.fail("The command associated to the treeview heading wasn't "
+ "invoked.")
+
+ # XXX The following raises an error in a tcl interpreter, but not in
+ # Python
+ #self.tv.heading('#0', command='I dont exist')
+ #simulate_heading_click(5, 5)
+
+
+ def test_index(self):
+ # item 'what' doesn't exist
+ self.assertRaises(tkinter.TclError, self.tv.index, 'what')
+
+ self.assertEqual(self.tv.index(''), 0)
+
+ item1 = self.tv.insert('', 'end')
+ item2 = self.tv.insert('', 'end')
+ c1 = self.tv.insert(item1, 'end')
+ c2 = self.tv.insert(item1, 'end')
+ self.assertEqual(self.tv.index(item1), 0)
+ self.assertEqual(self.tv.index(c1), 0)
+ self.assertEqual(self.tv.index(c2), 1)
+ self.assertEqual(self.tv.index(item2), 1)
+
+ self.tv.move(item2, '', 0)
+ self.assertEqual(self.tv.index(item2), 0)
+ self.assertEqual(self.tv.index(item1), 1)
+
+ # check that index still works even after its parent and siblings
+ # have been detached
+ self.tv.detach(item1)
+ self.assertEqual(self.tv.index(c2), 1)
+ self.tv.detach(c1)
+ self.assertEqual(self.tv.index(c2), 0)
+
+ # but it fails after item has been deleted
+ self.tv.delete(item1)
+ self.assertRaises(tkinter.TclError, self.tv.index, c2)
+
+
+ def test_insert_item(self):
+ # parent 'none' doesn't exist
+ self.assertRaises(tkinter.TclError, self.tv.insert, 'none', 'end')
+
+ # open values
+ self.assertRaises(tkinter.TclError, self.tv.insert, '', 'end',
+ open='')
+ self.assertRaises(tkinter.TclError, self.tv.insert, '', 'end',
+ open='please')
+ self.assertFalse(self.tv.delete(self.tv.insert('', 'end', open=True)))
+ self.assertFalse(self.tv.delete(self.tv.insert('', 'end', open=False)))
+
+ # invalid index
+ self.assertRaises(tkinter.TclError, self.tv.insert, '', 'middle')
+
+ # trying to duplicate item id is invalid
+ itemid = self.tv.insert('', 'end', 'first-item')
+ self.assertEqual(itemid, 'first-item')
+ self.assertRaises(tkinter.TclError, self.tv.insert, '', 'end',
+ 'first-item')
+ self.assertRaises(tkinter.TclError, self.tv.insert, '', 'end',
+ MockTclObj('first-item'))
+
+ # unicode values
+ value = u'\xe1ba'
+ item = self.tv.insert('', 'end', values=(value, ))
+ self.assertEqual(self.tv.item(item, 'values'),
+ (value,) if self.wantobjects else value)
+ self.assertEqual(self.tv.item(item, values=None),
+ (value,) if self.wantobjects else value)
+
+ self.tv.item(item, values=self.root.splitlist(self.tv.item(item, values=None)))
+ self.assertEqual(self.tv.item(item, values=None),
+ (value,) if self.wantobjects else value)
+
+ self.assertIsInstance(self.tv.item(item), dict)
+
+ # erase item values
+ self.tv.item(item, values='')
+ self.assertFalse(self.tv.item(item, values=None))
+
+ # item tags
+ item = self.tv.insert('', 'end', tags=[1, 2, value])
+ self.assertEqual(self.tv.item(item, tags=None),
+ ('1', '2', value) if self.wantobjects else
+ '1 2 %s' % value)
+ self.tv.item(item, tags=[])
+ self.assertFalse(self.tv.item(item, tags=None))
+ self.tv.item(item, tags=(1, 2))
+ self.assertEqual(self.tv.item(item, tags=None),
+ ('1', '2') if self.wantobjects else '1 2')
+
+ # values with spaces
+ item = self.tv.insert('', 'end', values=('a b c',
+ '%s %s' % (value, value)))
+ self.assertEqual(self.tv.item(item, values=None),
+ ('a b c', '%s %s' % (value, value)) if self.wantobjects else
+ '{a b c} {%s %s}' % (value, value))
+
+ # text
+ self.assertEqual(self.tv.item(
+ self.tv.insert('', 'end', text="Label here"), text=None),
+ "Label here")
+ self.assertEqual(self.tv.item(
+ self.tv.insert('', 'end', text=value), text=None),
+ value)
+
+
+ def test_selection(self):
+ # item 'none' doesn't exist
+ self.assertRaises(tkinter.TclError, self.tv.selection_set, 'none')
+ self.assertRaises(tkinter.TclError, self.tv.selection_add, 'none')
+ self.assertRaises(tkinter.TclError, self.tv.selection_remove, 'none')
+ self.assertRaises(tkinter.TclError, self.tv.selection_toggle, 'none')
+
+ item1 = self.tv.insert('', 'end')
+ item2 = self.tv.insert('', 'end')
+ c1 = self.tv.insert(item1, 'end')
+ c2 = self.tv.insert(item1, 'end')
+ c3 = self.tv.insert(item1, 'end')
+ self.assertEqual(self.tv.selection(), ())
+
+ self.tv.selection_set((c1, item2))
+ self.assertEqual(self.tv.selection(), (c1, item2))
+ self.tv.selection_set(c2)
+ self.assertEqual(self.tv.selection(), (c2,))
+
+ self.tv.selection_add((c1, item2))
+ self.assertEqual(self.tv.selection(), (c1, c2, item2))
+ self.tv.selection_add(item1)
+ self.assertEqual(self.tv.selection(), (item1, c1, c2, item2))
+
+ self.tv.selection_remove((item1, c3))
+ self.assertEqual(self.tv.selection(), (c1, c2, item2))
+ self.tv.selection_remove(c2)
+ self.assertEqual(self.tv.selection(), (c1, item2))
+
+ self.tv.selection_toggle((c1, c3))
+ self.assertEqual(self.tv.selection(), (c3, item2))
+ self.tv.selection_toggle(item2)
+ self.assertEqual(self.tv.selection(), (c3,))
+
+ self.tv.insert('', 'end', id='with spaces')
+ self.tv.selection_set('with spaces')
+ self.assertEqual(self.tv.selection(), ('with spaces',))
+
+ self.tv.insert('', 'end', id='{brace')
+ self.tv.selection_set('{brace')
+ self.assertEqual(self.tv.selection(), ('{brace',))
+
+ if have_unicode:
+ self.tv.insert('', 'end', id=u(r'unicode\u20ac'))
+ self.tv.selection_set(u(r'unicode\u20ac'))
+ self.assertEqual(self.tv.selection(), (u(r'unicode\u20ac'),))
+
+ self.tv.insert('', 'end', id='bytes\xe2\x82\xac')
+ self.tv.selection_set('bytes\xe2\x82\xac')
+ self.assertEqual(self.tv.selection(),
+ (u(r'bytes\u20ac') if have_unicode else
+ 'bytes\xe2\x82\xac',))
+
+
+ def test_set(self):
+ self.tv['columns'] = ['A', 'B']
+ item = self.tv.insert('', 'end', values=['a', 'b'])
+ self.assertEqual(self.tv.set(item), {'A': 'a', 'B': 'b'})
+
+ self.tv.set(item, 'B', 'a')
+ self.assertEqual(self.tv.item(item, values=None),
+ ('a', 'a') if self.wantobjects else 'a a')
+
+ self.tv['columns'] = ['B']
+ self.assertEqual(self.tv.set(item), {'B': 'a'})
+
+ self.tv.set(item, 'B', 'b')
+ self.assertEqual(self.tv.set(item, column='B'), 'b')
+ self.assertEqual(self.tv.item(item, values=None),
+ ('b', 'a') if self.wantobjects else 'b a')
+
+ self.tv.set(item, 'B', 123)
+ self.assertEqual(self.tv.set(item, 'B'),
+ 123 if self.wantobjects else '123')
+ self.assertEqual(self.tv.item(item, values=None),
+ (123, 'a') if self.wantobjects else '123 a')
+ self.assertEqual(self.tv.set(item),
+ {'B': 123} if self.wantobjects else {'B': '123'})
+
+ # inexistent column
+ self.assertRaises(tkinter.TclError, self.tv.set, item, 'A')
+ self.assertRaises(tkinter.TclError, self.tv.set, item, 'A', 'b')
+
+ # inexistent item
+ self.assertRaises(tkinter.TclError, self.tv.set, 'notme')
+
+
+ def test_tag_bind(self):
+ events = []
+ item1 = self.tv.insert('', 'end', tags=['call'])
+ item2 = self.tv.insert('', 'end', tags=['call'])
+ self.tv.tag_bind('call', '<ButtonPress-1>',
+ lambda evt: events.append(1))
+ self.tv.tag_bind('call', '<ButtonRelease-1>',
+ lambda evt: events.append(2))
+
+ self.tv.pack()
+ self.tv.wait_visibility()
+ self.tv.update()
+
+ pos_y = set()
+ found = set()
+ for i in range(0, 100, 10):
+ if len(found) == 2: # item1 and item2 already found
+ break
+ item_id = self.tv.identify_row(i)
+ if item_id and item_id not in found:
+ pos_y.add(i)
+ found.add(item_id)
+
+ self.assertEqual(len(pos_y), 2) # item1 and item2 y pos
+ for y in pos_y:
+ simulate_mouse_click(self.tv, 0, y)
+
+ # by now there should be 4 things in the events list, since each
+ # item had a bind for two events that were simulated above
+ self.assertEqual(len(events), 4)
+ for evt in zip(events[::2], events[1::2]):
+ self.assertEqual(evt, (1, 2))
+
+
+ def test_tag_configure(self):
+ # Just testing parameter passing for now
+ self.assertRaises(TypeError, self.tv.tag_configure)
+ self.assertRaises(tkinter.TclError, self.tv.tag_configure,
+ 'test', sky='blue')
+ self.tv.tag_configure('test', foreground='blue')
+ self.assertEqual(str(self.tv.tag_configure('test', 'foreground')),
+ 'blue')
+ self.assertEqual(str(self.tv.tag_configure('test', foreground=None)),
+ 'blue')
+ self.assertIsInstance(self.tv.tag_configure('test'), dict)
+
+ def test_tag_has(self):
+ item1 = self.tv.insert('', 'end', text='Item 1', tags=['tag1'])
+ item2 = self.tv.insert('', 'end', text='Item 2', tags=['tag2'])
+ self.assertRaises(TypeError, self.tv.tag_has)
+ self.assertRaises(TclError, self.tv.tag_has, 'tag1', 'non-existing')
+ self.assertTrue(self.tv.tag_has('tag1', item1))
+ self.assertFalse(self.tv.tag_has('tag1', item2))
+ self.assertFalse(self.tv.tag_has('tag2', item1))
+ self.assertTrue(self.tv.tag_has('tag2', item2))
+ self.assertFalse(self.tv.tag_has('tag3', item1))
+ self.assertFalse(self.tv.tag_has('tag3', item2))
+ self.assertEqual(self.tv.tag_has('tag1'), (item1,))
+ self.assertEqual(self.tv.tag_has('tag2'), (item2,))
+ self.assertEqual(self.tv.tag_has('tag3'), ())
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class SeparatorTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'cursor', 'orient', 'style', 'takefocus',
+ # 'state'?
+ )
+ default_orient = 'horizontal'
+
+ def create(self, **kwargs):
+ return ttk.Separator(self.root, **kwargs)
+
+
+@add_standard_options(StandardTtkOptionsTests)
+class SizegripTest(AbstractWidgetTest, unittest.TestCase):
+ OPTIONS = (
+ 'class', 'cursor', 'style', 'takefocus',
+ # 'state'?
+ )
+
+ def create(self, **kwargs):
+ return ttk.Sizegrip(self.root, **kwargs)
+
+
+tests_gui = (
+ ButtonTest, CheckbuttonTest, ComboboxTest, EntryTest,
+ FrameTest, LabelFrameTest, LabelTest, MenubuttonTest,
+ NotebookTest, PanedWindowTest, ProgressbarTest,
+ RadiobuttonTest, ScaleTest, ScrollbarTest, SeparatorTest,
+ SizegripTest, TreeviewTest, WidgetTest,
+ )
+
+tests_gui = (
+ TreeviewTest,
+ )
+
+if __name__ == "__main__":
+ run_unittest(*tests_gui)
diff --git a/lib/python2.7/lib-tk/test/widget_tests.py b/lib/python2.7/lib-tk/test/widget_tests.py
new file mode 100644
index 00000000..33f716fc
--- /dev/null
+++ b/lib/python2.7/lib-tk/test/widget_tests.py
@@ -0,0 +1,566 @@
+# Common tests for test_tkinter/test_widgets.py and test_ttk/test_widgets.py
+
+import unittest
+import sys
+import Tkinter as tkinter
+from ttk import Scale
+from test_ttk.support import (AbstractTkTest, tcl_version, requires_tcl,
+ get_tk_patchlevel, pixels_conv, tcl_obj_eq)
+import test.test_support
+
+
+noconv = noconv_meth = False
+if get_tk_patchlevel() < (8, 5, 11):
+ noconv = str
+noconv_meth = noconv and staticmethod(noconv)
+
+def int_round(x):
+ return int(round(x))
+
+pixels_round = int_round
+if get_tk_patchlevel()[:3] == (8, 5, 11):
+ # Issue #19085: Workaround a bug in Tk
+ # http://core.tcl.tk/tk/info/3497848
+ pixels_round = int
+
+
+_sentinel = object()
+
+class AbstractWidgetTest(AbstractTkTest):
+ _conv_pixels = staticmethod(pixels_round)
+ _conv_pad_pixels = None
+ _stringify = False
+
+ @property
+ def scaling(self):
+ try:
+ return self._scaling
+ except AttributeError:
+ self._scaling = float(self.root.call('tk', 'scaling'))
+ return self._scaling
+
+ def _str(self, value):
+ if not self._stringify and self.wantobjects and tcl_version >= (8, 6):
+ return value
+ if isinstance(value, tuple):
+ return ' '.join(map(self._str, value))
+ return str(value)
+
+ def assertEqual2(self, actual, expected, msg=None, eq=object.__eq__):
+ if eq(actual, expected):
+ return
+ self.assertEqual(actual, expected, msg)
+
+ def checkParam(self, widget, name, value, expected=_sentinel,
+ conv=False, eq=None):
+ widget[name] = value
+ if expected is _sentinel:
+ expected = value
+ if conv:
+ expected = conv(expected)
+ if self._stringify or not self.wantobjects:
+ if isinstance(expected, tuple):
+ expected = tkinter._join(expected)
+ else:
+ expected = str(expected)
+ if eq is None:
+ eq = tcl_obj_eq
+ self.assertEqual2(widget[name], expected, eq=eq)
+ self.assertEqual2(widget.cget(name), expected, eq=eq)
+ # XXX
+ if not isinstance(widget, Scale):
+ t = widget.configure(name)
+ self.assertEqual(len(t), 5)
+ self.assertEqual2(t[4], expected, eq=eq)
+
+ def checkInvalidParam(self, widget, name, value, errmsg=None,
+ keep_orig=True):
+ orig = widget[name]
+ if errmsg is not None:
+ errmsg = errmsg.format(value)
+ with self.assertRaises(tkinter.TclError) as cm:
+ widget[name] = value
+ if errmsg is not None:
+ self.assertEqual(str(cm.exception), errmsg)
+ if keep_orig:
+ self.assertEqual(widget[name], orig)
+ else:
+ widget[name] = orig
+ with self.assertRaises(tkinter.TclError) as cm:
+ widget.configure({name: value})
+ if errmsg is not None:
+ self.assertEqual(str(cm.exception), errmsg)
+ if keep_orig:
+ self.assertEqual(widget[name], orig)
+ else:
+ widget[name] = orig
+
+ def checkParams(self, widget, name, *values, **kwargs):
+ for value in values:
+ self.checkParam(widget, name, value, **kwargs)
+
+ def checkIntegerParam(self, widget, name, *values, **kwargs):
+ self.checkParams(widget, name, *values, **kwargs)
+ self.checkInvalidParam(widget, name, '',
+ errmsg='expected integer but got ""')
+ self.checkInvalidParam(widget, name, '10p',
+ errmsg='expected integer but got "10p"')
+ self.checkInvalidParam(widget, name, 3.2,
+ errmsg='expected integer but got "3.2"')
+
+ def checkFloatParam(self, widget, name, *values, **kwargs):
+ if 'conv' in kwargs:
+ conv = kwargs.pop('conv')
+ else:
+ conv = float
+ for value in values:
+ self.checkParam(widget, name, value, conv=conv, **kwargs)
+ self.checkInvalidParam(widget, name, '',
+ errmsg='expected floating-point number but got ""')
+ self.checkInvalidParam(widget, name, 'spam',
+ errmsg='expected floating-point number but got "spam"')
+
+ def checkBooleanParam(self, widget, name):
+ for value in (False, 0, 'false', 'no', 'off'):
+ self.checkParam(widget, name, value, expected=0)
+ for value in (True, 1, 'true', 'yes', 'on'):
+ self.checkParam(widget, name, value, expected=1)
+ self.checkInvalidParam(widget, name, '',
+ errmsg='expected boolean value but got ""')
+ self.checkInvalidParam(widget, name, 'spam',
+ errmsg='expected boolean value but got "spam"')
+
+ def checkColorParam(self, widget, name, allow_empty=None, **kwargs):
+ self.checkParams(widget, name,
+ '#ff0000', '#00ff00', '#0000ff', '#123456',
+ 'red', 'green', 'blue', 'white', 'black', 'grey',
+ **kwargs)
+ self.checkInvalidParam(widget, name, 'spam',
+ errmsg='unknown color name "spam"')
+
+ def checkCursorParam(self, widget, name, **kwargs):
+ self.checkParams(widget, name, 'arrow', 'watch', 'cross', '',**kwargs)
+ if tcl_version >= (8, 5):
+ self.checkParam(widget, name, 'none')
+ self.checkInvalidParam(widget, name, 'spam',
+ errmsg='bad cursor spec "spam"')
+
+ def checkCommandParam(self, widget, name):
+ def command(*args):
+ pass
+ widget[name] = command
+ self.assertTrue(widget[name])
+ self.checkParams(widget, name, '')
+
+ def checkEnumParam(self, widget, name, *values, **kwargs):
+ if 'errmsg' in kwargs:
+ errmsg = kwargs.pop('errmsg')
+ else:
+ errmsg = None
+ self.checkParams(widget, name, *values, **kwargs)
+ if errmsg is None:
+ errmsg2 = ' %s "{}": must be %s%s or %s' % (
+ name,
+ ', '.join(values[:-1]),
+ ',' if len(values) > 2 else '',
+ values[-1])
+ self.checkInvalidParam(widget, name, '',
+ errmsg='ambiguous' + errmsg2)
+ errmsg = 'bad' + errmsg2
+ self.checkInvalidParam(widget, name, 'spam', errmsg=errmsg)
+
+ def checkPixelsParam(self, widget, name, *values, **kwargs):
+ if 'conv' in kwargs:
+ conv = kwargs.pop('conv')
+ else:
+ conv = None
+ if conv is None:
+ conv = self._conv_pixels
+ if 'keep_orig' in kwargs:
+ keep_orig = kwargs.pop('keep_orig')
+ else:
+ keep_orig = True
+ for value in values:
+ expected = _sentinel
+ conv1 = conv
+ if isinstance(value, str):
+ if conv1 and conv1 is not str:
+ expected = pixels_conv(value) * self.scaling
+ conv1 = int_round
+ self.checkParam(widget, name, value, expected=expected,
+ conv=conv1, **kwargs)
+ self.checkInvalidParam(widget, name, '6x',
+ errmsg='bad screen distance "6x"', keep_orig=keep_orig)
+ self.checkInvalidParam(widget, name, 'spam',
+ errmsg='bad screen distance "spam"', keep_orig=keep_orig)
+
+ def checkReliefParam(self, widget, name):
+ self.checkParams(widget, name,
+ 'flat', 'groove', 'raised', 'ridge', 'solid', 'sunken')
+ errmsg='bad relief "spam": must be '\
+ 'flat, groove, raised, ridge, solid, or sunken'
+ if tcl_version < (8, 6):
+ errmsg = None
+ self.checkInvalidParam(widget, name, 'spam',
+ errmsg=errmsg)
+
+ def checkImageParam(self, widget, name):
+ image = tkinter.PhotoImage(master=self.root, name='image1')
+ self.checkParam(widget, name, image, conv=str)
+ self.checkInvalidParam(widget, name, 'spam',
+ errmsg='image "spam" doesn\'t exist')
+ widget[name] = ''
+
+ def checkVariableParam(self, widget, name, var):
+ self.checkParam(widget, name, var, conv=str)
+
+ def assertIsBoundingBox(self, bbox):
+ self.assertIsNotNone(bbox)
+ self.assertIsInstance(bbox, tuple)
+ if len(bbox) != 4:
+ self.fail('Invalid bounding box: %r' % (bbox,))
+ for item in bbox:
+ if not isinstance(item, int):
+ self.fail('Invalid bounding box: %r' % (bbox,))
+ break
+
+ def test_keys(self):
+ widget = self.create()
+ keys = widget.keys()
+ # XXX
+ if not isinstance(widget, Scale):
+ self.assertEqual(sorted(keys), sorted(widget.configure()))
+ for k in keys:
+ widget[k]
+ # Test if OPTIONS contains all keys
+ if test.test_support.verbose:
+ aliases = {
+ 'bd': 'borderwidth',
+ 'bg': 'background',
+ 'fg': 'foreground',
+ 'invcmd': 'invalidcommand',
+ 'vcmd': 'validatecommand',
+ }
+ keys = set(keys)
+ expected = set(self.OPTIONS)
+ for k in sorted(keys - expected):
+ if not (k in aliases and
+ aliases[k] in keys and
+ aliases[k] in expected):
+ print('%s.OPTIONS doesn\'t contain "%s"' %
+ (self.__class__.__name__, k))
+
+
+class StandardOptionsTests(object):
+ STANDARD_OPTIONS = (
+ 'activebackground', 'activeborderwidth', 'activeforeground', 'anchor',
+ 'background', 'bitmap', 'borderwidth', 'compound', 'cursor',
+ 'disabledforeground', 'exportselection', 'font', 'foreground',
+ 'highlightbackground', 'highlightcolor', 'highlightthickness',
+ 'image', 'insertbackground', 'insertborderwidth',
+ 'insertofftime', 'insertontime', 'insertwidth',
+ 'jump', 'justify', 'orient', 'padx', 'pady', 'relief',
+ 'repeatdelay', 'repeatinterval',
+ 'selectbackground', 'selectborderwidth', 'selectforeground',
+ 'setgrid', 'takefocus', 'text', 'textvariable', 'troughcolor',
+ 'underline', 'wraplength', 'xscrollcommand', 'yscrollcommand',
+ )
+
+ def test_activebackground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'activebackground')
+
+ def test_activeborderwidth(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'activeborderwidth',
+ 0, 1.3, 2.9, 6, -2, '10p')
+
+ def test_activeforeground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'activeforeground')
+
+ def test_anchor(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'anchor',
+ 'n', 'ne', 'e', 'se', 's', 'sw', 'w', 'nw', 'center')
+
+ def test_background(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'background')
+ if 'bg' in self.OPTIONS:
+ self.checkColorParam(widget, 'bg')
+
+ def test_bitmap(self):
+ widget = self.create()
+ self.checkParam(widget, 'bitmap', 'questhead')
+ self.checkParam(widget, 'bitmap', 'gray50')
+ filename = test.test_support.findfile('python.xbm', subdir='imghdrdata')
+ self.checkParam(widget, 'bitmap', '@' + filename)
+ # Cocoa Tk widgets don't detect invalid -bitmap values
+ # See https://core.tcl.tk/tk/info/31cd33dbf0
+ if not ('aqua' in self.root.tk.call('tk', 'windowingsystem') and
+ 'AppKit' in self.root.winfo_server()):
+ self.checkInvalidParam(widget, 'bitmap', 'spam',
+ errmsg='bitmap "spam" not defined')
+
+ def test_borderwidth(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'borderwidth',
+ 0, 1.3, 2.6, 6, -2, '10p')
+ if 'bd' in self.OPTIONS:
+ self.checkPixelsParam(widget, 'bd', 0, 1.3, 2.6, 6, -2, '10p')
+
+ def test_compound(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'compound',
+ 'bottom', 'center', 'left', 'none', 'right', 'top')
+
+ def test_cursor(self):
+ widget = self.create()
+ self.checkCursorParam(widget, 'cursor')
+
+ def test_disabledforeground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'disabledforeground')
+
+ def test_exportselection(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'exportselection')
+
+ def test_font(self):
+ widget = self.create()
+ self.checkParam(widget, 'font',
+ '-Adobe-Helvetica-Medium-R-Normal--*-120-*-*-*-*-*-*')
+ self.checkInvalidParam(widget, 'font', '',
+ errmsg='font "" doesn\'t exist')
+
+ def test_foreground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'foreground')
+ if 'fg' in self.OPTIONS:
+ self.checkColorParam(widget, 'fg')
+
+ def test_highlightbackground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'highlightbackground')
+
+ def test_highlightcolor(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'highlightcolor')
+
+ def test_highlightthickness(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'highlightthickness',
+ 0, 1.3, 2.6, 6, '10p')
+ self.checkParam(widget, 'highlightthickness', -2, expected=0,
+ conv=self._conv_pixels)
+
+ @unittest.skipIf(sys.platform == 'darwin',
+ 'crashes with Cocoa Tk (issue19733)')
+ def test_image(self):
+ widget = self.create()
+ self.checkImageParam(widget, 'image')
+
+ def test_insertbackground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'insertbackground')
+
+ def test_insertborderwidth(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'insertborderwidth',
+ 0, 1.3, 2.6, 6, -2, '10p')
+
+ def test_insertofftime(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'insertofftime', 100)
+
+ def test_insertontime(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'insertontime', 100)
+
+ def test_insertwidth(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'insertwidth', 1.3, 2.6, -2, '10p')
+
+ def test_jump(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'jump')
+
+ def test_justify(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'justify', 'left', 'right', 'center',
+ errmsg='bad justification "{}": must be '
+ 'left, right, or center')
+ self.checkInvalidParam(widget, 'justify', '',
+ errmsg='ambiguous justification "": must be '
+ 'left, right, or center')
+
+ def test_orient(self):
+ widget = self.create()
+ self.assertEqual(str(widget['orient']), self.default_orient)
+ self.checkEnumParam(widget, 'orient', 'horizontal', 'vertical')
+
+ def test_padx(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'padx', 3, 4.4, 5.6, -2, '12m',
+ conv=self._conv_pad_pixels)
+
+ def test_pady(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'pady', 3, 4.4, 5.6, -2, '12m',
+ conv=self._conv_pad_pixels)
+
+ def test_relief(self):
+ widget = self.create()
+ self.checkReliefParam(widget, 'relief')
+
+ def test_repeatdelay(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'repeatdelay', -500, 500)
+
+ def test_repeatinterval(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'repeatinterval', -500, 500)
+
+ def test_selectbackground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'selectbackground')
+
+ def test_selectborderwidth(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'selectborderwidth', 1.3, 2.6, -2, '10p')
+
+ def test_selectforeground(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'selectforeground')
+
+ def test_setgrid(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'setgrid')
+
+ def test_state(self):
+ widget = self.create()
+ self.checkEnumParam(widget, 'state', 'active', 'disabled', 'normal')
+
+ def test_takefocus(self):
+ widget = self.create()
+ self.checkParams(widget, 'takefocus', '0', '1', '')
+
+ def test_text(self):
+ widget = self.create()
+ self.checkParams(widget, 'text', '', 'any string')
+
+ def test_textvariable(self):
+ widget = self.create()
+ var = tkinter.StringVar(self.root)
+ self.checkVariableParam(widget, 'textvariable', var)
+
+ def test_troughcolor(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'troughcolor')
+
+ def test_underline(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'underline', 0, 1, 10)
+
+ def test_wraplength(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'wraplength', 100)
+
+ def test_xscrollcommand(self):
+ widget = self.create()
+ self.checkCommandParam(widget, 'xscrollcommand')
+
+ def test_yscrollcommand(self):
+ widget = self.create()
+ self.checkCommandParam(widget, 'yscrollcommand')
+
+ # non-standard but common options
+
+ def test_command(self):
+ widget = self.create()
+ self.checkCommandParam(widget, 'command')
+
+ def test_indicatoron(self):
+ widget = self.create()
+ self.checkBooleanParam(widget, 'indicatoron')
+
+ def test_offrelief(self):
+ widget = self.create()
+ self.checkReliefParam(widget, 'offrelief')
+
+ def test_overrelief(self):
+ widget = self.create()
+ self.checkReliefParam(widget, 'overrelief')
+
+ def test_selectcolor(self):
+ widget = self.create()
+ self.checkColorParam(widget, 'selectcolor')
+
+ def test_selectimage(self):
+ widget = self.create()
+ self.checkImageParam(widget, 'selectimage')
+
+ @requires_tcl(8, 5)
+ def test_tristateimage(self):
+ widget = self.create()
+ self.checkImageParam(widget, 'tristateimage')
+
+ @requires_tcl(8, 5)
+ def test_tristatevalue(self):
+ widget = self.create()
+ self.checkParam(widget, 'tristatevalue', 'unknowable')
+
+ def test_variable(self):
+ widget = self.create()
+ var = tkinter.DoubleVar(self.root)
+ self.checkVariableParam(widget, 'variable', var)
+
+
+class IntegerSizeTests(object):
+ def test_height(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'height', 100, -100, 0)
+
+ def test_width(self):
+ widget = self.create()
+ self.checkIntegerParam(widget, 'width', 402, -402, 0)
+
+
+class PixelSizeTests(object):
+ def test_height(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'height', 100, 101.2, 102.6, -100, 0, '3c')
+
+ def test_width(self):
+ widget = self.create()
+ self.checkPixelsParam(widget, 'width', 402, 403.4, 404.6, -402, 0, '5i')
+
+
+def add_standard_options(*source_classes):
+ # This decorator adds test_xxx methods from source classes for every xxx
+ # option in the OPTIONS class attribute if they are not defined explicitly.
+ def decorator(cls):
+ for option in cls.OPTIONS:
+ methodname = 'test_' + option
+ if not hasattr(cls, methodname):
+ for source_class in source_classes:
+ if hasattr(source_class, methodname):
+ setattr(cls, methodname,
+ getattr(source_class, methodname).im_func)
+ break
+ else:
+ def test(self, option=option):
+ widget = self.create()
+ widget[option]
+ raise AssertionError('Option "%s" is not tested in %s' %
+ (option, cls.__name__))
+ test.__name__ = methodname
+ setattr(cls, methodname, test)
+ return cls
+ return decorator
+
+def setUpModule():
+ if test.test_support.verbose:
+ tcl = tkinter.Tcl()
+ print 'patchlevel =', tcl.call('info', 'patchlevel')
diff --git a/lib/python2.7/lib-tk/tkColorChooser.py b/lib/python2.7/lib-tk/tkColorChooser.py
new file mode 100644
index 00000000..b65b47d4
--- /dev/null
+++ b/lib/python2.7/lib-tk/tkColorChooser.py
@@ -0,0 +1,72 @@
+# tk common color chooser dialogue
+#
+# this module provides an interface to the native color dialogue
+# available in Tk 4.2 and newer.
+#
+# written by Fredrik Lundh, May 1997
+#
+# fixed initialcolor handling in August 1998
+#
+
+#
+# options (all have default values):
+#
+# - initialcolor: color to mark as selected when dialog is displayed
+# (given as an RGB triplet or a Tk color string)
+#
+# - parent: which window to place the dialog on top of
+#
+# - title: dialog title
+#
+
+from tkCommonDialog import Dialog
+
+
+#
+# color chooser class
+
+class Chooser(Dialog):
+ "Ask for a color"
+
+ command = "tk_chooseColor"
+
+ def _fixoptions(self):
+ try:
+ # make sure initialcolor is a tk color string
+ color = self.options["initialcolor"]
+ if isinstance(color, tuple):
+ # assume an RGB triplet
+ self.options["initialcolor"] = "#%02x%02x%02x" % color
+ except KeyError:
+ pass
+
+ def _fixresult(self, widget, result):
+ # result can be somethings: an empty tuple, an empty string or
+ # a Tcl_Obj, so this somewhat weird check handles that
+ if not result or not str(result):
+ return None, None # canceled
+
+ # to simplify application code, the color chooser returns
+ # an RGB tuple together with the Tk color string
+ r, g, b = widget.winfo_rgb(result)
+ return (r/256, g/256, b/256), str(result)
+
+
+#
+# convenience stuff
+
+def askcolor(color = None, **options):
+ "Ask for a color"
+
+ if color:
+ options = options.copy()
+ options["initialcolor"] = color
+
+ return Chooser(**options).show()
+
+
+# --------------------------------------------------------------------
+# test stuff
+
+if __name__ == "__main__":
+ print "color", askcolor()
diff --git a/lib/python2.7/lib-tk/tkCommonDialog.py b/lib/python2.7/lib-tk/tkCommonDialog.py
new file mode 100644
index 00000000..2cd9be4e
--- /dev/null
+++ b/lib/python2.7/lib-tk/tkCommonDialog.py
@@ -0,0 +1,60 @@
+# base class for tk common dialogues
+#
+# this module provides a base class for accessing the common
+# dialogues available in Tk 4.2 and newer. use tkFileDialog,
+# tkColorChooser, and tkMessageBox to access the individual
+# dialogs.
+#
+# written by Fredrik Lundh, May 1997
+#
+
+from Tkinter import *
+
+class Dialog:
+
+ command = None
+
+ def __init__(self, master=None, **options):
+
+ # FIXME: should this be placed on the module level instead?
+ if TkVersion < 4.2:
+ raise TclError, "this module requires Tk 4.2 or newer"
+
+ self.master = master
+ self.options = options
+ if not master and options.get('parent'):
+ self.master = options['parent']
+
+ def _fixoptions(self):
+ pass # hook
+
+ def _fixresult(self, widget, result):
+ return result # hook
+
+ def show(self, **options):
+
+ # update instance options
+ for k, v in options.items():
+ self.options[k] = v
+
+ self._fixoptions()
+
+ # we need a dummy widget to properly process the options
+ # (at least as long as we use Tkinter 1.63)
+ w = Frame(self.master)
+
+ try:
+
+ s = w.tk.call(self.command, *w._options(self.options))
+
+ s = self._fixresult(w, s)
+
+ finally:
+
+ try:
+ # get rid of the widget
+ w.destroy()
+ except:
+ pass
+
+ return s
diff --git a/lib/python2.7/lib-tk/tkFileDialog.py b/lib/python2.7/lib-tk/tkFileDialog.py
new file mode 100644
index 00000000..15c7d5f6
--- /dev/null
+++ b/lib/python2.7/lib-tk/tkFileDialog.py
@@ -0,0 +1,215 @@
+#
+# Instant Python
+# $Id: tkFileDialog.py 36560 2004-07-18 06:16:08Z tim_one $
+#
+# tk common file dialogues
+#
+# this module provides interfaces to the native file dialogues
+# available in Tk 4.2 and newer, and the directory dialogue available
+# in Tk 8.3 and newer.
+#
+# written by Fredrik Lundh, May 1997.
+#
+
+#
+# options (all have default values):
+#
+# - defaultextension: added to filename if not explicitly given
+#
+# - filetypes: sequence of (label, pattern) tuples. the same pattern
+# may occur with several patterns. use "*" as pattern to indicate
+# all files.
+#
+# - initialdir: initial directory. preserved by dialog instance.
+#
+# - initialfile: initial file (ignored by the open dialog). preserved
+# by dialog instance.
+#
+# - parent: which window to place the dialog on top of
+#
+# - title: dialog title
+#
+# - multiple: if true user may select more than one file
+#
+# options for the directory chooser:
+#
+# - initialdir, parent, title: see above
+#
+# - mustexist: if true, user must pick an existing directory
+#
+#
+
+
+from tkCommonDialog import Dialog
+
+class _Dialog(Dialog):
+
+ def _fixoptions(self):
+ try:
+ # make sure "filetypes" is a tuple
+ self.options["filetypes"] = tuple(self.options["filetypes"])
+ except KeyError:
+ pass
+
+ def _fixresult(self, widget, result):
+ if result:
+ # keep directory and filename until next time
+ import os
+ # convert Tcl path objects to strings
+ try:
+ result = result.string
+ except AttributeError:
+ # it already is a string
+ pass
+ path, file = os.path.split(result)
+ self.options["initialdir"] = path
+ self.options["initialfile"] = file
+ self.filename = result # compatibility
+ return result
+
+
+#
+# file dialogs
+
+class Open(_Dialog):
+ "Ask for a filename to open"
+
+ command = "tk_getOpenFile"
+
+ def _fixresult(self, widget, result):
+ if isinstance(result, tuple):
+ # multiple results:
+ result = tuple([getattr(r, "string", r) for r in result])
+ if result:
+ import os
+ path, file = os.path.split(result[0])
+ self.options["initialdir"] = path
+ # don't set initialfile or filename, as we have multiple of these
+ return result
+ if not widget.tk.wantobjects() and "multiple" in self.options:
+ # Need to split result explicitly
+ return self._fixresult(widget, widget.tk.splitlist(result))
+ return _Dialog._fixresult(self, widget, result)
+
+class SaveAs(_Dialog):
+ "Ask for a filename to save as"
+
+ command = "tk_getSaveFile"
+
+
+# the directory dialog has its own _fix routines.
+class Directory(Dialog):
+ "Ask for a directory"
+
+ command = "tk_chooseDirectory"
+
+ def _fixresult(self, widget, result):
+ if result:
+ # convert Tcl path objects to strings
+ try:
+ result = result.string
+ except AttributeError:
+ # it already is a string
+ pass
+ # keep directory until next time
+ self.options["initialdir"] = result
+ self.directory = result # compatibility
+ return result
+
+#
+# convenience stuff
+
+def askopenfilename(**options):
+ "Ask for a filename to open"
+
+ return Open(**options).show()
+
+def asksaveasfilename(**options):
+ "Ask for a filename to save as"
+
+ return SaveAs(**options).show()
+
+def askopenfilenames(**options):
+ """Ask for multiple filenames to open
+
+ Returns a list of filenames or empty list if
+ cancel button selected
+ """
+ options["multiple"]=1
+ return Open(**options).show()
+
+# FIXME: are the following perhaps a bit too convenient?
+
+def askopenfile(mode = "r", **options):
+ "Ask for a filename to open, and returned the opened file"
+
+ filename = Open(**options).show()
+ if filename:
+ return open(filename, mode)
+ return None
+
+def askopenfiles(mode = "r", **options):
+ """Ask for multiple filenames and return the open file
+ objects
+
+ returns a list of open file objects or an empty list if
+ cancel selected
+ """
+
+ files = askopenfilenames(**options)
+ if files:
+ ofiles=[]
+ for filename in files:
+ ofiles.append(open(filename, mode))
+ files=ofiles
+ return files
+
+
+def asksaveasfile(mode = "w", **options):
+ "Ask for a filename to save as, and returned the opened file"
+
+ filename = SaveAs(**options).show()
+ if filename:
+ return open(filename, mode)
+ return None
+
+def askdirectory (**options):
+ "Ask for a directory, and return the file name"
+ return Directory(**options).show()
+
+# --------------------------------------------------------------------
+# test stuff
+
+if __name__ == "__main__":
+ # Since the file name may contain non-ASCII characters, we need
+ # to find an encoding that likely supports the file name, and
+ # displays correctly on the terminal.
+
+ # Start off with UTF-8
+ enc = "utf-8"
+ import sys
+
+ # See whether CODESET is defined
+ try:
+ import locale
+ locale.setlocale(locale.LC_ALL,'')
+ enc = locale.nl_langinfo(locale.CODESET)
+ except (ImportError, AttributeError):
+ pass
+
+ # dialog for openening files
+
+ openfilename=askopenfilename(filetypes=[("all files", "*")])
+ try:
+ fp=open(openfilename,"r")
+ fp.close()
+ except:
+ print "Could not open File: "
+ print sys.exc_info()[1]
+
+ print "open", openfilename.encode(enc)
+
+ # dialog for saving files
+
+ saveasfilename=asksaveasfilename()
+ print "saveas", saveasfilename.encode(enc)
diff --git a/lib/python2.7/lib-tk/tkFont.py b/lib/python2.7/lib-tk/tkFont.py
new file mode 100644
index 00000000..113c983b
--- /dev/null
+++ b/lib/python2.7/lib-tk/tkFont.py
@@ -0,0 +1,216 @@
+# Tkinter font wrapper
+#
+# written by Fredrik Lundh, February 1998
+#
+# FIXME: should add 'displayof' option where relevant (actual, families,
+# measure, and metrics)
+#
+
+__version__ = "0.9"
+
+import Tkinter
+
+# weight/slant
+NORMAL = "normal"
+ROMAN = "roman"
+BOLD = "bold"
+ITALIC = "italic"
+
+def nametofont(name):
+ """Given the name of a tk named font, returns a Font representation.
+ """
+ return Font(name=name, exists=True)
+
+class Font:
+
+ """Represents a named font.
+
+ Constructor options are:
+
+ font -- font specifier (name, system font, or (family, size, style)-tuple)
+ name -- name to use for this font configuration (defaults to a unique name)
+ exists -- does a named font by this name already exist?
+ Creates a new named font if False, points to the existing font if True.
+ Raises _Tkinter.TclError if the assertion is false.
+
+ the following are ignored if font is specified:
+
+ family -- font 'family', e.g. Courier, Times, Helvetica
+ size -- font size in points
+ weight -- font thickness: NORMAL, BOLD
+ slant -- font slant: ROMAN, ITALIC
+ underline -- font underlining: false (0), true (1)
+ overstrike -- font strikeout: false (0), true (1)
+
+ """
+
+ def _set(self, kw):
+ options = []
+ for k, v in kw.items():
+ options.append("-"+k)
+ options.append(str(v))
+ return tuple(options)
+
+ def _get(self, args):
+ options = []
+ for k in args:
+ options.append("-"+k)
+ return tuple(options)
+
+ def _mkdict(self, args):
+ options = {}
+ for i in range(0, len(args), 2):
+ options[args[i][1:]] = args[i+1]
+ return options
+
+ def __init__(self, root=None, font=None, name=None, exists=False, **options):
+ if not root:
+ root = Tkinter._default_root
+ tk = getattr(root, 'tk', root)
+ if font:
+ # get actual settings corresponding to the given font
+ font = tk.splitlist(tk.call("font", "actual", font))
+ else:
+ font = self._set(options)
+ if not name:
+ name = "font" + str(id(self))
+ self.name = name
+
+ if exists:
+ self.delete_font = False
+ # confirm font exists
+ if self.name not in tk.splitlist(tk.call("font", "names")):
+ raise Tkinter._tkinter.TclError, "named font %s does not already exist" % (self.name,)
+ # if font config info supplied, apply it
+ if font:
+ tk.call("font", "configure", self.name, *font)
+ else:
+ # create new font (raises TclError if the font exists)
+ tk.call("font", "create", self.name, *font)
+ self.delete_font = True
+ self._tk = tk
+ self._split = tk.splitlist
+ self._call = tk.call
+
+ def __str__(self):
+ return self.name
+
+ def __eq__(self, other):
+ return isinstance(other, Font) and self.name == other.name
+
+ def __getitem__(self, key):
+ return self.cget(key)
+
+ def __setitem__(self, key, value):
+ self.configure(**{key: value})
+
+ def __del__(self):
+ try:
+ if self.delete_font:
+ self._call("font", "delete", self.name)
+ except (KeyboardInterrupt, SystemExit):
+ raise
+ except Exception:
+ pass
+
+ def copy(self):
+ "Return a distinct copy of the current font"
+ return Font(self._tk, **self.actual())
+
+ def actual(self, option=None):
+ "Return actual font attributes"
+ if option:
+ return self._call("font", "actual", self.name, "-"+option)
+ else:
+ return self._mkdict(
+ self._split(self._call("font", "actual", self.name))
+ )
+
+ def cget(self, option):
+ "Get font attribute"
+ return self._call("font", "config", self.name, "-"+option)
+
+ def config(self, **options):
+ "Modify font attributes"
+ if options:
+ self._call("font", "config", self.name,
+ *self._set(options))
+ else:
+ return self._mkdict(
+ self._split(self._call("font", "config", self.name))
+ )
+
+ configure = config
+
+ def measure(self, text):
+ "Return text width"
+ return int(self._call("font", "measure", self.name, text))
+
+ def metrics(self, *options):
+ """Return font metrics.
+
+ For best performance, create a dummy widget
+ using this font before calling this method."""
+
+ if options:
+ return int(
+ self._call("font", "metrics", self.name, self._get(options))
+ )
+ else:
+ res = self._split(self._call("font", "metrics", self.name))
+ options = {}
+ for i in range(0, len(res), 2):
+ options[res[i][1:]] = int(res[i+1])
+ return options
+
+def families(root=None):
+ "Get font families (as a tuple)"
+ if not root:
+ root = Tkinter._default_root
+ return root.tk.splitlist(root.tk.call("font", "families"))
+
+def names(root=None):
+ "Get names of defined fonts (as a tuple)"
+ if not root:
+ root = Tkinter._default_root
+ return root.tk.splitlist(root.tk.call("font", "names"))
+
+# --------------------------------------------------------------------
+# test stuff
+
+if __name__ == "__main__":
+
+ root = Tkinter.Tk()
+
+ # create a font
+ f = Font(family="times", size=30, weight=NORMAL)
+
+ print f.actual()
+ print f.actual("family")
+ print f.actual("weight")
+
+ print f.config()
+ print f.cget("family")
+ print f.cget("weight")
+
+ print names()
+
+ print f.measure("hello"), f.metrics("linespace")
+
+ print f.metrics()
+
+ f = Font(font=("Courier", 20, "bold"))
+ print f.measure("hello"), f.metrics("linespace")
+
+ w = Tkinter.Label(root, text="Hello, world", font=f)
+ w.pack()
+
+ w = Tkinter.Button(root, text="Quit!", command=root.destroy)
+ w.pack()
+
+ fb = Font(font=w["font"]).copy()
+ fb.config(weight=BOLD)
+
+ w.config(font=fb)
+
+ Tkinter.mainloop()
diff --git a/lib/python2.7/lib-tk/tkMessageBox.py b/lib/python2.7/lib-tk/tkMessageBox.py
new file mode 100644
index 00000000..9ee92357
--- /dev/null
+++ b/lib/python2.7/lib-tk/tkMessageBox.py
@@ -0,0 +1,134 @@
+# tk common message boxes
+#
+# this module provides an interface to the native message boxes
+# available in Tk 4.2 and newer.
+#
+# written by Fredrik Lundh, May 1997
+#
+
+#
+# options (all have default values):
+#
+# - default: which button to make default (one of the reply codes)
+#
+# - icon: which icon to display (see below)
+#
+# - message: the message to display
+#
+# - parent: which window to place the dialog on top of
+#
+# - title: dialog title
+#
+# - type: dialog type; that is, which buttons to display (see below)
+#
+
+from tkCommonDialog import Dialog
+
+#
+# constants
+
+# icons
+ERROR = "error"
+INFO = "info"
+QUESTION = "question"
+WARNING = "warning"
+
+# types
+ABORTRETRYIGNORE = "abortretryignore"
+OK = "ok"
+OKCANCEL = "okcancel"
+RETRYCANCEL = "retrycancel"
+YESNO = "yesno"
+YESNOCANCEL = "yesnocancel"
+
+# replies
+ABORT = "abort"
+RETRY = "retry"
+IGNORE = "ignore"
+OK = "ok"
+CANCEL = "cancel"
+YES = "yes"
+NO = "no"
+
+
+#
+# message dialog class
+
+class Message(Dialog):
+ "A message box"
+
+ command = "tk_messageBox"
+
+
+#
+# convenience stuff
+
+# Rename _icon and _type options to allow overriding them in options
+def _show(title=None, message=None, _icon=None, _type=None, **options):
+ if _icon and "icon" not in options: options["icon"] = _icon
+ if _type and "type" not in options: options["type"] = _type
+ if title: options["title"] = title
+ if message: options["message"] = message
+ res = Message(**options).show()
+ # In some Tcl installations, yes/no is converted into a boolean.
+ if isinstance(res, bool):
+ if res:
+ return YES
+ return NO
+ # In others we get a Tcl_Obj.
+ return str(res)
+
+def showinfo(title=None, message=None, **options):
+ "Show an info message"
+ return _show(title, message, INFO, OK, **options)
+
+def showwarning(title=None, message=None, **options):
+ "Show a warning message"
+ return _show(title, message, WARNING, OK, **options)
+
+def showerror(title=None, message=None, **options):
+ "Show an error message"
+ return _show(title, message, ERROR, OK, **options)
+
+def askquestion(title=None, message=None, **options):
+ "Ask a question"
+ return _show(title, message, QUESTION, YESNO, **options)
+
+def askokcancel(title=None, message=None, **options):
+ "Ask if operation should proceed; return true if the answer is ok"
+ s = _show(title, message, QUESTION, OKCANCEL, **options)
+ return s == OK
+
+def askyesno(title=None, message=None, **options):
+ "Ask a question; return true if the answer is yes"
+ s = _show(title, message, QUESTION, YESNO, **options)
+ return s == YES
+
+def askyesnocancel(title=None, message=None, **options):
+ "Ask a question; return true if the answer is yes, None if cancelled."
+ s = _show(title, message, QUESTION, YESNOCANCEL, **options)
+ # s might be a Tcl index object, so convert it to a string
+ s = str(s)
+ if s == CANCEL:
+ return None
+ return s == YES
+
+def askretrycancel(title=None, message=None, **options):
+ "Ask if operation should be retried; return true if the answer is yes"
+ s = _show(title, message, WARNING, RETRYCANCEL, **options)
+ return s == RETRY
+
+
+# --------------------------------------------------------------------
+# test stuff
+
+if __name__ == "__main__":
+
+ print "info", showinfo("Spam", "Egg Information")
+ print "warning", showwarning("Spam", "Egg Warning")
+ print "error", showerror("Spam", "Egg Alert")
+ print "question", askquestion("Spam", "Question?")
+ print "proceed", askokcancel("Spam", "Proceed?")
+ print "yes/no", askyesno("Spam", "Got it?")
+ print "yes/no/cancel", askyesnocancel("Spam", "Want it?")
+ print "try again", askretrycancel("Spam", "Try again?")
diff --git a/lib/python2.7/lib-tk/tkSimpleDialog.py b/lib/python2.7/lib-tk/tkSimpleDialog.py
new file mode 100644
index 00000000..023475db
--- /dev/null
+++ b/lib/python2.7/lib-tk/tkSimpleDialog.py
@@ -0,0 +1,323 @@
+#
+# An Introduction to Tkinter
+# tkSimpleDialog.py
+#
+# Copyright (c) 1997 by Fredrik Lundh
+#
+# fredrik@pythonware.com
+# http://www.pythonware.com
+#
+
+# --------------------------------------------------------------------
+# dialog base class
+
+'''Dialog boxes
+
+This module handles dialog boxes. It contains the following
+public symbols:
+
+Dialog -- a base class for dialogs
+
+askinteger -- get an integer from the user
+
+askfloat -- get a float from the user
+
+askstring -- get a string from the user
+'''
+
+from Tkinter import *
+
+class Dialog(Toplevel):
+
+ '''Class to open dialogs.
+
+ This class is intended as a base class for custom dialogs
+ '''
+
+ def __init__(self, parent, title = None):
+
+ '''Initialize a dialog.
+
+ Arguments:
+
+ parent -- a parent window (the application window)
+
+ title -- the dialog title
+ '''
+ Toplevel.__init__(self, parent)
+
+ self.withdraw() # remain invisible for now
+ # If the master is not viewable, don't
+ # make the child transient, or else it
+ # would be opened withdrawn
+ if parent.winfo_viewable():
+ self.transient(parent)
+
+ if title:
+ self.title(title)
+
+ self.parent = parent
+
+ self.result = None
+
+ body = Frame(self)
+ self.initial_focus = self.body(body)
+ body.pack(padx=5, pady=5)
+
+ self.buttonbox()
+
+
+ if not self.initial_focus:
+ self.initial_focus = self
+
+ self.protocol("WM_DELETE_WINDOW", self.cancel)
+
+ if self.parent is not None:
+ self.geometry("+%d+%d" % (parent.winfo_rootx()+50,
+ parent.winfo_rooty()+50))
+
+ self.deiconify() # become visibile now
+
+ self.initial_focus.focus_set()
+
+ # wait for window to appear on screen before calling grab_set
+ self.wait_visibility()
+ self.grab_set()
+ self.wait_window(self)
+
+ def destroy(self):
+ '''Destroy the window'''
+ self.initial_focus = None
+ Toplevel.destroy(self)
+
+ #
+ # construction hooks
+
+ def body(self, master):
+ '''create dialog body.
+
+ return widget that should have initial focus.
+ This method should be overridden, and is called
+ by the __init__ method.
+ '''
+ pass
+
+ def buttonbox(self):
+ '''add standard button box.
+
+ override if you do not want the standard buttons
+ '''
+
+ box = Frame(self)
+
+ w = Button(box, text="OK", width=10, command=self.ok, default=ACTIVE)
+ w.pack(side=LEFT, padx=5, pady=5)
+ w = Button(box, text="Cancel", width=10, command=self.cancel)
+ w.pack(side=LEFT, padx=5, pady=5)
+
+ self.bind("<Return>", self.ok)
+ self.bind("<Escape>", self.cancel)
+
+ box.pack()
+
+ #
+ # standard button semantics
+
+ def ok(self, event=None):
+
+ if not self.validate():
+ self.initial_focus.focus_set() # put focus back
+ return
+
+ self.withdraw()
+ self.update_idletasks()
+
+ try:
+ self.apply()
+ finally:
+ self.cancel()
+
+ def cancel(self, event=None):
+
+ # put focus back to the parent window
+ if self.parent is not None:
+ self.parent.focus_set()
+ self.destroy()
+
+ #
+ # command hooks
+
+ def validate(self):
+ '''validate the data
+
+ This method is called automatically to validate the data before the
+ dialog is destroyed. By default, it always validates OK.
+ '''
+
+ return 1 # override
+
+ def apply(self):
+ '''process the data
+
+ This method is called automatically to process the data, *after*
+ the dialog is destroyed. By default, it does nothing.
+ '''
+
+ pass # override
+
+
+# --------------------------------------------------------------------
+# convenience dialogues
+
+class _QueryDialog(Dialog):
+
+ def __init__(self, title, prompt,
+ initialvalue=None,
+ minvalue = None, maxvalue = None,
+ parent = None):
+
+ if not parent:
+ import Tkinter
+ parent = Tkinter._default_root
+
+ self.prompt = prompt
+ self.minvalue = minvalue
+ self.maxvalue = maxvalue
+
+ self.initialvalue = initialvalue
+
+ Dialog.__init__(self, parent, title)
+
+ def destroy(self):
+ self.entry = None
+ Dialog.destroy(self)
+
+ def body(self, master):
+
+ w = Label(master, text=self.prompt, justify=LEFT)
+ w.grid(row=0, padx=5, sticky=W)
+
+ self.entry = Entry(master, name="entry")
+ self.entry.grid(row=1, padx=5, sticky=W+E)
+
+ if self.initialvalue is not None:
+ self.entry.insert(0, self.initialvalue)
+ self.entry.select_range(0, END)
+
+ return self.entry
+
+ def validate(self):
+
+ import tkMessageBox
+
+ try:
+ result = self.getresult()
+ except ValueError:
+ tkMessageBox.showwarning(
+ "Illegal value",
+ self.errormessage + "\nPlease try again",
+ parent = self
+ )
+ return 0
+
+ if self.minvalue is not None and result < self.minvalue:
+ tkMessageBox.showwarning(
+ "Too small",
+ "The allowed minimum value is %s. "
+ "Please try again." % self.minvalue,
+ parent = self
+ )
+ return 0
+
+ if self.maxvalue is not None and result > self.maxvalue:
+ tkMessageBox.showwarning(
+ "Too large",
+ "The allowed maximum value is %s. "
+ "Please try again." % self.maxvalue,
+ parent = self
+ )
+ return 0
+
+ self.result = result
+
+ return 1
+
+
+class _QueryInteger(_QueryDialog):
+ errormessage = "Not an integer."
+ def getresult(self):
+ return int(self.entry.get())
+
+def askinteger(title, prompt, **kw):
+ '''get an integer from the user
+
+ Arguments:
+
+ title -- the dialog title
+ prompt -- the label text
+ **kw -- see SimpleDialog class
+
+ Return value is an integer
+ '''
+ d = _QueryInteger(title, prompt, **kw)
+ return d.result
+
+class _QueryFloat(_QueryDialog):
+ errormessage = "Not a floating point value."
+ def getresult(self):
+ return float(self.entry.get())
+
+def askfloat(title, prompt, **kw):
+ '''get a float from the user
+
+ Arguments:
+
+ title -- the dialog title
+ prompt -- the label text
+ **kw -- see SimpleDialog class
+
+ Return value is a float
+ '''
+ d = _QueryFloat(title, prompt, **kw)
+ return d.result
+
+class _QueryString(_QueryDialog):
+ def __init__(self, *args, **kw):
+ if "show" in kw:
+ self.__show = kw["show"]
+ del kw["show"]
+ else:
+ self.__show = None
+ _QueryDialog.__init__(self, *args, **kw)
+
+ def body(self, master):
+ entry = _QueryDialog.body(self, master)
+ if self.__show is not None:
+ entry.configure(show=self.__show)
+ return entry
+
+ def getresult(self):
+ return self.entry.get()
+
+def askstring(title, prompt, **kw):
+ '''get a string from the user
+
+ Arguments:
+
+ title -- the dialog title
+ prompt -- the label text
+ **kw -- see SimpleDialog class
+
+ Return value is a string
+ '''
+ d = _QueryString(title, prompt, **kw)
+ return d.result
+
+if __name__ == "__main__":
+
+ root = Tk()
+ root.update()
+
+ print askinteger("Spam", "Egg count", initialvalue=12*12)
+ print askfloat("Spam", "Egg weight\n(in tons)", minvalue=1, maxvalue=100)
+ print askstring("Spam", "Egg label")
diff --git a/lib/python2.7/lib-tk/ttk.py b/lib/python2.7/lib-tk/ttk.py
new file mode 100644
index 00000000..11254391
--- /dev/null
+++ b/lib/python2.7/lib-tk/ttk.py
@@ -0,0 +1,1624 @@
+"""Ttk wrapper.
+
+This module provides classes to allow using Tk themed widget set.
+
+Ttk is based on a revised and enhanced version of
+TIP #48 (http://tip.tcl.tk/48) specified style engine.
+
+Its basic idea is to separate, to the extent possible, the code
+implementing a widget's behavior from the code implementing its
+appearance. Widget class bindings are primarily responsible for
+maintaining the widget state and invoking callbacks, all aspects
+of the widgets appearance lies at Themes.
+"""
+
+__version__ = "0.3.1"
+
+__author__ = "Guilherme Polo <ggpolo@gmail.com>"
+
+__all__ = ["Button", "Checkbutton", "Combobox", "Entry", "Frame", "Label",
+ "Labelframe", "LabelFrame", "Menubutton", "Notebook", "Panedwindow",
+ "PanedWindow", "Progressbar", "Radiobutton", "Scale", "Scrollbar",
+ "Separator", "Sizegrip", "Style", "Treeview",
+ # Extensions
+ "LabeledScale", "OptionMenu",
+ # functions
+ "tclobjs_to_py", "setup_master"]
+
+import Tkinter
+from Tkinter import _flatten, _join, _stringify, _splitdict
+
+# Verify if Tk is new enough to not need the Tile package
+_REQUIRE_TILE = True if Tkinter.TkVersion < 8.5 else False
+
+def _load_tile(master):
+ if _REQUIRE_TILE:
+ import os
+ tilelib = os.environ.get('TILE_LIBRARY')
+ if tilelib:
+ # append custom tile path to the list of directories that
+ # Tcl uses when attempting to resolve packages with the package
+ # command
+ master.tk.eval(
+ 'global auto_path; '
+ 'lappend auto_path {%s}' % tilelib)
+
+ master.tk.eval('package require tile') # TclError may be raised here
+ master._tile_loaded = True
+
+def _format_optvalue(value, script=False):
+ """Internal function."""
+ if script:
+ # if caller passes a Tcl script to tk.call, all the values need to
+ # be grouped into words (arguments to a command in Tcl dialect)
+ value = _stringify(value)
+ elif isinstance(value, (list, tuple)):
+ value = _join(value)
+ return value
+
+def _format_optdict(optdict, script=False, ignore=None):
+ """Formats optdict to a tuple to pass it to tk.call.
+
+ E.g. (script=False):
+ {'foreground': 'blue', 'padding': [1, 2, 3, 4]} returns:
+ ('-foreground', 'blue', '-padding', '1 2 3 4')"""
+
+ opts = []
+ for opt, value in optdict.iteritems():
+ if not ignore or opt not in ignore:
+ opts.append("-%s" % opt)
+ if value is not None:
+ opts.append(_format_optvalue(value, script))
+
+ return _flatten(opts)
+
+def _mapdict_values(items):
+ # each value in mapdict is expected to be a sequence, where each item
+ # is another sequence containing a state (or several) and a value
+ # E.g. (script=False):
+ # [('active', 'selected', 'grey'), ('focus', [1, 2, 3, 4])]
+ # returns:
+ # ['active selected', 'grey', 'focus', [1, 2, 3, 4]]
+ opt_val = []
+ for item in items:
+ state = item[:-1]
+ val = item[-1]
+ # hacks for bakward compatibility
+ state[0] # raise IndexError if empty
+ if len(state) == 1:
+ # if it is empty (something that evaluates to False), then
+ # format it to Tcl code to denote the "normal" state
+ state = state[0] or ''
+ else:
+ # group multiple states
+ state = ' '.join(state) # raise TypeError if not str
+ opt_val.append(state)
+ if val is not None:
+ opt_val.append(val)
+ return opt_val
+
+def _format_mapdict(mapdict, script=False):
+ """Formats mapdict to pass it to tk.call.
+
+ E.g. (script=False):
+ {'expand': [('active', 'selected', 'grey'), ('focus', [1, 2, 3, 4])]}
+
+ returns:
+
+ ('-expand', '{active selected} grey focus {1, 2, 3, 4}')"""
+
+ opts = []
+ for opt, value in mapdict.iteritems():
+ opts.extend(("-%s" % opt,
+ _format_optvalue(_mapdict_values(value), script)))
+
+ return _flatten(opts)
+
+def _format_elemcreate(etype, script=False, *args, **kw):
+ """Formats args and kw according to the given element factory etype."""
+ spec = None
+ opts = ()
+ if etype in ("image", "vsapi"):
+ if etype == "image": # define an element based on an image
+ # first arg should be the default image name
+ iname = args[0]
+ # next args, if any, are statespec/value pairs which is almost
+ # a mapdict, but we just need the value
+ imagespec = _join(_mapdict_values(args[1:]))
+ spec = "%s %s" % (iname, imagespec)
+
+ else:
+ # define an element whose visual appearance is drawn using the
+ # Microsoft Visual Styles API which is responsible for the
+ # themed styles on Windows XP and Vista.
+ # Availability: Tk 8.6, Windows XP and Vista.
+ class_name, part_id = args[:2]
+ statemap = _join(_mapdict_values(args[2:]))
+ spec = "%s %s %s" % (class_name, part_id, statemap)
+
+ opts = _format_optdict(kw, script)
+
+ elif etype == "from": # clone an element
+ # it expects a themename and optionally an element to clone from,
+ # otherwise it will clone {} (empty element)
+ spec = args[0] # theme name
+ if len(args) > 1: # elementfrom specified
+ opts = (_format_optvalue(args[1], script),)
+
+ if script:
+ spec = '{%s}' % spec
+ opts = ' '.join(opts)
+
+ return spec, opts
+
+def _format_layoutlist(layout, indent=0, indent_size=2):
+ """Formats a layout list so we can pass the result to ttk::style
+ layout and ttk::style settings. Note that the layout doesn't have to
+ be a list necessarily.
+
+ E.g.:
+ [("Menubutton.background", None),
+ ("Menubutton.button", {"children":
+ [("Menubutton.focus", {"children":
+ [("Menubutton.padding", {"children":
+ [("Menubutton.label", {"side": "left", "expand": 1})]
+ })]
+ })]
+ }),
+ ("Menubutton.indicator", {"side": "right"})
+ ]
+
+ returns:
+
+ Menubutton.background
+ Menubutton.button -children {
+ Menubutton.focus -children {
+ Menubutton.padding -children {
+ Menubutton.label -side left -expand 1
+ }
+ }
+ }
+ Menubutton.indicator -side right"""
+ script = []
+
+ for layout_elem in layout:
+ elem, opts = layout_elem
+ opts = opts or {}
+ fopts = ' '.join(_format_optdict(opts, True, ("children",)))
+ head = "%s%s%s" % (' ' * indent, elem, (" %s" % fopts) if fopts else '')
+
+ if "children" in opts:
+ script.append(head + " -children {")
+ indent += indent_size
+ newscript, indent = _format_layoutlist(opts['children'], indent,
+ indent_size)
+ script.append(newscript)
+ indent -= indent_size
+ script.append('%s}' % (' ' * indent))
+ else:
+ script.append(head)
+
+ return '\n'.join(script), indent
+
+def _script_from_settings(settings):
+ """Returns an appropriate script, based on settings, according to
+ theme_settings definition to be used by theme_settings and
+ theme_create."""
+ script = []
+ # a script will be generated according to settings passed, which
+ # will then be evaluated by Tcl
+ for name, opts in settings.iteritems():
+ # will format specific keys according to Tcl code
+ if opts.get('configure'): # format 'configure'
+ s = ' '.join(_format_optdict(opts['configure'], True))
+ script.append("ttk::style configure %s %s;" % (name, s))
+
+ if opts.get('map'): # format 'map'
+ s = ' '.join(_format_mapdict(opts['map'], True))
+ script.append("ttk::style map %s %s;" % (name, s))
+
+ if 'layout' in opts: # format 'layout' which may be empty
+ if not opts['layout']:
+ s = 'null' # could be any other word, but this one makes sense
+ else:
+ s, _ = _format_layoutlist(opts['layout'])
+ script.append("ttk::style layout %s {\n%s\n}" % (name, s))
+
+ if opts.get('element create'): # format 'element create'
+ eopts = opts['element create']
+ etype = eopts[0]
+
+ # find where args end, and where kwargs start
+ argc = 1 # etype was the first one
+ while argc < len(eopts) and not hasattr(eopts[argc], 'iteritems'):
+ argc += 1
+
+ elemargs = eopts[1:argc]
+ elemkw = eopts[argc] if argc < len(eopts) and eopts[argc] else {}
+ spec, opts = _format_elemcreate(etype, True, *elemargs, **elemkw)
+
+ script.append("ttk::style element create %s %s %s %s" % (
+ name, etype, spec, opts))
+
+ return '\n'.join(script)
+
+def _list_from_statespec(stuple):
+ """Construct a list from the given statespec tuple according to the
+ accepted statespec accepted by _format_mapdict."""
+ nval = []
+ for val in stuple:
+ typename = getattr(val, 'typename', None)
+ if typename is None:
+ nval.append(val)
+ else: # this is a Tcl object
+ val = str(val)
+ if typename == 'StateSpec':
+ val = val.split()
+ nval.append(val)
+
+ it = iter(nval)
+ return [_flatten(spec) for spec in zip(it, it)]
+
+def _list_from_layouttuple(tk, ltuple):
+ """Construct a list from the tuple returned by ttk::layout, this is
+ somewhat the reverse of _format_layoutlist."""
+ ltuple = tk.splitlist(ltuple)
+ res = []
+
+ indx = 0
+ while indx < len(ltuple):
+ name = ltuple[indx]
+ opts = {}
+ res.append((name, opts))
+ indx += 1
+
+ while indx < len(ltuple): # grab name's options
+ opt, val = ltuple[indx:indx + 2]
+ if not opt.startswith('-'): # found next name
+ break
+
+ opt = opt[1:] # remove the '-' from the option
+ indx += 2
+
+ if opt == 'children':
+ val = _list_from_layouttuple(tk, val)
+
+ opts[opt] = val
+
+ return res
+
+def _val_or_dict(tk, options, *args):
+ """Format options then call Tk command with args and options and return
+ the appropriate result.
+
+ If no option is specified, a dict is returned. If an option is
+ specified with the None value, the value for that option is returned.
+ Otherwise, the function just sets the passed options and the caller
+ shouldn't be expecting a return value anyway."""
+ options = _format_optdict(options)
+ res = tk.call(*(args + options))
+
+ if len(options) % 2: # option specified without a value, return its value
+ return res
+
+ return _splitdict(tk, res, conv=_tclobj_to_py)
+
+def _convert_stringval(value):
+ """Converts a value to, hopefully, a more appropriate Python object."""
+ value = unicode(value)
+ try:
+ value = int(value)
+ except (ValueError, TypeError):
+ pass
+
+ return value
+
+def _to_number(x):
+ if isinstance(x, str):
+ if '.' in x:
+ x = float(x)
+ else:
+ x = int(x)
+ return x
+
+def _tclobj_to_py(val):
+ """Return value converted from Tcl object to Python object."""
+ if val and hasattr(val, '__len__') and not isinstance(val, basestring):
+ if getattr(val[0], 'typename', None) == 'StateSpec':
+ val = _list_from_statespec(val)
+ else:
+ val = map(_convert_stringval, val)
+
+ elif hasattr(val, 'typename'): # some other (single) Tcl object
+ val = _convert_stringval(val)
+
+ return val
+
+def tclobjs_to_py(adict):
+ """Returns adict with its values converted from Tcl objects to Python
+ objects."""
+ for opt, val in adict.items():
+ adict[opt] = _tclobj_to_py(val)
+
+ return adict
+
+def setup_master(master=None):
+ """If master is not None, itself is returned. If master is None,
+ the default master is returned if there is one, otherwise a new
+ master is created and returned.
+
+ If it is not allowed to use the default root and master is None,
+ RuntimeError is raised."""
+ if master is None:
+ if Tkinter._support_default_root:
+ master = Tkinter._default_root or Tkinter.Tk()
+ else:
+ raise RuntimeError(
+ "No master specified and Tkinter is "
+ "configured to not support default root")
+ return master
+
+
+class Style(object):
+ """Manipulate style database."""
+
+ _name = "ttk::style"
+
+ def __init__(self, master=None):
+ master = setup_master(master)
+
+ if not getattr(master, '_tile_loaded', False):
+ # Load tile now, if needed
+ _load_tile(master)
+
+ self.master = master
+ self.tk = self.master.tk
+
+
+ def configure(self, style, query_opt=None, **kw):
+ """Query or sets the default value of the specified option(s) in
+ style.
+
+ Each key in kw is an option and each value is either a string or
+ a sequence identifying the value for that option."""
+ if query_opt is not None:
+ kw[query_opt] = None
+ return _val_or_dict(self.tk, kw, self._name, "configure", style)
+
+
+ def map(self, style, query_opt=None, **kw):
+ """Query or sets dynamic values of the specified option(s) in
+ style.
+
+ Each key in kw is an option and each value should be a list or a
+ tuple (usually) containing statespecs grouped in tuples, or list,
+ or something else of your preference. A statespec is compound of
+ one or more states and then a value."""
+ if query_opt is not None:
+ return _list_from_statespec(self.tk.splitlist(
+ self.tk.call(self._name, "map", style, '-%s' % query_opt)))
+
+ return _splitdict(
+ self.tk,
+ self.tk.call(self._name, "map", style, *_format_mapdict(kw)),
+ conv=_tclobj_to_py)
+
+
+ def lookup(self, style, option, state=None, default=None):
+ """Returns the value specified for option in style.
+
+ If state is specified it is expected to be a sequence of one
+ or more states. If the default argument is set, it is used as
+ a fallback value in case no specification for option is found."""
+ state = ' '.join(state) if state else ''
+
+ return self.tk.call(self._name, "lookup", style, '-%s' % option,
+ state, default)
+
+
+ def layout(self, style, layoutspec=None):
+ """Define the widget layout for given style. If layoutspec is
+ omitted, return the layout specification for given style.
+
+ layoutspec is expected to be a list or an object different than
+ None that evaluates to False if you want to "turn off" that style.
+ If it is a list (or tuple, or something else), each item should be
+ a tuple where the first item is the layout name and the second item
+ should have the format described below:
+
+ LAYOUTS
+
+ A layout can contain the value None, if takes no options, or
+ a dict of options specifying how to arrange the element.
+ The layout mechanism uses a simplified version of the pack
+ geometry manager: given an initial cavity, each element is
+ allocated a parcel. Valid options/values are:
+
+ side: whichside
+ Specifies which side of the cavity to place the
+ element; one of top, right, bottom or left. If
+ omitted, the element occupies the entire cavity.
+
+ sticky: nswe
+ Specifies where the element is placed inside its
+ allocated parcel.
+
+ children: [sublayout... ]
+ Specifies a list of elements to place inside the
+ element. Each element is a tuple (or other sequence)
+ where the first item is the layout name, and the other
+ is a LAYOUT."""
+ lspec = None
+ if layoutspec:
+ lspec = _format_layoutlist(layoutspec)[0]
+ elif layoutspec is not None: # will disable the layout ({}, '', etc)
+ lspec = "null" # could be any other word, but this may make sense
+ # when calling layout(style) later
+
+ return _list_from_layouttuple(self.tk,
+ self.tk.call(self._name, "layout", style, lspec))
+
+
+ def element_create(self, elementname, etype, *args, **kw):
+ """Create a new element in the current theme of given etype."""
+ spec, opts = _format_elemcreate(etype, False, *args, **kw)
+ self.tk.call(self._name, "element", "create", elementname, etype,
+ spec, *opts)
+
+
+ def element_names(self):
+ """Returns the list of elements defined in the current theme."""
+ return self.tk.splitlist(self.tk.call(self._name, "element", "names"))
+
+
+ def element_options(self, elementname):
+ """Return the list of elementname's options."""
+ return self.tk.splitlist(self.tk.call(self._name, "element", "options", elementname))
+
+
+ def theme_create(self, themename, parent=None, settings=None):
+ """Creates a new theme.
+
+ It is an error if themename already exists. If parent is
+ specified, the new theme will inherit styles, elements and
+ layouts from the specified parent theme. If settings are present,
+ they are expected to have the same syntax used for theme_settings."""
+ script = _script_from_settings(settings) if settings else ''
+
+ if parent:
+ self.tk.call(self._name, "theme", "create", themename,
+ "-parent", parent, "-settings", script)
+ else:
+ self.tk.call(self._name, "theme", "create", themename,
+ "-settings", script)
+
+
+ def theme_settings(self, themename, settings):
+ """Temporarily sets the current theme to themename, apply specified
+ settings and then restore the previous theme.
+
+ Each key in settings is a style and each value may contain the
+ keys 'configure', 'map', 'layout' and 'element create' and they
+ are expected to have the same format as specified by the methods
+ configure, map, layout and element_create respectively."""
+ script = _script_from_settings(settings)
+ self.tk.call(self._name, "theme", "settings", themename, script)
+
+
+ def theme_names(self):
+ """Returns a list of all known themes."""
+ return self.tk.splitlist(self.tk.call(self._name, "theme", "names"))
+
+
+ def theme_use(self, themename=None):
+ """If themename is None, returns the theme in use, otherwise, set
+ the current theme to themename, refreshes all widgets and emits
+ a <<ThemeChanged>> event."""
+ if themename is None:
+ # Starting on Tk 8.6, checking this global is no longer needed
+ # since it allows doing self.tk.call(self._name, "theme", "use")
+ return self.tk.eval("return $ttk::currentTheme")
+
+ # using "ttk::setTheme" instead of "ttk::style theme use" causes
+ # the variable currentTheme to be updated, also, ttk::setTheme calls
+ # "ttk::style theme use" in order to change theme.
+ self.tk.call("ttk::setTheme", themename)
+
+
+class Widget(Tkinter.Widget):
+ """Base class for Tk themed widgets."""
+
+ def __init__(self, master, widgetname, kw=None):
+ """Constructs a Ttk Widget with the parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, takefocus, style
+
+ SCROLLABLE WIDGET OPTIONS
+
+ xscrollcommand, yscrollcommand
+
+ LABEL WIDGET OPTIONS
+
+ text, textvariable, underline, image, compound, width
+
+ WIDGET STATES
+
+ active, disabled, focus, pressed, selected, background,
+ readonly, alternate, invalid
+ """
+ master = setup_master(master)
+ if not getattr(master, '_tile_loaded', False):
+ # Load tile now, if needed
+ _load_tile(master)
+ Tkinter.Widget.__init__(self, master, widgetname, kw=kw)
+
+
+ def identify(self, x, y):
+ """Returns the name of the element at position x, y, or the empty
+ string if the point does not lie within any element.
+
+ x and y are pixel coordinates relative to the widget."""
+ return self.tk.call(self._w, "identify", x, y)
+
+
+ def instate(self, statespec, callback=None, *args, **kw):
+ """Test the widget's state.
+
+ If callback is not specified, returns True if the widget state
+ matches statespec and False otherwise. If callback is specified,
+ then it will be invoked with *args, **kw if the widget state
+ matches statespec. statespec is expected to be a sequence."""
+ ret = self.tk.getboolean(
+ self.tk.call(self._w, "instate", ' '.join(statespec)))
+ if ret and callback:
+ return callback(*args, **kw)
+
+ return ret
+
+
+ def state(self, statespec=None):
+ """Modify or inquire widget state.
+
+ Widget state is returned if statespec is None, otherwise it is
+ set according to the statespec flags and then a new state spec
+ is returned indicating which flags were changed. statespec is
+ expected to be a sequence."""
+ if statespec is not None:
+ statespec = ' '.join(statespec)
+
+ return self.tk.splitlist(str(self.tk.call(self._w, "state", statespec)))
+
+
+class Button(Widget):
+ """Ttk Button widget, displays a textual label and/or image, and
+ evaluates a command when pressed."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Button widget with the parent master.
+
+ STANDARD OPTIONS
+
+ class, compound, cursor, image, state, style, takefocus,
+ text, textvariable, underline, width
+
+ WIDGET-SPECIFIC OPTIONS
+
+ command, default, width
+ """
+ Widget.__init__(self, master, "ttk::button", kw)
+
+
+ def invoke(self):
+ """Invokes the command associated with the button."""
+ return self.tk.call(self._w, "invoke")
+
+
+class Checkbutton(Widget):
+ """Ttk Checkbutton widget which is either in on- or off-state."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Checkbutton widget with the parent master.
+
+ STANDARD OPTIONS
+
+ class, compound, cursor, image, state, style, takefocus,
+ text, textvariable, underline, width
+
+ WIDGET-SPECIFIC OPTIONS
+
+ command, offvalue, onvalue, variable
+ """
+ Widget.__init__(self, master, "ttk::checkbutton", kw)
+
+
+ def invoke(self):
+ """Toggles between the selected and deselected states and
+ invokes the associated command. If the widget is currently
+ selected, sets the option variable to the offvalue option
+ and deselects the widget; otherwise, sets the option variable
+ to the option onvalue.
+
+ Returns the result of the associated command."""
+ return self.tk.call(self._w, "invoke")
+
+
+class Entry(Widget, Tkinter.Entry):
+ """Ttk Entry widget displays a one-line text string and allows that
+ string to be edited by the user."""
+
+ def __init__(self, master=None, widget=None, **kw):
+ """Constructs a Ttk Entry widget with the parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus, xscrollcommand
+
+ WIDGET-SPECIFIC OPTIONS
+
+ exportselection, invalidcommand, justify, show, state,
+ textvariable, validate, validatecommand, width
+
+ VALIDATION MODES
+
+ none, key, focus, focusin, focusout, all
+ """
+ Widget.__init__(self, master, widget or "ttk::entry", kw)
+
+
+ def bbox(self, index):
+ """Return a tuple of (x, y, width, height) which describes the
+ bounding box of the character given by index."""
+ return self._getints(self.tk.call(self._w, "bbox", index))
+
+
+ def identify(self, x, y):
+ """Returns the name of the element at position x, y, or the
+ empty string if the coordinates are outside the window."""
+ return self.tk.call(self._w, "identify", x, y)
+
+
+ def validate(self):
+ """Force revalidation, independent of the conditions specified
+ by the validate option. Returns False if validation fails, True
+ if it succeeds. Sets or clears the invalid state accordingly."""
+ return self.tk.getboolean(self.tk.call(self._w, "validate"))
+
+
+class Combobox(Entry):
+ """Ttk Combobox widget combines a text field with a pop-down list of
+ values."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Combobox widget with the parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus
+
+ WIDGET-SPECIFIC OPTIONS
+
+ exportselection, justify, height, postcommand, state,
+ textvariable, values, width
+ """
+ Entry.__init__(self, master, "ttk::combobox", **kw)
+
+
+ def current(self, newindex=None):
+ """If newindex is supplied, sets the combobox value to the
+ element at position newindex in the list of values. Otherwise,
+ returns the index of the current value in the list of values
+ or -1 if the current value does not appear in the list."""
+ if newindex is None:
+ return self.tk.getint(self.tk.call(self._w, "current"))
+ return self.tk.call(self._w, "current", newindex)
+
+
+ def set(self, value):
+ """Sets the value of the combobox to value."""
+ self.tk.call(self._w, "set", value)
+
+
+class Frame(Widget):
+ """Ttk Frame widget is a container, used to group other widgets
+ together."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Frame with parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus
+
+ WIDGET-SPECIFIC OPTIONS
+
+ borderwidth, relief, padding, width, height
+ """
+ Widget.__init__(self, master, "ttk::frame", kw)
+
+
+class Label(Widget):
+ """Ttk Label widget displays a textual label and/or image."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Label with parent master.
+
+ STANDARD OPTIONS
+
+ class, compound, cursor, image, style, takefocus, text,
+ textvariable, underline, width
+
+ WIDGET-SPECIFIC OPTIONS
+
+ anchor, background, font, foreground, justify, padding,
+ relief, text, wraplength
+ """
+ Widget.__init__(self, master, "ttk::label", kw)
+
+
+class Labelframe(Widget):
+ """Ttk Labelframe widget is a container used to group other widgets
+ together. It has an optional label, which may be a plain text string
+ or another widget."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Labelframe with parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus
+
+ WIDGET-SPECIFIC OPTIONS
+ labelanchor, text, underline, padding, labelwidget, width,
+ height
+ """
+ Widget.__init__(self, master, "ttk::labelframe", kw)
+
+LabelFrame = Labelframe # Tkinter name compatibility
+
+
+class Menubutton(Widget):
+ """Ttk Menubutton widget displays a textual label and/or image, and
+ displays a menu when pressed."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Menubutton with parent master.
+
+ STANDARD OPTIONS
+
+ class, compound, cursor, image, state, style, takefocus,
+ text, textvariable, underline, width
+
+ WIDGET-SPECIFIC OPTIONS
+
+ direction, menu
+ """
+ Widget.__init__(self, master, "ttk::menubutton", kw)
+
+
+class Notebook(Widget):
+ """Ttk Notebook widget manages a collection of windows and displays
+ a single one at a time. Each child window is associated with a tab,
+ which the user may select to change the currently-displayed window."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Notebook with parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus
+
+ WIDGET-SPECIFIC OPTIONS
+
+ height, padding, width
+
+ TAB OPTIONS
+
+ state, sticky, padding, text, image, compound, underline
+
+ TAB IDENTIFIERS (tab_id)
+
+ The tab_id argument found in several methods may take any of
+ the following forms:
+
+ * An integer between zero and the number of tabs
+ * The name of a child window
+ * A positional specification of the form "@x,y", which
+ defines the tab
+ * The string "current", which identifies the
+ currently-selected tab
+ * The string "end", which returns the number of tabs (only
+ valid for method index)
+ """
+ Widget.__init__(self, master, "ttk::notebook", kw)
+
+
+ def add(self, child, **kw):
+ """Adds a new tab to the notebook.
+
+ If window is currently managed by the notebook but hidden, it is
+ restored to its previous position."""
+ self.tk.call(self._w, "add", child, *(_format_optdict(kw)))
+
+
+ def forget(self, tab_id):
+ """Removes the tab specified by tab_id, unmaps and unmanages the
+ associated window."""
+ self.tk.call(self._w, "forget", tab_id)
+
+
+ def hide(self, tab_id):
+ """Hides the tab specified by tab_id.
+
+ The tab will not be displayed, but the associated window remains
+ managed by the notebook and its configuration remembered. Hidden
+ tabs may be restored with the add command."""
+ self.tk.call(self._w, "hide", tab_id)
+
+
+ def identify(self, x, y):
+ """Returns the name of the tab element at position x, y, or the
+ empty string if none."""
+ return self.tk.call(self._w, "identify", x, y)
+
+
+ def index(self, tab_id):
+ """Returns the numeric index of the tab specified by tab_id, or
+ the total number of tabs if tab_id is the string "end"."""
+ return self.tk.getint(self.tk.call(self._w, "index", tab_id))
+
+
+ def insert(self, pos, child, **kw):
+ """Inserts a pane at the specified position.
+
+ pos is either the string end, an integer index, or the name of
+ a managed child. If child is already managed by the notebook,
+ moves it to the specified position."""
+ self.tk.call(self._w, "insert", pos, child, *(_format_optdict(kw)))
+
+
+ def select(self, tab_id=None):
+ """Selects the specified tab.
+
+ The associated child window will be displayed, and the
+ previously-selected window (if different) is unmapped. If tab_id
+ is omitted, returns the widget name of the currently selected
+ pane."""
+ return self.tk.call(self._w, "select", tab_id)
+
+
+ def tab(self, tab_id, option=None, **kw):
+ """Query or modify the options of the specific tab_id.
+
+ If kw is not given, returns a dict of the tab option values. If option
+ is specified, returns the value of that option. Otherwise, sets the
+ options to the corresponding values."""
+ if option is not None:
+ kw[option] = None
+ return _val_or_dict(self.tk, kw, self._w, "tab", tab_id)
+
+
+ def tabs(self):
+ """Returns a list of windows managed by the notebook."""
+ return self.tk.splitlist(self.tk.call(self._w, "tabs") or ())
+
+
+ def enable_traversal(self):
+ """Enable keyboard traversal for a toplevel window containing
+ this notebook.
+
+ This will extend the bindings for the toplevel window containing
+ this notebook as follows:
+
+ Control-Tab: selects the tab following the currently selected
+ one
+
+ Shift-Control-Tab: selects the tab preceding the currently
+ selected one
+
+ Alt-K: where K is the mnemonic (underlined) character of any
+ tab, will select that tab.
+
+ Multiple notebooks in a single toplevel may be enabled for
+ traversal, including nested notebooks. However, notebook traversal
+ only works properly if all panes are direct children of the
+ notebook."""
+ # The only, and good, difference I see is about mnemonics, which works
+ # after calling this method. Control-Tab and Shift-Control-Tab always
+ # works (here at least).
+ self.tk.call("ttk::notebook::enableTraversal", self._w)
+
+
+class Panedwindow(Widget, Tkinter.PanedWindow):
+ """Ttk Panedwindow widget displays a number of subwindows, stacked
+ either vertically or horizontally."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Panedwindow with parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus
+
+ WIDGET-SPECIFIC OPTIONS
+
+ orient, width, height
+
+ PANE OPTIONS
+
+ weight
+ """
+ Widget.__init__(self, master, "ttk::panedwindow", kw)
+
+
+ forget = Tkinter.PanedWindow.forget # overrides Pack.forget
+
+
+ def insert(self, pos, child, **kw):
+ """Inserts a pane at the specified positions.
+
+ pos is either the string end, and integer index, or the name
+ of a child. If child is already managed by the paned window,
+ moves it to the specified position."""
+ self.tk.call(self._w, "insert", pos, child, *(_format_optdict(kw)))
+
+
+ def pane(self, pane, option=None, **kw):
+ """Query or modify the options of the specified pane.
+
+ pane is either an integer index or the name of a managed subwindow.
+ If kw is not given, returns a dict of the pane option values. If
+ option is specified then the value for that option is returned.
+ Otherwise, sets the options to the corresponding values."""
+ if option is not None:
+ kw[option] = None
+ return _val_or_dict(self.tk, kw, self._w, "pane", pane)
+
+
+ def sashpos(self, index, newpos=None):
+ """If newpos is specified, sets the position of sash number index.
+
+ May adjust the positions of adjacent sashes to ensure that
+ positions are monotonically increasing. Sash positions are further
+ constrained to be between 0 and the total size of the widget.
+
+ Returns the new position of sash number index."""
+ return self.tk.getint(self.tk.call(self._w, "sashpos", index, newpos))
+
+PanedWindow = Panedwindow # Tkinter name compatibility
+
+
+class Progressbar(Widget):
+ """Ttk Progressbar widget shows the status of a long-running
+ operation. They can operate in two modes: determinate mode shows the
+ amount completed relative to the total amount of work to be done, and
+ indeterminate mode provides an animated display to let the user know
+ that something is happening."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Progressbar with parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus
+
+ WIDGET-SPECIFIC OPTIONS
+
+ orient, length, mode, maximum, value, variable, phase
+ """
+ Widget.__init__(self, master, "ttk::progressbar", kw)
+
+
+ def start(self, interval=None):
+ """Begin autoincrement mode: schedules a recurring timer event
+ that calls method step every interval milliseconds.
+
+ interval defaults to 50 milliseconds (20 steps/second) if omitted."""
+ self.tk.call(self._w, "start", interval)
+
+
+ def step(self, amount=None):
+ """Increments the value option by amount.
+
+ amount defaults to 1.0 if omitted."""
+ self.tk.call(self._w, "step", amount)
+
+
+ def stop(self):
+ """Stop autoincrement mode: cancels any recurring timer event
+ initiated by start."""
+ self.tk.call(self._w, "stop")
+
+
+class Radiobutton(Widget):
+ """Ttk Radiobutton widgets are used in groups to show or change a
+ set of mutually-exclusive options."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Radiobutton with parent master.
+
+ STANDARD OPTIONS
+
+ class, compound, cursor, image, state, style, takefocus,
+ text, textvariable, underline, width
+
+ WIDGET-SPECIFIC OPTIONS
+
+ command, value, variable
+ """
+ Widget.__init__(self, master, "ttk::radiobutton", kw)
+
+
+ def invoke(self):
+ """Sets the option variable to the option value, selects the
+ widget, and invokes the associated command.
+
+ Returns the result of the command, or an empty string if
+ no command is specified."""
+ return self.tk.call(self._w, "invoke")
+
+
+class Scale(Widget, Tkinter.Scale):
+ """Ttk Scale widget is typically used to control the numeric value of
+ a linked variable that varies uniformly over some range."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Scale with parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus
+
+ WIDGET-SPECIFIC OPTIONS
+
+ command, from, length, orient, to, value, variable
+ """
+ Widget.__init__(self, master, "ttk::scale", kw)
+
+
+ def configure(self, cnf=None, **kw):
+ """Modify or query scale options.
+
+ Setting a value for any of the "from", "from_" or "to" options
+ generates a <<RangeChanged>> event."""
+ if cnf:
+ kw.update(cnf)
+ Widget.configure(self, **kw)
+ if any(['from' in kw, 'from_' in kw, 'to' in kw]):
+ self.event_generate('<<RangeChanged>>')
+
+
+ def get(self, x=None, y=None):
+ """Get the current value of the value option, or the value
+ corresponding to the coordinates x, y if they are specified.
+
+ x and y are pixel coordinates relative to the scale widget
+ origin."""
+ return self.tk.call(self._w, 'get', x, y)
+
+
+class Scrollbar(Widget, Tkinter.Scrollbar):
+ """Ttk Scrollbar controls the viewport of a scrollable widget."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Scrollbar with parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus
+
+ WIDGET-SPECIFIC OPTIONS
+
+ command, orient
+ """
+ Widget.__init__(self, master, "ttk::scrollbar", kw)
+
+
+class Separator(Widget):
+ """Ttk Separator widget displays a horizontal or vertical separator
+ bar."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Separator with parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus
+
+ WIDGET-SPECIFIC OPTIONS
+
+ orient
+ """
+ Widget.__init__(self, master, "ttk::separator", kw)
+
+
+class Sizegrip(Widget):
+ """Ttk Sizegrip allows the user to resize the containing toplevel
+ window by pressing and dragging the grip."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Sizegrip with parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, state, style, takefocus
+ """
+ Widget.__init__(self, master, "ttk::sizegrip", kw)
+
+
+class Treeview(Widget, Tkinter.XView, Tkinter.YView):
+ """Ttk Treeview widget displays a hierarchical collection of items.
+
+ Each item has a textual label, an optional image, and an optional list
+ of data values. The data values are displayed in successive columns
+ after the tree label."""
+
+ def __init__(self, master=None, **kw):
+ """Construct a Ttk Treeview with parent master.
+
+ STANDARD OPTIONS
+
+ class, cursor, style, takefocus, xscrollcommand,
+ yscrollcommand
+
+ WIDGET-SPECIFIC OPTIONS
+
+ columns, displaycolumns, height, padding, selectmode, show
+
+ ITEM OPTIONS
+
+ text, image, values, open, tags
+
+ TAG OPTIONS
+
+ foreground, background, font, image
+ """
+ Widget.__init__(self, master, "ttk::treeview", kw)
+
+
+ def bbox(self, item, column=None):
+ """Returns the bounding box (relative to the treeview widget's
+ window) of the specified item in the form x y width height.
+
+ If column is specified, returns the bounding box of that cell.
+ If the item is not visible (i.e., if it is a descendant of a
+ closed item or is scrolled offscreen), returns an empty string."""
+ return self._getints(self.tk.call(self._w, "bbox", item, column)) or ''
+
+
+ def get_children(self, item=None):
+ """Returns a tuple of children belonging to item.
+
+ If item is not specified, returns root children."""
+ return self.tk.splitlist(
+ self.tk.call(self._w, "children", item or '') or ())
+
+
+ def set_children(self, item, *newchildren):
+ """Replaces item's child with newchildren.
+
+ Children present in item that are not present in newchildren
+ are detached from tree. No items in newchildren may be an
+ ancestor of item."""
+ self.tk.call(self._w, "children", item, newchildren)
+
+
+ def column(self, column, option=None, **kw):
+ """Query or modify the options for the specified column.
+
+ If kw is not given, returns a dict of the column option values. If
+ option is specified then the value for that option is returned.
+ Otherwise, sets the options to the corresponding values."""
+ if option is not None:
+ kw[option] = None
+ return _val_or_dict(self.tk, kw, self._w, "column", column)
+
+
+ def delete(self, *items):
+ """Delete all specified items and all their descendants. The root
+ item may not be deleted."""
+ self.tk.call(self._w, "delete", items)
+
+
+ def detach(self, *items):
+ """Unlinks all of the specified items from the tree.
+
+ The items and all of their descendants are still present, and may
+ be reinserted at another point in the tree, but will not be
+ displayed. The root item may not be detached."""
+ self.tk.call(self._w, "detach", items)
+
+
+ def exists(self, item):
+ """Returns True if the specified item is present in the tree,
+ False otherwise."""
+ return self.tk.getboolean(self.tk.call(self._w, "exists", item))
+
+
+ def focus(self, item=None):
+ """If item is specified, sets the focus item to item. Otherwise,
+ returns the current focus item, or '' if there is none."""
+ return self.tk.call(self._w, "focus", item)
+
+
+ def heading(self, column, option=None, **kw):
+ """Query or modify the heading options for the specified column.
+
+ If kw is not given, returns a dict of the heading option values. If
+ option is specified then the value for that option is returned.
+ Otherwise, sets the options to the corresponding values.
+
+ Valid options/values are:
+ text: text
+ The text to display in the column heading
+ image: image_name
+ Specifies an image to display to the right of the column
+ heading
+ anchor: anchor
+ Specifies how the heading text should be aligned. One of
+ the standard Tk anchor values
+ command: callback
+ A callback to be invoked when the heading label is
+ pressed.
+
+ To configure the tree column heading, call this with column = "#0" """
+ cmd = kw.get('command')
+ if cmd and not isinstance(cmd, basestring):
+ # callback not registered yet, do it now
+ kw['command'] = self.master.register(cmd, self._substitute)
+
+ if option is not None:
+ kw[option] = None
+
+ return _val_or_dict(self.tk, kw, self._w, 'heading', column)
+
+
+ def identify(self, component, x, y):
+ """Returns a description of the specified component under the
+ point given by x and y, or the empty string if no such component
+ is present at that position."""
+ return self.tk.call(self._w, "identify", component, x, y)
+
+
+ def identify_row(self, y):
+ """Returns the item ID of the item at position y."""
+ return self.identify("row", 0, y)
+
+
+ def identify_column(self, x):
+ """Returns the data column identifier of the cell at position x.
+
+ The tree column has ID #0."""
+ return self.identify("column", x, 0)
+
+
+ def identify_region(self, x, y):
+ """Returns one of:
+
+ heading: Tree heading area.
+ separator: Space between two columns headings;
+ tree: The tree area.
+ cell: A data cell.
+
+ * Availability: Tk 8.6"""
+ return self.identify("region", x, y)
+
+
+ def identify_element(self, x, y):
+ """Returns the element at position x, y.
+
+ * Availability: Tk 8.6"""
+ return self.identify("element", x, y)
+
+
+ def index(self, item):
+ """Returns the integer index of item within its parent's list
+ of children."""
+ return self.tk.getint(self.tk.call(self._w, "index", item))
+
+
+ def insert(self, parent, index, iid=None, **kw):
+ """Creates a new item and return the item identifier of the newly
+ created item.
+
+ parent is the item ID of the parent item, or the empty string
+ to create a new top-level item. index is an integer, or the value
+ end, specifying where in the list of parent's children to insert
+ the new item. If index is less than or equal to zero, the new node
+ is inserted at the beginning, if index is greater than or equal to
+ the current number of children, it is inserted at the end. If iid
+ is specified, it is used as the item identifier, iid must not
+ already exist in the tree. Otherwise, a new unique identifier
+ is generated."""
+ opts = _format_optdict(kw)
+ if iid:
+ res = self.tk.call(self._w, "insert", parent, index,
+ "-id", iid, *opts)
+ else:
+ res = self.tk.call(self._w, "insert", parent, index, *opts)
+
+ return res
+
+
+ def item(self, item, option=None, **kw):
+ """Query or modify the options for the specified item.
+
+ If no options are given, a dict with options/values for the item
+ is returned. If option is specified then the value for that option
+ is returned. Otherwise, sets the options to the corresponding
+ values as given by kw."""
+ if option is not None:
+ kw[option] = None
+ return _val_or_dict(self.tk, kw, self._w, "item", item)
+
+
+ def move(self, item, parent, index):
+ """Moves item to position index in parent's list of children.
+
+ It is illegal to move an item under one of its descendants. If
+ index is less than or equal to zero, item is moved to the
+ beginning, if greater than or equal to the number of children,
+ it is moved to the end. If item was detached it is reattached."""
+ self.tk.call(self._w, "move", item, parent, index)
+
+ reattach = move # A sensible method name for reattaching detached items
+
+
+ def next(self, item):
+ """Returns the identifier of item's next sibling, or '' if item
+ is the last child of its parent."""
+ return self.tk.call(self._w, "next", item)
+
+
+ def parent(self, item):
+ """Returns the ID of the parent of item, or '' if item is at the
+ top level of the hierarchy."""
+ return self.tk.call(self._w, "parent", item)
+
+
+ def prev(self, item):
+ """Returns the identifier of item's previous sibling, or '' if
+ item is the first child of its parent."""
+ return self.tk.call(self._w, "prev", item)
+
+
+ def see(self, item):
+ """Ensure that item is visible.
+
+ Sets all of item's ancestors open option to True, and scrolls
+ the widget if necessary so that item is within the visible
+ portion of the tree."""
+ self.tk.call(self._w, "see", item)
+
+
+ def selection(self, selop=None, items=None):
+ """If selop is not specified, returns selected items."""
+ if isinstance(items, basestring):
+ items = (items,)
+ return self.tk.splitlist(self.tk.call(self._w, "selection", selop, items))
+
+
+ def selection_set(self, items):
+ """items becomes the new selection."""
+ self.selection("set", items)
+
+
+ def selection_add(self, items):
+ """Add items to the selection."""
+ self.selection("add", items)
+
+
+ def selection_remove(self, items):
+ """Remove items from the selection."""
+ self.selection("remove", items)
+
+
+ def selection_toggle(self, items):
+ """Toggle the selection state of each item in items."""
+ self.selection("toggle", items)
+
+
+ def set(self, item, column=None, value=None):
+ """Query or set the value of given item.
+
+ With one argument, return a dictionary of column/value pairs
+ for the specified item. With two arguments, return the current
+ value of the specified column. With three arguments, set the
+ value of given column in given item to the specified value."""
+ res = self.tk.call(self._w, "set", item, column, value)
+ if column is None and value is None:
+ return _splitdict(self.tk, res,
+ cut_minus=False, conv=_tclobj_to_py)
+ else:
+ return res
+
+
+ def tag_bind(self, tagname, sequence=None, callback=None):
+ """Bind a callback for the given event sequence to the tag tagname.
+ When an event is delivered to an item, the callbacks for each
+ of the item's tags option are called."""
+ self._bind((self._w, "tag", "bind", tagname), sequence, callback, add=0)
+
+
+ def tag_configure(self, tagname, option=None, **kw):
+ """Query or modify the options for the specified tagname.
+
+ If kw is not given, returns a dict of the option settings for tagname.
+ If option is specified, returns the value for that option for the
+ specified tagname. Otherwise, sets the options to the corresponding
+ values for the given tagname."""
+ if option is not None:
+ kw[option] = None
+ return _val_or_dict(self.tk, kw, self._w, "tag", "configure",
+ tagname)
+
+
+ def tag_has(self, tagname, item=None):
+ """If item is specified, returns 1 or 0 depending on whether the
+ specified item has the given tagname. Otherwise, returns a list of
+ all items which have the specified tag.
+
+ * Availability: Tk 8.6"""
+ if item is None:
+ return self.tk.splitlist(
+ self.tk.call(self._w, "tag", "has", tagname))
+ else:
+ return self.tk.getboolean(
+ self.tk.call(self._w, "tag", "has", tagname, item))
+
+
+# Extensions
+
+class LabeledScale(Frame, object):
+ """A Ttk Scale widget with a Ttk Label widget indicating its
+ current value.
+
+ The Ttk Scale can be accessed through instance.scale, and Ttk Label
+ can be accessed through instance.label"""
+
+ def __init__(self, master=None, variable=None, from_=0, to=10, **kw):
+ """Construct a horizontal LabeledScale with parent master, a
+ variable to be associated with the Ttk Scale widget and its range.
+ If variable is not specified, a Tkinter.IntVar is created.
+
+ WIDGET-SPECIFIC OPTIONS
+
+ compound: 'top' or 'bottom'
+ Specifies how to display the label relative to the scale.
+ Defaults to 'top'.
+ """
+ self._label_top = kw.pop('compound', 'top') == 'top'
+
+ Frame.__init__(self, master, **kw)
+ self._variable = variable or Tkinter.IntVar(master)
+ self._variable.set(from_)
+ self._last_valid = from_
+
+ self.label = Label(self)
+ self.scale = Scale(self, variable=self._variable, from_=from_, to=to)
+ self.scale.bind('<<RangeChanged>>', self._adjust)
+
+ # position scale and label according to the compound option
+ scale_side = 'bottom' if self._label_top else 'top'
+ label_side = 'top' if scale_side == 'bottom' else 'bottom'
+ self.scale.pack(side=scale_side, fill='x')
+ tmp = Label(self).pack(side=label_side) # place holder
+ self.label.place(anchor='n' if label_side == 'top' else 's')
+
+ # update the label as scale or variable changes
+ self.__tracecb = self._variable.trace_variable('w', self._adjust)
+ self.bind('<Configure>', self._adjust)
+ self.bind('<Map>', self._adjust)
+
+
+ def destroy(self):
+ """Destroy this widget and possibly its associated variable."""
+ try:
+ self._variable.trace_vdelete('w', self.__tracecb)
+ except AttributeError:
+ # widget has been destroyed already
+ pass
+ else:
+ del self._variable
+ Frame.destroy(self)
+
+
+ def _adjust(self, *args):
+ """Adjust the label position according to the scale."""
+ def adjust_label():
+ self.update_idletasks() # "force" scale redraw
+
+ x, y = self.scale.coords()
+ if self._label_top:
+ y = self.scale.winfo_y() - self.label.winfo_reqheight()
+ else:
+ y = self.scale.winfo_reqheight() + self.label.winfo_reqheight()
+
+ self.label.place_configure(x=x, y=y)
+
+ from_ = _to_number(self.scale['from'])
+ to = _to_number(self.scale['to'])
+ if to < from_:
+ from_, to = to, from_
+ newval = self._variable.get()
+ if not from_ <= newval <= to:
+ # value outside range, set value back to the last valid one
+ self.value = self._last_valid
+ return
+
+ self._last_valid = newval
+ self.label['text'] = newval
+ self.after_idle(adjust_label)
+
+
+ def _get_value(self):
+ """Return current scale value."""
+ return self._variable.get()
+
+
+ def _set_value(self, val):
+ """Set new scale value."""
+ self._variable.set(val)
+
+
+ value = property(_get_value, _set_value)
+
+
+class OptionMenu(Menubutton):
+ """Themed OptionMenu, based after Tkinter's OptionMenu, which allows
+ the user to select a value from a menu."""
+
+ def __init__(self, master, variable, default=None, *values, **kwargs):
+ """Construct a themed OptionMenu widget with master as the parent,
+ the resource textvariable set to variable, the initially selected
+ value specified by the default parameter, the menu values given by
+ *values and additional keywords.
+
+ WIDGET-SPECIFIC OPTIONS
+
+ style: stylename
+ Menubutton style.
+ direction: 'above', 'below', 'left', 'right', or 'flush'
+ Menubutton direction.
+ command: callback
+ A callback that will be invoked after selecting an item.
+ """
+ kw = {'textvariable': variable, 'style': kwargs.pop('style', None),
+ 'direction': kwargs.pop('direction', None)}
+ Menubutton.__init__(self, master, **kw)
+ self['menu'] = Tkinter.Menu(self, tearoff=False)
+
+ self._variable = variable
+ self._callback = kwargs.pop('command', None)
+ if kwargs:
+ raise Tkinter.TclError('unknown option -%s' % (
+ kwargs.iterkeys().next()))
+
+ self.set_menu(default, *values)
+
+
+ def __getitem__(self, item):
+ if item == 'menu':
+ return self.nametowidget(Menubutton.__getitem__(self, item))
+
+ return Menubutton.__getitem__(self, item)
+
+
+ def set_menu(self, default=None, *values):
+ """Build a new menu of radiobuttons with *values and optionally
+ a default value."""
+ menu = self['menu']
+ menu.delete(0, 'end')
+ for val in values:
+ menu.add_radiobutton(label=val,
+ command=Tkinter._setit(self._variable, val, self._callback))
+
+ if default:
+ self._variable.set(default)
+
+
+ def destroy(self):
+ """Destroy this widget and its associated variable."""
+ del self._variable
+ Menubutton.destroy(self)
diff --git a/lib/python2.7/lib-tk/turtle.py b/lib/python2.7/lib-tk/turtle.py
new file mode 100644
index 00000000..264318ef
--- /dev/null
+++ b/lib/python2.7/lib-tk/turtle.py
@@ -0,0 +1,4034 @@
+#
+# turtle.py: a Tkinter based turtle graphics module for Python
+# Version 1.0.1 - 24. 9. 2009
+#
+# Copyright (C) 2006 - 2010 Gregor Lingl
+# email: glingl@aon.at
+#
+# This software is provided 'as-is', without any express or implied
+# warranty. In no event will the authors be held liable for any damages
+# arising from the use of this software.
+#
+# Permission is granted to anyone to use this software for any purpose,
+# including commercial applications, and to alter it and redistribute it
+# freely, subject to the following restrictions:
+#
+# 1. The origin of this software must not be misrepresented; you must not
+# claim that you wrote the original software. If you use this software
+# in a product, an acknowledgment in the product documentation would be
+# appreciated but is not required.
+# 2. Altered source versions must be plainly marked as such, and must not be
+# misrepresented as being the original software.
+# 3. This notice may not be removed or altered from any source distribution.
+
+
+"""
+Turtle graphics is a popular way for introducing programming to
+kids. It was part of the original Logo programming language developed
+by Wally Feurzig and Seymour Papert in 1966.
+
+Imagine a robotic turtle starting at (0, 0) in the x-y plane. After an ``import turtle``, give it
+the command turtle.forward(15), and it moves (on-screen!) 15 pixels in
+the direction it is facing, drawing a line as it moves. Give it the
+command turtle.right(25), and it rotates in-place 25 degrees clockwise.
+
+By combining together these and similar commands, intricate shapes and
+pictures can easily be drawn.
+
+----- turtle.py
+
+This module is an extended reimplementation of turtle.py from the
+Python standard distribution up to Python 2.5. (See: http://www.python.org)
+
+It tries to keep the merits of turtle.py and to be (nearly) 100%
+compatible with it. This means in the first place to enable the
+learning programmer to use all the commands, classes and methods
+interactively when using the module from within IDLE run with
+the -n switch.
+
+Roughly it has the following features added:
+
+- Better animation of the turtle movements, especially of turning the
+ turtle. So the turtles can more easily be used as a visual feedback
+ instrument by the (beginning) programmer.
+
+- Different turtle shapes, gif-images as turtle shapes, user defined
+ and user controllable turtle shapes, among them compound
+ (multicolored) shapes. Turtle shapes can be stretched and tilted, which
+ makes turtles very versatile geometrical objects.
+
+- Fine control over turtle movement and screen updates via delay(),
+ and enhanced tracer() and speed() methods.
+
+- Aliases for the most commonly used commands, like fd for forward etc.,
+ following the early Logo traditions. This reduces the boring work of
+ typing long sequences of commands, which often occur in a natural way
+ when kids try to program fancy pictures on their first encounter with
+ turtle graphics.
+
+- Turtles now have an undo()-method with configurable undo-buffer.
+
+- Some simple commands/methods for creating event driven programs
+ (mouse-, key-, timer-events). Especially useful for programming games.
+
+- A scrollable Canvas class. The default scrollable Canvas can be
+ extended interactively as needed while playing around with the turtle(s).
+
+- A TurtleScreen class with methods controlling background color or
+ background image, window and canvas size and other properties of the
+ TurtleScreen.
+
+- There is a method, setworldcoordinates(), to install a user defined
+ coordinate-system for the TurtleScreen.
+
+- The implementation uses a 2-vector class named Vec2D, derived from tuple.
+ This class is public, so it can be imported by the application programmer,
+ which makes certain types of computations very natural and compact.
+
+- Appearance of the TurtleScreen and the Turtles at startup/import can be
+ configured by means of a turtle.cfg configuration file.
+ The default configuration mimics the appearance of the old turtle module.
+
+- If configured appropriately the module reads in docstrings from a docstring
+ dictionary in some different language, supplied separately and replaces
+ the English ones by those read in. There is a utility function
+ write_docstringdict() to write a dictionary with the original (English)
+ docstrings to disc, so it can serve as a template for translations.
+
+Behind the scenes there are some features included with possible
+extensions in mind. These will be commented and documented elsewhere.
+
+"""
+
+_ver = "turtle 1.0b1 - for Python 2.6 - 30. 5. 2008, 18:08"
+
+#print _ver
+
+import Tkinter as TK
+import types
+import math
+import time
+import os
+
+from os.path import isfile, split, join
+from copy import deepcopy
+
+from math import * ## for compatibility with old turtle module
+
+_tg_classes = ['ScrolledCanvas', 'TurtleScreen', 'Screen',
+ 'RawTurtle', 'Turtle', 'RawPen', 'Pen', 'Shape', 'Vec2D']
+_tg_screen_functions = ['addshape', 'bgcolor', 'bgpic', 'bye',
+ 'clearscreen', 'colormode', 'delay', 'exitonclick', 'getcanvas',
+ 'getshapes', 'listen', 'mode', 'onkey', 'onscreenclick', 'ontimer',
+ 'register_shape', 'resetscreen', 'screensize', 'setup',
+ 'setworldcoordinates', 'title', 'tracer', 'turtles', 'update',
+ 'window_height', 'window_width']
+_tg_turtle_functions = ['back', 'backward', 'begin_fill', 'begin_poly', 'bk',
+ 'circle', 'clear', 'clearstamp', 'clearstamps', 'clone', 'color',
+ 'degrees', 'distance', 'dot', 'down', 'end_fill', 'end_poly', 'fd',
+ 'fill', 'fillcolor', 'forward', 'get_poly', 'getpen', 'getscreen',
+ 'getturtle', 'goto', 'heading', 'hideturtle', 'home', 'ht', 'isdown',
+ 'isvisible', 'left', 'lt', 'onclick', 'ondrag', 'onrelease', 'pd',
+ 'pen', 'pencolor', 'pendown', 'pensize', 'penup', 'pos', 'position',
+ 'pu', 'radians', 'right', 'reset', 'resizemode', 'rt',
+ 'seth', 'setheading', 'setpos', 'setposition', 'settiltangle',
+ 'setundobuffer', 'setx', 'sety', 'shape', 'shapesize', 'showturtle',
+ 'speed', 'st', 'stamp', 'tilt', 'tiltangle', 'towards', 'tracer',
+ 'turtlesize', 'undo', 'undobufferentries', 'up', 'width',
+ 'window_height', 'window_width', 'write', 'xcor', 'ycor']
+_tg_utilities = ['write_docstringdict', 'done', 'mainloop']
+_math_functions = ['acos', 'asin', 'atan', 'atan2', 'ceil', 'cos', 'cosh',
+ 'e', 'exp', 'fabs', 'floor', 'fmod', 'frexp', 'hypot', 'ldexp', 'log',
+ 'log10', 'modf', 'pi', 'pow', 'sin', 'sinh', 'sqrt', 'tan', 'tanh']
+
+__all__ = (_tg_classes + _tg_screen_functions + _tg_turtle_functions +
+ _tg_utilities + ['Terminator'] + _math_functions)
+
+_alias_list = ['addshape', 'backward', 'bk', 'fd', 'ht', 'lt', 'pd', 'pos',
+ 'pu', 'rt', 'seth', 'setpos', 'setposition', 'st',
+ 'turtlesize', 'up', 'width']
+
+_CFG = {"width" : 0.5, # Screen
+ "height" : 0.75,
+ "canvwidth" : 400,
+ "canvheight": 300,
+ "leftright": None,
+ "topbottom": None,
+ "mode": "standard", # TurtleScreen
+ "colormode": 1.0,
+ "delay": 10,
+ "undobuffersize": 1000, # RawTurtle
+ "shape": "classic",
+ "pencolor" : "black",
+ "fillcolor" : "black",
+ "resizemode" : "noresize",
+ "visible" : True,
+ "language": "english", # docstrings
+ "exampleturtle": "turtle",
+ "examplescreen": "screen",
+ "title": "Python Turtle Graphics",
+ "using_IDLE": False
+ }
+
+##print "cwd:", os.getcwd()
+##print "__file__:", __file__
+##
+##def show(dictionary):
+## print "=========================="
+## for key in sorted(dictionary.keys()):
+## print key, ":", dictionary[key]
+## print "=========================="
+## print
+
+def config_dict(filename):
+ """Convert content of config-file into dictionary."""
+ f = open(filename, "r")
+ cfglines = f.readlines()
+ f.close()
+ cfgdict = {}
+ for line in cfglines:
+ line = line.strip()
+ if not line or line.startswith("#"):
+ continue
+ try:
+ key, value = line.split("=")
+ except ValueError:
+ print "Bad line in config-file %s:\n%s" % (filename,line)
+ continue
+ key = key.strip()
+ value = value.strip()
+ if value in ["True", "False", "None", "''", '""']:
+ value = eval(value)
+ else:
+ try:
+ if "." in value:
+ value = float(value)
+ else:
+ value = int(value)
+ except ValueError:
+ pass # value need not be converted
+ cfgdict[key] = value
+ return cfgdict
+
+def readconfig(cfgdict):
+ """Read config-files, change configuration-dict accordingly.
+
+ If there is a turtle.cfg file in the current working directory,
+ read it from there. If this contains an importconfig-value,
+ say 'myway', construct filename turtle_mayway.cfg else use
+ turtle.cfg and read it from the import-directory, where
+ turtle.py is located.
+ Update configuration dictionary first according to config-file,
+ in the import directory, then according to config-file in the
+ current working directory.
+ If no config-file is found, the default configuration is used.
+ """
+ default_cfg = "turtle.cfg"
+ cfgdict1 = {}
+ cfgdict2 = {}
+ if isfile(default_cfg):
+ cfgdict1 = config_dict(default_cfg)
+ #print "1. Loading config-file %s from: %s" % (default_cfg, os.getcwd())
+ if "importconfig" in cfgdict1:
+ default_cfg = "turtle_%s.cfg" % cfgdict1["importconfig"]
+ try:
+ head, tail = split(__file__)
+ cfg_file2 = join(head, default_cfg)
+ except BaseException:
+ cfg_file2 = ""
+ if isfile(cfg_file2):
+ #print "2. Loading config-file %s:" % cfg_file2
+ cfgdict2 = config_dict(cfg_file2)
+## show(_CFG)
+## show(cfgdict2)
+ _CFG.update(cfgdict2)
+## show(_CFG)
+## show(cfgdict1)
+ _CFG.update(cfgdict1)
+## show(_CFG)
+
+try:
+ readconfig(_CFG)
+except BaseException:
+ print "No configfile read, reason unknown"
+
+
+class Vec2D(tuple):
+ """A 2 dimensional vector class, used as a helper class
+ for implementing turtle graphics.
+ May be useful for turtle graphics programs also.
+ Derived from tuple, so a vector is a tuple!
+
+ Provides (for a, b vectors, k number):
+ a+b vector addition
+ a-b vector subtraction
+ a*b inner product
+ k*a and a*k multiplication with scalar
+ |a| absolute value of a
+ a.rotate(angle) rotation
+ """
+ def __new__(cls, x, y):
+ return tuple.__new__(cls, (x, y))
+ def __add__(self, other):
+ return Vec2D(self[0]+other[0], self[1]+other[1])
+ def __mul__(self, other):
+ if isinstance(other, Vec2D):
+ return self[0]*other[0]+self[1]*other[1]
+ return Vec2D(self[0]*other, self[1]*other)
+ def __rmul__(self, other):
+ if isinstance(other, int) or isinstance(other, float):
+ return Vec2D(self[0]*other, self[1]*other)
+ def __sub__(self, other):
+ return Vec2D(self[0]-other[0], self[1]-other[1])
+ def __neg__(self):
+ return Vec2D(-self[0], -self[1])
+ def __abs__(self):
+ return (self[0]**2 + self[1]**2)**0.5
+ def rotate(self, angle):
+ """rotate self counterclockwise by angle
+ """
+ perp = Vec2D(-self[1], self[0])
+ angle = angle * math.pi / 180.0
+ c, s = math.cos(angle), math.sin(angle)
+ return Vec2D(self[0]*c+perp[0]*s, self[1]*c+perp[1]*s)
+ def __getnewargs__(self):
+ return (self[0], self[1])
+ def __repr__(self):
+ return "(%.2f,%.2f)" % self
+
+
+##############################################################################
+### From here up to line : Tkinter - Interface for turtle.py ###
+### May be replaced by an interface to some different graphics toolkit ###
+##############################################################################
+
+## helper functions for Scrolled Canvas, to forward Canvas-methods
+## to ScrolledCanvas class
+
+def __methodDict(cls, _dict):
+ """helper function for Scrolled Canvas"""
+ baseList = list(cls.__bases__)
+ baseList.reverse()
+ for _super in baseList:
+ __methodDict(_super, _dict)
+ for key, value in cls.__dict__.items():
+ if type(value) == types.FunctionType:
+ _dict[key] = value
+
+def __methods(cls):
+ """helper function for Scrolled Canvas"""
+ _dict = {}
+ __methodDict(cls, _dict)
+ return _dict.keys()
+
+__stringBody = (
+ 'def %(method)s(self, *args, **kw): return ' +
+ 'self.%(attribute)s.%(method)s(*args, **kw)')
+
+def __forwardmethods(fromClass, toClass, toPart, exclude = ()):
+ """Helper functions for Scrolled Canvas, used to forward
+ ScrolledCanvas-methods to Tkinter.Canvas class.
+ """
+ _dict = {}
+ __methodDict(toClass, _dict)
+ for ex in _dict.keys():
+ if ex[:1] == '_' or ex[-1:] == '_':
+ del _dict[ex]
+ for ex in exclude:
+ if ex in _dict:
+ del _dict[ex]
+ for ex in __methods(fromClass):
+ if ex in _dict:
+ del _dict[ex]
+
+ for method, func in _dict.items():
+ d = {'method': method, 'func': func}
+ if type(toPart) == types.StringType:
+ execString = \
+ __stringBody % {'method' : method, 'attribute' : toPart}
+ exec execString in d
+ fromClass.__dict__[method] = d[method]
+
+
+class ScrolledCanvas(TK.Frame):
+ """Modeled after the scrolled canvas class from Grayons's Tkinter book.
+
+ Used as the default canvas, which pops up automatically when
+ using turtle graphics functions or the Turtle class.
+ """
+ def __init__(self, master, width=500, height=350,
+ canvwidth=600, canvheight=500):
+ TK.Frame.__init__(self, master, width=width, height=height)
+ self._rootwindow = self.winfo_toplevel()
+ self.width, self.height = width, height
+ self.canvwidth, self.canvheight = canvwidth, canvheight
+ self.bg = "white"
+ self._canvas = TK.Canvas(master, width=width, height=height,
+ bg=self.bg, relief=TK.SUNKEN, borderwidth=2)
+ self.hscroll = TK.Scrollbar(master, command=self._canvas.xview,
+ orient=TK.HORIZONTAL)
+ self.vscroll = TK.Scrollbar(master, command=self._canvas.yview)
+ self._canvas.configure(xscrollcommand=self.hscroll.set,
+ yscrollcommand=self.vscroll.set)
+ self.rowconfigure(0, weight=1, minsize=0)
+ self.columnconfigure(0, weight=1, minsize=0)
+ self._canvas.grid(padx=1, in_ = self, pady=1, row=0,
+ column=0, rowspan=1, columnspan=1, sticky='news')
+ self.vscroll.grid(padx=1, in_ = self, pady=1, row=0,
+ column=1, rowspan=1, columnspan=1, sticky='news')
+ self.hscroll.grid(padx=1, in_ = self, pady=1, row=1,
+ column=0, rowspan=1, columnspan=1, sticky='news')
+ self.reset()
+ self._rootwindow.bind('<Configure>', self.onResize)
+
+ def reset(self, canvwidth=None, canvheight=None, bg = None):
+ """Adjust canvas and scrollbars according to given canvas size."""
+ if canvwidth:
+ self.canvwidth = canvwidth
+ if canvheight:
+ self.canvheight = canvheight
+ if bg:
+ self.bg = bg
+ self._canvas.config(bg=bg,
+ scrollregion=(-self.canvwidth//2, -self.canvheight//2,
+ self.canvwidth//2, self.canvheight//2))
+ self._canvas.xview_moveto(0.5*(self.canvwidth - self.width + 30) /
+ self.canvwidth)
+ self._canvas.yview_moveto(0.5*(self.canvheight- self.height + 30) /
+ self.canvheight)
+ self.adjustScrolls()
+
+
+ def adjustScrolls(self):
+ """ Adjust scrollbars according to window- and canvas-size.
+ """
+ cwidth = self._canvas.winfo_width()
+ cheight = self._canvas.winfo_height()
+ self._canvas.xview_moveto(0.5*(self.canvwidth-cwidth)/self.canvwidth)
+ self._canvas.yview_moveto(0.5*(self.canvheight-cheight)/self.canvheight)
+ if cwidth < self.canvwidth or cheight < self.canvheight:
+ self.hscroll.grid(padx=1, in_ = self, pady=1, row=1,
+ column=0, rowspan=1, columnspan=1, sticky='news')
+ self.vscroll.grid(padx=1, in_ = self, pady=1, row=0,
+ column=1, rowspan=1, columnspan=1, sticky='news')
+ else:
+ self.hscroll.grid_forget()
+ self.vscroll.grid_forget()
+
+ def onResize(self, event):
+ """self-explanatory"""
+ self.adjustScrolls()
+
+ def bbox(self, *args):
+ """ 'forward' method, which canvas itself has inherited...
+ """
+ return self._canvas.bbox(*args)
+
+ def cget(self, *args, **kwargs):
+ """ 'forward' method, which canvas itself has inherited...
+ """
+ return self._canvas.cget(*args, **kwargs)
+
+ def config(self, *args, **kwargs):
+ """ 'forward' method, which canvas itself has inherited...
+ """
+ self._canvas.config(*args, **kwargs)
+
+ def bind(self, *args, **kwargs):
+ """ 'forward' method, which canvas itself has inherited...
+ """
+ self._canvas.bind(*args, **kwargs)
+
+ def unbind(self, *args, **kwargs):
+ """ 'forward' method, which canvas itself has inherited...
+ """
+ self._canvas.unbind(*args, **kwargs)
+
+ def focus_force(self):
+ """ 'forward' method, which canvas itself has inherited...
+ """
+ self._canvas.focus_force()
+
+__forwardmethods(ScrolledCanvas, TK.Canvas, '_canvas')
+
+
+class _Root(TK.Tk):
+ """Root class for Screen based on Tkinter."""
+ def __init__(self):
+ TK.Tk.__init__(self)
+
+ def setupcanvas(self, width, height, cwidth, cheight):
+ self._canvas = ScrolledCanvas(self, width, height, cwidth, cheight)
+ self._canvas.pack(expand=1, fill="both")
+
+ def _getcanvas(self):
+ return self._canvas
+
+ def set_geometry(self, width, height, startx, starty):
+ self.geometry("%dx%d%+d%+d"%(width, height, startx, starty))
+
+ def ondestroy(self, destroy):
+ self.wm_protocol("WM_DELETE_WINDOW", destroy)
+
+ def win_width(self):
+ return self.winfo_screenwidth()
+
+ def win_height(self):
+ return self.winfo_screenheight()
+
+Canvas = TK.Canvas
+
+
+class TurtleScreenBase(object):
+ """Provide the basic graphics functionality.
+ Interface between Tkinter and turtle.py.
+
+ To port turtle.py to some different graphics toolkit
+ a corresponding TurtleScreenBase class has to be implemented.
+ """
+
+ @staticmethod
+ def _blankimage():
+ """return a blank image object
+ """
+ img = TK.PhotoImage(width=1, height=1)
+ img.blank()
+ return img
+
+ @staticmethod
+ def _image(filename):
+ """return an image object containing the
+ imagedata from a gif-file named filename.
+ """
+ return TK.PhotoImage(file=filename)
+
+ def __init__(self, cv):
+ self.cv = cv
+ if isinstance(cv, ScrolledCanvas):
+ w = self.cv.canvwidth
+ h = self.cv.canvheight
+ else: # expected: ordinary TK.Canvas
+ w = int(self.cv.cget("width"))
+ h = int(self.cv.cget("height"))
+ self.cv.config(scrollregion = (-w//2, -h//2, w//2, h//2 ))
+ self.canvwidth = w
+ self.canvheight = h
+ self.xscale = self.yscale = 1.0
+
+ def _createpoly(self):
+ """Create an invisible polygon item on canvas self.cv)
+ """
+ return self.cv.create_polygon((0, 0, 0, 0, 0, 0), fill="", outline="")
+
+ def _drawpoly(self, polyitem, coordlist, fill=None,
+ outline=None, width=None, top=False):
+ """Configure polygonitem polyitem according to provided
+ arguments:
+ coordlist is sequence of coordinates
+ fill is filling color
+ outline is outline color
+ top is a boolean value, which specifies if polyitem
+ will be put on top of the canvas' displaylist so it
+ will not be covered by other items.
+ """
+ cl = []
+ for x, y in coordlist:
+ cl.append(x * self.xscale)
+ cl.append(-y * self.yscale)
+ self.cv.coords(polyitem, *cl)
+ if fill is not None:
+ self.cv.itemconfigure(polyitem, fill=fill)
+ if outline is not None:
+ self.cv.itemconfigure(polyitem, outline=outline)
+ if width is not None:
+ self.cv.itemconfigure(polyitem, width=width)
+ if top:
+ self.cv.tag_raise(polyitem)
+
+ def _createline(self):
+ """Create an invisible line item on canvas self.cv)
+ """
+ return self.cv.create_line(0, 0, 0, 0, fill="", width=2,
+ capstyle = TK.ROUND)
+
+ def _drawline(self, lineitem, coordlist=None,
+ fill=None, width=None, top=False):
+ """Configure lineitem according to provided arguments:
+ coordlist is sequence of coordinates
+ fill is drawing color
+ width is width of drawn line.
+ top is a boolean value, which specifies if polyitem
+ will be put on top of the canvas' displaylist so it
+ will not be covered by other items.
+ """
+ if coordlist is not None:
+ cl = []
+ for x, y in coordlist:
+ cl.append(x * self.xscale)
+ cl.append(-y * self.yscale)
+ self.cv.coords(lineitem, *cl)
+ if fill is not None:
+ self.cv.itemconfigure(lineitem, fill=fill)
+ if width is not None:
+ self.cv.itemconfigure(lineitem, width=width)
+ if top:
+ self.cv.tag_raise(lineitem)
+
+ def _delete(self, item):
+ """Delete graphics item from canvas.
+ If item is"all" delete all graphics items.
+ """
+ self.cv.delete(item)
+
+ def _update(self):
+ """Redraw graphics items on canvas
+ """
+ self.cv.update()
+
+ def _delay(self, delay):
+ """Delay subsequent canvas actions for delay ms."""
+ self.cv.after(delay)
+
+ def _iscolorstring(self, color):
+ """Check if the string color is a legal Tkinter color string.
+ """
+ try:
+ rgb = self.cv.winfo_rgb(color)
+ ok = True
+ except TK.TclError:
+ ok = False
+ return ok
+
+ def _bgcolor(self, color=None):
+ """Set canvas' backgroundcolor if color is not None,
+ else return backgroundcolor."""
+ if color is not None:
+ self.cv.config(bg = color)
+ self._update()
+ else:
+ return self.cv.cget("bg")
+
+ def _write(self, pos, txt, align, font, pencolor):
+ """Write txt at pos in canvas with specified font
+ and color.
+ Return text item and x-coord of right bottom corner
+ of text's bounding box."""
+ x, y = pos
+ x = x * self.xscale
+ y = y * self.yscale
+ anchor = {"left":"sw", "center":"s", "right":"se" }
+ item = self.cv.create_text(x-1, -y, text = txt, anchor = anchor[align],
+ fill = pencolor, font = font)
+ x0, y0, x1, y1 = self.cv.bbox(item)
+ self.cv.update()
+ return item, x1-1
+
+## def _dot(self, pos, size, color):
+## """may be implemented for some other graphics toolkit"""
+
+ def _onclick(self, item, fun, num=1, add=None):
+ """Bind fun to mouse-click event on turtle.
+ fun must be a function with two arguments, the coordinates
+ of the clicked point on the canvas.
+ num, the number of the mouse-button defaults to 1
+ """
+ if fun is None:
+ self.cv.tag_unbind(item, "<Button-%s>" % num)
+ else:
+ def eventfun(event):
+ x, y = (self.cv.canvasx(event.x)/self.xscale,
+ -self.cv.canvasy(event.y)/self.yscale)
+ fun(x, y)
+ self.cv.tag_bind(item, "<Button-%s>" % num, eventfun, add)
+
+ def _onrelease(self, item, fun, num=1, add=None):
+ """Bind fun to mouse-button-release event on turtle.
+ fun must be a function with two arguments, the coordinates
+ of the point on the canvas where mouse button is released.
+ num, the number of the mouse-button defaults to 1
+
+ If a turtle is clicked, first _onclick-event will be performed,
+ then _onscreensclick-event.
+ """
+ if fun is None:
+ self.cv.tag_unbind(item, "<Button%s-ButtonRelease>" % num)
+ else:
+ def eventfun(event):
+ x, y = (self.cv.canvasx(event.x)/self.xscale,
+ -self.cv.canvasy(event.y)/self.yscale)
+ fun(x, y)
+ self.cv.tag_bind(item, "<Button%s-ButtonRelease>" % num,
+ eventfun, add)
+
+ def _ondrag(self, item, fun, num=1, add=None):
+ """Bind fun to mouse-move-event (with pressed mouse button) on turtle.
+ fun must be a function with two arguments, the coordinates of the
+ actual mouse position on the canvas.
+ num, the number of the mouse-button defaults to 1
+
+ Every sequence of mouse-move-events on a turtle is preceded by a
+ mouse-click event on that turtle.
+ """
+ if fun is None:
+ self.cv.tag_unbind(item, "<Button%s-Motion>" % num)
+ else:
+ def eventfun(event):
+ try:
+ x, y = (self.cv.canvasx(event.x)/self.xscale,
+ -self.cv.canvasy(event.y)/self.yscale)
+ fun(x, y)
+ except BaseException:
+ pass
+ self.cv.tag_bind(item, "<Button%s-Motion>" % num, eventfun, add)
+
+ def _onscreenclick(self, fun, num=1, add=None):
+ """Bind fun to mouse-click event on canvas.
+ fun must be a function with two arguments, the coordinates
+ of the clicked point on the canvas.
+ num, the number of the mouse-button defaults to 1
+
+ If a turtle is clicked, first _onclick-event will be performed,
+ then _onscreensclick-event.
+ """
+ if fun is None:
+ self.cv.unbind("<Button-%s>" % num)
+ else:
+ def eventfun(event):
+ x, y = (self.cv.canvasx(event.x)/self.xscale,
+ -self.cv.canvasy(event.y)/self.yscale)
+ fun(x, y)
+ self.cv.bind("<Button-%s>" % num, eventfun, add)
+
+ def _onkey(self, fun, key):
+ """Bind fun to key-release event of key.
+ Canvas must have focus. See method listen
+ """
+ if fun is None:
+ self.cv.unbind("<KeyRelease-%s>" % key, None)
+ else:
+ def eventfun(event):
+ fun()
+ self.cv.bind("<KeyRelease-%s>" % key, eventfun)
+
+ def _listen(self):
+ """Set focus on canvas (in order to collect key-events)
+ """
+ self.cv.focus_force()
+
+ def _ontimer(self, fun, t):
+ """Install a timer, which calls fun after t milliseconds.
+ """
+ if t == 0:
+ self.cv.after_idle(fun)
+ else:
+ self.cv.after(t, fun)
+
+ def _createimage(self, image):
+ """Create and return image item on canvas.
+ """
+ return self.cv.create_image(0, 0, image=image)
+
+ def _drawimage(self, item, pos, image):
+ """Configure image item as to draw image object
+ at position (x,y) on canvas)
+ """
+ x, y = pos
+ self.cv.coords(item, (x * self.xscale, -y * self.yscale))
+ self.cv.itemconfig(item, image=image)
+
+ def _setbgpic(self, item, image):
+ """Configure image item as to draw image object
+ at center of canvas. Set item to the first item
+ in the displaylist, so it will be drawn below
+ any other item ."""
+ self.cv.itemconfig(item, image=image)
+ self.cv.tag_lower(item)
+
+ def _type(self, item):
+ """Return 'line' or 'polygon' or 'image' depending on
+ type of item.
+ """
+ return self.cv.type(item)
+
+ def _pointlist(self, item):
+ """returns list of coordinate-pairs of points of item
+ Example (for insiders):
+ >>> from turtle import *
+ >>> getscreen()._pointlist(getturtle().turtle._item)
+ [(0.0, 9.9999999999999982), (0.0, -9.9999999999999982),
+ (9.9999999999999982, 0.0)]
+ >>> """
+ cl = self.cv.coords(item)
+ pl = [(cl[i], -cl[i+1]) for i in range(0, len(cl), 2)]
+ return pl
+
+ def _setscrollregion(self, srx1, sry1, srx2, sry2):
+ self.cv.config(scrollregion=(srx1, sry1, srx2, sry2))
+
+ def _rescale(self, xscalefactor, yscalefactor):
+ items = self.cv.find_all()
+ for item in items:
+ coordinates = self.cv.coords(item)
+ newcoordlist = []
+ while coordinates:
+ x, y = coordinates[:2]
+ newcoordlist.append(x * xscalefactor)
+ newcoordlist.append(y * yscalefactor)
+ coordinates = coordinates[2:]
+ self.cv.coords(item, *newcoordlist)
+
+ def _resize(self, canvwidth=None, canvheight=None, bg=None):
+ """Resize the canvas the turtles are drawing on. Does
+ not alter the drawing window.
+ """
+ # needs amendment
+ if not isinstance(self.cv, ScrolledCanvas):
+ return self.canvwidth, self.canvheight
+ if canvwidth is canvheight is bg is None:
+ return self.cv.canvwidth, self.cv.canvheight
+ if canvwidth is not None:
+ self.canvwidth = canvwidth
+ if canvheight is not None:
+ self.canvheight = canvheight
+ self.cv.reset(canvwidth, canvheight, bg)
+
+ def _window_size(self):
+ """ Return the width and height of the turtle window.
+ """
+ width = self.cv.winfo_width()
+ if width <= 1: # the window isn't managed by a geometry manager
+ width = self.cv['width']
+ height = self.cv.winfo_height()
+ if height <= 1: # the window isn't managed by a geometry manager
+ height = self.cv['height']
+ return width, height
+
+
+##############################################################################
+### End of Tkinter - interface ###
+##############################################################################
+
+
+class Terminator (Exception):
+ """Will be raised in TurtleScreen.update, if _RUNNING becomes False.
+
+ This stops execution of a turtle graphics script.
+ Main purpose: use in the Demo-Viewer turtle.Demo.py.
+ """
+ pass
+
+
+class TurtleGraphicsError(Exception):
+ """Some TurtleGraphics Error
+ """
+
+
+class Shape(object):
+ """Data structure modeling shapes.
+
+ attribute _type is one of "polygon", "image", "compound"
+ attribute _data is - depending on _type a poygon-tuple,
+ an image or a list constructed using the addcomponent method.
+ """
+ def __init__(self, type_, data=None):
+ self._type = type_
+ if type_ == "polygon":
+ if isinstance(data, list):
+ data = tuple(data)
+ elif type_ == "image":
+ if isinstance(data, basestring):
+ if data.lower().endswith(".gif") and isfile(data):
+ data = TurtleScreen._image(data)
+ # else data assumed to be Photoimage
+ elif type_ == "compound":
+ data = []
+ else:
+ raise TurtleGraphicsError("There is no shape type %s" % type_)
+ self._data = data
+
+ def addcomponent(self, poly, fill, outline=None):
+ """Add component to a shape of type compound.
+
+ Arguments: poly is a polygon, i. e. a tuple of number pairs.
+ fill is the fillcolor of the component,
+ outline is the outline color of the component.
+
+ call (for a Shapeobject namend s):
+ -- s.addcomponent(((0,0), (10,10), (-10,10)), "red", "blue")
+
+ Example:
+ >>> poly = ((0,0),(10,-5),(0,10),(-10,-5))
+ >>> s = Shape("compound")
+ >>> s.addcomponent(poly, "red", "blue")
+ >>> # .. add more components and then use register_shape()
+ """
+ if self._type != "compound":
+ raise TurtleGraphicsError("Cannot add component to %s Shape"
+ % self._type)
+ if outline is None:
+ outline = fill
+ self._data.append([poly, fill, outline])
+
+
+class Tbuffer(object):
+ """Ring buffer used as undobuffer for RawTurtle objects."""
+ def __init__(self, bufsize=10):
+ self.bufsize = bufsize
+ self.buffer = [[None]] * bufsize
+ self.ptr = -1
+ self.cumulate = False
+ def reset(self, bufsize=None):
+ if bufsize is None:
+ for i in range(self.bufsize):
+ self.buffer[i] = [None]
+ else:
+ self.bufsize = bufsize
+ self.buffer = [[None]] * bufsize
+ self.ptr = -1
+ def push(self, item):
+ if self.bufsize > 0:
+ if not self.cumulate:
+ self.ptr = (self.ptr + 1) % self.bufsize
+ self.buffer[self.ptr] = item
+ else:
+ self.buffer[self.ptr].append(item)
+ def pop(self):
+ if self.bufsize > 0:
+ item = self.buffer[self.ptr]
+ if item is None:
+ return None
+ else:
+ self.buffer[self.ptr] = [None]
+ self.ptr = (self.ptr - 1) % self.bufsize
+ return (item)
+ def nr_of_items(self):
+ return self.bufsize - self.buffer.count([None])
+ def __repr__(self):
+ return str(self.buffer) + " " + str(self.ptr)
+
+
+
+class TurtleScreen(TurtleScreenBase):
+ """Provides screen oriented methods like setbg etc.
+
+ Only relies upon the methods of TurtleScreenBase and NOT
+ upon components of the underlying graphics toolkit -
+ which is Tkinter in this case.
+ """
+# _STANDARD_DELAY = 5
+ _RUNNING = True
+
+ def __init__(self, cv, mode=_CFG["mode"],
+ colormode=_CFG["colormode"], delay=_CFG["delay"]):
+ self._shapes = {
+ "arrow" : Shape("polygon", ((-10,0), (10,0), (0,10))),
+ "turtle" : Shape("polygon", ((0,16), (-2,14), (-1,10), (-4,7),
+ (-7,9), (-9,8), (-6,5), (-7,1), (-5,-3), (-8,-6),
+ (-6,-8), (-4,-5), (0,-7), (4,-5), (6,-8), (8,-6),
+ (5,-3), (7,1), (6,5), (9,8), (7,9), (4,7), (1,10),
+ (2,14))),
+ "circle" : Shape("polygon", ((10,0), (9.51,3.09), (8.09,5.88),
+ (5.88,8.09), (3.09,9.51), (0,10), (-3.09,9.51),
+ (-5.88,8.09), (-8.09,5.88), (-9.51,3.09), (-10,0),
+ (-9.51,-3.09), (-8.09,-5.88), (-5.88,-8.09),
+ (-3.09,-9.51), (-0.00,-10.00), (3.09,-9.51),
+ (5.88,-8.09), (8.09,-5.88), (9.51,-3.09))),
+ "square" : Shape("polygon", ((10,-10), (10,10), (-10,10),
+ (-10,-10))),
+ "triangle" : Shape("polygon", ((10,-5.77), (0,11.55),
+ (-10,-5.77))),
+ "classic": Shape("polygon", ((0,0),(-5,-9),(0,-7),(5,-9))),
+ "blank" : Shape("image", self._blankimage())
+ }
+
+ self._bgpics = {"nopic" : ""}
+
+ TurtleScreenBase.__init__(self, cv)
+ self._mode = mode
+ self._delayvalue = delay
+ self._colormode = _CFG["colormode"]
+ self._keys = []
+ self.clear()
+
+ def clear(self):
+ """Delete all drawings and all turtles from the TurtleScreen.
+
+ Reset empty TurtleScreen to its initial state: white background,
+ no backgroundimage, no eventbindings and tracing on.
+
+ No argument.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.clear()
+
+ Note: this method is not available as function.
+ """
+ self._delayvalue = _CFG["delay"]
+ self._colormode = _CFG["colormode"]
+ self._delete("all")
+ self._bgpic = self._createimage("")
+ self._bgpicname = "nopic"
+ self._tracing = 1
+ self._updatecounter = 0
+ self._turtles = []
+ self.bgcolor("white")
+ for btn in 1, 2, 3:
+ self.onclick(None, btn)
+ for key in self._keys[:]:
+ self.onkey(None, key)
+ Turtle._pen = None
+
+ def mode(self, mode=None):
+ """Set turtle-mode ('standard', 'logo' or 'world') and perform reset.
+
+ Optional argument:
+ mode -- one of the strings 'standard', 'logo' or 'world'
+
+ Mode 'standard' is compatible with turtle.py.
+ Mode 'logo' is compatible with most Logo-Turtle-Graphics.
+ Mode 'world' uses userdefined 'worldcoordinates'. *Attention*: in
+ this mode angles appear distorted if x/y unit-ratio doesn't equal 1.
+ If mode is not given, return the current mode.
+
+ Mode Initial turtle heading positive angles
+ ------------|-------------------------|-------------------
+ 'standard' to the right (east) counterclockwise
+ 'logo' upward (north) clockwise
+
+ Examples:
+ >>> mode('logo') # resets turtle heading to north
+ >>> mode()
+ 'logo'
+ """
+ if mode is None:
+ return self._mode
+ mode = mode.lower()
+ if mode not in ["standard", "logo", "world"]:
+ raise TurtleGraphicsError("No turtle-graphics-mode %s" % mode)
+ self._mode = mode
+ if mode in ["standard", "logo"]:
+ self._setscrollregion(-self.canvwidth//2, -self.canvheight//2,
+ self.canvwidth//2, self.canvheight//2)
+ self.xscale = self.yscale = 1.0
+ self.reset()
+
+ def setworldcoordinates(self, llx, lly, urx, ury):
+ """Set up a user defined coordinate-system.
+
+ Arguments:
+ llx -- a number, x-coordinate of lower left corner of canvas
+ lly -- a number, y-coordinate of lower left corner of canvas
+ urx -- a number, x-coordinate of upper right corner of canvas
+ ury -- a number, y-coordinate of upper right corner of canvas
+
+ Set up user coodinat-system and switch to mode 'world' if necessary.
+ This performs a screen.reset. If mode 'world' is already active,
+ all drawings are redrawn according to the new coordinates.
+
+ But ATTENTION: in user-defined coordinatesystems angles may appear
+ distorted. (see Screen.mode())
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.setworldcoordinates(-10,-0.5,50,1.5)
+ >>> for _ in range(36):
+ ... left(10)
+ ... forward(0.5)
+ """
+ if self.mode() != "world":
+ self.mode("world")
+ xspan = float(urx - llx)
+ yspan = float(ury - lly)
+ wx, wy = self._window_size()
+ self.screensize(wx-20, wy-20)
+ oldxscale, oldyscale = self.xscale, self.yscale
+ self.xscale = self.canvwidth / xspan
+ self.yscale = self.canvheight / yspan
+ srx1 = llx * self.xscale
+ sry1 = -ury * self.yscale
+ srx2 = self.canvwidth + srx1
+ sry2 = self.canvheight + sry1
+ self._setscrollregion(srx1, sry1, srx2, sry2)
+ self._rescale(self.xscale/oldxscale, self.yscale/oldyscale)
+ self.update()
+
+ def register_shape(self, name, shape=None):
+ """Adds a turtle shape to TurtleScreen's shapelist.
+
+ Arguments:
+ (1) name is the name of a gif-file and shape is None.
+ Installs the corresponding image shape.
+ !! Image-shapes DO NOT rotate when turning the turtle,
+ !! so they do not display the heading of the turtle!
+ (2) name is an arbitrary string and shape is a tuple
+ of pairs of coordinates. Installs the corresponding
+ polygon shape
+ (3) name is an arbitrary string and shape is a
+ (compound) Shape object. Installs the corresponding
+ compound shape.
+ To use a shape, you have to issue the command shape(shapename).
+
+ call: register_shape("turtle.gif")
+ --or: register_shape("tri", ((0,0), (10,10), (-10,10)))
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.register_shape("triangle", ((5,-3),(0,5),(-5,-3)))
+
+ """
+ if shape is None:
+ # image
+ if name.lower().endswith(".gif"):
+ shape = Shape("image", self._image(name))
+ else:
+ raise TurtleGraphicsError("Bad arguments for register_shape.\n"
+ + "Use help(register_shape)" )
+ elif isinstance(shape, tuple):
+ shape = Shape("polygon", shape)
+ ## else shape assumed to be Shape-instance
+ self._shapes[name] = shape
+ # print "shape added:" , self._shapes
+
+ def _colorstr(self, color):
+ """Return color string corresponding to args.
+
+ Argument may be a string or a tuple of three
+ numbers corresponding to actual colormode,
+ i.e. in the range 0<=n<=colormode.
+
+ If the argument doesn't represent a color,
+ an error is raised.
+ """
+ if len(color) == 1:
+ color = color[0]
+ if isinstance(color, basestring):
+ if self._iscolorstring(color) or color == "":
+ return color
+ else:
+ raise TurtleGraphicsError("bad color string: %s" % str(color))
+ try:
+ r, g, b = color
+ except (TypeError, ValueError):
+ raise TurtleGraphicsError("bad color arguments: %s" % str(color))
+ if self._colormode == 1.0:
+ r, g, b = [round(255.0*x) for x in (r, g, b)]
+ if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)):
+ raise TurtleGraphicsError("bad color sequence: %s" % str(color))
+ return "#%02x%02x%02x" % (r, g, b)
+
+ def _color(self, cstr):
+ if not cstr.startswith("#"):
+ return cstr
+ if len(cstr) == 7:
+ cl = [int(cstr[i:i+2], 16) for i in (1, 3, 5)]
+ elif len(cstr) == 4:
+ cl = [16*int(cstr[h], 16) for h in cstr[1:]]
+ else:
+ raise TurtleGraphicsError("bad colorstring: %s" % cstr)
+ return tuple([c * self._colormode/255 for c in cl])
+
+ def colormode(self, cmode=None):
+ """Return the colormode or set it to 1.0 or 255.
+
+ Optional argument:
+ cmode -- one of the values 1.0 or 255
+
+ r, g, b values of colortriples have to be in range 0..cmode.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.colormode()
+ 1.0
+ >>> screen.colormode(255)
+ >>> pencolor(240,160,80)
+ """
+ if cmode is None:
+ return self._colormode
+ if cmode == 1.0:
+ self._colormode = float(cmode)
+ elif cmode == 255:
+ self._colormode = int(cmode)
+
+ def reset(self):
+ """Reset all Turtles on the Screen to their initial state.
+
+ No argument.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.reset()
+ """
+ for turtle in self._turtles:
+ turtle._setmode(self._mode)
+ turtle.reset()
+
+ def turtles(self):
+ """Return the list of turtles on the screen.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.turtles()
+ [<turtle.Turtle object at 0x00E11FB0>]
+ """
+ return self._turtles
+
+ def bgcolor(self, *args):
+ """Set or return backgroundcolor of the TurtleScreen.
+
+ Arguments (if given): a color string or three numbers
+ in the range 0..colormode or a 3-tuple of such numbers.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.bgcolor("orange")
+ >>> screen.bgcolor()
+ 'orange'
+ >>> screen.bgcolor(0.5,0,0.5)
+ >>> screen.bgcolor()
+ '#800080'
+ """
+ if args:
+ color = self._colorstr(args)
+ else:
+ color = None
+ color = self._bgcolor(color)
+ if color is not None:
+ color = self._color(color)
+ return color
+
+ def tracer(self, n=None, delay=None):
+ """Turns turtle animation on/off and set delay for update drawings.
+
+ Optional arguments:
+ n -- nonnegative integer
+ delay -- nonnegative integer
+
+ If n is given, only each n-th regular screen update is really performed.
+ (Can be used to accelerate the drawing of complex graphics.)
+ Second arguments sets delay value (see RawTurtle.delay())
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.tracer(8, 25)
+ >>> dist = 2
+ >>> for i in range(200):
+ ... fd(dist)
+ ... rt(90)
+ ... dist += 2
+ """
+ if n is None:
+ return self._tracing
+ self._tracing = int(n)
+ self._updatecounter = 0
+ if delay is not None:
+ self._delayvalue = int(delay)
+ if self._tracing:
+ self.update()
+
+ def delay(self, delay=None):
+ """ Return or set the drawing delay in milliseconds.
+
+ Optional argument:
+ delay -- positive integer
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.delay(15)
+ >>> screen.delay()
+ 15
+ """
+ if delay is None:
+ return self._delayvalue
+ self._delayvalue = int(delay)
+
+ def _incrementudc(self):
+ """Increment update counter."""
+ if not TurtleScreen._RUNNING:
+ TurtleScreen._RUNNING = True
+ raise Terminator
+ if self._tracing > 0:
+ self._updatecounter += 1
+ self._updatecounter %= self._tracing
+
+ def update(self):
+ """Perform a TurtleScreen update.
+ """
+ tracing = self._tracing
+ self._tracing = True
+ for t in self.turtles():
+ t._update_data()
+ t._drawturtle()
+ self._tracing = tracing
+ self._update()
+
+ def window_width(self):
+ """ Return the width of the turtle window.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.window_width()
+ 640
+ """
+ return self._window_size()[0]
+
+ def window_height(self):
+ """ Return the height of the turtle window.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.window_height()
+ 480
+ """
+ return self._window_size()[1]
+
+ def getcanvas(self):
+ """Return the Canvas of this TurtleScreen.
+
+ No argument.
+
+ Example (for a Screen instance named screen):
+ >>> cv = screen.getcanvas()
+ >>> cv
+ <turtle.ScrolledCanvas instance at 0x010742D8>
+ """
+ return self.cv
+
+ def getshapes(self):
+ """Return a list of names of all currently available turtle shapes.
+
+ No argument.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.getshapes()
+ ['arrow', 'blank', 'circle', ... , 'turtle']
+ """
+ return sorted(self._shapes.keys())
+
+ def onclick(self, fun, btn=1, add=None):
+ """Bind fun to mouse-click event on canvas.
+
+ Arguments:
+ fun -- a function with two arguments, the coordinates of the
+ clicked point on the canvas.
+ num -- the number of the mouse-button, defaults to 1
+
+ Example (for a TurtleScreen instance named screen
+ and a Turtle instance named turtle):
+
+ >>> screen.onclick(goto)
+ >>> # Subsequently clicking into the TurtleScreen will
+ >>> # make the turtle move to the clicked point.
+ >>> screen.onclick(None)
+ """
+ self._onscreenclick(fun, btn, add)
+
+ def onkey(self, fun, key):
+ """Bind fun to key-release event of key.
+
+ Arguments:
+ fun -- a function with no arguments
+ key -- a string: key (e.g. "a") or key-symbol (e.g. "space")
+
+ In order to be able to register key-events, TurtleScreen
+ must have focus. (See method listen.)
+
+ Example (for a TurtleScreen instance named screen):
+
+ >>> def f():
+ ... fd(50)
+ ... lt(60)
+ ...
+ >>> screen.onkey(f, "Up")
+ >>> screen.listen()
+
+ Subsequently the turtle can be moved by repeatedly pressing
+ the up-arrow key, consequently drawing a hexagon
+
+ """
+ if fun is None:
+ if key in self._keys:
+ self._keys.remove(key)
+ elif key not in self._keys:
+ self._keys.append(key)
+ self._onkey(fun, key)
+
+ def listen(self, xdummy=None, ydummy=None):
+ """Set focus on TurtleScreen (in order to collect key-events)
+
+ No arguments.
+ Dummy arguments are provided in order
+ to be able to pass listen to the onclick method.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.listen()
+ """
+ self._listen()
+
+ def ontimer(self, fun, t=0):
+ """Install a timer, which calls fun after t milliseconds.
+
+ Arguments:
+ fun -- a function with no arguments.
+ t -- a number >= 0
+
+ Example (for a TurtleScreen instance named screen):
+
+ >>> running = True
+ >>> def f():
+ ... if running:
+ ... fd(50)
+ ... lt(60)
+ ... screen.ontimer(f, 250)
+ ...
+ >>> f() # makes the turtle marching around
+ >>> running = False
+ """
+ self._ontimer(fun, t)
+
+ def bgpic(self, picname=None):
+ """Set background image or return name of current backgroundimage.
+
+ Optional argument:
+ picname -- a string, name of a gif-file or "nopic".
+
+ If picname is a filename, set the corresponding image as background.
+ If picname is "nopic", delete backgroundimage, if present.
+ If picname is None, return the filename of the current backgroundimage.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.bgpic()
+ 'nopic'
+ >>> screen.bgpic("landscape.gif")
+ >>> screen.bgpic()
+ 'landscape.gif'
+ """
+ if picname is None:
+ return self._bgpicname
+ if picname not in self._bgpics:
+ self._bgpics[picname] = self._image(picname)
+ self._setbgpic(self._bgpic, self._bgpics[picname])
+ self._bgpicname = picname
+
+ def screensize(self, canvwidth=None, canvheight=None, bg=None):
+ """Resize the canvas the turtles are drawing on.
+
+ Optional arguments:
+ canvwidth -- positive integer, new width of canvas in pixels
+ canvheight -- positive integer, new height of canvas in pixels
+ bg -- colorstring or color-tuple, new backgroundcolor
+ If no arguments are given, return current (canvaswidth, canvasheight)
+
+ Do not alter the drawing window. To observe hidden parts of
+ the canvas use the scrollbars. (Can make visible those parts
+ of a drawing, which were outside the canvas before!)
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.screensize(2000,1500)
+ >>> # e. g. to search for an erroneously escaped turtle ;-)
+ """
+ return self._resize(canvwidth, canvheight, bg)
+
+ onscreenclick = onclick
+ resetscreen = reset
+ clearscreen = clear
+ addshape = register_shape
+
+class TNavigator(object):
+ """Navigation part of the RawTurtle.
+ Implements methods for turtle movement.
+ """
+ START_ORIENTATION = {
+ "standard": Vec2D(1.0, 0.0),
+ "world" : Vec2D(1.0, 0.0),
+ "logo" : Vec2D(0.0, 1.0) }
+ DEFAULT_MODE = "standard"
+ DEFAULT_ANGLEOFFSET = 0
+ DEFAULT_ANGLEORIENT = 1
+
+ def __init__(self, mode=DEFAULT_MODE):
+ self._angleOffset = self.DEFAULT_ANGLEOFFSET
+ self._angleOrient = self.DEFAULT_ANGLEORIENT
+ self._mode = mode
+ self.undobuffer = None
+ self.degrees()
+ self._mode = None
+ self._setmode(mode)
+ TNavigator.reset(self)
+
+ def reset(self):
+ """reset turtle to its initial values
+
+ Will be overwritten by parent class
+ """
+ self._position = Vec2D(0.0, 0.0)
+ self._orient = TNavigator.START_ORIENTATION[self._mode]
+
+ def _setmode(self, mode=None):
+ """Set turtle-mode to 'standard', 'world' or 'logo'.
+ """
+ if mode is None:
+ return self._mode
+ if mode not in ["standard", "logo", "world"]:
+ return
+ self._mode = mode
+ if mode in ["standard", "world"]:
+ self._angleOffset = 0
+ self._angleOrient = 1
+ else: # mode == "logo":
+ self._angleOffset = self._fullcircle/4.
+ self._angleOrient = -1
+
+ def _setDegreesPerAU(self, fullcircle):
+ """Helper function for degrees() and radians()"""
+ self._fullcircle = fullcircle
+ self._degreesPerAU = 360/fullcircle
+ if self._mode == "standard":
+ self._angleOffset = 0
+ else:
+ self._angleOffset = fullcircle/4.
+
+ def degrees(self, fullcircle=360.0):
+ """ Set angle measurement units to degrees.
+
+ Optional argument:
+ fullcircle - a number
+
+ Set angle measurement units, i. e. set number
+ of 'degrees' for a full circle. Dafault value is
+ 360 degrees.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.left(90)
+ >>> turtle.heading()
+ 90
+
+ Change angle measurement unit to grad (also known as gon,
+ grade, or gradian and equals 1/100-th of the right angle.)
+ >>> turtle.degrees(400.0)
+ >>> turtle.heading()
+ 100
+
+ """
+ self._setDegreesPerAU(fullcircle)
+
+ def radians(self):
+ """ Set the angle measurement units to radians.
+
+ No arguments.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.heading()
+ 90
+ >>> turtle.radians()
+ >>> turtle.heading()
+ 1.5707963267948966
+ """
+ self._setDegreesPerAU(2*math.pi)
+
+ def _go(self, distance):
+ """move turtle forward by specified distance"""
+ ende = self._position + self._orient * distance
+ self._goto(ende)
+
+ def _rotate(self, angle):
+ """Turn turtle counterclockwise by specified angle if angle > 0."""
+ angle *= self._degreesPerAU
+ self._orient = self._orient.rotate(angle)
+
+ def _goto(self, end):
+ """move turtle to position end."""
+ self._position = end
+
+ def forward(self, distance):
+ """Move the turtle forward by the specified distance.
+
+ Aliases: forward | fd
+
+ Argument:
+ distance -- a number (integer or float)
+
+ Move the turtle forward by the specified distance, in the direction
+ the turtle is headed.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.position()
+ (0.00, 0.00)
+ >>> turtle.forward(25)
+ >>> turtle.position()
+ (25.00,0.00)
+ >>> turtle.forward(-75)
+ >>> turtle.position()
+ (-50.00,0.00)
+ """
+ self._go(distance)
+
+ def back(self, distance):
+ """Move the turtle backward by distance.
+
+ Aliases: back | backward | bk
+
+ Argument:
+ distance -- a number
+
+ Move the turtle backward by distance ,opposite to the direction the
+ turtle is headed. Do not change the turtle's heading.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.position()
+ (0.00, 0.00)
+ >>> turtle.backward(30)
+ >>> turtle.position()
+ (-30.00, 0.00)
+ """
+ self._go(-distance)
+
+ def right(self, angle):
+ """Turn turtle right by angle units.
+
+ Aliases: right | rt
+
+ Argument:
+ angle -- a number (integer or float)
+
+ Turn turtle right by angle units. (Units are by default degrees,
+ but can be set via the degrees() and radians() functions.)
+ Angle orientation depends on mode. (See this.)
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.heading()
+ 22.0
+ >>> turtle.right(45)
+ >>> turtle.heading()
+ 337.0
+ """
+ self._rotate(-angle)
+
+ def left(self, angle):
+ """Turn turtle left by angle units.
+
+ Aliases: left | lt
+
+ Argument:
+ angle -- a number (integer or float)
+
+ Turn turtle left by angle units. (Units are by default degrees,
+ but can be set via the degrees() and radians() functions.)
+ Angle orientation depends on mode. (See this.)
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.heading()
+ 22.0
+ >>> turtle.left(45)
+ >>> turtle.heading()
+ 67.0
+ """
+ self._rotate(angle)
+
+ def pos(self):
+ """Return the turtle's current location (x,y), as a Vec2D-vector.
+
+ Aliases: pos | position
+
+ No arguments.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.pos()
+ (0.00, 240.00)
+ """
+ return self._position
+
+ def xcor(self):
+ """ Return the turtle's x coordinate.
+
+ No arguments.
+
+ Example (for a Turtle instance named turtle):
+ >>> reset()
+ >>> turtle.left(60)
+ >>> turtle.forward(100)
+ >>> print turtle.xcor()
+ 50.0
+ """
+ return self._position[0]
+
+ def ycor(self):
+ """ Return the turtle's y coordinate
+ ---
+ No arguments.
+
+ Example (for a Turtle instance named turtle):
+ >>> reset()
+ >>> turtle.left(60)
+ >>> turtle.forward(100)
+ >>> print turtle.ycor()
+ 86.6025403784
+ """
+ return self._position[1]
+
+
+ def goto(self, x, y=None):
+ """Move turtle to an absolute position.
+
+ Aliases: setpos | setposition | goto:
+
+ Arguments:
+ x -- a number or a pair/vector of numbers
+ y -- a number None
+
+ call: goto(x, y) # two coordinates
+ --or: goto((x, y)) # a pair (tuple) of coordinates
+ --or: goto(vec) # e.g. as returned by pos()
+
+ Move turtle to an absolute position. If the pen is down,
+ a line will be drawn. The turtle's orientation does not change.
+
+ Example (for a Turtle instance named turtle):
+ >>> tp = turtle.pos()
+ >>> tp
+ (0.00, 0.00)
+ >>> turtle.setpos(60,30)
+ >>> turtle.pos()
+ (60.00,30.00)
+ >>> turtle.setpos((20,80))
+ >>> turtle.pos()
+ (20.00,80.00)
+ >>> turtle.setpos(tp)
+ >>> turtle.pos()
+ (0.00,0.00)
+ """
+ if y is None:
+ self._goto(Vec2D(*x))
+ else:
+ self._goto(Vec2D(x, y))
+
+ def home(self):
+ """Move turtle to the origin - coordinates (0,0).
+
+ No arguments.
+
+ Move turtle to the origin - coordinates (0,0) and set its
+ heading to its start-orientation (which depends on mode).
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.home()
+ """
+ self.goto(0, 0)
+ self.setheading(0)
+
+ def setx(self, x):
+ """Set the turtle's first coordinate to x
+
+ Argument:
+ x -- a number (integer or float)
+
+ Set the turtle's first coordinate to x, leave second coordinate
+ unchanged.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.position()
+ (0.00, 240.00)
+ >>> turtle.setx(10)
+ >>> turtle.position()
+ (10.00, 240.00)
+ """
+ self._goto(Vec2D(x, self._position[1]))
+
+ def sety(self, y):
+ """Set the turtle's second coordinate to y
+
+ Argument:
+ y -- a number (integer or float)
+
+ Set the turtle's first coordinate to x, second coordinate remains
+ unchanged.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.position()
+ (0.00, 40.00)
+ >>> turtle.sety(-10)
+ >>> turtle.position()
+ (0.00, -10.00)
+ """
+ self._goto(Vec2D(self._position[0], y))
+
+ def distance(self, x, y=None):
+ """Return the distance from the turtle to (x,y) in turtle step units.
+
+ Arguments:
+ x -- a number or a pair/vector of numbers or a turtle instance
+ y -- a number None None
+
+ call: distance(x, y) # two coordinates
+ --or: distance((x, y)) # a pair (tuple) of coordinates
+ --or: distance(vec) # e.g. as returned by pos()
+ --or: distance(mypen) # where mypen is another turtle
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.pos()
+ (0.00, 0.00)
+ >>> turtle.distance(30,40)
+ 50.0
+ >>> pen = Turtle()
+ >>> pen.forward(77)
+ >>> turtle.distance(pen)
+ 77.0
+ """
+ if y is not None:
+ pos = Vec2D(x, y)
+ if isinstance(x, Vec2D):
+ pos = x
+ elif isinstance(x, tuple):
+ pos = Vec2D(*x)
+ elif isinstance(x, TNavigator):
+ pos = x._position
+ return abs(pos - self._position)
+
+ def towards(self, x, y=None):
+ """Return the angle of the line from the turtle's position to (x, y).
+
+ Arguments:
+ x -- a number or a pair/vector of numbers or a turtle instance
+ y -- a number None None
+
+ call: distance(x, y) # two coordinates
+ --or: distance((x, y)) # a pair (tuple) of coordinates
+ --or: distance(vec) # e.g. as returned by pos()
+ --or: distance(mypen) # where mypen is another turtle
+
+ Return the angle, between the line from turtle-position to position
+ specified by x, y and the turtle's start orientation. (Depends on
+ modes - "standard" or "logo")
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.pos()
+ (10.00, 10.00)
+ >>> turtle.towards(0,0)
+ 225.0
+ """
+ if y is not None:
+ pos = Vec2D(x, y)
+ if isinstance(x, Vec2D):
+ pos = x
+ elif isinstance(x, tuple):
+ pos = Vec2D(*x)
+ elif isinstance(x, TNavigator):
+ pos = x._position
+ x, y = pos - self._position
+ result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0
+ result /= self._degreesPerAU
+ return (self._angleOffset + self._angleOrient*result) % self._fullcircle
+
+ def heading(self):
+ """ Return the turtle's current heading.
+
+ No arguments.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.left(67)
+ >>> turtle.heading()
+ 67.0
+ """
+ x, y = self._orient
+ result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0
+ result /= self._degreesPerAU
+ return (self._angleOffset + self._angleOrient*result) % self._fullcircle
+
+ def setheading(self, to_angle):
+ """Set the orientation of the turtle to to_angle.
+
+ Aliases: setheading | seth
+
+ Argument:
+ to_angle -- a number (integer or float)
+
+ Set the orientation of the turtle to to_angle.
+ Here are some common directions in degrees:
+
+ standard - mode: logo-mode:
+ -------------------|--------------------
+ 0 - east 0 - north
+ 90 - north 90 - east
+ 180 - west 180 - south
+ 270 - south 270 - west
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.setheading(90)
+ >>> turtle.heading()
+ 90
+ """
+ angle = (to_angle - self.heading())*self._angleOrient
+ full = self._fullcircle
+ angle = (angle+full/2.)%full - full/2.
+ self._rotate(angle)
+
+ def circle(self, radius, extent = None, steps = None):
+ """ Draw a circle with given radius.
+
+ Arguments:
+ radius -- a number
+ extent (optional) -- a number
+ steps (optional) -- an integer
+
+ Draw a circle with given radius. The center is radius units left
+ of the turtle; extent - an angle - determines which part of the
+ circle is drawn. If extent is not given, draw the entire circle.
+ If extent is not a full circle, one endpoint of the arc is the
+ current pen position. Draw the arc in counterclockwise direction
+ if radius is positive, otherwise in clockwise direction. Finally
+ the direction of the turtle is changed by the amount of extent.
+
+ As the circle is approximated by an inscribed regular polygon,
+ steps determines the number of steps to use. If not given,
+ it will be calculated automatically. Maybe used to draw regular
+ polygons.
+
+ call: circle(radius) # full circle
+ --or: circle(radius, extent) # arc
+ --or: circle(radius, extent, steps)
+ --or: circle(radius, steps=6) # 6-sided polygon
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.circle(50)
+ >>> turtle.circle(120, 180) # semicircle
+ """
+ if self.undobuffer:
+ self.undobuffer.push(["seq"])
+ self.undobuffer.cumulate = True
+ speed = self.speed()
+ if extent is None:
+ extent = self._fullcircle
+ if steps is None:
+ frac = abs(extent)/self._fullcircle
+ steps = 1+int(min(11+abs(radius)/6.0, 59.0)*frac)
+ w = 1.0 * extent / steps
+ w2 = 0.5 * w
+ l = 2.0 * radius * math.sin(w2*math.pi/180.0*self._degreesPerAU)
+ if radius < 0:
+ l, w, w2 = -l, -w, -w2
+ tr = self.tracer()
+ dl = self._delay()
+ if speed == 0:
+ self.tracer(0, 0)
+ else:
+ self.speed(0)
+ self._rotate(w2)
+ for i in range(steps):
+ self.speed(speed)
+ self._go(l)
+ self.speed(0)
+ self._rotate(w)
+ self._rotate(-w2)
+ if speed == 0:
+ self.tracer(tr, dl)
+ self.speed(speed)
+ if self.undobuffer:
+ self.undobuffer.cumulate = False
+
+## three dummy methods to be implemented by child class:
+
+ def speed(self, s=0):
+ """dummy method - to be overwritten by child class"""
+ def tracer(self, a=None, b=None):
+ """dummy method - to be overwritten by child class"""
+ def _delay(self, n=None):
+ """dummy method - to be overwritten by child class"""
+
+ fd = forward
+ bk = back
+ backward = back
+ rt = right
+ lt = left
+ position = pos
+ setpos = goto
+ setposition = goto
+ seth = setheading
+
+
+class TPen(object):
+ """Drawing part of the RawTurtle.
+ Implements drawing properties.
+ """
+ def __init__(self, resizemode=_CFG["resizemode"]):
+ self._resizemode = resizemode # or "user" or "noresize"
+ self.undobuffer = None
+ TPen._reset(self)
+
+ def _reset(self, pencolor=_CFG["pencolor"],
+ fillcolor=_CFG["fillcolor"]):
+ self._pensize = 1
+ self._shown = True
+ self._pencolor = pencolor
+ self._fillcolor = fillcolor
+ self._drawing = True
+ self._speed = 3
+ self._stretchfactor = (1, 1)
+ self._tilt = 0
+ self._outlinewidth = 1
+ ### self.screen = None # to override by child class
+
+ def resizemode(self, rmode=None):
+ """Set resizemode to one of the values: "auto", "user", "noresize".
+
+ (Optional) Argument:
+ rmode -- one of the strings "auto", "user", "noresize"
+
+ Different resizemodes have the following effects:
+ - "auto" adapts the appearance of the turtle
+ corresponding to the value of pensize.
+ - "user" adapts the appearance of the turtle according to the
+ values of stretchfactor and outlinewidth (outline),
+ which are set by shapesize()
+ - "noresize" no adaption of the turtle's appearance takes place.
+ If no argument is given, return current resizemode.
+ resizemode("user") is called by a call of shapesize with arguments.
+
+
+ Examples (for a Turtle instance named turtle):
+ >>> turtle.resizemode("noresize")
+ >>> turtle.resizemode()
+ 'noresize'
+ """
+ if rmode is None:
+ return self._resizemode
+ rmode = rmode.lower()
+ if rmode in ["auto", "user", "noresize"]:
+ self.pen(resizemode=rmode)
+
+ def pensize(self, width=None):
+ """Set or return the line thickness.
+
+ Aliases: pensize | width
+
+ Argument:
+ width -- positive number
+
+ Set the line thickness to width or return it. If resizemode is set
+ to "auto" and turtleshape is a polygon, that polygon is drawn with
+ the same line thickness. If no argument is given, current pensize
+ is returned.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.pensize()
+ 1
+ >>> turtle.pensize(10) # from here on lines of width 10 are drawn
+ """
+ if width is None:
+ return self._pensize
+ self.pen(pensize=width)
+
+
+ def penup(self):
+ """Pull the pen up -- no drawing when moving.
+
+ Aliases: penup | pu | up
+
+ No argument
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.penup()
+ """
+ if not self._drawing:
+ return
+ self.pen(pendown=False)
+
+ def pendown(self):
+ """Pull the pen down -- drawing when moving.
+
+ Aliases: pendown | pd | down
+
+ No argument.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.pendown()
+ """
+ if self._drawing:
+ return
+ self.pen(pendown=True)
+
+ def isdown(self):
+ """Return True if pen is down, False if it's up.
+
+ No argument.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.penup()
+ >>> turtle.isdown()
+ False
+ >>> turtle.pendown()
+ >>> turtle.isdown()
+ True
+ """
+ return self._drawing
+
+ def speed(self, speed=None):
+ """ Return or set the turtle's speed.
+
+ Optional argument:
+ speed -- an integer in the range 0..10 or a speedstring (see below)
+
+ Set the turtle's speed to an integer value in the range 0 .. 10.
+ If no argument is given: return current speed.
+
+ If input is a number greater than 10 or smaller than 0.5,
+ speed is set to 0.
+ Speedstrings are mapped to speedvalues in the following way:
+ 'fastest' : 0
+ 'fast' : 10
+ 'normal' : 6
+ 'slow' : 3
+ 'slowest' : 1
+ speeds from 1 to 10 enforce increasingly faster animation of
+ line drawing and turtle turning.
+
+ Attention:
+ speed = 0 : *no* animation takes place. forward/back makes turtle jump
+ and likewise left/right make the turtle turn instantly.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.speed(3)
+ """
+ speeds = {'fastest':0, 'fast':10, 'normal':6, 'slow':3, 'slowest':1 }
+ if speed is None:
+ return self._speed
+ if speed in speeds:
+ speed = speeds[speed]
+ elif 0.5 < speed < 10.5:
+ speed = int(round(speed))
+ else:
+ speed = 0
+ self.pen(speed=speed)
+
+ def color(self, *args):
+ """Return or set the pencolor and fillcolor.
+
+ Arguments:
+ Several input formats are allowed.
+ They use 0, 1, 2, or 3 arguments as follows:
+
+ color()
+ Return the current pencolor and the current fillcolor
+ as a pair of color specification strings as are returned
+ by pencolor and fillcolor.
+ color(colorstring), color((r,g,b)), color(r,g,b)
+ inputs as in pencolor, set both, fillcolor and pencolor,
+ to the given value.
+ color(colorstring1, colorstring2),
+ color((r1,g1,b1), (r2,g2,b2))
+ equivalent to pencolor(colorstring1) and fillcolor(colorstring2)
+ and analogously, if the other input format is used.
+
+ If turtleshape is a polygon, outline and interior of that polygon
+ is drawn with the newly set colors.
+ For mor info see: pencolor, fillcolor
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.color('red', 'green')
+ >>> turtle.color()
+ ('red', 'green')
+ >>> colormode(255)
+ >>> color((40, 80, 120), (160, 200, 240))
+ >>> color()
+ ('#285078', '#a0c8f0')
+ """
+ if args:
+ l = len(args)
+ if l == 1:
+ pcolor = fcolor = args[0]
+ elif l == 2:
+ pcolor, fcolor = args
+ elif l == 3:
+ pcolor = fcolor = args
+ pcolor = self._colorstr(pcolor)
+ fcolor = self._colorstr(fcolor)
+ self.pen(pencolor=pcolor, fillcolor=fcolor)
+ else:
+ return self._color(self._pencolor), self._color(self._fillcolor)
+
+ def pencolor(self, *args):
+ """ Return or set the pencolor.
+
+ Arguments:
+ Four input formats are allowed:
+ - pencolor()
+ Return the current pencolor as color specification string,
+ possibly in hex-number format (see example).
+ May be used as input to another color/pencolor/fillcolor call.
+ - pencolor(colorstring)
+ s is a Tk color specification string, such as "red" or "yellow"
+ - pencolor((r, g, b))
+ *a tuple* of r, g, and b, which represent, an RGB color,
+ and each of r, g, and b are in the range 0..colormode,
+ where colormode is either 1.0 or 255
+ - pencolor(r, g, b)
+ r, g, and b represent an RGB color, and each of r, g, and b
+ are in the range 0..colormode
+
+ If turtleshape is a polygon, the outline of that polygon is drawn
+ with the newly set pencolor.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.pencolor('brown')
+ >>> tup = (0.2, 0.8, 0.55)
+ >>> turtle.pencolor(tup)
+ >>> turtle.pencolor()
+ '#33cc8c'
+ """
+ if args:
+ color = self._colorstr(args)
+ if color == self._pencolor:
+ return
+ self.pen(pencolor=color)
+ else:
+ return self._color(self._pencolor)
+
+ def fillcolor(self, *args):
+ """ Return or set the fillcolor.
+
+ Arguments:
+ Four input formats are allowed:
+ - fillcolor()
+ Return the current fillcolor as color specification string,
+ possibly in hex-number format (see example).
+ May be used as input to another color/pencolor/fillcolor call.
+ - fillcolor(colorstring)
+ s is a Tk color specification string, such as "red" or "yellow"
+ - fillcolor((r, g, b))
+ *a tuple* of r, g, and b, which represent, an RGB color,
+ and each of r, g, and b are in the range 0..colormode,
+ where colormode is either 1.0 or 255
+ - fillcolor(r, g, b)
+ r, g, and b represent an RGB color, and each of r, g, and b
+ are in the range 0..colormode
+
+ If turtleshape is a polygon, the interior of that polygon is drawn
+ with the newly set fillcolor.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.fillcolor('violet')
+ >>> col = turtle.pencolor()
+ >>> turtle.fillcolor(col)
+ >>> turtle.fillcolor(0, .5, 0)
+ """
+ if args:
+ color = self._colorstr(args)
+ if color == self._fillcolor:
+ return
+ self.pen(fillcolor=color)
+ else:
+ return self._color(self._fillcolor)
+
+ def showturtle(self):
+ """Makes the turtle visible.
+
+ Aliases: showturtle | st
+
+ No argument.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.hideturtle()
+ >>> turtle.showturtle()
+ """
+ self.pen(shown=True)
+
+ def hideturtle(self):
+ """Makes the turtle invisible.
+
+ Aliases: hideturtle | ht
+
+ No argument.
+
+ It's a good idea to do this while you're in the
+ middle of a complicated drawing, because hiding
+ the turtle speeds up the drawing observably.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.hideturtle()
+ """
+ self.pen(shown=False)
+
+ def isvisible(self):
+ """Return True if the Turtle is shown, False if it's hidden.
+
+ No argument.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.hideturtle()
+ >>> print turtle.isvisible():
+ False
+ """
+ return self._shown
+
+ def pen(self, pen=None, **pendict):
+ """Return or set the pen's attributes.
+
+ Arguments:
+ pen -- a dictionary with some or all of the below listed keys.
+ **pendict -- one or more keyword-arguments with the below
+ listed keys as keywords.
+
+ Return or set the pen's attributes in a 'pen-dictionary'
+ with the following key/value pairs:
+ "shown" : True/False
+ "pendown" : True/False
+ "pencolor" : color-string or color-tuple
+ "fillcolor" : color-string or color-tuple
+ "pensize" : positive number
+ "speed" : number in range 0..10
+ "resizemode" : "auto" or "user" or "noresize"
+ "stretchfactor": (positive number, positive number)
+ "outline" : positive number
+ "tilt" : number
+
+ This dictionary can be used as argument for a subsequent
+ pen()-call to restore the former pen-state. Moreover one
+ or more of these attributes can be provided as keyword-arguments.
+ This can be used to set several pen attributes in one statement.
+
+
+ Examples (for a Turtle instance named turtle):
+ >>> turtle.pen(fillcolor="black", pencolor="red", pensize=10)
+ >>> turtle.pen()
+ {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
+ 'pencolor': 'red', 'pendown': True, 'fillcolor': 'black',
+ 'stretchfactor': (1,1), 'speed': 3}
+ >>> penstate=turtle.pen()
+ >>> turtle.color("yellow","")
+ >>> turtle.penup()
+ >>> turtle.pen()
+ {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
+ 'pencolor': 'yellow', 'pendown': False, 'fillcolor': '',
+ 'stretchfactor': (1,1), 'speed': 3}
+ >>> p.pen(penstate, fillcolor="green")
+ >>> p.pen()
+ {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1,
+ 'pencolor': 'red', 'pendown': True, 'fillcolor': 'green',
+ 'stretchfactor': (1,1), 'speed': 3}
+ """
+ _pd = {"shown" : self._shown,
+ "pendown" : self._drawing,
+ "pencolor" : self._pencolor,
+ "fillcolor" : self._fillcolor,
+ "pensize" : self._pensize,
+ "speed" : self._speed,
+ "resizemode" : self._resizemode,
+ "stretchfactor" : self._stretchfactor,
+ "outline" : self._outlinewidth,
+ "tilt" : self._tilt
+ }
+
+ if not (pen or pendict):
+ return _pd
+
+ if isinstance(pen, dict):
+ p = pen
+ else:
+ p = {}
+ p.update(pendict)
+
+ _p_buf = {}
+ for key in p:
+ _p_buf[key] = _pd[key]
+
+ if self.undobuffer:
+ self.undobuffer.push(("pen", _p_buf))
+
+ newLine = False
+ if "pendown" in p:
+ if self._drawing != p["pendown"]:
+ newLine = True
+ if "pencolor" in p:
+ if isinstance(p["pencolor"], tuple):
+ p["pencolor"] = self._colorstr((p["pencolor"],))
+ if self._pencolor != p["pencolor"]:
+ newLine = True
+ if "pensize" in p:
+ if self._pensize != p["pensize"]:
+ newLine = True
+ if newLine:
+ self._newLine()
+ if "pendown" in p:
+ self._drawing = p["pendown"]
+ if "pencolor" in p:
+ self._pencolor = p["pencolor"]
+ if "pensize" in p:
+ self._pensize = p["pensize"]
+ if "fillcolor" in p:
+ if isinstance(p["fillcolor"], tuple):
+ p["fillcolor"] = self._colorstr((p["fillcolor"],))
+ self._fillcolor = p["fillcolor"]
+ if "speed" in p:
+ self._speed = p["speed"]
+ if "resizemode" in p:
+ self._resizemode = p["resizemode"]
+ if "stretchfactor" in p:
+ sf = p["stretchfactor"]
+ if isinstance(sf, (int, float)):
+ sf = (sf, sf)
+ self._stretchfactor = sf
+ if "outline" in p:
+ self._outlinewidth = p["outline"]
+ if "shown" in p:
+ self._shown = p["shown"]
+ if "tilt" in p:
+ self._tilt = p["tilt"]
+ self._update()
+
+## three dummy methods to be implemented by child class:
+
+ def _newLine(self, usePos = True):
+ """dummy method - to be overwritten by child class"""
+ def _update(self, count=True, forced=False):
+ """dummy method - to be overwritten by child class"""
+ def _color(self, args):
+ """dummy method - to be overwritten by child class"""
+ def _colorstr(self, args):
+ """dummy method - to be overwritten by child class"""
+
+ width = pensize
+ up = penup
+ pu = penup
+ pd = pendown
+ down = pendown
+ st = showturtle
+ ht = hideturtle
+
+
+class _TurtleImage(object):
+ """Helper class: Datatype to store Turtle attributes
+ """
+
+ def __init__(self, screen, shapeIndex):
+ self.screen = screen
+ self._type = None
+ self._setshape(shapeIndex)
+
+ def _setshape(self, shapeIndex):
+ screen = self.screen # RawTurtle.screens[self.screenIndex]
+ self.shapeIndex = shapeIndex
+ if self._type == "polygon" == screen._shapes[shapeIndex]._type:
+ return
+ if self._type == "image" == screen._shapes[shapeIndex]._type:
+ return
+ if self._type in ["image", "polygon"]:
+ screen._delete(self._item)
+ elif self._type == "compound":
+ for item in self._item:
+ screen._delete(item)
+ self._type = screen._shapes[shapeIndex]._type
+ if self._type == "polygon":
+ self._item = screen._createpoly()
+ elif self._type == "image":
+ self._item = screen._createimage(screen._shapes["blank"]._data)
+ elif self._type == "compound":
+ self._item = [screen._createpoly() for item in
+ screen._shapes[shapeIndex]._data]
+
+
+class RawTurtle(TPen, TNavigator):
+ """Animation part of the RawTurtle.
+ Puts RawTurtle upon a TurtleScreen and provides tools for
+ its animation.
+ """
+ screens = []
+
+ def __init__(self, canvas=None,
+ shape=_CFG["shape"],
+ undobuffersize=_CFG["undobuffersize"],
+ visible=_CFG["visible"]):
+ if isinstance(canvas, _Screen):
+ self.screen = canvas
+ elif isinstance(canvas, TurtleScreen):
+ if canvas not in RawTurtle.screens:
+ RawTurtle.screens.append(canvas)
+ self.screen = canvas
+ elif isinstance(canvas, (ScrolledCanvas, Canvas)):
+ for screen in RawTurtle.screens:
+ if screen.cv == canvas:
+ self.screen = screen
+ break
+ else:
+ self.screen = TurtleScreen(canvas)
+ RawTurtle.screens.append(self.screen)
+ else:
+ raise TurtleGraphicsError("bad canvas argument %s" % canvas)
+
+ screen = self.screen
+ TNavigator.__init__(self, screen.mode())
+ TPen.__init__(self)
+ screen._turtles.append(self)
+ self.drawingLineItem = screen._createline()
+ self.turtle = _TurtleImage(screen, shape)
+ self._poly = None
+ self._creatingPoly = False
+ self._fillitem = self._fillpath = None
+ self._shown = visible
+ self._hidden_from_screen = False
+ self.currentLineItem = screen._createline()
+ self.currentLine = [self._position]
+ self.items = [self.currentLineItem]
+ self.stampItems = []
+ self._undobuffersize = undobuffersize
+ self.undobuffer = Tbuffer(undobuffersize)
+ self._update()
+
+ def reset(self):
+ """Delete the turtle's drawings and restore its default values.
+
+ No argument.
+,
+ Delete the turtle's drawings from the screen, re-center the turtle
+ and set variables to the default values.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.position()
+ (0.00,-22.00)
+ >>> turtle.heading()
+ 100.0
+ >>> turtle.reset()
+ >>> turtle.position()
+ (0.00,0.00)
+ >>> turtle.heading()
+ 0.0
+ """
+ TNavigator.reset(self)
+ TPen._reset(self)
+ self._clear()
+ self._drawturtle()
+ self._update()
+
+ def setundobuffer(self, size):
+ """Set or disable undobuffer.
+
+ Argument:
+ size -- an integer or None
+
+ If size is an integer an empty undobuffer of given size is installed.
+ Size gives the maximum number of turtle-actions that can be undone
+ by the undo() function.
+ If size is None, no undobuffer is present.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.setundobuffer(42)
+ """
+ if size is None or size <= 0:
+ self.undobuffer = None
+ else:
+ self.undobuffer = Tbuffer(size)
+
+ def undobufferentries(self):
+ """Return count of entries in the undobuffer.
+
+ No argument.
+
+ Example (for a Turtle instance named turtle):
+ >>> while undobufferentries():
+ ... undo()
+ """
+ if self.undobuffer is None:
+ return 0
+ return self.undobuffer.nr_of_items()
+
+ def _clear(self):
+ """Delete all of pen's drawings"""
+ self._fillitem = self._fillpath = None
+ for item in self.items:
+ self.screen._delete(item)
+ self.currentLineItem = self.screen._createline()
+ self.currentLine = []
+ if self._drawing:
+ self.currentLine.append(self._position)
+ self.items = [self.currentLineItem]
+ self.clearstamps()
+ self.setundobuffer(self._undobuffersize)
+
+
+ def clear(self):
+ """Delete the turtle's drawings from the screen. Do not move turtle.
+
+ No arguments.
+
+ Delete the turtle's drawings from the screen. Do not move turtle.
+ State and position of the turtle as well as drawings of other
+ turtles are not affected.
+
+ Examples (for a Turtle instance named turtle):
+ >>> turtle.clear()
+ """
+ self._clear()
+ self._update()
+
+ def _update_data(self):
+ self.screen._incrementudc()
+ if self.screen._updatecounter != 0:
+ return
+ if len(self.currentLine)>1:
+ self.screen._drawline(self.currentLineItem, self.currentLine,
+ self._pencolor, self._pensize)
+
+ def _update(self):
+ """Perform a Turtle-data update.
+ """
+ screen = self.screen
+ if screen._tracing == 0:
+ return
+ elif screen._tracing == 1:
+ self._update_data()
+ self._drawturtle()
+ screen._update() # TurtleScreenBase
+ screen._delay(screen._delayvalue) # TurtleScreenBase
+ else:
+ self._update_data()
+ if screen._updatecounter == 0:
+ for t in screen.turtles():
+ t._drawturtle()
+ screen._update()
+
+ def tracer(self, flag=None, delay=None):
+ """Turns turtle animation on/off and set delay for update drawings.
+
+ Optional arguments:
+ n -- nonnegative integer
+ delay -- nonnegative integer
+
+ If n is given, only each n-th regular screen update is really performed.
+ (Can be used to accelerate the drawing of complex graphics.)
+ Second arguments sets delay value (see RawTurtle.delay())
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.tracer(8, 25)
+ >>> dist = 2
+ >>> for i in range(200):
+ ... turtle.fd(dist)
+ ... turtle.rt(90)
+ ... dist += 2
+ """
+ return self.screen.tracer(flag, delay)
+
+ def _color(self, args):
+ return self.screen._color(args)
+
+ def _colorstr(self, args):
+ return self.screen._colorstr(args)
+
+ def _cc(self, args):
+ """Convert colortriples to hexstrings.
+ """
+ if isinstance(args, basestring):
+ return args
+ try:
+ r, g, b = args
+ except (TypeError, ValueError):
+ raise TurtleGraphicsError("bad color arguments: %s" % str(args))
+ if self.screen._colormode == 1.0:
+ r, g, b = [round(255.0*x) for x in (r, g, b)]
+ if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)):
+ raise TurtleGraphicsError("bad color sequence: %s" % str(args))
+ return "#%02x%02x%02x" % (r, g, b)
+
+ def clone(self):
+ """Create and return a clone of the turtle.
+
+ No argument.
+
+ Create and return a clone of the turtle with same position, heading
+ and turtle properties.
+
+ Example (for a Turtle instance named mick):
+ mick = Turtle()
+ joe = mick.clone()
+ """
+ screen = self.screen
+ self._newLine(self._drawing)
+
+ turtle = self.turtle
+ self.screen = None
+ self.turtle = None # too make self deepcopy-able
+
+ q = deepcopy(self)
+
+ self.screen = screen
+ self.turtle = turtle
+
+ q.screen = screen
+ q.turtle = _TurtleImage(screen, self.turtle.shapeIndex)
+
+ screen._turtles.append(q)
+ ttype = screen._shapes[self.turtle.shapeIndex]._type
+ if ttype == "polygon":
+ q.turtle._item = screen._createpoly()
+ elif ttype == "image":
+ q.turtle._item = screen._createimage(screen._shapes["blank"]._data)
+ elif ttype == "compound":
+ q.turtle._item = [screen._createpoly() for item in
+ screen._shapes[self.turtle.shapeIndex]._data]
+ q.currentLineItem = screen._createline()
+ q._update()
+ return q
+
+ def shape(self, name=None):
+ """Set turtle shape to shape with given name / return current shapename.
+
+ Optional argument:
+ name -- a string, which is a valid shapename
+
+ Set turtle shape to shape with given name or, if name is not given,
+ return name of current shape.
+ Shape with name must exist in the TurtleScreen's shape dictionary.
+ Initially there are the following polygon shapes:
+ 'arrow', 'turtle', 'circle', 'square', 'triangle', 'classic'.
+ To learn about how to deal with shapes see Screen-method register_shape.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.shape()
+ 'arrow'
+ >>> turtle.shape("turtle")
+ >>> turtle.shape()
+ 'turtle'
+ """
+ if name is None:
+ return self.turtle.shapeIndex
+ if not name in self.screen.getshapes():
+ raise TurtleGraphicsError("There is no shape named %s" % name)
+ self.turtle._setshape(name)
+ self._update()
+
+ def shapesize(self, stretch_wid=None, stretch_len=None, outline=None):
+ """Set/return turtle's stretchfactors/outline. Set resizemode to "user".
+
+ Optional arguments:
+ stretch_wid : positive number
+ stretch_len : positive number
+ outline : positive number
+
+ Return or set the pen's attributes x/y-stretchfactors and/or outline.
+ Set resizemode to "user".
+ If and only if resizemode is set to "user", the turtle will be displayed
+ stretched according to its stretchfactors:
+ stretch_wid is stretchfactor perpendicular to orientation
+ stretch_len is stretchfactor in direction of turtles orientation.
+ outline determines the width of the shapes's outline.
+
+ Examples (for a Turtle instance named turtle):
+ >>> turtle.resizemode("user")
+ >>> turtle.shapesize(5, 5, 12)
+ >>> turtle.shapesize(outline=8)
+ """
+ if stretch_wid is stretch_len is outline is None:
+ stretch_wid, stretch_len = self._stretchfactor
+ return stretch_wid, stretch_len, self._outlinewidth
+ if stretch_wid is not None:
+ if stretch_len is None:
+ stretchfactor = stretch_wid, stretch_wid
+ else:
+ stretchfactor = stretch_wid, stretch_len
+ elif stretch_len is not None:
+ stretchfactor = self._stretchfactor[0], stretch_len
+ else:
+ stretchfactor = self._stretchfactor
+ if outline is None:
+ outline = self._outlinewidth
+ self.pen(resizemode="user",
+ stretchfactor=stretchfactor, outline=outline)
+
+ def settiltangle(self, angle):
+ """Rotate the turtleshape to point in the specified direction
+
+ Optional argument:
+ angle -- number
+
+ Rotate the turtleshape to point in the direction specified by angle,
+ regardless of its current tilt-angle. DO NOT change the turtle's
+ heading (direction of movement).
+
+
+ Examples (for a Turtle instance named turtle):
+ >>> turtle.shape("circle")
+ >>> turtle.shapesize(5,2)
+ >>> turtle.settiltangle(45)
+ >>> stamp()
+ >>> turtle.fd(50)
+ >>> turtle.settiltangle(-45)
+ >>> stamp()
+ >>> turtle.fd(50)
+ """
+ tilt = -angle * self._degreesPerAU * self._angleOrient
+ tilt = (tilt * math.pi / 180.0) % (2*math.pi)
+ self.pen(resizemode="user", tilt=tilt)
+
+ def tiltangle(self):
+ """Return the current tilt-angle.
+
+ No argument.
+
+ Return the current tilt-angle, i. e. the angle between the
+ orientation of the turtleshape and the heading of the turtle
+ (its direction of movement).
+
+ Examples (for a Turtle instance named turtle):
+ >>> turtle.shape("circle")
+ >>> turtle.shapesize(5,2)
+ >>> turtle.tilt(45)
+ >>> turtle.tiltangle()
+ """
+ tilt = -self._tilt * (180.0/math.pi) * self._angleOrient
+ return (tilt / self._degreesPerAU) % self._fullcircle
+
+ def tilt(self, angle):
+ """Rotate the turtleshape by angle.
+
+ Argument:
+ angle - a number
+
+ Rotate the turtleshape by angle from its current tilt-angle,
+ but do NOT change the turtle's heading (direction of movement).
+
+ Examples (for a Turtle instance named turtle):
+ >>> turtle.shape("circle")
+ >>> turtle.shapesize(5,2)
+ >>> turtle.tilt(30)
+ >>> turtle.fd(50)
+ >>> turtle.tilt(30)
+ >>> turtle.fd(50)
+ """
+ self.settiltangle(angle + self.tiltangle())
+
+ def _polytrafo(self, poly):
+ """Computes transformed polygon shapes from a shape
+ according to current position and heading.
+ """
+ screen = self.screen
+ p0, p1 = self._position
+ e0, e1 = self._orient
+ e = Vec2D(e0, e1 * screen.yscale / screen.xscale)
+ e0, e1 = (1.0 / abs(e)) * e
+ return [(p0+(e1*x+e0*y)/screen.xscale, p1+(-e0*x+e1*y)/screen.yscale)
+ for (x, y) in poly]
+
+ def _drawturtle(self):
+ """Manages the correct rendering of the turtle with respect to
+ its shape, resizemode, stretch and tilt etc."""
+ screen = self.screen
+ shape = screen._shapes[self.turtle.shapeIndex]
+ ttype = shape._type
+ titem = self.turtle._item
+ if self._shown and screen._updatecounter == 0 and screen._tracing > 0:
+ self._hidden_from_screen = False
+ tshape = shape._data
+ if ttype == "polygon":
+ if self._resizemode == "noresize":
+ w = 1
+ shape = tshape
+ else:
+ if self._resizemode == "auto":
+ lx = ly = max(1, self._pensize/5.0)
+ w = self._pensize
+ tiltangle = 0
+ elif self._resizemode == "user":
+ lx, ly = self._stretchfactor
+ w = self._outlinewidth
+ tiltangle = self._tilt
+ shape = [(lx*x, ly*y) for (x, y) in tshape]
+ t0, t1 = math.sin(tiltangle), math.cos(tiltangle)
+ shape = [(t1*x+t0*y, -t0*x+t1*y) for (x, y) in shape]
+ shape = self._polytrafo(shape)
+ fc, oc = self._fillcolor, self._pencolor
+ screen._drawpoly(titem, shape, fill=fc, outline=oc,
+ width=w, top=True)
+ elif ttype == "image":
+ screen._drawimage(titem, self._position, tshape)
+ elif ttype == "compound":
+ lx, ly = self._stretchfactor
+ w = self._outlinewidth
+ for item, (poly, fc, oc) in zip(titem, tshape):
+ poly = [(lx*x, ly*y) for (x, y) in poly]
+ poly = self._polytrafo(poly)
+ screen._drawpoly(item, poly, fill=self._cc(fc),
+ outline=self._cc(oc), width=w, top=True)
+ else:
+ if self._hidden_from_screen:
+ return
+ if ttype == "polygon":
+ screen._drawpoly(titem, ((0, 0), (0, 0), (0, 0)), "", "")
+ elif ttype == "image":
+ screen._drawimage(titem, self._position,
+ screen._shapes["blank"]._data)
+ elif ttype == "compound":
+ for item in titem:
+ screen._drawpoly(item, ((0, 0), (0, 0), (0, 0)), "", "")
+ self._hidden_from_screen = True
+
+############################## stamp stuff ###############################
+
+ def stamp(self):
+ """Stamp a copy of the turtleshape onto the canvas and return its id.
+
+ No argument.
+
+ Stamp a copy of the turtle shape onto the canvas at the current
+ turtle position. Return a stamp_id for that stamp, which can be
+ used to delete it by calling clearstamp(stamp_id).
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.color("blue")
+ >>> turtle.stamp()
+ 13
+ >>> turtle.fd(50)
+ """
+ screen = self.screen
+ shape = screen._shapes[self.turtle.shapeIndex]
+ ttype = shape._type
+ tshape = shape._data
+ if ttype == "polygon":
+ stitem = screen._createpoly()
+ if self._resizemode == "noresize":
+ w = 1
+ shape = tshape
+ else:
+ if self._resizemode == "auto":
+ lx = ly = max(1, self._pensize/5.0)
+ w = self._pensize
+ tiltangle = 0
+ elif self._resizemode == "user":
+ lx, ly = self._stretchfactor
+ w = self._outlinewidth
+ tiltangle = self._tilt
+ shape = [(lx*x, ly*y) for (x, y) in tshape]
+ t0, t1 = math.sin(tiltangle), math.cos(tiltangle)
+ shape = [(t1*x+t0*y, -t0*x+t1*y) for (x, y) in shape]
+ shape = self._polytrafo(shape)
+ fc, oc = self._fillcolor, self._pencolor
+ screen._drawpoly(stitem, shape, fill=fc, outline=oc,
+ width=w, top=True)
+ elif ttype == "image":
+ stitem = screen._createimage("")
+ screen._drawimage(stitem, self._position, tshape)
+ elif ttype == "compound":
+ stitem = []
+ for element in tshape:
+ item = screen._createpoly()
+ stitem.append(item)
+ stitem = tuple(stitem)
+ lx, ly = self._stretchfactor
+ w = self._outlinewidth
+ for item, (poly, fc, oc) in zip(stitem, tshape):
+ poly = [(lx*x, ly*y) for (x, y) in poly]
+ poly = self._polytrafo(poly)
+ screen._drawpoly(item, poly, fill=self._cc(fc),
+ outline=self._cc(oc), width=w, top=True)
+ self.stampItems.append(stitem)
+ self.undobuffer.push(("stamp", stitem))
+ return stitem
+
+ def _clearstamp(self, stampid):
+ """does the work for clearstamp() and clearstamps()
+ """
+ if stampid in self.stampItems:
+ if isinstance(stampid, tuple):
+ for subitem in stampid:
+ self.screen._delete(subitem)
+ else:
+ self.screen._delete(stampid)
+ self.stampItems.remove(stampid)
+ # Delete stampitem from undobuffer if necessary
+ # if clearstamp is called directly.
+ item = ("stamp", stampid)
+ buf = self.undobuffer
+ if item not in buf.buffer:
+ return
+ index = buf.buffer.index(item)
+ buf.buffer.remove(item)
+ if index <= buf.ptr:
+ buf.ptr = (buf.ptr - 1) % buf.bufsize
+ buf.buffer.insert((buf.ptr+1)%buf.bufsize, [None])
+
+ def clearstamp(self, stampid):
+ """Delete stamp with given stampid
+
+ Argument:
+ stampid - an integer, must be return value of previous stamp() call.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.color("blue")
+ >>> astamp = turtle.stamp()
+ >>> turtle.fd(50)
+ >>> turtle.clearstamp(astamp)
+ """
+ self._clearstamp(stampid)
+ self._update()
+
+ def clearstamps(self, n=None):
+ """Delete all or first/last n of turtle's stamps.
+
+ Optional argument:
+ n -- an integer
+
+ If n is None, delete all of pen's stamps,
+ else if n > 0 delete first n stamps
+ else if n < 0 delete last n stamps.
+
+ Example (for a Turtle instance named turtle):
+ >>> for i in range(8):
+ ... turtle.stamp(); turtle.fd(30)
+ ...
+ >>> turtle.clearstamps(2)
+ >>> turtle.clearstamps(-2)
+ >>> turtle.clearstamps()
+ """
+ if n is None:
+ toDelete = self.stampItems[:]
+ elif n >= 0:
+ toDelete = self.stampItems[:n]
+ else:
+ toDelete = self.stampItems[n:]
+ for item in toDelete:
+ self._clearstamp(item)
+ self._update()
+
+ def _goto(self, end):
+ """Move the pen to the point end, thereby drawing a line
+ if pen is down. All other methods for turtle movement depend
+ on this one.
+ """
+ ## Version mit undo-stuff
+ go_modes = ( self._drawing,
+ self._pencolor,
+ self._pensize,
+ isinstance(self._fillpath, list))
+ screen = self.screen
+ undo_entry = ("go", self._position, end, go_modes,
+ (self.currentLineItem,
+ self.currentLine[:],
+ screen._pointlist(self.currentLineItem),
+ self.items[:])
+ )
+ if self.undobuffer:
+ self.undobuffer.push(undo_entry)
+ start = self._position
+ if self._speed and screen._tracing == 1:
+ diff = (end-start)
+ diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2
+ nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed))
+ delta = diff * (1.0/nhops)
+ for n in range(1, nhops):
+ if n == 1:
+ top = True
+ else:
+ top = False
+ self._position = start + delta * n
+ if self._drawing:
+ screen._drawline(self.drawingLineItem,
+ (start, self._position),
+ self._pencolor, self._pensize, top)
+ self._update()
+ if self._drawing:
+ screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)),
+ fill="", width=self._pensize)
+ # Turtle now at end,
+ if self._drawing: # now update currentLine
+ self.currentLine.append(end)
+ if isinstance(self._fillpath, list):
+ self._fillpath.append(end)
+ ###### vererbung!!!!!!!!!!!!!!!!!!!!!!
+ self._position = end
+ if self._creatingPoly:
+ self._poly.append(end)
+ if len(self.currentLine) > 42: # 42! answer to the ultimate question
+ # of life, the universe and everything
+ self._newLine()
+ self._update() #count=True)
+
+ def _undogoto(self, entry):
+ """Reverse a _goto. Used for undo()
+ """
+ old, new, go_modes, coodata = entry
+ drawing, pc, ps, filling = go_modes
+ cLI, cL, pl, items = coodata
+ screen = self.screen
+ if abs(self._position - new) > 0.5:
+ print "undogoto: HALLO-DA-STIMMT-WAS-NICHT!"
+ # restore former situation
+ self.currentLineItem = cLI
+ self.currentLine = cL
+
+ if pl == [(0, 0), (0, 0)]:
+ usepc = ""
+ else:
+ usepc = pc
+ screen._drawline(cLI, pl, fill=usepc, width=ps)
+
+ todelete = [i for i in self.items if (i not in items) and
+ (screen._type(i) == "line")]
+ for i in todelete:
+ screen._delete(i)
+ self.items.remove(i)
+
+ start = old
+ if self._speed and screen._tracing == 1:
+ diff = old - new
+ diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2
+ nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed))
+ delta = diff * (1.0/nhops)
+ for n in range(1, nhops):
+ if n == 1:
+ top = True
+ else:
+ top = False
+ self._position = new + delta * n
+ if drawing:
+ screen._drawline(self.drawingLineItem,
+ (start, self._position),
+ pc, ps, top)
+ self._update()
+ if drawing:
+ screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)),
+ fill="", width=ps)
+ # Turtle now at position old,
+ self._position = old
+ ## if undo is done during creating a polygon, the last vertex
+ ## will be deleted. if the polygon is entirely deleted,
+ ## creatingPoly will be set to False.
+ ## Polygons created before the last one will not be affected by undo()
+ if self._creatingPoly:
+ if len(self._poly) > 0:
+ self._poly.pop()
+ if self._poly == []:
+ self._creatingPoly = False
+ self._poly = None
+ if filling:
+ if self._fillpath == []:
+ self._fillpath = None
+ print "Unwahrscheinlich in _undogoto!"
+ elif self._fillpath is not None:
+ self._fillpath.pop()
+ self._update() #count=True)
+
+ def _rotate(self, angle):
+ """Turns pen clockwise by angle.
+ """
+ if self.undobuffer:
+ self.undobuffer.push(("rot", angle, self._degreesPerAU))
+ angle *= self._degreesPerAU
+ neworient = self._orient.rotate(angle)
+ tracing = self.screen._tracing
+ if tracing == 1 and self._speed > 0:
+ anglevel = 3.0 * self._speed
+ steps = 1 + int(abs(angle)/anglevel)
+ delta = 1.0*angle/steps
+ for _ in range(steps):
+ self._orient = self._orient.rotate(delta)
+ self._update()
+ self._orient = neworient
+ self._update()
+
+ def _newLine(self, usePos=True):
+ """Closes current line item and starts a new one.
+ Remark: if current line became too long, animation
+ performance (via _drawline) slowed down considerably.
+ """
+ if len(self.currentLine) > 1:
+ self.screen._drawline(self.currentLineItem, self.currentLine,
+ self._pencolor, self._pensize)
+ self.currentLineItem = self.screen._createline()
+ self.items.append(self.currentLineItem)
+ else:
+ self.screen._drawline(self.currentLineItem, top=True)
+ self.currentLine = []
+ if usePos:
+ self.currentLine = [self._position]
+
+ def fill(self, flag=None):
+ """Call fill(True) before drawing a shape to fill, fill(False) when done.
+
+ Optional argument:
+ flag -- True/False (or 1/0 respectively)
+
+ Call fill(True) before drawing the shape you want to fill,
+ and fill(False) when done.
+ When used without argument: return fillstate (True if filling,
+ False else)
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.fill(True)
+ >>> turtle.forward(100)
+ >>> turtle.left(90)
+ >>> turtle.forward(100)
+ >>> turtle.left(90)
+ >>> turtle.forward(100)
+ >>> turtle.left(90)
+ >>> turtle.forward(100)
+ >>> turtle.fill(False)
+ """
+ filling = isinstance(self._fillpath, list)
+ if flag is None:
+ return filling
+ screen = self.screen
+ entry1 = entry2 = ()
+ if filling:
+ if len(self._fillpath) > 2:
+ self.screen._drawpoly(self._fillitem, self._fillpath,
+ fill=self._fillcolor)
+ entry1 = ("dofill", self._fillitem)
+ if flag:
+ self._fillitem = self.screen._createpoly()
+ self.items.append(self._fillitem)
+ self._fillpath = [self._position]
+ entry2 = ("beginfill", self._fillitem) # , self._fillpath)
+ self._newLine()
+ else:
+ self._fillitem = self._fillpath = None
+ if self.undobuffer:
+ if entry1 == ():
+ if entry2 != ():
+ self.undobuffer.push(entry2)
+ else:
+ if entry2 == ():
+ self.undobuffer.push(entry1)
+ else:
+ self.undobuffer.push(["seq", entry1, entry2])
+ self._update()
+
+ def begin_fill(self):
+ """Called just before drawing a shape to be filled.
+
+ No argument.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.begin_fill()
+ >>> turtle.forward(100)
+ >>> turtle.left(90)
+ >>> turtle.forward(100)
+ >>> turtle.left(90)
+ >>> turtle.forward(100)
+ >>> turtle.left(90)
+ >>> turtle.forward(100)
+ >>> turtle.end_fill()
+ """
+ self.fill(True)
+
+ def end_fill(self):
+ """Fill the shape drawn after the call begin_fill().
+
+ No argument.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.begin_fill()
+ >>> turtle.forward(100)
+ >>> turtle.left(90)
+ >>> turtle.forward(100)
+ >>> turtle.left(90)
+ >>> turtle.forward(100)
+ >>> turtle.left(90)
+ >>> turtle.forward(100)
+ >>> turtle.end_fill()
+ """
+ self.fill(False)
+
+ def dot(self, size=None, *color):
+ """Draw a dot with diameter size, using color.
+
+ Optional arguments:
+ size -- an integer >= 1 (if given)
+ color -- a colorstring or a numeric color tuple
+
+ Draw a circular dot with diameter size, using color.
+ If size is not given, the maximum of pensize+4 and 2*pensize is used.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.dot()
+ >>> turtle.fd(50); turtle.dot(20, "blue"); turtle.fd(50)
+ """
+ #print "dot-1:", size, color
+ if not color:
+ if isinstance(size, (basestring, tuple)):
+ color = self._colorstr(size)
+ size = self._pensize + max(self._pensize, 4)
+ else:
+ color = self._pencolor
+ if not size:
+ size = self._pensize + max(self._pensize, 4)
+ else:
+ if size is None:
+ size = self._pensize + max(self._pensize, 4)
+ color = self._colorstr(color)
+ #print "dot-2:", size, color
+ if hasattr(self.screen, "_dot"):
+ item = self.screen._dot(self._position, size, color)
+ #print "dot:", size, color, "item:", item
+ self.items.append(item)
+ if self.undobuffer:
+ self.undobuffer.push(("dot", item))
+ else:
+ pen = self.pen()
+ if self.undobuffer:
+ self.undobuffer.push(["seq"])
+ self.undobuffer.cumulate = True
+ try:
+ if self.resizemode() == 'auto':
+ self.ht()
+ self.pendown()
+ self.pensize(size)
+ self.pencolor(color)
+ self.forward(0)
+ finally:
+ self.pen(pen)
+ if self.undobuffer:
+ self.undobuffer.cumulate = False
+
+ def _write(self, txt, align, font):
+ """Performs the writing for write()
+ """
+ item, end = self.screen._write(self._position, txt, align, font,
+ self._pencolor)
+ self.items.append(item)
+ if self.undobuffer:
+ self.undobuffer.push(("wri", item))
+ return end
+
+ def write(self, arg, move=False, align="left", font=("Arial", 8, "normal")):
+ """Write text at the current turtle position.
+
+ Arguments:
+ arg -- info, which is to be written to the TurtleScreen
+ move (optional) -- True/False
+ align (optional) -- one of the strings "left", "center" or right"
+ font (optional) -- a triple (fontname, fontsize, fonttype)
+
+ Write text - the string representation of arg - at the current
+ turtle position according to align ("left", "center" or right")
+ and with the given font.
+ If move is True, the pen is moved to the bottom-right corner
+ of the text. By default, move is False.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.write('Home = ', True, align="center")
+ >>> turtle.write((0,0), True)
+ """
+ if self.undobuffer:
+ self.undobuffer.push(["seq"])
+ self.undobuffer.cumulate = True
+ end = self._write(str(arg), align.lower(), font)
+ if move:
+ x, y = self.pos()
+ self.setpos(end, y)
+ if self.undobuffer:
+ self.undobuffer.cumulate = False
+
+ def begin_poly(self):
+ """Start recording the vertices of a polygon.
+
+ No argument.
+
+ Start recording the vertices of a polygon. Current turtle position
+ is first point of polygon.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.begin_poly()
+ """
+ self._poly = [self._position]
+ self._creatingPoly = True
+
+ def end_poly(self):
+ """Stop recording the vertices of a polygon.
+
+ No argument.
+
+ Stop recording the vertices of a polygon. Current turtle position is
+ last point of polygon. This will be connected with the first point.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.end_poly()
+ """
+ self._creatingPoly = False
+
+ def get_poly(self):
+ """Return the lastly recorded polygon.
+
+ No argument.
+
+ Example (for a Turtle instance named turtle):
+ >>> p = turtle.get_poly()
+ >>> turtle.register_shape("myFavouriteShape", p)
+ """
+ ## check if there is any poly? -- 1st solution:
+ if self._poly is not None:
+ return tuple(self._poly)
+
+ def getscreen(self):
+ """Return the TurtleScreen object, the turtle is drawing on.
+
+ No argument.
+
+ Return the TurtleScreen object, the turtle is drawing on.
+ So TurtleScreen-methods can be called for that object.
+
+ Example (for a Turtle instance named turtle):
+ >>> ts = turtle.getscreen()
+ >>> ts
+ <turtle.TurtleScreen object at 0x0106B770>
+ >>> ts.bgcolor("pink")
+ """
+ return self.screen
+
+ def getturtle(self):
+ """Return the Turtleobject itself.
+
+ No argument.
+
+ Only reasonable use: as a function to return the 'anonymous turtle':
+
+ Example:
+ >>> pet = getturtle()
+ >>> pet.fd(50)
+ >>> pet
+ <turtle.Turtle object at 0x0187D810>
+ >>> turtles()
+ [<turtle.Turtle object at 0x0187D810>]
+ """
+ return self
+
+ getpen = getturtle
+
+
+ ################################################################
+ ### screen oriented methods recurring to methods of TurtleScreen
+ ################################################################
+
+ def window_width(self):
+ """ Returns the width of the turtle window.
+
+ No argument.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.window_width()
+ 640
+ """
+ return self.screen._window_size()[0]
+
+ def window_height(self):
+ """ Return the height of the turtle window.
+
+ No argument.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.window_height()
+ 480
+ """
+ return self.screen._window_size()[1]
+
+ def _delay(self, delay=None):
+ """Set delay value which determines speed of turtle animation.
+ """
+ return self.screen.delay(delay)
+
+ ##### event binding methods #####
+
+ def onclick(self, fun, btn=1, add=None):
+ """Bind fun to mouse-click event on this turtle on canvas.
+
+ Arguments:
+ fun -- a function with two arguments, to which will be assigned
+ the coordinates of the clicked point on the canvas.
+ num -- number of the mouse-button defaults to 1 (left mouse button).
+ add -- True or False. If True, new binding will be added, otherwise
+ it will replace a former binding.
+
+ Example for the anonymous turtle, i. e. the procedural way:
+
+ >>> def turn(x, y):
+ ... left(360)
+ ...
+ >>> onclick(turn) # Now clicking into the turtle will turn it.
+ >>> onclick(None) # event-binding will be removed
+ """
+ self.screen._onclick(self.turtle._item, fun, btn, add)
+ self._update()
+
+ def onrelease(self, fun, btn=1, add=None):
+ """Bind fun to mouse-button-release event on this turtle on canvas.
+
+ Arguments:
+ fun -- a function with two arguments, to which will be assigned
+ the coordinates of the clicked point on the canvas.
+ num -- number of the mouse-button defaults to 1 (left mouse button).
+
+ Example (for a MyTurtle instance named joe):
+ >>> class MyTurtle(Turtle):
+ ... def glow(self,x,y):
+ ... self.fillcolor("red")
+ ... def unglow(self,x,y):
+ ... self.fillcolor("")
+ ...
+ >>> joe = MyTurtle()
+ >>> joe.onclick(joe.glow)
+ >>> joe.onrelease(joe.unglow)
+
+ Clicking on joe turns fillcolor red, unclicking turns it to
+ transparent.
+ """
+ self.screen._onrelease(self.turtle._item, fun, btn, add)
+ self._update()
+
+ def ondrag(self, fun, btn=1, add=None):
+ """Bind fun to mouse-move event on this turtle on canvas.
+
+ Arguments:
+ fun -- a function with two arguments, to which will be assigned
+ the coordinates of the clicked point on the canvas.
+ num -- number of the mouse-button defaults to 1 (left mouse button).
+
+ Every sequence of mouse-move-events on a turtle is preceded by a
+ mouse-click event on that turtle.
+
+ Example (for a Turtle instance named turtle):
+ >>> turtle.ondrag(turtle.goto)
+
+ Subsequently clicking and dragging a Turtle will move it
+ across the screen thereby producing handdrawings (if pen is
+ down).
+ """
+ self.screen._ondrag(self.turtle._item, fun, btn, add)
+
+
+ def _undo(self, action, data):
+ """Does the main part of the work for undo()
+ """
+ if self.undobuffer is None:
+ return
+ if action == "rot":
+ angle, degPAU = data
+ self._rotate(-angle*degPAU/self._degreesPerAU)
+ dummy = self.undobuffer.pop()
+ elif action == "stamp":
+ stitem = data[0]
+ self.clearstamp(stitem)
+ elif action == "go":
+ self._undogoto(data)
+ elif action in ["wri", "dot"]:
+ item = data[0]
+ self.screen._delete(item)
+ self.items.remove(item)
+ elif action == "dofill":
+ item = data[0]
+ self.screen._drawpoly(item, ((0, 0),(0, 0),(0, 0)),
+ fill="", outline="")
+ elif action == "beginfill":
+ item = data[0]
+ self._fillitem = self._fillpath = None
+ self.screen._delete(item)
+ self.items.remove(item)
+ elif action == "pen":
+ TPen.pen(self, data[0])
+ self.undobuffer.pop()
+
+ def undo(self):
+ """undo (repeatedly) the last turtle action.
+
+ No argument.
+
+ undo (repeatedly) the last turtle action.
+ Number of available undo actions is determined by the size of
+ the undobuffer.
+
+ Example (for a Turtle instance named turtle):
+ >>> for i in range(4):
+ ... turtle.fd(50); turtle.lt(80)
+ ...
+ >>> for i in range(8):
+ ... turtle.undo()
+ ...
+ """
+ if self.undobuffer is None:
+ return
+ item = self.undobuffer.pop()
+ action = item[0]
+ data = item[1:]
+ if action == "seq":
+ while data:
+ item = data.pop()
+ self._undo(item[0], item[1:])
+ else:
+ self._undo(action, data)
+
+ turtlesize = shapesize
+
+RawPen = RawTurtle
+
+### Screen - Singleton ########################
+
+def Screen():
+ """Return the singleton screen object.
+ If none exists at the moment, create a new one and return it,
+ else return the existing one."""
+ if Turtle._screen is None:
+ Turtle._screen = _Screen()
+ return Turtle._screen
+
+class _Screen(TurtleScreen):
+
+ _root = None
+ _canvas = None
+ _title = _CFG["title"]
+
+ def __init__(self):
+ # XXX there is no need for this code to be conditional,
+ # as there will be only a single _Screen instance, anyway
+ # XXX actually, the turtle demo is injecting root window,
+ # so perhaps the conditional creation of a root should be
+ # preserved (perhaps by passing it as an optional parameter)
+ if _Screen._root is None:
+ _Screen._root = self._root = _Root()
+ self._root.title(_Screen._title)
+ self._root.ondestroy(self._destroy)
+ if _Screen._canvas is None:
+ width = _CFG["width"]
+ height = _CFG["height"]
+ canvwidth = _CFG["canvwidth"]
+ canvheight = _CFG["canvheight"]
+ leftright = _CFG["leftright"]
+ topbottom = _CFG["topbottom"]
+ self._root.setupcanvas(width, height, canvwidth, canvheight)
+ _Screen._canvas = self._root._getcanvas()
+ TurtleScreen.__init__(self, _Screen._canvas)
+ self.setup(width, height, leftright, topbottom)
+
+ def setup(self, width=_CFG["width"], height=_CFG["height"],
+ startx=_CFG["leftright"], starty=_CFG["topbottom"]):
+ """ Set the size and position of the main window.
+
+ Arguments:
+ width: as integer a size in pixels, as float a fraction of the screen.
+ Default is 50% of screen.
+ height: as integer the height in pixels, as float a fraction of the
+ screen. Default is 75% of screen.
+ startx: if positive, starting position in pixels from the left
+ edge of the screen, if negative from the right edge
+ Default, startx=None is to center window horizontally.
+ starty: if positive, starting position in pixels from the top
+ edge of the screen, if negative from the bottom edge
+ Default, starty=None is to center window vertically.
+
+ Examples (for a Screen instance named screen):
+ >>> screen.setup (width=200, height=200, startx=0, starty=0)
+
+ sets window to 200x200 pixels, in upper left of screen
+
+ >>> screen.setup(width=.75, height=0.5, startx=None, starty=None)
+
+ sets window to 75% of screen by 50% of screen and centers
+ """
+ if not hasattr(self._root, "set_geometry"):
+ return
+ sw = self._root.win_width()
+ sh = self._root.win_height()
+ if isinstance(width, float) and 0 <= width <= 1:
+ width = sw*width
+ if startx is None:
+ startx = (sw - width) / 2
+ if isinstance(height, float) and 0 <= height <= 1:
+ height = sh*height
+ if starty is None:
+ starty = (sh - height) / 2
+ self._root.set_geometry(width, height, startx, starty)
+ self.update()
+
+ def title(self, titlestring):
+ """Set title of turtle-window
+
+ Argument:
+ titlestring -- a string, to appear in the titlebar of the
+ turtle graphics window.
+
+ This is a method of Screen-class. Not available for TurtleScreen-
+ objects.
+
+ Example (for a Screen instance named screen):
+ >>> screen.title("Welcome to the turtle-zoo!")
+ """
+ if _Screen._root is not None:
+ _Screen._root.title(titlestring)
+ _Screen._title = titlestring
+
+ def _destroy(self):
+ root = self._root
+ if root is _Screen._root:
+ Turtle._pen = None
+ Turtle._screen = None
+ _Screen._root = None
+ _Screen._canvas = None
+ TurtleScreen._RUNNING = False
+ root.destroy()
+
+ def bye(self):
+ """Shut the turtlegraphics window.
+
+ Example (for a TurtleScreen instance named screen):
+ >>> screen.bye()
+ """
+ self._destroy()
+
+ def exitonclick(self):
+ """Go into mainloop until the mouse is clicked.
+
+ No arguments.
+
+ Bind bye() method to mouseclick on TurtleScreen.
+ If "using_IDLE" - value in configuration dictionary is False
+ (default value), enter mainloop.
+ If IDLE with -n switch (no subprocess) is used, this value should be
+ set to True in turtle.cfg. In this case IDLE's mainloop
+ is active also for the client script.
+
+ This is a method of the Screen-class and not available for
+ TurtleScreen instances.
+
+ Example (for a Screen instance named screen):
+ >>> screen.exitonclick()
+
+ """
+ def exitGracefully(x, y):
+ """Screen.bye() with two dummy-parameters"""
+ self.bye()
+ self.onclick(exitGracefully)
+ if _CFG["using_IDLE"]:
+ return
+ try:
+ mainloop()
+ except AttributeError:
+ exit(0)
+
+class Turtle(RawTurtle):
+ """RawTurtle auto-creating (scrolled) canvas.
+
+ When a Turtle object is created or a function derived from some
+ Turtle method is called a TurtleScreen object is automatically created.
+ """
+ _pen = None
+ _screen = None
+
+ def __init__(self,
+ shape=_CFG["shape"],
+ undobuffersize=_CFG["undobuffersize"],
+ visible=_CFG["visible"]):
+ if Turtle._screen is None:
+ Turtle._screen = Screen()
+ RawTurtle.__init__(self, Turtle._screen,
+ shape=shape,
+ undobuffersize=undobuffersize,
+ visible=visible)
+
+Pen = Turtle
+
+def write_docstringdict(filename="turtle_docstringdict"):
+ """Create and write docstring-dictionary to file.
+
+ Optional argument:
+ filename -- a string, used as filename
+ default value is turtle_docstringdict
+
+ Has to be called explicitly, (not used by the turtle-graphics classes)
+ The docstring dictionary will be written to the Python script <filname>.py
+ It is intended to serve as a template for translation of the docstrings
+ into different languages.
+ """
+ docsdict = {}
+
+ for methodname in _tg_screen_functions:
+ key = "_Screen."+methodname
+ docsdict[key] = eval(key).__doc__
+ for methodname in _tg_turtle_functions:
+ key = "Turtle."+methodname
+ docsdict[key] = eval(key).__doc__
+
+ f = open("%s.py" % filename,"w")
+ keys = sorted([x for x in docsdict.keys()
+ if x.split('.')[1] not in _alias_list])
+ f.write('docsdict = {\n\n')
+ for key in keys[:-1]:
+ f.write('%s :\n' % repr(key))
+ f.write(' """%s\n""",\n\n' % docsdict[key])
+ key = keys[-1]
+ f.write('%s :\n' % repr(key))
+ f.write(' """%s\n"""\n\n' % docsdict[key])
+ f.write("}\n")
+ f.close()
+
+def read_docstrings(lang):
+ """Read in docstrings from lang-specific docstring dictionary.
+
+ Transfer docstrings, translated to lang, from a dictionary-file
+ to the methods of classes Screen and Turtle and - in revised form -
+ to the corresponding functions.
+ """
+ modname = "turtle_docstringdict_%(language)s" % {'language':lang.lower()}
+ module = __import__(modname)
+ docsdict = module.docsdict
+ for key in docsdict:
+ #print key
+ try:
+ eval(key).im_func.__doc__ = docsdict[key]
+ except BaseException:
+ print "Bad docstring-entry: %s" % key
+
+_LANGUAGE = _CFG["language"]
+
+try:
+ if _LANGUAGE != "english":
+ read_docstrings(_LANGUAGE)
+except ImportError:
+ print "Cannot find docsdict for", _LANGUAGE
+except BaseException:
+ print ("Unknown Error when trying to import %s-docstring-dictionary" %
+ _LANGUAGE)
+
+
+def getmethparlist(ob):
+ "Get strings describing the arguments for the given object"
+ argText1 = argText2 = ""
+ # bit of a hack for methods - turn it into a function
+ # but we drop the "self" param.
+ if type(ob)==types.MethodType:
+ fob = ob.im_func
+ argOffset = 1
+ else:
+ fob = ob
+ argOffset = 0
+ # Try and build one for Python defined functions
+ if type(fob) in [types.FunctionType, types.LambdaType]:
+ try:
+ counter = fob.func_code.co_argcount
+ items2 = list(fob.func_code.co_varnames[argOffset:counter])
+ realArgs = fob.func_code.co_varnames[argOffset:counter]
+ defaults = fob.func_defaults or []
+ defaults = list(map(lambda name: "=%s" % repr(name), defaults))
+ defaults = [""] * (len(realArgs)-len(defaults)) + defaults
+ items1 = map(lambda arg, dflt: arg+dflt, realArgs, defaults)
+ if fob.func_code.co_flags & 0x4:
+ items1.append("*"+fob.func_code.co_varnames[counter])
+ items2.append("*"+fob.func_code.co_varnames[counter])
+ counter += 1
+ if fob.func_code.co_flags & 0x8:
+ items1.append("**"+fob.func_code.co_varnames[counter])
+ items2.append("**"+fob.func_code.co_varnames[counter])
+ argText1 = ", ".join(items1)
+ argText1 = "(%s)" % argText1
+ argText2 = ", ".join(items2)
+ argText2 = "(%s)" % argText2
+ except:
+ pass
+ return argText1, argText2
+
+def _turtle_docrevise(docstr):
+ """To reduce docstrings from RawTurtle class for functions
+ """
+ import re
+ if docstr is None:
+ return None
+ turtlename = _CFG["exampleturtle"]
+ newdocstr = docstr.replace("%s." % turtlename,"")
+ parexp = re.compile(r' \(.+ %s\):' % turtlename)
+ newdocstr = parexp.sub(":", newdocstr)
+ return newdocstr
+
+def _screen_docrevise(docstr):
+ """To reduce docstrings from TurtleScreen class for functions
+ """
+ import re
+ if docstr is None:
+ return None
+ screenname = _CFG["examplescreen"]
+ newdocstr = docstr.replace("%s." % screenname,"")
+ parexp = re.compile(r' \(.+ %s\):' % screenname)
+ newdocstr = parexp.sub(":", newdocstr)
+ return newdocstr
+
+## The following mechanism makes all methods of RawTurtle and Turtle available
+## as functions. So we can enhance, change, add, delete methods to these
+## classes and do not need to change anything here.
+
+__func_body = """\
+def {name}{paramslist}:
+ if {obj} is None:
+ if not TurtleScreen._RUNNING:
+ TurtleScreen._RUNNING = True
+ raise Terminator
+ {obj} = {init}
+ try:
+ return {obj}.{name}{argslist}
+ except TK.TclError:
+ if not TurtleScreen._RUNNING:
+ TurtleScreen._RUNNING = True
+ raise Terminator
+ raise
+"""
+
+def _make_global_funcs(functions, cls, obj, init, docrevise):
+ for methodname in functions:
+ method = getattr(cls, methodname)
+ pl1, pl2 = getmethparlist(method)
+ if pl1 == "":
+ print ">>>>>>", pl1, pl2
+ continue
+ defstr = __func_body.format(obj=obj, init=init, name=methodname,
+ paramslist=pl1, argslist=pl2)
+ exec defstr in globals()
+ globals()[methodname].__doc__ = docrevise(method.__doc__)
+
+_make_global_funcs(_tg_screen_functions, _Screen,
+ 'Turtle._screen', 'Screen()', _screen_docrevise)
+_make_global_funcs(_tg_turtle_functions, Turtle,
+ 'Turtle._pen', 'Turtle()', _turtle_docrevise)
+
+
+done = mainloop = TK.mainloop
+
+if __name__ == "__main__":
+ def switchpen():
+ if isdown():
+ pu()
+ else:
+ pd()
+
+ def demo1():
+ """Demo of old turtle.py - module"""
+ reset()
+ tracer(True)
+ up()
+ backward(100)
+ down()
+ # draw 3 squares; the last filled
+ width(3)
+ for i in range(3):
+ if i == 2:
+ fill(1)
+ for _ in range(4):
+ forward(20)
+ left(90)
+ if i == 2:
+ color("maroon")
+ fill(0)
+ up()
+ forward(30)
+ down()
+ width(1)
+ color("black")
+ # move out of the way
+ tracer(False)
+ up()
+ right(90)
+ forward(100)
+ right(90)
+ forward(100)
+ right(180)
+ down()
+ # some text
+ write("startstart", 1)
+ write(u"start", 1)
+ color("red")
+ # staircase
+ for i in range(5):
+ forward(20)
+ left(90)
+ forward(20)
+ right(90)
+ # filled staircase
+ tracer(True)
+ fill(1)
+ for i in range(5):
+ forward(20)
+ left(90)
+ forward(20)
+ right(90)
+ fill(0)
+ # more text
+
+ def demo2():
+ """Demo of some new features."""
+ speed(1)
+ st()
+ pensize(3)
+ setheading(towards(0, 0))
+ radius = distance(0, 0)/2.0
+ rt(90)
+ for _ in range(18):
+ switchpen()
+ circle(radius, 10)
+ write("wait a moment...")
+ while undobufferentries():
+ undo()
+ reset()
+ lt(90)
+ colormode(255)
+ laenge = 10
+ pencolor("green")
+ pensize(3)
+ lt(180)
+ for i in range(-2, 16):
+ if i > 0:
+ begin_fill()
+ fillcolor(255-15*i, 0, 15*i)
+ for _ in range(3):
+ fd(laenge)
+ lt(120)
+ laenge += 10
+ lt(15)
+ speed((speed()+1)%12)
+ end_fill()
+
+ lt(120)
+ pu()
+ fd(70)
+ rt(30)
+ pd()
+ color("red","yellow")
+ speed(0)
+ fill(1)
+ for _ in range(4):
+ circle(50, 90)
+ rt(90)
+ fd(30)
+ rt(90)
+ fill(0)
+ lt(90)
+ pu()
+ fd(30)
+ pd()
+ shape("turtle")
+
+ tri = getturtle()
+ tri.resizemode("auto")
+ turtle = Turtle()
+ turtle.resizemode(u"auto")
+ turtle.shape("turtle")
+ turtle.reset()
+ turtle.left(90)
+ turtle.speed(0)
+ turtle.up()
+ turtle.goto(280, 40)
+ turtle.lt(30)
+ turtle.down()
+ turtle.speed(6)
+ turtle.color("blue",u"orange")
+ turtle.pensize(2)
+ tri.speed(6)
+ setheading(towards(turtle))
+ count = 1
+ while tri.distance(turtle) > 4:
+ turtle.fd(3.5)
+ turtle.lt(0.6)
+ tri.setheading(tri.towards(turtle))
+ tri.fd(4)
+ if count % 20 == 0:
+ turtle.stamp()
+ tri.stamp()
+ switchpen()
+ count += 1
+ tri.write("CAUGHT! ", font=("Arial", 16, "bold"), align=u"right")
+ tri.pencolor("black")
+ tri.pencolor(u"red")
+
+ def baba(xdummy, ydummy):
+ clearscreen()
+ bye()
+
+ time.sleep(2)
+
+ while undobufferentries():
+ tri.undo()
+ turtle.undo()
+ tri.fd(50)
+ tri.write(" Click me!", font = ("Courier", 12, "bold") )
+ tri.onclick(baba, 1)
+
+ demo1()
+ demo2()
+ exitonclick()